summaryrefslogtreecommitdiff
path: root/include/violite.h
Commit message (Expand)AuthorAgeFilesLines
* WL#3817: Simplify string / memory area types and make things more consistent ...monty@mysql.com/narttu.mysql.fi2007-05-101-10/+10
* Merge pilot.blaudden:/home/msvensson/mysql/mysql-5.0-maintmsvensson@pilot.blaudden2007-03-281-0/+3
|\
| * Set yaSSL to use same type as MySQL do for socket handlesmsvensson@pilot.blaudden2007-03-281-0/+3
* | Merge mysql.com:/home/kent/bk/main/mysql-5.0kent@kent-amd64.(none)2006-12-231-2/+1
|\ \ | |/
| * Many files:kent@mysql.com/kent-amd64.(none)2006-12-231-2/+1
| * Add new define YASSL_PREFIX beforee including ssl.h to activate inclusion of ...msvensson@shellback.(none)2006-05-311-0/+1
* | Re-apply missing changeset, orignally pushed by elliotmonty@mysql.com2006-06-061-0/+1
* | Some fixes that were not done in original merge, compilation revealed.jani@a193-229-222-105.elisa-laajakaista.fi2006-05-111-1/+1
* | Merge ua141d10.elisa.omakaista.fi:/home/my/bk/mysql-5.0jani@ua141d10.elisa.omakaista.fi2006-05-091-16/+9
|\ \ | |/
| * Remove valgrind and compiler warningsmsvensson@neptunus.(none)2006-05-081-0/+4
| * Cleanup SSL implementationmsvensson@neptunus.(none)2006-03-101-16/+5
* | Added support for key_block_size for key and table level (WL#602)monty@mysql.com2006-05-031-0/+1
|/
* Merge mysql.com:/home/jimw/my/mysql-4.1-cleanjimw@mysql.com2005-09-121-0/+4
|\
| * Merge selena.:H:/MYSQL/src/#05588-mysql-4.0SergeyV@selena.2005-09-071-0/+4
| |\
| | * Fixes bug #5588. vio_was_interrupted() function was added to detectSergeyV@selena.2005-08-301-0/+4
* | | Merge bk-internal.mysql.com:/users/rburnett/bug9721rburnett@bk-internal.mysql.com2005-05-061-3/+3
|\ \ \ | |/ /
| * | Bug #9721 net_write_timeout not used on Windows rburnett@bk-internal.mysql.com2005-05-051-3/+3
* | | WL#2286 Compile MySQL w/YASSL supportsvoj@mysql.com2005-04-281-0/+1
* | | Mergeramil@mysql.com2005-03-301-2/+2
|\ \ \ | |/ /
| * | Fedora now defines read(2)/write(2) as macros.serg@serg.mylan2005-03-291-2/+2
* | | Porting of "buffered read" patch to 5.0 and post-review fixes.konstantin@mysql.com2005-03-061-6/+14
|/ /
* | fix indentationwax@kishkin.ru2004-12-231-11/+11
* | BUG#6056 wax@kishkin.ru2004-12-141-1/+3
* | Merge with 4.0.21monty@mysql.com2004-06-181-0/+8
|\ \ | |/
| * Fixed issue 'the definition of macro DES_ede3_cbc_encrypt is corrupt'gluh@gluh.mysql.r18.ru2004-06-171-1/+1
| * Fixed issue with compilation MySQL with OpenSSL gluh@gluh.mysql.r18.ru2004-06-091-0/+8
* | Add read_rnd_buffer_size in my.cnf example filesmonty@mysql.com2004-05-101-8/+2
* | Merge key cache structures to onemonty@mysql.com2003-11-201-1/+1
* | merge with 4.0.15monty@narttu.mysql.fi2003-08-291-132/+70
|\ \ | |/
| * vio ssl structure renames (to get rid of ending _)monty@narttu.mysql.fi2003-08-271-103/+41
* | SCRUMhf@deer.(none)2003-07-041-2/+1
* | SCRUMhf@deer.(none)2003-06-171-2/+2
* | Merge with 4.0.13monty@narttu.mysql.fi2003-05-191-2/+2
|\ \ | |/
| * Fix to remove compiler warningsmonty@mashka.mysql.fi2003-04-281-2/+2
* | Merge with 4.0monty@narttu.mysql.fi2003-03-161-3/+3
|\ \ | |/
| * postmerging fix (SCRUM)bell@sanja.is.com.ua2003-02-271-2/+2
| * client port number added to SHOW PROCESSLIST (SCRUM?)bell@sanja.is.com.ua2003-02-171-2/+2
* | After merge fixmonty@mashka.mysql.fi2003-02-041-2/+5
* | Fix for windows specific errorsvenu@myvenu.com2003-01-281-1/+1
* | Mergemonty@mashka.mysql.fi2003-01-211-1/+2
|\ \
| * | Portability fixes (for windows)monty@mashka.mysql.fi2003-01-211-1/+2
* | | Big purge about embedded library (scrum)hf@deer.mysql.r18.ru2002-12-161-5/+1
* | | Pull conflicts resolutionshf@genie.(none)2002-11-291-1/+5
|\ \ \ | |/ / |/| |
| * | Huge pullhf@genie.(none)2002-10-071-2/+7
| |\ \
| | * \ Resolving of conflicts from pullhf@bison.(none)2002-06-171-2/+7
| | |\ \
| | | * | Removing net emulation out of embedded libraryhf@bison.(none)2002-06-171-2/+7
* | | | | Merge with 4.0monty@mashka.mysql.fi2002-11-211-2/+1
|\ \ \ \ \ | | |_|_|/ | |/| | |
| * | | | Error code for ssl connectiongluh@gluh.(none)2002-11-051-2/+1
| |/ / /
* | | | Add shared memory protocol and option --protocolwax@mysql.com2002-11-151-1/+26
|/ / /
* | | Added CREATE TEMPORARY TABLES and LOCK TABLES to db and host tablesmonty@mashka.mysql.fi2002-09-161-1/+1