diff options
90 files changed, 1835 insertions, 292 deletions
diff --git a/.gitignore b/.gitignore index f5b6427ca03..91ea81bfc4e 100644 --- a/.gitignore +++ b/.gitignore @@ -26,6 +26,7 @@ config/initializers/smtp_settings.rb config/resque.yml config/unicorn.rb config/secrets.yml +config/sidekiq.yml coverage/* db/*.sqlite3 db/*.sqlite3-journal diff --git a/CHANGELOG b/CHANGELOG index 47ef06bee54..eb3664e5e10 100644 --- a/CHANGELOG +++ b/CHANGELOG @@ -1,6 +1,7 @@ Please view this file on the master branch, on stable branches it's out of date. v 8.4.0 (unreleased) + - Fix missing date of month in network graph when commits span a month (Stan Hu) - Expire view caches when application settings change (e.g. Gravatar disabled) (Stan Hu) - Don't notify users twice if they are both project watchers and subscribers (Stan Hu) - Implement new UI for group page @@ -18,12 +19,19 @@ v 8.4.0 (unreleased) - Fix version check image in Safari - Show 'All' tab by default in the builds page - Fix API project lookups when querying with a namespace with dots (Stan Hu) + - Update version check images to use SVG + - Validate README format before displaying + - Enable Microsoft Azure OAuth2 support (Janis Meybohm) v 8.3.3 (unreleased) + - Get "Merge when build succeeds" to work when commits were pushed to MR target branch while builds were running - Fix project transfer e-mail sending incorrect paths in e-mail notification (Stan Hu) - Enable "Add key" button when user fills in a proper key (Stan Hu) v 8.3.2 + - Change single user API endpoint to return more detailed data (Michael Potthoff) + +v 8.3.2 (unreleased) - Disable --follow in `git log` to avoid loading duplicate commit data in infinite scroll (Stan Hu) - Add support for Google reCAPTCHA in user registration @@ -33,6 +41,7 @@ v 8.3.1 - Fix LDAP identity and user retrieval when special characters are used - Move Sidekiq-cron configuration to gitlab.yml - Enable forcing Two-Factor authentication sitewide, with optional grace period + - Import GitHub Pull Requests into GitLab v 8.3.0 - Bump rack-attack to 4.3.1 for security fix (Stan Hu) @@ -96,6 +105,9 @@ v 8.3.0 - Do not show build status unless builds are enabled and `.gitlab-ci.yml` is present - Persist runners registration token in database - Fix online editor should not remove newlines at the end of the file + - Expose Git's version in the admin area + - Show "New Merge Request" buttons on canonical repos when you have a fork (Josh Frye) + - Add file finder feature in tree view v 8.2.3 - Fix application settings cache not expiring after changes (Stan Hu) @@ -154,6 +166,8 @@ v 8.2.0 - Allow to define cache in `.gitlab-ci.yml` - Fix: 500 error returned if destroy request without HTTP referer (Kazuki Shimizu) - Remove deprecated CI events from project settings page + - Use issue editor as cross reference comment author when issue is edited with a new mention. + - Add graphs of commits ahead and behind default branch (Jeff Stubler) - Improve personal snippet access workflow (Douglas Alexandre) - [API] Add ability to fetch the commit ID of the last commit that actually touched a file - Fix omniauth documentation setting for omnibus configuration (Jon Cairns) @@ -33,6 +33,7 @@ gem 'omniauth-saml', '~> 1.4.0' gem 'omniauth-shibboleth', '~> 1.2.0' gem 'omniauth-twitter', '~> 1.2.0' gem 'omniauth_crowd' +gem 'omniauth-azure-oauth2' gem 'rack-oauth2', '~> 1.2.1' # reCAPTCHA protection @@ -48,7 +49,7 @@ gem "browser", '~> 1.0.0' # Extracting information from a git repository # Provide access to Gitlab::Git library -gem "gitlab_git", '~> 7.2.20' +gem "gitlab_git", '~> 7.2.22' # LDAP Auth # GitLab fork with several improvements to original library. For full list of changes diff --git a/Gemfile.lock b/Gemfile.lock index ffb7cef0aba..a1168ed3b7a 100644 --- a/Gemfile.lock +++ b/Gemfile.lock @@ -488,6 +488,10 @@ GEM activesupport nokogiri (>= 1.4.4) omniauth (~> 1.0) + omniauth-azure-oauth2 (0.0.6) + jwt (~> 1.0) + omniauth (~> 1.0) + omniauth-oauth2 (~> 1.1) opennebula (4.14.2) json nokogiri @@ -883,7 +887,7 @@ DEPENDENCIES github-markup (~> 1.3.1) gitlab-flowdock-git-hook (~> 1.0.1) gitlab_emoji (~> 0.2.0) - gitlab_git (~> 7.2.20) + gitlab_git (~> 7.2.22) gitlab_meta (= 7.0) gitlab_omniauth-ldap (~> 1.2.1) gollum-lib (~> 4.1.0) @@ -927,6 +931,7 @@ DEPENDENCIES omniauth-shibboleth (~> 1.2.0) omniauth-twitter (~> 1.2.0) omniauth_crowd + omniauth-azure-oauth2 org-ruby (~> 0.9.12) paranoia (~> 2.0) pg (~> 0.18.2) diff --git a/app/assets/images/auth_buttons/azure_64.png b/app/assets/images/auth_buttons/azure_64.png Binary files differnew file mode 100644 index 00000000000..a82c751e001 --- /dev/null +++ b/app/assets/images/auth_buttons/azure_64.png diff --git a/app/assets/javascripts/application.js.coffee b/app/assets/javascripts/application.js.coffee index b9b095e004a..c095e5ae2b1 100644 --- a/app/assets/javascripts/application.js.coffee +++ b/app/assets/javascripts/application.js.coffee @@ -40,6 +40,7 @@ #= require shortcuts_network #= require jquery.nicescroll.min #= require_tree . +#= require fuzzaldrin-plus.min window.slugify = (text) -> text.replace(/[^-a-zA-Z0-9]+/g, '_').toLowerCase() diff --git a/app/assets/javascripts/branch-graph.js.coffee b/app/assets/javascripts/branch-graph.js.coffee index 917228bd276..f2fd2a775a4 100644 --- a/app/assets/javascripts/branch-graph.js.coffee +++ b/app/assets/javascripts/branch-graph.js.coffee @@ -66,7 +66,7 @@ class @BranchGraph r.rect(40, 0, 30, @barHeight).attr fill: "#444" for day, mm in @days - if cuday isnt day[0] + if cuday isnt day[0] || cumonth isnt day[1] # Dates r.text(55, @offsetY + @unitTime * mm, day[0]) .attr( diff --git a/app/assets/javascripts/dispatcher.js.coffee b/app/assets/javascripts/dispatcher.js.coffee index 69e061ce6e9..58d6b9d4060 100644 --- a/app/assets/javascripts/dispatcher.js.coffee +++ b/app/assets/javascripts/dispatcher.js.coffee @@ -87,7 +87,9 @@ class Dispatcher new GroupAvatar() when 'projects:tree:show' new TreeView() - shortcut_handler = new ShortcutsNavigation() + shortcut_handler = new ShortcutsTree() + when 'projects:find_file:show' + shortcut_handler = true when 'projects:blob:show' new LineHighlighter() shortcut_handler = new ShortcutsNavigation() diff --git a/app/assets/javascripts/project_find_file.js.coffee b/app/assets/javascripts/project_find_file.js.coffee new file mode 100644 index 00000000000..0dd32352c34 --- /dev/null +++ b/app/assets/javascripts/project_find_file.js.coffee @@ -0,0 +1,125 @@ +class @ProjectFindFile
+ constructor: (@element, @options)->
+ @filePaths = {}
+ @inputElement = @element.find(".file-finder-input")
+
+ # init event
+ @initEvent()
+
+ # focus text input box
+ @inputElement.focus()
+
+ # load file list
+ @load(@options.url)
+
+ # init event
+ initEvent: ->
+ @inputElement.off "keyup"
+ @inputElement.on "keyup", (event) =>
+ target = $(event.target)
+ value = target.val()
+ oldValue = target.data("oldValue") ? ""
+
+ if value != oldValue
+ target.data("oldValue", value)
+ @findFile()
+ @element.find("tr.tree-item").eq(0).addClass("selected").focus()
+
+ @element.find(".tree-content-holder .tree-table").on "click", (event) ->
+ if (event.target.nodeName != "A")
+ path = @element.find(".tree-item-file-name a", this).attr("href")
+ location.href = path if path
+
+ # find file
+ findFile: ->
+ searchText = @inputElement.val()
+ result = if searchText.length > 0 then fuzzaldrinPlus.filter(@filePaths, searchText) else @filePaths
+ @renderList result, searchText
+
+ # files pathes load
+ load: (url) ->
+ $.ajax
+ url: url
+ method: "get"
+ dataType: "json"
+ success: (data) =>
+ @element.find(".loading").hide()
+ @filePaths = data
+ @findFile()
+ @element.find(".files-slider tr.tree-item").eq(0).addClass("selected").focus()
+
+ # render result
+ renderList: (filePaths, searchText) ->
+ @element.find(".tree-table > tbody").empty()
+
+ for filePath, i in filePaths
+ break if i == 20
+
+ if searchText
+ matches = fuzzaldrinPlus.match(filePath, searchText)
+
+ blobItemUrl = "#{@options.blobUrlTemplate}/#{filePath}"
+
+ html = @makeHtml filePath, matches, blobItemUrl
+ @element.find(".tree-table > tbody").append(html)
+
+ # highlight text(awefwbwgtc -> <b>a</b>wefw<b>b</b>wgt<b>c</b> )
+ highlighter = (element, text, matches) ->
+ lastIndex = 0
+ highlightText = ""
+ matchedChars = []
+
+ for matchIndex in matches
+ unmatched = text.substring(lastIndex, matchIndex)
+
+ if unmatched
+ element.append(matchedChars.join("").bold()) if matchedChars.length
+ matchedChars = []
+ element.append(document.createTextNode(unmatched))
+
+ matchedChars.push(text[matchIndex])
+ lastIndex = matchIndex + 1
+
+ element.append(matchedChars.join("").bold()) if matchedChars.length
+ element.append(document.createTextNode(text.substring(lastIndex)))
+
+ # make tbody row html
+ makeHtml: (filePath, matches, blobItemUrl) ->
+ $tr = $("<tr class='tree-item'><td class='tree-item-file-name'><i class='fa fa-file-text-o fa-fw'></i><span class='str-truncated'><a></a></span></td></tr>")
+ if matches
+ $tr.find("a").replaceWith(highlighter($tr.find("a"), filePath, matches).attr("href", blobItemUrl))
+ else
+ $tr.find("a").attr("href", blobItemUrl).text(filePath)
+
+ return $tr
+
+ selectRow: (type) ->
+ rows = @element.find(".files-slider tr.tree-item")
+ selectedRow = @element.find(".files-slider tr.tree-item.selected")
+
+ if rows && rows.length > 0
+ if selectedRow && selectedRow.length > 0
+ if type == "UP"
+ next = selectedRow.prev()
+ else if type == "DOWN"
+ next = selectedRow.next()
+
+ if next.length > 0
+ selectedRow.removeClass "selected"
+ selectedRow = next
+ else
+ selectedRow = rows.eq(0)
+ selectedRow.addClass("selected").focus()
+
+ selectRowUp: =>
+ @selectRow "UP"
+
+ selectRowDown: =>
+ @selectRow "DOWN"
+
+ goToTree: =>
+ location.href = @options.treeUrl
+
+ goToBlob: =>
+ path = @element.find(".tree-item.selected .tree-item-file-name a").attr("href")
+ location.href = path if path
diff --git a/app/assets/javascripts/shortcuts_find_file.js.coffee b/app/assets/javascripts/shortcuts_find_file.js.coffee new file mode 100644 index 00000000000..311e80bae19 --- /dev/null +++ b/app/assets/javascripts/shortcuts_find_file.js.coffee @@ -0,0 +1,19 @@ +#= require shortcuts_navigation + +class @ShortcutsFindFile extends ShortcutsNavigation + constructor: (@projectFindFile) -> + super() + _oldStopCallback = Mousetrap.stopCallback + # override to fire shortcuts action when focus in textbox + Mousetrap.stopCallback = (event, element, combo) => + if element == @projectFindFile.inputElement[0] and (combo == 'up' or combo == 'down' or combo == 'esc' or combo == 'enter') + # when press up/down key in textbox, cusor prevent to move to home/end + event.preventDefault() + return false + + return _oldStopCallback(event, element, combo) + + Mousetrap.bind('up', @projectFindFile.selectRowUp) + Mousetrap.bind('down', @projectFindFile.selectRowDown) + Mousetrap.bind('esc', @projectFindFile.goToTree) + Mousetrap.bind('enter', @projectFindFile.goToBlob) diff --git a/app/assets/javascripts/shortcuts_tree.coffee b/app/assets/javascripts/shortcuts_tree.coffee new file mode 100644 index 00000000000..ba0839c9fc0 --- /dev/null +++ b/app/assets/javascripts/shortcuts_tree.coffee @@ -0,0 +1,4 @@ +class @ShortcutsTree extends ShortcutsNavigation + constructor: -> + super() + Mousetrap.bind('t', -> ShortcutsTree.findAndFollowLink('.shortcuts-find-file')) diff --git a/app/assets/stylesheets/pages/commits.scss b/app/assets/stylesheets/pages/commits.scss index c9dfcff6290..879bd287470 100644 --- a/app/assets/stylesheets/pages/commits.scss +++ b/app/assets/stylesheets/pages/commits.scss @@ -122,3 +122,59 @@ li.commit { color: $gl-gray; } } + +.divergence-graph { + padding: 12px 12px 0 0; + float: right; + + .graph-side { + position: relative; + width: 80px; + height: 22px; + padding: 5px 0 13px; + float: left; + + .bar { + position: absolute; + height: 4px; + background-color: #ccc; + } + + .bar-behind { + right: 0; + border-radius: 3px 0 0 3px; + } + + .bar-ahead { + left: 0; + border-radius: 0 3px 3px 0; + } + + .count { + padding-top: 6px; + padding-bottom: 0px; + font-size: 12px; + color: #333; + display: block; + } + + .count-behind { + padding-right: 4px; + text-align: right; + } + + .count-ahead { + padding-left: 4px; + text-align: left; + } + } + + .graph-separator { + position: relative; + width: 1px; + height: 18px; + margin: 5px 0 0; + float: left; + background-color: #ccc; + } +} diff --git a/app/assets/stylesheets/pages/tree.scss b/app/assets/stylesheets/pages/tree.scss index d4ab6967ccd..97505edeabf 100644 --- a/app/assets/stylesheets/pages/tree.scss +++ b/app/assets/stylesheets/pages/tree.scss @@ -1,5 +1,13 @@ .tree-holder { + .file-finder { + width: 50%; + .file-finder-input { + width: 95%; + display: inline-block; + } + } + .tree-table { margin-bottom: 0; diff --git a/app/controllers/abuse_reports_controller.rb b/app/controllers/abuse_reports_controller.rb index 20bc5173f1d..38814459f66 100644 --- a/app/controllers/abuse_reports_controller.rb +++ b/app/controllers/abuse_reports_controller.rb @@ -9,12 +9,10 @@ class AbuseReportsController < ApplicationController @abuse_report.reporter = current_user if @abuse_report.save - if current_application_settings.admin_notification_email.present? - AbuseReportMailer.notify(@abuse_report.id).deliver_later - end + @abuse_report.notify message = "Thank you for your report. A GitLab administrator will look into it shortly." - redirect_to root_path, notice: message + redirect_to @abuse_report.user, notice: message else render :new end @@ -23,6 +21,9 @@ class AbuseReportsController < ApplicationController private def report_params - params.require(:abuse_report).permit(:user_id, :message) + params.require(:abuse_report).permit(%i( + message + user_id + )) end end diff --git a/app/controllers/admin/application_settings_controller.rb b/app/controllers/admin/application_settings_controller.rb index 10e736fd362..44d06b6a647 100644 --- a/app/controllers/admin/application_settings_controller.rb +++ b/app/controllers/admin/application_settings_controller.rb @@ -70,8 +70,6 @@ class Admin::ApplicationSettingsController < Admin::ApplicationController :metrics_enabled, :metrics_host, :metrics_port, - :metrics_username, - :metrics_password, :metrics_pool_size, :metrics_timeout, :metrics_method_call_threshold, diff --git a/app/controllers/projects/branches_controller.rb b/app/controllers/projects/branches_controller.rb index 3c2849a7601..4db3b3bf23d 100644 --- a/app/controllers/projects/branches_controller.rb +++ b/app/controllers/projects/branches_controller.rb @@ -9,6 +9,11 @@ class Projects::BranchesController < Projects::ApplicationController @sort = params[:sort] || 'name' @branches = @repository.branches_sorted_by(@sort) @branches = Kaminari.paginate_array(@branches).page(params[:page]).per(PER_PAGE) + + @max_commits = @branches.reduce(0) do |memo, branch| + diverging_commit_counts = repository.diverging_commit_counts(branch) + [memo, diverging_commit_counts[:behind], diverging_commit_counts[:ahead]].max + end end def recent diff --git a/app/controllers/projects/find_file_controller.rb b/app/controllers/projects/find_file_controller.rb new file mode 100644 index 00000000000..54a0c447aee --- /dev/null +++ b/app/controllers/projects/find_file_controller.rb @@ -0,0 +1,26 @@ +# Controller for viewing a repository's file structure
+class Projects::FindFileController < Projects::ApplicationController
+ include ExtractsPath
+ include ActionView::Helpers::SanitizeHelper
+ include TreeHelper
+
+ before_action :require_non_empty_project
+ before_action :assign_ref_vars
+ before_action :authorize_download_code!
