summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--Gemfile10
-rw-r--r--Gemfile.lock10
-rw-r--r--app/assets/javascripts/build.js1
-rw-r--r--app/assets/javascripts/build_variables.js2
-rw-r--r--app/assets/javascripts/commons/bootstrap.js2
-rw-r--r--app/assets/javascripts/commons/jquery.js1
-rw-r--r--app/assets/javascripts/dispatcher.js1
-rw-r--r--app/assets/javascripts/project_select.js17
-rw-r--r--app/assets/javascripts/project_select_combo_button.js85
-rw-r--r--app/assets/javascripts/projects/project_import_gitlab_project.js14
-rw-r--r--app/assets/javascripts/projects/project_new.js20
-rw-r--r--app/assets/javascripts/wikis.js2
-rw-r--r--app/assets/stylesheets/framework/layout.scss12
-rw-r--r--app/assets/stylesheets/framework/nav.scss26
-rw-r--r--app/assets/stylesheets/framework/sidebar.scss5
-rw-r--r--app/assets/stylesheets/framework/variables.scss8
-rw-r--r--app/assets/stylesheets/new_sidebar.scss55
-rw-r--r--app/assets/stylesheets/pages/builds.scss19
-rw-r--r--app/assets/stylesheets/pages/projects.scss134
-rw-r--r--app/assets/stylesheets/pages/wiki.scss12
-rw-r--r--app/controllers/import/gitlab_projects_controller.rb10
-rw-r--r--app/controllers/omniauth_callbacks_controller.rb21
-rw-r--r--app/controllers/projects_controller.rb1
-rw-r--r--app/helpers/gitlab_routing_helper.rb16
-rw-r--r--app/helpers/milestones_routing_helper.rb17
-rw-r--r--app/models/conversational_development_index/metric.rb4
-rw-r--r--app/models/milestone.rb12
-rw-r--r--app/models/project.rb6
-rw-r--r--app/models/project_import_data.rb2
-rw-r--r--app/services/issuable_base_service.rb5
-rw-r--r--app/services/projects/autocomplete_service.rb10
-rw-r--r--app/services/projects/create_from_template_service.rb15
-rw-r--r--app/services/projects/create_service.rb4
-rw-r--r--app/services/projects/gitlab_projects_import_service.rb36
-rw-r--r--app/services/projects/import_service.rb8
-rw-r--r--app/services/submit_usage_ping_service.rb20
-rw-r--r--app/services/system_note_service.rb3
-rw-r--r--app/views/import/gitlab_projects/new.html.haml50
-rw-r--r--app/views/layouts/nav/_new_admin_sidebar.html.haml3
-rw-r--r--app/views/layouts/nav/_new_group_sidebar.html.haml3
-rw-r--r--app/views/layouts/nav/_new_profile_sidebar.html.haml3
-rw-r--r--app/views/layouts/nav/_new_project_sidebar.html.haml3
-rw-r--r--app/views/projects/_project_templates.html.haml10
-rw-r--r--app/views/projects/jobs/_sidebar.html.haml168
-rw-r--r--app/views/projects/new.html.haml109
-rw-r--r--app/views/projects/wikis/_sidebar.html.haml31
-rw-r--r--app/views/shared/_import_form.html.haml26
-rw-r--r--app/views/shared/_new_project_item_select.html.haml7
-rw-r--r--app/views/shared/_sidebar_toggle_button.html.haml4
-rw-r--r--app/views/shared/icons/_java_spring.svg6
-rw-r--r--app/views/shared/icons/_node_express.svg6
-rw-r--r--app/views/shared/icons/_rails.svg6
-rw-r--r--changelogs/unreleased/35483-improve-mobile-sidebar.yml4
-rw-r--r--changelogs/unreleased/35761-convdev-perc.yml4
-rw-r--r--changelogs/unreleased/github.yml4
-rw-r--r--changelogs/unreleased/group-milestone-references-system-notes.yml4
-rw-r--r--changelogs/unreleased/group-new-issue.yml4
-rw-r--r--changelogs/unreleased/pawel-add-sidekiq-metrics-endpoint-32145.yml4
-rw-r--r--changelogs/unreleased/zj-project-templates.yml4
-rw-r--r--config/application.rb4
-rw-r--r--config/dependency_decisions.yml6
-rw-r--r--config/gitlab.yml.example6
-rw-r--r--config/initializers/1_settings.rb4
-rw-r--r--config/initializers/7_prometheus_metrics.rb6
-rw-r--r--config/webpack.config.js22
-rw-r--r--db/migrate/20170731175128_add_percentages_to_conv_dev.rb32
-rw-r--r--db/post_migrate/20170803090603_calculate_conv_dev_index_percentages.rb30
-rw-r--r--db/schema.rb10
-rw-r--r--doc/development/rake_tasks.md17
-rw-r--r--doc/user/markdown.md6
-rw-r--r--doc/user/project/milestones/index.md3
-rw-r--r--lib/banzai/filter/abstract_reference_filter.rb81
-rw-r--r--lib/banzai/filter/milestone_reference_filter.rb34
-rw-r--r--lib/github/client.rb36
-rw-r--r--lib/github/import.rb34
-rw-r--r--lib/gitlab/daemon.rb62
-rw-r--r--lib/gitlab/git/blob.rb136
-rw-r--r--lib/gitlab/git/repository.rb29
-rw-r--r--lib/gitlab/import_sources.rb2
-rw-r--r--lib/gitlab/key_fingerprint.rb71
-rw-r--r--lib/gitlab/metrics/base_sampler.rb75
-rw-r--r--lib/gitlab/metrics/sidekiq_metrics_exporter.rb39
-rw-r--r--lib/gitlab/project_template.rb45
-rw-r--r--lib/gitlab/shell.rb24
-rw-r--r--lib/tasks/gitlab/update_templates.rake49
-rw-r--r--lib/tasks/import.rake3
-rw-r--r--package.json14
-rw-r--r--spec/factories/conversational_development_index_metrics.rb10
-rw-r--r--spec/features/dashboard/issues_spec.rb15
-rw-r--r--spec/features/groups/empty_states_spec.rb4
-rw-r--r--spec/features/issues/issue_sidebar_spec.rb8
-rw-r--r--spec/features/projects/import_export/import_file_spec.rb14
-rw-r--r--spec/features/projects_spec.rb21
-rw-r--r--spec/fixtures/markdown.md.erb5
-rw-r--r--spec/helpers/gitlab_routing_helper_spec.rb40
-rw-r--r--spec/helpers/milestones_routing_helper_spec.rb46
-rw-r--r--spec/javascripts/build_spec.js1
-rw-r--r--spec/javascripts/fixtures/project_select_combo_button.html.haml6
-rw-r--r--spec/javascripts/labels_issue_sidebar_spec.js1
-rw-r--r--spec/javascripts/project_select_combo_button_spec.js105
-rw-r--r--spec/javascripts/projects/project_import_gitlab_project_spec.js25
-rw-r--r--spec/lib/banzai/filter/milestone_reference_filter_spec.rb196
-rw-r--r--spec/lib/gitlab/bitbucket_import/importer_spec.rb2
-rw-r--r--spec/lib/gitlab/daemon_spec.rb103
-rw-r--r--spec/lib/gitlab/git/blob_spec.rb71
-rw-r--r--spec/lib/gitlab/import_sources_spec.rb2
-rw-r--r--spec/lib/gitlab/key_fingerprint_spec.rb84
-rw-r--r--spec/lib/gitlab/metrics/influx_sampler_spec.rb2
-rw-r--r--spec/lib/gitlab/metrics/sidekiq_metrics_exporter_spec.rb101
-rw-r--r--spec/lib/gitlab/project_template_spec.rb63
-rw-r--r--spec/lib/gitlab/shell_spec.rb90
-rw-r--r--spec/migrations/calculate_conv_dev_index_percentages_spec.rb41
-rw-r--r--spec/models/conversational_development_index/metric_spec.rb11
-rw-r--r--spec/models/key_spec.rb10
-rw-r--r--spec/models/milestone_spec.rb38
-rw-r--r--spec/presenters/conversational_development_index/metric_presenter_spec.rb6
-rw-r--r--spec/services/projects/autocomplete_service_spec.rb27
-rw-r--r--spec/services/projects/create_from_template_service_spec.rb26
-rw-r--r--spec/services/projects/import_service_spec.rb32
-rw-r--r--spec/services/submit_usage_ping_service_spec.rb7
-rw-r--r--spec/services/system_note_service_spec.rb53
-rw-r--r--spec/spec_helper.rb4
-rw-r--r--spec/support/issuable_shared_examples.rb6
-rw-r--r--spec/support/markdown_feature.rb6
-rw-r--r--spec/support/matchers/markdown_matchers.rb2
-rw-r--r--spec/support/migrations_helpers.rb10
-rw-r--r--vendor/assets/javascripts/jquery.nicescroll.js3634
-rw-r--r--vendor/project_templates/rails.tar.gzbin0 -> 899958 bytes
-rw-r--r--yarn.lock572
129 files changed, 2938 insertions, 4531 deletions
diff --git a/Gemfile b/Gemfile
index 37a4eb5fde4..f27ba905b4f 100644
--- a/Gemfile
+++ b/Gemfile
@@ -390,6 +390,16 @@ gem 'health_check', '~> 2.6.0'
gem 'vmstat', '~> 2.3.0'
gem 'sys-filesystem', '~> 1.1.6'
+# SSH host key support
+gem 'net-ssh', '~> 4.1.0'
+
+# Required for ED25519 SSH host key support
+group :ed25519 do
+ gem 'rbnacl-libsodium'
+ gem 'rbnacl', '~> 3.2'
+ gem 'bcrypt_pbkdf', '~> 1.0'
+end
+
# Gitaly GRPC client
gem 'gitaly', '~> 0.24.0'
diff --git a/Gemfile.lock b/Gemfile.lock
index 04d17d54636..8bbd8cce322 100644
--- a/Gemfile.lock
+++ b/Gemfile.lock
@@ -75,6 +75,7 @@ GEM
babosa (1.0.2)
base32 (0.3.2)
bcrypt (3.1.11)
+ bcrypt_pbkdf (1.0.0)
benchmark-ips (2.3.0)
better_errors (2.1.1)
coderay (>= 1.0.0)
@@ -475,6 +476,7 @@ GEM
mustermann (~> 1.0.0)
mysql2 (0.4.5)
net-ldap (0.16.0)
+ net-ssh (4.1.0)
netrc (0.11.0)
nokogiri (1.6.8.1)
mini_portile2 (~> 2.1.0)
@@ -662,6 +664,10 @@ GEM
rake (12.0.0)
rblineprof (0.3.6)
debugger-ruby_core_source (~> 1.3)
+ rbnacl (3.4.0)
+ ffi
+ rbnacl-libsodium (1.0.11)
+ rbnacl (>= 3.0.1)
rdoc (4.2.2)
json (~> 1.4)
re2 (1.1.1)
@@ -924,6 +930,7 @@ DEPENDENCIES
awesome_print (~> 1.2.0)
babosa (~> 1.0.2)
base32 (~> 0.3.0)
+ bcrypt_pbkdf (~> 1.0)
benchmark-ips (~> 2.3.0)
better_errors (~> 2.1.0)
binding_of_caller (~> 0.7.2)
@@ -1016,6 +1023,7 @@ DEPENDENCIES
mousetrap-rails (~> 1.4.6)
mysql2 (~> 0.4.5)
net-ldap
+ net-ssh (~> 4.1.0)
nokogiri (~> 1.6.7, >= 1.6.7.2)
oauth2 (~> 1.4)
octokit (~> 4.6.2)
@@ -1062,6 +1070,8 @@ DEPENDENCIES
rainbow (~> 2.2)
raindrops (~> 0.18)
rblineprof (~> 0.3.6)
+ rbnacl (~> 3.2)
+ rbnacl-libsodium
rdoc (~> 4.2)
re2 (~> 1.1.1)
recaptcha (~> 3.0)
diff --git a/app/assets/javascripts/build.js b/app/assets/javascripts/build.js
index b3d3bbcf84f..940326dcd33 100644
--- a/app/assets/javascripts/build.js
+++ b/app/assets/javascripts/build.js
@@ -164,7 +164,6 @@ window.Build = (function () {
Build.prototype.initSidebar = function () {
this.$sidebar = $('.js-build-sidebar');
- this.$sidebar.niceScroll();
};
Build.prototype.getBuildTrace = function () {
diff --git a/app/assets/javascripts/build_variables.js b/app/assets/javascripts/build_variables.js
index 99082b412e2..c955a9ac2ea 100644
--- a/app/assets/javascripts/build_variables.js
+++ b/app/assets/javascripts/build_variables.js
@@ -2,7 +2,7 @@
$(function() {
$('.reveal-variables').off('click').on('click', function() {
- $('.js-build').toggle().niceScroll();
+ $('.js-build-variables').toggle();
$(this).hide();
});
});
diff --git a/app/assets/javascripts/commons/bootstrap.js b/app/assets/javascripts/commons/bootstrap.js
index 389587a2596..c11b7d5f340 100644
--- a/app/assets/javascripts/commons/bootstrap.js
+++ b/app/assets/javascripts/commons/bootstrap.js
@@ -3,13 +3,13 @@ import $ from 'jquery';
// bootstrap jQuery plugins
import 'bootstrap-sass/assets/javascripts/bootstrap/affix';
import 'bootstrap-sass/assets/javascripts/bootstrap/alert';
+import 'bootstrap-sass/assets/javascripts/bootstrap/button';
import 'bootstrap-sass/assets/javascripts/bootstrap/dropdown';
import 'bootstrap-sass/assets/javascripts/bootstrap/modal';
import 'bootstrap-sass/assets/javascripts/bootstrap/tab';
import 'bootstrap-sass/assets/javascripts/bootstrap/transition';
import 'bootstrap-sass/assets/javascripts/bootstrap/tooltip';
import 'bootstrap-sass/assets/javascripts/bootstrap/popover';
-import 'bootstrap-sass/assets/javascripts/bootstrap/button';
// custom jQuery functions
$.fn.extend({
diff --git a/app/assets/javascripts/commons/jquery.js b/app/assets/javascripts/commons/jquery.js
index b53f6284afc..b93e94a3c97 100644
--- a/app/assets/javascripts/commons/jquery.js
+++ b/app/assets/javascripts/commons/jquery.js
@@ -6,6 +6,5 @@ import 'vendor/jquery.endless-scroll';
import 'vendor/jquery.caret';
import 'vendor/jquery.atwho';
import 'vendor/jquery.scrollTo';
-import 'vendor/jquery.nicescroll';
import 'vendor/jquery.waitforimages';
import 'select2/select2';
diff --git a/app/assets/javascripts/dispatcher.js b/app/assets/javascripts/dispatcher.js
index b72259b86b5..e95892a6189 100644
--- a/app/assets/javascripts/dispatcher.js
+++ b/app/assets/javascripts/dispatcher.js
@@ -577,7 +577,6 @@ import GpgBadges from './gpg_badges';
shortcut_handler = new ShortcutsWiki();
new ZenMode();
new gl.GLForm($('.wiki-form'), true);
- new Sidebar();
break;
case 'snippets':
shortcut_handler = new ShortcutsNavigation();
diff --git a/app/assets/javascripts/project_select.js b/app/assets/javascripts/project_select.js
index ebcefc819f5..1b4ed6be90a 100644
--- a/app/assets/javascripts/project_select.js
+++ b/app/assets/javascripts/project_select.js
@@ -1,5 +1,6 @@
/* eslint-disable func-names, space-before-function-paren, wrap-iife, prefer-arrow-callback, no-var, comma-dangle, object-shorthand, one-var, one-var-declaration-per-line, no-else-return, quotes, max-len */
import Api from './api';
+import ProjectSelectComboButton from './project_select_combo_button';
(function() {
this.ProjectSelect = (function() {
@@ -58,7 +59,8 @@ import Api from './api';
if (this.includeGroups) {
placeholder += " or group";
}
- return $(select).select2({
+
+ $(select).select2({
placeholder: placeholder,
minimumInputLength: 0,
query: (function(_this) {
@@ -96,21 +98,18 @@ import Api from './api';
};
})(this),
id: function(project) {
- return project.web_url;
+ return JSON.stringify({
+ name: project.name,
+ url: project.web_url,
+ });
},
text: function(project) {
return project.name_with_namespace || project.name;
},
dropdownCssClass: "ajax-project-dropdown"
});
- });
-
- $('.new-project-item-select-button').on('click', function() {
- $('.project-item-select', this.parentNode).select2('open');
- });
- $('.project-item-select').on('click', function() {
- window.location = `${$(this).val()}/${this.dataset.relativePath}`;
+ return new ProjectSelectComboButton(select);
});
}
diff --git a/app/assets/javascripts/project_select_combo_button.js b/app/assets/javascripts/project_select_combo_button.js
new file mode 100644
index 00000000000..f799d9d619a
--- /dev/null
+++ b/app/assets/javascripts/project_select_combo_button.js
@@ -0,0 +1,85 @@
+import AccessorUtilities from './lib/utils/accessor';
+
+export default class ProjectSelectComboButton {
+ constructor(select) {
+ this.projectSelectInput = $(select);
+ this.newItemBtn = $('.new-project-item-link');
+ this.newItemBtnBaseText = this.newItemBtn.data('label');
+ this.itemType = this.deriveItemTypeFromLabel();
+ this.groupId = this.projectSelectInput.data('groupId');
+
+ this.bindEvents();
+ this.initLocalStorage();
+ }
+
+ bindEvents() {
+ this.projectSelectInput.siblings('.new-project-item-select-button')
+ .on('click', this.openDropdown);
+
+ this.projectSelectInput.on('change', () => this.selectProject());
+ }
+
+ initLocalStorage() {
+ const localStorageIsSafe = AccessorUtilities.isLocalStorageAccessSafe();
+
+ if (localStorageIsSafe) {
+ const itemTypeKebabed = this.newItemBtnBaseText.toLowerCase().split(' ').join('-');
+
+ this.localStorageKey = ['group', this.groupId, itemTypeKebabed, 'recent-project'].join('-');
+ this.setBtnTextFromLocalStorage();
+ }
+ }
+
+ openDropdown() {
+ $(this).siblings('.project-item-select').select2('open');
+ }
+
+ selectProject() {
+ const selectedProjectData = JSON.parse(this.projectSelectInput.val());
+ const projectUrl = `${selectedProjectData.url}/${this.projectSelectInput.data('relativePath')}`;
+ const projectName = selectedProjectData.name;
+
+ const projectMeta = {
+ url: projectUrl,
+ name: projectName,
+ };
+
+ this.setNewItemBtnAttributes(projectMeta);
+ this.setProjectInLocalStorage(projectMeta);
+ }
+
+ setBtnTextFromLocalStorage() {
+ const cachedProjectData = this.getProjectFromLocalStorage();
+
+ this.setNewItemBtnAttributes(cachedProjectData);
+ }
+
+ setNewItemBtnAttributes(project) {
+ if (project) {
+ this.newItemBtn.attr('href', project.url);
+ this.newItemBtn.text(`${this.newItemBtnBaseText} in ${project.name}`);
+ this.newItemBtn.enable();
+ } else {
+ this.newItemBtn.text(`Select project to create ${this.itemType}`);
+ this.newItemBtn.disable();
+ }
+ }
+
+ deriveItemTypeFromLabel() {
+ // label is either 'New issue' or 'New merge request'
+ return this.newItemBtnBaseText.split(' ').slice(1).join(' ');
+ }
+
+ getProjectFromLocalStorage() {
+ const projectString = localStorage.getItem(this.localStorageKey);
+
+ return JSON.parse(projectString);
+ }
+
+ setProjectInLocalStorage(projectMeta) {
+ const projectString = JSON.stringify(projectMeta);
+
+ localStorage.setItem(this.localStorageKey, projectString);
+ }
+}
+
diff --git a/app/assets/javascripts/projects/project_import_gitlab_project.js b/app/assets/javascripts/projects/project_import_gitlab_project.js
new file mode 100644
index 00000000000..c34927499fc
--- /dev/null
+++ b/app/assets/javascripts/projects/project_import_gitlab_project.js
@@ -0,0 +1,14 @@
+import '../lib/utils/url_utility';
+
+const bindEvents = () => {
+ const path = gl.utils.getParameterValues('path')[0];
+
+ // get the path url and append it in the inputS
+ $('.js-path-name').val(path);
+};
+
+document.addEventListener('DOMContentLoaded', bindEvents);
+
+export default {
+ bindEvents,
+};
diff --git a/app/assets/javascripts/projects/project_new.js b/app/assets/javascripts/projects/project_new.js
index 1dc1dbf356d..985521aef34 100644
--- a/app/assets/javascripts/projects/project_new.js
+++ b/app/assets/javascripts/projects/project_new.js
@@ -1,7 +1,7 @@
let hasUserDefinedProjectPath = false;
const deriveProjectPathFromUrl = ($projectImportUrl, $projectPath) => {
- if ($projectImportUrl.attr('disabled') || hasUserDefinedProjectPath) {
+ if (hasUserDefinedProjectPath) {
return;
}
@@ -27,8 +27,6 @@ const deriveProjectPathFromUrl = ($projectImportUrl, $projectPath) => {
const bindEvents = () => {
const $newProjectForm = $('#new_project');
- const importBtnTooltip = 'Please enter a valid project name.';
- const $importBtnWrapper = $('.import_gitlab_project');
const $projectImportUrl = $('#project_import_url');
const $projectPath = $('#project_path');
@@ -50,31 +48,15 @@ const bindEvents = () => {
$('.btn_import_gitlab_project').attr('href', `${importHref}?namespace_id=${$('#project_namespace_id').val()}&path=${$projectPath.val()}`);
});
- $('.btn_import_gitlab_project').attr('disabled', !$projectPath.val().trim().length);
- $importBtnWrapper.attr('title', importBtnTooltip);
-
$newProjectForm.on('submit', () => {
$projectPath.val($projectPath.val().trim());
});
$projectPath.on('keyup', () => {
hasUserDefinedProjectPath = $projectPath.val().trim().length > 0;
- if (hasUserDefinedProjectPath) {
- $('.btn_import_gitlab_project').attr('disabled', false);
- $importBtnWrapper.attr('title', '');
- $importBtnWrapper.removeClass('has-tooltip');
- } else {
- $('.btn_import_gitlab_project').attr('disabled', true);
- $importBtnWrapper.addClass('has-tooltip');
- }
});
- $projectImportUrl.disable();
$projectImportUrl.keyup(() => deriveProjectPathFromUrl($projectImportUrl, $projectPath));
-
- $('.import_git').on('click', () => {
- $projectImportUrl.attr('disabled', !$projectImportUrl.attr('disabled'));
- });
};
document.addEventListener('DOMContentLoaded', bindEvents);
diff --git a/app/assets/javascripts/wikis.js b/app/assets/javascripts/wikis.js
index 00676bcb0b3..51ed2b4fd15 100644
--- a/app/assets/javascripts/wikis.js
+++ b/app/assets/javascripts/wikis.js
@@ -1,6 +1,5 @@
/* global Breakpoints */
-import 'vendor/jquery.nicescroll';
import './breakpoints';
export default class Wikis {
@@ -8,7 +7,6 @@ export default class Wikis {
this.bp = Breakpoints.get();
this.sidebarEl = document.querySelector('.js-wiki-sidebar');
this.sidebarExpanded = false;
- $(this.sidebarEl).niceScroll();
const sidebarToggles = document.querySelectorAll('.js-sidebar-wiki-toggle');
for (let i = 0; i < sidebarToggles.length; i += 1) {
diff --git a/app/assets/stylesheets/framework/layout.scss b/app/assets/stylesheets/framework/layout.scss
index 67c3287ed74..0d8827bec11 100644
--- a/app/assets/stylesheets/framework/layout.scss
+++ b/app/assets/stylesheets/framework/layout.scss
@@ -109,16 +109,8 @@ body {
}
}
-
-/* The following prevents side effects related to iOS Safari's implementation of -webkit-overflow-scrolling: touch,
-which is applied to the body by jquery.nicescroling plugin to force hardware acceleration for momentum scrolling. Side
-effects are commonly related to inconsisent z-index behavior (e.g. tooltips). By applying the following to direct children
-of the body element here, we negate cascading side effects but allow momentum scrolling to be applied to the body */
-
-.navbar,
-.page-gutter,
-.page-with-sidebar {
- -webkit-overflow-scrolling: auto;
+.page-with-sidebar > .content-wrapper {
+ min-height: calc(100vh - #{$header-height});
}
.with-performance-bar .page-with-sidebar {
diff --git a/app/assets/stylesheets/framework/nav.scss b/app/assets/stylesheets/framework/nav.scss
index 88e7ba117d5..d386ac5ba9c 100644
--- a/app/assets/stylesheets/framework/nav.scss
+++ b/app/assets/stylesheets/framework/nav.scss
@@ -251,7 +251,6 @@
// Applies on /dashboard/issues
.project-item-select-holder {
- display: block;
margin: 0;
}
}
@@ -283,6 +282,31 @@
}
}
+.project-item-select-holder.btn-group {
+ display: flex;
+ max-width: 350px;
+ overflow: hidden;
+
+ @media(max-width: $screen-xs-max) {
+ width: 100%;
+ max-width: none;
+ }
+
+ .new-project-item-link {
+ white-space: nowrap;
+ overflow: hidden;
+ text-overflow: ellipsis;
+ }
+
+ .new-project-item-select-button {
+ width: 32px;
+ }
+}
+
+.new-project-item-select-button .fa-caret-down {
+ margin-left: 2px;
+}
+
.layout-nav {
width: 100%;
background: $gray-light;
diff --git a/app/assets/stylesheets/framework/sidebar.scss b/app/assets/stylesheets/framework/sidebar.scss
index 09b60ad1676..40e8a928e6e 100644
--- a/app/assets/stylesheets/framework/sidebar.scss
+++ b/app/assets/stylesheets/framework/sidebar.scss
@@ -78,15 +78,12 @@
.right-sidebar {
border-left: 1px solid $border-color;
+ height: calc(100% - #{$header-height});
&.affix {
position: fixed;
top: $header-height;
}
-
- &:not(.affix-top) {
- min-height: 100%;
- }
}
.with-performance-bar .right-sidebar.affix {
diff --git a/app/assets/stylesheets/framework/variables.scss b/app/assets/stylesheets/framework/variables.scss
index 1d0f10d6a32..7a1a89cd2f9 100644
--- a/app/assets/stylesheets/framework/variables.scss
+++ b/app/assets/stylesheets/framework/variables.scss
@@ -629,3 +629,11 @@ $perf-bar-bucket-bg: #111;
$perf-bar-bucket-color: #ccc;
$perf-bar-bucket-box-shadow-from: rgba($white-light, .2);
$perf-bar-bucket-box-shadow-to: rgba($black, .25);
+
+
+/*
+Project Templates Icons
+*/
+$rails: #c00;
+$node: #353535;
+$java: #70ad51;
diff --git a/app/assets/stylesheets/new_sidebar.scss b/app/assets/stylesheets/new_sidebar.scss
index 30029a94d9d..76dccd2df56 100644
--- a/app/assets/stylesheets/new_sidebar.scss
+++ b/app/assets/stylesheets/new_sidebar.scss
@@ -15,7 +15,9 @@ $new-sidebar-width: 220px;
$new-sidebar-collapsed-width: 50px;
.page-with-new-sidebar {
- padding-left: $new-sidebar-collapsed-width;
+ @media (min-width: $screen-md-min) {
+ padding-left: $new-sidebar-collapsed-width;
+ }
@media (min-width: $screen-lg-min) {
padding-left: $new-sidebar-width;
@@ -24,7 +26,7 @@ $new-sidebar-collapsed-width: 50px;
// Override position: absolute
.right-sidebar {
position: fixed;
- height: 100%;
+ height: calc(100% - #{$header-height});
}
.issues-bulk-update.right-sidebar.right-sidebar-expanded .issuable-sidebar-header {
@@ -49,10 +51,6 @@ $new-sidebar-collapsed-width: 50px;
align-items: center;
padding: 10px 16px 10px 10px;
color: $gl-text-color;
-
- @media (max-width: $screen-xs-max) {
- padding-right: 30px;
- }
}
&:hover,
@@ -77,26 +75,6 @@ $new-sidebar-collapsed-width: 50px;
overflow: hidden;
text-overflow: ellipsis;
}
-
- .close-nav-button {
- display: none;
- position: absolute;
- top: 0;
- right: 0;
- height: 100%;
- background-color: transparent;
- border: 0;
- padding: 0 10px;
- color: $gl-text-color-secondary;
-
- @media (max-width: $screen-xs-max) {
- display: block;
- }
-
- &:hover {
- color: $gl-text-color;
- }
- }
}
.settings-avatar {
@@ -339,21 +317,19 @@ $new-sidebar-collapsed-width: 50px;
// Collapsed nav
-.toggle-sidebar-button {
+.toggle-sidebar-button,
+.close-nav-button {
width: $new-sidebar-width - 2px;
position: fixed;
bottom: 0;
padding: 16px;
background-color: $gray-normal;
+ border: 0;
border-top: 2px solid $border-color;
color: $gl-text-color-secondary;
display: flex;
align-items: center;
- @media (max-width: $screen-xs-max) {
- display: none;
- }
-
i {
font-size: 20px;
margin-right: 8px;
@@ -369,6 +345,13 @@ $new-sidebar-collapsed-width: 50px;
}
}
+.toggle-sidebar-button {
+ @media (max-width: $screen-xs-max) {
+ display: none;
+ }
+}
+
+
.sidebar-icons-only {
.context-header {
height: 60px;
@@ -416,6 +399,10 @@ $new-sidebar-collapsed-width: 50px;
// Mobile nav
+.close-nav-button {
+ display: none;
+}
+
.toggle-mobile-nav {
display: none;
background-color: transparent;
@@ -435,6 +422,12 @@ $new-sidebar-collapsed-width: 50px;
}
}
+@media (max-width: $screen-xs-max) {
+ .close-nav-button {
+ display: flex;
+ }
+}
+
.mobile-overlay {
display: none;
diff --git a/app/assets/stylesheets/pages/builds.scss b/app/assets/stylesheets/pages/builds.scss
index 28c99d8e57c..486424fb729 100644
--- a/app/assets/stylesheets/pages/builds.scss
+++ b/app/assets/stylesheets/pages/builds.scss
@@ -235,8 +235,18 @@
display: none;
}
+ .sidebar-container {
+ width: calc(100% + 100px);
+ padding-right: 100px;
+ height: 100%;
+ overflow-y: scroll;
+ overflow-x: hidden;
+ -webkit-overflow-scrolling: touch;
+ }
+
.blocks-container {
padding: 0 $gl-padding;
+ width: 289px;
}
.block {
@@ -259,7 +269,15 @@
padding: 16px 0;
}
+ .trigger-build-variables {
+ margin: 0;
+ overflow-x: auto;
+ -ms-overflow-style: scrollbar;
+ -webkit-overflow-scrolling: touch;
+ }
+
.trigger-build-variable {
+ font-weight: normal;
color: $code-color;
}
@@ -326,6 +344,7 @@
border-top: 1px solid $border-color;
border-bottom: 1px solid $border-color;
max-height: 300px;
+ width: 289px;
overflow: auto;
svg {
diff --git a/app/assets/stylesheets/pages/projects.scss b/app/assets/stylesheets/pages/projects.scss
index 73603f20ef6..276465488e7 100644
--- a/app/assets/stylesheets/pages/projects.scss
+++ b/app/assets/stylesheets/pages/projects.scss
@@ -7,7 +7,8 @@
}
.new_project,
-.edit-project {
+.edit-project,
+.import-project {
.sharing-and-permissions {
.header {
@@ -457,6 +458,7 @@ a.deploy-project-label {
}
}
+.project-template,
.project-import {
.form-group {
margin-bottom: 5px;
@@ -471,7 +473,44 @@ a.deploy-project-label {
.btn {
padding: 8px;
- margin-left: 10px;
+ margin-right: 10px;
+ }
+
+ .blank-option {
+ min-width: 70px;
+ }
+
+ .btn-template-icon {
+ height: 24px;
+ width: inherit;
+ display: block;
+ margin: 0 auto 4px;
+ font-size: 24px;
+
+ @media (min-width: $screen-xs-max) {
+ top: 0;
+ }
+ }
+
+ @media (max-width: $screen-xs-max) {
+ .btn-template-icon {
+ display: inline-block;
+ height: 14px;
+ font-size: 14px;
+ margin: 0;
+ }
+ }
+
+ .icon-rails path {
+ fill: $rails;
+ }
+
+ .icon-node-express path {
+ fill: $node;
+ }
+
+ .icon-java-spring path {
+ fill: $java;
}
> div {
@@ -481,6 +520,97 @@ a.deploy-project-label {
}
}
+.project-templates-buttons .btn:last-child {
+ margin-right: 0;
+}
+
+.create-project-options {
+ display: flex;
+
+ @media (max-width: $screen-xs-max) {
+ display: block;
+ }
+
+ .first-column {
+ @media(min-width: $screen-xs-min) {
+ max-width: 50%;
+ padding-right: 30px;
+ }
+
+ @media(max-width: $screen-xs-max) {
+ max-width: 100%;
+ width: 100%;
+ }
+ }
+
+ .second-column {
+ @media(min-width: $screen-xs-min) {
+ width: 50%;
+ flex: 1;
+ padding-left: 30px;
+ position: relative;
+ }
+
+ @media(max-width: $screen-xs-max) {
+ max-width: 100%;
+ width: 100%;
+ padding-left: 0;
+ position: relative;
+ }
+
+ // Mobile
+ @media (max-width: $screen-xs-max) {
+ padding-top: 30px;
+ }
+
+ &::before {
+ content: "OR";
+ position: absolute;
+ left: 0;
+ top: 40%;
+ z-index: 10;
+ padding: 8px 0;
+ text-align: center;
+ background-color: $white-light;
+ color: $gl-text-color-tertiary;
+ transform: translateX(-50%);
+ font-size: 12px;
+ font-weight: bold;
+ line-height: 20px;
+
+ // Mobile
+ @media (max-width: $screen-xs-max) {
+ left: 50%;
+ top: 10px;
+ transform: translateY(-50%);
+ padding: 0 8px;
+ }
+ }
+
+ &::after {
+ content: "";
+ position: absolute;
+ background-color: $border-color;
+ bottom: 0;
+ left: 0;
+ right: auto;
+ height: 100%;
+ width: 1px;
+ top: 0;
+
+ // Mobile
+ @media (max-width: $screen-xs-max) {
+ top: 10px;
+ left: 10px;
+ right: 10px;
+ height: 1px;
+ width: auto;
+ }
+ }
+ }
+}
+
+
.project-stats {
font-size: 0;
text-align: center;
diff --git a/app/assets/stylesheets/pages/wiki.scss b/app/assets/stylesheets/pages/wiki.scss
index 45c21c5d274..fa6bdd297eb 100644
--- a/app/assets/stylesheets/pages/wiki.scss
+++ b/app/assets/stylesheets/pages/wiki.scss
@@ -95,12 +95,22 @@
}
.right-sidebar.wiki-sidebar {
- padding: $gl-padding 0;
+ padding: 0;
&.right-sidebar-collapsed {
display: none;
}
+ .sidebar-container {
+ padding: $gl-padding 0;
+ width: calc(100% + 100px);
+ padding-right: 100px;
+ height: 100%;
+ overflow-y: scroll;
+ overflow-x: hidden;
+ -webkit-overflow-scrolling: touch;
+ }
+
.blocks-container {
padding: 0 $gl-padding;
}
diff --git a/app/controllers/import/gitlab_projects_controller.rb b/app/controllers/import/gitlab_projects_controller.rb
index 36d246d185b..510813846a4 100644
--- a/app/controllers/import/gitlab_projects_controller.rb
+++ b/app/controllers/import/gitlab_projects_controller.rb
@@ -12,15 +12,7 @@ class Import::GitlabProjectsController < Import::BaseController
return redirect_back_or_default(options: { alert: "You need to upload a GitLab project export archive." })
end
- import_upload_path = Gitlab::ImportExport.import_upload_path(filename: project_params[:file].original_filename)
-
- FileUtils.mkdir_p(File.dirname(import_upload_path))
- FileUtils.copy_entry(project_params[:file].path, import_upload_path)
-
- @project = Gitlab::ImportExport::ProjectCreator.new(project_params[:namespace_id],
- current_user,
- import_upload_path,
- project_params[:path]).execute
+ @project = ::Projects::GitlabProjectsImportService.new(current_user, project_params).execute
if @project.saved?
redirect_to(
diff --git a/app/controllers/omniauth_callbacks_controller.rb b/app/controllers/omniauth_callbacks_controller.rb
index 323d5d26eb6..b4213574561 100644
--- a/app/controllers/omniauth_callbacks_controller.rb
+++ b/app/controllers/omniauth_callbacks_controller.rb
@@ -34,12 +34,11 @@ class OmniauthCallbacksController < Devise::OmniauthCallbacksController
if @user.two_factor_enabled?
prompt_for_two_factor(@user)
else
- log_audit_event(@user, with: :ldap)
+ log_audit_event(@user, with: oauth['provider'])
sign_in_and_redirect(@user)
end
else
- flash[:alert] = "Access denied for your LDAP account."
- redirect_to new_user_session_path
+ fail_ldap_login
end
end
@@ -123,9 +122,7 @@ class OmniauthCallbacksController < Devise::OmniauthCallbacksController
sign_in_and_redirect(@user)
end
else
- error_message = @user.errors.full_messages.to_sentence
-
- return redirect_to omniauth_error_path(oauth['provider'], error: error_message)
+ fail_login
end
end
@@ -145,6 +142,18 @@ class OmniauthCallbacksController < Devise::OmniauthCallbacksController
def oauth
@oauth ||= request.env['omniauth.auth']
end
+
+ def fail_login
+ error_message = @user.errors.full_messages.to_sentence
+
+ return redirect_to omniauth_error_path(oauth['provider'], error: error_message)
+ end
+
+ def fail_ldap_login
+ flash[:alert] = 'Access denied for your LDAP account.'
+
+ redirect_to new_user_session_path
+ end
def log_audit_event(user, options = {})
AuditEventService.new(user, user, options)
diff --git a/app/controllers/projects_controller.rb b/app/controllers/projects_controller.rb
index 2d7cbd4614e..0bffae6decd 100644
--- a/app/controllers/projects_controller.rb
+++ b/app/controllers/projects_controller.rb
@@ -324,6 +324,7 @@ class ProjectsController < Projects::ApplicationController
:runners_token,
:tag_list,
:visibility_level,
+ :template_name,
project_feature_attributes: %i[
builds_access_level
diff --git a/app/helpers/gitlab_routing_helper.rb b/app/helpers/gitlab_routing_helper.rb
index 1f7db9b2eb8..d4a91e533c1 100644
--- a/app/helpers/gitlab_routing_helper.rb
+++ b/app/helpers/gitlab_routing_helper.rb
@@ -47,14 +47,6 @@ module GitlabRoutingHelper
project_pipeline_path(pipeline.project, pipeline.id, *args)
end
- def milestone_path(entity, *args)
- if entity.is_group_milestone?
- group_milestone_path(entity.group, entity, *args)
- elsif entity.is_project_milestone?
- project_milestone_path(entity.project, entity, *args)
- end
- end
-
def issue_url(entity, *args)
project_issue_url(entity.project, entity, *args)
end
@@ -67,14 +59,6 @@ module GitlabRoutingHelper
project_pipeline_url(pipeline.project, pipeline.id, *args)
end
- def milestone_url(entity, *args)
- if entity.is_group_milestone?
- group_milestone_url(entity.group, entity, *args)
- elsif entity.is_project_milestone?
- project_milestone_url(entity.project, entity, *args)
- end
- end
-
def pipeline_job_url(pipeline, build, *args)
project_job_url(pipeline.project, build.id, *args)
end
diff --git a/app/helpers/milestones_routing_helper.rb b/app/helpers/milestones_routing_helper.rb
new file mode 100644
index 00000000000..766d5262018
--- /dev/null
+++ b/app/helpers/milestones_routing_helper.rb
@@ -0,0 +1,17 @@
+module MilestonesRoutingHelper
+ def milestone_path(milestone, *args)
+ if milestone.is_group_milestone?
+ group_milestone_path(milestone.group, milestone, *args)
+ elsif milestone.is_project_milestone?
+ project_milestone_path(milestone.project, milestone, *args)
+ end
+ end
+
+ def milestone_url(milestone, *args)
+ if milestone.is_group_milestone?
+ group_milestone_url(milestone.group, milestone, *args)
+ elsif milestone.is_project_milestone?
+ project_milestone_url(milestone.project, milestone, *args)
+ end
+ end
+end
diff --git a/app/models/conversational_development_index/metric.rb b/app/models/conversational_development_index/metric.rb
index f42f516f99a..0bee62f954f 100644
--- a/app/models/conversational_development_index/metric.rb
+++ b/app/models/conversational_development_index/metric.rb
@@ -13,9 +13,7 @@ module ConversationalDevelopmentIndex
end
def percentage_score(feature)
- return 100 if leader_score(feature).zero?
-
- 100 * instance_score(feature) / leader_score(feature)
+ self["percentage_#{feature}"]
end
end
end
diff --git a/app/models/milestone.rb b/app/models/milestone.rb
index 48d00764965..01e0d0155a3 100644
--- a/app/models/milestone.rb
+++ b/app/models/milestone.rb
@@ -149,7 +149,9 @@ class Milestone < ActiveRecord::Base
end
##
- # Returns the String necessary to reference this Milestone in Markdown
+ # Returns the String necessary to reference this Milestone in Markdown. Group
+ # milestones only support name references, and do not support cross-project
+ # references.
#
# format - Symbol format to use (default: :iid, optional: :name)
#
@@ -161,12 +163,16 @@ class Milestone < ActiveRecord::Base
# Milestone.first.to_reference(same_namespace_project) # => "gitlab-ce%1"
#
def to_reference(from_project = nil, format: :iid, full: false)
- return if is_group_milestone?
+ return if is_group_milestone? && format != :name
format_reference = milestone_format_reference(format)
reference = "#{self.class.reference_prefix}#{format_reference}"
- "#{project.to_reference(from_project, full: full)}#{reference}"
+ if project
+ "#{project.to_reference(from_project, full: full)}#{reference}"
+ else
+ reference
+ end
end
def reference_link_text(from_project = nil)
diff --git a/app/models/project.rb b/app/models/project.rb
index 09b1305739c..e7baba2ef08 100644
--- a/app/models/project.rb
+++ b/app/models/project.rb
@@ -75,6 +75,7 @@ class Project < ActiveRecord::Base
attr_accessor :new_default_branch
attr_accessor :old_path_with_namespace
+ attr_accessor :template_name
attr_writer :pipeline_status
alias_attribute :title, :name
@@ -163,7 +164,7 @@ class Project < ActiveRecord::Base
has_many :todos
has_many :notification_settings, as: :source, dependent: :delete_all # rubocop:disable Cop/ActiveRecordDependent
- has_one :import_data, class_name: 'ProjectImportData'
+ has_one :import_data, class_name: 'ProjectImportData', inverse_of: :project, autosave: true
has_one :project_feature
has_one :statistics, class_name: 'ProjectStatistics'
@@ -192,6 +193,7 @@ class Project < ActiveRecord::Base
accepts_nested_attributes_for :variables, allow_destroy: true
accepts_nested_attributes_for :project_feature
+ accepts_nested_attributes_for :import_data
delegate :name, to: :owner, allow_nil: true, prefix: true
delegate :count, to: :forks, prefix: true
@@ -588,8 +590,6 @@ class Project < ActiveRecord::Base
project_import_data.credentials ||= {}
project_import_data.credentials = project_import_data.credentials.merge(credentials)
end
-
- project_import_data.save
end
def import?
diff --git a/app/models/project_import_data.rb b/app/models/project_import_data.rb
index 37730474324..6da6632f4f2 100644
--- a/app/models/project_import_data.rb
+++ b/app/models/project_import_data.rb
@@ -1,7 +1,7 @@
require 'carrierwave/orm/activerecord'
class ProjectImportData < ActiveRecord::Base
- belongs_to :project
+ belongs_to :project, inverse_of: :import_data
attr_encrypted :credentials,
key: Gitlab::Application.secrets.db_key_base,
marshal: true,
diff --git a/app/services/issuable_base_service.rb b/app/services/issuable_base_service.rb
index 760a15e3ed0..7df5039f2e4 100644
--- a/app/services/issuable_base_service.rb
+++ b/app/services/issuable_base_service.rb
@@ -2,11 +2,8 @@ class IssuableBaseService < BaseService
private
def create_milestone_note(issuable)
- milestone = issuable.milestone
- return if milestone && milestone.is_group_milestone?
