summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--deps/npm/CHANGELOG.md59
-rw-r--r--deps/npm/README.md8
-rw-r--r--deps/npm/doc/files/package.json.md2
-rw-r--r--deps/npm/html/doc/README.html12
-rw-r--r--deps/npm/html/doc/api/npm-bin.html2
-rw-r--r--deps/npm/html/doc/api/npm-bugs.html2
-rw-r--r--deps/npm/html/doc/api/npm-cache.html2
-rw-r--r--deps/npm/html/doc/api/npm-commands.html2
-rw-r--r--deps/npm/html/doc/api/npm-config.html2
-rw-r--r--deps/npm/html/doc/api/npm-deprecate.html2
-rw-r--r--deps/npm/html/doc/api/npm-docs.html2
-rw-r--r--deps/npm/html/doc/api/npm-edit.html2
-rw-r--r--deps/npm/html/doc/api/npm-explore.html2
-rw-r--r--deps/npm/html/doc/api/npm-help-search.html2
-rw-r--r--deps/npm/html/doc/api/npm-init.html2
-rw-r--r--deps/npm/html/doc/api/npm-install.html2
-rw-r--r--deps/npm/html/doc/api/npm-link.html2
-rw-r--r--deps/npm/html/doc/api/npm-load.html2
-rw-r--r--deps/npm/html/doc/api/npm-ls.html2
-rw-r--r--deps/npm/html/doc/api/npm-outdated.html2
-rw-r--r--deps/npm/html/doc/api/npm-owner.html2
-rw-r--r--deps/npm/html/doc/api/npm-pack.html2
-rw-r--r--deps/npm/html/doc/api/npm-prefix.html2
-rw-r--r--deps/npm/html/doc/api/npm-prune.html2
-rw-r--r--deps/npm/html/doc/api/npm-publish.html2
-rw-r--r--deps/npm/html/doc/api/npm-rebuild.html2
-rw-r--r--deps/npm/html/doc/api/npm-repo.html2
-rw-r--r--deps/npm/html/doc/api/npm-restart.html2
-rw-r--r--deps/npm/html/doc/api/npm-root.html2
-rw-r--r--deps/npm/html/doc/api/npm-run-script.html2
-rw-r--r--deps/npm/html/doc/api/npm-search.html2
-rw-r--r--deps/npm/html/doc/api/npm-shrinkwrap.html2
-rw-r--r--deps/npm/html/doc/api/npm-start.html2
-rw-r--r--deps/npm/html/doc/api/npm-stop.html2
-rw-r--r--deps/npm/html/doc/api/npm-tag.html2
-rw-r--r--deps/npm/html/doc/api/npm-test.html2
-rw-r--r--deps/npm/html/doc/api/npm-uninstall.html2
-rw-r--r--deps/npm/html/doc/api/npm-unpublish.html2
-rw-r--r--deps/npm/html/doc/api/npm-update.html2
-rw-r--r--deps/npm/html/doc/api/npm-version.html2
-rw-r--r--deps/npm/html/doc/api/npm-view.html2
-rw-r--r--deps/npm/html/doc/api/npm-whoami.html2
-rw-r--r--deps/npm/html/doc/api/npm.html4
-rw-r--r--deps/npm/html/doc/cli/npm-access.html2
-rw-r--r--deps/npm/html/doc/cli/npm-adduser.html2
-rw-r--r--deps/npm/html/doc/cli/npm-bin.html2
-rw-r--r--deps/npm/html/doc/cli/npm-bugs.html2
-rw-r--r--deps/npm/html/doc/cli/npm-build.html2
-rw-r--r--deps/npm/html/doc/cli/npm-bundle.html2
-rw-r--r--deps/npm/html/doc/cli/npm-cache.html2
-rw-r--r--deps/npm/html/doc/cli/npm-completion.html2
-rw-r--r--deps/npm/html/doc/cli/npm-config.html2
-rw-r--r--deps/npm/html/doc/cli/npm-dedupe.html2
-rw-r--r--deps/npm/html/doc/cli/npm-deprecate.html2
-rw-r--r--deps/npm/html/doc/cli/npm-dist-tag.html2
-rw-r--r--deps/npm/html/doc/cli/npm-docs.html2
-rw-r--r--deps/npm/html/doc/cli/npm-edit.html2
-rw-r--r--deps/npm/html/doc/cli/npm-explore.html2
-rw-r--r--deps/npm/html/doc/cli/npm-help-search.html2
-rw-r--r--deps/npm/html/doc/cli/npm-help.html2
-rw-r--r--deps/npm/html/doc/cli/npm-init.html2
-rw-r--r--deps/npm/html/doc/cli/npm-install.html2
-rw-r--r--deps/npm/html/doc/cli/npm-link.html2
-rw-r--r--deps/npm/html/doc/cli/npm-logout.html2
-rw-r--r--deps/npm/html/doc/cli/npm-ls.html4
-rw-r--r--deps/npm/html/doc/cli/npm-outdated.html2
-rw-r--r--deps/npm/html/doc/cli/npm-owner.html2
-rw-r--r--deps/npm/html/doc/cli/npm-pack.html2
-rw-r--r--deps/npm/html/doc/cli/npm-prefix.html2
-rw-r--r--deps/npm/html/doc/cli/npm-prune.html2
-rw-r--r--deps/npm/html/doc/cli/npm-publish.html2
-rw-r--r--deps/npm/html/doc/cli/npm-rebuild.html2
-rw-r--r--deps/npm/html/doc/cli/npm-repo.html2
-rw-r--r--deps/npm/html/doc/cli/npm-restart.html2
-rw-r--r--deps/npm/html/doc/cli/npm-rm.html2
-rw-r--r--deps/npm/html/doc/cli/npm-root.html2
-rw-r--r--deps/npm/html/doc/cli/npm-run-script.html2
-rw-r--r--deps/npm/html/doc/cli/npm-search.html2
-rw-r--r--deps/npm/html/doc/cli/npm-shrinkwrap.html2
-rw-r--r--deps/npm/html/doc/cli/npm-star.html2
-rw-r--r--deps/npm/html/doc/cli/npm-stars.html2
-rw-r--r--deps/npm/html/doc/cli/npm-start.html2
-rw-r--r--deps/npm/html/doc/cli/npm-stop.html2
-rw-r--r--deps/npm/html/doc/cli/npm-tag.html2
-rw-r--r--deps/npm/html/doc/cli/npm-test.html2
-rw-r--r--deps/npm/html/doc/cli/npm-uninstall.html2
-rw-r--r--deps/npm/html/doc/cli/npm-unpublish.html2
-rw-r--r--deps/npm/html/doc/cli/npm-update.html2
-rw-r--r--deps/npm/html/doc/cli/npm-version.html2
-rw-r--r--deps/npm/html/doc/cli/npm-view.html2
-rw-r--r--deps/npm/html/doc/cli/npm-whoami.html2
-rw-r--r--deps/npm/html/doc/cli/npm.html10
-rw-r--r--deps/npm/html/doc/files/npm-folders.html2
-rw-r--r--deps/npm/html/doc/files/npm-global.html2
-rw-r--r--deps/npm/html/doc/files/npm-json.html4
-rw-r--r--deps/npm/html/doc/files/npmrc.html2
-rw-r--r--deps/npm/html/doc/files/package.json.html4
-rw-r--r--deps/npm/html/doc/index.html2
-rw-r--r--deps/npm/html/doc/misc/npm-coding-style.html2
-rw-r--r--deps/npm/html/doc/misc/npm-config.html2
-rw-r--r--deps/npm/html/doc/misc/npm-developers.html2
-rw-r--r--deps/npm/html/doc/misc/npm-disputes.html8
-rw-r--r--deps/npm/html/doc/misc/npm-faq.html4
-rw-r--r--deps/npm/html/doc/misc/npm-index.html2
-rw-r--r--deps/npm/html/doc/misc/npm-registry.html2
-rw-r--r--deps/npm/html/doc/misc/npm-scope.html2
-rw-r--r--deps/npm/html/doc/misc/npm-scripts.html2
-rw-r--r--deps/npm/html/doc/misc/removing-npm.html2
-rw-r--r--deps/npm/html/doc/misc/semver.html2
-rw-r--r--deps/npm/html/partial/doc/README.html10
-rw-r--r--deps/npm/html/partial/doc/api/npm.html2
-rw-r--r--deps/npm/html/partial/doc/cli/npm-ls.html2
-rw-r--r--deps/npm/html/partial/doc/cli/npm.html8
-rw-r--r--deps/npm/html/partial/doc/files/npm-json.html2
-rw-r--r--deps/npm/html/partial/doc/files/package.json.html2
-rw-r--r--deps/npm/html/partial/doc/misc/npm-disputes.html6
-rw-r--r--deps/npm/html/partial/doc/misc/npm-faq.html2
-rw-r--r--deps/npm/lib/cache/add-remote-git.js2
-rw-r--r--deps/npm/lib/cache/maybe-github.js6
-rw-r--r--deps/npm/lib/cache/update-index.js124
-rw-r--r--deps/npm/lib/config/core.js1
-rw-r--r--deps/npm/lib/config/load-cafile.js6
-rw-r--r--deps/npm/lib/link.js2
-rw-r--r--deps/npm/lib/search.js30
-rw-r--r--deps/npm/lib/utils/link.js5
-rw-r--r--deps/npm/man/man1/npm-README.110
-rw-r--r--deps/npm/man/man1/npm-access.12
-rw-r--r--deps/npm/man/man1/npm-adduser.12
-rw-r--r--deps/npm/man/man1/npm-bin.12
-rw-r--r--deps/npm/man/man1/npm-bugs.12
-rw-r--r--deps/npm/man/man1/npm-build.12
-rw-r--r--deps/npm/man/man1/npm-bundle.12
-rw-r--r--deps/npm/man/man1/npm-cache.12
-rw-r--r--deps/npm/man/man1/npm-completion.12
-rw-r--r--deps/npm/man/man1/npm-config.12
-rw-r--r--deps/npm/man/man1/npm-dedupe.12
-rw-r--r--deps/npm/man/man1/npm-deprecate.12
-rw-r--r--deps/npm/man/man1/npm-dist-tag.12
-rw-r--r--deps/npm/man/man1/npm-docs.12
-rw-r--r--deps/npm/man/man1/npm-edit.12
-rw-r--r--deps/npm/man/man1/npm-explore.12
-rw-r--r--deps/npm/man/man1/npm-help-search.12
-rw-r--r--deps/npm/man/man1/npm-help.12
-rw-r--r--deps/npm/man/man1/npm-init.12
-rw-r--r--deps/npm/man/man1/npm-install.12
-rw-r--r--deps/npm/man/man1/npm-link.12
-rw-r--r--deps/npm/man/man1/npm-logout.12
-rw-r--r--deps/npm/man/man1/npm-ls.14
-rw-r--r--deps/npm/man/man1/npm-outdated.12
-rw-r--r--deps/npm/man/man1/npm-owner.12
-rw-r--r--deps/npm/man/man1/npm-pack.12
-rw-r--r--deps/npm/man/man1/npm-prefix.12
-rw-r--r--deps/npm/man/man1/npm-prune.12
-rw-r--r--deps/npm/man/man1/npm-publish.12
-rw-r--r--deps/npm/man/man1/npm-rebuild.12
-rw-r--r--deps/npm/man/man1/npm-repo.12
-rw-r--r--deps/npm/man/man1/npm-restart.12
-rw-r--r--deps/npm/man/man1/npm-rm.12
-rw-r--r--deps/npm/man/man1/npm-root.12
-rw-r--r--deps/npm/man/man1/npm-run-script.12
-rw-r--r--deps/npm/man/man1/npm-search.12
-rw-r--r--deps/npm/man/man1/npm-shrinkwrap.12
-rw-r--r--deps/npm/man/man1/npm-star.12
-rw-r--r--deps/npm/man/man1/npm-stars.12
-rw-r--r--deps/npm/man/man1/npm-start.12
-rw-r--r--deps/npm/man/man1/npm-stop.12
-rw-r--r--deps/npm/man/man1/npm-tag.12
-rw-r--r--deps/npm/man/man1/npm-test.12
-rw-r--r--deps/npm/man/man1/npm-uninstall.12
-rw-r--r--deps/npm/man/man1/npm-unpublish.12
-rw-r--r--deps/npm/man/man1/npm-update.12
-rw-r--r--deps/npm/man/man1/npm-version.12
-rw-r--r--deps/npm/man/man1/npm-view.12
-rw-r--r--deps/npm/man/man1/npm-whoami.12
-rw-r--r--deps/npm/man/man1/npm.14
-rw-r--r--deps/npm/man/man3/npm-bin.32
-rw-r--r--deps/npm/man/man3/npm-bugs.32
-rw-r--r--deps/npm/man/man3/npm-cache.32
-rw-r--r--deps/npm/man/man3/npm-commands.32
-rw-r--r--deps/npm/man/man3/npm-config.32
-rw-r--r--deps/npm/man/man3/npm-deprecate.32
-rw-r--r--deps/npm/man/man3/npm-docs.32
-rw-r--r--deps/npm/man/man3/npm-edit.32
-rw-r--r--deps/npm/man/man3/npm-explore.32
-rw-r--r--deps/npm/man/man3/npm-help-search.32
-rw-r--r--deps/npm/man/man3/npm-init.32
-rw-r--r--deps/npm/man/man3/npm-install.32
-rw-r--r--deps/npm/man/man3/npm-link.32
-rw-r--r--deps/npm/man/man3/npm-load.32
-rw-r--r--deps/npm/man/man3/npm-ls.32
-rw-r--r--deps/npm/man/man3/npm-outdated.32
-rw-r--r--deps/npm/man/man3/npm-owner.32
-rw-r--r--deps/npm/man/man3/npm-pack.32
-rw-r--r--deps/npm/man/man3/npm-prefix.32
-rw-r--r--deps/npm/man/man3/npm-prune.32
-rw-r--r--deps/npm/man/man3/npm-publish.32
-rw-r--r--deps/npm/man/man3/npm-rebuild.32
-rw-r--r--deps/npm/man/man3/npm-repo.32
-rw-r--r--deps/npm/man/man3/npm-restart.32
-rw-r--r--deps/npm/man/man3/npm-root.32
-rw-r--r--deps/npm/man/man3/npm-run-script.32
-rw-r--r--deps/npm/man/man3/npm-search.32
-rw-r--r--deps/npm/man/man3/npm-shrinkwrap.32
-rw-r--r--deps/npm/man/man3/npm-start.32
-rw-r--r--deps/npm/man/man3/npm-stop.32
-rw-r--r--deps/npm/man/man3/npm-tag.32
-rw-r--r--deps/npm/man/man3/npm-test.32
-rw-r--r--deps/npm/man/man3/npm-uninstall.32
-rw-r--r--deps/npm/man/man3/npm-unpublish.32
-rw-r--r--deps/npm/man/man3/npm-update.34
-rw-r--r--deps/npm/man/man3/npm-version.32
-rw-r--r--deps/npm/man/man3/npm-view.32
-rw-r--r--deps/npm/man/man3/npm-whoami.32
-rw-r--r--deps/npm/man/man3/npm.34
-rw-r--r--deps/npm/man/man5/npm-folders.52
-rw-r--r--deps/npm/man/man5/npm-global.52
-rw-r--r--deps/npm/man/man5/npm-json.54
-rw-r--r--deps/npm/man/man5/npmrc.52
-rw-r--r--deps/npm/man/man5/package.json.54
-rw-r--r--deps/npm/man/man7/npm-coding-style.72
-rw-r--r--deps/npm/man/man7/npm-config.72
-rw-r--r--deps/npm/man/man7/npm-developers.72
-rw-r--r--deps/npm/man/man7/npm-disputes.72
-rw-r--r--deps/npm/man/man7/npm-faq.72
-rw-r--r--deps/npm/man/man7/npm-index.72
-rw-r--r--deps/npm/man/man7/npm-registry.72
-rw-r--r--deps/npm/man/man7/npm-scope.72
-rw-r--r--deps/npm/man/man7/npm-scripts.72
-rw-r--r--deps/npm/man/man7/removing-npm.72
-rw-r--r--deps/npm/man/man7/semver.72
-rw-r--r--deps/npm/node_modules/hosted-git-info/README.md~87
-rw-r--r--deps/npm/node_modules/inflight/.eslintrc17
-rw-r--r--deps/npm/node_modules/node-gyp/addon.gypi27
-rw-r--r--deps/npm/node_modules/node-gyp/lib/build.js8
-rw-r--r--deps/npm/node_modules/node-gyp/lib/install.js40
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json1
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/glob/package.json2
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json6
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json3
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore5
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml4
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE25
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/README.md48
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js19
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js24
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js35
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js30
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js169
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js213
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js191
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js140
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js86
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js14
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js384
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js231
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js271
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/package.json60
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/tar.js173
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js53
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js132
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js367
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgzbin0 -> 19352 bytes
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js183
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js886
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js934
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js359
-rw-r--r--deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js20
-rw-r--r--deps/npm/node_modules/node-gyp/package.json3
-rw-r--r--deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c32
-rw-r--r--deps/npm/node_modules/normalize-git-url/.eslintrc19
-rw-r--r--deps/npm/node_modules/npm-registry-client/test/fixtures/@npm/npm-registry-client/cache.json1
-rw-r--r--deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/cache.json1
-rw-r--r--deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/package.tgzbin58692 -> 0 bytes
-rw-r--r--deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/cache.json1
-rw-r--r--deps/npm/node_modules/npmlog/node_modules/gauge/README.md~153
-rw-r--r--deps/npm/node_modules/npmlog/node_modules/gauge/node_modules/has-unicode/README.md~4
-rw-r--r--deps/npm/node_modules/opener/LICENSE.txt2
-rwxr-xr-xdeps/npm/node_modules/opener/opener.js5
-rw-r--r--deps/npm/node_modules/opener/package.json38
-rw-r--r--deps/npm/node_modules/read-installed/node_modules/readdir-scoped-modules/.eslintrc17
-rw-r--r--deps/npm/node_modules/request/.eslintrc39
-rw-r--r--deps/npm/node_modules/request/.travis.yml4
-rw-r--r--deps/npm/node_modules/request/CHANGELOG.md28
-rw-r--r--deps/npm/node_modules/request/README.md637
-rwxr-xr-xdeps/npm/node_modules/request/index.js81
-rw-r--r--deps/npm/node_modules/request/lib/auth.js32
-rw-r--r--deps/npm/node_modules/request/lib/getProxyFromURI.js4
-rw-r--r--deps/npm/node_modules/request/lib/har.js205
-rw-r--r--deps/npm/node_modules/request/lib/helpers.js4
-rw-r--r--deps/npm/node_modules/request/lib/multipart.js109
-rw-r--r--deps/npm/node_modules/request/lib/oauth.js38
-rw-r--r--deps/npm/node_modules/request/lib/redirect.js154
-rw-r--r--deps/npm/node_modules/request/node_modules/aws-sign2/package.json4
-rw-r--r--deps/npm/node_modules/request/node_modules/bl/.jshintrc59
-rw-r--r--deps/npm/node_modules/request/node_modules/bl/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/caseless/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/combined-stream/node_modules/delayed-stream/package.json6
-rw-r--r--deps/npm/node_modules/request/node_modules/combined-stream/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/forever-agent/index.js6
-rw-r--r--deps/npm/node_modules/request/node_modules/forever-agent/package.json37
-rw-r--r--deps/npm/node_modules/request/node_modules/form-data/node_modules/async/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/form-data/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/LICENSE21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/README.md323
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/har-validator/bin/har-validator45
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/.travis.yml3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/LICENSE19
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/README.md1646
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/component.json11
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/har-validator/node_modules/async/lib/async.js1123
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/package.json59
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/LICENSE21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/README.md676
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/changelog.md1579
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.js4679
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.min.js31
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/any.js21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/assert.js55
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/async.js106
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bind.js73
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bluebird.js11
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/call_get.js123
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/cancel.js47
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/captured_trace.js492
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/catch_filter.js66
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/context.js38
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/debuggability.js139
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/direct_resolve.js54
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/each.js12
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/errors.js111
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/es5.js80
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/filter.js12
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/finally.js99
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/generators.js136
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/join.js107
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/map.js131
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/method.js44
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/nodeify.js58
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/progress.js76
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise.js700
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_array.js142
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_resolver.js123
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promisify.js290
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/props.js79
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/queue.js90
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/race.js47
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/reduce.js146
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/schedule.js35
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/settle.js40
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/some.js125
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/synchronous_inspection.js94
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/thenables.js89
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/timers.js58
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/using.js202
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/util.js276
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/package.json96
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/index.js100
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/index.js56
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/package.json80
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/readme.md86
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/index.js11
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/package.json70
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/readme.md27
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/cli.js45
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/index.js4
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/index.js4
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/package.json86
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/readme.md33
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/index.js49
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/package.json64
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/readme.md44
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/package.json92
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/readme.md45
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/cli.js47
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/index.js6
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/index.js4
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/package.json86
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/readme.md33
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/package.json89
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/readme.md43
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/cli.js29
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/index.js43
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/license21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/package.json85
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/readme.md46
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/package.json83
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/readme.md197
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/History.md239
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/LICENSE22
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/Readme.md310
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/index.js1051
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.npmignore3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.travis.yml5
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/LICENSE21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/README.md17
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/index.js10
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/package.json47
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/package.json73
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/.npmignore6
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/History.md186
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Makefile33
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Readme.md178
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/bower.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/browser.js175
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/component.json19
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/debug.js197
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node.js209
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/.npmignore5
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/LICENSE20
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/README.md35
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/index.js123
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/package.json47
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/package.json73
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.npmignore2
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.travis.yml3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/LICENSE21
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/README.md173
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/example.js18
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/formats.js14
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js553
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.npmignore1
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.travis.yml3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/README.md72
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/example.js27
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/index.js61
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/package.json52
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/test.js33
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.npmignore1
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.travis.yml3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/README.md19
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/index.js8
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/.npmignore17
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/LICENSE22
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/README.md28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/is-property.js5
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/package.json58
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/package.json43
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/test.js12
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml6
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md31
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js79
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json60
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js100
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.jshintrc30
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.npmignore1
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/LICENCE19
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/Makefile4
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/README.md32
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/immutable.js17
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/mutable.js15
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/package.json87
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/test.js63
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json62
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/require.js12
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/fixtures/cosmic.js84
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalItems.json82
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalProperties.json88
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/allOf.json112
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/anyOf.json68
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/bignum.json107
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/default.json49
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/definitions.json32
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/dependencies.json113
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/enum.json72
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/format.json143
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/items.json46
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxItems.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxLength.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxProperties.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maximum.json42
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minItems.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minLength.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minProperties.json28
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minimum.json42
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/multipleOf.json60
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/not.json96
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/nullAndFormat.json18
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/oneOf.json68
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/pattern.json23
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/patternProperties.json110
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/properties.json92
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/ref.json128
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/refRemote.json74
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/required.json39
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/type.json330
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/uniqueItems.json79
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema.js23
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js366
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.jshintrc67
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.npmignore1
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.travis.yml3
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/LICENSE22
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/README.markdown183
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/index.js86
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/package.json71
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/package.json80
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/src/index.js45
-rw-r--r--deps/npm/node_modules/request/node_modules/har-validator/src/schemas.json222
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/boom/package.json3
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/package.json3
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/.travis.yml2
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/README.md12
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/lib/index.js44
-rw-r--r--deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/package.json19
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/test/index.js44
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/node_modules/sntp/package.json3
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/hawk/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/http-signature/node_modules/asn1/package.json9
-rw-r--r--deps/npm/node_modules/request/node_modules/http-signature/node_modules/assert-plus/package.json5
-rw-r--r--deps/npm/node_modules/request/node_modules/http-signature/node_modules/ctype/package.json7
-rw-r--r--deps/npm/node_modules/request/node_modules/http-signature/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/isstream/.jshintrc59
-rw-r--r--deps/npm/node_modules/request/node_modules/isstream/LICENSE39
-rw-r--r--deps/npm/node_modules/request/node_modules/isstream/LICENSE.md11
-rw-r--r--deps/npm/node_modules/request/node_modules/isstream/README.md2
-rw-r--r--deps/npm/node_modules/request/node_modules/isstream/package.json17
-rw-r--r--deps/npm/node_modules/request/node_modules/json-stringify-safe/package.json4
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md13
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/README.md3
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md14
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/README.md11
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json18
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json45
-rw-r--r--deps/npm/node_modules/request/node_modules/mime-types/package.json19
-rw-r--r--deps/npm/node_modules/request/node_modules/node-uuid/bower.json23
-rw-r--r--deps/npm/node_modules/request/node_modules/node-uuid/component.json4
-rw-r--r--deps/npm/node_modules/request/node_modules/node-uuid/package.json14
-rw-r--r--deps/npm/node_modules/request/node_modules/node-uuid/uuid.js10
-rw-r--r--deps/npm/node_modules/request/node_modules/oauth-sign/package.json3
-rw-r--r--deps/npm/node_modules/request/node_modules/qs/.jshintrc10
-rw-r--r--deps/npm/node_modules/request/node_modules/qs/.travis.yml4
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/qs/Readme.md11
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/qs/lib/parse.js4
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/qs/lib/stringify.js38
-rw-r--r--deps/npm/node_modules/request/node_modules/qs/package.json21
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/qs/test/parse.js2
-rwxr-xr-xdeps/npm/node_modules/request/node_modules/qs/test/stringify.js30
-rw-r--r--deps/npm/node_modules/request/node_modules/stringstream/package.json7
-rw-r--r--deps/npm/node_modules/request/node_modules/tunnel-agent/.jshintrc5
-rw-r--r--deps/npm/node_modules/request/node_modules/tunnel-agent/package.json4
-rw-r--r--deps/npm/node_modules/request/package.json38
-rw-r--r--deps/npm/node_modules/request/request.js309
-rw-r--r--deps/npm/node_modules/semver/package.json23
-rw-r--r--deps/npm/node_modules/semver/semver.browser.js27
-rw-r--r--deps/npm/node_modules/semver/semver.browser.js.gzbin7786 -> 7938 bytes
-rw-r--r--deps/npm/node_modules/semver/semver.js27
-rw-r--r--deps/npm/node_modules/semver/semver.min.js2
-rw-r--r--deps/npm/node_modules/semver/semver.min.js.gzbin3606 -> 3756 bytes
-rw-r--r--deps/npm/node_modules/semver/test/big-numbers.js24
-rw-r--r--deps/npm/node_modules/tar/lib/extract.js23
-rw-r--r--deps/npm/node_modules/tar/package.json10
-rw-r--r--deps/npm/node_modules/tar/test/dir-normalization.js141
-rw-r--r--deps/npm/node_modules/tar/test/dir-normalization.tarbin0 -> 10240 bytes
-rw-r--r--deps/npm/package.json12
-rwxr-xr-xdeps/npm/scripts/doc-build.sh2
-rw-r--r--deps/npm/test/tap/config-new-cafile.js56
-rw-r--r--deps/npm/test/tap/github-shortcut.js32
-rw-r--r--deps/npm/test/tap/link.js119
-rw-r--r--deps/npm/test/tap/update-index.js226
565 files changed, 32788 insertions, 1951 deletions
diff --git a/deps/npm/CHANGELOG.md b/deps/npm/CHANGELOG.md
index ee2004cd5b..d0cb5ea7eb 100644
--- a/deps/npm/CHANGELOG.md
+++ b/deps/npm/CHANGELOG.md
@@ -1,3 +1,60 @@
+### v2.7.5 (2015-03-26):
+
+#### BUG FIXES
+
+* [`5811468`](https://github.com/npm/npm/commit/5811468e104ccb6b26b8715dff390d68daa10066)
+ [#7713](https://github.com/npm/npm/issues/7713) Add a test for `npm link` and
+ `npm link <package>`. ([@w](https://github.com/w)atilde)
+* [`3cf3b0c`](https://github.com/npm/npm/commit/3cf3b0c8fddb6b66f969969feebea85fabd0360b)
+ [#7713](https://github.com/npm/npm/issues/7713) Only use absolute symbolic
+ links when `npm link`ing. ([@hokaccha](https://github.com/hokaccha))
+* [`f35aa93`](https://github.com/npm/npm/commit/f35aa933e136228a89e3fcfdebe8c7cc4f1e7c00)
+ [#7443](https://github.com/npm/npm/issues/7443) Keep relative URLs when
+ hitting search endpoint. ([@othiym23](https://github.com/othiym23))
+* [`eab6184`](https://github.com/npm/npm/commit/eab618425c51e3aa4416da28dcd8ca4ba63aec41)
+ [#7766](https://github.com/npm/npm/issues/7766) One last tweak to ensure that
+ GitHub shortcuts work with private repositories.
+ ([@iarna](https://github.com/iarna))
+* [`5d7f704`](https://github.com/npm/npm/commit/5d7f704823f5f92ddd7ff3e7dd2b8bcc66c73005)
+ [#7656](https://github.com/npm/npm/issues/7656) Don't try to load a deleted
+ CA file, allowing the `cafile` config to be changed.
+ ([@KenanY](https://github.com/KenanY))
+* [`a840a13`](https://github.com/npm/npm/commit/a840a13bbf0330157536381ea8e58d0bd93b4c05)
+ [#7746](https://github.com/npm/npm/issues/7746) Only fix up URL paths when
+ there are paths to fix up. ([@othiym23](https://github.com/othiym23))
+
+#### DEPENDENCY UPDATES
+
+* [`300834e`](https://github.com/npm/npm/commit/300834e91a4e2a95fb7fb59c309e7c3fc91d2312)
+ `tar@2.0.0`: Normalize symbolic links that point to targets outside the
+ extraction root. ([@othiym23](https://github.com/othiym23))
+* [`0dc6875`](https://github.com/npm/npm/commit/0dc68757cffd5397c280bc71365d106523a5a052)
+ `semver@4.3.2`: Package versions can be no more than 256 characters long.
+ ([@isaacs](https://github.com/isaacs))
+* [`94df809`](https://github.com/npm/npm/commit/94df8095985bf5ba9d8db99dc445d05dac136aaf)
+ `request@2.54.0`: Fixes for Node.js 0.12 and io.js.
+ ([@simov](https://github.com/simov))
+* [`98a13ea`](https://github.com/npm/npm/commit/98a13eafdf098b53069ad15297008fcab9c61653)
+ `opener@1.4.1`: Deal with `start` on Windows more conventionally.
+ ([@domenic](https://github.com/domenic))
+* [`c2417c7`](https://github.com/npm/npm/commit/c2417c7702459a446f07d43ca3c4e99bde7fe9d6)
+ `require-inject@1.2.0`: Add installGlobally to bypass cleanups.
+ ([@iarna](https://github.com/iarna))
+
+#### DOCUMENTATION FIXES
+
+* [`f87c728`](https://github.com/npm/npm/commit/f87c728f8732c9e977c0dc2060c0610649e79155)
+ [#7696](https://github.com/npm/npm/issues/7696) Months and minutes were
+ swapped in doc-build.sh ([@MeddahJ](https://github.com/MeddahJ))
+* [`4e216b2`](https://github.com/npm/npm/commit/4e216b29b30463f06afe6e3c645e205da5f50922)
+ [#7752](https://github.com/npm/npm/issues/7752) Update string examples to be
+ properly quoted. ([@snuggs](https://github.com/snuggs))
+* [`402f52a`](https://github.com/npm/npm/commit/402f52ab201efa348feb87cad753fc4b91e8a3fb)
+ [#7635](https://github.com/npm/npm/issues/7635) Clarify Windows installation
+ instructions. ([@msikma](https://github.com/msikma))
+* [`c910399`](https://github.com/npm/npm/commit/c910399ecfd8db49fe4496dd26887765a8aed20f)
+ small typo fix to `CHANGELOG.md` ([@e-jigsaw](https://github.com/e-jigsaw))
+
### v2.7.4 (2015-03-20):
#### BUG FIXES
@@ -105,7 +162,7 @@
* [`6823807`](https://github.com/npm/npm/commit/6823807bba6c00228a724e1205ae90d67df0adad)
[#7121](https://github.com/npm/npm/issues/7121) `npm install --save` for Git
dependencies saves the URL passed in, instead of the temporary directory used
- to clone the remote repo. Fixes using Git dependencies when shrinkwwapping.
+ to clone the remote repo. Fixes using Git dependencies when shrinkwrapping.
In the process, rewrote the Git dependency caching code. Again. No more
single-letter variable names, and a much clearer workflow.
([@othiym23](https://github.com/othiym23))
diff --git a/deps/npm/README.md b/deps/npm/README.md
index 9ed084297a..0c2705ec05 100644
--- a/deps/npm/README.md
+++ b/deps/npm/README.md
@@ -64,11 +64,11 @@ for testing, or running stuff without actually installing npm itself.)
## Windows Install or Upgrade
-You can download a zip file from <https://github.com/npm/npm/releases>, and unpack it
-in the same folder where node.exe lives.
+You can download a zip file from <https://github.com/npm/npm/releases>, and
+unpack it in the `node_modules\npm\` folder inside node's installation folder.
-The latest version in a zip file is 1.4.12. To upgrade to npm 2, follow the
-Windows upgrade instructions in the npm Troubleshooting Guide:
+To upgrade to npm 2, follow the Windows upgrade instructions in
+the npm Troubleshooting Guide:
<https://github.com/npm/npm/wiki/Troubleshooting#upgrading-on-windows>
diff --git a/deps/npm/doc/files/package.json.md b/deps/npm/doc/files/package.json.md
index 3f29a8c35c..18a398b77e 100644
--- a/deps/npm/doc/files/package.json.md
+++ b/deps/npm/doc/files/package.json.md
@@ -114,7 +114,7 @@ is an object with a "name" field and optionally "url" and "email", like this:
Or you can shorten that all into a single string, and npm will parse it for you:
- "Barney Rubble <b@rubble.com> (http://barnyrubble.tumblr.com/)
+ "Barney Rubble <b@rubble.com> (http://barnyrubble.tumblr.com/)"
Both email and url are optional either way.
diff --git a/deps/npm/html/doc/README.html b/deps/npm/html/doc/README.html
index 72c7ec0136..9cfe54be57 100644
--- a/deps/npm/html/doc/README.html
+++ b/deps/npm/html/doc/README.html
@@ -46,10 +46,10 @@ arbitrary config keys using the <code>./configure --key=val ...</code>, and then
run npm commands by doing <code>node cli.js &lt;cmd&gt; &lt;args&gt;</code>. (This is helpful
for testing, or running stuff without actually installing npm itself.)</p>
<h2 id="windows-install-or-upgrade">Windows Install or Upgrade</h2>
-<p>You can download a zip file from <a href="https://github.com/npm/npm/releases">https://github.com/npm/npm/releases</a>, and unpack it
-in the same folder where node.exe lives.</p>
-<p>The latest version in a zip file is 1.4.12. To upgrade to npm 2, follow the
-Windows upgrade instructions in the npm Troubleshooting Guide:</p>
+<p>You can download a zip file from <a href="https://github.com/npm/npm/releases">https://github.com/npm/npm/releases</a>, and
+unpack it in the <code>node_modules\npm\</code> folder inside node&#39;s installation folder.</p>
+<p>To upgrade to npm 2, follow the Windows upgrade instructions in
+the npm Troubleshooting Guide:</p>
<p><a href="https://github.com/npm/npm/wiki/Troubleshooting#upgrading-on-windows">https://github.com/npm/npm/wiki/Troubleshooting#upgrading-on-windows</a></p>
<p>If that&#39;s not fancy enough for you, then you can fetch the code with
git, and mess with it directly.</p>
@@ -126,7 +126,7 @@ specific purpose, or lack of malice in any given npm package.</p>
<p>If you have a complaint about a package in the public npm registry,
and cannot <a href="https://docs.npmjs.com/misc/disputes">resolve it with the package
owner</a>, please email
-<a href="&#x6d;&#x61;&#x69;&#x6c;&#x74;&#x6f;&#x3a;&#115;&#x75;&#x70;&#112;&#111;&#114;&#116;&#x40;&#x6e;&#112;&#x6d;&#106;&#x73;&#x2e;&#x63;&#x6f;&#x6d;">&#115;&#x75;&#x70;&#112;&#111;&#114;&#116;&#x40;&#x6e;&#112;&#x6d;&#106;&#x73;&#x2e;&#x63;&#x6f;&#x6d;</a> and explain the situation.</p>
+<a href="&#109;&#x61;&#x69;&#108;&#x74;&#x6f;&#58;&#115;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#106;&#x73;&#46;&#99;&#111;&#x6d;">&#115;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#106;&#x73;&#46;&#99;&#111;&#x6d;</a> and explain the situation.</p>
<p>Any data published to The npm Registry (including user account
information) may be removed or modified at the sole discretion of the
npm server administrators.</p>
@@ -169,5 +169,5 @@ will no doubt tell you to put the output in a gist or email.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer"><a href="../doc/README.html">README</a> &mdash; npm@2.7.4</p>
+<p id="footer"><a href="../doc/README.html">README</a> &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-bin.html b/deps/npm/html/doc/api/npm-bin.html
index 3fd6088c58..5131e0ebc1 100644
--- a/deps/npm/html/doc/api/npm-bin.html
+++ b/deps/npm/html/doc/api/npm-bin.html
@@ -28,5 +28,5 @@ to the <code>npm.bin</code> property.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-bin &mdash; npm@2.7.4</p>
+<p id="footer">npm-bin &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-bugs.html b/deps/npm/html/doc/api/npm-bugs.html
index 2eb2c43488..6289dc507e 100644
--- a/deps/npm/html/doc/api/npm-bugs.html
+++ b/deps/npm/html/doc/api/npm-bugs.html
@@ -33,5 +33,5 @@ friendly for programmatic use.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-bugs &mdash; npm@2.7.4</p>
+<p id="footer">npm-bugs &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-cache.html b/deps/npm/html/doc/api/npm-cache.html
index 0cb4d14cfd..8df692cb0e 100644
--- a/deps/npm/html/doc/api/npm-cache.html
+++ b/deps/npm/html/doc/api/npm-cache.html
@@ -42,5 +42,5 @@ incrementation.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-cache &mdash; npm@2.7.4</p>
+<p id="footer">npm-cache &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-commands.html b/deps/npm/html/doc/api/npm-commands.html
index 7fcced1b69..f5454c84b5 100644
--- a/deps/npm/html/doc/api/npm-commands.html
+++ b/deps/npm/html/doc/api/npm-commands.html
@@ -36,5 +36,5 @@ usage, or <code>man 3 npm-&lt;command&gt;</code> for programmatic usage.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-commands &mdash; npm@2.7.4</p>
+<p id="footer">npm-commands &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-config.html b/deps/npm/html/doc/api/npm-config.html
index b1b6801e6a..e104e677f5 100644
--- a/deps/npm/html/doc/api/npm-config.html
+++ b/deps/npm/html/doc/api/npm-config.html
@@ -57,5 +57,5 @@ functions instead.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-config &mdash; npm@2.7.4</p>
+<p id="footer">npm-config &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-deprecate.html b/deps/npm/html/doc/api/npm-deprecate.html
index eb3572ad55..8a7693a11b 100644
--- a/deps/npm/html/doc/api/npm-deprecate.html
+++ b/deps/npm/html/doc/api/npm-deprecate.html
@@ -47,5 +47,5 @@ a deprecation warning to all who attempt to install it.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-deprecate &mdash; npm@2.7.4</p>
+<p id="footer">npm-deprecate &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-docs.html b/deps/npm/html/doc/api/npm-docs.html
index ca14313c03..815eeecd57 100644
--- a/deps/npm/html/doc/api/npm-docs.html
+++ b/deps/npm/html/doc/api/npm-docs.html
@@ -33,5 +33,5 @@ friendly for programmatic use.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-docs &mdash; npm@2.7.4</p>
+<p id="footer">npm-docs &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-edit.html b/deps/npm/html/doc/api/npm-edit.html
index 73c306cee2..40321d18a3 100644
--- a/deps/npm/html/doc/api/npm-edit.html
+++ b/deps/npm/html/doc/api/npm-edit.html
@@ -36,5 +36,5 @@ and how this is used.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-edit &mdash; npm@2.7.4</p>
+<p id="footer">npm-edit &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-explore.html b/deps/npm/html/doc/api/npm-explore.html
index 79f4093633..5b045bc1f5 100644
--- a/deps/npm/html/doc/api/npm-explore.html
+++ b/deps/npm/html/doc/api/npm-explore.html
@@ -31,5 +31,5 @@ sure to use <code>npm rebuild &lt;pkg&gt;</code> if you make any changes.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-explore &mdash; npm@2.7.4</p>
+<p id="footer">npm-explore &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-help-search.html b/deps/npm/html/doc/api/npm-help-search.html
index 1245b350b3..159c44d925 100644
--- a/deps/npm/html/doc/api/npm-help-search.html
+++ b/deps/npm/html/doc/api/npm-help-search.html
@@ -44,5 +44,5 @@ Name of the file that matched</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-help-search &mdash; npm@2.7.4</p>
+<p id="footer">npm-help-search &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-init.html b/deps/npm/html/doc/api/npm-init.html
index 0ec6d0c7a9..696028d6ee 100644
--- a/deps/npm/html/doc/api/npm-init.html
+++ b/deps/npm/html/doc/api/npm-init.html
@@ -39,5 +39,5 @@ then go ahead and use this programmatically.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-init &mdash; npm@2.7.4</p>
+<p id="footer">npm-init &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-install.html b/deps/npm/html/doc/api/npm-install.html
index bdc174d03c..665a59af3a 100644
--- a/deps/npm/html/doc/api/npm-install.html
+++ b/deps/npm/html/doc/api/npm-install.html
@@ -32,5 +32,5 @@ installed or when an error has been encountered.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-install &mdash; npm@2.7.4</p>
+<p id="footer">npm-install &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-link.html b/deps/npm/html/doc/api/npm-link.html
index 1ce84e0618..580ed70a72 100644
--- a/deps/npm/html/doc/api/npm-link.html
+++ b/deps/npm/html/doc/api/npm-link.html
@@ -42,5 +42,5 @@ the package in the current working directory</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-link &mdash; npm@2.7.4</p>
+<p id="footer">npm-link &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-load.html b/deps/npm/html/doc/api/npm-load.html
index 4a99f46334..5c7fc776af 100644
--- a/deps/npm/html/doc/api/npm-load.html
+++ b/deps/npm/html/doc/api/npm-load.html
@@ -37,5 +37,5 @@ config object.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-load &mdash; npm@2.7.4</p>
+<p id="footer">npm-load &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-ls.html b/deps/npm/html/doc/api/npm-ls.html
index 8bd1400e97..8d732caddf 100644
--- a/deps/npm/html/doc/api/npm-ls.html
+++ b/deps/npm/html/doc/api/npm-ls.html
@@ -63,5 +63,5 @@ dependency will only be output once.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-ls &mdash; npm@2.7.4</p>
+<p id="footer">npm-ls &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-outdated.html b/deps/npm/html/doc/api/npm-outdated.html
index e81d4ad97c..5e4ceb7160 100644
--- a/deps/npm/html/doc/api/npm-outdated.html
+++ b/deps/npm/html/doc/api/npm-outdated.html
@@ -28,5 +28,5 @@ currently outdated.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-outdated &mdash; npm@2.7.4</p>
+<p id="footer">npm-outdated &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-owner.html b/deps/npm/html/doc/api/npm-owner.html
index c501d1b383..a002279b18 100644
--- a/deps/npm/html/doc/api/npm-owner.html
+++ b/deps/npm/html/doc/api/npm-owner.html
@@ -47,5 +47,5 @@ that is not implemented at this time.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-owner &mdash; npm@2.7.4</p>
+<p id="footer">npm-owner &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-pack.html b/deps/npm/html/doc/api/npm-pack.html
index 01b0291a0d..e31206bb8d 100644
--- a/deps/npm/html/doc/api/npm-pack.html
+++ b/deps/npm/html/doc/api/npm-pack.html
@@ -33,5 +33,5 @@ overwritten the second time.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-pack &mdash; npm@2.7.4</p>
+<p id="footer">npm-pack &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-prefix.html b/deps/npm/html/doc/api/npm-prefix.html
index f063710709..321a4f0386 100644
--- a/deps/npm/html/doc/api/npm-prefix.html
+++ b/deps/npm/html/doc/api/npm-prefix.html
@@ -29,5 +29,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-prefix &mdash; npm@2.7.4</p>
+<p id="footer">npm-prefix &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-prune.html b/deps/npm/html/doc/api/npm-prune.html
index f7929be9df..f0cc1c9708 100644
--- a/deps/npm/html/doc/api/npm-prune.html
+++ b/deps/npm/html/doc/api/npm-prune.html
@@ -30,5 +30,5 @@ package&#39;s dependencies list.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-prune &mdash; npm@2.7.4</p>
+<p id="footer">npm-prune &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-publish.html b/deps/npm/html/doc/api/npm-publish.html
index 6d53de2723..d9081ea844 100644
--- a/deps/npm/html/doc/api/npm-publish.html
+++ b/deps/npm/html/doc/api/npm-publish.html
@@ -46,5 +46,5 @@ the registry. Overwrites when the &quot;force&quot; environment variable is set
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-publish &mdash; npm@2.7.4</p>
+<p id="footer">npm-publish &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-rebuild.html b/deps/npm/html/doc/api/npm-rebuild.html
index 93b4fe4935..25aa4df967 100644
--- a/deps/npm/html/doc/api/npm-rebuild.html
+++ b/deps/npm/html/doc/api/npm-rebuild.html
@@ -30,5 +30,5 @@ the new binary. If no &#39;packages&#39; parameter is specify, every package wil
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-rebuild &mdash; npm@2.7.4</p>
+<p id="footer">npm-rebuild &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-repo.html b/deps/npm/html/doc/api/npm-repo.html
index 75f841d5fe..cdf86d7c42 100644
--- a/deps/npm/html/doc/api/npm-repo.html
+++ b/deps/npm/html/doc/api/npm-repo.html
@@ -33,5 +33,5 @@ friendly for programmatic use.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-repo &mdash; npm@2.7.4</p>
+<p id="footer">npm-repo &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-restart.html b/deps/npm/html/doc/api/npm-restart.html
index f1133a38ff..4e8651ab19 100644
--- a/deps/npm/html/doc/api/npm-restart.html
+++ b/deps/npm/html/doc/api/npm-restart.html
@@ -52,5 +52,5 @@ behavior will be accompanied by an increase in major version number</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-restart &mdash; npm@2.7.4</p>
+<p id="footer">npm-restart &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-root.html b/deps/npm/html/doc/api/npm-root.html
index 85c2df9af5..2d074835d4 100644
--- a/deps/npm/html/doc/api/npm-root.html
+++ b/deps/npm/html/doc/api/npm-root.html
@@ -29,5 +29,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-root &mdash; npm@2.7.4</p>
+<p id="footer">npm-root &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-run-script.html b/deps/npm/html/doc/api/npm-run-script.html
index 3655f4c286..cc5c306458 100644
--- a/deps/npm/html/doc/api/npm-run-script.html
+++ b/deps/npm/html/doc/api/npm-run-script.html
@@ -41,5 +41,5 @@ assumed to be the command to run. All other elements are ignored.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-run-script &mdash; npm@2.7.4</p>
+<p id="footer">npm-run-script &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-search.html b/deps/npm/html/doc/api/npm-search.html
index 83f59d0af9..379975da05 100644
--- a/deps/npm/html/doc/api/npm-search.html
+++ b/deps/npm/html/doc/api/npm-search.html
@@ -53,5 +53,5 @@ like).</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-search &mdash; npm@2.7.4</p>
+<p id="footer">npm-search &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-shrinkwrap.html b/deps/npm/html/doc/api/npm-shrinkwrap.html
index d40c5bd112..7e2ee6faa8 100644
--- a/deps/npm/html/doc/api/npm-shrinkwrap.html
+++ b/deps/npm/html/doc/api/npm-shrinkwrap.html
@@ -33,5 +33,5 @@ been saved.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-shrinkwrap &mdash; npm@2.7.4</p>
+<p id="footer">npm-shrinkwrap &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-start.html b/deps/npm/html/doc/api/npm-start.html
index 608de64957..371c88b597 100644
--- a/deps/npm/html/doc/api/npm-start.html
+++ b/deps/npm/html/doc/api/npm-start.html
@@ -28,5 +28,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-start &mdash; npm@2.7.4</p>
+<p id="footer">npm-start &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-stop.html b/deps/npm/html/doc/api/npm-stop.html
index dd31b08e89..be8f0a247e 100644
--- a/deps/npm/html/doc/api/npm-stop.html
+++ b/deps/npm/html/doc/api/npm-stop.html
@@ -28,5 +28,5 @@ in the <code>packages</code> parameter.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-stop &mdash; npm@2.7.4</p>
+<p id="footer">npm-stop &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-tag.html b/deps/npm/html/doc/api/npm-tag.html
index 935da0c26b..de9076fbc8 100644
--- a/deps/npm/html/doc/api/npm-tag.html
+++ b/deps/npm/html/doc/api/npm-tag.html
@@ -36,5 +36,5 @@ used. For more information about how to set this config, check
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-tag &mdash; npm@2.7.4</p>
+<p id="footer">npm-tag &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-test.html b/deps/npm/html/doc/api/npm-test.html
index ccc93c07ca..bdb2572e41 100644
--- a/deps/npm/html/doc/api/npm-test.html
+++ b/deps/npm/html/doc/api/npm-test.html
@@ -30,5 +30,5 @@ in the <code>packages</code> parameter.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-test &mdash; npm@2.7.4</p>
+<p id="footer">npm-test &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-uninstall.html b/deps/npm/html/doc/api/npm-uninstall.html
index 739796752b..34dd04d991 100644
--- a/deps/npm/html/doc/api/npm-uninstall.html
+++ b/deps/npm/html/doc/api/npm-uninstall.html
@@ -30,5 +30,5 @@ uninstalled or when an error has been encountered.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-uninstall &mdash; npm@2.7.4</p>
+<p id="footer">npm-uninstall &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-unpublish.html b/deps/npm/html/doc/api/npm-unpublish.html
index 4ce0faadfd..19a28760ce 100644
--- a/deps/npm/html/doc/api/npm-unpublish.html
+++ b/deps/npm/html/doc/api/npm-unpublish.html
@@ -33,5 +33,5 @@ the root package entry is removed from the registry entirely.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-unpublish &mdash; npm@2.7.4</p>
+<p id="footer">npm-unpublish &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-update.html b/deps/npm/html/doc/api/npm-update.html
index 52be0c53c6..7ef9855180 100644
--- a/deps/npm/html/doc/api/npm-update.html
+++ b/deps/npm/html/doc/api/npm-update.html
@@ -33,5 +33,5 @@ parameter will be called when done or when an error occurs.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-update &mdash; npm@2.7.4</p>
+<p id="footer">npm-update &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-version.html b/deps/npm/html/doc/api/npm-version.html
index 5d96ffe812..f1205e687b 100644
--- a/deps/npm/html/doc/api/npm-version.html
+++ b/deps/npm/html/doc/api/npm-version.html
@@ -32,5 +32,5 @@ not have exactly one element. The only element should be a version number.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-version &mdash; npm@2.7.4</p>
+<p id="footer">npm-version &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-view.html b/deps/npm/html/doc/api/npm-view.html
index df2f03c40f..0303f8f5cd 100644
--- a/deps/npm/html/doc/api/npm-view.html
+++ b/deps/npm/html/doc/api/npm-view.html
@@ -81,5 +81,5 @@ the field name.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-view &mdash; npm@2.7.4</p>
+<p id="footer">npm-view &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm-whoami.html b/deps/npm/html/doc/api/npm-whoami.html
index 017f49618a..0dbd82f9e1 100644
--- a/deps/npm/html/doc/api/npm-whoami.html
+++ b/deps/npm/html/doc/api/npm-whoami.html
@@ -29,5 +29,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-whoami &mdash; npm@2.7.4</p>
+<p id="footer">npm-whoami &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/api/npm.html b/deps/npm/html/doc/api/npm.html
index 74cd146f8e..2b21fb3a20 100644
--- a/deps/npm/html/doc/api/npm.html
+++ b/deps/npm/html/doc/api/npm.html
@@ -23,7 +23,7 @@ npm.load([configObject, ]function (er, npm) {
npm.commands.install([&quot;package&quot;], cb)
})
</code></pre><h2 id="version">VERSION</h2>
-<p>2.7.4</p>
+<p>2.7.5</p>
<h2 id="description">DESCRIPTION</h2>
<p>This is the API documentation for npm.
To find documentation of the command line
@@ -109,5 +109,5 @@ method names. Use the <code>npm.deref</code> method to find the real name.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm &mdash; npm@2.7.4</p>
+<p id="footer">npm &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-access.html b/deps/npm/html/doc/cli/npm-access.html
index a4aea8b89d..a1e7761cc3 100644
--- a/deps/npm/html/doc/cli/npm-access.html
+++ b/deps/npm/html/doc/cli/npm-access.html
@@ -75,5 +75,5 @@ with an HTTP 402 status code (logically enough), unless you use
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-access &mdash; npm@2.7.4</p>
+<p id="footer">npm-access &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-adduser.html b/deps/npm/html/doc/cli/npm-adduser.html
index c7865b4e14..94101e86a3 100644
--- a/deps/npm/html/doc/cli/npm-adduser.html
+++ b/deps/npm/html/doc/cli/npm-adduser.html
@@ -68,5 +68,5 @@ precedence over any global configuration.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-adduser &mdash; npm@2.7.4</p>
+<p id="footer">npm-adduser &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-bin.html b/deps/npm/html/doc/cli/npm-bin.html
index 94b778bd9f..de3c29208b 100644
--- a/deps/npm/html/doc/cli/npm-bin.html
+++ b/deps/npm/html/doc/cli/npm-bin.html
@@ -35,5 +35,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-bin &mdash; npm@2.7.4</p>
+<p id="footer">npm-bin &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-bugs.html b/deps/npm/html/doc/cli/npm-bugs.html
index 04a23c05b6..e96dc7fae8 100644
--- a/deps/npm/html/doc/cli/npm-bugs.html
+++ b/deps/npm/html/doc/cli/npm-bugs.html
@@ -54,5 +54,5 @@ a <code>package.json</code> in the current folder and use the <code>name</code>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-bugs &mdash; npm@2.7.4</p>
+<p id="footer">npm-bugs &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-build.html b/deps/npm/html/doc/cli/npm-build.html
index 4dfe30b3db..4fda5886f9 100644
--- a/deps/npm/html/doc/cli/npm-build.html
+++ b/deps/npm/html/doc/cli/npm-build.html
@@ -38,5 +38,5 @@ A folder containing a <code>package.json</code> file in its root.</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-build &mdash; npm@2.7.4</p>
+<p id="footer">npm-build &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-bundle.html b/deps/npm/html/doc/cli/npm-bundle.html
index 298d7ebb18..aee8e4ee42 100644
--- a/deps/npm/html/doc/cli/npm-bundle.html
+++ b/deps/npm/html/doc/cli/npm-bundle.html
@@ -31,5 +31,5 @@ install packages into the local space.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-bundle &mdash; npm@2.7.4</p>
+<p id="footer">npm-bundle &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-cache.html b/deps/npm/html/doc/cli/npm-cache.html
index 781f252776..333ed49e07 100644
--- a/deps/npm/html/doc/cli/npm-cache.html
+++ b/deps/npm/html/doc/cli/npm-cache.html
@@ -81,5 +81,5 @@ they do not make an HTTP request to the registry.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-cache &mdash; npm@2.7.4</p>
+<p id="footer">npm-cache &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-completion.html b/deps/npm/html/doc/cli/npm-completion.html
index 14ee7e7686..b04c6816ac 100644
--- a/deps/npm/html/doc/cli/npm-completion.html
+++ b/deps/npm/html/doc/cli/npm-completion.html
@@ -42,5 +42,5 @@ completions based on the arguments.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-completion &mdash; npm@2.7.4</p>
+<p id="footer">npm-completion &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-config.html b/deps/npm/html/doc/cli/npm-config.html
index 6afdbb4bf5..bba607d3e6 100644
--- a/deps/npm/html/doc/cli/npm-config.html
+++ b/deps/npm/html/doc/cli/npm-config.html
@@ -66,5 +66,5 @@ global config.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-config &mdash; npm@2.7.4</p>
+<p id="footer">npm-config &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-dedupe.html b/deps/npm/html/doc/cli/npm-dedupe.html
index aac9b262ab..79f03cdef3 100644
--- a/deps/npm/html/doc/cli/npm-dedupe.html
+++ b/deps/npm/html/doc/cli/npm-dedupe.html
@@ -63,5 +63,5 @@ versions.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-dedupe &mdash; npm@2.7.4</p>
+<p id="footer">npm-dedupe &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-deprecate.html b/deps/npm/html/doc/cli/npm-deprecate.html
index 57dc15ea08..ad9b0e765a 100644
--- a/deps/npm/html/doc/cli/npm-deprecate.html
+++ b/deps/npm/html/doc/cli/npm-deprecate.html
@@ -38,5 +38,5 @@ something like this:</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-deprecate &mdash; npm@2.7.4</p>
+<p id="footer">npm-deprecate &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-dist-tag.html b/deps/npm/html/doc/cli/npm-dist-tag.html
index 855b3370d8..1eab24b022 100644
--- a/deps/npm/html/doc/cli/npm-dist-tag.html
+++ b/deps/npm/html/doc/cli/npm-dist-tag.html
@@ -76,5 +76,5 @@ begin with a number or the letter <code>v</code>.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-dist-tag &mdash; npm@2.7.4</p>
+<p id="footer">npm-dist-tag &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-docs.html b/deps/npm/html/doc/cli/npm-docs.html
index 57bca77658..a0f9f665d1 100644
--- a/deps/npm/html/doc/cli/npm-docs.html
+++ b/deps/npm/html/doc/cli/npm-docs.html
@@ -56,5 +56,5 @@ the current folder and use the <code>name</code> property.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-docs &mdash; npm@2.7.4</p>
+<p id="footer">npm-docs &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-edit.html b/deps/npm/html/doc/cli/npm-edit.html
index e62355b4ba..7cd7a107e4 100644
--- a/deps/npm/html/doc/cli/npm-edit.html
+++ b/deps/npm/html/doc/cli/npm-edit.html
@@ -49,5 +49,5 @@ or <code>&quot;notepad&quot;</code> on Windows.</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-edit &mdash; npm@2.7.4</p>
+<p id="footer">npm-edit &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-explore.html b/deps/npm/html/doc/cli/npm-explore.html
index 11e2852fe7..6bb44c8c4a 100644
--- a/deps/npm/html/doc/cli/npm-explore.html
+++ b/deps/npm/html/doc/cli/npm-explore.html
@@ -49,5 +49,5 @@ Windows</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-explore &mdash; npm@2.7.4</p>
+<p id="footer">npm-explore &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-help-search.html b/deps/npm/html/doc/cli/npm-help-search.html
index 00e24251d8..fb08000129 100644
--- a/deps/npm/html/doc/cli/npm-help-search.html
+++ b/deps/npm/html/doc/cli/npm-help-search.html
@@ -46,5 +46,5 @@ where the terms were found in the documentation.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-help-search &mdash; npm@2.7.4</p>
+<p id="footer">npm-help-search &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-help.html b/deps/npm/html/doc/cli/npm-help.html
index e27a7041b5..ece9d77e35 100644
--- a/deps/npm/html/doc/cli/npm-help.html
+++ b/deps/npm/html/doc/cli/npm-help.html
@@ -52,5 +52,5 @@ matches are equivalent to specifying a topic name.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-help &mdash; npm@2.7.4</p>
+<p id="footer">npm-help &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-init.html b/deps/npm/html/doc/cli/npm-init.html
index f440313882..6745599077 100644
--- a/deps/npm/html/doc/cli/npm-init.html
+++ b/deps/npm/html/doc/cli/npm-init.html
@@ -48,5 +48,5 @@ defaults and not prompt you for any options.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-init &mdash; npm@2.7.4</p>
+<p id="footer">npm-init &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-install.html b/deps/npm/html/doc/cli/npm-install.html
index 2daed14b23..7a6586f0bd 100644
--- a/deps/npm/html/doc/cli/npm-install.html
+++ b/deps/npm/html/doc/cli/npm-install.html
@@ -240,5 +240,5 @@ affects a real use-case, it will be investigated.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-install &mdash; npm@2.7.4</p>
+<p id="footer">npm-install &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-link.html b/deps/npm/html/doc/cli/npm-link.html
index 4a14ee51b2..1cc2aa46f9 100644
--- a/deps/npm/html/doc/cli/npm-link.html
+++ b/deps/npm/html/doc/cli/npm-link.html
@@ -72,5 +72,5 @@ include that scope, e.g.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-link &mdash; npm@2.7.4</p>
+<p id="footer">npm-link &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-logout.html b/deps/npm/html/doc/cli/npm-logout.html
index 5fd1de1d36..06b7a06245 100644
--- a/deps/npm/html/doc/cli/npm-logout.html
+++ b/deps/npm/html/doc/cli/npm-logout.html
@@ -55,5 +55,5 @@ that registry at the same time.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-logout &mdash; npm@2.7.4</p>
+<p id="footer">npm-logout &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-ls.html b/deps/npm/html/doc/cli/npm-ls.html
index 65b527209d..6d8875406c 100644
--- a/deps/npm/html/doc/cli/npm-ls.html
+++ b/deps/npm/html/doc/cli/npm-ls.html
@@ -22,7 +22,7 @@ installed, as well as their dependencies, in a tree-structure.</p>
limit the results to only the paths to the packages named. Note that
nested packages will <em>also</em> show the paths to the specified packages.
For example, running <code>npm ls promzard</code> in npm&#39;s source tree will show:</p>
-<pre><code>npm@2.7.4 /path/to/npm
+<pre><code>npm@2.7.5 /path/to/npm
└─┬ init-package-json@0.0.4
└── promzard@0.1.5
</code></pre><p>It will print out extraneous, missing, and invalid packages.</p>
@@ -97,5 +97,5 @@ project.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-ls &mdash; npm@2.7.4</p>
+<p id="footer">npm-ls &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-outdated.html b/deps/npm/html/doc/cli/npm-outdated.html
index b93706992c..e1497c731f 100644
--- a/deps/npm/html/doc/cli/npm-outdated.html
+++ b/deps/npm/html/doc/cli/npm-outdated.html
@@ -67,5 +67,5 @@ project.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-outdated &mdash; npm@2.7.4</p>
+<p id="footer">npm-outdated &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-owner.html b/deps/npm/html/doc/cli/npm-owner.html
index 4a35d71aab..d7ba195a2b 100644
--- a/deps/npm/html/doc/cli/npm-owner.html
+++ b/deps/npm/html/doc/cli/npm-owner.html
@@ -49,5 +49,5 @@ that is not implemented at this time.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-owner &mdash; npm@2.7.4</p>
+<p id="footer">npm-owner &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-pack.html b/deps/npm/html/doc/cli/npm-pack.html
index 9d63fa076f..e269070151 100644
--- a/deps/npm/html/doc/cli/npm-pack.html
+++ b/deps/npm/html/doc/cli/npm-pack.html
@@ -41,5 +41,5 @@ overwritten the second time.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-pack &mdash; npm@2.7.4</p>
+<p id="footer">npm-pack &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-prefix.html b/deps/npm/html/doc/cli/npm-prefix.html
index e0aab08004..783e8024e9 100644
--- a/deps/npm/html/doc/cli/npm-prefix.html
+++ b/deps/npm/html/doc/cli/npm-prefix.html
@@ -38,5 +38,5 @@ to contain a package.json file unless <code>-g</code> is also specified.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-prefix &mdash; npm@2.7.4</p>
+<p id="footer">npm-prefix &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-prune.html b/deps/npm/html/doc/cli/npm-prune.html
index 5b19ac5b8a..76cafea3d9 100644
--- a/deps/npm/html/doc/cli/npm-prune.html
+++ b/deps/npm/html/doc/cli/npm-prune.html
@@ -39,5 +39,5 @@ packages specified in your <code>devDependencies</code>.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-prune &mdash; npm@2.7.4</p>
+<p id="footer">npm-prune &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-publish.html b/deps/npm/html/doc/cli/npm-publish.html
index 5ec4e988ee..14511e6f6f 100644
--- a/deps/npm/html/doc/cli/npm-publish.html
+++ b/deps/npm/html/doc/cli/npm-publish.html
@@ -66,5 +66,5 @@ it is removed with <a href="../cli/npm-unpublish.html"><a href="../cli/npm-unpub
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-publish &mdash; npm@2.7.4</p>
+<p id="footer">npm-publish &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-rebuild.html b/deps/npm/html/doc/cli/npm-rebuild.html
index ed0dd148ce..a59f345f25 100644
--- a/deps/npm/html/doc/cli/npm-rebuild.html
+++ b/deps/npm/html/doc/cli/npm-rebuild.html
@@ -38,5 +38,5 @@ the new binary.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-rebuild &mdash; npm@2.7.4</p>
+<p id="footer">npm-rebuild &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-repo.html b/deps/npm/html/doc/cli/npm-repo.html
index 09bc008dee..ad16cee003 100644
--- a/deps/npm/html/doc/cli/npm-repo.html
+++ b/deps/npm/html/doc/cli/npm-repo.html
@@ -42,5 +42,5 @@ a <code>package.json</code> in the current folder and use the <code>name</code>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-repo &mdash; npm@2.7.4</p>
+<p id="footer">npm-repo &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-restart.html b/deps/npm/html/doc/cli/npm-restart.html
index dde4bc9f28..ba48b30831 100644
--- a/deps/npm/html/doc/cli/npm-restart.html
+++ b/deps/npm/html/doc/cli/npm-restart.html
@@ -53,5 +53,5 @@ behavior will be accompanied by an increase in major version number</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-restart &mdash; npm@2.7.4</p>
+<p id="footer">npm-restart &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-rm.html b/deps/npm/html/doc/cli/npm-rm.html
index f3d4e6fc0d..1772909e0b 100644
--- a/deps/npm/html/doc/cli/npm-rm.html
+++ b/deps/npm/html/doc/cli/npm-rm.html
@@ -39,5 +39,5 @@ on its behalf.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-rm &mdash; npm@2.7.4</p>
+<p id="footer">npm-rm &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-root.html b/deps/npm/html/doc/cli/npm-root.html
index 98907fe361..d501f82344 100644
--- a/deps/npm/html/doc/cli/npm-root.html
+++ b/deps/npm/html/doc/cli/npm-root.html
@@ -35,5 +35,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-root &mdash; npm@2.7.4</p>
+<p id="footer">npm-root &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-run-script.html b/deps/npm/html/doc/cli/npm-run-script.html
index 7a6b3923d5..cd0325ebf4 100644
--- a/deps/npm/html/doc/cli/npm-run-script.html
+++ b/deps/npm/html/doc/cli/npm-run-script.html
@@ -56,5 +56,5 @@ you should write <code>&quot;scripts&quot;: {&quot;test&quot;: &quot;tap test/\*
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-run-script &mdash; npm@2.7.4</p>
+<p id="footer">npm-run-script &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-search.html b/deps/npm/html/doc/cli/npm-search.html
index 8df680055a..fef3bedcf5 100644
--- a/deps/npm/html/doc/cli/npm-search.html
+++ b/deps/npm/html/doc/cli/npm-search.html
@@ -49,5 +49,5 @@ fall on multiple lines.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-search &mdash; npm@2.7.4</p>
+<p id="footer">npm-search &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-shrinkwrap.html b/deps/npm/html/doc/cli/npm-shrinkwrap.html
index 0cc001ad3f..f081956435 100644
--- a/deps/npm/html/doc/cli/npm-shrinkwrap.html
+++ b/deps/npm/html/doc/cli/npm-shrinkwrap.html
@@ -164,5 +164,5 @@ contents rather than versions.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-shrinkwrap &mdash; npm@2.7.4</p>
+<p id="footer">npm-shrinkwrap &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-star.html b/deps/npm/html/doc/cli/npm-star.html
index ca70668397..8e4d07c71c 100644
--- a/deps/npm/html/doc/cli/npm-star.html
+++ b/deps/npm/html/doc/cli/npm-star.html
@@ -36,5 +36,5 @@ a vaguely positive way to show that you care.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-star &mdash; npm@2.7.4</p>
+<p id="footer">npm-star &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-stars.html b/deps/npm/html/doc/cli/npm-stars.html
index 05c72e30fe..c17863bf8d 100644
--- a/deps/npm/html/doc/cli/npm-stars.html
+++ b/deps/npm/html/doc/cli/npm-stars.html
@@ -37,5 +37,5 @@ you will most certainly enjoy this command.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-stars &mdash; npm@2.7.4</p>
+<p id="footer">npm-stars &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-start.html b/deps/npm/html/doc/cli/npm-start.html
index dbd9417392..40ecf47ace 100644
--- a/deps/npm/html/doc/cli/npm-start.html
+++ b/deps/npm/html/doc/cli/npm-start.html
@@ -34,5 +34,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-start &mdash; npm@2.7.4</p>
+<p id="footer">npm-start &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-stop.html b/deps/npm/html/doc/cli/npm-stop.html
index 7dc2bf7de6..ad8d927eae 100644
--- a/deps/npm/html/doc/cli/npm-stop.html
+++ b/deps/npm/html/doc/cli/npm-stop.html
@@ -34,5 +34,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-stop &mdash; npm@2.7.4</p>
+<p id="footer">npm-stop &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-tag.html b/deps/npm/html/doc/cli/npm-tag.html
index 3a671610ac..9824273fa8 100644
--- a/deps/npm/html/doc/cli/npm-tag.html
+++ b/deps/npm/html/doc/cli/npm-tag.html
@@ -62,5 +62,5 @@ that do not begin with a number or the letter <code>v</code>.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-tag &mdash; npm@2.7.4</p>
+<p id="footer">npm-tag &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-test.html b/deps/npm/html/doc/cli/npm-test.html
index d461e5f966..b0f1a6fb4e 100644
--- a/deps/npm/html/doc/cli/npm-test.html
+++ b/deps/npm/html/doc/cli/npm-test.html
@@ -37,5 +37,5 @@ true.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-test &mdash; npm@2.7.4</p>
+<p id="footer">npm-test &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-uninstall.html b/deps/npm/html/doc/cli/npm-uninstall.html
index 6921b46270..67b218648e 100644
--- a/deps/npm/html/doc/cli/npm-uninstall.html
+++ b/deps/npm/html/doc/cli/npm-uninstall.html
@@ -57,5 +57,5 @@ npm uninstall dtrace-provider --save-optional
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-uninstall &mdash; npm@2.7.4</p>
+<p id="footer">npm-uninstall &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-unpublish.html b/deps/npm/html/doc/cli/npm-unpublish.html
index 202c0a1586..6a554a7bb7 100644
--- a/deps/npm/html/doc/cli/npm-unpublish.html
+++ b/deps/npm/html/doc/cli/npm-unpublish.html
@@ -47,5 +47,5 @@ package again, a new version number must be used.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-unpublish &mdash; npm@2.7.4</p>
+<p id="footer">npm-unpublish &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-update.html b/deps/npm/html/doc/cli/npm-update.html
index 03f83bdc88..229b3bac99 100644
--- a/deps/npm/html/doc/cli/npm-update.html
+++ b/deps/npm/html/doc/cli/npm-update.html
@@ -119,5 +119,5 @@ be <em>downgraded</em>.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-update &mdash; npm@2.7.4</p>
+<p id="footer">npm-update &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-version.html b/deps/npm/html/doc/cli/npm-version.html
index bd323a1ab1..2ec981303c 100644
--- a/deps/npm/html/doc/cli/npm-version.html
+++ b/deps/npm/html/doc/cli/npm-version.html
@@ -65,5 +65,5 @@ Enter passphrase:
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-version &mdash; npm@2.7.4</p>
+<p id="footer">npm-version &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-view.html b/deps/npm/html/doc/cli/npm-view.html
index cb1c1b21bb..d41f16da88 100644
--- a/deps/npm/html/doc/cli/npm-view.html
+++ b/deps/npm/html/doc/cli/npm-view.html
@@ -82,5 +82,5 @@ the field name.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-view &mdash; npm@2.7.4</p>
+<p id="footer">npm-view &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm-whoami.html b/deps/npm/html/doc/cli/npm-whoami.html
index 54f7eb8822..0769395adb 100644
--- a/deps/npm/html/doc/cli/npm-whoami.html
+++ b/deps/npm/html/doc/cli/npm-whoami.html
@@ -33,5 +33,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-whoami &mdash; npm@2.7.4</p>
+<p id="footer">npm-whoami &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/cli/npm.html b/deps/npm/html/doc/cli/npm.html
index 059d6f3437..0bb0cbb777 100644
--- a/deps/npm/html/doc/cli/npm.html
+++ b/deps/npm/html/doc/cli/npm.html
@@ -13,7 +13,7 @@
<h2 id="synopsis">SYNOPSIS</h2>
<pre><code>npm &lt;command&gt; [args]
</code></pre><h2 id="version">VERSION</h2>
-<p>2.7.4</p>
+<p>2.7.5</p>
<h2 id="description">DESCRIPTION</h2>
<p>npm is the package manager for the Node JavaScript platform. It puts
modules in place so that node can find them, and manages dependency
@@ -110,7 +110,7 @@ easily by doing <code>npm view npm contributors</code>.</p>
the issues list or ask on the mailing list.</p>
<ul>
<li><a href="http://github.com/npm/npm/issues">http://github.com/npm/npm/issues</a></li>
-<li><a href="&#x6d;&#97;&#105;&#x6c;&#x74;&#x6f;&#x3a;&#x6e;&#x70;&#109;&#45;&#64;&#x67;&#111;&#x6f;&#x67;&#108;&#101;&#x67;&#114;&#x6f;&#x75;&#112;&#115;&#x2e;&#x63;&#x6f;&#x6d;">&#x6e;&#x70;&#109;&#45;&#64;&#x67;&#111;&#x6f;&#x67;&#108;&#101;&#x67;&#114;&#x6f;&#x75;&#112;&#115;&#x2e;&#x63;&#x6f;&#x6d;</a></li>
+<li><a href="&#x6d;&#97;&#x69;&#108;&#x74;&#111;&#58;&#110;&#x70;&#x6d;&#45;&#x40;&#103;&#111;&#111;&#x67;&#108;&#101;&#103;&#114;&#x6f;&#x75;&#x70;&#115;&#46;&#x63;&#111;&#x6d;">&#110;&#x70;&#x6d;&#45;&#x40;&#103;&#111;&#111;&#x67;&#108;&#101;&#103;&#114;&#x6f;&#x75;&#x70;&#115;&#46;&#x63;&#111;&#x6d;</a></li>
</ul>
<h2 id="bugs">BUGS</h2>
<p>When you find issues, please report them:</p>
@@ -118,7 +118,7 @@ the issues list or ask on the mailing list.</p>
<li>web:
<a href="http://github.com/npm/npm/issues">http://github.com/npm/npm/issues</a></li>
<li>email:
-<a href="&#109;&#97;&#105;&#108;&#x74;&#111;&#58;&#110;&#112;&#109;&#45;&#64;&#x67;&#x6f;&#x6f;&#x67;&#x6c;&#x65;&#103;&#114;&#x6f;&#117;&#x70;&#115;&#46;&#99;&#111;&#109;">&#110;&#112;&#109;&#45;&#64;&#x67;&#x6f;&#x6f;&#x67;&#x6c;&#x65;&#103;&#114;&#x6f;&#117;&#x70;&#115;&#46;&#99;&#111;&#109;</a></li>
+<a href="&#x6d;&#x61;&#105;&#108;&#116;&#x6f;&#x3a;&#x6e;&#x70;&#109;&#x2d;&#x40;&#103;&#111;&#111;&#x67;&#x6c;&#x65;&#x67;&#x72;&#111;&#x75;&#112;&#x73;&#46;&#99;&#x6f;&#109;">&#x6e;&#x70;&#109;&#x2d;&#x40;&#103;&#111;&#111;&#x67;&#x6c;&#x65;&#x67;&#x72;&#111;&#x75;&#112;&#x73;&#46;&#99;&#x6f;&#109;</a></li>
</ul>
<p>Be sure to include <em>all</em> of the output from the npm command that didn&#39;t work
as expected. The <code>npm-debug.log</code> file is also helpful to provide.</p>
@@ -128,7 +128,7 @@ will no doubt tell you to put the output in a gist or email.</p>
<p><a href="http://blog.izs.me/">Isaac Z. Schlueter</a> ::
<a href="https://github.com/isaacs/">isaacs</a> ::
<a href="http://twitter.com/izs">@izs</a> ::
-<a href="&#x6d;&#x61;&#105;&#108;&#x74;&#111;&#x3a;&#x69;&#x40;&#105;&#122;&#115;&#x2e;&#109;&#101;">&#x69;&#x40;&#105;&#122;&#115;&#x2e;&#109;&#101;</a></p>
+<a href="&#109;&#x61;&#x69;&#108;&#x74;&#x6f;&#58;&#x69;&#x40;&#105;&#x7a;&#115;&#46;&#109;&#101;">&#x69;&#x40;&#105;&#x7a;&#115;&#46;&#109;&#101;</a></p>
<h2 id="see-also">SEE ALSO</h2>
<ul>
<li><a href="../cli/npm-help.html"><a href="../cli/npm-help.html">npm-help(1)</a></a></li>
@@ -154,5 +154,5 @@ will no doubt tell you to put the output in a gist or email.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm &mdash; npm@2.7.4</p>
+<p id="footer">npm &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/files/npm-folders.html b/deps/npm/html/doc/files/npm-folders.html
index 168fc2ec81..b4a810ad89 100644
--- a/deps/npm/html/doc/files/npm-folders.html
+++ b/deps/npm/html/doc/files/npm-folders.html
@@ -184,5 +184,5 @@ cannot be found elsewhere. See <code><a href="../files/package.json.html"><a hr
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-folders &mdash; npm@2.7.4</p>
+<p id="footer">npm-folders &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/files/npm-global.html b/deps/npm/html/doc/files/npm-global.html
index 86a81d44d6..02d51dd32f 100644
--- a/deps/npm/html/doc/files/npm-global.html
+++ b/deps/npm/html/doc/files/npm-global.html
@@ -184,5 +184,5 @@ cannot be found elsewhere. See <code><a href="../files/package.json.html"><a hr
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-global &mdash; npm@2.7.4</p>
+<p id="footer">npm-global &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/files/npm-json.html b/deps/npm/html/doc/files/npm-json.html
index 37eadfebad..16fce2f90b 100644
--- a/deps/npm/html/doc/files/npm-json.html
+++ b/deps/npm/html/doc/files/npm-json.html
@@ -89,7 +89,7 @@ is an object with a &quot;name&quot; field and optionally &quot;url&quot; and &q
, &quot;url&quot; : &quot;http://barnyrubble.tumblr.com/&quot;
}
</code></pre><p>Or you can shorten that all into a single string, and npm will parse it for you:</p>
-<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)
+<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)&quot;
</code></pre><p>Both email and url are optional either way.</p>
<p>npm also sets a top-level &quot;maintainers&quot; field with your npm user info.</p>
<h2 id="files">files</h2>
@@ -496,5 +496,5 @@ ignored.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-json &mdash; npm@2.7.4</p>
+<p id="footer">npm-json &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/files/npmrc.html b/deps/npm/html/doc/files/npmrc.html
index 9aea72e9a4..360f664922 100644
--- a/deps/npm/html/doc/files/npmrc.html
+++ b/deps/npm/html/doc/files/npmrc.html
@@ -77,5 +77,5 @@ manner.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npmrc &mdash; npm@2.7.4</p>
+<p id="footer">npmrc &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/files/package.json.html b/deps/npm/html/doc/files/package.json.html
index 13dba5edeb..f8bf0c8f2f 100644
--- a/deps/npm/html/doc/files/package.json.html
+++ b/deps/npm/html/doc/files/package.json.html
@@ -89,7 +89,7 @@ is an object with a &quot;name&quot; field and optionally &quot;url&quot; and &q
, &quot;url&quot; : &quot;http://barnyrubble.tumblr.com/&quot;
}
</code></pre><p>Or you can shorten that all into a single string, and npm will parse it for you:</p>
-<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)
+<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)&quot;
</code></pre><p>Both email and url are optional either way.</p>
<p>npm also sets a top-level &quot;maintainers&quot; field with your npm user info.</p>
<h2 id="files">files</h2>
@@ -496,5 +496,5 @@ ignored.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">package.json &mdash; npm@2.7.4</p>
+<p id="footer">package.json &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/index.html b/deps/npm/html/doc/index.html
index 7f8fff793b..7b5facafb7 100644
--- a/deps/npm/html/doc/index.html
+++ b/deps/npm/html/doc/index.html
@@ -236,5 +236,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">index &mdash; npm@2.7.4</p>
+<p id="footer">index &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-coding-style.html b/deps/npm/html/doc/misc/npm-coding-style.html
index c8d521861f..39cd776ae2 100644
--- a/deps/npm/html/doc/misc/npm-coding-style.html
+++ b/deps/npm/html/doc/misc/npm-coding-style.html
@@ -147,5 +147,5 @@ set to anything.&quot;</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-coding-style &mdash; npm@2.7.4</p>
+<p id="footer">npm-coding-style &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-config.html b/deps/npm/html/doc/misc/npm-config.html
index c1060330b2..1b3ee6e458 100644
--- a/deps/npm/html/doc/misc/npm-config.html
+++ b/deps/npm/html/doc/misc/npm-config.html
@@ -788,5 +788,5 @@ exit successfully.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-config &mdash; npm@2.7.4</p>
+<p id="footer">npm-config &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-developers.html b/deps/npm/html/doc/misc/npm-developers.html
index b837dfa85b..971b1a5b22 100644
--- a/deps/npm/html/doc/misc/npm-developers.html
+++ b/deps/npm/html/doc/misc/npm-developers.html
@@ -189,5 +189,5 @@ from a fresh checkout.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-developers &mdash; npm@2.7.4</p>
+<p id="footer">npm-developers &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-disputes.html b/deps/npm/html/doc/misc/npm-disputes.html
index e4f8e17920..80acf84a70 100644
--- a/deps/npm/html/doc/misc/npm-disputes.html
+++ b/deps/npm/html/doc/misc/npm-disputes.html
@@ -13,7 +13,7 @@
<h2 id="synopsis">SYNOPSIS</h2>
<ol>
<li>Get the author email with <code>npm owner ls &lt;pkgname&gt;</code></li>
-<li>Email the author, CC <a href="&#x6d;&#97;&#105;&#108;&#x74;&#x6f;&#58;&#x73;&#x75;&#x70;&#x70;&#x6f;&#x72;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#x73;&#x2e;&#x63;&#111;&#x6d;">&#x73;&#x75;&#x70;&#x70;&#x6f;&#x72;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#x73;&#x2e;&#x63;&#111;&#x6d;</a></li>
+<li>Email the author, CC <a href="&#109;&#97;&#105;&#x6c;&#116;&#111;&#x3a;&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#x74;&#x40;&#x6e;&#112;&#109;&#x6a;&#115;&#x2e;&#x63;&#x6f;&#109;">&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#x74;&#x40;&#x6e;&#112;&#109;&#x6a;&#115;&#x2e;&#x63;&#x6f;&#109;</a></li>
<li>After a few weeks, if there&#39;s no resolution, we&#39;ll sort it out.</li>
</ol>
<p>Don&#39;t squat on package names. Publish code or move out of the way.</p>
@@ -51,12 +51,12 @@ Joe&#39;s appropriate course of action in each case is the same.</p>
owner (Bob).</li>
<li>Joe emails Bob, explaining the situation <strong>as respectfully as
possible</strong>, and what he would like to do with the module name. He
-adds the npm support staff <a href="&#109;&#x61;&#x69;&#108;&#116;&#x6f;&#x3a;&#115;&#x75;&#112;&#x70;&#x6f;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#115;&#46;&#x63;&#111;&#x6d;">&#115;&#x75;&#112;&#x70;&#x6f;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#115;&#46;&#x63;&#111;&#x6d;</a> to the CC list of
+adds the npm support staff <a href="&#x6d;&#x61;&#105;&#108;&#x74;&#x6f;&#x3a;&#115;&#x75;&#x70;&#x70;&#111;&#x72;&#116;&#64;&#x6e;&#x70;&#x6d;&#x6a;&#x73;&#46;&#99;&#x6f;&#x6d;">&#115;&#x75;&#x70;&#x70;&#111;&#x72;&#116;&#64;&#x6e;&#x70;&#x6d;&#x6a;&#x73;&#46;&#99;&#x6f;&#x6d;</a> to the CC list of
the email. Mention in the email that Bob can run <code>npm owner add
joe foo</code> to add Joe as an owner of the <code>foo</code> package.</li>
<li>After a reasonable amount of time, if Bob has not responded, or if
Bob and Joe can&#39;t come to any sort of resolution, email support
-<a href="&#109;&#97;&#105;&#108;&#x74;&#111;&#x3a;&#x73;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#x40;&#x6e;&#112;&#109;&#106;&#x73;&#x2e;&#x63;&#111;&#109;">&#x73;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#x40;&#x6e;&#112;&#109;&#106;&#x73;&#x2e;&#x63;&#111;&#109;</a> and we&#39;ll sort it out. (&quot;Reasonable&quot; is
+<a href="&#109;&#97;&#105;&#108;&#116;&#111;&#x3a;&#115;&#117;&#x70;&#112;&#111;&#x72;&#116;&#64;&#110;&#112;&#109;&#x6a;&#115;&#46;&#x63;&#111;&#109;">&#115;&#117;&#x70;&#112;&#111;&#x72;&#116;&#64;&#110;&#112;&#109;&#x6a;&#115;&#46;&#x63;&#111;&#109;</a> and we&#39;ll sort it out. (&quot;Reasonable&quot; is
usually at least 4 weeks, but extra time is allowed around common
holidays.)</li>
</ol>
@@ -112,5 +112,5 @@ things into it.</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-disputes &mdash; npm@2.7.4</p>
+<p id="footer">npm-disputes &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-faq.html b/deps/npm/html/doc/misc/npm-faq.html
index 221fd18e84..29c8bc48f8 100644
--- a/deps/npm/html/doc/misc/npm-faq.html
+++ b/deps/npm/html/doc/misc/npm-faq.html
@@ -236,7 +236,7 @@ that has a package.json in its root, or a git url.