+
+ def show
+ return render_404 unless @repository.commit(@ref)
+
+ respond_to do |format|
+ format.html
+ end
+ end
+
+ def list
+ file_paths = @repo.ls_files(@ref)
+
+ respond_to do |format|
+ format.json { render json: file_paths }
+ end
+ end
+end
diff --git a/app/controllers/projects/merge_requests_controller.rb b/app/controllers/projects/merge_requests_controller.rb index ab5c953189c..de948d271c8 100644 --- a/app/controllers/projects/merge_requests_controller.rb +++ b/app/controllers/projects/merge_requests_controller.rb @@ -153,7 +153,7 @@ class Projects::MergeRequestsController < Projects::ApplicationController end def merge_check - @merge_request.check_if_can_be_merged if @merge_request.unchecked? + @merge_request.check_if_can_be_merged render partial: "projects/merge_requests/widget/show.html.haml", layout: false end diff --git a/app/controllers/projects/refs_controller.rb b/app/controllers/projects/refs_controller.rb index c4e18c17077..a8f091819ca 100644 --- a/app/controllers/projects/refs_controller.rb +++ b/app/controllers/projects/refs_controller.rb @@ -20,6 +20,8 @@ class Projects::RefsController < Projects::ApplicationController namespace_project_network_path(@project.namespace, @project, @id, @options) when "graphs" namespace_project_graph_path(@project.namespace, @project, @id) + when "find_file" + namespace_project_find_file_path(@project.namespace, @project, @id) when "graphs_commits" commits_namespace_project_graph_path(@project.namespace, @project, @id) else diff --git a/app/helpers/auth_helper.rb b/app/helpers/auth_helper.rb index 0cfc0565e84..de669e529a7 100644 --- a/app/helpers/auth_helper.rb +++ b/app/helpers/auth_helper.rb @@ -1,5 +1,5 @@ module AuthHelper - PROVIDERS_WITH_ICONS = %w(twitter github gitlab bitbucket google_oauth2 facebook).freeze + PROVIDERS_WITH_ICONS = %w(twitter github gitlab bitbucket google_oauth2 facebook azure_oauth2).freeze FORM_BASED_PROVIDERS = [/\Aldap/, 'crowd'].freeze def ldap_enabled? diff --git a/app/helpers/page_layout_helper.rb b/app/helpers/page_layout_helper.rb index 791cb9e50bd..82f805fa444 100644 --- a/app/helpers/page_layout_helper.rb +++ b/app/helpers/page_layout_helper.rb @@ -27,35 +27,20 @@ module PageLayoutHelper # # Returns an HTML-safe String. def page_description(description = nil) - @page_description ||= page_description_default - if description.present? @page_description = description.squish - else + elsif @page_description.present? sanitize(@page_description, tags: []).truncate_words(30) end end - # Default value for page_description when one hasn't been defined manually by - # a view - def page_description_default - if @project - @project.description || brand_title - else - brand_title - end - end - def page_image default = image_url('gitlab_logo.png') - if @project - @project.avatar_url || default - elsif @user - avatar_icon(@user) - else - default - end + subject = @project || @user || @group + + image = subject.avatar_url if subject.present? + image || default end # Define or get attributes to be used as Twitter card metadata diff --git a/app/mailers/abuse_report_mailer.rb b/app/mailers/abuse_report_mailer.rb index f0c41f69a5c..d0ce827a595 100644 --- a/app/mailers/abuse_report_mailer.rb +++ b/app/mailers/abuse_report_mailer.rb @@ -2,11 +2,19 @@ class AbuseReportMailer < BaseMailer include Gitlab::CurrentSettings def notify(abuse_report_id) + return unless deliverable? + @abuse_report = AbuseReport.find(abuse_report_id) mail( - to: current_application_settings.admin_notification_email, + to: current_application_settings.admin_notification_email, subject: "#{@abuse_report.user.name} (#{@abuse_report.user.username}) was reported for abuse" ) end + + private + + def deliverable? + current_application_settings.admin_notification_email.present? + end end diff --git a/app/mailers/emails/notes.rb b/app/mailers/emails/notes.rb index 65f37e92677..e1382d2da12 100644 --- a/app/mailers/emails/notes.rb +++ b/app/mailers/emails/notes.rb @@ -48,7 +48,7 @@ module Emails yield - SentNotification.record(@note, recipient_id, reply_key) + SentNotification.record_note(@note, recipient_id, reply_key) end end end diff --git a/app/models/abuse_report.rb b/app/models/abuse_report.rb index 89b3116b9f2..55864236b2f 100644 --- a/app/models/abuse_report.rb +++ b/app/models/abuse_report.rb @@ -18,4 +18,10 @@ class AbuseReport < ActiveRecord::Base validates :user, presence: true validates :message, presence: true validates :user_id, uniqueness: true + + def notify + return unless self.persisted? + + AbuseReportMailer.notify(self.id).deliver_later + end end diff --git a/app/models/ci/build.rb b/app/models/ci/build.rb index 3e67b2771c1..d7fccb2197d 100644 --- a/app/models/ci/build.rb +++ b/app/models/ci/build.rb @@ -54,6 +54,8 @@ module Ci # To prevent db load megabytes of data from trace default_scope -> { select(Ci::Build.columns_without_lazy) } + before_destroy { project } + class << self def columns_without_lazy (column_names - LAZY_ATTRIBUTES).map do |column_name| @@ -145,10 +147,6 @@ module Ci end end - def project - commit.project - end - def project_id commit.project.id end diff --git a/app/models/concerns/mentionable.rb b/app/models/concerns/mentionable.rb index 6316ee208b5..98f71ae8cb0 100644 --- a/app/models/concerns/mentionable.rb +++ b/app/models/concerns/mentionable.rb @@ -51,8 +51,11 @@ module Mentionable else self.class.mentionable_attrs.each do |attr, options| text = send(attr) - options[:cache_key] = [self, attr] if options.delete(:cache) && self.persisted? - ext.analyze(text, options) + + context = options.dup + context[:cache_key] = [self, attr] if context.delete(:cache) && self.persisted? + + ext.analyze(text, context) end end diff --git a/app/models/merge_request.rb b/app/models/merge_request.rb index ac25d38eb63..30d0c2b5961 100644 --- a/app/models/merge_request.rb +++ b/app/models/merge_request.rb @@ -229,6 +229,8 @@ class MergeRequest < ActiveRecord::Base end def check_if_can_be_merged + return unless unchecked? + can_be_merged = project.repository.can_be_merged?(source_sha, target_branch) @@ -252,7 +254,11 @@ class MergeRequest < ActiveRecord::Base end def mergeable? - open? && !work_in_progress? && can_be_merged? + return false unless open? && !work_in_progress? + + check_if_can_be_merged + + can_be_merged? end def gitlab_merge_status @@ -452,6 +458,10 @@ class MergeRequest < ActiveRecord::Base !source_branch_exists? || !target_branch_exists? end + def broken? + self.commits.blank? || branch_missing? || cannot_be_merged? + end + def can_be_merged_by?(user) ::Gitlab::GitAccess.new(user, project).can_push_to_branch?(target_branch) end @@ -507,8 +517,4 @@ class MergeRequest < ActiveRecord::Base def ci_commit @ci_commit ||= source_project.ci_commit(last_commit.id) if last_commit && source_project end - - def broken? - self.commits.blank? || branch_missing? || cannot_be_merged? - end end diff --git a/app/models/project.rb b/app/models/project.rb index eadc42d1da5..b1a6cfa86af 100644 --- a/app/models/project.rb +++ b/app/models/project.rb @@ -775,6 +775,8 @@ class Project < ActiveRecord::Base end def change_head(branch) + # Cached divergent commit counts are based on repository head + repository.expire_branch_cache gitlab_shell.update_repository_head(self.path_with_namespace, branch) reload_default_branch end diff --git a/app/models/project_services/asana_service.rb b/app/models/project_services/asana_service.rb index e6e16058d41..7d367e40037 100644 --- a/app/models/project_services/asana_service.rb +++ b/app/models/project_services/asana_service.rb @@ -40,8 +40,8 @@ get the commit comment added to it. You can also close a task with a message containing: `fix #123456`. -You can find your Api Keys here: -http://developer.asana.com/documentation/#api_keys' +You can create a Personal Access Token here: +http://app.asana.com/-/account_api' end def to_param @@ -53,14 +53,12 @@ http://developer.asana.com/documentation/#api_keys' { type: 'text', name: 'api_key', - placeholder: 'User API token. User must have access to task, -all comments will be attributed to this user.' + placeholder: 'User Personal Access Token. User must have access to task, all comments will be attributed to this user.' }, { type: 'text', name: 'restrict_to_branch', - placeholder: 'Comma-separated list of branches which will be -automatically inspected. Leave blank to include all branches.' + placeholder: 'Comma-separated list of branches which will be automatically inspected. Leave blank to include all branches.' } ] end @@ -69,58 +67,58 @@ automatically inspected. Leave blank to include all branches.' %w(push) end + def client + @_client ||= begin + Asana::Client.new do |c| + c.authentication :access_token, api_key + end + end + end + def execute(data) return unless supported_events.include?(data[:object_kind]) - Asana.configure do |client| - client.api_key = api_key - end - - user = data[:user_name] + # check the branch restriction is poplulated and branch is not included branch = Gitlab::Git.ref_name(data[:ref]) - branch_restriction = restrict_to_branch.to_s - - # check the branch restriction is poplulated and branch is not included if branch_restriction.length > 0 && branch_restriction.index(branch).nil? return end + user = data[:user_name] project_name = project.name_with_namespace - push_msg = user + ' pushed to branch ' + branch + ' of ' + project_name data[:commits].each do |commit| - check_commit(' ( ' + commit[:url] + ' ): ' + commit[:message], push_msg) + push_msg = "#{user} pushed to branch #{branch} of #{project_name} ( #{commit[:url]} ):" + check_commit(commit[:message], push_msg) end end def check_commit(message, push_msg) - task_list = [] - close_list = [] - - message.split("\n").each do |line| - # look for a task ID or a full Asana url - task_list.concat(line.scan(/#(\d+)/)) - task_list.concat(line.scan(/https:\/\/app\.asana\.com\/\d+\/\d+\/(\d+)/)) - # look for a word starting with 'fix' followed by a task ID - close_list.concat(line.scan(/(fix\w*)\W*#(\d+)/i)) - end - - # post commit to every taskid found - task_list.each do |taskid| - task = Asana::Task.find(taskid[0]) - - if task - task.create_story(text: push_msg + ' ' + message) - end - end - - # close all tasks that had 'fix(ed/es/ing) #:id' in them - close_list.each do |taskid| - task = Asana::Task.find(taskid.last) - - if task - task.modify(completed: true) + # matches either: + # - #1234 + # - https://app.asana.com/0/0/1234 + # optionally preceded with: + # - fix/ed/es/ing + # - close/s/d + # - closing + issue_finder = /(fix\w*|clos[ei]\w*+)?\W*(?:https:\/\/app\.asana\.com\/\d+\/\d+\/(\d+)|#(\d+))/i + + message.scan(issue_finder).each do |tuple| + # tuple will be + # [ 'fix', 'id_from_url', 'id_from_pound' ] + taskid = tuple[2] || tuple[1] + + begin + task = Asana::Task.find_by_id(client, taskid) + task.add_comment(text: "#{push_msg} #{message}") + + if tuple[0] + task.update(completed: true) + end + rescue => e + Rails.logger.error(e.message) + next end end end diff --git a/app/models/repository.rb b/app/models/repository.rb index a9bf4eb4033..9deb08d93b8 100644 --- a/app/models/repository.rb +++ b/app/models/repository.rb @@ -175,11 +175,29 @@ class Repository def size cache.fetch(:size) { raw_repository.size } end + + def diverging_commit_counts(branch) + root_ref_hash = raw_repository.rev_parse_target(root_ref).oid + cache.fetch(:"diverging_commit_counts_#{branch.name}") do + # Rugged seems to throw a `ReferenceError` when given branch_names rather + # than SHA-1 hashes + number_commits_behind = commits_between(branch.target, root_ref_hash).size + number_commits_ahead = commits_between(root_ref_hash, branch.target).size + + { behind: number_commits_behind, ahead: number_commits_ahead } + end + end def cache_keys %i(size branch_names tag_names commit_count readme version contribution_guide changelog license) end + + def branch_cache_keys + branches.map do |branch| + :"diverging_commit_counts_#{branch.name}" + end + end def build_cache cache_keys.each do |key| @@ -187,6 +205,12 @@ class Repository send(key) end end + + branches.each do |branch| + unless cache.exist?(:"diverging_commit_counts_#{branch.name}") + send(:diverging_commit_counts, branch) + end + end end def expire_tags_cache @@ -203,6 +227,14 @@ class Repository cache_keys.each do |key| cache.expire(key) end + + expire_branch_cache + end + + def expire_branch_cache + branches.each do |branch| + cache.expire(:"diverging_commit_counts_#{branch.name}") + end end def rebuild_cache @@ -210,6 +242,11 @@ class Repository cache.expire(key) send(key) end + + branches.each do |branch| + cache.expire(:"diverging_commit_counts_#{branch.name}") + diverging_commit_counts(branch) + end end def lookup_cache @@ -644,6 +681,11 @@ class Repository end end + def ls_files(ref) + actual_ref = ref || root_ref + raw_repository.ls_files(actual_ref) + end + private def cache diff --git a/app/models/tree.rb b/app/models/tree.rb index 93b3246a668..e0e04d8859f 100644 --- a/app/models/tree.rb +++ b/app/models/tree.rb @@ -17,18 +17,16 @@ class Tree def readme return @readme if defined?(@readme) - available_readmes = blobs.select(&:readme?) + # Take the first previewable readme, or return nil if none is available or + # we can't preview any of them + readme_tree = blobs.find do |blob| + blob.readme? && (previewable?(blob.name) || plain?(blob.name)) + end - if available_readmes.count == 0 + if readme_tree.nil? return @readme = nil end - # Take the first previewable readme, or the first available readme, if we - # can't preview any of them - readme_tree = available_readmes.find do |readme| - previewable?