-
SystemNoteService.change_milestone(
- issuable, issuable.project, current_user, milestone)
+ issuable, issuable.project, current_user, issuable.milestone)
end
def create_labels_note(issuable, old_labels)
diff --git a/app/services/projects/autocomplete_service.rb b/app/services/projects/autocomplete_service.rb
index fc85f398935..724a77c873a 100644
--- a/app/services/projects/autocomplete_service.rb
+++ b/app/services/projects/autocomplete_service.rb
@@ -5,7 +5,15 @@ module Projects
end
def milestones
- @project.milestones.active.reorder(due_date: :asc, title: :asc).select([:iid, :title])
+ finder_params = {
+ project_ids: [@project.id],
+ state: :active,
+ order: { due_date: :asc, title: :asc }
+ }
+
+ finder_params[:group_ids] = [@project.group.id] if @project.group
+
+ MilestonesFinder.new(finder_params).execute.select([:iid, :title])
end
def merge_requests
diff --git a/app/services/projects/create_from_template_service.rb b/app/services/projects/create_from_template_service.rb
new file mode 100644
index 00000000000..87d9ed7a0e6
--- /dev/null
+++ b/app/services/projects/create_from_template_service.rb
@@ -0,0 +1,15 @@
+module Projects
+ class CreateFromTemplateService < BaseService
+ def initialize(user, params)
+ @current_user, @params = user, params.dup
+ end
+
+ def execute
+ params[:file] = Gitlab::ProjectTemplate.find(params[:template_name]).file
+
+ GitlabProjectsImportService.new(@current_user, @params).execute
+ ensure
+ params[:file]&.close
+ end
+ end
+end
diff --git a/app/services/projects/create_service.rb b/app/services/projects/create_service.rb
index e874a2d8789..48578b6d9e5 100644
--- a/app/services/projects/create_service.rb
+++ b/app/services/projects/create_service.rb
@@ -5,6 +5,10 @@ module Projects
end
def execute
+ if @params[:template_name]&.present?
+ return ::Projects::CreateFromTemplateService.new(current_user, params).execute
+ end
+
forked_from_project_id = params.delete(:forked_from_project_id)
import_data = params.delete(:import_data)
@skip_wiki = params.delete(:skip_wiki)
diff --git a/app/services/projects/gitlab_projects_import_service.rb b/app/services/projects/gitlab_projects_import_service.rb
new file mode 100644
index 00000000000..4ca6414b73b
--- /dev/null
+++ b/app/services/projects/gitlab_projects_import_service.rb
@@ -0,0 +1,36 @@
+# This service is an adapter used to for the GitLab Import feature, and
+# creating a project from a template.
+# The latter will under the hood just import an archive supplied by GitLab.
+module Projects
+ class GitlabProjectsImportService
+ attr_reader :current_user, :params
+
+ def initialize(user, params)
+ @current_user, @params = user, params.dup
+ end
+
+ def execute
+ FileUtils.mkdir_p(File.dirname(import_upload_path))
+ FileUtils.copy_entry(file.path, import_upload_path)
+
+ Gitlab::ImportExport::ProjectCreator.new(params[:namespace_id],
+ current_user,
+ import_upload_path,
+ params[:path]).execute
+ end
+
+ private
+
+ def import_upload_path
+ @import_upload_path ||= Gitlab::ImportExport.import_upload_path(filename: tmp_filename)
+ end
+
+ def tmp_filename
+ "#{SecureRandom.hex}_#{params[:path]}"
+ end
+
+ def file
+ params[:file]
+ end
+ end
+end
diff --git a/app/services/projects/import_service.rb b/app/services/projects/import_service.rb
index 50ec3651515..c3bf0031409 100644
--- a/app/services/projects/import_service.rb
+++ b/app/services/projects/import_service.rb
@@ -34,8 +34,12 @@ module Projects
def import_repository
raise Error, 'Blocked import URL.' if Gitlab::UrlBlocker.blocked_url?(project.import_url)
+ # We should return early for a GitHub import because the new GitHub
+ # importer fetch the project repositories for us.
+ return if project.github_import?
+
begin
- if project.github_import? || project.gitea_import?
+ if project.gitea_import?
fetch_repository
else
clone_repository
@@ -55,7 +59,7 @@ module Projects
end
def fetch_repository
- project.create_repository
+ project.ensure_repository
project.repository.add_remote(project.import_type, project.import_url)
project.repository.set_remote_as_mirror(project.import_type)
project.repository.fetch_remote(project.import_type, forced: true)
diff --git a/app/services/submit_usage_ping_service.rb b/app/services/submit_usage_ping_service.rb
index 17857ca62f2..14171bce782 100644
--- a/app/services/submit_usage_ping_service.rb
+++ b/app/services/submit_usage_ping_service.rb
@@ -1,6 +1,16 @@
class SubmitUsagePingService
URL = 'https://version.gitlab.com/usage_data'.freeze
+ METRICS = %w[leader_issues instance_issues percentage_issues leader_notes instance_notes
+ percentage_notes leader_milestones instance_milestones percentage_milestones
+ leader_boards instance_boards percentage_boards leader_merge_requests
+ instance_merge_requests percentage_merge_requests leader_ci_pipelines
+ instance_ci_pipelines percentage_ci_pipelines leader_environments instance_environments
+ percentage_environments leader_deployments instance_deployments percentage_deployments
+ leader_projects_prometheus_active instance_projects_prometheus_active
+ percentage_projects_prometheus_active leader_service_desk_issues instance_service_desk_issues
+ percentage_service_desk_issues].freeze
+
include Gitlab::CurrentSettings
def execute
@@ -27,15 +37,7 @@ class SubmitUsagePingService
return unless response['conv_index'].present?
ConversationalDevelopmentIndex::Metric.create!(
- response['conv_index'].slice(
- 'leader_issues', 'instance_issues', 'leader_notes', 'instance_notes',
- 'leader_milestones', 'instance_milestones', 'leader_boards', 'instance_boards',
- 'leader_merge_requests', 'instance_merge_requests', 'leader_ci_pipelines',
- 'instance_ci_pipelines', 'leader_environments', 'instance_environments',
- 'leader_deployments', 'instance_deployments', 'leader_projects_prometheus_active',
- 'instance_projects_prometheus_active', 'leader_service_desk_issues',
- 'instance_service_desk_issues'
- )
+ response['conv_index'].slice(*METRICS)
)
end
end
diff --git a/app/services/system_note_service.rb b/app/services/system_note_service.rb
index 2dbee9c246e..1763f64a4e4 100644
--- a/app/services/system_note_service.rb
+++ b/app/services/system_note_service.rb
@@ -142,7 +142,8 @@ module SystemNoteService
#
# Returns the created Note object
def change_milestone(noteable, project, author, milestone)
- body = milestone.nil? ? 'removed milestone' : "changed milestone to #{milestone.to_reference(project)}"
+ format = milestone&.is_group_milestone? ? :name : :iid
+ body = milestone.nil? ? 'removed milestone' : "changed milestone to #{milestone.to_reference(project, format: format)}"
create_note(NoteSummary.new(noteable, project, author, body, action: 'milestone'))
end
diff --git a/app/views/import/gitlab_projects/new.html.haml b/app/views/import/gitlab_projects/new.html.haml
index 767dffb5589..008e8287aa3 100644
--- a/app/views/import/gitlab_projects/new.html.haml
+++ b/app/views/import/gitlab_projects/new.html.haml
@@ -1,25 +1,43 @@
- page_title "GitLab Import"
- header_title "Projects", root_path
+- content_for :page_specific_javascripts do
+ = webpack_bundle_tag 'project_import_gl'
+
%h3.page-title
= icon('gitlab')
Import an exported GitLab project
%hr
-= form_tag import_gitlab_project_path, class: 'form-horizontal', multipart: true do
- %p
- Project will be imported as
- %strong
- #{@namespace.name}/#{@path}
+= form_tag import_gitlab_project_path, class: 'new_project', multipart: true do
+ .row
+ .form-group.col-xs-12.col-sm-6
+ = label_tag :namespace_id, 'Project path', class: 'label-light'
+ .form-group
+ .input-group
+ - if current_user.can_select_namespace?
+ .input-group-addon
+ = root_url
+ = select_tag :namespace_id, namespaces_options(namespace_id_from(params) || :current_user, display_path: true, extra_group: namespace_id_from(params)), class: 'select2 js-select-namespace', tabindex: 1
- %p
- To move or copy an entire GitLab project from another GitLab installation to this one, navigate to the original project's settings page, generate an export file, and upload it here.
- .form-group
- = hidden_field_tag :namespace_id, @namespace.id
- = hidden_field_tag :path, @path
- = label_tag :file, class: 'control-label' do
- %span GitLab project export
- .col-sm-10
- = file_field_tag :file, class: ''
+ - else
+ .input-group-addon.static-namespace
+ #{root_url}#{current_user.username}/
+ = hidden_field_tag :namespace_id, value: current_user.namespace_id
+ .form-group.col-xs-12.col-sm-6.project-path
+ = label_tag :path, 'Project name', class: 'label-light'
+ = text_field_tag :path, nil, placeholder: "my-awesome-project", class: "js-path-name form-control", tabindex: 2, autofocus: true, required: true
- .form-actions
- = submit_tag 'Import project', class: 'btn btn-create'
+ .row
+ .form-group.col-md-12
+ To move or copy an entire GitLab project from another GitLab installation to this one, navigate to the original project's settings page, generate an export file, and upload it here.
+ .row
+ .form-group.col-sm-12
+ = hidden_field_tag :namespace_id, @namespace.id
+ = hidden_field_tag :path, @path
+ = label_tag :file, 'GitLab project export', class: 'label-light'
+ .form-group
+ = file_field_tag :file, class: ''
+ .row
+ .form-actions
+ = submit_tag 'Import project', class: 'btn btn-create'
+ = link_to 'Cancel', new_project_path, class: 'btn btn-cancel'
diff --git a/app/views/layouts/nav/_new_admin_sidebar.html.haml b/app/views/layouts/nav/_new_admin_sidebar.html.haml
index a30243c0a39..0b4a9d92bea 100644
--- a/app/views/layouts/nav/_new_admin_sidebar.html.haml
+++ b/app/views/layouts/nav/_new_admin_sidebar.html.haml
@@ -4,9 +4,6 @@
.avatar-container.s40.settings-avatar
= icon('wrench')
.project-title Admin Area
- = button_tag class: 'close-nav-button', type: 'button' do
- %span.sr-only Close sidebar
- = icon ('times')
%ul.sidebar-top-level-items
= nav_link(controller: %w(dashboard admin projects users groups jobs runners cohorts), html_options: {class: 'home'}) do
= link_to admin_root_path, title: 'Overview', class: 'shortcuts-tree' do
diff --git a/app/views/layouts/nav/_new_group_sidebar.html.haml b/app/views/layouts/nav/_new_group_sidebar.html.haml
index 48e3d1e2f6d..c7dabbd8237 100644
--- a/app/views/layouts/nav/_new_group_sidebar.html.haml
+++ b/app/views/layouts/nav/_new_group_sidebar.html.haml
@@ -5,9 +5,6 @@
= image_tag group_icon(@group), class: "avatar s40 avatar-tile"
.group-title
= @group.name
- = button_tag class: 'close-nav-button', type: 'button' do
- %span.sr-only Close sidebar
- = icon ('times')
%ul.sidebar-top-level-items
= nav_link(path: ['groups#show', 'groups#activity', 'groups#subgroups'], html_options: { class: 'home' }) do
= link_to group_path(@group), title: 'Group overview' do
diff --git a/app/views/layouts/nav/_new_profile_sidebar.html.haml b/app/views/layouts/nav/_new_profile_sidebar.html.haml
index d339619a3e8..edae009a28e 100644
--- a/app/views/layouts/nav/_new_profile_sidebar.html.haml
+++ b/app/views/layouts/nav/_new_profile_sidebar.html.haml
@@ -4,9 +4,6 @@
.avatar-container.s40.settings-avatar
= icon('user')
.project-title User Settings
- = button_tag class: 'close-nav-button', type: 'button' do
- %span.sr-only Close sidebar
- = icon ('times')
%ul.sidebar-top-level-items
= nav_link(path: 'profiles#show', html_options: {class: 'home'}) do
= link_to profile_path, title: 'Profile Settings' do
diff --git a/app/views/layouts/nav/_new_project_sidebar.html.haml b/app/views/layouts/nav/_new_project_sidebar.html.haml
index df8dfe0c2f7..e0477c29ebe 100644
--- a/app/views/layouts/nav/_new_project_sidebar.html.haml
+++ b/app/views/layouts/nav/_new_project_sidebar.html.haml
@@ -6,9 +6,6 @@
= project_icon(@project, alt: @project.name, class: 'avatar s40 avatar-tile')
.project-title
= @project.name
- = button_tag class: 'close-nav-button', type: 'button' do
- %span.sr-only Close sidebar
- = icon ('times')
%ul.sidebar-top-level-items
= nav_link(path: ['projects#show', 'projects#activity', 'cycle_analytics#show'], html_options: { class: 'home' }) do
= link_to project_path(@project), title: 'Project overview', class: 'shortcuts-project' do
diff --git a/app/views/projects/_project_templates.html.haml b/app/views/projects/_project_templates.html.haml
new file mode 100644
index 00000000000..21baf35f2ac
--- /dev/null
+++ b/app/views/projects/_project_templates.html.haml
@@ -0,0 +1,10 @@
+.project-templates-buttons.import-buttons{ data: { toggle: "buttons" } }
+ .btn.blank-option.active
+ %input{ type: "radio", autocomplete: "off", name: "project_templates", id: "blank", checked: "true" }
+ = icon('file-o', class: 'btn-template-icon')
+ Blank
+ - Gitlab::ProjectTemplate.all.each do |template|
+ .btn
+ %input{ type: "radio", autocomplete: "off", name: "project_templates", id: template.name }
+ = custom_icon(template.logo)
+ = template.title
diff --git a/app/views/projects/jobs/_sidebar.html.haml b/app/views/projects/jobs/_sidebar.html.haml
index f2db71e8838..99f4b30d085 100644
--- a/app/views/projects/jobs/_sidebar.html.haml
+++ b/app/views/projects/jobs/_sidebar.html.haml
@@ -1,101 +1,101 @@
- builds = @build.pipeline.builds.to_a
%aside.right-sidebar.right-sidebar-expanded.build-sidebar.js-build-sidebar.js-right-sidebar{ data: { "offset-top" => "101", "spy" => "affix" } }
- .blocks-container
- .block
- %strong
- = @build.name
- %a.gutter-toggle.pull-right.visible-xs-block.visible-sm-block.js-sidebar-build-toggle{ href: "#", 'aria-label': 'Toggle Sidebar', role: 'button' }
- = icon('angle-double-right')
-
- #js-details-block-vue
-
- - if can?(current_user, :read_build, @project) && (@build.artifacts? || @build.artifacts_expired?)
+ .sidebar-container
+ .blocks-container
.block
- .title
- Job artifacts
- - if @build.artifacts_expired?
- %p.build-detail-row
- The artifacts were removed
- #{time_ago_with_tooltip(@build.artifacts_expire_at)}
- - elsif @build.has_expiring_artifacts?
- %p.build-detail-row
- The artifacts will be removed in
- %span.js-artifacts-remove= @build.artifacts_expire_at
+ %strong
+ = @build.name
+ %a.gutter-toggle.pull-right.visible-xs-block.visible-sm-block.js-sidebar-build-toggle{ href: "#", 'aria-label': 'Toggle Sidebar', role: 'button' }
+ = icon('angle-double-right')
- - if @build.artifacts?
- .btn-group.btn-group-justified{ role: :group }
- - if @build.has_expiring_artifacts? && can?(current_user, :update_build, @build)
- = link_to keep_project_job_artifacts_path(@project, @build), class: 'btn btn-sm btn-default', method: :post do
- Keep
+ #js-details-block-vue
- = link_to download_project_job_artifacts_path(@project, @build), rel: 'nofollow', download: '', class: 'btn btn-sm btn-default' do
- Download
+ - if can?(current_user, :read_build, @project) && (@build.artifacts? || @build.artifacts_expired?)
+ .block
+ .title
+ Job artifacts
+ - if @build.artifacts_expired?
+ %p.build-detail-row
+ The artifacts were removed
+ #{time_ago_with_tooltip(@build.artifacts_expire_at)}
+ - elsif @build.has_expiring_artifacts?
+ %p.build-detail-row
+ The artifacts will be removed in
+ %span.js-artifacts-remove= @build.artifacts_expire_at
- - if @build.artifacts_metadata?
- = link_to browse_project_job_artifacts_path(@project, @build), class: 'btn btn-sm btn-default' do
- Browse
+ - if @build.artifacts?
+ .btn-group.btn-group-justified{ role: :group }
+ - if @build.has_expiring_artifacts? && can?(current_user, :update_build, @build)
+ = link_to keep_project_job_artifacts_path(@project, @build), class: 'btn btn-sm btn-default', method: :post do
+ Keep
- - if @build.trigger_request
- .build-widget.block
- %h4.title
- Trigger
+ = link_to download_project_job_artifacts_path(@project, @build), rel: 'nofollow', download: '', class: 'btn btn-sm btn-default' do
+ Download
- %p
- %span.build-light-text Token:
- #{@build.trigger_request.trigger.short_token}
+ - if @build.artifacts_metadata?
+ = link_to browse_project_job_artifacts_path(@project, @build), class: 'btn btn-sm btn-default' do
+ Browse
+
+ - if @build.trigger_request
+ .build-widget.block
+ %h4.title
+ Trigger
- - if @build.trigger_request.variables
%p
- %button.btn.group.btn-group-justified.reveal-variables Reveal Variables
+ %span.build-light-text Token:
+ #{@build.trigger_request.trigger.short_token}
+ - if @build.trigger_request.variables
+ %p
+ %button.btn.group.btn-group-justified.reveal-variables Reveal Variables
- - @build.trigger_request.variables.each do |key, value|
- .hide.js-build
- .js-build-variable.trigger-build-variable= key
- .js-build-value.trigger-build-value= value
+ %dl.js-build-variables.trigger-build-variables.hide
+ - @build.trigger_request.variables.each do |key, value|
+ %dt.js-build-variable.trigger-build-variable= key
+ %dd.js-build-value.trigger-build-value= value
- %div{ class: (@build.pipeline.stages_count > 1 ? "block" : "block-last") }
- %p
- Commit
- = link_to @build.pipeline.short_sha, project_commit_path(@project, @build.pipeline.sha), class: 'commit-sha link-commit'
- = clipboard_button(text: @build.pipeline.short_sha, title: "Copy commit SHA to clipboard")
- - if @build.merge_request
- in
- = link_to "#{@build.merge_request.to_reference}", merge_request_path(@build.merge_request), class: 'link-commit'
+ %div{ class: (@build.pipeline.stages_count > 1 ? "block" : "block-last") }
+ %p
+ Commit
+ = link_to @build.pipeline.short_sha, project_commit_path(@project, @build.pipeline.sha), class: 'commit-sha link-commit'
+ = clipboard_button(text: @build.pipeline.short_sha, title: "Copy commit SHA to clipboard")
+ - if @build.merge_request
+ in
+ = link_to "#{@build.merge_request.to_reference}", merge_request_path(@build.merge_request), class: 'link-commit'
- %p.build-light-text.append-bottom-0
- #{@build.pipeline.git_commit_title}
+ %p.build-light-text.append-bottom-0
+ #{@build.pipeline.git_commit_title}
- - if @build.pipeline.stages_count > 1
- .dropdown.build-dropdown
- %div
- %span{ class: "ci-status-icon-#{@build.pipeline.status}" }
- = ci_icon_for_status(@build.pipeline.status)
- Pipeline
- = link_to "##{@build.pipeline.id}", project_pipeline_path(@project, @build.pipeline), class: 'link-commit'
- from
- = link_to "#{@build.pipeline.ref}", project_branch_path(@project, @build.pipeline.ref), class: 'link-commit'
- %button.dropdown-menu-toggle{ type: 'button', 'data-toggle' => 'dropdown' }
- %span.stage-selection More
- = icon('chevron-down')
- %ul.dropdown-menu
- - @build.pipeline.legacy_stages.each do |stage|
- %li
- %a.stage-item= stage.name
+ - if @build.pipeline.stages_count > 1
+ .block-last.dropdown.build-dropdown
+ %div
+ %span{ class: "ci-status-icon-#{@build.pipeline.status}" }
+ = ci_icon_for_status(@build.pipeline.status)
+ Pipeline
+ = link_to "##{@build.pipeline.id}", project_pipeline_path(@project, @build.pipeline), class: 'link-commit'
+ from
+ = link_to "#{@build.pipeline.ref}", project_branch_path(@project, @build.pipeline.ref), class: 'link-commit'
+ %button.dropdown-menu-toggle{ type: 'button', 'data-toggle' => 'dropdown' }
+ %span.stage-selection More
+ = icon('chevron-down')
+ %ul.dropdown-menu
+ - @build.pipeline.legacy_stages.each do |stage|
+ %li
+ %a.stage-item= stage.name
- .builds-container
- - HasStatus::ORDERED_STATUSES.each do |build_status|
- - builds.select{|build| build.status == build_status}.each do |build|
- .build-job{ class: sidebar_build_class(build, @build), data: { stage: build.stage } }
- = link_to project_job_path(@project, build) do
- = icon('arrow-right')
- %span{ class: "ci-status-icon-#{build.status}" }
- = ci_icon_for_status(build.status)
- %span
- - if build.name
- = build.name
- - else
- = build.id
- - if build.retried?
- %i.fa.fa-refresh.has-tooltip{ data: { container: 'body', placement: 'bottom' }, title: 'Job was retried' }
+ .builds-container
+ - HasStatus::ORDERED_STATUSES.each do |build_status|
+ - builds.select{|build| build.status == build_status}.each do |build|
+ .build-job{ class: sidebar_build_class(build, @build), data: { stage: build.stage } }
+ = link_to project_job_path(@project, build) do
+ = icon('arrow-right')
+ %span{ class: "ci-status-icon-#{build.status}" }
+ = ci_icon_for_status(build.status)
+ %span
+ - if build.name
+ = build.name
+ - else
+ = build.id
+ - if build.retried?
+ %i.fa.fa-refresh.has-tooltip{ data: { container: 'body', placement: 'bottom' }, title: 'Job was retried' }
diff --git a/app/views/projects/new.html.haml b/app/views/projects/new.html.haml
index 25109f0f414..e3bbebbcf4c 100644
--- a/app/views/projects/new.html.haml
+++ b/app/views/projects/new.html.haml
@@ -17,8 +17,68 @@
- if import_sources_enabled?
%p
Create or Import your project from popular Git services
- .col-lg-9
+ .col-lg-9.js-toggle-container
= form_for @project, html: { class: 'new_project' } do |f|
+ .create-project-options
+ .first-column
+ .project-template
+ .form-group
+ = f.label :template_project, class: 'label-light' do
+ Create from template
+ = link_to icon('question-circle'), help_page_path("public_access/public_access"), aria: { label: "What’s included in a template?" }, title: "What’s included in a template?", class: 'has-tooltip', data: { placement: 'top'}
+ %div
+ = render 'project_templates', f: f
+ .second-column
+ - if import_sources_enabled?
+ .project-import
+ .form-group.clearfix
+ = f.label :visibility_level, class: 'label-light' do #the label here seems wrong
+ Import project from
+ .col-sm-12.import-buttons
+ %div
+ - if github_import_enabled?
+ = link_to new_import_github_path, class: 'btn import_github' do
+ = icon('github', text: 'GitHub')
+ %div
+ - if bitbucket_import_enabled?
+ = link_to status_import_bitbucket_path, class: "btn import_bitbucket #{'how_to_import_link' unless bitbucket_import_configured?}" do
+ = icon('bitbucket', text: 'Bitbucket')
+ - unless bitbucket_import_configured?
+ = render 'bitbucket_import_modal'
+ %div
+ - if gitlab_import_enabled?
+ = link_to status_import_gitlab_path, class: "btn import_gitlab #{'how_to_import_link' unless gitlab_import_configured?}" do
+ = icon('gitlab', text: 'GitLab.com')
+ - unless gitlab_import_configured?
+ = render 'gitlab_import_modal'
+ %div
+ - if google_code_import_enabled?
+ = link_to new_import_google_code_path, class: 'btn import_google_code' do
+ = icon('google', text: 'Google Code')
+ %div
+ - if fogbugz_import_enabled?
+ = link_to new_import_fogbugz_path, class: 'btn import_fogbugz' do
+ = icon('bug', text: 'Fogbugz')
+ %div
+ - if gitea_import_enabled?
+ = link_to new_import_gitea_url, class: 'btn import_gitea' do
+ = custom_icon('go_logo')
+ Gitea
+ %div
+ - if git_import_enabled?
+ %button.btn.js-toggle-button.import_git{ type: "button" }
+ = icon('git', text: 'Repo by URL')
+ .import_gitlab_project.has-tooltip{ data: { container: 'body' } }
+ = link_to new_import_gitlab_project_path, class: 'btn btn_import_gitlab_project project-submit' do
+ = icon('gitlab', text: 'GitLab export')
+
+ .row
+ .col-lg-12
+ .js-toggle-content.hide
+ %hr
+ = render "shared/import_form", f: f
+ %hr
+
.row
.form-group.col-xs-12.col-sm-6
= f.label :namespace_id, class: 'label-light' do
@@ -45,53 +105,6 @@
Want to house several dependent projects under the same namespace?
= link_to "Create a group", new_group_path
- - if import_sources_enabled?
- .project-import.js-toggle-container
- .form-group.clearfix
- = f.label :visibility_level, class: 'label-light' do
- Import project from
- .col-sm-12.import-buttons
- %div
- - if github_import_enabled?
- = link_to new_import_github_path, class: 'btn import_github' do
- = icon('github', text: 'GitHub')
- %div
- - if bitbucket_import_enabled?
- = link_to status_import_bitbucket_path, class: "btn import_bitbucket #{'how_to_import_link' unless bitbucket_import_configured?}" do
- = icon('bitbucket', text: 'Bitbucket')
- - unless bitbucket_import_configured?
- = render 'bitbucket_import_modal'
- %div
- - if gitlab_import_enabled?
- = link_to status_import_gitlab_path, class: "btn import_gitlab #{'how_to_import_link' unless gitlab_import_configured?}" do
- = icon('gitlab', text: 'GitLab.com')
- - unless gitlab_import_configured?
- = render 'gitlab_import_modal'
- %div
- - if google_code_import_enabled?
- = link_to new_import_google_code_path, class: 'btn import_google_code' do
- = icon('google', text: 'Google Code')
- %div
- - if fogbugz_import_enabled?
- = link_to new_import_fogbugz_path, class: 'btn import_fogbugz' do
- = icon('bug', text: 'FogBugz')
- %div
- - if gitea_import_enabled?
- = link_to new_import_gitea_url, class: 'btn import_gitea' do
- = custom_icon('go_logo')
- Gitea
- %div
- - if git_import_enabled?
- %button.btn.js-toggle-button.import_git{ type: "button" }
- = icon('git', text: 'Repo by URL')
- .import_gitlab_project.has-tooltip{ data: { container: 'body' } }
- - if gitlab_project_import_enabled?
- = link_to new_import_gitlab_project_path, class: 'btn btn_import_gitlab_project project-submit' do
- = icon('gitlab', text: 'GitLab export')
-
- .js-toggle-content.hide
- = render "shared/import_form", f: f
-
.form-group
= f.label :description, class: 'label-light' do
Project description
diff --git a/app/views/projects/wikis/_sidebar.html.haml b/app/views/projects/wikis/_sidebar.html.haml
index e71ce1f357f..f7283ae4739 100644
--- a/app/views/projects/wikis/_sidebar.html.haml
+++ b/app/views/projects/wikis/_sidebar.html.haml
@@ -1,21 +1,22 @@
%aside.right-sidebar.right-sidebar-expanded.wiki-sidebar.js-wiki-sidebar.js-right-sidebar{ data: { "offset-top" => "50", "spy" => "affix" } }
- .block.wiki-sidebar-header.append-bottom-default
- %a.gutter-toggle.pull-right.visible-xs-block.visible-sm-block.js-sidebar-wiki-toggle{ href: "#" }
- = icon('angle-double-right')
+ .sidebar-container
+ .block.wiki-sidebar-header.append-bottom-default
+ %a.gutter-toggle.pull-right.visible-xs-block.visible-sm-block.js-sidebar-wiki-toggle{ href: "#" }
+ = icon('angle-double-right')
- - git_access_url = project_wikis_git_access_path(@project)
- = link_to git_access_url, class: active_nav_link?(path: 'wikis#git_access') ? 'active' : '' do
- = succeed '&nbsp;' do
- = icon('cloud-download')
- Clone repository
+ - git_access_url = project_wikis_git_access_path(@project)
+ = link_to git_access_url, class: active_nav_link?(path: 'wikis#git_access') ? 'active' : '' do
+ = succeed '&nbsp;' do
+ = icon('cloud-download')
+ Clone repository
- .blocks-container
- .block.block-first
- %ul.wiki-pages
- = render @sidebar_wiki_entries, context: 'sidebar'
+ .blocks-container
+ .block.block-first
+ %ul.wiki-pages
+ = render @sidebar_wiki_entries, context: 'sidebar'
- .block
- = link_to project_wikis_pages_path(@project), class: 'btn btn-block' do
- More Pages
+ .block
+ = link_to project_wikis_pages_path(@project), class: 'btn btn-block' do
+ More Pages
= render 'projects/wikis/new'
diff --git a/app/views/shared/_import_form.html.haml b/app/views/shared/_import_form.html.haml
index 1c7c73be933..873179339dc 100644
--- a/app/views/shared/_import_form.html.haml
+++ b/app/views/shared/_import_form.html.haml
@@ -1,16 +1,16 @@
.form-group.import-url-data
- = f.label :import_url, class: 'control-label' do
+ = f.label :import_url, class: 'label-light' do
%span Git repository URL
- .col-sm-10
- = f.text_field :import_url, autocomplete: 'off', class: 'form-control', placeholder: 'https://username:password@gitlab.company.com/group/project.git'
- .well.prepend-top-20
- %ul
- %li
- The repository must be accessible over <code>http://</code>, <code>https://</code> or <code>git://</code>.
- %li
- If your HTTP repository is not publicly accessible, add authentication information to the URL: <code>https://username:password@gitlab.company.com/group/project.git</code>.
- %li
- The import will time out after 15 minutes. For repositories that take longer, use a clone/push combination.
- %li
- To migrate an SVN repository, check out #{link_to "this document", help_page_path('workflow/importing/migrating_from_svn')}.
+ = f.text_field :import_url, autocomplete: 'off', class: 'form-control', placeholder: 'https://username:password@gitlab.company.com/group/project.git'
+
+ .well.prepend-top-20
+ %ul
+ %li
+ The repository must be accessible over <code>http://</code>, <code>https://</code> or <code>git://</code>.
+ %li
+ If your HTTP repository is not publicly accessible, add authentication information to the URL: <code>https://username:password@gitlab.company.com/group/project.git</code>.
+ %li
+ The import will time out after 15 minutes. For repositories that take longer, use a clone/push combination.
+ %li
+ To migrate an SVN repository, check out #{link_to "this document", help_page_path('workflow/importing/migrating_from_svn')}.
diff --git a/app/views/shared/_new_project_item_select.html.haml b/app/views/shared/_new_project_item_select.html.haml
index b417e83cdb6..96502d7ce93 100644
--- a/app/views/shared/_new_project_item_select.html.haml
+++ b/app/views/shared/_new_project_item_select.html.haml
@@ -1,6 +1,7 @@
- if any_projects?(@projects)
- .project-item-select-holder
+ .project-item-select-holder.btn-group.pull-right
+ %a.btn.btn-new.new-project-item-link{ href: '', data: { label: local_assigns[:label] } }
+ = icon('spinner spin')
= project_select_tag :project_path, class: "project-item-select", data: { include_groups: local_assigns[:include_groups], order_by: 'last_activity_at', relative_path: local_assigns[:path] }, with_feature_enabled: local_assigns[:with_feature_enabled]
- %a.btn.btn-new.new-project-item-select-button
- = local_assigns[:label]
+ %button.btn.btn-new.new-project-item-select-button
= icon('caret-down')
diff --git a/app/views/shared/_sidebar_toggle_button.html.haml b/app/views/shared/_sidebar_toggle_button.html.haml
index e70faad4894..eb5ddb0dde4 100644
--- a/app/views/shared/_sidebar_toggle_button.html.haml
+++ b/app/views/shared/_sidebar_toggle_button.html.haml
@@ -2,3 +2,7 @@
= icon('angle-double-left')
= icon('angle-double-right')
%span.collapse-text Collapse sidebar
+
+= button_tag class: 'close-nav-button', type: 'button' do
+ = icon ('times')
+ %span.collapse-text Close sidebar
diff --git a/app/views/shared/icons/_java_spring.svg b/app/views/shared/icons/_java_spring.svg
new file mode 100644
index 00000000000..508349aa456
--- /dev/null
+++ b/app/views/shared/icons/_java_spring.svg
@@ -0,0 +1,6 @@
+<svg xmlns="http://www.w3.org/2000/svg" width="32" height="32" viewBox="0 0 32 32" class="btn-template-icon icon-java-spring">
+ <g fill="none" fill-rule="evenodd">
+ <rect width="32" height="32"/>
+ <path fill="#70AD51" d="M5.46647617,27.9932117 C6.0517027,28.4658996 6.91159892,28.3777063 7.38425926,27.7914452 C7.85922261,27.2048452 7.76991326,26.3449044 7.18398981,25.8699411 C6.59874295,25.3956543 5.74015536,25.4869934 5.26383884,26.0722403 C4.81393367,26.6267596 4.87238621,27.4284565 5.37913494,27.9159868 L5.11431334,27.6818383 C1.97157151,24.7616933 0,20.5966301 0,15.9782542 C0,7.16842834 7.16775175,0 15.9796074,0 C20.4586065,0 24.5113565,1.8565519 27.4145869,4.8362365 C28.0749348,3.93840692 28.6466499,2.93435335 29.115524,1.82069284 C31.1513712,7.93770658 32.3482517,13.0811131 31.909824,17.1311567 C31.3178113,25.4044499 24.4017495,31.9585382 15.9796074,31.9585382 C12.0682639,31.9585382 8.48438805,30.5444735 5.7042963,28.2034861 L5.46647617,27.9932117 Z M29.0471888,23.0106888 C33.0546075,17.6737787 30.8211972,9.04527781 28.9612624,3.529749 C27.3029502,6.98304378 23.2217836,9.62375882 19.6981239,10.4613722 C16.3950312,11.2482417 13.4715032,10.6021021 10.4153644,11.7780085 C3.44517575,14.457289 3.55613585,22.7698242 7.39373146,24.6365249 C7.39711439,24.6392312 7.62444728,24.7616933 7.62174094,24.7576338 C7.62309411,24.7562806 13.2658211,23.6358542 16.3862356,22.4843049 C20.9450718,20.7996058 25.9524846,16.6494275 27.5986182,11.8273993 C26.723116,16.8415779 22.4179995,21.6669891 18.093262,23.8828081 C15.7908399,25.0648038 14.0005934,25.3279957 10.2123886,26.6385428 C9.74892722,26.798217 9.38492397,26.9538318 9.38492397,26.9538318 C10.3463526,26.7948341 11.301692,26.7420604 11.301692,26.7420604 C16.6954354,26.4869875 25.1087819,28.2582896 29.0471888,23.0106888 Z"/>
+ </g>
+</svg>
diff --git a/app/views/shared/icons/_node_express.svg b/app/views/shared/icons/_node_express.svg
new file mode 100644
index 00000000000..f2c94319f19
--- /dev/null
+++ b/app/views/shared/icons/_node_express.svg
@@ -0,0 +1,6 @@
+<svg xmlns="http://www.w3.org/2000/svg" width="27" height="32" viewBox="0 0 27 32" class="btn-template-icon icon-node-express">
+ <g fill="none" fill-rule="evenodd" transform="translate(-3)">
+ <rect width="32" height="32"/>
+ <path fill="#353535" d="M4.19170065,16.2667139 C4.23142421,18.3323387 4.47969269,20.2489714 4.93651356,22.0166696 C5.39333443,23.7843677 6.09841693,25.3236323 7.05178222,26.6345096 C8.00514751,27.9453869 9.23655921,28.9781838 10.7460543,29.7329313 C12.2555493,30.4876788 14.1026668,30.8650469 16.2874623,30.8650469 C19.5050701,30.8650469 22.1764391,30.0209341 24.3016492,28.3326831 C26.4268593,26.644432 27.7476477,24.1120935 28.2640539,20.7355914 L29.4557545,20.7355914 C29.0187954,24.3107112 27.6086304,27.0813875 25.2252172,29.0477034 C22.841804,31.0140194 19.9023051,31.9971626 16.4066324,31.9971626 C14.0232191,32.0368861 11.9874175,31.659518 10.2991665,30.8650469 C8.61091547,30.0705759 7.23054269,28.9484023 6.15800673,27.4984926 C5.08547078,26.0485829 4.29101162,24.3404957 3.77460543,22.3741798 C3.25819923,20.4078639 3,18.2926164 3,16.0283738 C3,13.4860664 3.3773681,11.2218578 4.13211562,9.23568007 C4.88686314,7.24950238 5.87993709,5.57120741 7.11136726,4.20074481 C8.34279742,2.8302822 9.77282391,1.78755456 11.4014896,1.07253059 C13.0301553,0.357506621 14.6985195,0 16.4066324,0 C18.7900456,0 20.8457087,0.456814016 22.5736832,1.37045575 C24.3016578,2.28409749 25.7118228,3.4956477 26.8042206,5.00514275 C27.8966183,6.51463779 28.6910775,8.24258646 29.1876219,10.1890406 C29.6841663,12.1354947 29.8927118,14.1613656 29.8132647,16.2667139 L4.19170065,16.2667139 Z M28.6215641,15.0750133 C28.6215641,13.2080062 28.3633648,11.4304039 27.8469586,9.74215285 C27.3305524,8.05390181 26.5658855,6.57422163 25.5529349,5.30306791 C24.5399843,4.03191419 23.2787803,3.0289095 21.7692853,2.29402376 C20.2597903,1.55913801 18.5119801,1.19170065 16.5258024,1.19170065 C14.8574132,1.19170065 13.2982871,1.50948432 11.8483774,2.14506118 C10.3984676,2.78063804 9.12733299,3.70419681 8.03493526,4.9157652 C6.94253754,6.12733359 6.05870172,7.58715229 5.38340131,9.2952651 C4.70810089,11.0033779 4.31087132,12.9299414 4.19170065,15.0750133 L28.6215641,15.0750133 Z"/>
+ </g>
+</svg>
diff --git a/app/views/shared/icons/_rails.svg b/app/views/shared/icons/_rails.svg
new file mode 100644
index 00000000000..0bb09a705df
--- /dev/null
+++ b/app/views/shared/icons/_rails.svg
@@ -0,0 +1,6 @@
+<svg xmlns="http://www.w3.org/2000/svg" width="32" height="20" viewBox="0 0 32 20" class="btn-template-icon icon-rails">
+ <g fill="none" fill-rule="evenodd" transform="translate(0 -6)">
+ <rect width="32" height="32"/>
+ <path fill="#C00" fill-rule="nonzero" d="M0.984615385,25.636044 C0.984615385,25.636044 1.40659341,21.4725275 4.36043956,16.5494505 C7.31428571,11.6263736 12.3498901,7.8989011 16.4430769,7.53318681 C24.5872527,6.71736264 31.9015385,14.0175824 31.9015385,14.0175824 C31.9015385,14.0175824 31.6624176,14.1863736 31.4092308,14.3973626 C23.4197802,8.48967033 18.5389011,11.2747253 17.0057143,12.0202198 C9.97274725,15.9446154 12.0967033,25.636044 12.0967033,25.636044 L0.984615385,25.636044 Z M24.1371429,8.32087912 C23.687033,8.13802198 23.2369231,7.96923077 22.7727473,7.81450549 L22.829011,6.88615385 C23.7151648,7.13934066 24.0668132,7.30813187 24.1934066,7.37846154 L24.1371429,8.32087912 Z M22.8008791,11.3028571 C23.250989,11.330989 23.7151648,11.3872527 24.1934066,11.4857143 L24.1371429,12.3578022 C23.672967,12.2593407 23.2087912,12.2030769 22.7446154,12.189011 L22.8008791,11.3028571 Z M17.5964835,6.91428571 C17.1885714,6.91428571 16.7806593,6.92835165 16.3727473,6.97054945 L16.1054945,6.14065934 C16.5696703,6.0843956 17.0197802,6.05626374 17.4558242,6.05626374 L17.7371429,6.91428571 C17.6949451,6.91428571 17.6386813,6.91428571 17.5964835,6.91428571 Z M18.2716484,12.0905495 C18.6232967,11.9358242 19.0312088,11.7810989 19.5094505,11.6404396 L19.8189011,12.5687912 C19.410989,12.6953846 19.0030769,12.8641758 18.5951648,13.0610989 L18.2716484,12.0905495 Z M11.8857143,8.39120879 C11.52,8.57406593 11.1683516,8.78505495 10.8026374,9.01010989 L10.1556044,8.02549451 C10.5353846,7.80043956 10.9010989,7.60351648 11.2527473,7.42065934 L11.8857143,8.39120879 Z M14.7692308,14.7208791 C15.0224176,14.3973626 15.3178022,14.0738462 15.6413187,13.7784615 L16.2742857,14.7349451 C15.9648352,15.0584615 15.6835165,15.381978 15.4443956,15.7336264 L14.7692308,14.7208791 Z M12.7296703,19.2501099 C12.8421978,18.7437363 12.9687912,18.2232967 13.1516484,17.7028571 L14.1643956,18.5046154 C14.0237363,19.0531868 13.9252747,19.6017582 13.869011,20.1503297 L12.7296703,19.2501099 Z M6.56879121,12.5687912 C6.23120879,12.9204396 5.90769231,13.3002198 5.61230769,13.68 L4.52923077,12.7516484 C4.85274725,12.4 5.2043956,12.0483516 5.57010989,11.6967033 L6.56879121,12.5687912 Z M2.32087912,18.8562637 C2.09582418,19.3767033 1.80043956,20.0659341 1.61758242,20.5441758 L0,19.9534066 C0.140659341,19.5736264 0.436043956,18.8703297 0.703296703,18.2654945 L2.32087912,18.8562637 Z M12.5186813,22.8228571 L14.0378022,23.3714286 C14.1221978,24.0325275 14.2487912,24.6514286 14.3753846,25.2 L12.6874725,24.5951648 C12.6171429,24.1731868 12.5468132,23.5683516 12.5186813,22.8228571 Z"/>
+ </g>
+</svg>
diff --git a/changelogs/unreleased/35483-improve-mobile-sidebar.yml b/changelogs/unreleased/35483-improve-mobile-sidebar.yml
new file mode 100644
index 00000000000..eb3dab1da9e
--- /dev/null
+++ b/changelogs/unreleased/35483-improve-mobile-sidebar.yml
@@ -0,0 +1,4 @@
+---
+title: Improve mobile sidebar
+merge_request:
+author:
diff --git a/changelogs/unreleased/35761-convdev-perc.yml b/changelogs/unreleased/35761-convdev-perc.yml
new file mode 100644
index 00000000000..319c4d18219
--- /dev/null
+++ b/changelogs/unreleased/35761-convdev-perc.yml
@@ -0,0 +1,4 @@
+---
+title: Store & use ConvDev percentages returned by the Version app
+merge_request:
+author:
diff --git a/changelogs/unreleased/github.yml b/changelogs/unreleased/github.yml
new file mode 100644
index 00000000000..585b9b13b65
--- /dev/null
+++ b/changelogs/unreleased/github.yml
@@ -0,0 +1,4 @@
+---
+title: Reduce memory usage of the GitHub importer
+merge_request: 12886
+author:
diff --git a/changelogs/unreleased/group-milestone-references-system-notes.yml b/changelogs/unreleased/group-milestone-references-system-notes.yml
new file mode 100644
index 00000000000..58215352305
--- /dev/null
+++ b/changelogs/unreleased/group-milestone-references-system-notes.yml
@@ -0,0 +1,4 @@
+---
+title: Support Markdown references, autocomplete, and quick actions for group milestones
+merge_request:
+author:
diff --git a/changelogs/unreleased/group-new-issue.yml b/changelogs/unreleased/group-new-issue.yml
new file mode 100644
index 00000000000..5480a44526b
--- /dev/null
+++ b/changelogs/unreleased/group-new-issue.yml
@@ -0,0 +1,4 @@
+---
+title: Cache recent projects for group-level new resource creation.