<p>To check if the registry is down, open up
<a href="https://registry.npmjs.org/">https://registry.npmjs.org/</a> in a web browser. This will also tell
you if you are just unable to access the internet for some reason.</p>
-<p>If the registry IS down, let us know by emailing <a href="&#x6d;&#x61;&#105;&#108;&#116;&#x6f;&#x3a;&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#116;&#x40;&#x6e;&#112;&#x6d;&#x6a;&#x73;&#46;&#x63;&#111;&#109;">&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#116;&#x40;&#x6e;&#112;&#x6d;&#x6a;&#x73;&#46;&#x63;&#111;&#109;</a>
+<p>If the registry IS down, let us know by emailing <a href="&#109;&#x61;&#105;&#108;&#116;&#111;&#x3a;&#x73;&#117;&#112;&#112;&#111;&#114;&#116;&#x40;&#110;&#112;&#109;&#x6a;&#x73;&#46;&#99;&#111;&#109;">&#x73;&#117;&#112;&#112;&#111;&#114;&#116;&#x40;&#110;&#112;&#109;&#x6a;&#x73;&#46;&#99;&#111;&#109;</a>
or posting an issue at <a href="https://github.com/npm/npm/issues">https://github.com/npm/npm/issues</a>. If it&#39;s
down for the world (and not just on your local network) then we&#39;re
probably already being pinged about it.</p>
@@ -307,5 +307,5 @@ good folks at <a href="http://www.npmjs.com">npm, Inc.</a></p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-faq &mdash; npm@2.7.4</p>
+<p id="footer">npm-faq &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-index.html b/deps/npm/html/doc/misc/npm-index.html
index cc2aab8025..1da8f8d847 100644
--- a/deps/npm/html/doc/misc/npm-index.html
+++ b/deps/npm/html/doc/misc/npm-index.html
@@ -236,5 +236,5 @@
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-index &mdash; npm@2.7.4</p>
+<p id="footer">npm-index &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-registry.html b/deps/npm/html/doc/misc/npm-registry.html
index c59e94efe1..ab3efd843b 100644
--- a/deps/npm/html/doc/misc/npm-registry.html
+++ b/deps/npm/html/doc/misc/npm-registry.html
@@ -70,5 +70,5 @@ effectively implement the entire CouchDB API anyway.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-registry &mdash; npm@2.7.4</p>
+<p id="footer">npm-registry &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-scope.html b/deps/npm/html/doc/misc/npm-scope.html
index 99c1a90bf6..4e8f6e9ac1 100644
--- a/deps/npm/html/doc/misc/npm-scope.html
+++ b/deps/npm/html/doc/misc/npm-scope.html
@@ -78,5 +78,5 @@ that registry instead.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-scope &mdash; npm@2.7.4</p>
+<p id="footer">npm-scope &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/npm-scripts.html b/deps/npm/html/doc/misc/npm-scripts.html
index 050fa1a03f..e0810242a2 100644
--- a/deps/npm/html/doc/misc/npm-scripts.html
+++ b/deps/npm/html/doc/misc/npm-scripts.html
@@ -203,5 +203,5 @@ scripts is for compilation which must be done on the target architecture.</li>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">npm-scripts &mdash; npm@2.7.4</p>
+<p id="footer">npm-scripts &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/removing-npm.html b/deps/npm/html/doc/misc/removing-npm.html
index f6e1e0fcbe..03aba07d6d 100644
--- a/deps/npm/html/doc/misc/removing-npm.html
+++ b/deps/npm/html/doc/misc/removing-npm.html
@@ -57,5 +57,5 @@ modules. To track those down, you can do the following:</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">removing-npm &mdash; npm@2.7.4</p>
+<p id="footer">removing-npm &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/doc/misc/semver.html b/deps/npm/html/doc/misc/semver.html
index 32c8014701..24df1b7f13 100644
--- a/deps/npm/html/doc/misc/semver.html
+++ b/deps/npm/html/doc/misc/semver.html
@@ -282,5 +282,5 @@ range, use the <code>satisfies(version, range)</code> function.</p>
<tr><td style="width:60px;height:10px;background:rgb(237,127,127)" colspan=6>&nbsp;</td><td colspan=10 style="width:10px;height:10px;background:rgb(237,127,127)">&nbsp;</td></tr>
<tr><td colspan=5 style="width:50px;height:10px;background:#fff">&nbsp;</td><td style="width:40px;height:10px;background:rgb(237,127,127)" colspan=4>&nbsp;</td><td style="width:90px;height:10px;background:#fff" colspan=9>&nbsp;</td></tr>
</table>
-<p id="footer">semver &mdash; npm@2.7.4</p>
+<p id="footer">semver &mdash; npm@2.7.5</p>
diff --git a/deps/npm/html/partial/doc/README.html b/deps/npm/html/partial/doc/README.html
index 0ee224499e..7201d55d5d 100644
--- a/deps/npm/html/partial/doc/README.html
+++ b/deps/npm/html/partial/doc/README.html
@@ -35,10 +35,10 @@ arbitrary config keys using the <code>./configure --key=val ...</code>, and then
run npm commands by doing <code>node cli.js &lt;cmd&gt; &lt;args&gt;</code>. (This is helpful
for testing, or running stuff without actually installing npm itself.)</p>
<h2 id="windows-install-or-upgrade">Windows Install or Upgrade</h2>
-<p>You can download a zip file from <a href="https://github.com/npm/npm/releases">https://github.com/npm/npm/releases</a>, and unpack it
-in the same folder where node.exe lives.</p>
-<p>The latest version in a zip file is 1.4.12. To upgrade to npm 2, follow the
-Windows upgrade instructions in the npm Troubleshooting Guide:</p>
+<p>You can download a zip file from <a href="https://github.com/npm/npm/releases">https://github.com/npm/npm/releases</a>, and
+unpack it in the <code>node_modules\npm\</code> folder inside node&#39;s installation folder.</p>
+<p>To upgrade to npm 2, follow the Windows upgrade instructions in
+the npm Troubleshooting Guide:</p>
<p><a href="https://github.com/npm/npm/wiki/Troubleshooting#upgrading-on-windows">https://github.com/npm/npm/wiki/Troubleshooting#upgrading-on-windows</a></p>
<p>If that&#39;s not fancy enough for you, then you can fetch the code with
git, and mess with it directly.</p>
@@ -115,7 +115,7 @@ specific purpose, or lack of malice in any given npm package.</p>
<p>If you have a complaint about a package in the public npm registry,
and cannot <a href="https://docs.npmjs.com/misc/disputes">resolve it with the package
owner</a>, please email
-<a href="&#x6d;&#x61;&#x69;&#x6c;&#x74;&#x6f;&#x3a;&#115;&#x75;&#x70;&#112;&#111;&#114;&#116;&#x40;&#x6e;&#112;&#x6d;&#106;&#x73;&#x2e;&#x63;&#x6f;&#x6d;">&#115;&#x75;&#x70;&#112;&#111;&#114;&#116;&#x40;&#x6e;&#112;&#x6d;&#106;&#x73;&#x2e;&#x63;&#x6f;&#x6d;</a> and explain the situation.</p>
+<a href="&#109;&#x61;&#x69;&#108;&#x74;&#x6f;&#58;&#115;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#106;&#x73;&#46;&#99;&#111;&#x6d;">&#115;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#106;&#x73;&#46;&#99;&#111;&#x6d;</a> and explain the situation.</p>
<p>Any data published to The npm Registry (including user account
information) may be removed or modified at the sole discretion of the
npm server administrators.</p>
diff --git a/deps/npm/html/partial/doc/api/npm.html b/deps/npm/html/partial/doc/api/npm.html
index 706cf0a9e4..41512147bc 100644
--- a/deps/npm/html/partial/doc/api/npm.html
+++ b/deps/npm/html/partial/doc/api/npm.html
@@ -12,7 +12,7 @@ npm.load([configObject, ]function (er, npm) {
npm.commands.install([&quot;package&quot;], cb)
})
</code></pre><h2 id="version">VERSION</h2>
-<p>2.7.4</p>
+<p>2.7.5</p>
<h2 id="description">DESCRIPTION</h2>
<p>This is the API documentation for npm.
To find documentation of the command line
diff --git a/deps/npm/html/partial/doc/cli/npm-ls.html b/deps/npm/html/partial/doc/cli/npm-ls.html
index 76fc9a7e15..c10abb55b8 100644
--- a/deps/npm/html/partial/doc/cli/npm-ls.html
+++ b/deps/npm/html/partial/doc/cli/npm-ls.html
@@ -11,7 +11,7 @@ installed, as well as their dependencies, in a tree-structure.</p>
limit the results to only the paths to the packages named. Note that
nested packages will <em>also</em> show the paths to the specified packages.
For example, running <code>npm ls promzard</code> in npm&#39;s source tree will show:</p>
-<pre><code>npm@2.7.4 /path/to/npm
+<pre><code>npm@2.7.5 /path/to/npm
└─┬ init-package-json@0.0.4
└── promzard@0.1.5
</code></pre><p>It will print out extraneous, missing, and invalid packages.</p>
diff --git a/deps/npm/html/partial/doc/cli/npm.html b/deps/npm/html/partial/doc/cli/npm.html
index c2272b8f0d..334a5886fe 100644
--- a/deps/npm/html/partial/doc/cli/npm.html
+++ b/deps/npm/html/partial/doc/cli/npm.html
@@ -2,7 +2,7 @@
<h2 id="synopsis">SYNOPSIS</h2>
<pre><code>npm &lt;command&gt; [args]
</code></pre><h2 id="version">VERSION</h2>
-<p>2.7.4</p>
+<p>2.7.5</p>
<h2 id="description">DESCRIPTION</h2>
<p>npm is the package manager for the Node JavaScript platform. It puts
modules in place so that node can find them, and manages dependency
@@ -99,7 +99,7 @@ easily by doing <code>npm view npm contributors</code>.</p>
the issues list or ask on the mailing list.</p>
<ul>
<li><a href="http://github.com/npm/npm/issues">http://github.com/npm/npm/issues</a></li>
-<li><a href="&#x6d;&#97;&#105;&#x6c;&#x74;&#x6f;&#x3a;&#x6e;&#x70;&#109;&#45;&#64;&#x67;&#111;&#x6f;&#x67;&#108;&#101;&#x67;&#114;&#x6f;&#x75;&#112;&#115;&#x2e;&#x63;&#x6f;&#x6d;">&#x6e;&#x70;&#109;&#45;&#64;&#x67;&#111;&#x6f;&#x67;&#108;&#101;&#x67;&#114;&#x6f;&#x75;&#112;&#115;&#x2e;&#x63;&#x6f;&#x6d;</a></li>
+<li><a href="&#x6d;&#97;&#x69;&#108;&#x74;&#111;&#58;&#110;&#x70;&#x6d;&#45;&#x40;&#103;&#111;&#111;&#x67;&#108;&#101;&#103;&#114;&#x6f;&#x75;&#x70;&#115;&#46;&#x63;&#111;&#x6d;">&#110;&#x70;&#x6d;&#45;&#x40;&#103;&#111;&#111;&#x67;&#108;&#101;&#103;&#114;&#x6f;&#x75;&#x70;&#115;&#46;&#x63;&#111;&#x6d;</a></li>
</ul>
<h2 id="bugs">BUGS</h2>
<p>When you find issues, please report them:</p>
@@ -107,7 +107,7 @@ the issues list or ask on the mailing list.</p>
<li>web:
<a href="http://github.com/npm/npm/issues">http://github.com/npm/npm/issues</a></li>
<li>email:
-<a href="&#109;&#97;&#105;&#108;&#x74;&#111;&#58;&#110;&#112;&#109;&#45;&#64;&#x67;&#x6f;&#x6f;&#x67;&#x6c;&#x65;&#103;&#114;&#x6f;&#117;&#x70;&#115;&#46;&#99;&#111;&#109;">&#110;&#112;&#109;&#45;&#64;&#x67;&#x6f;&#x6f;&#x67;&#x6c;&#x65;&#103;&#114;&#x6f;&#117;&#x70;&#115;&#46;&#99;&#111;&#109;</a></li>
+<a href="&#x6d;&#x61;&#105;&#108;&#116;&#x6f;&#x3a;&#x6e;&#x70;&#109;&#x2d;&#x40;&#103;&#111;&#111;&#x67;&#x6c;&#x65;&#x67;&#x72;&#111;&#x75;&#112;&#x73;&#46;&#99;&#x6f;&#109;">&#x6e;&#x70;&#109;&#x2d;&#x40;&#103;&#111;&#111;&#x67;&#x6c;&#x65;&#x67;&#x72;&#111;&#x75;&#112;&#x73;&#46;&#99;&#x6f;&#109;</a></li>
</ul>
<p>Be sure to include <em>all</em> of the output from the npm command that didn&#39;t work
as expected. The <code>npm-debug.log</code> file is also helpful to provide.</p>
@@ -117,7 +117,7 @@ will no doubt tell you to put the output in a gist or email.</p>
<p><a href="http://blog.izs.me/">Isaac Z. Schlueter</a> ::
<a href="https://github.com/isaacs/">isaacs</a> ::
<a href="http://twitter.com/izs">@izs</a> ::
-<a href="&#x6d;&#x61;&#105;&#108;&#x74;&#111;&#x3a;&#x69;&#x40;&#105;&#122;&#115;&#x2e;&#109;&#101;">&#x69;&#x40;&#105;&#122;&#115;&#x2e;&#109;&#101;</a></p>
+<a href="&#109;&#x61;&#x69;&#108;&#x74;&#x6f;&#58;&#x69;&#x40;&#105;&#x7a;&#115;&#46;&#109;&#101;">&#x69;&#x40;&#105;&#x7a;&#115;&#46;&#109;&#101;</a></p>
<h2 id="see-also">SEE ALSO</h2>
<ul>
<li><a href="../cli/npm-help.html">npm-help(1)</a></li>
diff --git a/deps/npm/html/partial/doc/files/npm-json.html b/deps/npm/html/partial/doc/files/npm-json.html
index 401d27aec8..4d5937d4da 100644
--- a/deps/npm/html/partial/doc/files/npm-json.html
+++ b/deps/npm/html/partial/doc/files/npm-json.html
@@ -78,7 +78,7 @@ is an object with a &quot;name&quot; field and optionally &quot;url&quot; and &q
, &quot;url&quot; : &quot;http://barnyrubble.tumblr.com/&quot;
}
</code></pre><p>Or you can shorten that all into a single string, and npm will parse it for you:</p>
-<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)
+<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)&quot;
</code></pre><p>Both email and url are optional either way.</p>
<p>npm also sets a top-level &quot;maintainers&quot; field with your npm user info.</p>
<h2 id="files">files</h2>
diff --git a/deps/npm/html/partial/doc/files/package.json.html b/deps/npm/html/partial/doc/files/package.json.html
index 401d27aec8..4d5937d4da 100644
--- a/deps/npm/html/partial/doc/files/package.json.html
+++ b/deps/npm/html/partial/doc/files/package.json.html
@@ -78,7 +78,7 @@ is an object with a &quot;name&quot; field and optionally &quot;url&quot; and &q
, &quot;url&quot; : &quot;http://barnyrubble.tumblr.com/&quot;
}
</code></pre><p>Or you can shorten that all into a single string, and npm will parse it for you:</p>
-<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)
+<pre><code>&quot;Barney Rubble &lt;b@rubble.com&gt; (http://barnyrubble.tumblr.com/)&quot;
</code></pre><p>Both email and url are optional either way.</p>
<p>npm also sets a top-level &quot;maintainers&quot; field with your npm user info.</p>
<h2 id="files">files</h2>
diff --git a/deps/npm/html/partial/doc/misc/npm-disputes.html b/deps/npm/html/partial/doc/misc/npm-disputes.html
index 6291bafaf8..0f2eedad3a 100644
--- a/deps/npm/html/partial/doc/misc/npm-disputes.html
+++ b/deps/npm/html/partial/doc/misc/npm-disputes.html
@@ -2,7 +2,7 @@
<h2 id="synopsis">SYNOPSIS</h2>
<ol>
<li>Get the author email with <code>npm owner ls &lt;pkgname&gt;</code></li>
-<li>Email the author, CC <a href="&#x6d;&#97;&#105;&#108;&#x74;&#x6f;&#58;&#x73;&#x75;&#x70;&#x70;&#x6f;&#x72;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#x73;&#x2e;&#x63;&#111;&#x6d;">&#x73;&#x75;&#x70;&#x70;&#x6f;&#x72;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#x73;&#x2e;&#x63;&#111;&#x6d;</a></li>
+<li>Email the author, CC <a href="&#109;&#97;&#105;&#x6c;&#116;&#111;&#x3a;&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#x74;&#x40;&#x6e;&#112;&#109;&#x6a;&#115;&#x2e;&#x63;&#x6f;&#109;">&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#x74;&#x40;&#x6e;&#112;&#109;&#x6a;&#115;&#x2e;&#x63;&#x6f;&#109;</a></li>
<li>After a few weeks, if there&#39;s no resolution, we&#39;ll sort it out.</li>
</ol>
<p>Don&#39;t squat on package names. Publish code or move out of the way.</p>
@@ -40,12 +40,12 @@ Joe&#39;s appropriate course of action in each case is the same.</p>
owner (Bob).</li>
<li>Joe emails Bob, explaining the situation <strong>as respectfully as
possible</strong>, and what he would like to do with the module name. He
-adds the npm support staff <a href="&#109;&#x61;&#x69;&#108;&#116;&#x6f;&#x3a;&#115;&#x75;&#112;&#x70;&#x6f;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#115;&#46;&#x63;&#111;&#x6d;">&#115;&#x75;&#112;&#x70;&#x6f;&#114;&#x74;&#64;&#110;&#112;&#x6d;&#x6a;&#115;&#46;&#x63;&#111;&#x6d;</a> to the CC list of
+adds the npm support staff <a href="&#x6d;&#x61;&#105;&#108;&#x74;&#x6f;&#x3a;&#115;&#x75;&#x70;&#x70;&#111;&#x72;&#116;&#64;&#x6e;&#x70;&#x6d;&#x6a;&#x73;&#46;&#99;&#x6f;&#x6d;">&#115;&#x75;&#x70;&#x70;&#111;&#x72;&#116;&#64;&#x6e;&#x70;&#x6d;&#x6a;&#x73;&#46;&#99;&#x6f;&#x6d;</a> to the CC list of
the email. Mention in the email that Bob can run <code>npm owner add
joe foo</code> to add Joe as an owner of the <code>foo</code> package.</li>
<li>After a reasonable amount of time, if Bob has not responded, or if
Bob and Joe can&#39;t come to any sort of resolution, email support
-<a href="&#109;&#97;&#105;&#108;&#x74;&#111;&#x3a;&#x73;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#x40;&#x6e;&#112;&#109;&#106;&#x73;&#x2e;&#x63;&#111;&#109;">&#x73;&#x75;&#112;&#x70;&#111;&#114;&#x74;&#x40;&#x6e;&#112;&#109;&#106;&#x73;&#x2e;&#x63;&#111;&#109;</a> and we&#39;ll sort it out. (&quot;Reasonable&quot; is
+<a href="&#109;&#97;&#105;&#108;&#116;&#111;&#x3a;&#115;&#117;&#x70;&#112;&#111;&#x72;&#116;&#64;&#110;&#112;&#109;&#x6a;&#115;&#46;&#x63;&#111;&#109;">&#115;&#117;&#x70;&#112;&#111;&#x72;&#116;&#64;&#110;&#112;&#109;&#x6a;&#115;&#46;&#x63;&#111;&#109;</a> and we&#39;ll sort it out. (&quot;Reasonable&quot; is
usually at least 4 weeks, but extra time is allowed around common
holidays.)</li>
</ol>
diff --git a/deps/npm/html/partial/doc/misc/npm-faq.html b/deps/npm/html/partial/doc/misc/npm-faq.html
index b8cc31c725..7aa6014ac9 100644
--- a/deps/npm/html/partial/doc/misc/npm-faq.html
+++ b/deps/npm/html/partial/doc/misc/npm-faq.html
@@ -225,7 +225,7 @@ that has a package.json in its root, or a git url.
<p>To check if the registry is down, open up
<a href="https://registry.npmjs.org/">https://registry.npmjs.org/</a> in a web browser. This will also tell
you if you are just unable to access the internet for some reason.</p>
-<p>If the registry IS down, let us know by emailing <a href="&#x6d;&#x61;&#105;&#108;&#116;&#x6f;&#x3a;&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#116;&#x40;&#x6e;&#112;&#x6d;&#x6a;&#x73;&#46;&#x63;&#111;&#109;">&#x73;&#x75;&#112;&#x70;&#x6f;&#x72;&#116;&#x40;&#x6e;&#112;&#x6d;&#x6a;&#x73;&#46;&#x63;&#111;&#109;</a>
+<p>If the registry IS down, let us know by emailing <a href="&#109;&#x61;&#105;&#108;&#116;&#111;&#x3a;&#x73;&#117;&#112;&#112;&#111;&#114;&#116;&#x40;&#110;&#112;&#109;&#x6a;&#x73;&#46;&#99;&#111;&#109;">&#x73;&#117;&#112;&#112;&#111;&#114;&#116;&#x40;&#110;&#112;&#109;&#x6a;&#x73;&#46;&#99;&#111;&#109;</a>
or posting an issue at <a href="https://github.com/npm/npm/issues">https://github.com/npm/npm/issues</a>. If it&#39;s
down for the world (and not just on your local network) then we&#39;re
probably already being pinged about it.</p>
diff --git a/deps/npm/lib/cache/add-remote-git.js b/deps/npm/lib/cache/add-remote-git.js
index 9eaf6b18a5..cf0a5d4c8c 100644
--- a/deps/npm/lib/cache/add-remote-git.js
+++ b/deps/npm/lib/cache/add-remote-git.js
@@ -354,7 +354,7 @@ function getResolved (uri, treeish) {
// https://github.com/npm/npm/issues/3224
var spo = uri.split(parsed.host)
var spr = resolved.split(parsed.host)
- if (spo[1].charAt(0) === ':' && spr[1].charAt(0) === '/') {
+ if (spo[1] && spo[1].charAt(0) === ':' && spr[1] && spr[1].charAt(0) === '/') {
spr[1] = spr[1].slice(1)
}
return spr.join(parsed.host)
diff --git a/deps/npm/lib/cache/maybe-github.js b/deps/npm/lib/cache/maybe-github.js
index 44d9031066..1a033c3d5a 100644
--- a/deps/npm/lib/cache/maybe-github.js
+++ b/deps/npm/lib/cache/maybe-github.js
@@ -13,12 +13,12 @@ module.exports = function maybeGithub (p, cb) {
return addRemoteGit(parsed.git(), true, function (er, data) {
if (er) {
log.info("maybeGithub", "Couldn't clone %s", parsed.git())
- log.info("maybeGithub", "Now attempting %s from %s", p, parsed.ssh())
+ log.info("maybeGithub", "Now attempting %s from %s", p, parsed.sshurl())
- return addRemoteGit(parsed.ssh(), false, function (er, data) {
+ return addRemoteGit(parsed.sshurl(), false, function (er, data) {
if (er) return cb(er)
- success(parsed.ssh(), data)
+ success(parsed.sshurl(), data)
})
}
diff --git a/deps/npm/lib/cache/update-index.js b/deps/npm/lib/cache/update-index.js
index 2955f6a148..ab1ede120b 100644
--- a/deps/npm/lib/cache/update-index.js
+++ b/deps/npm/lib/cache/update-index.js
@@ -1,82 +1,86 @@
module.exports = updateIndex
-var fs = require("graceful-fs")
- , assert = require("assert")
- , path = require("path")
- , mkdir = require("mkdirp")
- , chownr = require("chownr")
- , url = require("url")
- , npm = require("../npm.js")
- , log = require("npmlog")
- , cacheFile = require("npm-cache-filename")
- , getCacheStat = require("./get-stat.js")
+var fs = require('graceful-fs')
+var assert = require('assert')
+var path = require('path')
+var mkdir = require('mkdirp')
+var chownr = require('chownr')
+var npm = require('../npm.js')
+var log = require('npmlog')
+var cacheFile = require('npm-cache-filename')
+var getCacheStat = require('./get-stat.js')
+var mapToRegistry = require('../utils/map-to-registry.js')
/* /-/all is special.
* It uses timestamp-based caching and partial updates,
* because it is a monster.
*/
-function updateIndex (uri, params, cb) {
- assert(typeof uri === "string", "must pass registry URI to updateIndex")
- assert(params && typeof params === "object", "must pass params to updateIndex")
- assert(typeof cb === "function", "must pass callback to updateIndex")
-
- var parsed = url.parse(uri)
- assert(
- parsed.protocol === "http:" || parsed.protocol === "https:",
- "must have a URL that starts with http: or https:"
- )
-
- var cacheBase = cacheFile(npm.config.get("cache"))(uri)
- var cachePath = path.join(cacheBase, ".cache.json")
- log.info("updateIndex", cachePath)
-
- getCacheStat(function (er, st) {
+function updateIndex (staleness, cb) {
+ assert(typeof cb === 'function', 'must pass callback to updateIndex')
+
+ mapToRegistry('-/all', npm.config, function (er, uri, auth) {
if (er) return cb(er)
- mkdir(cacheBase, function (er, made) {
- if (er) return cb(er)
+ var params = {
+ timeout: staleness,
+ follow: true,
+ staleOk: true,
+ auth: auth
+ }
+ var cacheBase = cacheFile(npm.config.get('cache'))(uri)
+ var cachePath = path.join(cacheBase, '.cache.json')
+ log.info('updateIndex', cachePath)
- fs.readFile(cachePath, function (er, data) {
- if (er) return updateIndex_(uri, params, 0, {}, cachePath, cb)
+ getCacheStat(function (er, st) {
+ if (er) return cb(er)
- try {
- data = JSON.parse(data)
- }
- catch (ex) {
- fs.writeFile(cachePath, "{}", function (er) {
- if (er) return cb(new Error("Broken cache."))
+ mkdir(cacheBase, function (er, made) {
+ if (er) return cb(er)
- return updateIndex_(uri, params, 0, {}, cachePath, cb)
+ fs.readFile(cachePath, function (er, data) {
+ if (er) {
+ log.warn('', 'Building the local index for the first time, please be patient')
+ return updateIndex_(uri, params, {}, cachePath, cb)
+ }
+
+ chownr(made || cachePath, st.uid, st.gid, function (er) {
+ if (er) return cb(er)
+
+ try {
+ data = JSON.parse(data)
+ } catch (ex) {
+ fs.writeFile(cachePath, '{}', function (er) {
+ if (er) return cb(new Error('Broken cache.'))
+
+ log.warn('', 'Building the local index for the first time, please be patient')
+ return updateIndex_(uri, params, {}, cachePath, cb)
+ })
+ }
+
+ var t = +data._updated || 0
+ // use the cache and update in the background if it's not too old
+ if (Date.now() - t < 60000) {
+ cb(null, data)
+ cb = function () {}
+ }
+
+ if (t === 0) {
+ log.warn('', 'Building the local index for the first time, please be patient')
+ } else {
+ log.verbose('updateIndex', 'Cached search data present with timestamp', t)
+ uri += '/since?stale=update_after&startkey=' + t
+ }
+ updateIndex_(uri, params, data, cachePath, cb)
})
- }
- var t = +data._updated || 0
- chownr(made || cachePath, st.uid, st.gid, function (er) {
- if (er) return cb(er)
-
- updateIndex_(uri, params, t, data, cachePath, cb)
})
})
})
})
}
-function updateIndex_ (uri, params, t, data, cachePath, cb) {
- // use the cache and update in the background if it's not too old
- if (Date.now() - t < 60000) {
- cb(null, data)
- cb = function () {}
- }
-
- var full
- if (t === 0) {
- log.warn("", "Building the local index for the first time, please be patient")
- full = url.resolve(uri, "/-/all")
- }
- else {
- full = url.resolve(uri, "/-/all/since?stale=update_after&startkey=" + t)
- }
-
- npm.registry.request(full, params, function (er, updates, _, res) {
+function updateIndex_ (all, params, data, cachePath, cb) {
+ log.silly('update-index', 'fetching', all)
+ npm.registry.request(all, params, function (er, updates, _, res) {
if (er) return cb(er, data)
var headers = res.headers
diff --git a/deps/npm/lib/config/core.js b/deps/npm/lib/config/core.js
index 97c17919d2..fc1569eaf3 100644
--- a/deps/npm/lib/config/core.js
+++ b/deps/npm/lib/config/core.js
@@ -76,6 +76,7 @@ function load () {
cb = once(function (er, conf) {
if (!er)
exports.loaded = conf
+ loading = false
loadCbs.forEach(function (fn) {
fn(er, conf)
})
diff --git a/deps/npm/lib/config/load-cafile.js b/deps/npm/lib/config/load-cafile.js
index dc1ff9f03a..cc63615ff5 100644
--- a/deps/npm/lib/config/load-cafile.js
+++ b/deps/npm/lib/config/load-cafile.js
@@ -9,8 +9,12 @@ function loadCAFile(cafilePath, cb) {
fs.readFile(cafilePath, "utf8", afterCARead.bind(this))
function afterCARead(er, cadata) {
- if (er)
+
+ if (er) {
+ // previous cafile no longer exists, so just continue on gracefully
+ if (er.code === 'ENOENT') return cb()
return cb(er)
+ }
var delim = "-----END CERTIFICATE-----"
var output
diff --git a/deps/npm/lib/link.js b/deps/npm/lib/link.js
index 387fb35c3a..916ebd6afe 100644
--- a/deps/npm/lib/link.js
+++ b/deps/npm/lib/link.js
@@ -127,7 +127,7 @@ function linkPkg (folder, cb_) {
return cb(er)
}
var target = path.resolve(npm.globalDir, d.name)
- symlink(me, target, function (er) {
+ symlink(me, target, false, true, function (er) {
if (er) return cb(er)
log.verbose("link", "build target", target)
// also install missing dependencies.
diff --git a/deps/npm/lib/search.js b/deps/npm/lib/search.js
index ad3f312e54..840bc2f6b7 100644
--- a/deps/npm/lib/search.js
+++ b/deps/npm/lib/search.js
@@ -3,7 +3,6 @@ module.exports = exports = search
var npm = require("./npm.js")
, columnify = require("columnify")
- , mapToRegistry = require("./utils/map-to-registry.js")
, updateIndex = require("./cache/update-index.js")
search.usage = "npm search [some search terms ...]"
@@ -35,19 +34,24 @@ function search (args, silent, staleness, cb) {
if (typeof cb !== "function") cb = silent, silent = false
var searchopts = npm.config.get("searchopts")
- , searchexclude = npm.config.get("searchexclude")
+ var searchexclude = npm.config.get("searchexclude")
+
if (typeof searchopts !== "string") searchopts = ""
searchopts = searchopts.split(/\s+/)
- if (typeof searchexclude === "string") {
- searchexclude = searchexclude.split(/\s+/)
- } else searchexclude = []
var opts = searchopts.concat(args).map(function (s) {
return s.toLowerCase()
}).filter(function (s) { return s })
+
+ if (typeof searchexclude === "string") {
+ searchexclude = searchexclude.split(/\s+/)
+ } else {
+ searchexclude = []
+ }
searchexclude = searchexclude.map(function (s) {
return s.toLowerCase()
})
- getFilteredData( staleness, opts, searchexclude, function (er, data) {
+
+ getFilteredData(staleness, opts, searchexclude, function (er, data) {
// now data is the list of data that we want to show.
// prettify and print it, and then provide the raw
// data to the cb.
@@ -58,19 +62,9 @@ function search (args, silent, staleness, cb) {
}
function getFilteredData (staleness, args, notArgs, cb) {
- mapToRegistry("-/all", npm.config, function (er, uri, auth) {
+ updateIndex(staleness, function (er, data) {
if (er) return cb(er)
-
- var params = {
- timeout : staleness,
- follow : true,
- staleOk : true,
- auth : auth
- }
- updateIndex(uri, params, function (er, data) {
- if (er) return cb(er)
- return cb(null, filter(data, args, notArgs))
- })
+ return cb(null, filter(data, args, notArgs))
})
}
diff --git a/deps/npm/lib/utils/link.js b/deps/npm/lib/utils/link.js
index 9e01d82e61..e353bfae93 100644
--- a/deps/npm/lib/utils/link.js
+++ b/deps/npm/lib/utils/link.js
@@ -16,13 +16,14 @@ function linkIfExists (from, to, gently, cb) {
})
}
-function link (from, to, gently, cb) {
+function link (from, to, gently, abs, cb) {
+ if (typeof cb !== "function") cb = abs, abs = false
if (typeof cb !== "function") cb = gently, gently = null
if (npm.config.get("force")) gently = false
to = path.resolve(to)
var target = from = path.resolve(from)
- if (process.platform !== "win32") {
+ if (!abs && process.platform !== "win32") {
// junctions on windows must be absolute
target = path.relative(path.dirname(to), from)
// if there is no folder in common, then it will be much
diff --git a/deps/npm/man/man1/npm-README.1 b/deps/npm/man/man1/npm-README.1
index 6f1d12f777..d48cc9beb3 100644
--- a/deps/npm/man/man1/npm-README.1
+++ b/deps/npm/man/man1/npm-README.1
@@ -1,4 +1,4 @@
-.TH "NPM" "1" "March 2015" "" ""
+.TH "NPM" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm\fR \- a JavaScript package manager
.P
@@ -69,11 +69,11 @@ run npm commands by doing \fBnode cli\.js <cmd> <args>\fR\|\. (This is helpful
for testing, or running stuff without actually installing npm itself\.)
.SH Windows Install or Upgrade
.P
-You can download a zip file from https://github\.com/npm/npm/releases, and unpack it
-in the same folder where node\.exe lives\.
+You can download a zip file from https://github\.com/npm/npm/releases, and
+unpack it in the \fBnode_modules\\npm\\\fR folder inside node's installation folder\.
.P
-The latest version in a zip file is 1\.4\.12\. To upgrade to npm 2, follow the
-Windows upgrade instructions in the npm Troubleshooting Guide:
+To upgrade to npm 2, follow the Windows upgrade instructions in
+the npm Troubleshooting Guide:
.P
https://github\.com/npm/npm/wiki/Troubleshooting#upgrading\-on\-windows
.P
diff --git a/deps/npm/man/man1/npm-access.1 b/deps/npm/man/man1/npm-access.1
index a8ac57e3d5..68c3233b31 100644
--- a/deps/npm/man/man1/npm-access.1
+++ b/deps/npm/man/man1/npm-access.1
@@ -1,4 +1,4 @@
-.TH "NPM\-ACCESS" "1" "March 2015" "" ""
+.TH "NPM\-ACCESS" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-access\fR \- Set access level on published packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-adduser.1 b/deps/npm/man/man1/npm-adduser.1
index ed2a8bc5e9..ba2248a2b1 100644
--- a/deps/npm/man/man1/npm-adduser.1
+++ b/deps/npm/man/man1/npm-adduser.1
@@ -1,4 +1,4 @@
-.TH "NPM\-ADDUSER" "1" "March 2015" "" ""
+.TH "NPM\-ADDUSER" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-adduser\fR \- Add a registry user account
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-bin.1 b/deps/npm/man/man1/npm-bin.1
index 5b604fafa3..830eae6e31 100644
--- a/deps/npm/man/man1/npm-bin.1
+++ b/deps/npm/man/man1/npm-bin.1
@@ -1,4 +1,4 @@
-.TH "NPM\-BIN" "1" "March 2015" "" ""
+.TH "NPM\-BIN" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-bin\fR \- Display npm bin folder
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-bugs.1 b/deps/npm/man/man1/npm-bugs.1
index a0fdc0d346..05fdcb1cf1 100644
--- a/deps/npm/man/man1/npm-bugs.1
+++ b/deps/npm/man/man1/npm-bugs.1
@@ -1,4 +1,4 @@
-.TH "NPM\-BUGS" "1" "March 2015" "" ""
+.TH "NPM\-BUGS" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-bugs\fR \- Bugs for a package in a web browser maybe
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-build.1 b/deps/npm/man/man1/npm-build.1
index 4653cccf89..f40c185af0 100644
--- a/deps/npm/man/man1/npm-build.1
+++ b/deps/npm/man/man1/npm-build.1
@@ -1,4 +1,4 @@
-.TH "NPM\-BUILD" "1" "March 2015" "" ""
+.TH "NPM\-BUILD" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-build\fR \- Build a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-bundle.1 b/deps/npm/man/man1/npm-bundle.1
index a8b2e21ec7..b5dad2f4e6 100644
--- a/deps/npm/man/man1/npm-bundle.1
+++ b/deps/npm/man/man1/npm-bundle.1
@@ -1,4 +1,4 @@
-.TH "NPM\-BUNDLE" "1" "March 2015" "" ""
+.TH "NPM\-BUNDLE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-bundle\fR \- REMOVED
.SH DESCRIPTION
diff --git a/deps/npm/man/man1/npm-cache.1 b/deps/npm/man/man1/npm-cache.1
index 4beaf5d410..84d952c193 100644
--- a/deps/npm/man/man1/npm-cache.1
+++ b/deps/npm/man/man1/npm-cache.1
@@ -1,4 +1,4 @@
-.TH "NPM\-CACHE" "1" "March 2015" "" ""
+.TH "NPM\-CACHE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-cache\fR \- Manipulates packages cache
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-completion.1 b/deps/npm/man/man1/npm-completion.1
index 42142acfbc..3dfa1bd8e2 100644
--- a/deps/npm/man/man1/npm-completion.1
+++ b/deps/npm/man/man1/npm-completion.1
@@ -1,4 +1,4 @@
-.TH "NPM\-COMPLETION" "1" "March 2015" "" ""
+.TH "NPM\-COMPLETION" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-completion\fR \- Tab Completion for npm
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-config.1 b/deps/npm/man/man1/npm-config.1
index 0c9334f2ef..8f6ff03fb5 100644
--- a/deps/npm/man/man1/npm-config.1
+++ b/deps/npm/man/man1/npm-config.1
@@ -1,4 +1,4 @@
-.TH "NPM\-CONFIG" "1" "March 2015" "" ""
+.TH "NPM\-CONFIG" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-config\fR \- Manage the npm configuration files
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-dedupe.1 b/deps/npm/man/man1/npm-dedupe.1
index 0f0f8d17ba..ab4ad69475 100644
--- a/deps/npm/man/man1/npm-dedupe.1
+++ b/deps/npm/man/man1/npm-dedupe.1
@@ -1,4 +1,4 @@
-.TH "NPM\-DEDUPE" "1" "March 2015" "" ""
+.TH "NPM\-DEDUPE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-dedupe\fR \- Reduce duplication
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-deprecate.1 b/deps/npm/man/man1/npm-deprecate.1
index 936713e4ae..d9b8c40831 100644
--- a/deps/npm/man/man1/npm-deprecate.1
+++ b/deps/npm/man/man1/npm-deprecate.1
@@ -1,4 +1,4 @@
-.TH "NPM\-DEPRECATE" "1" "March 2015" "" ""
+.TH "NPM\-DEPRECATE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-deprecate\fR \- Deprecate a version of a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-dist-tag.1 b/deps/npm/man/man1/npm-dist-tag.1
index 1833529718..31d6e96438 100644
--- a/deps/npm/man/man1/npm-dist-tag.1
+++ b/deps/npm/man/man1/npm-dist-tag.1
@@ -1,4 +1,4 @@
-.TH "NPM\-DIST\-TAG" "1" "March 2015" "" ""
+.TH "NPM\-DIST\-TAG" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-dist-tag\fR \- Modify package distribution tags
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-docs.1 b/deps/npm/man/man1/npm-docs.1
index 3b6dfa0782..fc3c6dff56 100644
--- a/deps/npm/man/man1/npm-docs.1
+++ b/deps/npm/man/man1/npm-docs.1
@@ -1,4 +1,4 @@
-.TH "NPM\-DOCS" "1" "March 2015" "" ""
+.TH "NPM\-DOCS" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-docs\fR \- Docs for a package in a web browser maybe
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-edit.1 b/deps/npm/man/man1/npm-edit.1
index e5ca2b3fc1..c8aad7e410 100644
--- a/deps/npm/man/man1/npm-edit.1
+++ b/deps/npm/man/man1/npm-edit.1
@@ -1,4 +1,4 @@
-.TH "NPM\-EDIT" "1" "March 2015" "" ""
+.TH "NPM\-EDIT" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-edit\fR \- Edit an installed package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-explore.1 b/deps/npm/man/man1/npm-explore.1
index e1fd0a053d..318075d38f 100644
--- a/deps/npm/man/man1/npm-explore.1
+++ b/deps/npm/man/man1/npm-explore.1
@@ -1,4 +1,4 @@
-.TH "NPM\-EXPLORE" "1" "March 2015" "" ""
+.TH "NPM\-EXPLORE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-explore\fR \- Browse an installed package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-help-search.1 b/deps/npm/man/man1/npm-help-search.1
index 17a5346a19..80bb25f472 100644
--- a/deps/npm/man/man1/npm-help-search.1
+++ b/deps/npm/man/man1/npm-help-search.1
@@ -1,4 +1,4 @@
-.TH "NPM\-HELP\-SEARCH" "1" "March 2015" "" ""
+.TH "NPM\-HELP\-SEARCH" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-help-search\fR \- Search npm help documentation
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-help.1 b/deps/npm/man/man1/npm-help.1
index eddc08b838..45533fb6d1 100644
--- a/deps/npm/man/man1/npm-help.1
+++ b/deps/npm/man/man1/npm-help.1
@@ -1,4 +1,4 @@
-.TH "NPM\-HELP" "1" "March 2015" "" ""
+.TH "NPM\-HELP" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-help\fR \- Get help on npm
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-init.1 b/deps/npm/man/man1/npm-init.1
index 1161f17c34..112e727695 100644
--- a/deps/npm/man/man1/npm-init.1
+++ b/deps/npm/man/man1/npm-init.1
@@ -1,4 +1,4 @@
-.TH "NPM\-INIT" "1" "March 2015" "" ""
+.TH "NPM\-INIT" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-init\fR \- Interactively create a package\.json file
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-install.1 b/deps/npm/man/man1/npm-install.1
index e8416eb4c3..d7b2c00c88 100644
--- a/deps/npm/man/man1/npm-install.1
+++ b/deps/npm/man/man1/npm-install.1
@@ -1,4 +1,4 @@
-.TH "NPM\-INSTALL" "1" "March 2015" "" ""
+.TH "NPM\-INSTALL" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-install\fR \- Install a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-link.1 b/deps/npm/man/man1/npm-link.1
index 523731f3b5..7a0c1fc183 100644
--- a/deps/npm/man/man1/npm-link.1
+++ b/deps/npm/man/man1/npm-link.1
@@ -1,4 +1,4 @@
-.TH "NPM\-LINK" "1" "March 2015" "" ""
+.TH "NPM\-LINK" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-link\fR \- Symlink a package folder
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-logout.1 b/deps/npm/man/man1/npm-logout.1
index 1ad6b900a9..2f3f824652 100644
--- a/deps/npm/man/man1/npm-logout.1
+++ b/deps/npm/man/man1/npm-logout.1
@@ -1,4 +1,4 @@
-.TH "NPM\-LOGOUT" "1" "March 2015" "" ""
+.TH "NPM\-LOGOUT" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-logout\fR \- Log out of the registry
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-ls.1 b/deps/npm/man/man1/npm-ls.1
index 7c56469152..9d8d6d4f10 100644
--- a/deps/npm/man/man1/npm-ls.1
+++ b/deps/npm/man/man1/npm-ls.1
@@ -1,4 +1,4 @@
-.TH "NPM\-LS" "1" "March 2015" "" ""
+.TH "NPM\-LS" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-ls\fR \- List installed packages
.SH SYNOPSIS
@@ -23,7 +23,7 @@ For example, running \fBnpm ls promzard\fR in npm's source tree will show:
.P
.RS 2
.nf
-npm@2.7.4 /path/to/npm
+npm@2.7.5 /path/to/npm
└─┬ init\-package\-json@0\.0\.4
└── promzard@0\.1\.5
.fi
diff --git a/deps/npm/man/man1/npm-outdated.1 b/deps/npm/man/man1/npm-outdated.1
index c510fea971..87514f4ef5 100644
--- a/deps/npm/man/man1/npm-outdated.1
+++ b/deps/npm/man/man1/npm-outdated.1
@@ -1,4 +1,4 @@
-.TH "NPM\-OUTDATED" "1" "March 2015" "" ""
+.TH "NPM\-OUTDATED" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-outdated\fR \- Check for outdated packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-owner.1 b/deps/npm/man/man1/npm-owner.1
index 7ceaddce6e..f60a8e5398 100644
--- a/deps/npm/man/man1/npm-owner.1
+++ b/deps/npm/man/man1/npm-owner.1
@@ -1,4 +1,4 @@
-.TH "NPM\-OWNER" "1" "March 2015" "" ""
+.TH "NPM\-OWNER" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-owner\fR \- Manage package owners
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-pack.1 b/deps/npm/man/man1/npm-pack.1
index 96e6f705f7..444e2b5d01 100644
--- a/deps/npm/man/man1/npm-pack.1
+++ b/deps/npm/man/man1/npm-pack.1
@@ -1,4 +1,4 @@
-.TH "NPM\-PACK" "1" "March 2015" "" ""
+.TH "NPM\-PACK" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-pack\fR \- Create a tarball from a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-prefix.1 b/deps/npm/man/man1/npm-prefix.1
index 339896aac8..e8fd211416 100644
--- a/deps/npm/man/man1/npm-prefix.1
+++ b/deps/npm/man/man1/npm-prefix.1
@@ -1,4 +1,4 @@
-.TH "NPM\-PREFIX" "1" "March 2015" "" ""
+.TH "NPM\-PREFIX" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-prefix\fR \- Display prefix
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-prune.1 b/deps/npm/man/man1/npm-prune.1
index 7a34afe6f6..db458cc523 100644
--- a/deps/npm/man/man1/npm-prune.1
+++ b/deps/npm/man/man1/npm-prune.1
@@ -1,4 +1,4 @@
-.TH "NPM\-PRUNE" "1" "March 2015" "" ""
+.TH "NPM\-PRUNE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-prune\fR \- Remove extraneous packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-publish.1 b/deps/npm/man/man1/npm-publish.1
index c763aa660e..496e287a4a 100644
--- a/deps/npm/man/man1/npm-publish.1
+++ b/deps/npm/man/man1/npm-publish.1
@@ -1,4 +1,4 @@
-.TH "NPM\-PUBLISH" "1" "March 2015" "" ""
+.TH "NPM\-PUBLISH" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-publish\fR \- Publish a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-rebuild.1 b/deps/npm/man/man1/npm-rebuild.1
index e6cb6c1029..0aa05dbecb 100644
--- a/deps/npm/man/man1/npm-rebuild.1
+++ b/deps/npm/man/man1/npm-rebuild.1
@@ -1,4 +1,4 @@
-.TH "NPM\-REBUILD" "1" "March 2015" "" ""
+.TH "NPM\-REBUILD" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-rebuild\fR \- Rebuild a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-repo.1 b/deps/npm/man/man1/npm-repo.1
index 5097e109ec..06e4cff9cd 100644
--- a/deps/npm/man/man1/npm-repo.1
+++ b/deps/npm/man/man1/npm-repo.1
@@ -1,4 +1,4 @@
-.TH "NPM\-REPO" "1" "March 2015" "" ""
+.TH "NPM\-REPO" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-repo\fR \- Open package repository page in the browser
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-restart.1 b/deps/npm/man/man1/npm-restart.1
index 0cdde8b201..0213b47f4f 100644
--- a/deps/npm/man/man1/npm-restart.1
+++ b/deps/npm/man/man1/npm-restart.1
@@ -1,4 +1,4 @@
-.TH "NPM\-RESTART" "1" "March 2015" "" ""
+.TH "NPM\-RESTART" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-restart\fR \- Restart a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-rm.1 b/deps/npm/man/man1/npm-rm.1
index 26f4dad033..4fa2d9e32b 100644
--- a/deps/npm/man/man1/npm-rm.1
+++ b/deps/npm/man/man1/npm-rm.1
@@ -1,4 +1,4 @@
-.TH "NPM\-RM" "1" "March 2015" "" ""
+.TH "NPM\-RM" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-rm\fR \- Remove a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-root.1 b/deps/npm/man/man1/npm-root.1
index 10855e1c7f..2828c50eb9 100644
--- a/deps/npm/man/man1/npm-root.1
+++ b/deps/npm/man/man1/npm-root.1
@@ -1,4 +1,4 @@
-.TH "NPM\-ROOT" "1" "March 2015" "" ""
+.TH "NPM\-ROOT" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-root\fR \- Display npm root
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-run-script.1 b/deps/npm/man/man1/npm-run-script.1
index 7f94067d30..aa1ba4e56f 100644
--- a/deps/npm/man/man1/npm-run-script.1
+++ b/deps/npm/man/man1/npm-run-script.1
@@ -1,4 +1,4 @@
-.TH "NPM\-RUN\-SCRIPT" "1" "March 2015" "" ""
+.TH "NPM\-RUN\-SCRIPT" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-run-script\fR \- Run arbitrary package scripts
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-search.1 b/deps/npm/man/man1/npm-search.1
index 04989533ca..f815c5116f 100644
--- a/deps/npm/man/man1/npm-search.1
+++ b/deps/npm/man/man1/npm-search.1
@@ -1,4 +1,4 @@
-.TH "NPM\-SEARCH" "1" "March 2015" "" ""
+.TH "NPM\-SEARCH" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-search\fR \- Search for packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-shrinkwrap.1 b/deps/npm/man/man1/npm-shrinkwrap.1
index d416f6666c..40eb480fc7 100644
--- a/deps/npm/man/man1/npm-shrinkwrap.1
+++ b/deps/npm/man/man1/npm-shrinkwrap.1
@@ -1,4 +1,4 @@
-.TH "NPM\-SHRINKWRAP" "1" "March 2015" "" ""
+.TH "NPM\-SHRINKWRAP" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-shrinkwrap\fR \- Lock down dependency versions
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-star.1 b/deps/npm/man/man1/npm-star.1
index b249df62b7..a942d6da1b 100644
--- a/deps/npm/man/man1/npm-star.1
+++ b/deps/npm/man/man1/npm-star.1
@@ -1,4 +1,4 @@
-.TH "NPM\-STAR" "1" "March 2015" "" ""
+.TH "NPM\-STAR" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-star\fR \- Mark your favorite packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-stars.1 b/deps/npm/man/man1/npm-stars.1
index 2320a0c460..24ead178b8 100644
--- a/deps/npm/man/man1/npm-stars.1
+++ b/deps/npm/man/man1/npm-stars.1
@@ -1,4 +1,4 @@
-.TH "NPM\-STARS" "1" "March 2015" "" ""
+.TH "NPM\-STARS" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-stars\fR \- View packages marked as favorites
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-start.1 b/deps/npm/man/man1/npm-start.1
index 5cd7012563..d14bfa1485 100644
--- a/deps/npm/man/man1/npm-start.1
+++ b/deps/npm/man/man1/npm-start.1
@@ -1,4 +1,4 @@
-.TH "NPM\-START" "1" "March 2015" "" ""
+.TH "NPM\-START" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-start\fR \- Start a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-stop.1 b/deps/npm/man/man1/npm-stop.1
index 6f4de89fa8..4de2ed3a58 100644
--- a/deps/npm/man/man1/npm-stop.1
+++ b/deps/npm/man/man1/npm-stop.1
@@ -1,4 +1,4 @@
-.TH "NPM\-STOP" "1" "March 2015" "" ""
+.TH "NPM\-STOP" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-stop\fR \- Stop a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-tag.1 b/deps/npm/man/man1/npm-tag.1
index 91530fc076..6c31801c49 100644
--- a/deps/npm/man/man1/npm-tag.1
+++ b/deps/npm/man/man1/npm-tag.1
@@ -1,4 +1,4 @@
-.TH "NPM\-TAG" "1" "March 2015" "" ""
+.TH "NPM\-TAG" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-tag\fR \- Tag a published version
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-test.1 b/deps/npm/man/man1/npm-test.1
index 0a4e9e0c51..c447088e0a 100644
--- a/deps/npm/man/man1/npm-test.1
+++ b/deps/npm/man/man1/npm-test.1
@@ -1,4 +1,4 @@
-.TH "NPM\-TEST" "1" "March 2015" "" ""
+.TH "NPM\-TEST" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-test\fR \- Test a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-uninstall.1 b/deps/npm/man/man1/npm-uninstall.1
index 29fe20a72b..c81f251ef2 100644
--- a/deps/npm/man/man1/npm-uninstall.1
+++ b/deps/npm/man/man1/npm-uninstall.1
@@ -1,4 +1,4 @@
-.TH "NPM\-RM" "1" "March 2015" "" ""
+.TH "NPM\-RM" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-rm\fR \- Remove a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-unpublish.1 b/deps/npm/man/man1/npm-unpublish.1
index 463e925aaa..914d02aa5c 100644
--- a/deps/npm/man/man1/npm-unpublish.1
+++ b/deps/npm/man/man1/npm-unpublish.1
@@ -1,4 +1,4 @@
-.TH "NPM\-UNPUBLISH" "1" "March 2015" "" ""
+.TH "NPM\-UNPUBLISH" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-unpublish\fR \- Remove a package from the registry
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-update.1 b/deps/npm/man/man1/npm-update.1
index a8ee566e08..dd5a4efd53 100644
--- a/deps/npm/man/man1/npm-update.1
+++ b/deps/npm/man/man1/npm-update.1
@@ -1,4 +1,4 @@
-.TH "NPM\-UPDATE" "1" "March 2015" "" ""
+.TH "NPM\-UPDATE" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-update\fR \- Update a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-version.1 b/deps/npm/man/man1/npm-version.1
index 78921acfd5..9e8d74c62f 100644
--- a/deps/npm/man/man1/npm-version.1
+++ b/deps/npm/man/man1/npm-version.1
@@ -1,4 +1,4 @@
-.TH "NPM\-VERSION" "1" "March 2015" "" ""
+.TH "NPM\-VERSION" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-version\fR \- Bump a package version
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-view.1 b/deps/npm/man/man1/npm-view.1
index 372696f0a4..2d659ebc39 100644
--- a/deps/npm/man/man1/npm-view.1
+++ b/deps/npm/man/man1/npm-view.1
@@ -1,4 +1,4 @@
-.TH "NPM\-VIEW" "1" "March 2015" "" ""
+.TH "NPM\-VIEW" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-view\fR \- View registry info
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm-whoami.1 b/deps/npm/man/man1/npm-whoami.1
index 0d50afb665..b97bc0c449 100644
--- a/deps/npm/man/man1/npm-whoami.1
+++ b/deps/npm/man/man1/npm-whoami.1
@@ -1,4 +1,4 @@
-.TH "NPM\-WHOAMI" "1" "March 2015" "" ""
+.TH "NPM\-WHOAMI" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-whoami\fR \- Display npm username
.SH SYNOPSIS
diff --git a/deps/npm/man/man1/npm.1 b/deps/npm/man/man1/npm.1
index 601d61a092..a34403b777 100644
--- a/deps/npm/man/man1/npm.1
+++ b/deps/npm/man/man1/npm.1
@@ -1,4 +1,4 @@
-.TH "NPM" "1" "March 2015" "" ""
+.TH "NPM" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm\fR \- javascript package manager
.SH SYNOPSIS
@@ -10,7 +10,7 @@ npm <command> [args]
.RE
.SH VERSION
.P
-2.7.4
+2.7.5
.SH DESCRIPTION
.P
npm is the package manager for the Node JavaScript platform\. It puts
diff --git a/deps/npm/man/man3/npm-bin.3 b/deps/npm/man/man3/npm-bin.3
index ac236ad6ee..9b6f869c85 100644
--- a/deps/npm/man/man3/npm-bin.3
+++ b/deps/npm/man/man3/npm-bin.3
@@ -1,4 +1,4 @@
-.TH "NPM\-BIN" "3" "March 2015" "" ""
+.TH "NPM\-BIN" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-bin\fR \- Display npm bin folder
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-bugs.3 b/deps/npm/man/man3/npm-bugs.3
index 7b4597e2ba..ab93f58e6c 100644
--- a/deps/npm/man/man3/npm-bugs.3
+++ b/deps/npm/man/man3/npm-bugs.3
@@ -1,4 +1,4 @@
-.TH "NPM\-BUGS" "3" "March 2015" "" ""
+.TH "NPM\-BUGS" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-bugs\fR \- Bugs for a package in a web browser maybe
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-cache.3 b/deps/npm/man/man3/npm-cache.3
index bdd43226a6..127555dcb0 100644
--- a/deps/npm/man/man3/npm-cache.3
+++ b/deps/npm/man/man3/npm-cache.3
@@ -1,4 +1,4 @@
-.TH "NPM\-CACHE" "3" "March 2015" "" ""
+.TH "NPM\-CACHE" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-cache\fR \- manage the npm cache programmatically
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-commands.3 b/deps/npm/man/man3/npm-commands.3
index 61ce8a1f47..cde69b4c4d 100644
--- a/deps/npm/man/man3/npm-commands.3
+++ b/deps/npm/man/man3/npm-commands.3
@@ -1,4 +1,4 @@
-.TH "NPM\-COMMANDS" "3" "March 2015" "" ""
+.TH "NPM\-COMMANDS" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-commands\fR \- npm commands
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-config.3 b/deps/npm/man/man3/npm-config.3
index bd1ab1a117..c6a152d9d9 100644
--- a/deps/npm/man/man3/npm-config.3
+++ b/deps/npm/man/man3/npm-config.3
@@ -1,4 +1,4 @@
-.TH "NPM\-CONFIG" "3" "March 2015" "" ""
+.TH "NPM\-CONFIG" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-config\fR \- Manage the npm configuration files
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-deprecate.3 b/deps/npm/man/man3/npm-deprecate.3
index 2abbb245ca..2c4d22f55e 100644
--- a/deps/npm/man/man3/npm-deprecate.3
+++ b/deps/npm/man/man3/npm-deprecate.3
@@ -1,4 +1,4 @@
-.TH "NPM\-DEPRECATE" "3" "March 2015" "" ""
+.TH "NPM\-DEPRECATE" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-deprecate\fR \- Deprecate a version of a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-docs.3 b/deps/npm/man/man3/npm-docs.3
index e33b3562d4..bcdfe3f705 100644
--- a/deps/npm/man/man3/npm-docs.3
+++ b/deps/npm/man/man3/npm-docs.3
@@ -1,4 +1,4 @@
-.TH "NPM\-DOCS" "3" "March 2015" "" ""
+.TH "NPM\-DOCS" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-docs\fR \- Docs for a package in a web browser maybe
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-edit.3 b/deps/npm/man/man3/npm-edit.3
index faae5eb25c..5db96fd12c 100644
--- a/deps/npm/man/man3/npm-edit.3
+++ b/deps/npm/man/man3/npm-edit.3
@@ -1,4 +1,4 @@
-.TH "NPM\-EDIT" "3" "March 2015" "" ""
+.TH "NPM\-EDIT" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-edit\fR \- Edit an installed package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-explore.3 b/deps/npm/man/man3/npm-explore.3
index 042b8a5aab..c9e1e69b32 100644
--- a/deps/npm/man/man3/npm-explore.3
+++ b/deps/npm/man/man3/npm-explore.3
@@ -1,4 +1,4 @@
-.TH "NPM\-EXPLORE" "3" "March 2015" "" ""
+.TH "NPM\-EXPLORE" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-explore\fR \- Browse an installed package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-help-search.3 b/deps/npm/man/man3/npm-help-search.3
index c10fd683a0..42b58d3f47 100644
--- a/deps/npm/man/man3/npm-help-search.3
+++ b/deps/npm/man/man3/npm-help-search.3
@@ -1,4 +1,4 @@
-.TH "NPM\-HELP\-SEARCH" "3" "March 2015" "" ""
+.TH "NPM\-HELP\-SEARCH" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-help-search\fR \- Search the help pages
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-init.3 b/deps/npm/man/man3/npm-init.3
index 340cf3ff05..1fe406f258 100644
--- a/deps/npm/man/man3/npm-init.3
+++ b/deps/npm/man/man3/npm-init.3
@@ -1,4 +1,4 @@
-.TH "NPM" "" "March 2015" "" ""
+.TH "NPM" "" "April 2015" "" ""
.SH "NAME"
\fBnpm\fR
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-install.3 b/deps/npm/man/man3/npm-install.3
index 6c140102cc..7eaa388536 100644
--- a/deps/npm/man/man3/npm-install.3
+++ b/deps/npm/man/man3/npm-install.3
@@ -1,4 +1,4 @@
-.TH "NPM\-INSTALL" "3" "March 2015" "" ""
+.TH "NPM\-INSTALL" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-install\fR \- install a package programmatically
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-link.3 b/deps/npm/man/man3/npm-link.3
index 86fef62a43..050a42b13f 100644
--- a/deps/npm/man/man3/npm-link.3
+++ b/deps/npm/man/man3/npm-link.3
@@ -1,4 +1,4 @@
-.TH "NPM\-LINK" "3" "March 2015" "" ""
+.TH "NPM\-LINK" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-link\fR \- Symlink a package folder
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-load.3 b/deps/npm/man/man3/npm-load.3
index fd57800a40..aa344d025e 100644
--- a/deps/npm/man/man3/npm-load.3
+++ b/deps/npm/man/man3/npm-load.3
@@ -1,4 +1,4 @@
-.TH "NPM\-LOAD" "3" "March 2015" "" ""
+.TH "NPM\-LOAD" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-load\fR \- Load config settings
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-ls.3 b/deps/npm/man/man3/npm-ls.3
index eb3eb53bcc..df7c3c77ca 100644
--- a/deps/npm/man/man3/npm-ls.3
+++ b/deps/npm/man/man3/npm-ls.3
@@ -1,4 +1,4 @@
-.TH "NPM\-LS" "3" "March 2015" "" ""
+.TH "NPM\-LS" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-ls\fR \- List installed packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-outdated.3 b/deps/npm/man/man3/npm-outdated.3
index 49211088c6..83409223f1 100644
--- a/deps/npm/man/man3/npm-outdated.3
+++ b/deps/npm/man/man3/npm-outdated.3
@@ -1,4 +1,4 @@
-.TH "NPM\-OUTDATED" "3" "March 2015" "" ""
+.TH "NPM\-OUTDATED" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-outdated\fR \- Check for outdated packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-owner.3 b/deps/npm/man/man3/npm-owner.3
index f95c79aef5..2508a312f4 100644
--- a/deps/npm/man/man3/npm-owner.3
+++ b/deps/npm/man/man3/npm-owner.3
@@ -1,4 +1,4 @@
-.TH "NPM\-OWNER" "3" "March 2015" "" ""
+.TH "NPM\-OWNER" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-owner\fR \- Manage package owners
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-pack.3 b/deps/npm/man/man3/npm-pack.3
index 1a0f5910e8..4a2401136f 100644
--- a/deps/npm/man/man3/npm-pack.3
+++ b/deps/npm/man/man3/npm-pack.3
@@ -1,4 +1,4 @@
-.TH "NPM\-PACK" "3" "March 2015" "" ""
+.TH "NPM\-PACK" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-pack\fR \- Create a tarball from a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-prefix.3 b/deps/npm/man/man3/npm-prefix.3
index 5289c9e898..e0ceb93b3f 100644
--- a/deps/npm/man/man3/npm-prefix.3
+++ b/deps/npm/man/man3/npm-prefix.3
@@ -1,4 +1,4 @@
-.TH "NPM\-PREFIX" "3" "March 2015" "" ""
+.TH "NPM\-PREFIX" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-prefix\fR \- Display prefix
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-prune.3 b/deps/npm/man/man3/npm-prune.3
index b50fc9e8fe..024e933b6f 100644
--- a/deps/npm/man/man3/npm-prune.3
+++ b/deps/npm/man/man3/npm-prune.3
@@ -1,4 +1,4 @@
-.TH "NPM\-PRUNE" "3" "March 2015" "" ""
+.TH "NPM\-PRUNE" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-prune\fR \- Remove extraneous packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-publish.3 b/deps/npm/man/man3/npm-publish.3
index 2ca3987226..2d0d0e0dae 100644
--- a/deps/npm/man/man3/npm-publish.3
+++ b/deps/npm/man/man3/npm-publish.3
@@ -1,4 +1,4 @@
-.TH "NPM\-PUBLISH" "3" "March 2015" "" ""
+.TH "NPM\-PUBLISH" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-publish\fR \- Publish a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-rebuild.3 b/deps/npm/man/man3/npm-rebuild.3
index f0bf76155f..c94e1d8eaa 100644
--- a/deps/npm/man/man3/npm-rebuild.3
+++ b/deps/npm/man/man3/npm-rebuild.3
@@ -1,4 +1,4 @@
-.TH "NPM\-REBUILD" "3" "March 2015" "" ""
+.TH "NPM\-REBUILD" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-rebuild\fR \- Rebuild a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-repo.3 b/deps/npm/man/man3/npm-repo.3
index e36b160e92..4db47172f9 100644
--- a/deps/npm/man/man3/npm-repo.3
+++ b/deps/npm/man/man3/npm-repo.3
@@ -1,4 +1,4 @@
-.TH "NPM\-REPO" "3" "March 2015" "" ""
+.TH "NPM\-REPO" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-repo\fR \- Open package repository page in the browser
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-restart.3 b/deps/npm/man/man3/npm-restart.3
index 8027bd49ed..876b8b9a54 100644
--- a/deps/npm/man/man3/npm-restart.3
+++ b/deps/npm/man/man3/npm-restart.3
@@ -1,4 +1,4 @@
-.TH "NPM\-RESTART" "3" "March 2015" "" ""
+.TH "NPM\-RESTART" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-restart\fR \- Restart a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-root.3 b/deps/npm/man/man3/npm-root.3
index 0932b77189..f3a3e0fbd1 100644
--- a/deps/npm/man/man3/npm-root.3
+++ b/deps/npm/man/man3/npm-root.3
@@ -1,4 +1,4 @@
-.TH "NPM\-ROOT" "3" "March 2015" "" ""
+.TH "NPM\-ROOT" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-root\fR \- Display npm root
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-run-script.3 b/deps/npm/man/man3/npm-run-script.3
index 411ffeedd7..8b16b3ce77 100644
--- a/deps/npm/man/man3/npm-run-script.3
+++ b/deps/npm/man/man3/npm-run-script.3
@@ -1,4 +1,4 @@
-.TH "NPM\-RUN\-SCRIPT" "3" "March 2015" "" ""
+.TH "NPM\-RUN\-SCRIPT" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-run-script\fR \- Run arbitrary package scripts
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-search.3 b/deps/npm/man/man3/npm-search.3
index 071cab9f48..7698f74deb 100644
--- a/deps/npm/man/man3/npm-search.3
+++ b/deps/npm/man/man3/npm-search.3
@@ -1,4 +1,4 @@
-.TH "NPM\-SEARCH" "3" "March 2015" "" ""
+.TH "NPM\-SEARCH" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-search\fR \- Search for packages
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-shrinkwrap.3 b/deps/npm/man/man3/npm-shrinkwrap.3
index da7134c1e7..294f307511 100644
--- a/deps/npm/man/man3/npm-shrinkwrap.3
+++ b/deps/npm/man/man3/npm-shrinkwrap.3
@@ -1,4 +1,4 @@
-.TH "NPM\-SHRINKWRAP" "3" "March 2015" "" ""
+.TH "NPM\-SHRINKWRAP" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-shrinkwrap\fR \- programmatically generate package shrinkwrap file
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-start.3 b/deps/npm/man/man3/npm-start.3
index fee38728b0..f3ac79acb9 100644
--- a/deps/npm/man/man3/npm-start.3
+++ b/deps/npm/man/man3/npm-start.3
@@ -1,4 +1,4 @@
-.TH "NPM\-START" "3" "March 2015" "" ""
+.TH "NPM\-START" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-start\fR \- Start a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-stop.3 b/deps/npm/man/man3/npm-stop.3
index c17766074a..7ea9ee95e1 100644
--- a/deps/npm/man/man3/npm-stop.3
+++ b/deps/npm/man/man3/npm-stop.3
@@ -1,4 +1,4 @@
-.TH "NPM\-STOP" "3" "March 2015" "" ""
+.TH "NPM\-STOP" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-stop\fR \- Stop a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-tag.3 b/deps/npm/man/man3/npm-tag.3
index 4aec0b138d..ace3a0a8a1 100644
--- a/deps/npm/man/man3/npm-tag.3
+++ b/deps/npm/man/man3/npm-tag.3
@@ -1,4 +1,4 @@
-.TH "NPM\-TAG" "3" "March 2015" "" ""
+.TH "NPM\-TAG" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-tag\fR \- Tag a published version
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-test.3 b/deps/npm/man/man3/npm-test.3
index 71d40fa8eb..d6aad659c4 100644
--- a/deps/npm/man/man3/npm-test.3
+++ b/deps/npm/man/man3/npm-test.3
@@ -1,4 +1,4 @@
-.TH "NPM\-TEST" "3" "March 2015" "" ""
+.TH "NPM\-TEST" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-test\fR \- Test a package
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-uninstall.3 b/deps/npm/man/man3/npm-uninstall.3
index dacca6337f..7b17c8faf0 100644
--- a/deps/npm/man/man3/npm-uninstall.3
+++ b/deps/npm/man/man3/npm-uninstall.3
@@ -1,4 +1,4 @@
-.TH "NPM\-UNINSTALL" "3" "March 2015" "" ""
+.TH "NPM\-UNINSTALL" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-uninstall\fR \- uninstall a package programmatically
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-unpublish.3 b/deps/npm/man/man3/npm-unpublish.3
index 073435f083..cab0bd3d98 100644
--- a/deps/npm/man/man3/npm-unpublish.3
+++ b/deps/npm/man/man3/npm-unpublish.3
@@ -1,4 +1,4 @@
-.TH "NPM\-UNPUBLISH" "3" "March 2015" "" ""
+.TH "NPM\-UNPUBLISH" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-unpublish\fR \- Remove a package from the registry
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-update.3 b/deps/npm/man/man3/npm-update.3
index f5d6885853..e299ee2842 100644
--- a/deps/npm/man/man3/npm-update.3
+++ b/deps/npm/man/man3/npm-update.3
@@ -1,4 +1,4 @@
-.TH "NPM\-UPDATE" "3" "March 2015" "" ""
+.TH "NPM\-UPDATE" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-update\fR \- Update a package
.SH SYNOPSIS
@@ -8,7 +8,7 @@
npm\.commands\.update(packages, callback)
.fi
.RE
-.TH "DESCRIPTION" "" "March 2015" "" ""
+.TH "DESCRIPTION" "" "April 2015" "" ""
.SH "NAME"
\fBDESCRIPTION\fR
.P
diff --git a/deps/npm/man/man3/npm-version.3 b/deps/npm/man/man3/npm-version.3
index e032f966d0..43a6805926 100644
--- a/deps/npm/man/man3/npm-version.3
+++ b/deps/npm/man/man3/npm-version.3
@@ -1,4 +1,4 @@
-.TH "NPM\-VERSION" "3" "March 2015" "" ""
+.TH "NPM\-VERSION" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-version\fR \- Bump a package version
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-view.3 b/deps/npm/man/man3/npm-view.3
index 1267ff23f3..eb6d8d6f1b 100644
--- a/deps/npm/man/man3/npm-view.3
+++ b/deps/npm/man/man3/npm-view.3
@@ -1,4 +1,4 @@
-.TH "NPM\-VIEW" "3" "March 2015" "" ""
+.TH "NPM\-VIEW" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-view\fR \- View registry info
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm-whoami.3 b/deps/npm/man/man3/npm-whoami.3
index 6e427004b1..a7b968fe99 100644
--- a/deps/npm/man/man3/npm-whoami.3
+++ b/deps/npm/man/man3/npm-whoami.3
@@ -1,4 +1,4 @@
-.TH "NPM\-WHOAMI" "3" "March 2015" "" ""
+.TH "NPM\-WHOAMI" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm-whoami\fR \- Display npm username
.SH SYNOPSIS
diff --git a/deps/npm/man/man3/npm.3 b/deps/npm/man/man3/npm.3
index 05f330b5a4..fd992f1b84 100644
--- a/deps/npm/man/man3/npm.3
+++ b/deps/npm/man/man3/npm.3
@@ -1,4 +1,4 @@
-.TH "NPM" "3" "March 2015" "" ""
+.TH "NPM" "3" "April 2015" "" ""
.SH "NAME"
\fBnpm\fR \- javascript package manager
.SH SYNOPSIS
@@ -20,7 +20,7 @@ npm\.load([configObject, ]function (er, npm) {
.RE
.SH VERSION
.P
-2.7.4
+2.7.5
.SH DESCRIPTION
.P
This is the API documentation for npm\.