(readme.name) - end || available_readmes.first - readme_path = path == '/' ? readme_tree.name : File.join(path, readme_tree.name) git_repo = repository.raw_repository diff --git a/app/views/abuse_report_mailer/notify.html.haml b/app/views/abuse_report_mailer/notify.html.haml index 619533e09a7..2741eb44357 100644 --- a/app/views/abuse_report_mailer/notify.html.haml +++ b/app/views/abuse_report_mailer/notify.html.haml @@ -8,4 +8,4 @@ = @abuse_report.message %p - = link_to "View details", abuse_reports_url + = link_to "View details", admin_abuse_reports_url diff --git a/app/views/admin/application_settings/_form.html.haml b/app/views/admin/application_settings/_form.html.haml index 89b38a0dad0..81337432ab7 100644 --- a/app/views/admin/application_settings/_form.html.haml +++ b/app/views/admin/application_settings/_form.html.haml @@ -180,14 +180,6 @@ sending messages to this port, without it metrics data will not be saved. .form-group - = f.label :metrics_username, 'InfluxDB username', class: 'control-label col-sm-2' - .col-sm-10 - = f.text_field :metrics_username, class: 'form-control' - .form-group - = f.label :metrics_password, 'InfluxDB password', class: 'control-label col-sm-2' - .col-sm-10 - = f.text_field :metrics_password, class: 'form-control' - .form-group = f.label :metrics_pool_size, 'Connection pool size', class: 'control-label col-sm-2' .col-sm-10 = f.number_field :metrics_pool_size, class: 'form-control' diff --git a/app/views/help/_shortcuts.html.haml b/app/views/help/_shortcuts.html.haml index e8e331dd109..9ee6f07b26b 100644 --- a/app/views/help/_shortcuts.html.haml +++ b/app/views/help/_shortcuts.html.haml @@ -40,6 +40,32 @@ %td.shortcut .key enter %td Open Selection + %tr + %td.shortcut + .key t + %td Go to finding file + %tbody + %tr + %th + %th Finding Project File + %tr + %td.shortcut + .key + %i.fa.fa-arrow-up + %td Move selection up + %tr + %td.shortcut + .key + %i.fa.fa-arrow-down + %td Move selection down + %tr + %td.shortcut + .key enter + %td Open Selection + %tr + %td.shortcut + .key esc + %td Go back .col-lg-4 %table.shortcut-mappings diff --git a/app/views/layouts/_head.html.haml b/app/views/layouts/_head.html.haml index dd133ee8b56..38ca4f91c4d 100644 --- a/app/views/layouts/_head.html.haml +++ b/app/views/layouts/_head.html.haml @@ -1,10 +1,13 @@ +- page_description brand_title unless page_description + +- site_name = "GitLab" %head{prefix: "og: http://ogp.me/ns#"} %meta{charset: "utf-8"} %meta{'http-equiv' => 'X-UA-Compatible', content: 'IE=edge'} -# Open Graph - http://ogp.me/ %meta{property: 'og:type', content: "object"} - %meta{property: 'og:site_name', content: "GitLab"} + %meta{property: 'og:site_name', content: site_name} %meta{property: 'og:title', content: page_title} %meta{property: 'og:description', content: page_description} %meta{property: 'og:image', content: page_image} @@ -17,7 +20,7 @@ %meta{property: 'twitter:image', content: page_image} = page_card_meta_tags - %title= page_title('GitLab') + %title= page_title(site_name) %meta{name: "description", content: page_description} = favicon_link_tag 'favicon.ico' diff --git a/app/views/layouts/group.html.haml b/app/views/layouts/group.html.haml index 31888c5580e..2e483b7148d 100644 --- a/app/views/layouts/group.html.haml +++ b/app/views/layouts/group.html.haml @@ -1,5 +1,6 @@ -- page_title @group.name -- header_title group_title(@group) unless header_title -- sidebar "group" unless sidebar +- page_title @group.name +- page_description @group.description unless page_description +- header_title group_title(@group) unless header_title +- sidebar "group" unless sidebar = render template: "layouts/application" diff --git a/app/views/layouts/nav/_project.html.haml b/app/views/layouts/nav/_project.html.haml index d3eaf0f3209..270ccfd387f 100644 --- a/app/views/layouts/nav/_project.html.haml +++ b/app/views/layouts/nav/_project.html.haml @@ -25,7 +25,7 @@ %span Activity - if project_nav_tab? :files - = nav_link(controller: %w(tree blob blame edit_tree new_tree)) do + = nav_link(controller: %w(tree blob blame edit_tree new_tree find_file)) do = link_to project_files_path(@project), title: 'Files', class: 'shortcuts-tree' do = icon('files-o fw') %span @@ -117,4 +117,3 @@ %li.hidden = link_to namespace_project_network_path(@project.namespace, @project, current_ref), title: 'Network', class: 'shortcuts-network' do Network - diff --git a/app/views/layouts/project.html.haml b/app/views/layouts/project.html.haml index abf73bcc709..ab527e8e438 100644 --- a/app/views/layouts/project.html.haml +++ b/app/views/layouts/project.html.haml @@ -1,6 +1,7 @@ -- page_title @project.name_with_namespace -- header_title project_title(@project) unless header_title -- sidebar "project" unless sidebar +- page_title @project.name_with_namespace +- page_description @project.description unless page_description +- header_title project_title(@project) unless header_title +- sidebar "project" unless sidebar - content_for :scripts_body_top do - project = @target_project || @project diff --git a/app/views/projects/_find_file_link.html.haml b/app/views/projects/_find_file_link.html.haml new file mode 100644 index 00000000000..08e2fc48be7 --- /dev/null +++ b/app/views/projects/_find_file_link.html.haml @@ -0,0 +1,3 @@ += link_to namespace_project_find_file_path(@project.namespace, @project, @ref), class: 'btn btn-grouped shortcuts-find-file', rel: 'nofollow' do
+ = icon('search')
+ %span Find File
diff --git a/app/views/projects/branches/_branch.html.haml b/app/views/projects/branches/_branch.html.haml index 5081bae6801..a234536723e 100644 --- a/app/views/projects/branches/_branch.html.haml +++ b/app/views/projects/branches/_branch.html.haml @@ -1,4 +1,8 @@ - commit = @repository.commit(branch.target) +- bar_graph_width_factor = @max_commits > 0 ? 100.0/@max_commits : 0 +- diverging_commit_counts = @repository.diverging_commit_counts(branch) +- number_commits_behind = diverging_commit_counts[:behind] +- number_commits_ahead = diverging_commit_counts[:ahead] %li(class="js-branch-#{branch.name}") %div = link_to namespace_project_tree_path(@project.namespace, @project, branch.name) do @@ -29,6 +33,17 @@ = link_to namespace_project_branch_path(@project.namespace, @project, branch.name), class: 'btn btn-grouped btn-xs btn-remove remove-row has_tooltip', title: "Delete branch", method: :delete, data: { confirm: "Deleting the '#{branch.name}' branch cannot be undone. Are you sure?", container: 'body' }, remote: true do = icon("trash-o") + - if branch.name != @repository.root_ref + .divergence-graph{ title: "#{number_commits_ahead} commits ahead, #{number_commits_behind} commits behind #{@repository.root_ref}" } + .graph-side + .bar.bar-behind{ style: "width: #{number_commits_behind * bar_graph_width_factor}%" } + %span.count.count-behind= number_commits_behind + .graph-separator + .graph-side + .bar.bar-ahead{ style: "width: #{number_commits_ahead * bar_graph_width_factor}%" } + %span.count.count-ahead= number_commits_ahead + + - if commit = render 'projects/branches/commit', commit: commit, project: @project - else diff --git a/app/views/projects/buttons/_dropdown.html.haml b/app/views/projects/buttons/_dropdown.html.haml index 1f639fecc30..f9ab78e7874 100644 --- a/app/views/projects/buttons/_dropdown.html.haml +++ b/app/views/projects/buttons/_dropdown.html.haml @@ -8,9 +8,10 @@ = link_to url_for_new_issue(@project, only_path: true) do = icon('exclamation-circle fw') New issue - - if can?(current_user, :create_merge_request, @project) + - merge_project = can?(current_user, :create_merge_request, @project) ? @project : (current_user && current_user.fork_of(@project)) + - if merge_project %li - = link_to new_namespace_project_merge_request_path(@project.namespace, @project) do + = link_to new_namespace_project_merge_request_path(merge_project.namespace, merge_project) do = icon('tasks fw') New merge request - if can?(current_user, :create_snippet, @project) diff --git a/app/views/projects/commit/show.html.haml b/app/views/projects/commit/show.html.haml index 069b8b1f169..58aa45e8d2c 100644 --- a/app/views/projects/commit/show.html.haml +++ b/app/views/projects/commit/show.html.haml @@ -1,4 +1,6 @@ -- page_title "#{@commit.title} (#{@commit.short_id})", "Commits" +- page_title "#{@commit.title} (#{@commit.short_id})", "Commits" +- page_description @commit.description + = render "projects/commits/header_title" = render "commit_box" - if @ci_commit diff --git a/app/views/projects/find_file/show.html.haml b/app/views/projects/find_file/show.html.haml new file mode 100644 index 00000000000..2930209fb56 --- /dev/null +++ b/app/views/projects/find_file/show.html.haml @@ -0,0 +1,27 @@ +- page_title "Find File", @ref +- header_title project_title(@project, "Files", project_files_path(@project)) + +.file-finder-holder.tree-holder.clearfix + .gray-content-block.top-block + .tree-ref-holder + = render 'shared/ref_switcher', destination: 'find_file', path: @path + %ul.breadcrumb.repo-breadcrumb + %li + = link_to namespace_project_tree_path(@project.namespace, @project, @ref) do + = @project.path + %li.file-finder + %input#file_find.form-control.file-finder-input{type: "text", placeholder: 'Find by path'} + + %div.tree-content-holder + .table-holder + %table.table.files-slider{class: "table_#{@hex_path} tree-table table-striped" } + %tbody + = spinner nil, true + +:coffeescript + projectFindFile = new ProjectFindFile($(".file-finder-holder"), { + url: "#{escape_javascript(namespace_project_files_path(@project.namespace, @project, @ref, @options.merge(format: :json)))}" + treeUrl: "#{escape_javascript(namespace_project_tree_path(@project.namespace, @project, @ref))}" + blobUrlTemplate: "#{escape_javascript(namespace_project_blob_path(@project.namespace, @project, @id || @commit.id))}" + }) + new ShortcutsFindFile(projectFindFile) diff --git a/app/views/projects/merge_requests/_show.html.haml b/app/views/projects/merge_requests/_show.html.haml index ba7c2c01e93..095876450a0 100644 --- a/app/views/projects/merge_requests/_show.html.haml +++ b/app/views/projects/merge_requests/_show.html.haml @@ -38,7 +38,7 @@ = render "projects/merge_requests/show/how_to_merge" = render "projects/merge_requests/widget/show.html.haml" - - if @merge_request.open? && @merge_request.source_branch_exists? && @merge_request.can_be_merged? && @merge_request.can_be_merged_by?(current_user) + - if @merge_request.source_branch_exists? && @merge_request.mergeable? && @merge_request.can_be_merged_by?(current_user) .light.prepend-top-default You can also accept this merge request manually using the = succeed '.' do diff --git a/app/views/projects/merge_requests/index.html.haml b/app/views/projects/merge_requests/index.html.haml index 086298e5af1..8d5d0394a82 100644 --- a/app/views/projects/merge_requests/index.html.haml +++ b/app/views/projects/merge_requests/index.html.haml @@ -6,9 +6,10 @@ .controls = render 'shared/issuable/search_form', path: namespace_project_merge_requests_path(@project.namespace, @project) - - if can? current_user, :create_merge_request, @project + - merge_project = can?(current_user, :create_merge_request, @project) ? @project : (current_user && current_user.fork_of(@project)) + - if merge_project .pull-left.hidden-xs - = link_to new_namespace_project_merge_request_path(@project.namespace, @project), class: "btn btn-new", title: "New Merge Request" do + = link_to new_namespace_project_merge_request_path(merge_project.namespace, merge_project), class: "btn btn-new", title: "New Merge Request" do %i.fa.fa-plus New Merge Request = render 'shared/issuable/filter', type: :merge_requests diff --git a/app/views/projects/show.html.haml b/app/views/projects/show.html.haml index ffbe445b447..8436be433b1 100644 --- a/app/views/projects/show.html.haml +++ b/app/views/projects/show.html.haml @@ -68,4 +68,4 @@ = render 'projects/last_commit', commit: @repository.commit, project: @project %div{class: "project-show-#{default_project_view}"} - = render default_project_view
\ No newline at end of file + = render default_project_view diff --git a/app/views/projects/tree/show.html.haml b/app/views/projects/tree/show.html.haml index ec14bd7f65a..c57570afa09 100644 --- a/app/views/projects/tree/show.html.haml +++ b/app/views/projects/tree/show.html.haml @@ -3,12 +3,12 @@ = content_for :meta_tags do - if current_user = auto_discovery_link_tag(:atom, namespace_project_commits_url(@project.namespace, @project, @ref, format: :atom, private_token: current_user.private_token), title: "#{@project.name}:#{@ref} commits") - = render 'projects/last_push' -- if can? current_user, :download_code, @project - .tree-download-holder - = render 'projects/repositories/download_archive', ref: @ref, btn_class: 'btn-group pull-right hidden-xs hidden-sm', split_button: true +.pull-right + = render 'projects/find_file_link' + - if can? current_user, :download_code, @project + = render 'projects/repositories/download_archive', ref: @ref, btn_class: 'hidden-xs hidden-sm btn-grouped', split_button: true #tree-holder.tree-holder.clearfix .gray-content-block.top-block diff --git a/config/routes.rb b/config/routes.rb index 3e7d9f78710..5b69d06eb76 100644 --- a/config/routes.rb +++ b/config/routes.rb @@ -441,6 +441,24 @@ Rails.application.routes.draw do end scope do + get( + '/find_file/*id', + to: 'find_file#show', + constraints: { id: /.+/, format: /html/ }, + as: :find_file + ) + end + + scope do + get( + '/files/*id', + to: 'find_file#list', + constraints: { id: /(?:[^.]|\.(?!json$))+/, format: /json/ }, + as: :files + ) + end + + scope do post( '/create_dir/*id', to: 'tree#create_dir', diff --git a/db/migrate/20160106164438_remove_influxdb_credentials.rb b/db/migrate/20160106164438_remove_influxdb_credentials.rb new file mode 100644 index 00000000000..47e74400b97 --- /dev/null +++ b/db/migrate/20160106164438_remove_influxdb_credentials.rb @@ -0,0 +1,6 @@ +class RemoveInfluxdbCredentials < ActiveRecord::Migration + def change + remove_column :application_settings, :metrics_username, :string + remove_column :application_settings, :metrics_password, :string + end +end diff --git a/db/schema.rb b/db/schema.rb index 48e6983684a..2ded8a45e18 100644 --- a/db/schema.rb +++ b/db/schema.rb @@ -11,7 +11,7 @@ # # It's strongly recommended that you check this file into your version control system. -ActiveRecord::Schema.define(version: 20151229112614) do +ActiveRecord::Schema.define(version: 20160106164438) do # These are extensions that must be enabled in order to support this database enable_extension "plpgsql" @@ -50,16 +50,14 @@ ActiveRecord::Schema.define(version: 20151229112614) do t.boolean "shared_runners_enabled", default: true, null: false t.integer "max_artifacts_size", default: 100, null: false t.string "runners_registration_token" - t.boolean "require_two_factor_authentication", default: false - t.integer "two_factor_grace_period", default: 48 - t.boolean "metrics_enabled", default: false - t.string "metrics_host", default: "localhost" - t.string "metrics_username" - t.string "metrics_password" - t.integer "metrics_pool_size", default: 16 - t.integer "metrics_timeout", default: 10 - t.integer "metrics_method_call_threshold", default: 10 - t.boolean "recaptcha_enabled", default: false + t.boolean "require_two_factor_authentication", default: false + t.integer "two_factor_grace_period", default: 48 + t.boolean "metrics_enabled", default: false + t.string "metrics_host", default: "localhost" + t.integer "metrics_pool_size", default: 16 + t.integer "metrics_timeout", default: 10 + t.integer "metrics_method_call_threshold", default: 10 + t.boolean "recaptcha_enabled", default: false t.string "recaptcha_site_key" t.string "recaptcha_private_key" t.integer "metrics_port", default: 8089 diff --git a/doc/README.md b/doc/README.md index f4553a899d3..25fe3abcb9a 100644 --- a/doc/README.md +++ b/doc/README.md @@ -19,6 +19,7 @@ ## CI Documentation - [Quick Start](ci/quick_start/README.md) +- [Enable or disable GitLab CI](ci/enable_or_disable_ci.md) - [Configuring project (.gitlab-ci.yml)](ci/yaml/README.md) - [Configuring runner](ci/runners/README.md) - [Configuring deployment](ci/deployment/README.md) diff --git a/doc/api/users.md b/doc/api/users.md index 66d2fd52526..773fe36d277 100644 --- a/doc/api/users.md +++ b/doc/api/users.md @@ -123,6 +123,13 @@ Parameters: "name": "John