+merge_request: !13058
+author:
diff --git a/changelogs/unreleased/pawel-add-sidekiq-metrics-endpoint-32145.yml b/changelogs/unreleased/pawel-add-sidekiq-metrics-endpoint-32145.yml
new file mode 100644
index 00000000000..71eabdc16d2
--- /dev/null
+++ b/changelogs/unreleased/pawel-add-sidekiq-metrics-endpoint-32145.yml
@@ -0,0 +1,4 @@
+---
+title: Add Prometheus metrics exporter to Sidekiq
+merge_request: 13082
+author:
diff --git a/changelogs/unreleased/zj-project-templates.yml b/changelogs/unreleased/zj-project-templates.yml
new file mode 100644
index 00000000000..ab6e0f2d5f2
--- /dev/null
+++ b/changelogs/unreleased/zj-project-templates.yml
@@ -0,0 +1,4 @@
+---
+title: Projects can be created from templates
+merge_request: 13108
+author:
diff --git a/config/application.rb b/config/application.rb
index f7145566262..47887bf8596 100644
--- a/config/application.rb
+++ b/config/application.rb
@@ -181,7 +181,11 @@ module Gitlab
end
end
+ # We add the MilestonesRoutingHelper because we know that this does not
+ # conflict with the methods defined in `project_url_helpers`, and we want
+ # these methods available in the same places.
Gitlab::Routing.add_helpers(project_url_helpers)
+ Gitlab::Routing.add_helpers(MilestonesRoutingHelper)
end
end
end
diff --git a/config/dependency_decisions.yml b/config/dependency_decisions.yml
index 59c7050a14d..ca5b941aebf 100644
--- a/config/dependency_decisions.yml
+++ b/config/dependency_decisions.yml
@@ -398,3 +398,9 @@
:why: https://github.com/remy/undefsafe/blob/master/LICENSE
:versions: []
:when: 2017-04-10 06:30:00.002555000 Z
+- - :approve
+ - thunky
+ - :who: Mike Greiling
+ :why: https://github.com/mafintosh/thunky/blob/master/README.md#license
+ :versions: []
+ :when: 2017-08-07 05:56:09.907045000 Z
diff --git a/config/gitlab.yml.example b/config/gitlab.yml.example
index 45ab4e1a851..e73db08fcac 100644
--- a/config/gitlab.yml.example
+++ b/config/gitlab.yml.example
@@ -590,6 +590,12 @@ production: &base
ip_whitelist:
- 127.0.0.0/8
+ # Sidekiq exporter is webserver built in to Sidekiq to expose Prometheus metrics
+ sidekiq_exporter:
+ # enabled: true
+ # address: localhost
+ # port: 3807
+
#
# 5. Extra customization
# ==========================
diff --git a/config/initializers/1_settings.rb b/config/initializers/1_settings.rb
index 7a43bf939ea..e24cf33adb5 100644
--- a/config/initializers/1_settings.rb
+++ b/config/initializers/1_settings.rb
@@ -524,6 +524,10 @@ Settings.webpack.dev_server['port'] ||= 3808
Settings['monitoring'] ||= Settingslogic.new({})
Settings.monitoring['ip_whitelist'] ||= ['127.0.0.1/8']
Settings.monitoring['unicorn_sampler_interval'] ||= 10
+Settings.monitoring['sidekiq_exporter'] ||= Settingslogic.new({})
+Settings.monitoring.sidekiq_exporter['enabled'] ||= false
+Settings.monitoring.sidekiq_exporter['address'] ||= 'localhost'
+Settings.monitoring.sidekiq_exporter['port'] ||= 3807
#
# Testing settings
diff --git a/config/initializers/7_prometheus_metrics.rb b/config/initializers/7_prometheus_metrics.rb
index a2f8421f5d7..54c797e0714 100644
--- a/config/initializers/7_prometheus_metrics.rb
+++ b/config/initializers/7_prometheus_metrics.rb
@@ -10,3 +10,9 @@ Prometheus::Client.configure do |config|
config.multiprocess_files_dir ||= Rails.root.join('tmp/prometheus_multiproc_dir')
end
end
+
+Sidekiq.configure_server do |config|
+ config.on(:startup) do
+ Gitlab::Metrics::SidekiqMetricsExporter.instance.start
+ end
+end
diff --git a/config/webpack.config.js b/config/webpack.config.js
index 1205b90de40..d856806e5bd 100644
--- a/config/webpack.config.js
+++ b/config/webpack.config.js
@@ -3,7 +3,7 @@
var fs = require('fs');
var path = require('path');
var webpack = require('webpack');
-var StatsPlugin = require('stats-webpack-plugin');
+var StatsWriterPlugin = require('webpack-stats-plugin').StatsWriterPlugin;
var CompressionPlugin = require('compression-webpack-plugin');
var NameAllModulesPlugin = require('name-all-modules-plugin');
var BundleAnalyzerPlugin = require('webpack-bundle-analyzer').BundleAnalyzerPlugin;
@@ -60,6 +60,7 @@ var config = {
pipelines_details: './pipelines/pipeline_details_bundle.js',
pipelines_times: './pipelines/pipelines_times.js',
profile: './profile/profile_bundle.js',
+ project_import_gl: './projects/project_import_gitlab_project.js',
project_new: './projects/project_new.js',
prometheus_metrics: './prometheus_metrics',
protected_branches: './protected_branches',
@@ -127,12 +128,18 @@ var config = {
plugins: [
// manifest filename must match config.webpack.manifest_filename
// webpack-rails only needs assetsByChunkName to function properly
- new StatsPlugin('manifest.json', {
- chunkModules: false,
- source: false,
- chunks: false,
- modules: false,
- assets: true
+ new StatsWriterPlugin({
+ filename: 'manifest.json',
+ transform: function(data, opts) {
+ var stats = opts.compiler.getStats().toJson({
+ chunkModules: false,
+ source: false,
+ chunks: false,
+ modules: false,
+ assets: true
+ });
+ return JSON.stringify(stats, null, 2);
+ }
}),
// prevent pikaday from including moment.js
@@ -251,6 +258,7 @@ if (IS_DEV_SERVER) {
config.devServer = {
host: DEV_SERVER_HOST,
port: DEV_SERVER_PORT,
+ disableHostCheck: true,
headers: { 'Access-Control-Allow-Origin': '*' },
stats: 'errors-only',
hot: DEV_SERVER_LIVERELOAD,
diff --git a/db/migrate/20170731175128_add_percentages_to_conv_dev.rb b/db/migrate/20170731175128_add_percentages_to_conv_dev.rb
new file mode 100644
index 00000000000..1819bfc96bb
--- /dev/null
+++ b/db/migrate/20170731175128_add_percentages_to_conv_dev.rb
@@ -0,0 +1,32 @@
+class AddPercentagesToConvDev < ActiveRecord::Migration
+ include Gitlab::Database::MigrationHelpers
+ disable_ddl_transaction!
+
+ DOWNTIME = false
+
+ def up
+ add_column_with_default :conversational_development_index_metrics, :percentage_boards, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_ci_pipelines, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_deployments, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_environments, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_issues, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_merge_requests, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_milestones, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_notes, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_projects_prometheus_active, :float, allow_null: false, default: 0
+ add_column_with_default :conversational_development_index_metrics, :percentage_service_desk_issues, :float, allow_null: false, default: 0
+ end
+
+ def down
+ remove_column :conversational_development_index_metrics, :percentage_boards
+ remove_column :conversational_development_index_metrics, :percentage_ci_pipelines
+ remove_column :conversational_development_index_metrics, :percentage_deployments
+ remove_column :conversational_development_index_metrics, :percentage_environments
+ remove_column :conversational_development_index_metrics, :percentage_issues
+ remove_column :conversational_development_index_metrics, :percentage_merge_requests
+ remove_column :conversational_development_index_metrics, :percentage_milestones
+ remove_column :conversational_development_index_metrics, :percentage_notes
+ remove_column :conversational_development_index_metrics, :percentage_projects_prometheus_active
+ remove_column :conversational_development_index_metrics, :percentage_service_desk_issues
+ end
+end
diff --git a/db/post_migrate/20170803090603_calculate_conv_dev_index_percentages.rb b/db/post_migrate/20170803090603_calculate_conv_dev_index_percentages.rb
new file mode 100644
index 00000000000..9af76c94bf3
--- /dev/null
+++ b/db/post_migrate/20170803090603_calculate_conv_dev_index_percentages.rb
@@ -0,0 +1,30 @@
+class CalculateConvDevIndexPercentages < ActiveRecord::Migration
+ include Gitlab::Database::MigrationHelpers
+ DOWNTIME = false
+
+ class ConversationalDevelopmentIndexMetric < ActiveRecord::Base
+ self.table_name = 'conversational_development_index_metrics'
+
+ METRICS = %w[boards ci_pipelines deployments environments issues merge_requests milestones notes
+ projects_prometheus_active service_desk_issues]
+ end
+
+ def up
+ ConversationalDevelopmentIndexMetric.find_each do |conv_dev_index|
+ update = []
+
+ ConversationalDevelopmentIndexMetric::METRICS.each do |metric|
+ instance_score = conv_dev_index["instance_#{metric}"].to_f
+ leader_score = conv_dev_index["leader_#{metric}"].to_f
+
+ percentage = leader_score.zero? ? 0.0 : (instance_score / leader_score) * 100
+ update << "percentage_#{metric} = '#{percentage}'"
+ end
+
+ execute("UPDATE conversational_development_index_metrics SET #{update.join(',')} WHERE id = #{conv_dev_index.id}")
+ end
+ end
+
+ def down
+ end
+end
diff --git a/db/schema.rb b/db/schema.rb
index f2f35acef95..dc5640ad2ca 100644
--- a/db/schema.rb
+++ b/db/schema.rb
@@ -451,6 +451,16 @@ ActiveRecord::Schema.define(version: 20170803130232) do
t.float "instance_service_desk_issues", null: false
t.datetime "created_at", null: false
t.datetime "updated_at", null: false
+ t.float "percentage_boards", default: 0.0, null: false
+ t.float "percentage_ci_pipelines", default: 0.0, null: false
+ t.float "percentage_deployments", default: 0.0, null: false
+ t.float "percentage_environments", default: 0.0, null: false
+ t.float "percentage_issues", default: 0.0, null: false
+ t.float "percentage_merge_requests", default: 0.0, null: false
+ t.float "percentage_milestones", default: 0.0, null: false
+ t.float "percentage_notes", default: 0.0, null: false
+ t.float "percentage_projects_prometheus_active", default: 0.0, null: false
+ t.float "percentage_service_desk_issues", default: 0.0, null: false
end
create_table "deploy_keys_projects", force: :cascade do |t|
diff --git a/doc/development/rake_tasks.md b/doc/development/rake_tasks.md
index 42bb5e8619c..bfd80aab6a4 100644
--- a/doc/development/rake_tasks.md
+++ b/doc/development/rake_tasks.md
@@ -146,3 +146,20 @@ If new emoji are added, the spritesheet may change size. To compensate for
such changes, first generate the `emoji.png` spritesheet with the above Rake
task, then check the dimensions of the new spritesheet and update the
`SPRITESHEET_WIDTH` and `SPRITESHEET_HEIGHT` constants accordingly.
+
+## Updating project templates
+
+Starting a project from a template needs this project to be exported. On a
+up to date master branch with run:
+
+```
+gdk run db
+# In a new terminal window
+bundle exec rake gitlab:update_project_templates
+git checkout -b update-project-templates
+git add vendor/project_templates
+git commit
+git push -u origin update-project-templates
+```
+
+Now create a merge request and merge that to master.
diff --git a/doc/user/markdown.md b/doc/user/markdown.md
index 0d29b471d52..b42b8f0a525 100644
--- a/doc/user/markdown.md
+++ b/doc/user/markdown.md
@@ -248,7 +248,7 @@ GFM will recognize the following:
| `~123` | label by ID |
| `~bug` | one-word label by name |
| `~"feature request"` | multi-word label by name |
-| `%123` | milestone by ID |
+| `%123` | project milestone by ID |
| `%v1.23` | one-word milestone by name |
| `%"release candidate"` | multi-word milestone by name |
| `9ba12248` | specific commit |
@@ -262,7 +262,7 @@ GFM also recognizes certain cross-project references:
|:----------------------------------------|:------------------------|
| `namespace/project#123` | issue |
| `namespace/project!123` | merge request |
-| `namespace/project%123` | milestone |
+| `namespace/project%123` | project milestone |
| `namespace/project$123` | snippet |
| `namespace/project@9ba12248` | specific commit |
| `namespace/project@9ba12248...b19a04f5` | commit range comparison |
@@ -274,7 +274,7 @@ It also has a shorthand version to reference other projects from the same namesp
|:------------------------------|:------------------------|
| `project#123` | issue |
| `project!123` | merge request |
-| `project%123` | milestone |
+| `project%123` | project milestone |
| `project$123` | snippet |
| `project@9ba12248` | specific commit |
| `project@9ba12248...b19a04f5` | commit range comparison |
diff --git a/doc/user/project/milestones/index.md b/doc/user/project/milestones/index.md
index 23ffde4e8bd..876b98a4dc5 100644
--- a/doc/user/project/milestones/index.md
+++ b/doc/user/project/milestones/index.md
@@ -56,4 +56,5 @@ total merge requests and issues.
## Quick actions
-[Quick actions](../quick_actions.md) are available for assigning and removing project milestones only. [In the future](https://gitlab.com/gitlab-org/gitlab-ce/issues/34778), this will also apply to group milestones.
+[Quick actions](../quick_actions.md) are available for assigning and removing
+project and group milestones.
diff --git a/lib/banzai/filter/abstract_reference_filter.rb b/lib/banzai/filter/abstract_reference_filter.rb
index 685b43605ae..ef4578aabd6 100644
--- a/lib/banzai/filter/abstract_reference_filter.rb
+++ b/lib/banzai/filter/abstract_reference_filter.rb
@@ -54,42 +54,42 @@ module Banzai
self.class.references_in(*args, &block)
end
+ # Implement in child class
+ # Example: project.merge_requests.find
def find_object(project, id)
- # Implement in child class
- # Example: project.merge_requests.find
end
- def find_object_cached(project, id)
- if RequestStore.active?
- cache = find_objects_cache[object_class][project.id]
+ # Override if the link reference pattern produces a different ID (global
+ # ID vs internal ID, for instance) to the regular reference pattern.
+ def find_object_from_link(project, id)
+ find_object(project, id)
+ end
- get_or_set_cache(cache, id) { find_object(project, id) }
- else
+ # Implement in child class
+ # Example: project_merge_request_url
+ def url_for_object(object, project)
+ end
+
+ def find_object_cached(project, id)
+ cached_call(:banzai_find_object, id, path: [object_class, project.id]) do
find_object(project, id)
end
end
- def project_from_ref_cached(ref)
- if RequestStore.active?
- cache = project_refs_cache
-
- get_or_set_cache(cache, ref) { project_from_ref(ref) }
- else
- project_from_ref(ref)
+ def find_object_from_link_cached(project, id)
+ cached_call(:banzai_find_object_from_link, id, path: [object_class, project.id]) do
+ find_object_from_link(project, id)
end
end
- def url_for_object(object, project)
- # Implement in child class
- # Example: project_merge_request_url
+ def project_from_ref_cached(ref)
+ cached_call(:banzai_project_refs, ref) do
+ project_from_ref(ref)
+ end
end
def url_for_object_cached(object, project)
- if RequestStore.active?
- cache = url_for_object_cache[object_class][project.id]
-
- get_or_set_cache(cache, object) { url_for_object(object, project) }
- else
+ cached_call(:banzai_url_for_object, object, path: [object_class, project.id]) do
url_for_object(object, project)
end
end
@@ -120,7 +120,7 @@ module Banzai
if link == inner_html && inner_html =~ /\A#{link_pattern}/
replace_link_node_with_text(node, link) do
- object_link_filter(inner_html, link_pattern)
+ object_link_filter(inner_html, link_pattern, link_reference: true)
end
next
@@ -128,7 +128,7 @@ module Banzai
if link =~ /\A#{link_pattern}\z/
replace_link_node_with_href(node, link) do
- object_link_filter(link, link_pattern, link_content: inner_html)
+ object_link_filter(link, link_pattern, link_content: inner_html, link_reference: true)
end
next
@@ -146,15 +146,26 @@ module Banzai
# text - String text to replace references in.
# pattern - Reference pattern to match against.
# link_content - Original content of the link being replaced.
+ # link_reference - True if this was using the link reference pattern,
+ # false otherwise.
#
# Returns a String with references replaced with links. All links
# have `gfm` and `gfm-OBJECT_NAME` class names attached for styling.
- def object_link_filter(text, pattern, link_content: nil)
+ def object_link_filter(text, pattern, link_content: nil, link_reference: false)
references_in(text, pattern) do |match, id, project_ref, namespace_ref, matches|
project_path = full_project_path(namespace_ref, project_ref)
project = project_from_ref_cached(project_path)
- if project && object = find_object_cached(project, id)
+ if project
+ object =
+ if link_reference
+ find_object_from_link_cached(project, id)
+ else
+ find_object_cached(project, id)
+ end
+ end
+
+ if object
title = object_link_title(object)
klass = reference_class(object_sym)
@@ -297,15 +308,17 @@ module Banzai
RequestStore[:banzai_project_refs] ||= {}
end
- def find_objects_cache
- RequestStore[:banzai_find_objects_cache] ||= Hash.new do |hash, key|
- hash[key] = Hash.new { |h, k| h[k] = {} }
- end
- end
+ def cached_call(request_store_key, cache_key, path: [])
+ if RequestStore.active?
+ cache = RequestStore[request_store_key] ||= Hash.new do |hash, key|
+ hash[key] = Hash.new { |h, k| h[k] = {} }
+ end
- def url_for_object_cache
- RequestStore[:banzai_url_for_object] ||= Hash.new do |hash, key|
- hash[key] = Hash.new { |h, k| h[k] = {} }
+ cache = cache.dig(*path) if path.any?
+
+ get_or_set_cache(cache, cache_key) { yield }
+ else
+ yield
end
end
diff --git a/lib/banzai/filter/milestone_reference_filter.rb b/lib/banzai/filter/milestone_reference_filter.rb
index 45c033d32a8..4fc5f211e84 100644
--- a/lib/banzai/filter/milestone_reference_filter.rb
+++ b/lib/banzai/filter/milestone_reference_filter.rb
@@ -8,8 +8,15 @@ module Banzai
Milestone
end
+ # Links to project milestones contain the IID, but when we're handling
+ # 'regular' references, we need to use the global ID to disambiguate
+ # between group and project milestones.
def find_object(project, id)
- project.milestones.find_by(iid: id)
+ find_milestone_with_finder(project, id: id)
+ end
+
+ def find_object_from_link(project, iid)
+ find_milestone_with_finder(project, iid: iid)
end
def references_in(text, pattern = Milestone.reference_pattern)
@@ -22,7 +29,7 @@ module Banzai
milestone = find_milestone($~[:project], $~[:namespace], $~[:milestone_iid], $~[:milestone_name])
if milestone
- yield match, milestone.iid, $~[:project], $~[:namespace], $~
+ yield match, milestone.id, $~[:project], $~[:namespace], $~
else
match
end
@@ -36,7 +43,8 @@ module Banzai
return unless project
milestone_params = milestone_params(milestone_id, milestone_name)
- project.milestones.find_by(milestone_params)
+
+ find_milestone_with_finder(project, milestone_params)
end
def milestone_params(iid, name)
@@ -47,15 +55,27 @@ module Banzai
end
end
+ def find_milestone_with_finder(project, params)
+ finder_params = { project_ids: [project.id], order: nil }
+
+ # We don't support IID lookups for group milestones, because IIDs can
+ # clash between group and project milestones.
+ if project.group && !params[:iid]
+ finder_params[:group_ids] = [project.group.id]
+ end
+
+ MilestonesFinder.new(finder_params).execute.find_by(params)
+ end
+
def url_for_object(milestone, project)
- h = Gitlab::Routing.url_helpers
- h.project_milestone_url(project, milestone,
- only_path: context[:only_path])
+ Gitlab::Routing
+ .url_helpers
+ .milestone_url(milestone, only_path: context[:only_path])
end
def object_link_text(object, matches)
milestone_link = escape_once(super)
- reference = object.project.to_reference(project)
+ reference = object.project&.to_reference(project)
if reference.present?
"#{milestone_link} <i>in #{reference}</i>".html_safe
diff --git a/lib/github/client.rb b/lib/github/client.rb
index e65d908d232..9c476df7d46 100644
--- a/lib/github/client.rb
+++ b/lib/github/client.rb
@@ -1,13 +1,16 @@
module Github
class Client
+ TIMEOUT = 60
+
attr_reader :connection, :rate_limit
def initialize(options)
- @connection = Faraday.new(url: options.fetch(:url)) do |faraday|
- faraday.options.open_timeout = options.fetch(:timeout, 60)
- faraday.options.timeout = options.fetch(:timeout, 60)
+ @connection = Faraday.new(url: options.fetch(:url, root_endpoint)) do |faraday|
+ faraday.options.open_timeout = options.fetch(:timeout, TIMEOUT)
+ faraday.options.timeout = options.fetch(:timeout, TIMEOUT)
faraday.authorization 'token', options.fetch(:token)
faraday.adapter :net_http
+ faraday.ssl.verify = verify_ssl
end
@rate_limit = RateLimit.new(connection)
@@ -19,5 +22,32 @@ module Github
Github::Response.new(connection.get(url, query))
end
+
+ private
+
+ def root_endpoint
+ custom_endpoint || github_endpoint
+ end
+
+ def custom_endpoint
+ github_omniauth_provider.dig('args', 'client_options', 'site')
+ end
+
+ def verify_ssl
+ # If there is no config, we're connecting to github.com
+ # and we should verify ssl.
+ github_omniauth_provider.fetch('verify_ssl', true)
+ end
+
+ def github_endpoint
+ OmniAuth::Strategies::GitHub.default_options[:client_options][:site]
+ end
+
+ def github_omniauth_provider
+ @github_omniauth_provider ||=
+ Gitlab.config.omniauth.providers
+ .find { |provider| provider.name == 'github' }
+ .to_h
+ end
end
end
diff --git a/lib/github/import.rb b/lib/github/import.rb
index cea4be5460b..4cc01593ef4 100644
--- a/lib/github/import.rb
+++ b/lib/github/import.rb
@@ -41,13 +41,16 @@ module Github
self.reset_callbacks :validate
end
- attr_reader :project, :repository, :repo, :options, :errors, :cached, :verbose
+ attr_reader :project, :repository, :repo, :repo_url, :wiki_url,
+ :options, :errors, :cached, :verbose
- def initialize(project, options)
+ def initialize(project, options = {})
@project = project
@repository = project.repository
@repo = project.import_source
- @options = options
+ @repo_url = project.import_url
+ @wiki_url = project.import_url.sub(/\.git\z/, '.wiki.git')
+ @options = options.reverse_merge(token: project.import_data&.credentials&.fetch(:user))
@verbose = options.fetch(:verbose, false)
@cached = Hash.new { |hash, key| hash[key] = Hash.new }
@errors = []
@@ -65,6 +68,8 @@ module Github
fetch_pull_requests
puts 'Fetching issues...'.color(:aqua) if verbose
fetch_issues
+ puts 'Fetching releases...'.color(:aqua) if verbose
+ fetch_releases
puts 'Cloning wiki repository...'.color(:aqua) if verbose
fetch_wiki_repository
puts 'Expiring repository cache...'.color(:aqua) if verbose
@@ -72,6 +77,7 @@ module Github
true
rescue Github::RepositoryFetchError
+ expire_repository_cache
false
ensure
keep_track_of_errors
@@ -81,23 +87,21 @@ module Github
def fetch_repository
begin
- project.create_repository unless project.repository.exists?
- project.repository.add_remote('github', "https://#{options.fetch(:token)}@github.com/#{repo}.git")
+ project.ensure_repository
+ project.repository.add_remote('github', repo_url)
project.repository.set_remote_as_mirror('github')
project.repository.fetch_remote('github', forced: true)
- rescue Gitlab::Shell::Error => e
- error(:project, "https://github.com/#{repo}.git", e.message)
+ rescue Gitlab::Git::Repository::NoRepository, Gitlab::Shell::Error => e
+ error(:project, repo_url, e.message)
raise Github::RepositoryFetchError
end
end
def fetch_wiki_repository
- wiki_url = "https://#{options.fetch(:token)}@github.com/#{repo}.wiki.git"
- wiki_path = "#{project.full_path}.wiki"
+ return if project.wiki.repository_exists?
- unless project.wiki.repository_exists?
- gitlab_shell.import_repository(project.repository_storage_path, wiki_path, wiki_url)
- end
+ wiki_path = "#{project.disk_path}.wiki"
+ gitlab_shell.import_repository(project.repository_storage_path, wiki_path, wiki_url)
rescue Gitlab::Shell::Error => e
# GitHub error message when the wiki repo has not been created,
# this means that repo has wiki enabled, but have no pages. So,
@@ -309,7 +313,7 @@ module Github
next unless representation.valid?
release = ::Release.find_or_initialize_by(project_id: project.id, tag: representation.tag)
- next unless relese.new_record?
+ next unless release.new_record?
begin
release.description = representation.description
@@ -337,7 +341,7 @@ module Github
def user_id(user, fallback_id = nil)
return unless user.present?
- return cached[:user_ids][user.id] if cached[:user_ids].key?(user.id)
+ return cached[:user_ids][user.id] if cached[:user_ids][user.id].present?
gitlab_user_id = user_id_by_external_uid(user.id) || user_id_by_email(user.email)
@@ -367,7 +371,7 @@ module Github
end
def expire_repository_cache
- repository.expire_content_cache
+ repository.expire_content_cache if project.repository_exists?
end
def keep_track_of_errors
diff --git a/lib/gitlab/daemon.rb b/lib/gitlab/daemon.rb
new file mode 100644
index 00000000000..dfd17e35707
--- /dev/null
+++ b/lib/gitlab/daemon.rb
@@ -0,0 +1,62 @@
+module Gitlab
+ class Daemon
+ def self.initialize_instance(*args)
+ raise "#{name} singleton instance already initialized" if @instance
+ @instance = new(*args)
+ Kernel.at_exit(&@instance.method(:stop))
+ @instance
+ end
+
+ def self.instance
+ @instance ||= initialize_instance
+ end
+
+ attr_reader :thread
+
+ def thread?
+ !thread.nil?
+ end
+
+ def initialize
+ @mutex = Mutex.new
+ end
+
+ def enabled?
+ true
+ end
+
+ def start
+ return unless enabled?
+
+ @mutex.synchronize do
+ return thread if thread?
+
+ @thread = Thread.new { start_working }
+ end
+ end
+
+ def stop
+ @mutex.synchronize do
+ return unless thread?
+
+ stop_working
+
+ if thread
+ thread.wakeup if thread.alive?
+ thread.join
+ @thread = nil
+ end
+ end
+ end
+
+ private
+
+ def start_working
+ raise NotImplementedError
+ end
+
+ def stop_working
+ # no-ops
+ end
+ end
+end
diff --git a/lib/gitlab/git/blob.rb b/lib/gitlab/git/blob.rb
index db6cfc9671f..77b81d2d437 100644
--- a/lib/gitlab/git/blob.rb
+++ b/lib/gitlab/git/blob.rb
@@ -20,66 +20,7 @@ module Gitlab
if is_enabled
find_by_gitaly(repository, sha, path)
else
- find_by_rugged(repository, sha, path)
- end
- end
- end
-
- def find_by_gitaly(repository, sha, path)
- path = path.sub(/\A\/*/, '')
- path = '/' if path.empty?
- name = File.basename(path)
- entry = Gitlab::GitalyClient::CommitService.new(repository).tree_entry(sha, path, MAX_DATA_DISPLAY_SIZE)
- return unless entry
-
- case entry.type
- when :COMMIT
- new(
- id: entry.oid,
- name: name,
- size: 0,
- data: '',
- path: path,
- commit_id: sha
- )
- when :BLOB
- new(
- id: entry.oid,
- name: name,
- size: entry.size,
- data: entry.data.dup,
- mode: entry.mode.to_s(8),
- path: path,
- commit_id: sha,
- binary: binary?(entry.data)
- )
- end
- end
-
- def find_by_rugged(repository, sha, path)
- commit = repository.lookup(sha)
- root_tree = commit.tree
-
- blob_entry = find_entry_by_path(repository, root_tree.oid, path)
-
- return nil unless blob_entry
-
- if blob_entry[:type] == :commit
- submodule_blob(blob_entry, path, sha)
- else
- blob = repository.lookup(blob_entry[:oid])
-
- if blob
- new(
- id: blob.oid,
- name: blob_entry[:name],
- size: blob.size,
- data: blob.content(MAX_DATA_DISPLAY_SIZE),
- mode: blob_entry[:filemode].to_s(8),
- path: path,
- commit_id: sha,
- binary: blob.binary?
- )
+ find_by_rugged(repository, sha, path, limit: MAX_DATA_DISPLAY_SIZE)
end
end
end
@@ -109,6 +50,21 @@ module Gitlab
detect && detect[:type] == :binary
end
+ # Returns an array of Blob instances, specified in blob_references as
+ # [[commit_sha, path], [commit_sha, path], ...]. If blob_size_limit < 0 then the
+ # full blob contents are returned. If blob_size_limit >= 0 then each blob will
+ # contain no more than limit bytes in its data attribute.
+ #
+ # Keep in mind that this method may allocate a lot of memory. It is up
+ # to the caller to limit the number of blobs and blob_size_limit.
+ #
+ def batch(repository, blob_references, blob_size_limit: nil)
+ blob_size_limit ||= MAX_DATA_DISPLAY_SIZE
+ blob_references.map do |sha, path|
+ find_by_rugged(repository, sha, path, limit: blob_size_limit)
+ end
+ end
+
private
# Recursive search of blob id by path
@@ -153,6 +109,66 @@ module Gitlab
commit_id: sha
)
end
+
+ def find_by_gitaly(repository, sha, path)
+ path = path.sub(/\A\/*/, '')
+ path = '/' if path.empty?
+ name = File.basename(path)
+ entry = Gitlab::GitalyClient::CommitService.new(repository).tree_entry(sha, path, MAX_DATA_DISPLAY_SIZE)
+ return unless entry
+
+ case entry.type
+ when :COMMIT
+ new(
+ id: entry.oid,
+ name: name,
+ size: 0,
+ data: '',
+ path: path,
+ commit_id: sha
+ )
+ when :BLOB
+ new(
+ id: entry.oid,
+ name: name,
+ size: entry.size,
+ data: entry.data.dup,
+ mode: entry.mode.to_s(8),
+ path: path,
+ commit_id: sha,
+ binary: binary?(entry.data)
+ )
+ end
+ end
+
+ def find_by_rugged(repository, sha, path, limit:)
+ commit = repository.lookup(sha)
+ root_tree = commit.tree
+
+ blob_entry = find_entry_by_path(repository, root_tree.oid, path)
+
+ return nil unless blob_entry
+
+ if blob_entry[:type] == :commit
+ submodule_blob(blob_entry, path, sha)
+ else
+ blob = repository.lookup(blob_entry[:oid])
+
+ if blob
+ new(
+ id: blob.oid,
+ name: blob_entry[:name],
+ size: blob.size,
+ # Rugged::Blob#content is expensive; don't call it if we don't have to.
+ data: limit.zero? ? '' : blob.content(limit),
+ mode: blob_entry[:filemode].to_s(8),
+ path: path,
+ commit_id: sha,
+ binary: blob.binary?
+ )
+ end
+ end
+ end
end
def initialize(options)
diff --git a/lib/gitlab/git/repository.rb b/lib/gitlab/git/repository.rb
index 1005a819f95..f6f9d49bf37 100644
--- a/lib/gitlab/git/repository.rb
+++ b/lib/gitlab/git/repository.rb
@@ -299,6 +299,21 @@ module Gitlab
#
# Gitaly migration: https://gitlab.com/gitlab-org/gitaly/issues/446
def log(options)
+ default_options = {
+ limit: 10,
+ offset: 0,
+ path: nil,
+ follow: false,
+ skip_merges: false,
+ disable_walk: false,
+ after: nil,
+ before: nil
+ }
+
+ options = default_options.merge(options)
+ options[:limit] ||= 0
+ options[:offset] ||= 0
+
raw_log(options).map { |c| Commit.decorate(c) }
end
@@ -712,20 +727,6 @@ module Gitlab
end
def raw_log(options)
- default_options = {
- limit: 10,
- offset: 0,
- path: nil,
- follow: false,
- skip_merges: false,
- disable_walk: false,
- after: nil,
- before: nil
- }
-
- options = default_options.merge(options)
- options[:limit] ||= 0
- options[:offset] ||= 0
actual_ref = options[:ref] || root_ref
begin
sha = sha_from_ref(actual_ref)
diff --git a/lib/gitlab/import_sources.rb b/lib/gitlab/import_sources.rb
index 52276cbcd9a..5404dc11a87 100644
--- a/lib/gitlab/import_sources.rb
+++ b/lib/gitlab/import_sources.rb
@@ -8,7 +8,7 @@ module Gitlab
ImportSource = Struct.new(:name, :title, :importer)
ImportTable = [
- ImportSource.new('github', 'GitHub', Gitlab::GithubImport::Importer),
+ ImportSource.new('github', 'GitHub', Github::Import),
ImportSource.new('bitbucket', 'Bitbucket', Gitlab::BitbucketImport::Importer),
ImportSource.new('gitlab', 'GitLab.com', Gitlab::GitlabImport::Importer),
ImportSource.new('google_code', 'Google Code', Gitlab::GoogleCodeImport::Importer),
diff --git a/lib/gitlab/key_fingerprint.rb b/lib/gitlab/key_fingerprint.rb
index b75ae512d92..d9a79f7c291 100644
--- a/lib/gitlab/key_fingerprint.rb
+++ b/lib/gitlab/key_fingerprint.rb
@@ -1,55 +1,48 @@
module Gitlab
class KeyFingerprint
- include Gitlab::Popen
+ attr_reader :key, :ssh_key
- attr_accessor :key
+ # Unqualified MD5 fingerprint for compatibility
+ delegate :fingerprint, to: :ssh_key, allow_nil: true
def initialize(key)
@key = key
- end
-
- def fingerprint
- cmd_status = 0
- cmd_output = ''
-
- Tempfile.open('gitlab_key_file') do |file|
- file.puts key
- file.rewind
-
- cmd = []
- cmd.push('ssh-keygen')
- cmd.push('-E', 'md5') if explicit_fingerprint_algorithm?
- cmd.push('-lf', file.path)
-
- cmd_output, cmd_status = popen(cmd, '/tmp')
- end
-
- return nil unless cmd_status.zero?
- # 16 hex bytes separated by ':', optionally starting with "MD5:"
- fingerprint_matches = cmd_output.match(/(MD5:)?(?<fingerprint>(\h{2}:){15}\h{2})/)
- return nil unless fingerprint_matches
-
- fingerprint_matches[:fingerprint]
+ @ssh_key =
+ begin
+ Net::SSH::KeyFactory.load_data_public_key(key)
+ rescue Net::SSH::Exception, NotImplementedError
+ end
end
- private
-
- def explicit_fingerprint_algorithm?
- # OpenSSH 6.8 introduces a new default output format for fingerprints.
- # Check the version and decide which command to use.
-
- version_output, version_status = popen(%w(ssh -V))
- return false unless version_status.zero?
+ def valid?
+ ssh_key.present?
+ end
- version_matches = version_output.match(/OpenSSH_(?<major>\d+)\.(?<minor>\d+)/)
- return false unless version_matches
+ def type
+ return unless valid?
- version_info = Gitlab::VersionInfo.new(version_matches[:major].to_i, version_matches[:minor].to_i)
+ parts = ssh_key.ssh_type.split('-')
+ parts.shift if parts[0] == 'ssh'
- required_version_info = Gitlab::VersionInfo.new(6, 8)
+ parts[0].upcase
+ end
- version_info >= required_version_info
+ def bits
+ return unless valid?
+
+ case type
+ when 'RSA'
+ ssh_key.n.num_bits
+ when 'DSS', 'DSA'
+ ssh_key.p.num_bits
+ when 'ECDSA'
+ ssh_key.group.order.num_bits
+ when 'ED25519'
+ 256
+ else
+ raise "Unsupported key type: #{type}"
+ end
end
end
end
diff --git a/lib/gitlab/metrics/base_sampler.rb b/lib/gitlab/metrics/base_sampler.rb
index 219accfc029..716d20bb91a 100644
--- a/lib/gitlab/metrics/base_sampler.rb
+++ b/lib/gitlab/metrics/base_sampler.rb
@@ -1,20 +1,7 @@
require 'logger'
module Gitlab
module Metrics
- class BaseSampler
- def self.initialize_instance(*args)
- raise "#{name} singleton instance already initialized" if @instance
- @instance = new(*args)
- at_exit(&@instance.method(:stop))
- @instance
- end
-
- def self.instance
- @instance
- end
-
- attr_reader :running
-
+ class BaseSampler < Daemon
# interval - The sampling interval in seconds.
def initialize(interval)
interval_half = interval.to_f / 2
@@ -22,44 +9,7 @@ module Gitlab
@interval = interval
@interval_steps = (-interval_half..interval_half).step(0.1).to_a
- @mutex = Mutex.new
- end
-
- def enabled?
- true
- end
-
- def start
- return unless enabled?
-
- @mutex.synchronize do
- return if running
- @running = true
-
- @thread = Thread.new do
- sleep(sleep_interval)
-
- while running
- safe_sample
-
- sleep(sleep_interval)
- end
- end
- end
- end
-
- def stop
- @mutex.synchronize do
- return unless running
-
- @running = false
-
- if @thread
- @thread.wakeup if @thread.alive?
- @thread.join
- @thread = nil
- end
- end
+ super()
end
def safe_sample
@@ -81,7 +31,7 @@ module Gitlab
# potentially missing anything that happens in between samples).
# 2. Don't sample data at the same interval two times in a row.
def sleep_interval
- while step = @interval_steps.sample
+ while (step = @interval_steps.sample)
if step != @last_step
@last_step = step
@@ -89,6 +39,25 @@ module Gitlab
end
end
end
+
+ private
+
+ attr_reader :running
+
+ def start_working
+ @running = true
+ sleep(sleep_interval)
+
+ while running
+ safe_sample
+
+ sleep(sleep_interval)
+ end
+ end
+
+ def stop_working
+ @running = false
+ end
end
end
end
diff --git a/lib/gitlab/metrics/sidekiq_metrics_exporter.rb b/lib/gitlab/metrics/sidekiq_metrics_exporter.rb
new file mode 100644
index 00000000000..5980a4ded2b
--- /dev/null
+++ b/lib/gitlab/metrics/sidekiq_metrics_exporter.rb
@@ -0,0 +1,39 @@
+require 'webrick'
+require 'prometheus/client/rack/exporter'
+
+module Gitlab
+ module Metrics
+ class SidekiqMetricsExporter < Daemon
+ def enabled?
+ Gitlab::Metrics.metrics_folder_present? && settings.enabled
+ end
+
+ def settings
+ Settings.monitoring.sidekiq_exporter
+ end
+
+ private
+
+ attr_reader :server
+
+ def start_working
+ @server = ::WEBrick::HTTPServer.new(Port: settings.port, BindAddress: settings.address)
+ server.mount "/", Rack::Handler::WEBrick, rack_app
+ server.start
+ end
+
+ def stop_working
+ server.shutdown
+ @server = nil
+ end
+
+ def rack_app
+ Rack::Builder.app do
+ use Rack::Deflater
+ use ::Prometheus::Client::Rack::Exporter
+ run -> (env) { [404, {}, ['']] }
+ end
+ end
+ end
+ end
+end
diff --git a/lib/gitlab/project_template.rb b/lib/gitlab/project_template.rb
new file mode 100644
index 00000000000..cf461adf697
--- /dev/null
+++ b/lib/gitlab/project_template.rb
@@ -0,0 +1,45 @@
+module Gitlab
+ class ProjectTemplate
+ attr_reader :title, :name
+
+ def initialize(name, title)
+ @name, @title = name, title
+ end
+
+ alias_method :logo, :name
+
+ def file
+ archive_path.open
+ end
+
+ def archive_path
+ Rails.root.join("vendor/project_templates/#{name}.tar.gz")
+ end
+
+ def clone_url
+ "https://gitlab.com/gitlab-org/project-templates/#{name}.git"
+ end
+
+ def ==(other)
+ name == other.name && title == other.title
+ end
+
+ TEMPLATES_TABLE = [
+ ProjectTemplate.new('rails', 'Ruby on Rails')
+ ].freeze
+
+ class << self
+ def all
+ TEMPLATES_TABLE
+ end
+
+ def find(name)
+ all.find { |template| template.name == name.to_s }
+ end
+
+ def archive_directory
+ Rails.root.join("vendor_directory/project_templates")
+ end
+ end
+ end
+end
diff --git a/lib/gitlab/shell.rb b/lib/gitlab/shell.rb
index 4366ff336ef..0cb28732402 100644
--- a/lib/gitlab/shell.rb
+++ b/lib/gitlab/shell.rb
@@ -105,12 +105,24 @@ module Gitlab
# fetch_remote("gitlab/gitlab-ci", "upstream")
#
# Gitaly migration: https://gitlab.com/gitlab-org/gitaly/issues/387
- def fetch_remote(storage, name, remote, forced: false, no_tags: false)
+ def fetch_remote(storage, name, remote, ssh_auth: nil, forced: false, no_tags: false)
args = [gitlab_shell_projects_path, 'fetch-remote', storage, "#{name}.git", remote, "#{Gitlab.config.gitlab_shell.git_timeout}"]
args << '--force' if forced
args << '--no-tags' if no_tags
- gitlab_shell_fast_execute_raise_error(args)
+ vars = {}
+
+ if ssh_auth&.ssh_import?
+ if ssh_auth.ssh_key_auth? && ssh_auth.ssh_private_key.present?
+ vars['GITLAB_SHELL_SSH_KEY'] = ssh_auth.ssh_private_key
+ end
+
+ if ssh_auth.ssh_known_hosts.present?
+ vars['GITLAB_SHELL_KNOWN_HOSTS'] = ssh_auth.ssh_known_hosts
+ end
+ end
+
+ gitlab_shell_fast_execute_raise_error(args, vars)
end
# Move repository
@@ -293,15 +305,15 @@ module Gitlab
false
end
- def gitlab_shell_fast_execute_raise_error(cmd)
- output, status = gitlab_shell_fast_execute_helper(cmd)
+ def gitlab_shell_fast_execute_raise_error(cmd, vars = {})
+ output, status = gitlab_shell_fast_execute_helper(cmd, vars)
raise Error, output unless status.zero?
true
end
- def gitlab_shell_fast_execute_helper(cmd)
- vars = ENV.to_h.slice(*GITLAB_SHELL_ENV_VARS)
+ def gitlab_shell_fast_execute_helper(cmd, vars = {})
+ vars.merge!(ENV.to_h.slice(*GITLAB_SHELL_ENV_VARS))
# Don't pass along the entire parent environment to prevent gitlab-shell
# from wasting I/O by searching through GEM_PATH
diff --git a/lib/tasks/gitlab/update_templates.rake b/lib/tasks/gitlab/update_templates.rake
index 59c32bbe7a4..a7e30423c7a 100644
--- a/lib/tasks/gitlab/update_templates.rake
+++ b/lib/tasks/gitlab/update_templates.rake
@@ -4,6 +4,55 @@ namespace :gitlab do
TEMPLATE_DATA.each { |template| update(template) }
end
+ desc "GitLab | Update project templates"
+ task :update_project_templates do
+ if Rails.env.production?
+ puts "This rake task is not meant fo production instances".red
+ exit(1)
+ end
+ admin = User.find_by(admin: true)
+
+ unless admin
+ puts "No admin user could be found".red
+ exit(1)
+ end
+
+ Gitlab::ProjectTemplate.all.each do |template|
+ params = {
+ import_url: template.clone_url,
+ namespace_id: admin.namespace.id,
+ path: template.title,
+ skip_wiki: true
+ }
+
+ puts "Creating project for #{template.name}"
+ project = Projects::CreateService.new(admin, params).execute
+
+ loop do
+ if project.finished?