diff --git a/deps/npm/man/man5/npm-folders.5 b/deps/npm/man/man5/npm-folders.5
index b01d9245ec..454a6950ad 100644
--- a/deps/npm/man/man5/npm-folders.5
+++ b/deps/npm/man/man5/npm-folders.5
@@ -1,4 +1,4 @@
-.TH "NPM\-FOLDERS" "5" "March 2015" "" ""
+.TH "NPM\-FOLDERS" "5" "April 2015" "" ""
.SH "NAME"
\fBnpm-folders\fR \- Folder Structures Used by npm
.SH DESCRIPTION
diff --git a/deps/npm/man/man5/npm-global.5 b/deps/npm/man/man5/npm-global.5
index b01d9245ec..454a6950ad 100644
--- a/deps/npm/man/man5/npm-global.5
+++ b/deps/npm/man/man5/npm-global.5
@@ -1,4 +1,4 @@
-.TH "NPM\-FOLDERS" "5" "March 2015" "" ""
+.TH "NPM\-FOLDERS" "5" "April 2015" "" ""
.SH "NAME"
\fBnpm-folders\fR \- Folder Structures Used by npm
.SH DESCRIPTION
diff --git a/deps/npm/man/man5/npm-json.5 b/deps/npm/man/man5/npm-json.5
index 61420dee33..62fce52d8d 100644
--- a/deps/npm/man/man5/npm-json.5
+++ b/deps/npm/man/man5/npm-json.5
@@ -1,4 +1,4 @@
-.TH "PACKAGE\.JSON" "5" "March 2015" "" ""
+.TH "PACKAGE\.JSON" "5" "April 2015" "" ""
.SH "NAME"
\fBpackage.json\fR \- Specifics of npm's package\.json handling
.SH DESCRIPTION
@@ -126,7 +126,7 @@ Or you can shorten that all into a single string, and npm will parse it for you:
.P
.RS 2
.nf
-"Barney Rubble <b@rubble\.com> (http://barnyrubble\.tumblr\.com/)
+"Barney Rubble <b@rubble\.com> (http://barnyrubble\.tumblr\.com/)"
.fi
.RE
.P
diff --git a/deps/npm/man/man5/npmrc.5 b/deps/npm/man/man5/npmrc.5
index 150729dcab..703176aaa5 100644
--- a/deps/npm/man/man5/npmrc.5
+++ b/deps/npm/man/man5/npmrc.5
@@ -1,4 +1,4 @@
-.TH "NPMRC" "5" "March 2015" "" ""
+.TH "NPMRC" "5" "April 2015" "" ""
.SH "NAME"
\fBnpmrc\fR \- The npm config files
.SH DESCRIPTION
diff --git a/deps/npm/man/man5/package.json.5 b/deps/npm/man/man5/package.json.5
index 61420dee33..62fce52d8d 100644
--- a/deps/npm/man/man5/package.json.5
+++ b/deps/npm/man/man5/package.json.5
@@ -1,4 +1,4 @@
-.TH "PACKAGE\.JSON" "5" "March 2015" "" ""
+.TH "PACKAGE\.JSON" "5" "April 2015" "" ""
.SH "NAME"
\fBpackage.json\fR \- Specifics of npm's package\.json handling
.SH DESCRIPTION
@@ -126,7 +126,7 @@ Or you can shorten that all into a single string, and npm will parse it for you:
.P
.RS 2
.nf
-"Barney Rubble <b@rubble\.com> (http://barnyrubble\.tumblr\.com/)
+"Barney Rubble <b@rubble\.com> (http://barnyrubble\.tumblr\.com/)"
.fi
.RE
.P
diff --git a/deps/npm/man/man7/npm-coding-style.7 b/deps/npm/man/man7/npm-coding-style.7
index bbe6dcc498..b018adbac1 100644
--- a/deps/npm/man/man7/npm-coding-style.7
+++ b/deps/npm/man/man7/npm-coding-style.7
@@ -1,4 +1,4 @@
-.TH "NPM\-CODING\-STYLE" "7" "March 2015" "" ""
+.TH "NPM\-CODING\-STYLE" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-coding-style\fR \- npm's "funny" coding style
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/npm-config.7 b/deps/npm/man/man7/npm-config.7
index 591da2c321..821595161b 100644
--- a/deps/npm/man/man7/npm-config.7
+++ b/deps/npm/man/man7/npm-config.7
@@ -1,4 +1,4 @@
-.TH "NPM\-CONFIG" "7" "March 2015" "" ""
+.TH "NPM\-CONFIG" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-config\fR \- More than you probably want to know about npm configuration
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/npm-developers.7 b/deps/npm/man/man7/npm-developers.7
index 9b55e2a921..f3c85e453b 100644
--- a/deps/npm/man/man7/npm-developers.7
+++ b/deps/npm/man/man7/npm-developers.7
@@ -1,4 +1,4 @@
-.TH "NPM\-DEVELOPERS" "7" "March 2015" "" ""
+.TH "NPM\-DEVELOPERS" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-developers\fR \- Developer Guide
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/npm-disputes.7 b/deps/npm/man/man7/npm-disputes.7
index de9b873978..0db6f8a4db 100644
--- a/deps/npm/man/man7/npm-disputes.7
+++ b/deps/npm/man/man7/npm-disputes.7
@@ -1,4 +1,4 @@
-.TH "NPM\-DISPUTES" "7" "March 2015" "" ""
+.TH "NPM\-DISPUTES" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-disputes\fR \- Handling Module Name Disputes
.SH SYNOPSIS
diff --git a/deps/npm/man/man7/npm-faq.7 b/deps/npm/man/man7/npm-faq.7
index 39958c3f51..db84fbe8d7 100644
--- a/deps/npm/man/man7/npm-faq.7
+++ b/deps/npm/man/man7/npm-faq.7
@@ -1,4 +1,4 @@
-.TH "NPM\-FAQ" "7" "March 2015" "" ""
+.TH "NPM\-FAQ" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-faq\fR \- Frequently Asked Questions
.SH Where can I find these docs in HTML?
diff --git a/deps/npm/man/man7/npm-index.7 b/deps/npm/man/man7/npm-index.7
index a923d53e88..787668e656 100644
--- a/deps/npm/man/man7/npm-index.7
+++ b/deps/npm/man/man7/npm-index.7
@@ -1,4 +1,4 @@
-.TH "NPM\-INDEX" "7" "March 2015" "" ""
+.TH "NPM\-INDEX" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-index\fR \- Index of all npm documentation
.SS npm help README
diff --git a/deps/npm/man/man7/npm-registry.7 b/deps/npm/man/man7/npm-registry.7
index 761248031e..dd493a8b12 100644
--- a/deps/npm/man/man7/npm-registry.7
+++ b/deps/npm/man/man7/npm-registry.7
@@ -1,4 +1,4 @@
-.TH "NPM\-REGISTRY" "7" "March 2015" "" ""
+.TH "NPM\-REGISTRY" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-registry\fR \- The JavaScript Package Registry
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/npm-scope.7 b/deps/npm/man/man7/npm-scope.7
index 0a68fc3196..dca1c50322 100644
--- a/deps/npm/man/man7/npm-scope.7
+++ b/deps/npm/man/man7/npm-scope.7
@@ -1,4 +1,4 @@
-.TH "NPM\-SCOPE" "7" "March 2015" "" ""
+.TH "NPM\-SCOPE" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-scope\fR \- Scoped packages
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/npm-scripts.7 b/deps/npm/man/man7/npm-scripts.7
index bdd0813287..2ca079346a 100644
--- a/deps/npm/man/man7/npm-scripts.7
+++ b/deps/npm/man/man7/npm-scripts.7
@@ -1,4 +1,4 @@
-.TH "NPM\-SCRIPTS" "7" "March 2015" "" ""
+.TH "NPM\-SCRIPTS" "7" "April 2015" "" ""
.SH "NAME"
\fBnpm-scripts\fR \- How npm handles the "scripts" field
.SH DESCRIPTION
diff --git a/deps/npm/man/man7/removing-npm.7 b/deps/npm/man/man7/removing-npm.7
index a63c66b9b1..f3e47cfefc 100644
--- a/deps/npm/man/man7/removing-npm.7
+++ b/deps/npm/man/man7/removing-npm.7
@@ -1,4 +1,4 @@
-.TH "NPM\-REMOVAL" "1" "March 2015" "" ""
+.TH "NPM\-REMOVAL" "1" "April 2015" "" ""
.SH "NAME"
\fBnpm-removal\fR \- Cleaning the Slate
.SH SYNOPSIS
diff --git a/deps/npm/man/man7/semver.7 b/deps/npm/man/man7/semver.7
index 7378be9862..f77a51ee5d 100644
--- a/deps/npm/man/man7/semver.7
+++ b/deps/npm/man/man7/semver.7
@@ -1,4 +1,4 @@
-.TH "SEMVER" "7" "March 2015" "" ""
+.TH "SEMVER" "7" "April 2015" "" ""
.SH "NAME"
\fBsemver\fR \- The semantic versioner for npm
.SH Usage
diff --git a/deps/npm/node_modules/hosted-git-info/README.md~ b/deps/npm/node_modules/hosted-git-info/README.md~
deleted file mode 100644
index aadbbee1f4..0000000000
--- a/deps/npm/node_modules/hosted-git-info/README.md~
+++ /dev/null
@@ -1,87 +0,0 @@
-# hosted-git-info
-
-This will let you identify and transform various git hosts URLs between
-protocols. It also can tell you what the URL is for the raw path for
-particular file for direct access without git.
-
-## Usage
-
-```javascript
-var hostedGitInfo = require("hosted-git-info")
-var info = hostedGitInfo.fromUrl("git@github.com:npm/hosted-git-info.git")
-/* info looks like:
-{
- type: "github",
- domain: "github.com",
- user: "npm",
- project: "hosted-git-info"
-}
-*/
-```
-
-If the URL can't be matched with a git host, `null` will be returned. We
-can match git, ssh and https urls. Additionally, we can match ssh connect
-strings (`git@github.com:npm/hosted-git-info`) and shortcuts (eg,
-`github:npm/hosted-git-info`). Github specifically, is detected in the case
-of a third, unprefixed, form: `npm/hosted-git-info`.
-
-If it does match, the returned object has properties of:
-
-* info.type -- The short name of the service
-* info.domain -- The domain for git protocol use
-* info.user -- The name of the user/org on the git host
-* info.project -- The name of the project on the git host
-
-And methods of:
-
-* info.file(path)
-
-Given the path of a file relative to the repository, returns a URL for
-directly fetching it from the githost. If no comittish was set then
-`master` will be used as the default.
-
-<<<<<<< HEAD
-For example `hostedGitInfo.fromUrl("git@github.com:npm/hosted-git-info.git#v1.0.0").file("package.json")`
-||||||| merged common ancestors
-For example `hostedGitInfo("git@github.com:npm/hosted-git-info.git").file("v1.0.0")`
-=======
-For example `hostedGitInfo.fromUrl("git@github.com:npm/hosted-git-info.git").file("v1.0.0")`
->>>>>>> Another README fix
-would return `https://raw.githubusercontent.com/npm/hosted-git-info/v1.0.0/package.json`
-
-* info.shortcut()
-
-eg, `github:npm/hosted-git-info`
-
-* info.browse()
-
-eg, `https://github.com/npm/hosted-git-info/tree/v1.2.0`
-
-* info.bugs()
-
-eg, `https://github.com/npm/hosted-git-info/issues`
-
-* info.docs()
-
-eg, `https://github.com/npm/hosted-git-info/tree/v1.2.0#readme`
-
-* info.https()
-
-eg, `https://github.com/npm/hosted-git-info.git`
-
-* info.sshurl()
-
-eg, `git+ssh://git@github.com/npm/hosted-git-info.git`
-
-* info.ssh()
-
-eg, `git@github.com:npm/hosted-git-info.git`
-
-* info.path()
-
-eg, `npm/hosted-git-info`
-
-## Supported hosts
-
-Currently this supports Github, Bitbucket and Gitlab. Pull requests for
-additional hosts welcome.
diff --git a/deps/npm/node_modules/inflight/.eslintrc b/deps/npm/node_modules/inflight/.eslintrc
deleted file mode 100644
index b7a1550efc..0000000000
--- a/deps/npm/node_modules/inflight/.eslintrc
+++ /dev/null
@@ -1,17 +0,0 @@
-{
- "env" : {
- "node" : true
- },
- "rules" : {
- "semi": [2, "never"],
- "strict": 0,
- "quotes": [1, "single", "avoid-escape"],
- "no-use-before-define": 0,
- "curly": 0,
- "no-underscore-dangle": 0,
- "no-lonely-if": 1,
- "no-unused-vars": [2, {"vars" : "all", "args" : "after-used"}],
- "no-mixed-requires": 0,
- "space-infix-ops": 0
- }
-}
diff --git a/deps/npm/node_modules/node-gyp/addon.gypi b/deps/npm/node_modules/node-gyp/addon.gypi
index 1604f248ca..0b81fab202 100644
--- a/deps/npm/node_modules/node-gyp/addon.gypi
+++ b/deps/npm/node_modules/node-gyp/addon.gypi
@@ -1,9 +1,7 @@
{
'target_defaults': {
'type': 'loadable_module',
- 'win_delay_load_hook': 'false',
'product_prefix': '',
-
'include_dirs': [
'<(node_root_dir)/src',
'<(node_root_dir)/deps/uv/include',
@@ -15,34 +13,11 @@
'product_extension': 'node',
'defines': [ 'BUILDING_NODE_EXTENSION' ],
}],
-
['_type=="static_library"', {
# set to `1` to *disable* the -T thin archive 'ld' flag.
# older linkers don't support this flag.
'standalone_static_library': '<(standalone_static_library)'
}],
-
- ['_win_delay_load_hook=="true"', {
- # If the addon specifies `'win_delay_load_hook': 'true'` in its
- # binding.gyp, link a delay-load hook into the DLL. This hook ensures
- # that the addon will work regardless of whether the node/iojs binary
- # is named node.exe, iojs.exe, or something else.
- 'conditions': [
- [ 'OS=="win"', {
- 'sources': [
- 'src/win_delay_load_hook.c',
- ],
- 'msvs_settings': {
- 'VCLinkerTool': {
- 'DelayLoadDLLs': [ 'iojs.exe', 'node.exe' ],
- # Don't print a linker warning when no imports from either .exe
- # are used.
- 'AdditionalOptions': [ '/ignore:4199' ],
- },
- },
- }],
- ],
- }],
],
'conditions': [
@@ -67,7 +42,7 @@
'-luuid.lib',
'-lodbc32.lib',
'-lDelayImp.lib',
- '-l"<(node_root_dir)/$(ConfigurationName)/iojs.lib"'
+ '-l"<(node_root_dir)/$(ConfigurationName)/node.lib"'
],
# warning C4251: 'node::ObjectWrap::handle_' : class 'v8::Persistent<T>'
# needs to have dll-interface to be used by clients of class 'node::ObjectWrap'
diff --git a/deps/npm/node_modules/node-gyp/lib/build.js b/deps/npm/node_modules/node-gyp/lib/build.js
index f9722aeaa5..df24aaf454 100644
--- a/deps/npm/node_modules/node-gyp/lib/build.js
+++ b/deps/npm/node_modules/node-gyp/lib/build.js
@@ -173,7 +173,7 @@ function build (gyp, argv, callback) {
}
/**
- * Copies the iojs.lib file for the current target architecture into the
+ * Copies the node.lib file for the current target architecture into the
* current proper dev dir location.
*/
@@ -181,15 +181,15 @@ function build (gyp, argv, callback) {
if (!win || !copyDevLib) return doBuild()
var buildDir = path.resolve(nodeDir, buildType)
- , archNodeLibPath = path.resolve(nodeDir, arch, 'iojs.lib')
- , buildNodeLibPath = path.resolve(buildDir, 'iojs.lib')
+ , archNodeLibPath = path.resolve(nodeDir, arch, 'node.lib')
+ , buildNodeLibPath = path.resolve(buildDir, 'node.lib')
mkdirp(buildDir, function (err, isNew) {
if (err) return callback(err)
log.verbose('"' + buildType + '" dir needed to be created?', isNew)
var rs = fs.createReadStream(archNodeLibPath)
, ws = fs.createWriteStream(buildNodeLibPath)
- log.verbose('copying "iojs.lib" for ' + arch, buildNodeLibPath)
+ log.verbose('copying "node.lib" for ' + arch, buildNodeLibPath)
rs.pipe(ws)
rs.on('error', callback)
ws.on('error', callback)
diff --git a/deps/npm/node_modules/node-gyp/lib/install.js b/deps/npm/node_modules/node-gyp/lib/install.js
index f9176b3ab0..6f72e6a93d 100644
--- a/deps/npm/node_modules/node-gyp/lib/install.js
+++ b/deps/npm/node_modules/node-gyp/lib/install.js
@@ -39,7 +39,7 @@ function install (gyp, argv, callback) {
}
}
- var distUrl = gyp.opts['dist-url'] || gyp.opts.disturl || 'https://iojs.org/dist'
+ var distUrl = gyp.opts['dist-url'] || gyp.opts.disturl || 'http://nodejs.org/dist'
// Determine which node dev files version we are installing
@@ -185,7 +185,7 @@ function install (gyp, argv, callback) {
// now download the node tarball
var tarPath = gyp.opts['tarball']
- var tarballUrl = tarPath ? tarPath : distUrl + '/v' + version + '/iojs-v' + version + '.tar.gz'
+ var tarballUrl = tarPath ? tarPath : distUrl + '/v' + version + '/node-v' + version + '.tar.gz'
, badDownload = false
, extractCount = 0
, gunzip = zlib.createGunzip()
@@ -267,7 +267,7 @@ function install (gyp, argv, callback) {
var async = 0
if (win) {
- // need to download iojs.lib
+ // need to download node.lib
async++
downloadNodeLib(deref)
}
@@ -343,36 +343,36 @@ function install (gyp, argv, callback) {
}
function downloadNodeLib (done) {
- log.verbose('on Windows; need to download `iojs.lib`...')
+ log.verbose('on Windows; need to download `node.lib`...')
var dir32 = path.resolve(devDir, 'ia32')
, dir64 = path.resolve(devDir, 'x64')
- , nodeLibPath32 = path.resolve(dir32, 'iojs.lib')
- , nodeLibPath64 = path.resolve(dir64, 'iojs.lib')
- , nodeLibUrl32 = distUrl + '/v' + version + '/win-x86/iojs.lib'
- , nodeLibUrl64 = distUrl + '/v' + version + '/win-x64/iojs.lib'
+ , nodeLibPath32 = path.resolve(dir32, 'node.lib')
+ , nodeLibPath64 = path.resolve(dir64, 'node.lib')
+ , nodeLibUrl32 = distUrl + '/v' + version + '/node.lib'
+ , nodeLibUrl64 = distUrl + '/v' + version + '/x64/node.lib'
- log.verbose('32-bit iojs.lib dir', dir32)
- log.verbose('64-bit iojs.lib dir', dir64)
- log.verbose('`iojs.lib` 32-bit url', nodeLibUrl32)
- log.verbose('`iojs.lib` 64-bit url', nodeLibUrl64)
+ log.verbose('32-bit node.lib dir', dir32)
+ log.verbose('64-bit node.lib dir', dir64)
+ log.verbose('`node.lib` 32-bit url', nodeLibUrl32)
+ log.verbose('`node.lib` 64-bit url', nodeLibUrl64)
var async = 2
mkdir(dir32, function (err) {
if (err) return done(err)
- log.verbose('streaming 32-bit iojs.lib to:', nodeLibPath32)
+ log.verbose('streaming 32-bit node.lib to:', nodeLibPath32)
var req = download(nodeLibUrl32)
if (!req) return
req.on('error', done)
req.on('response', function (res) {
if (res.statusCode !== 200) {
- done(new Error(res.statusCode + ' status code downloading 32-bit iojs.lib'))
+ done(new Error(res.statusCode + ' status code downloading 32-bit node.lib'))
return
}
getContentSha(res, function (_, checksum) {
- contentShasums['win-x86/iojs.lib'] = checksum
- log.verbose('content checksum', 'win-x86/iojs.lib', checksum)
+ contentShasums['node.lib'] = checksum
+ log.verbose('content checksum', 'node.lib', checksum)
})
var ws = fs.createWriteStream(nodeLibPath32)
@@ -385,20 +385,20 @@ function install (gyp, argv, callback) {
})
mkdir(dir64, function (err) {
if (err) return done(err)
- log.verbose('streaming 64-bit iojs.lib to:', nodeLibPath64)
+ log.verbose('streaming 64-bit node.lib to:', nodeLibPath64)
var req = download(nodeLibUrl64)
if (!req) return
req.on('error', done)
req.on('response', function (res) {
if (res.statusCode !== 200) {
- done(new Error(res.statusCode + ' status code downloading 64-bit iojs.lib'))
+ done(new Error(res.statusCode + ' status code downloading 64-bit node.lib'))
return
}
getContentSha(res, function (_, checksum) {
- contentShasums['win-x64/iojs.lib'] = checksum
- log.verbose('content checksum', 'win-x64/iojs.lib', checksum)
+ contentShasums['x64/node.lib'] = checksum
+ log.verbose('content checksum', 'x64/node.lib', checksum)
})
var ws = fs.createWriteStream(nodeLibPath64)
diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json
index fa65e262a3..ed83501e92 100644
--- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json
+++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json
@@ -58,6 +58,7 @@
"shasum": "83bea115803e7a097a78022427287edb762fafed",
"tarball": "http://registry.npmjs.org/minimatch/-/minimatch-2.0.4.tgz"
},
+ "directories": {},
"_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-2.0.4.tgz",
"readme": "ERROR: No README data found!"
}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/package.json
index 7a2cb4c634..434e4696f8 100644
--- a/deps/npm/node_modules/node-gyp/node_modules/glob/package.json
+++ b/deps/npm/node_modules/node-gyp/node_modules/glob/package.json
@@ -49,7 +49,7 @@
"homepage": "https://github.com/isaacs/node-glob",
"_id": "glob@4.5.3",
"_shasum": "c6cb73d3226c1efef04de3c56d012f03377ee15f",
- "_from": "glob@>=4.4.2 <5.0.0",
+ "_from": "glob@>=3.0.0 <4.0.0||>=4.0.0 <5.0.0",
"_npmVersion": "2.7.1",
"_nodeVersion": "1.4.2",
"_npmUser": {
diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json
index bd516c2977..86b783a1d9 100644
--- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json
+++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json
@@ -50,9 +50,5 @@
],
"_shasum": "66a2b3a749ae8b5fb89efd4fcc01dc94fbe02296",
"_resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.0.tgz",
- "_from": "sigmund@>=1.0.0 <1.1.0",
- "bugs": {
- "url": "https://github.com/isaacs/sigmund/issues"
- },
- "homepage": "https://github.com/isaacs/sigmund"
+ "_from": "sigmund@>=1.0.0 <1.1.0"
}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json b/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json
index 8bf46ccae0..ed21c51376 100644
--- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json
+++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json
@@ -53,6 +53,5 @@
"tarball": "http://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz"
}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore
new file mode 100644
index 0000000000..c167ad5b1c
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore
@@ -0,0 +1,5 @@
+.*.swp
+node_modules
+examples/extract/
+test/tmp/
+test/fixtures/
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml
new file mode 100644
index 0000000000..fca8ef0194
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+node_js:
+ - 0.10
+ - 0.11
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE b/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE
new file mode 100644
index 0000000000..74489e2e26
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE
@@ -0,0 +1,25 @@
+Copyright (c) Isaac Z. Schlueter
+All rights reserved.
+
+The BSD License
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS
+``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED
+TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS
+BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR
+CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF
+SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS
+INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN
+CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE)
+ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE
+POSSIBILITY OF SUCH DAMAGE.
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/README.md b/deps/npm/node_modules/node-gyp/node_modules/tar/README.md
new file mode 100644
index 0000000000..424a2782bf
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/README.md
@@ -0,0 +1,48 @@
+# node-tar
+
+Tar for Node.js.
+
+[![NPM](https://nodei.co/npm/tar.png)](https://nodei.co/npm/tar/)
+
+## API
+
+See `examples/` for usage examples.
+
+### var tar = require('tar')
+
+Returns an object with `.Pack`, `.Extract` and `.Parse` methods.
+
+### tar.Pack([properties])
+
+Returns a through stream. Use
+[fstream](https://npmjs.org/package/fstream) to write files into the
+pack stream and you will receive tar archive data from the pack
+stream.
+
+This only works with directories, it does not work with individual files.
+
+The optional `properties` object are used to set properties in the tar
+'Global Extended Header'.
+
+### tar.Extract([options])
+
+Returns a through stream. Write tar data to the stream and the files
+in the tarball will be extracted onto the filesystem.
+
+`options` can be:
+
+```js
+{
+ path: '/path/to/extract/tar/into',
+ strip: 0, // how many path segments to strip from the root when extracting
+}
+```
+
+`options` also get passed to the `fstream.Writer` instance that `tar`
+uses internally.
+
+### tar.Parse()
+
+Returns a writable stream. Write tar data to it and it will emit
+`entry` events for each entry parsed from the tarball. This is used by
+`tar.Extract`.
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js
new file mode 100644
index 0000000000..f6253a72c5
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js
@@ -0,0 +1,19 @@
+var tar = require("../tar.js")
+ , fs = require("fs")
+
+
+function onError(err) {
+ console.error('An error occurred:', err)
+}
+
+function onEnd() {
+ console.log('Extracted!')
+}
+
+var extractor = tar.Extract({path: __dirname + "/extract"})
+ .on('error', onError)
+ .on('end', onEnd);
+
+fs.createReadStream(__dirname + "/../test/fixtures/c.tar")
+ .on('error', onError)
+ .pipe(extractor);
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js
new file mode 100644
index 0000000000..039969ce30
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js
@@ -0,0 +1,24 @@
+var tar = require("../tar.js")
+ , fstream = require("fstream")
+ , fs = require("fs")
+
+var dirDest = fs.createWriteStream('dir.tar')
+
+
+function onError(err) {
+ console.error('An error occurred:', err)
+}
+
+function onEnd() {
+ console.log('Packed!')
+}
+
+var packer = tar.Pack({ noProprietary: true })
+ .on('error', onError)
+ .on('end', onEnd);
+
+// This must be a "directory"
+fstream.Reader({ path: __dirname, type: "Directory" })
+ .on('error', onError)
+ .pipe(packer)
+ .pipe(dirDest)
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js
new file mode 100644
index 0000000000..8d113ad30d
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js
@@ -0,0 +1,35 @@
+var tar = require("../tar.js")
+ , fs = require("fs")
+
+fs.createReadStream(__dirname + "/../test/fixtures/c.tar")
+ .pipe(tar.Parse())
+ .on("extendedHeader", function (e) {
+ console.error("extended pax header", e.props)
+ e.on("end", function () {
+ console.error("extended pax fields:", e.fields)
+ })
+ })
+ .on("ignoredEntry", function (e) {
+ console.error("ignoredEntry?!?", e.props)
+ })
+ .on("longLinkpath", function (e) {
+ console.error("longLinkpath entry", e.props)
+ e.on("end", function () {
+ console.error("value=%j", e.body.toString())
+ })
+ })
+ .on("longPath", function (e) {
+ console.error("longPath entry", e.props)
+ e.on("end", function () {
+ console.error("value=%j", e.body.toString())
+ })
+ })
+ .on("entry", function (e) {
+ console.error("entry", e.props)
+ e.on("data", function (c) {
+ console.error(" >>>" + c.toString().replace(/\n/g, "\\n"))
+ })
+ e.on("end", function () {
+ console.error(" <<<EOF")
+ })
+ })
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js
new file mode 100644
index 0000000000..6c1da2373a
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js
@@ -0,0 +1,30 @@
+// just like the Entry class, but it buffers the contents
+//
+// XXX It would be good to set a maximum BufferEntry filesize,
+// since it eats up memory. In normal operation,
+// these are only for long filenames or link names, which are
+// rarely very big.
+
+module.exports = BufferEntry
+
+var inherits = require("inherits")
+ , Entry = require("./entry.js")
+
+function BufferEntry () {
+ Entry.apply(this, arguments)
+ this._buffer = new Buffer(this.props.size)
+ this._offset = 0
+ this.body = ""
+ this.on("end", function () {
+ this.body = this._buffer.toString().slice(0, -1)
+ })
+}
+
+inherits(BufferEntry, Entry)
+
+// collect the bytes as they come in.
+BufferEntry.prototype.write = function (c) {
+ c.copy(this._buffer, this._offset)
+ this._offset += c.length
+ Entry.prototype.write.call(this, c)
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js
new file mode 100644
index 0000000000..8e09042d01
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js
@@ -0,0 +1,169 @@
+module.exports = EntryWriter
+
+var tar = require("../tar.js")
+ , TarHeader = require("./header.js")
+ , Entry = require("./entry.js")
+ , inherits = require("inherits")
+ , BlockStream = require("block-stream")
+ , ExtendedHeaderWriter
+ , Stream = require("stream").Stream
+ , EOF = {}
+
+inherits(EntryWriter, Stream)
+
+function EntryWriter (props) {
+ var me = this
+
+ if (!(me instanceof EntryWriter)) {
+ return new EntryWriter(props)
+ }
+
+ Stream.apply(this)
+
+ me.writable = true
+ me.readable = true
+
+ me._stream = new BlockStream(512)
+
+ me._stream.on("data", function (c) {
+ me.emit("data", c)
+ })
+
+ me._stream.on("drain", function () {
+ me.emit("drain")
+ })
+
+ me._stream.on("end", function () {
+ me.emit("end")
+ me.emit("close")
+ })
+
+ me.props = props
+ if (props.type === "Directory") {
+ props.size = 0
+ }
+ props.ustar = "ustar\0"
+ props.ustarver = "00"
+ me.path = props.path
+
+ me._buffer = []
+ me._didHeader = false
+ me._meta = false
+
+ me.on("pipe", function () {
+ me._process()
+ })
+}
+
+EntryWriter.prototype.write = function (c) {
+ // console.error(".. ew write")
+ if (this._ended) return this.emit("error", new Error("write after end"))
+ this._buffer.push(c)
+ this._process()
+ this._needDrain = this._buffer.length > 0
+ return !this._needDrain
+}
+
+EntryWriter.prototype.end = function (c) {
+ // console.error(".. ew end")
+ if (c) this._buffer.push(c)
+ this._buffer.push(EOF)
+ this._ended = true
+ this._process()
+ this._needDrain = this._buffer.length > 0
+}
+
+EntryWriter.prototype.pause = function () {
+ // console.error(".. ew pause")
+ this._paused = true
+ this.emit("pause")
+}
+
+EntryWriter.prototype.resume = function () {
+ // console.error(".. ew resume")
+ this._paused = false
+ this.emit("resume")
+ this._process()
+}
+
+EntryWriter.prototype.add = function (entry) {
+ // console.error(".. ew add")
+ if (!this.parent) return this.emit("error", new Error("no parent"))
+
+ // make sure that the _header and such is emitted, and clear out
+ // the _currentEntry link on the parent.
+ if (!this._ended) this.end()
+
+ return this.parent.add(entry)
+}
+
+EntryWriter.prototype._header = function () {
+ // console.error(".. ew header")
+ if (this._didHeader) return
+ this._didHeader = true
+
+ var headerBlock = TarHeader.encode(this.props)
+
+ if (this.props.needExtended && !this._meta) {
+ var me = this
+
+ ExtendedHeaderWriter = ExtendedHeaderWriter ||
+ require("./extended-header-writer.js")
+
+ ExtendedHeaderWriter(this.props)
+ .on("data", function (c) {
+ me.emit("data", c)
+ })
+ .on("error", function (er) {
+ me.emit("error", er)
+ })
+ .end()
+ }
+
+ // console.error(".. .. ew headerBlock emitting")
+ this.emit("data", headerBlock)
+ this.emit("header")
+}
+
+EntryWriter.prototype._process = function () {
+ // console.error(".. .. ew process")
+ if (!this._didHeader && !this._meta) {
+ this._header()
+ }
+
+ if (this._paused || this._processing) {
+ // console.error(".. .. .. paused=%j, processing=%j", this._paused, this._processing)
+ return
+ }
+
+ this._processing = true
+
+ var buf = this._buffer
+ for (var i = 0; i < buf.length; i ++) {
+ // console.error(".. .. .. i=%d", i)
+
+ var c = buf[i]
+
+ if (c === EOF) this._stream.end()
+ else this._stream.write(c)
+
+ if (this._paused) {
+ // console.error(".. .. .. paused mid-emission")
+ this._processing = false
+ if (i < buf.length) {
+ this._needDrain = true
+ this._buffer = buf.slice(i + 1)
+ }
+ return
+ }
+ }
+
+ // console.error(".. .. .. emitted")
+ this._buffer.length = 0
+ this._processing = false
+
+ // console.error(".. .. .. emitting drain")
+ this.emit("drain")
+}
+
+EntryWriter.prototype.destroy = function () {}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js
new file mode 100644
index 0000000000..4af5c41083
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js
@@ -0,0 +1,213 @@
+// A passthrough read/write stream that sets its properties
+// based on a header, extendedHeader, and globalHeader
+//
+// Can be either a file system object of some sort, or
+// a pax/ustar metadata entry.
+
+module.exports = Entry
+
+var TarHeader = require("./header.js")
+ , tar = require("../tar")
+ , assert = require("assert").ok
+ , Stream = require("stream").Stream
+ , inherits = require("inherits")
+ , fstream = require("fstream").Abstract
+
+function Entry (header, extended, global) {
+ Stream.call(this)
+ this.readable = true
+ this.writable = true
+
+ this._needDrain = false
+ this._paused = false
+ this._reading = false
+ this._ending = false
+ this._ended = false
+ this._remaining = 0
+ this._queue = []
+ this._index = 0
+ this._queueLen = 0
+
+ this._read = this._read.bind(this)
+
+ this.props = {}
+ this._header = header
+ this._extended = extended || {}
+
+ // globals can change throughout the course of
+ // a file parse operation. Freeze it at its current state.
+ this._global = {}
+ var me = this
+ Object.keys(global || {}).forEach(function (g) {
+ me._global[g] = global[g]
+ })
+
+ this._setProps()
+}
+
+inherits(Entry, Stream)
+
+Entry.prototype.write = function (c) {
+ if (this._ending) this.error("write() after end()", null, true)
+ if (this._remaining === 0) {
+ this.error("invalid bytes past eof")
+ }
+
+ // often we'll get a bunch of \0 at the end of the last write,
+ // since chunks will always be 512 bytes when reading a tarball.
+ if (c.length > this._remaining) {
+ c = c.slice(0, this._remaining)
+ }
+ this._remaining -= c.length
+
+ // put it on the stack.
+ var ql = this._queueLen
+ this._queue.push(c)
+ this._queueLen ++
+
+ this._read()
+
+ // either paused, or buffered
+ if (this._paused || ql > 0) {
+ this._needDrain = true
+ return false
+ }
+
+ return true
+}
+
+Entry.prototype.end = function (c) {
+ if (c) this.write(c)
+ this._ending = true
+ this._read()
+}
+
+Entry.prototype.pause = function () {
+ this._paused = true
+ this.emit("pause")
+}
+
+Entry.prototype.resume = function () {
+ // console.error(" Tar Entry resume", this.path)
+ this.emit("resume")
+ this._paused = false
+ this._read()
+ return this._queueLen - this._index > 1
+}
+
+ // This is bound to the instance
+Entry.prototype._read = function () {
+ // console.error(" Tar Entry _read", this.path)
+
+ if (this._paused || this._reading || this._ended) return
+
+ // set this flag so that event handlers don't inadvertently
+ // get multiple _read() calls running.
+ this._reading = true
+
+ // have any data to emit?
+ while (this._index < this._queueLen && !this._paused) {
+ var chunk = this._queue[this._index ++]
+ this.emit("data", chunk)
+ }
+
+ // check if we're drained
+ if (this._index >= this._queueLen) {
+ this._queue.length = this._queueLen = this._index = 0
+ if (this._needDrain) {
+ this._needDrain = false
+ this.emit("drain")
+ }
+ if (this._ending) {
+ this._ended = true
+ this.emit("end")
+ }
+ }
+
+ // if the queue gets too big, then pluck off whatever we can.
+ // this should be fairly rare.
+ var mql = this._maxQueueLen
+ if (this._queueLen > mql && this._index > 0) {
+ mql = Math.min(this._index, mql)
+ this._index -= mql
+ this._queueLen -= mql
+ this._queue = this._queue.slice(mql)
+ }
+
+ this._reading = false
+}
+
+Entry.prototype._setProps = function () {
+ // props = extended->global->header->{}
+ var header = this._header
+ , extended = this._extended
+ , global = this._global
+ , props = this.props
+
+ // first get the values from the normal header.
+ var fields = tar.fields
+ for (var f = 0; fields[f] !== null; f ++) {
+ var field = fields[f]
+ , val = header[field]
+ if (typeof val !== "undefined") props[field] = val
+ }
+
+ // next, the global header for this file.
+ // numeric values, etc, will have already been parsed.
+ ;[global, extended].forEach(function (p) {
+ Object.keys(p).forEach(function (f) {
+ if (typeof p[f] !== "undefined") props[f] = p[f]
+ })
+ })
+
+ // no nulls allowed in path or linkpath
+ ;["path", "linkpath"].forEach(function (p) {
+ if (props.hasOwnProperty(p)) {
+ props[p] = props[p].split("\0")[0]
+ }
+ })
+
+
+ // set date fields to be a proper date
+ ;["mtime", "ctime", "atime"].forEach(function (p) {
+ if (props.hasOwnProperty(p)) {
+ props[p] = new Date(props[p] * 1000)
+ }
+ })
+
+ // set the type so that we know what kind of file to create
+ var type
+ switch (tar.types[props.type]) {
+ case "OldFile":
+ case "ContiguousFile":
+ type = "File"
+ break
+
+ case "GNUDumpDir":
+ type = "Directory"
+ break
+
+ case undefined:
+ type = "Unknown"
+ break
+
+ case "Link":
+ case "SymbolicLink":
+ case "CharacterDevice":
+ case "BlockDevice":
+ case "Directory":
+ case "FIFO":
+ default:
+ type = tar.types[props.type]
+ }
+
+ this.type = type
+ this.path = props.path
+ this.size = props.size
+
+ // size is special, since it signals when the file needs to end.
+ this._remaining = props.size
+}
+
+Entry.prototype.warn = fstream.warn
+Entry.prototype.error = fstream.error
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js
new file mode 100644
index 0000000000..1728c4583a
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js
@@ -0,0 +1,191 @@
+
+module.exports = ExtendedHeaderWriter
+
+var inherits = require("inherits")
+ , EntryWriter = require("./entry-writer.js")
+
+inherits(ExtendedHeaderWriter, EntryWriter)
+
+var tar = require("../tar.js")
+ , path = require("path")
+ , TarHeader = require("./header.js")
+
+// props is the props of the thing we need to write an
+// extended header for.
+// Don't be shy with it. Just encode everything.
+function ExtendedHeaderWriter (props) {
+ // console.error(">> ehw ctor")
+ var me = this
+
+ if (!(me instanceof ExtendedHeaderWriter)) {
+ return new ExtendedHeaderWriter(props)
+ }
+
+ me.fields = props
+
+ var p =
+ { path : ("PaxHeader" + path.join("/", props.path || ""))
+ .replace(/\\/g, "/").substr(0, 100)
+ , mode : props.mode || 0666
+ , uid : props.uid || 0
+ , gid : props.gid || 0
+ , size : 0 // will be set later
+ , mtime : props.mtime || Date.now() / 1000
+ , type : "x"
+ , linkpath : ""
+ , ustar : "ustar\0"
+ , ustarver : "00"
+ , uname : props.uname || ""
+ , gname : props.gname || ""
+ , devmaj : props.devmaj || 0
+ , devmin : props.devmin || 0
+ }
+
+
+ EntryWriter.call(me, p)
+ // console.error(">> ehw props", me.props)
+ me.props = p
+
+ me._meta = true
+}
+
+ExtendedHeaderWriter.prototype.end = function () {
+ // console.error(">> ehw end")
+ var me = this
+
+ if (me._ended) return
+ me._ended = true
+
+ me._encodeFields()
+
+ if (me.props.size === 0) {
+ // nothing to write!
+ me._ready = true
+ me._stream.end()
+ return
+ }
+
+ me._stream.write(TarHeader.encode(me.props))
+ me.body.forEach(function (l) {
+ me._stream.write(l)
+ })
+ me._ready = true
+
+ // console.error(">> ehw _process calling end()", me.props)
+ this._stream.end()
+}
+
+ExtendedHeaderWriter.prototype._encodeFields = function () {
+ // console.error(">> ehw _encodeFields")
+ this.body = []
+ if (this.fields.prefix) {
+ this.fields.path = this.fields.prefix + "/" + this.fields.path
+ this.fields.prefix = ""
+ }
+ encodeFields(this.fields, "", this.body, this.fields.noProprietary)
+ var me = this
+ this.body.forEach(function (l) {
+ me.props.size += l.length
+ })
+}
+
+function encodeFields (fields, prefix, body, nop) {
+ // console.error(">> >> ehw encodeFields")
+ // "%d %s=%s\n", <length>, <keyword>, <value>
+ // The length is a decimal number, and includes itself and the \n
+ // Numeric values are decimal strings.
+
+ Object.keys(fields).forEach(function (k) {
+ var val = fields[k]
+ , numeric = tar.numeric[k]
+
+ if (prefix) k = prefix + "." + k
+
+ // already including NODETAR.type, don't need File=true also
+ if (k === fields.type && val === true) return
+
+ switch (k) {
+ // don't include anything that's always handled just fine
+ // in the normal header, or only meaningful in the context
+ // of nodetar
+ case "mode":
+ case "cksum":
+ case "ustar":
+ case "ustarver":
+ case "prefix":
+ case "basename":
+ case "dirname":
+ case "needExtended":
+ case "block":
+ case "filter":
+ return
+
+ case "rdev":
+ if (val === 0) return
+ break
+
+ case "nlink":
+ case "dev": // Truly a hero among men, Creator of Star!
+ case "ino": // Speak his name with reverent awe! It is:
+ k = "SCHILY." + k
+ break
+
+ default: break
+ }
+
+ if (val && typeof val === "object" &&
+ !Buffer.isBuffer(val)) encodeFields(val, k, body, nop)
+ else if (val === null || val === undefined) return
+ else body.push.apply(body, encodeField(k, val, nop))
+ })
+
+ return body
+}
+
+function encodeField (k, v, nop) {
+ // lowercase keys must be valid, otherwise prefix with
+ // "NODETAR."
+ if (k.charAt(0) === k.charAt(0).toLowerCase()) {
+ var m = k.split(".")[0]
+ if (!tar.knownExtended[m]) k = "NODETAR." + k
+ }
+
+ // no proprietary
+ if (nop && k.charAt(0) !== k.charAt(0).toLowerCase()) {
+ return []
+ }
+
+ if (typeof val === "number") val = val.toString(10)
+
+ var s = new Buffer(" " + k + "=" + v + "\n")
+ , digits = Math.floor(Math.log(s.length) / Math.log(10)) + 1
+
+ // console.error("1 s=%j digits=%j s.length=%d", s.toString(), digits, s.length)
+
+ // if adding that many digits will make it go over that length,
+ // then add one to it. For example, if the string is:
+ // " foo=bar\n"
+ // then that's 9 characters. With the "9", that bumps the length
+ // up to 10. However, this is invalid:
+ // "10 foo=bar\n"
+ // but, since that's actually 11 characters, since 10 adds another
+ // character to the length, and the length includes the number
+ // itself. In that case, just bump it up again.
+ if (s.length + digits >= Math.pow(10, digits)) digits += 1
+ // console.error("2 s=%j digits=%j s.length=%d", s.toString(), digits, s.length)
+
+ var len = digits + s.length
+ // console.error("3 s=%j digits=%j s.length=%d len=%d", s.toString(), digits, s.length, len)
+ var lenBuf = new Buffer("" + len)
+ if (lenBuf.length + s.length !== len) {
+ throw new Error("Bad length calculation\n"+
+ "len="+len+"\n"+
+ "lenBuf="+JSON.stringify(lenBuf.toString())+"\n"+
+ "lenBuf.length="+lenBuf.length+"\n"+
+ "digits="+digits+"\n"+
+ "s="+JSON.stringify(s.toString())+"\n"+
+ "s.length="+s.length)
+ }
+
+ return [lenBuf, s]
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js
new file mode 100644
index 0000000000..74f432ceee
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js
@@ -0,0 +1,140 @@
+// An Entry consisting of:
+//
+// "%d %s=%s\n", <length>, <keyword>, <value>
+//
+// The length is a decimal number, and includes itself and the \n
+// \0 does not terminate anything. Only the length terminates the string.
+// Numeric values are decimal strings.
+
+module.exports = ExtendedHeader
+
+var Entry = require("./entry.js")
+ , inherits = require("inherits")
+ , tar = require("../tar.js")
+ , numeric = tar.numeric
+ , keyTrans = { "SCHILY.dev": "dev"
+ , "SCHILY.ino": "ino"
+ , "SCHILY.nlink": "nlink" }
+
+function ExtendedHeader () {
+ Entry.apply(this, arguments)
+ this.on("data", this._parse)
+ this.fields = {}
+ this._position = 0
+ this._fieldPos = 0
+ this._state = SIZE
+ this._sizeBuf = []
+ this._keyBuf = []
+ this._valBuf = []
+ this._size = -1
+ this._key = ""
+}
+
+inherits(ExtendedHeader, Entry)
+ExtendedHeader.prototype._parse = parse
+
+var s = 0
+ , states = ExtendedHeader.states = {}
+ , SIZE = states.SIZE = s++
+ , KEY = states.KEY = s++
+ , VAL = states.VAL = s++
+ , ERR = states.ERR = s++
+
+Object.keys(states).forEach(function (s) {
+ states[states[s]] = states[s]
+})
+
+states[s] = null
+
+// char code values for comparison
+var _0 = "0".charCodeAt(0)
+ , _9 = "9".charCodeAt(0)
+ , point = ".".charCodeAt(0)
+ , a = "a".charCodeAt(0)
+ , Z = "Z".charCodeAt(0)
+ , a = "a".charCodeAt(0)
+ , z = "z".charCodeAt(0)
+ , space = " ".charCodeAt(0)
+ , eq = "=".charCodeAt(0)
+ , cr = "\n".charCodeAt(0)
+
+function parse (c) {
+ if (this._state === ERR) return
+
+ for ( var i = 0, l = c.length
+ ; i < l
+ ; this._position++, this._fieldPos++, i++) {
+ // console.error("top of loop, size="+this._size)
+
+ var b = c[i]
+
+ if (this._size >= 0 && this._fieldPos > this._size) {
+ error(this, "field exceeds length="+this._size)
+ return
+ }
+
+ switch (this._state) {
+ case ERR: return
+
+ case SIZE:
+ // console.error("parsing size, b=%d, rest=%j", b, c.slice(i).toString())
+ if (b === space) {
+ this._state = KEY
+ // this._fieldPos = this._sizeBuf.length
+ this._size = parseInt(new Buffer(this._sizeBuf).toString(), 10)
+ this._sizeBuf.length = 0
+ continue
+ }
+ if (b < _0 || b > _9) {
+ error(this, "expected [" + _0 + ".." + _9 + "], got " + b)
+ return
+ }
+ this._sizeBuf.push(b)
+ continue
+
+ case KEY:
+ // can be any char except =, not > size.
+ if (b === eq) {
+ this._state = VAL
+ this._key = new Buffer(this._keyBuf).toString()
+ if (keyTrans[this._key]) this._key = keyTrans[this._key]
+ this._keyBuf.length = 0
+ continue
+ }
+ this._keyBuf.push(b)
+ continue
+
+ case VAL:
+ // field must end with cr
+ if (this._fieldPos === this._size - 1) {
+ // console.error("finished with "+this._key)
+ if (b !== cr) {
+ error(this, "expected \\n at end of field")
+ return
+ }
+ var val = new Buffer(this._valBuf).toString()
+ if (numeric[this._key]) {
+ val = parseFloat(val)
+ }
+ this.fields[this._key] = val
+
+ this._valBuf.length = 0
+ this._state = SIZE
+ this._size = -1
+ this._fieldPos = -1
+ continue
+ }
+ this._valBuf.push(b)
+ continue
+ }
+ }
+}
+
+function error (me, msg) {
+ msg = "invalid header: " + msg
+ + "\nposition=" + me._position
+ + "\nfield position=" + me._fieldPos
+
+ me.error(msg)
+ me.state = ERR
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js
new file mode 100644
index 0000000000..9fb1e6fb1b
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js
@@ -0,0 +1,86 @@
+// give it a tarball and a path, and it'll dump the contents
+
+module.exports = Extract
+
+var tar = require("../tar.js")
+ , fstream = require("fstream")
+ , inherits = require("inherits")
+ , path = require("path")
+
+function Extract (opts) {
+ if (!(this instanceof Extract)) return new Extract(opts)
+ tar.Parse.apply(this)
+
+ // have to dump into a directory
+ opts.type = "Directory"
+ opts.Directory = true
+
+ if (typeof opts !== "object") {
+ opts = { path: opts }
+ }
+
+ // better to drop in cwd? seems more standard.
+ opts.path = opts.path || path.resolve("node-tar-extract")
+ opts.type = "Directory"
+ opts.Directory = true
+
+ // similar to --strip or --strip-components
+ opts.strip = +opts.strip
+ if (!opts.strip || opts.strip <= 0) opts.strip = 0
+
+ this._fst = fstream.Writer(opts)
+
+ this.pause()
+ var me = this
+
+ // Hardlinks in tarballs are relative to the root
+ // of the tarball. So, they need to be resolved against
+ // the target directory in order to be created properly.
+ me.on("entry", function (entry) {
+ // if there's a "strip" argument, then strip off that many
+ // path components.
+ if (opts.strip) {
+ var p = entry.path.split("/").slice(opts.strip).join("/")
+ entry.path = entry.props.path = p
+ if (entry.linkpath) {
+ var lp = entry.linkpath.split("/").slice(opts.strip).join("/")
+ entry.linkpath = entry.props.linkpath = lp
+ }
+ }
+ if (entry.type !== "Link") return
+ entry.linkpath = entry.props.linkpath =
+ path.join(opts.path, path.join("/", entry.props.linkpath))
+ })
+
+ this._fst.on("ready", function () {
+ me.pipe(me._fst, { end: false })
+ me.resume()
+ })
+
+ this._fst.on('error', function(err) {
+ me.emit('error', err)
+ })
+
+ this._fst.on('drain', function() {
+ me.emit('drain')
+ })
+
+ // this._fst.on("end", function () {
+ // console.error("\nEEEE Extract End", me._fst.path)
+ // })
+
+ this._fst.on("close", function () {
+ // console.error("\nEEEE Extract End", me._fst.path)
+ me.emit("end")
+ me.emit("close")
+ })
+}
+
+inherits(Extract, tar.Parse)
+
+Extract.prototype._streamEnd = function () {
+ var me = this
+ if (!me._ended) me.error("unexpected eof")
+ me._fst.end()
+ // my .end() is coming later.
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js
new file mode 100644
index 0000000000..0bfc7b80aa
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js
@@ -0,0 +1,14 @@
+module.exports = GlobalHeaderWriter
+
+var ExtendedHeaderWriter = require("./extended-header-writer.js")
+ , inherits = require("inherits")
+
+inherits(GlobalHeaderWriter, ExtendedHeaderWriter)
+
+function GlobalHeaderWriter (props) {
+ if (!(this instanceof GlobalHeaderWriter)) {
+ return new GlobalHeaderWriter(props)
+ }
+ ExtendedHeaderWriter.call(this, props)
+ this.props.type = "g"
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js
new file mode 100644
index 0000000000..3741d5d3f2
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js
@@ -0,0 +1,384 @@
+// parse a 512-byte header block to a data object, or vice-versa
+// If the data won't fit nicely in a simple header, then generate
+// the appropriate extended header file, and return that.
+
+module.exports = TarHeader
+
+var tar = require("../tar.js")
+ , fields = tar.fields
+ , fieldOffs = tar.fieldOffs
+ , fieldEnds = tar.fieldEnds
+ , fieldSize = tar.fieldSize
+ , numeric = tar.numeric
+ , assert = require("assert").ok
+ , space = " ".charCodeAt(0)
+ , slash = "/".charCodeAt(0)
+ , bslash = process.platform === "win32" ? "\\".charCodeAt(0) : null
+
+function TarHeader (block) {
+ if (!(this instanceof TarHeader)) return new TarHeader(block)
+ if (block) this.decode(block)
+}
+
+TarHeader.prototype =
+ { decode : decode
+ , encode: encode
+ , calcSum: calcSum
+ , checkSum: checkSum
+ }
+
+TarHeader.parseNumeric = parseNumeric
+TarHeader.encode = encode
+TarHeader.decode = decode
+
+// note that this will only do the normal ustar header, not any kind
+// of extended posix header file. If something doesn't fit comfortably,
+// then it will set obj.needExtended = true, and set the block to
+// the closest approximation.
+function encode (obj) {
+ if (!obj && !(this instanceof TarHeader)) throw new Error(
+ "encode must be called on a TarHeader, or supplied an object")
+
+ obj = obj || this
+ var block = obj.block = new Buffer(512)
+
+ // if the object has a "prefix", then that's actually an extension of
+ // the path field.
+ if (obj.prefix) {
+ // console.error("%% header encoding, got a prefix", obj.prefix)
+ obj.path = obj.prefix + "/" + obj.path
+ // console.error("%% header encoding, prefixed path", obj.path)
+ obj.prefix = ""
+ }
+
+ obj.needExtended = false
+
+ if (obj.mode) {
+ if (typeof obj.mode === "string") obj.mode = parseInt(obj.mode, 8)
+ obj.mode = obj.mode & 0777
+ }
+
+ for (var f = 0; fields[f] !== null; f ++) {
+ var field = fields[f]
+ , off = fieldOffs[f]
+ , end = fieldEnds[f]
+ , ret
+
+ switch (field) {
+ case "cksum":
+ // special, done below, after all the others
+ break
+
+ case "prefix":
+ // special, this is an extension of the "path" field.
+ // console.error("%% header encoding, skip prefix later")
+ break
+
+ case "type":
+ // convert from long name to a single char.
+ var type = obj.type || "0"
+ if (type.length > 1) {
+ type = tar.types[obj.type]
+ if (!type) type = "0"
+ }
+ writeText(block, off, end, type)
+ break
+
+ case "path":
+ // uses the "prefix" field if > 100 bytes, but <= 255
+ var pathLen = Buffer.byteLength(obj.path)
+ , pathFSize = fieldSize[fields.path]
+ , prefFSize = fieldSize[fields.prefix]
+
+ // paths between 100 and 255 should use the prefix field.
+ // longer than 255
+ if (pathLen > pathFSize &&
+ pathLen <= pathFSize + prefFSize) {
+ // need to find a slash somewhere in the middle so that
+ // path and prefix both fit in their respective fields
+ var searchStart = pathLen - 1 - pathFSize
+ , searchEnd = prefFSize
+ , found = false
+ , pathBuf = new Buffer(obj.path)
+
+ for ( var s = searchStart
+ ; (s <= searchEnd)
+ ; s ++ ) {
+ if (pathBuf[s] === slash || pathBuf[s] === bslash) {
+ found = s
+ break
+ }
+ }
+
+ if (found !== false) {
+ prefix = pathBuf.slice(0, found).toString("utf8")
+ path = pathBuf.slice(found + 1).toString("utf8")
+
+ ret = writeText(block, off, end, path)
+ off = fieldOffs[fields.prefix]
+ end = fieldEnds[fields.prefix]
+ // console.error("%% header writing prefix", off, end, prefix)
+ ret = writeText(block, off, end, prefix) || ret
+ break
+ }
+ }
+
+ // paths less than 100 chars don't need a prefix
+ // and paths longer than 255 need an extended header and will fail
+ // on old implementations no matter what we do here.
+ // Null out the prefix, and fallthrough to default.
+ // console.error("%% header writing no prefix")
+ var poff = fieldOffs[fields.prefix]
+ , pend = fieldEnds[fields.prefix]
+ writeText(block, poff, pend, "")
+ // fallthrough
+
+ // all other fields are numeric or text
+ default:
+ ret = numeric[field]
+ ? writeNumeric(block, off, end, obj[field])
+ : writeText(block, off, end, obj[field] || "")
+ break
+ }
+ obj.needExtended = obj.needExtended || ret
+ }
+
+ var off = fieldOffs[fields.cksum]
+ , end = fieldEnds[fields.cksum]
+
+ writeNumeric(block, off, end, calcSum.call(this, block))
+
+ return block
+}
+
+// if it's a negative number, or greater than will fit,
+// then use write256.
+var MAXNUM = { 12: 077777777777
+ , 11: 07777777777
+ , 8 : 07777777
+ , 7 : 0777777 }
+function writeNumeric (block, off, end, num) {
+ var writeLen = end - off
+ , maxNum = MAXNUM[writeLen] || 0
+
+ num = num || 0
+ // console.error(" numeric", num)
+
+ if (num instanceof Date ||
+ Object.prototype.toString.call(num) === "[object Date]") {
+ num = num.getTime() / 1000
+ }
+
+ if (num > maxNum || num < 0) {
+ write256(block, off, end, num)
+ // need an extended header if negative or too big.
+ return true
+ }
+
+ // god, tar is so annoying
+ // if the string is small enough, you should put a space
+ // between the octal string and the \0, but if it doesn't
+ // fit, then don't.
+ var numStr = Math.floor(num).toString(8)
+ if (num < MAXNUM[writeLen - 1]) numStr += " "
+
+ // pad with "0" chars
+ if (numStr.length < writeLen) {
+ numStr = (new Array(writeLen - numStr.length).join("0")) + numStr
+ }
+
+ if (numStr.length !== writeLen - 1) {
+ throw new Error("invalid length: " + JSON.stringify(numStr) + "\n" +
+ "expected: "+writeLen)
+ }
+ block.write(numStr, off, writeLen, "utf8")
+ block[end - 1] = 0
+}
+
+function write256 (block, off, end, num) {
+ var buf = block.slice(off, end)
+ var positive = num >= 0
+ buf[0] = positive ? 0x80 : 0xFF
+
+ // get the number as a base-256 tuple
+ if (!positive) num *= -1
+ var tuple = []
+ do {
+ var n = num % 256
+ tuple.push(n)
+ num = (num - n) / 256
+ } while (num)
+
+ var bytes = tuple.length
+
+ var fill = buf.length - bytes
+ for (var i = 1; i < fill; i ++) {
+ buf[i] = positive ? 0 : 0xFF
+ }
+
+ // tuple is a base256 number, with [0] as the *least* significant byte
+ // if it's negative, then we need to flip all the bits once we hit the
+ // first non-zero bit. The 2's-complement is (0x100 - n), and the 1's-
+ // complement is (0xFF - n).
+ var zero = true
+ for (i = bytes; i > 0; i --) {
+ var byte = tuple[bytes - i]
+ if (positive) buf[fill + i] = byte
+ else if (zero && byte === 0) buf[fill + i] = 0
+ else if (zero) {
+ zero = false
+ buf[fill + i] = 0x100 - byte
+ } else buf[fill + i] = 0xFF - byte
+ }
+}
+
+function writeText (block, off, end, str) {
+ // strings are written as utf8, then padded with \0
+ var strLen = Buffer.byteLength(str)
+ , writeLen = Math.min(strLen, end - off)
+ // non-ascii fields need extended headers
+ // long fields get truncated
+ , needExtended = strLen !== str.length || strLen > writeLen
+
+ // write the string, and null-pad
+ if (writeLen > 0) block.write(str, off, writeLen, "utf8")
+ for (var i = off + writeLen; i < end; i ++) block[i] = 0
+
+ return needExtended
+}
+
+function calcSum (block) {
+ block = block || this.block
+ assert(Buffer.isBuffer(block) && block.length === 512)
+
+ if (!block) throw new Error("Need block to checksum")
+
+ // now figure out what it would be if the cksum was " "
+ var sum = 0
+ , start = fieldOffs[fields.cksum]
+ , end = fieldEnds[fields.cksum]
+
+ for (var i = 0; i < fieldOffs[fields.cksum]; i ++) {
+ sum += block[i]
+ }
+
+ for (var i = start; i < end; i ++) {
+ sum += space
+ }
+
+ for (var i = end; i < 512; i ++) {
+ sum += block[i]
+ }
+
+ return sum
+}
+
+
+function checkSum (block) {
+ var sum = calcSum.call(this, block)
+ block = block || this.block
+
+ var cksum = block.slice(fieldOffs[fields.cksum], fieldEnds[fields.cksum])
+ cksum = parseNumeric(cksum)
+
+ return cksum === sum
+}
+
+function decode (block) {
+ block = block || this.block
+ assert(Buffer.isBuffer(block) && block.length === 512)
+
+ this.block = block
+ this.cksumValid = this.checkSum()
+
+ var prefix = null
+
+ // slice off each field.
+ for (var f = 0; fields[f] !== null; f ++) {
+ var field = fields[f]
+ , val = block.slice(fieldOffs[f], fieldEnds[f])
+
+ switch (field) {
+ case "ustar":
+ // if not ustar, then everything after that is just padding.
+ if (val.toString() !== "ustar\0") {
+ this.ustar = false
+ return
+ } else {
+ // console.error("ustar:", val, val.toString())
+ this.ustar = val.toString()
+ }
+ break
+
+ // prefix is special, since it might signal the xstar header
+ case "prefix":
+ var atime = parseNumeric(val.slice(131, 131 + 12))
+ , ctime = parseNumeric(val.slice(131 + 12, 131 + 12 + 12))
+ if ((val[130] === 0 || val[130] === space) &&
+ typeof atime === "number" &&
+ typeof ctime === "number" &&
+ val[131 + 12] === space &&
+ val[131 + 12 + 12] === space) {
+ this.atime = atime
+ this.ctime = ctime
+ val = val.slice(0, 130)
+ }
+ prefix = val.toString("utf8").replace(/\0+$/, "")
+ // console.error("%% header reading prefix", prefix)
+ break
+
+ // all other fields are null-padding text
+ // or a number.
+ default:
+ if (numeric[field]) {
+ this[field] = parseNumeric(val)
+ } else {
+ this[field] = val.toString("utf8").replace(/\0+$/, "")
+ }
+ break
+ }
+ }
+
+ // if we got a prefix, then prepend it to the path.
+ if (prefix) {
+ this.path = prefix + "/" + this.path
+ // console.error("%% header got a prefix", this.path)
+ }
+}
+
+function parse256 (buf) {
+ // first byte MUST be either 80 or FF
+ // 80 for positive, FF for 2's comp
+ var positive
+ if (buf[0] === 0x80) positive = true
+ else if (buf[0] === 0xFF) positive = false
+ else return null
+
+ // build up a base-256 tuple from the least sig to the highest
+ var zero = false
+ , tuple = []
+ for (var i = buf.length - 1; i > 0; i --) {
+ var byte = buf[i]
+ if (positive) tuple.push(byte)
+ else if (zero && byte === 0) tuple.push(0)
+ else if (zero) {
+ zero = false
+ tuple.push(0x100 - byte)
+ } else tuple.push(0xFF - byte)
+ }
+
+ for (var sum = 0, i = 0, l = tuple.length; i < l; i ++) {
+ sum += tuple[i] * Math.pow(256, i)
+ }
+
+ return positive ? sum : -1 * sum
+}
+
+function parseNumeric (f) {
+ if (f[0] & 0x80) return parse256(f)
+
+ var str = f.toString("utf8").split("\0")[0].trim()
+ , res = parseInt(str, 8)
+
+ return isNaN(res) ? null : res
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js
new file mode 100644
index 0000000000..3ff14dd695
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js
@@ -0,0 +1,231 @@
+// pipe in an fstream, and it'll make a tarball.
+// key-value pair argument is global extended header props.
+
+module.exports = Pack
+
+var EntryWriter = require("./entry-writer.js")
+ , Stream = require("stream").Stream
+ , path = require("path")
+ , inherits = require("inherits")
+ , GlobalHeaderWriter = require("./global-header-writer.js")
+ , collect = require("fstream").collect
+ , eof = new Buffer(512)
+
+for (var i = 0; i < 512; i ++) eof[i] = 0
+
+inherits(Pack, Stream)
+
+function Pack (props) {
+ // console.error("-- p ctor")
+ var me = this
+ if (!(me instanceof Pack)) return new Pack(props)
+
+ if (props) me._noProprietary = props.noProprietary
+ else me._noProprietary = false
+
+ me._global = props
+
+ me.readable = true
+ me.writable = true
+ me._buffer = []
+ // console.error("-- -- set current to null in ctor")
+ me._currentEntry = null
+ me._processing = false
+
+ me._pipeRoot = null
+ me.on("pipe", function (src) {
+ if (src.root === me._pipeRoot) return
+ me._pipeRoot = src
+ src.on("end", function () {
+ me._pipeRoot = null
+ })
+ me.add(src)
+ })
+}
+
+Pack.prototype.addGlobal = function (props) {
+ // console.error("-- p addGlobal")
+ if (this._didGlobal) return
+ this._didGlobal = true
+
+ var me = this
+ GlobalHeaderWriter(props)
+ .on("data", function (c) {
+ me.emit("data", c)
+ })
+ .end()
+}
+
+Pack.prototype.add = function (stream) {
+ if (this._global && !this._didGlobal) this.addGlobal(this._global)
+
+ if (this._ended) return this.emit("error", new Error("add after end"))
+
+ collect(stream)
+ this._buffer.push(stream)
+ this._process()
+ this._needDrain = this._buffer.length > 0
+ return !this._needDrain
+}
+
+Pack.prototype.pause = function () {
+ this._paused = true
+ if (this._currentEntry) this._currentEntry.pause()
+ this.emit("pause")
+}
+
+Pack.prototype.resume = function () {
+ this._paused = false
+ if (this._currentEntry) this._currentEntry.resume()
+ this.emit("resume")
+ this._process()
+}
+
+Pack.prototype.end = function () {
+ this._ended = true
+ this._buffer.push(eof)
+ this._process()
+}
+
+Pack.prototype._process = function () {
+ var me = this
+ if (me._paused || me._processing) {
+ return
+ }
+
+ var entry = me._buffer.shift()
+
+ if (!entry) {
+ if (me._needDrain) {
+ me.emit("drain")
+ }
+ return
+ }
+
+ if (entry.ready === false) {
+ // console.error("-- entry is not ready", entry)
+ me._buffer.unshift(entry)
+ entry.on("ready", function () {
+ // console.error("-- -- ready!", entry)
+ me._process()
+ })
+ return
+ }
+
+ me._processing = true
+
+ if (entry === eof) {
+ // need 2 ending null blocks.
+ me.emit("data", eof)
+ me.emit("data", eof)
+ me.emit("end")
+ me.emit("close")
+ return
+ }
+
+ // Change the path to be relative to the root dir that was
+ // added to the tarball.
+ //
+ // XXX This should be more like how -C works, so you can
+ // explicitly set a root dir, and also explicitly set a pathname
+ // in the tarball to use. That way we can skip a lot of extra
+ // work when resolving symlinks for bundled dependencies in npm.
+
+ var root = path.dirname((entry.root || entry).path)
+ var wprops = {}
+
+ Object.keys(entry.props || {}).forEach(function (k) {
+ wprops[k] = entry.props[k]
+ })
+
+ if (me._noProprietary) wprops.noProprietary = true
+
+ wprops.path = path.relative(root, entry.path || '')
+
+ // actually not a matter of opinion or taste.
+ if (process.platform === "win32") {
+ wprops.path = wprops.path.replace(/\\/g, "/")
+ }
+
+ if (!wprops.type)
+ wprops.type = 'Directory'
+
+ switch (wprops.type) {
+ // sockets not supported
+ case "Socket":
+ return
+
+ case "Directory":
+ wprops.path += "/"
+ wprops.size = 0
+ break
+
+ case "Link":
+ var lp = path.resolve(path.dirname(entry.path), entry.linkpath)
+ wprops.linkpath = path.relative(root, lp) || "."
+ wprops.size = 0
+ break
+
+ case "SymbolicLink":
+ var lp = path.resolve(path.dirname(entry.path), entry.linkpath)
+ wprops.linkpath = path.relative(path.dirname(entry.path), lp) || "."
+ wprops.size = 0
+ break
+ }
+
+ // console.error("-- new writer", wprops)
+ // if (!wprops.type) {
+ // // console.error("-- no type?", entry.constructor.name, entry)
+ // }
+
+ // console.error("-- -- set current to new writer", wprops.path)
+ var writer = me._currentEntry = EntryWriter(wprops)
+
+ writer.parent = me
+
+ // writer.on("end", function () {
+ // // console.error("-- -- writer end", writer.path)
+ // })
+
+ writer.on("data", function (c) {
+ me.emit("data", c)
+ })
+
+ writer.on("header", function () {
+ Buffer.prototype.toJSON = function () {
+ return this.toString().split(/\0/).join(".")
+ }
+ // console.error("-- -- writer header %j", writer.props)
+ if (writer.props.size === 0) nextEntry()
+ })
+ writer.on("close", nextEntry)
+
+ var ended = false
+ function nextEntry () {
+ if (ended) return
+ ended = true
+
+ // console.error("-- -- writer close", writer.path)
+ // console.error("-- -- set current to null", wprops.path)
+ me._currentEntry = null
+ me._processing = false
+ me._process()
+ }
+
+ writer.on("error", function (er) {
+ // console.error("-- -- writer error", writer.path)
+ me.emit("error", er)
+ })
+
+ // if it's the root, then there's no need to add its entries,
+ // or data, since they'll be added directly.
+ if (entry === me._pipeRoot) {
+ // console.error("-- is the root, don't auto-add")
+ writer.add = null
+ }
+
+ entry.pipe(writer)
+}
+
+Pack.prototype.destroy = function () {}
+Pack.prototype.write = function () {}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js
new file mode 100644
index 0000000000..8517c481bc
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js
@@ -0,0 +1,271 @@
+
+// A writable stream.
+// It emits "entry" events, which provide a readable stream that has
+// header info attached.
+
+module.exports = Parse.create = Parse
+
+var stream = require("stream")
+ , Stream = stream.Stream
+ , BlockStream = require("block-stream")
+ , tar = require("../tar.js")
+ , TarHeader = require("./header.js")
+ , Entry = require("./entry.js")
+ , BufferEntry = require("./buffer-entry.js")
+ , ExtendedHeader = require("./extended-header.js")
+ , assert = require("assert").ok
+ , inherits = require("inherits")
+ , fstream = require("fstream")
+
+// reading a tar is a lot like reading a directory
+// However, we're actually not going to run the ctor,
+// since it does a stat and various other stuff.
+// This inheritance gives us the pause/resume/pipe
+// behavior that is desired.
+inherits(Parse, fstream.Reader)
+
+function Parse () {
+ var me = this
+ if (!(me instanceof Parse)) return new Parse()
+
+ // doesn't apply fstream.Reader ctor?
+ // no, becasue we don't want to stat/etc, we just
+ // want to get the entry/add logic from .pipe()
+ Stream.apply(me)
+
+ me.writable = true
+ me.readable = true
+ me._stream = new BlockStream(512)
+ me.position = 0
+ me._ended = false
+
+ me._stream.on("error", function (e) {
+ me.emit("error", e)
+ })
+
+ me._stream.on("data", function (c) {
+ me._process(c)
+ })
+
+ me._stream.on("end", function () {
+ me._streamEnd()
+ })
+
+ me._stream.on("drain", function () {
+ me.emit("drain")
+ })
+}
+
+// overridden in Extract class, since it needs to
+// wait for its DirWriter part to finish before
+// emitting "end"
+Parse.prototype._streamEnd = function () {
+ var me = this
+ if (!me._ended) me.error("unexpected eof")
+ me.emit("end")
+}
+
+// a tar reader is actually a filter, not just a readable stream.
+// So, you should pipe a tarball stream into it, and it needs these
+// write/end methods to do that.
+Parse.prototype.write = function (c) {
+ if (this._ended) {
+ // gnutar puts a LOT of nulls at the end.
+ // you can keep writing these things forever.
+ // Just ignore them.
+ for (var i = 0, l = c.length; i > l; i ++) {
+ if (c[i] !== 0) return this.error("write() after end()")
+ }
+ return
+ }
+ return this._stream.write(c)
+}
+
+Parse.prototype.end = function (c) {
+ this._ended = true
+ return this._stream.end(c)
+}
+
+// don't need to do anything, since we're just
+// proxying the data up from the _stream.
+// Just need to override the parent's "Not Implemented"
+// error-thrower.
+Parse.prototype._read = function () {}
+
+Parse.prototype._process = function (c) {
+ assert(c && c.length === 512, "block size should be 512")
+
+ // one of three cases.
+ // 1. A new header
+ // 2. A part of a file/extended header
+ // 3. One of two or more EOF null blocks
+
+ if (this._entry) {
+ var entry = this._entry
+ entry.write(c)
+ if (entry._remaining === 0) {
+ entry.end()
+ this._entry = null
+ }
+ } else {
+ // either zeroes or a header
+ var zero = true
+ for (var i = 0; i < 512 && zero; i ++) {
+ zero = c[i] === 0
+ }
+
+ // eof is *at least* 2 blocks of nulls, and then the end of the
+ // file. you can put blocks of nulls between entries anywhere,
+ // so appending one tarball to another is technically valid.
+ // ending without the eof null blocks is not allowed, however.
+ if (zero) {
+ if (this._eofStarted)
+ this._ended = true
+ this._eofStarted = true
+ } else {
+ this._eofStarted = false
+ this._startEntry(c)
+ }
+ }
+
+ this.position += 512
+}
+
+// take a header chunk, start the right kind of entry.
+Parse.prototype._startEntry = function (c) {
+ var header = new TarHeader(c)
+ , self = this
+ , entry
+ , ev
+ , EntryType
+ , onend
+ , meta = false
+
+ if (null === header.size || !header.cksumValid) {
+ var e = new Error("invalid tar file")
+ e.header = header
+ e.tar_file_offset = this.position
+ e.tar_block = this.position / 512
+ return this.emit("error", e)
+ }
+
+ switch (tar.types[header.type]) {
+ case "File":
+ case "OldFile":
+ case "Link":
+ case "SymbolicLink":
+ case "CharacterDevice":
+ case "BlockDevice":
+ case "Directory":
+ case "FIFO":
+ case "ContiguousFile":
+ case "GNUDumpDir":
+ // start a file.