Smith", "state": "active", "avatar_url": "http://localhost:3000/uploads/user/avatar/1/cd8.jpeg", + "created_at": "2012-05-23T08:00:58Z", + "is_admin": false, + "bio": null, + "skype": "", + "linkedin": "", + "twitter": "", + "website_url": "" } ``` diff --git a/doc/ci/README.md b/doc/ci/README.md index a1f5513d88e..4cdd2e1ad33 100644 --- a/doc/ci/README.md +++ b/doc/ci/README.md @@ -3,6 +3,7 @@ ### User documentation * [Quick Start](quick_start/README.md) +* [Enable or disable GitLab CI](enable_or_disable_ci.md) * [Configuring project (.gitlab-ci.yml)](yaml/README.md) * [Configuring runner](runners/README.md) * [Configuring deployment](deployment/README.md) diff --git a/doc/ci/enable_or_disable_ci.md b/doc/ci/enable_or_disable_ci.md new file mode 100644 index 00000000000..9bd2f5aff22 --- /dev/null +++ b/doc/ci/enable_or_disable_ci.md @@ -0,0 +1,70 @@ +## Enable or disable GitLab CI + +_To effectively use GitLab CI, you need a valid [`.gitlab-ci.yml`](yaml/README.md) +file present at the root directory of your project and a +[runner](runners/README.md) properly set up. You can read our +[quick start guide](quick_start/README.md) to get you started._ + +If you are using an external CI server like Jenkins or Drone CI, it is advised +to disable GitLab CI in order to not have any conflicts with the commits status +API. + +--- + +As of GitLab 8.2, GitLab CI is mainly exposed via the `/builds` page of a +project. Disabling GitLab CI in a project does not delete any previous builds. +In fact, the `/builds` page can still be accessed, although it's hidden from +the left sidebar menu. + +GitLab CI is enabled by default on new installations and can be disabled either +individually under each project's settings, or site-wide by modifying the +settings in `gitlab.yml` and `gitlab.rb` for source and Omnibus installations +respectively. + +### Per-project user setting + +The setting to enable or disable GitLab CI can be found with the name **Builds** +under the **Features** area of a project's settings along with **Issues**, +**Merge Requests**, **Wiki** and **Snippets**. Select or deselect the checkbox +and hit **Save** for the settings to take effect. + + + +--- + +### Site-wide administrator setting + +You can disable GitLab CI site-wide, by modifying the settings in `gitlab.yml` +and `gitlab.rb` for source and Omnibus installations respectively. + +Two things to note: + +1. Disabling GitLab CI, will affect only newly-created projects. Projects that + had it enabled prior to this modification, will work as before. +1. Even if you disable GitLab CI, users will still be able to enable it in the + project's settings. + +--- + +For installations from source, open `gitlab.yml` with your editor and set +`builds` to `false`: + +```yaml +## Default project features settings +default_projects_features: + issues: true + merge_requests: true + wiki: true + snippets: false + builds: false +``` + +Save the file and restart GitLab: `sudo service gitlab restart`. + +For Omnibus installations, edit `/etc/gitlab/gitlab.rb` and add the line: + +``` +gitlab-rails['gitlab_default_projects_features_builds'] = false +``` + +Save the file and reconfigure GitLab: `sudo gitlab-ctl reconfigure`. diff --git a/doc/ci/img/features_settings.png b/doc/ci/img/features_settings.png Binary files differnew file mode 100644 index 00000000000..17aba5d14d8 --- /dev/null +++ b/doc/ci/img/features_settings.png diff --git a/doc/integration/azure.md b/doc/integration/azure.md new file mode 100644 index 00000000000..48dddf7df44 --- /dev/null +++ b/doc/integration/azure.md @@ -0,0 +1,83 @@ +# Microsoft Azure OAuth2 OmniAuth Provider + +To enable the Microsoft Azure OAuth2 OmniAuth provider you must register your application with Azure. Azure will generate a client ID and secret key for you to use. + +1. Sign in to the [Azure Management Portal](https://manage.windowsazure.com>). + +1. Select "Active Directory" on the left and choose the directory you want to use to register GitLab. + +1. Select "Applications" at the top bar and click the "Add" button the bottom. + +1. Select "Add an application my organization is developing". + +1. Provide the project information and click the "Next" button. + - Name: 'GitLab' works just fine here. + - Type: 'WEB APPLICATION AND/OR WEB API' + +1. On the "App properties" page enter the needed URI's and click the "Complete" button. + - SIGN-IN URL: Enter the URL of your GitLab installation (e.g 'https://gitlab.mycompany.com/') + - APP ID URI: Enter the endpoint URL for Microsoft to use, just has to be unique (e.g 'https://mycompany.onmicrosoft.com/gitlab') + +1. Select "Configure" in the top menu. + +1. Add a "Reply URL" pointing to the Azure OAuth callback of your GitLab installation (e.g. https://gitlab.mycompany.com/users/auth/azure_oauth2/callback). + +1. Create a "Client secret" by selecting a duration, the secret will be generated as soon as you click the "Save" button in the bottom menu.. + +1. Note the "CLIENT ID" and the "CLIENT SECRET". + +1. Select "View endpoints" from the bottom menu. + +1. You will see lots of endpoint URLs in the form 'https://login.microsoftonline.com/TENANT ID/...', note down the TENANT ID part of one of those endpoints. + +1. On your GitLab server, open the configuration file. + + For omnibus package: + + ```sh + sudo editor /etc/gitlab/gitlab.rb + ``` + + For installations from source: + + ```sh + cd /home/git/gitlab + + sudo -u git -H editor config/gitlab.yml + ``` + +1. See [Initial OmniAuth Configuration](omniauth.md#initial-omniauth-configuration) for initial settings. + +1. Add the provider configuration: + + For omnibus package: + + ```ruby + gitlab_rails['omniauth_providers'] = [ + { + "name" => "azure_oauth2", + "args" => { + "client_id" => "CLIENT ID", + "client_secret" => "CLIENT SECRET", + "tenant_id" => "TENANT ID", + } + } + ] + ``` + + For installations from source: + + ``` + - { name: 'azure_oauth2', + args: { client_id: "CLIENT ID", + client_secret: "CLIENT SECRET", + tenant_id: "TENANT ID" } } + ``` + +1. Replace 'CLIENT ID', 'CLIENT SECRET' and 'TENANT ID' with the values you got above. + +1. Save the configuration file. + +1. Restart GitLab for the changes to take effect. + +On the sign in page there should now be a Microsoft icon below the regular sign in form. Click the icon to begin the authentication process. Microsoft will ask the user to sign in and authorize the GitLab application. If everything goes well the user will be returned to GitLab and will be signed in. diff --git a/doc/integration/omniauth.md b/doc/integration/omniauth.md index f2b1721fc03..e9e17eb4165 100644 --- a/doc/integration/omniauth.md +++ b/doc/integration/omniauth.md @@ -78,6 +78,7 @@ Now we can choose one or more of the Supported Providers below to continue confi - [Shibboleth](shibboleth.md) - [SAML](saml.md) - [Crowd](crowd.md) +- [Azure](azure.md) ## Enable OmniAuth for an Existing User diff --git a/doc/workflow/importing/import_projects_from_github.md b/doc/workflow/importing/import_projects_from_github.md index 2d77c6d1172..2027a055c37 100644 --- a/doc/workflow/importing/import_projects_from_github.md +++ b/doc/workflow/importing/import_projects_from_github.md @@ -14,7 +14,7 @@ If you want to import from a GitHub Enterprise instance, you need to use GitLab 
-* To import a project, you can simple click "Add". The importer will import your repository and issues. Once the importer is done, a new GitLab project will be created with your imported data.
+* To import a project, you can simple click "Add". The importer will import your repository, issues, and pull requests. Once the importer is done, a new GitLab project will be created with your imported data.
### Note
-When you import your projects from GitHub, it is not possible to keep your labels and milestones. We are working on improving this in the near future.
+When you import your projects from GitHub, it is not possible to keep your labels, milestones, and cross-repository pull requests. We are working on improving this in the near future.
diff --git a/doc/workflow/shortcuts.png b/doc/workflow/shortcuts.png Binary files differindex 68756ed1f98..e5914aa8e67 100644 --- a/doc/workflow/shortcuts.png +++ b/doc/workflow/shortcuts.png diff --git a/features/project/find_file.feature b/features/project/find_file.feature new file mode 100644 index 00000000000..ae8fa245923 --- /dev/null +++ b/features/project/find_file.feature @@ -0,0 +1,42 @@ +@dashboard +Feature: Project Find File + Background: + Given I sign in as a user + And I own a project + And I visit my project's files page + + @javascript + Scenario: Navigate to find file by shortcut + Given I press "t" + Then I should see "find file" page + + Scenario: Navigate to find file + Given I click Find File button + Then I should see "find file" page + + @javascript + Scenario: I search file + Given I visit project find file page + And I fill in file find with "change" + Then I should not see ".gitignore" in files + And I should not see ".gitmodules" in files + And I should see "CHANGELOG" in files + And I should not see "VERSION" in files + + @javascript + Scenario: I search file that not exist + Given I visit project find file page + And I fill in file find with "asdfghjklqwertyuizxcvbnm" + Then I should not see ".gitignore" in files + And I should not see ".gitmodules" in files + And I should not see "CHANGELOG" in files + And I should not see "VERSION" in files + + @javascript + Scenario: I search file that partially matches + Given I visit project find file page + And I fill in file find with "git" + Then I should see ".gitignore" in files + And I should see ".gitmodules" in files + And I should not see "CHANGELOG" in files + And I should not see "VERSION" in files diff --git a/features/project/fork.feature b/features/project/fork.feature index 22f68e5b340..37cd53ee977 100644 --- a/features/project/fork.feature +++ b/features/project/fork.feature @@ -14,3 +14,14 @@ Feature: Project Fork And I click link "Fork" When I fork to my namespace Then I should see a "Name has already been taken" warning + + Scenario: Merge request on canonical repo goes to fork merge request page + Given I click link "Fork" + And I fork to my namespace + Then I should see the forked project page + When I visit project "Shop" page + Then I should see "New merge request" + And I goto the Merge Requests page + Then I should see "New merge request" + And I click link "New merge request" + Then I should see the new merge request page for my namespace diff --git a/features/steps/project/fork.rb b/features/steps/project/fork.rb index b0230add34f..e98bd51ca89 100644 --- a/features/steps/project/fork.rb +++ b/features/steps/project/fork.rb @@ -30,4 +30,23 @@ class Spinach::Features::ProjectFork < Spinach::FeatureSteps click_link current_user.name end end + + step 'I should see "New merge request"' do + expect(page).to have_content(/new merge request/i) + end + + step 'I goto the Merge Requests page' do + page.within '.page-sidebar-expanded' do + click_link "Merge Requests" + end + end + + step 'I click link "New merge request"' do + expect(page).to have_content(/new merge request/i) + click_link "New Merge Request" + end + + step 'I should see the new merge request page for my namespace' do + current_path.should have_content(/#{current_user.namespace.name}/i) + end end diff --git a/features/steps/project/project_find_file.rb b/features/steps/project/project_find_file.rb new file mode 100644 index 00000000000..8c1d09d6cc6 --- /dev/null +++ b/features/steps/project/project_find_file.rb @@ -0,0 +1,73 @@ +class Spinach::Features::ProjectFindFile < Spinach::FeatureSteps + include SharedAuthentication + include SharedPaths + include SharedProject + include SharedProjectTab + + step 'I press "t"' do + find('body').native.send_key('t') + end + + step 'I click Find File button' do + click_link 'Find File' + end + + step 'I should see "find file" page' do + ensure_active_main_tab('Files') + expect(page).to have_selector('.file-finder-holder', count: 1) + end + + step 'I fill in Find by path with "git"' do + ensure_active_main_tab('Files') + expect(page).to have_selector('.file-finder-holder', count: 1) + end + + step 'I fill in file find with "git"' do + find_file "git" + end + + step 'I fill in file find with "change"' do + find_file "change" + end + + step 'I fill in file find with "asdfghjklqwertyuizxcvbnm"' do + find_file "asdfghjklqwertyuizxcvbnm" + end + + step 'I should see "VERSION" in files' do + expect(page).to have_content("VERSION") + end + + step 'I should not see "VERSION" in files' do + expect(page).not_to have_content("VERSION") + end + + step 'I should see "CHANGELOG" in files' do + expect(page).to have_content("CHANGELOG") + end + + step 'I should not see "CHANGELOG" in files' do + expect(page).not_to have_content("CHANGELOG") + end + + step 'I should see ".gitmodules" in files' do + expect(page).to have_content(".gitmodules") + end + + step 'I should not see ".gitmodules" in files' do + expect(page).not_to have_content(".gitmodules") + end + + step 'I should see ".gitignore" in files' do + expect(page).to have_content(".gitignore") + end + + step 'I should not see ".gitignore" in files' do + expect(page).not_to have_content(".gitignore") + end + + + def find_file(text) + fill_in 'file_find', with: text + end +end diff --git a/features/steps/shared/paths.rb b/features/steps/shared/paths.rb index b33bd332655..4264c9c6f1a 100644 --- a/features/steps/shared/paths.rb +++ b/features/steps/shared/paths.rb @@ -259,6 +259,10 @@ module SharedPaths visit namespace_project_deploy_keys_path(@project.namespace, @project) end + step 'I visit project find file page' do + visit namespace_project_find_file_path(@project.namespace, @project, root_ref) + end + # ---------------------------------------- # "Shop" Project # ---------------------------------------- diff --git a/lib/api/merge_requests.rb b/lib/api/merge_requests.rb index 3c1c6bda260..5c97fe1c88c 100644 --- a/lib/api/merge_requests.rb +++ b/lib/api/merge_requests.rb @@ -211,7 +211,7 @@ module API unauthorized! unless merge_request.can_be_merged_by?(current_user) not_allowed! if !merge_request.open? || merge_request.work_in_progress? - merge_request.check_if_can_be_merged if merge_request.unchecked? + merge_request.check_if_can_be_merged render_api_error!('Branch cannot be merged', 406) unless merge_request.can_be_merged? diff --git a/lib/api/users.rb b/lib/api/users.rb index 3400f0713ef..0d7813428e2 100644 --- a/lib/api/users.rb +++ b/lib/api/users.rb @@ -39,7 +39,7 @@ module API if current_user.is_admin? present @user, with: Entities::UserFull else - present @user, with: Entities::UserBasic + present @user, with: Entities::User end end diff --git a/lib/banzai/filter/relative_link_filter.rb b/lib/banzai/filter/relative_link_filter.rb index 5a081125f21..66f166939e4 100644 --- a/lib/banzai/filter/relative_link_filter.rb +++ b/lib/banzai/filter/relative_link_filter.rb @@ -91,7 +91,7 @@ module Banzai parts = request_path.split('/') parts.pop if path_type(request_path) != 'tree' - while parts.length > 1 && path.start_with?