+ puts "Import finished for #{template.name}"
+ break
+ end
+
+ if project.failed?
+ puts "Failed to import from #{project_params[:import_url]}".red
+ exit(1)
+ end
+
+ puts "Waiting for the import to finish"
+
+ sleep(5)
+ project.reload
+ end
+
+ Projects::ImportExport::ExportService.new(project, admin).execute
+ FileUtils.cp(project.export_project_path, template.archive_path)
+ Projects::DestroyService.new(admin, project).execute
+ puts "Exported #{template.name}".green
+ end
+ puts "Done".green
+ end
+
def update(template)
sub_dir = template.repo_url.match(/([A-Za-z-]+)\.git\z/)[1]
dir = File.join(vendor_directory, sub_dir)
diff --git a/lib/tasks/import.rake b/lib/tasks/import.rake
index 50b8e331469..96b8f59242c 100644
--- a/lib/tasks/import.rake
+++ b/lib/tasks/import.rake
@@ -7,7 +7,7 @@ class GithubImport
end
def initialize(token, gitlab_username, project_path, extras)
- @options = { url: 'https://api.github.com', token: token, verbose: true }
+ @options = { token: token, verbose: true }
@project_path = project_path
@current_user = User.find_by_username(gitlab_username)
@github_repo = extras.empty? ? nil : extras.first
@@ -62,6 +62,7 @@ class GithubImport
visibility_level: visibility_level,
import_type: 'github',
import_source: @repo['full_name'],
+ import_url: @repo['clone_url'].sub('://', "://#{@options[:token]}@"),
skip_wiki: @repo['has_wiki']
).execute
end
diff --git a/package.json b/package.json
index eb3084f30bc..b50efee72ff 100644
--- a/package.json
+++ b/package.json
@@ -14,7 +14,7 @@
"dependencies": {
"babel-core": "^6.22.1",
"babel-eslint": "^7.2.1",
- "babel-loader": "^6.2.10",
+ "babel-loader": "^7.1.1",
"babel-plugin-transform-define": "^1.2.0",
"babel-preset-latest": "^6.24.0",
"babel-preset-stage-2": "^6.22.0",
@@ -48,7 +48,6 @@
"react-dev-utils": "^0.5.2",
"select2": "3.5.2-browserify",
"sql.js": "^0.4.0",
- "stats-webpack-plugin": "^0.4.3",
"three": "^0.84.0",
"three-orbit-controls": "^82.1.0",
"three-stl-loader": "^1.0.4",
@@ -60,14 +59,15 @@
"vue-loader": "^11.3.4",
"vue-resource": "^1.3.4",
"vue-template-compiler": "^2.2.6",
- "webpack": "^2.6.1",
- "webpack-bundle-analyzer": "^2.8.2"
+ "webpack": "^3.4.0",
+ "webpack-bundle-analyzer": "^2.8.2",
+ "webpack-stats-plugin": "^0.1.5"
},
"devDependencies": {
"babel-plugin-istanbul": "^4.0.0",
"eslint": "^3.10.1",
"eslint-config-airbnb-base": "^10.0.1",
- "eslint-import-resolver-webpack": "^0.8.1",
+ "eslint-import-resolver-webpack": "^0.8.3",
"eslint-plugin-filenames": "^1.1.0",
"eslint-plugin-import": "^2.2.0",
"eslint-plugin-jasmine": "^2.1.0",
@@ -81,8 +81,8 @@
"karma-jasmine": "^1.1.0",
"karma-mocha-reporter": "^2.2.2",
"karma-sourcemap-loader": "^0.3.7",
- "karma-webpack": "^2.0.2",
+ "karma-webpack": "^2.0.4",
"nodemon": "^1.11.0",
- "webpack-dev-server": "^2.4.2"
+ "webpack-dev-server": "^2.6.1"
}
}
diff --git a/spec/factories/conversational_development_index_metrics.rb b/spec/factories/conversational_development_index_metrics.rb
index a5412629195..3806c43ba15 100644
--- a/spec/factories/conversational_development_index_metrics.rb
+++ b/spec/factories/conversational_development_index_metrics.rb
@@ -2,32 +2,42 @@ FactoryGirl.define do
factory :conversational_development_index_metric, class: ConversationalDevelopmentIndex::Metric do
leader_issues 9.256
instance_issues 1.234
+ percentage_issues 13.331
leader_notes 30.33333
instance_notes 28.123
+ percentage_notes 92.713
leader_milestones 16.2456
instance_milestones 1.234
+ percentage_milestones 7.595
leader_boards 5.2123
instance_boards 3.254
+ percentage_boards 62.429
leader_merge_requests 1.2
instance_merge_requests 0.6
+ percentage_merge_requests 50.0
leader_ci_pipelines 12.1234
instance_ci_pipelines 2.344
+ percentage_ci_pipelines 19.334
leader_environments 3.3333
instance_environments 2.2222
+ percentage_environments 66.672
leader_deployments 1.200
instance_deployments 0.771
+ percentage_deployments 64.25
leader_projects_prometheus_active 0.111
instance_projects_prometheus_active 0.109
+ percentage_projects_prometheus_active 98.198
leader_service_desk_issues 15.891
instance_service_desk_issues 13.345
+ percentage_service_desk_issues 83.978
end
end
diff --git a/spec/features/dashboard/issues_spec.rb b/spec/features/dashboard/issues_spec.rb
index be6f78ee607..795335aa106 100644
--- a/spec/features/dashboard/issues_spec.rb
+++ b/spec/features/dashboard/issues_spec.rb
@@ -79,12 +79,21 @@ RSpec.describe 'Dashboard Issues' do
end
end
- it 'shows the new issue page', :js do
+ it 'shows the new issue page', js: true do
find('.new-project-item-select-button').trigger('click')
+
wait_for_requests
- find('.select2-results li').click
- expect(page).to have_current_path("/#{project.path_with_namespace}/issues/new")
+ project_path = "/#{project.path_with_namespace}"
+ project_json = { name: project.name_with_namespace, url: project_path }.to_json
+
+ # similate selection, and prevent overlap by dropdown menu
+ execute_script("$('.project-item-select').val('#{project_json}').trigger('change');")
+ execute_script("$('#select2-drop-mask').remove();")
+
+ find('.new-project-item-link').trigger('click')
+
+ expect(page).to have_current_path("#{project_path}/issues/new")
page.within('#content-body') do
expect(page).to have_selector('.issue-form')
diff --git a/spec/features/groups/empty_states_spec.rb b/spec/features/groups/empty_states_spec.rb
index 7f28553c44e..243e8536168 100644
--- a/spec/features/groups/empty_states_spec.rb
+++ b/spec/features/groups/empty_states_spec.rb
@@ -38,7 +38,7 @@ feature 'Groups Merge Requests Empty States' do
it 'should show a new merge request button' do
within '.empty-state' do
- expect(page).to have_content('New merge request')
+ expect(page).to have_content('create merge request')
end
end
@@ -63,7 +63,7 @@ feature 'Groups Merge Requests Empty States' do
it 'should not show a new merge request button' do
within '.empty-state' do
- expect(page).not_to have_link('New merge request')
+ expect(page).not_to have_link('create merge request')
end
end
end
diff --git a/spec/features/issues/issue_sidebar_spec.rb b/spec/features/issues/issue_sidebar_spec.rb
index 8e22441e0e8..af11b474842 100644
--- a/spec/features/issues/issue_sidebar_spec.rb
+++ b/spec/features/issues/issue_sidebar_spec.rb
@@ -130,8 +130,8 @@ feature 'Issue Sidebar' do
it 'adds new label' do
page.within('.block.labels') do
fill_in 'new_label_name', with: 'wontfix'
- page.find(".suggest-colors a", match: :first).click
- click_button 'Create'
+ page.find('.suggest-colors a', match: :first).trigger('click')
+ page.find('button', text: 'Create').trigger('click')
page.within('.dropdown-page-one') do
expect(page).to have_content 'wontfix'
@@ -142,8 +142,8 @@ feature 'Issue Sidebar' do
it 'shows error message if label title is taken' do
page.within('.block.labels') do
fill_in 'new_label_name', with: label.title
- page.find('.suggest-colors a', match: :first).click
- click_button 'Create'
+ page.find('.suggest-colors a', match: :first).trigger('click')
+ page.find('button', text: 'Create').trigger('click')
page.within('.dropdown-page-two') do
expect(page).to have_content 'Title has already been taken'
diff --git a/spec/features/projects/import_export/import_file_spec.rb b/spec/features/projects/import_export/import_file_spec.rb
index c0cfb9eafe2..24e7843db63 100644
--- a/spec/features/projects/import_export/import_file_spec.rb
+++ b/spec/features/projects/import_export/import_file_spec.rb
@@ -29,8 +29,9 @@ feature 'Import/Export - project import integration test', js: true do
fill_in :project_path, with: 'test-project-path', visible: true
click_link 'GitLab export'
- expect(page).to have_content('GitLab project export')
+ expect(page).to have_content('Import an exported GitLab project')
expect(URI.parse(current_url).query).to eq("namespace_id=#{namespace.id}&path=test-project-path")
+ expect(Gitlab::ImportExport).to receive(:import_upload_path).with(filename: /\A\h{32}_test-project-path\z/).and_call_original
attach_file('file', file)
@@ -60,17 +61,6 @@ feature 'Import/Export - project import integration test', js: true do
expect(page).to have_content('Project could not be imported')
end
end
-
- scenario 'project with no name' do
- create(:project, namespace: namespace)
-
- visit new_project_path
-
- select2(namespace.id, from: '#project_namespace_id')
-
- # Check for tooltip disabled import button
- expect(find('.import_gitlab_project')['title']).to eq('Please enter a valid project name.')
- end
end
context 'when limited to the default user namespace' do
diff --git a/spec/features/projects_spec.rb b/spec/features/projects_spec.rb
index dbcdac902d5..7e4d53332e5 100644
--- a/spec/features/projects_spec.rb
+++ b/spec/features/projects_spec.rb
@@ -1,6 +1,27 @@
require 'spec_helper'
feature 'Project' do
+ describe 'creating from template' do
+ let(:user) { create(:user) }
+ let(:template) { Gitlab::ProjectTemplate.find(:rails) }
+
+ before do
+ sign_in user
+ visit new_project_path
+ end
+
+ it "allows creation from templates" do
+ page.choose(template.name)
+ fill_in("project_path", with: template.name)
+
+ page.within '#content-body' do
+ click_button "Create project"
+ end
+
+ expect(page).to have_content 'This project Loading..'
+ end
+ end
+
describe 'description' do
let(:project) { create(:project, :repository) }
let(:path) { project_path(project) }
diff --git a/spec/fixtures/markdown.md.erb b/spec/fixtures/markdown.md.erb
index 58b43805705..4f46e40ce7a 100644
--- a/spec/fixtures/markdown.md.erb
+++ b/spec/fixtures/markdown.md.erb
@@ -227,8 +227,11 @@ References should be parseable even inside _<%= merge_request.to_reference %>_ e
- Milestone in another project: <%= xmilestone.to_reference(project) %>
- Ignored in code: `<%= simple_milestone.to_reference %>`
- Ignored in links: [Link to <%= simple_milestone.to_reference %>](#milestone-link)
-- Milestone by URL: <%= urls.project_milestone_url(milestone.project, milestone) %>
+- Milestone by URL: <%= urls.milestone_url(milestone) %>
- Link to milestone by URL: [Milestone](<%= milestone.to_reference %>)
+- Group milestone by name: <%= Milestone.reference_prefix %><%= group_milestone.name %>
+- Group milestone by name in quotes: <%= group_milestone.to_reference(format: :name) %>
+- Group milestone by URL is ignore: <%= urls.milestone_url(group_milestone) %>
### Task Lists
diff --git a/spec/helpers/gitlab_routing_helper_spec.rb b/spec/helpers/gitlab_routing_helper_spec.rb
index 537e457513f..a44b200c5da 100644
--- a/spec/helpers/gitlab_routing_helper_spec.rb
+++ b/spec/helpers/gitlab_routing_helper_spec.rb
@@ -63,44 +63,4 @@ describe GitlabRoutingHelper do
it { expect(resend_invite_group_member_path(group_member)).to eq resend_invite_group_group_member_path(group_member.source, group_member) }
end
end
-
- describe '#milestone_path' do
- context 'for a group milestone' do
- let(:milestone) { build_stubbed(:milestone, group: group, iid: 1) }
-
- it 'links to the group milestone page' do
- expect(milestone_path(milestone))
- .to eq(group_milestone_path(group, milestone))
- end
- end
-
- context 'for a project milestone' do
- let(:milestone) { build_stubbed(:milestone, project: project, iid: 1) }
-
- it 'links to the project milestone page' do
- expect(milestone_path(milestone))
- .to eq(project_milestone_path(project, milestone))
- end
- end
- end
-
- describe '#milestone_url' do
- context 'for a group milestone' do
- let(:milestone) { build_stubbed(:milestone, group: group, iid: 1) }
-
- it 'links to the group milestone page' do
- expect(milestone_url(milestone))
- .to eq(group_milestone_url(group, milestone))
- end
- end
-
- context 'for a project milestone' do
- let(:milestone) { build_stubbed(:milestone, project: project, iid: 1) }
-
- it 'links to the project milestone page' do
- expect(milestone_url(milestone))
- .to eq(project_milestone_url(project, milestone))
- end
- end
- end
end
diff --git a/spec/helpers/milestones_routing_helper_spec.rb b/spec/helpers/milestones_routing_helper_spec.rb
new file mode 100644
index 00000000000..dc13a43c2ab
--- /dev/null
+++ b/spec/helpers/milestones_routing_helper_spec.rb
@@ -0,0 +1,46 @@
+require 'spec_helper'
+
+describe MilestonesRoutingHelper do
+ let(:project) { build_stubbed(:project) }
+ let(:group) { build_stubbed(:group) }
+
+ describe '#milestone_path' do
+ context 'for a group milestone' do
+ let(:milestone) { build_stubbed(:milestone, group: group, iid: 1) }
+
+ it 'links to the group milestone page' do
+ expect(milestone_path(milestone))
+ .to eq(group_milestone_path(group, milestone))
+ end
+ end
+
+ context 'for a project milestone' do
+ let(:milestone) { build_stubbed(:milestone, project: project, iid: 1) }
+
+ it 'links to the project milestone page' do
+ expect(milestone_path(milestone))
+ .to eq(project_milestone_path(project, milestone))
+ end
+ end
+ end
+
+ describe '#milestone_url' do
+ context 'for a group milestone' do
+ let(:milestone) { build_stubbed(:milestone, group: group, iid: 1) }
+
+ it 'links to the group milestone page' do
+ expect(milestone_url(milestone))
+ .to eq(group_milestone_url(group, milestone))
+ end
+ end
+
+ context 'for a project milestone' do
+ let(:milestone) { build_stubbed(:milestone, project: project, iid: 1) }
+
+ it 'links to the project milestone page' do
+ expect(milestone_url(milestone))
+ .to eq(project_milestone_url(project, milestone))
+ end
+ end
+ end
+end
diff --git a/spec/javascripts/build_spec.js b/spec/javascripts/build_spec.js
index be90dbdd88a..35149611095 100644
--- a/spec/javascripts/build_spec.js
+++ b/spec/javascripts/build_spec.js
@@ -5,7 +5,6 @@ import '~/lib/utils/datetime_utility';
import '~/lib/utils/url_utility';
import '~/build';
import '~/breakpoints';
-import 'vendor/jquery.nicescroll';
describe('Build', () => {
const BUILD_URL = `${gl.TEST_HOST}/frontend-fixtures/builds-project/-/jobs/1`;
diff --git a/spec/javascripts/fixtures/project_select_combo_button.html.haml b/spec/javascripts/fixtures/project_select_combo_button.html.haml
new file mode 100644
index 00000000000..54bc1a59279
--- /dev/null
+++ b/spec/javascripts/fixtures/project_select_combo_button.html.haml
@@ -0,0 +1,6 @@
+.project-item-select-holder
+ %input.project-item-select{ data: { group_id: '12345' , relative_path: 'issues/new' } }
+ %a.new-project-item-link{ data: { label: 'New issue' }, href: ''}
+ %i.fa.fa-spinner.spin
+ %a.new-project-item-select-button
+ %i.fa.fa-caret-down
diff --git a/spec/javascripts/labels_issue_sidebar_spec.js b/spec/javascripts/labels_issue_sidebar_spec.js
index c99f379b871..e47adc49224 100644
--- a/spec/javascripts/labels_issue_sidebar_spec.js
+++ b/spec/javascripts/labels_issue_sidebar_spec.js
@@ -4,7 +4,6 @@
import '~/gl_dropdown';
import 'select2';
-import 'vendor/jquery.nicescroll';
import '~/api';
import '~/create_label';
import '~/issuable_context';
diff --git a/spec/javascripts/project_select_combo_button_spec.js b/spec/javascripts/project_select_combo_button_spec.js
new file mode 100644
index 00000000000..e10a5a3bef6
--- /dev/null
+++ b/spec/javascripts/project_select_combo_button_spec.js
@@ -0,0 +1,105 @@
+import ProjectSelectComboButton from '~/project_select_combo_button';
+
+const fixturePath = 'static/project_select_combo_button.html.raw';
+
+describe('Project Select Combo Button', function () {
+ preloadFixtures(fixturePath);
+
+ beforeEach(function () {
+ this.defaults = {
+ label: 'Select project to create issue',
+ groupId: 12345,
+ projectMeta: {
+ name: 'My Cool Project',
+ url: 'http://mycoolproject.com',
+ },
+ newProjectMeta: {
+ name: 'My Other Cool Project',
+ url: 'http://myothercoolproject.com',
+ },
+ localStorageKey: 'group-12345-new-issue-recent-project',
+ relativePath: 'issues/new',
+ };
+
+ loadFixtures(fixturePath);
+
+ this.newItemBtn = document.querySelector('.new-project-item-link');
+ this.projectSelectInput = document.querySelector('.project-item-select');
+ });
+
+ describe('on page load when localStorage is empty', function () {
+ beforeEach(function () {
+ this.comboButton = new ProjectSelectComboButton(this.projectSelectInput);
+ });
+
+ it('newItemBtn is disabled', function () {
+ expect(this.newItemBtn.hasAttribute('disabled')).toBe(true);
+ expect(this.newItemBtn.classList.contains('disabled')).toBe(true);
+ });
+
+ it('newItemBtn href is null', function () {
+ expect(this.newItemBtn.getAttribute('href')).toBe('');
+ });
+
+ it('newItemBtn text is the plain default label', function () {
+ expect(this.newItemBtn.textContent).toBe(this.defaults.label);
+ });
+ });
+
+ describe('on page load when localStorage is filled', function () {
+ beforeEach(function () {
+ window.localStorage
+ .setItem(this.defaults.localStorageKey, JSON.stringify(this.defaults.projectMeta));
+ this.comboButton = new ProjectSelectComboButton(this.projectSelectInput);
+ });
+
+ it('newItemBtn is not disabled', function () {
+ expect(this.newItemBtn.hasAttribute('disabled')).toBe(false);
+ expect(this.newItemBtn.classList.contains('disabled')).toBe(false);
+ });
+
+ it('newItemBtn href is correctly set', function () {
+ expect(this.newItemBtn.getAttribute('href')).toBe(this.defaults.projectMeta.url);
+ });
+
+ it('newItemBtn text is the cached label', function () {
+ expect(this.newItemBtn.textContent)
+ .toBe(`New issue in ${this.defaults.projectMeta.name}`);
+ });
+
+ afterEach(function () {
+ window.localStorage.clear();
+ });
+ });
+
+ describe('after selecting a new project', function () {
+ beforeEach(function () {
+ this.comboButton = new ProjectSelectComboButton(this.projectSelectInput);
+
+ // mock the effect of selecting an item from the projects dropdown (select2)
+ $('.project-item-select')
+ .val(JSON.stringify(this.defaults.newProjectMeta))
+ .trigger('change');
+ });
+
+ it('newItemBtn is not disabled', function () {
+ expect(this.newItemBtn.hasAttribute('disabled')).toBe(false);
+ expect(this.newItemBtn.classList.contains('disabled')).toBe(false);
+ });
+
+ it('newItemBtn href is correctly set', function () {
+ expect(this.newItemBtn.getAttribute('href'))
+ .toBe('http://myothercoolproject.com/issues/new');
+ });
+
+ it('newItemBtn text is the selected project label', function () {
+ expect(this.newItemBtn.textContent)
+ .toBe(`New issue in ${this.defaults.newProjectMeta.name}`);
+ });
+
+ afterEach(function () {
+ window.localStorage.clear();
+ });
+ });
+});
+
diff --git a/spec/javascripts/projects/project_import_gitlab_project_spec.js b/spec/javascripts/projects/project_import_gitlab_project_spec.js
new file mode 100644
index 00000000000..2f1aae109e3
--- /dev/null
+++ b/spec/javascripts/projects/project_import_gitlab_project_spec.js
@@ -0,0 +1,25 @@
+import projectImportGitlab from '~/projects/project_import_gitlab_project';
+
+describe('Import Gitlab project', () => {
+ let projectName;
+ beforeEach(() => {
+ projectName = 'project';
+ window.history.pushState({}, null, `?path=${projectName}`);
+
+ setFixtures(`
+ <input class="js-path-name" />
+ `);
+
+ projectImportGitlab.bindEvents();
+ });
+
+ afterEach(() => {
+ window.history.pushState({}, null, '');
+ });
+
+ describe('path name', () => {
+ it('should fill in the project name derived from the previously filled project name', () => {
+ expect(document.querySelector('.js-path-name').value).toEqual(projectName);
+ });
+ });
+});
diff --git a/spec/lib/banzai/filter/milestone_reference_filter_spec.rb b/spec/lib/banzai/filter/milestone_reference_filter_spec.rb
index 5db77566513..ebd6c79077e 100644
--- a/spec/lib/banzai/filter/milestone_reference_filter_spec.rb
+++ b/spec/lib/banzai/filter/milestone_reference_filter_spec.rb
@@ -3,57 +3,57 @@ require 'spec_helper'
describe Banzai::Filter::MilestoneReferenceFilter do
include FilterSpecHelper
- let(:project) { create(:project, :public) }
- let(:milestone) { create(:milestone, project: project) }
- let(:reference) { milestone.to_reference }
+ let(:group) { create(:group, :public) }
+ let(:project) { create(:project, :public, group: group) }
it 'requires project context' do
expect { described_class.call('') }.to raise_error(ArgumentError, /:project/)
end
- %w(pre code a style).each do |elem|
- it "ignores valid references contained inside '#{elem}' element" do
- exp = act = "<#{elem}>milestone #{milestone.to_reference}</#{elem}>"
- expect(reference_filter(act).to_html).to eq exp
+ shared_examples 'reference parsing' do
+ %w(pre code a style).each do |elem|
+ it "ignores valid references contained inside '#{elem}' element" do
+ exp = act = "<#{elem}>milestone #{reference}</#{elem}>"
+ expect(reference_filter(act).to_html).to eq exp
+ end
end
- end
- it 'includes default classes' do
- doc = reference_filter("Milestone #{reference}")
- expect(doc.css('a').first.attr('class')).to eq 'gfm gfm-milestone has-tooltip'
- end
+ it 'includes default classes' do
+ doc = reference_filter("Milestone #{reference}")
- it 'includes a data-project attribute' do
- doc = reference_filter("Milestone #{reference}")
- link = doc.css('a').first
+ expect(doc.css('a').first.attr('class')).to eq 'gfm gfm-milestone has-tooltip'
+ end
- expect(link).to have_attribute('data-project')
- expect(link.attr('data-project')).to eq project.id.to_s
- end
+ it 'includes a data-project attribute' do
+ doc = reference_filter("Milestone #{reference}")
+ link = doc.css('a').first
- it 'includes a data-milestone attribute' do
- doc = reference_filter("See #{reference}")
- link = doc.css('a').first
+ expect(link).to have_attribute('data-project')
+ expect(link.attr('data-project')).to eq project.id.to_s
+ end
- expect(link).to have_attribute('data-milestone')
- expect(link.attr('data-milestone')).to eq milestone.id.to_s
- end
+ it 'includes a data-milestone attribute' do
+ doc = reference_filter("See #{reference}")
+ link = doc.css('a').first
+
+ expect(link).to have_attribute('data-milestone')
+ expect(link.attr('data-milestone')).to eq milestone.id.to_s
+ end
- it 'supports an :only_path context' do
- doc = reference_filter("Milestone #{reference}", only_path: true)
- link = doc.css('a').first.attr('href')
+ it 'supports an :only_path context' do
+ doc = reference_filter("Milestone #{reference}", only_path: true)
+ link = doc.css('a').first.attr('href')
- expect(link).not_to match %r(https?://)
- expect(link).to eq urls
- .project_milestone_path(project, milestone)
+ expect(link).not_to match %r(https?://)
+ expect(link).to eq urls.milestone_path(milestone)
+ end
end
- context 'Integer-based references' do
+ shared_examples 'Integer-based references' do
it 'links to a valid reference' do
doc = reference_filter("See #{reference}")
- expect(doc.css('a').first.attr('href')).to eq urls
- .project_milestone_url(project, milestone)
+ expect(doc.css('a').first.attr('href')).to eq urls.milestone_url(milestone)
end
it 'links with adjacent text' do
@@ -68,15 +68,17 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- context 'String-based single-word references' do
- let(:milestone) { create(:milestone, name: 'gfm', project: project) }
+ shared_examples 'String-based single-word references' do
let(:reference) { "#{Milestone.reference_prefix}#{milestone.name}" }
+ before do
+ milestone.update!(name: 'gfm')
+ end
+
it 'links to a valid reference' do
doc = reference_filter("See #{reference}")
- expect(doc.css('a').first.attr('href')).to eq urls
- .project_milestone_url(project, milestone)
+ expect(doc.css('a').first.attr('href')).to eq urls.milestone_url(milestone)
expect(doc.text).to eq 'See gfm'
end
@@ -92,15 +94,17 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- context 'String-based multi-word references in quotes' do
- let(:milestone) { create(:milestone, name: 'gfm references', project: project) }
+ shared_examples 'String-based multi-word references in quotes' do
let(:reference) { milestone.to_reference(format: :name) }
+ before do
+ milestone.update!(name: 'gfm references')
+ end
+
it 'links to a valid reference' do
doc = reference_filter("See #{reference}")
- expect(doc.css('a').first.attr('href')).to eq urls
- .project_milestone_url(project, milestone)
+ expect(doc.css('a').first.attr('href')).to eq urls.milestone_url(milestone)
expect(doc.text).to eq 'See gfm references'
end
@@ -116,23 +120,27 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- describe 'referencing a milestone in a link href' do
- let(:reference) { %Q{<a href="#{milestone.to_reference}">Milestone</a>} }
+ shared_examples 'referencing a milestone in a link href' do
+ let(:unquoted_reference) { "#{Milestone.reference_prefix}#{milestone.name}" }
+ let(:link_reference) { %Q{<a href="#{unquoted_reference}">Milestone</a>} }
+
+ before do
+ milestone.update!(name: 'gfm')
+ end
it 'links to a valid reference' do
- doc = reference_filter("See #{reference}")
+ doc = reference_filter("See #{link_reference}")
- expect(doc.css('a').first.attr('href')).to eq urls
- .project_milestone_url(project, milestone)
+ expect(doc.css('a').first.attr('href')).to eq urls.milestone_url(milestone)
end
it 'links with adjacent text' do
- doc = reference_filter("Milestone (#{reference}.)")
+ doc = reference_filter("Milestone (#{link_reference}.)")
expect(doc.to_html).to match(%r(\(<a.+>Milestone</a>\.\)))
end
it 'includes a data-project attribute' do
- doc = reference_filter("Milestone #{reference}")
+ doc = reference_filter("Milestone #{link_reference}")
link = doc.css('a').first
expect(link).to have_attribute('data-project')
@@ -140,7 +148,7 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
it 'includes a data-milestone attribute' do
- doc = reference_filter("See #{reference}")
+ doc = reference_filter("See #{link_reference}")
link = doc.css('a').first
expect(link).to have_attribute('data-milestone')
@@ -148,7 +156,35 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- describe 'cross-project / cross-namespace complete reference' do
+ shared_examples 'linking to a milestone as the entire link' do
+ let(:unquoted_reference) { "#{Milestone.reference_prefix}#{milestone.name}" }
+ let(:link) { urls.milestone_url(milestone) }
+ let(:link_reference) { %Q{<a href="#{link}">#{link}</a>} }
+
+ it 'replaces the link text with the milestone reference' do
+ doc = reference_filter("See #{link}")
+
+ expect(doc.css('a').first.text).to eq(unquoted_reference)
+ end
+
+ it 'includes a data-project attribute' do
+ doc = reference_filter("Milestone #{link_reference}")
+ link = doc.css('a').first
+
+ expect(link).to have_attribute('data-project')
+ expect(link.attr('data-project')).to eq project.id.to_s
+ end
+
+ it 'includes a data-milestone attribute' do
+ doc = reference_filter("See #{link_reference}")
+ link = doc.css('a').first
+
+ expect(link).to have_attribute('data-milestone')
+ expect(link.attr('data-milestone')).to eq milestone.id.to_s
+ end
+ end
+
+ shared_examples 'cross-project / cross-namespace complete reference' do
let(:namespace) { create(:namespace) }
let(:another_project) { create(:project, :public, namespace: namespace) }
let(:milestone) { create(:milestone, project: another_project) }
@@ -184,7 +220,7 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- describe 'cross-project / same-namespace complete reference' do
+ shared_examples 'cross-project / same-namespace complete reference' do
let(:namespace) { create(:namespace) }
let(:project) { create(:project, :public, namespace: namespace) }
let(:another_project) { create(:project, :public, namespace: namespace) }
@@ -221,7 +257,7 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- describe 'cross project shorthand reference' do
+ shared_examples 'cross project shorthand reference' do
let(:namespace) { create(:namespace) }
let(:project) { create(:project, :public, namespace: namespace) }
let(:another_project) { create(:project, :public, namespace: namespace) }
@@ -258,27 +294,53 @@ describe Banzai::Filter::MilestoneReferenceFilter do
end
end
- describe 'cross project milestone references' do
- let(:another_project) { create(:project, :public) }
- let(:project_path) { another_project.full_path }
- let(:milestone) { create(:milestone, project: another_project) }
- let(:reference) { milestone.to_reference(project) }
+ context 'project milestones' do
+ let(:milestone) { create(:milestone, project: project) }
+ let(:reference) { milestone.to_reference }
- let!(:result) { reference_filter("See #{reference}") }
+ include_examples 'reference parsing'
- it 'points to referenced project milestone page' do
- expect(result.css('a').first.attr('href')).to eq urls
- .project_milestone_url(another_project, milestone)
+ it_behaves_like 'Integer-based references'
+ it_behaves_like 'String-based single-word references'
+ it_behaves_like 'String-based multi-word references in quotes'
+ it_behaves_like 'referencing a milestone in a link href'
+ it_behaves_like 'cross-project / cross-namespace complete reference'
+ it_behaves_like 'cross-project / same-namespace complete reference'
+ it_behaves_like 'cross project shorthand reference'
+ end
+
+ context 'group milestones' do
+ let(:milestone) { create(:milestone, group: group) }
+ let(:reference) { milestone.to_reference(format: :name) }
+
+ include_examples 'reference parsing'
+
+ it_behaves_like 'String-based single-word references'
+ it_behaves_like 'String-based multi-word references in quotes'
+ it_behaves_like 'referencing a milestone in a link href'
+
+ it 'does not support references by IID' do
+ doc = reference_filter("See #{Milestone.reference_prefix}#{milestone.iid}")
+
+ expect(doc.css('a')).to be_empty
end
- it 'contains cross project content' do
- expect(result.css('a').first.text).to eq "#{milestone.name} in #{project_path}"
+ it 'does not support references by link' do
+ doc = reference_filter("See #{urls.milestone_url(milestone)}")
+
+ expect(doc.css('a').first.text).to eq(urls.milestone_url(milestone))
end
- it 'escapes the name attribute' do
- allow_any_instance_of(Milestone).to receive(:title).and_return(%{"></a>whatever<a title="})
- doc = reference_filter("See #{reference}")
- expect(doc.css('a').first.text).to eq "#{milestone.name} in #{project_path}"
+ it 'does not support cross-project references' do
+ another_group = create(:group)
+ another_project = create(:project, :public, group: group)
+ project_reference = another_project.to_reference(project)
+
+ milestone.update!(group: another_group)
+
+ doc = reference_filter("See #{project_reference}#{reference}")
+
+ expect(doc.css('a')).to be_empty
end
end
end
diff --git a/spec/lib/gitlab/bitbucket_import/importer_spec.rb b/spec/lib/gitlab/bitbucket_import/importer_spec.rb
index d7d6a37f7cf..a66347ead76 100644
--- a/spec/lib/gitlab/bitbucket_import/importer_spec.rb
+++ b/spec/lib/gitlab/bitbucket_import/importer_spec.rb
@@ -54,7 +54,7 @@ describe Gitlab::BitbucketImport::Importer do
create(
:project,
import_source: project_identifier,
- import_data: ProjectImportData.new(credentials: data)
+ import_data_attributes: { credentials: data }
)
end
diff --git a/spec/lib/gitlab/daemon_spec.rb b/spec/lib/gitlab/daemon_spec.rb
new file mode 100644
index 00000000000..c519984a267
--- /dev/null
+++ b/spec/lib/gitlab/daemon_spec.rb
@@ -0,0 +1,103 @@
+require 'spec_helper'
+
+describe Gitlab::Daemon do
+ subject { described_class.new }
+
+ before do
+ allow(subject).to receive(:start_working)
+ allow(subject).to receive(:stop_working)
+ end
+
+ describe '.instance' do
+ before do
+ allow(Kernel).to receive(:at_exit)
+ end
+
+ after(:each) do
+ described_class.instance_variable_set(:@instance, nil)
+ end
+
+ it 'provides instance of Daemon' do
+ expect(described_class.instance).to be_instance_of(described_class)
+ end
+
+ it 'subsequent invocations provide the same instance' do
+ expect(described_class.instance).to eq(described_class.instance)
+ end
+
+ it 'creates at_exit hook when instance is created' do
+ expect(described_class.instance).not_to be_nil
+
+ expect(Kernel).to have_received(:at_exit)
+ end
+ end
+
+ describe 'when Daemon is enabled' do
+ before do
+ allow(subject).to receive(:enabled?).and_return(true)
+ end
+
+ describe 'when Daemon is stopped' do
+ describe '#start' do
+ it 'starts the Daemon' do
+ expect { subject.start.join }.to change { subject.thread? }.from(false).to(true)
+
+ expect(subject).to have_received(:start_working)
+ end
+ end
+
+ describe '#stop' do
+ it "doesn't shutdown stopped Daemon" do
+ expect { subject.stop }.not_to change { subject.thread? }
+
+ expect(subject).not_to have_received(:start_working)
+ end
+ end
+ end
+
+ describe 'when Daemon is running' do
+ before do
+ subject.start.join
+ end
+
+ describe '#start' do
+ it "doesn't start running Daemon" do
+ expect { subject.start.join }.not_to change { subject.thread? }
+
+ expect(subject).to have_received(:start_working).once
+ end
+ end
+
+ describe '#stop' do
+ it 'shutdowns Daemon' do
+ expect { subject.stop }.to change { subject.thread? }.from(true).to(false)
+
+ expect(subject).to have_received(:stop_working)
+ end
+ end
+ end
+ end
+
+ describe 'when Daemon is disabled' do
+ before do
+ allow(subject).to receive(:enabled?).and_return(false)
+ end
+
+ describe '#start' do
+ it "doesn't start working" do
+ expect(subject.start).to be_nil
+ expect { subject.start }.not_to change { subject.thread? }
+
+ expect(subject).not_to have_received(:start_working)
+ end
+ end
+
+ describe '#stop' do
+ it "doesn't stop working" do
+ expect { subject.stop }.not_to change { subject.thread? }
+
+ expect(subject).not_to have_received(:stop_working)
+ end
+ end
+ end
+end
diff --git a/spec/lib/gitlab/git/blob_spec.rb b/spec/lib/gitlab/git/blob_spec.rb
index 18320bb23b9..dfab0c2fe85 100644
--- a/spec/lib/gitlab/git/blob_spec.rb
+++ b/spec/lib/gitlab/git/blob_spec.rb
@@ -152,6 +152,77 @@ describe Gitlab::Git::Blob, seed_helper: true do
end
end
+ describe '.batch' do
+ let(:blob_references) do
+ [
+ [SeedRepo::Commit::ID, "files/ruby/popen.rb"],
+ [SeedRepo::Commit::ID, 'six']
+ ]
+ end
+
+ subject { described_class.batch(repository, blob_references) }
+
+ it { expect(subject.size).to eq(blob_references.size) }
+
+ context 'first blob' do
+ let(:blob) { subject[0] }
+
+ it { expect(blob.id).to eq(SeedRepo::RubyBlob::ID) }
+ it { expect(blob.name).to eq(SeedRepo::RubyBlob::NAME) }
+ it { expect(blob.path).to eq("files/ruby/popen.rb") }
+ it { expect(blob.commit_id).to eq(SeedRepo::Commit::ID) }
+ it { expect(blob.data[0..10]).to eq(SeedRepo::RubyBlob::CONTENT[0..10]) }
+ it { expect(blob.size).to eq(669) }
+ it { expect(blob.mode).to eq("100644") }
+ end
+
+ context 'second blob' do
+ let(:blob) { subject[1] }
+
+ it { expect(blob.id).to eq('409f37c4f05865e4fb208c771485f211a22c4c2d') }
+ it { expect(blob.data).to eq('') }
+ it 'does not mark the blob as binary' do
+ expect(blob).not_to be_binary
+ end
+ end
+
+ context 'limiting' do
+ subject { described_class.batch(repository, blob_references, blob_size_limit: blob_size_limit) }
+
+ context 'default' do
+ let(:blob_size_limit) { nil }
+
+ it 'limits to MAX_DATA_DISPLAY_SIZE' do
+ stub_const('Gitlab::Git::Blob::MAX_DATA_DISPLAY_SIZE', 100)
+
+ expect(subject.first.data.size).to eq(100)
+ end
+ end
+
+ context 'positive' do
+ let(:blob_size_limit) { 10 }
+
+ it { expect(subject.first.data.size).to eq(10) }
+ end
+
+ context 'zero' do
+ let(:blob_size_limit) { 0 }
+
+ it { expect(subject.first.data).to eq('') }
+ end
+
+ context 'negative' do
+ let(:blob_size_limit) { -1 }
+
+ it 'ignores MAX_DATA_DISPLAY_SIZE' do
+ stub_const('Gitlab::Git::Blob::MAX_DATA_DISPLAY_SIZE', 100)
+
+ expect(subject.first.data.size).to eq(669)
+ end
+ end
+ end
+ end
+
describe 'encoding' do
context 'file with russian text' do
let(:blob) { Gitlab::Git::Blob.find(repository, SeedRepo::Commit::ID, "encoding/russian.rb") }
diff --git a/spec/lib/gitlab/import_sources_spec.rb b/spec/lib/gitlab/import_sources_spec.rb
index b3b5e5e7e33..c5725f47453 100644
--- a/spec/lib/gitlab/import_sources_spec.rb
+++ b/spec/lib/gitlab/import_sources_spec.rb
@@ -56,7 +56,7 @@ describe Gitlab::ImportSources do
describe '.importer' do
import_sources = {
- 'github' => Gitlab::GithubImport::Importer,
+ 'github' => Github::Import,
'bitbucket' => Gitlab::BitbucketImport::Importer,
'gitlab' => Gitlab::GitlabImport::Importer,
'google_code' => Gitlab::GoogleCodeImport::Importer,
diff --git a/spec/lib/gitlab/key_fingerprint_spec.rb b/spec/lib/gitlab/key_fingerprint_spec.rb
index d7bebaca675..f5fd5a96bc9 100644
--- a/spec/lib/gitlab/key_fingerprint_spec.rb
+++ b/spec/lib/gitlab/key_fingerprint_spec.rb
@@ -1,12 +1,82 @@
-require "spec_helper"
+require 'spec_helper'
-describe Gitlab::KeyFingerprint do
- let(:key) { "ssh-rsa AAAAB3NzaC1yc2EAAAABJQAAAIEAiPWx6WM4lhHNedGfBpPJNPpZ7yKu+dnn1SJejgt4596k6YjzGGphH2TUxwKzxcKDKKezwkpfnxPkSMkuEspGRt/aZZ9wa++Oi7Qkr8prgHc4soW6NUlfDzpvZK2H5E7eQaSeP3SAwGmQKUFHCddNaP0L+hM7zhFNzjFvpaMgJw0=" }
- let(:fingerprint) { "3f:a2:ee:de:b5:de:53:c3:aa:2f:9c:45:24:4c:47:7b" }
+describe Gitlab::KeyFingerprint, lib: true do
+ KEYS = {
+ rsa:
+ 'example.com ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQC5z65PwQ1GE6foJgwk' \
+ '9rmQi/glaXbUeVa5uvQpnZ3Z5+forcI7aTngh3aZ/H2UDP2L70TGy7kKNyp0J3a8/OdG' \
+ 'Z08y5yi3JlbjFARO1NyoFEjw2H1SJxeJ43L6zmvTlu+hlK1jSAlidl7enS0ufTlzEEj4' \
+ 'iJcuTPKdVzKRgZuTRVm9woWNVKqIrdRC0rJiTinERnfSAp/vNYERMuaoN4oJt8p/NEek' \