+ // pass in any extended headers
+ // These ones consumers are typically most interested in.
+ EntryType = Entry
+ ev = "entry"
+ break
+
+ case "GlobalExtendedHeader":
+ // extended headers that apply to the rest of the tarball
+ EntryType = ExtendedHeader
+ onend = function () {
+ self._global = self._global || {}
+ Object.keys(entry.fields).forEach(function (k) {
+ self._global[k] = entry.fields[k]
+ })
+ }
+ ev = "globalExtendedHeader"
+ meta = true
+ break
+
+ case "ExtendedHeader":
+ case "OldExtendedHeader":
+ // extended headers that apply to the next entry
+ EntryType = ExtendedHeader
+ onend = function () {
+ self._extended = entry.fields
+ }
+ ev = "extendedHeader"
+ meta = true
+ break
+
+ case "NextFileHasLongLinkpath":
+ // set linkpath=<contents> in extended header
+ EntryType = BufferEntry
+ onend = function () {
+ self._extended = self._extended || {}
+ self._extended.linkpath = entry.body
+ }
+ ev = "longLinkpath"
+ meta = true
+ break
+
+ case "NextFileHasLongPath":
+ case "OldGnuLongPath":
+ // set path=<contents> in file-extended header
+ EntryType = BufferEntry
+ onend = function () {
+ self._extended = self._extended || {}
+ self._extended.path = entry.body
+ }
+ ev = "longPath"
+ meta = true
+ break
+
+ default:
+ // all the rest we skip, but still set the _entry
+ // member, so that we can skip over their data appropriately.
+ // emit an event to say that this is an ignored entry type?
+ EntryType = Entry
+ ev = "ignoredEntry"
+ break
+ }
+
+ var global, extended
+ if (meta) {
+ global = extended = null
+ } else {
+ var global = this._global
+ var extended = this._extended
+
+ // extendedHeader only applies to one entry, so once we start
+ // an entry, it's over.
+ this._extended = null
+ }
+ entry = new EntryType(header, extended, global)
+ entry.meta = meta
+
+ // only proxy data events of normal files.
+ if (!meta) {
+ entry.on("data", function (c) {
+ me.emit("data", c)
+ })
+ }
+
+ if (onend) entry.on("end", onend)
+
+ this._entry = entry
+ var me = this
+
+ entry.on("pause", function () {
+ me.pause()
+ })
+
+ entry.on("resume", function () {
+ me.resume()
+ })
+
+ if (this.listeners("*").length) {
+ this.emit("*", ev, entry)
+ }
+
+ this.emit(ev, entry)
+
+ // Zero-byte entry. End immediately.
+ if (entry.props.size === 0) {
+ entry.end()
+ this._entry = null
+ }
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/package.json b/deps/npm/node_modules/node-gyp/node_modules/tar/package.json
new file mode 100644
index 0000000000..5aa78aec30
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/package.json
@@ -0,0 +1,60 @@
+{
+ "author": {
+ "name": "Isaac Z. Schlueter",
+ "email": "i@izs.me",
+ "url": "http://blog.izs.me/"
+ },
+ "name": "tar",
+ "description": "tar for node",
+ "version": "1.0.3",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/isaacs/node-tar.git"
+ },
+ "main": "tar.js",
+ "scripts": {
+ "test": "tap test/*.js"
+ },
+ "dependencies": {
+ "block-stream": "*",
+ "fstream": "^1.0.2",
+ "inherits": "2"
+ },
+ "devDependencies": {
+ "graceful-fs": "^3.0.2",
+ "rimraf": "1.x",
+ "tap": "0.x",
+ "mkdirp": "^0.5.0"
+ },
+ "license": "BSD",
+ "gitHead": "f4151128c585da236c6b1e278b762ecaedc20c15",
+ "bugs": {
+ "url": "https://github.com/isaacs/node-tar/issues"
+ },
+ "homepage": "https://github.com/isaacs/node-tar",
+ "_id": "tar@1.0.3",
+ "_shasum": "15bcdab244fa4add44e4244a0176edb8aa9a2b44",
+ "_from": "tar@>=1.0.0 <2.0.0",
+ "_npmVersion": "2.1.10",
+ "_nodeVersion": "0.10.33",
+ "_npmUser": {
+ "name": "othiym23",
+ "email": "ogd@aoaioxxysz.net"
+ },
+ "maintainers": [
+ {
+ "name": "isaacs",
+ "email": "i@izs.me"
+ },
+ {
+ "name": "othiym23",
+ "email": "ogd@aoaioxxysz.net"
+ }
+ ],
+ "dist": {
+ "shasum": "15bcdab244fa4add44e4244a0176edb8aa9a2b44",
+ "tarball": "http://registry.npmjs.org/tar/-/tar-1.0.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/tar/-/tar-1.0.3.tgz"
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js b/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js
new file mode 100644
index 0000000000..a81298b9a0
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js
@@ -0,0 +1,173 @@
+// field paths that every tar file must have.
+// header is padded to 512 bytes.
+var f = 0
+ , fields = {}
+ , path = fields.path = f++
+ , mode = fields.mode = f++
+ , uid = fields.uid = f++
+ , gid = fields.gid = f++
+ , size = fields.size = f++
+ , mtime = fields.mtime = f++
+ , cksum = fields.cksum = f++
+ , type = fields.type = f++
+ , linkpath = fields.linkpath = f++
+ , headerSize = 512
+ , blockSize = 512
+ , fieldSize = []
+
+fieldSize[path] = 100
+fieldSize[mode] = 8
+fieldSize[uid] = 8
+fieldSize[gid] = 8
+fieldSize[size] = 12
+fieldSize[mtime] = 12
+fieldSize[cksum] = 8
+fieldSize[type] = 1
+fieldSize[linkpath] = 100
+
+// "ustar\0" may introduce another bunch of headers.
+// these are optional, and will be nulled out if not present.
+
+var ustar = fields.ustar = f++
+ , ustarver = fields.ustarver = f++
+ , uname = fields.uname = f++
+ , gname = fields.gname = f++
+ , devmaj = fields.devmaj = f++
+ , devmin = fields.devmin = f++
+ , prefix = fields.prefix = f++
+ , fill = fields.fill = f++
+
+// terminate fields.
+fields[f] = null
+
+fieldSize[ustar] = 6
+fieldSize[ustarver] = 2
+fieldSize[uname] = 32
+fieldSize[gname] = 32
+fieldSize[devmaj] = 8
+fieldSize[devmin] = 8
+fieldSize[prefix] = 155
+fieldSize[fill] = 12
+
+// nb: prefix field may in fact be 130 bytes of prefix,
+// a null char, 12 bytes for atime, 12 bytes for ctime.
+//
+// To recognize this format:
+// 1. prefix[130] === ' ' or '\0'
+// 2. atime and ctime are octal numeric values
+// 3. atime and ctime have ' ' in their last byte
+
+var fieldEnds = {}
+ , fieldOffs = {}
+ , fe = 0
+for (var i = 0; i < f; i ++) {
+ fieldOffs[i] = fe
+ fieldEnds[i] = (fe += fieldSize[i])
+}
+
+// build a translation table of field paths.
+Object.keys(fields).forEach(function (f) {
+ if (fields[f] !== null) fields[fields[f]] = f
+})
+
+// different values of the 'type' field
+// paths match the values of Stats.isX() functions, where appropriate
+var types =
+ { 0: "File"
+ , "\0": "OldFile" // like 0
+ , "": "OldFile"
+ , 1: "Link"
+ , 2: "SymbolicLink"
+ , 3: "CharacterDevice"
+ , 4: "BlockDevice"
+ , 5: "Directory"
+ , 6: "FIFO"
+ , 7: "ContiguousFile" // like 0
+ // posix headers
+ , g: "GlobalExtendedHeader" // k=v for the rest of the archive
+ , x: "ExtendedHeader" // k=v for the next file
+ // vendor-specific stuff
+ , A: "SolarisACL" // skip
+ , D: "GNUDumpDir" // like 5, but with data, which should be skipped
+ , I: "Inode" // metadata only, skip
+ , K: "NextFileHasLongLinkpath" // data = link path of next file
+ , L: "NextFileHasLongPath" // data = path of next file
+ , M: "ContinuationFile" // skip
+ , N: "OldGnuLongPath" // like L
+ , S: "SparseFile" // skip
+ , V: "TapeVolumeHeader" // skip
+ , X: "OldExtendedHeader" // like x
+ }
+
+Object.keys(types).forEach(function (t) {
+ types[types[t]] = types[types[t]] || t
+})
+
+// values for the mode field
+var modes =
+ { suid: 04000 // set uid on extraction
+ , sgid: 02000 // set gid on extraction
+ , svtx: 01000 // set restricted deletion flag on dirs on extraction
+ , uread: 0400
+ , uwrite: 0200
+ , uexec: 0100
+ , gread: 040
+ , gwrite: 020
+ , gexec: 010
+ , oread: 4
+ , owrite: 2
+ , oexec: 1
+ , all: 07777
+ }
+
+var numeric =
+ { mode: true
+ , uid: true
+ , gid: true
+ , size: true
+ , mtime: true
+ , devmaj: true
+ , devmin: true
+ , cksum: true
+ , atime: true
+ , ctime: true
+ , dev: true
+ , ino: true
+ , nlink: true
+ }
+
+Object.keys(modes).forEach(function (t) {
+ modes[modes[t]] = modes[modes[t]] || t
+})
+
+var knownExtended =
+ { atime: true
+ , charset: true
+ , comment: true
+ , ctime: true
+ , gid: true
+ , gname: true
+ , linkpath: true
+ , mtime: true
+ , path: true
+ , realtime: true
+ , security: true
+ , size: true
+ , uid: true
+ , uname: true }
+
+
+exports.fields = fields
+exports.fieldSize = fieldSize
+exports.fieldOffs = fieldOffs
+exports.fieldEnds = fieldEnds
+exports.types = types
+exports.modes = modes
+exports.numeric = numeric
+exports.headerSize = headerSize
+exports.blockSize = blockSize
+exports.knownExtended = knownExtended
+
+exports.Pack = require("./lib/pack.js")
+exports.Parse = require("./lib/parse.js")
+exports.Extract = require("./lib/extract.js")
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js
new file mode 100644
index 0000000000..1524ff7af0
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js
@@ -0,0 +1,53 @@
+// the fixtures have some weird stuff that is painful
+// to include directly in the repo for various reasons.
+//
+// So, unpack the fixtures with the system tar first.
+//
+// This means, of course, that it'll only work if you
+// already have a tar implementation, and some of them
+// will not properly unpack the fixtures anyway.
+//
+// But, since usually those tests will fail on Windows
+// and other systems with less capable filesystems anyway,
+// at least this way we don't cause inconveniences by
+// merely cloning the repo or installing the package.
+
+var tap = require("tap")
+, child_process = require("child_process")
+, rimraf = require("rimraf")
+, test = tap.test
+, path = require("path")
+
+test("clean fixtures", function (t) {
+ rimraf(path.resolve(__dirname, "fixtures"), function (er) {
+ t.ifError(er, "rimraf ./fixtures/")
+ t.end()
+ })
+})
+
+test("clean tmp", function (t) {
+ rimraf(path.resolve(__dirname, "tmp"), function (er) {
+ t.ifError(er, "rimraf ./tmp/")
+ t.end()
+ })
+})
+
+test("extract fixtures", function (t) {
+ var c = child_process.spawn("tar"
+ ,["xzvf", "fixtures.tgz"]
+ ,{ cwd: __dirname })
+
+ c.stdout.on("data", errwrite)
+ c.stderr.on("data", errwrite)
+ function errwrite (chunk) {
+ process.stderr.write(chunk)
+ }
+
+ c.on("exit", function (code) {
+ t.equal(code, 0, "extract fixtures should exit with 0")
+ if (code) {
+ t.comment("Note, all tests from here on out will fail because of this.")
+ }
+ t.end()
+ })
+})
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js
new file mode 100644
index 0000000000..45400cd9bb
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js
@@ -0,0 +1,132 @@
+// Set the umask, so that it works the same everywhere.
+process.umask(parseInt('22', 8))
+
+var tap = require("tap")
+ , tar = require("../tar.js")
+ , fs = require("fs")
+ , gfs = require("graceful-fs")
+ , path = require("path")
+ , file = path.resolve(__dirname, "fixtures/dir.tar")
+ , target = path.resolve(__dirname, "tmp/extract-test")
+ , index = 0
+ , fstream = require("fstream")
+ , rimraf = require("rimraf")
+ , mkdirp = require("mkdirp")
+
+ , ee = 0
+ , expectEntries = [
+ {
+ "path" : "dir/",
+ "mode" : "750",
+ "type" : "5",
+ "depth" : undefined,
+ "size" : 0,
+ "linkpath" : "",
+ "nlink" : undefined,
+ "dev" : undefined,
+ "ino" : undefined
+ },
+ {
+ "path" : "dir/sub/",
+ "mode" : "750",
+ "type" : "5",
+ "depth" : undefined,
+ "size" : 0,
+ "linkpath" : "",
+ "nlink" : undefined,
+ "dev" : undefined,
+ "ino" : undefined
+ } ]
+
+function slow (fs, method, t1, t2) {
+ var orig = fs[method]
+ if (!orig) return null
+ fs[method] = function () {
+ var args = [].slice.call(arguments)
+ console.error("slow", method, args[0])
+ var cb = args.pop()
+
+ setTimeout(function () {
+ orig.apply(fs, args.concat(function(er, data) {
+ setTimeout(function() {
+ cb(er, data)
+ }, t2)
+ }))
+ }, t1)
+ }
+}
+
+// Make sure we get the graceful-fs that fstream is using.
+var gfs2
+try {
+ gfs2 = require("fstream/node_modules/graceful-fs")
+} catch (er) {}
+
+var slowMethods = ["chown", "chmod", "utimes", "lutimes"]
+slowMethods.forEach(function (method) {
+ var t1 = 500
+ var t2 = 0
+ slow(fs, method, t1, t2)
+ slow(gfs, method, t1, t2)
+ if (gfs2) {
+ slow(gfs2, method, t1, t2)
+ }
+})
+
+
+
+// The extract class basically just pipes the input
+// to a Reader, and then to a fstream.DirWriter
+
+// So, this is as much a test of fstream.Reader and fstream.Writer
+// as it is of tar.Extract, but it sort of makes sense.
+
+tap.test("preclean", function (t) {
+ rimraf.sync(target)
+ /mkdirp.sync(target)
+ t.pass("cleaned!")
+ t.end()
+})
+
+tap.test("extract test", function (t) {
+ var extract = tar.Extract(target)
+ var inp = fs.createReadStream(file)
+
+ // give it a weird buffer size to try to break in odd places
+ inp.bufferSize = 1234
+
+ inp.pipe(extract)
+
+ extract.on("end", function () {
+ rimraf.sync(target)
+
+ t.equal(ee, expectEntries.length, "should see "+ee+" entries")
+
+ // should get no more entries after end
+ extract.removeAllListeners("entry")
+ extract.on("entry", function (e) {
+ t.fail("Should not get entries after end!")
+ })
+
+ t.end()
+ })
+
+
+ extract.on("entry", function (entry) {
+ var found =
+ { path: entry.path
+ , mode: entry.props.mode.toString(8)
+ , type: entry.props.type
+ , depth: entry.props.depth
+ , size: entry.props.size
+ , linkpath: entry.props.linkpath
+ , nlink: entry.props.nlink
+ , dev: entry.props.dev
+ , ino: entry.props.ino
+ }
+
+ var wanted = expectEntries[ee ++]
+
+ t.equivalent(found, wanted, "tar entry " + ee + " " + wanted.path)
+ })
+})
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js
new file mode 100644
index 0000000000..eca4e7cc96
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js
@@ -0,0 +1,367 @@
+// Set the umask, so that it works the same everywhere.
+process.umask(parseInt('22', 8))
+
+var tap = require("tap")
+ , tar = require("../tar.js")
+ , fs = require("fs")
+ , path = require("path")
+ , file = path.resolve(__dirname, "fixtures/c.tar")
+ , target = path.resolve(__dirname, "tmp/extract-test")
+ , index = 0
+ , fstream = require("fstream")
+
+ , ee = 0
+ , expectEntries =
+[ { path: 'c.txt',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 513,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: 'cc.txt',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 513,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 100,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: 'Ω.txt',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 2,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: 'Ω.txt',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 2,
+ linkpath: '',
+ nlink: 1,
+ dev: 234881026,
+ ino: 51693379 },
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 200,
+ linkpath: '',
+ nlink: 1,
+ dev: 234881026,
+ ino: 51681874 },
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 201,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL',
+ mode: '777',
+ type: '2',
+ depth: undefined,
+ size: 0,
+ linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined },
+ { path: '200-hard',
+ mode: '644',
+ type: '0',
+ depth: undefined,
+ size: 200,
+ linkpath: '',
+ nlink: 2,
+ dev: 234881026,
+ ino: 51681874 },
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '644',
+ type: '1',
+ depth: undefined,
+ size: 0,
+ linkpath: path.resolve(target, '200-hard'),
+ nlink: 2,
+ dev: 234881026,
+ ino: 51681874 } ]
+
+ , ef = 0
+ , expectFiles =
+[ { path: '',
+ mode: '40755',
+ type: 'Directory',
+ depth: 0,
+ linkpath: undefined },
+ { path: '/200-hard',
+ mode: '100644',
+ type: 'File',
+ depth: 1,
+ size: 200,
+ linkpath: undefined,
+ nlink: 2 },
+ { path: '/200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL',
+ mode: '120777',
+ type: 'SymbolicLink',
+ depth: 1,
+ size: 200,
+ linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ nlink: 1 },
+ { path: '/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '100644',
+ type: 'Link',
+ depth: 1,
+ size: 200,
+ linkpath: path.join(target, '200-hard'),
+ nlink: 2 },
+ { path: '/c.txt',
+ mode: '100644',
+ type: 'File',
+ depth: 1,
+ size: 513,
+ linkpath: undefined,
+ nlink: 1 },
+ { path: '/cc.txt',
+ mode: '100644',
+ type: 'File',
+ depth: 1,
+ size: 513,
+ linkpath: undefined,
+ nlink: 1 },
+ { path: '/r',
+ mode: '40755',
+ type: 'Directory',
+ depth: 1,
+ linkpath: undefined },
+ { path: '/r/e',
+ mode: '40755',
+ type: 'Directory',
+ depth: 2,
+ linkpath: undefined },
+ { path: '/r/e/a',
+ mode: '40755',
+ type: 'Directory',
+ depth: 3,
+ linkpath: undefined },
+ { path: '/r/e/a/l',
+ mode: '40755',
+ type: 'Directory',
+ depth: 4,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l',
+ mode: '40755',
+ type: 'Directory',
+ depth: 5,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y',
+ mode: '40755',
+ type: 'Directory',
+ depth: 6,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-',
+ mode: '40755',
+ type: 'Directory',
+ depth: 7,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d',
+ mode: '40755',
+ type: 'Directory',
+ depth: 8,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e',
+ mode: '40755',
+ type: 'Directory',
+ depth: 9,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e',
+ mode: '40755',
+ type: 'Directory',
+ depth: 10,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p',
+ mode: '40755',
+ type: 'Directory',
+ depth: 11,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-',
+ mode: '40755',
+ type: 'Directory',
+ depth: 12,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f',
+ mode: '40755',
+ type: 'Directory',
+ depth: 13,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o',
+ mode: '40755',
+ type: 'Directory',
+ depth: 14,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l',
+ mode: '40755',
+ type: 'Directory',
+ depth: 15,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d',
+ mode: '40755',
+ type: 'Directory',
+ depth: 16,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e',
+ mode: '40755',
+ type: 'Directory',
+ depth: 17,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r',
+ mode: '40755',
+ type: 'Directory',
+ depth: 18,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-',
+ mode: '40755',
+ type: 'Directory',
+ depth: 19,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p',
+ mode: '40755',
+ type: 'Directory',
+ depth: 20,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a',
+ mode: '40755',
+ type: 'Directory',
+ depth: 21,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t',
+ mode: '40755',
+ type: 'Directory',
+ depth: 22,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h',
+ mode: '40755',
+ type: 'Directory',
+ depth: 23,
+ linkpath: undefined },
+ { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: '100644',
+ type: 'File',
+ depth: 24,
+ size: 100,
+ linkpath: undefined,
+ nlink: 1 },
+ { path: '/Ω.txt',
+ mode: '100644',
+ type: 'File',
+ depth: 1,
+ size: 2,
+ linkpath: undefined,
+ nlink: 1 } ]
+
+
+
+// The extract class basically just pipes the input
+// to a Reader, and then to a fstream.DirWriter
+
+// So, this is as much a test of fstream.Reader and fstream.Writer
+// as it is of tar.Extract, but it sort of makes sense.
+
+tap.test("preclean", function (t) {
+ require("rimraf").sync(__dirname + "/tmp/extract-test")
+ t.pass("cleaned!")
+ t.end()
+})
+
+tap.test("extract test", function (t) {
+ var extract = tar.Extract(target)
+ var inp = fs.createReadStream(file)
+
+ // give it a weird buffer size to try to break in odd places
+ inp.bufferSize = 1234
+
+ inp.pipe(extract)
+
+ extract.on("end", function () {
+ t.equal(ee, expectEntries.length, "should see "+ee+" entries")
+
+ // should get no more entries after end
+ extract.removeAllListeners("entry")
+ extract.on("entry", function (e) {
+ t.fail("Should not get entries after end!")
+ })
+
+ next()
+ })
+
+ extract.on("entry", function (entry) {
+ var found =
+ { path: entry.path
+ , mode: entry.props.mode.toString(8)
+ , type: entry.props.type
+ , depth: entry.props.depth
+ , size: entry.props.size
+ , linkpath: entry.props.linkpath
+ , nlink: entry.props.nlink
+ , dev: entry.props.dev
+ , ino: entry.props.ino
+ }
+
+ var wanted = expectEntries[ee ++]
+
+ t.equivalent(found, wanted, "tar entry " + ee + " " + wanted.path)
+ })
+
+ function next () {
+ var r = fstream.Reader({ path: target
+ , type: "Directory"
+ // this is just to encourage consistency
+ , sort: "alpha" })
+
+ r.on("ready", function () {
+ foundEntry(r)
+ })
+
+ r.on("end", finish)
+
+ function foundEntry (entry) {
+ var p = entry.path.substr(target.length)
+ var found =
+ { path: p
+ , mode: entry.props.mode.toString(8)
+ , type: entry.props.type
+ , depth: entry.props.depth
+ , size: entry.props.size
+ , linkpath: entry.props.linkpath
+ , nlink: entry.props.nlink
+ }
+
+ var wanted = expectFiles[ef ++]
+
+ t.has(found, wanted, "unpacked file " + ef + " " + wanted.path)
+
+ entry.on("entry", foundEntry)
+ }
+
+ function finish () {
+ t.equal(ef, expectFiles.length, "should have "+ef+" items")
+ t.end()
+ }
+ }
+})
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz b/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz
new file mode 100644
index 0000000000..f1676023af
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz
Binary files differ
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js
new file mode 100644
index 0000000000..8ea6f79500
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js
@@ -0,0 +1,183 @@
+var tap = require("tap")
+var TarHeader = require("../lib/header.js")
+var tar = require("../tar.js")
+var fs = require("fs")
+
+
+var headers =
+ { "a.txt file header":
+ [ "612e747874000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303430312031313635313336303333332030313234353100203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true
+ , path: 'a.txt'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 257
+ , mtime: 1319493851
+ , cksum: 5417
+ , type: '0'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' }
+ ]
+
+ , "omega pax": // the extended header from omega tar.
+ [ "5061784865616465722fcea92e74787400000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303137302031313534333731303631312030313530353100207800000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true
+ , path: 'PaxHeader/Ω.txt'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 120
+ , mtime: 1301254537
+ , cksum: 6697
+ , type: 'x'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' } ]
+
+ , "omega file header":
+ [ "cea92e7478740000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303030322031313534333731303631312030313330373200203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true
+ , path: 'Ω.txt'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 2
+ , mtime: 1301254537
+ , cksum: 5690
+ , type: '0'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' } ]
+
+ , "foo.js file header":
+ [ "666f6f2e6a730000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303030342031313534333637303734312030313236313700203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true
+ , path: 'foo.js'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 4
+ , mtime: 1301246433
+ , cksum: 5519
+ , type: '0'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' }
+ ]
+
+ , "b.txt file header":
+ [ "622e747874000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030313030302031313635313336303637372030313234363100203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true
+ , path: 'b.txt'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 512
+ , mtime: 1319494079
+ , cksum: 5425
+ , type: '0'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' }
+ ]
+
+ , "deep nested file":
+ [ "636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363633030303634342000303537373631200030303030323420003030303030303030313434203131363532313531353333203034333331340020300000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000075737461720030306973616163730000000000000000000000000000000000000000000000000000737461666600000000000000000000000000000000000000000000000000000030303030303020003030303030302000722f652f612f6c2f6c2f792f2d2f642f652f652f702f2d2f662f6f2f6c2f642f652f722f2d2f702f612f742f680000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000"
+ , { cksumValid: true,
+ path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc'
+ , mode: 420
+ , uid: 24561
+ , gid: 20
+ , size: 100
+ , mtime: 1319687003
+ , cksum: 18124
+ , type: '0'
+ , linkpath: ''
+ , ustar: 'ustar\0'
+ , ustarver: '00'
+ , uname: 'isaacs'
+ , gname: 'staff'
+ , devmaj: 0
+ , devmin: 0
+ , fill: '' }
+ ]
+ }
+
+tap.test("parsing", function (t) {
+ Object.keys(headers).forEach(function (name) {
+ var h = headers[name]
+ , header = new Buffer(h[0], "hex")
+ , expect = h[1]
+ , parsed = new TarHeader(header)
+
+ // console.error(parsed)
+ t.has(parsed, expect, "parse " + name)
+ })
+ t.end()
+})
+
+tap.test("encoding", function (t) {
+ Object.keys(headers).forEach(function (name) {
+ var h = headers[name]
+ , expect = new Buffer(h[0], "hex")
+ , encoded = TarHeader.encode(h[1])
+
+ // might have slightly different bytes, since the standard
+ // isn't very strict, but should have the same semantics
+ // checkSum will be different, but cksumValid will be true
+
+ var th = new TarHeader(encoded)
+ delete h[1].block
+ delete h[1].needExtended
+ delete h[1].cksum
+ t.has(th, h[1], "fields "+name)
+ })
+ t.end()
+})
+
+// test these manually. they're a bit rare to find in the wild
+tap.test("parseNumeric tests", function (t) {
+ var parseNumeric = TarHeader.parseNumeric
+ , numbers =
+ { "303737373737373700": 2097151
+ , "30373737373737373737373700": 8589934591
+ , "303030303036343400": 420
+ , "800000ffffffffffff": 281474976710655
+ , "ffffff000000000001": -281474976710654
+ , "ffffff000000000000": -281474976710655
+ , "800000000000200000": 2097152
+ , "8000000000001544c5": 1393861
+ , "ffffffffffff1544c5": -15383354 }
+ Object.keys(numbers).forEach(function (n) {
+ var b = new Buffer(n, "hex")
+ t.equal(parseNumeric(b), numbers[n], n + " === " + numbers[n])
+ })
+ t.end()
+})
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js
new file mode 100644
index 0000000000..d4b03a1fe9
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js
@@ -0,0 +1,886 @@
+// This is exactly like test/pack.js, except that it's excluding
+// any proprietary headers.
+//
+// This loses some information about the filesystem, but creates
+// tarballs that are supported by more versions of tar, especially
+// old non-spec-compliant copies of gnutar.
+
+// the symlink file is excluded from git, because it makes
+// windows freak the hell out.
+var fs = require("fs")
+ , path = require("path")
+ , symlink = path.resolve(__dirname, "fixtures/symlink")
+try { fs.unlinkSync(symlink) } catch (e) {}
+fs.symlinkSync("./hardlink-1", symlink)
+process.on("exit", function () {
+ fs.unlinkSync(symlink)
+})
+
+var tap = require("tap")
+ , tar = require("../tar.js")
+ , pkg = require("../package.json")
+ , Pack = tar.Pack
+ , fstream = require("fstream")
+ , Reader = fstream.Reader
+ , Writer = fstream.Writer
+ , input = path.resolve(__dirname, "fixtures/")
+ , target = path.resolve(__dirname, "tmp/pack.tar")
+ , uid = process.getuid ? process.getuid() : 0
+ , gid = process.getgid ? process.getgid() : 0
+
+ , entries =
+
+ // the global header and root fixtures/ dir are going to get
+ // a different date each time, so omit that bit.
+ // Also, dev/ino values differ across machines, so that's not
+ // included.
+ [ [ 'entry',
+ { path: 'fixtures/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/200cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ uid: uid,
+ gid: gid,
+ size: 200 } ]
+
+ , [ 'entry',
+ { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 200,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/a.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 257,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/b.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 512,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/c.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 513,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/cc.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 513,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/dir/',
+ mode: 488,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/dir/sub/',
+ mode: 488,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/foo.js',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 4,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/hardlink-1',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 200,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/hardlink-2',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '1',
+ linkpath: 'fixtures/hardlink-1',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/omega.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/omega.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/star.4.html',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 54081,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/packtest/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: 'fixtures/packtest/Ω.txt',
+ uid: uid,
+ gid: gid,
+ size: 2 } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 100,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/symlink',
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '2',
+ linkpath: 'hardlink-1',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: "fixtures/Ω.txt"
+ , uid: uid
+ , gid: gid
+ , size: 2 } ]
+
+ , [ 'entry',
+ { path: 'fixtures/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+ ]
+
+
+// first, make sure that the hardlinks are actually hardlinks, or this
+// won't work. Git has a way of replacing them with a copy.
+var hard1 = path.resolve(__dirname, "fixtures/hardlink-1")
+ , hard2 = path.resolve(__dirname, "fixtures/hardlink-2")
+ , fs = require("fs")
+
+try { fs.unlinkSync(hard2) } catch (e) {}
+fs.linkSync(hard1, hard2)
+
+tap.test("with global header", { timeout: 10000 }, function (t) {
+ runTest(t, true)
+})
+
+tap.test("without global header", { timeout: 10000 }, function (t) {
+ runTest(t, false)
+})
+
+function alphasort (a, b) {
+ return a === b ? 0
+ : a.toLowerCase() > b.toLowerCase() ? 1
+ : a.toLowerCase() < b.toLowerCase() ? -1
+ : a > b ? 1
+ : -1
+}
+
+
+function runTest (t, doGH) {
+ var reader = Reader({ path: input
+ , filter: function () {
+ return !this.path.match(/\.(tar|hex)$/)
+ }
+ , sort: alphasort
+ })
+
+ var props = doGH ? pkg : {}
+ props.noProprietary = true
+ var pack = Pack(props)
+ var writer = Writer(target)
+
+ // global header should be skipped regardless, since it has no content.
+ var entry = 0
+
+ t.ok(reader, "reader ok")
+ t.ok(pack, "pack ok")
+ t.ok(writer, "writer ok")
+
+ pack.pipe(writer)
+
+ var parse = tar.Parse()
+ t.ok(parse, "parser should be ok")
+
+ pack.on("data", function (c) {
+ // console.error("PACK DATA")
+ if (c.length !== 512) {
+ // this one is too noisy, only assert if it'll be relevant
+ t.equal(c.length, 512, "parser should emit data in 512byte blocks")
+ }
+ parse.write(c)
+ })
+
+ pack.on("end", function () {
+ // console.error("PACK END")
+ t.pass("parser ends")
+ parse.end()
+ })
+
+ pack.on("error", function (er) {
+ t.fail("pack error", er)
+ })
+
+ parse.on("error", function (er) {
+ t.fail("parse error", er)
+ })
+
+ writer.on("error", function (er) {
+ t.fail("writer error", er)
+ })
+
+ reader.on("error", function (er) {
+ t.fail("reader error", er)
+ })
+
+ parse.on("*", function (ev, e) {
+ var wanted = entries[entry++]
+ if (!wanted) {
+ t.fail("unexpected event: "+ev)
+ return
+ }
+ t.equal(ev, wanted[0], "event type should be "+wanted[0])
+
+ if (ev !== wanted[0] || e.path !== wanted[1].path) {
+ console.error("wanted", wanted)
+ console.error([ev, e.props])
+ e.on("end", function () {
+ console.error(e.fields)
+ throw "break"
+ })
+ }
+
+ t.has(e.props, wanted[1], "properties "+wanted[1].path)
+ if (wanted[2]) {
+ e.on("end", function () {
+ if (!e.fields) {
+ t.ok(e.fields, "should get fields")
+ } else {
+ t.has(e.fields, wanted[2], "should get expected fields")
+ }
+ })
+ }
+ })
+
+ reader.pipe(pack)
+
+ writer.on("close", function () {
+ t.equal(entry, entries.length, "should get all expected entries")
+ t.pass("it finished")
+ t.end()
+ })
+
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js
new file mode 100644
index 0000000000..bf033c1298
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js
@@ -0,0 +1,934 @@
+
+// the symlink file is excluded from git, because it makes
+// windows freak the hell out.
+var fs = require("fs")
+ , path = require("path")
+ , symlink = path.resolve(__dirname, "fixtures/symlink")
+try { fs.unlinkSync(symlink) } catch (e) {}
+fs.symlinkSync("./hardlink-1", symlink)
+process.on("exit", function () {
+ fs.unlinkSync(symlink)
+})
+
+
+var tap = require("tap")
+ , tar = require("../tar.js")
+ , pkg = require("../package.json")
+ , Pack = tar.Pack
+ , fstream = require("fstream")
+ , Reader = fstream.Reader
+ , Writer = fstream.Writer
+ , input = path.resolve(__dirname, "fixtures/")
+ , target = path.resolve(__dirname, "tmp/pack.tar")
+ , uid = process.getuid ? process.getuid() : 0
+ , gid = process.getgid ? process.getgid() : 0
+
+ , entries =
+
+ // the global header and root fixtures/ dir are going to get
+ // a different date each time, so omit that bit.
+ // Also, dev/ino values differ across machines, so that's not
+ // included.
+ [ [ 'globalExtendedHeader',
+ { path: 'PaxHeader/',
+ mode: 438,
+ uid: 0,
+ gid: 0,
+ type: 'g',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { "NODETAR.author": pkg.author,
+ "NODETAR.name": pkg.name,
+ "NODETAR.description": pkg.description,
+ "NODETAR.version": pkg.version,
+ "NODETAR.repository.type": pkg.repository.type,
+ "NODETAR.repository.url": pkg.repository.url,
+ "NODETAR.main": pkg.main,
+ "NODETAR.scripts.test": pkg.scripts.test } ]
+
+ , [ 'entry',
+ { path: 'fixtures/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/200cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ 'NODETAR.depth': '1',
+ 'NODETAR.type': 'File',
+ nlink: 1,
+ uid: uid,
+ gid: gid,
+ size: 200,
+ 'NODETAR.blksize': '4096',
+ 'NODETAR.blocks': '8' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 200,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ 'NODETAR.depth': '1',
+ 'NODETAR.type': 'File',
+ nlink: 1,
+ 'NODETAR.blksize': '4096',
+ 'NODETAR.blocks': '8' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/a.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 257,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/b.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 512,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/c.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 513,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/cc.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 513,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/dir/',
+ mode: 488,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/dir/sub/',
+ mode: 488,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+
+ , [ 'entry',
+ { path: 'fixtures/foo.js',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 4,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/hardlink-1',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 200,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/hardlink-2',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '1',
+ linkpath: 'fixtures/hardlink-1',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/omega.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/omega.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/star.4.html',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 54081,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/packtest/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: 'fixtures/packtest/Ω.txt',
+ 'NODETAR.depth': '2',
+ 'NODETAR.type': 'File',
+ nlink: 1,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ 'NODETAR.blksize': '4096',
+ 'NODETAR.blocks': '8' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/packtest/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ 'NODETAR.depth': '2',
+ 'NODETAR.type': 'File',
+ nlink: 1,
+ 'NODETAR.blksize': '4096',
+ 'NODETAR.blocks': '8' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/',
+ mode: 493,
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '5',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 100,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'entry',
+ { path: 'fixtures/symlink',
+ uid: uid,
+ gid: gid,
+ size: 0,
+ type: '2',
+ linkpath: 'hardlink-1',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' } ]
+
+ , [ 'extendedHeader',
+ { path: 'PaxHeader/fixtures/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: "fixtures/Ω.txt"
+ , "NODETAR.depth": "1"
+ , "NODETAR.type": "File"
+ , nlink: 1
+ , uid: uid
+ , gid: gid
+ , size: 2
+ , "NODETAR.blksize": "4096"
+ , "NODETAR.blocks": "8" } ]
+
+ , [ 'entry',
+ { path: 'fixtures/Ω.txt',
+ mode: 420,
+ uid: uid,
+ gid: gid,
+ size: 2,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\u0000',
+ ustarver: '00',
+ uname: '',
+ gname: '',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ 'NODETAR.depth': '1',
+ 'NODETAR.type': 'File',
+ nlink: 1,
+ 'NODETAR.blksize': '4096',
+ 'NODETAR.blocks': '8' } ]
+ ]
+
+
+// first, make sure that the hardlinks are actually hardlinks, or this
+// won't work. Git has a way of replacing them with a copy.
+var hard1 = path.resolve(__dirname, "fixtures/hardlink-1")
+ , hard2 = path.resolve(__dirname, "fixtures/hardlink-2")
+ , fs = require("fs")
+
+try { fs.unlinkSync(hard2) } catch (e) {}
+fs.linkSync(hard1, hard2)
+
+tap.test("with global header", { timeout: 10000 }, function (t) {
+ runTest(t, true)
+})
+
+tap.test("without global header", { timeout: 10000 }, function (t) {
+ runTest(t, false)
+})
+
+function alphasort (a, b) {
+ return a === b ? 0
+ : a.toLowerCase() > b.toLowerCase() ? 1
+ : a.toLowerCase() < b.toLowerCase() ? -1
+ : a > b ? 1
+ : -1
+}
+
+
+function runTest (t, doGH) {
+ var reader = Reader({ path: input
+ , filter: function () {
+ return !this.path.match(/\.(tar|hex)$/)
+ }
+ , sort: alphasort
+ })
+
+ var pack = Pack(doGH ? pkg : null)
+ var writer = Writer(target)
+
+ // skip the global header if we're not doing that.
+ var entry = doGH ? 0 : 1
+
+ t.ok(reader, "reader ok")
+ t.ok(pack, "pack ok")
+ t.ok(writer, "writer ok")
+
+ pack.pipe(writer)
+
+ var parse = tar.Parse()
+ t.ok(parse, "parser should be ok")
+
+ pack.on("data", function (c) {
+ // console.error("PACK DATA")
+ if (c.length !== 512) {
+ // this one is too noisy, only assert if it'll be relevant
+ t.equal(c.length, 512, "parser should emit data in 512byte blocks")
+ }
+ parse.write(c)
+ })
+
+ pack.on("end", function () {
+ // console.error("PACK END")
+ t.pass("parser ends")
+ parse.end()
+ })
+
+ pack.on("error", function (er) {
+ t.fail("pack error", er)
+ })
+
+ parse.on("error", function (er) {
+ t.fail("parse error", er)
+ })
+
+ writer.on("error", function (er) {
+ t.fail("writer error", er)
+ })
+
+ reader.on("error", function (er) {
+ t.fail("reader error", er)
+ })
+
+ parse.on("*", function (ev, e) {
+ var wanted = entries[entry++]
+ if (!wanted) {
+ t.fail("unexpected event: "+ev)
+ return
+ }
+ t.equal(ev, wanted[0], "event type should be "+wanted[0])
+
+ if (ev !== wanted[0] || e.path !== wanted[1].path) {
+ console.error("wanted", wanted)
+ console.error([ev, e.props])
+ e.on("end", function () {
+ console.error(e.fields)
+ throw "break"
+ })
+ }
+
+
+ t.has(e.props, wanted[1], "properties "+wanted[1].path)
+ if (wanted[2]) {
+ e.on("end", function () {
+ if (!e.fields) {
+ t.ok(e.fields, "should get fields")
+ } else {
+ t.has(e.fields, wanted[2], "should get expected fields")
+ }
+ })
+ }
+ })
+
+ reader.pipe(pack)
+
+ writer.on("close", function () {
+ t.equal(entry, entries.length, "should get all expected entries")
+ t.pass("it finished")
+ t.end()
+ })
+
+}
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js
new file mode 100644
index 0000000000..f765a50129
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js
@@ -0,0 +1,359 @@
+var tap = require("tap")
+ , tar = require("../tar.js")
+ , fs = require("fs")
+ , path = require("path")
+ , file = path.resolve(__dirname, "fixtures/c.tar")
+ , index = 0
+
+ , expect =
+[ [ 'entry',
+ { path: 'c.txt',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 513,
+ mtime: new Date('Wed, 26 Oct 2011 01:10:58 GMT'),
+ cksum: 5422,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ undefined ],
+ [ 'entry',
+ { path: 'cc.txt',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 513,
+ mtime: new Date('Wed, 26 Oct 2011 01:11:02 GMT'),
+ cksum: 5525,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ undefined ],
+ [ 'entry',
+ { path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 100,
+ mtime: new Date('Thu, 27 Oct 2011 03:43:23 GMT'),
+ cksum: 18124,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ undefined ],
+ [ 'entry',
+ { path: 'Ω.txt',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 2,
+ mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'),
+ cksum: 5695,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ undefined ],
+ [ 'extendedHeader',
+ { path: 'PaxHeader/Ω.txt',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 120,
+ mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'),
+ cksum: 6702,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: 'Ω.txt',
+ ctime: 1319737909,
+ atime: 1319739061,
+ dev: 234881026,
+ ino: 51693379,
+ nlink: 1 } ],
+ [ 'entry',
+ { path: 'Ω.txt',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 2,
+ mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'),
+ cksum: 5695,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ ctime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'),
+ atime: new Date('Thu, 27 Oct 2011 18:11:01 GMT'),
+ dev: 234881026,
+ ino: 51693379,
+ nlink: 1 },
+ undefined ],
+ [ 'extendedHeader',
+ { path: 'PaxHeader/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 353,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 14488,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ ctime: 1319686868,
+ atime: 1319741254,
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 1 } ],
+ [ 'entry',
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 200,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 14570,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ ctime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ atime: new Date('Thu, 27 Oct 2011 18:47:34 GMT'),
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 1 },
+ undefined ],
+ [ 'longPath',
+ { path: '././@LongLink',
+ mode: 0,
+ uid: 0,
+ gid: 0,
+ size: 201,
+ mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'),
+ cksum: 4976,
+ type: 'L',
+ linkpath: '',
+ ustar: false },
+ '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc' ],
+ [ 'entry',
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 1000,
+ gid: 1000,
+ size: 201,
+ mtime: new Date('Thu, 27 Oct 2011 22:21:50 GMT'),
+ cksum: 14086,
+ type: '0',
+ linkpath: '',
+ ustar: false },
+ undefined ],
+ [ 'longLinkpath',
+ { path: '././@LongLink',
+ mode: 0,
+ uid: 0,
+ gid: 0,
+ size: 201,
+ mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'),
+ cksum: 4975,
+ type: 'K',
+ linkpath: '',
+ ustar: false },
+ '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc' ],
+ [ 'longPath',
+ { path: '././@LongLink',
+ mode: 0,
+ uid: 0,
+ gid: 0,
+ size: 201,
+ mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'),
+ cksum: 4976,
+ type: 'L',
+ linkpath: '',
+ ustar: false },
+ '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL' ],
+ [ 'entry',
+ { path: '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL',
+ mode: 511,
+ uid: 1000,
+ gid: 1000,
+ size: 0,
+ mtime: new Date('Fri, 28 Oct 2011 23:05:17 GMT'),
+ cksum: 21603,
+ type: '2',
+ linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ ustar: false },
+ undefined ],
+ [ 'extendedHeader',
+ { path: 'PaxHeader/200-hard',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 143,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 6533,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { ctime: 1320617144,
+ atime: 1320617232,
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 2 } ],
+ [ 'entry',
+ { path: '200-hard',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 200,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 5526,
+ type: '0',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ ctime: new Date('Sun, 06 Nov 2011 22:05:44 GMT'),
+ atime: new Date('Sun, 06 Nov 2011 22:07:12 GMT'),
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 2 },
+ undefined ],
+ [ 'extendedHeader',
+ { path: 'PaxHeader/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 353,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 14488,
+ type: 'x',
+ linkpath: '',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '' },
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ ctime: 1320617144,
+ atime: 1320617406,
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 2 } ],
+ [ 'entry',
+ { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc',
+ mode: 420,
+ uid: 24561,
+ gid: 20,
+ size: 0,
+ mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'),
+ cksum: 15173,
+ type: '1',
+ linkpath: '200-hard',
+ ustar: 'ustar\0',
+ ustarver: '00',
+ uname: 'isaacs',
+ gname: 'staff',
+ devmaj: 0,
+ devmin: 0,
+ fill: '',
+ ctime: new Date('Sun, 06 Nov 2011 22:05:44 GMT'),
+ atime: new Date('Sun, 06 Nov 2011 22:10:06 GMT'),
+ 'LIBARCHIVE.creationtime': '1319686852',
+ dev: 234881026,
+ ino: 51681874,
+ nlink: 2 },
+ undefined ] ]
+
+
+tap.test("parser test", function (t) {
+ var parser = tar.Parse()
+
+ parser.on("end", function () {
+ t.equal(index, expect.length, "saw all expected events")
+ t.end()
+ })
+
+ fs.createReadStream(file)
+ .pipe(parser)
+ .on("*", function (ev, entry) {
+ var wanted = expect[index]
+ if (!wanted) {
+ return t.fail("Unexpected event: " + ev)
+ }
+ var result = [ev, entry.props]
+ entry.on("end", function () {
+ result.push(entry.fields || entry.body)
+
+ t.equal(ev, wanted[0], index + " event type")
+ t.equivalent(entry.props, wanted[1], wanted[1].path + " entry properties")
+ if (wanted[2]) {
+ t.equivalent(result[2], wanted[2], "metadata values")
+ }
+ index ++
+ })
+ })
+})
diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js
new file mode 100644
index 0000000000..a00ff7faa0
--- /dev/null
+++ b/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js
@@ -0,0 +1,20 @@
+// clean up the fixtures
+
+var tap = require("tap")
+, rimraf = require("rimraf")
+, test = tap.test
+, path = require("path")
+
+test("clean fixtures", function (t) {
+ rimraf(path.resolve(__dirname, "fixtures"), function (er) {
+ t.ifError(er, "rimraf ./fixtures/")
+ t.end()
+ })
+})
+
+test("clean tmp", function (t) {
+ rimraf(path.resolve(__dirname, "tmp"), function (er) {
+ t.ifError(er, "rimraf ./tmp/")
+ t.end()
+ })
+})
diff --git a/deps/npm/node_modules/node-gyp/package.json b/deps/npm/node_modules/node-gyp/package.json
index 8b092ddca3..6015fe750a 100644
--- a/deps/npm/node_modules/node-gyp/package.json
+++ b/deps/npm/node_modules/node-gyp/package.json
@@ -77,6 +77,5 @@
"tarball": "http://registry.npmjs.org/node-gyp/-/node-gyp-1.0.3.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-1.0.3.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-1.0.3.tgz"
}
diff --git a/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c b/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c
deleted file mode 100644
index 05c4c39887..0000000000
--- a/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c
+++ /dev/null
@@ -1,32 +0,0 @@
-/*
- * When this file is linked to a DLL, it sets up a delay-load hook that
- * intervenes when the DLL is trying to load 'node.exe' or 'iojs.exe'
- * dynamically. Instead of trying to locate the .exe file it'll just return
- * a handle to the process image.
- *
- * This allows compiled addons to work when node.exe or iojs.exe is renamed.
- */
-
-#ifdef _MSC_VER
-
-#define WIN32_LEAN_AND_MEAN
-#include <windows.h>
-
-#include <delayimp.h>
-#include <string.h>
-
-static FARPROC WINAPI load_exe_hook(unsigned int event, DelayLoadInfo* info) {
- if (event != dliNotePreLoadLibrary)
- return NULL;
-
- if (_stricmp(info->szDll, "iojs.exe") != 0 &&
- _stricmp(info->szDll, "node.exe") != 0)
- return NULL;
-
- HMODULE m = GetModuleHandle(NULL);
- return (FARPROC) m;
-}
-
-PfnDliHook __pfnDliNotifyHook2 = load_exe_hook;
-
-#endif
diff --git a/deps/npm/node_modules/normalize-git-url/.eslintrc b/deps/npm/node_modules/normalize-git-url/.eslintrc
deleted file mode 100644
index b54e30fd2a..0000000000
--- a/deps/npm/node_modules/normalize-git-url/.eslintrc
+++ /dev/null
@@ -1,19 +0,0 @@
-{
- "env" : {
- "node" : true
- },
- "rules" : {
- "semi": [2, "never"],
- "strict": 0,
- "quotes": [1, "double", "avoid-escape"],
- "no-use-before-define": 0,
- "curly": 0,
- "no-underscore-dangle": 0,
- "no-lonely-if": 1,
- "no-unused-vars": [2, {"vars" : "all", "args" : "after-used"}],
- "no-mixed-requires": 0,
- "space-infix-ops": 0,
- "key-spacing": 0,
- "no-multi-spaces": 0
- }
-}
diff --git a/deps/npm/node_modules/npm-registry-client/test/fixtures/@npm/npm-registry-client/cache.json b/deps/npm/node_modules/npm-registry-client/test/fixtures/@npm/npm-registry-client/cache.json
deleted file mode 100644
index 4561db502b..0000000000
--- a/deps/npm/node_modules/npm-registry-client/test/fixtures/@npm/npm-registry-client/cache.json
+++ /dev/null
@@ -1 +0,0 @@
-{"_id":"@npm%2fnpm-registry-client","_rev":"213-0a1049cf56172b7d9a1184742c6477b9","name":"@npm/npm-registry-client","description":"Client for the npm registry","dist-tags":{"latest":"2.0.4","v2.0":"2.0.3"},"versions":{"0.0.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_npmUser":{"name":"isaacs","email":"i@izs.me"},"_id":"@npm%2fnpm-registry-client@0.0.1","_engineSupported":true,"_npmVersion":"1.1.24","_nodeVersion":"v0.7.10-pre","_defaultsLoaded":true,"dist":{"shasum":"693a08f6d2faea22bbd2bf412508a63d3e6229a7","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.1.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_npmUser":{"name":"isaacs","email":"i@izs.me"},"_id":"@npm%2fnpm-registry-client@0.0.2","_engineSupported":true,"_npmVersion":"1.1.24","_nodeVersion":"v0.7.10-pre","_defaultsLoaded":true,"dist":{"shasum":"b48c0ec5563c6a6fdc253454fc56d2c60c5a26f4","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.2.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_npmUser":{"name":"isaacs","email":"i@izs.me"},"_id":"@npm%2fnpm-registry-client@0.0.3","_engineSupported":true,"_npmVersion":"1.1.24","_nodeVersion":"v0.7.10-pre","_defaultsLoaded":true,"dist":{"shasum":"ccc0254c2d59e3ea9b9050e2b16edef78df1a1e8","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.3.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_npmUser":{"name":"isaacs","email":"i@izs.me"},"_id":"@npm%2fnpm-registry-client@0.0.4","_engineSupported":true,"_npmVersion":"1.1.25","_nodeVersion":"v0.7.10-pre","_defaultsLoaded":true,"dist":{"shasum":"faabd25ef477521c74ac21e0f4cf3a2f66d18fb3","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.4.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.5":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.5","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_id":"@npm%2fnpm-registry-client@0.0.5","dist":{"shasum":"85219810c9d89ae8d28ea766e7cf74efbd9f1e52","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.5.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.6":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"The code that npm uses to talk to the registry","version":"0.0.6","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_id":"@npm%2fnpm-registry-client@0.0.6","dist":{"shasum":"cc6533b3b41df65e6e9db2601fbbf1a509a7e94c","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.6.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.7":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"The code that npm uses to talk to the registry","version":"0.0.7","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"engines":{"node":"*"},"_id":"@npm%2fnpm-registry-client@0.0.7","dist":{"shasum":"0cee1d1c61f1c8e483774fe1f7bbb81c4f394a3a","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.7.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.8":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.8","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.0.8","dist":{"shasum":"1b7411c3f7310ec2a96b055b00e7ca606e47bd07","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.8.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.9":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.9","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.0.9","dist":{"shasum":"6d5bfde431559ac9e2e52a7db85f5839b874f022","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.9.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.10":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.10","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.0.10","dist":{"shasum":"0c8b6a4615bce82aa6cc04a0d1f7dc89921f7a38","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.10.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.0.11":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.0.11","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.0.11","dist":{"shasum":"afab40be5bed1faa946d8e1827844698f2ec1db7","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.0.11.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.1.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.1.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.1.0","dist":{"shasum":"1077d6bbb5e432450239dc6622a59474953ffbea","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.1.0.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.1.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.1.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.1.1","dist":{"shasum":"759765361d09b715270f59cf50f10908e4e9c5fc","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.1.1.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.1.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.1.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.1.2","dist":{"shasum":"541ce93abb3d35f5c325545c718dd3bbeaaa9ff0","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.1.2.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.1.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.1.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.1.3","dist":{"shasum":"e9a40d7031e8f809af5fd85aa9aac979e17efc97","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.1.3.tgz"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.1.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.1.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.1.4","dist":{"shasum":"b211485b046191a1085362376530316f0cab0420","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.1.4.tgz"},"_npmVersion":"1.1.48","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.0","dist":{"shasum":"6508a4b4d96f31057d5200ca5779531bafd2b840","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.0.tgz"},"_npmVersion":"1.1.49","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"node-uuid":"~1.3.3","request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.1","dist":{"shasum":"1bc8c4576c368cd88253d8a52daf40c55b89bb1a","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.1.tgz"},"_npmVersion":"1.1.49","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.5":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.5","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.5","dist":{"shasum":"2f55d675dfb977403b1ad0d96874c1d30e8058d7","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.5.tgz"},"_npmVersion":"1.1.51","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.6":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.6","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.6","dist":{"shasum":"f05df6695360360ad220e6e13a6a7bace7165fbe","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.6.tgz"},"_npmVersion":"1.1.56","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.7":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.7","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.0.14","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.7","dist":{"shasum":"867bad8854cae82ed89ee3b7f1d391af59491671","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.7.tgz"},"_npmVersion":"1.1.59","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.8":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.8","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.6","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.8","dist":{"shasum":"ef194cdb70f1ea03a576cff2c97392fa96e36563","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.8.tgz"},"_npmVersion":"1.1.62","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.9":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.9","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.9","dist":{"shasum":"3cec10431dfed1594adaf99c50f482ee56ecf9e4","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.9.tgz"},"_npmVersion":"1.1.59","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.10":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.10","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2.0.1","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.10","dist":{"shasum":"1e69726dae0944e78562fd77243f839c6a2ced1e","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.10.tgz"},"_npmVersion":"1.1.64","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.11":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.11","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.11","dist":{"shasum":"d92f33c297eb1bbd57fd597c3d8f5f7e9340a0b5","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.11.tgz"},"_npmVersion":"1.1.70","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.12":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.12","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.1.8","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.12","dist":{"shasum":"3bfb6fc0e4b131d665580cd1481c341fe521bfd3","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.12.tgz"},"_from":".","_npmVersion":"1.2.2","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.13":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.13","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.13","dist":{"shasum":"e03f2a4340065511b7184a3e2862cd5d459ef027","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.13.tgz"},"_from":".","_npmVersion":"1.2.4","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.14":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.14","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.14","dist":{"shasum":"186874a7790417a340d582b1cd4a7c338087ee12","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.14.tgz"},"_from":".","_npmVersion":"1.2.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.15":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.15","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.15","dist":{"shasum":"f71f32b7185855f1f8b7a5ef49e49d2357c2c552","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.15.tgz"},"_from":".","_npmVersion":"1.2.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.16":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.16","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.16","dist":{"shasum":"3331323b5050fc5afdf77c3a35913c16f3e43964","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.16.tgz"},"_from":".","_npmVersion":"1.2.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.17":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.17","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.17","dist":{"shasum":"1df2bbecac6751f5d9600fb43722aef96d956773","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.17.tgz"},"_from":".","_npmVersion":"1.2.11","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.18":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.18","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.9.202","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.18","dist":{"shasum":"198c8d15ed9b1ed546faf6e431eb63a6b18193ad","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.18.tgz"},"_from":".","_npmVersion":"1.2.13","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.19":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.19","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.16","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.19","dist":{"shasum":"106da826f0d2007f6e081f2b68fb6f26fa951b20","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.19.tgz"},"_from":".","_npmVersion":"1.2.14","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.20":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.20","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.16","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","_id":"@npm%2fnpm-registry-client@0.2.20","dist":{"shasum":"3fff194331e26660be2cf8ebf45ddf7d36add5f6","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.20.tgz"},"_from":".","_npmVersion":"1.2.15","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.21":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.21","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.16","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.21","dist":{"shasum":"d85dd32525f193925c46ff9eb0e0f529dfd1b254","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.21.tgz"},"_from":".","_npmVersion":"1.2.18","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.22":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.22","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"~2.20.0","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.22","dist":{"shasum":"caa22ff40a1ccd632a660b8b80c333c8f92d5a17","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.22.tgz"},"_from":".","_npmVersion":"1.2.18","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.23":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.23","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.20.0","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.23","dist":{"shasum":"a320ab2b1d048b4f7b88e40bd86974ca322b4c24","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.23.tgz"},"_from":".","_npmVersion":"1.2.19","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.24":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.24","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.20.0","graceful-fs":"~1.2.0","semver":"~1.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.24","dist":{"shasum":"e12f644338619319ee7f233363a1714a87f3c72d","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.24.tgz"},"_from":".","_npmVersion":"1.2.22","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.25":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.25","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.20.0","graceful-fs":"~1.2.0","semver":"~2.0.5","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.25","dist":{"shasum":"c2caeb1dcf937d6fcc4a187765d401f5e2f54027","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.25.tgz"},"_from":".","_npmVersion":"1.2.32","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.26":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.26","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.20.0","graceful-fs":"~1.2.0","semver":"~2.0.5","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.26","dist":{"shasum":"4c5a2b3de946e383032f10fa497d0c15ee5f4c60","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.26.tgz"},"_from":".","_npmVersion":"1.3.1","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.27":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.27","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.20.0","graceful-fs":"~2.0.0","semver":"~2.0.5","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.15","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.27","dist":{"shasum":"8f338189d32769267886a07ad7b7fd2267446adf","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.27.tgz"},"_from":".","_npmVersion":"1.3.2","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.28":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.28","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"~2.1.0","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"_id":"@npm%2fnpm-registry-client@0.2.28","dist":{"shasum":"959141fc0180d7b1ad089e87015a8a2142a8bffc","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.28.tgz"},"_from":".","_npmVersion":"1.3.6","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.29":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.29","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.2.29","dist":{"shasum":"66ff2766f0c61d41e8a6139d3692d8833002c686","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.29.tgz"},"_from":".","_npmVersion":"1.3.12","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.30":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.30","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.2.30","dist":{"shasum":"f01cae5c51aa0a1c5dc2516cbad3ebde068d3eaa","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.30.tgz"},"_from":".","_npmVersion":"1.3.14","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.2.31":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.2.31","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.2.31","dist":{"shasum":"24a23e24e43246677cb485f8391829e9536563d4","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.2.31.tgz"},"_from":".","_npmVersion":"1.3.17","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.0","dist":{"shasum":"66eab02a69be67f232ac14023eddfb8308c2eccd","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.0.tgz"},"_from":".","_npmVersion":"1.3.18","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.1","dist":{"shasum":"16dba07cc304442edcece378218672d0a1258ef8","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.1.tgz"},"_from":".","_npmVersion":"1.3.18","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.2","dist":{"shasum":"ea3060bd0a87fb1d97b87433b50f38f7272b1686","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.2.tgz"},"_from":".","_npmVersion":"1.3.20","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.3","dist":{"shasum":"da08bb681fb24aa5c988ca71f8c10f27f09daf4a","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.3.tgz"},"_from":".","_npmVersion":"1.3.21","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.4","dist":{"shasum":"25d771771590b1ca39277aea4506af234c5f4342","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.4.tgz"},"_from":".","_npmVersion":"1.3.25","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.5":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.5","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","couch-login":"~0.1.18","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.5","dist":{"shasum":"98ba1ac851a3939a3fb9917c28fa8da522dc635f","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.5.tgz"},"_from":".","_npmVersion":"1.3.25","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.3.6":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.3.6","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.3.6","dist":{"shasum":"c48a2a03643769acc49672860f7920ec6bffac6e","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.3.6.tgz"},"_from":".","_npmVersion":"1.3.26","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.0","dist":{"shasum":"30d0c178b7f2e54183a6a3fc9fe4071eb10290bf","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.0.tgz"},"_from":".","_npmVersion":"1.3.26","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.1","dist":{"shasum":"9c49b3e44558e2072158fb085be8a083c5f83537","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.1.tgz"},"_from":".","_npmVersion":"1.4.0","_npmUser":{"name":"npm-www","email":"npm@npmjs.com"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.2","dist":{"shasum":"d9568a9413bee14951201ce73f3b3992ec6658c0","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.2.tgz"},"_from":".","_npmVersion":"1.4.1","_npmUser":{"name":"npm-www","email":"npm@npmjs.com"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.3","dist":{"shasum":"aa188fc5067158e991a57f4697c54994108f5389","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.3.tgz"},"_from":".","_npmVersion":"1.4.2","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.4","dist":{"shasum":"f9dbc383a49069d8c7f67755a3ff6e424aff584f","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.4.tgz"},"_from":".","_npmVersion":"1.4.2","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.5":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.5","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.5","dist":{"shasum":"7d6fdca46139470715f9477ddb5ad3e770d4de7b","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.5.tgz"},"_from":".","_npmVersion":"1.4.4","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.6":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.6","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.6","_from":".","_npmVersion":"1.4.6","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"657f69a79543fc4cc264c3b2de958bd15f7140fe","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.6.tgz"},"directories":{}},"0.4.7":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.7","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.7","dist":{"shasum":"f4369b59890da7882527eb7c427dd95d43707afb","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.7.tgz"},"_from":".","_npmVersion":"1.4.6","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"directories":{}},"0.4.8":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.8","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.8","_shasum":"a6685a161033101be6064b7af887ab440e8695d0","_from":".","_npmVersion":"1.4.8","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"a6685a161033101be6064b7af887ab440e8695d0","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.8.tgz"},"directories":{}},"0.4.9":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.9","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.9","_shasum":"304d3d4726a58e33d8cc965afdc9ed70b996580c","_from":".","_npmVersion":"1.4.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"304d3d4726a58e33d8cc965afdc9ed70b996580c","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.9.tgz"},"directories":{}},"0.4.10":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.10","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"^2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.10","_shasum":"ab7bf1be3ba07d769eaf74dee3c9347e02283116","_from":".","_npmVersion":"1.4.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"ab7bf1be3ba07d769eaf74dee3c9347e02283116","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.10.tgz"},"directories":{}},"0.4.11":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.11","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"2 >=2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.11","_shasum":"032e9b6b050ed052ee9441841a945a184ea6bc33","_from":".","_npmVersion":"1.4.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"032e9b6b050ed052ee9441841a945a184ea6bc33","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.11.tgz"},"directories":{}},"0.4.12":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"0.4.12","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"request":"2 >=2.25.0","graceful-fs":"~2.0.0","semver":"2 >=2.2.1","slide":"~1.1.3","chownr":"0","mkdirp":"~0.3.3","rimraf":"~2","retry":"0.6.0","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@0.4.12","_shasum":"34303422f6a3da93ca3a387a2650d707c8595b99","_from":".","_npmVersion":"1.4.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"34303422f6a3da93ca3a387a2650d707c8595b99","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-0.4.12.tgz"},"directories":{}},"1.0.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"1.0.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"~2.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@1.0.0","_shasum":"2a6f9dfdce5f8ebf4b9af4dbfd738384d25014e5","_from":".","_npmVersion":"1.4.10","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"2a6f9dfdce5f8ebf4b9af4dbfd738384d25014e5","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-1.0.0.tgz"},"directories":{}},"1.0.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"1.0.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"~2.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"98b1278c230cf6c159f189e2f8c69daffa727ab8","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@1.0.1","_shasum":"c5f6a87d285f2005a35d3f67d9c724bce551b0f1","_from":".","_npmVersion":"1.4.13","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"c5f6a87d285f2005a35d3f67d9c724bce551b0f1","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-1.0.1.tgz"},"directories":{}},"2.0.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"2.0.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"~2.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"47a98069b6a34e751cbd5b84ce92858cae5abe70","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@2.0.0","_shasum":"88810dac2d534c0df1d905c79e723392fcfc791a","_from":".","_npmVersion":"1.4.14","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"}],"dist":{"shasum":"88810dac2d534c0df1d905c79e723392fcfc791a","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-2.0.0.tgz"},"directories":{}},"2.0.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"2.0.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"123e40131f83f7265f66ecd2a558cce44a3aea86","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@2.0.1","_shasum":"611c7cb7c8f7ff22be2ebc6398423b5de10db0e2","_from":".","_npmVersion":"1.4.14","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"611c7cb7c8f7ff22be2ebc6398423b5de10db0e2","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-2.0.1.tgz"},"directories":{}},"2.0.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"2.0.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"6ecc311c9dd4890f2d9b6bae60447070a3321e12","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@2.0.2","_shasum":"a82b000354c7f830114fb18444764bc477d5740f","_from":".","_npmVersion":"1.4.15","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"a82b000354c7f830114fb18444764bc477d5740f","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-2.0.2.tgz"},"directories":{}},"3.0.0":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.0","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","normalize-package-data":"^0.4.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"6bb1aec1e85fa82ee075bd997d6fb9f2dbb7f643","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.0","_shasum":"4febc5cdb274e9fa06bc3008910e3fa1ec007994","_from":".","_npmVersion":"1.5.0-pre","_npmUser":{"name":"othiym23","email":"ogd@aoaioxxysz.net"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"4febc5cdb274e9fa06bc3008910e3fa1ec007994","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.0.tgz"},"directories":{}},"3.0.1":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.1","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","normalize-package-data":"^0.4.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"fe8382dde609ea1e3580fcdc5bc3d0bba119cfc6","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.1","_shasum":"5f3ee362ce5c237cfb798fce22c77875fc1a63c2","_from":".","_npmVersion":"1.5.0-alpha-1","_npmUser":{"name":"othiym23","email":"ogd@aoaioxxysz.net"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"5f3ee362ce5c237cfb798fce22c77875fc1a63c2","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.1.tgz"},"directories":{}},"2.0.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"2.0.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"2578fb9a807d77417554ba235ba8fac39405e832","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@2.0.3","_shasum":"93dad3d9a162c99404badb71739c622c0f3b9a72","_from":".","_npmVersion":"1.5.0-alpha-1","_npmUser":{"name":"othiym23","email":"ogd@aoaioxxysz.net"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"93dad3d9a162c99404badb71739c622c0f3b9a72","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-2.0.3.tgz"},"directories":{}},"3.0.2":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.2","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","normalize-package-data":"^0.4.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"15343019160ace0b9874cf0ec186b3425dbc7301","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.2","_shasum":"5dd0910157ce55f4286a1871d39f9a2128cd3c99","_from":".","_npmVersion":"1.5.0-alpha-2","_npmUser":{"name":"othiym23","email":"ogd@aoaioxxysz.net"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"5dd0910157ce55f4286a1871d39f9a2128cd3c99","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.2.tgz"},"directories":{}},"3.0.3":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.3","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.3.3","normalize-package-data":"^0.4.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1 || 3.x","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"b18a780d1185f27c06c27812147b83aba0d4a2f5","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.3","_shasum":"2377dc1cf69b4d374b3a95fb7feba8c804d8cb30","_from":".","_npmVersion":"2.0.0-alpha-5","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"2377dc1cf69b4d374b3a95fb7feba8c804d8cb30","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.3.tgz"},"directories":{}},"3.0.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"~0.5.0","normalize-package-data":"^0.4.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1 || 3.x","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"54900fe4b2eb5b99ee6dfe173f145732fdfae80e","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.4","_shasum":"d4a177d1f25615cfaef9b6844fa366ffbf5f578a","_from":".","_npmVersion":"2.0.0-alpha-5","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"d4a177d1f25615cfaef9b6844fa366ffbf5f578a","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.4.tgz"},"directories":{}},"3.0.5":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.5","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"0.5","normalize-package-data":"0.4","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"2","semver":"2 >=2.2.1 || 3.x","slide":"^1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"BSD","gitHead":"635db1654346bc86473df7b39626601425f46177","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.5","_shasum":"cdabaefa399b81ac8a86a48718aefd80e7b19ff3","_from":".","_npmVersion":"2.0.0-alpha-5","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"cdabaefa399b81ac8a86a48718aefd80e7b19ff3","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.5.tgz"},"directories":{}},"3.0.6":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"3.0.6","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"^0.5.0","normalize-package-data":"0.4","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"2","semver":"2 >=2.2.1 || 3.x","slide":"^1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"ISC","gitHead":"eba30fadd724ed5cad1aec95ac3ee907a59b7317","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@3.0.6","_shasum":"14a17d9a60ed2a80b04edcbc596dbce0d96540ee","_from":".","_npmVersion":"1.4.22","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"14a17d9a60ed2a80b04edcbc596dbce0d96540ee","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-3.0.6.tgz"},"directories":{}},"2.0.4":{"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"name":"@npm/npm-registry-client","description":"Client for the npm registry","version":"2.0.4","repository":{"url":"git://github.com/isaacs/npm-registry-client"},"main":"index.js","scripts":{"test":"tap test/*.js"},"dependencies":{"chownr":"0","graceful-fs":"^3.0.0","mkdirp":"^0.5.0","npm-cache-filename":"^1.0.0","request":"2 >=2.25.0","retry":"0.6.0","rimraf":"~2","semver":"2 >=2.2.1","slide":"~1.1.3","npmlog":""},"devDependencies":{"tap":""},"optionalDependencies":{"npmlog":""},"license":"ISC","gitHead":"a10f621d9cdc813b9d3092a14b661f65bfa6d40d","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"homepage":"https://github.com/isaacs/npm-registry-client","_id":"@npm%2fnpm-registry-client@2.0.4","_shasum":"528e08900d7655c12096d1637d1c3a7a5b451019","_from":".","_npmVersion":"1.4.22","_npmUser":{"name":"isaacs","email":"i@izs.me"},"maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"dist":{"shasum":"528e08900d7655c12096d1637d1c3a7a5b451019","tarball":"http://registry.npmjs.org/@npm%2fnpm-registry-client/-/@npm%2fnpm-registry-client-2.0.4.tgz"},"directories":{}}},"readme":"# npm-registry-client\u000a\u000aThe code that npm uses to talk to the registry.\u000a\u000aIt handles all the caching and HTTP calls.\u000a\u000a## Usage\u000a\u000a```javascript\u000avar RegClient = require('npm-registry-client')\u000avar client = new RegClient(config)\u000avar uri = \"npm://registry.npmjs.org/npm\"\u000avar options = {timeout: 1000}\u000a\u000aclient.get(uri, options, function (error, data, raw, res) {\u000a // error is an error if there was a problem.\u000a // data is the parsed data object\u000a // raw is the json string\u000a // res is the response from couch\u000a})\u000a```\u000a\u000a# Registry URLs\u000a\u000aThe registry calls take either a full URL pointing to a resource in the\u000aregistry, or a base URL for the registry as a whole (for the base URL, any path\u000awill be ignored). In addition to `http` and `https`, `npm` URLs are allowed.\u000a`npm` URLs are `https` URLs with the additional restrictions that they will\u000aalways include authorization credentials, and the response is always registry\u000ametadata (and not tarballs or other attachments).\u000a\u000a# Configuration\u000a\u000aThis program is designed to work with\u000a[npmconf](https://npmjs.org/package/npmconf), but you can also pass in\u000aa plain-jane object with the appropriate configs, and it'll shim it\u000afor you. Any configuration thingie that has get/set/del methods will\u000aalso be accepted.\u000a\u000a* `cache` **Required** {String} Path to the cache folder\u000a* `always-auth` {Boolean} Auth even for GET requests.\u000a* `auth` {String} A base64-encoded `username:password`\u000a* `email` {String} User's email address\u000a* `tag` {String} The default tag to use when publishing new packages.\u000a Default = `\"latest\"`\u000a* `ca` {String} Cerficate signing authority certificates to trust.\u000a* `cert` {String} Client certificate (PEM encoded). Enable access\u000a to servers that require client certificates\u000a* `key` {String} Private key (PEM encoded) for client certificate 'cert'\u000a* `strict-ssl` {Boolean} Whether or not to be strict with SSL\u000a certificates. Default = `true`\u000a* `user-agent` {String} User agent header to send. Default =\u000a `\"node/{process.version} {process.platform} {process.arch}\"`\u000a* `log` {Object} The logger to use. Defaults to `require(\"npmlog\")` if\u000a that works, otherwise logs are disabled.\u000a* `fetch-retries` {Number} Number of times to retry on GET failures.\u000a Default=2\u000a* `fetch-retry-factor` {Number} `factor` setting for `node-retry`. Default=10\u000a* `fetch-retry-mintimeout` {Number} `minTimeout` setting for `node-retry`.\u000a Default=10000 (10 seconds)\u000a* `fetch-retry-maxtimeout` {Number} `maxTimeout` setting for `node-retry`.\u000a Default=60000 (60 seconds)\u000a* `proxy` {URL} The url to proxy requests through.\u000a* `https-proxy` {URL} The url to proxy https requests through.\u000a Defaults to be the same as `proxy` if unset.\u000a* `_auth` {String} The base64-encoded authorization header.\u000a* `username` `_password` {String} Username/password to use to generate\u000a `_auth` if not supplied.\u000a* `_token` {Object} A token for use with\u000a [couch-login](https://npmjs.org/package/couch-login)\u000a\u000a# client.request(method, uri, options, cb)\u000a\u000a* `method` {String} HTTP method\u000a* `uri` {String} URI pointing to the resource to request\u000a* `options` {Object} Object containing optional per-request properties.\u000a * `what` {Stream | Buffer | String | Object} The request body. Objects\u000a that are not Buffers or Streams are encoded as JSON.\u000a * `etag` {String} The cached ETag\u000a * `follow` {Boolean} Follow 302/301 responses (defaults to true)\u000a* `cb` {Function}\u000a * `error` {Error | null}\u000a * `data` {Object} the parsed data object\u000a * `raw` {String} the json\u000a * `res` {Response Object} response from couch\u000a\u000aMake a request to the registry. All the other methods are wrappers around\u000a`request`.\u000a\u000a# client.adduser(base, username, password, email, cb)\u000a\u000a* `base` {String} Base registry URL\u000a* `username` {String}\u000a* `password` {String}\u000a* `email` {String}\u000a* `cb` {Function}\u000a\u000aAdd a user account to the registry, or verify the credentials.\u000a\u000a# client.deprecate(uri, version, message, cb)\u000a\u000a* `uri` {String} Full registry URI for the deprecated package\u000a* `version` {String} Semver version range\u000a* `message` {String} The message to use as a deprecation warning\u000a* `cb` {Function}\u000a\u000aDeprecate a version of a package in the registry.\u000a\u000a# client.bugs(uri, cb)\u000a\u000a* `uri` {String} Full registry URI for the package\u000a* `cb` {Function}\u000a\u000aGet the url for bugs of a package\u000a\u000a# client.get(uri, options, cb)\u000a\u000a* `uri` {String} The complete registry URI to fetch\u000a* `options` {Object} Object containing optional per-request properties.\u000a * `timeout` {Number} Duration before the request times out.\u000a * `follow` {Boolean} Follow 302/301 responses (defaults to true)\u000a * `staleOk` {Boolean} If there's cached data available, then return that\u000a to the callback quickly, and update the cache the background.\u000a\u000aFetches data from the registry via a GET request, saving it in the cache folder\u000awith the ETag.\u000a\u000a# client.publish(uri, data, tarball, cb)\u000a\u000a* `uri` {String} The registry URI to publish to\u000a* `data` {Object} Package data\u000a* `tarball` {String | Stream} Filename or stream of the package tarball\u000a* `cb` {Function}\u000a\u000aPublish a package to the registry.\u000a\u000aNote that this does not create the tarball from a folder. However, it can\u000aaccept a gzipped tar stream or a filename to a tarball.\u000a\u000a# client.star(uri, starred, cb)\u000a\u000a* `uri` {String} The complete registry URI to star\u000a* `starred` {Boolean} True to star the package, false to unstar it.\u000a* `cb` {Function}\u000a\u000aStar or unstar a package.\u000a\u000aNote that the user does not have to be the package owner to star or unstar a\u000apackage, though other writes do require that the user be the package owner.\u000a\u000a# client.stars(base, username, cb)\u000a\u000a* `base` {String} The base URL for the registry\u000a* `username` {String} Name of user to fetch starred packages for.\u000a* `cb` {Function}\u000a\u000aView your own or another user's starred packages.\u000a\u000a# client.tag(uri, version, tag, cb)\u000a\u000a* `uri` {String} The complete registry URI to tag\u000a* `version` {String} Version to tag\u000a* `tag` {String} Tag name to apply\u000a* `cb` {Function}\u000a\u000aMark a version in the `dist-tags` hash, so that `pkg@tag` will fetch the\u000aspecified version.\u000a\u000a# client.unpublish(uri, [ver], cb)\u000a\u000a* `uri` {String} The complete registry URI to unpublish\u000a* `ver` {String} version to unpublish. Leave blank to unpublish all\u000a versions.\u000a* `cb` {Function}\u000a\u000aRemove a version of a package (or all versions) from the registry. When the\u000alast version us unpublished, the entire document is removed from the database.\u000a\u000a# client.upload(uri, file, [etag], [nofollow], cb)\u000a\u000a* `uri` {String} The complete registry URI to upload to\u000a* `file` {String | Stream} Either the filename or a readable stream\u000a* `etag` {String} Cache ETag\u000a* `nofollow` {Boolean} Do not follow 301/302 responses\u000a* `cb` {Function}\u000a\u000aUpload an attachment. Mostly used by `client.publish()`.\u000a","maintainers":[{"name":"isaacs","email":"i@izs.me"},{"name":"othiym23","email":"ogd@aoaioxxysz.net"}],"time":{"modified":"2014-07-31T21:59:52.896Z","created":"2012-06-07T04:43:36.581Z","0.0.1":"2012-06-07T04:43:38.123Z","0.0.2":"2012-06-07T05:35:05.937Z","0.0.3":"2012-06-09T00:55:25.861Z","0.0.4":"2012-06-11T03:53:26.548Z","0.0.5":"2012-06-11T23:48:11.235Z","0.0.6":"2012-06-17T06:23:27.320Z","0.0.7":"2012-06-18T19:19:38.315Z","0.0.8":"2012-06-28T20:40:20.563Z","0.0.9":"2012-07-10T03:28:04.651Z","0.0.10":"2012-07-11T17:03:45.151Z","0.0.11":"2012-07-17T14:06:37.489Z","0.1.0":"2012-07-23T18:17:38.007Z","0.1.1":"2012-07-23T21:21:28.196Z","0.1.2":"2012-07-24T06:14:12.831Z","0.1.3":"2012-08-07T02:02:20.564Z","0.1.4":"2012-08-15T03:04:52.822Z","0.1.5":"2012-08-17T21:59:33.310Z","0.2.0":"2012-08-17T22:00:18.081Z","0.2.1":"2012-08-17T22:07:28.827Z","0.2.2":"2012-08-17T22:37:24.352Z","0.2.3":"2012-08-19T19:16:44.808Z","0.2.4":"2012-08-19T19:18:51.792Z","0.2.5":"2012-08-20T16:54:50.794Z","0.2.6":"2012-08-22T00:25:04.766Z","0.2.7":"2012-08-27T19:07:34.829Z","0.2.8":"2012-10-02T19:53:50.661Z","0.2.9":"2012-10-03T22:09:50.766Z","0.2.10":"2012-10-25T14:55:54.216Z","0.2.11":"2012-12-21T16:26:38.094Z","0.2.12":"2013-01-18T22:22:41.668Z","0.2.13":"2013-02-06T00:16:35.939Z","0.2.14":"2013-02-10T02:44:02.764Z","0.2.15":"2013-02-11T19:18:55.678Z","0.2.16":"2013-02-15T17:09:03.249Z","0.2.17":"2013-02-16T03:47:13.898Z","0.2.18":"2013-03-06T22:09:23.536Z","0.2.19":"2013-03-20T06:27:39.128Z","0.2.20":"2013-03-28T00:43:07.558Z","0.2.21":"2013-04-29T15:46:54.094Z","0.2.22":"2013-04-29T15:51:02.178Z","0.2.23":"2013-05-11T00:28:14.198Z","0.2.24":"2013-05-24T21:27:50.693Z","0.2.25":"2013-06-20T15:36:46.277Z","0.2.26":"2013-07-06T17:12:54.670Z","0.2.27":"2013-07-11T07:14:45.740Z","0.2.28":"2013-08-02T20:27:41.732Z","0.2.29":"2013-10-28T18:23:24.477Z","0.2.30":"2013-11-18T23:12:00.540Z","0.2.31":"2013-12-16T08:36:43.044Z","0.3.0":"2013-12-17T07:03:10.699Z","0.3.1":"2013-12-17T16:53:27.867Z","0.3.2":"2013-12-17T22:25:14.882Z","0.3.3":"2013-12-21T16:07:06.773Z","0.3.4":"2014-01-29T15:24:05.163Z","0.3.5":"2014-01-31T01:53:19.656Z","0.3.6":"2014-02-07T00:17:21.362Z","0.4.0":"2014-02-13T01:17:18.973Z","0.4.1":"2014-02-13T23:47:37.892Z","0.4.2":"2014-02-14T00:29:13.086Z","0.4.3":"2014-02-16T03:40:54.640Z","0.4.4":"2014-02-16T03:41:48.856Z","0.4.5":"2014-03-12T05:09:17.474Z","0.4.6":"2014-03-29T19:44:15.041Z","0.4.7":"2014-04-02T19:41:07.149Z","0.4.8":"2014-05-01T22:24:54.980Z","0.4.9":"2014-05-12T21:52:55.127Z","0.4.10":"2014-05-13T16:44:29.801Z","0.4.11":"2014-05-13T20:33:04.738Z","0.4.12":"2014-05-14T06:14:22.842Z","1.0.0":"2014-05-14T23:04:37.188Z","1.0.1":"2014-06-03T00:55:54.448Z","2.0.0":"2014-06-06T04:23:46.579Z","2.0.1":"2014-06-06T06:25:14.419Z","2.0.2":"2014-06-14T00:33:10.205Z","3.0.0":"2014-07-02T00:30:29.154Z","3.0.1":"2014-07-14T23:29:05.057Z","2.0.3":"2014-07-15T00:09:36.043Z","3.0.2":"2014-07-17T06:30:02.659Z","3.0.3":"2014-07-23T21:20:42.406Z","3.0.4":"2014-07-25T00:27:26.007Z","3.0.5":"2014-07-25T00:28:48.007Z","3.0.6":"2014-07-31T21:57:49.043Z","2.0.4":"2014-07-31T21:59:52.896Z"},"author":{"name":"Isaac Z. Schlueter","email":"i@izs.me","url":"http://blog.izs.me/"},"repository":{"url":"git://github.com/isaacs/npm-registry-client"},"users":{"fgribreau":true,"fengmk2":true},"readmeFilename":"README.md","homepage":"https://github.com/isaacs/npm-registry-client","bugs":{"url":"https://github.com/isaacs/npm-registry-client/issues"},"license":"ISC","_attachments":{}}
diff --git a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/cache.json b/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/cache.json
deleted file mode 100644
index 01da300276..0000000000
--- a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/cache.json
+++ /dev/null
@@ -1 +0,0 @@
-{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.3.3","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.3.3","dependencies":{},"devDependencies":{},"optionalDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.1.1","_nodeVersion":"v0.6.11","_defaultsLoaded":true,"dist":{"shasum":"47ac53683daf832bfa952e1774417da47817ae42","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.3.3.tgz"},"readme":" __ \n /\\ \\ __ \n __ __ ___ \\_\\ \\ __ _ __ ____ ___ ___ _ __ __ /\\_\\ ____ \n /\\ \\/\\ \\ /' _ `\\ /'_ \\ /'__`\\/\\ __\\/ ,__\\ / ___\\ / __`\\/\\ __\\/'__`\\ \\/\\ \\ /',__\\ \n \\ \\ \\_\\ \\/\\ \\/\\ \\/\\ \\ \\ \\/\\ __/\\ \\ \\//\\__, `\\/\\ \\__//\\ \\ \\ \\ \\ \\//\\ __/ __ \\ \\ \\/\\__, `\\\n \\ \\____/\\ \\_\\ \\_\\ \\___,_\\ \\____\\\\ \\_\\\\/\\____/\\ \\____\\ \\____/\\ \\_\\\\ \\____\\/\\_\\ _\\ \\ \\/\\____/\n \\/___/ \\/_/\\/_/\\/__,_ /\\/____/ \\/_/ \\/___/ \\/____/\\/___/ \\/_/ \\/____/\\/_//\\ \\_\\ \\/___/ \n \\ \\____/ \n \\/___/\n \nUnderscore.js is a utility-belt library for JavaScript that provides \nsupport for the usual functional suspects (each, map, reduce, filter...) \nwithout extending any core JavaScript objects.\n\nFor Docs, License, Tests, and pre-packed downloads, see:\nhttp://documentcloud.github.com/underscore/\n\nMany thanks to our contributors:\nhttps://github.com/documentcloud/underscore/contributors\n","maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}} \ No newline at end of file
diff --git a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/package.tgz b/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/package.tgz
deleted file mode 100644
index 19da9baa7f..0000000000
--- a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/1.3.3/package.tgz
+++ /dev/null
Binary files differ
diff --git a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/cache.json b/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/cache.json
deleted file mode 100644
index d899f11922..0000000000
--- a/deps/npm/node_modules/npm-registry-client/test/fixtures/underscore/cache.json
+++ /dev/null
@@ -1 +0,0 @@
-{"_id":"underscore","_rev":"72-47f2986bfd8e8b55068b204588bbf484","name":"underscore","description":"JavaScript's functional programming helper library.","dist-tags":{"latest":"1.3.3","stable":"1.3.3"},"versions":{"1.0.3":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.0.3","_id":"underscore@1.0.3","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.7-2","_nodeVersion":"v0.3.1-pre","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.0.3.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.0.4":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.0.4","_id":"underscore@1.0.4","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.7-2","_nodeVersion":"v0.3.1-pre","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.0.4.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.0":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.1.0","_id":"underscore@1.1.0","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.7-2","_nodeVersion":"v0.3.1-pre","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.0.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.1":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.1.1","_id":"underscore@1.1.1","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.7-2","_nodeVersion":"v0.3.1-pre","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.1.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.2":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.1.2","_id":"underscore@1.1.2","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.7-2","_nodeVersion":"v0.3.1-pre","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.2.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.3":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore","version":"1.1.3","_id":"underscore@1.1.3","engines":{"node":"*"},"_nodeSupported":true,"_npmVersion":"0.2.8-1","_nodeVersion":"v0.2.5","dist":{"tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.3.tgz"},"directories":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.4":{"name":"underscore","description":"Functional programming aid for JavaScript. Works well with jQuery.","url":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"lib":".","main":"underscore.js","version":"1.1.4","_id":"underscore@1.1.4","engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"0.3.9","_nodeVersion":"v0.5.0-pre","dist":{"shasum":"9e82274902865625b3a6d4c315a38ffd80047dae","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.4.tgz"},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.1.5":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.1.5","_id":"underscore@1.1.5","engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"0.3.16","_nodeVersion":"v0.4.2","directories":{},"files":[""],"_defaultsLoaded":true,"dist":{"shasum":"23601d62c75619998b2f0db24938102793336a56","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.5.tgz"},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.6":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.1.6","_id":"underscore@1.1.6","engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"0.3.18","_nodeVersion":"v0.4.2","directories":{},"files":[""],"_defaultsLoaded":true,"dist":{"shasum":"6868da1bdd72d75285be0b4e50f228e70d001a2c","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.6.tgz"},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}]},"1.1.7":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.1.7","devDependencies":{},"_id":"underscore@1.1.7","engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.3","_nodeVersion":"v0.4.7","_defaultsLoaded":true,"dist":{"shasum":"40bab84bad19d230096e8d6ef628bff055d83db0","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.1.7.tgz"},"scripts":{},"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.2.0":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.2.0","_npmJsonOpts":{"file":"/Users/jashkenas/.npm/underscore/1.2.0/package/package.json","wscript":false,"contributors":false,"serverjs":false},"_id":"underscore@1.2.0","devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.22","_nodeVersion":"v0.4.10","_defaultsLoaded":true,"dist":{"shasum":"b32ce32c8c118caa8031c10b54c7f65ab3b557fd","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.2.0.tgz"},"scripts":{},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"directories":{}},"1.2.1":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.2.1","_npmJsonOpts":{"file":"/Users/jashkenas/.npm/underscore/1.2.1/package/package.json","wscript":false,"contributors":false,"serverjs":false},"_id":"underscore@1.2.1","devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.22","_nodeVersion":"v0.4.10","_defaultsLoaded":true,"dist":{"shasum":"fc5c6b0765673d92a2d4ac8b4dc0aa88702e2bd4","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.2.1.tgz"},"scripts":{},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"directories":{}},"1.2.2":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.2.2","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.2.2","devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.104","_nodeVersion":"v0.6.0","_defaultsLoaded":true,"dist":{"shasum":"74dd40e9face84e724eb2edae945b8aedc233ba3","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.2.2.tgz"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.2.3":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"dependencies":{},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.2.3","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.2.3","devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.104","_nodeVersion":"v0.6.0","_defaultsLoaded":true,"dist":{"shasum":"11b874da70f4683d7d48bba2b44be1e600d2f6cf","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.2.3.tgz"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.2.4":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.2.4","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.2.4","dependencies":{},"devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.104","_nodeVersion":"v0.6.6","_defaultsLoaded":true,"dist":{"shasum":"e8da6241aa06f64df2473bb2590b8c17c84c3c7e","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.2.4.tgz"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.3.0":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"contributors":[],"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.3.0","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.3.0","dependencies":{},"devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.104","_nodeVersion":"v0.6.6","_defaultsLoaded":true,"dist":{"shasum":"253b2d79b7bb67943ced0fc744eb18267963ede8","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.3.0.tgz"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.3.1":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.3.1","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.3.1","dependencies":{},"devDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.0.104","_nodeVersion":"v0.6.6","_defaultsLoaded":true,"dist":{"shasum":"6cb8aad0e77eb5dbbfb54b22bcd8697309cf9641","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.3.1.tgz"},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.3.2":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.3.2","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.3.2","dependencies":{},"devDependencies":{},"optionalDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.1.1","_nodeVersion":"v0.6.11","_defaultsLoaded":true,"dist":{"shasum":"1b4e455089ab1d1d38ab6794ffe6cf08f764394a","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.3.2.tgz"},"readme":" __ \n /\\ \\ __ \n __ __ ___ \\_\\ \\ __ _ __ ____ ___ ___ _ __ __ /\\_\\ ____ \n /\\ \\/\\ \\ /' _ `\\ /'_ \\ /'__`\\/\\ __\\/ ,__\\ / ___\\ / __`\\/\\ __\\/'__`\\ \\/\\ \\ /',__\\ \n \\ \\ \\_\\ \\/\\ \\/\\ \\/\\ \\ \\ \\/\\ __/\\ \\ \\//\\__, `\\/\\ \\__//\\ \\ \\ \\ \\ \\//\\ __/ __ \\ \\ \\/\\__, `\\\n \\ \\____/\\ \\_\\ \\_\\ \\___,_\\ \\____\\\\ \\_\\\\/\\____/\\ \\____\\ \\____/\\ \\_\\\\ \\____\\/\\_\\ _\\ \\ \\/\\____/\n \\/___/ \\/_/\\/_/\\/__,_ /\\/____/ \\/_/ \\/___/ \\/____/\\/___/ \\/_/ \\/____/\\/_//\\ \\_\\ \\/___/ \n \\ \\____/ \n \\/___/\n \nUnderscore.js is a utility-belt library for JavaScript that provides \nsupport for the usual functional suspects (each, map, reduce, filter...) \nwithout extending any core JavaScript objects.\n\nFor Docs, License, Tests, and pre-packed downloads, see:\nhttp://documentcloud.github.com/underscore/\n\nMany thanks to our contributors:\nhttps://github.com/documentcloud/underscore/contributors\n","maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}},"1.3.3":{"name":"underscore","description":"JavaScript's functional programming helper library.","homepage":"http://documentcloud.github.com/underscore/","keywords":["util","functional","server","client","browser"],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"main":"underscore.js","version":"1.3.3","_npmUser":{"name":"jashkenas","email":"jashkenas@gmail.com"},"_id":"underscore@1.3.3","dependencies":{},"devDependencies":{},"optionalDependencies":{},"engines":{"node":"*"},"_engineSupported":true,"_npmVersion":"1.1.1","_nodeVersion":"v0.6.11","_defaultsLoaded":true,"dist":{"shasum":"47ac53683daf832bfa952e1774417da47817ae42","tarball":"http://registry.npmjs.org/underscore/-/underscore-1.3.3.tgz"},"readme":" __ \n /\\ \\ __ \n __ __ ___ \\_\\ \\ __ _ __ ____ ___ ___ _ __ __ /\\_\\ ____ \n /\\ \\/\\ \\ /' _ `\\ /'_ \\ /'__`\\/\\ __\\/ ,__\\ / ___\\ / __`\\/\\ __\\/'__`\\ \\/\\ \\ /',__\\ \n \\ \\ \\_\\ \\/\\ \\/\\ \\/\\ \\ \\ \\/\\ __/\\ \\ \\//\\__, `\\/\\ \\__//\\ \\ \\ \\ \\ \\//\\ __/ __ \\ \\ \\/\\__, `\\\n \\ \\____/\\ \\_\\ \\_\\ \\___,_\\ \\____\\\\ \\_\\\\/\\____/\\ \\____\\ \\____/\\ \\_\\\\ \\____\\/\\_\\ _\\ \\ \\/\\____/\n \\/___/ \\/_/\\/_/\\/__,_ /\\/____/ \\/_/ \\/___/ \\/____/\\/___/ \\/_/ \\/____/\\/_//\\ \\_\\ \\/___/ \n \\ \\____/ \n \\/___/\n \nUnderscore.js is a utility-belt library for JavaScript that provides \nsupport for the usual functional suspects (each, map, reduce, filter...) \nwithout extending any core JavaScript objects.\n\nFor Docs, License, Tests, and pre-packed downloads, see:\nhttp://documentcloud.github.com/underscore/\n\nMany thanks to our contributors:\nhttps://github.com/documentcloud/underscore/contributors\n","maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"directories":{}}},"maintainers":[{"name":"documentcloud","email":"jeremy@documentcloud.org"},{"name":"jashkenas","email":"jashkenas@gmail.com"}],"author":{"name":"Jeremy Ashkenas","email":"jeremy@documentcloud.org"},"time":{"1.0.3":"2011-12-07T15:12:18.045Z","1.0.4":"2011-12-07T15:12:18.045Z","1.1.0":"2011-12-07T15:12:18.045Z","1.1.1":"2011-12-07T15:12:18.045Z","1.1.2":"2011-12-07T15:12:18.045Z","1.1.3":"2011-12-07T15:12:18.045Z","1.1.4":"2011-12-07T15:12:18.045Z","1.1.5":"2011-12-07T15:12:18.045Z","1.1.6":"2011-12-07T15:12:18.045Z","1.1.7":"2011-12-07T15:12:18.045Z","1.2.0":"2011-12-07T15:12:18.045Z","1.2.1":"2011-12-07T15:12:18.045Z","1.2.2":"2011-11-14T20:28:47.115Z","1.2.3":"2011-12-07T15:12:18.045Z","1.2.4":"2012-01-09T17:23:14.818Z","1.3.0":"2012-01-11T16:41:38.459Z","1.3.1":"2012-01-23T22:57:36.474Z","1.3.2":"2012-04-09T18:38:14.345Z","1.3.3":"2012-04-10T14:43:48.089Z"},"repository":{"type":"git","url":"git://github.com/documentcloud/underscore.git"},"users":{"vesln":true,"mvolkmann":true,"lancehunt":true,"mikl":true,"linus":true,"vasc":true,"bat":true,"dmalam":true,"mbrevoort":true,"danielr":true,"rsimoes":true,"thlorenz":true}} \ No newline at end of file
diff --git a/deps/npm/node_modules/npmlog/node_modules/gauge/README.md~ b/deps/npm/node_modules/npmlog/node_modules/gauge/README.md~
deleted file mode 100644
index cdab5bc27f..0000000000
--- a/deps/npm/node_modules/npmlog/node_modules/gauge/README.md~
+++ /dev/null
@@ -1,153 +0,0 @@
-gauge
-=====
-
-A nearly stateless terminal based horizontal guage / progress bar.