('../') + while path.start_with?('../') parts.pop path.sub!('../', '') end diff --git a/lib/banzai/pipeline/single_line_pipeline.rb b/lib/banzai/pipeline/single_line_pipeline.rb index 6725c9039a9..a3c9d4f43aa 100644 --- a/lib/banzai/pipeline/single_line_pipeline.rb +++ b/lib/banzai/pipeline/single_line_pipeline.rb @@ -3,7 +3,23 @@ require 'banzai' module Banzai module Pipeline class SingleLinePipeline < GfmPipeline + def self.filters + @filters ||= [ + Filter::SanitizationFilter, + Filter::EmojiFilter, + Filter::AutolinkFilter, + Filter::ExternalLinkFilter, + + Filter::UserReferenceFilter, + Filter::IssueReferenceFilter, + Filter::ExternalIssueReferenceFilter, + Filter::MergeRequestReferenceFilter, + Filter::SnippetReferenceFilter, + Filter::CommitRangeReferenceFilter, + Filter::CommitReferenceFilter, + ] + end end end end diff --git a/lib/banzai/renderer.rb b/lib/banzai/renderer.rb index 910e1c6994e..891c0fd7749 100644 --- a/lib/banzai/renderer.rb +++ b/lib/banzai/renderer.rb @@ -18,22 +18,13 @@ module Banzai cache_key = context.delete(:cache_key) cache_key = full_cache_key(cache_key, context[:pipeline]) - cacheless = cacheless_render(text, context) - - if cache_key && ENV["DEBUG_BANZAI_CACHE"] - cached = Rails.cache.fetch(cache_key) { cacheless } - - if cached != cacheless - Rails.logger.warn "Banzai cache mismatch" - Rails.logger.warn "Text: #{text.inspect}" - Rails.logger.warn "Context: #{context.inspect}" - Rails.logger.warn "Cache key: #{cache_key.inspect}" - Rails.logger.warn "Cacheless: #{cacheless.inspect}" - Rails.logger.warn "With cache: #{cached.inspect}" + if cache_key + Rails.cache.fetch(cache_key) do + cacheless_render(text, context) end + else + cacheless_render(text, context) end - - cacheless end def self.render_result(text, context = {}) diff --git a/lib/gitlab/github_import/base_formatter.rb b/lib/gitlab/github_import/base_formatter.rb new file mode 100644 index 00000000000..202263c6742 --- /dev/null +++ b/lib/gitlab/github_import/base_formatter.rb @@ -0,0 +1,21 @@ +module Gitlab + module GithubImport + class BaseFormatter + attr_reader :formatter, :project, :raw_data + + def initialize(project, raw_data) + @project = project + @raw_data = raw_data + @formatter = Gitlab::ImportFormatter.new + end + + private + + def gl_user_id(github_id) + User.joins(:identities). + find_by("identities.extern_uid = ? AND identities.provider = 'github'", github_id.to_s). + try(:id) + end + end + end +end diff --git a/lib/gitlab/github_import/comment_formatter.rb b/lib/gitlab/github_import/comment_formatter.rb new file mode 100644 index 00000000000..7d58e53991a --- /dev/null +++ b/lib/gitlab/github_import/comment_formatter.rb @@ -0,0 +1,45 @@ +module Gitlab + module GithubImport + class CommentFormatter < BaseFormatter + def attributes + { + project: project, + note: note, + commit_id: raw_data.commit_id, + line_code: line_code, + author_id: author_id, + created_at: raw_data.created_at, + updated_at: raw_data.updated_at + } + end + + private + + def author + raw_data.user.login + end + + def author_id + gl_user_id(raw_data.user.id) || project.creator_id + end + + def body + raw_data.body || "" + end + + def line_code + if on_diff? + Gitlab::Diff::LineCode.generate(raw_data.path, raw_data.position, 0) + end + end + + def on_diff? + raw_data.path && raw_data.position + end + + def note + formatter.author_line(author) + body + end + end + end +end diff --git a/lib/gitlab/github_import/importer.rb b/lib/gitlab/github_import/importer.rb index b5720f6e2cb..2b0afbc7b39 100644 --- a/lib/gitlab/github_import/importer.rb +++ b/lib/gitlab/github_import/importer.rb @@ -12,39 +12,59 @@ module Gitlab end def execute - #Issues && Comments + import_issues + import_pull_requests + + true + end + + private + + def import_issues client.list_issues(project.import_source, state: :all, sort: :created, - direction: :asc).each do |issue| - if issue.pull_request.nil? - - body = @formatter.author_line(issue.user.login) - body += issue.body || "" + direction: :asc).each do |raw_data| + gh_issue = IssueFormatter.new(project, raw_data) - if issue.comments > 0 - body += @formatter.comments_header + if gh_issue.valid? + issue = Issue.create!(gh_issue.attributes) - client.issue_comments(project.import_source, issue.number).each do |c| - body += @formatter.comment(c.user.login, c.created_at, c.body) - end + if gh_issue.has_comments? + import_comments(gh_issue.number, issue) end + end + end + end + + def import_pull_requests + client.pull_requests(project.import_source, state: :all, + sort: :created, + direction: :asc).each do |raw_data| + pull_request = PullRequestFormatter.new(project, raw_data) - project.issues.create!( - description: body, - title: issue.title, - state: issue.state == 'closed' ? 'closed' : 'opened', - author_id: gl_user_id(project, issue.user.id) - ) + if !pull_request.cross_project? && pull_request.valid? + merge_request = MergeRequest.create!(pull_request.attributes) + import_comments(pull_request.number, merge_request) + import_comments_on_diff(pull_request.number, merge_request) end end end - private + def import_comments(issue_number, noteable) + comments = client.issue_comments(project.import_source, issue_number) + create_comments(comments, noteable) + end - def gl_user_id(project, github_id) - user = User.joins(:identities). - find_by("identities.extern_uid = ? AND identities.provider = 'github'", github_id.to_s) - (user && user.id) || project.creator_id + def import_comments_on_diff(pull_request_number, merge_request) + comments = client.pull_request_comments(project.import_source, pull_request_number) + create_comments(comments, merge_request) + end + + def create_comments(comments, noteable) + comments.each do |raw_data| + comment = CommentFormatter.new(project, raw_data) + noteable.notes.create!(comment.attributes) + end end end end diff --git a/lib/gitlab/github_import/issue_formatter.rb b/lib/gitlab/github_import/issue_formatter.rb new file mode 100644 index 00000000000..1e3ba44f27c --- /dev/null +++ b/lib/gitlab/github_import/issue_formatter.rb @@ -0,0 +1,66 @@ +module Gitlab + module GithubImport + class IssueFormatter < BaseFormatter + def attributes + { + project: project, + title: raw_data.title, + description: description, + state: state, + author_id: author_id, + assignee_id: assignee_id, + created_at: raw_data.created_at, + updated_at: updated_at + } + end + + def has_comments? + raw_data.comments > 0 + end + + def number + raw_data.number + end + + def valid? + raw_data.pull_request.nil? + end + + private + + def assigned? + raw_data.assignee.present? + end + + def assignee_id + if assigned? + gl_user_id(raw_data.assignee.id) + end + end + + def author + raw_data.user.login + end + + def author_id + gl_user_id(raw_data.user.id) || project.creator_id + end + + def body + raw_data.body || "" + end + + def description + @formatter.author_line(author) + body + end + + def state + raw_data.state == 'closed' ? 'closed' : 'opened' + end + + def updated_at + state == 'closed' ? raw_data.closed_at : raw_data.updated_at + end + end + end +end diff --git a/lib/gitlab/github_import/pull_request_formatter.rb b/lib/gitlab/github_import/pull_request_formatter.rb new file mode 100644 index 00000000000..b7c47958cc7 --- /dev/null +++ b/lib/gitlab/github_import/pull_request_formatter.rb @@ -0,0 +1,101 @@ +module Gitlab + module GithubImport + class PullRequestFormatter < BaseFormatter + def attributes + { + title: raw_data.title, + description: description, + source_project: source_project, + source_branch: source_branch.name, + target_project: target_project, + target_branch: target_branch.name, + state: state, + author_id: author_id, + assignee_id: assignee_id, + created_at: raw_data.created_at, + updated_at: updated_at + } + end + + def cross_project? + source_repo.fork == true + end + + def number + raw_data.number + end + + def valid? + source_branch.present? && target_branch.present? + end + + private + + def assigned? + raw_data.assignee.present? + end + + def assignee_id + if assigned? + gl_user_id(raw_data.assignee.id) + end + end + + def author + raw_data.user.login + end + + def author_id + gl_user_id(raw_data.user.id) || project.creator_id + end + + def body + raw_data.body || "" + end + + def description + formatter.author_line(author) + body + end + + def source_project + project + end + + def source_repo + raw_data.head.repo + end + + def source_branch + source_project.repository.find_branch(raw_data.head.ref) + end + + def target_project + project + end + + def target_branch + target_project.repository.find_branch(raw_data.base.ref) + end + + def state + @state ||= case true + when raw_data.state == 'closed' && raw_data.merged_at.present? + 'merged' + when raw_data.state == 'closed' + 'closed' + else + 'opened' + end + end + + def updated_at + case state + when 'merged' then raw_data.merged_at + when 'closed' then raw_data.closed_at + else + raw_data.updated_at + end + end + end + end +end diff --git a/lib/gitlab/metrics.rb b/lib/gitlab/metrics.rb index ee88ab34d6c..44356a0e42c 100644 --- a/lib/gitlab/metrics.rb +++ b/lib/gitlab/metrics.rb @@ -13,8 +13,6 @@ module Gitlab timeout: current_application_settings[:metrics_timeout], method_call_threshold: current_application_settings[:metrics_method_call_threshold], host: current_application_settings[:metrics_host], - username: current_application_settings[:metrics_username], - password: current_application_settings[:metrics_password], port: current_application_settings[:metrics_port] } end @@ -90,12 +88,10 @@ module Gitlab if enabled? @pool = ConnectionPool.new(size: settings[:pool_size], timeout: settings[:timeout]) do host = settings[:host] - user = settings[:username] - pw = settings[:password] port = settings[:port] InfluxDB::Client. - new(udp: { host: host, port: port }, username: user, password: pw) + new(udp: { host: host, port: port }) end end end diff --git a/lib/version_check.rb b/lib/version_check.rb index ea23344948c..91ad07feee5 100644 --- a/lib/version_check.rb +++ b/lib/version_check.rb @@ -13,6 +13,6 @@ class VersionCheck end def host - 'https://version.gitlab.com/check.png' + 'https://version.gitlab.com/check.svg' end end diff --git a/spec/controllers/abuse_reports_controller_spec.rb b/spec/controllers/abuse_reports_controller_spec.rb index 15824a1c67f..80a418feb3e 100644 --- a/spec/controllers/abuse_reports_controller_spec.rb +++ b/spec/controllers/abuse_reports_controller_spec.rb @@ -1,76 +1,46 @@ require 'spec_helper' describe AbuseReportsController do - let(:reporter) { create(:user) } - let(:user) { create(:user) } - let(:message) { "This user is a spammer" } + let(:reporter) { create(:user) } + let(:user) { create(:user) } + let(:attrs) do + attributes_for(:abuse_report) do |hash| + hash[:user_id] = user.id + end + end before do sign_in(reporter) end - describe "POST create" do - context "with admin notification email set" do - let(:admin_email) { "admin@example.com"} - - before(:each) do - stub_application_setting(admin_notification_email: admin_email) + describe 'POST create' do + context 'with valid attributes' do + it 'saves the abuse report' do + expect do + post :create, abuse_report: attrs + end.to change { AbuseReport.count }.by(1) end - it "sends a notification email" do - perform_enqueued_jobs do - post :create, - abuse_report: { - user_id: user.id, - message: message - } - - email = ActionMailer::Base.deliveries.last + it 'calls notify' do + expect_any_instance_of(AbuseReport).to receive(:notify) - expect(email.to).to eq([admin_email]) - expect(email.subject).to include(user.username) - expect(email.text_part.body).to include(message) - end + post :create, abuse_report: attrs end - it "saves the abuse report" do - perform_enqueued_jobs do - expect do - post :create, - abuse_report: { - user_id: user.id, - message: message - } - end.to change { AbuseReport.count }.by(1) - end - end - end + it 'redirects back to the reported user' do + post :create, abuse_report: attrs - context "without admin notification email set" do - before(:each) do - stub_application_setting(admin_notification_email: nil) + expect(response).to redirect_to user end + end - it "does not send a notification email" do - expect do - post :create, - abuse_report: { - user_id: user.id, - message: message - } - end.not_to change { ActionMailer::Base.deliveries.count } - end + context 'with invalid attributes' do + it 'renders new' do + attrs.delete(:user_id) + post :create, abuse_report: attrs - it "saves the abuse report" do - expect do - post :create, - abuse_report: { - user_id: user.id, - message: message - } - end.to change { AbuseReport.count }.by(1) + expect(response).to render_template(:new) end end end - end diff --git a/spec/controllers/projects/find_file_controller_spec.rb b/spec/controllers/projects/find_file_controller_spec.rb new file mode 100644 index 00000000000..038dfeb8466 --- /dev/null +++ b/spec/controllers/projects/find_file_controller_spec.rb @@ -0,0 +1,66 @@ +require 'spec_helper' + +describe Projects::FindFileController do + let(:project) { create(:project) } + let(:user) { create(:user) } + + before do + sign_in(user) + + project.team << [user, :master] + controller.instance_variable_set(:@project, project) + end + + describe "GET #show" do + # Make sure any errors accessing the tree in our views bubble up to this spec + render_views + + before do + get(:show, + namespace_id: project.namespace.to_param, + project_id: project.to_param, + id: id) + end + + context "valid branch" do + let(:id) { 'master' } + it { is_expected.to respond_with(:success) } + end + + context "invalid branch" do + let(:id) { 'invalid-branch' } + it { is_expected.to respond_with(:not_found) } + end + end + + describe "GET #list" do + def go(format: 'json') + get :list, + namespace_id: project.namespace.to_param, + project_id: project.to_param, + id: id, + format: format + end + + context "valid branch" do + let(:id) { 'master' } + it 'returns an array of file path list' do + go + + json = JSON.parse(response.body) + is_expected.to respond_with(:success) + expect(json).not_to eq(nil) + expect(json.length).to be >= 0 + end + end + + context "invalid branch" do + let(:id) { 'invalid-branch' } + + it 'responds with status 404' do + go + is_expected.to respond_with(:not_found) + end + end + end +end diff --git a/spec/helpers/page_layout_helper_spec.rb b/spec/helpers/page_layout_helper_spec.rb index fd7107779f6..cf632f594c7 100644 --- a/spec/helpers/page_layout_helper_spec.rb +++ b/spec/helpers/page_layout_helper_spec.rb @@ -2,10 +2,8 @@ require 'rails_helper' describe PageLayoutHelper do describe 'page_description' do - it 'defaults to value returned by page_description_default helper' do - allow(helper).to receive(:page_description_default).and_return('Foo') - - expect(helper.page_description).to eq 'Foo' + it 'defaults to nil' do + expect(helper.page_description).to eq nil end it 'returns the last-pushed description' do @@ -42,58 +40,32 @@ describe PageLayoutHelper do end end - describe 'page_description_default' do - it 'uses Project description when available' do - project = double(description: 'Project Description') - helper.instance_variable_set(:@project, project) - - expect(helper.page_description_default).to eq 'Project Description' - end - - it 'uses brand_title when Project description is nil' do - project = double(description: nil) - helper.instance_variable_set(:@project, project) - - expect(helper).to receive(:brand_title).and_return('Brand Title') - expect(helper.page_description_default).to eq 'Brand Title' - end - - it 'falls back to brand_title' do - allow(helper).to receive(:brand_title).and_return('Brand Title') - - expect(helper.page_description_default).to eq 'Brand Title' - end - end - describe 'page_image' do it 'defaults to the GitLab logo' do expect(helper.page_image).to end_with 'assets/gitlab_logo.png' end - context 'with @project' do - it 'uses Project avatar if available' do - project = double(avatar_url: 'http://example.com/uploads/avatar.png') - helper.instance_variable_set(:@project, project) + %w(project user group).each do |type| + context "with @#{type} assigned" do + it "uses #{type.titlecase} avatar if available" do + object = double(avatar_url: 'http://example.com/uploads/avatar.png') + assign(type, object) - expect(helper.page_image).to eq project.avatar_url - end + expect(helper.page_image).to eq object.avatar_url + end - it 'falls back to the default' do - project = double(avatar_url: nil) - helper.instance_variable_set(:@project, project) + it 'falls back to the default when avatar_url is nil' do + object = double(avatar_url: nil) + assign(type, object) - expect(helper.page_image).to end_with 'assets/gitlab_logo.png' + expect(helper.page_image).to end_with 'assets/gitlab_logo.png' + end end - end - - context 'with @user' do - it 'delegates to avatar_icon helper' do - user = double('User') - helper.instance_variable_set(:@user, user) - - expect(helper).to receive(:avatar_icon).with(user) - helper.page_image + context "with no assignments" do + it 'falls back to the default' do + expect(helper.page_image).to end_with 'assets/gitlab_logo.png' + end end end end diff --git a/spec/lib/banzai/filter/relative_link_filter_spec.rb b/spec/lib/banzai/filter/relative_link_filter_spec.rb index 0b3e5ecbc9f..0e6685f0ffb 100644 --- a/spec/lib/banzai/filter/relative_link_filter_spec.rb +++ b/spec/lib/banzai/filter/relative_link_filter_spec.rb @@ -92,6 +92,14 @@ describe Banzai::Filter::RelativeLinkFilter, lib: true do to eq "/#{project_path}/blob/#{ref}/doc/api/README.md" end + it 'rebuilds relative URL for a file in the repository root' do + relative_link = link('../README.md') + doc = filter(relative_link, requested_path: 'doc/some-file.md') + + expect(doc.at_css('a')['href']). + to eq "/#{project_path}/blob/#{ref}/README.md" + end + it 'rebuilds relative URL for a file in the repo with an anchor' do doc = filter(link('README.md#section')) expect(doc.at_css('a')['href']). diff --git a/spec/lib/gitlab/github_import/comment_formatter_spec.rb b/spec/lib/gitlab/github_import/comment_formatter_spec.rb new file mode 100644 index 00000000000..a324a82e69f --- /dev/null +++ b/spec/lib/gitlab/github_import/comment_formatter_spec.rb @@ -0,0 +1,80 @@ +require 'spec_helper' + +describe Gitlab::GithubImport::CommentFormatter, lib: true do + let(:project) { create(:project) } + let(:octocat) { OpenStruct.new(id: 123456, login: 'octocat') } + let(:created_at) { DateTime.strptime('2013-04-10T20:09:31Z') } + let(:updated_at) { DateTime.strptime('2014-03-03T18:58:10Z') } + let(:base_data) do + { + body: "I'm having a problem with this.", + user: octocat, + created_at: created_at, + updated_at: updated_at + } + end + + subject(:comment) { described_class.new(project, raw_data)} + + describe '#attributes' do + context 'when do not reference a portion of the diff' do + let(:raw_data) { OpenStruct.new(base_data) } + + it 'returns formatted attributes' do + expected = { + project: project, + note: "*Created by: octocat*\n\nI'm having a problem with this.", + commit_id: nil, + line_code: nil, + author_id: project.creator_id, + created_at: created_at, + updated_at: updated_at + } + + expect(comment.attributes).to eq(expected) + end + end + + context 'when on a portion of the diff' do + let(:diff_data) do + { + body: 'Great stuff', + commit_id: '6dcb09b5b57875f334f61aebed695e2e4193db5e', + diff_hunk: '@@ -16,33 +16,40 @@ public class Connection : IConnection...', + path: 'file1.txt', + position: 1 + } + end + + let(:raw_data) { OpenStruct.new(base_data.merge(diff_data)) } + + it 'returns formatted attributes' do + expected = { + project: project, + note: "*Created by: octocat*\n\nGreat stuff", + commit_id: '6dcb09b5b57875f334f61aebed695e2e4193db5e', + line_code: 'ce1be0ff4065a6e9415095c95f25f47a633cef2b_0_1', + author_id: project.creator_id, + created_at: created_at, + updated_at: updated_at + } + + expect(comment.attributes).to eq(expected) + end + end + + context 'when author is a GitLab user' do + let(:raw_data) { OpenStruct.new(base_data.merge(user: octocat)) } + + it 'returns project#creator_id as author_id when is not a GitLab user' do + expect(comment.attributes.fetch(:author_id)).to eq project.creator_id + end + + it 'returns GitLab user id as author_id when is a GitLab user' do + gl_user = create(:omniauth_user, extern_uid: octocat.id, provider: 'github') + + expect(comment.attributes.fetch(:author_id)).to eq gl_user.id + end + end + end +end diff --git a/spec/lib/gitlab/github_import/issue_formatter_spec.rb b/spec/lib/gitlab/github_import/issue_formatter_spec.rb new file mode 100644 index 00000000000..fd05428b322 --- /dev/null +++ b/spec/lib/gitlab/github_import/issue_formatter_spec.rb @@ -0,0 +1,139 @@ +require 'spec_helper' + +describe Gitlab::GithubImport::IssueFormatter, lib: true do + let!(:project) { create(:project, namespace: create(:namespace, path: 'octocat')) } + let(:octocat) { OpenStruct.new(id: 123456, login: 'octocat') } + let(:created_at) { DateTime.strptime('2011-01-26T19:01:12Z') } + let(:updated_at) { DateTime.strptime('2011-01-27T19:01:12Z') } + + let(:base_data) do + { + number: 1347, + state: 'open', + title: 'Found a bug', + body: "I'm having a problem with this.", + assignee: nil, + user: octocat, + comments: 0, + pull_request: nil, + created_at: created_at, + updated_at: updated_at, + closed_at: nil + } + end + + subject(:issue) { described_class.new(project, raw_data)} + + describe '#attributes' do + context 'when issue is open' do + let(:raw_data) { OpenStruct.new(base_data.merge(state: 'open')) } + + it 'returns formatted attributes' do + expected = { + project: project, + title: 'Found a bug', + description: "*Created by: octocat*\n\nI'm having a problem with this.", + state: 'opened', + author_id: project.creator_id, + assignee_id: nil, + created_at: created_at, + updated_at: updated_at + } + + expect(issue.attributes).to eq(expected) + end + end + + context 'when issue is closed' do + let(:closed_at) { DateTime.strptime('2011-01-28T19:01:12Z') } + let(:raw_data) { OpenStruct.new(base_data.merge(state: 'closed', closed_at: closed_at)) } + + it 'returns formatted attributes' do + expected = { + project: project, + title: 'Found a bug', + description: "*Created by: octocat*\n\nI'm having a problem with this.", + state: 'closed', + author_id: project.creator_id, + assignee_id: nil, + created_at: created_at, + updated_at: closed_at + } + + expect(issue.attributes).to eq(expected) + end + end + + context 'when it is assigned to someone' do + let(:raw_data) { OpenStruct.new(base_data.merge(assignee: octocat)) } + + it 'returns nil as assignee_id when is not a GitLab user' do + expect(issue.attributes.fetch(:assignee_id)).to be_nil + end + + it 'returns GitLab user id as assignee_id when is a GitLab user' do + gl_user = create(:omniauth_user, extern_uid: octocat.id, provider: 'github') + + expect(issue.attributes.fetch(:assignee_id)).to eq gl_user.id + end + end + + context 'when author is a GitLab user' do + let(:raw_data) { OpenStruct.new(base_data.merge(user: octocat)) } + + it 'returns project#creator_id as author_id when is not a GitLab user' do + expect(issue.attributes.fetch(:author_id)).to eq project.creator_id + end + + it 'returns GitLab user id as author_id when is a GitLab user' do + gl_user = create(:omniauth_user, extern_uid: octocat.id, provider: 'github') + + expect(issue.attributes.fetch(:author_id)).to eq gl_user.id + end + end + end + + describe '#has_comments?' do + context 'when number of comments is greater than zero' do + let(:raw_data) { OpenStruct.new(base_data.merge(comments: 1)) } + + it 'returns true' do + expect(issue.has_comments?).to eq true + end + end + + context 'when number of comments is equal to zero' do + let(:raw_data) { OpenStruct.new(base_data.merge(comments: 0)) } + + it 'returns false' do + expect(issue.has_comments?).to eq false + end + end + end + + describe '#number' do + let(:raw_data) { OpenStruct.new(base_data.merge(number: 1347)) } + + it 'returns pull request number' do + expect(issue.number).to eq 1347 + end + end + + describe '#valid?' do + context 'when mention a pull request' do + let(:raw_data) { OpenStruct.new(base_data.merge(pull_request: OpenStruct.new)) } + + it 'returns false' do + expect(issue.valid?).to eq false + end + end + + context 'when does not mention a pull request' do + let(:raw_data) { OpenStruct.new(base_data.merge(pull_request: nil)) } + + it 'returns true' do + expect(issue.valid?).to eq true + end + end + end +end diff --git a/spec/lib/gitlab/github_import/pull_request_formatter_spec.rb b/spec/lib/gitlab/github_import/pull_request_formatter_spec.rb new file mode 100644 index 00000000000..9aefec77f6d --- /dev/null +++ b/spec/lib/gitlab/github_import/pull_request_formatter_spec.rb @@ -0,0 +1,184 @@ +require 'spec_helper' + +describe Gitlab::GithubImport::PullRequestFormatter, lib: true do + let(:project) { create(:project) } + let(:source_branch) { OpenStruct.new(ref: 'feature') } + let(:target_branch) { OpenStruct.new(ref: 'master') } + let(:octocat) { OpenStruct.new(id: 123456, login: 'octocat') } + let(:created_at) { DateTime.strptime('2011-01-26T19:01:12Z') } + let(:updated_at) { DateTime.strptime('2011-01-27T19:01:12Z') } + let(:base_data) do + { + number: 1347, + state: 'open', + title: 'New feature', + body: 'Please pull these awesome changes', + head: source_branch, + base: target_branch, + assignee: nil, + user: octocat, + created_at: created_at, + updated_at: updated_at, + closed_at: nil, + merged_at: nil + } + end + + subject(:pull_request) { described_class.new(project, raw_data)} + + describe '#attributes' do + context 'when pull request is open' do + let(:raw_data) { OpenStruct.new(base_data.merge(state: 'open')) } + + it 'returns formatted attributes' do + expected = { + title: 'New feature', + description: "*Created by: octocat*\n\nPlease pull these awesome changes", + source_project: project, + source_branch: 'feature', + target_project: project, + target_branch: 'master', + state: 'opened', + author_id: project.creator_id, + assignee_id: nil, + created_at: created_at, + updated_at: updated_at + } + + expect(pull_request.attributes).to eq(expected) + end + end + + context 'when pull request is closed' do + let(:closed_at) { DateTime.strptime('2011-01-28T19:01:12Z') } + let(:raw_data) { OpenStruct.new(base_data.merge(state: 'closed', closed_at: closed_at)) } + + it 'returns formatted attributes' do + expected = { + title: 'New feature', + description: "*Created by: octocat*\n\nPlease pull these awesome changes", + source_project: project, + source_branch: 'feature', + target_project: project, + target_branch: 'master', + state: 'closed', + author_id: project.creator_id, + assignee_id: nil, + created_at: created_at, + updated_at: closed_at + } + + expect(pull_request.attributes).to eq(expected) + end + end + + context 'when pull request is merged' do + let(:merged_at) { DateTime.strptime('2011-01-28T13:01:12Z') } + let(:raw_data) { OpenStruct.new(base_data.merge(state: 'closed', merged_at: merged_at)) } + + it 'returns formatted attributes' do + expected = { + title: 'New feature', + description: "*Created by: octocat*\n\nPlease pull these awesome changes", + source_project: project, + source_branch: 'feature', + target_project: project, + target_branch: 'master', + state: 'merged', + author_id: project.creator_id, + assignee_id: nil, + created_at: created_at, + updated_at: merged_at + } + + expect(pull_request.attributes).to eq(expected) + end + end + + context 'when it is assigned to someone' do + let(:raw_data) { OpenStruct.new(base_data.merge(assignee: octocat)) } + + it 'returns nil as assignee_id when is not a GitLab user' do + expect(pull_request.attributes.fetch(:assignee_id)).to be_nil + end + + it 'returns GitLab user id as assignee_id when is a GitLab user' do + gl_user = create(:omniauth_user, extern_uid: octocat.id, provider: 'github') + + expect(pull_request.attributes.fetch(:assignee_id)).to eq gl_user.id + end + end + + context 'when author is a GitLab user' do + let(:raw_data) { OpenStruct.new(base_data.merge(user: octocat)) } + + it 'returns project#creator_id as author_id when is not a GitLab user' do + expect(pull_request.attributes.fetch(:author_id)).to eq project.creator_id + end + + it 'returns GitLab user id as author_id when is a GitLab user' do + gl_user = create(:omniauth_user, extern_uid: octocat.id, provider: 'github') + + expect(pull_request.attributes.fetch(:author_id)).to eq gl_user.id + end + end + end + + describe '#cross_project?' do + context 'when source repo is not a fork' do + let(:local_repo) { OpenStruct.new(fork: false) } + let(:source_branch) { OpenStruct.new(ref: 'feature', repo: local_repo) } + let(:raw_data) { OpenStruct.new(base_data.merge(head: source_branch)) } + + it 'returns false' do + expect(pull_request.cross_project?).to eq false + end + end + + context 'when source repo is a fork' do + let(:forked_repo) { OpenStruct.new(fork: true) } + let(:source_branch) { OpenStruct.new(ref: 'feature', repo: forked_repo) } + let(:raw_data) { OpenStruct.new(base_data.merge(head: source_branch)) } + + it 'returns true' do + expect(pull_request.cross_project?).to eq true + end + end + end + + describe '#number' do + let(:raw_data) { OpenStruct.new(base_data.merge(number: 1347)) } + + it 'returns pull request number' do + expect(pull_request.number).to eq 1347 + end + end + + describe '#valid?' do + let(:invalid_branch) { OpenStruct.new(ref: 'invalid-branch') } + + context 'when source and target branches exists' do + let(:raw_data) { OpenStruct.new(base_data.merge(head: source_branch, base: target_branch)) } + + it 'returns true' do + expect(pull_request.valid?).to eq true + end + end + + context 'when source branch doesn not exists' do + let(:raw_data) { OpenStruct.new(base_data.merge(head: invalid_branch, base: target_branch)) } + + it 'returns false' do + expect(pull_request.valid?).to eq false + end + end + + context 'when target branch doesn not exists' do + let(:raw_data) { OpenStruct.new(base_data.merge(head: source_branch, base: invalid_branch)) } + + it 'returns false' do + expect(pull_request.valid?).to eq false + end + end + end +end diff --git a/spec/mailers/abuse_report_mailer_spec.rb b/spec/mailers/abuse_report_mailer_spec.rb new file mode 100644 index 00000000000..eb433c38873 --- /dev/null +++ b/spec/mailers/abuse_report_mailer_spec.rb @@ -0,0 +1,38 @@ +require 'rails_helper' + +describe AbuseReportMailer do + include EmailSpec::Matchers + + describe '.notify' do + context 'with admin_notification_email set' do + before do + stub_application_setting(admin_notification_email: 'admin@example.com') + end + + it 'sends to the admin_notification_email' do + report = create(:abuse_report) + + mail = described_class.notify(report.id) + + expect(mail).to deliver_to 'admin@example.com' + end + + it 'includes the user in the subject' do + report = create(:abuse_report) + + mail = described_class.notify(report.id) + + expect(mail).to have_subject "#{report.user.name} (#{report.user.username}) was reported for abuse" + end + end + + context 'with no admin_notification_email set' do + it 'returns early' do + stub_application_setting(admin_notification_email: nil) + + expect { described_class.notify(spy).deliver_now }. + not_to change { ActionMailer::Base.deliveries.count } + end + end + end +end diff --git a/spec/models/abuse_report_spec.rb b/spec/models/abuse_report_spec.rb index d45319b25d4..46cab1644c7 100644 --- a/spec/models/abuse_report_spec.rb +++ b/spec/models/abuse_report_spec.rb @@ -28,4 +28,21 @@ RSpec.describe AbuseReport, type: :model do it { is_expected.to validate_presence_of(:message) } it { is_expected.to validate_uniqueness_of(:user_id) } end + + describe '#notify' do + it 'delivers' do + expect(AbuseReportMailer).to receive(:notify).with(subject.id). + and_return(spy) + + subject.notify + end + + it 'returns early when not persisted' do + report = build(:abuse_report) + + expect(AbuseReportMailer).not_to receive(:notify) + + report.notify + end + end end diff --git a/spec/models/note_spec.rb b/spec/models/note_spec.rb index 593d8f76215..151a29e974b 100644 --- a/spec/models/note_spec.rb +++ b/spec/models/note_spec.rb @@ -125,6 +125,19 @@ describe Note, models: true do let(:set_mentionable_text) { ->(txt) { subject.note = txt } } end + describe "#all_references" do + let!(:note1) { create(:note) } + let!(:note2) { create(:note) } + + it "reads the rendered note body from the cache" do + expect(Banzai::Renderer).to receive(:render).with(note1.note, pipeline: :note, cache_key: [note1, "note"], project: note1.project) + expect(Banzai::Renderer).to receive(:render).with(note2.note, pipeline: :note, cache_key: [note2, "note"], project: note2.project) + + note1.all_references + note2.all_references + end + end + describe :search do let!(:note) { create(:note, note: "WoW") } @@ -164,7 +177,7 @@ describe Note, models: true do expect(note.editable?).to be_falsy end end - + describe "set_award!" do let(:issue) { create :issue } diff --git a/spec/models/project_services/asana_service_spec.rb b/spec/models/project_services/asana_service_spec.rb index 64bb92fba95..f3d15f3c1ea 100644 --- a/spec/models/project_services/asana_service_spec.rb +++ b/spec/models/project_services/asana_service_spec.rb @@ -40,6 +40,20 @@ describe AsanaService, models: true do let(:user) { create(:user) } let(:project) { create(:project) } + def create_data_for_commits(*messages) + { + object_kind: 'push', + ref: 'master', + user_name: user.name, + commits: messages.map do |m| + { + message: m, + url: 'https://gitlab.com/', + } + end + } + end + before do @asana = AsanaService.new allow(@asana).to receive_messages( @@ -51,16 +65,67 @@ describe AsanaService, models: true do ) end - it 'should call Asana service to created a story' do - expect(Asana::Task).to receive(:find).with('123456').once + it 'should call Asana service to create a story' do + data = create_data_for_commits('Message from commit. related to #123456') + expected_message = "#{data[:user_name]} pushed to branch #{data[:ref]} of #{project.name_with_namespace} ( #{data[:commits][0][:url]} ): #{data[:commits][0][:message]}" - @asana.check_commit('related to #123456', 'pushed') + d1 = double('Asana::Task') + expect(d1).to receive(:add_comment).with(text: expected_message) + expect(Asana::Task).to receive(:find_by_id).with(anything, '123456').once.and_return(d1) + + @asana.execute(data) end - it 'should call Asana service to created a story and close a task' do - expect(Asana::Task).to receive(:find).with('456789').twice + it 'should call Asana service to create a story and close a task' do + data = create_data_for_commits('fix #456789') + d1 = double('Asana::Task') + expect(d1).to receive(:add_comment) + expect(d1).to receive(:update).with(completed: true) + expect(Asana::Task).to receive(:find_by_id).with(anything, '456789').once.and_return(d1) + + @asana.execute(data) + end + + it 'should be able to close via url' do + data = create_data_for_commits('closes https://app.asana.com/19292/956299/42') + d1 = double('Asana::Task') + expect(d1).to receive(:add_comment) + expect(d1).to receive(:update).with(completed: true) + expect(Asana::Task).to receive(:find_by_id).with(anything, '42').once.and_return(d1) + + @asana.execute(data) + end + + it 'should allow multiple matches per line' do + message = <<-EOF + minor bigfix, refactoring, fixed #123 and Closes #456 work on #789 + ref https://app.asana.com/19292/956299/42 and closing https://app.asana.com/19292/956299/12 + EOF + data = create_data_for_commits(message) + d1 = double('Asana::Task') + expect(d1).to receive(:add_comment) + expect(d1).to receive(:update).with(completed: true) + expect(Asana::Task).to receive(:find_by_id).with(anything, '123').once.and_return(d1) + + d2 = double('Asana::Task') + expect(d2).to receive(:add_comment) + expect(d2).to receive(:update).with(completed: true) + expect(Asana::Task).to receive(:find_by_id).with(anything, '456').once.and_return(d2) + + d3 = double('Asana::Task') + expect(d3).to receive(:add_comment) + expect(Asana::Task).to receive(:find_by_id).with(anything, '789').once.and_return(d3) + + d4 = double('Asana::Task') + expect(d4).to receive(:add_comment) + expect(Asana::Task).to receive(:find_by_id).with(anything, '42').once.and_return(d4) + + d5 = double('Asana::Task') + expect(d5).to receive(:add_comment) + expect(d5).to receive(:update).with(completed: true) + expect(Asana::Task).to receive(:find_by_id).with(anything, '12').once.and_return(d5) - @asana.check_commit('fix #456789', 'pushed') + @asana.execute(data) end end end diff --git a/spec/routing/project_routing_spec.rb b/spec/routing/project_routing_spec.rb index 82f62a8709c..2a70c190337 100644 --- a/spec/routing/project_routing_spec.rb +++ b/spec/routing/project_routing_spec.rb @@ -434,6 +434,18 @@ describe Projects::TreeController, 'routing' do end end +# project_find_file GET /:namespace_id/:project_id/find_file/*id(.:format) projects/find_file#show {:id=>/.+/, :namespace_id=>/[a-zA-Z.0-9_\-]+/, :project_id=>/[a-zA-Z.0-9_\-]+(?<!\.atom)/, :format=>/html/} +# project_files GET /:namespace_id/:project_id/files/*id(.:format) projects/find_file#list {:id=>/(?:[^.]|\.(?!json$))+/, :namespace_id=>/[a-zA-Z.0-9_\-]+/, :project_id=>/[a-zA-Z.0-9_\-]+(?<!\.atom)/, :format=>/json/} +describe Projects::FindFileController, 'routing' do + it 'to #show' do + expect(get('/gitlab/gitlabhq/find_file/master')).to route_to('projects/find_file#show', namespace_id: 'gitlab', project_id: 'gitlabhq', id: 'master') + end + + it 'to #list' do + expect(get('/gitlab/gitlabhq/files/master.json')).to route_to('projects/find_file#list', namespace_id: 'gitlab', project_id: 'gitlabhq', id: 'master', format: 'json') + end +end + describe Projects::BlobController, 'routing' do it 'to #edit' do expect(get('/gitlab/gitlabhq/edit/master/app/models/project.rb')).to( diff --git a/spec/services/notification_service_spec.rb b/spec/services/notification_service_spec.rb index 588ecc51382..6d219f35895 100644 --- a/spec/services/notification_service_spec.rb +++ b/spec/services/notification_service_spec.rb @@ -52,6 +52,9 @@ describe NotificationService, services: true do it do add_users_with_subscription(note.project, issue) + # Ensure create SentNotification by noteable = issue 6 times, not noteable = note + expect(SentNotification).to receive(:record).with(issue, any_args).exactly(7).times + ActionMailer::Base.deliveries.clear notification.new_note(note) diff --git a/vendor/assets/javascripts/fuzzaldrin-plus.min.js b/vendor/assets/javascripts/fuzzaldrin-plus.min.js new file mode 100644 index 00000000000..3f25c2d8373 --- /dev/null +++ b/vendor/assets/javascripts/fuzzaldrin-plus.min.js @@ -0,0 +1 @@ +(function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(require,module,exports){(function(){var PathSeparator,legacy_scorer,pluckCandidates,scorer,sortCandidates;scorer=require('./scorer');legacy_scorer=require('./legacy');pluckCandidates=function(a){return a.candidate};sortCandidates=function(a,b){return b.score-a.score};PathSeparator=require('path').sep;module.exports=function(candidates,query,arg){var allowErrors,bAllowErrors,bKey,candidate,coreQuery,i,j,key,legacy,len,len1,maxInners,maxResults,prepQuery,queryHasSlashes,ref,score,scoredCandidates,spotLeft,string;ref=arg!=null?arg:{},key=ref.key,maxResults=ref.maxResults,maxInners=ref.maxInners,allowErrors=ref.allowErrors,legacy=ref.legacy;scoredCandidates=[];spotLeft=(maxInners!=null)&&maxInners>0?maxInners:candidates.length;bAllowErrors=!!allowErrors;bKey=key!=null;prepQuery=scorer.prepQuery(query);if(!legacy){for(i=0,len=candidates.length;i<len;i++){candidate=candidates[i];string=bKey?candidate[key]:candidate;if(!string){continue}score=scorer.score(string,query,prepQuery,bAllowErrors);if(score>0){scoredCandidates.push({candidate:candidate,score:score});if(!--spotLeft){break}}}}else{queryHasSlashes=prepQuery.depth>0;coreQuery=prepQuery.core;for(j=0,len1=candidates.length;j<len1;j++){candidate=candidates[j];string=key!=null?candidate[key]:candidate;if(!string){continue}score=legacy_scorer.score(string,coreQuery,queryHasSlashes);if(!queryHasSlashes){score=legacy_scorer.basenameScore(string,coreQuery,score)}if(score>0){scoredCandidates.push({candidate:candidate,score:score})}}}scoredCandidates.sort(sortCandidates);candidates=scoredCandidates.map(pluckCandidates);if(maxResults!=null){candidates=candidates.slice(0,maxResults)}return candidates}}).call(this)},{"./legacy":4,"./scorer":6,"path":7}],2:[function(require,module,exports){(function(){var PathSeparator,filter,legacy_scorer,matcher,prepQueryCache,scorer;scorer=require('./scorer');legacy_scorer=require('./legacy');filter=require('./filter');matcher=require('./matcher');PathSeparator=require('path').sep;prepQueryCache=null;module.exports={filter:function(candidates,query,options){if(!((query!=null?query.length:void 0)&&(candidates!=null?candidates.length:void 0))){return[]}return filter(candidates,query,options)},prepQuery:function(query){return scorer.prepQuery(query)},score:function(string,query,prepQuery,arg){var allowErrors,coreQuery,legacy,queryHasSlashes,ref,score;ref=arg!=null?arg:{},allowErrors=ref.allowErrors,legacy=ref.legacy;if(!((string!=null?string.length:void 0)&&(query!=null?query.length:void 0))){return 0}if(prepQuery==null){prepQuery=prepQueryCache&&prepQueryCache.query===query?prepQueryCache:(prepQueryCache=scorer.prepQuery(query))}if(!legacy){score=scorer.score(string,query,prepQuery,!!allowErrors)}else{queryHasSlashes=prepQuery.depth>0;coreQuery=prepQuery.core;score=legacy_scorer.score(string,coreQuery,queryHasSlashes);if(!queryHasSlashes){score=legacy_scorer.basenameScore(string,coreQuery,score)}}return score},match:function(string,query,prepQuery,arg){var allowErrors,baseMatches,i,matches,query_lw,ref,results,string_lw;allowErrors=(arg!=null?arg:{}).allowErrors;if(!string){return[]}if(!query){return[]}if(string===query){return(function(){results=[];for(var i=0,ref=string.length;0<=ref?i<ref:i>ref;0<=ref?i++:i--){results.push(i)}return results}).apply(this)}if(prepQuery==null){prepQuery=prepQueryCache&&prepQueryCache.query===query?prepQueryCache:(prepQueryCache=scorer.prepQuery(query))}if(!(allowErrors||scorer.isMatch(string,prepQuery.core_lw,prepQuery.core_up))){return[]}string_lw=string.toLowerCase();query_lw=prepQuery.query_lw;matches=matcher.match(string,string_lw,prepQuery);if(matches.length===0){return matches}if(string.indexOf(PathSeparator)>-1){baseMatches=matcher.basenameMatch(string,string_lw,prepQuery);matches=matcher.mergeMatches(matches,baseMatches)}return matches}}}).call(this)},{"./filter":1,"./legacy":4,"./matcher":5,"./scorer":6,"path":7}],3:[function(require,module,exports){fuzzaldrinPlus=require('./fuzzaldrin')},{"./fuzzaldrin":2}],4:[function(require,module,exports){(function(){var PathSeparator,queryIsLastPathSegment;PathSeparator=require('path').sep;exports.basenameScore=function(string,query,score){var base,depth,index,lastCharacter,segmentCount,slashCount;index=string.length-1;while(string[index]===PathSeparator){index--}slashCount=0;lastCharacter=index;base=null;while(index>=0){if(string[index]===PathSeparator){slashCount++;if(base==null){base=string.substring(index+1,lastCharacter+1)}}else if(index===0){if(lastCharacter<string.length-1){if(base==null){base=string.substring(0,lastCharacter+1)}}else{if(base==null){base=string}}}index--}if(base===string){score*=2}else if(base){score+=exports.score(base,query)}segmentCount=slashCount+1;depth=Math.max(1,10-segmentCount);score*=depth*0.01;return score};exports.score=function(string,query){var character,characterScore,indexInQuery,indexInString,lowerCaseIndex,minIndex,queryLength,queryScore,ref,stringLength,totalCharacterScore,upperCaseIndex;if(string===query){return 1}if(queryIsLastPathSegment(string,query)){return 1}totalCharacterScore=0;queryLength=query.length;stringLength=string.length;indexInQuery=0;indexInString=0;while(indexInQuery<queryLength){character=query[indexInQuery++];lowerCaseIndex=string.indexOf(character.toLowerCase());upperCaseIndex=string.indexOf(character.toUpperCase());minIndex=Math.min(lowerCaseIndex,upperCaseIndex);if(minIndex===-1){minIndex=Math.max(lowerCaseIndex,upperCaseIndex)}indexInString=minIndex;if(indexInString===-1){return 0}characterScore=0.1;if(string[indexInString]===character){characterScore+=0.1}if(indexInString===0||string[indexInString-1]===PathSeparator){characterScore+=0.8}else if((ref=string[indexInString-1])==='-'||ref==='_'||ref===' '){characterScore+=0.7}string=string.substring(indexInString+1,stringLength);totalCharacterScore+=characterScore}queryScore=totalCharacterScore/queryLength;return((queryScore*(queryLength/stringLength))+queryScore)/2};queryIsLastPathSegment=function(string,query){if(string[string.length-query.length-1]===PathSeparator){return string.lastIndexOf(query)===string.length-query.length}};exports.match=function(string,query,stringOffset){var