+ 'rmFoDsQOsyDW5RAnCnjWUU+jFBKDpfkJQ1U2n6BjJewC9dl6ODK639l3yN4WOLZEk4tN' \
+ 'UysfbGeF3rmMeflaD6O1Jplpv3YhwVGFNKa7fMq6k3Z0tszTJPYh',
+ ecdsa:
+ 'example.com ecdsa-sha2-nistp256 AAAAE2VjZHNhLXNoYTItbmlzdHAyNTYAAAAI' \
+ 'bmlzdHAyNTYAAABBBKTJy43NZzJSfNxpv/e2E6Zy3qoHoTQbmOsU5FEfpWfWa1MdTeXQ' \
+ 'YvKOi+qz/1AaNx6BK421jGu74JCDJtiZWT8=',
+ ed25519:
+ '@revoked example.com ssh-ed25519 AAAAC3NzaC1lZDI1NTE5AAAAIAfuCHKVTjq' \
+ 'uxvt6CM6tdG4SLp1Btn/nOeHHE5UOzRdf',
+ dss:
+ 'example.com ssh-dss AAAAB3NzaC1kc3MAAACBAP1/U4EddRIpUt9KnC7s5Of2EbdS' \
+ 'PO9EAMMeP4C2USZpRV1AIlH7WT2NWPq/xfW6MPbLm1Vs14E7gB00b/JmYLdrmVClpJ+f' \
+ '6AR7ECLCT7up1/63xhv4O1fnxqimFQ8E+4P208UewwI1VBNaFpEy9nXzrith1yrv8iID' \
+ 'GZ3RSAHHAAAAFQCXYFCPFSMLzLKSuYKi64QL8Fgc9QAAAIEA9+GghdabPd7LvKtcNrhX' \
+ 'uXmUr7v6OuqC+VdMCz0HgmdRWVeOutRZT+ZxBxCBgLRJFnEj6EwoFhO3zwkyjMim4TwW' \
+ 'eotUfI0o4KOuHiuzpnWRbqN/C/ohNWLx+2J6ASQ7zKTxvqhRkImog9/hWuWfBpKLZl6A' \
+ 'e1UlZAFMO/7PSSoAAACBAJcQ4JODqhuGbXIEpqxetm7PWbdbCcr3y/GzIZ066pRovpL6' \
+ 'qm3qCVIym4cyChxWwb8qlyCIi+YRUUWm1z/wiBYT2Vf3S4FXBnyymCkKEaV/EY7+jd4X' \
+ '1bXI58OD2u+bLCB/sInM4fGB8CZUIWT9nJH0Ve9jJUge2ms348/QOJ1+'
+ }.freeze
- describe "#fingerprint" do
- it "generates the key's fingerprint" do
- expect(described_class.new(key).fingerprint).to eq(fingerprint)
+ MD5_FINGERPRINTS = {
+ rsa: '06:b2:8a:92:df:0e:11:2c:ca:7b:8f:a4:ba:6e:4b:fd',
+ ecdsa: '45:ff:5b:98:9a:b6:8a:41:13:c1:30:8b:09:5e:7b:4e',
+ ed25519: '2e:65:6a:c8:cf:bf:b2:8b:9a:bd:6d:9f:11:5c:12:16',
+ dss: '57:98:86:02:5f:9c:f4:9b:ad:5a:1e:51:92:0e:fd:2b'
+ }.freeze
+
+ BIT_COUNTS = {
+ rsa: 2048,
+ ecdsa: 256,
+ ed25519: 256,
+ dss: 1024
+ }.freeze
+
+ describe '#type' do
+ KEYS.each do |type, key|
+ it "calculates the type of #{type} keys" do
+ calculated_type = described_class.new(key).type
+
+ expect(calculated_type).to eq(type.to_s.upcase)
+ end
+ end
+ end
+
+ describe '#fingerprint' do
+ KEYS.each do |type, key|
+ it "calculates the MD5 fingerprint for #{type} keys" do
+ fp = described_class.new(key).fingerprint
+
+ expect(fp).to eq(MD5_FINGERPRINTS[type])
+ end
+ end
+ end
+
+ describe '#bits' do
+ KEYS.each do |type, key|
+ it "calculates the number of bits in #{type} keys" do
+ bits = described_class.new(key).bits
+
+ expect(bits).to eq(BIT_COUNTS[type])
+ end
+ end
+ end
+
+ describe '#key' do
+ it 'carries the unmodified key data' do
+ key = described_class.new(KEYS[:rsa]).key
+
+ expect(key).to eq(KEYS[:rsa])
end
end
end
diff --git a/spec/lib/gitlab/metrics/influx_sampler_spec.rb b/spec/lib/gitlab/metrics/influx_sampler_spec.rb
index 0bc68d64276..999a9536d82 100644
--- a/spec/lib/gitlab/metrics/influx_sampler_spec.rb
+++ b/spec/lib/gitlab/metrics/influx_sampler_spec.rb
@@ -11,7 +11,7 @@ describe Gitlab::Metrics::InfluxSampler do
it 'runs once and gathers a sample at a given interval' do
expect(sampler).to receive(:sleep).with(a_kind_of(Numeric)).twice
expect(sampler).to receive(:sample).once
- expect(sampler).to receive(:running).and_return(false, true, false)
+ expect(sampler).to receive(:running).and_return(true, false)
sampler.start.join
end
diff --git a/spec/lib/gitlab/metrics/sidekiq_metrics_exporter_spec.rb b/spec/lib/gitlab/metrics/sidekiq_metrics_exporter_spec.rb
new file mode 100644
index 00000000000..6721e02fb85
--- /dev/null
+++ b/spec/lib/gitlab/metrics/sidekiq_metrics_exporter_spec.rb
@@ -0,0 +1,101 @@
+require 'spec_helper'
+
+describe Gitlab::Metrics::SidekiqMetricsExporter do
+ let(:exporter) { described_class.new }
+ let(:server) { double('server') }
+
+ before do
+ allow(::WEBrick::HTTPServer).to receive(:new).and_return(server)
+ allow(server).to receive(:mount)
+ allow(server).to receive(:start)
+ allow(server).to receive(:shutdown)
+ end
+
+ describe 'when exporter is enabled' do
+ before do
+ allow(Settings.monitoring.sidekiq_exporter).to receive(:enabled).and_return(true)
+ end
+
+ describe 'when exporter is stopped' do
+ describe '#start' do
+ it 'starts the exporter' do
+ expect { exporter.start.join }.to change { exporter.thread? }.from(false).to(true)
+
+ expect(server).to have_received(:start)
+ end
+
+ describe 'with custom settings' do
+ let(:port) { 99999 }
+ let(:address) { 'sidekiq_exporter_address' }
+
+ before do
+ allow(Settings.monitoring.sidekiq_exporter).to receive(:port).and_return(port)
+ allow(Settings.monitoring.sidekiq_exporter).to receive(:address).and_return(address)
+ end
+
+ it 'starts server with port and address from settings' do
+ exporter.start.join
+
+ expect(::WEBrick::HTTPServer).to have_received(:new).with(
+ Port: port,
+ BindAddress: address
+ )
+ end
+ end
+ end
+
+ describe '#stop' do
+ it "doesn't shutdown stopped server" do
+ expect { exporter.stop }.not_to change { exporter.thread? }
+
+ expect(server).not_to have_received(:shutdown)
+ end
+ end
+ end
+
+ describe 'when exporter is running' do
+ before do
+ exporter.start.join
+ end
+
+ describe '#start' do
+ it "doesn't start running server" do
+ expect { exporter.start.join }.not_to change { exporter.thread? }
+
+ expect(server).to have_received(:start).once
+ end
+ end
+
+ describe '#stop' do
+ it 'shutdowns server' do
+ expect { exporter.stop }.to change { exporter.thread? }.from(true).to(false)
+
+ expect(server).to have_received(:shutdown)
+ end
+ end
+ end
+ end
+
+ describe 'when exporter is disabled' do
+ before do
+ allow(Settings.monitoring.sidekiq_exporter).to receive(:enabled).and_return(false)
+ end
+
+ describe '#start' do
+ it "doesn't start" do
+ expect(exporter.start).to be_nil
+ expect { exporter.start }.not_to change { exporter.thread? }
+
+ expect(server).not_to have_received(:start)
+ end
+ end
+
+ describe '#stop' do
+ it "doesn't shutdown" do
+ expect { exporter.stop }.not_to change { exporter.thread? }
+
+ expect(server).not_to have_received(:shutdown)
+ end
+ end
+ end
+end
diff --git a/spec/lib/gitlab/project_template_spec.rb b/spec/lib/gitlab/project_template_spec.rb
new file mode 100644
index 00000000000..12e75cdd5d0
--- /dev/null
+++ b/spec/lib/gitlab/project_template_spec.rb
@@ -0,0 +1,63 @@
+require 'spec_helper'
+
+describe Gitlab::ProjectTemplate do
+ describe '.all' do
+ it 'returns a all templates' do
+ expected = [
+ described_class.new('rails', 'Ruby on Rails')
+ ]
+
+ expect(described_class.all).to be_an(Array)
+ expect(described_class.all).to eq(expected)
+ end
+ end
+
+ describe '.find' do
+ subject { described_class.find(query) }
+
+ context 'when there is a match' do
+ let(:query) { :rails }
+
+ it { is_expected.to be_a(described_class) }
+ end
+
+ context 'when there is no match' do
+ let(:query) { 'no-match' }
+
+ it { is_expected.to be(nil) }
+ end
+ end
+
+ describe 'instance methods' do
+ subject { described_class.new('phoenix', 'Phoenix Framework') }
+
+ it { is_expected.to respond_to(:logo, :file, :archive_path) }
+ end
+
+ describe 'validate all templates' do
+ set(:admin) { create(:admin) }
+
+ described_class.all.each do |template|
+ it "#{template.name} has a valid archive" do
+ archive = template.archive_path
+
+ expect(File.exist?(archive)).to be(true)
+ end
+
+ context 'with valid parameters' do
+ it 'can be imported' do
+ params = {
+ template_name: template.name,
+ namespace_id: admin.namespace.id,
+ path: template.name
+ }
+
+ project = Projects::CreateFromTemplateService.new(admin, params).execute
+
+ expect(project).to be_valid
+ expect(project).to be_persisted
+ end
+ end
+ end
+ end
+end
diff --git a/spec/lib/gitlab/shell_spec.rb b/spec/lib/gitlab/shell_spec.rb
index b90d8dede0f..2345874cf10 100644
--- a/spec/lib/gitlab/shell_spec.rb
+++ b/spec/lib/gitlab/shell_spec.rb
@@ -174,20 +174,94 @@ describe Gitlab::Shell do
end
describe '#fetch_remote' do
+ def fetch_remote(ssh_auth = nil)
+ gitlab_shell.fetch_remote('current/storage', 'project/path', 'new/storage', ssh_auth: ssh_auth)
+ end
+
+ def expect_popen(vars = {})
+ popen_args = [
+ projects_path,
+ 'fetch-remote',
+ 'current/storage',
+ 'project/path.git',
+ 'new/storage',
+ Gitlab.config.gitlab_shell.git_timeout.to_s
+ ]
+
+ expect(Gitlab::Popen).to receive(:popen).with(popen_args, nil, popen_vars.merge(vars))
+ end
+
+ def build_ssh_auth(opts = {})
+ defaults = {
+ ssh_import?: true,
+ ssh_key_auth?: false,
+ ssh_known_hosts: nil,
+ ssh_private_key: nil
+ }
+
+ double(:ssh_auth, defaults.merge(opts))
+ end
+
it 'returns true when the command succeeds' do
- expect(Gitlab::Popen).to receive(:popen)
- .with([projects_path, 'fetch-remote', 'current/storage', 'project/path.git', 'new/storage', '800'],
- nil, popen_vars).and_return([nil, 0])
+ expect_popen.and_return([nil, 0])
- expect(gitlab_shell.fetch_remote('current/storage', 'project/path', 'new/storage')).to be true
+ expect(fetch_remote).to be_truthy
end
it 'raises an exception when the command fails' do
- expect(Gitlab::Popen).to receive(:popen)
- .with([projects_path, 'fetch-remote', 'current/storage', 'project/path.git', 'new/storage', '800'],
- nil, popen_vars).and_return(["error", 1])
+ expect_popen.and_return(["error", 1])
+
+ expect { fetch_remote }.to raise_error(Gitlab::Shell::Error, "error")
+ end
+
+ context 'SSH auth' do
+ it 'passes the SSH key if specified' do
+ expect_popen('GITLAB_SHELL_SSH_KEY' => 'foo').and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_key_auth?: true, ssh_private_key: 'foo')
+
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
+
+ it 'does not pass an empty SSH key' do
+ expect_popen.and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_key_auth: true, ssh_private_key: '')
+
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
+
+ it 'does not pass the key unless SSH key auth is to be used' do
+ expect_popen.and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_key_auth: false, ssh_private_key: 'foo')
+
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
+
+ it 'passes the known_hosts data if specified' do
+ expect_popen('GITLAB_SHELL_KNOWN_HOSTS' => 'foo').and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_known_hosts: 'foo')
+
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
+
+ it 'does not pass empty known_hosts data' do
+ expect_popen.and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_known_hosts: '')
+
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
+
+ it 'does not pass known_hosts data unless SSH is to be used' do
+ expect_popen(popen_vars).and_return([nil, 0])
+
+ ssh_auth = build_ssh_auth(ssh_import?: false, ssh_known_hosts: 'foo')
- expect { gitlab_shell.fetch_remote('current/storage', 'project/path', 'new/storage') }.to raise_error(Gitlab::Shell::Error, "error")
+ expect(fetch_remote(ssh_auth)).to be_truthy
+ end
end
end
diff --git a/spec/migrations/calculate_conv_dev_index_percentages_spec.rb b/spec/migrations/calculate_conv_dev_index_percentages_spec.rb
new file mode 100644
index 00000000000..597d8eab51c
--- /dev/null
+++ b/spec/migrations/calculate_conv_dev_index_percentages_spec.rb
@@ -0,0 +1,41 @@
+# encoding: utf-8
+
+require 'spec_helper'
+require Rails.root.join('db', 'post_migrate', '20170803090603_calculate_conv_dev_index_percentages.rb')
+
+describe CalculateConvDevIndexPercentages, truncate: true do
+ let(:migration) { described_class.new }
+ let!(:conv_dev_index) do
+ create(:conversational_development_index_metric,
+ leader_notes: 0,
+ instance_milestones: 0,
+ percentage_issues: 0,
+ percentage_notes: 0,
+ percentage_milestones: 0,
+ percentage_boards: 0,
+ percentage_merge_requests: 0,
+ percentage_ci_pipelines: 0,
+ percentage_environments: 0,
+ percentage_deployments: 0,
+ percentage_projects_prometheus_active: 0,
+ percentage_service_desk_issues: 0)
+ end
+
+ describe '#up' do
+ it 'calculates percentages correctly' do
+ migration.up
+ conv_dev_index.reload
+
+ expect(conv_dev_index.percentage_issues).to be_within(0.1).of(13.3)
+ expect(conv_dev_index.percentage_notes).to be_zero # leader 0
+ expect(conv_dev_index.percentage_milestones).to be_zero # instance 0
+ expect(conv_dev_index.percentage_boards).to be_within(0.1).of(62.4)
+ expect(conv_dev_index.percentage_merge_requests).to eq(50.0)
+ expect(conv_dev_index.percentage_ci_pipelines).to be_within(0.1).of(19.3)
+ expect(conv_dev_index.percentage_environments).to be_within(0.1).of(66.7)
+ expect(conv_dev_index.percentage_deployments).to be_within(0.1).of(64.2)
+ expect(conv_dev_index.percentage_projects_prometheus_active).to be_within(0.1).of(98.2)
+ expect(conv_dev_index.percentage_service_desk_issues).to be_within(0.1).of(84.0)
+ end
+ end
+end
diff --git a/spec/models/conversational_development_index/metric_spec.rb b/spec/models/conversational_development_index/metric_spec.rb
new file mode 100644
index 00000000000..b3193619503
--- /dev/null
+++ b/spec/models/conversational_development_index/metric_spec.rb
@@ -0,0 +1,11 @@
+require 'rails_helper'
+
+describe ConversationalDevelopmentIndex::Metric do
+ let(:conv_dev_index) { create(:conversational_development_index_metric) }
+
+ describe '#percentage_score' do
+ it 'returns stored percentage score' do
+ expect(conv_dev_index.percentage_score('issues')).to eq(13.331)
+ end
+ end
+end
diff --git a/spec/models/key_spec.rb b/spec/models/key_spec.rb
index 0daeb337168..3508391c721 100644
--- a/spec/models/key_spec.rb
+++ b/spec/models/key_spec.rb
@@ -83,15 +83,6 @@ describe Key, :mailer do
expect(build(:key)).to be_valid
end
- it 'rejects an unfingerprintable key that contains a space' do
- key = build(:key)
-
- # Not always the middle, but close enough
- key.key = key.key[0..100] + ' ' + key.key[101..-1]
-
- expect(key).not_to be_valid
- end
-
it 'accepts a key with newline charecters after stripping them' do
key = build(:key)
key.key = key.key.insert(100, "\n")
@@ -102,7 +93,6 @@ describe Key, :mailer do
it 'rejects the unfingerprintable key (not a key)' do
expect(build(:key, key: 'ssh-rsa an-invalid-key==')).not_to be_valid
end
-
end
context 'callbacks' do
diff --git a/spec/models/milestone_spec.rb b/spec/models/milestone_spec.rb
index b48aa9558d5..d3da0107d5c 100644
--- a/spec/models/milestone_spec.rb
+++ b/spec/models/milestone_spec.rb
@@ -230,16 +230,40 @@ describe Milestone do
end
describe '#to_reference' do
- let(:project) { build(:project, name: 'sample-project') }
- let(:milestone) { build(:milestone, iid: 1, project: project) }
+ let(:group) { build_stubbed(:group) }
+ let(:project) { build_stubbed(:project, name: 'sample-project') }
+ let(:another_project) { build_stubbed(:project, name: 'another-project', namespace: project.namespace) }
+
+ context 'for a project milestone' do
+ let(:milestone) { build_stubbed(:milestone, iid: 1, project: project, name: 'milestone') }
+
+ it 'returns a String reference to the object' do
+ expect(milestone.to_reference).to eq '%1'
+ end
+
+ it 'returns a reference by name when the format is set to :name' do
+ expect(milestone.to_reference(format: :name)).to eq '%"milestone"'
+ end
- it 'returns a String reference to the object' do
- expect(milestone.to_reference).to eq "%1"
+ it 'supports a cross-project reference' do
+ expect(milestone.to_reference(another_project)).to eq 'sample-project%1'
+ end
end
- it 'supports a cross-project reference' do
- another_project = build(:project, name: 'another-project', namespace: project.namespace)
- expect(milestone.to_reference(another_project)).to eq "sample-project%1"
+ context 'for a group milestone' do
+ let(:milestone) { build_stubbed(:milestone, iid: 1, group: group, name: 'milestone') }
+
+ it 'returns nil with the default format' do
+ expect(milestone.to_reference).to be_nil
+ end
+
+ it 'returns a reference by name when the format is set to :name' do
+ expect(milestone.to_reference(format: :name)).to eq '%"milestone"'
+ end
+
+ it 'does not supports cross-project references' do
+ expect(milestone.to_reference(another_project, format: :name)).to eq '%"milestone"'
+ end
end
end
diff --git a/spec/presenters/conversational_development_index/metric_presenter_spec.rb b/spec/presenters/conversational_development_index/metric_presenter_spec.rb
index 1e015c71f5b..81eb05a9a6b 100644
--- a/spec/presenters/conversational_development_index/metric_presenter_spec.rb
+++ b/spec/presenters/conversational_development_index/metric_presenter_spec.rb
@@ -8,9 +8,9 @@ describe ConversationalDevelopmentIndex::MetricPresenter do
it 'includes instance score, leader score and percentage score' do
issues_card = subject.cards.first
- expect(issues_card.instance_score).to eq 1.234
- expect(issues_card.leader_score).to eq 9.256
- expect(issues_card.percentage_score).to be_within(0.1).of(13.3)
+ expect(issues_card.instance_score).to eq(1.234)
+ expect(issues_card.leader_score).to eq(9.256)
+ expect(issues_card.percentage_score).to eq(13.331)
end
end
diff --git a/spec/services/projects/autocomplete_service_spec.rb b/spec/services/projects/autocomplete_service_spec.rb
index c1f098530bf..426593be428 100644
--- a/spec/services/projects/autocomplete_service_spec.rb
+++ b/spec/services/projects/autocomplete_service_spec.rb
@@ -88,4 +88,31 @@ describe Projects::AutocompleteService do
end
end
end
+
+ describe '#milestones' do
+ let(:user) { create(:user) }
+ let(:group) { create(:group) }
+ let(:project) { create(:project, group: group) }
+ let!(:group_milestone) { create(:milestone, group: group) }
+ let!(:project_milestone) { create(:milestone, project: project) }
+
+ let(:milestone_titles) { described_class.new(project, user).milestones.map(&:title) }
+
+ it 'includes project and group milestones' do
+ expect(milestone_titles).to eq([group_milestone.title, project_milestone.title])
+ end
+
+ it 'does not include closed milestones' do
+ group_milestone.close
+
+ expect(milestone_titles).to eq([project_milestone.title])
+ end
+
+ it 'does not include milestones from other projects in the group' do
+ other_project = create(:project, group: group)
+ project_milestone.update!(project: other_project)
+
+ expect(milestone_titles).to eq([group_milestone.title])
+ end
+ end
end
diff --git a/spec/services/projects/create_from_template_service_spec.rb b/spec/services/projects/create_from_template_service_spec.rb
new file mode 100644
index 00000000000..9919ec254c6
--- /dev/null
+++ b/spec/services/projects/create_from_template_service_spec.rb
@@ -0,0 +1,26 @@
+require 'spec_helper'
+
+describe Projects::CreateFromTemplateService do
+ let(:user) { create(:user) }
+ let(:project_params) do
+ {
+ path: user.to_param,
+ template_name: 'rails'
+ }
+ end
+
+ subject { described_class.new(user, project_params) }
+
+ it 'calls the importer service' do
+ expect_any_instance_of(Projects::GitlabProjectsImportService).to receive(:execute)
+
+ subject.execute
+ end
+
+ it 'returns the project thats created' do
+ project = subject.execute
+
+ expect(project).to be_saved
+ expect(project.scheduled?).to be(true)
+ end
+end
diff --git a/spec/services/projects/import_service_spec.rb b/spec/services/projects/import_service_spec.rb
index c0ab1ea704d..034065aab00 100644
--- a/spec/services/projects/import_service_spec.rb
+++ b/spec/services/projects/import_service_spec.rb
@@ -38,8 +38,7 @@ describe Projects::ImportService do
context 'with a Github repository' do
it 'succeeds if repository import is successfully' do
- expect_any_instance_of(Repository).to receive(:fetch_remote).and_return(true)
- expect_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute).and_return(true)
+ expect_any_instance_of(Github::Import).to receive(:execute).and_return(true)
result = subject.execute
@@ -52,16 +51,7 @@ describe Projects::ImportService do
result = subject.execute
expect(result[:status]).to eq :error
- expect(result[:message]).to eq "Error importing repository #{project.import_url} into #{project.full_path} - Failed to import the repository"
- end
-
- it 'does not remove the GitHub remote' do
- expect_any_instance_of(Repository).to receive(:fetch_remote).and_return(true)
- expect_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute).and_return(true)
-
- subject.execute
-
- expect(project.repository.raw_repository.remote_names).to include('github')
+ expect(result[:message]).to eq "Error importing repository #{project.import_url} into #{project.path_with_namespace} - The remote data could not be imported."
end
end
@@ -102,8 +92,7 @@ describe Projects::ImportService do
end
it 'succeeds if importer succeeds' do
- allow_any_instance_of(Repository).to receive(:fetch_remote).and_return(true)
- allow_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute).and_return(true)
+ allow_any_instance_of(Github::Import).to receive(:execute).and_return(true)
result = subject.execute
@@ -111,10 +100,7 @@ describe Projects::ImportService do
end
it 'flushes various caches' do
- allow_any_instance_of(Repository).to receive(:fetch_remote)
- .and_return(true)
-
- allow_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute)
+ allow_any_instance_of(Github::Import).to receive(:execute)
.and_return(true)
expect_any_instance_of(Repository).to receive(:expire_content_cache)
@@ -123,8 +109,7 @@ describe Projects::ImportService do
end
it 'fails if importer fails' do
- allow_any_instance_of(Repository).to receive(:fetch_remote).and_return(true)
- allow_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute).and_return(false)
+ allow_any_instance_of(Github::Import).to receive(:execute).and_return(false)
result = subject.execute
@@ -133,8 +118,7 @@ describe Projects::ImportService do
end
it 'fails if importer raise an error' do
- allow_any_instance_of(Gitlab::Shell).to receive(:fetch_remote).and_return(true)
- allow_any_instance_of(Gitlab::GithubImport::Importer).to receive(:execute).and_raise(Projects::ImportService::Error.new('Github: failed to connect API'))
+ allow_any_instance_of(Github::Import).to receive(:execute).and_raise(Projects::ImportService::Error.new('Github: failed to connect API'))
result = subject.execute
@@ -143,9 +127,9 @@ describe Projects::ImportService do
end
it 'expires content cache after error' do
- allow_any_instance_of(Project).to receive(:repository_exists?).and_return(false, true)
+ allow_any_instance_of(Project).to receive(:repository_exists?).and_return(false)
- expect_any_instance_of(Gitlab::Shell).to receive(:fetch_remote).and_raise(Gitlab::Shell::Error.new('Failed to import the repository'))
+ expect_any_instance_of(Repository).to receive(:fetch_remote).and_raise(Gitlab::Shell::Error.new)
expect_any_instance_of(Repository).to receive(:expire_content_cache)
subject.execute
diff --git a/spec/services/submit_usage_ping_service_spec.rb b/spec/services/submit_usage_ping_service_spec.rb
index 817fa4262d5..c8a6fc1a99b 100644
--- a/spec/services/submit_usage_ping_service_spec.rb
+++ b/spec/services/submit_usage_ping_service_spec.rb
@@ -46,6 +46,8 @@ describe SubmitUsagePingService do
.by(1)
expect(ConversationalDevelopmentIndex::Metric.last.leader_issues).to eq 10.2
+ expect(ConversationalDevelopmentIndex::Metric.last.instance_issues).to eq 3.2
+ expect(ConversationalDevelopmentIndex::Metric.last.percentage_issues).to eq 31.37
end
end
@@ -60,6 +62,7 @@ describe SubmitUsagePingService do
conv_index: {
leader_issues: 10.2,
instance_issues: 3.2,
+ percentage_issues: 31.37,
leader_notes: 25.3,
instance_notes: 23.2,
@@ -86,7 +89,9 @@ describe SubmitUsagePingService do
instance_projects_prometheus_active: 0.30,
leader_service_desk_issues: 15.8,
- instance_service_desk_issues: 15.1
+ instance_service_desk_issues: 15.1,
+
+ non_existing_column: 'value'
}
}
end
diff --git a/spec/services/system_note_service_spec.rb b/spec/services/system_note_service_spec.rb
index e3805160b04..8f1eb4863d9 100644
--- a/spec/services/system_note_service_spec.rb
+++ b/spec/services/system_note_service_spec.rb
@@ -3,7 +3,8 @@ require 'spec_helper'
describe SystemNoteService do
include Gitlab::Routing
- let(:project) { create(:project) }
+ let(:group) { create(:group) }
+ let(:project) { create(:project, group: group) }
let(:author) { create(:user) }
let(:noteable) { create(:issue, project: project) }
let(:issue) { noteable }
@@ -242,25 +243,51 @@ describe SystemNoteService do
end
describe '.change_milestone' do
- subject { described_class.change_milestone(noteable, project, author, milestone) }
+ context 'for a project milestone' do
+ subject { described_class.change_milestone(noteable, project, author, milestone) }
- let(:milestone) { create(:milestone, project: project) }
+ let(:milestone) { create(:milestone, project: project) }
- it_behaves_like 'a system note' do
- let(:action) { 'milestone' }
- end
+ it_behaves_like 'a system note' do
+ let(:action) { 'milestone' }
+ end
- context 'when milestone added' do
- it 'sets the note text' do
- expect(subject.note).to eq "changed milestone to #{milestone.to_reference}"
+ context 'when milestone added' do
+ it 'sets the note text' do
+ expect(subject.note).to eq "changed milestone to #{milestone.to_reference}"
+ end
+ end
+
+ context 'when milestone removed' do
+ let(:milestone) { nil }
+
+ it 'sets the note text' do
+ expect(subject.note).to eq 'removed milestone'
+ end
end
end
- context 'when milestone removed' do
- let(:milestone) { nil }
+ context 'for a group milestone' do
+ subject { described_class.change_milestone(noteable, project, author, milestone) }
- it 'sets the note text' do
- expect(subject.note).to eq 'removed milestone'
+ let(:milestone) { create(:milestone, group: group) }
+
+ it_behaves_like 'a system note' do
+ let(:action) { 'milestone' }
+ end
+
+ context 'when milestone added' do
+ it 'sets the note text to use the milestone name' do
+ expect(subject.note).to eq "changed milestone to #{milestone.to_reference(format: :name)}"
+ end
+ end
+
+ context 'when milestone removed' do
+ let(:milestone) { nil }
+
+ it 'sets the note text' do
+ expect(subject.note).to eq 'removed milestone'
+ end
end
end
end
diff --git a/spec/spec_helper.rb b/spec/spec_helper.rb
index 06769b241ad..0ba6ed56314 100644
--- a/spec/spec_helper.rb
+++ b/spec/spec_helper.rb
@@ -134,13 +134,13 @@ RSpec.configure do |config|
ActiveRecord::Migrator
.migrate(migrations_paths, previous_migration.version)
- ActiveRecord::Base.descendants.each(&:reset_column_information)
+ reset_column_in_migration_models
end
config.after(:example, :migration) do
ActiveRecord::Migrator.migrate(migrations_paths)
- ActiveRecord::Base.descendants.each(&:reset_column_information)
+ reset_column_in_migration_models
end
config.around(:each, :nested_groups) do |example|
diff --git a/spec/support/issuable_shared_examples.rb b/spec/support/issuable_shared_examples.rb
index 970fe10db2b..42f3b4db23c 100644
--- a/spec/support/issuable_shared_examples.rb
+++ b/spec/support/issuable_shared_examples.rb
@@ -21,15 +21,15 @@ shared_examples 'system notes for milestones' do
create(:group_member, group: group, user: user)
end
- it 'does not create system note' do
+ it 'creates a system note' do
expect do
update_issuable(milestone: group_milestone)
- end.not_to change { Note.system.count }
+ end.to change { Note.system.count }.by(1)
end
end
context 'project milestones' do
- it 'creates system note' do
+ it 'creates a system note' do
expect do
update_issuable(milestone: create(:milestone))
end.to change { Note.system.count }.by(1)
diff --git a/spec/support/markdown_feature.rb b/spec/support/markdown_feature.rb
index 21a054af4e1..c90359d7cfa 100644
--- a/spec/support/markdown_feature.rb
+++ b/spec/support/markdown_feature.rb
@@ -23,7 +23,7 @@ class MarkdownFeature
# Direct references ----------------------------------------------------------
def project
- @project ||= create(:project, :repository).tap do |project|
+ @project ||= create(:project, :repository, group: group).tap do |project|
project.team << [user, :master]
end
end
@@ -75,6 +75,10 @@ class MarkdownFeature
@milestone ||= create(:milestone, name: 'next goal', project: project)
end
+ def group_milestone
+ @group_milestone ||= create(:milestone, name: 'group-milestone', group: group)
+ end
+
# Cross-references -----------------------------------------------------------
def xproject
diff --git a/spec/support/matchers/markdown_matchers.rb b/spec/support/matchers/markdown_matchers.rb
index 7afa57fb76b..d12b2757427 100644
--- a/spec/support/matchers/markdown_matchers.rb
+++ b/spec/support/matchers/markdown_matchers.rb
@@ -155,7 +155,7 @@ module MarkdownMatchers
set_default_markdown_messages
match do |actual|
- expect(actual).to have_selector('a.gfm.gfm-milestone', count: 6)
+ expect(actual).to have_selector('a.gfm.gfm-milestone', count: 8)
end
end
diff --git a/spec/support/migrations_helpers.rb b/spec/support/migrations_helpers.rb
index 91fbb4eaf48..aabdad13047 100644
--- a/spec/support/migrations_helpers.rb
+++ b/spec/support/migrations_helpers.rb
@@ -15,6 +15,16 @@ module MigrationsHelpers
ActiveRecord::Migrator.migrations(migrations_paths)
end
+ def reset_column_in_migration_models
+ described_class.constants.sort.each do |name|
+ const = described_class.const_get(name)
+
+ if const.is_a?(Class) && const < ActiveRecord::Base
+ const.reset_column_information
+ end
+ end
+ end
+
def previous_migration
migrations.each_cons(2) do |previous, migration|
break previous if migration.name == described_class.name
diff --git a/vendor/assets/javascripts/jquery.nicescroll.js b/vendor/assets/javascripts/jquery.nicescroll.js
deleted file mode 100644
index 7653f25df4b..00000000000
--- a/vendor/assets/javascripts/jquery.nicescroll.js
+++ /dev/null
@@ -1,3634 +0,0 @@
-/* jquery.nicescroll
--- version 3.6.0
--- copyright 2014-11-21 InuYaksa*2014
--- licensed under the MIT
---
--- http://nicescroll.areaaperta.com/
--- https://github.com/inuyaksa/jquery.nicescroll
---
-*/
-
-(function(factory) {
- if (typeof define === 'function' && define.amd) {
- // AMD. Register as anonymous module.
- define(['jquery'], factory);
- } else {
- // Browser globals.
- factory(jQuery);
- }
-}(function(jQuery) {
- "use strict";
-
- // globals
- var domfocus = false;
- var mousefocus = false;
- var tabindexcounter = 0;
- var ascrailcounter = 2000;
- var globalmaxzindex = 0;
-
- var $ = jQuery; // sandbox
-
- // http://stackoverflow.com/questions/2161159/get-script-path
- function getScriptPath() {
- var scripts = document.getElementsByTagName('script');
- var path = scripts[scripts.length - 1].src.split('?')[0];
- return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
- }
-
- var vendors = ['webkit','ms','moz','o'];
-
- var setAnimationFrame = window.requestAnimationFrame || false;
- var clearAnimationFrame = window.cancelAnimationFrame || false;
-
- if (!setAnimationFrame) { // legacy detection
- for (var vx in vendors) {
- var v = vendors[vx];
- if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'];
- if (!clearAnimationFrame) clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
- }
- }
-
- var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
-
- var _globaloptions = {
- zindex: "auto",
- cursoropacitymin: 0,
- cursoropacitymax: 1,
- cursorcolor: "#424242",
- cursorwidth: "5px",
- cursorborder: "1px solid #fff",
- cursorborderradius: "5px",
- scrollspeed: 60,
- mousescrollstep: 8 * 3,
- touchbehavior: false,
- hwacceleration: true,
- usetransition: true,
- boxzoom: false,
- dblclickzoom: true,
- gesturezoom: true,
- grabcursorenabled: true,
- autohidemode: true,
- background: "",
- iframeautoresize: true,
- cursorminheight: 32,
- preservenativescrolling: true,
- railoffset: false,
- railhoffset: false,
- bouncescroll: true,
- spacebarenabled: true,
- railpadding: {
- top: 0,
- right: 0,
- left: 0,
- bottom: 0
- },
- disableoutline: true,
- horizrailenabled: true,
- railalign: "right",
- railvalign: "bottom",
- enabletranslate3d: true,
- enablemousewheel: true,
- enablekeyboard: true,
- smoothscroll: true,
- sensitiverail: true,
- enablemouselockapi: true,
- // cursormaxheight:false,
- cursorfixedheight: false,
- directionlockdeadzone: 6,
- hidecursordelay: 400,
- nativeparentscrolling: true,
- enablescrollonselection: true,
- overflowx: true,
- overflowy: true,
- cursordragspeed: 0.3,
- rtlmode: "auto",
- cursordragontouch: false,
- oneaxismousemode: "auto",
- scriptpath: getScriptPath(),
- preventmultitouchscrolling: true
- };
-
- var browserdetected = false;
-
- var getBrowserDetection = function() {
-
- if (browserdetected) return browserdetected;
-
- var _el = document.createElement('DIV'),
- _style = _el.style,
- _agent = navigator.userAgent,
- _platform = navigator.platform,
- d = {};
-
- d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
-
- d.isopera = ("opera" in window); // 12-
- d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
- d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
-
- d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
- d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
- d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
- d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
- d.isie9 = d.isie && ("performance" in window) && (document.documentMode >= 9);
- d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
- d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
-
- d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
- if (d.isie9mobile) d.isie9 = false;
- d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
-
- d.ismozilla = ("MozAppearance" in _style);
-
- d.iswebkit = ("WebkitAppearance" in _style);
-
- d.ischrome = ("chrome" in window);
- d.ischrome22 = (d.ischrome && d.haspointerlock);
- d.ischrome26 = (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
-
- d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // detection for Chrome Touch Emulation
- d.hasmstouch = (window.MSPointerEvent || false); // IE10 pointer events
- d.hasw3ctouch = (window.PointerEvent || false); //IE11 pointer events, following W3C Pointer Events spec
-
- d.ismac = /^mac$/i.test(_platform);
-
- d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
- d.isios4 = ((d.isios) && !("seal" in Object));
- d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+
-
- d.isandroid = (/android/i.test(_agent));
-
- d.haseventlistener = ("addEventListener" in _el);
-
- d.trstyle = false;
- d.hastransform = false;
- d.hastranslate3d = false;
- d.transitionstyle = false;
- d.hastransition = false;
- d.transitionend = false;
-
- var a;
- var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
- for (a = 0; a < check.length; a++) {
- if (typeof _style[check[a]] != "undefined") {
- d.trstyle = check[a];
- break;
- }
- }
- d.hastransform = (!!d.trstyle);
- if (d.hastransform) {
- _style[d.trstyle] = "translate3d(1px,2px,3px)";
- d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
- }
-
- d.transitionstyle = false;
- d.prefixstyle = '';
- d.transitionend = false;
- check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
- var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
- var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
- for (a = 0; a < check.length; a++) {
- if (check[a] in _style) {
- d.transitionstyle = check[a];
- d.prefixstyle = prefix[a];
- d.transitionend = evs[a];
- break;
- }
- }
- if (d.ischrome26) { // always use prefix
- d.prefixstyle = prefix[1];
- }
-
- d.hastransition = (d.transitionstyle);
-
- function detectCursorGrab() {
- var lst = ['-webkit-grab', '-moz-grab', 'grab'];
- if ((d.ischrome && !d.ischrome22) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
- for (var a = 0; a < lst.length; a++) {
- var p = lst[a];
- _style.cursor = p;
- if (_style.cursor == p) return p;
- }
- return 'url(//mail.google.com/mail/images/2/openhand.cur),n-resize'; // thank you google for custom cursor!
- }
- d.cursorgrabvalue = detectCursorGrab();
-
- d.hasmousecapture = ("setCapture" in _el);
-
- d.hasMutationObserver = (ClsMutationObserver !== false);
-
- _el = null; //memory released
-
- browserdetected = d;
-
- return d;
- };
-
- var NiceScrollClass = function(myopt, me) {
-
- var self = this;
-
- this.version = '3.6.0';
- this.name = 'nicescroll';
-
- this.me = me;
-
- this.opt = {
- doc: $("body"),
- win: false
- };
-
- $.extend(this.opt, _globaloptions); // clone opts
-
- // Options for internal use
- this.opt.snapbackspeed = 80;
-
- if (myopt || false) {
- for (var a in self.opt) {
- if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
- }
- }
-
- this.doc = self.opt.doc;
- this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
- this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
- this.haswrapper = (self.opt.win !== false);
- this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
- this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
- this.body = $("body");
- this.viewport = false;
-
- this.isfixed = false;
-
- this.iframe = false;
- this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
-
- this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
-
- this.forcescreen = false; //force to use screen position on events
-
- this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
-
- // Events jump table
- this.onmousedown = false;
- this.onmouseup = false;
- this.onmousemove = false;
- this.onmousewheel = false;
- this.onkeypress = false;
- this.ongesturezoom = false;
- this.onclick = false;
-
- // Nicescroll custom events
- this.onscrollstart = false;
- this.onscrollend = false;
- this.onscrollcancel = false;
-
- this.onzoomin = false;
- this.onzoomout = false;
-
- // Let's start!