-
-```javascript
-var Gauge = require("gauge")
-
-var gauge = new Gauge()
-
-gauge.show("test", 0.20)
-
-gauge.pulse("this")
-
-gauge.hide()
-```
-
-![](example.png)
-
-
-### `var gauge = new Gauge([options], [ansiStream])`
-
-* **options** – *(optional)* An option object. (See [below] for details.)
-* **ansiStream** – *(optional)* A stream that's been blessed by the [ansi]
- module to include various commands for controlling the cursor in a terminal.
-
-[ansi]: https://www.npmjs.com/package/ansi
-[below]: #theme-objects
-
-Constructs a new gauge. Gauges are drawn on a single line, and are not drawn
-if the current terminal isn't a tty.
-
-The **options** object can have the following properties, all of which are
-optional:
-
-* maxUpdateFrequency: defaults to 50 msec, the gauge will not be drawn more
- than once in this period of time. This applies to `show` and `pulse`
- calls, but if you `hide` and then `show` the gauge it will draw it
- regardless of time since last draw.
-* theme: defaults to Gauge.unicode` if the terminal supports
- unicode according to [has-unicode], otherwise it defaults to `Gauge.ascii`.
- Details on the [theme object](#theme-objects) are documented elsewhere.
-* template: see [documentation elsewhere](#template-objects) for
- defaults and details.
-
-[has-unicode]: https://www.npmjs.com/package/has-unicode
-
-If **ansiStream** isn't passed in, then one will be constructed from stderr
-with `ansi(process.stderr)`.
-
-### `gauge.show([name, [completed]])`
-
-* **name** – *(optional)* The name of the current thing contributing to progress. Defaults to the last value used, or "".
-* **completed** – *(optional)* The portion completed as a value between 0 and 1. Defaults to the last value used, or 0.
-
-If `process.stdout.isTTY` is false then this does nothing. If completed is 0
-and `gauge.pulse` has never been called, then similarly nothing will be printed.
-
-If `maxUpdateFrequency` msec haven't passed since the last call to `show` or
-`pulse` then similarly, nothing will be printed. (Actually, the update is
-deferred until `maxUpdateFrequency` msec have passed and if nothing else has
-happened, the gauge update will happen.)
-
-### `gauge.hide()`
-
-Removes the gauge from the terminal.
-
-### `gauge.pulse([name])`
-
-* **name** – *(optional)* The specific thing that triggered this pulse
-
-Spins the spinner in the gauge to show output. If **name** is included then
-it will be combined with the last name passed to `gauge.show` using the
-subsection property of the theme (typically a right facing arrow).
-
-### `gauge.disable()`
-
-Hides the gauge and ignores further calls to `show` or `pulse`.
-
-### `gauge.enable()`
-
-Shows the gauge and resumes updating when `show` or `pulse` is called.
-
-### Theme Objects
-
-There are two theme objects available as a part of the module, `Gauge.unicode` and `Gauge.ascii`.
-Theme objects have the follow properties:
-
-| Property | Unicode | ASCII |
-| ---------- | ------- | ----- |
-| startgroup | ╢ | \| |
-| endgroup | ╟ | \| |
-| complete | █ | # |
-| incomplete | ░ | - |
-| spinner | ▀▐▄▌ | -\\\|/ |
-| subsection | → | -> |
-
-*startgroup*, *endgroup* and *subsection* can be as many characters as you want.
-
-*complete* and *incomplete* should be a single character width each.
-
-*spinner* is a list of characters to use in turn when displaying an activity
-spinner. The Gauge will spin as many characters as you give here.
-
-### Template Objects
-
-A template is an array of objects and strings that, after being evaluated,
-will be turned into the gauge line. The default template is:
-
-```javascript
-[
- {type: "name", separated: true, maxLength: 25, minWidth: 25, align: "left"},
- {type: "spinner", separated: true},
- {type: "startgroup"},
- {type: "completionbar"},
- {type: "endgroup"}
-]
-```
-
-The various template elements can either be **plain strings**, in which case they will
-be be included verbatum in the output.
-
-If the template element is an object, it can have the following keys:
-
-* *type* can be:
- * `name` – The most recent name passed to `show`; if this is in response to a
- `pulse` then the name passed to `pulse` will be appended along with the
- subsection property from the theme.
- * `spinner` – If you've ever called `pulse` this will be one of the characters
- from the spinner property of the theme.
- * `startgroup` – The `startgroup` property from the theme.
- * `completionbar` – This progress bar itself
- * `endgroup` – The `endgroup` property from the theme.
-* *separated* – If true, the element will be separated with spaces from things on
- either side (and margins count as space, so it won't be indented), but only
- if its included.
-* *maxLength* – The maximum length for this element. If its value is longer it
- will be truncated.
-* *minLength* – The minimum length for this element. If its value is shorter it
- will be padded according to the *align* value.
-* *align* – (Default: left) Possible values "left", "right" and "center". Works
- as you'd expect from word processors.
-* *length* – Provides a single value for both *minLength* and *maxLength*. If both
- *length* and *minLength or *maxLength* are specifed then the latter take precedence.
-
-### Tracking Completion
-
-If you have more than one thing going on that you want to track completion
-of, you may find the related [are-we-there-yet] helpful. It's `change`
-event can be wired up to the `show` method to get a more traditional
-progress bar interface.
-
-[are-we-there-yet]: https://www.npmjs.com/package/are-we-there-yet
diff --git a/deps/npm/node_modules/npmlog/node_modules/gauge/node_modules/has-unicode/README.md~ b/deps/npm/node_modules/npmlog/node_modules/gauge/node_modules/has-unicode/README.md~
deleted file mode 100644
index e712b7000c..0000000000
--- a/deps/npm/node_modules/npmlog/node_modules/gauge/node_modules/has-unicode/README.md~
+++ /dev/null
@@ -1,4 +0,0 @@
-has-unicode
-===========
-
-Try to guess if your terminal supports unicode
diff --git a/deps/npm/node_modules/opener/LICENSE.txt b/deps/npm/node_modules/opener/LICENSE.txt
index 0407ecda83..f580e3d3af 100644
--- a/deps/npm/node_modules/opener/LICENSE.txt
+++ b/deps/npm/node_modules/opener/LICENSE.txt
@@ -1,4 +1,4 @@
-Copyright © 2012–2014 Domenic Denicola <domenic@domenicdenicola.com>
+Copyright © 2012–2015 Domenic Denicola <d@domenic.me>
This work is free. You can redistribute it and/or modify it under the
terms of the Do What The Fuck You Want To Public License, Version 2,
diff --git a/deps/npm/node_modules/opener/opener.js b/deps/npm/node_modules/opener/opener.js
index 3f95d0635a..8951fa2def 100755
--- a/deps/npm/node_modules/opener/opener.js
+++ b/deps/npm/node_modules/opener/opener.js
@@ -35,6 +35,11 @@ function opener(args, options, callback) {
//
// Furthermore, if "cmd /c" double-quoted the first parameter, then "start" will interpret it as a window title,
// so we need to add a dummy empty-string window title: http://stackoverflow.com/a/154090/3191
+ //
+ // Additionally, on Windows ampersand needs to be escaped when passed to "start"
+ args = args.map(function(value) {
+ return value.replace(/&/g, '^&');
+ });
args = ["/c", "start", '""'].concat(args);
}
diff --git a/deps/npm/node_modules/opener/package.json b/deps/npm/node_modules/opener/package.json
index b62915e6ef..aab02afc15 100644
--- a/deps/npm/node_modules/opener/package.json
+++ b/deps/npm/node_modules/opener/package.json
@@ -1,39 +1,43 @@
{
"name": "opener",
"description": "Opens stuff, like webpages and files and executables, cross-platform",
- "version": "1.4.0",
+ "version": "1.4.1",
"author": {
"name": "Domenic Denicola",
- "email": "domenic@domenicdenicola.com",
- "url": "http://domenic.me/"
+ "email": "d@domenic.me",
+ "url": "https://domenic.me/"
},
"license": "WTFPL",
"repository": {
"type": "git",
- "url": "git://github.com/domenic/opener.git"
- },
- "bugs": {
- "url": "http://github.com/domenic/opener/issues"
+ "url": "https://github.com/domenic/opener"
},
"main": "opener.js",
"bin": {
"opener": "opener.js"
},
+ "files": [
+ "opener.js"
+ ],
"scripts": {
"lint": "jshint opener.js"
},
"devDependencies": {
- "jshint": "^2.5.4"
+ "jshint": "^2.6.3"
+ },
+ "gitHead": "d0ee95b19951703462fa593baa16e81fdff7827c",
+ "bugs": {
+ "url": "https://github.com/domenic/opener/issues"
},
- "gitHead": "b9d36d4f82c26560acdadbabbb10ddba46a30dc5",
"homepage": "https://github.com/domenic/opener",
- "_id": "opener@1.4.0",
- "_shasum": "d11f86eeeb076883735c9d509f538fe82d10b941",
- "_from": "opener@>=1.4.0 <1.5.0",
- "_npmVersion": "1.4.23",
+ "_id": "opener@1.4.1",
+ "_shasum": "897590acd1aed3311b703b58bccb4d43f56f2895",
+ "_from": "opener@>=1.4.1 <1.5.0",
+ "_npmVersion": "2.7.0",
+ "_nodeVersion": "1.5.1",
"_npmUser": {
"name": "domenic",
- "email": "domenic@domenicdenicola.com"
+ "email": "d@domenic.me"
},
"maintainers": [
{
@@ -42,9 +46,9 @@
}
],
"dist": {
- "shasum": "d11f86eeeb076883735c9d509f538fe82d10b941",
- "tarball": "http://registry.npmjs.org/opener/-/opener-1.4.0.tgz"
+ "shasum": "897590acd1aed3311b703b58bccb4d43f56f2895",
+ "tarball": "http://registry.npmjs.org/opener/-/opener-1.4.1.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/opener/-/opener-1.4.0.tgz"
+ "_resolved": "https://registry.npmjs.org/opener/-/opener-1.4.1.tgz"
}
diff --git a/deps/npm/node_modules/read-installed/node_modules/readdir-scoped-modules/.eslintrc b/deps/npm/node_modules/read-installed/node_modules/readdir-scoped-modules/.eslintrc
deleted file mode 100644
index ba33150421..0000000000
--- a/deps/npm/node_modules/read-installed/node_modules/readdir-scoped-modules/.eslintrc
+++ /dev/null
@@ -1,17 +0,0 @@
-{
- "env" : {
- "node" : true
- },
- "rules" : {
- "semi": [2, "never"],
- "strict": 0,
- "quotes": [1, "double", "avoid-escape"],
- "no-use-before-define": 0,
- "curly": 0,
- "no-underscore-dangle": 0,
- "no-lonely-if": 1,
- "no-unused-vars": [2, {"vars" : "all", "args" : "after-used"}],
- "no-mixed-requires": 0,
- "space-infix-ops": 0
- }
-}
diff --git a/deps/npm/node_modules/request/.eslintrc b/deps/npm/node_modules/request/.eslintrc
deleted file mode 100644
index 8538b419c1..0000000000
--- a/deps/npm/node_modules/request/.eslintrc
+++ /dev/null
@@ -1,39 +0,0 @@
-{
- "env": {
- "node": true
- },
- "rules": {
- // 2-space indentation
- "indent": [2, 2],
- // Disallow semi-colons, unless needed to disambiguate statement
- "semi": [2, "never"],
- // Require strings to use single quotes
- "quotes": [2, "single"],
- // Require curly braces for all control statements
- "curly": 2,
- // Disallow using variables and functions before they've been defined
- "no-use-before-define": 2,
- // Allow any case for variable naming
- "camelcase": 0,
- // Disallow unused variables, except as function arguments
- "no-unused-vars": [2, {"args":"none"}],
- // Allow leading underscores for method names
- // REASON: we use underscores to denote private methods
- "no-underscore-dangle": 0,
- // Allow multi spaces around operators since they are
- // used for alignment. This is not consistent in the
- // code.
- "no-multi-spaces": 0,
- // Style rule is: most objects use { beforeColon: false, afterColon: true }, unless aligning which uses:
- //
- // {
- // beforeColon : true,
- // afterColon : true
- // }
- //
- // eslint can't handle this, so the check is disabled.
- "key-spacing": 0,
- // Allow shadowing vars in outer scope (needs discussion)
- "no-shadow": 0
- }
-}
diff --git a/deps/npm/node_modules/request/.travis.yml b/deps/npm/node_modules/request/.travis.yml
index 0988483f3b..bd0f638eb7 100644
--- a/deps/npm/node_modules/request/.travis.yml
+++ b/deps/npm/node_modules/request/.travis.yml
@@ -1,8 +1,8 @@
language: node_js
node_js:
- - "0.8"
+ - "io.js"
+ - "0.12"
- "0.10"
-before_install: npm install -g npm@~1.4.6
after_script: ./node_modules/.bin/istanbul cover ./node_modules/tape/bin/tape tests/test-*.js --report lcovonly && cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js --verbose
webhooks:
urls: https://webhooks.gitter.im/e/237280ed4796c19cc626
diff --git a/deps/npm/node_modules/request/CHANGELOG.md b/deps/npm/node_modules/request/CHANGELOG.md
index cfaf173848..9d6a58ffca 100644
--- a/deps/npm/node_modules/request/CHANGELOG.md
+++ b/deps/npm/node_modules/request/CHANGELOG.md
@@ -1,5 +1,33 @@
## Change Log
+### v2.54.0 (2015/03/24)
+- [#1501](https://github.com/request/request/pull/1501) HTTP Archive 1.2 support (@ahmadnassri)
+- [#1486](https://github.com/request/request/pull/1486) Add a test for the forever agent (@akshayp)
+- [#1500](https://github.com/request/request/pull/1500) Adding handling for no auth method and null bearer (@philberg)
+- [#1498](https://github.com/request/request/pull/1498) Add table of contents in readme (@simov)
+- [#1477](https://github.com/request/request/pull/1477) Add support for qs options via qsOptions key (@simov)
+- [#1496](https://github.com/request/request/pull/1496) Parameters encoded to base 64 should be decoded as UTF-8, not ASCII. (@albanm)
+- [#1494](https://github.com/request/request/pull/1494) Update eslint (@froatsnook)
+- [#1474](https://github.com/request/request/pull/1474) Require Colon in Basic Auth (@erykwalder)
+- [#1481](https://github.com/request/request/pull/1481) Fix baseUrl and redirections. (@burningtree)
+- [#1469](https://github.com/request/request/pull/1469) Feature/base url (@froatsnook)
+- [#1459](https://github.com/request/request/pull/1459) Add option to time request/response cycle (including rollup of redirects) (@aaron-em)
+- [#1468](https://github.com/request/request/pull/1468) Re-enable io.js/node 0.12 build (@simov, @BBB)
+- [#1442](https://github.com/request/request/pull/1442) Fixed the issue with strictSSL tests on 0.12 & io.js by explicitly setting a cipher that matches the cert. (@BBB, @nicolasmccurdy, @simov, @0x4139)
+- [#1460](https://github.com/request/request/pull/1460) localAddress or proxy config is lost when redirecting (@simov, @0x4139)
+- [#1453](https://github.com/request/request/pull/1453) Test on Node.js 0.12 and io.js with allowed failures (@nicolasmccurdy)
+- [#1426](https://github.com/request/request/pull/1426) Fixing tests to pass on io.js and node 0.12 (only test-https.js stiff failing) (@mikeal)
+- [#1446](https://github.com/request/request/pull/1446) Missing HTTP referer header with redirects Fixes #1038 (@simov, @guimonz)
+- [#1428](https://github.com/request/request/pull/1428) Deprecate Node v0.8.x (@nylen)
+- [#1436](https://github.com/request/request/pull/1436) Add ability to set a requester without setting default options (@tikotzky)
+- [#1435](https://github.com/request/request/pull/1435) dry up verb methods (@sethpollack)
+- [#1423](https://github.com/request/request/pull/1423) Allow fully qualified multipart content-type header (@simov)
+- [#1430](https://github.com/request/request/pull/1430) Fix recursive requester (@tikotzky)
+- [#1429](https://github.com/request/request/pull/1429) Throw error when making HEAD request with a body (@tikotzky)
+- [#1419](https://github.com/request/request/pull/1419) Add note that the project is broken in 0.12.x (@nylen)
+- [#1413](https://github.com/request/request/pull/1413) Fix basic auth (@simov)
+- [#1397](https://github.com/request/request/pull/1397) Improve pipe-from-file tests (@nylen)
+
### v2.53.0 (2015/02/02)
- [#1396](https://github.com/request/request/pull/1396) Do not rfc3986 escape JSON bodies (@nylen, @simov)
- [#1392](https://github.com/request/request/pull/1392) Improve `timeout` option description (@watson)
diff --git a/deps/npm/node_modules/request/README.md b/deps/npm/node_modules/request/README.md
index 8b668f99f7..2abc9e1714 100644
--- a/deps/npm/node_modules/request/README.md
+++ b/deps/npm/node_modules/request/README.md
@@ -1,15 +1,18 @@
-# Request — Simplified HTTP client
+
+# Request - Simplified HTTP client
+
[![npm package](https://nodei.co/npm/request.png?downloads=true&downloadRank=true&stars=true)](https://nodei.co/npm/request/)
-[![Build status](https://img.shields.io/travis/request/request.svg?style=flat)](https://travis-ci.org/request/request)
-[![Coverage](https://img.shields.io/coveralls/request/request.svg?style=flat)](https://coveralls.io/r/request/request)
-[![Gitter](https://img.shields.io/badge/gitter-join_chat-blue.svg?style=flat)](https://gitter.im/request/request?utm_source=badge)
+[![Build status](https://img.shields.io/travis/request/request.svg?style=flat-square)](https://travis-ci.org/request/request)
+[![Coverage](https://img.shields.io/coveralls/request/request.svg?style=flat-square)](https://coveralls.io/r/request/request)
+[![Gitter](https://img.shields.io/badge/gitter-join_chat-blue.svg?style=flat-square)](https://gitter.im/request/request?utm_source=badge)
+
## Super simple to use
Request is designed to be the simplest way possible to make http calls. It supports HTTPS and follows redirects by default.
-```javascript
+```js
var request = require('request');
request('http://www.google.com', function (error, response, body) {
if (!error && response.statusCode == 200) {
@@ -18,29 +21,52 @@ request('http://www.google.com', function (error, response, body) {
})
```
+
+## Table of contents
+
+- [Streaming](#streaming)
+- [Forms](#forms)
+- [HTTP Authentication](#http-authentication)
+- [Custom HTTP Headers](#custom-http-headers)
+- [OAuth Signing](#oauth-signing)
+- [Proxies](#proxies)
+- [Unix Domain Sockets](#unix-domain-sockets)
+- [TLS/SSL Protocol](#tlsssl-protocol)
+- [Support for HAR 1.2](#support-for-har-12)
+- [**All Available Options**](#requestoptions-callback)
+
+Request also offers [convenience methods](#convenience-methods) like
+`request.defaults` and `request.post`, and there are
+lots of [usage examples](#examples) and several
+[debugging techniques](#debugging).
+
+
+---
+
+
## Streaming
You can stream any response to a file stream.
-```javascript
+```js
request('http://google.com/doodle.png').pipe(fs.createWriteStream('doodle.png'))
```
You can also stream a file to a PUT or POST request. This method will also check the file extension against a mapping of file extensions to content-types (in this case `application/json`) and use the proper `content-type` in the PUT request (if the headers don’t already provide one).
-```javascript
+```js
fs.createReadStream('file.json').pipe(request.put('http://mysite.com/obj.json'))
```
Request can also `pipe` to itself. When doing so, `content-type` and `content-length` are preserved in the PUT headers.
-```javascript
+```js
request.get('http://google.com/img.png').pipe(request.put('http://mysite.com/img.png'))
```
Request emits a "response" event when a response is received. The `response` argument will be an instance of [http.IncomingMessage](http://nodejs.org/api/http.html#http_http_incomingmessage).
-```javascript
+```js
request
.get('http://google.com/img.png')
.on('response', function(response) {
@@ -52,7 +78,7 @@ request
To easily handle errors when streaming requests, listen to the `error` event before piping:
-```javascript
+```js
request
.get('http://mysite.com/doodle.png')
.on('error', function(err) {
@@ -63,7 +89,7 @@ request
Now let’s get fancy.
-```javascript
+```js
http.createServer(function (req, resp) {
if (req.url === '/doodle.png') {
if (req.method === 'PUT') {
@@ -77,7 +103,7 @@ http.createServer(function (req, resp) {
You can also `pipe()` from `http.ServerRequest` instances, as well as to `http.ServerResponse` instances. The HTTP method, headers, and entity-body data will be sent. Which means that, if you don't really care about security, you can do:
-```javascript
+```js
http.createServer(function (req, resp) {
if (req.url === '/doodle.png') {
var x = request('http://mysite.com/doodle.png')
@@ -89,13 +115,13 @@ http.createServer(function (req, resp) {
And since `pipe()` returns the destination stream in ≥ Node 0.5.x you can do one line proxying. :)
-```javascript
+```js
req.pipe(request('http://mysite.com/doodle.png')).pipe(resp)
```
Also, none of this new functionality conflicts with requests previous features, it just expands them.
-```javascript
+```js
var r = request.defaults({'proxy':'http://localproxy.com'})
http.createServer(function (req, resp) {
@@ -107,139 +133,22 @@ http.createServer(function (req, resp) {
You can still use intermediate proxies, the requests will still follow HTTP forwards, etc.
-## Proxies
-
-If you specify a `proxy` option, then the request (and any subsequent
-redirects) will be sent via a connection to the proxy server.
-
-If your endpoint is an `https` url, and you are using a proxy, then
-request will send a `CONNECT` request to the proxy server *first*, and
-then use the supplied connection to connect to the endpoint.
-
-That is, first it will make a request like:
-
-```
-HTTP/1.1 CONNECT endpoint-server.com:80
-Host: proxy-server.com
-User-Agent: whatever user agent you specify
-```
-
-and then the proxy server make a TCP connection to `endpoint-server`
-on port `80`, and return a response that looks like:
-
-```
-HTTP/1.1 200 OK
-```
-
-At this point, the connection is left open, and the client is
-communicating directly with the `endpoint-server.com` machine.
-
-See [the wikipedia page on HTTP Tunneling](http://en.wikipedia.org/wiki/HTTP_tunnel)
-for more information.
-
-By default, when proxying `http` traffic, request will simply make a
-standard proxied `http` request. This is done by making the `url`
-section of the initial line of the request a fully qualified url to
-the endpoint.
-
-For example, it will make a single request that looks like:
-
-```
-HTTP/1.1 GET http://endpoint-server.com/some-url
-Host: proxy-server.com
-Other-Headers: all go here
-
-request body or whatever
-```
-
-Because a pure "http over http" tunnel offers no additional security
-or other features, it is generally simpler to go with a
-straightforward HTTP proxy in this case. However, if you would like
-to force a tunneling proxy, you may set the `tunnel` option to `true`.
-
-You can also make a standard proxied `http` request by explicitly setting
-`tunnel : false`, but **note that this will allow the proxy to see the traffic
-to/from the destination server**.
-
-If you are using a tunneling proxy, you may set the
-`proxyHeaderWhiteList` to share certain headers with the proxy.
-
-You can also set the `proxyHeaderExclusiveList` to share certain
-headers only with the proxy and not with destination host.
-
-By default, this set is:
-
-```
-accept
-accept-charset
-accept-encoding
-accept-language
-accept-ranges
-cache-control
-content-encoding
-content-language
-content-length
-content-location
-content-md5
-content-range
-content-type
-connection
-date
-expect
-max-forwards
-pragma
-proxy-authorization
-referer
-te
-transfer-encoding
-user-agent
-via
-```
-
-Note that, when using a tunneling proxy, the `proxy-authorization`
-header and any headers from custom `proxyHeaderExclusiveList` are
-*never* sent to the endpoint server, but only to the proxy server.
-
-### Controlling proxy behaviour using environment variables
-
-The following environment variables are respected by `request`:
-
- * `HTTP_PROXY` / `http_proxy`
- * `HTTPS_PROXY` / `https_proxy`
- * `NO_PROXY` / `no_proxy`
+[back to top](#table-of-contents)
-When `HTTP_PROXY` / `http_proxy` are set, they will be used to proxy non-SSL requests that do not have an explicit `proxy` configuration option present. Similarly, `HTTPS_PROXY` / `https_proxy` will be respected for SSL requests that do not have an explicit `proxy` configuration option. It is valid to define a proxy in one of the environment variables, but then override it for a specific request, using the `proxy` configuration option. Furthermore, the `proxy` configuration option can be explicitly set to false / null to opt out of proxying altogether for that request.
-`request` is also aware of the `NO_PROXY`/`no_proxy` environment variables. These variables provide a granular way to opt out of proxying, on a per-host basis. It should contain a comma separated list of hosts to opt out of proxying. It is also possible to opt of proxying when a particular destination port is used. Finally, the variable may be set to `*` to opt out of the implicit proxy configuration of the other environment variables.
-
-Here's some examples of valid `no_proxy` values:
-
- * `google.com` - don't proxy HTTP/HTTPS requests to Google.
- * `google.com:443` - don't proxy HTTPS requests to Google, but *do* proxy HTTP requests to Google.
- * `google.com:443, yahoo.com:80` - don't proxy HTTPS requests to Google, and don't proxy HTTP requests to Yahoo!
- * `*` - ignore `https_proxy`/`http_proxy` environment variables altogether.
-
-## UNIX Socket
-
-`request` supports making requests to [UNIX Domain Sockets](http://en.wikipedia.org/wiki/Unix_domain_socket). To make one, use the following URL scheme:
-
-```javascript
-/* Pattern */ 'http://unix:SOCKET:PATH'
-/* Example */ request.get('http://unix:/absolute/path/to/unix.socket:/request/path')
-```
-
-Note: The `SOCKET` path is assumed to be absolute to the root of the host file system.
+---
## Forms
`request` supports `application/x-www-form-urlencoded` and `multipart/form-data` form uploads. For `multipart/related` refer to the `multipart` API.
+
#### application/x-www-form-urlencoded (URL-Encoded Forms)
URL-encoded forms are simple.
-```javascript
+```js
request.post('http://service.com/upload', {form:{key:'value'}})
// or
request.post('http://service.com/upload').form({key:'value'})
@@ -247,12 +156,13 @@ request.post('http://service.com/upload').form({key:'value'})
request.post({url:'http://service.com/upload', form: {key:'value'}}, function(err,httpResponse,body){ /* ... */ })
```
+
#### multipart/form-data (Multipart Form Uploads)
For `multipart/form-data` we use the [form-data](https://github.com/felixge/node-form-data) library by [@felixge](https://github.com/felixge). For the most cases, you can pass your upload form data via the `formData` option.
-```javascript
+```js
var formData = {
// Pass a simple key-value pair
my_field: 'my_value',
@@ -286,7 +196,7 @@ request.post({url:'http://service.com/upload', formData: formData}, function opt
For advanced cases, you can access the form-data object itself via `r.form()`. This can be modified until the request is fired on the next cycle of the event-loop. (Note that this calling `form()` will clear the currently set form data for that request.)
-```javascript
+```js
// NOTE: Advanced use-case, for normal use see 'formData' usage above
var r = request.post('http://service.com/upload', function optionalCallback(err, httpResponse, body) { // ...
@@ -297,11 +207,12 @@ form.append('custom_file', fs.createReadStream(__dirname + '/unicycle.jpg'), {fi
```
See the [form-data README](https://github.com/felixge/node-form-data) for more information & examples.
+
#### multipart/related
Some variations in different HTTP implementations require a newline/CRLF before, after, or both before and after the boundary of a `multipart/related` request (using the multipart option). This has been observed in the .NET WebAPI version 4.0. You can turn on a boundary preambleCRLF or postamble by passing them as `true` to your request options.
-```javascript
+```js
request({
method: 'PUT',
preambleCRLF: true,
@@ -335,10 +246,15 @@ Some variations in different HTTP implementations require a newline/CRLF before,
})
```
+[back to top](#table-of-contents)
+
+
+---
+
## HTTP Authentication
-```javascript
+```js
request.get('http://some.server.com/').auth('username', 'password', false);
// or
request.get('http://some.server.com/', {
@@ -378,7 +294,7 @@ Note that you can also specify basic authentication using the URL itself, as
detailed in [RFC 1738](http://www.ietf.org/rfc/rfc1738.txt). Simply pass the
`user:password` before the host with an `@` sign:
-```javascript
+```js
var username = 'username',
password = 'password',
url = 'http://' + username + ':' + password + '@some.server.com';
@@ -398,13 +314,53 @@ available. The value may be either a `String` or a `Function` returning a
used in conjuction with `defaults` to allow a single function to supply the
last known token at the time of sending a request, or to compute one on the fly.
+[back to top](#table-of-contents)
+
+
+---
+
+
+## Custom HTTP Headers
+
+HTTP Headers, such as `User-Agent`, can be set in the `options` object.
+In the example below, we call the github API to find out the number
+of stars and forks for the request repository. This requires a
+custom `User-Agent` header as well as https.
+
+```js
+var request = require('request');
+
+var options = {
+ url: 'https://api.github.com/repos/request/request',
+ headers: {
+ 'User-Agent': 'request'
+ }
+};
+
+function callback(error, response, body) {
+ if (!error && response.statusCode == 200) {
+ var info = JSON.parse(body);
+ console.log(info.stargazers_count + " Stars");
+ console.log(info.forks_count + " Forks");
+ }
+}
+
+request(options, callback);
+```
+
+[back to top](#table-of-contents)
+
+
+---
+
+
## OAuth Signing
[OAuth version 1.0](https://tools.ietf.org/html/rfc5849) is supported. The
default signing algorithm is
[HMAC-SHA1](https://tools.ietf.org/html/rfc5849#section-3.4.2):
-```javascript
+```js
// OAuth1.0 - 3-legged server side flow (Twitter example)
// step 1
var qs = require('querystring')
@@ -478,33 +434,147 @@ section of the oauth1 spec:
options object.
* `transport_method` defaults to `'header'`
-## Custom HTTP Headers
+[back to top](#table-of-contents)
-HTTP Headers, such as `User-Agent`, can be set in the `options` object.
-In the example below, we call the github API to find out the number
-of stars and forks for the request repository. This requires a
-custom `User-Agent` header as well as https.
-```javascript
-var request = require('request');
+---
-var options = {
- url: 'https://api.github.com/repos/request/request',
- headers: {
- 'User-Agent': 'request'
- }
-};
-function callback(error, response, body) {
- if (!error && response.statusCode == 200) {
- var info = JSON.parse(body);
- console.log(info.stargazers_count + " Stars");
- console.log(info.forks_count + " Forks");
- }
-}
+## Proxies
+
+If you specify a `proxy` option, then the request (and any subsequent
+redirects) will be sent via a connection to the proxy server.
+
+If your endpoint is an `https` url, and you are using a proxy, then
+request will send a `CONNECT` request to the proxy server *first*, and
+then use the supplied connection to connect to the endpoint.
+
+That is, first it will make a request like:
-request(options, callback);
```
+HTTP/1.1 CONNECT endpoint-server.com:80
+Host: proxy-server.com
+User-Agent: whatever user agent you specify
+```
+
+and then the proxy server make a TCP connection to `endpoint-server`
+on port `80`, and return a response that looks like:
+
+```
+HTTP/1.1 200 OK
+```
+
+At this point, the connection is left open, and the client is
+communicating directly with the `endpoint-server.com` machine.
+
+See [the wikipedia page on HTTP Tunneling](http://en.wikipedia.org/wiki/HTTP_tunnel)
+for more information.
+
+By default, when proxying `http` traffic, request will simply make a
+standard proxied `http` request. This is done by making the `url`
+section of the initial line of the request a fully qualified url to
+the endpoint.
+
+For example, it will make a single request that looks like:
+
+```
+HTTP/1.1 GET http://endpoint-server.com/some-url
+Host: proxy-server.com
+Other-Headers: all go here
+
+request body or whatever
+```
+
+Because a pure "http over http" tunnel offers no additional security
+or other features, it is generally simpler to go with a
+straightforward HTTP proxy in this case. However, if you would like
+to force a tunneling proxy, you may set the `tunnel` option to `true`.
+
+You can also make a standard proxied `http` request by explicitly setting
+`tunnel : false`, but **note that this will allow the proxy to see the traffic
+to/from the destination server**.
+
+If you are using a tunneling proxy, you may set the
+`proxyHeaderWhiteList` to share certain headers with the proxy.
+
+You can also set the `proxyHeaderExclusiveList` to share certain
+headers only with the proxy and not with destination host.
+
+By default, this set is:
+
+```
+accept
+accept-charset
+accept-encoding
+accept-language
+accept-ranges
+cache-control
+content-encoding
+content-language
+content-length
+content-location
+content-md5
+content-range
+content-type
+connection
+date
+expect
+max-forwards
+pragma
+proxy-authorization
+referer
+te
+transfer-encoding
+user-agent
+via
+```
+
+Note that, when using a tunneling proxy, the `proxy-authorization`
+header and any headers from custom `proxyHeaderExclusiveList` are
+*never* sent to the endpoint server, but only to the proxy server.
+
+
+### Controlling proxy behaviour using environment variables
+
+The following environment variables are respected by `request`:
+
+ * `HTTP_PROXY` / `http_proxy`
+ * `HTTPS_PROXY` / `https_proxy`
+ * `NO_PROXY` / `no_proxy`
+
+When `HTTP_PROXY` / `http_proxy` are set, they will be used to proxy non-SSL requests that do not have an explicit `proxy` configuration option present. Similarly, `HTTPS_PROXY` / `https_proxy` will be respected for SSL requests that do not have an explicit `proxy` configuration option. It is valid to define a proxy in one of the environment variables, but then override it for a specific request, using the `proxy` configuration option. Furthermore, the `proxy` configuration option can be explicitly set to false / null to opt out of proxying altogether for that request.
+
+`request` is also aware of the `NO_PROXY`/`no_proxy` environment variables. These variables provide a granular way to opt out of proxying, on a per-host basis. It should contain a comma separated list of hosts to opt out of proxying. It is also possible to opt of proxying when a particular destination port is used. Finally, the variable may be set to `*` to opt out of the implicit proxy configuration of the other environment variables.
+
+Here's some examples of valid `no_proxy` values:
+
+ * `google.com` - don't proxy HTTP/HTTPS requests to Google.
+ * `google.com:443` - don't proxy HTTPS requests to Google, but *do* proxy HTTP requests to Google.
+ * `google.com:443, yahoo.com:80` - don't proxy HTTPS requests to Google, and don't proxy HTTP requests to Yahoo!
+ * `*` - ignore `https_proxy`/`http_proxy` environment variables altogether.
+
+[back to top](#table-of-contents)
+
+
+---
+
+
+## UNIX Domain Sockets
+
+`request` supports making requests to [UNIX Domain Sockets](http://en.wikipedia.org/wiki/Unix_domain_socket). To make one, use the following URL scheme:
+
+```js
+/* Pattern */ 'http://unix:SOCKET:PATH'
+/* Example */ request.get('http://unix:/absolute/path/to/unix.socket:/request/path')
+```
+
+Note: The `SOCKET` path is assumed to be absolute to the root of the host file system.
+
+[back to top](#table-of-contents)
+
+
+---
+
## TLS/SSL Protocol
@@ -513,7 +583,7 @@ set in the `agentOptions` property of the `options` object.
In the example below, we call an API requires client side SSL certificate
(in PEM format) with passphrase protected private key (in PEM format) and disable the SSLv3 protocol:
-```javascript
+```js
var fs = require('fs')
, path = require('path')
, certFile = path.resolve(__dirname, 'ssl/client.crt')
@@ -537,7 +607,7 @@ request.get(options);
It is able to force using SSLv3 only by specifying `secureProtocol`:
-```javascript
+```js
request.get({
url: 'https://api.some-server.com/',
agentOptions: {
@@ -550,7 +620,7 @@ It is possible to accept other certificates than those signed by generally allow
This can be useful, for example, when using self-signed certificates.
To allow a different certificate, you can specify the signing CA by adding the contents of the CA's certificate file to the `agentOptions`:
-```javascript
+```js
request.get({
url: 'https://api.some-server.com/',
agentOptions: {
@@ -559,73 +629,155 @@ request.get({
});
```
+[back to top](#table-of-contents)
+
+
+---
+
+## Support for HAR 1.2
+
+The `options.har` property will override the values: `url`, `method`, `qs`, `headers`, `form`, `formData`, `body`, `json`, as well as construct multipart data and read files from disk when `request.postData.params[].fileName` is present without a matching `value`.
+
+a validation step will check if the HAR Request format matches the latest spec (v1.2) and will skip parsing if not matching.
+
+```js
+ var request = require('request')
+ request({
+ // will be ignored
+ method: 'GET'
+ uri: 'http://www.google.com',
+
+ // HTTP Archive Request Object
+ har: {
+ url: 'http://www.mockbin.com/har'
+ method: 'POST',
+ headers: [
+ {
+ name: 'content-type',
+ value: 'application/x-www-form-urlencoded'
+ }
+ ],
+ postData: {
+ mimeType: 'application/x-www-form-urlencoded',
+ params: [
+ {
+ name: 'foo',
+ value: 'bar'
+ },
+ {
+ name: 'hello',
+ value: 'world'
+ }
+ ]
+ }
+ }
+ })
+
+ // a POST request will be sent to http://www.mockbin.com
+ // with body an application/x-www-form-urlencoded body:
+ // foo=bar&hello=world
+```
+
+[back to top](#table-of-contents)
+
+
+---
+
## request(options, callback)
The first argument can be either a `url` or an `options` object. The only required option is `uri`; all others are optional.
-* `uri` || `url` - fully qualified uri or a parsed url object from `url.parse()`
-* `qs` - object containing querystring values to be appended to the `uri`
-* `useQuerystring` - If true, use `querystring` to stringify and parse
+- `uri` || `url` - fully qualified uri or a parsed url object from `url.parse()`
+- `baseUrl` - fully qualified uri string used as the base url. Most useful with `request.defaults`, for example when you want to do many requests to the same domain. If `baseUrl` is `https://example.com/api/`, then requesting `/end/point?test=true` will fetch `https://example.com/api/end/point?test=true`. When `baseUrl` is given, `uri` must also be a string.
+- `method` - http method (default: `"GET"`)
+- `headers` - http headers (default: `{}`)
+
+---
+
+- `qs` - object containing querystring values to be appended to the `uri`
+- `qsParseOptions` - object containing options to pass to the [qs.parse](https://github.com/hapijs/qs#parsing-objects) method or [querystring.parse](https://nodejs.org/docs/v0.12.0/api/querystring.html#querystring_querystring_parse_str_sep_eq_options) method
+- `qsStringifyOptions` - object containing options to pass to the [qs.stringify](https://github.com/hapijs/qs#stringifying) method or to the [querystring.stringify](https://nodejs.org/docs/v0.12.0/api/querystring.html#querystring_querystring_stringify_obj_sep_eq_options) method. For example, to change the way arrays are converted to query strings pass the `arrayFormat` option with one of `indices|brackets|repeat`
+- `useQuerystring` - If true, use `querystring` to stringify and parse
querystrings, otherwise use `qs` (default: `false`). Set this option to
`true` if you need arrays to be serialized as `foo=bar&foo=baz` instead of the
default `foo[0]=bar&foo[1]=baz`.
-* `method` - http method (default: `"GET"`)
-* `headers` - http headers (default: `{}`)
-* `body` - entity body for PATCH, POST and PUT requests. Must be a `Buffer` or `String`, unless `json` is `true`. If `json` is `true`, then `body` must be a JSON-serializable object.
-* `form` - when passed an object or a querystring, this sets `body` to a querystring representation of value, and adds `Content-type: application/x-www-form-urlencoded` header. When passed no options, a `FormData` instance is returned (and is piped to request). See "Forms" section above.
-* `formData` - Data to pass for a `multipart/form-data` request. See
+
+---
+
+- `body` - entity body for PATCH, POST and PUT requests. Must be a `Buffer` or `String`, unless `json` is `true`. If `json` is `true`, then `body` must be a JSON-serializable object.
+- `form` - when passed an object or a querystring, this sets `body` to a querystring representation of value, and adds `Content-type: application/x-www-form-urlencoded` header. When passed no options, a `FormData` instance is returned (and is piped to request). See "Forms" section above.
+- `formData` - Data to pass for a `multipart/form-data` request. See
[Forms](#forms) section above.
-* `multipart` - array of objects which contain their own headers and `body`
+- `multipart` - array of objects which contain their own headers and `body`
attributes. Sends a `multipart/related` request. See [Forms](#forms) section
above.
- * Alternatively you can pass in an object `{chunked: false, data: []}` where
+ - Alternatively you can pass in an object `{chunked: false, data: []}` where
`chunked` is used to specify whether the request is sent in
[chunked transfer encoding](https://en.wikipedia.org/wiki/Chunked_transfer_encoding)
In non-chunked requests, data items with body streams are not allowed.
-* `auth` - A hash containing values `user` || `username`, `pass` || `password`, and `sendImmediately` (optional). See documentation above.
-* `json` - sets `body` but to JSON representation of value and adds `Content-type: application/json` header. Additionally, parses the response body as JSON.
-* `jsonReviver` - a [reviver function](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse) that will be passed to `JSON.parse()` when parsing a JSON response body.
-* `preambleCRLF` - append a newline/CRLF before the boundary of your `multipart/form-data` request.
-* `postambleCRLF` - append a newline/CRLF at the end of the boundary of your `multipart/form-data` request.
-* `followRedirect` - follow HTTP 3xx responses as redirects (default: `true`). This property can also be implemented as function which gets `response` object as a single argument and should return `true` if redirects should continue or `false` otherwise.
-* `followAllRedirects` - follow non-GET HTTP 3xx responses as redirects (default: `false`)
-* `maxRedirects` - the maximum number of redirects to follow (default: `10`)
-* `encoding` - Encoding to be used on `setEncoding` of response data. If `null`, the `body` is returned as a `Buffer`. Anything else **(including the default value of `undefined`)** will be passed as the [encoding](http://nodejs.org/api/buffer.html#buffer_buffer) parameter to `toString()` (meaning this is effectively `utf8` by default).
-* `pool` - An object describing which agents to use for the request. If this option is omitted the request will use the global agent (as long as [your options allow for it](request.js#L747)). Otherwise, request will search the pool for your custom agent. If no custom agent is found, a new agent will be created and added to the pool.
- * A `maxSockets` property can also be provided on the `pool` object to set the max number of sockets for all agents created (ex: `pool: {maxSockets: Infinity}`).
- * Note that if you are sending multiple requests in a loop and creating
+- `preambleCRLF` - append a newline/CRLF before the boundary of your `multipart/form-data` request.
+- `postambleCRLF` - append a newline/CRLF at the end of the boundary of your `multipart/form-data` request.
+- `json` - sets `body` but to JSON representation of value and adds `Content-type: application/json` header. Additionally, parses the response body as JSON.
+- `jsonReviver` - a [reviver function](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/parse) that will be passed to `JSON.parse()` when parsing a JSON response body.
+
+---
+
+- `auth` - A hash containing values `user` || `username`, `pass` || `password`, and `sendImmediately` (optional). See documentation above.
+- `oauth` - Options for OAuth HMAC-SHA1 signing. See documentation above.
+- `hawk` - Options for [Hawk signing](https://github.com/hueniverse/hawk). The `credentials` key must contain the necessary signing info, [see hawk docs for details](https://github.com/hueniverse/hawk#usage-example).
+- `aws` - `object` containing AWS signing information. Should have the properties `key`, `secret`. Also requires the property `bucket`, unless you’re specifying your `bucket` as part of the path, or the request doesn’t use a bucket (i.e. GET Services)
+- `httpSignature` - Options for the [HTTP Signature Scheme](https://github.com/joyent/node-http-signature/blob/master/http_signing.md) using [Joyent's library](https://github.com/joyent/node-http-signature). The `keyId` and `key` properties must be specified. See the docs for other options.
+
+---
+
+- `followRedirect` - follow HTTP 3xx responses as redirects (default: `true`). This property can also be implemented as function which gets `response` object as a single argument and should return `true` if redirects should continue or `false` otherwise.
+- `followAllRedirects` - follow non-GET HTTP 3xx responses as redirects (default: `false`)
+- `maxRedirects` - the maximum number of redirects to follow (default: `10`)
+
+---
+
+- `encoding` - Encoding to be used on `setEncoding` of response data. If `null`, the `body` is returned as a `Buffer`. Anything else **(including the default value of `undefined`)** will be passed as the [encoding](http://nodejs.org/api/buffer.html#buffer_buffer) parameter to `toString()` (meaning this is effectively `utf8` by default).
+- `gzip` - If `true`, add an `Accept-Encoding` header to request compressed content encodings from the server (if not already present) and decode supported content encodings in the response. **Note:** Automatic decoding of the response content is performed on the body data returned through `request` (both through the `request` stream and passed to the callback function) but is not performed on the `response` stream (available from the `response` event) which is the unmodified `http.IncomingMessage` object which may contain compressed data. See example below.
+- `jar` - If `true` and `tough-cookie` is installed, remember cookies for future use (or define your custom cookie jar; see examples section)
+
+---
+
+- `pool` - An object describing which agents to use for the request. If this option is omitted the request will use the global agent (as long as [your options allow for it](request.js#L747)). Otherwise, request will search the pool for your custom agent. If no custom agent is found, a new agent will be created and added to the pool.
+ - A `maxSockets` property can also be provided on the `pool` object to set the max number of sockets for all agents created (ex: `pool: {maxSockets: Infinity}`).
+ - Note that if you are sending multiple requests in a loop and creating
multiple new `pool` objects, `maxSockets` will not work as intended. To
work around this, either use [`request.defaults`](#requestdefaultsoptions)
with your pool options or create the pool object with the `maxSockets`
property outside of the loop.
-* `timeout` - Integer containing the number of milliseconds to wait for a
+- `timeout` - Integer containing the number of milliseconds to wait for a
request to respond before aborting the request. Note that if the underlying
TCP connection cannot be established, the OS-wide TCP connection timeout will
overrule the `timeout` option ([the default in Linux is around 20 seconds](http://www.sekuda.com/overriding_the_default_linux_kernel_20_second_tcp_socket_connect_timeout)).
-* `proxy` - An HTTP proxy to be used. Supports proxy Auth with Basic Auth, identical to support for the `url` parameter (by embedding the auth info in the `uri`)
-* `oauth` - Options for OAuth HMAC-SHA1 signing. See documentation above.
-* `hawk` - Options for [Hawk signing](https://github.com/hueniverse/hawk). The `credentials` key must contain the necessary signing info, [see hawk docs for details](https://github.com/hueniverse/hawk#usage-example).
-* `strictSSL` - If `true`, requires SSL certificates be valid. **Note:** to use your own certificate authority, you need to specify an agent that was created with that CA as an option.
-* `agentOptions` - Object containing user agent options. See documentation above. **Note:** [see tls API doc for TLS/SSL options](http://nodejs.org/api/tls.html#tls_tls_connect_options_callback).
-
-* `jar` - If `true` and `tough-cookie` is installed, remember cookies for future use (or define your custom cookie jar; see examples section)
-* `aws` - `object` containing AWS signing information. Should have the properties `key`, `secret`. Also requires the property `bucket`, unless you’re specifying your `bucket` as part of the path, or the request doesn’t use a bucket (i.e. GET Services)
-* `httpSignature` - Options for the [HTTP Signature Scheme](https://github.com/joyent/node-http-signature/blob/master/http_signing.md) using [Joyent's library](https://github.com/joyent/node-http-signature). The `keyId` and `key` properties must be specified. See the docs for other options.
-* `localAddress` - Local interface to bind for network connections.
-* `gzip` - If `true`, add an `Accept-Encoding` header to request compressed content encodings from the server (if not already present) and decode supported content encodings in the response. **Note:** Automatic decoding of the response content is performed on the body data returned through `request` (both through the `request` stream and passed to the callback function) but is not performed on the `response` stream (available from the `response` event) which is the unmodified `http.IncomingMessage` object which may contain compressed data. See example below.
-* `tunnel` - controls the behavior of
+- `localAddress` - Local interface to bind for network connections.
+- `proxy` - An HTTP proxy to be used. Supports proxy Auth with Basic Auth, identical to support for the `url` parameter (by embedding the auth info in the `uri`)
+- `strictSSL` - If `true`, requires SSL certificates be valid. **Note:** to use your own certificate authority, you need to specify an agent that was created with that CA as an option.
+- `agentOptions` - Object containing user agent options. See documentation above. **Note:** [see tls API doc for TLS/SSL options](http://nodejs.org/api/tls.html#tls_tls_connect_options_callback).
+- `tunnel` - controls the behavior of
[HTTP `CONNECT` tunneling](https://en.wikipedia.org/wiki/HTTP_tunnel#HTTP_CONNECT_tunneling)
as follows:
- * `undefined` (default) - `true` if the destination is `https` or a previous
+ - `undefined` (default) - `true` if the destination is `https` or a previous
request in the redirect chain used a tunneling proxy, `false` otherwise
- * `true` - always tunnel to the destination by making a `CONNECT` request to
+ - `true` - always tunnel to the destination by making a `CONNECT` request to
the proxy
- * `false` - request the destination as a `GET` request.
-* `proxyHeaderWhiteList` - A whitelist of headers to send to a
+ - `false` - request the destination as a `GET` request.
+- `proxyHeaderWhiteList` - A whitelist of headers to send to a
tunneling proxy.
-* `proxyHeaderExclusiveList` - A whitelist of headers to send
+- `proxyHeaderExclusiveList` - A whitelist of headers to send
exclusively to a tunneling proxy and not to destination.
+- `removeRefererHeader` - removes the referer header when a redirect happens (default: `false`).
+
+---
+
+- `time` - If `true`, the request-response cycle (including all redirects) is timed at millisecond resolution, and the result provided on the response's `elapsedTime` property.
+---
+
+- `har` - A [HAR 1.2 Request Object](http://www.softwareishard.com/blog/har-12-spec/#request), will be processed from HAR format into options overwriting matching values *(see the [HAR 1.2 section](#support-for-har-1.2) for details)*
The callback argument gets 3 arguments:
@@ -633,10 +785,16 @@ The callback argument gets 3 arguments:
2. An [`http.IncomingMessage`](http://nodejs.org/api/http.html#http_http_incomingmessage) object
3. The third is the `response` body (`String` or `Buffer`, or JSON object if the `json` option is supplied)
+[back to top](#table-of-contents)
+
+
+---
+
## Convenience methods
There are also shorthand methods for different HTTP METHODs and some other conveniences.
+
### request.defaults(options)
This method **returns a wrapper** around the normal request API that defaults
@@ -649,7 +807,7 @@ instead, it **returns a wrapper** that has your default settings applied to it.
`request.defaults` to add/override defaults that were previously defaulted.
For example:
-```javascript
+```js
//requests using baseRequest() will set the 'x-token' header
var baseRequest = request.defaults({
headers: {x-token: 'my-token'}
@@ -666,7 +824,7 @@ var specialRequest = baseRequest.defaults({
Same as `request()`, but defaults to `method: "PUT"`.
-```javascript
+```js
request.put(url)
```
@@ -674,7 +832,7 @@ request.put(url)
Same as `request()`, but defaults to `method: "PATCH"`.
-```javascript
+```js
request.patch(url)
```
@@ -682,7 +840,7 @@ request.patch(url)
Same as `request()`, but defaults to `method: "POST"`.
-```javascript
+```js
request.post(url)
```
@@ -690,7 +848,7 @@ request.post(url)
Same as `request()`, but defaults to `method: "HEAD"`.
-```javascript
+```js
request.head(url)
```
@@ -698,7 +856,7 @@ request.head(url)
Same as `request()`, but defaults to `method: "DELETE"`.
-```javascript
+```js
request.del(url)
```
@@ -706,28 +864,52 @@ request.del(url)
Same as `request()` (for uniformity).
-```javascript
+```js
request.get(url)
```
### request.cookie
Function that creates a new cookie.
-```javascript
+```js
request.cookie('key1=value1')
```
### request.jar()
Function that creates a new cookie jar.
-```javascript
+```js
request.jar()
```
+[back to top](#table-of-contents)
+
+
+---
+
+
+## Debugging
+
+There are at least three ways to debug the operation of `request`:
+
+1. Launch the node process like `NODE_DEBUG=request node script.js`
+ (`lib,request,otherlib` works too).
+
+2. Set `require('request').debug = true` at any time (this does the same thing
+ as #1).
+
+3. Use the [request-debug module](https://github.com/nylen/request-debug) to
+ view request and response headers and bodies.
+
+[back to top](#table-of-contents)
+
+
+---
+
## Examples:
-```javascript
+```js
var request = require('request')
, rand = Math.floor(Math.random()*100000000).toString()
;
@@ -758,7 +940,7 @@ that the body data passed through `request` is automatically decompressed
while the response object is unmodified and will contain compressed data if
the server sent a compressed response.
-```javascript
+```js
var request = require('request')
request(
{ method: 'GET'
@@ -785,7 +967,7 @@ the server sent a compressed response.
Cookies are disabled by default (else, they would be used in subsequent requests). To enable cookies, set `jar` to `true` (either in `defaults` or `options`) and install `tough-cookie`.
-```javascript
+```js
var request = request.defaults({jar: true})
request('http://www.google.com', function () {
request('http://images.google.com')
@@ -794,7 +976,7 @@ request('http://www.google.com', function () {
To use a custom cookie jar (instead of `request`’s global cookie jar), set `jar` to an instance of `request.jar()` (either in `defaults` or `options`)
-```javascript
+```js
var j = request.jar()
var request = request.defaults({jar:j})
request('http://www.google.com', function () {
@@ -804,7 +986,7 @@ request('http://www.google.com', function () {
OR
-```javascript
+```js
var j = request.jar();
var cookie = request.cookie('key1=value1');
var url = 'http://www.google.com';
@@ -819,7 +1001,7 @@ To use a custom cookie store (such as a
which supports saving to and restoring from JSON files), pass it as a parameter
to `request.jar()`:
-```javascript
+```js
var FileCookieStore = require('tough-cookie-filestore');
// NOTE - currently the 'cookies.json' file must already exist!
var j = request.jar(new FileCookieStore('cookies.json'));
@@ -837,7 +1019,7 @@ for details.
To inspect your cookie jar after a request:
-```javascript
+```js
var j = request.jar()
request({url: 'http://www.google.com', jar: j}, function () {
var cookie_string = j.getCookieString(uri); // "key1=value1; key2=value2; ..."
@@ -846,15 +1028,4 @@ request({url: 'http://www.google.com', jar: j}, function () {
})
```
-## Debugging
-
-There are at least three ways to debug the operation of `request`:
-
-1. Launch the node process like `NODE_DEBUG=request node script.js`
- (`lib,request,otherlib` works too).
-
-2. Set `require('request').debug = true` at any time (this does the same thing
- as #1).
-
-3. Use the [request-debug module](https://github.com/nylen/request-debug) to
- view request and response headers and bodies.
+[back to top](#table-of-contents)
diff --git a/deps/npm/node_modules/request/index.js b/deps/npm/node_modules/request/index.js
index 3581b83b46..f8b35150e4 100755
--- a/deps/npm/node_modules/request/index.js
+++ b/deps/npm/node_modules/request/index.js
@@ -47,56 +47,23 @@ function request (uri, options, callback) {
options.callback = params.callback
options.uri = params.uri
- return new request.Request(options)
-}
-
-function requester(params) {
- if(typeof params.options._requester === 'function') {
- return params.options._requester
- }
- return request
-}
-
-request.get = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'GET'
- return requester(params)(params.uri || null, params.options, params.callback)
-}
-
-request.head = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'HEAD'
-
- if (paramsHaveRequestBody(params)) {
+ if (params.options.method === 'HEAD' && paramsHaveRequestBody(params)) {
throw new Error('HTTP HEAD requests MUST NOT include a request body.')