character,i,indexInQuery,indexInString,lowerCaseIndex,matches,minIndex,queryLength,ref,results,stringLength,upperCaseIndex;if(stringOffset==null){stringOffset=0}if(string===query){return(function(){results=[];for(var i=stringOffset,ref=stringOffset+string.length;stringOffset<=ref?i<ref:i>ref;stringOffset<=ref?i++:i--){results.push(i)}return results}).apply(this)}queryLength=query.length;stringLength=string.length;indexInQuery=0;indexInString=0;matches=[];while(indexInQuery<queryLength){character=query[indexInQuery++];lowerCaseIndex=string.indexOf(character.toLowerCase());upperCaseIndex=string.indexOf(character.toUpperCase());minIndex=Math.min(lowerCaseIndex,upperCaseIndex);if(minIndex===-1){minIndex=Math.max(lowerCaseIndex,upperCaseIndex)}indexInString=minIndex;if(indexInString===-1){return[]}matches.push(stringOffset+indexInString);stringOffset+=indexInString+1;string=string.substring(indexInString+1,stringLength)}return matches}}).call(this)},{"path":7}],5:[function(require,module,exports){(function(){var PathSeparator,scorer;PathSeparator=require('path').sep;scorer=require('./scorer');exports.basenameMatch=function(subject,subject_lw,prepQuery){var basePos,depth,end;end=subject.length-1;while(subject[end]===PathSeparator){end--}basePos=subject.lastIndexOf(PathSeparator,end);if(basePos===-1){return[]}depth=prepQuery.depth;while(depth-->0){basePos=subject.lastIndexOf(PathSeparator,basePos-1);if(basePos===-1){return[]}}basePos++;end++;return exports.match(subject.slice(basePos,end),subject_lw.slice(basePos,end),prepQuery,basePos)};exports.mergeMatches=function(a,b){var ai,bj,i,j,m,n,out;m=a.length;n=b.length;if(n===0){return a.slice()}if(m===0){return b.slice()}i=-1;j=0;bj=b[j];out=[];while(++i<m){ai=a[i];while(bj<=ai&&++j<n){if(bj<ai){out.push(bj)}bj=b[j]}out.push(ai)}while(j<n){out.push(b[j++])}return out};exports.match=function(subject,subject_lw,prepQuery,offset){var DIAGONAL,LEFT,STOP,UP,acro_score,align,backtrack,csc_diag,csc_row,csc_score,i,j,m,matches,move,n,pos,query,query_lw,score,score_diag,score_row,score_up,si_lw,start,trace;if(offset==null){offset=0}query=prepQuery.query;query_lw=prepQuery.query_lw;m=subject.length;n=query.length;acro_score=scorer.scoreAcronyms(subject,subject_lw,query,query_lw).score;score_row=new Array(n);csc_row=new Array(n);STOP=0;UP=1;LEFT=2;DIAGONAL=3;trace=new Array(m*n);pos=-1;j=-1;while(++j<n){score_row[j]=0;csc_row[j]=0}i=-1;while(++i<m){score=0;score_up=0;csc_diag=0;si_lw=subject_lw[i];j=-1;while(++j<n){csc_score=0;align=0;score_diag=score_up;if(query_lw[j]===si_lw){start=scorer.isWordStart(i,subject,subject_lw);csc_score=csc_diag>0?csc_diag:scorer.scoreConsecutives(subject,subject_lw,query,query_lw,i,j,start);align=score_diag+scorer.scoreCharacter(i,j,start,acro_score,csc_score)}score_up=score_row[j];csc_diag=csc_row[j];if(score>score_up){move=LEFT}else{score=score_up;move=UP}if(align>score){score=align;move=DIAGONAL}else{csc_score=0}score_row[j]=score;csc_row[j]=csc_score;trace[++pos]=score>0?move:STOP}}i=m-1;j=n-1;pos=i*n+j;backtrack=true;matches=[];while(backtrack&&i>=0&&j>=0){switch(trace[pos]){case UP:i--;pos-=n;break;case LEFT:j--;pos--;break;case DIAGONAL:matches.push(i+offset);j--;i--;pos-=n+1;break;default:backtrack=false}}matches.reverse();return matches}}).call(this)},{"./scorer":6,"path":7}],6:[function(require,module,exports){(function(){var AcronymResult,PathSeparator,Query,basenameScore,coreChars,countDir,doScore,emptyAcronymResult,file_coeff,isMatch,isSeparator,isWordEnd,isWordStart,miss_coeff,opt_char_re,pos_bonus,scoreAcronyms,scoreCharacter,scoreConsecutives,scoreExact,scoreExactMatch,scorePattern,scorePosition,scoreSize,tau_depth,tau_size,truncatedUpperCase,wm;PathSeparator=require('path').sep;wm=150;pos_bonus=20;tau_depth=13;tau_size=85;file_coeff=1.2;miss_coeff=0.75;opt_char_re=/[ _\-:\/\\]/g;exports.coreChars=coreChars=function(query){return query.replace(opt_char_re,'')};exports.score=function(string,query,prepQuery,allowErrors){var score,string_lw;if(prepQuery==null){prepQuery=new Query(query)}if(allowErrors==null){allowErrors=false}if(!(allowErrors||isMatch(string,prepQuery.core_lw,prepQuery.core_up))){return 0}string_lw=string.toLowerCase();score=doScore(string,string_lw,prepQuery);return Math.ceil(basenameScore(string,string_lw,prepQuery,score))};Query=(function(){function Query(query){if(!(query!=null?query.length:void 0)){return null}this.query=query;this.query_lw=query.toLowerCase();this.core=coreChars(query);this.core_lw=this.core.toLowerCase();this.core_up=truncatedUpperCase(this.core);this.depth=countDir(query,query.length)}return Query})();exports.prepQuery=function(query){return new Query(query)};exports.isMatch=isMatch=function(subject,query_lw,query_up){var i,j,m,n,qj_lw,qj_up,si;m=subject.length;n=query_lw.length;if(!m||!n||n>m){return false}i=-1;j=-1;while(++j<n){qj_lw=query_lw[j];qj_up=query_up[j];while(++i<m){si=subject[i];if(si===qj_lw||si===qj_up){break}}if(i===m){return false}}return true};doScore=function(subject,subject_lw,prepQuery){var acro,acro_score,align,csc_diag,csc_row,csc_score,i,j,m,miss_budget,miss_left,mm,n,pos,query,query_lw,record_miss,score,score_diag,score_row,score_up,si_lw,start,sz;query=prepQuery.query;query_lw=prepQuery.query_lw;m=subject.length;n=query.length;acro=scoreAcronyms(subject,subject_lw,query,query_lw);acro_score=acro.score;if(acro.count===n){return scoreExact(n,m,acro_score,acro.pos)}pos=subject_lw.indexOf(query_lw);if(pos>-1){return scoreExactMatch(subject,subject_lw,query,query_lw,pos,n,m)}score_row=new Array(n);csc_row=new Array(n);sz=scoreSize(n,m);miss_budget=Math.ceil(miss_coeff*n)+5;miss_left=miss_budget;j=-1;while(++j<n){score_row[j]=0;csc_row[j]=0}i=subject_lw.indexOf(query_lw[0]);if(i>-1){i--}mm=subject_lw.lastIndexOf(query_lw[n-1],m);if(mm>i){m=mm+1}while(++i<m){score=0;score_diag=0;csc_diag=0;si_lw=subject_lw[i];record_miss=true;j=-1;while(++j<n){score_up=score_row[j];if(score_up>score){score=score_up}csc_score=0;if(query_lw[j]===si_lw){start=isWordStart(i,subject,subject_lw);csc_score=csc_diag>0?csc_diag:scoreConsecutives(subject,subject_lw,query,query_lw,i,j,start);align=score_diag+scoreCharacter(i,j,start,acro_score,csc_score);if(align>score){score=align;miss_left=miss_budget}else{if(record_miss&&--miss_left<=0){return score_row[n-1]*sz}record_miss=false}}score_diag=score_up;csc_diag=csc_row[j];csc_row[j]=csc_score;score_row[j]=score}}return score*sz};exports.isWordStart=isWordStart=function(pos,subject,subject_lw){var curr_s,prev_s;if(pos===0){return true}curr_s=subject[pos];prev_s=subject[pos-1];return isSeparator(curr_s)||isSeparator(prev_s)||(curr_s!==subject_lw[pos]&&prev_s===subject_lw[pos-1])};exports.isWordEnd=isWordEnd=function(pos,subject,subject_lw,len){var curr_s,next_s;if(pos===len-1){return true}curr_s=subject[pos];next_s=subject[pos+1];return isSeparator(curr_s)||isSeparator(next_s)||(curr_s===subject_lw[pos]&&next_s!==subject_lw[pos+1])};isSeparator=function(c){return c===' '||c==='.'||c==='-'||c==='_'||c==='/'||c==='\\'};scorePosition=function(pos){var sc;if(pos<pos_bonus){sc=pos_bonus-pos;return 100+sc*sc}else{return Math.max(100+pos_bonus-pos,0)}};scoreSize=function(n,m){return tau_size/(tau_size+Math.abs(m-n))};scoreExact=function(n,m,quality,pos){return 2*n*(wm*quality+scorePosition(pos))*scoreSize(n,m)};exports.scorePattern=scorePattern=function(count,len,sameCase,start,end){var bonus,sz;sz=count;bonus=6;if(sameCase===count){bonus+=2}if(start){bonus+=3}if(end){bonus+=1}if(count===len){if(start){if(sameCase===len){sz+=2}else{sz+=1}}if(end){bonus+=1}}return sameCase+sz*(sz+bonus)};exports.scoreCharacter=scoreCharacter=function(i,j,start,acro_score,csc_score){var posBonus;posBonus=scorePosition(i);if(start){return posBonus+wm*((acro_score>csc_score?acro_score:csc_score)+10)}return posBonus+wm*csc_score};exports.scoreConsecutives=scoreConsecutives=function(subject,subject_lw,query,query_lw,i,j,start){var k,m,mi,n,nj,sameCase,startPos,sz;m=subject.length;n=query.length;mi=m-i;nj=n-j;k=mi<nj?mi:nj;startPos=i;sameCase=0;sz=0;if(query[j]===subject[i]){sameCase++}while(++sz<k&&query_lw[++j]===subject_lw[++i]){if(query[j]===subject[i]){sameCase++}}if(sz===1){return 1+2*sameCase}return scorePattern(sz,n,sameCase,start,isWordEnd(i,subject,subject_lw,m))};exports.scoreExactMatch=scoreExactMatch=function(subject,subject_lw,query,query_lw,pos,n,m){var end,i,pos2,sameCase,start;start=isWordStart(pos,subject,subject_lw);if(!start){pos2=subject_lw.indexOf(query_lw,pos+1);if(pos2>-1){start=isWordStart(pos2,subject,subject_lw);if(start){pos=pos2}}}i=-1;sameCase=0;while(++i<n){if(query[pos+i]===subject[i]){sameCase++}}end=isWordEnd(pos+n-1,subject,subject_lw,m);return scoreExact(n,m,scorePattern(n,n,sameCase,start,end),pos)};AcronymResult=(function(){function AcronymResult(score1,pos1,count1){this.score=score1;this.pos=pos1;this.count=count1}return AcronymResult})();emptyAcronymResult=new AcronymResult(0,0.1,0);exports.scoreAcronyms=scoreAcronyms=function(subject,subject_lw,query,query_lw){var count,i,j,m,n,pos,qj_lw,sameCase,score;m=subject.length;n=query.length;if(!(m>1&&n>1)){return emptyAcronymResult}count=0;pos=0;sameCase=0;i=-1;j=-1;while(++j<n){qj_lw=query_lw[j];while(++i<m){if(qj_lw===subject_lw[i]&&isWordStart(i,subject,subject_lw)){if(query[j]===subject[i]){sameCase++}pos+=i;count++;break}}if(i===m){break}}if(count<2){return emptyAcronymResult}score=scorePattern(count,n,sameCase,true,false);return new AcronymResult(score,pos/count,count)};basenameScore=function(subject,subject_lw,prepQuery,fullPathScore){var alpha,basePathScore,basePos,depth,end;if(fullPathScore===0){return 0}end=subject.length-1;while(subject[end]===PathSeparator){end--}basePos=subject.lastIndexOf(PathSeparator,end);if(basePos===-1){return fullPathScore}depth=prepQuery.depth;while(depth-->0){basePos=subject.lastIndexOf(PathSeparator,basePos-1);if(basePos===-1){return fullPathScore}}basePos++;end++;basePathScore=doScore(subject.slice(basePos,end),subject_lw.slice(basePos,end),prepQuery);alpha=0.5*tau_depth/(tau_depth+countDir(subject,end+1));return alpha*basePathScore+(1-alpha)*fullPathScore*scoreSize(0,file_coeff*(end-basePos))};exports.countDir=countDir=function(path,end){var count,i;if(end<1){return 0}count=0;i=-1;while(++i<end&&path[i]===PathSeparator){continue}while(++i<end){if(path[i]===PathSeparator){count++;while(++i<end&&path[i]===PathSeparator){continue}}}return count};truncatedUpperCase=function(str){var char,l,len1,upper;upper="";for(l=0,len1=str.length;l<len1;l++){char=str[l];upper+=char.toUpperCase()[0]}return upper}}).call(this)},{"path":7}],7:[function(require,module,exports){(function(process){function normalizeArray(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==='.'){parts.splice(i,1)}else if(last==='..'){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up--;up){parts.unshift('..')}}return parts}var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;var splitPath=function(filename){return splitPathRe.exec(filename).slice(1)};exports.resolve=function(){var resolvedPath='',resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=(i>=0)?arguments[i]:process.cwd();if(typeof path!=='string'){throw new TypeError('Arguments to path.resolve must be strings');}else if(!path){continue}resolvedPath=path+'/'+resolvedPath;resolvedAbsolute=path.charAt(0)==='/'}resolvedPath=normalizeArray(filter(resolvedPath.split('/'),function(p){return!!p}),!resolvedAbsolute).join('/');return((resolvedAbsolute?'/':'')+resolvedPath)||'.'};exports.normalize=function(path){var isAbsolute=exports.isAbsolute(path),trailingSlash=substr(path,-1)==='/';path=normalizeArray(filter(path.split('/'),function(p){return!!p}),!isAbsolute).join('/');if(!path&&!isAbsolute){path='.'}if(path&&trailingSlash){path+='/'}return(isAbsolute?'/':'')+path};exports.isAbsolute=function(path){return path.charAt(0)==='/'};exports.join=function(){var paths=Array.prototype.slice.call(arguments,0);return exports.normalize(filter(paths,function(p,index){if(typeof p!=='string'){throw new TypeError('Arguments to path.join must be strings');}return p}).join('/'))};exports.relative=function(from,to){from=exports.resolve(from).substr(1);to=exports.resolve(to).substr(1);function trim(arr){var start=0;for(;start<arr.length;start++){if(arr[start]!=='')break}var end=arr.length-1;for(;end>=0;end--){if(arr[end]!=='')break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split('/'));var toParts=trim(to.split('/'));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i<length;i++){if(fromParts[i]!==toParts[i]){samePartsLength=i;break}}var outputParts=[];for(var i=samePartsLength;i<fromParts.length;i++){outputParts.push('..')}outputParts=outputParts.concat(toParts.slice(samePartsLength));return outputParts.join('/')};exports.sep='/';exports.delimiter=':';exports.dirname=function(path){var result=splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return'.'}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir};exports.basename=function(path,ext){var f=splitPath(path)[2];if(ext&&f.substr(-1*ext.length)===ext){f=f.substr(0,f.length-ext.length)}return f};exports.extname=function(path){return splitPath(path)[3]};function filter(xs,f){if(xs.filter)return xs.filter(f);var res=[];for(var i=0;i<xs.length;i++){if(f(xs[i],i,xs))res.push(xs[i])}return res}var substr='ab'.substr(-1)==='b'?function(str,start,len){return str.substr(start,len)}:function(str,start,len){if(start<0)start=str.length+start;return str.substr(start,len)}}).call(this,require('_process'))},{"_process":8}],8:[function(require,module,exports){var process=module.exports={};var queue=[];var draining=false;var currentQueue;var queueIndex=-1;function cleanUpNextTick(){draining=false;if(currentQueue.length){queue=currentQueue.concat(queue)}else{queueIndex=-1}if(queue.length){drainQueue()}}function drainQueue(){if(draining){return}var timeout=setTimeout(cleanUpNextTick);draining=true;var len=queue.length;while(len){currentQueue=queue;queue=[];while(++queueIndex<len){if(currentQueue){currentQueue[queueIndex].run()}}queueIndex=-1;len=queue.length}currentQueue=null;draining=false;clearTimeout(timeout)}process.nextTick=function(fun){var args=new Array(arguments.length-1);if(arguments.length>1){for(var i=1;i<arguments.length;i++){args[i-1]=arguments[i]}}queue.push(new Item(fun,args));if(queue.length===1&&!draining){setTimeout(drainQueue,0)}};function Item(fun,array){this.fun=fun;this.array=array}Item.prototype.run=function(){this.fun.apply(null,this.array)};process.title='browser';process.browser=true;process.env={};process.argv=[];process.version='';process.versions={};function noop(){}process.on=noop;process.addListener=noop;process.once=noop;process.off=noop;process.removeListener=noop;process.removeAllListeners=noop;process.emit=noop;process.binding=function(name){throw new Error('process.binding is not supported');};process.cwd=function(){return'/'};process.chdir=function(dir){throw new Error('process.chdir is not supported');};process.umask=function(){return 0}},{}]},{},[3]); |