- this.view = false;
- this.page = false;
-
- this.scroll = {
- x: 0,
- y: 0
- };
- this.scrollratio = {
- x: 0,
- y: 0
- };
- this.cursorheight = 20;
- this.scrollvaluemax = 0;
-
- this.isrtlmode = (this.opt.rtlmode == "auto") ? ((this.win[0] == window ? this.body : this.win).css("direction") == "rtl") : (this.opt.rtlmode === true);
- // this.checkrtlmode = false;
-
- this.scrollrunning = false;
-
- this.scrollmom = false;
-
- this.observer = false; // observer div changes
- this.observerremover = false; // observer on parent for remove detection
- this.observerbody = false; // observer on body for position change
-
- do {
- this.id = "ascrail" + (ascrailcounter++);
- } while (document.getElementById(this.id));
-
- this.rail = false;
- this.cursor = false;
- this.cursorfreezed = false;
- this.selectiondrag = false;
-
- this.zoom = false;
- this.zoomactive = false;
-
- this.hasfocus = false;
- this.hasmousefocus = false;
-
- this.visibility = true;
- this.railslocked = false; // locked by resize
- this.locked = false; // prevent lost of locked status sets by user
- this.hidden = false; // rails always hidden
- this.cursoractive = true; // user can interact with cursors
-
- this.wheelprevented = false; //prevent mousewheel event
-
- this.overflowx = self.opt.overflowx;
- this.overflowy = self.opt.overflowy;
-
- this.nativescrollingarea = false;
- this.checkarea = 0;
-
- this.events = []; // event list for unbind
-
- this.saved = {}; // style saved
-
- this.delaylist = {};
- this.synclist = {};
-
- this.lastdeltax = 0;
- this.lastdeltay = 0;
-
- this.detected = getBrowserDetection();
-
- var cap = $.extend({}, this.detected);
-
- this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
- this.ishwscroll = (this.canhwscroll && self.haswrapper);
-
- this.hasreversehr = (this.isrtlmode&&!cap.iswebkit); //RTL mode with reverse horizontal axis
-
- this.istouchcapable = false; // desktop devices with touch screen support
-
- //## Check WebKit-based desktop with touch support
- //## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
- if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
- this.istouchcapable = true;
- cap.cantouch = false; // parse normal desktop events
- }
-
- //## disable MouseLock API on user request
- if (!self.opt.enablemouselockapi) {
- cap.hasmousecapture = false;
- cap.haspointerlock = false;
- }
-
-/* deprecated
- this.delayed = function(name, fn, tm, lazy) {
- };
-*/
-
- this.debounced = function(name, fn, tm) {
- var dd = self.delaylist[name];
- self.delaylist[name] = fn;
- if (!dd) {
- setTimeout(function() {
- var fn = self.delaylist[name];
- self.delaylist[name] = false;
- fn.call(self);
- }, tm);
- }
- };
-
- var _onsync = false;
-
- this.synched = function(name, fn) {
-
- function requestSync() {
- if (_onsync) return;
- setAnimationFrame(function() {
- _onsync = false;
- for (var nn in self.synclist) {
- var fn = self.synclist[nn];
- if (fn) fn.call(self);
- self.synclist[nn] = false;
- }
- });
- _onsync = true;
- }
-
- self.synclist[name] = fn;
- requestSync();
- return name;
- };
-
- this.unsynched = function(name) {
- if (self.synclist[name]) self.synclist[name] = false;
- };
-
- this.css = function(el, pars) { // save & set
- for (var n in pars) {
- self.saved.css.push([el, n, el.css(n)]);
- el.css(n, pars[n]);
- }
- };
-
- this.scrollTop = function(val) {
- return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
- };
-
- this.scrollLeft = function(val) {
- return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
- };
-
- // derived by by Dan Pupius www.pupius.net
- var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
-
- this.st = st;
- this.ed = ed;
- this.spd = spd;
-
- this.p1 = p1 || 0;
- this.p2 = p2 || 1;
- this.p3 = p3 || 0;
- this.p4 = p4 || 1;
-
- this.ts = (new Date()).getTime();
- this.df = this.ed - this.st;
- };
- BezierClass.prototype = {
- B2: function(t) {
- return 3 * t * t * (1 - t);
- },
- B3: function(t) {
- return 3 * t * (1 - t) * (1 - t);
- },
- B4: function(t) {
- return (1 - t) * (1 - t) * (1 - t);
- },
- getNow: function() {
- var nw = (new Date()).getTime();
- var pc = 1 - ((nw - this.ts) / this.spd);
- var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
- return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
- },
- update: function(ed, spd) {
- this.st = this.getNow();
- this.ed = ed;
- this.spd = spd;
- this.ts = (new Date()).getTime();
- this.df = this.ed - this.st;
- return this;
- }
- };
-
- //derived from http://stackoverflow.com/questions/11236090/
- function getMatrixValues() {
- var tr = self.doc.css(cap.trstyle);
- if (tr && (tr.substr(0, 6) == "matrix")) {
- return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
- }
- return false;
- }
-
- if (this.ishwscroll) {
- // hw accelerated scroll
- this.doc.translate = {
- x: 0,
- y: 0,
- tx: "0px",
- ty: "0px"
- };
-
- //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
- if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
-
- this.getScrollTop = function(last) {
- if (!last) {
- var mtx = getMatrixValues();
- if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
- if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
- }
- return self.doc.translate.y;
- };
-
- this.getScrollLeft = function(last) {
- if (!last) {
- var mtx = getMatrixValues();
- if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
- if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
- }
- return self.doc.translate.x;
- };
-
- this.notifyScrollEvent = function(el) {
- var e = document.createEvent("UIEvents");
- e.initUIEvent("scroll", false, true, window, 1);
- e.niceevent = true;
- el.dispatchEvent(e);
- };
-
- var cxscrollleft = (this.isrtlmode) ? 1 : -1;
-
- if (cap.hastranslate3d && self.opt.enabletranslate3d) {
- this.setScrollTop = function(val, silent) {
- self.doc.translate.y = val;
- self.doc.translate.ty = (val * -1) + "px";
- self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
- if (!silent) self.notifyScrollEvent(self.win[0]);
- };
- this.setScrollLeft = function(val, silent) {
- self.doc.translate.x = val;
- self.doc.translate.tx = (val * cxscrollleft) + "px";
- self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
- if (!silent) self.notifyScrollEvent(self.win[0]);
- };
- } else {
- this.setScrollTop = function(val, silent) {
- self.doc.translate.y = val;
- self.doc.translate.ty = (val * -1) + "px";
- self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
- if (!silent) self.notifyScrollEvent(self.win[0]);
- };
- this.setScrollLeft = function(val, silent) {
- self.doc.translate.x = val;
- self.doc.translate.tx = (val * cxscrollleft) + "px";
- self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
- if (!silent) self.notifyScrollEvent(self.win[0]);
- };
- }
- } else {
- // native scroll
- this.getScrollTop = function() {
- return self.docscroll.scrollTop();
- };
- this.setScrollTop = function(val) {
- return self.docscroll.scrollTop(val);
- };
- this.getScrollLeft = function() {
- if (self.detected.ismozilla && self.isrtlmode)
- return Math.abs(self.docscroll.scrollLeft());
- return self.docscroll.scrollLeft();
- };
- this.setScrollLeft = function(val) {
- return self.docscroll.scrollLeft((self.detected.ismozilla && self.isrtlmode) ? -val : val);
- };
- }
-
- this.getTarget = function(e) {
- if (!e) return false;
- if (e.target) return e.target;
- if (e.srcElement) return e.srcElement;
- return false;
- };
-
- this.hasParent = function(e, id) {
- if (!e) return false;
- var el = e.target || e.srcElement || e || false;
- while (el && el.id != id) {
- el = el.parentNode || false;
- }
- return (el !== false);
- };
-
- function getZIndex() {
- var dom = self.win;
- if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
- while (dom.length > 0) {
- if (dom[0].nodeType == 9) return false;
- var zi = dom.css('zIndex');
- if (!isNaN(zi) && zi != 0) return parseInt(zi);
- dom = dom.parent();
- }
- return false;
- }
-
- //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
- var _convertBorderWidth = {
- "thin": 1,
- "medium": 3,
- "thick": 5
- };
-
- function getWidthToPixel(dom, prop, chkheight) {
- var wd = dom.css(prop);
- var px = parseFloat(wd);
- if (isNaN(px)) {
- px = _convertBorderWidth[wd] || 0;
- var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
- if (self.isie8 && px) px += 1;
- return (brd) ? px : 0;
- }
- return px;
- }
-
- this.getDocumentScrollOffset = function() {
- return {top:window.pageYOffset||document.documentElement.scrollTop,
- left:window.pageXOffset||document.documentElement.scrollLeft};
- }
-
- this.getOffset = function() {
- if (self.isfixed) {
- var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
- var scrl = self.getDocumentScrollOffset();
- ofs.top-=scrl.top;
- ofs.left-=scrl.left;
- return ofs;
- }
- var ww = self.win.offset();
- if (!self.viewport) return ww;
- var vp = self.viewport.offset();
- return {
- top: ww.top - vp.top,// + self.viewport.scrollTop(),
- left: ww.left - vp.left // + self.viewport.scrollLeft()
- };
- };
-
- this.updateScrollBar = function(len) {
- if (self.ishwscroll) {
- self.rail.css({ //**
- height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
- });
- if (self.railh) self.railh.css({ //**
- width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
- });
-
- } else {
- var wpos = self.getOffset();
- var pos = {
- top: wpos.top,
- left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
- };
- pos.top += getWidthToPixel(self.win, 'border-top-width', true);
- pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
-
- var off = self.opt.railoffset;
- if (off) {
- if (off.top) pos.top += off.top;
- if (self.rail.align && off.left) pos.left += off.left;
- }
-
- if (!self.railslocked) self.rail.css({
- top: pos.top,
- left: pos.left,
- height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
- });
-
- if (self.zoom) {
- self.zoom.css({
- top: pos.top + 1,
- left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
- });
- }
-
- if (self.railh && !self.railslocked) {
- var pos = {
- top: wpos.top,
- left: wpos.left
- };
- var off = self.opt.railhoffset;
- if (!!off) {
- if (!!off.top) pos.top += off.top;
- if (!!off.left) pos.left += off.left;
- }
- var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
- var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
- self.railh.css({
- top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
- left: x,
- width: self.railh.width
- });
- }
-
-
- }
- };
-
- this.doRailClick = function(e, dbl, hr) {
- var fn, pg, cur, pos;
-
- if (self.railslocked) return;
- self.cancelEvent(e);
-
- if (dbl) {
- fn = (hr) ? self.doScrollLeft : self.doScrollTop;
- cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
- fn(cur);
- } else {
- fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
- cur = (hr) ? self.scroll.x : self.scroll.y;
- pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
- pg = (hr) ? self.view.w : self.view.h;
- fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg);
- }
-
- };
-
- self.hasanimationframe = (setAnimationFrame);
- self.hascancelanimationframe = (clearAnimationFrame);
-
- if (!self.hasanimationframe) {
- setAnimationFrame = function(fn) {
- return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
- }; // 1000/60)};
- clearAnimationFrame = clearInterval;
- } else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
- self.cancelAnimationFrame = true;
- };
-
- this.init = function() {
-
- self.saved.css = [];
-
- if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
- if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
-
- if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
- '-ms-touch-action': 'none'
- });
-
- self.zindex = "auto";
- if (!self.ispage && self.opt.zindex == "auto") {
- self.zindex = getZIndex() || "auto";
- } else {
- self.zindex = self.opt.zindex;
- }
-
- if (!self.ispage && self.zindex != "auto") {
- if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex;
- }
-
- if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
- self.zindex = "auto";
- }
-
- if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
-
- var cont = self.docscroll;
- if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
-
- if (!cap.isie9mobile) self.css(cont, {
- 'overflow-y': 'hidden'
- });
-
- if (self.ispage && cap.isie7) {
- if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
- 'overflow-y': 'hidden'
- }); //IE7 double scrollbar issue
- else if (self.doc[0].nodeName == 'HTML') self.css($("body"), {
- 'overflow-y': 'hidden'
- }); //IE7 double scrollbar issue
- }
-
- if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
- "-webkit-overflow-scrolling": "touch"
- }); //force hw acceleration
-
- var cursor = $(document.createElement('div'));
- cursor.css({
- position: "relative",
- top: 0,
- "float": "right",
- width: self.opt.cursorwidth,
- height: "0px",
- 'background-color': self.opt.cursorcolor,
- border: self.opt.cursorborder,
- 'background-clip': 'padding-box',
- '-webkit-border-radius': self.opt.cursorborderradius,
- '-moz-border-radius': self.opt.cursorborderradius,
- 'border-radius': self.opt.cursorborderradius
- });
-
- cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
-
- cursor.addClass('nicescroll-cursors');
-
- self.cursor = cursor;
-
- var rail = $(document.createElement('div'));
- rail.attr('id', self.id);
- rail.addClass('nicescroll-rails nicescroll-rails-vr');
-
- var v, a, kp = ["left","right","top","bottom"]; //**
- for (var n in kp) {
- a = kp[n];
- v = self.opt.railpadding[a];
- (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
- }
-
- rail.append(cursor);
-
- rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
- rail.css({
- width: rail.width + "px",
- 'zIndex': self.zindex,
- "background": self.opt.background,
- cursor: "default"
- });
-
- rail.visibility = true;
- rail.scrollable = true;
-
- rail.align = (self.opt.railalign == "left") ? 0 : 1;
-
- self.rail = rail;
-
- self.rail.drag = false;
-
- var zoom = false;
- if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
- zoom = document.createElement('div');
-
- self.bind(zoom, "click", self.doZoom);
- self.bind(zoom, "mouseenter", function() {
- self.zoom.css('opacity', self.opt.cursoropacitymax);
- });
- self.bind(zoom, "mouseleave", function() {
- self.zoom.css('opacity', self.opt.cursoropacitymin);
- });
-
- self.zoom = $(zoom);
- self.zoom.css({
- "cursor": "pointer",
- 'z-index': self.zindex,
- 'backgroundImage': 'url(' + self.opt.scriptpath + 'zoomico.png)',
- 'height': 18,
- 'width': 18,
- 'backgroundPosition': '0px 0px'
- });
- if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
- if (cap.cantouch && self.opt.gesturezoom) {
- self.ongesturezoom = function(e) {
- if (e.scale > 1.5) self.doZoomIn(e);
- if (e.scale < 0.8) self.doZoomOut(e);
- return self.cancelEvent(e);
- };
- self.bind(self.win, "gestureend", self.ongesturezoom);
- }
- }
-
- // init HORIZ
-
- self.railh = false;
- var railh;
-
- if (self.opt.horizrailenabled) {
-
- self.css(cont, {
- 'overflow-x': 'hidden'
- });
-
- var cursor = $(document.createElement('div'));
- cursor.css({
- position: "absolute",
- top: 0,
- height: self.opt.cursorwidth,
- width: "0px",
- 'background-color': self.opt.cursorcolor,
- border: self.opt.cursorborder,
- 'background-clip': 'padding-box',
- '-webkit-border-radius': self.opt.cursorborderradius,
- '-moz-border-radius': self.opt.cursorborderradius,
- 'border-radius': self.opt.cursorborderradius
- });
-
- if (cap.isieold) cursor.css({'overflow':'hidden'}); //IE6 horiz scrollbar issue
-
- cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
-
- cursor.addClass('nicescroll-cursors');
-
- self.cursorh = cursor;
-
- railh = $(document.createElement('div'));
- railh.attr('id', self.id + '-hr');
- railh.addClass('nicescroll-rails nicescroll-rails-hr');
- railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
- railh.css({
- height: railh.height + "px",
- 'zIndex': self.zindex,
- "background": self.opt.background
- });
-
- railh.append(cursor);
-
- railh.visibility = true;
- railh.scrollable = true;
-
- railh.align = (self.opt.railvalign == "top") ? 0 : 1;
-
- self.railh = railh;
-
- self.railh.drag = false;
-
- }
-
- //
-
- if (self.ispage) {
- rail.css({
- position: "fixed",
- top: "0px",
- height: "100%"
- });
- (rail.align) ? rail.css({
- right: "0px"
- }): rail.css({
- left: "0px"
- });
- self.body.append(rail);
- if (self.railh) {
- railh.css({
- position: "fixed",
- left: "0px",
- width: "100%"
- });
- (railh.align) ? railh.css({
- bottom: "0px"
- }): railh.css({
- top: "0px"
- });
- self.body.append(railh);
- }
- } else {
- if (self.ishwscroll) {
- if (self.win.css('position') == 'static') self.css(self.win, {
- 'position': 'relative'
- });
- var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
- $(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
- if (self.zoom) {
- self.zoom.css({
- position: "absolute",
- top: 1,
- right: 0,
- "margin-right": rail.width + 4
- });
- bd.append(self.zoom);
- }
- rail.css({
- position: "absolute",
- top: 0
- });
- (rail.align) ? rail.css({
- right: 0
- }): rail.css({
- left: 0
- });
- bd.append(rail);
- if (railh) {
- railh.css({
- position: "absolute",
- left: 0,
- bottom: 0
- });
- (railh.align) ? railh.css({
- bottom: 0
- }): railh.css({
- top: 0
- });
- bd.append(railh);
- }
- } else {
- self.isfixed = (self.win.css("position") == "fixed");
- var rlpos = (self.isfixed) ? "fixed" : "absolute";
-
- if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
- if (self.viewport) {
- self.body = self.viewport;
- if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
- "position": "relative"
- });
- }
-
- rail.css({
- position: rlpos
- });
- if (self.zoom) self.zoom.css({
- position: rlpos
- });
- self.updateScrollBar();
- self.body.append(rail);
- if (self.zoom) self.body.append(self.zoom);
- if (self.railh) {
- railh.css({
- position: rlpos
- });
- self.body.append(railh);
- }
- }
-
- if (cap.isios) self.css(self.win, {
- '-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
- '-webkit-touch-callout': 'none'
- }); // prevent grey layer on click
-
- if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
- if (cap.iswebkit && self.opt.disableoutline) self.win.css({"outline": "none"}); // Webkit outline
- //if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO]
-
- }
-
- if (self.opt.autohidemode === false) {
- self.autohidedom = false;
- self.rail.css({
- opacity: self.opt.cursoropacitymax
- });
- if (self.railh) self.railh.css({
- opacity: self.opt.cursoropacitymax
- });
- } else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
- self.autohidedom = $().add(self.rail);
- if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
- if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
- if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
- } else if (self.opt.autohidemode == "scroll") {
- self.autohidedom = $().add(self.rail);
- if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
- } else if (self.opt.autohidemode == "cursor") {
- self.autohidedom = $().add(self.cursor);
- if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
- } else if (self.opt.autohidemode == "hidden") {
- self.autohidedom = false;
- self.hide();
- self.railslocked = false;
- }
-
- if (cap.isie9mobile) {
-
- self.scrollmom = new ScrollMomentumClass2D(self);
-
- self.onmangotouch = function() {
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
-
- if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
-
- var dfy = py - self.mangotouch.sy;
- var dfx = px - self.mangotouch.sx;
- var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
- if (df == 0) return;
-
- var dry = (dfy < 0) ? -1 : 1;
- var drx = (dfx < 0) ? -1 : 1;
-
- var tm = +new Date();
- if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
-
- if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
- self.scrollmom.stop();
- self.scrollmom.reset(px, py);
- self.mangotouch.sy = py;
- self.mangotouch.ly = py;
- self.mangotouch.sx = px;
- self.mangotouch.lx = px;
- self.mangotouch.dry = dry;
- self.mangotouch.drx = drx;
- self.mangotouch.tm = tm;
- } else {
-
- self.scrollmom.stop();
- self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
- self.mangotouch.tm = tm;
-
- var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
- self.mangotouch.ly = py;
- self.mangotouch.lx = px;
-
- if (ds > 2) {
- self.mangotouch.lazy = setTimeout(function() {
- self.mangotouch.lazy = false;
- self.mangotouch.dry = 0;
- self.mangotouch.drx = 0;
- self.mangotouch.tm = 0;
- self.scrollmom.doMomentum(30);
- }, 100);
- }
- }
- };
-
- var top = self.getScrollTop();
- var lef = self.getScrollLeft();
- self.mangotouch = {
- sy: top,
- ly: top,
- dry: 0,
- sx: lef,
- lx: lef,
- drx: 0,
- lazy: false,
- tm: 0
- };
-
- self.bind(self.docscroll, "scroll", self.onmangotouch);
-
- } else {
-
- if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
-
- self.scrollmom = new ScrollMomentumClass2D(self);
-
- self.ontouchstart = function(e) {
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-
- self.hasmoving = false;
-
- if (!self.railslocked) {
-
- var tg;
- if (cap.hasmstouch) {
- tg = (e.target) ? e.target : false;
- while (tg) {
- var nc = $(tg).getNiceScroll();
- if ((nc.length > 0) && (nc[0].me == self.me)) break;
- if (nc.length > 0) return false;
- if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
- tg = (tg.parentNode) ? tg.parentNode : false;
- }
- }
-
- self.cancelScroll();
-
- tg = self.getTarget(e);
-
- if (tg) {
- var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
- if (skp) return self.stopPropagation(e);
- }
-
- if (!("clientX" in e) && ("changedTouches" in e)) {
- e.clientX = e.changedTouches[0].clientX;
- e.clientY = e.changedTouches[0].clientY;
- }
-
- if (self.forcescreen) {
- var le = e;
- e = {
- "original": (e.original) ? e.original : e
- };
- e.clientX = le.screenX;
- e.clientY = le.screenY;
- }
-
- self.rail.drag = {
- x: e.clientX,
- y: e.clientY,
- sx: self.scroll.x,
- sy: self.scroll.y,
- st: self.getScrollTop(),
- sl: self.getScrollLeft(),
- pt: 2,
- dl: false
- };
-
- if (self.ispage || !self.opt.directionlockdeadzone) {
- self.rail.drag.dl = "f";
- } else {
-
- var view = {
- w: $(window).width(),
- h: $(window).height()
- };
-
- var page = {
- w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
- h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
- };
-
- var maxh = Math.max(0, page.h - view.h);
- var maxw = Math.max(0, page.w - view.w);
-
- if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
- else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
- else self.rail.drag.ck = false;
- if (!self.rail.drag.ck) self.rail.drag.dl = "f";
- }
-
- if (self.opt.touchbehavior && self.isiframe && cap.isie) {
- var wp = self.win.position();
- self.rail.drag.x += wp.left;
- self.rail.drag.y += wp.top;
- }
-
- self.hasmoving = false;
- self.lastmouseup = false;
- self.scrollmom.reset(e.clientX, e.clientY);
-
- if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
-
- var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
- if (!ip) {
- if (!self.ispage && cap.hasmousecapture) tg.setCapture();
- if (self.opt.touchbehavior) {
- if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
- tg._onclick = tg.onclick;
- tg.onclick = function(e) {
- if (self.hasmoving) return false;
- tg._onclick.call(this, e);
- };
- }
- return self.cancelEvent(e);
- }
- return self.stopPropagation(e);
- }
-
- if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
- pc = {
- "tg": tg,
- "click": false
- };
- self.preventclick = pc;
- }
-
- }
- }
-
- };
-
- self.ontouchend = function(e) {
- if (!self.rail.drag) return true;
- if (self.rail.drag.pt == 2) {
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
- self.scrollmom.doMomentum();
- self.rail.drag = false;
- if (self.hasmoving) {
- self.lastmouseup = true;
- self.hideCursor();
- if (cap.hasmousecapture) document.releaseCapture();
- if (!cap.cantouch) return self.cancelEvent(e);
- }
- }
- else if (self.rail.drag.pt == 1) {
- return self.onmouseup(e);
- }
-
- };
-
- var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
-
- self.ontouchmove = function(e, byiframe) {
-
- if (!self.rail.drag) return false;
-
- if (e.targetTouches && self.opt.preventmultitouchscrolling) {
- if (e.targetTouches.length > 1) return false; // multitouch
- }
-
- if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
-
- if (self.rail.drag.pt == 2) {
- if (cap.cantouch && (cap.isios) && (typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
-
- self.hasmoving = true;
-
- if (self.preventclick && !self.preventclick.click) {
- self.preventclick.click = self.preventclick.tg.onclick || false;
- self.preventclick.tg.onclick = self.onpreventclick;
- }
-
- var ev = $.extend({
- "original": e
- }, e);
- e = ev;
-
- if (("changedTouches" in e)) {
- e.clientX = e.changedTouches[0].clientX;
- e.clientY = e.changedTouches[0].clientY;
- }
-
- if (self.forcescreen) {
- var le = e;
- e = {
- "original": (e.original) ? e.original : e
- };
- e.clientX = le.screenX;
- e.clientY = le.screenY;
- }
-
- var ofy,ofx;
- ofx = ofy = 0;
-
- if (moveneedoffset && !byiframe) {
- var wp = self.win.position();
- ofx = -wp.left;
- ofy = -wp.top;
- }
-
- var fy = e.clientY + ofy;
- var my = (fy - self.rail.drag.y);
- var fx = e.clientX + ofx;
- var mx = (fx - self.rail.drag.x);
-
- var ny = self.rail.drag.st - my;
-
- if (self.ishwscroll && self.opt.bouncescroll) {
- if (ny < 0) {
- ny = Math.round(ny / 2);
- // fy = 0;
- } else if (ny > self.page.maxh) {
- ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
- // fy = 0;
- }
- } else {
- if (ny < 0) {
- ny = 0;
- fy = 0;
- }
- if (ny > self.page.maxh) {
- ny = self.page.maxh;
- fy = 0;
- }
- }
-
- var nx;
- if (self.railh && self.railh.scrollable) {
- nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
-
- if (self.ishwscroll && self.opt.bouncescroll) {
- if (nx < 0) {
- nx = Math.round(nx / 2);
- // fx = 0;
- } else if (nx > self.page.maxw) {
- nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
- // fx = 0;
- }
- } else {
- if (nx < 0) {
- nx = 0;
- fx = 0;
- }
- if (nx > self.page.maxw) {
- nx = self.page.maxw;
- fx = 0;
- }
- }
-
- }
-
- var grabbed = false;
- if (self.rail.drag.dl) {
- grabbed = true;
- if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
- else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
- } else {
- var ay = Math.abs(my);
- var ax = Math.abs(mx);
- var dz = self.opt.directionlockdeadzone;
- if (self.rail.drag.ck == "v") {
- if (ay > dz && (ax <= (ay * 0.3))) {
- self.rail.drag = false;
- return true;
- } else if (ax > dz) {
- self.rail.drag.dl = "f";
- $("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
- }
- } else if (self.rail.drag.ck == "h") {
- if (ax > dz && (ay <= (ax * 0.3))) {
- self.rail.drag = false;
- return true;
- } else if (ay > dz) {
- self.rail.drag.dl = "f";
- $("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
- }
- }
- }
-
- self.synched("touchmove", function() {
- if (self.rail.drag && (self.rail.drag.pt == 2)) {
- if (self.prepareTransition) self.prepareTransition(0);
- if (self.rail.scrollable) self.setScrollTop(ny);
- self.scrollmom.update(fx, fy);
- if (self.railh && self.railh.scrollable) {
- self.setScrollLeft(nx);
- self.showCursor(ny, nx);
- } else {
- self.showCursor(ny);
- }
- if (cap.isie10) document.selection.clear();
- }
- });
-
- if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
- if (grabbed) return self.cancelEvent(e);
- }
- else if (self.rail.drag.pt == 1) { // drag on cursor
- return self.onmousemove(e);
- }
-
- };
-
- }
-
- self.onmousedown = function(e, hronly) {
- if (self.rail.drag && self.rail.drag.pt != 1) return;
- if (self.railslocked) return self.cancelEvent(e);
- self.cancelScroll();
- self.rail.drag = {
- x: e.clientX,
- y: e.clientY,
- sx: self.scroll.x,
- sy: self.scroll.y,
- pt: 1,
- hr: (!!hronly)
- };
- var tg = self.getTarget(e);
- if (!self.ispage && cap.hasmousecapture) tg.setCapture();
- if (self.isiframe && !cap.hasmousecapture) {
- self.saved.csspointerevents = self.doc.css("pointer-events");
- self.css(self.doc, {
- "pointer-events": "none"
- });
- }
- self.hasmoving = false;
- return self.cancelEvent(e);
- };
-
- self.onmouseup = function(e) {
- if (self.rail.drag) {
- if (self.rail.drag.pt != 1) return true;
- if (cap.hasmousecapture) document.releaseCapture();
- if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
- self.rail.drag = false;
- //if (!self.rail.active) self.hideCursor();
- if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
- return self.cancelEvent(e);
- }
- };
-
- self.onmousemove = function(e) {
- if (self.rail.drag) {
- if (self.rail.drag.pt != 1) return;
-
- if (cap.ischrome && e.which == 0) return self.onmouseup(e);
-
- self.cursorfreezed = true;
- self.hasmoving = true;
-
- if (self.rail.drag.hr) {
- self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
- if (self.scroll.x < 0) self.scroll.x = 0;
- var mw = self.scrollvaluemaxw;
- if (self.scroll.x > mw) self.scroll.x = mw;
- } else {
- self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
- if (self.scroll.y < 0) self.scroll.y = 0;
- var my = self.scrollvaluemax;
- if (self.scroll.y > my) self.scroll.y = my;
- }
-
- self.synched('mousemove', function() {
- if (self.rail.drag && (self.rail.drag.pt == 1)) {
- self.showCursor();
- if (self.rail.drag.hr) {
- if (self.hasreversehr) {
- self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
- } else {
- self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
- }
- }
- else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
- }
- });
-
- return self.cancelEvent(e);
- }
- /*
- else {
- self.checkarea = true;
- }
-*/
- };
-
- if (cap.cantouch || self.opt.touchbehavior) {
-
- self.onpreventclick = function(e) {
- if (self.preventclick) {
- self.preventclick.tg.onclick = self.preventclick.click;
- self.preventclick = false;
- return self.cancelEvent(e);
- }
- }
-
- self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
-
- self.onclick = (cap.isios) ? false : function(e) {
- if (self.lastmouseup) {
- self.lastmouseup = false;
- return self.cancelEvent(e);
- } else {
- return true;
- }
- };
-
- if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
- self.css((self.ispage) ? self.doc : self.win, {
- 'cursor': cap.cursorgrabvalue
- });
- self.css(self.rail, {
- 'cursor': cap.cursorgrabvalue
- });
- }
-
- } else {
-
- var checkSelectionScroll = function(e) {
- if (!self.selectiondrag) return;
-
- if (e) {
- var ww = self.win.outerHeight();
- var df = (e.pageY - self.selectiondrag.top);
- if (df > 0 && df < ww) df = 0;
- if (df >= ww) df -= ww;
- self.selectiondrag.df = df;
- }
- if (self.selectiondrag.df == 0) return;
-
- var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
- self.doScrollBy(rt);
-
- self.debounced("doselectionscroll", function() {
- checkSelectionScroll()
- }, 50);
- };
-
- if ("getSelection" in document) { // A grade - Major browsers
- self.hasTextSelected = function() {
- return (document.getSelection().rangeCount > 0);
- };
- } else if ("selection" in document) { //IE9-
- self.hasTextSelected = function() {
- return (document.selection.type != "None");
- };
- } else {
- self.hasTextSelected = function() { // no support
- return false;
- };
- }
-
- self.onselectionstart = function(e) {
-/* More testing - severe chrome issues
- if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
- self.win.css({'overflow':'auto'});
- setTimeout(function(){
- self.win.css({'overflow':''});
- },10);
- return true;
- }
-*/
- if (self.ispage) return;
- self.selectiondrag = self.win.offset();
- };
-
- self.onselectionend = function(e) {
- self.selectiondrag = false;
- };
- self.onselectiondrag = function(e) {
- if (!self.selectiondrag) return;
- if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
- checkSelectionScroll(e)
- }, 250);
- };
-
-
- }
-
- if (cap.hasw3ctouch) { //IE11+
- self.css(self.rail, {
- 'touch-action': 'none'
- });
- self.css(self.cursor, {
- 'touch-action': 'none'
- });
- self.bind(self.win, "pointerdown", self.ontouchstart);
- self.bind(document, "pointerup", self.ontouchend);
- self.bind(document, "pointermove", self.ontouchmove);
- } else if (cap.hasmstouch) { //IE10
- self.css(self.rail, {
- '-ms-touch-action': 'none'
- });
- self.css(self.cursor, {
- '-ms-touch-action': 'none'
- });
- self.bind(self.win, "MSPointerDown", self.ontouchstart);
- self.bind(document, "MSPointerUp", self.ontouchend);
- self.bind(document, "MSPointerMove", self.ontouchmove);
- self.bind(self.cursor, "MSGestureHold", function(e) {
- e.preventDefault()
- });
- self.bind(self.cursor, "contextmenu", function(e) {
- e.preventDefault()
- });
- } else if (this.istouchcapable) { //desktop with screen touch enabled
- self.bind(self.win, "touchstart", self.ontouchstart);
- self.bind(document, "touchend", self.ontouchend);
- self.bind(document, "touchcancel", self.ontouchend);
- self.bind(document, "touchmove", self.ontouchmove);
- }
-
-
- if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
-
- self.rail.css({
- "cursor": "default"
- });
- self.railh && self.railh.css({
- "cursor": "default"
- });
-
- self.jqbind(self.rail, "mouseenter", function() {
- if (!self.ispage && !self.win.is(":visible")) return false;
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.rail, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
-
- if (self.opt.sensitiverail) {
- self.bind(self.rail, "click", function(e) {
- self.doRailClick(e, false, false)
- });
- self.bind(self.rail, "dblclick", function(e) {
- self.doRailClick(e, true, false)
- });
- self.bind(self.cursor, "click", function(e) {
- self.cancelEvent(e)
- });
- self.bind(self.cursor, "dblclick", function(e) {
- self.cancelEvent(e)
- });
- }
-
- if (self.railh) {
- self.jqbind(self.railh, "mouseenter", function() {
- if (!self.ispage && !self.win.is(":visible")) return false;
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.railh, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
-
- if (self.opt.sensitiverail) {
- self.bind(self.railh, "click", function(e) {
- self.doRailClick(e, false, true)
- });
- self.bind(self.railh, "dblclick", function(e) {
- self.doRailClick(e, true, true)
- });
- self.bind(self.cursorh, "click", function(e) {
- self.cancelEvent(e)
- });
- self.bind(self.cursorh, "dblclick", function(e) {
- self.cancelEvent(e)
- });
- }
-
- }
-
- }
-
- if (!cap.cantouch && !self.opt.touchbehavior) {
-
- self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
- self.bind(document, "mousemove", self.onmousemove);
- if (self.onclick) self.bind(document, "click", self.onclick);
-
- self.bind(self.cursor, "mousedown", self.onmousedown);
- self.bind(self.cursor, "mouseup", self.onmouseup);
-
- if (self.railh) {
- self.bind(self.cursorh, "mousedown", function(e) {
- self.onmousedown(e, true)
- });
- self.bind(self.cursorh, "mouseup", self.onmouseup);
- }
-
- if (!self.ispage && self.opt.enablescrollonselection) {
- self.bind(self.win[0], "mousedown", self.onselectionstart);
- self.bind(document, "mouseup", self.onselectionend);
- self.bind(self.cursor, "mouseup", self.onselectionend);
- if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
- self.bind(document, "mousemove", self.onselectiondrag);
- }
-
- if (self.zoom) {
- self.jqbind(self.zoom, "mouseenter", function() {
- if (self.canshowonmouseevent) self.showCursor();
- self.rail.active = true;
- });
- self.jqbind(self.zoom, "mouseleave", function() {
- self.rail.active = false;
- if (!self.rail.drag) self.hideCursor();
- });
- }
-
- } else {
-
- self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
- self.bind(document, "mousemove", self.ontouchmove);
- if (self.onclick) self.bind(document, "click", self.onclick);
-
- if (self.opt.cursordragontouch) {
- self.bind(self.cursor, "mousedown", self.onmousedown);
- self.bind(self.cursor, "mouseup", self.onmouseup);
- //self.bind(self.cursor, "mousemove", self.onmousemove);
- self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
- self.onmousedown(e, true)
- });
- //self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
- self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
- }
-
- }
-
- if (self.opt.enablemousewheel) {
- if (!self.isiframe) self.bind((cap.isie && self.ispage) ? document : self.win /*self.docscroll*/ , "mousewheel", self.onmousewheel);
- self.bind(self.rail, "mousewheel", self.onmousewheel);
- if (self.railh) self.bind(self.railh, "mousewheel", self.onmousewheelhr);
- }
-
- if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
- if (!self.win.attr("tabindex")) self.win.attr({
- "tabindex": tabindexcounter++
- });
-
- self.jqbind(self.win, "focus", function(e) {
- domfocus = (self.getTarget(e)).id || true;
- self.hasfocus = true;
- if (self.canshowonmouseevent) self.noticeCursor();
- });
- self.jqbind(self.win, "blur", function(e) {
- domfocus = false;
- self.hasfocus = false;
- });
-
- self.jqbind(self.win, "mouseenter", function(e) {
- mousefocus = (self.getTarget(e)).id || true;
- self.hasmousefocus = true;
- if (self.canshowonmouseevent) self.noticeCursor();
- });
- self.jqbind(self.win, "mouseleave", function() {
- mousefocus = false;
- self.hasmousefocus = false;
- if (!self.rail.drag) self.hideCursor();
- });
-
- }
-
- } // !ie9mobile
-
- //Thanks to http://www.quirksmode.org !!
- self.onkeypress = function(e) {
- if (self.railslocked && self.page.maxh == 0) return true;
-
- e = (e) ? e : window.e;
- var tg = self.getTarget(e);
- if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
- var tp = tg.getAttribute('type') || tg.type || false;
- if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
- }
-
- if ($(tg).attr('contenteditable')) return true;
-
- if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
- var key = e.keyCode;
-
- if (self.railslocked && key != 27) return self.cancelEvent(e);
-
- var ctrl = e.ctrlKey || false;
- var shift = e.shiftKey || false;
-
- var ret = false;
- switch (key) {
- case 38:
- case 63233: //safari
- self.doScrollBy(24 * 3);
- ret = true;
- break;
- case 40:
- case 63235: //safari
- self.doScrollBy(-24 * 3);
- ret = true;
- break;
- case 37:
- case 63232: //safari
- if (self.railh) {
- (ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
- ret = true;
- }
- break;
- case 39:
- case 63234: //safari
- if (self.railh) {
- (ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
- ret = true;
- }
- break;
- case 33:
- case 63276: // safari
- self.doScrollBy(self.view.h);
- ret = true;
- break;
- case 34:
- case 63277: // safari
- self.doScrollBy(-self.view.h);
- ret = true;
- break;
- case 36:
- case 63273: // safari
- (self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
- ret = true;
- break;
- case 35:
- case 63275: // safari
- (self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
- ret = true;
- break;
- case 32:
- if (self.opt.spacebarenabled) {
- (shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
- ret = true;
- }
- break;
- case 27: // ESC
- if (self.zoomactive) {
- self.doZoom();
- ret = true;
- }
- break;
- }
- if (ret) return self.cancelEvent(e);
- }
- };
-
- if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
-
- self.bind(document, "keydown", function(e) {
- var ctrl = e.ctrlKey || false;
- if (ctrl) self.wheelprevented = true;
- });
- self.bind(document, "keyup", function(e) {
- var ctrl = e.ctrlKey || false;
- if (!ctrl) self.wheelprevented = false;
- });
- self.bind(window,"blur",function(e){
- self.wheelprevented = false;
- });
-
- self.bind(window, 'resize', self.lazyResize);
- self.bind(window, 'orientationchange', self.lazyResize);
-
- self.bind(window, "load", self.lazyResize);
-
- if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
- var tmp = self.win.attr("style");
- var ww = parseFloat(self.win.css("width")) + 1;
- self.win.css('width', ww);
- self.synched("chromefix", function() {
- self.win.attr("style", tmp)
- });
- }
-
-
- // Trying a cross-browser implementation - good luck!
-
- self.onAttributeChange = function(e) {
- self.lazyResize(self.isieold ? 250 : 30);
- };
-
- if (ClsMutationObserver !== false) {
- self.observerbody = new ClsMutationObserver(function(mutations) {
- mutations.forEach(function(mut){
- if (mut.type=="attributes") {
- return ($("body").hasClass("modal-open")) ? self.hide() : self.show(); // Support for Bootstrap modal
- }
- });
- if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
- });
- self.observerbody.observe(document.body, {
- childList: true,
- subtree: true,
- characterData: false,
- attributes: true,
- attributeFilter: ['class']
- });
- }
-
- if (!self.ispage && !self.haswrapper) {
- // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
- if (ClsMutationObserver !== false) {
- self.observer = new ClsMutationObserver(function(mutations) {
- mutations.forEach(self.onAttributeChange);
- });
- self.observer.observe(self.win[0], {
- childList: true,
- characterData: false,
- attributes: true,
- subtree: false
- });
- self.observerremover = new ClsMutationObserver(function(mutations) {
- mutations.forEach(function(mo) {
- if (mo.removedNodes.length > 0) {
- for (var dd in mo.removedNodes) {
- if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
- }
- }
- });
- });
- self.observerremover.observe(self.win[0].parentNode, {
- childList: true,
- characterData: false,
- attributes: false,
- subtree: false
- });
- } else {
- self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
- if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
- self.bind(self.win, "DOMNodeRemoved", function(e) {
- if (e.target == self.win[0]) self.remove();
- });
- }
- }
-
- //
-
- if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
- if (self.istextarea) self.bind(self.win, "mouseup", self.lazyResize);
-
- // self.checkrtlmode = true;
- self.lazyResize(30);
-
- }
-
- if (this.doc[0].nodeName == 'IFRAME') {
- var oniframeload = function() {
- self.iframexd = false;
- var doc;
- try {
- doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
- var a = doc.domain;
- } catch (e) {
- self.iframexd = true;
- doc = false
- }
-
- if (self.iframexd) {
- if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
- return true; //cross-domain - I can't manage this
- }
-
- self.forcescreen = true;
-
- if (self.isiframe) {
- self.iframe = {
- "doc": $(doc),
- "html": self.doc.contents().find('html')[0],
- "body": self.doc.contents().find('body')[0]
- };
- self.getContentSize = function() {
- return {
- w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
- h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
- };
- };
- self.docscroll = $(self.iframe.body); //$(this.contentWindow);
- }
-
- if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
- self.win.scrollTop(0); // reset position
- self.doc.height(""); //reset height to fix browser bug
- var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
- self.doc.height(hh);
- }
- self.lazyResize(30);
-
- if (cap.isie7) self.css($(self.iframe.html), {
- 'overflow-y': 'hidden'
- });
- self.css($(self.iframe.body), {
- 'overflow-y': 'hidden'
- });
-
- if (cap.isios && self.haswrapper) {
- self.css($(doc.body), {
- '-webkit-transform': 'translate3d(0,0,0)'
- }); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
- }
-
- if ('contentWindow' in this) {
- self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
- } else {
- self.bind(doc, "scroll", self.onscroll);
- }
-
- if (self.opt.enablemousewheel) {
- self.bind(doc, "mousewheel", self.onmousewheel);
- }
-
- if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
-
- if (cap.cantouch || self.opt.touchbehavior) {
- self.bind(doc, "mousedown", self.ontouchstart);
- self.bind(doc, "mousemove", function(e) {
- return self.ontouchmove(e, true)
- });
- if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
- 'cursor': cap.cursorgrabvalue
- });
- }
-
- self.bind(doc, "mouseup", self.ontouchend);
-
- if (self.zoom) {
- if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
- if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
- }
- };
-
- if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
- setTimeout(function() {
- oniframeload.call(self.doc[0], false)
- }, 500);
- }
- self.bind(this.doc, "load", oniframeload);
-
- }
-
- };
-
- this.showCursor = function(py, px) {
- if (self.cursortimeout) {
- clearTimeout(self.cursortimeout);
- self.cursortimeout = 0;
- }
- if (!self.rail) return;
- if (self.autohidedom) {
- self.autohidedom.stop().css({
- opacity: self.opt.cursoropacitymax
- });
- self.cursoractive = true;
- }
-
- if (!self.rail.drag || self.rail.drag.pt != 1) {
- if ((typeof py != "undefined") && (py !== false)) {
- self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
- }
- if (typeof px != "undefined") {
- self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
- }
- }
-
- self.cursor.css({
- height: self.cursorheight,
- top: self.scroll.y
- });
- if (self.cursorh) {
- var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
- (!self.rail.align && self.rail.visibility) ? self.cursorh.css({
- width: self.cursorwidth,
- left: lx + self.rail.width
- }): self.cursorh.css({
- width: self.cursorwidth,
- left: lx
- });
- self.cursoractive = true;
- }
-
- if (self.zoom) self.zoom.stop().css({
- opacity: self.opt.cursoropacitymax
- });
- };
-
- this.hideCursor = function(tm) {
- if (self.cursortimeout) return;
- if (!self.rail) return;
- if (!self.autohidedom) return;
- if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
- self.cursortimeout = setTimeout(function() {
- if (!self.rail.active || !self.showonmouseevent) {
- self.autohidedom.stop().animate({
- opacity: self.opt.cursoropacitymin
- });
- if (self.zoom) self.zoom.stop().animate({
- opacity: self.opt.cursoropacitymin
- });
- self.cursoractive = false;
- }
- self.cursortimeout = 0;
- }, tm || self.opt.hidecursordelay);
- };
-
- this.noticeCursor = function(tm, py, px) {
- self.showCursor(py, px);
- if (!self.rail.active) self.hideCursor(tm);
- };
-
- this.getContentSize =
- (self.ispage) ?
- function() {
- return {
- w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
- h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
- }
- } : (self.haswrapper) ?
- function() {
- return {
- w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
- h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
- }
- } : function() {
- return {
- w: self.docscroll[0].scrollWidth,
- h: self.docscroll[0].scrollHeight
- }
- };
-
- this.onResize = function(e, page) {
-
- if (!self || !self.win) return false;
-
- if (!self.haswrapper && !self.ispage) {
- if (self.win.css('display') == 'none') {
- if (self.visibility) self.hideRail().hideRailHr();
- return false;
- } else {
- if (!self.hidden && !self.visibility) self.showRail().showRailHr();
- }
- }
-
- var premaxh = self.page.maxh;
- var premaxw = self.page.maxw;
-
- var preview = {
- h: self.view.h,
- w: self.view.w
- };
-
- self.view = {
- w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
- h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
- };
-
- self.page = (page) ? page : self.getContentSize();
-
- self.page.maxh = Math.max(0, self.page.h - self.view.h);
- self.page.maxw = Math.max(0, self.page.w - self.view.w);
-
- if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
- // test position
- if (!self.ispage) {
- var pos = self.win.offset();
- if (self.lastposition) {
- var lst = self.lastposition;
- if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
- }
- self.lastposition = pos;
- } else {
- return self; //nothing to do
- }
- }
-
- if (self.page.maxh == 0) {
- self.hideRail();
- self.scrollvaluemax = 0;
- self.scroll.y = 0;
- self.scrollratio.y = 0;
- self.cursorheight = 0;
- self.setScrollTop(0);
- self.rail.scrollable = false;
- } else {
- self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
- self.rail.scrollable = true;
- }
-
- if (self.page.maxw == 0) {
- self.hideRailHr();
- self.scrollvaluemaxw = 0;
- self.scroll.x = 0;
- self.scrollratio.x = 0;
- self.cursorwidth = 0;
- self.setScrollLeft(0);
- self.railh.scrollable = false;
- } else {
- self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //**
- self.railh.scrollable = true;
- }
-
- self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
- if (self.railslocked) {
- if (!self.ispage) self.updateScrollBar(self.view);
- return false;
- }
-
- if (!self.hidden && !self.visibility) {
- self.showRail().showRailHr();
- }
- else if (!self.hidden && !self.railh.visibility) self.showRailHr();
-
- if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
-
- self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
- self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
-
- self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
- self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
-
- self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
-
- if (self.railh) {
- self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
- self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //**
- }
-
- /*
- if (self.checkrtlmode&&self.railh) {
- self.checkrtlmode = false;
- if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
- }
-*/
-
- if (!self.ispage) self.updateScrollBar(self.view);
-
- self.scrollratio = {
- x: (self.page.maxw / self.scrollvaluemaxw),
- y: (self.page.maxh / self.scrollvaluemax)
- };
-
- var sy = self.getScrollTop();
- if (sy > self.page.maxh) {
- self.doScrollTop(self.page.maxh);
- } else {
- self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
- self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
- if (self.cursoractive) self.noticeCursor();
- }
-
- if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
-
- return self;
- };
-
- this.resize = self.onResize;
-
- this.lazyResize = function(tm) { // event debounce
- tm = (isNaN(tm)) ? 30 : tm;
- self.debounced('resize', self.resize, tm);
- return self;
- };
-
- // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
- function _modernWheelEvent(dom, name, fn, bubble) {
- self._bind(dom, name, function(e) {
- var e = (e) ? e : window.event;
- var event = {
- original: e,
- target: e.target || e.srcElement,
- type: "wheel",
- deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
- deltaX: 0,
- deltaZ: 0,
- preventDefault: function() {
- e.preventDefault ? e.preventDefault() : e.returnValue = false;
- return false;
- },
- stopImmediatePropagation: function() {
- (e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
- }
- };
-
- if (name == "mousewheel") {
- event.deltaY = -1 / 40 * e.wheelDelta;
- e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
- } else {
- event.deltaY = e.detail;
- }
-
- return fn.call(dom, event);
- }, bubble);
- };
-
-
-
- this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
- self.events.push({
- e: dom,
- n: name,
- f: fn,
- q: true
- });
- $(dom).bind(name, fn);
- };
-
- this.bind = function(dom, name, fn, bubble) { // touch-oriented & fixing jquery bind
- var el = ("jquery" in dom) ? dom[0] : dom;
-
- if (name == 'mousewheel') {
- if (window.addEventListener||'onwheel' in document) { // modern brosers & IE9 detection fix
- self._bind(el, "wheel", fn, bubble || false);
- } else {
- var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
- _modernWheelEvent(el, wname, fn, bubble || false);
- if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
- }
- } else if (el.addEventListener) {
- if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
- var tt = (name == 'mousedown') ? 'touchstart' : (name == 'mouseup') ? 'touchend' : 'touchmove';
- self._bind(el, tt, function(e) {
- if (e.touches) {
- if (e.touches.length < 2) {
- var ev = (e.touches.length) ? e.touches[0] : e;
- ev.original = e;
- fn.call(this, ev);
- }
- } else if (e.changedTouches) {
- var ev = e.changedTouches[0];
- ev.original = e;
- fn.call(this, ev);
- } //blackberry
- }, bubble || false);
- }
- self._bind(el, name, fn, bubble || false);
- if (cap.cantouch && name == "mouseup") self._bind(el, "touchcancel", fn, bubble || false);
- } else {
- self._bind(el, name, function(e) {
- e = e || window.event || false;
- if (e) {
- if (e.srcElement) e.target = e.srcElement;
- }
- if (!("pageY" in e)) {
- e.pageX = e.clientX + document.documentElement.scrollLeft;
- e.pageY = e.clientY + document.documentElement.scrollTop;
- }
- return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
- });
- }
- };
-
- if (cap.haseventlistener) { // W3C standard model
- this._bind = function(el, name, fn, bubble) { // primitive bind
- self.events.push({
- e: el,
- n: name,
- f: fn,
- b: bubble,
- q: false
- });
- el.addEventListener(name, fn, bubble || false);
- };
- this.cancelEvent = function(e) {
- if (!e) return false;
- var e = (e.original) ? e.original : e;
- e.preventDefault();
- e.stopPropagation();
- if (e.preventManipulation) e.preventManipulation(); //IE10
- return false;
- };
- this.stopPropagation = function(e) {
- if (!e) return false;
- var e = (e.original) ? e.original : e;
- e.stopPropagation();
- return false;
- };
- this._unbind = function(el, name, fn, bub) { // primitive unbind
- el.removeEventListener(name, fn, bub);
- };
- } else { // old IE model
- this._bind = function(el, name, fn, bubble) { // primitive bind
- self.events.push({
- e: el,
- n: name,
- f: fn,
- b: bubble,
- q: false
- });
- if (el.attachEvent) {
- el.attachEvent("on" + name, fn);
- } else {
- el["on" + name] = fn;
- }
- };
- // Thanks to http://www.switchonthecode.com !!