}
- return requester(params)(params.uri || null, params.options, params.callback)
-}
-
-request.post = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'POST'
- return requester(params)(params.uri || null, params.options, params.callback)
+ return new request.Request(options)
}
-request.put = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'PUT'
- return requester(params)(params.uri || null, params.options, params.callback)
-}
+var verbs = ['get', 'head', 'post', 'put', 'patch', 'del']
-request.patch = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'PATCH'
- return requester(params)(params.uri || null, params.options, params.callback)
-}
-
-request.del = function (uri, options, callback) {
- var params = initParams(uri, options, callback)
- params.options.method = 'DELETE'
- return requester(params)(params.uri || null, params.options, params.callback)
-}
+verbs.forEach(function(verb){
+ var method = verb === 'del' ? 'DELETE' : verb.toUpperCase()
+ request[verb] = function(uri, options, callback){
+ var params = initParams(uri, options, callback)
+ params.options.method = method
+ return this(params.uri || null, params.options, params.callback)
+ }
+})
request.jar = function (store) {
return cookies.jar(store)
@@ -107,6 +74,12 @@ request.cookie = function (str) {
}
request.defaults = function (options, requester) {
+
+ if (typeof options === 'function') {
+ requester = options
+ options = {}
+ }
+
var self = this
var wrap = function (method) {
var headerlessOptions = function (options) {
@@ -131,11 +104,7 @@ request.defaults = function (options, requester) {
}
if (isFunction(requester)) {
- if (method === self) {
- method = requester
- } else {
- params.options._requester = requester
- }
+ method = requester
}
return method(params.options, params.callback)
@@ -143,13 +112,13 @@ request.defaults = function (options, requester) {
}
var defaults = wrap(self)
- defaults.get = wrap(self.get)
- defaults.patch = wrap(self.patch)
- defaults.post = wrap(self.post)
- defaults.put = wrap(self.put)
- defaults.head = wrap(self.head)
- defaults.del = wrap(self.del)
- defaults.cookie = wrap(self.cookie)
+ defaults.get = self.get
+ defaults.patch = self.patch
+ defaults.post = self.post
+ defaults.put = self.put
+ defaults.head = self.head
+ defaults.del = self.del
+ defaults.cookie = self.cookie
defaults.jar = self.jar
defaults.defaults = self.defaults
return defaults
diff --git a/deps/npm/node_modules/request/lib/auth.js b/deps/npm/node_modules/request/lib/auth.js
index abe6274536..13c3ac8f3c 100644
--- a/deps/npm/node_modules/request/lib/auth.js
+++ b/deps/npm/node_modules/request/lib/auth.js
@@ -8,8 +8,9 @@ var md5 = helpers.md5
, toBase64 = helpers.toBase64
-function Auth () {
+function Auth (request) {
// define all public properties here
+ this.request = request
this.hasAuth = false
this.sentAuth = false
this.bearerToken = null
@@ -25,7 +26,7 @@ Auth.prototype.basic = function (user, pass, sendImmediately) {
self.user = user
self.pass = pass
self.hasAuth = true
- var header = typeof pass !== 'undefined' ? user + ':' + pass : user
+ var header = user + ':' + (pass || '')
if (sendImmediately || typeof sendImmediately === 'undefined') {
var authHeader = 'Basic ' + toBase64(header)
self.sentAuth = true
@@ -41,7 +42,7 @@ Auth.prototype.bearer = function (bearer, sendImmediately) {
if (typeof bearer === 'function') {
bearer = bearer()
}
- var authHeader = 'Bearer ' + bearer
+ var authHeader = 'Bearer ' + (bearer || '')
self.sentAuth = true
return authHeader
}
@@ -108,11 +109,30 @@ Auth.prototype.digest = function (method, path, authHeader) {
return authHeader
}
-Auth.prototype.response = function (method, path, headers) {
+Auth.prototype.onRequest = function (user, pass, sendImmediately, bearer) {
var self = this
+ , request = self.request
+
+ var authHeader
+ if (bearer === undefined && user === undefined) {
+ throw new Error('no auth mechanism defined')
+ } else if (bearer !== undefined) {
+ authHeader = self.bearer(bearer, sendImmediately)
+ } else {
+ authHeader = self.basic(user, pass, sendImmediately)
+ }
+ if (authHeader) {
+ request.setHeader('authorization', authHeader)
+ }
+}
+
+Auth.prototype.onResponse = function (response) {
+ var self = this
+ , request = self.request
+
if (!self.hasAuth || self.sentAuth) { return null }
- var c = caseless(headers)
+ var c = caseless(response.headers)
var authHeader = c.get('www-authenticate')
var authVerb = authHeader && authHeader.split(' ')[0].toLowerCase()
@@ -126,7 +146,7 @@ Auth.prototype.response = function (method, path, headers) {
return self.bearer(self.bearerToken, true)
case 'digest':
- return self.digest(method, path, authHeader)
+ return self.digest(request.method, request.path, authHeader)
}
}
diff --git a/deps/npm/node_modules/request/lib/getProxyFromURI.js b/deps/npm/node_modules/request/lib/getProxyFromURI.js
index 0e54767f54..c2013a6e12 100644
--- a/deps/npm/node_modules/request/lib/getProxyFromURI.js
+++ b/deps/npm/node_modules/request/lib/getProxyFromURI.js
@@ -49,7 +49,7 @@ function getProxyFromURI(uri) {
if (noProxy === '*') {
return null
}
-
+
// if the noProxy is not empty and the uri is found return null
if (noProxy !== '' && uriInNoProxy(uri, noProxy)) {
@@ -62,7 +62,7 @@ function getProxyFromURI(uri) {
return process.env.HTTP_PROXY ||
process.env.http_proxy || null
}
-
+
if (uri.protocol === 'https:') {
return process.env.HTTPS_PROXY ||
process.env.https_proxy ||
diff --git a/deps/npm/node_modules/request/lib/har.js b/deps/npm/node_modules/request/lib/har.js
new file mode 100644
index 0000000000..83453a3274
--- /dev/null
+++ b/deps/npm/node_modules/request/lib/har.js
@@ -0,0 +1,205 @@
+'use strict'
+
+var fs = require('fs')
+var qs = require('querystring')
+var validate = require('har-validator')
+var util = require('util')
+
+function Har (request) {
+ this.request = request
+}
+
+Har.prototype.reducer = function (obj, pair) {
+ // new property ?
+ if (obj[pair.name] === undefined) {
+ obj[pair.name] = pair.value
+ return obj
+ }
+
+ // existing? convert to array
+ var arr = [
+ obj[pair.name],
+ pair.value
+ ]
+
+ obj[pair.name] = arr
+
+ return obj
+}
+
+Har.prototype.prep = function (data) {
+ // construct utility properties
+ data.queryObj = {}
+ data.headersObj = {}
+ data.postData.jsonObj = false
+ data.postData.paramsObj = false
+
+ // construct query objects
+ if (data.queryString && data.queryString.length) {
+ data.queryObj = data.queryString.reduce(this.reducer, {})
+ }
+
+ // construct headers objects
+ if (data.headers && data.headers.length) {
+ // loweCase header keys
+ data.headersObj = data.headers.reduceRight(function (headers, header) {
+ headers[header.name] = header.value
+ return headers
+ }, {})
+ }
+
+ // construct Cookie header
+ if (data.cookies && data.cookies.length) {
+ var cookies = data.cookies.map(function (cookie) {
+ return cookie.name + '=' + cookie.value
+ })
+
+ if (cookies.length) {
+ data.headersObj.cookie = cookies.join('; ')
+ }
+ }
+
+ // prep body
+ switch (data.postData.mimeType) {
+ case 'multipart/mixed':
+ case 'multipart/related':
+ case 'multipart/form-data':
+ case 'multipart/alternative':
+ // reset values
+ data.postData.mimeType = 'multipart/form-data'
+ break
+
+ case 'application/x-www-form-urlencoded':
+ if (!data.postData.params) {
+ data.postData.text = ''
+ } else {
+ data.postData.paramsObj = data.postData.params.reduce(this.reducer, {})
+
+ // always overwrite
+ data.postData.text = qs.stringify(data.postData.paramsObj)
+ }
+ break
+
+ case 'text/json':
+ case 'text/x-json':
+ case 'application/json':
+ case 'application/x-json':
+ data.postData.mimeType = 'application/json'
+
+ if (data.postData.text) {
+ try {
+ data.postData.jsonObj = JSON.parse(data.postData.text)
+ } catch (e) {
+ this.request.debug(e)
+
+ // force back to text/plain
+ data.postData.mimeType = 'text/plain'
+ }
+ }
+ break
+ }
+
+ return data
+}
+
+Har.prototype.options = function (options) {
+ // skip if no har property defined
+ if (!options.har) {
+ return options
+ }
+
+ var har = util._extend({}, options.har)
+
+ // only process the first entry
+ if (har.log && har.log.entries) {
+ har = har.log.entries[0]
+ }
+
+ // add optional properties to make validation successful
+ har.url = har.url || options.url || options.uri || options.baseUrl || '/'
+ har.httpVersion = har.httpVersion || 'HTTP/1.1'
+ har.queryString = har.queryString || []
+ har.headers = har.headers || []
+ har.cookies = har.cookies || []
+ har.postData = har.postData || {}
+ har.postData.mimeType = har.postData.mimeType || 'application/octet-stream'
+
+ har.bodySize = 0
+ har.headersSize = 0
+ har.postData.size = 0
+
+ if (!validate.request(har)) {
+ return options
+ }
+
+ // clean up and get some utility properties
+ var req = this.prep(har)
+
+ // construct new options
+ if (req.url) {
+ options.url = req.url
+ }
+
+ if (req.method) {
+ options.method = req.method
+ }
+
+ if (Object.keys(req.queryObj).length) {
+ options.qs = req.queryObj
+ }
+
+ if (Object.keys(req.headersObj).length) {
+ options.headers = req.headersObj
+ }
+
+ switch (req.postData.mimeType) {
+ case 'application/x-www-form-urlencoded':
+ options.form = req.postData.paramsObj
+ break
+
+ case 'application/json':
+ if (req.postData.jsonObj) {
+ options.body = req.postData.jsonObj
+ options.json = true
+ }
+ break
+
+ case 'multipart/form-data':
+ options.formData = {}
+
+ req.postData.params.forEach(function (param) {
+ var attachment = {}
+
+ if (!param.fileName && !param.fileName && !param.contentType) {
+ options.formData[param.name] = param.value
+ return
+ }
+
+ // attempt to read from disk!
+ if (param.fileName && !param.value) {
+ attachment.value = fs.createReadStream(param.fileName)
+ } else if (param.value) {
+ attachment.value = param.value
+ }
+
+ if (param.fileName) {
+ attachment.options = {
+ filename: param.fileName,
+ contentType: param.contentType ? param.contentType : null
+ }
+ }
+
+ options.formData[param.name] = attachment
+ })
+ break
+
+ default:
+ if (req.postData.text) {
+ options.body = req.postData.text
+ }
+ }
+
+ return options
+}
+
+exports.Har = Har
diff --git a/deps/npm/node_modules/request/lib/helpers.js b/deps/npm/node_modules/request/lib/helpers.js
index fa5712ffbc..036b0d6f1b 100644
--- a/deps/npm/node_modules/request/lib/helpers.js
+++ b/deps/npm/node_modules/request/lib/helpers.js
@@ -8,7 +8,7 @@ function deferMethod() {
if(typeof setImmediate === 'undefined') {
return process.nextTick
}
-
+
return setImmediate
}
@@ -74,7 +74,7 @@ function isReadStream (rs) {
}
function toBase64 (str) {
- return (new Buffer(str || '', 'ascii')).toString('base64')
+ return (new Buffer(str || '', 'utf8')).toString('base64')
}
exports.isFunction = isFunction
diff --git a/deps/npm/node_modules/request/lib/multipart.js b/deps/npm/node_modules/request/lib/multipart.js
new file mode 100644
index 0000000000..390a7f2d1b
--- /dev/null
+++ b/deps/npm/node_modules/request/lib/multipart.js
@@ -0,0 +1,109 @@
+'use strict'
+
+var uuid = require('node-uuid')
+ , CombinedStream = require('combined-stream')
+ , isstream = require('isstream')
+
+
+function Multipart (request) {
+ this.request = request
+ this.boundary = uuid()
+ this.chunked = false
+ this.body = null
+}
+
+Multipart.prototype.isChunked = function (options) {
+ var self = this
+ , chunked = false
+ , parts = options.data || options
+
+ if (!parts.forEach) {
+ throw new Error('Argument error, options.multipart.')
+ }
+
+ if (options.chunked !== undefined) {
+ chunked = options.chunked
+ }
+
+ if (self.request.getHeader('transfer-encoding') === 'chunked') {
+ chunked = true
+ }
+
+ if (!chunked) {
+ parts.forEach(function (part) {
+ if(typeof part.body === 'undefined') {
+ throw new Error('Body attribute missing in multipart.')
+ }
+ if (isstream(part.body)) {
+ chunked = true
+ }
+ })
+ }
+
+ return chunked
+}
+
+Multipart.prototype.setHeaders = function (chunked) {
+ var self = this
+
+ if (chunked && !self.request.hasHeader('transfer-encoding')) {
+ self.request.setHeader('transfer-encoding', 'chunked')
+ }
+
+ var header = self.request.getHeader('content-type')
+
+ if (!header || header.indexOf('multipart') === -1) {
+ self.request.setHeader('content-type', 'multipart/related; boundary=' + self.boundary)
+ } else {
+ if (header.indexOf('boundary') !== -1) {
+ self.boundary = header.replace(/.*boundary=([^\s;])+.*/, '$1')
+ } else {
+ self.request.setHeader('content-type', header + '; boundary=' + self.boundary)
+ }
+ }
+}
+
+Multipart.prototype.build = function (parts, chunked) {
+ var self = this
+ var body = chunked ? new CombinedStream() : []
+
+ function add (part) {
+ return chunked ? body.append(part) : body.push(new Buffer(part))
+ }
+
+ if (self.request.preambleCRLF) {
+ add('\r\n')
+ }
+
+ parts.forEach(function (part) {
+ var preamble = '--' + self.boundary + '\r\n'
+ Object.keys(part).forEach(function (key) {
+ if (key === 'body') { return }
+ preamble += key + ': ' + part[key] + '\r\n'
+ })
+ preamble += '\r\n'
+ add(preamble)
+ add(part.body)
+ add('\r\n')
+ })
+ add('--' + self.boundary + '--')
+
+ if (self.request.postambleCRLF) {
+ add('\r\n')
+ }
+
+ return body
+}
+
+Multipart.prototype.onRequest = function (options) {
+ var self = this
+
+ var chunked = self.isChunked(options)
+ , parts = options.data || options
+
+ self.setHeaders(chunked)
+ self.chunked = chunked
+ self.body = self.build(parts, chunked)
+}
+
+exports.Multipart = Multipart
diff --git a/deps/npm/node_modules/request/lib/oauth.js b/deps/npm/node_modules/request/lib/oauth.js
index 3224601ccf..fc1cac6d5d 100644
--- a/deps/npm/node_modules/request/lib/oauth.js
+++ b/deps/npm/node_modules/request/lib/oauth.js
@@ -1,13 +1,16 @@
'use strict'
-var querystring = require('querystring')
- , qs = require('qs')
+var qs = require('qs')
, caseless = require('caseless')
, uuid = require('node-uuid')
, oauth = require('oauth-sign')
-exports.buildParams = function (_oauth, uri, method, query, form, qsLib) {
+function OAuth (request) {
+ this.request = request
+}
+
+OAuth.prototype.buildParams = function (_oauth, uri, method, query, form, qsLib) {
var oa = {}
for (var i in _oauth) {
oa['oauth_' + i] = _oauth[i]
@@ -54,7 +57,7 @@ exports.buildParams = function (_oauth, uri, method, query, form, qsLib) {
return oa
}
-exports.concatParams = function (oa, sep, wrap) {
+OAuth.prototype.concatParams = function (oa, sep, wrap) {
wrap = wrap || ''
var params = Object.keys(oa).filter(function (i) {
@@ -71,13 +74,15 @@ exports.concatParams = function (oa, sep, wrap) {
}).join(sep)
}
-exports.oauth = function (args) {
- var uri = args.uri || {}
- , method = args.method || ''
- , headers = caseless(args.headers)
- , body = args.body || ''
- , _oauth = args.oauth || {}
- , qsLib = args.qsLib || qs
+OAuth.prototype.onRequest = function (_oauth) {
+ var self = this
+ , request = self.request
+
+ var uri = request.uri || {}
+ , method = request.method || ''
+ , headers = caseless(request.headers)
+ , body = request.body || ''
+ , qsLib = request.qsLib || qs
var form
, query
@@ -99,23 +104,22 @@ exports.oauth = function (args) {
var oa = this.buildParams(_oauth, uri, method, query, form, qsLib)
- var data
switch (transport) {
case 'header':
- data = 'OAuth ' + this.concatParams(oa, ',', '"')
+ request.setHeader('Authorization', 'OAuth ' + this.concatParams(oa, ',', '"'))
break
case 'query':
- data = (query ? '&' : '?') + this.concatParams(oa, '&')
+ request.path = (query ? '&' : '?') + this.concatParams(oa, '&')
break
case 'body':
- data = (form ? form + '&' : '') + this.concatParams(oa, '&')
+ request.body = (form ? form + '&' : '') + this.concatParams(oa, '&')
break
default:
throw new Error('oauth: transport_method invalid')
}
-
- return {oauth:data, transport:transport}
}
+
+exports.OAuth = OAuth
diff --git a/deps/npm/node_modules/request/lib/redirect.js b/deps/npm/node_modules/request/lib/redirect.js
new file mode 100644
index 0000000000..7dd6c254c7
--- /dev/null
+++ b/deps/npm/node_modules/request/lib/redirect.js
@@ -0,0 +1,154 @@
+'use strict'
+
+var url = require('url')
+var isUrl = /^https?:/
+
+function Redirect (request) {
+ this.request = request
+ this.followRedirect = true
+ this.followRedirects = true
+ this.followAllRedirects = false
+ this.allowRedirect = function () {return true}
+ this.maxRedirects = 10
+ this.redirects = []
+ this.redirectsFollowed = 0
+ this.removeRefererHeader = false
+}
+
+Redirect.prototype.onRequest = function () {
+ var self = this
+ , request = self.request
+
+ if (request.maxRedirects !== undefined) {
+ self.maxRedirects = request.maxRedirects
+ }
+ if (typeof request.followRedirect === 'function') {
+ self.allowRedirect = request.followRedirect
+ }
+ if (request.followRedirect !== undefined) {
+ self.followRedirects = !!request.followRedirect
+ }
+ if (request.followAllRedirects !== undefined) {
+ self.followAllRedirects = request.followAllRedirects
+ }
+ if (self.followRedirects || self.followAllRedirects) {
+ self.redirects = self.redirects || []
+ }
+ if (request.removeRefererHeader !== undefined) {
+ self.removeRefererHeader = request.removeRefererHeader
+ }
+}
+
+Redirect.prototype.redirectTo = function (response) {
+ var self = this
+ , request = self.request
+
+ var redirectTo = null
+ if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) {
+ var location = response.caseless.get('location')
+ // debug('redirect', location)
+
+ if (self.followAllRedirects) {
+ redirectTo = location
+ } else if (self.followRedirects) {
+ switch (request.method) {
+ case 'PATCH':
+ case 'PUT':
+ case 'POST':
+ case 'DELETE':
+ // Do not follow redirects
+ break
+ default:
+ redirectTo = location
+ break
+ }
+ }
+ } else if (response.statusCode === 401) {
+ var authHeader = request._auth.onResponse(response)
+ if (authHeader) {
+ request.setHeader('authorization', authHeader)
+ redirectTo = request.uri
+ }
+ }
+ return redirectTo
+}
+
+Redirect.prototype.onResponse = function (response) {
+ var self = this
+ , request = self.request
+
+ var redirectTo = self.redirectTo(response)
+ if (!redirectTo || !self.allowRedirect.call(request, response)) {
+ return false
+ }
+
+
+ // debug('redirect to', redirectTo)
+
+ // ignore any potential response body. it cannot possibly be useful
+ // to us at this point.
+ if (request._paused) {
+ response.resume()
+ }
+
+ if (self.redirectsFollowed >= self.maxRedirects) {
+ request.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + request.uri.href))
+ return false
+ }
+ self.redirectsFollowed += 1
+
+ if (!isUrl.test(redirectTo)) {
+ redirectTo = url.resolve(request.uri.href, redirectTo)
+ }
+
+ var uriPrev = request.uri
+ request.uri = url.parse(redirectTo)
+
+ // handle the case where we change protocol from https to http or vice versa
+ if (request.uri.protocol !== uriPrev.protocol) {
+ request._updateProtocol()
+ }
+
+ self.redirects.push(
+ { statusCode : response.statusCode
+ , redirectUri: redirectTo
+ }
+ )
+ if (self.followAllRedirects && response.statusCode !== 401 && response.statusCode !== 307) {
+ request.method = 'GET'
+ }
+ // request.method = 'GET' // Force all redirects to use GET || commented out fixes #215
+ delete request.src
+ delete request.req
+ delete request.agent
+ delete request._started
+ if (response.statusCode !== 401 && response.statusCode !== 307) {
+ // Remove parameters from the previous response, unless this is the second request
+ // for a server that requires digest authentication.
+ delete request.body
+ delete request._form
+ if (request.headers) {
+ request.removeHeader('host')
+ request.removeHeader('content-type')
+ request.removeHeader('content-length')
+ if (request.uri.hostname !== request.originalHost.split(':')[0]) {
+ // Remove authorization if changing hostnames (but not if just
+ // changing ports or protocols). This matches the behavior of curl:
+ // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710
+ request.removeHeader('authorization')
+ }
+ }
+ }
+
+ if (!self.removeRefererHeader) {
+ request.setHeader('referer', request.uri.href)
+ }
+
+ request.emit('redirect')
+
+ request.init()
+
+ return true
+}
+
+exports.Redirect = Redirect
diff --git a/deps/npm/node_modules/request/node_modules/aws-sign2/package.json b/deps/npm/node_modules/request/node_modules/aws-sign2/package.json
index 9104550c82..decba70fa0 100644
--- a/deps/npm/node_modules/request/node_modules/aws-sign2/package.json
+++ b/deps/npm/node_modules/request/node_modules/aws-sign2/package.json
@@ -41,7 +41,5 @@
],
"directories": {},
"_shasum": "c57103f7a17fc037f02d7c2e64b602ea223f7d63",
- "_resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.5.0.tgz",
- "homepage": "https://github.com/mikeal/aws-sign",
- "scripts": {}
+ "_resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.5.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/bl/.jshintrc b/deps/npm/node_modules/request/node_modules/bl/.jshintrc
deleted file mode 100644
index c8ef3ca409..0000000000
--- a/deps/npm/node_modules/request/node_modules/bl/.jshintrc
+++ /dev/null
@@ -1,59 +0,0 @@
-{
- "predef": [ ]
- , "bitwise": false
- , "camelcase": false
- , "curly": false
- , "eqeqeq": false
- , "forin": false
- , "immed": false
- , "latedef": false
- , "noarg": true
- , "noempty": true
- , "nonew": true
- , "plusplus": false
- , "quotmark": true
- , "regexp": false
- , "undef": true
- , "unused": true
- , "strict": false
- , "trailing": true
- , "maxlen": 120
- , "asi": true
- , "boss": true
- , "debug": true
- , "eqnull": true
- , "esnext": true
- , "evil": true
- , "expr": true
- , "funcscope": false
- , "globalstrict": false
- , "iterator": false
- , "lastsemic": true
- , "laxbreak": true
- , "laxcomma": true
- , "loopfunc": true
- , "multistr": false
- , "onecase": false
- , "proto": false
- , "regexdash": false
- , "scripturl": true
- , "smarttabs": false
- , "shadow": false
- , "sub": true
- , "supernew": false
- , "validthis": true
- , "browser": true
- , "couch": false
- , "devel": false
- , "dojo": false
- , "mootools": false
- , "node": true
- , "nonstandard": true
- , "prototypejs": false
- , "rhino": false
- , "worker": true
- , "wsh": false
- , "nomen": false
- , "onevar": false
- , "passfail": false
-} \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/bl/package.json b/deps/npm/node_modules/request/node_modules/bl/package.json
index 3ffbd6a8ad..8571244fce 100644
--- a/deps/npm/node_modules/request/node_modules/bl/package.json
+++ b/deps/npm/node_modules/request/node_modules/bl/package.json
@@ -57,6 +57,5 @@
"tarball": "http://registry.npmjs.org/bl/-/bl-0.9.4.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/bl/-/bl-0.9.4.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/bl/-/bl-0.9.4.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/caseless/package.json b/deps/npm/node_modules/request/node_modules/caseless/package.json
index 39153e6144..362113c6de 100644
--- a/deps/npm/node_modules/request/node_modules/caseless/package.json
+++ b/deps/npm/node_modules/request/node_modules/caseless/package.json
@@ -52,6 +52,5 @@
"tarball": "http://registry.npmjs.org/caseless/-/caseless-0.9.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/caseless/-/caseless-0.9.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/caseless/-/caseless-0.9.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/combined-stream/node_modules/delayed-stream/package.json b/deps/npm/node_modules/request/node_modules/combined-stream/node_modules/delayed-stream/package.json
index 3324a13e97..e76ce93184 100644
--- a/deps/npm/node_modules/request/node_modules/combined-stream/node_modules/delayed-stream/package.json
+++ b/deps/npm/node_modules/request/node_modules/combined-stream/node_modules/delayed-stream/package.json
@@ -34,9 +34,5 @@
"directories": {},
"_shasum": "d4b1f43a93e8296dfe02694f4680bc37a313c73f",
"_resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-0.0.5.tgz",
- "_from": "delayed-stream@0.0.5",
- "bugs": {
- "url": "https://github.com/felixge/node-delayed-stream/issues"
- },
- "readme": "ERROR: No README data found!"
+ "_from": "delayed-stream@0.0.5"
}
diff --git a/deps/npm/node_modules/request/node_modules/combined-stream/package.json b/deps/npm/node_modules/request/node_modules/combined-stream/package.json
index a44fef9845..a609ec1165 100644
--- a/deps/npm/node_modules/request/node_modules/combined-stream/package.json
+++ b/deps/npm/node_modules/request/node_modules/combined-stream/package.json
@@ -55,6 +55,5 @@
],
"directories": {},
"_shasum": "0137e657baa5a7541c57ac37ac5fc07d73b4dc1f",
- "_resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-0.0.7.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-0.0.7.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/forever-agent/index.js b/deps/npm/node_modules/request/node_modules/forever-agent/index.js
index 1e8efcdf25..417b1de1a3 100644
--- a/deps/npm/node_modules/request/node_modules/forever-agent/index.js
+++ b/deps/npm/node_modules/request/node_modules/forever-agent/index.js
@@ -47,6 +47,12 @@ ForeverAgent.defaultMinSockets = 5
ForeverAgent.prototype.createConnection = net.createConnection
ForeverAgent.prototype.addRequestNoreuse = Agent.prototype.addRequest
ForeverAgent.prototype.addRequest = function(req, host, port) {
+ if (typeof host !== 'string') {
+ var options = host
+ port = options.port
+ host = options.host
+ }
+
var name = host + ':' + port
if (this.freeSockets[name] && this.freeSockets[name].length > 0 && !req.useChunkedEncodingByDefault) {
var idleSocket = this.freeSockets[name].pop()
diff --git a/deps/npm/node_modules/request/node_modules/forever-agent/package.json b/deps/npm/node_modules/request/node_modules/forever-agent/package.json
index 1bb4441936..77b62f04cc 100644
--- a/deps/npm/node_modules/request/node_modules/forever-agent/package.json
+++ b/deps/npm/node_modules/request/node_modules/forever-agent/package.json
@@ -6,7 +6,8 @@
},
"name": "forever-agent",
"description": "HTTP Agent that keeps socket connections alive between keep-alive requests. Formerly part of mikeal/request, now a standalone module.",
- "version": "0.5.2",
+ "version": "0.6.0",
+ "license": "Apache-2.0",
"repository": {
"url": "https://github.com/mikeal/forever-agent"
},
@@ -17,30 +18,38 @@
"engines": {
"node": "*"
},
+ "gitHead": "e45a6772c58c5b14f8d9b85b1b1a2094075b7161",
"bugs": {
"url": "https://github.com/mikeal/forever-agent/issues"
},
"homepage": "https://github.com/mikeal/forever-agent",
- "_id": "forever-agent@0.5.2",
- "dist": {
- "shasum": "6d0e09c4921f94a27f63d3b49c5feff1ea4c5130",
- "tarball": "http://registry.npmjs.org/forever-agent/-/forever-agent-0.5.2.tgz"
- },
- "_from": "forever-agent@>=0.5.0 <0.6.0",
- "_npmVersion": "1.3.21",
+ "_id": "forever-agent@0.6.0",
+ "scripts": {},
+ "_shasum": "1f9b9aff11eddb1c789c751f974ba7b15454ac5d",
+ "_from": "forever-agent@>=0.6.0 <0.7.0",
+ "_npmVersion": "1.4.14",
"_npmUser": {
- "name": "mikeal",
- "email": "mikeal.rogers@gmail.com"
+ "name": "nylen",
+ "email": "jnylen@gmail.com"
},
"maintainers": [
{
"name": "mikeal",
"email": "mikeal.rogers@gmail.com"
+ },
+ {
+ "name": "nylen",
+ "email": "jnylen@gmail.com"
+ },
+ {
+ "name": "simov",
+ "email": "simeonvelichkov@gmail.com"
}
],
+ "dist": {
+ "shasum": "1f9b9aff11eddb1c789c751f974ba7b15454ac5d",
+ "tarball": "http://registry.npmjs.org/forever-agent/-/forever-agent-0.6.0.tgz"
+ },
"directories": {},
- "_shasum": "6d0e09c4921f94a27f63d3b49c5feff1ea4c5130",
- "_resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.5.2.tgz",
- "readme": "ERROR: No README data found!",
- "scripts": {}
+ "_resolved": "https://registry.npmjs.org/forever-agent/-/forever-agent-0.6.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/package.json b/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/package.json
index e8f9ed81b6..3171f4af0c 100644
--- a/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/package.json
+++ b/deps/npm/node_modules/request/node_modules/form-data/node_modules/async/package.json
@@ -55,6 +55,5 @@
],
"directories": {},
"_shasum": "ac3613b1da9bed1b47510bb4651b8931e47146c7",
- "_resolved": "https://registry.npmjs.org/async/-/async-0.9.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/async/-/async-0.9.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/form-data/package.json b/deps/npm/node_modules/request/node_modules/form-data/package.json
index 7f1adae962..9ec7fe59e9 100644
--- a/deps/npm/node_modules/request/node_modules/form-data/package.json
+++ b/deps/npm/node_modules/request/node_modules/form-data/package.json
@@ -75,6 +75,5 @@
"tarball": "http://registry.npmjs.org/form-data/-/form-data-0.2.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/form-data/-/form-data-0.2.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/form-data/-/form-data-0.2.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/LICENSE
new file mode 100644
index 0000000000..d52787158d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Ahmad Nassri (https://www.ahmadnassri.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/README.md b/deps/npm/node_modules/request/node_modules/har-validator/README.md
new file mode 100644
index 0000000000..4022d14da6
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/README.md
@@ -0,0 +1,323 @@
+# HAR Validator [![version][npm-version]][npm-url] [![License][npm-license]][license-url]
+
+Extremely fast HTTP Archive ([HAR](http://www.softwareishard.com/blog/har-12-spec/)) validator using JSON Schema.
+
+[![Build Status][travis-image]][travis-url]
+[![Downloads][npm-downloads]][npm-url]
+[![Code Climate][codeclimate-quality]][codeclimate-url]
+[![Coverage Status][codeclimate-coverage]][codeclimate-url]
+[![Dependencies][david-image]][david-url]
+
+## Install
+
+```shell
+# to use in cli
+npm install --global har-validator
+
+# to use as a module
+npm install --save har-validator
+```
+
+## Usage
+
+```
+
+ Usage: har-validator [options] <files ...>
+
+ Options:
+
+ -h, --help output usage information
+ -V, --version output the version number
+ -s, --schema [name] validate schema name (log, request, response, etc ...)
+
+```
+
+###### Example
+
+```shell
+har-validator har.json
+
+har-validator --schema request request.json
+```
+
+## API
+
+### Validate(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [log](http://www.softwareishard.com/blog/har-12-spec/#log) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var HAR = require('./har.json');
+var validate = require('har-validator');
+
+validate(HAR, function (e, valid) {
+ if (e) console.log(e.errors)
+
+ if (valid) console.log('horray!');
+});
+```
+
+### Validate.cache(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [cache](http://www.softwareishard.com/blog/har-12-spec/#cache) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.cache(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.cacheEntry(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a ["beforeRequest" or "afterRequest"](http://www.softwareishard.com/blog/har-12-spec/#cache) objects
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.cacheEntry(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.content(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [content](http://www.softwareishard.com/blog/har-12-spec/#content) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.content(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.cookie(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [cookie](http://www.softwareishard.com/blog/har-12-spec/#cookies) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.cookie(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.creator(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [creator](http://www.softwareishard.com/blog/har-12-spec/#creator) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.creator(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.entry(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [entry](http://www.softwareishard.com/blog/har-12-spec/#entries) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.entry(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.log(data [, callback])
+
+alias of [`Validate(data [, callback])`](#validate-data-callback-)
+
+### Validate.page(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [page](http://www.softwareishard.com/blog/har-12-spec/#pages) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.page(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.pageTimings(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [pageTimings](http://www.softwareishard.com/blog/har-12-spec/#pageTimings) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.pageTimings(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.postData(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [postData](http://www.softwareishard.com/blog/har-12-spec/#postData) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.postData(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.record(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [record](http://www.softwareishard.com/blog/har-12-spec/#headers) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.record(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.request(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [request](http://www.softwareishard.com/blog/har-12-spec/#request) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.request(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.response(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [response](http://www.softwareishard.com/blog/har-12-spec/#response) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.cacheEntry(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+### Validate.timings(data [, callback])
+
+Returns `true` or `false`.
+
+- **data**: `Object` *(Required)*
+ a [timings](http://www.softwareishard.com/blog/har-12-spec/#timings) object
+
+- **callback**: `Function`
+ gets two arguments (err, valid)
+
+```js
+var validate = require('har-validator');
+
+validate.timings(data, function (e, valid) {
+ if (e) console.log(e.errors)
+});
+```
+
+## License
+
+[MIT](LICENSE) &copy; [Ahmad Nassri](https://www.ahmadnassri.com)
+
+[license-url]: https://github.com/ahmadnassri/har-validator/blob/master/LICENSE
+
+[travis-url]: https://travis-ci.org/ahmadnassri/har-validator
+[travis-image]: https://img.shields.io/travis/ahmadnassri/har-validator.svg?style=flat-square
+
+[npm-url]: https://www.npmjs.com/package/har-validator
+[npm-license]: https://img.shields.io/npm/l/har-validator.svg?style=flat-square
+[npm-version]: https://img.shields.io/npm/v/har-validator.svg?style=flat-square
+[npm-downloads]: https://img.shields.io/npm/dm/har-validator.svg?style=flat-square
+
+[codeclimate-url]: https://codeclimate.com/github/ahmadnassri/har-validator
+[codeclimate-quality]: https://img.shields.io/codeclimate/github/ahmadnassri/har-validator.svg?style=flat-square
+[codeclimate-coverage]: https://img.shields.io/codeclimate/coverage/github/ahmadnassri/har-validator.svg?style=flat-square
+
+[david-url]: https://david-dm.org/ahmadnassri/har-validator
+[david-image]: https://img.shields.io/david/ahmadnassri/har-validator.svg?style=flat-square
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/bin/har-validator b/deps/npm/node_modules/request/node_modules/har-validator/bin/har-validator
new file mode 100755
index 0000000000..94b7e90713
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/bin/har-validator
@@ -0,0 +1,45 @@
+#!/usr/bin/env node
+
+'use strict'
+
+var Promise = require('bluebird')
+
+var chalk = require('chalk')
+var cmd = require('commander')
+var fs = Promise.promisifyAll(require('fs'))
+var path = require('path')
+var pkg = require('../package.json')
+var validate = Promise.promisifyAll(require('..'))
+
+cmd
+ .version(pkg.version)
+ .usage('[options] <files ...>')
+ .option('-s, --schema [name]', 'validate schema name (log, request, response, etc ...)')
+ .parse(process.argv)
+
+if (!cmd.args.length) {
+ cmd.help()
+}
+
+if (!cmd.schema) {
+ cmd.schema = 'log'
+}
+
+cmd.args.map(function (fileName) {
+ var file = chalk.yellow.italic(path.basename(fileName))
+
+ fs.readFileAsync(fileName)
+ .then(JSON.parse)
+ .then(validate[cmd.schema + 'Async'])
+ .then(function () {
+ console.log('%s [%s] is valid', chalk.green('✓'), file)
+ })
+ .catch(SyntaxError, function (e) {
+ console.error('%s [%s] failed to read JSON: %s', chalk.red('✖'), file, chalk.red(e.message))
+ })
+ .catch(function (e) {
+ e.errors.map(function (err) {
+ console.error('%s [%s] failed validation: (%s: %s) %s', chalk.red('✖'), file, chalk.cyan.italic(err.field), chalk.magenta.italic(err.value), chalk.red(err.message))
+ })
+ })
+})
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/.travis.yml
new file mode 100644
index 0000000000..6e5919de39
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+ - "0.10"
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/LICENSE
new file mode 100644
index 0000000000..8f29698588
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2010-2014 Caolan McMahon
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/README.md
new file mode 100644
index 0000000000..392c64100a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/README.md
@@ -0,0 +1,1646 @@
+# Async.js
+
+[![Build Status via Travis CI](https://travis-ci.org/caolan/async.svg?branch=master)](https://travis-ci.org/caolan/async)
+
+
+Async is a utility module which provides straight-forward, powerful functions
+for working with asynchronous JavaScript. Although originally designed for
+use with [Node.js](http://nodejs.org), it can also be used directly in the
+browser. Also supports [component](https://github.com/component/component).
+
+Async provides around 20 functions that include the usual 'functional'
+suspects (`map`, `reduce`, `filter`, `each`…) as well as some common patterns
+for asynchronous control flow (`parallel`, `series`, `waterfall`…). All these
+functions assume you follow the Node.js convention of providing a single
+callback as the last argument of your `async` function.
+
+
+## Quick Examples
+
+```javascript
+async.map(['file1','file2','file3'], fs.stat, function(err, results){
+ // results is now an array of stats for each file
+});
+
+async.filter(['file1','file2','file3'], fs.exists, function(results){
+ // results now equals an array of the existing files
+});
+
+async.parallel([
+ function(){ ... },
+ function(){ ... }
+], callback);
+
+async.series([
+ function(){ ... },
+ function(){ ... }
+]);
+```
+
+There are many more functions available so take a look at the docs below for a
+full list. This module aims to be comprehensive, so if you feel anything is
+missing please create a GitHub issue for it.
+
+## Common Pitfalls
+
+### Binding a context to an iterator
+
+This section is really about `bind`, not about `async`. If you are wondering how to
+make `async` execute your iterators in a given context, or are confused as to why
+a method of another library isn't working as an iterator, study this example:
+
+```js
+// Here is a simple object with an (unnecessarily roundabout) squaring method
+var AsyncSquaringLibrary = {
+ squareExponent: 2,
+ square: function(number, callback){
+ var result = Math.pow(number, this.squareExponent);
+ setTimeout(function(){
+ callback(null, result);
+ }, 200);
+ }
+};
+
+async.map([1, 2, 3], AsyncSquaringLibrary.square, function(err, result){
+ // result is [NaN, NaN, NaN]
+ // This fails because the `this.squareExponent` expression in the square
+ // function is not evaluated in the context of AsyncSquaringLibrary, and is
+ // therefore undefined.
+});
+
+async.map([1, 2, 3], AsyncSquaringLibrary.square.bind(AsyncSquaringLibrary), function(err, result){
+ // result is [1, 4, 9]
+ // With the help of bind we can attach a context to the iterator before
+ // passing it to async. Now the square function will be executed in its
+ // 'home' AsyncSquaringLibrary context and the value of `this.squareExponent`
+ // will be as expected.
+});
+```
+
+## Download
+
+The source is available for download from
+[GitHub](http://github.com/caolan/async).
+Alternatively, you can install using Node Package Manager (`npm`):
+
+ npm install async
+
+__Development:__ [async.js](https://github.com/caolan/async/raw/master/lib/async.js) - 29.6kb Uncompressed
+
+## In the Browser
+
+So far it's been tested in IE6, IE7, IE8, FF3.6 and Chrome 5.
+
+Usage:
+
+```html
+<script type="text/javascript" src="async.js"></script>
+<script type="text/javascript">
+
+ async.map(data, asyncProcess, function(err, results){
+ alert(results);
+ });
+
+</script>
+```
+
+## Documentation
+
+### Collections
+
+* [`each`](#each)
+* [`eachSeries`](#eachSeries)
+* [`eachLimit`](#eachLimit)
+* [`map`](#map)
+* [`mapSeries`](#mapSeries)
+* [`mapLimit`](#mapLimit)
+* [`filter`](#filter)
+* [`filterSeries`](#filterSeries)
+* [`reject`](#reject)
+* [`rejectSeries`](#rejectSeries)
+* [`reduce`](#reduce)
+* [`reduceRight`](#reduceRight)
+* [`detect`](#detect)
+* [`detectSeries`](#detectSeries)
+* [`sortBy`](#sortBy)
+* [`some`](#some)
+* [`every`](#every)
+* [`concat`](#concat)
+* [`concatSeries`](#concatSeries)
+
+### Control Flow
+
+* [`series`](#seriestasks-callback)
+* [`parallel`](#parallel)
+* [`parallelLimit`](#parallellimittasks-limit-callback)
+* [`whilst`](#whilst)
+* [`doWhilst`](#doWhilst)
+* [`until`](#until)
+* [`doUntil`](#doUntil)
+* [`forever`](#forever)
+* [`waterfall`](#waterfall)
+* [`compose`](#compose)
+* [`seq`](#seq)
+* [`applyEach`](#applyEach)
+* [`applyEachSeries`](#applyEachSeries)
+* [`queue`](#queue)
+* [`priorityQueue`](#priorityQueue)
+* [`cargo`](#cargo)
+* [`auto`](#auto)
+* [`retry`](#retry)
+* [`iterator`](#iterator)
+* [`apply`](#apply)
+* [`nextTick`](#nextTick)
+* [`times`](#times)
+* [`timesSeries`](#timesSeries)
+
+### Utils
+
+* [`memoize`](#memoize)
+* [`unmemoize`](#unmemoize)
+* [`log`](#log)
+* [`dir`](#dir)
+* [`noConflict`](#noConflict)
+
+
+## Collections
+
+<a name="forEach" />
+<a name="each" />
+### each(arr, iterator, callback)
+
+Applies the function `iterator` to each item in `arr`, in parallel.
+The `iterator` is called with an item from the list, and a callback for when it
+has finished. If the `iterator` passes an error to its `callback`, the main
+`callback` (for the `each` function) is immediately called with the error.
+
+Note, that since this function applies `iterator` to each item in parallel,
+there is no guarantee that the iterator functions will complete in order.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err)` which must be called once it has
+ completed. If no error has occured, the `callback` should be run without
+ arguments or with an explicit `null` argument.
+* `callback(err)` - A callback which is called when all `iterator` functions
+ have finished, or an error occurs.
+
+__Examples__
+
+
+```js
+// assuming openFiles is an array of file names and saveFile is a function
+// to save the modified contents of that file:
+
+async.each(openFiles, saveFile, function(err){
+ // if any of the saves produced an error, err would equal that error
+});
+```
+
+```js
+// assuming openFiles is an array of file names
+
+async.each(openFiles, function( file, callback) {
+
+ // Perform operation on file here.
+ console.log('Processing file ' + file);
+
+ if( file.length > 32 ) {
+ console.log('This file name is too long');
+ callback('File name too long');
+ } else {
+ // Do work to process file here
+ console.log('File processed');
+ callback();
+ }
+}, function(err){
+ // if any of the file processing produced an error, err would equal that error
+ if( err ) {
+ // One of the iterations produced an error.
+ // All processing will now stop.
+ console.log('A file failed to process');
+ } else {
+ console.log('All files have been processed successfully');
+ }
+});
+```
+
+---------------------------------------
+
+<a name="forEachSeries" />
+<a name="eachSeries" />
+### eachSeries(arr, iterator, callback)
+
+The same as [`each`](#each), only `iterator` is applied to each item in `arr` in
+series. The next `iterator` is only called once the current one has completed.
+This means the `iterator` functions will complete in order.
+
+
+---------------------------------------
+
+<a name="forEachLimit" />
+<a name="eachLimit" />
+### eachLimit(arr, limit, iterator, callback)
+
+The same as [`each`](#each), only no more than `limit` `iterator`s will be simultaneously
+running at any time.
+
+Note that the items in `arr` are not processed in batches, so there is no guarantee that
+the first `limit` `iterator` functions will complete before any others are started.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `limit` - The maximum number of `iterator`s to run at any time.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err)` which must be called once it has
+ completed. If no error has occured, the callback should be run without
+ arguments or with an explicit `null` argument.
+* `callback(err)` - A callback which is called when all `iterator` functions
+ have finished, or an error occurs.
+
+__Example__
+
+```js
+// Assume documents is an array of JSON objects and requestApi is a
+// function that interacts with a rate-limited REST api.
+
+async.eachLimit(documents, 20, requestApi, function(err){
+ // if any of the saves produced an error, err would equal that error
+});
+```
+
+---------------------------------------
+
+<a name="map" />
+### map(arr, iterator, callback)
+
+Produces a new array of values by mapping each value in `arr` through
+the `iterator` function. The `iterator` is called with an item from `arr` and a
+callback for when it has finished processing. Each of these callback takes 2 arguments:
+an `error`, and the transformed item from `arr`. If `iterator` passes an error to this
+callback, the main `callback` (for the `map` function) is immediately called with the error.
+
+Note, that since this function applies the `iterator` to each item in parallel,
+there is no guarantee that the `iterator` functions will complete in order.
+However, the results array will be in the same order as the original `arr`.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err, transformed)` which must be called once
+ it has completed with an error (which can be `null`) and a transformed item.
+* `callback(err, results)` - A callback which is called when all `iterator`
+ functions have finished, or an error occurs. Results is an array of the
+ transformed items from the `arr`.
+
+__Example__
+
+```js
+async.map(['file1','file2','file3'], fs.stat, function(err, results){
+ // results is now an array of stats for each file
+});
+```
+
+---------------------------------------
+
+<a name="mapSeries" />
+### mapSeries(arr, iterator, callback)
+
+The same as [`map`](#map), only the `iterator` is applied to each item in `arr` in
+series. The next `iterator` is only called once the current one has completed.
+The results array will be in the same order as the original.
+
+
+---------------------------------------
+
+<a name="mapLimit" />
+### mapLimit(arr, limit, iterator, callback)
+
+The same as [`map`](#map), only no more than `limit` `iterator`s will be simultaneously
+running at any time.
+
+Note that the items are not processed in batches, so there is no guarantee that
+the first `limit` `iterator` functions will complete before any others are started.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `limit` - The maximum number of `iterator`s to run at any time.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err, transformed)` which must be called once
+ it has completed with an error (which can be `null`) and a transformed item.
+* `callback(err, results)` - A callback which is called when all `iterator`
+ calls have finished, or an error occurs. The result is an array of the
+ transformed items from the original `arr`.
+
+__Example__
+
+```js
+async.mapLimit(['file1','file2','file3'], 1, fs.stat, function(err, results){
+ // results is now an array of stats for each file
+});
+```
+
+---------------------------------------
+
+<a name="select" />
+<a name="filter" />
+### filter(arr, iterator, callback)
+
+__Alias:__ `select`
+
+Returns a new array of all the values in `arr` which pass an async truth test.
+_The callback for each `iterator` call only accepts a single argument of `true` or
+`false`; it does not accept an error argument first!_ This is in-line with the
+way node libraries work with truth tests like `fs.exists`. This operation is
+performed in parallel, but the results array will be in the same order as the
+original.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A truth test to apply to each item in `arr`.
+ The `iterator` is passed a `callback(truthValue)`, which must be called with a
+ boolean argument once it has completed.
+* `callback(results)` - A callback which is called after all the `iterator`
+ functions have finished.
+
+__Example__
+
+```js
+async.filter(['file1','file2','file3'], fs.exists, function(results){
+ // results now equals an array of the existing files
+});
+```
+
+---------------------------------------
+
+<a name="selectSeries" />
+<a name="filterSeries" />
+### filterSeries(arr, iterator, callback)
+
+__Alias:__ `selectSeries`
+
+The same as [`filter`](#filter) only the `iterator` is applied to each item in `arr` in
+series. The next `iterator` is only called once the current one has completed.
+The results array will be in the same order as the original.
+
+---------------------------------------
+
+<a name="reject" />
+### reject(arr, iterator, callback)
+
+The opposite of [`filter`](#filter). Removes values that pass an `async` truth test.
+
+---------------------------------------
+
+<a name="rejectSeries" />
+### rejectSeries(arr, iterator, callback)
+
+The same as [`reject`](#reject), only the `iterator` is applied to each item in `arr`
+in series.
+
+
+---------------------------------------
+
+<a name="reduce" />
+### reduce(arr, memo, iterator, callback)
+
+__Aliases:__ `inject`, `foldl`
+
+Reduces `arr` into a single value using an async `iterator` to return
+each successive step. `memo` is the initial state of the reduction.
+This function only operates in series.
+
+For performance reasons, it may make sense to split a call to this function into
+a parallel map, and then use the normal `Array.prototype.reduce` on the results.
+This function is for situations where each step in the reduction needs to be async;
+if you can get the data before reducing it, then it's probably a good idea to do so.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `memo` - The initial state of the reduction.
+* `iterator(memo, item, callback)` - A function applied to each item in the
+ array to produce the next step in the reduction. The `iterator` is passed a
+ `callback(err, reduction)` which accepts an optional error as its first
+ argument, and the state of the reduction as the second. If an error is
+ passed to the callback, the reduction is stopped and the main `callback` is
+ immediately called with the error.
+* `callback(err, result)` - A callback which is called after all the `iterator`
+ functions have finished. Result is the reduced value.
+
+__Example__
+
+```js
+async.reduce([1,2,3], 0, function(memo, item, callback){
+ // pointless async:
+ process.nextTick(function(){
+ callback(null, memo + item)
+ });
+}, function(err, result){
+ // result is now equal to the last value of memo, which is 6
+});
+```
+
+---------------------------------------
+
+<a name="reduceRight" />
+### reduceRight(arr, memo, iterator, callback)
+
+__Alias:__ `foldr`
+
+Same as [`reduce`](#reduce), only operates on `arr` in reverse order.
+
+
+---------------------------------------
+
+<a name="detect" />
+### detect(arr, iterator, callback)
+
+Returns the first value in `arr` that passes an async truth test. The
+`iterator` is applied in parallel, meaning the first iterator to return `true` will
+fire the detect `callback` with that result. That means the result might not be
+the first item in the original `arr` (in terms of order) that passes the test.
+
+If order within the original `arr` is important, then look at [`detectSeries`](#detectSeries).
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A truth test to apply to each item in `arr`.
+ The iterator is passed a `callback(truthValue)` which must be called with a
+ boolean argument once it has completed.
+* `callback(result)` - A callback which is called as soon as any iterator returns
+ `true`, or after all the `iterator` functions have finished. Result will be
+ the first item in the array that passes the truth test (iterator) or the
+ value `undefined` if none passed.
+
+__Example__
+
+```js
+async.detect(['file1','file2','file3'], fs.exists, function(result){
+ // result now equals the first file in the list that exists
+});
+```
+
+---------------------------------------
+
+<a name="detectSeries" />
+### detectSeries(arr, iterator, callback)
+
+The same as [`detect`](#detect), only the `iterator` is applied to each item in `arr`
+in series. This means the result is always the first in the original `arr` (in
+terms of array order) that passes the truth test.
+
+
+---------------------------------------
+
+<a name="sortBy" />
+### sortBy(arr, iterator, callback)
+
+Sorts a list by the results of running each `arr` value through an async `iterator`.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err, sortValue)` which must be called once it
+ has completed with an error (which can be `null`) and a value to use as the sort
+ criteria.
+* `callback(err, results)` - A callback which is called after all the `iterator`
+ functions have finished, or an error occurs. Results is the items from
+ the original `arr` sorted by the values returned by the `iterator` calls.
+
+__Example__
+
+```js
+async.sortBy(['file1','file2','file3'], function(file, callback){
+ fs.stat(file, function(err, stats){
+ callback(err, stats.mtime);
+ });
+}, function(err, results){
+ // results is now the original array of files sorted by
+ // modified date
+});
+```
+
+__Sort Order__
+
+By modifying the callback parameter the sorting order can be influenced:
+
+```js
+//ascending order
+async.sortBy([1,9,3,5], function(x, callback){
+ callback(err, x);
+}, function(err,result){
+ //result callback
+} );
+
+//descending order
+async.sortBy([1,9,3,5], function(x, callback){
+ callback(err, x*-1); //<- x*-1 instead of x, turns the order around
+}, function(err,result){
+ //result callback
+} );
+```
+
+---------------------------------------
+
+<a name="some" />
+### some(arr, iterator, callback)
+
+__Alias:__ `any`
+
+Returns `true` if at least one element in the `arr` satisfies an async test.
+_The callback for each iterator call only accepts a single argument of `true` or
+`false`; it does not accept an error argument first!_ This is in-line with the
+way node libraries work with truth tests like `fs.exists`. Once any iterator
+call returns `true`, the main `callback` is immediately called.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A truth test to apply to each item in the array
+ in parallel. The iterator is passed a callback(truthValue) which must be
+ called with a boolean argument once it has completed.
+* `callback(result)` - A callback which is called as soon as any iterator returns
+ `true`, or after all the iterator functions have finished. Result will be
+ either `true` or `false` depending on the values of the async tests.
+
+__Example__
+
+```js
+async.some(['file1','file2','file3'], fs.exists, function(result){
+ // if result is true then at least one of the files exists
+});
+```
+
+---------------------------------------
+
+<a name="every" />
+### every(arr, iterator, callback)
+
+__Alias:__ `all`
+
+Returns `true` if every element in `arr` satisfies an async test.
+_The callback for each `iterator` call only accepts a single argument of `true` or
+`false`; it does not accept an error argument first!_ This is in-line with the
+way node libraries work with truth tests like `fs.exists`.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A truth test to apply to each item in the array
+ in parallel. The iterator is passed a callback(truthValue) which must be
+ called with a boolean argument once it has completed.
+* `callback(result)` - A callback which is called after all the `iterator`
+ functions have finished. Result will be either `true` or `false` depending on
+ the values of the async tests.
+
+__Example__
+
+```js
+async.every(['file1','file2','file3'], fs.exists, function(result){
+ // if result is true then every file exists
+});
+```
+
+---------------------------------------
+
+<a name="concat" />
+### concat(arr, iterator, callback)
+
+Applies `iterator` to each item in `arr`, concatenating the results. Returns the
+concatenated list. The `iterator`s are called in parallel, and the results are
+concatenated as they return. There is no guarantee that the results array will
+be returned in the original order of `arr` passed to the `iterator` function.
+
+__Arguments__
+
+* `arr` - An array to iterate over.
+* `iterator(item, callback)` - A function to apply to each item in `arr`.
+ The iterator is passed a `callback(err, results)` which must be called once it
+ has completed with an error (which can be `null`) and an array of results.
+* `callback(err, results)` - A callback which is called after all the `iterator`
+ functions have finished, or an error occurs. Results is an array containing
+ the concatenated results of the `iterator` function.
+
+__Example__
+
+```js
+async.concat(['dir1','dir2','dir3'], fs.readdir, function(err, files){
+ // files is now a list of filenames that exist in the 3 directories
+});
+```
+
+---------------------------------------
+
+<a name="concatSeries" />
+### concatSeries(arr, iterator, callback)
+
+Same as [`concat`](#concat), but executes in series instead of parallel.
+
+
+## Control Flow
+
+<a name="series" />
+### series(tasks, [callback])
+
+Run the functions in the `tasks` array in series, each one running once the previous
+function has completed. If any functions in the series pass an error to its
+callback, no more functions are run, and `callback` is immediately called with the value of the error.
+Otherwise, `callback` receives an array of results when `tasks` have completed.
+
+It is also possible to use an object instead of an array. Each property will be
+run as a function, and the results will be passed to the final `callback` as an object
+instead of an array. This can be a more readable way of handling results from
+[`series`](#series).
+
+**Note** that while many implementations preserve the order of object properties, the
+[ECMAScript Language Specifcation](http://www.ecma-international.org/ecma-262/5.1/#sec-8.6)
+explicitly states that
+
+> The mechanics and order of enumerating the properties is not specified.
+
+So if you rely on the order in which your series of functions are executed, and want
+this to work on all platforms, consider using an array.
+
+__Arguments__
+
+* `tasks` - An array or object containing functions to run, each function is passed
+ a `callback(err, result)` it must call on completion with an error `err` (which can
+ be `null`) and an optional `result` value.
+* `callback(err, results)` - An optional callback to run once all the functions
+ have completed. This function gets a results array (or object) containing all
+ the result arguments passed to the `task` callbacks.
+
+__Example__
+
+```js
+async.series([
+ function(callback){
+ // do some stuff ...
+ callback(null, 'one');
+ },
+ function(callback){
+ // do some more stuff ...
+ callback(null, 'two');
+ }
+],
+// optional callback
+function(err, results){
+ // results is now equal to ['one', 'two']
+});
+
+
+// an example using an object instead of an array
+async.series({
+ one: function(callback){
+ setTimeout(function(){
+ callback(null, 1);
+ }, 200);
+ },
+ two: function(callback){
+ setTimeout(function(){
+ callback(null, 2);
+ }, 100);
+ }
+},
+function(err, results) {
+ // results is now equal to: {one: 1, two: 2}
+});
+```
+
+---------------------------------------
+
+<a name="parallel" />
+### parallel(tasks, [callback])
+
+Run the `tasks` array of functions in parallel, without waiting until the previous
+function has completed. If any of the functions pass an error to its
+callback, the main `callback` is immediately called with the value of the error.
+Once the `tasks` have completed, the results are passed to the final `callback` as an
+array.
+
+It is also possible to use an object instead of an array. Each property will be
+run as a function and the results will be passed to the final `callback` as an object
+instead of an array. This can be a more readable way of handling results from
+[`parallel`](#parallel).
+
+
+__Arguments__
+
+* `tasks` - An array or object containing functions to run. Each function is passed
+ a `callback(err, result)` which it must call on completion with an error `err`
+ (which can be `null`) and an optional `result` value.
+* `callback(err, results)` - An optional callback to run once all the functions
+ have completed. This function gets a results array (or object) containing all
+ the result arguments passed to the task callbacks.
+
+__Example__
+
+```js
+async.parallel([
+ function(callback){
+ setTimeout(function(){
+ callback(null, 'one');
+ }, 200);
+ },
+ function(callback){
+ setTimeout(function(){
+ callback(null, 'two');
+ }, 100);
+ }
+],
+// optional callback
+function(err, results){
+ // the results array will equal ['one','two'] even though
+ // the second function had a shorter timeout.
+});
+
+
+// an example using an object instead of an array
+async.parallel({
+ one: function(callback){
+ setTimeout(function(){
+ callback(null, 1);
+ }, 200);
+ },
+ two: function(callback){
+ setTimeout(function(){
+ callback(null, 2);
+ }, 100);
+ }
+},
+function(err, results) {
+ // results is now equals to: {one: 1, two: 2}
+});
+```
+
+---------------------------------------
+
+<a name="parallelLimit" />
+### parallelLimit(tasks, limit, [callback])
+
+The same as [`parallel`](#parallel), only `tasks` are executed in parallel
+with a maximum of `limit` tasks executing at any time.
+
+Note that the `tasks` are not executed in batches, so there is no guarantee that
+the first `limit` tasks will complete before any others are started.
+
+__Arguments__
+
+* `tasks` - An array or object containing functions to run, each function is passed
+ a `callback(err, result)` it must call on completion with an error `err` (which can
+ be `null`) and an optional `result` value.
+* `limit` - The maximum number of `tasks` to run at any time.
+* `callback(err, results)` - An optional callback to run once all the functions
+ have completed. This function gets a results array (or object) containing all
+ the result arguments passed to the `task` callbacks.
+
+---------------------------------------
+
+<a name="whilst" />
+### whilst(test, fn, callback)
+
+Repeatedly call `fn`, while `test` returns `true`. Calls `callback` when stopped,
+or an error occurs.
+
+__Arguments__
+
+* `test()` - synchronous truth test to perform before each execution of `fn`.
+* `fn(callback)` - A function which is called each time `test` passes. The function is
+ passed a `callback(err)`, which must be called once it has completed with an
+ optional `err` argument.
+* `callback(err)` - A callback which is called after the test fails and repeated
+ execution of `fn` has stopped.
+
+__Example__
+
+```js
+var count = 0;
+
+async.whilst(
+ function () { return count < 5; },
+ function (callback) {
+ count++;
+ setTimeout(callback, 1000);
+ },
+ function (err) {
+ // 5 seconds have passed
+ }
+);
+```
+
+---------------------------------------
+
+<a name="doWhilst" />
+### doWhilst(fn, test, callback)
+
+The post-check version of [`whilst`](#whilst). To reflect the difference in
+the order of operations, the arguments `test` and `fn` are switched.
+
+`doWhilst` is to `whilst` as `do while` is to `while` in plain JavaScript.
+
+---------------------------------------
+
+<a name="until" />
+### until(test, fn, callback)
+
+Repeatedly call `fn` until `test` returns `true`. Calls `callback` when stopped,
+or an error occurs.
+
+The inverse of [`whilst`](#whilst).
+
+---------------------------------------
+
+<a name="doUntil" />
+### doUntil(fn, test, callback)
+
+Like [`doWhilst`](#doWhilst), except the `test` is inverted. Note the argument ordering differs from `until`.
+
+---------------------------------------
+
+<a name="forever" />
+### forever(fn, errback)
+
+Calls the asynchronous function `fn` with a callback parameter that allows it to
+call itself again, in series, indefinitely.
+
+If an error is passed to the callback then `errback` is called with the
+error, and execution stops, otherwise it will never be called.
+
+```js
+async.forever(
+ function(next) {
+ // next is suitable for passing to things that need a callback(err [, whatever]);
+ // it will result in this function being called again.
+ },
+ function(err) {
+ // if next is called with a value in its first parameter, it will appear
+ // in here as 'err', and execution will stop.
+ }
+);
+```
+
+---------------------------------------
+
+<a name="waterfall" />
+### waterfall(tasks, [callback])
+
+Runs the `tasks` array of functions in series, each passing their results to the next in
+the array. However, if any of the `tasks` pass an error to their own callback, the
+next function is not executed, and the main `callback` is immediately called with
+the error.
+
+__Arguments__
+
+* `tasks` - An array of functions to run, each function is passed a
+ `callback(err, result1, result2, ...)` it must call on completion. The first
+ argument is an error (which can be `null`) and any further arguments will be
+ passed as arguments in order to the next task.
+* `callback(err, [results])` - An optional callback to run once all the functions
+ have completed. This will be passed the results of the last task's callback.
+
+
+
+__Example__
+
+```js
+async.waterfall([
+ function(callback){
+ callback(null, 'one', 'two');
+ },
+ function(arg1, arg2, callback){
+ // arg1 now equals 'one' and arg2 now equals 'two'
+ callback(null, 'three');
+ },
+ function(arg1, callback){
+ // arg1 now equals 'three'
+ callback(null, 'done');
+ }
+], function (err, result) {
+ // result now equals 'done'
+});
+```
+
+---------------------------------------
+<a name="compose" />
+### compose(fn1, fn2...)
+
+Creates a function which is a composition of the passed asynchronous
+functions. Each function consumes the return value of the function that
+follows. Composing functions `f()`, `g()`, and `h()` would produce the result of
+`f(g(h()))`, only this version uses callbacks to obtain the return values.
+
+Each function is executed with the `this` binding of the composed function.
+
+__Arguments__
+
+* `functions...` - the asynchronous functions to compose
+
+
+__Example__
+
+```js
+function add1(n, callback) {
+ setTimeout(function () {
+ callback(null, n + 1);
+ }, 10);
+}
+
+function mul3(n, callback) {
+ setTimeout(function () {
+ callback(null, n * 3);
+ }, 10);
+}
+
+var add1mul3 = async.compose(mul3, add1);
+
+add1mul3(4, function (err, result) {
+ // result now equals 15
+});
+```
+
+---------------------------------------
+<a name="seq" />
+### seq(fn1, fn2...)
+
+Version of the compose function that is more natural to read.
+Each following function consumes the return value of the latter function.
+
+Each function is executed with the `this` binding of the composed function.
+
+__Arguments__
+
+* functions... - the asynchronous functions to compose
+
+
+__Example__
+
+```js
+// Requires lodash (or underscore), express3 and dresende's orm2.
+// Part of an app, that fetches cats of the logged user.
+// This example uses `seq` function to avoid overnesting and error
+// handling clutter.
+app.get('/cats', function(request, response) {
+ function handleError(err, data, callback) {
+ if (err) {
+ console.error(err);
+ response.json({ status: 'error', message: err.message });
+ }
+ else {
+ callback(data);
+ }
+ }
+ var User = request.models.User;
+ async.seq(
+ _.bind(User.get, User), // 'User.get' has signature (id, callback(err, data))
+ handleError,
+ function(user, fn) {
+ user.getCats(fn); // 'getCats' has signature (callback(err, data))
+ },
+ handleError,
+ function(cats) {
+ response.json({ status: 'ok', message: 'Cats found', data: cats });
+ }
+ )(req.session.user_id);
+ }
+});
+```
+
+---------------------------------------
+<a name="applyEach" />
+### applyEach(fns, args..., callback)
+
+Applies the provided arguments to each function in the array, calling
+`callback` after all functions have completed. If you only provide the first
+argument, then it will return a function which lets you pass in the
+arguments as if it were a single function call.
+
+__Arguments__
+
+* `fns` - the asynchronous functions to all call with the same arguments
+* `args...` - any number of separate arguments to pass to the function
+* `callback` - the final argument should be the callback, called when all
+ functions have completed processing
+
+
+__Example__
+
+```js
+async.applyEach([enableSearch, updateSchema], 'bucket', callback);
+
+// partial application example:
+async.each(
+ buckets,
+ async.applyEach([enableSearch, updateSchema]),
+ callback
+);
+```
+
+---------------------------------------
+
+<a name="applyEachSeries" />
+### applyEachSeries(arr, iterator, callback)
+
+The same as [`applyEach`](#applyEach) only the functions are applied in series.
+
+---------------------------------------
+
+<a name="queue" />
+### queue(worker, concurrency)
+
+Creates a `queue` object with the specified `concurrency`. Tasks added to the
+`queue` are processed in parallel (up to the `concurrency` limit). If all
+`worker`s are in progress, the task is queued until one becomes available.
+Once a `worker` completes a `task`, that `task`'s callback is called.
+
+__Arguments__
+
+* `worker(task, callback)` - An asynchronous function for processing a queued
+ task, which must call its `callback(err)` argument when finished, with an
+ optional `error` as an argument.
+* `concurrency` - An `integer` for determining how many `worker` functions should be
+ run in parallel.
+
+__Queue objects__
+
+The `queue` object returned by this function has the following properties and
+methods:
+
+* `length()` - a function returning the number of items waiting to be processed.
+* `started` - a function returning whether or not any items have been pushed and processed by the queue
+* `running()` - a function returning the number of items currently being processed.
+* `idle()` - a function returning false if there are items waiting or being processed, or true if not.
+* `concurrency` - an integer for determining how many `worker` functions should be
+ run in parallel. This property can be changed after a `queue` is created to
+ alter the concurrency on-the-fly.
+* `push(task, [callback])` - add a new task to the `queue`. Calls `callback` once
+ the `worker` has finished processing the task. Instead of a single task, a `tasks` array
+ can be submitted. The respective callback is used for every task in the list.
+* `unshift(task, [callback])` - add a new task to the front of the `queue`.
+* `saturated` - a callback that is called when the `queue` length hits the `concurrency` limit,
+ and further tasks will be queued.
+* `empty` - a callback that is called when the last item from the `queue` is given to a `worker`.
+* `drain` - a callback that is called when the last item from the `queue` has returned from the `worker`.
+* `paused` - a boolean for determining whether the queue is in a paused state
+* `pause()` - a function that pauses the processing of tasks until `resume()` is called.
+* `resume()` - a function that resumes the processing of queued tasks when the queue is paused.
+* `kill()` - a function that empties remaining tasks from the queue forcing it to go idle.
+
+__Example__
+
+```js
+// create a queue object with concurrency 2
+
+var q = async.queue(function (task, callback) {
+ console.log('hello ' + task.name);
+ callback();
+}, 2);
+
+
+// assign a callback
+q.drain = function() {
+ console.log('all items have been processed');
+}
+
+// add some items to the queue
+
+q.push({name: 'foo'}, function (err) {
+ console.log('finished processing foo');
+});
+q.push({name: 'bar'}, function (err) {
+ console.log('finished processing bar');
+});
+
+// add some items to the queue (batch-wise)
+
+q.push([{name: 'baz'},{name: 'bay'},{name: 'bax'}], function (err) {
+ console.log('finished processing bar');
+});
+
+// add some items to the front of the queue
+
+q.unshift({name: 'bar'}, function (err) {
+ console.log('finished processing bar');
+});
+```
+
+
+---------------------------------------
+
+<a name="priorityQueue" />
+### priorityQueue(worker, concurrency)
+
+The same as [`queue`](#queue) only tasks are assigned a priority and completed in ascending priority order. There are two differences between `queue` and `priorityQueue` objects:
+
+* `push(task, priority, [callback])` - `priority` should be a number. If an array of
+ `tasks` is given, all tasks will be assigned the same priority.
+* The `unshift` method was removed.
+
+---------------------------------------
+
+<a name="cargo" />
+### cargo(worker, [payload])
+
+Creates a `cargo` object with the specified payload. Tasks added to the
+cargo will be processed altogether (up to the `payload` limit). If the
+`worker` is in progress, the task is queued until it becomes available. Once
+the `worker` has completed some tasks, each callback of those tasks is called.
+Check out [this animation](https://camo.githubusercontent.com/6bbd36f4cf5b35a0f11a96dcd2e97711ffc2fb37/68747470733a2f2f662e636c6f75642e6769746875622e636f6d2f6173736574732f313637363837312f36383130382f62626330636662302d356632392d313165322d393734662d3333393763363464633835382e676966) for how `cargo` and `queue` work.
+
+While [queue](#queue) passes only one task to one of a group of workers
+at a time, cargo passes an array of tasks to a single worker, repeating
+when the worker is finished.
+
+__Arguments__
+
+* `worker(tasks, callback)` - An asynchronous function for processing an array of
+ queued tasks, which must call its `callback(err)` argument when finished, with
+ an optional `err` argument.
+* `payload` - An optional `integer` for determining how many tasks should be
+ processed per round; if omitted, the default is unlimited.
+
+__Cargo objects__
+
+The `cargo` object returned by this function has the following properties and
+methods:
+
+* `length()` - A function returning the number of items waiting to be processed.
+* `payload` - An `integer` for determining how many tasks should be
+ process per round. This property can be changed after a `cargo` is created to
+ alter the payload on-the-fly.
+* `push(task, [callback])` - Adds `task` to the `queue`. The callback is called
+ once the `worker` has finished processing the task. Instead of a single task, an array of `tasks`
+ can be submitted. The respective callback is used for every task in the list.
+* `saturated` - A callback that is called when the `queue.length()` hits the concurrency and further tasks will be queued.
+* `empty` - A callback that is called when the last item from the `queue` is given to a `worker`.
+* `drain` - A callback that is called when the last item from the `queue` has returned from the `worker`.
+
+__Example__
+
+```js
+// create a cargo object with payload 2
+
+var cargo = async.cargo(function (tasks, callback) {
+ for(var i=0; i<tasks.length; i++){
+ console.log('hello ' + tasks[i].name);
+ }
+ callback();
+}, 2);
+
+
+// add some items
+
+cargo.push({name: 'foo'}, function (err) {
+ console.log('finished processing foo');
+});
+cargo.push({name: 'bar'}, function (err) {
+ console.log('finished processing bar');
+});
+cargo.push({name: 'baz'}, function (err) {
+ console.log('finished processing baz');
+});
+```
+
+---------------------------------------
+
+<a name="auto" />
+### auto(tasks, [callback])
+
+Determines the best order for running the functions in `tasks`, based on their
+requirements. Each function can optionally depend on other functions being completed
+first, and each function is run as soon as its requirements are satisfied.
+
+If any of the functions pass an error to their callback, it will not
+complete (so any other functions depending on it will not run), and the main
+`callback` is immediately called with the error. Functions also receive an
+object containing the results of functions which have completed so far.
+
+Note, all functions are called with a `results` object as a second argument,
+so it is unsafe to pass functions in the `tasks` object which cannot handle the
+extra argument.
+
+For example, this snippet of code:
+
+```js
+async.auto({
+ readData: async.apply(fs.readFile, 'data.txt', 'utf-8')
+}, callback);
+```
+
+will have the effect of calling `readFile` with the results object as the last
+argument, which will fail:
+
+```js
+fs.readFile('data.txt', 'utf-8', cb, {});
+```
+
+Instead, wrap the call to `readFile` in a function which does not forward the
+`results` object:
+
+```js
+async.auto({
+ readData: function(cb, results){
+ fs.readFile('data.txt', 'utf-8', cb);
+ }
+}, callback);
+```
+
+__Arguments__
+
+* `tasks` - An object. Each of its properties is either a function or an array of
+ requirements, with the function itself the last item in the array. The object's key
+ of a property serves as the name of the task defined by that property,
+ i.e. can be used when specifying requirements for other tasks.
+ The function receives two arguments: (1) a `callback(err, result)` which must be
+ called when finished, passing an `error` (which can be `null`) and the result of
+ the function's execution, and (2) a `results` object, containing the results of
+ the previously executed functions.
+* `callback(err, results)` - An optional callback which is called when all the
+ tasks have been completed. It receives the `err` argument if any `tasks`
+ pass an error to their callback. Results are always returned; however, if
+ an error occurs, no further `tasks` will be performed, and the results
+ object will only contain partial results.
+
+
+__Example__
+
+```js
+async.auto({
+ get_data: function(callback){
+ console.log('in get_data');
+ // async code to get some data
+ callback(null, 'data', 'converted to array');
+ },
+ make_folder: function(callback){
+ console.log('in make_folder');
+ // async code to create a directory to store a file in
+ // this is run at the same time as getting the data
+ callback(null, 'folder');
+ },
+ write_file: ['get_data', 'make_folder', function(callback, results){
+ console.log('in write_file', JSON.stringify(results));
+ // once there is some data and the directory exists,
+ // write the data to a file in the directory
+ callback(null, 'filename');
+ }],
+ email_link: ['write_file', function(callback, results){
+ console.log('in email_link', JSON.stringify(results));
+ // once the file is written let's email a link to it...
+ // results.write_file contains the filename returned by write_file.
+ callback(null, {'file':results.write_file, 'email':'user@example.com'});
+ }]
+}, function(err, results) {
+ console.log('err = ', err);
+ console.log('results = ', results);
+});
+```
+
+This is a fairly trivial example, but to do this using the basic parallel and
+series functions would look like this:
+
+```js
+async.parallel([
+ function(callback){
+ console.log('in get_data');
+ // async code to get some data
+ callback(null, 'data', 'converted to array');
+ },
+ function(callback){
+ console.log('in make_folder');
+ // async code to create a directory to store a file in
+ // this is run at the same time as getting the data
+ callback(null, 'folder');
+ }
+],
+function(err, results){
+ async.series([
+ function(callback){
+ console.log('in write_file', JSON.stringify(results));
+ // once there is some data and the directory exists,
+ // write the data to a file in the directory
+ results.push('filename');
+ callback(null);
+ },
+ function(callback){
+ console.log('in email_link', JSON.stringify(results));
+ // once the file is written let's email a link to it...
+ callback(null, {'file':results.pop(), 'email':'user@example.com'});
+ }
+ ]);
+});
+```
+
+For a complicated series of `async` tasks, using the [`auto`](#auto) function makes adding
+new tasks much easier (and the code more readable).
+
+
+---------------------------------------
+
+<a name="retry" />
+### retry([times = 5], task, [callback])
+
+Attempts to get a successful response from `task` no more than `times` times before
+returning an error. If the task is successful, the `callback` will be passed the result
+of the successfull task. If all attemps fail, the callback will be passed the error and
+result (if any) of the final attempt.
+
+__Arguments__
+
+* `times` - An integer indicating how many times to attempt the `task` before giving up. Defaults to 5.
+* `task(callback, results)` - A function which receives two arguments: (1) a `callback(err, result)`
+ which must be called when finished, passing `err` (which can be `null`) and the `result` of
+ the function's execution, and (2) a `results` object, containing the results of
+ the previously executed functions (if nested inside another control flow).
+* `callback(err, results)` - An optional callback which is called when the
+ task has succeeded, or after the final failed attempt. It receives the `err` and `result` arguments of the last attempt at completing the `task`.
+
+The [`retry`](#retry) function can be used as a stand-alone control flow by passing a
+callback, as shown below:
+
+```js
+async.retry(3, apiMethod, function(err, result) {
+ // do something with the result
+});
+```
+
+It can also be embeded within other control flow functions to retry individual methods
+that are not as reliable, like this:
+
+```js
+async.auto({
+ users: api.getUsers.bind(api),
+ payments: async.retry(3, api.getPayments.bind(api))
+}, function(err, results) {
+ // do something with the results
+});
+```
+
+
+---------------------------------------
+
+<a name="iterator" />
+### iterator(tasks)
+
+Creates an iterator function which calls the next function in the `tasks` array,
+returning a continuation to call the next one after that. It's also possible to
+“peek” at the next iterator with `iterator.next()`.
+
+This function is used internally by the `async` module, but can be useful when
+you want to manually control the flow of functions in series.
+
+__Arguments__
+
+* `tasks` - An array of functions to run.
+
+__Example__
+
+```js
+var iterator = async.iterator([
+ function(){ sys.p('one'); },
+ function(){ sys.p('two'); },
+ function(){ sys.p('three'); }
+]);
+
+node> var iterator2 = iterator();
+'one'
+node> var iterator3 = iterator2();
+'two'
+node> iterator3();
+'three'
+node> var nextfn = iterator2.next();
+node> nextfn();
+'three'
+```
+
+---------------------------------------
+
+<a name="apply" />
+### apply(function, arguments..)
+
+Creates a continuation function with some arguments already applied.
+
+Useful as a shorthand when combined with other control flow functions. Any arguments
+passed to the returned function are added to the arguments originally passed
+to apply.
+
+__Arguments__
+
+* `function` - The function you want to eventually apply all arguments to.
+* `arguments...` - Any number of arguments to automatically apply when the
+ continuation is called.
+
+__Example__
+
+```js
+// using apply
+
+async.parallel([
+ async.apply(fs.writeFile, 'testfile1', 'test1'),
+ async.apply(fs.writeFile, 'testfile2', 'test2'),
+]);
+
+
+// the same process without using apply
+
+async.parallel([
+ function(callback){
+ fs.writeFile('testfile1', 'test1', callback);
+ },
+ function(callback){
+ fs.writeFile('testfile2', 'test2', callback);
+ }
+]);
+```
+
+It's possible to pass any number of additional arguments when calling the
+continuation:
+
+```js
+node> var fn = async.apply(sys.puts, 'one');
+node> fn('two', 'three');
+one
+two
+three
+```
+
+---------------------------------------
+
+<a name="nextTick" />
+### nextTick(callback)
+
+Calls `callback` on a later loop around the event loop. In Node.js this just
+calls `process.nextTick`; in the browser it falls back to `setImmediate(callback)`
+if available, otherwise `setTimeout(callback, 0)`, which means other higher priority
+events may precede the execution of `callback`.
+
+This is used internally for browser-compatibility purposes.
+
+__Arguments__
+
+* `callback` - The function to call on a later loop around the event loop.
+
+__Example__
+
+```js
+var call_order = [];
+async.nextTick(function(){
+ call_order.push('two');
+ // call_order now equals ['one','two']
+});
+call_order.push('one')
+```
+
+<a name="times" />
+### times(n, callback)
+
+Calls the `callback` function `n` times, and accumulates results in the same manner
+you would use with [`map`](#map).
+
+__Arguments__
+
+* `n` - The number of times to run the function.
+* `callback` - The function to call `n` times.
+
+__Example__
+
+```js
+// Pretend this is some complicated async factory
+var createUser = function(id, callback) {
+ callback(null, {
+ id: 'user' + id
+ })
+}
+// generate 5 users
+async.times(5, function(n, next){
+ createUser(n, function(err, user) {
+ next(err, user)
+ })
+}, function(err, users) {
+ // we should now have 5 users
+});
+```
+
+<a name="timesSeries" />
+### timesSeries(n, callback)
+
+The same as [`times`](#times), only the iterator is applied to each item in `arr` in
+series. The next `iterator` is only called once the current one has completed.
+The results array will be in the same order as the original.
+
+
+## Utils
+
+<a name="memoize" />
+### memoize(fn, [hasher])
+
+Caches the results of an `async` function. When creating a hash to store function
+results against, the callback is omitted from the hash and an optional hash
+function can be used.
+
+The cache of results is exposed as the `memo` property of the function returned
+by `memoize`.
+
+__Arguments__
+
+* `fn` - The function to proxy and cache results from.
+* `hasher` - Tn optional function for generating a custom hash for storing
+ results. It has all the arguments applied to it apart from the callback, and
+ must be synchronous.
+
+__Example__
+
+```js
+var slow_fn = function (name, callback) {
+ // do something
+ callback(null, result);
+};
+var fn = async.memoize(slow_fn);
+
+// fn can now be used as if it were slow_fn
+fn('some name', function () {
+ // callback
+});
+```
+
+<a name="unmemoize" />
+### unmemoize(fn)
+
+Undoes a [`memoize`](#memoize)d function, reverting it to the original, unmemoized
+form. Handy for testing.
+
+__Arguments__
+
+* `fn` - the memoized function
+
+<a name="log" />
+### log(function, arguments)
+
+Logs the result of an `async` function to the `console`. Only works in Node.js or
+in browsers that support `console.log` and `console.error` (such as FF and Chrome).
+If multiple arguments are returned from the async function, `console.log` is
+called on each argument in order.
+
+__Arguments__
+
+* `function` - The function you want to eventually apply all arguments to.
+* `arguments...` - Any number of arguments to apply to the function.
+
+__Example__
+
+```js
+var hello = function(name, callback){
+ setTimeout(function(){
+ callback(null, 'hello ' + name);
+ }, 1000);
+};
+```
+```js
+node> async.log(hello, 'world');
+'hello world'
+```
+
+---------------------------------------
+
+<a name="dir" />
+### dir(function, arguments)
+
+Logs the result of an `async` function to the `console` using `console.dir` to
+display the properties of the resulting object. Only works in Node.js or
+in browsers that support `console.dir` and `console.error` (such as FF and Chrome).
+If multiple arguments are returned from the async function, `console.dir` is
+called on each argument in order.
+
+__Arguments__
+
+* `function` - The function you want to eventually apply all arguments to.
+* `arguments...` - Any number of arguments to apply to the function.
+
+__Example__
+
+```js
+var hello = function(name, callback){
+ setTimeout(function(){
+ callback(null, {hello: name});
+ }, 1000);
+};
+```
+```js
+node> async.dir(hello, 'world');
+{hello: 'world'}
+```
+
+---------------------------------------
+
+<a name="noConflict" />
+### noConflict()
+
+Changes the value of `async` back to its original value, returning a reference to the
+`async` object.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/component.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/component.json
new file mode 100644
index 0000000000..bbb011548c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/component.json
@@ -0,0 +1,11 @@
+{
+ "name": "async",
+ "repo": "caolan/async",
+ "description": "Higher-order functions and common patterns for asynchronous code",
+ "version": "0.1.23",
+ "keywords": [],
+ "dependencies": {},
+ "development": {},
+ "main": "lib/async.js",
+ "scripts": [ "lib/async.js" ]
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/lib/async.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/lib/async.js
new file mode 100755
index 0000000000..1077aafc4c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/lib/async.js
@@ -0,0 +1,1123 @@
+/*!
+ * async
+ * https://github.com/caolan/async
+ *
+ * Copyright 2010-2014 Caolan McMahon
+ * Released under the MIT license
+ */
+/*jshint onevar: false, indent:4 */
+/*global setImmediate: false, setTimeout: false, console: false */
+(function () {
+
+ var async = {};
+
+ // global on the server, window in the browser
+ var root, previous_async;
+
+ root = this;
+ if (root != null) {
+ previous_async = root.async;
+ }
+
+ async.noConflict = function () {
+ root.async = previous_async;
+ return async;
+ };
+
+ function only_once(fn) {
+ var called = false;
+ return function() {
+ if (called) throw new Error("Callback was already called.");
+ called = true;
+ fn.apply(root, arguments);
+ }
+ }
+
+ //// cross-browser compatiblity functions ////
+
+ var _toString = Object.prototype.toString;
+
+ var _isArray = Array.isArray || function (obj) {
+ return _toString.call(obj) === '[object Array]';
+ };
+
+ var _each = function (arr, iterator) {
+ if (arr.forEach) {
+ return arr.forEach(iterator);
+ }
+ for (var i = 0; i < arr.length; i += 1) {
+ iterator(arr[i], i, arr);
+ }
+ };
+
+ var _map = function (arr, iterator) {
+ if (arr.map) {
+ return arr.map(iterator);
+ }
+ var results = [];
+ _each(arr, function (x, i, a) {
+ results.push(iterator(x, i, a));
+ });
+ return results;
+ };
+
+ var _reduce = function (arr, iterator, memo) {
+ if (arr.reduce) {
+ return arr.reduce(iterator, memo);
+ }
+ _each(arr, function (x, i, a) {
+ memo = iterator(memo, x, i, a);
+ });
+ return memo;
+ };
+
+ var _keys = function (obj) {
+ if (Object.keys) {
+ return Object.keys(obj);
+ }
+ var keys = [];
+ for (var k in obj) {
+ if (obj.hasOwnProperty(k)) {
+ keys.push(k);
+ }
+ }
+ return keys;
+ };
+
+ //// exported async module functions ////
+
+ //// nextTick implementation with browser-compatible fallback ////
+ if (typeof process === 'undefined' || !(process.nextTick)) {
+ if (typeof setImmediate === 'function') {
+ async.nextTick = function (fn) {
+ // not a direct alias for IE10 compatibility
+ setImmediate(fn);
+ };
+ async.setImmediate = async.nextTick;
+ }
+ else {
+ async.nextTick = function (fn) {
+ setTimeout(fn, 0);
+ };
+ async.setImmediate = async.nextTick;
+ }
+ }
+ else {
+ async.nextTick = process.nextTick;
+ if (typeof setImmediate !== 'undefined') {
+ async.setImmediate = function (fn) {
+ // not a direct alias for IE10 compatibility
+ setImmediate(fn);
+ };
+ }
+ else {
+ async.setImmediate = async.nextTick;
+ }
+ }
+
+ async.each = function (arr, iterator, callback) {
+ callback = callback || function () {};
+ if (!arr.length) {
+ return callback();
+ }
+ var completed = 0;
+ _each(arr, function (x) {
+ iterator(x, only_once(done) );
+ });
+ function done(err) {
+ if (err) {
+ callback(err);
+ callback = function () {};
+ }
+ else {
+ completed += 1;
+ if (completed >= arr.length) {
+ callback();
+ }
+ }
+ }
+ };
+ async.forEach = async.each;
+
+ async.eachSeries = function (arr, iterator, callback) {
+ callback = callback || function () {};
+ if (!arr.length) {
+ return callback();
+ }
+ var completed = 0;
+ var iterate = function () {
+ iterator(arr[completed], function (err) {
+ if (err) {
+ callback(err);
+ callback = function () {};
+ }
+ else {
+ completed += 1;
+ if (completed >= arr.length) {
+ callback();
+ }
+ else {
+ iterate();
+ }
+ }
+ });
+ };
+ iterate();
+ };
+ async.forEachSeries = async.eachSeries;
+
+ async.eachLimit = function (arr, limit, iterator, callback) {
+ var fn = _eachLimit(limit);
+ fn.apply(null, [arr, iterator, callback]);
+ };
+ async.forEachLimit = async.eachLimit;
+
+ var _eachLimit = function (limit) {
+
+ return function (arr, iterator, callback) {
+ callback = callback || function () {};
+ if (!arr.length || limit <= 0) {
+ return callback();
+ }
+ var completed = 0;
+ var started = 0;
+ var running = 0;
+
+ (function replenish () {
+ if (completed >= arr.length) {
+ return callback();
+ }
+
+ while (running < limit && started < arr.length) {
+ started += 1;
+ running += 1;
+ iterator(arr[started - 1], function (err) {
+ if (err) {
+ callback(err);
+ callback = function () {};
+ }
+ else {
+ completed += 1;
+ running -= 1;
+ if (completed >= arr.length) {
+ callback();
+ }
+ else {
+ replenish();
+ }
+ }
+ });
+ }
+ })();
+ };
+ };
+
+
+ var doParallel = function (fn) {
+ return function () {
+ var args = Array.prototype.slice.call(arguments);
+ return fn.apply(null, [async.each].concat(args));
+ };
+ };
+ var doParallelLimit = function(limit, fn) {
+ return function () {
+ var args = Array.prototype.slice.call(arguments);
+ return fn.apply(null, [_eachLimit(limit)].concat(args));
+ };
+ };
+ var doSeries = function (fn) {
+ return function () {
+ var args = Array.prototype.slice.call(arguments);
+ return fn.apply(null, [async.eachSeries].concat(args));
+ };
+ };
+
+
+ var _asyncMap = function (eachfn, arr, iterator, callback) {
+ arr = _map(arr, function (x, i) {
+ return {index: i, value: x};
+ });
+ if (!callback) {
+ eachfn(arr, function (x, callback) {
+ iterator(x.value, function (err) {
+ callback(err);
+ });
+ });
+ } else {
+ var results = [];
+ eachfn(arr, function (x, callback) {
+ iterator(x.value, function (err, v) {
+ results[x.index] = v;
+ callback(err);
+ });
+ }, function (err) {
+ callback(err, results);
+ });
+ }
+ };
+ async.map = doParallel(_asyncMap);
+ async.mapSeries = doSeries(_asyncMap);
+ async.mapLimit = function (arr, limit, iterator, callback) {
+ return _mapLimit(limit)(arr, iterator, callback);
+ };
+
+ var _mapLimit = function(limit) {
+ return doParallelLimit(limit, _asyncMap);
+ };
+
+ // reduce only has a series version, as doing reduce in parallel won't
+ // work in many situations.
+ async.reduce = function (arr, memo, iterator, callback) {
+ async.eachSeries(arr, function (x, callback) {
+ iterator(memo, x, function (err, v) {
+ memo = v;
+ callback(err);
+ });
+ }, function (err) {
+ callback(err, memo);
+ });
+ };
+ // inject alias
+ async.inject = async.reduce;
+ // foldl alias
+ async.foldl = async.reduce;
+
+ async.reduceRight = function (arr, memo, iterator, callback) {
+ var reversed = _map(arr, function (x) {
+ return x;
+ }).reverse();
+ async.reduce(reversed, memo, iterator, callback);
+ };
+ // foldr alias
+ async.foldr = async.reduceRight;
+
+ var _filter = function (eachfn, arr, iterator, callback) {
+ var results = [];
+ arr = _map(arr, function (x, i) {
+ return {index: i, value: x};
+ });
+ eachfn(arr, function (x, callback) {
+ iterator(x.value, function (v) {
+ if (v) {
+ results.push(x);
+ }
+ callback();
+ });
+ }, function (err) {
+ callback(_map(results.sort(function (a, b) {
+ return a.index - b.index;
+ }), function (x) {
+ return x.value;
+ }));
+ });
+ };
+ async.filter = doParallel(_filter);
+ async.filterSeries = doSeries(_filter);
+ // select alias
+ async.select = async.filter;
+ async.selectSeries = async.filterSeries;
+
+ var _reject = function (eachfn, arr, iterator, callback) {
+ var results = [];
+ arr = _map(arr, function (x, i) {
+ return {index: i, value: x};
+ });
+ eachfn(arr, function (x, callback) {
+ iterator(x.value, function (v) {
+ if (!v) {
+ results.push(x);
+ }
+ callback();
+ });
+ }, function (err) {
+ callback(_map(results.sort(function (a, b) {
+ return a.index - b.index;
+ }), function (x) {
+ return x.value;
+ }));
+ });
+ };
+ async.reject = doParallel(_reject);
+ async.rejectSeries = doSeries(_reject);
+
+ var _detect = function (eachfn, arr, iterator, main_callback) {
+ eachfn(arr, function (x, callback) {
+ iterator(x, function (result) {
+ if (result) {
+ main_callback(x);
+ main_callback = function () {};
+ }
+ else {
+ callback();
+ }
+ });
+ }, function (err) {
+ main_callback();
+ });
+ };
+ async.detect = doParallel(_detect);
+ async.detectSeries = doSeries(_detect);
+
+ async.some = function (arr, iterator, main_callback) {
+ async.each(arr, function (x, callback) {
+ iterator(x, function (v) {
+ if (v) {
+ main_callback(true);
+ main_callback = function () {};
+ }
+ callback();
+ });
+ }, function (err) {
+ main_callback(false);
+ });
+ };
+ // any alias
+ async.any = async.some;
+
+ async.every = function (arr, iterator, main_callback) {
+ async.each(arr, function (x, callback) {
+ iterator(x, function (v) {
+ if (!v) {
+ main_callback(false);
+ main_callback = function () {};
+ }
+ callback();
+ });
+ }, function (err) {
+ main_callback(true);
+ });
+ };
+ // all alias
+ async.all = async.every;
+
+ async.sortBy = function (arr, iterator, callback) {
+ async.map(arr, function (x, callback) {
+ iterator(x, function (err, criteria) {
+ if (err) {
+ callback(err);
+ }
+ else {
+ callback(null, {value: x, criteria: criteria});
+ }
+ });
+ }, function (err, results) {
+ if (err) {
+ return callback(err);
+ }
+ else {
+ var fn = function (left, right) {
+ var a = left.criteria, b = right.criteria;
+ return a < b ? -1 : a > b ? 1 : 0;
+ };
+ callback(null, _map(results.sort(fn), function (x) {
+ return x.value;
+ }));
+ }
+ });
+ };
+
+ async.auto = function (tasks, callback) {
+ callback = callback || function () {};
+ var keys = _keys(tasks);
+ var remainingTasks = keys.length
+ if (!remainingTasks) {
+ return callback();
+ }
+
+ var results = {};
+
+ var listeners = [];
+ var addListener = function (fn) {
+ listeners.unshift(fn);
+ };
+ var removeListener = function (fn) {
+ for (var i = 0; i < listeners.length; i += 1) {
+ if (listeners[i] === fn) {
+ listeners.splice(i, 1);
+ return;
+ }
+ }
+ };
+ var taskComplete = function () {
+ remainingTasks--
+ _each(listeners.slice(0), function (fn) {
+ fn();
+ });
+ };
+
+ addListener(function () {
+ if (!remainingTasks) {
+ var theCallback = callback;
+ // prevent final callback from calling itself if it errors
+ callback = function () {};
+
+ theCallback(null, results);
+ }
+ });
+
+ _each(keys, function (k) {
+ var task = _isArray(tasks[k]) ? tasks[k]: [tasks[k]];
+ var taskCallback = function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (args.length <= 1) {
+ args = args[0];
+ }
+ if (err) {
+ var safeResults = {};
+ _each(_keys(results), function(rkey) {
+ safeResults[rkey] = results[rkey];
+ });
+ safeResults[k] = args;
+ callback(err, safeResults);
+ // stop subsequent errors hitting callback multiple times
+ callback = function () {};
+ }
+ else {
+ results[k] = args;
+ async.setImmediate(taskComplete);
+ }
+ };
+ var requires = task.slice(0, Math.abs(task.length - 1)) || [];
+ var ready = function () {
+ return _reduce(requires, function (a, x) {
+ return (a && results.hasOwnProperty(x));
+ }, true) && !results.hasOwnProperty(k);
+ };
+ if (ready()) {
+ task[task.length - 1](taskCallback, results);
+ }
+ else {
+ var listener = function () {
+ if (ready()) {
+ removeListener(listener);
+ task[task.length - 1](taskCallback, results);
+ }
+ };
+ addListener(listener);
+ }
+ });
+ };
+
+ async.retry = function(times, task, callback) {
+ var DEFAULT_TIMES = 5;
+ var attempts = [];
+ // Use defaults if times not passed
+ if (typeof times === 'function') {
+ callback = task;
+ task = times;
+ times = DEFAULT_TIMES;
+ }
+ // Make sure times is a number
+ times = parseInt(times, 10) || DEFAULT_TIMES;
+ var wrappedTask = function(wrappedCallback, wrappedResults) {
+ var retryAttempt = function(task, finalAttempt) {
+ return function(seriesCallback) {
+ task(function(err, result){
+ seriesCallback(!err || finalAttempt, {err: err, result: result});
+ }, wrappedResults);
+ };
+ };
+ while (times) {
+ attempts.push(retryAttempt(task, !(times-=1)));
+ }
+ async.series(attempts, function(done, data){
+ data = data[data.length - 1];
+ (wrappedCallback || callback)(data.err, data.result);
+ });
+ }
+ // If a callback is passed, run this as a controll flow
+ return callback ? wrappedTask() : wrappedTask
+ };
+
+ async.waterfall = function (tasks, callback) {
+ callback = callback || function () {};
+ if (!_isArray(tasks)) {
+ var err = new Error('First argument to waterfall must be an array of functions');
+ return callback(err);
+ }
+ if (!tasks.length) {
+ return callback();
+ }
+ var wrapIterator = function (iterator) {
+ return function (err) {
+ if (err) {
+ callback.apply(null, arguments);
+ callback = function () {};
+ }
+ else {
+ var args = Array.prototype.slice.call(arguments, 1);
+ var next = iterator.next();
+ if (next) {
+ args.push(wrapIterator(next));
+ }
+ else {
+ args.push(callback);
+ }
+ async.setImmediate(function () {
+ iterator.apply(null, args);
+ });
+ }
+ };
+ };
+ wrapIterator(async.iterator(tasks))();
+ };
+
+ var _parallel = function(eachfn, tasks, callback) {
+ callback = callback || function () {};
+ if (_isArray(tasks)) {
+ eachfn.map(tasks, function (fn, callback) {
+ if (fn) {
+ fn(function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (args.length <= 1) {
+ args = args[0];
+ }
+ callback.call(null, err, args);
+ });
+ }
+ }, callback);
+ }
+ else {
+ var results = {};
+ eachfn.each(_keys(tasks), function (k, callback) {
+ tasks[k](function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (args.length <= 1) {
+ args = args[0];
+ }
+ results[k] = args;
+ callback(err);
+ });
+ }, function (err) {
+ callback(err, results);
+ });
+ }
+ };
+
+ async.parallel = function (tasks, callback) {
+ _parallel({ map: async.map, each: async.each }, tasks, callback);
+ };
+
+ async.parallelLimit = function(tasks, limit, callback) {
+ _parallel({ map: _mapLimit(limit), each: _eachLimit(limit) }, tasks, callback);
+ };
+
+ async.series = function (tasks, callback) {
+ callback = callback || function () {};
+ if (_isArray(tasks)) {
+ async.mapSeries(tasks, function (fn, callback) {
+ if (fn) {
+ fn(function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (args.length <= 1) {
+ args = args[0];
+ }
+ callback.call(null, err, args);
+ });
+ }
+ }, callback);
+ }
+ else {
+ var results = {};
+ async.eachSeries(_keys(tasks), function (k, callback) {
+ tasks[k](function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (args.length <= 1) {
+ args = args[0];
+ }
+ results[k] = args;
+ callback(err);
+ });
+ }, function (err) {
+ callback(err, results);
+ });
+ }
+ };
+
+ async.iterator = function (tasks) {
+ var makeCallback = function (index) {
+ var fn = function () {
+ if (tasks.length) {
+ tasks[index].apply(null, arguments);
+ }
+ return fn.next();
+ };
+ fn.next = function () {
+ return (index < tasks.length - 1) ? makeCallback(index + 1): null;
+ };
+ return fn;
+ };
+ return makeCallback(0);
+ };
+
+ async.apply = function (fn) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ return function () {
+ return fn.apply(
+ null, args.concat(Array.prototype.slice.call(arguments))
+ );
+ };
+ };
+
+ var _concat = function (eachfn, arr, fn, callback) {
+ var r = [];
+ eachfn(arr, function (x, cb) {
+ fn(x, function (err, y) {
+ r = r.concat(y || []);
+ cb(err);
+ });
+ }, function (err) {
+ callback(err, r);
+ });
+ };
+ async.concat = doParallel(_concat);
+ async.concatSeries = doSeries(_concat);
+
+ async.whilst = function (test, iterator, callback) {
+ if (test()) {
+ iterator(function (err) {
+ if (err) {
+ return callback(err);
+ }
+ async.whilst(test, iterator, callback);
+ });
+ }
+ else {
+ callback();
+ }
+ };
+
+ async.doWhilst = function (iterator, test, callback) {
+ iterator(function (err) {
+ if (err) {
+ return callback(err);
+ }
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (test.apply(null, args)) {
+ async.doWhilst(iterator, test, callback);
+ }
+ else {
+ callback();
+ }
+ });
+ };
+
+ async.until = function (test, iterator, callback) {
+ if (!test()) {
+ iterator(function (err) {
+ if (err) {
+ return callback(err);
+ }
+ async.until(test, iterator, callback);
+ });
+ }
+ else {
+ callback();
+ }
+ };
+
+ async.doUntil = function (iterator, test, callback) {
+ iterator(function (err) {
+ if (err) {
+ return callback(err);
+ }
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (!test.apply(null, args)) {
+ async.doUntil(iterator, test, callback);
+ }
+ else {
+ callback();
+ }
+ });
+ };
+
+ async.queue = function (worker, concurrency) {
+ if (concurrency === undefined) {
+ concurrency = 1;
+ }
+ function _insert(q, data, pos, callback) {
+ if (!q.started){
+ q.started = true;
+ }
+ if (!_isArray(data)) {
+ data = [data];
+ }
+ if(data.length == 0) {
+ // call drain immediately if there are no tasks
+ return async.setImmediate(function() {
+ if (q.drain) {
+ q.drain();
+ }
+ });
+ }
+ _each(data, function(task) {
+ var item = {
+ data: task,
+ callback: typeof callback === 'function' ? callback : null
+ };
+
+ if (pos) {
+ q.tasks.unshift(item);
+ } else {
+ q.tasks.push(item);
+ }
+
+ if (q.saturated && q.tasks.length === q.concurrency) {
+ q.saturated();
+ }
+ async.setImmediate(q.process);
+ });
+ }
+
+ var workers = 0;
+ var q = {
+ tasks: [],
+ concurrency: concurrency,
+ saturated: null,
+ empty: null,
+ drain: null,
+ started: false,
+ paused: false,
+ push: function (data, callback) {
+ _insert(q, data, false, callback);
+ },
+ kill: function () {
+ q.drain = null;
+ q.tasks = [];
+ },
+ unshift: function (data, callback) {
+ _insert(q, data, true, callback);
+ },
+ process: function () {
+ if (!q.paused && workers < q.concurrency && q.tasks.length) {
+ var task = q.tasks.shift();
+ if (q.empty && q.tasks.length === 0) {
+ q.empty();
+ }
+ workers += 1;
+ var next = function () {
+ workers -= 1;
+ if (task.callback) {
+ task.callback.apply(task, arguments);
+ }
+ if (q.drain && q.tasks.length + workers === 0) {
+ q.drain();
+ }
+ q.process();
+ };
+ var cb = only_once(next);
+ worker(task.data, cb);
+ }
+ },
+ length: function () {
+ return q.tasks.length;
+ },
+ running: function () {
+ return workers;
+ },
+ idle: function() {
+ return q.tasks.length + workers === 0;
+ },
+ pause: function () {
+ if (q.paused === true) { return; }
+ q.paused = true;
+ q.process();
+ },
+ resume: function () {
+ if (q.paused === false) { return; }
+ q.paused = false;
+ q.process();
+ }
+ };
+ return q;
+ };
+
+ async.priorityQueue = function (worker, concurrency) {
+
+ function _compareTasks(a, b){
+ return a.priority - b.priority;
+ };
+
+ function _binarySearch(sequence, item, compare) {
+ var beg = -1,
+ end = sequence.length - 1;
+ while (beg < end) {
+ var mid = beg + ((end - beg + 1) >>> 1);
+ if (compare(item, sequence[mid]) >= 0) {
+ beg = mid;
+ } else {
+ end = mid - 1;
+ }
+ }
+ return beg;
+ }
+
+ function _insert(q, data, priority, callback) {
+ if (!q.started){
+ q.started = true;
+ }
+ if (!_isArray(data)) {
+ data = [data];
+ }
+ if(data.length == 0) {
+ // call drain immediately if there are no tasks
+ return async.setImmediate(function() {
+ if (q.drain) {
+ q.drain();
+ }
+ });
+ }
+ _each(data, function(task) {
+ var item = {
+ data: task,
+ priority: priority,
+ callback: typeof callback === 'function' ? callback : null
+ };
+
+ q.tasks.splice(_binarySearch(q.tasks, item, _compareTasks) + 1, 0, item);
+
+ if (q.saturated && q.tasks.length === q.concurrency) {
+ q.saturated();
+ }
+ async.setImmediate(q.process);
+ });
+ }
+
+ // Start with a normal queue
+ var q = async.queue(worker, concurrency);
+
+ // Override push to accept second parameter representing priority
+ q.push = function (data, priority, callback) {
+ _insert(q, data, priority, callback);
+ };
+
+ // Remove unshift function
+ delete q.unshift;
+
+ return q;
+ };
+
+ async.cargo = function (worker, payload) {
+ var working = false,
+ tasks = [];
+
+ var cargo = {
+ tasks: tasks,
+ payload: payload,
+ saturated: null,
+ empty: null,
+ drain: null,
+ drained: true,
+ push: function (data, callback) {
+ if (!_isArray(data)) {
+ data = [data];
+ }
+ _each(data, function(task) {
+ tasks.push({
+ data: task,
+ callback: typeof callback === 'function' ? callback : null
+ });
+ cargo.drained = false;
+ if (cargo.saturated && tasks.length === payload) {
+ cargo.saturated();
+ }
+ });
+ async.setImmediate(cargo.process);
+ },
+ process: function process() {
+ if (working) return;
+ if (tasks.length === 0) {
+ if(cargo.drain && !cargo.drained) cargo.drain();
+ cargo.drained = true;
+ return;
+ }
+
+ var ts = typeof payload === 'number'
+ ? tasks.splice(0, payload)
+ : tasks.splice(0, tasks.length);
+
+ var ds = _map(ts, function (task) {
+ return task.data;
+ });
+
+ if(cargo.empty) cargo.empty();
+ working = true;
+ worker(ds, function () {
+ working = false;
+
+ var args = arguments;
+ _each(ts, function (data) {
+ if (data.callback) {
+ data.callback.apply(null, args);
+ }
+ });
+
+ process();
+ });
+ },
+ length: function () {
+ return tasks.length;
+ },
+ running: function () {
+ return working;
+ }
+ };
+ return cargo;
+ };
+
+ var _console_fn = function (name) {
+ return function (fn) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ fn.apply(null, args.concat([function (err) {
+ var args = Array.prototype.slice.call(arguments, 1);
+ if (typeof console !== 'undefined') {
+ if (err) {
+ if (console.error) {
+ console.error(err);
+ }
+ }
+ else if (console[name]) {
+ _each(args, function (x) {
+ console[name](x);
+ });
+ }
+ }
+ }]));
+ };
+ };
+ async.log = _console_fn('log');
+ async.dir = _console_fn('dir');
+ /*async.info = _console_fn('info');
+ async.warn = _console_fn('warn');
+ async.error = _console_fn('error');*/
+
+ async.memoize = function (fn, hasher) {
+ var memo = {};
+ var queues = {};
+ hasher = hasher || function (x) {
+ return x;
+ };
+ var memoized = function () {
+ var args = Array.prototype.slice.call(arguments);
+ var callback = args.pop();
+ var key = hasher.apply(null, args);
+ if (key in memo) {
+ async.nextTick(function () {
+ callback.apply(null, memo[key]);
+ });
+ }
+ else if (key in queues) {
+ queues[key].push(callback);
+ }
+ else {
+ queues[key] = [callback];
+ fn.apply(null, args.concat([function () {
+ memo[key] = arguments;
+ var q = queues[key];
+ delete queues[key];
+ for (var i = 0, l = q.length; i < l; i++) {
+ q[i].apply(null, arguments);
+ }
+ }]));
+ }
+ };
+ memoized.memo = memo;
+ memoized.unmemoized = fn;
+ return memoized;
+ };
+
+ async.unmemoize = function (fn) {
+ return function () {
+ return (fn.unmemoized || fn).apply(null, arguments);
+ };
+ };
+
+ async.times = function (count, iterator, callback) {
+ var counter = [];
+ for (var i = 0; i < count; i++) {
+ counter.push(i);
+ }
+ return async.map(counter, iterator, callback);
+ };
+
+ async.timesSeries = function (count, iterator, callback) {
+ var counter = [];
+ for (var i = 0; i < count; i++) {
+ counter.push(i);
+ }
+ return async.mapSeries(counter, iterator, callback);
+ };
+
+ async.seq = function (/* functions... */) {
+ var fns = arguments;
+ return function () {
+ var that = this;
+ var args = Array.prototype.slice.call(arguments);
+ var callback = args.pop();
+ async.reduce(fns, args, function (newargs, fn, cb) {
+ fn.apply(that, newargs.concat([function () {
+ var err = arguments[0];
+ var nextargs = Array.prototype.slice.call(arguments, 1);
+ cb(err, nextargs);
+ }]))
+ },
+ function (err, results) {
+ callback.apply(that, [err].concat(results));
+ });
+ };
+ };
+
+ async.compose = function (/* functions... */) {
+ return async.seq.apply(null, Array.prototype.reverse.call(arguments));
+ };
+
+ var _applyEach = function (eachfn, fns /*args...*/) {
+ var go = function () {
+ var that = this;
+ var args = Array.prototype.slice.call(arguments);
+ var callback = args.pop();
+ return eachfn(fns, function (fn, cb) {
+ fn.apply(that, args.concat([cb]));
+ },
+ callback);
+ };
+ if (arguments.length > 2) {
+ var args = Array.prototype.slice.call(arguments, 2);
+ return go.apply(this, args);
+ }
+ else {
+ return go;
+ }
+ };
+ async.applyEach = doParallel(_applyEach);
+ async.applyEachSeries = doSeries(_applyEach);
+
+ async.forever = function (fn, callback) {
+ function next(err) {
+ if (err) {
+ if (callback) {
+ return callback(err);
+ }
+ throw err;
+ }
+ fn(next);
+ }
+ next();
+ };
+
+ // Node.js
+ if (typeof module !== 'undefined' && module.exports) {
+ module.exports = async;
+ }
+ // AMD / RequireJS
+ else if (typeof define !== 'undefined' && define.amd) {
+ define([], function () {
+ return async;
+ });
+ }
+ // included directly via <script> tag
+ else {
+ root.async = async;
+ }
+
+}());
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/package.json
new file mode 100644
index 0000000000..3171f4af0c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/async/package.json
@@ -0,0 +1,59 @@
+{
+ "name": "async",
+ "description": "Higher-order functions and common patterns for asynchronous code",
+ "main": "./lib/async",
+ "author": {
+ "name": "Caolan McMahon"
+ },
+ "version": "0.9.0",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/caolan/async.git"
+ },
+ "bugs": {
+ "url": "https://github.com/caolan/async/issues"
+ },
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "https://github.com/caolan/async/raw/master/LICENSE"
+ }
+ ],
+ "devDependencies": {
+ "nodeunit": ">0.0.0",
+ "uglify-js": "1.2.x",
+ "nodelint": ">0.0.0"
+ },
+ "jam": {
+ "main": "lib/async.js",
+ "include": [
+ "lib/async.js",
+ "README.md",
+ "LICENSE"
+ ]
+ },
+ "scripts": {
+ "test": "nodeunit test/test-async.js"
+ },
+ "homepage": "https://github.com/caolan/async",
+ "_id": "async@0.9.0",
+ "dist": {
+ "shasum": "ac3613b1da9bed1b47510bb4651b8931e47146c7",
+ "tarball": "http://registry.npmjs.org/async/-/async-0.9.0.tgz"
+ },
+ "_from": "async@>=0.9.0 <0.10.0",
+ "_npmVersion": "1.4.3",
+ "_npmUser": {
+ "name": "caolan",
+ "email": "caolan.mcmahon@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "caolan",
+ "email": "caolan@caolanmcmahon.com"
+ }
+ ],
+ "directories": {},
+ "_shasum": "ac3613b1da9bed1b47510bb4651b8931e47146c7",
+ "_resolved": "https://registry.npmjs.org/async/-/async-0.9.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/LICENSE
new file mode 100644
index 0000000000..a3966cf935
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:</p>
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/README.md
new file mode 100644
index 0000000000..b793c07c64
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/README.md
@@ -0,0 +1,676 @@
+<a href="http://promisesaplus.com/">
+ <img src="http://promisesaplus.com/assets/logo-small.png" alt="Promises/A+ logo"
+ title="Promises/A+ 1.1 compliant" align="right" />
+</a>
+[![Build Status](https://travis-ci.org/petkaantonov/bluebird.svg?branch=master)](https://travis-ci.org/petkaantonov/bluebird)
+[![coverage-98%](http://img.shields.io/badge/coverage-98%-brightgreen.svg?style=flat)](http://petkaantonov.github.io/bluebird/coverage/debug/index.html)
+
+
+# Introduction
+
+Bluebird is a fully featured [promise](#what-are-promises-and-why-should-i-use-them) library with focus on innovative features and performance
+
+
+
+# Topics
+
+- [Features](#features)
+- [Quick start](#quick-start)
+- [API Reference and examples](API.md)
+- [Support](#support)
+- [What are promises and why should I use them?](#what-are-promises-and-why-should-i-use-them)
+- [Questions and issues](#questions-and-issues)
+- [Error handling](#error-handling)
+- [Development](#development)
+ - [Testing](#testing)
+ - [Benchmarking](#benchmarks)
+ - [Custom builds](#custom-builds)
+ - [For library authors](#for-library-authors)
+- [What is the sync build?](#what-is-the-sync-build)
+- [License](#license)
+- [Snippets for common problems](https://github.com/petkaantonov/bluebird/wiki/Snippets)
+- [Promise anti-patterns](https://github.com/petkaantonov/bluebird/wiki/Promise-anti-patterns)
+- [Changelog](changelog.md)
+- [Optimization guide](#optimization-guide)
+
+# Features
+<img src="http://petkaantonov.github.io/bluebird/logo.png" alt="bluebird logo" align="right" />
+
+- [Promises A+](http://promisesaplus.com)
+- [Synchronous inspection](API.md#synchronous-inspection)
+- [Concurrency coordination](API.md#collections)
+- [Promisification on steroids](API.md#promisification)
+- [Resource management through a parallel of python `with`/C# `using`](API.md#resource-management)
+- [Cancellation and timeouts](API.md#cancellation)
+- [Parallel for C# `async` and `await`](API.md#generators)
+- Mind blowing utilities such as
+ - [`.bind()`](API.md#binddynamic-thisarg---promise)
+ - [`.call()`](API.md#callstring-propertyname--dynamic-arg---promise)
+ - [`Promise.join()`](API.md#promisejoinpromisethenablevalue-promises-function-handler---promise)
+ - [And](API.md#core) [much](API.md#timers) [more](API.md#utility)!
+- [Practical debugging solutions and sane defaults](#error-handling)
+- [Sick performance](benchmark/)
+
+<hr>
+
+# Quick start
+
+## Node.js
+
+ npm install bluebird
+
+Then:
+
+```js
+var Promise = require("bluebird");
+```
+
+## Browsers
+
+There are many ways to use bluebird in browsers:
+
+- Direct downloads
+ - Full build [bluebird.js](https://cdn.jsdelivr.net/bluebird/latest/bluebird.js)
+ - Full build minified [bluebird.min.js](https://cdn.jsdelivr.net/bluebird/latest/bluebird.min.js)
+- You may use browserify on the main export
+- You may use the [bower](http://bower.io) package.
+
+When using script tags the global variables `Promise` and `P` (alias for `Promise`) become available.
+
+A [minimal bluebird browser build](#custom-builds) is &asymp;38.92KB minified*, 11.65KB gzipped and has no external dependencies.
+
+*Google Closure Compiler using Simple.
+
+#### Browser support
+
+Browsers that [implement ECMA-262, edition 3](http://en.wikipedia.org/wiki/Ecmascript#Implementations) and later are supported.
+
+[![Selenium Test Status](https://saucelabs.com/browser-matrix/petka_antonov.svg)](https://saucelabs.com/u/petka_antonov)
+
+**Note** that in ECMA-262, edition 3 (IE7, IE8 etc.) it is not possible to use methods that have keyword names like `.catch` and `.finally`. The [API documentation](API.md) always lists a compatible alternative name that you can use if you need to support these browsers. For example `.catch` is replaced with `.caught` and `.finally` with `.lastly`.
+
+Also, [long stack trace](API.md#promiselongstacktraces---void) support is only available in Chrome, Firefox and Internet Explorer 10+.
+
+After quick start, see [API Reference and examples](API.md)
+
+<hr>
+
+# Support
+
+- Mailing list: [bluebird-js@googlegroups.com](https://groups.google.com/forum/#!forum/bluebird-js)
+- IRC: #promises @freenode
+- StackOverflow: [bluebird tag](http://stackoverflow.com/questions/tagged/bluebird)
+- Bugs and feature requests: [github issue tracker](https://github.com/petkaantonov/bluebird/issues?state=open)
+
+<hr>
+
+# What are promises and why should I use them?
+
+You should use promises to turn this:
+
+```js
+fs.readFile("file.json", function(err, val) {
+ if( err ) {
+ console.error("unable to read file");
+ }
+ else {
+ try {
+ val = JSON.parse(val);
+ console.log(val.success);
+ }
+ catch( e ) {
+ console.error("invalid json in file");
+ }
+ }
+});
+```
+
+Into this:
+
+```js
+fs.readFileAsync("file.json").then(JSON.parse).then(function(val) {
+ console.log(val.success);
+})
+.catch(SyntaxError, function(e) {
+ console.error("invalid json in file");
+})
+.catch(function(e) {
+ console.error("unable to read file")
+});
+```
+
+*If you are wondering "there is no `readFileAsync` method on `fs` that returns a promise", see [promisification](API.md#promisification)*
+
+Actually you might notice the latter has a lot in common with code that would do the same using synchronous I/O:
+
+```js
+try {
+ var val = JSON.parse(fs.readFileSync("file.json"));
+ console.log(val.success);
+}
+//Syntax actually not supported in JS but drives the point
+catch(SyntaxError e) {
+ console.error("invalid json in file");
+}
+catch(Error e) {
+ console.error("unable to read file")
+}
+```
+
+And that is the point - being able to have something that is a lot like `return` and `throw` in synchronous code.
+
+You can also use promises to improve code that was written with callback helpers:
+
+
+```js
+//Copyright Plato http://stackoverflow.com/a/19385911/995876
+//CC BY-SA 2.5
+mapSeries(URLs, function (URL, done) {
+ var options = {};
+ needle.get(URL, options, function (error, response, body) {
+ if (error) {
+ return done(error)
+ }
+ try {
+ var ret = JSON.parse(body);
+ return done(null, ret);
+ }
+ catch (e) {
+ done(e);
+ }
+ });
+}, function (err, results) {
+ if (err) {
+ console.log(err)
+ } else {
+ console.log('All Needle requests successful');
+ // results is a 1 to 1 mapping in order of URLs > needle.body
+ processAndSaveAllInDB(results, function (err) {
+ if (err) {
+ return done(err)
+ }
+ console.log('All Needle requests saved');
+ done(null);
+ });
+ }
+});
+```
+
+Is more pleasing to the eye when done with promises:
+
+```js
+Promise.promisifyAll(needle);
+var options = {};
+
+var current = Promise.resolve();
+Promise.map(URLs, function(URL) {
+ current = current.then(function () {
+ return needle.getAsync(URL, options);
+ });
+ return current;
+}).map(function(responseAndBody){
+ return JSON.parse(responseAndBody[1]);
+}).then(function (results) {
+ return processAndSaveAllInDB(results);
+}).then(function(){
+ console.log('All Needle requests saved');
+}).catch(function (e) {
+ console.log(e);
+});
+```
+
+Also promises don't just give you correspondences for synchronous features but can also be used as limited event emitters or callback aggregators.
+
+More reading:
+
+ - [Promise nuggets](https://promise-nuggets.github.io/)
+ - [Why I am switching to promises](http://spion.github.io/posts/why-i-am-switching-to-promises.html)
+ - [What is the the point of promises](http://domenic.me/2012/10/14/youre-missing-the-point-of-promises/#toc_1)
+ - [Snippets for common problems](https://github.com/petkaantonov/bluebird/wiki/Snippets)
+ - [Promise anti-patterns](https://github.com/petkaantonov/bluebird/wiki/Promise-anti-patterns)
+
+# Questions and issues
+
+If you find a bug in bluebird or have a feature request, file an issue in the [github issue tracker](https://github.com/petkaantonov/bluebird/issues). Anything else, such as questions for help in using the library, should be posted in [StackOverflow](http://stackoverflow.com/questions/tagged/bluebird) under tags `promise` and `bluebird`.
+
+# Error handling
+
+This is a problem every promise library needs to handle in some way. Unhandled rejections/exceptions don't really have a good agreed-on asynchronous correspondence. The problem is that it is impossible to predict the future and know if a rejected promise will eventually be handled.
+
+There are two common pragmatic attempts at solving the problem that promise libraries do.
+
+The more popular one is to have the user explicitly communicate that they are done and any unhandled rejections should be thrown, like so:
+
+```js
+download().then(...).then(...).done();
+```
+
+For handling this problem, in my opinion, this is completely unacceptable and pointless. The user must remember to explicitly call `.done` and that cannot be justified when the problem is forgetting to create an error handler in the first place.
+
+The second approach, which is what bluebird by default takes, is to call a registered handler if a rejection is unhandled by the start of a second turn. The default handler is to write the stack trace to `stderr` or `console.error` in browsers. This is close to what happens with synchronous code - your code doesn't work as expected and you open console and see a stack trace. Nice.
+
+Of course this is not perfect, if your code for some reason needs to swoop in and attach error handler to some promise after the promise has been hanging around a while then you will see annoying messages. In that case you can use the `.done()` method to signal that any hanging exceptions should be thrown.
+
+If you want to override the default handler for these possibly unhandled rejections, you can pass yours like so:
+
+```js
+Promise.onPossiblyUnhandledRejection(function(error){
+ throw error;
+});
+```
+
+If you want to also enable long stack traces, call:
+
+```js
+Promise.longStackTraces();
+```
+
+right after the library is loaded.
+
+In node.js use the environment flag `BLUEBIRD_DEBUG`:
+
+```
+BLUEBIRD_DEBUG=1 node server.js
+```
+
+to enable long stack traces in all instances of bluebird.
+
+Long stack traces cannot be disabled after being enabled, and cannot be enabled after promises have already been created. Long stack traces imply a substantial performance penalty, even after using every trick to optimize them.
+
+Long stack traces are enabled by default in the debug build.
+
+#### Expected and unexpected errors
+
+A practical problem with Promises/A+ is that it models Javascript `try-catch` too closely for its own good. Therefore by default promises inherit `try-catch` warts such as the inability to specify the error types that the catch block is eligible for. It is an anti-pattern in every other language to use catch-all handlers because they swallow exceptions that you might not know about.
+
+Now, Javascript does have a perfectly fine and working way of creating error type hierarchies. It is still quite awkward to use them with the built-in `try-catch` however:
+
+```js
+try {
+ //code
+}
+catch(e) {
+ if( e instanceof WhatIWantError) {
+ //handle
+ }
+ else {
+ throw e;
+ }
+}
+```
+
+Without such checking, unexpected errors would be silently swallowed. However, with promises, bluebird brings the future (hopefully) here now and extends the `.catch` to [accept potential error type eligibility](API.md#catchfunction-errorclass-function-handler---promise).
+
+For instance here it is expected that some evil or incompetent entity will try to crash our server from `SyntaxError` by providing syntactically invalid JSON:
+
+```js
+getJSONFromSomewhere().then(function(jsonString) {
+ return JSON.parse(jsonString);
+}).then(function(object) {
+ console.log("it was valid json: ", object);
+}).catch(SyntaxError, function(e){
+ console.log("don't be evil");
+});
+```
+
+Here any kind of unexpected error will automatically reported on `stderr` along with a stack trace because we only register a handler for the expected `SyntaxError`.
+
+Ok, so, that's pretty neat. But actually not many libraries define error types and it is in fact a complete ghetto out there with ad hoc strings being attached as some arbitrary property name like `.name`, `.type`, `.code`, not having any property at all or even throwing strings as errors and so on. So how can we still listen for expected errors?
+
+Bluebird defines a special error type `OperationalError` (you can get a reference from `Promise.OperationalError`). This type of error is given as rejection reason by promisified methods when
+their underlying library gives an untyped, but expected error. Primitives such as strings, and error objects that are directly created like `new Error("database didn't respond")` are considered untyped.
+
+Example of such library is the node core library `fs`. So if we promisify it, we can catch just the errors we want pretty easily and have programmer errors be redirected to unhandled rejection handler so that we notice them:
+
+```js
+//Read more about promisification in the API Reference:
+//API.md
+var fs = Promise.promisifyAll(require("fs"));
+
+fs.readFileAsync("myfile.json").then(JSON.parse).then(function (json) {
+ console.log("Successful json")
+}).catch(SyntaxError, function (e) {
+ console.error("file contains invalid json");
+}).catch(Promise.OperationalError, function (e) {
+ console.error("unable to read file, because: ", e.message);
+});
+```
+
+The last `catch` handler is only invoked when the `fs` module explicitly used the `err` argument convention of async callbacks to inform of an expected error. The `OperationalError` instance will contain the original error in its `.cause` property but it does have a direct copy of the `.message` and `.stack` too. In this code any unexpected error - be it in our code or the `fs` module - would not be caught by these handlers and therefore not swallowed.
+
+Since a `catch` handler typed to `Promise.OperationalError` is expected to be used very often, it has a neat shorthand:
+
+```js
+.error(function (e) {
+ console.error("unable to read file, because: ", e.message);
+});
+```
+
+See [API documentation for `.error()`](API.md#error-rejectedhandler----promise)
+
+Finally, Bluebird also supports predicate-based filters. If you pass a
+predicate function instead of an error type, the predicate will receive
+the error as an argument. The return result will be used determine whether
+the error handler should be called.
+
+Predicates should allow for very fine grained control over caught errors:
+pattern matching, error typesets with set operations and many other techniques
+can be implemented on top of them.
+
+Example of using a predicate-based filter:
+
+```js
+var Promise = require("bluebird");
+var request = Promise.promisify(require("request"));
+
+function clientError(e) {
+ return e.code >= 400 && e.code < 500;
+}
+
+request("http://www.google.com").then(function(contents){
+ console.log(contents);
+}).catch(clientError, function(e){
+ //A client error like 400 Bad Request happened
+});
+```
+
+**Danger:** The JavaScript language allows throwing primitive values like strings. Throwing primitives can lead to worse or no stack traces. Primitives [are not exceptions](http://www.devthought.com/2011/12/22/a-string-is-not-an-error/). You should consider always throwing Error objects when handling exceptions.
+
+<hr>
+
+#### How do long stack traces differ from e.g. Q?
+
+Bluebird attempts to have more elaborate traces. Consider:
+
+```js
+Error.stackTraceLimit = 25;
+Q.longStackSupport = true;
+Q().then(function outer() {
+ return Q().then(function inner() {
+ return Q().then(function evenMoreInner() {
+ a.b.c.d();
+ }).catch(function catcher(e){
+ console.error(e.stack);
+ });
+ })
+});
+```
+
+You will see
+
+ ReferenceError: a is not defined
+ at evenMoreInner (<anonymous>:7:13)
+ From previous event:
+ at inner (<anonymous>:6:20)
+
+Compare to:
+
+```js
+Error.stackTraceLimit = 25;
+Promise.longStackTraces();
+Promise.resolve().then(function outer() {
+ return Promise.resolve().then(function inner() {
+ return Promise.resolve().then(function evenMoreInner() {
+ a.b.c.d()
+ }).catch(function catcher(e){
+ console.error(e.stack);
+ });
+ });
+});
+```
+
+ ReferenceError: a is not defined
+ at evenMoreInner (<anonymous>:7:13)
+ From previous event:
+ at inner (<anonymous>:6:36)
+ From previous event:
+ at outer (<anonymous>:5:32)
+ From previous event:
+ at <anonymous>:4:21
+ at Object.InjectedScript._evaluateOn (<anonymous>:572:39)
+ at Object.InjectedScript._evaluateAndWrap (<anonymous>:531:52)
+ at Object.InjectedScript.evaluate (<anonymous>:450:21)
+
+
+A better and more practical example of the differences can be seen in gorgikosev's [debuggability competition](https://github.com/spion/async-compare#debuggability).
+
+<hr>
+
+# Development
+
+For development tasks such as running benchmarks or testing, you need to clone the repository and install dev-dependencies.
+
+Install [node](http://nodejs.org/) and [npm](https://npmjs.org/)
+
+ git clone git@github.com:petkaantonov/bluebird.git
+ cd bluebird
+ npm install
+
+## Testing
+
+To run all tests, run
+
+ node tools/test
+
+If you need to run generator tests run the `tool/test.js` script with `--harmony` argument and node 0.11+:
+
+ node-dev --harmony tools/test
+
+You may specify an individual test file to run with the `--run` script flag:
+
+ node tools/test --run=cancel.js
+
+
+This enables output from the test and may give a better idea where the test is failing. The paramter to `--run` can be any file name located in `test/mocha` folder.
+
+#### Testing in browsers
+
+To run the test in a browser instead of node, pass the flag `--browser` to the test tool
+
+ node tools/test --run=cancel.js --browser
+
+This will automatically create a server (default port 9999) and open it in your default browser once the tests have been compiled.
+
+Keep the test tab active because some tests are timing-sensitive and will fail if the browser is throttling timeouts. Chrome will do this for example when the tab is not active.
+
+#### Supported options by the test tool
+
+The value of boolean flags is determined by presence, if you want to pass false value for a boolean flag, use the `no-`-prefix e.g. `--no-browser`.
+
+ - `--run=String`. Which tests to run (or compile when testing in browser). Default `"all"`. Can also be a glob string (relative to ./test/mocha folder)
+ - `--cover=String`. Create code coverage using the String as istanbul reporter. Coverage is created in the ./coverage folder. No coverage is created by default, default reporter is `"html"` (use `--cover` to use default reporter).
+ - `--browser` - Whether to compile tests for browsers. Default `false`.
+ - `--port=Number` - Whe port where local server is hosted when testing in browser. Default `9999`
+ - `--execute-browser-tests` - Whether to execute the compiled tests for browser when using `--browser`. Default `true`.
+ - `--open-browser` - Whether to open the default browser when executing browser tests. Default `true`.
+ - `--fake-timers` - Whether to use fake timers (`setTimeout` etc) when running tests in node. Default `true`.
+ - `--js-hint` - Whether to run JSHint on source files. Default `true`.
+ - `--saucelabs` Wheter to create a tunnel to sauce labs and run tests in their VMs instead of your browser when compiling tests for browser.Default `false`.
+
+## Benchmarks
+
+To run a benchmark, run the given command for a benchmark while on the project root. Requires bash (on windows the mingw32 that comes with git works fine too).
+
+Node 0.11.2+ is required to run the generator examples.
+
+### 1\. DoxBee sequential
+
+Currently the most relevant benchmark is @gorkikosev's benchmark in the article [Analysis of generators and other async patterns in node](http://spion.github.io/posts/analysis-generators-and-other-async-patterns-node.html). The benchmark emulates a situation where n amount of users are making a request in parallel to execute some mixed async/sync action. The benchmark has been modified to include a warm-up phase to minimize any JITing during timed sections.
+
+Command: `bench doxbee`
+
+### 2\. Made-up parallel
+
+This made-up scenario runs 15 shimmed queries in parallel.
+
+Command: `bench parallel`
+
+## Custom builds
+
+Custom builds for browsers are supported through a command-line utility.
+
+
+<table>
+ <caption>The following features can be disabled</caption>
+ <thead>
+ <tr>
+ <th>Feature(s)</th>
+ <th>Command line identifier</th>
+ </tr>
+ </thead>
+ <tbody>
+
+ <tr><td><a href="API.md#any---promise"><code>.any</code></a> and <a href="API.md#promiseanyarraydynamicpromise-values---promise"><code>Promise.any</code></a></td><td><code>any</code></td></tr>
+ <tr><td><a href="API.md#race---promise"><code>.race</code></a> and <a href="API.md#promiseracearraypromise-promises---promise"><code>Promise.race</code></a></td><td><code>race</code></td></tr>
+ <tr><td><a href="API.md#callstring-propertyname--dynamic-arg---promise"><code>.call</code></a> and <a href="API.md#getstring-propertyname---promise"><code>.get</code></a></td><td><code>call_get</code></td></tr>
+ <tr><td><a href="API.md#filterfunction-filterer---promise"><code>.filter</code></a> and <a href="API.md#promisefilterarraydynamicpromise-values-function-filterer---promise"><code>Promise.filter</code></a></td><td><code>filter</code></td></tr>
+ <tr><td><a href="API.md#mapfunction-mapper---promise"><code>.map</code></a> and <a href="API.md#promisemaparraydynamicpromise-values-function-mapper---promise"><code>Promise.map</code></a></td><td><code>map</code></td></tr>
+ <tr><td><a href="API.md#reducefunction-reducer--dynamic-initialvalue---promise"><code>.reduce</code></a> and <a href="API.md#promisereducearraydynamicpromise-values-function-reducer--dynamic-initialvalue---promise"><code>Promise.reduce</code></a></td><td><code>reduce</code></td></tr>
+ <tr><td><a href="API.md#props---promise"><code>.props</code></a> and <a href="API.md#promisepropsobjectpromise-object---promise"><code>Promise.props</code></a></td><td><code>props</code></td></tr>
+ <tr><td><a href="API.md#settle---promise"><code>.settle</code></a> and <a href="API.md#promisesettlearraydynamicpromise-values---promise"><code>Promise.settle</code></a></td><td><code>settle</code></td></tr>
+ <tr><td><a href="API.md#someint-count---promise"><code>.some</code></a> and <a href="API.md#promisesomearraydynamicpromise-values-int-count---promise"><code>Promise.some</code></a></td><td><code>some</code></td></tr>
+ <tr><td><a href="API.md#nodeifyfunction-callback---promise"><code>.nodeify</code></a></td><td><code>nodeify</code></td></tr>
+ <tr><td><a href="API.md#promisecoroutinegeneratorfunction-generatorfunction---function"><code>Promise.coroutine</code></a> and <a href="API.md#promisespawngeneratorfunction-generatorfunction---promise"><code>Promise.spawn</code></a></td><td><code>generators</code></td></tr>
+ <tr><td><a href="API.md#progression">Progression</a></td><td><code>progress</code></td></tr>
+ <tr><td><a href="API.md#promisification">Promisification</a></td><td><code>promisify</code></td></tr>
+ <tr><td><a href="API.md#cancellation">Cancellation</a></td><td><code>cancel</code></td></tr>
+ <tr><td><a href="API.md#timers">Timers</a></td><td><code>timers</code></td></tr>
+ <tr><td><a href="API.md#resource-management">Resource management</a></td><td><code>using</code></td></tr>
+
+ </tbody>
+</table>
+
+
+Make sure you have cloned the repo somewhere and did `npm install` successfully.
+
+After that you can run:
+
+ node tools/build --features="core"
+
+
+The above builds the most minimal build you can get. You can add more features separated by spaces from the above list:
+
+ node tools/build --features="core filter map reduce"
+
+The custom build file will be found from `/js/browser/bluebird.js`. It will have a comment that lists the disabled and enabled features.
+
+Note that the build leaves the `/js/main` etc folders with same features so if you use the folder for node.js at the same time, don't forget to build
+a full version afterwards (after having taken a copy of the bluebird.js somewhere):
+
+ node tools/build --debug --main --zalgo --browser --minify
+
+#### Supported options by the build tool
+
+The value of boolean flags is determined by presence, if you want to pass false value for a boolean flag, use the `no-`-prefix e.g. `--no-debug`.
+
+ - `--main` - Whether to build the main build. The main build is placed at `js/main` directory. Default `false`.
+ - `--debug` - Whether to build the debug build. The debug build is placed at `js/debug` directory. Default `false`.
+ - `--zalgo` - Whether to build the zalgo build. The zalgo build is placed at `js/zalgo` directory. Default `false`.
+ - `--browser` - Whether to compile the browser build. The browser build file is placed at `js/browser/bluebird.js` Default `false`.
+ - `--minify` - Whether to minify the compiled browser build. The minified browser build file is placed at `js/browser/bluebird.min.js` Default `true`.
+ - `--features=String` - See [custom builds](#custom-builds)
+
+<hr>
+
+## For library authors
+
+Building a library that depends on bluebird? You should know about a few features.
+
+If your library needs to do something obtrusive like adding or modifying methods on the `Promise` prototype, uses long stack traces or uses a custom unhandled rejection handler then... that's totally ok as long as you don't use `require("bluebird")`. Instead you should create a file
+that creates an isolated copy. For example, creating a file called `bluebird-extended.js` that contains:
+
+```js
+ //NOTE the function call right after
+module.exports = require("bluebird/js/main/promise")();
+```
+
+Your library can then use `var Promise = require("bluebird-extended");` and do whatever it wants with it. Then if the application or other library uses their own bluebird promises they will all play well together because of Promises/A+ thenable assimilation magic.
+
+You should also know about [`.nodeify()`](API.md#nodeifyfunction-callback---promise) which makes it easy to provide a dual callback/promise API.
+
+<hr>
+
+## What is the sync build?
+
+You may now use sync build by:
+
+ var Promise = require("bluebird/zalgo");
+
+The sync build is provided to see how forced asynchronity affects benchmarks. It should not be used in real code due to the implied hazards.
+
+The normal async build gives Promises/A+ guarantees about asynchronous resolution of promises. Some people think this affects performance or just plain love their code having a possibility
+of stack overflow errors and non-deterministic behavior.
+
+The sync build skips the async call trampoline completely, e.g code like:
+
+ async.invoke( this.fn, this, val );
+
+Appears as this in the sync build:
+
+ this.fn(val);
+
+This should pressure the CPU slightly less and thus the sync build should perform better. Indeed it does, but only marginally. The biggest performance boosts are from writing efficient Javascript, not from compromising determinism.
+
+Note that while some benchmarks are waiting for the next event tick, the CPU is actually not in use during that time. So the resulting benchmark result is not completely accurate because on node.js you only care about how much the CPU is taxed. Any time spent on CPU is time the whole process (or server) is paralyzed. And it is not graceful like it would be with threads.
+
+
+```js
+var cache = new Map(); //ES6 Map or DataStructures/Map or whatever...
+function getResult(url) {
+ var resolver = Promise.pending();
+ if (cache.has(url)) {
+ resolver.resolve(cache.get(url));
+ }
+ else {
+ http.get(url, function(err, content) {
+ if (err) resolver.reject(err);
+ else {
+ cache.set(url, content);
+ resolver.resolve(content);
+ }
+ });
+ }
+ return resolver.promise;
+}
+
+
+
+//The result of console.log is truly random without async guarantees
+function guessWhatItPrints( url ) {
+ var i = 3;
+ getResult(url).then(function(){
+ i = 4;
+ });
+ console.log(i);
+}
+```
+
+# Optimization guide
+
+Articles about optimization will be periodically posted in [the wiki section](https://github.com/petkaantonov/bluebird/wiki), polishing edits are welcome.
+
+A single cohesive guide compiled from the articles will probably be done eventually.
+
+# License
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/changelog.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/changelog.md
new file mode 100644
index 0000000000..6079e5f159
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/changelog.md
@@ -0,0 +1,1579 @@
+## 2.9.15 (2015-03-26)
+
+Features:
+
+ - Added `.asCallback` alias for `.nodeify`.
+
+Bugfixes:
+
+ - Don't always use nextTick, but try to pick up setImmediate or setTimeout in NW. Fixes [#534](.), [#525](.)
+ - Make progress a core feature. Fixes [#535](.) Note that progress has been removed in 3.x - this is only a fix necessary for 2.x custom builds.
+
+## 2.9.14 (2015-03-12)
+
+Bugfixes:
+
+ - Always use process.nextTick. Fixes [#525](.)
+
+## 2.9.13 (2015-02-27)
+
+Bugfixes:
+
+ - Fix .each, .filter, .reduce and .map callbacks being called synchornously if the input is immediate. ([#513](.))
+
+## 2.9.12 (2015-02-19)
+
+Bugfixes:
+
+ - Fix memory leak introduced in 2.9.0 ([#502](.))
+
+## 2.9.11 (2015-02-19)
+
+Bugfixes:
+
+ - Fix [#503](.)
+
+## 2.9.10 (2015-02-18)
+
+Bugfixes:
+
+ - Fix [#501](.)
+
+## 2.9.9 (2015-02-12)
+
+Bugfixes:
+
+ - Fix `TypeError: Cannot assign to read only property 'length'` when jsdom has declared a read-only length for all objects to inherit.
+
+## 2.9.8 (2015-02-10)
+
+Bugfixes:
+
+ - Fix regression introduced in 2.9.7 where promisify didn't properly dynamically look up methods on `this`
+
+## 2.9.7 (2015-02-08)
+
+Bugfixes:
+
+ - Fix `promisify` not retaining custom properties of the function. This enables promisifying the `"request"` module's export function and its methods at the same time.
+ - Fix `promisifyAll` methods being dependent on `this` when they are not originally dependent on `this`. This enables e.g. passing promisified `fs` functions directly as callbacks without having to bind them to `fs`.
+ - Fix `process.nextTick` being used over `setImmediate` in node.
+
+## 2.9.6 (2015-02-02)
+
+Bugfixes:
+
+ - Node environment detection can no longer be fooled
+
+## 2.9.5 (2015-02-02)
+
+Misc:
+
+ - Warn when [`.then()`](.) is passed non-functions
+
+## 2.9.4 (2015-01-30)
+
+Bugfixes:
+
+ - Fix [.timeout()](.) not calling `clearTimeout` with the proper handle in node causing the process to wait for unneeded timeout. This was a regression introduced in 2.9.1.
+
+## 2.9.3 (2015-01-27)
+
+Bugfixes:
+
+ - Fix node-webkit compatibility issue ([#467](https://github.com/petkaantonov/bluebird/pull/467))
+ - Fix long stack trace support in recent firefox versions
+
+## 2.9.2 (2015-01-26)
+
+Bugfixes:
+
+ - Fix critical bug regarding to using promisifyAll in browser that was introduced in 2.9.0 ([#466](https://github.com/petkaantonov/bluebird/issues/466)).
+
+Misc:
+
+ - Add `"browser"` entry point to package.json
+
+## 2.9.1 (2015-01-24)
+
+Features:
+
+ - If a bound promise is returned by the callback to [`Promise.method`](#promisemethodfunction-fn---function) and [`Promise.try`](#promisetryfunction-fn--arraydynamicdynamic-arguments--dynamic-ctx----promise), the returned promise will be bound to the same value
+
+## 2.9.0 (2015-01-24)
+
+Features:
+
+ - Add [`Promise.fromNode`](API.md#promisefromnodefunction-resolver---promise)
+ - Add new paramter `value` for [`Promise.bind`](API.md#promisebinddynamic-thisarg--dynamic-value---promise)
+
+Bugfixes:
+
+ - Fix several issues with [`cancellation`](API.md#cancellation) and [`.bind()`](API.md#binddynamic-thisarg---promise) interoperation when `thisArg` is a promise or thenable
+ - Fix promises created in [`disposers`](API#disposerfunction-disposer---disposer) not having proper long stack trace context
+ - Fix [`Promise.join`](API.md#promisejoinpromisethenablevalue-promises-function-handler---promise) sometimes passing the passed in callback function as the last argument to itself.
+
+Misc:
+
+ - Reduce minified full browser build file size by not including unused code generation functionality.
+ - Major internal refactoring related to testing code and source code file layout
+
+## 2.8.2 (2015-01-20)
+
+Features:
+
+ - [Global rejection events](https://github.com/petkaantonov/bluebird/blob/master/API.md#global-rejection-events) are now fired both as DOM3 events and as legacy events in browsers
+
+## 2.8.1 (2015-01-20)
+
+Bugfixes:
+
+ - Fix long stack trace stiching consistency when rejected from thenables
+
+## 2.8.0 (2015-01-19)
+
+Features:
+
+ - Major debuggability improvements:
+ - Long stack traces have been re-designed. They are now much more readable,
+ succint, relevant and consistent across bluebird features.
+ - Long stack traces are supported now in IE10+
+
+## 2.7.1 (2015-01-15)
+
+Bugfixes:
+
+ - Fix [#447](https://github.com/petkaantonov/bluebird/issues/447)
+
+## 2.7.0 (2015-01-15)
+
+Features:
+
+ - Added more context to stack traces originating from coroutines ([#421](https://github.com/petkaantonov/bluebird/issues/421))
+ - Implemented [global rejection events](https://github.com/petkaantonov/bluebird/blob/master/API.md#global-rejection-events) ([#428](https://github.com/petkaantonov/bluebird/issues/428), [#357](https://github.com/petkaantonov/bluebird/issues/357))
+ - [Custom promisifiers](https://github.com/petkaantonov/bluebird/blob/master/API.md#option-promisifier) are now passed the default promisifier which can be used to add enhancements on top of normal node promisification
+ - [Promisification filters](https://github.com/petkaantonov/bluebird/blob/master/API.md#option-filter) are now passed `passesDefaultFilter` boolean
+
+Bugfixes:
+
+ - Fix `.noConflict()` call signature ([#446]())
+ - Fix `Promise.method`ified functions being called with `undefined` when they were called with no arguments
+
+## 2.6.4 (2015-01-12)
+
+Bugfixes:
+
+ - `OperationalErrors` thrown by promisified functions retain custom properties, such as `.code` and `.path`.
+
+## 2.6.3 (2015-01-12)
+
+Bugfixes:
+
+ - Fix [#429](https://github.com/petkaantonov/bluebird/issues/429)
+ - Fix [#432](https://github.com/petkaantonov/bluebird/issues/432)
+ - Fix [#433](https://github.com/petkaantonov/bluebird/issues/433)
+
+## 2.6.2 (2015-01-07)
+
+Bugfixes:
+
+ - Fix [#426](https://github.com/petkaantonov/bluebird/issues/426)
+
+## 2.6.1 (2015-01-07)
+
+Bugfixes:
+
+ - Fixed built browser files not being included in the git tag release for bower
+
+## 2.6.0 (2015-01-06)
+
+Features:
+
+ - Significantly improve parallel promise performance and memory usage (+50% faster, -50% less memory)
+
+
+## 2.5.3 (2014-12-30)
+
+## 2.5.2 (2014-12-29)
+
+Bugfixes:
+
+ - Fix bug where already resolved promise gets attached more handlers while calling its handlers resulting in some handlers not being called
+ - Fix bug where then handlers are not called in the same order as they would run if Promises/A+ 2.3.2 was implemented as adoption
+ - Fix bug where using `Object.create(null)` as a rejection reason would crash bluebird
+
+## 2.5.1 (2014-12-29)
+
+Bugfixes:
+
+ - Fix `.finally` throwing null error when it is derived from a promise that is resolved with a promise that is resolved with a promise
+
+## 2.5.0 (2014-12-28)
+
+Features:
+
+ - [`.get`](#API.md#https://github.com/petkaantonov/bluebird/blob/master/API.md#getstring-propertyname---promise) now supports negative indexing.
+
+Bugfixes:
+
+ - Fix bug with `Promise.method` wrapped function returning a promise that never resolves if the function returns a promise that is resolved with another promise
+ - Fix bug with `Promise.delay` never resolving if the value is a promise that is resolved with another promise
+
+## 2.4.3 (2014-12-28)
+
+Bugfixes:
+
+ - Fix memory leak as described in [this Promises/A+ spec issue](https://github.com/promises-aplus/promises-spec/issues/179).
+
+## 2.4.2 (2014-12-21)
+
+Bugfixes:
+
+ - Fix bug where spread rejected handler is ignored in case of rejection
+ - Fix synchronous scheduler passed to `setScheduler` causing infinite loop
+
+## 2.4.1 (2014-12-20)
+
+Features:
+
+ - Error messages now have links to wiki pages for additional information
+ - Promises now clean up all references (to handlers, child promises etc) as soon as possible.
+
+## 2.4.0 (2014-12-18)
+
+Features:
+
+ - Better filtering of bluebird internal calls in long stack traces, especially when using minified file in browsers
+ - Small performance improvements for all collection methods
+ - Promises now delete references to handlers attached to them as soon as possible
+ - Additional stack traces are now output on stderr/`console.warn` for errors that are thrown in the process/window from rejected `.done()` promises. See [#411](https://github.com/petkaantonov/bluebird/issues/411)
+
+## 2.3.11 (2014-10-31)
+
+Bugfixes:
+
+ - Fix [#371](https://github.com/petkaantonov/bluebird/issues/371), [#373](https://github.com/petkaantonov/bluebird/issues/373)
+
+
+## 2.3.10 (2014-10-28)
+
+Features:
+
+ - `Promise.method` no longer wraps primitive errors
+ - `Promise.try` no longer wraps primitive errors
+
+## 2.3.7 (2014-10-25)
+
+Bugfixes:
+
+ - Fix [#359](https://github.com/petkaantonov/bluebird/issues/359), [#362](https://github.com/petkaantonov/bluebird/issues/362) and [#364](https://github.com/petkaantonov/bluebird/issues/364)
+
+## 2.3.6 (2014-10-15)
+
+Features:
+
+ - Implement [`.reflect()`](API.md#reflect---promisepromiseinspection)
+
+## 2.3.5 (2014-10-06)
+
+Bugfixes:
+
+ - Fix issue when promisifying methods whose names contain the string 'args'
+
+## 2.3.4 (2014-09-27)
+
+ - `P` alias was not declared inside WebWorkers
+
+## 2.3.3 (2014-09-27)
+
+Bugfixes:
+
+ - Fix [#318](https://github.com/petkaantonov/bluebird/issues/318), [#314](https://github.com/petkaantonov/bluebird/issues/#314)
+
+## 2.3.2 (2014-08-25)
+
+Bugfixes:
+
+ - `P` alias for `Promise` now exists in global scope when using browser builds without a module loader, fixing an issue with firefox extensions
+
+## 2.3.1 (2014-08-23)
+
+Features:
+
+ - `.using` can now be used with disposers created from different bluebird copy
+
+## 2.3.0 (2014-08-13)
+
+Features:
+
+ - [`.bind()`](API.md#binddynamic-thisarg---promise) and [`Promise.bind()`](API.md#promisebinddynamic-thisarg---promise) now await for the resolution of the `thisArg` if it's a promise or a thenable
+
+Bugfixes:
+
+ - Fix [#276](https://github.com/petkaantonov/bluebird/issues/276)
+
+## 2.2.2 (2014-07-14)
+
+ - Fix [#259](https://github.com/petkaantonov/bluebird/issues/259)
+
+## 2.2.1 (2014-07-07)
+
+ - Fix multiline error messages only showing the first line
+
+## 2.2.0 (2014-07-07)
+
+Bugfixes:
+
+ - `.any` and `.some` now consistently reject with RangeError when input array contains too few promises
+ - Fix iteration bug with `.reduce` when input array contains already fulfilled promises
+
+## 2.1.3 (2014-06-18)
+
+Bugfixes:
+
+ - Fix [#235](https://github.com/petkaantonov/bluebird/issues/235)
+
+## 2.1.2 (2014-06-15)
+
+Bugfixes:
+
+ - Fix [#232](https://github.com/petkaantonov/bluebird/issues/232)
+
+## 2.1.1 (2014-06-11)
+
+## 2.1.0 (2014-06-11)
+
+Features:
+
+ - Add [`promisifier`](API.md#option-promisifier) option to `Promise.promisifyAll()`
+ - Improve performance of `.props()` and collection methods when used with immediate values
+
+
+Bugfixes:
+
+ - Fix a bug where .reduce calls the callback for an already visited item
+ - Fix a bug where stack trace limit is calculated to be too small, which resulted in too short stack traces
+
+<sub>Add undocumented experimental `yieldHandler` option to `Promise.coroutine`</sub>
+
+## 2.0.7 (2014-06-08)
+## 2.0.6 (2014-06-07)
+## 2.0.5 (2014-06-05)
+## 2.0.4 (2014-06-05)
+## 2.0.3 (2014-06-05)
+## 2.0.2 (2014-06-04)
+## 2.0.1 (2014-06-04)
+
+## 2.0.0 (2014-06-04)
+
+#What's new in 2.0
+
+- [Resource management](API.md#resource-management) - never leak resources again
+- [Promisification](API.md#promisification) on steroids - entire modules can now be promisified with one line of code
+- [`.map()`](API.md#mapfunction-mapper--object-options---promise), [`.each()`](API.md#eachfunction-iterator---promise), [`.filter()`](API.md#filterfunction-filterer--object-options---promise), [`.reduce()`](API.md#reducefunction-reducer--dynamic-initialvalue---promise) reimagined from simple sugar to powerful concurrency coordination tools
+- [API Documentation](API.md) has been reorganized and more elaborate examples added
+- Deprecated [progression](#progression-migration) and [deferreds](#deferred-migration)
+- Improved performance and readability
+
+Features:
+
+- Added [`using()`](API.md#promiseusingpromisedisposer-promise-promisedisposer-promise--function-handler---promise) and [`disposer()`](API.md#disposerfunction-disposer---disposer)
+- [`.map()`](API.md#mapfunction-mapper--object-options---promise) now calls the handler as soon as items in the input array become fulfilled
+- Added a concurrency option to [`.map()`](API.md#mapfunction-mapper--object-options---promise)
+- [`.filter()`](API.md#filterfunction-filterer--object-options---promise) now calls the handler as soon as items in the input array become fulfilled
+- Added a concurrency option to [`.filter()`](API.md#filterfunction-filterer--object-options---promise)
+- [`.reduce()`](API.md#reducefunction-reducer--dynamic-initialvalue---promise) now calls the handler as soon as items in the input array become fulfilled, but in-order
+- Added [`.each()`](API.md#eachfunction-iterator---promise)
+- [`Promise.resolve()`](API.md#promiseresolvedynamic-value---promise) behaves like `Promise.cast`. `Promise.cast` deprecated.
+- [Synchronous inspection](API.md#synchronous-inspection): Removed `.inspect()`, added [`.value()`](API.md#value---dynamic) and [`.reason()`](API.md#reason---dynamic)
+- [`Promise.join()`](API.md#promisejoinpromisethenablevalue-promises-function-handler---promise) now takes a function as the last argument
+- Added [`Promise.setScheduler()`](API.md#promisesetschedulerfunction-scheduler---void)
+- [`.cancel()`](API.md#cancelerror-reason---promise) supports a custom cancellation reason
+- [`.timeout()`](API.md#timeoutint-ms--string-message---promise) now cancels the promise instead of rejecting it
+- [`.nodeify()`](API.md#nodeifyfunction-callback--object-options---promise) now supports passing multiple success results when mapping promises to nodebacks
+- Added `suffix` and `filter` options to [`Promise.promisifyAll()`](API.md#promisepromisifyallobject-target--object-options---object)
+
+Breaking changes:
+
+- Sparse array holes are not skipped by collection methods but treated as existing elements with `undefined` value
+- `.map()` and `.filter()` do not call the given mapper or filterer function in any specific order
+- Removed the `.inspect()` method
+- Yielding an array from a coroutine is not supported by default. You can use [`coroutine.addYieldHandler()`](API.md#promisecoroutineaddyieldhandlerfunction-handler---void) to configure the old behavior (or any behavior you want).
+- [`.any()`](API.md#any---promise) and [`.some()`](API.md#someint-count---promise) no longer use an array as the rejection reason. [`AggregateError`](API.md#aggregateerror) is used instead.
+
+
+## 1.2.4 (2014-04-27)
+
+Bugfixes:
+
+ - Fix promisifyAll causing a syntax error when a method name is not a valid identifier
+ - Fix syntax error when es5.js is used in strict mode
+
+## 1.2.3 (2014-04-17)
+
+Bugfixes:
+
+ - Fix [#179](https://github.com/petkaantonov/bluebird/issues/179)
+
+## 1.2.2 (2014-04-09)
+
+Bugfixes:
+
+ - Promisified methods from promisifyAll no longer call the original method when it is overriden
+ - Nodeify doesn't pass second argument to the callback if the promise is fulfilled with `undefined`
+
+## 1.2.1 (2014-03-31)
+
+Bugfixes:
+
+ - Fix [#168](https://github.com/petkaantonov/bluebird/issues/168)
+
+## 1.2.0 (2014-03-29)
+
+Features:
+
+ - New method: [`.value()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#value---dynamic)
+ - New method: [`.reason()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#reason---dynamic)
+ - New method: [`Promise.onUnhandledRejectionHandled()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#promiseonunhandledrejectionhandledfunction-handler---undefined)
+ - `Promise.map()`, `.map()`, `Promise.filter()` and `.filter()` start calling their callbacks as soon as possible while retaining a correct order. See [`8085922f`](https://github.com/petkaantonov/bluebird/commit/8085922fb95a9987fda0cf2337598ab4a98dc315).