- this.cancelEvent = function(e) {
- var e = window.event || false;
- if (!e) return false;
- e.cancelBubble = true;
- e.cancel = true;
- e.returnValue = false;
- return false;
- };
- this.stopPropagation = function(e) {
- var e = window.event || false;
- if (!e) return false;
- e.cancelBubble = true;
- return false;
- };
- this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
- if (el.detachEvent) {
- el.detachEvent('on' + name, fn);
- } else {
- el['on' + name] = false;
- }
- };
- }
-
- this.unbindAll = function() {
- for (var a = 0; a < self.events.length; a++) {
- var r = self.events[a];
- (r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
- }
- };
-
- this.showRail = function() {
- if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
- self.visibility = true;
- self.rail.visibility = true;
- self.rail.css('display', 'block');
- }
- return self;
- };
-
- this.showRailHr = function() {
- if (!self.railh) return self;
- if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
- self.railh.visibility = true;
- self.railh.css('display', 'block');
- }
- return self;
- };
-
- this.hideRail = function() {
- self.visibility = false;
- self.rail.visibility = false;
- self.rail.css('display', 'none');
- return self;
- };
-
- this.hideRailHr = function() {
- if (!self.railh) return self;
- self.railh.visibility = false;
- self.railh.css('display', 'none');
- return self;
- };
-
- this.show = function() {
- self.hidden = false;
- self.railslocked = false;
- return self.showRail().showRailHr();
- };
-
- this.hide = function() {
- self.hidden = true;
- self.railslocked = true;
- return self.hideRail().hideRailHr();
- };
-
- this.toggle = function() {
- return (self.hidden) ? self.show() : self.hide();
- };
-
- this.remove = function() {
- self.stop();
- if (self.cursortimeout) clearTimeout(self.cursortimeout);
- self.doZoomOut();
- self.unbindAll();
-
- if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
-
- if (self.observer !== false) self.observer.disconnect();
- if (self.observerremover !== false) self.observerremover.disconnect();
- if (self.observerbody !== false) self.observerbody.disconnect();
-
- self.events = null;
-
- if (self.cursor) {
- self.cursor.remove();
- }
- if (self.cursorh) {
- self.cursorh.remove();
- }
- if (self.rail) {
- self.rail.remove();
- }
- if (self.railh) {
- self.railh.remove();
- }
- if (self.zoom) {
- self.zoom.remove();
- }
- for (var a = 0; a < self.saved.css.length; a++) {
- var d = self.saved.css[a];
- d[0].css(d[1], (typeof d[2] == "undefined") ? '' : d[2]);
- }
- self.saved = false;
- self.me.data('__nicescroll', ''); //erase all traces
-
- // memory leak fixed by GianlucaGuarini - thanks a lot!
- // remove the current nicescroll from the $.nicescroll array & normalize array
- var lst = $.nicescroll;
- lst.each(function(i) {
- if (!this) return;
- if (this.id === self.id) {
- delete lst[i];
- for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
- lst.length--;
- if (lst.length) delete lst[lst.length];
- }
- });
-
- for (var i in self) {
- self[i] = null;
- delete self[i];
- }
-
- self = null;
-
- };
-
- this.scrollstart = function(fn) {
- this.onscrollstart = fn;
- return self;
- };
- this.scrollend = function(fn) {
- this.onscrollend = fn;
- return self;
- };
- this.scrollcancel = function(fn) {
- this.onscrollcancel = fn;
- return self;
- };
-
- this.zoomin = function(fn) {
- this.onzoomin = fn;
- return self;
- };
- this.zoomout = function(fn) {
- this.onzoomout = fn;
- return self;
- };
-
- this.isScrollable = function(e) {
- var dom = (e.target) ? e.target : e;
- if (dom.nodeName == 'OPTION') return true;
- while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
- var dd = $(dom);
- var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
- if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
- dom = (dom.parentNode) ? dom.parentNode : false;
- }
- return false;
- };
-
- this.getViewport = function(me) {
- var dom = (me && me.parentNode) ? me.parentNode : false;
- while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
- var dd = $(dom);
- if (/fixed|absolute/.test(dd.css("position"))) return dd;
- var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
- if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
- if (dd.getNiceScroll().length > 0) return dd;
- dom = (dom.parentNode) ? dom.parentNode : false;
- }
- return false; //(dom) ? $(dom) : false;
- };
-
- this.triggerScrollEnd = function() {
- if (!self.onscrollend) return;
-
- var px = self.getScrollLeft();
- var py = self.getScrollTop();
-
- var info = {
- "type": "scrollend",
- "current": {
- "x": px,
- "y": py
- },
- "end": {
- "x": px,
- "y": py
- }
- };
- self.onscrollend.call(self, info);
- }
-
- function execScrollWheel(e, hr, chkscroll) {
- var px, py;
-
- if (e.deltaMode == 0) { // PIXEL
- px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
- py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
- } else if (e.deltaMode == 1) { // LINE
- px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
- py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
- }
-
- if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
- px = py;
- py = 0;
-
- if (chkscroll) {
- var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
- if (hrend) { // preserve vertical scrolling
- py = px;
- px = 0;
- }
- }
-
- }
-
- if (px) {
- if (self.scrollmom) {
- self.scrollmom.stop()
- }
- self.lastdeltax += px;
- self.debounced("mousewheelx", function() {
- var dt = self.lastdeltax;
- self.lastdeltax = 0;
- if (!self.rail.drag) {
- self.doScrollLeftBy(dt)
- }
- }, 15);
- }
- if (py) {
- if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
- if (py < 0) {
- if (self.getScrollTop() >= self.page.maxh) return true;
- } else {
- if (self.getScrollTop() <= 0) return true;
- }
- }
- if (self.scrollmom) {
- self.scrollmom.stop()
- }
- self.lastdeltay += py;
- self.debounced("mousewheely", function() {
- var dt = self.lastdeltay;
- self.lastdeltay = 0;
- if (!self.rail.drag) {
- self.doScrollBy(dt)
- }
- }, 15);
- }
-
- e.stopImmediatePropagation();
- return e.preventDefault();
- };
-
- this.onmousewheel = function(e) {
- if (self.wheelprevented) return;
- if (self.railslocked) {
- self.debounced("checkunlock", self.resize, 250);
- return true;
- }
- if (self.rail.drag) return self.cancelEvent(e);
-
- if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
-
- if (self.opt.oneaxismousemode && e.deltaX == 0) {
- if (!self.rail.scrollable) {
- if (self.railh && self.railh.scrollable) {
- return self.onmousewheelhr(e);
- } else {
- return true;
- }
- }
- }
-
- var nw = +(new Date());
- var chk = false;
- if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
- self.nativescrollingarea = self.isScrollable(e);
- chk = true;
- }
- self.checkarea = nw;
- if (self.nativescrollingarea) return true; // this isn't my business
- var ret = execScrollWheel(e, false, chk);
- if (ret) self.checkarea = 0;
- return ret;
- };
-
- this.onmousewheelhr = function(e) {
- if (self.wheelprevented) return;
- if (self.railslocked || !self.railh.scrollable) return true;
- if (self.rail.drag) return self.cancelEvent(e);
-
- var nw = +(new Date());
- var chk = false;
- if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
- self.nativescrollingarea = self.isScrollable(e);
- chk = true;
- }
- self.checkarea = nw;
- if (self.nativescrollingarea) return true; // this isn't my business
- if (self.railslocked) return self.cancelEvent(e);
-
- return execScrollWheel(e, true, chk);
- };
-
- this.stop = function() {
- self.cancelScroll();
- if (self.scrollmon) self.scrollmon.stop();
- self.cursorfreezed = false;
- self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
- self.noticeCursor();
- return self;
- };
-
- this.getTransitionSpeed = function(dif) {
- var sp = Math.round(self.opt.scrollspeed * 10);
- var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
- return (ex > 20) ? ex : 0;
- };
-
- if (!self.opt.smoothscroll) {
- this.doScrollLeft = function(x, spd) { //direct
- var y = self.getScrollTop();
- self.doScrollPos(x, y, spd);
- };
- this.doScrollTop = function(y, spd) { //direct
- var x = self.getScrollLeft();
- self.doScrollPos(x, y, spd);
- };
- this.doScrollPos = function(x, y, spd) { //direct
- var nx = (x > self.page.maxw) ? self.page.maxw : x;
- if (nx < 0) nx = 0;
- var ny = (y > self.page.maxh) ? self.page.maxh : y;
- if (ny < 0) ny = 0;
- self.synched('scroll', function() {
- self.setScrollTop(ny);
- self.setScrollLeft(nx);
- });
- };
- this.cancelScroll = function() {}; // direct
- } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
- this.prepareTransition = function(dif, istime) {
- var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
- var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
- if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
- self.lasttransitionstyle = trans;
- self.doc.css(cap.transitionstyle, trans);
- }
- return ex;
- };
-
- this.doScrollLeft = function(x, spd) { //trans
- var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
- self.doScrollPos(x, y, spd);
- };
-
- this.doScrollTop = function(y, spd) { //trans
- var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
- self.doScrollPos(x, y, spd);
- };
-
- this.doScrollPos = function(x, y, spd) { //trans
-
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
-
- if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
-
- if (self.opt.bouncescroll == false) {
- if (y < 0) y = 0;
- else if (y > self.page.maxh) y = self.page.maxh;
- if (x < 0) x = 0;
- else if (x > self.page.maxw) x = self.page.maxw;
- }
-
- if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
-
- self.newscrolly = y;
- self.newscrollx = x;
-
- self.newscrollspeed = spd || false;
-
- if (self.timer) return false;
-
- self.timer = setTimeout(function() {
-
- var top = self.getScrollTop();
- var lft = self.getScrollLeft();
-
- var dst = {};
- dst.x = x - lft;
- dst.y = y - top;
- dst.px = lft;
- dst.py = top;
-
- var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
- var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
- if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
-
- self.prepareTransition(ms, true);
-
- if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
-
- if (ms > 0) {
-
- if (!self.scrollrunning && self.onscrollstart) {
- var info = {
- "type": "scrollstart",
- "current": {
- "x": lft,
- "y": top
- },
- "request": {
- "x": x,
- "y": y
- },
- "end": {
- "x": self.newscrollx,
- "y": self.newscrolly
- },
- "speed": ms
- };
- self.onscrollstart.call(self, info);
- }
-
- if (cap.transitionend) {
- if (!self.scrollendtrapped) {
- self.scrollendtrapped = true;
- self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
- }
- } else {
- if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
- self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
- }
-
- var py = top;
- var px = lft;
- self.timerscroll = {
- bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
- bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
- };
- if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
- self.showCursor(self.getScrollTop(), self.getScrollLeft())
- }, 60);
-
- }
-
- self.synched("doScroll-set", function() {
- self.timer = 0;
- if (self.scrollendtrapped) self.scrollrunning = true;
- self.setScrollTop(self.newscrolly);
- self.setScrollLeft(self.newscrollx);
- if (!self.scrollendtrapped) self.onScrollTransitionEnd();
- });
-
-
- }, 50);
-
- };
-
- this.cancelScroll = function() {
- if (!self.scrollendtrapped) return true;
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
- self.scrollrunning = false;
- if (!cap.transitionend) clearTimeout(cap.transitionend);
- self.scrollendtrapped = false;
- self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
- self.prepareTransition(0);
- self.setScrollTop(py); // fire event onscroll
- if (self.railh) self.setScrollLeft(px);
- if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
- self.timerscroll = false;
-
- self.cursorfreezed = false;
-
- self.showCursor(py, px);
- return self;
- };
- this.onScrollTransitionEnd = function() {
- if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
- self.scrollendtrapped = false;
- self.prepareTransition(0);
- if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
- self.timerscroll = false;
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
- self.setScrollTop(py); // fire event onscroll
- if (self.railh) self.setScrollLeft(px); // fire event onscroll left
-
- self.noticeCursor(false, py, px);
-
- self.cursorfreezed = false;
-
- if (py < 0) py = 0
- else if (py > self.page.maxh) py = self.page.maxh;
- if (px < 0) px = 0
- else if (px > self.page.maxw) px = self.page.maxw;
- if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
-
- if (self.onscrollend && self.scrollrunning) {
- self.triggerScrollEnd();
- }
- self.scrollrunning = false;
-
- };
-
- } else {
-
- this.doScrollLeft = function(x, spd) { //no-trans
- var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
- self.doScrollPos(x, y, spd);
- };
-
- this.doScrollTop = function(y, spd) { //no-trans
- var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
- self.doScrollPos(x, y, spd);
- };
-
- this.doScrollPos = function(x, y, spd) { //no-trans
- var y = ((typeof y == "undefined") || (y === false)) ? self.getScrollTop(true) : y;
-
- if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
-
- if (self.timer) clearAnimationFrame(self.timer);
- self.timer = 0;
-
- var py = self.getScrollTop();
- var px = self.getScrollLeft();
-
- if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
-
- self.newscrolly = y;
- self.newscrollx = x;
-
- if (!self.bouncescroll || !self.rail.visibility) {
- if (self.newscrolly < 0) {
- self.newscrolly = 0;
- } else if (self.newscrolly > self.page.maxh) {
- self.newscrolly = self.page.maxh;
- }
- }
- if (!self.bouncescroll || !self.railh.visibility) {
- if (self.newscrollx < 0) {
- self.newscrollx = 0;
- } else if (self.newscrollx > self.page.maxw) {
- self.newscrollx = self.page.maxw;
- }
- }
-
- self.dst = {};
- self.dst.x = x - px;
- self.dst.y = y - py;
- self.dst.px = px;
- self.dst.py = py;
-
- var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
-
- self.dst.ax = self.dst.x / dst;
- self.dst.ay = self.dst.y / dst;
-
- var pa = 0;
- var pe = dst;
-
- if (self.dst.x == 0) {
- pa = py;
- pe = y;
- self.dst.ay = 1;
- self.dst.py = 0;
- } else if (self.dst.y == 0) {
- pa = px;
- pe = x;
- self.dst.ax = 1;
- self.dst.px = 0;
- }
-
- var ms = self.getTransitionSpeed(dst);
- if (spd && spd <= 1) ms *= spd;
- if (ms > 0) {
- self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
- } else {
- self.bzscroll = false;
- }
-
- if (self.timer) return;
-
- if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
-
- var sync = 1;
-
- function scrolling() {
- if (self.cancelAnimationFrame) return true;
-
- self.scrollrunning = true;
-
- sync = 1 - sync;
- if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
-
- var done = 0;
- var sx, sy;
-
- var sc = sy = self.getScrollTop();
- if (self.dst.ay) {
- sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
- var dr = sc - sy;
- if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
- self.setScrollTop(sc);
- if (sc == self.newscrolly) done = 1;
- } else {
- done = 1;
- }
-
- var scx = sx = self.getScrollLeft();
- if (self.dst.ax) {
- scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
- var dr = scx - sx;
- if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
- self.setScrollLeft(scx);
- if (scx == self.newscrollx) done += 1;
- } else {
- done += 1;
- }
-
- if (done == 2) {
- self.timer = 0;
- self.cursorfreezed = false;
- self.bzscroll = false;
- self.scrollrunning = false;
- if (sc < 0) sc = 0;
- else if (sc > self.page.maxh) sc = self.page.maxh;
- if (scx < 0) scx = 0;
- else if (scx > self.page.maxw) scx = self.page.maxw;
- if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
- else {
- if (self.onscrollend) {
- self.triggerScrollEnd();
- }
- }
- } else {
- self.timer = setAnimationFrame(scrolling) || 1;
- }
- };
- self.cancelAnimationFrame = false;
- self.timer = 1;
-
- if (self.onscrollstart && !self.scrollrunning) {
- var info = {
- "type": "scrollstart",
- "current": {
- "x": px,
- "y": py
- },
- "request": {
- "x": x,
- "y": y
- },
- "end": {
- "x": self.newscrollx,
- "y": self.newscrolly
- },
- "speed": ms
- };
- self.onscrollstart.call(self, info);
- }
-
- scrolling();
-
- if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
-
- self.noticeCursor();
- };
-
- this.cancelScroll = function() {
- if (self.timer) clearAnimationFrame(self.timer);
- self.timer = 0;
- self.bzscroll = false;
- self.scrollrunning = false;
- return self;
- };
-
- }
-
- this.doScrollBy = function(stp, relative) {
- var ny = 0;
- if (relative) {
- ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
- } else {
- var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
- ny = sy - stp;
- }
- if (self.bouncescroll) {
- var haf = Math.round(self.view.h / 2);
- if (ny < -haf) ny = -haf
- else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
- }
- self.cursorfreezed = false;
-
- var py = self.getScrollTop(true);
- if (ny < 0 && py <= 0) return self.noticeCursor();
- else if (ny > self.page.maxh && py >= self.page.maxh) {
- self.checkContentSize();
- return self.noticeCursor();
- }
-
- self.doScrollTop(ny);
- };
-
- this.doScrollLeftBy = function(stp, relative) {
- var nx = 0;
- if (relative) {
- nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
- } else {
- var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
- nx = sx - stp;
- }
- if (self.bouncescroll) {
- var haf = Math.round(self.view.w / 2);
- if (nx < -haf) nx = -haf;
- else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
- }
- self.cursorfreezed = false;
-
- var px = self.getScrollLeft(true);
- if (nx < 0 && px <= 0) return self.noticeCursor();
- else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
-
- self.doScrollLeft(nx);
- };
-
- this.doScrollTo = function(pos, relative) {
- var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
- if (ny < 0) ny = 0;
- else if (ny > self.page.maxh) ny = self.page.maxh;
- self.cursorfreezed = false;
- self.doScrollTop(pos);
- };
-
- this.checkContentSize = function() {
- var pg = self.getContentSize();
- if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
- };
-
- self.onscroll = function(e) {
- if (self.rail.drag) return;
- if (!self.cursorfreezed) {
- self.synched('scroll', function() {
- self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
- if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
- self.noticeCursor();
- });
- }
- };
- self.bind(self.docscroll, "scroll", self.onscroll);
-
- this.doZoomIn = function(e) {
- if (self.zoomactive) return;
- self.zoomactive = true;
-
- self.zoomrestore = {
- style: {}
- };
- var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
- var win = self.win[0].style;
- for (var a in lst) {
- var pp = lst[a];
- self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
- }
-
- self.zoomrestore.style.width = self.win.css('width');
- self.zoomrestore.style.height = self.win.css('height');
-
- self.zoomrestore.padding = {
- w: self.win.outerWidth() - self.win.width(),
- h: self.win.outerHeight() - self.win.height()
- };
-
- if (cap.isios4) {
- self.zoomrestore.scrollTop = $(window).scrollTop();
- $(window).scrollTop(0);
- }
-
- self.win.css({
- "position": (cap.isios4) ? "absolute" : "fixed",
- "top": 0,
- "left": 0,
- "z-index": globalmaxzindex + 100,
- "margin": "0px"
- });
- var bkg = self.win.css("backgroundColor");
- if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
- self.rail.css({
- "z-index": globalmaxzindex + 101
- });
- self.zoom.css({
- "z-index": globalmaxzindex + 102
- });
- self.zoom.css('backgroundPosition', '0px -18px');
- self.resizeZoom();
-
- if (self.onzoomin) self.onzoomin.call(self);
-
- return self.cancelEvent(e);
- };
-
- this.doZoomOut = function(e) {
- if (!self.zoomactive) return;
- self.zoomactive = false;
-
- self.win.css("margin", "");
- self.win.css(self.zoomrestore.style);
-
- if (cap.isios4) {
- $(window).scrollTop(self.zoomrestore.scrollTop);
- }
-
- self.rail.css({
- "z-index": self.zindex
- });
- self.zoom.css({
- "z-index": self.zindex
- });
- self.zoomrestore = false;
- self.zoom.css('backgroundPosition', '0px 0px');
- self.onResize();
-
- if (self.onzoomout) self.onzoomout.call(self);
-
- return self.cancelEvent(e);
- };
-
- this.doZoom = function(e) {
- return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
- };
-
- this.resizeZoom = function() {
- if (!self.zoomactive) return;
-
- var py = self.getScrollTop(); //preserve scrolling position
- self.win.css({
- width: $(window).width() - self.zoomrestore.padding.w + "px",
- height: $(window).height() - self.zoomrestore.padding.h + "px"
- });
- self.onResize();
-
- self.setScrollTop(Math.min(self.page.maxh, py));
- };
-
- this.init();
-
- $.nicescroll.push(this);
-
- };
-
- // Inspired by the work of Kin Blas
- // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
-
-
- var ScrollMomentumClass2D = function(nc) {
- var self = this;
- this.nc = nc;
-
- this.lastx = 0;
- this.lasty = 0;
- this.speedx = 0;
- this.speedy = 0;
- this.lasttime = 0;
- this.steptime = 0;
- this.snapx = false;
- this.snapy = false;
- this.demulx = 0;
- this.demuly = 0;
-
- this.lastscrollx = -1;
- this.lastscrolly = -1;
-
- this.chkx = 0;
- this.chky = 0;
-
- this.timer = 0;
-
- this.time = function() {
- return +new Date(); //beautifull hack
- };
-
- this.reset = function(px, py) {
- self.stop();
- var now = self.time();
- self.steptime = 0;
- self.lasttime = now;
- self.speedx = 0;
- self.speedy = 0;
- self.lastx = px;
- self.lasty = py;
- self.lastscrollx = -1;
- self.lastscrolly = -1;
- };
-
- this.update = function(px, py) {
- var now = self.time();
- self.steptime = now - self.lasttime;
- self.lasttime = now;
- var dy = py - self.lasty;
- var dx = px - self.lastx;
- var sy = self.nc.getScrollTop();
- var sx = self.nc.getScrollLeft();
- var newy = sy + dy;
- var newx = sx + dx;
- self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
- self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
- self.speedx = dx;
- self.speedy = dy;
- self.lastx = px;
- self.lasty = py;
- };
-
- this.stop = function() {
- self.nc.unsynched("domomentum2d");
- if (self.timer) clearTimeout(self.timer);
- self.timer = 0;
- self.lastscrollx = -1;
- self.lastscrolly = -1;
- };
-
- this.doSnapy = function(nx, ny) {
- var snap = false;
-
- if (ny < 0) {
- ny = 0;
- snap = true;
- } else if (ny > self.nc.page.maxh) {
- ny = self.nc.page.maxh;
- snap = true;
- }
-
- if (nx < 0) {
- nx = 0;
- snap = true;
- } else if (nx > self.nc.page.maxw) {
- nx = self.nc.page.maxw;
- snap = true;
- }
-
- (snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
- };
-
- this.doMomentum = function(gp) {
- var t = self.time();
- var l = (gp) ? t + gp : self.lasttime;
-
- var sl = self.nc.getScrollLeft();
- var st = self.nc.getScrollTop();
-
- var pageh = self.nc.page.maxh;
- var pagew = self.nc.page.maxw;
-
- self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
- self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
-
- var chk = l && (t - l) <= 60;
-
- if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
-
- var sy = (self.speedy && chk) ? self.speedy : false;
- var sx = (self.speedx && chk) ? self.speedx : false;
-
- if (sy || sx) {
- var tm = Math.max(16, self.steptime); //timeout granularity
-
- if (tm > 50) { // do smooth
- var xm = tm / 50;
- self.speedx *= xm;
- self.speedy *= xm;
- tm = 50;
- }
-
- self.demulxy = 0;
-
- self.lastscrollx = self.nc.getScrollLeft();
- self.chkx = self.lastscrollx;
- self.lastscrolly = self.nc.getScrollTop();
- self.chky = self.lastscrolly;
-
- var nx = self.lastscrollx;
- var ny = self.lastscrolly;
-
- var onscroll = function() {
- var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
-
- if (self.speedx) {
- nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
- self.lastscrollx = nx;
- if ((nx < 0) || (nx > pagew)) df = 0.10;
- }
-
- if (self.speedy) {
- ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
- self.lastscrolly = ny;
- if ((ny < 0) || (ny > pageh)) df = 0.10;
- }
-
- self.demulxy = Math.min(1, self.demulxy + df);
-
- self.nc.synched("domomentum2d", function() {
-
- if (self.speedx) {
- var scx = self.nc.getScrollLeft();
- if (scx != self.chkx) self.stop();
- self.chkx = nx;
- self.nc.setScrollLeft(nx);
- }
-
- if (self.speedy) {
- var scy = self.nc.getScrollTop();
- if (scy != self.chky) self.stop();
- self.chky = ny;
- self.nc.setScrollTop(ny);
- }
-
- if (!self.timer) {
- self.nc.hideCursor();
- self.doSnapy(nx, ny);
- }
-
- });
-
- if (self.demulxy < 1) {
- self.timer = setTimeout(onscroll, tm);
- } else {
- self.stop();
- self.nc.hideCursor();
- self.doSnapy(nx, ny);
- }
- };
-
- onscroll();
-
- } else {
- self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
- }
-
- }
-
- };
-
-
- // override jQuery scrollTop
-
- var _scrollTop = jQuery.fn.scrollTop; // preserve original function
-
- jQuery.cssHooks["pageYOffset"] = {
- get: function(elem, computed, extra) {
- var nice = $.data(elem, '__nicescroll') || false;
- return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
- },
- set: function(elem, value) {
- var nice = $.data(elem, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
- return this;
- }
- };
-
- /*
- $.fx.step["scrollTop"] = function(fx){
- $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
- };
-*/
-
- jQuery.fn.scrollTop = function(value) {
- if (typeof value == "undefined") {
- var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
- return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
- } else {
- return this.each(function() {
- var nice = $.data(this, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
- });
- }
- };
-
- // override jQuery scrollLeft
-
- var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
-
- $.cssHooks.pageXOffset = {
- get: function(elem, computed, extra) {
- var nice = $.data(elem, '__nicescroll') || false;
- return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
- },
- set: function(elem, value) {
- var nice = $.data(elem, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
- return this;
- }
- };
-
- /*
- $.fx.step["scrollLeft"] = function(fx){
- $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
- };
-*/
-
- jQuery.fn.scrollLeft = function(value) {
- if (typeof value == "undefined") {
- var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
- return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
- } else {
- return this.each(function() {
- var nice = $.data(this, '__nicescroll') || false;
- (nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
- });
- }
- };
-
- var NiceScrollArray = function(doms) {
- var self = this;
- this.length = 0;
- this.name = "nicescrollarray";
-
- this.each = function(fn) {
- for (var a = 0, i = 0; a < self.length; a++) fn.call(self[a], i++);
- return self;
- };
-
- this.push = function(nice) {
- self[self.length] = nice;
- self.length++;
- };
-
- this.eq = function(idx) {
- return self[idx];
- };
-
- if (doms) {
- for (var a = 0; a < doms.length; a++) {
- var nice = $.data(doms[a], '__nicescroll') || false;
- if (nice) {
- this[this.length] = nice;
- this.length++;
- }
- };
- }
-
- return this;
- };
-
- function mplex(el, lst, fn) {
- for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
- };
- mplex(
- NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
- function(e, n) {
- e[n] = function() {
- var args = arguments;
- return this.each(function() {
- this[n].apply(this, args);
- });
- };
- }
- );
-
- jQuery.fn.getNiceScroll = function(index) {
- if (typeof index == "undefined") {
- return new NiceScrollArray(this);
- } else {
- var nice = this[index] && $.data(this[index], '__nicescroll') || false;
- return nice;
- }
- };
-
- jQuery.extend(jQuery.expr[':'], {
- nicescroll: function(a) {
- return ($.data(a, '__nicescroll')) ? true : false;
- }
- });
-
- $.fn.niceScroll = function(wrapper, opt) {
- if (typeof opt == "undefined") {
- if ((typeof wrapper == "object") && !("jquery" in wrapper)) {
- opt = wrapper;
- wrapper = false;
- }
- }
- opt = $.extend({},opt); // cloning
- var ret = new NiceScrollArray();
- if (typeof opt == "undefined") opt = {};
-
- if (wrapper || false) {
- opt.doc = $(wrapper);
- opt.win = $(this);
- }
- var docundef = !("doc" in opt);
- if (!docundef && !("win" in opt)) opt.win = $(this);
-
- this.each(function() {
- var nice = $(this).data('__nicescroll') || false;
- if (!nice) {
- opt.doc = (docundef) ? $(this) : opt.doc;
- nice = new NiceScrollClass(opt, $(this));
- $(this).data('__nicescroll', nice);
- }
- ret.push(nice);
- });
- return (ret.length == 1) ? ret[0] : ret;
- };
-
- window.NiceScroll = {
- getjQuery: function() {
- return jQuery
- }
- };
-
- if (!$.nicescroll) {
- $.nicescroll = new NiceScrollArray();
- $.nicescroll.options = _globaloptions;
- }
-
-})); \ No newline at end of file
diff --git a/vendor/project_templates/rails.tar.gz b/vendor/project_templates/rails.tar.gz
new file mode 100644
index 00000000000..b54cae3143a
--- /dev/null
+++ b/vendor/project_templates/rails.tar.gz
Binary files differ
diff --git a/yarn.lock b/yarn.lock
index 63d4e99cddc..b1cd07a8e9c 100644
--- a/yarn.lock
+++ b/yarn.lock
@@ -41,10 +41,14 @@ after@0.8.2:
version "0.8.2"
resolved "https://registry.yarnpkg.com/after/-/after-0.8.2.tgz#fedb394f9f0e02aa9768e702bda23b505fae7e1f"
-ajv-keywords@^1.0.0, ajv-keywords@^1.1.1:
+ajv-keywords@^1.0.0:
version "1.5.1"
resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-1.5.1.tgz#314dd0a4b3368fad3dfcdc54ede6171b886daf3c"
+ajv-keywords@^2.0.0:
+ version "2.1.0"
+ resolved "https://registry.yarnpkg.com/ajv-keywords/-/ajv-keywords-2.1.0.tgz#a296e17f7bfae7c1ce4f7e0de53d29cb32162df0"
+
ajv@^4.7.0:
version "4.11.2"
resolved "https://registry.yarnpkg.com/ajv/-/ajv-4.11.2.tgz#f166c3c11cbc6cb9dcc102a5bcfe5b72c95287e6"
@@ -52,6 +56,15 @@ ajv@^4.7.0:
co "^4.6.0"
json-stable-stringify "^1.0.1"
+ajv@^5.1.5:
+ version "5.2.0"
+ resolved "https://registry.yarnpkg.com/ajv/-/ajv-5.2.0.tgz#c1735024c5da2ef75cc190713073d44f098bf486"
+ dependencies:
+ co "^4.6.0"
+ fast-deep-equal "^0.1.0"
+ json-schema-traverse "^0.3.0"
+ json-stable-stringify "^1.0.1"
+
align-text@^0.1.1, align-text@^0.1.3:
version "0.1.4"
resolved "https://registry.yarnpkg.com/align-text/-/align-text-0.1.4.tgz#0cd90a561093f35d0a99256c22b7069433fad117"
@@ -128,6 +141,10 @@ arr-flatten@^1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/arr-flatten/-/arr-flatten-1.0.1.tgz#e5ffe54d45e19f32f216e91eb99c8ce892bb604b"
+array-find-index@^1.0.1:
+ version "1.0.2"
+ resolved "https://registry.yarnpkg.com/array-find-index/-/array-find-index-1.0.2.tgz#df010aa1287e164bbda6f9723b0a96a1ec4187a1"
+
array-find@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/array-find/-/array-find-1.0.0.tgz#6c8e286d11ed768327f8e62ecee87353ca3e78b8"
@@ -136,6 +153,10 @@ array-flatten@1.1.1:
version "1.1.1"
resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-1.1.1.tgz#9a5f699051b1e7073328f2a008968b64ea2955d2"
+array-flatten@^2.1.0:
+ version "2.1.1"
+ resolved "https://registry.yarnpkg.com/array-flatten/-/array-flatten-2.1.1.tgz#426bb9da84090c1838d812c8150af20a8331e296"
+
array-slice@^0.2.3:
version "0.2.3"
resolved "https://registry.yarnpkg.com/array-slice/-/array-slice-0.2.3.tgz#dd3cfb80ed7973a75117cdac69b0b99ec86186f5"
@@ -405,14 +426,13 @@ babel-helpers@^6.23.0:
babel-runtime "^6.22.0"
babel-template "^6.23.0"
-babel-loader@^6.2.10:
- version "6.2.10"
- resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-6.2.10.tgz#adefc2b242320cd5d15e65b31cea0e8b1b02d4b0"
+babel-loader@^7.1.1:
+ version "7.1.1"
+ resolved "https://registry.yarnpkg.com/babel-loader/-/babel-loader-7.1.1.tgz#b87134c8b12e3e4c2a94e0546085bc680a2b8488"
dependencies:
- find-cache-dir "^0.1.1"
- loader-utils "^0.2.11"
+ find-cache-dir "^1.0.0"
+ loader-utils "^1.0.2"
mkdirp "^0.5.1"
- object-assign "^4.0.1"
babel-messages@^6.23.0:
version "6.23.0"
@@ -825,11 +845,7 @@ babel-types@^6.18.0, babel-types@^6.19.0, babel-types@^6.22.0, babel-types@^6.23
lodash "^4.2.0"
to-fast-properties "^1.0.1"
-babylon@^6.11.0:
- version "6.15.0"
- resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.15.0.tgz#ba65cfa1a80e1759b0e89fb562e27dccae70348e"
-
-babylon@^6.13.0, babylon@^6.15.0, babylon@^6.16.1:
+babylon@^6.11.0, babylon@^6.13.0, babylon@^6.15.0, babylon@^6.16.1:
version "6.16.1"
resolved "https://registry.yarnpkg.com/babylon/-/babylon-6.16.1.tgz#30c5a22f481978a9e7f8cdfdf496b11d94b404d3"
@@ -910,6 +926,17 @@ body-parser@^1.16.1:
raw-body "~2.2.0"
type-is "~1.6.15"
+bonjour@^3.5.0:
+ version "3.5.0"
+ resolved "https://registry.yarnpkg.com/bonjour/-/bonjour-3.5.0.tgz#8e890a183d8ee9a2393b3844c691a42bcf7bc9f5"
+ dependencies:
+ array-flatten "^2.1.0"
+ deep-equal "^1.0.1"
+ dns-equal "^1.0.0"
+ dns-txt "^2.0.2"
+ multicast-dns "^6.0.1"
+ multicast-dns-service-types "^1.1.0"
+
boom@2.x.x:
version "2.10.1"
resolved "https://registry.yarnpkg.com/boom/-/boom-2.10.1.tgz#39c8918ceff5799f83f9492a848f625add0c766f"
@@ -1003,6 +1030,10 @@ browserslist@^1.3.6, browserslist@^1.5.2, browserslist@^1.7.6:
caniuse-db "^1.0.30000639"
electron-to-chromium "^1.2.7"
+buffer-indexof@^1.0.0:
+ version "1.1.0"
+ resolved "https://registry.yarnpkg.com/buffer-indexof/-/buffer-indexof-1.1.0.tgz#f54f647c4f4e25228baa656a2e57e43d5f270982"
+
buffer-shims@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/buffer-shims/-/buffer-shims-1.0.0.tgz#9978ce317388c649ad8793028c3477ef044a8b51"
@@ -1049,14 +1080,29 @@ callsites@^0.2.0:
version "0.2.0"
resolved "https://registry.yarnpkg.com/callsites/-/callsites-0.2.0.tgz#afab96262910a7f33c19a5775825c69f34e350ca"
+camelcase-keys@^2.0.0:
+ version "2.1.0"
+ resolved "https://registry.yarnpkg.com/camelcase-keys/-/camelcase-keys-2.1.0.tgz#308beeaffdf28119051efa1d932213c91b8f92e7"
+ dependencies:
+ camelcase "^2.0.0"
+ map-obj "^1.0.0"
+
camelcase@^1.0.2:
version "1.2.1"
resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-1.2.1.tgz#9bb5304d2e0b56698b2c758b08a3eaa9daa58a39"
+camelcase@^2.0.0:
+ version "2.1.1"
+ resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-2.1.1.tgz#7c1d16d679a1bbe59ca02cacecfb011e201f5a1f"
+
camelcase@^3.0.0:
version "3.0.0"
resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-3.0.0.tgz#32fc4b9fcdaf845fcdf7e73bb97cac2261f0ab0a"
+camelcase@^4.1.0:
+ version "4.1.0"
+ resolved "https://registry.yarnpkg.com/camelcase/-/camelcase-4.1.0.tgz#d545635be1e33c542649c69173e5de6acfae34dd"
+
caniuse-api@^1.5.2:
version "1.6.1"
resolved "https://registry.yarnpkg.com/caniuse-api/-/caniuse-api-1.6.1.tgz#b534e7c734c4f81ec5fbe8aca2ad24354b962c6c"
@@ -1106,6 +1152,21 @@ chokidar@^1.4.1, chokidar@^1.4.3, chokidar@^1.6.0:
optionalDependencies:
fsevents "^1.0.0"
+chokidar@^1.7.0:
+ version "1.7.0"
+ resolved "https://registry.yarnpkg.com/chokidar/-/chokidar-1.7.0.tgz#798e689778151c8076b4b360e5edd28cda2bb468"
+ dependencies:
+ anymatch "^1.3.0"
+ async-each "^1.0.0"
+ glob-parent "^2.0.0"
+ inherits "^2.0.1"
+ is-binary-path "^1.0.0"
+ is-glob "^2.0.0"
+ path-is-absolute "^1.0.0"
+ readdirp "^2.0.0"
+ optionalDependencies:
+ fsevents "^1.0.0"
+
cipher-base@^1.0.0, cipher-base@^1.0.1:
version "1.0.3"
resolved "https://registry.yarnpkg.com/cipher-base/-/cipher-base-1.0.3.tgz#eeabf194419ce900da3018c207d212f2a6df0a07"
@@ -1415,6 +1476,14 @@ cropper@^2.3.0:
dependencies:
jquery ">= 1.9.1"
+cross-spawn@^5.0.1:
+ version "5.1.0"
+ resolved "https://registry.yarnpkg.com/cross-spawn/-/cross-spawn-5.1.0.tgz#e8bd0efee58fcff6f8f94510a0a554bbfa235449"
+ dependencies:
+ lru-cache "^4.0.1"
+ shebang-command "^1.2.0"
+ which "^1.2.9"
+
cryptiles@2.x.x:
version "2.0.5"
resolved "https://registry.yarnpkg.com/cryptiles/-/cryptiles-2.0.5.tgz#3bdfecdc608147c1c67202fa291e7dca59eaa3b8"
@@ -1521,6 +1590,12 @@ csso@~2.3.1:
clap "^1.0.9"
source-map "^0.5.3"
+currently-unhandled@^0.4.1:
+ version "0.4.1"
+ resolved "https://registry.yarnpkg.com/currently-unhandled/-/currently-unhandled-0.4.1.tgz#988df33feab191ef799a61369dd76c17adf957ea"
+ dependencies:
+ array-find-index "^1.0.1"
+
custom-event@~1.0.0:
version "1.0.1"
resolved "https://registry.yarnpkg.com/custom-event/-/custom-event-1.0.1.tgz#5d02a46850adf1b4a317946a3928fccb5bfd0425"
@@ -1567,11 +1642,11 @@ debug@2.6.7:
dependencies:
ms "2.0.0"
-debug@^2.1.0, debug@^2.1.1, debug@^2.2.0:
- version "2.6.0"
- resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.0.tgz#bc596bcabe7617f11d9fa15361eded5608b8499b"
+debug@^2.1.0, debug@^2.1.1, debug@^2.2.0, debug@^2.6.6, debug@^2.6.8:
+ version "2.6.8"
+ resolved "https://registry.yarnpkg.com/debug/-/debug-2.6.8.tgz#e731531ca2ede27d188222427da17821d68ff4fc"
dependencies:
- ms "0.7.2"
+ ms "2.0.0"
decamelize@^1.0.0, decamelize@^1.1.1, decamelize@^1.1.2:
version "1.2.0"
@@ -1587,6 +1662,10 @@ decompress-response@^3.2.0:
dependencies:
mimic-response "^1.0.0"
+deep-equal@^1.0.1:
+ version "1.0.1"
+ resolved "https://registry.yarnpkg.com/deep-equal/-/deep-equal-1.0.1.tgz#f5d260292b660e084eff4cdbc9f08ad3247448b5"
+
deep-extend@~0.4.0:
version "0.4.1"
resolved "https://registry.yarnpkg.com/deep-extend/-/deep-extend-0.4.1.tgz#efe4113d08085f4e6f9687759810f807469e2253"
@@ -1623,6 +1702,17 @@ del@^2.0.2:
pinkie-promise "^2.0.0"
rimraf "^2.2.8"
+del@^3.0.0:
+ version "3.0.0"
+ resolved "https://registry.yarnpkg.com/del/-/del-3.0.0.tgz#53ecf699ffcbcb39637691ab13baf160819766e5"
+ dependencies:
+ globby "^6.1.0"
+ is-path-cwd "^1.0.0"
+ is-path-in-cwd "^1.0.0"
+ p-map "^1.1.1"
+ pify "^3.0.0"
+ rimraf "^2.2.8"
+
delayed-stream@~1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619"
@@ -1668,6 +1758,23 @@ diffie-hellman@^5.0.0:
miller-rabin "^4.0.0"
randombytes "^2.0.0"
+dns-equal@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/dns-equal/-/dns-equal-1.0.0.tgz#b39e7f1da6eb0a75ba9c17324b34753c47e0654d"
+
+dns-packet@^1.0.1:
+ version "1.1.1"
+ resolved "https://registry.yarnpkg.com/dns-packet/-/dns-packet-1.1.1.tgz#2369d45038af045f3898e6fa56862aed3f40296c"
+ dependencies:
+ ip "^1.1.0"
+ safe-buffer "^5.0.1"
+
+dns-txt@^2.0.2:
+ version "2.0.2"
+ resolved "https://registry.yarnpkg.com/dns-txt/-/dns-txt-2.0.2.tgz#b91d806f5d27188e4ab3e7d107d881a1cc4642b6"
+ dependencies:
+ buffer-indexof "^1.0.0"
+
doctrine@1.5.0, doctrine@^1.2.2:
version "1.5.0"
resolved "https://registry.yarnpkg.com/doctrine/-/doctrine-1.5.0.tgz#379dce730f6166f76cefa4e6707a159b02c5a6fa"
@@ -1834,14 +1941,14 @@ engine.io@1.8.3:
engine.io-parser "1.3.2"
ws "1.1.2"
-enhanced-resolve@^3.0.0:
- version "3.1.0"
- resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.1.0.tgz#9f4b626f577245edcf4b2ad83d86e17f4f421dec"
+enhanced-resolve@^3.4.0:
+ version "3.4.1"
+ resolved "https://registry.yarnpkg.com/enhanced-resolve/-/enhanced-resolve-3.4.1.tgz#0421e339fd71419b3da13d129b3979040230476e"
dependencies:
graceful-fs "^4.1.2"
memory-fs "^0.4.0"
object-assign "^4.0.1"
- tapable "^0.2.5"
+ tapable "^0.2.7"
enhanced-resolve@~0.9.0:
version "0.9.1"
@@ -1967,12 +2074,12 @@ eslint-import-resolver-node@^0.2.0:
object-assign "^4.0.1"
resolve "^1.1.6"
-eslint-import-resolver-webpack@^0.8.1:
- version "0.8.1"
- resolved "https://registry.yarnpkg.com/eslint-import-resolver-webpack/-/eslint-import-resolver-webpack-0.8.1.tgz#c7f8b4d5bd3c5b489457e5728c5db1c4ffbac9aa"
+eslint-import-resolver-webpack@^0.8.3:
+ version "0.8.3"
+ resolved "https://registry.yarnpkg.com/eslint-import-resolver-webpack/-/eslint-import-resolver-webpack-0.8.3.tgz#ad61e28df378a474459d953f246fd43f92675385"
dependencies:
array-find "^1.0.0"
- debug "^2.2.0"
+ debug "^2.6.8"
enhanced-resolve "~0.9.0"
find-root "^0.1.1"
has "^1.0.1"
@@ -2151,6 +2258,18 @@ evp_bytestokey@^1.0.0:
dependencies:
create-hash "^1.1.1"
+execa@^0.7.0:
+ version "0.7.0"
+ resolved "https://registry.yarnpkg.com/execa/-/execa-0.7.0.tgz#944becd34cc41ee32a63a9faf27ad5a65fc59777"
+ dependencies:
+ cross-spawn "^5.0.1"
+ get-stream "^3.0.0"
+ is-stream "^1.1.0"
+ npm-run-path "^2.0.0"
+ p-finally "^1.0.0"
+ signal-exit "^3.0.0"
+ strip-eof "^1.0.0"
+
exit-hook@^1.0.0:
version "1.1.1"
resolved "https://registry.yarnpkg.com/exit-hook/-/exit-hook-1.1.1.tgz#f05ca233b48c05d54fff07765df8507e95c02ff8"
@@ -2236,6 +2355,10 @@ extsprintf@1.0.2:
version "1.0.2"
resolved "https://registry.yarnpkg.com/extsprintf/-/extsprintf-1.0.2.tgz#e1080e0658e300b06294990cc70e1502235fd550"
+fast-deep-equal@^0.1.0:
+ version "0.1.0"
+ resolved "https://registry.yarnpkg.com/fast-deep-equal/-/fast-deep-equal-0.1.0.tgz#5c6f4599aba6b333ee3342e2ed978672f1001f8d"
+
fast-levenshtein@~2.0.4:
version "2.0.6"
resolved "https://registry.yarnpkg.com/fast-levenshtein/-/fast-levenshtein-2.0.6.tgz#3d8a5c66883a16a30ca8643e851f19baa7797917"
@@ -2323,13 +2446,13 @@ finalhandler@1.0.3, finalhandler@~1.0.3:
statuses "~1.3.1"
unpipe "~1.0.0"
-find-cache-dir@^0.1.1:
- version "0.1.1"
- resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-0.1.1.tgz#c8defae57c8a52a8a784f9e31c57c742e993a0b9"
+find-cache-dir@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/find-cache-dir/-/find-cache-dir-1.0.0.tgz#9288e3e9e3cc3748717d39eade17cf71fc30ee6f"
dependencies:
commondir "^1.0.1"
- mkdirp "^0.5.1"
- pkg-dir "^1.0.0"
+ make-dir "^1.0.0"
+ pkg-dir "^2.0.0"
find-root@^0.1.1:
version "0.1.2"
@@ -2342,7 +2465,7 @@ find-up@^1.0.0:
path-exists "^2.0.0"
pinkie-promise "^2.0.0"
-find-up@^2.1.0:
+find-up@^2.0.0, find-up@^2.1.0:
version "2.1.0"
resolved "https://registry.yarnpkg.com/find-up/-/find-up-2.1.0.tgz#45d1b7e506c717ddd482775a2b77920a3c0c57a7"
dependencies:
@@ -2461,6 +2584,10 @@ get-caller-file@^1.0.1:
version "1.0.2"
resolved "https://registry.yarnpkg.com/get-caller-file/-/get-caller-file-1.0.2.tgz#f702e63127e7e231c160a80c1554acb70d5047e5"
+get-stdin@^4.0.1:
+ version "4.0.1"
+ resolved "https://registry.yarnpkg.com/get-stdin/-/get-stdin-4.0.1.tgz#b968c6b0a04384324902e8bf1a5df32579a450fe"
+
get-stream@^3.0.0:
version "3.0.0"
resolved "https://registry.yarnpkg.com/get-stream/-/get-stream-3.0.0.tgz#8e943d1358dc37555054ecbe2edb05aa174ede14"
@@ -2520,6 +2647,16 @@ globby@^5.0.0:
pify "^2.0.0"
pinkie-promise "^2.0.0"
+globby@^6.1.0:
+ version "6.1.0"
+ resolved "https://registry.yarnpkg.com/globby/-/globby-6.1.0.tgz#f5a6d70e8395e21c858fb0489d64df02424d506c"
+ dependencies:
+ array-union "^1.0.1"
+ glob "^7.0.3"
+ object-assign "^4.0.1"
+ pify "^2.0.0"
+ pinkie-promise "^2.0.0"
+
good-listener@^1.2.0:
version "1.2.2"
resolved "https://registry.yarnpkg.com/good-listener/-/good-listener-1.2.2.tgz#d53b30cdf9313dffb7dc9a0d477096aa6d145c50"
@@ -2617,6 +2754,10 @@ has-flag@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-1.0.0.tgz#9d9e793165ce017a00f00418c43f942a7b1d11fa"
+has-flag@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/has-flag/-/has-flag-2.0.0.tgz#e8207af1cc7b30d446cc70b734b5e8be18f88d51"
+
has-symbol-support-x@^1.3.0:
version "1.3.0"
resolved "https://registry.yarnpkg.com/has-symbol-support-x/-/has-symbol-support-x-1.3.0.tgz#588bd6927eaa0e296afae24160659167fc2be4f8"
@@ -2780,6 +2921,12 @@ imurmurhash@^0.1.4:
version "0.1.4"
resolved "https://registry.yarnpkg.com/imurmurhash/-/imurmurhash-0.1.4.tgz#9218b9b2b928a238b13dc4fb6b6d576f231453ea"
+indent-string@^2.1.0:
+ version "2.1.0"
+ resolved "https://registry.yarnpkg.com/indent-string/-/indent-string-2.1.0.tgz#8e2d48348742121b4a8218b7a137e9a52049dc80"
+ dependencies:
+ repeating "^2.0.0"
+
indexes-of@^1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/indexes-of/-/indexes-of-1.0.1.tgz#f30f716c8e2bd346c7b67d3df3915566a7c05607"
@@ -2829,6 +2976,12 @@ inquirer@^0.12.0:
strip-ansi "^3.0.0"
through "^2.3.6"
+internal-ip@^1.2.0:
+ version "1.2.0"
+ resolved "https://registry.yarnpkg.com/internal-ip/-/internal-ip-1.2.0.tgz#ae9fbf93b984878785d50a8de1b356956058cf5c"
+ dependencies:
+ meow "^3.3.0"
+
interpret@^1.0.0:
version "1.0.1"
resolved "https://registry.yarnpkg.com/interpret/-/interpret-1.0.1.tgz#d579fb7f693b858004947af39fa0db49f795602c"
@@ -2843,6 +2996,10 @@ invert-kv@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/invert-kv/-/invert-kv-1.0.0.tgz#104a8e4aaca6d3d8cd157a8ef8bfab2d7a3ffdb6"
+ip@^1.1.0:
+ version "1.1.5"
+ resolved "https://registry.yarnpkg.com/ip/-/ip-1.1.5.tgz#bdded70114290828c0a039e72ef25f5aaec4354a"
+
ipaddr.js@1.3.0:
version "1.3.0"
resolved "https://registry.yarnpkg.com/ipaddr.js/-/ipaddr.js-1.3.0.tgz#1e03a52fdad83a8bbb2b25cbf4998b4cffcd3dec"
@@ -3007,7 +3164,7 @@ is-retry-allowed@^1.0.0:
version "1.1.0"
resolved "https://registry.yarnpkg.com/is-retry-allowed/-/is-retry-allowed-1.1.0.tgz#11a060568b67339444033d0125a61a20d564fb34"
-is-stream@^1.0.0:
+is-stream@^1.0.0, is-stream@^1.1.0:
version "1.1.0"
resolved "https://registry.yarnpkg.com/is-stream/-/is-stream-1.1.0.tgz#12d4a3dd4e68e0b79ceb8dbc84173ae80d91ca44"
@@ -3230,6 +3387,10 @@ json-loader@^0.5.4:
version "0.5.4"
resolved "https://registry.yarnpkg.com/json-loader/-/json-loader-0.5.4.tgz#8baa1365a632f58a3c46d20175fc6002c96e37de"
+json-schema-traverse@^0.3.0:
+ version "0.3.0"
+ resolved "https://registry.yarnpkg.com/json-schema-traverse/-/json-schema-traverse-0.3.0.tgz#0016c0b1ca1efe46d44d37541bcdfc19dcfae0db"
+
json-schema@0.2.3:
version "0.2.3"
resolved "https://registry.yarnpkg.com/json-schema/-/json-schema-0.2.3.tgz#b480c892e59a2f05954ce727bd3f2a4e882f9e13"
@@ -3311,9 +3472,9 @@ karma-sourcemap-loader@^0.3.7:
dependencies:
graceful-fs "^4.1.2"
-karma-webpack@^2.0.2:
- version "2.0.2"
- resolved "https://registry.yarnpkg.com/karma-webpack/-/karma-webpack-2.0.2.tgz#bd38350af5645c9644090770939ebe7ce726f864"
+karma-webpack@^2.0.4:
+ version "2.0.4"
+ resolved "https://registry.yarnpkg.com/karma-webpack/-/karma-webpack-2.0.4.tgz#3e2d4f48ba94a878e1c66bb8e1ae6128987a175b"
dependencies:
async "~0.9.0"
loader-utils "^0.2.5"
@@ -3398,11 +3559,20 @@ load-json-file@^1.0.0:
pinkie-promise "^2.0.0"
strip-bom "^2.0.0"
+load-json-file@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/load-json-file/-/load-json-file-2.0.0.tgz#7947e42149af80d696cbf797bcaabcfe1fe29ca8"
+ dependencies:
+ graceful-fs "^4.1.2"
+ parse-json "^2.2.0"
+ pify "^2.0.0"
+ strip-bom "^3.0.0"
+
loader-runner@^2.3.0:
version "2.3.0"
resolved "https://registry.yarnpkg.com/loader-runner/-/loader-runner-2.3.0.tgz#f482aea82d543e07921700d5a46ef26fdac6b8a2"
-loader-utils@^0.2.11, loader-utils@^0.2.16, loader-utils@^0.2.5:
+loader-utils@^0.2.5:
version "0.2.16"
resolved "https://registry.yarnpkg.com/loader-utils/-/loader-utils-0.2.16.tgz#f08632066ed8282835dff88dfb52704765adee6d"
dependencies:
@@ -3578,6 +3748,10 @@ log4js@^0.6.31:
readable-stream "~1.0.2"
semver "~4.3.3"
+loglevel@^1.4.1:
+ version "1.4.1"
+ resolved "https://registry.yarnpkg.com/loglevel/-/loglevel-1.4.1.tgz#95b383f91a3c2756fd4ab093667e4309161f2bcd"
+
longest@^1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/longest/-/longest-1.0.1.tgz#30a0b2da38f73770e8294a0d22e6625ed77d0097"
@@ -3588,6 +3762,13 @@ loose-envify@^1.0.0:
dependencies:
js-tokens "^3.0.0"
+loud-rejection@^1.0.0:
+ version "1.6.0"
+ resolved "https://registry.yarnpkg.com/loud-rejection/-/loud-rejection-1.6.0.tgz#5b46f80147edee578870f086d04821cf998e551f"
+ dependencies:
+ currently-unhandled "^0.4.1"
+ signal-exit "^3.0.0"
+
lowercase-keys@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/lowercase-keys/-/lowercase-keys-1.0.0.tgz#4e3366b39e7f5457e35f1324bdf6f88d0bfc7306"
@@ -3613,6 +3794,16 @@ macaddress@^0.2.8:
version "0.2.8"
resolved "https://registry.yarnpkg.com/macaddress/-/macaddress-0.2.8.tgz#5904dc537c39ec6dbefeae902327135fa8511f12"
+make-dir@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/make-dir/-/make-dir-1.0.0.tgz#97a011751e91dd87cfadef58832ebb04936de978"
+ dependencies:
+ pify "^2.3.0"
+
+map-obj@^1.0.0, map-obj@^1.0.1:
+ version "1.0.1"
+ resolved "https://registry.yarnpkg.com/map-obj/-/map-obj-1.0.1.tgz#d933ceb9205d82bdcf4886f6742bdc2b4dea146d"
+
map-stream@~0.1.0:
version "0.1.0"
resolved "https://registry.yarnpkg.com/map-stream/-/map-stream-0.1.0.tgz#e56aa94c4c8055a16404a0674b78f215f7c8e194"
@@ -3629,6 +3820,12 @@ media-typer@0.3.0:
version "0.3.0"
resolved "https://registry.yarnpkg.com/media-typer/-/media-typer-0.3.0.tgz#8710d7af0aa626f8fffa1ce00168545263255748"
+mem@^1.1.0:
+ version "1.1.0"
+ resolved "https://registry.yarnpkg.com/mem/-/mem-1.1.0.tgz#5edd52b485ca1d900fe64895505399a0dfa45f76"
+ dependencies:
+ mimic-fn "^1.0.0"
+
memory-fs@^0.2.0:
version "0.2.0"
resolved "https://registry.yarnpkg.com/memory-fs/-/memory-fs-0.2.0.tgz#f2bb25368bc121e391c2520de92969caee0a0290"
@@ -3640,6 +3837,21 @@ memory-fs@^0.4.0, memory-fs@~0.4.1:
errno "^0.1.3"
readable-stream "^2.0.1"
+meow@^3.3.0:
+ version "3.7.0"
+ resolved "https://registry.yarnpkg.com/meow/-/meow-3.7.0.tgz#72cb668b425228290abbfa856892587308a801fb"
+ dependencies:
+ camelcase-keys "^2.0.0"
+ decamelize "^1.1.2"
+ loud-rejection "^1.0.0"
+ map-obj "^1.0.1"
+ minimist "^1.1.3"
+ normalize-package-data "^2.3.4"
+ object-assign "^4.0.1"
+ read-pkg-up "^1.0.1"
+ redent "^1.0.0"
+ trim-newlines "^1.0.0"
+
merge-descriptors@1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/merge-descriptors/-/merge-descriptors-1.0.1.tgz#b00aaa556dd8b44568150ec9d1b953f3f90cbb61"
@@ -3673,30 +3885,24 @@ miller-rabin@^4.0.0:
bn.js "^4.0.0"
brorand "^1.0.1"
-"mime-db@>= 1.24.0 < 2", mime-db@~1.26.0:
- version "1.26.0"
- resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.26.0.tgz#eaffcd0e4fc6935cf8134da246e2e6c35305adff"
-
-mime-db@~1.27.0:
+"mime-db@>= 1.24.0 < 2", mime-db@~1.27.0:
version "1.27.0"
resolved "https://registry.yarnpkg.com/mime-db/-/mime-db-1.27.0.tgz#820f572296bbd20ec25ed55e5b5de869e5436eb1"
-mime-types@^2.1.12, mime-types@~2.1.15, mime-types@~2.1.7:
+mime-types@^2.1.12, mime-types@~2.1.11, mime-types@~2.1.15, mime-types@~2.1.7:
version "2.1.15"
resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.15.tgz#a4ebf5064094569237b8cf70046776d09fc92aed"
dependencies:
mime-db "~1.27.0"
-mime-types@~2.1.11:
- version "2.1.14"
- resolved "https://registry.yarnpkg.com/mime-types/-/mime-types-2.1.14.tgz#f7ef7d97583fcaf3b7d282b6f8b5679dab1e94ee"
- dependencies:
- mime-db "~1.26.0"
-
mime@1.3.4, mime@1.3.x, mime@^1.3.4:
version "1.3.4"
resolved "https://registry.yarnpkg.com/mime/-/mime-1.3.4.tgz#115f9e3b6b3daf2959983cb38f149a2d40eb5d53"
+mimic-fn@^1.0.0:
+ version "1.1.0"
+ resolved "https://registry.yarnpkg.com/mimic-fn/-/mimic-fn-1.1.0.tgz#e667783d92e89dbd342818b5230b9d62a672ad18"
+
mimic-response@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/mimic-response/-/mimic-response-1.0.0.tgz#df3d3652a73fded6b9b0b24146e6fd052353458e"
@@ -3715,7 +3921,7 @@ minimist@0.0.8, minimist@~0.0.1:
version "0.0.8"
resolved "https://registry.yarnpkg.com/minimist/-/minimist-0.0.8.tgz#857fcabfc3397d2625b8228262e86aa7a011b05d"
-minimist@^1.2.0:
+minimist@^1.1.3, minimist@^1.2.0:
version "1.2.0"
resolved "https://registry.yarnpkg.com/minimist/-/minimist-1.2.0.tgz#a35008b20f41383eec1fb914f4cd5df79a264284"
@@ -3745,6 +3951,17 @@ ms@2.0.0:
version "2.0.0"
resolved "https://registry.yarnpkg.com/ms/-/ms-2.0.0.tgz#5608aeadfc00be6c2901df5f9861788de0d597c8"
+multicast-dns-service-types@^1.1.0:
+ version "1.1.0"
+ resolved "https://registry.yarnpkg.com/multicast-dns-service-types/-/multicast-dns-service-types-1.1.0.tgz#899f11d9686e5e05cb91b35d5f0e63b773cfc901"
+
+multicast-dns@^6.0.1:
+ version "6.1.1"
+ resolved "https://registry.yarnpkg.com/multicast-dns/-/multicast-dns-6.1.1.tgz#6e7de86a570872ab17058adea7160bbeca814dde"
+ dependencies:
+ dns-packet "^1.0.1"
+ thunky "^0.1.0"
+
mute-stream@0.0.5:
version "0.0.5"
resolved "https://registry.yarnpkg.com/mute-stream/-/mute-stream-0.0.5.tgz#8fbfabb0a98a253d3184331f9e8deb7372fac6c0"
@@ -3771,6 +3988,10 @@ nested-error-stacks@^1.0.0:
dependencies:
inherits "~2.0.1"
+node-forge@0.6.33:
+ version "0.6.33"
+ resolved "https://registry.yarnpkg.com/node-forge/-/node-forge-0.6.33.tgz#463811879f573d45155ad6a9f43dc296e8e85ebc"
+
node-libs-browser@^1.0.0:
version "1.1.1"
resolved "https://registry.yarnpkg.com/node-libs-browser/-/node-libs-browser-1.1.1.tgz#2a38243abedd7dffcd07a97c9aca5668975a6fea"
@@ -3877,7 +4098,7 @@ nopt@~1.0.10:
dependencies:
abbrev "1"
-normalize-package-data@^2.3.2:
+normalize-package-data@^2.3.2, normalize-package-data@^2.3.4:
version "2.3.5"
resolved "https://registry.yarnpkg.com/normalize-package-data/-/normalize-package-data-2.3.5.tgz#8d924f142960e1777e7ffe170543631cc7cb02df"
dependencies:
@@ -3903,6 +4124,12 @@ normalize-url@^1.4.0:
query-string "^4.1.0"
sort-keys "^1.0.0"
+npm-run-path@^2.0.0:
+ version "2.0.2"
+ resolved "https://registry.yarnpkg.com/npm-run-path/-/npm-run-path-2.0.2.tgz#35a9232dfa35d7067b4cb2ddf2357b1871536c5f"
+ dependencies:
+ path-key "^2.0.0"
+
npmlog@^4.0.1:
version "4.0.2"
resolved "https://registry.yarnpkg.com/npmlog/-/npmlog-4.0.2.tgz#d03950e0e78ce1527ba26d2a7592e9348ac3e75f"
@@ -4034,6 +4261,14 @@ os-locale@^1.4.0:
dependencies:
lcid "^1.0.0"
+os-locale@^2.0.0:
+ version "2.1.0"
+ resolved "https://registry.yarnpkg.com/os-locale/-/os-locale-2.1.0.tgz#42bc2900a6b5b8bd17376c8e882b65afccf24bf2"
+ dependencies:
+ execa "^0.7.0"
+ lcid "^1.0.0"
+ mem "^1.1.0"
+
os-tmpdir@^1.0.0, os-tmpdir@^1.0.1, os-tmpdir@~1.0.1:
version "1.0.2"
resolved "https://registry.yarnpkg.com/os-tmpdir/-/os-tmpdir-1.0.2.tgz#bbe67406c79aa85c5cfec766fe5734555dfa1274"
@@ -4063,6 +4298,10 @@ p-locate@^2.0.0:
dependencies:
p-limit "^1.1.0"
+p-map@^1.1.1:
+ version "1.1.1"
+ resolved "https://registry.yarnpkg.com/p-map/-/p-map-1.1.1.tgz#05f5e4ae97a068371bc2a5cc86bfbdbc19c4ae7a"
+
p-timeout@^1.1.1:
version "1.2.0"
resolved "https://registry.yarnpkg.com/p-timeout/-/p-timeout-1.2.0.tgz#9820f99434c5817868b4f34809ee5291660d5b6c"
@@ -4153,6 +4392,10 @@ path-is-inside@^1.0.1:
version "1.0.2"
resolved "https://registry.yarnpkg.com/path-is-inside/-/path-is-inside-1.0.2.tgz#365417dede44430d1c11af61027facf074bdfc53"
+path-key@^2.0.0:
+ version "2.0.1"
+ resolved "https://registry.yarnpkg.com/path-key/-/path-key-2.0.1.tgz#411cadb574c5a140d3a4b1910d40d80cc9f40b40"
+
path-parse@^1.0.5:
version "1.0.5"
resolved "https://registry.yarnpkg.com/path-parse/-/path-parse-1.0.5.tgz#3c1adf871ea9cd6c9431b6ea2bd74a0ff055c4c1"
@@ -4169,6 +4412,12 @@ path-type@^1.0.0:
pify "^2.0.0"
pinkie-promise "^2.0.0"
+path-type@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/path-type/-/path-type-2.0.0.tgz#f012ccb8415b7096fc2daa1054c3d72389594c73"
+ dependencies:
+ pify "^2.0.0"
+
pause-stream@0.0.11:
version "0.0.11"
resolved "https://registry.yarnpkg.com/pause-stream/-/pause-stream-0.0.11.tgz#fe5a34b0cbce12b5aa6a2b403ee2e73b602f1445"
@@ -4181,10 +4430,14 @@ pbkdf2@^3.0.3:
dependencies:
create-hmac "^1.1.2"
-pify@^2.0.0:
+pify@^2.0.0, pify@^2.3.0:
version "2.3.0"
resolved "https://registry.yarnpkg.com/pify/-/pify-2.3.0.tgz#ed141a6ac043a849ea588498e7dca8b15330e90c"
+pify@^3.0.0:
+ version "3.0.0"
+ resolved "https://registry.yarnpkg.com/pify/-/pify-3.0.0.tgz#e5a4acd2c101fdf3d9a4d07f0dbc4db49dd28176"
+
pikaday@^1.5.1:
version "1.5.1"
resolved "https://registry.yarnpkg.com/pikaday/-/pikaday-1.5.1.tgz#0a48549bc1a14ea1d08c44074d761bc2f2bfcfd3"
@@ -4207,6 +4460,12 @@ pkg-dir@^1.0.0:
dependencies:
find-up "^1.0.0"
+pkg-dir@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/pkg-dir/-/pkg-dir-2.0.0.tgz#f6d5d1109e19d63edf428e0bd57e12777615334b"
+ dependencies:
+ find-up "^2.1.0"
+
pkg-up@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/pkg-up/-/pkg-up-1.0.0.tgz#3e08fb461525c4421624a33b9f7e6d0af5b05a26"
@@ -4598,6 +4857,10 @@ querystringify@0.0.x:
version "0.0.4"
resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-0.0.4.tgz#0cf7f84f9463ff0ae51c4c4b142d95be37724d9c"
+querystringify@~1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/querystringify/-/querystringify-1.0.0.tgz#6286242112c5b712fa654e526652bf6a13ff05cb"
+
randomatic@^1.1.3:
version "1.1.6"
resolved "https://registry.yarnpkg.com/randomatic/-/randomatic-1.1.6.tgz#110dcabff397e9dcff7c0789ccc0a49adf1ec5bb"
@@ -4675,6 +4938,13 @@ read-pkg-up@^1.0.1:
find-up "^1.0.0"
read-pkg "^1.0.0"
+read-pkg-up@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/read-pkg-up/-/read-pkg-up-2.0.0.tgz#6b72a8048984e0c41e79510fd5e9fa99b3b549be"
+ dependencies:
+ find-up "^2.0.0"
+ read-pkg "^2.0.0"
+
read-pkg@^1.0.0:
version "1.1.0"
resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-1.1.0.tgz#f5ffaa5ecd29cb31c0474bca7d756b6bb29e3f28"
@@ -4683,6 +4953,14 @@ read-pkg@^1.0.0:
normalize-package-data "^2.3.2"
path-type "^1.0.0"
+read-pkg@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/read-pkg/-/read-pkg-2.0.0.tgz#8ef1c0623c6a6db0dc6713c4bfac46332b2368f8"
+ dependencies:
+ load-json-file "^2.0.0"
+ normalize-package-data "^2.3.2"
+ path-type "^2.0.0"
+
readable-stream@^2.0.0, "readable-stream@^2.0.0 || ^1.1.13", readable-stream@^2.1.0, readable-stream@^2.2.2:
version "2.2.2"
resolved "https://registry.yarnpkg.com/readable-stream/-/readable-stream-2.2.2.tgz#a9e6fec3c7dda85f8bb1b3ba7028604556fc825e"
@@ -4756,6 +5034,13 @@ recursive-readdir@2.1.1:
dependencies:
minimatch "3.0.3"
+redent@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/redent/-/redent-1.0.0.tgz#cf916ab1fd5f1f16dfb20822dd6ec7f730c2afde"
+ dependencies:
+ indent-string "^2.1.0"
+ strip-indent "^1.0.1"
+
reduce-css-calc@^1.2.6:
version "1.3.0"
resolved "https://registry.yarnpkg.com/reduce-css-calc/-/reduce-css-calc-1.3.0.tgz#747c914e049614a4c9cfbba629871ad1d2927716"
@@ -4968,6 +5253,12 @@ select@^1.1.2:
version "1.1.2"
resolved "https://registry.yarnpkg.com/select/-/select-1.1.2.tgz#0e7350acdec80b1108528786ec1d4418d11b396d"
+selfsigned@^1.9.1:
+ version "1.9.1"
+ resolved "https://registry.yarnpkg.com/selfsigned/-/selfsigned-1.9.1.tgz#cdda4492d70d486570f87c65546023558e1dfa5a"
+ dependencies:
+ node-forge "0.6.33"
+
semver-diff@^2.0.0:
version "2.1.0"
resolved "https://registry.yarnpkg.com/semver-diff/-/semver-diff-2.1.0.tgz#4bbb8437c8d37e4b0cf1a68fd726ec6d645d6d36"
@@ -5047,6 +5338,16 @@ sha.js@^2.3.6:
dependencies:
inherits "^2.0.1"
+shebang-command@^1.2.0:
+ version "1.2.0"
+ resolved "https://registry.yarnpkg.com/shebang-command/-/shebang-command-1.2.0.tgz#44aac65b695b03398968c39f363fee5deafdf1ea"
+ dependencies:
+ shebang-regex "^1.0.0"
+
+shebang-regex@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/shebang-regex/-/shebang-regex-1.0.0.tgz#da42f49740c0b42db2ca9728571cb190c98efea3"
+
shelljs@^0.7.5:
version "0.7.6"
resolved "https://registry.yarnpkg.com/shelljs/-/shelljs-0.7.6.tgz#379cccfb56b91c8601e4793356eb5382924de9ad"
@@ -5136,16 +5437,16 @@ sockjs-client@1.0.1:
json3 "^3.3.2"
url-parse "^1.0.1"
-sockjs-client@1.1.2:
- version "1.1.2"
- resolved "https://registry.yarnpkg.com/sockjs-client/-/sockjs-client-1.1.2.tgz#f0212a8550e4c9468c8cceaeefd2e3493c033ad5"
+sockjs-client@1.1.4:
+ version "1.1.4"
+ resolved "https://registry.yarnpkg.com/sockjs-client/-/sockjs-client-1.1.4.tgz#5babe386b775e4cf14e7520911452654016c8b12"
dependencies:
- debug "^2.2.0"
+ debug "^2.6.6"
eventsource "0.1.6"
faye-websocket "~0.11.0"
inherits "^2.0.1"
json3 "^3.3.2"
- url-parse "^1.1.1"
+ url-parse "^1.1.8"
sockjs@0.3.18:
version "0.3.18"
@@ -5164,9 +5465,9 @@ source-list-map@^0.1.7, source-list-map@~0.1.7:
version "0.1.8"
resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-0.1.8.tgz#c550b2ab5427f6b3f21f5afead88c4f5587b2106"
-source-list-map@^1.1.1:
- version "1.1.1"
- resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-1.1.1.tgz#1a33ac210ca144d1e561f906ebccab5669ff4cb4"
+source-list-map@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/source-list-map/-/source-list-map-2.0.0.tgz#aaa47403f7b245a92fbc97ea08f250d6087ed085"
source-map-support@^0.4.2:
version "0.4.11"
@@ -5259,10 +5560,6 @@ sshpk@^1.7.0:
jsbn "~0.1.0"
tweetnacl "~0.14.0"
-stats-webpack-plugin@^0.4.3:
- version "0.4.3"
- resolved "https://registry.yarnpkg.com/stats-webpack-plugin/-/stats-webpack-plugin-0.4.3.tgz#b2f618202f28dd04ab47d7ecf54ab846137b7aea"
-
"statuses@>= 1.3.1 < 2", statuses@~1.3.1:
version "1.3.1"
resolved "https://registry.yarnpkg.com/statuses/-/statuses-1.3.1.tgz#faf51b9eb74aaef3b3acf4ad5f61abf24cb7b93e"
@@ -5343,6 +5640,16 @@ strip-bom@^3.0.0:
version "3.0.0"
resolved "https://registry.yarnpkg.com/strip-bom/-/strip-bom-3.0.0.tgz#2334c18e9c759f7bdd56fdef7e9ae3d588e68ed3"
+strip-eof@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/strip-eof/-/strip-eof-1.0.0.tgz#bb43ff5598a6eb05d89b59fcd129c983313606bf"
+
+strip-indent@^1.0.1:
+ version "1.0.1"
+ resolved "https://registry.yarnpkg.com/strip-indent/-/strip-indent-1.0.1.tgz#0c7962a6adefa7bbd4ac366460a638552ae1a0a2"
+ dependencies:
+ get-stdin "^4.0.1"
+
strip-json-comments@~1.0.4:
version "1.0.4"
resolved "https://registry.yarnpkg.com/strip-json-comments/-/strip-json-comments-1.0.4.tgz#1e15fbcac97d3ee99bf2d73b4c656b082bbafb91"
@@ -5365,6 +5672,12 @@ supports-color@^3.1.0, supports-color@^3.1.1, supports-color@^3.1.2, supports-co
dependencies:
has-flag "^1.0.0"
+supports-color@^4.2.1:
+ version "4.2.1"
+ resolved "https://registry.yarnpkg.com/supports-color/-/supports-color-4.2.1.tgz#65a4bb2631e90e02420dba5554c375a4754bb836"
+ dependencies:
+ has-flag "^2.0.0"
+
svgo@^0.7.0:
version "0.7.2"
resolved "https://registry.yarnpkg.com/svgo/-/svgo-0.7.2.tgz#9f5772413952135c6fefbf40afe6a4faa88b4bb5"
@@ -5392,9 +5705,9 @@ tapable@^0.1.8:
version "0.1.10"
resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.1.10.tgz#29c35707c2b70e50d07482b5d202e8ed446dafd4"
-tapable@^0.2.5, tapable@~0.2.5:
- version "0.2.6"
- resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.6.tgz#206be8e188860b514425375e6f1ae89bfb01fd8d"
+tapable@^0.2.7:
+ version "0.2.7"
+ resolved "https://registry.yarnpkg.com/tapable/-/tapable-0.2.7.tgz#e46c0daacbb2b8a98b9b0cea0f4052105817ed5c"
tar-pack@~3.3.0:
version "3.3.0"
@@ -5447,6 +5760,10 @@ through@2, through@^2.3.6, through@~2.3, through@~2.3.1:
version "2.3.8"
resolved "https://registry.yarnpkg.com/through/-/through-2.3.8.tgz#0dd4c9ffaabc357960b1b724115d7e0e86a2e1f5"
+thunky@^0.1.0:
+ version "0.1.0"
+ resolved "https://registry.yarnpkg.com/thunky/-/thunky-0.1.0.tgz#bf30146824e2b6e67b0f2d7a4ac8beb26908684e"
+
timeago.js@^2.0.5:
version "2.0.5"
resolved "https://registry.yarnpkg.com/timeago.js/-/timeago.js-2.0.5.tgz#730c74fbdb0b0917a553675a4460e3a7f80db86c"
@@ -5509,6 +5826,10 @@ traverse@0.6.6:
version "0.6.6"
resolved "https://registry.yarnpkg.com/traverse/-/traverse-0.6.6.tgz#cbdf560fd7b9af632502fed40f918c157ea97137"
+trim-newlines@^1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/trim-newlines/-/trim-newlines-1.0.0.tgz#5887966bb582a4503a41eb524f7d35011815a613"
+
trim-right@^1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/trim-right/-/trim-right-1.0.1.tgz#cb2e1203067e0c8de1f614094b9fe45704ea6003"
@@ -5546,9 +5867,9 @@ typedarray@^0.0.6:
version "0.0.6"
resolved "https://registry.yarnpkg.com/typedarray/-/typedarray-0.0.6.tgz#867ac74e3864187b1d3d47d996a78ec5c8830777"
-uglify-js@^2.6, uglify-js@^2.8.27:
- version "2.8.27"
- resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.27.tgz#47787f912b0f242e5b984343be8e35e95f694c9c"
+uglify-js@^2.6, uglify-js@^2.8.29:
+ version "2.8.29"
+ resolved "https://registry.yarnpkg.com/uglify-js/-/uglify-js-2.8.29.tgz#29c5733148057bb4e1f75df35b7a9cb72e6a59dd"
dependencies:
source-map "~0.5.1"
yargs "~3.10.0"
@@ -5559,6 +5880,14 @@ uglify-to-browserify@~1.0.0:
version "1.0.2"
resolved "https://registry.yarnpkg.com/uglify-to-browserify/-/uglify-to-browserify-1.0.2.tgz#6e0924d6bda6b5afe349e39a6d632850a0f882b7"
+uglifyjs-webpack-plugin@^0.4.6:
+ version "0.4.6"
+ resolved "https://registry.yarnpkg.com/uglifyjs-webpack-plugin/-/uglifyjs-webpack-plugin-0.4.6.tgz#b951f4abb6bd617e66f63eb891498e391763e309"
+ dependencies:
+ source-map "^0.5.6"
+ uglify-js "^2.8.29"
+ webpack-sources "^1.0.1"
+
uid-number@~0.0.6:
version "0.0.6"
resolved "https://registry.yarnpkg.com/uid-number/-/uid-number-0.0.6.tgz#0ea10e8035e8eb5b8e4449f06da1c730663baa81"
@@ -5633,13 +5962,20 @@ url-parse@1.0.x:
querystringify "0.0.x"
requires-port "1.0.x"
-url-parse@^1.0.1, url-parse@^1.1.1:
+url-parse@^1.0.1:
version "1.1.7"
resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.1.7.tgz#025cff999653a459ab34232147d89514cc87d74a"
dependencies:
querystringify "0.0.x"
requires-port "1.0.x"
+url-parse@^1.1.8:
+ version "1.1.9"
+ resolved "https://registry.yarnpkg.com/url-parse/-/url-parse-1.1.9.tgz#c67f1d775d51f0a18911dd7b3ffad27bb9e5bd19"
+ dependencies:
+ querystringify "~1.0.0"
+ requires-port "1.0.x"
+
url-to-options@^1.0.1:
version "1.0.1"
resolved "https://registry.yarnpkg.com/url-to-options/-/url-to-options-1.0.1.tgz#1505a03a289a48cbd7a434efbaeec5055f5633a9"
@@ -5770,12 +6106,12 @@ vue@^2.2.6:
version "2.2.6"
resolved "https://registry.yarnpkg.com/vue/-/vue-2.2.6.tgz#451714b394dd6d4eae7b773c40c2034a59621aed"
-watchpack@^1.3.1:
- version "1.3.1"
- resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.3.1.tgz#7d8693907b28ce6013e7f3610aa2a1acf07dad87"
+watchpack@^1.4.0:
+ version "1.4.0"
+ resolved "https://registry.yarnpkg.com/watchpack/-/watchpack-1.4.0.tgz#4a1472bcbb952bd0a9bb4036801f954dfb39faac"
dependencies:
async "^2.1.2"
- chokidar "^1.4.3"
+ chokidar "^1.7.0"
graceful-fs "^4.1.2"
wbuf@^1.1.0, wbuf@^1.4.0:
@@ -5800,35 +6136,40 @@ webpack-bundle-analyzer@^2.8.2:
opener "^1.4.3"
ws "^2.3.1"
-webpack-dev-middleware@^1.0.11, webpack-dev-middleware@^1.9.0:
- version "1.10.0"
- resolved "https://registry.yarnpkg.com/webpack-dev-middleware/-/webpack-dev-middleware-1.10.0.tgz#7d5be2651e692fddfafd8aaed177c16ff51f0eb8"
+webpack-dev-middleware@^1.0.11, webpack-dev-middleware@^1.11.0:
+ version "1.11.0"
+ resolved "https://registry.yarnpkg.com/webpack-dev-middleware/-/webpack-dev-middleware-1.11.0.tgz#09691d0973a30ad1f82ac73a12e2087f0a4754f9"
dependencies:
memory-fs "~0.4.1"
mime "^1.3.4"
path-is-absolute "^1.0.0"
range-parser "^1.0.3"
-webpack-dev-server@^2.4.2:
- version "2.4.2"
- resolved "https://registry.yarnpkg.com/webpack-dev-server/-/webpack-dev-server-2.4.2.tgz#cf595d6b40878452b6d2ad7229056b686f8a16be"
+webpack-dev-server@^2.6.1:
+ version "2.6.1"
+ resolved "https://registry.yarnpkg.com/webpack-dev-server/-/webpack-dev-server-2.6.1.tgz#0b292a9da96daf80a65988f69f87b4166e5defe7"
dependencies:
ansi-html "0.0.7"
+ bonjour "^3.5.0"
chokidar "^1.6.0"
compression "^1.5.2"
connect-history-api-fallback "^1.3.0"
+ del "^3.0.0"
express "^4.13.3"
html-entities "^1.2.0"
http-proxy-middleware "~0.17.4"
+ internal-ip "^1.2.0"
+ loglevel "^1.4.1"
opn "4.0.2"
portfinder "^1.0.9"
+ selfsigned "^1.9.1"
serve-index "^1.7.2"
sockjs "0.3.18"
- sockjs-client "1.1.2"
+ sockjs-client "1.1.4"
spdy "^3.4.1"
strip-ansi "^3.0.0"
supports-color "^3.1.1"
- webpack-dev-middleware "^1.9.0"
+ webpack-dev-middleware "^1.11.0"
yargs "^6.0.0"
webpack-sources@^0.1.0:
@@ -5838,38 +6179,43 @@ webpack-sources@^0.1.0:
source-list-map "~0.1.7"
source-map "~0.5.3"
-webpack-sources@^0.2.3:
- version "0.2.3"
- resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-0.2.3.tgz#17c62bfaf13c707f9d02c479e0dcdde8380697fb"
+webpack-sources@^1.0.1:
+ version "1.0.1"
+ resolved "https://registry.yarnpkg.com/webpack-sources/-/webpack-sources-1.0.1.tgz#c7356436a4d13123be2e2426a05d1dad9cbe65cf"
dependencies:
- source-list-map "^1.1.1"
+ source-list-map "^2.0.0"
source-map "~0.5.3"
-webpack@^2.6.1:
- version "2.6.1"
- resolved "https://registry.yarnpkg.com/webpack/-/webpack-2.6.1.tgz#2e0457f0abb1ac5df3ab106c69c672f236785f07"
+webpack-stats-plugin@^0.1.5:
+ version "0.1.5"
+ resolved "https://registry.yarnpkg.com/webpack-stats-plugin/-/webpack-stats-plugin-0.1.5.tgz#29e5f12ebfd53158d31d656a113ac1f7b86179d9"
+
+webpack@^3.4.0:
+ version "3.4.0"
+ resolved "https://registry.yarnpkg.com/webpack/-/webpack-3.4.0.tgz#e9465b660ad79dd2d33874d968b31746ea9a8e63"
dependencies:
acorn "^5.0.0"
acorn-dynamic-import "^2.0.0"
- ajv "^4.7.0"
- ajv-keywords "^1.1.1"
+ ajv "^5.1.5"
+ ajv-keywords "^2.0.0"
async "^2.1.2"
- enhanced-resolve "^3.0.0"
+ enhanced-resolve "^3.4.0"
+ escope "^3.6.0"
interpret "^1.0.0"
json-loader "^0.5.4"
json5 "^0.5.1"
loader-runner "^2.3.0"
- loader-utils "^0.2.16"
+ loader-utils "^1.1.0"
memory-fs "~0.4.1"
mkdirp "~0.5.0"
node-libs-browser "^2.0.0"
source-map "^0.5.3"
- supports-color "^3.1.0"
- tapable "~0.2.5"
- uglify-js "^2.8.27"
- watchpack "^1.3.1"
- webpack-sources "^0.2.3"
- yargs "^6.0.0"
+ supports-color "^4.2.1"
+ tapable "^0.2.7"
+ uglifyjs-webpack-plugin "^0.4.6"
+ watchpack "^1.4.0"
+ webpack-sources "^1.0.1"
+ yargs "^8.0.2"
websocket-driver@>=0.3.6, websocket-driver@>=0.5.1:
version "0.6.5"
@@ -5889,7 +6235,11 @@ which-module@^1.0.0:
version "1.0.0"
resolved "https://registry.yarnpkg.com/which-module/-/which-module-1.0.0.tgz#bba63ca861948994ff307736089e3b96026c2a4f"
-which@^1.1.1, which@^1.2.1:
+which-module@^2.0.0:
+ version "2.0.0"
+ resolved "https://registry.yarnpkg.com/which-module/-/which-module-2.0.0.tgz#d9ef07dce77b9902b8a3a8fa4b31c3e3f7e6e87a"
+
+which@^1.1.1, which@^1.2.1, which@^1.2.9:
version "1.2.12"
resolved "https://registry.yarnpkg.com/which/-/which-1.2.12.tgz#de67b5e450269f194909ef23ece4ebe416fa1192"
dependencies:
@@ -5988,6 +6338,12 @@ yargs-parser@^4.2.0:
dependencies:
camelcase "^3.0.0"
+yargs-parser@^7.0.0:
+ version "7.0.0"
+ resolved "https://registry.yarnpkg.com/yargs-parser/-/yargs-parser-7.0.0.tgz#8d0ac42f16ea55debd332caf4c4038b3e3f5dfd9"
+ dependencies:
+ camelcase "^4.1.0"
+
yargs@^6.0.0:
version "6.6.0"
resolved "https://registry.yarnpkg.com/yargs/-/yargs-6.6.0.tgz#782ec21ef403345f830a808ca3d513af56065208"
@@ -6006,6 +6362,24 @@ yargs@^6.0.0:
y18n "^3.2.1"
yargs-parser "^4.2.0"
+yargs@^8.0.2:
+ version "8.0.2"
+ resolved "https://registry.yarnpkg.com/yargs/-/yargs-8.0.2.tgz#6299a9055b1cefc969ff7e79c1d918dceb22c360"
+ dependencies:
+ camelcase "^4.1.0"
+ cliui "^3.2.0"
+ decamelize "^1.1.1"
+ get-caller-file "^1.0.1"
+ os-locale "^2.0.0"
+ read-pkg-up "^2.0.0"
+ require-directory "^2.1.1"
+ require-main-filename "^1.0.1"
+ set-blocking "^2.0.0"
+ string-width "^2.0.0"
+ which-module "^2.0.0"
+ y18n "^3.2.1"
+ yargs-parser "^7.0.0"
+
yargs@~3.10.0:
version "3.10.0"
resolved "https://registry.yarnpkg.com/yargs/-/yargs-3.10.0.tgz#f7ee7bd857dd7c1d2d38c0e74efbd681d1431fd1"