+
+Bugfixes:
+
+ - Fix [#165](https://github.com/petkaantonov/bluebird/issues/165)
+ - Fix [#166](https://github.com/petkaantonov/bluebird/issues/166)
+
+## 1.1.1 (2014-03-18)
+
+Bugfixes:
+
+ - [#138](https://github.com/petkaantonov/bluebird/issues/138)
+ - [#144](https://github.com/petkaantonov/bluebird/issues/144)
+ - [#148](https://github.com/petkaantonov/bluebird/issues/148)
+ - [#151](https://github.com/petkaantonov/bluebird/issues/151)
+
+## 1.1.0 (2014-03-08)
+
+Features:
+
+ - Implement [`Promise.prototype.tap()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#tapfunction-handler---promise)
+ - Implement [`Promise.coroutine.addYieldHandler()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#promisecoroutineaddyieldhandlerfunction-handler---void)
+ - Deprecate `Promise.prototype.spawn`
+
+Bugfixes:
+
+ - Fix already rejected promises being reported as unhandled when handled through collection methods
+ - Fix browserisfy crashing from checking `process.version.indexOf`
+
+## 1.0.8 (2014-03-03)
+
+Bugfixes:
+
+ - Fix active domain being lost across asynchronous boundaries in Node.JS 10.xx
+
+## 1.0.7 (2014-02-25)
+
+Bugfixes:
+
+ - Fix handled errors being reported
+
+## 1.0.6 (2014-02-17)
+
+Bugfixes:
+
+ - Fix bug with unhandled rejections not being reported
+ when using `Promise.try` or `Promise.method` without
+ attaching further handlers
+
+## 1.0.5 (2014-02-15)
+
+Features:
+
+ - Node.js performance: promisified functions try to check amount of passed arguments in most optimal order
+ - Node.js promisified functions will have same `.length` as the original function minus one (for the callback parameter)
+
+## 1.0.4 (2014-02-09)
+
+Features:
+
+ - Possibly unhandled rejection handler will always get a stack trace, even if the rejection or thrown error was not an error
+ - Unhandled rejections are tracked per promise, not per error. So if you create multiple branches from a single ancestor and that ancestor gets rejected, each branch with no error handler with the end will cause a possibly unhandled rejection handler invocation
+
+Bugfixes:
+
+ - Fix unhandled non-writable objects or primitives not reported by possibly unhandled rejection handler
+
+## 1.0.3 (2014-02-05)
+
+Bugfixes:
+
+ - [#93](https://github.com/petkaantonov/bluebird/issues/88)
+
+## 1.0.2 (2014-02-04)
+
+Features:
+
+ - Significantly improve performance of foreign bluebird thenables
+
+Bugfixes:
+
+ - [#88](https://github.com/petkaantonov/bluebird/issues/88)
+
+## 1.0.1 (2014-01-28)
+
+Features:
+
+ - Error objects that have property `.isAsync = true` will now be caught by `.error()`
+
+Bugfixes:
+
+ - Fix TypeError and RangeError shims not working without `new` operator
+
+## 1.0.0 (2014-01-12)
+
+Features:
+
+ - `.filter`, `.map`, and `.reduce` no longer skip sparse array holes. This is a backwards incompatible change.
+ - Like `.map` and `.filter`, `.reduce` now allows returning promises and thenables from the iteration function.
+
+Bugfixes:
+
+ - [#58](https://github.com/petkaantonov/bluebird/issues/58)
+ - [#61](https://github.com/petkaantonov/bluebird/issues/61)
+ - [#64](https://github.com/petkaantonov/bluebird/issues/64)
+ - [#60](https://github.com/petkaantonov/bluebird/issues/60)
+
+## 0.11.6-1 (2013-12-29)
+
+## 0.11.6-0 (2013-12-29)
+
+Features:
+
+ - You may now return promises and thenables from the filterer function used in `Promise.filter` and `Promise.prototype.filter`.
+
+ - `.error()` now catches additional sources of rejections:
+
+ - Rejections originating from `Promise.reject`
+
+ - Rejections originating from thenables using
+ the `reject` callback
+
+ - Rejections originating from promisified callbacks
+ which use the `errback` argument
+
+ - Rejections originating from `new Promise` constructor
+ where the `reject` callback is called explicitly
+
+ - Rejections originating from `PromiseResolver` where
+ `.reject()` method is called explicitly
+
+Bugfixes:
+
+ - Fix `captureStackTrace` being called when it was `null`
+ - Fix `Promise.map` not unwrapping thenables
+
+## 0.11.5-1 (2013-12-15)
+
+## 0.11.5-0 (2013-12-03)
+
+Features:
+
+ - Improve performance of collection methods
+ - Improve performance of promise chains
+
+## 0.11.4-1 (2013-12-02)
+
+## 0.11.4-0 (2013-12-02)
+
+Bugfixes:
+
+ - Fix `Promise.some` behavior with arguments like negative integers, 0...
+ - Fix stack traces of synchronously throwing promisified functions'
+
+## 0.11.3-0 (2013-12-02)
+
+Features:
+
+ - Improve performance of generators
+
+Bugfixes:
+
+ - Fix critical bug with collection methods.
+
+## 0.11.2-0 (2013-12-02)
+
+Features:
+
+ - Improve performance of all collection methods
+
+## 0.11.1-0 (2013-12-02)
+
+Features:
+
+- Improve overall performance.
+- Improve performance of promisified functions.
+- Improve performance of catch filters.
+- Improve performance of .finally.
+
+Bugfixes:
+
+- Fix `.finally()` rejecting if passed non-function. It will now ignore non-functions like `.then`.
+- Fix `.finally()` not converting thenables returned from the handler to promises.
+- `.spread()` now rejects if the ultimate value given to it is not spreadable.
+
+## 0.11.0-0 (2013-12-02)
+
+Features:
+
+ - Improve overall performance when not using `.bind()` or cancellation.
+ - Promises are now not cancellable by default. This is backwards incompatible change - see [`.cancellable()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#cancellable---promise)
+ - [`Promise.delay`](https://github.com/petkaantonov/bluebird/blob/master/API.md#promisedelaydynamic-value-int-ms---promise)
+ - [`.delay()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#delayint-ms---promise)
+ - [`.timeout()`](https://github.com/petkaantonov/bluebird/blob/master/API.md#timeoutint-ms--string-message---promise)
+
+## 0.10.14-0 (2013-12-01)
+
+Bugfixes:
+
+ - Fix race condition when mixing 3rd party asynchrony.
+
+## 0.10.13-1 (2013-11-30)
+
+## 0.10.13-0 (2013-11-30)
+
+Bugfixes:
+
+ - Fix another bug with progression.
+
+## 0.10.12-0 (2013-11-30)
+
+Bugfixes:
+
+ - Fix bug with progression.
+
+## 0.10.11-4 (2013-11-29)
+
+## 0.10.11-2 (2013-11-29)
+
+Bugfixes:
+
+ - Fix `.race()` not propagating bound values.
+
+## 0.10.11-1 (2013-11-29)
+
+Features:
+
+ - Improve performance of `Promise.race`
+
+## 0.10.11-0 (2013-11-29)
+
+Bugfixes:
+
+ - Fixed `Promise.promisifyAll` invoking property accessors. Only data properties with function values are considered.
+
+## 0.10.10-0 (2013-11-28)
+
+Features:
+
+ - Disable long stack traces in browsers by default. Call `Promise.longStackTraces()` to enable them.
+
+## 0.10.9-1 (2013-11-27)
+
+Bugfixes:
+
+ - Fail early when `new Promise` is constructed incorrectly
+
+## 0.10.9-0 (2013-11-27)
+
+Bugfixes:
+
+ - Promise.props now takes a [thenable-for-collection](https://github.com/petkaantonov/bluebird/blob/f41edac61b7c421608ff439bb5a09b7cffeadcf9/test/mocha/props.js#L197-L217)
+ - All promise collection methods now reject when a promise-or-thenable-for-collection turns out not to give a collection
+
+## 0.10.8-0 (2013-11-25)
+
+Features:
+
+ - All static collection methods take thenable-for-collection
+
+## 0.10.7-0 (2013-11-25)
+
+Features:
+
+ - throw TypeError when thenable resolves with itself
+ - Make .race() and Promise.race() forever pending on empty collections
+
+## 0.10.6-0 (2013-11-25)
+
+Bugfixes:
+
+ - Promise.resolve and PromiseResolver.resolve follow thenables too.
+
+## 0.10.5-0 (2013-11-24)
+
+Bugfixes:
+
+ - Fix infinite loop when thenable resolves with itself
+
+## 0.10.4-1 (2013-11-24)
+
+Bugfixes:
+
+ - Fix a file missing from build. (Critical fix)
+
+## 0.10.4-0 (2013-11-24)
+
+Features:
+
+ - Remove dependency of es5-shim and es5-sham when using ES3.
+
+## 0.10.3-0 (2013-11-24)
+
+Features:
+
+ - Improve performance of `Promise.method`
+
+## 0.10.2-1 (2013-11-24)
+
+Features:
+
+ - Rename PromiseResolver#asCallback to PromiseResolver#callback
+
+## 0.10.2-0 (2013-11-24)
+
+Features:
+
+ - Remove memoization of thenables
+
+## 0.10.1-0 (2013-11-21)
+
+Features:
+
+ - Add methods `Promise.resolve()`, `Promise.reject()`, `Promise.defer()` and `.resolve()`.
+
+## 0.10.0-1 (2013-11-17)
+
+## 0.10.0-0 (2013-11-17)
+
+Features:
+
+ - Implement `Promise.method()`
+ - Implement `.return()`
+ - Implement `.throw()`
+
+Bugfixes:
+
+ - Fix promises being able to use themselves as resolution or follower value
+
+## 0.9.11-1 (2013-11-14)
+
+Features:
+
+ - Implicit `Promise.all()` when yielding an array from generators
+
+## 0.9.11-0 (2013-11-13)
+
+Bugfixes:
+
+ - Fix `.spread` not unwrapping thenables
+
+## 0.9.10-2 (2013-11-13)
+
+Features:
+
+ - Improve performance of promisified functions on V8
+
+Bugfixes:
+
+ - Report unhandled rejections even when long stack traces are disabled
+ - Fix `.error()` showing up in stack traces
+
+## 0.9.10-1 (2013-11-05)
+
+Bugfixes:
+
+ - Catch filter method calls showing in stack traces
+
+## 0.9.10-0 (2013-11-05)
+
+Bugfixes:
+
+ - Support primitives in catch filters
+
+## 0.9.9-0 (2013-11-05)
+
+Features:
+
+ - Add `Promise.race()` and `.race()`
+
+## 0.9.8-0 (2013-11-01)
+
+Bugfixes:
+
+ - Fix bug with `Promise.try` not unwrapping returned promises and thenables
+
+## 0.9.7-0 (2013-10-29)
+
+Bugfixes:
+
+ - Fix bug with build files containing duplicated code for promise.js
+
+## 0.9.6-0 (2013-10-28)
+
+Features:
+
+ - Improve output of reporting unhandled non-errors
+ - Implement RejectionError wrapping and `.error()` method
+
+## 0.9.5-0 (2013-10-27)
+
+Features:
+
+ - Allow fresh copies of the library to be made
+
+## 0.9.4-1 (2013-10-27)
+
+## 0.9.4-0 (2013-10-27)
+
+Bugfixes:
+
+ - Rollback non-working multiple fresh copies feature
+
+## 0.9.3-0 (2013-10-27)
+
+Features:
+
+ - Allow fresh copies of the library to be made
+ - Add more components to customized builds
+
+## 0.9.2-1 (2013-10-25)
+
+## 0.9.2-0 (2013-10-25)
+
+Features:
+
+ - Allow custom builds
+
+## 0.9.1-1 (2013-10-22)
+
+Bugfixes:
+
+ - Fix unhandled rethrown exceptions not reported
+
+## 0.9.1-0 (2013-10-22)
+
+Features:
+
+ - Improve performance of `Promise.try`
+ - Extend `Promise.try` to accept arguments and ctx to make it more usable in promisification of synchronous functions.
+
+## 0.9.0-0 (2013-10-18)
+
+Features:
+
+ - Implement `.bind` and `Promise.bind`
+
+Bugfixes:
+
+ - Fix `.some()` when argument is a pending promise that later resolves to an array
+
+## 0.8.5-1 (2013-10-17)
+
+Features:
+
+ - Enable process wide long stack traces through BLUEBIRD_DEBUG environment variable
+
+## 0.8.5-0 (2013-10-16)
+
+Features:
+
+ - Improve performance of all collection methods
+
+Bugfixes:
+
+ - Fix .finally passing the value to handlers
+ - Remove kew from benchmarks due to bugs in the library breaking the benchmark
+ - Fix some bluebird library calls potentially appearing in stack traces
+
+## 0.8.4-1 (2013-10-15)
+
+Bugfixes:
+
+ - Fix .pending() call showing in long stack traces
+
+## 0.8.4-0 (2013-10-15)
+
+Bugfixes:
+
+ - Fix PromiseArray and its sub-classes swallowing possibly unhandled rejections
+
+## 0.8.3-3 (2013-10-14)
+
+Bugfixes:
+
+ - Fix AMD-declaration using named module.
+
+## 0.8.3-2 (2013-10-14)
+
+Features:
+
+ - The mortals that can handle it may now release Zalgo by `require("bluebird/zalgo");`
+
+## 0.8.3-1 (2013-10-14)
+
+Bugfixes:
+
+ - Fix memory leak when using the same promise to attach handlers over and over again
+
+## 0.8.3-0 (2013-10-13)
+
+Features:
+
+ - Add `Promise.props()` and `Promise.prototype.props()`. They work like `.all()` for object properties.
+
+Bugfixes:
+
+ - Fix bug with .some returning garbage when sparse arrays have rejections
+
+## 0.8.2-2 (2013-10-13)
+
+Features:
+
+ - Improve performance of `.reduce()` when `initialValue` can be synchronously cast to a value
+
+## 0.8.2-1 (2013-10-12)
+
+Bugfixes:
+
+ - Fix .npmignore having irrelevant files
+
+## 0.8.2-0 (2013-10-12)
+
+Features:
+
+ - Improve performance of `.some()`
+
+## 0.8.1-0 (2013-10-11)
+
+Bugfixes:
+
+ - Remove uses of dynamic evaluation (`new Function`, `eval` etc) when strictly not necessary. Use feature detection to use static evaluation to avoid errors when dynamic evaluation is prohibited.
+
+## 0.8.0-3 (2013-10-10)
+
+Features:
+
+ - Add `.asCallback` property to `PromiseResolver`s
+
+## 0.8.0-2 (2013-10-10)
+
+## 0.8.0-1 (2013-10-09)
+
+Features:
+
+ - Improve overall performance. Be able to sustain infinite recursion when using promises.
+
+## 0.8.0-0 (2013-10-09)
+
+Bugfixes:
+
+ - Fix stackoverflow error when function calls itself "synchronously" from a promise handler
+
+## 0.7.12-2 (2013-10-09)
+
+Bugfixes:
+
+ - Fix safari 6 not using `MutationObserver` as a scheduler
+ - Fix process exceptions interfering with internal queue flushing
+
+## 0.7.12-1 (2013-10-09)
+
+Bugfixes:
+
+ - Don't try to detect if generators are available to allow shims to be used
+
+## 0.7.12-0 (2013-10-08)
+
+Features:
+
+ - Promisification now consider all functions on the object and its prototype chain
+ - Individual promisifcation uses current `this` if no explicit receiver is given
+ - Give better stack traces when promisified callbacks throw or errback primitives such as strings by wrapping them in an `Error` object.
+
+Bugfixes:
+
+ - Fix runtime APIs throwing synchronous errors
+
+## 0.7.11-0 (2013-10-08)
+
+Features:
+
+ - Deprecate `Promise.promisify(Object target)` in favor of `Promise.promisifyAll(Object target)` to avoid confusion with function objects
+ - Coroutines now throw error when a non-promise is `yielded`
+
+## 0.7.10-1 (2013-10-05)
+
+Features:
+
+ - Make tests pass Internet Explorer 8
+
+## 0.7.10-0 (2013-10-05)
+
+Features:
+
+ - Create browser tests
+
+## 0.7.9-1 (2013-10-03)
+
+Bugfixes:
+
+ - Fix promise cast bug when thenable fulfills using itself as the fulfillment value
+
+## 0.7.9-0 (2013-10-03)
+
+Features:
+
+ - More performance improvements when long stack traces are enabled
+
+## 0.7.8-1 (2013-10-02)
+
+Features:
+
+ - Performance improvements when long stack traces are enabled
+
+## 0.7.8-0 (2013-10-02)
+
+Bugfixes:
+
+ - Fix promisified methods not turning synchronous exceptions into rejections
+
+## 0.7.7-1 (2013-10-02)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.7-0 (2013-10-01)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.6-0 (2013-09-29)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.5-0 (2013-09-28)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.4-1 (2013-09-28)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.4-0 (2013-09-28)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.3-1 (2013-09-28)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.3-0 (2013-09-27)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.2-0 (2013-09-27)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-5 (2013-09-26)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-4 (2013-09-25)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-3 (2013-09-25)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-2 (2013-09-24)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-1 (2013-09-24)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.1-0 (2013-09-24)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.0-1 (2013-09-23)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.7.0-0 (2013-09-23)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.5-2 (2013-09-20)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.5-1 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.5-0 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.4-1 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.4-0 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.3-4 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.3-3 (2013-09-18)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.3-2 (2013-09-16)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.3-1 (2013-09-16)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.3-0 (2013-09-15)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.2-1 (2013-09-14)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.2-0 (2013-09-14)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.1-0 (2013-09-14)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.6.0-0 (2013-09-13)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-6 (2013-09-12)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-5 (2013-09-12)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-4 (2013-09-12)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-3 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-2 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-1 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.9-0 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.8-1 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.8-0 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.7-0 (2013-09-11)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.6-1 (2013-09-10)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.6-0 (2013-09-10)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.5-1 (2013-09-10)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.5-0 (2013-09-09)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.4-1 (2013-09-08)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.4-0 (2013-09-08)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.3-0 (2013-09-07)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.2-0 (2013-09-07)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.1-0 (2013-09-07)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.5.0-0 (2013-09-07)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.4.0-0 (2013-09-06)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.3.0-1 (2013-09-06)
+
+Features:
+
+ - feature
+
+Bugfixes:
+
+ - bugfix
+
+## 0.3.0 (2013-09-06)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.js
new file mode 100644
index 0000000000..3ed20bd096
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.js
@@ -0,0 +1,4679 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2014 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:</p>
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 2.9.15
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, cancel, using, filter, any, each, timers
+*/
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.Promise=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof _dereq_=="function"&&_dereq_;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof _dereq_=="function"&&_dereq_;for(var o=0;o<r.length;o++)s(r[o]);return s})({1:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var SomePromiseArray = Promise._SomePromiseArray;
+function any(promises) {
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(1);
+ ret.setUnwrap();
+ ret.init();
+ return promise;
+}
+
+Promise.any = function (promises) {
+ return any(promises);
+};
+
+Promise.prototype.any = function () {
+ return any(this);
+};
+
+};
+
+},{}],2:[function(_dereq_,module,exports){
+"use strict";
+var firstLineError;
+try {throw new Error(); } catch (e) {firstLineError = e;}
+var schedule = _dereq_("./schedule.js");
+var Queue = _dereq_("./queue.js");
+var _process = typeof process !== "undefined" ? process : undefined;
+
+function Async() {
+ this._isTickUsed = false;
+ this._lateQueue = new Queue(16);
+ this._normalQueue = new Queue(16);
+ var self = this;
+ this.drainQueues = function () {
+ self._drainQueues();
+ };
+ this._schedule =
+ schedule.isStatic ? schedule(this.drainQueues) : schedule;
+}
+
+Async.prototype.haveItemsQueued = function () {
+ return this._normalQueue.length() > 0;
+};
+
+Async.prototype._withDomain = function(fn) {
+ if (_process !== undefined &&
+ _process.domain != null &&
+ !fn.domain) {
+ fn = _process.domain.bind(fn);
+ }
+ return fn;
+};
+
+Async.prototype.throwLater = function(fn, arg) {
+ if (arguments.length === 1) {
+ arg = fn;
+ fn = function () { throw arg; };
+ }
+ fn = this._withDomain(fn);
+ if (typeof setTimeout !== "undefined") {
+ setTimeout(function() {
+ fn(arg);
+ }, 0);
+ } else try {
+ this._schedule(function() {
+ fn(arg);
+ });
+ } catch (e) {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/m3OTXk\u000a");
+ }
+};
+
+Async.prototype.invokeLater = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._lateQueue.push(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.invokeFirst = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._normalQueue.unshift(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.invoke = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._normalQueue.push(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.settlePromises = function(promise) {
+ this._normalQueue._pushOne(promise);
+ this._queueTick();
+};
+
+Async.prototype._drainQueue = function(queue) {
+ while (queue.length() > 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = new Async();
+module.exports.firstLineError = firstLineError;
+
+},{"./queue.js":28,"./schedule.js":31}],3:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise) {
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ this._setBoundTo(thisArg);
+ if (this._isPending()) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, ret._progress, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, ret._progress, ret, context);
+ } else {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 131072;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~131072);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 131072) === 131072;
+};
+
+Promise.bind = function (thisArg, value) {
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise._then(function(thisArg) {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(value);
+ }, ret._reject, ret._progress, ret, null);
+ } else {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(value);
+ }
+ return ret;
+};
+};
+
+},{}],4:[function(_dereq_,module,exports){
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = _dereq_("./promise.js")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
+
+},{"./promise.js":23}],5:[function(_dereq_,module,exports){
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = _dereq_("./util.js");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!true) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var $_len = arguments.length;var args = new Array($_len - 1); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];}
+ if (!true) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
+
+},{"./util.js":38}],6:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var errors = _dereq_("./errors.js");
+var async = _dereq_("./async.js");
+var CancellationError = errors.CancellationError;
+
+Promise.prototype._cancel = function (reason) {
+ if (!this.isCancellable()) return this;
+ var parent;
+ var promiseToReject = this;
+ while ((parent = promiseToReject._cancellationParent) !== undefined &&
+ parent.isCancellable()) {
+ promiseToReject = parent;
+ }
+ this._unsetCancellable();
+ promiseToReject._target()._rejectCallback(reason, false, true);
+};
+
+Promise.prototype.cancel = function (reason) {
+ if (!this.isCancellable()) return this;
+ if (reason === undefined) reason = new CancellationError();
+ async.invokeLater(this._cancel, this, reason);
+ return this;
+};
+
+Promise.prototype.cancellable = function () {
+ if (this._cancellable()) return this;
+ this._setCancellable();
+ this._cancellationParent = undefined;
+ return this;
+};
+
+Promise.prototype.uncancellable = function () {
+ var ret = this.then();
+ ret._unsetCancellable();
+ return ret;
+};
+
+Promise.prototype.fork = function (didFulfill, didReject, didProgress) {
+ var ret = this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+
+ ret._setCancellable();
+ ret._cancellationParent = undefined;
+ return ret;
+};
+};
+
+},{"./async.js":2,"./errors.js":13}],7:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var async = _dereq_("./async.js");
+var util = _dereq_("./util.js");
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](main|debug|zalgo|instrumented)/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var warn;
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.parent = function() {
+ return this._parent;
+};
+
+CapturedTrace.prototype.hasParent = function() {
+ return this._parent !== undefined;
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = CapturedTrace.parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ error.stack = reconstructStack(message, stacks);
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = stackFramePattern.test(line) ||
+ " (No stack trace)" === line;
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0) {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+CapturedTrace.parseStackAndMessage = function(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: cleanStack(stack)
+ };
+};
+
+CapturedTrace.formatAndLogError = function(error, title) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (typeof error === "object" || typeof error === "function") {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof warn === "function") {
+ warn(message);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+};
+
+CapturedTrace.unhandledRejection = function (reason) {
+ CapturedTrace.formatAndLogError(reason, "^--- With additional stack trace: ");
+};
+
+CapturedTrace.isSupported = function () {
+ return typeof captureStackTrace === "function";
+};
+
+CapturedTrace.fireRejectionEvent =
+function(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent(name, reason, promise);
+ } catch (e) {
+ globalEventFired = true;
+ async.throwLater(e);
+ }
+
+ var domEventFired = false;
+ if (fireDomEvent) {
+ try {
+ domEventFired = fireDomEvent(name.toLowerCase(), {
+ reason: reason,
+ promise: promise
+ });
+ } catch (e) {
+ domEventFired = true;
+ async.throwLater(e);
+ }
+ }
+
+ if (!globalEventFired && !localEventFired && !domEventFired &&
+ name === "unhandledRejection") {
+ CapturedTrace.formatAndLogError(reason, "Unhandled rejection ");
+ }
+};
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj.toString();
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+CapturedTrace.setBounds = function(firstLineError, lastLineError) {
+ if (!CapturedTrace.isSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit = Error.stackTraceLimit - 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow) {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit = Error.stackTraceLimit - 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+var fireDomEvent;
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function(name, reason, promise) {
+ if (name === "rejectionHandled") {
+ return process.emit(name, promise);
+ } else {
+ return process.emit(name, reason, promise);
+ }
+ };
+ } else {
+ var customEventWorks = false;
+ var anyEventWorks = true;
+ try {
+ var ev = new self.CustomEvent("test");
+ customEventWorks = ev instanceof CustomEvent;
+ } catch (e) {}
+ if (!customEventWorks) {
+ try {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ self.dispatchEvent(event);
+ } catch (e) {
+ anyEventWorks = false;
+ }
+ }
+ if (anyEventWorks) {
+ fireDomEvent = function(type, detail) {
+ var event;
+ if (customEventWorks) {
+ event = new self.CustomEvent(type, {
+ detail: detail,
+ bubbles: false,
+ cancelable: true
+ });
+ } else if (self.dispatchEvent) {
+ event = document.createEvent("CustomEvent");
+ event.initCustomEvent(type, false, true, detail);
+ }
+
+ return event ? !self.dispatchEvent(event) : false;
+ };
+ }
+
+ var toWindowMethodNameMap = {};
+ toWindowMethodNameMap["unhandledRejection"] = ("on" +
+ "unhandledRejection").toLowerCase();
+ toWindowMethodNameMap["rejectionHandled"] = ("on" +
+ "rejectionHandled").toLowerCase();
+
+ return function(name, reason, promise) {
+ var methodName = toWindowMethodNameMap[name];
+ var method = self[methodName];
+ if (!method) return false;
+ if (name === "rejectionHandled") {
+ method.call(self, promise);
+ } else {
+ method.call(self, reason, promise);
+ }
+ return true;
+ };
+ }
+})();
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ warn = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ warn = function(message) {
+ process.stderr.write("\u001b[31m" + message + "\u001b[39m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ warn = function(message) {
+ console.warn("%c" + message, "color: red");
+ };
+ }
+}
+
+return CapturedTrace;
+};
+
+},{"./async.js":2,"./util.js":38}],8:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = _dereq_("./util.js");
+var errors = _dereq_("./errors.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var keys = _dereq_("./es5.js").keys;
+var TypeError = errors.TypeError;
+
+function CatchFilter(instances, callback, promise) {
+ this._instances = instances;
+ this._callback = callback;
+ this._promise = promise;
+}
+
+function safePredicate(predicate, e) {
+ var safeObject = {};
+ var retfilter = tryCatch(predicate).call(safeObject, e);
+
+ if (retfilter === errorObj) return retfilter;
+
+ var safeKeys = keys(safeObject);
+ if (safeKeys.length) {
+ errorObj.e = new TypeError("Catch filter must inherit from Error or be a simple predicate function\u000a\u000a See http://goo.gl/o84o68\u000a");
+ return errorObj;
+ }
+ return retfilter;
+}
+
+CatchFilter.prototype.doFilter = function (e) {
+ var cb = this._callback;
+ var promise = this._promise;
+ var boundTo = promise._boundTo;
+ for (var i = 0, len = this._instances.length; i < len; ++i) {
+ var item = this._instances[i];
+ var itemIsErrorType = item === Error ||
+ (item != null && item.prototype instanceof Error);
+
+ if (itemIsErrorType && e instanceof item) {
+ var ret = tryCatch(cb).call(boundTo, e);
+ if (ret === errorObj) {
+ NEXT_FILTER.e = ret.e;
+ return NEXT_FILTER;
+ }
+ return ret;
+ } else if (typeof item === "function" && !itemIsErrorType) {
+ var shouldHandle = safePredicate(item, e);
+ if (shouldHandle === errorObj) {
+ e = errorObj.e;
+ break;
+ } else if (shouldHandle) {
+ var ret = tryCatch(cb).call(boundTo, e);
+ if (ret === errorObj) {
+ NEXT_FILTER.e = ret.e;
+ return NEXT_FILTER;
+ }
+ return ret;
+ }
+ }
+ }
+ NEXT_FILTER.e = e;
+ return NEXT_FILTER;
+};
+
+return CatchFilter;
+};
+
+},{"./errors.js":13,"./es5.js":14,"./util.js":38}],9:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, CapturedTrace, isDebugging) {
+var contextStack = [];
+function Context() {
+ this._trace = new CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (!isDebugging()) return;
+ if (this._trace !== undefined) {
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (!isDebugging()) return;
+ if (this._trace !== undefined) {
+ contextStack.pop();
+ }
+};
+
+function createContext() {
+ if (isDebugging()) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+
+Promise.prototype._peekContext = peekContext;
+Promise.prototype._pushContext = Context.prototype._pushContext;
+Promise.prototype._popContext = Context.prototype._popContext;
+
+return createContext;
+};
+
+},{}],10:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, CapturedTrace) {
+var async = _dereq_("./async.js");
+var Warning = _dereq_("./errors.js").Warning;
+var util = _dereq_("./util.js");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var debugging = false || (util.isNode &&
+ (!!process.env["BLUEBIRD_DEBUG"] ||
+ process.env["NODE_ENV"] === "development"));
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ this._setRejectionIsUnhandled();
+ async.invokeLater(this._notifyUnhandledRejection, this, undefined);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ CapturedTrace.fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._getCarriedStackTrace() || this._settledValue;
+ this._setUnhandledRejectionIsNotified();
+ CapturedTrace.fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 524288;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~524288);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 524288) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 2097152;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~2097152);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 2097152) > 0;
+};
+
+Promise.prototype._setCarriedStackTrace = function (capturedTrace) {
+ this._bitField = this._bitField | 1048576;
+ this._fulfillmentHandler0 = capturedTrace;
+};
+
+Promise.prototype._isCarryingStackTrace = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._getCarriedStackTrace = function () {
+ return this._isCarryingStackTrace()
+ ? this._fulfillmentHandler0
+ : undefined;
+};
+
+Promise.prototype._captureStackTrace = function () {
+ if (debugging) {
+ this._trace = new CapturedTrace(this._peekContext());
+ }
+ return this;
+};
+
+Promise.prototype._attachExtraTrace = function (error, ignoreSelf) {
+ if (debugging && canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = CapturedTrace.parseStackAndMessage(error);
+ error.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+};
+
+Promise.prototype._warn = function(message) {
+ var warning = new Warning(message);
+ var ctx = this._peekContext();
+ if (ctx) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = CapturedTrace.parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+ CapturedTrace.formatAndLogError(warning, "");
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ possiblyUnhandledRejection = typeof fn === "function" ? fn : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ unhandledRejectionHandled = typeof fn === "function" ? fn : undefined;
+};
+
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() &&
+ debugging === false
+ ) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/DT1qyG\u000a");
+ }
+ debugging = CapturedTrace.isSupported();
+};
+
+Promise.hasLongStackTraces = function () {
+ return debugging && CapturedTrace.isSupported();
+};
+
+if (!CapturedTrace.isSupported()) {
+ Promise.longStackTraces = function(){};
+ debugging = false;
+}
+
+return function() {
+ return debugging;
+};
+};
+
+},{"./async.js":2,"./errors.js":13,"./util.js":38}],11:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util.js");
+var isPrimitive = util.isPrimitive;
+var wrapsPrimitiveReceiver = util.wrapsPrimitiveReceiver;
+
+module.exports = function(Promise) {
+var returner = function () {
+ return this;
+};
+var thrower = function () {
+ throw this;
+};
+
+var wrapper = function (value, action) {
+ if (action === 1) {
+ return function () {
+ throw value;
+ };
+ } else if (action === 2) {
+ return function () {
+ return value;
+ };
+ }
+};
+
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (wrapsPrimitiveReceiver && isPrimitive(value)) {
+ return this._then(
+ wrapper(value, 2),
+ undefined,
+ undefined,
+ undefined,
+ undefined
+ );
+ }
+ return this._then(returner, undefined, undefined, value, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ if (wrapsPrimitiveReceiver && isPrimitive(reason)) {
+ return this._then(
+ wrapper(reason, 1),
+ undefined,
+ undefined,
+ undefined,
+ undefined
+ );
+ }
+ return this._then(thrower, undefined, undefined, reason, undefined);
+};
+};
+
+},{"./util.js":38}],12:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, null, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, null, INTERNAL);
+};
+};
+
+},{}],13:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5.js");
+var Objectfreeze = es5.freeze;
+var util = _dereq_("./util.js");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ notEnumerableProp(Error, "__BluebirdErrorTypes__", errorTypes);
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
+
+},{"./es5.js":14,"./util.js":38}],14:[function(_dereq_,module,exports){
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
+
+},{}],15:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
+
+},{}],16:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, NEXT_FILTER, tryConvertToPromise) {
+var util = _dereq_("./util.js");
+var wrapsPrimitiveReceiver = util.wrapsPrimitiveReceiver;
+var isPrimitive = util.isPrimitive;
+var thrower = util.thrower;
+
+function returnThis() {
+ return this;
+}
+function throwThis() {
+ throw this;
+}
+function return$(r) {
+ return function() {
+ return r;
+ };
+}
+function throw$(r) {
+ return function() {
+ throw r;
+ };
+}
+function promisedFinally(ret, reasonOrValue, isFulfilled) {
+ var then;
+ if (wrapsPrimitiveReceiver && isPrimitive(reasonOrValue)) {
+ then = isFulfilled ? return$(reasonOrValue) : throw$(reasonOrValue);
+ } else {
+ then = isFulfilled ? returnThis : throwThis;
+ }
+ return ret._then(then, thrower, undefined, reasonOrValue, undefined);
+}
+
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ var ret = promise._isBound()
+ ? handler.call(promise._boundTo)
+ : handler();
+
+ if (ret !== undefined) {
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ return promisedFinally(maybePromise, reasonOrValue,
+ promise.isFulfilled());
+ }
+ }
+
+ if (promise.isRejected()) {
+ NEXT_FILTER.e = reasonOrValue;
+ return NEXT_FILTER;
+ } else {
+ return reasonOrValue;
+ }
+}
+
+function tapHandler(value) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ var ret = promise._isBound()
+ ? handler.call(promise._boundTo, value)
+ : handler(value);
+
+ if (ret !== undefined) {
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ return promisedFinally(maybePromise, value, true);
+ }
+ }
+ return value;
+}
+
+Promise.prototype._passThroughHandler = function (handler, isFinally) {
+ if (typeof handler !== "function") return this.then();
+
+ var promiseAndHandler = {
+ promise: this,
+ handler: handler
+ };
+
+ return this._then(
+ isFinally ? finallyHandler : tapHandler,
+ isFinally ? finallyHandler : undefined, undefined,
+ promiseAndHandler, undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThroughHandler(handler, true);
+};
+
+Promise.prototype.tap = function (handler) {
+ return this._passThroughHandler(handler, false);
+};
+};
+
+},{"./util.js":38}],17:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise) {
+var errors = _dereq_("./errors.js");
+var TypeError = errors.TypeError;
+var util = _dereq_("./util.js");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+}
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._next(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ if (result === errorObj) {
+ return this._promise._rejectCallback(result.e, false, true);
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._promise._resolveCallback(value);
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._throw(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/4Y4pDk\u000a\u000a".replace("%s", value) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise._then(
+ this._next,
+ this._throw,
+ undefined,
+ this,
+ null
+ );
+ }
+};
+
+PromiseSpawn.prototype._throw = function (reason) {
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._next = function (value) {
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/6Vqhm0\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ spawn._generator = generator;
+ spawn._next(undefined);
+ return spawn.promise();
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/6Vqhm0\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
+
+},{"./errors.js":13,"./util.js":38}],18:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL) {
+var util = _dereq_("./util.js");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!true) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var caller = function(count) {
+ var values = [];
+ for (var i = 1; i <= count; ++i) values.push("holder.p" + i);
+ return new Function("holder", " \n\
+ 'use strict'; \n\
+ var callback = holder.fn; \n\
+ return callback(values); \n\
+ ".replace(/values/g, values.join(", ")));
+ };
+ var thenCallbacks = [];
+ var callers = [undefined];
+ for (var i = 1; i <= 5; ++i) {
+ thenCallbacks.push(thenCallback(i));
+ callers.push(caller(i));
+ }
+
+ var Holder = function(total, fn) {
+ this.p1 = this.p2 = this.p3 = this.p4 = this.p5 = null;
+ this.fn = fn;
+ this.total = total;
+ this.now = 0;
+ };
+
+ Holder.prototype.callers = callers;
+ Holder.prototype.checkFulfillment = function(promise) {
+ var now = this.now;
+ now++;
+ var total = this.total;
+ if (now >= total) {
+ var handler = this.callers[total];
+ promise._pushContext();
+ var ret = tryCatch(handler)(this);
+ promise._popContext();
+ if (ret === errorObj) {
+ promise._rejectCallback(ret.e, false, true);
+ } else {
+ promise._resolveCallback(ret);
+ }
+ } else {
+ this.now = now;
+ }
+ };
+
+ var reject = function (reason) {
+ this._reject(reason);
+ };
+}
+}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!true) {
+ if (last < 6 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var holder = new Holder(last, fn);
+ var callbacks = thenCallbacks;
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ } else if (maybePromise._isFulfilled()) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else {
+ ret._reject(maybePromise._reason());
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+ return ret;
+ }
+ }
+ }
+ var $_len = arguments.length;var args = new Array($_len); for(var $_i = 0; $_i < $_len; ++$_i) {args[$_i] = arguments[$_i];}
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
+
+},{"./util.js":38}],19:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL) {
+var async = _dereq_("./async.js");
+var util = _dereq_("./util.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var PENDING = {};
+var EMPTY_ARRAY = [];
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ this._callback = fn;
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = limit >= 1 ? [] : EMPTY_ARRAY;
+ async.invoke(init, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+function init() {this._init$(undefined, -2);}
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+ if (values[index] === PENDING) {
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var callback = this._callback;
+ var receiver = this._promise._boundTo;
+ this._promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ this._promise._popContext();
+ if (ret === errorObj) return this._reject(ret.e);
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = PENDING;
+ return maybePromise._proxyPromiseArray(this, index);
+ } else if (maybePromise._isFulfilled()) {
+ ret = maybePromise._value();
+ } else {
+ return this._reject(maybePromise._reason());
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+
+ }
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ var limit = typeof options === "object" && options !== null
+ ? options.concurrency
+ : 0;
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter);
+}
+
+Promise.prototype.map = function (fn, options) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+
+ return map(this, fn, options, null).promise();
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ return map(promises, fn, options, _filter).promise();
+};
+
+
+};
+
+},{"./async.js":2,"./util.js":38}],20:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util.js");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ ret._popContext();
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn, args, ctx) {
+ if (typeof fn !== "function") {
+ return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = util.isArray(args)
+ ? tryCatch(fn).apply(ctx, args)
+ : tryCatch(fn).call(ctx, args);
+ ret._popContext();
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false, true);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
+
+},{"./util.js":38}],21:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var util = _dereq_("./util.js");
+var async = _dereq_("./async.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret = tryCatch(nodeback).apply(promise._boundTo, [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundTo;
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var target = promise._target();
+ var newReason = target._getCarriedStackTrace();
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundTo, reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback =
+Promise.prototype.nodeify = function (nodeback, options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
+
+},{"./async.js":2,"./util.js":38}],22:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, PromiseArray) {
+var util = _dereq_("./util.js");
+var async = _dereq_("./async.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+Promise.prototype.progressed = function (handler) {
+ return this._then(undefined, undefined, handler, undefined, undefined);
+};
+
+Promise.prototype._progress = function (progressValue) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._target()._progressUnchecked(progressValue);
+
+};
+
+Promise.prototype._progressHandlerAt = function (index) {
+ return index === 0
+ ? this._progressHandler0
+ : this[(index << 2) + index - 5 + 2];
+};
+
+Promise.prototype._doProgressWith = function (progression) {
+ var progressValue = progression.value;
+ var handler = progression.handler;
+ var promise = progression.promise;
+ var receiver = progression.receiver;
+
+ var ret = tryCatch(handler).call(receiver, progressValue);
+ if (ret === errorObj) {
+ if (ret.e != null &&
+ ret.e.name !== "StopProgressPropagation") {
+ var trace = util.canAttachTrace(ret.e)
+ ? ret.e : new Error(util.toString(ret.e));
+ promise._attachExtraTrace(trace);
+ promise._progress(ret.e);
+ }
+ } else if (ret instanceof Promise) {
+ ret._then(promise._progress, null, null, promise, undefined);
+ } else {
+ promise._progress(ret);
+ }
+};
+
+
+Promise.prototype._progressUnchecked = function (progressValue) {
+ var len = this._length();
+ var progress = this._progress;
+ for (var i = 0; i < len; i++) {
+ var handler = this._progressHandlerAt(i);
+ var promise = this._promiseAt(i);
+ if (!(promise instanceof Promise)) {
+ var receiver = this._receiverAt(i);
+ if (typeof handler === "function") {
+ handler.call(receiver, progressValue, promise);
+ } else if (receiver instanceof PromiseArray &&
+ !receiver._isResolved()) {
+ receiver._promiseProgressed(progressValue, promise);
+ }
+ continue;
+ }
+
+ if (typeof handler === "function") {
+ async.invoke(this._doProgressWith, this, {
+ handler: handler,
+ promise: promise,
+ receiver: this._receiverAt(i),
+ value: progressValue
+ });
+ } else {
+ async.invoke(progress, promise, progressValue);
+ }
+ }
+};
+};
+
+},{"./async.js":2,"./util.js":38}],23:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/LhFpo0\u000a");
+};
+var reflect = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+var util = _dereq_("./util.js");
+var async = _dereq_("./async.js");
+var errors = _dereq_("./errors.js");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {e: null};
+var tryConvertToPromise = _dereq_("./thenables.js")(Promise, INTERNAL);
+var PromiseArray =
+ _dereq_("./promise_array.js")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection);
+var CapturedTrace = _dereq_("./captured_trace.js")();
+var isDebugging = _dereq_("./debuggability.js")(Promise, CapturedTrace);
+ /*jshint unused:false*/
+var createContext =
+ _dereq_("./context.js")(Promise, CapturedTrace, isDebugging);
+var CatchFilter = _dereq_("./catch_filter.js")(NEXT_FILTER);
+var PromiseResolver = _dereq_("./promise_resolver.js");
+var nodebackForPromise = PromiseResolver._nodebackForPromise;
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function Promise(resolver) {
+ if (typeof resolver !== "function") {
+ throw new TypeError("the promise constructor requires a resolver function\u000a\u000a See http://goo.gl/EC22Yn\u000a");
+ }
+ if (this.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/KsIlge\u000a");
+ }
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._progressHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settledValue = undefined;
+ if (resolver !== INTERNAL) this._resolveFromResolver(resolver);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (typeof item === "function") {
+ catchInstances[j++] = item;
+ } else {
+ return Promise.reject(
+ new TypeError("Catch filter must inherit from Error or be a simple predicate function\u000a\u000a See http://goo.gl/o84o68\u000a"));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ var catchFilter = new CatchFilter(catchInstances, fn, this);
+ return this._then(undefined, catchFilter.doFilter, undefined,
+ catchFilter, undefined);
+ }
+ return this._then(undefined, fn, undefined, undefined, undefined);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflect, reflect, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject, didProgress) {
+ if (isDebugging() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject, didProgress) {
+ var promise = this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (didFulfill, didReject) {
+ return this.all()._then(didFulfill, didReject, undefined, APPLY, undefined);
+};
+
+Promise.prototype.isCancellable = function () {
+ return !this.isResolved() &&
+ this._cancellable();
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = function(fn) {
+ var ret = new Promise(INTERNAL);
+ var result = tryCatch(fn)(nodebackForPromise(ret));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true, true);
+ }
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.defer = Promise.pending = function () {
+ var promise = new Promise(INTERNAL);
+ return new PromiseResolver(promise);
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ var val = ret;
+ ret = new Promise(INTERNAL);
+ ret._fulfillUnchecked(val);
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ var prev = async._schedule;
+ async._schedule = fn;
+ return prev;
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ didProgress,
+ receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var ret = haveInternalData ? internalData : new Promise(INTERNAL);
+
+ if (!haveInternalData) {
+ ret._propagateFrom(this, 4 | 1);
+ ret._captureStackTrace();
+ }
+
+ var target = this._target();
+ if (target !== this) {
+ if (receiver === undefined) receiver = this._boundTo;
+ if (!haveInternalData) ret._setIsMigrated();
+ }
+
+ var callbackIndex =
+ target._addCallbacks(didFulfill, didReject, didProgress, ret, receiver);
+
+ if (target._isResolved() && !target._isSettlePromisesQueued()) {
+ async.invoke(
+ target._settlePromiseAtPostResolution, target, callbackIndex);
+ }
+
+ return ret;
+};
+
+Promise.prototype._settlePromiseAtPostResolution = function (index) {
+ if (this._isRejectionUnhandled()) this._unsetRejectionIsUnhandled();
+ this._settlePromiseAt(index);
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 131071;
+};
+
+Promise.prototype._isFollowingOrFulfilledOrRejected = function () {
+ return (this._bitField & 939524096) > 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 536870912) === 536870912;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -131072) |
+ (len & 131071);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 536870912;
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 33554432;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 33554432) > 0;
+};
+
+Promise.prototype._cancellable = function () {
+ return (this._bitField & 67108864) > 0;
+};
+
+Promise.prototype._setCancellable = function () {
+ this._bitField = this._bitField | 67108864;
+};
+
+Promise.prototype._unsetCancellable = function () {
+ this._bitField = this._bitField & (~67108864);
+};
+
+Promise.prototype._setIsMigrated = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._unsetIsMigrated = function () {
+ this._bitField = this._bitField & (~4194304);
+};
+
+Promise.prototype._isMigrated = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0
+ ? this._receiver0
+ : this[
+ index * 5 - 5 + 4];
+ if (ret === undefined && this._isBound()) {
+ return this._boundTo;
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return index === 0
+ ? this._promise0
+ : this[index * 5 - 5 + 3];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return index === 0
+ ? this._fulfillmentHandler0
+ : this[index * 5 - 5 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return index === 0
+ ? this._rejectionHandler0
+ : this[index * 5 - 5 + 1];
+};
+
+Promise.prototype._migrateCallbacks = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var progress = follower._progressHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (promise instanceof Promise) promise._setIsMigrated();
+ this._addCallbacks(fulfill, reject, progress, promise, receiver);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ progress,
+ promise,
+ receiver
+) {
+ var index = this._length();
+
+ if (index >= 131071 - 5) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ if (receiver !== undefined) this._receiver0 = receiver;
+ if (typeof fulfill === "function" && !this._isCarryingStackTrace())
+ this._fulfillmentHandler0 = fulfill;
+ if (typeof reject === "function") this._rejectionHandler0 = reject;
+ if (typeof progress === "function") this._progressHandler0 = progress;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] = promise;
+ this[base + 4] = receiver;
+ if (typeof fulfill === "function")
+ this[base + 0] = fulfill;
+ if (typeof reject === "function")
+ this[base + 1] = reject;
+ if (typeof progress === "function")
+ this[base + 2] = progress;
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._setProxyHandlers = function (receiver, promiseSlotValue) {
+ var index = this._length();
+
+ if (index >= 131071 - 5) {
+ index = 0;
+ this._setLength(0);
+ }
+ if (index === 0) {
+ this._promise0 = promiseSlotValue;
+ this._receiver0 = receiver;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] = promiseSlotValue;
+ this[base + 4] = receiver;
+ }
+ this._setLength(index + 1);
+};
+
+Promise.prototype._proxyPromiseArray = function (promiseArray, index) {
+ this._setProxyHandlers(promiseArray, index);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false, true);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ var propagationFlags = 1 | (shouldBind ? 4 : 0);
+ this._propagateFrom(maybePromise, propagationFlags);
+ var promise = maybePromise._target();
+ if (promise._isPending()) {
+ var len = this._length();
+ for (var i = 0; i < len; ++i) {
+ promise._migrateCallbacks(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (promise._isFulfilled()) {
+ this._fulfillUnchecked(promise._value());
+ } else {
+ this._rejectUnchecked(promise._reason(),
+ promise._getCarriedStackTrace());
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, shouldNotMarkOriginatingFromRejection) {
+ if (!shouldNotMarkOriginatingFromRejection) {
+ util.markAsOriginatingFromRejection(reason);
+ }
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason, hasStack ? undefined : trace);
+};
+
+Promise.prototype._resolveFromResolver = function (resolver) {
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = tryCatch(resolver)(function(value) {
+ if (promise === null) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }, function (reason) {
+ if (promise === null) return;
+ promise._rejectCallback(reason, synchronous);
+ promise = null;
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined && r === errorObj && promise !== null) {
+ promise._rejectCallback(r.e, true, true);
+ promise = null;
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ if (promise._isRejected()) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY && !this._isRejected()) {
+ x = tryCatch(handler).apply(this._boundTo, value);
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ promise._popContext();
+
+ if (x === errorObj || x === promise || x === NEXT_FILTER) {
+ var err = x === promise ? makeSelfResolutionError() : x.e;
+ promise._rejectCallback(err, false, true);
+ } else {
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._cleanValues = function () {
+ if (this._cancellable()) {
+ this._cancellationParent = undefined;
+ }
+};
+
+Promise.prototype._propagateFrom = function (parent, flags) {
+ if ((flags & 1) > 0 && parent._cancellable()) {
+ this._setCancellable();
+ this._cancellationParent = parent;
+ }
+ if ((flags & 4) > 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+};
+
+Promise.prototype._fulfill = function (value) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._fulfillUnchecked(value);
+};
+
+Promise.prototype._reject = function (reason, carriedStackTrace) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._rejectUnchecked(reason, carriedStackTrace);
+};
+
+Promise.prototype._settlePromiseAt = function (index) {
+ var promise = this._promiseAt(index);
+ var isPromise = promise instanceof Promise;
+
+ if (isPromise && promise._isMigrated()) {
+ promise._unsetIsMigrated();
+ return async.invoke(this._settlePromiseAt, this, index);
+ }
+ var handler = this._isFulfilled()
+ ? this._fulfillmentHandlerAt(index)
+ : this._rejectionHandlerAt(index);
+
+ var carriedStackTrace =
+ this._isCarryingStackTrace() ? this._getCarriedStackTrace() : undefined;
+ var value = this._settledValue;
+ var receiver = this._receiverAt(index);
+
+
+ this._clearCallbackDataAtIndex(index);
+
+ if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof PromiseArray) {
+ if (!receiver._isResolved()) {
+ if (this._isFulfilled()) {
+ receiver._promiseFulfilled(value, promise);
+ }
+ else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (this._isFulfilled()) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value, carriedStackTrace);
+ }
+ }
+
+ if (index >= 4 && (index & 31) === 4)
+ async.invokeLater(this._setLength, this, 0);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ if (index === 0) {
+ if (!this._isCarryingStackTrace()) {
+ this._fulfillmentHandler0 = undefined;
+ }
+ this._rejectionHandler0 =
+ this._progressHandler0 =
+ this._receiver0 =
+ this._promise0 = undefined;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] =
+ this[base + 4] =
+ this[base + 0] =
+ this[base + 1] =
+ this[base + 2] = undefined;
+ }
+};
+
+Promise.prototype._isSettlePromisesQueued = function () {
+ return (this._bitField &
+ -1073741824) === -1073741824;
+};
+
+Promise.prototype._setSettlePromisesQueued = function () {
+ this._bitField = this._bitField | -1073741824;
+};
+
+Promise.prototype._unsetSettlePromisesQueued = function () {
+ this._bitField = this._bitField & (~-1073741824);
+};
+
+Promise.prototype._queueSettlePromises = function() {
+ async.settlePromises(this);
+ this._setSettlePromisesQueued();
+};
+
+Promise.prototype._fulfillUnchecked = function (value) {
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._rejectUnchecked(err, undefined);
+ }
+ this._setFulfilled();
+ this._settledValue = value;
+ this._cleanValues();
+
+ if (this._length() > 0) {
+ this._queueSettlePromises();
+ }
+};
+
+Promise.prototype._rejectUncheckedCheckError = function (reason) {
+ var trace = util.ensureErrorObject(reason);
+ this._rejectUnchecked(reason, trace === reason ? undefined : trace);
+};
+
+Promise.prototype._rejectUnchecked = function (reason, trace) {
+ if (reason === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._rejectUnchecked(err);
+ }
+ this._setRejected();
+ this._settledValue = reason;
+ this._cleanValues();
+
+ if (this._isFinal()) {
+ async.throwLater(function(e) {
+ if ("stack" in e) {
+ async.invokeFirst(
+ CapturedTrace.unhandledRejection, undefined, e);
+ }
+ throw e;
+ }, trace === undefined ? reason : trace);
+ return;
+ }
+
+ if (trace !== undefined && trace !== reason) {
+ this._setCarriedStackTrace(trace);
+ }
+
+ if (this._length() > 0) {
+ this._queueSettlePromises();
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ this._unsetSettlePromisesQueued();
+ var len = this._length();
+ for (var i = 0; i < len; i++) {
+ this._settlePromiseAt(i);
+ }
+};
+
+Promise._makeSelfResolutionError = makeSelfResolutionError;
+_dereq_("./progress.js")(Promise, PromiseArray);
+_dereq_("./method.js")(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+_dereq_("./bind.js")(Promise, INTERNAL, tryConvertToPromise);
+_dereq_("./finally.js")(Promise, NEXT_FILTER, tryConvertToPromise);
+_dereq_("./direct_resolve.js")(Promise);
+_dereq_("./synchronous_inspection.js")(Promise);
+_dereq_("./join.js")(Promise, PromiseArray, tryConvertToPromise, INTERNAL);
+Promise.Promise = Promise;
+_dereq_('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL);
+_dereq_('./cancel.js')(Promise);
+_dereq_('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext);
+_dereq_('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise);
+_dereq_('./nodeify.js')(Promise);
+_dereq_('./call_get.js')(Promise);
+_dereq_('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+_dereq_('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+_dereq_('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL);
+_dereq_('./settle.js')(Promise, PromiseArray);
+_dereq_('./some.js')(Promise, PromiseArray, apiRejection);
+_dereq_('./promisify.js')(Promise, INTERNAL);
+_dereq_('./any.js')(Promise);
+_dereq_('./each.js')(Promise, INTERNAL);
+_dereq_('./timers.js')(Promise, INTERNAL);
+_dereq_('./filter.js')(Promise, INTERNAL);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._progressHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ p._settledValue = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ CapturedTrace.setBounds(async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
+
+},{"./any.js":1,"./async.js":2,"./bind.js":3,"./call_get.js":5,"./cancel.js":6,"./captured_trace.js":7,"./catch_filter.js":8,"./context.js":9,"./debuggability.js":10,"./direct_resolve.js":11,"./each.js":12,"./errors.js":13,"./filter.js":15,"./finally.js":16,"./generators.js":17,"./join.js":18,"./map.js":19,"./method.js":20,"./nodeify.js":21,"./progress.js":22,"./promise_array.js":24,"./promise_resolver.js":25,"./promisify.js":26,"./props.js":27,"./race.js":29,"./reduce.js":30,"./settle.js":32,"./some.js":33,"./synchronous_inspection.js":34,"./thenables.js":35,"./timers.js":36,"./using.js":37,"./util.js":38}],24:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection) {
+var util = _dereq_("./util.js");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ var parent;
+ if (values instanceof Promise) {
+ parent = values;
+ promise._propagateFrom(parent, 1 | 4);
+ }
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ this._values = values;
+ if (values._isFulfilled()) {
+ values = values._value();
+ if (!isArray(values)) {
+ var err = new Promise.TypeError("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a");
+ this.__hardReject__(err);
+ return;
+ }
+ } else if (values._isPending()) {
+ values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ return;
+ } else {
+ this._reject(values._reason());
+ return;
+ }
+ } else if (!isArray(values)) {
+ this._promise._reject(apiRejection("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a")._reason());
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var promise = this._promise;
+ for (var i = 0; i < len; ++i) {
+ var isResolved = this._isResolved();
+ var maybePromise = tryConvertToPromise(values[i], promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (isResolved) {
+ maybePromise._unsetRejectionIsUnhandled();
+ } else if (maybePromise._isPending()) {
+ maybePromise._proxyPromiseArray(this, i);
+ } else if (maybePromise._isFulfilled()) {
+ this._promiseFulfilled(maybePromise._value(), i);
+ } else {
+ this._promiseRejected(maybePromise._reason(), i);
+ }
+ } else if (!isResolved) {
+ this._promiseFulfilled(maybePromise, i);
+ }
+ }
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype.__hardReject__ =
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false, true);
+};
+
+PromiseArray.prototype._promiseProgressed = function (progressValue, index) {
+ this._promise._progress({
+ index: index,
+ value: progressValue
+ });
+};
+
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ }
+};
+
+PromiseArray.prototype._promiseRejected = function (reason, index) {
+ this._totalResolved++;
+ this._reject(reason);
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
+
+},{"./util.js":38}],25:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util.js");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = _dereq_("./errors.js");
+var TimeoutError = errors.TimeoutError;
+var OperationalError = errors.OperationalError;
+var haveGetters = util.haveGetters;
+var es5 = _dereq_("./es5.js");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise) {
+ return function(err, value) {
+ if (promise === null) return;
+
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (arguments.length > 2) {
+ var $_len = arguments.length;var args = new Array($_len - 1); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];}
+ promise._fulfill(args);
+ } else {
+ promise._fulfill(value);
+ }
+
+ promise = null;
+ };
+}
+
+
+var PromiseResolver;
+if (!haveGetters) {
+ PromiseResolver = function (promise) {
+ this.promise = promise;
+ this.asCallback = nodebackForPromise(promise);
+ this.callback = this.asCallback;
+ };
+}
+else {
+ PromiseResolver = function (promise) {
+ this.promise = promise;
+ };
+}
+if (haveGetters) {
+ var prop = {
+ get: function() {
+ return nodebackForPromise(this.promise);
+ }
+ };
+ es5.defineProperty(PromiseResolver.prototype, "asCallback", prop);
+ es5.defineProperty(PromiseResolver.prototype, "callback", prop);
+}
+
+PromiseResolver._nodebackForPromise = nodebackForPromise;
+
+PromiseResolver.prototype.toString = function () {
+ return "[object PromiseResolver]";
+};
+
+PromiseResolver.prototype.resolve =
+PromiseResolver.prototype.fulfill = function (value) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._resolveCallback(value);
+};
+
+PromiseResolver.prototype.reject = function (reason) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._rejectCallback(reason);
+};
+
+PromiseResolver.prototype.progress = function (value) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._progress(value);
+};
+
+PromiseResolver.prototype.cancel = function (err) {
+ this.promise.cancel(err);
+};
+
+PromiseResolver.prototype.timeout = function () {
+ this.reject(new TimeoutError("timeout"));
+};
+
+PromiseResolver.prototype.isResolved = function () {
+ return this.promise.isResolved();
+};
+
+PromiseResolver.prototype.toJSON = function () {
+ return this.promise.toJSON();
+};
+
+module.exports = PromiseResolver;
+
+},{"./errors.js":13,"./es5.js":14,"./util.js":38}],26:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = _dereq_("./util.js");
+var nodebackForPromise = _dereq_("./promise_resolver.js")
+ ._nodebackForPromise;
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = _dereq_("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyPropsPattern =
+ /^(?:length|name|arguments|caller|prototype|__isPromisified__)$/;
+var defaultFilter = function(name, func) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ !util.isClass(func);
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/iWrZbw\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!true) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "INTERNAL","'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ return promise; \n\
+ }; \n\
+ ret.__isPromisified__ = true; \n\
+ return ret; \n\
+ "
+ .replace("Parameters", parameterDeclaration(newParameterCount))
+ .replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode))(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ INTERNAL
+ );
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ return promise;
+ }
+ promisified.__isPromisified__ = true;
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ obj[promisifiedKey] = promisifier === makeNodePromisified
+ ? makeNodePromisified(key, THIS, key, fn, suffix)
+ : promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key, fn, suffix);
+ });
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver) {
+ return makeNodePromisified(callback, receiver, undefined, callback);
+}
+
+Promise.promisify = function (fn, receiver) {
+ if (typeof fn !== "function") {
+ throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ var ret = promisify(fn, arguments.length < 2 ? THIS : receiver);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/9ITlV0\u000a");
+ }
+ options = Object(options);
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/8FZo5V\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier);
+ promisifyAll(value, suffix, filter, promisifier);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier);
+};
+};
+
+
+},{"./errors":13,"./promise_resolver.js":25,"./util.js":38}],27:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util.js");
+var isObject = util.isObject;
+var es5 = _dereq_("./es5.js");
+
+function PropertiesPromiseArray(obj) {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ var values = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ values[i] = obj[key];
+ values[i + len] = key;
+ }
+ this.constructor$(values);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {
+ this._init$(undefined, -3) ;
+};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ this._resolve(val);
+ }
+};
+
+PropertiesPromiseArray.prototype._promiseProgressed = function (value, index) {
+ this._promise._progress({
+ key: this._values[index + this.length()],
+ value: value
+ });
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/OsFKC8\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 4);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
+
+},{"./es5.js":14,"./util.js":38}],28:[function(_dereq_,module,exports){
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype._unshiftOne = function(value) {
+ var capacity = this._capacity;
+ this._checkCapacity(this.length() + 1);
+ var front = this._front;
+ var i = (((( front - 1 ) &
+ ( capacity - 1) ) ^ capacity ) - capacity );
+ this[i] = value;
+ this._front = i;
+ this._length = this.length() + 1;
+};
+
+Queue.prototype.unshift = function(fn, receiver, arg) {
+ this._unshiftOne(arg);
+ this._unshiftOne(receiver);
+ this._unshiftOne(fn);
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
+
+},{}],29:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var isArray = _dereq_("./util.js").isArray;
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else if (!isArray(promises)) {
+ return apiRejection("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a");
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 4 | 1);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
+
+},{"./util.js":38}],30:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL) {
+var async = _dereq_("./async.js");
+var util = _dereq_("./util.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+function ReductionPromiseArray(promises, fn, accum, _each) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ this._preservedValues = _each === INTERNAL ? [] : null;
+ this._zerothIsAccum = (accum === undefined);
+ this._gotAccum = false;
+ this._reducingIndex = (this._zerothIsAccum ? 1 : 0);
+ this._valuesPhase = undefined;
+ var maybePromise = tryConvertToPromise(accum, this._promise);
+ var rejected = false;
+ var isPromise = maybePromise instanceof Promise;
+ if (isPromise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ maybePromise._proxyPromiseArray(this, -1);
+ } else if (maybePromise._isFulfilled()) {
+ accum = maybePromise._value();
+ this._gotAccum = true;
+ } else {
+ this._reject(maybePromise._reason());
+ rejected = true;
+ }
+ }
+ if (!(isPromise || this._zerothIsAccum)) this._gotAccum = true;
+ this._callback = fn;
+ this._accum = accum;
+ if (!rejected) async.invoke(init, this, undefined);
+}
+function init() {
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._init = function () {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function () {
+ if (this._gotAccum || this._zerothIsAccum) {
+ this._resolve(this._preservedValues !== null
+ ? [] : this._accum);
+ }
+};
+
+ReductionPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ values[index] = value;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var isEach = preservedValues !== null;
+ var gotAccum = this._gotAccum;
+ var valuesPhase = this._valuesPhase;
+ var valuesPhaseIndex;
+ if (!valuesPhase) {
+ valuesPhase = this._valuesPhase = new Array(length);
+ for (valuesPhaseIndex=0; valuesPhaseIndex<length; ++valuesPhaseIndex) {
+ valuesPhase[valuesPhaseIndex] = 0;
+ }
+ }
+ valuesPhaseIndex = valuesPhase[index];
+
+ if (index === 0 && this._zerothIsAccum) {
+ this._accum = value;
+ this._gotAccum = gotAccum = true;
+ valuesPhase[index] = ((valuesPhaseIndex === 0)
+ ? 1 : 2);
+ } else if (index === -1) {
+ this._accum = value;
+ this._gotAccum = gotAccum = true;
+ } else {
+ if (valuesPhaseIndex === 0) {
+ valuesPhase[index] = 1;
+ } else {
+ valuesPhase[index] = 2;
+ this._accum = value;
+ }
+ }
+ if (!gotAccum) return;
+
+ var callback = this._callback;
+ var receiver = this._promise._boundTo;
+ var ret;
+
+ for (var i = this._reducingIndex; i < length; ++i) {
+ valuesPhaseIndex = valuesPhase[i];
+ if (valuesPhaseIndex === 2) {
+ this._reducingIndex = i + 1;
+ continue;
+ }
+ if (valuesPhaseIndex !== 1) return;
+ value = values[i];
+ this._promise._pushContext();
+ if (isEach) {
+ preservedValues.push(value);
+ ret = tryCatch(callback).call(receiver, value, i, length);
+ }
+ else {
+ ret = tryCatch(callback)
+ .call(receiver, this._accum, value, i, length);
+ }
+ this._promise._popContext();
+
+ if (ret === errorObj) return this._reject(ret.e);
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ valuesPhase[i] = 4;
+ return maybePromise._proxyPromiseArray(this, i);
+ } else if (maybePromise._isFulfilled()) {
+ ret = maybePromise._value();
+ } else {
+ return this._reject(maybePromise._reason());
+ }
+ }
+
+ this._reducingIndex = i + 1;
+ this._accum = ret;
+ }
+
+ this._resolve(isEach ? preservedValues : this._accum);
+};
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+};
+
+},{"./async.js":2,"./util.js":38}],31:[function(_dereq_,module,exports){
+"use strict";
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/m3OTXk\u000a");
+};
+if (_dereq_("./util.js").isNode) {
+ var version = process.versions.node.split(".").map(Number);
+ schedule = (version[0] === 0 && version[1] > 10) || (version[0] > 0)
+ ? global.setImmediate : process.nextTick;
+
+ if (!schedule) {
+ if (typeof setImmediate !== "undefined") {
+ schedule = setImmediate;
+ } else if (typeof setTimeout !== "undefined") {
+ schedule = setTimeout;
+ } else {
+ schedule = noAsyncScheduler;
+ }
+ }
+} else if (typeof MutationObserver !== "undefined") {
+ schedule = function(fn) {
+ var div = document.createElement("div");
+ var observer = new MutationObserver(fn);
+ observer.observe(div, {attributes: true});
+ return function() { div.classList.toggle("foo"); };
+ };
+ schedule.isStatic = true;
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
+
+},{"./util.js":38}],32:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+ function(Promise, PromiseArray) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = _dereq_("./util.js");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ }
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 268435456;
+ ret._settledValue = value;
+ this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 134217728;
+ ret._settledValue = reason;
+ this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return new SettledPromiseArray(this).promise();
+};
+};
+
+},{"./util.js":38}],33:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = _dereq_("./util.js");
+var RangeError = _dereq_("./errors.js").RangeError;
+var AggregateError = _dereq_("./errors.js").AggregateError;
+var isArray = util.isArray;
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ }
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ e.push(this._values[i]);
+ }
+ this._reject(e);
+ }
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/1wAmHx\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
+
+},{"./errors.js":13,"./util.js":38}],34:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValue = promise._settledValue;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValue = undefined;
+ }
+}
+
+PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/hc1DLj\u000a");
+ }
+ return this._settledValue;
+};
+
+PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/hPuiwB\u000a");
+ }
+ return this._settledValue;
+};
+
+PromiseInspection.prototype.isFulfilled =
+Promise.prototype._isFulfilled = function () {
+ return (this._bitField & 268435456) > 0;
+};
+
+PromiseInspection.prototype.isRejected =
+Promise.prototype._isRejected = function () {
+ return (this._bitField & 134217728) > 0;
+};
+
+PromiseInspection.prototype.isPending =
+Promise.prototype._isPending = function () {
+ return (this._bitField & 402653184) === 0;
+};
+
+PromiseInspection.prototype.isResolved =
+Promise.prototype._isResolved = function () {
+ return (this._bitField & 402653184) > 0;
+};
+
+Promise.prototype.isPending = function() {
+ return this._target()._isPending();
+};
+
+Promise.prototype.isRejected = function() {
+ return this._target()._isRejected();
+};
+
+Promise.prototype.isFulfilled = function() {
+ return this._target()._isFulfilled();
+};
+
+Promise.prototype.isResolved = function() {
+ return this._target()._isResolved();
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue;
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue;
+};
+
+Promise.prototype.value = function() {
+ var target = this._target();
+ if (!target.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/hc1DLj\u000a");
+ }
+ return target._settledValue;
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ if (!target.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/hPuiwB\u000a");
+ }
+ target._unsetRejectionIsUnhandled();
+ return target._settledValue;
+};
+
+
+Promise.PromiseInspection = PromiseInspection;
+};
+
+},{}],35:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util.js");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) {
+ return obj;
+ }
+ else if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfillUnchecked,
+ ret._rejectUncheckedCheckError,
+ ret._progressUnchecked,
+ ret,
+ null
+ );
+ return ret;
+ }
+ var then = util.tryCatch(getThen)(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function getThen(obj) {
+ return obj.then;
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ return hasProp.call(obj, "_promise0");
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x,
+ resolveFromThenable,
+ rejectFromThenable,
+ progressFromThenable);
+ synchronous = false;
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolveFromThenable(value) {
+ if (!promise) return;
+ if (x === value) {
+ promise._rejectCallback(
+ Promise._makeSelfResolutionError(), false, true);
+ } else {
+ promise._resolveCallback(value);
+ }
+ promise = null;
+ }
+
+ function rejectFromThenable(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+
+ function progressFromThenable(value) {
+ if (!promise) return;
+ if (typeof promise._progress === "function") {
+ promise._progress(value);
+ }
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
+
+},{"./util.js":38}],36:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util.js");
+var TimeoutError = Promise.TimeoutError;
+
+var afterTimeout = function (promise, message) {
+ if (!promise.isPending()) return;
+ if (typeof message !== "string") {
+ message = "operation timed out";
+ }
+ var err = new TimeoutError(message);
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._cancel(err);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (value, ms) {
+ if (ms === undefined) {
+ ms = value;
+ value = undefined;
+ var ret = new Promise(INTERNAL);
+ setTimeout(function() { ret._fulfill(); }, ms);
+ return ret;
+ }
+ ms = +ms;
+ return Promise.resolve(value)._then(afterValue, null, null, ms, undefined);
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(this, ms);
+};
+
+function successClear(value) {
+ var handle = this;
+ if (handle instanceof Number) handle = +handle;
+ clearTimeout(handle);
+ return value;
+}
+
+function failureClear(reason) {
+ var handle = this;
+ if (handle instanceof Number) handle = +handle;
+ clearTimeout(handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret = this.then().cancellable();
+ ret._cancellationParent = this;
+ var handle = setTimeout(function timeoutTimeout() {
+ afterTimeout(ret, message);
+ }, ms);
+ return ret._then(successClear, failureClear, undefined, handle, undefined);
+};
+
+};
+
+},{"./util.js":38}],37:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext) {
+ var TypeError = _dereq_("./errors.js").TypeError;
+ var inherits = _dereq_("./util.js").inherits;
+ var PromiseInspection = Promise.PromiseInspection;
+
+ function inspectionMapper(inspections) {
+ var len = inspections.length;
+ for (var i = 0; i < len; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ return Promise.reject(inspection.error());
+ }
+ inspections[i] = inspection._settledValue;
+ }
+ return inspections;
+ }
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = Promise.defer();
+ function iterator() {
+ if (i >= len) return ret.resolve();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret.promise;
+ }
+
+ function disposerSuccess(value) {
+ var inspection = new PromiseInspection();
+ inspection._settledValue = value;
+ inspection._bitField = 268435456;
+ return dispose(this, inspection).thenReturn(value);
+ }
+
+ function disposerFail(reason) {
+ var inspection = new PromiseInspection();
+ inspection._settledValue = reason;
+ inspection._bitField = 134217728;
+ return dispose(this, inspection).thenThrow(reason);
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return null;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== null
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ len--;
+ var resources = new Array(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = arguments[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var promise = Promise.settle(resources)
+ .then(inspectionMapper)
+ .then(function(vals) {
+ promise._pushContext();
+ var ret;
+ try {
+ ret = fn.apply(undefined, vals);
+ } finally {
+ promise._popContext();
+ }
+ return ret;
+ })
+ ._then(
+ disposerSuccess, disposerFail, undefined, resources, undefined);
+ resources.promise = promise;
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 262144;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 262144) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~262144);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
+
+},{"./errors.js":13,"./util.js":38}],38:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5.js");
+var canEvaluate = typeof navigator == "undefined";
+var haveGetters = (function(){
+ try {
+ var o = {};
+ es5.defineProperty(o, "f", {
+ get: function () {
+ return 3;
+ }
+ });
+ return o.f === 3;
+ }
+ catch (e) {
+ return false;
+ }
+
+})();
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+function tryCatcher() {
+ try {
+ return tryCatchTarget.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return !isPrimitive(value);
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+
+var wrapsPrimitiveReceiver = (function() {
+ return this !== "string";
+}).call("string");
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ if (es5.isES5) {
+ var oProto = Object.prototype;
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && obj !== oProto) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ return function(obj) {
+ var ret = [];
+ /*jshint forin:false */
+ for (var key in obj) {
+ ret.push(key);
+ }
+ return ret;
+ };
+ }
+
+})();
+
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+ if (es5.isES5) return keys.length > 1;
+ return keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027*/
+ function f() {}
+ f.prototype = obj;
+ return f;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return obj instanceof Error && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ }
+ }
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ haveGetters: haveGetters,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ wrapsPrimitiveReceiver: wrapsPrimitiveReceiver,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ isNode: typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]"
+};
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
+
+},{"./es5.js":14}]},{},[4])(4)
+}); ;if (typeof window !== 'undefined' && window !== null) { window.P = window.Promise; } else if (typeof self !== 'undefined' && self !== null) { self.P = self.Promise; } \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.min.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.min.js
new file mode 100644
index 0000000000..2f5231bfa4
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/browser/bluebird.min.js
@@ -0,0 +1,31 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2014 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:</p>
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 2.9.15
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, cancel, using, filter, any, each, timers
+*/
+!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;"undefined"!=typeof window?e=window:"undefined"!=typeof global?e=global:"undefined"!=typeof self&&(e=self),e.Promise=t()}}(function(){var t,e,r;return function n(t,e,r){function i(s,a){if(!e[s]){if(!t[s]){var u="function"==typeof _dereq_&&_dereq_;if(!a&&u)return u(s,!0);if(o)return o(s,!0);var c=new Error("Cannot find module '"+s+"'");throw c.code="MODULE_NOT_FOUND",c}var l=e[s]={exports:{}};t[s][0].call(l.exports,function(e){var r=t[s][1][e];return i(r?r:e)},l,l.exports,n,t,e,r)}return e[s].exports}for(var o="function"==typeof _dereq_&&_dereq_,s=0;s<r.length;s++)i(r[s]);return i}({1:[function(t,e){"use strict";e.exports=function(t){function e(t){var e=new r(t),n=e.promise();return e.setHowMany(1),e.setUnwrap(),e.init(),n}var r=t._SomePromiseArray;t.any=function(t){return e(t)},t.prototype.any=function(){return e(this)}}},{}],2:[function(t,e){"use strict";function r(){this._isTickUsed=!1,this._lateQueue=new s(16),this._normalQueue=new s(16);var t=this;this.drainQueues=function(){t._drainQueues()},this._schedule=o.isStatic?o(this.drainQueues):o}var n;try{throw new Error}catch(i){n=i}var o=t("./schedule.js"),s=t("./queue.js"),a="undefined"!=typeof process?process:void 0;r.prototype.haveItemsQueued=function(){return this._normalQueue.length()>0},r.prototype._withDomain=function(t){return void 0===a||null==a.domain||t.domain||(t=a.domain.bind(t)),t},r.prototype.throwLater=function(t,e){if(1===arguments.length&&(e=t,t=function(){throw e}),t=this._withDomain(t),"undefined"!=typeof setTimeout)setTimeout(function(){t(e)},0);else try{this._schedule(function(){t(e)})}catch(r){throw new Error("No async scheduler available\n\n See http://goo.gl/m3OTXk\n")}},r.prototype.invokeLater=function(t,e,r){t=this._withDomain(t),this._lateQueue.push(t,e,r),this._queueTick()},r.prototype.invokeFirst=function(t,e,r){t=this._withDomain(t),this._normalQueue.unshift(t,e,r),this._queueTick()},r.prototype.invoke=function(t,e,r){t=this._withDomain(t),this._normalQueue.push(t,e,r),this._queueTick()},r.prototype.settlePromises=function(t){this._normalQueue._pushOne(t),this._queueTick()},r.prototype._drainQueue=function(t){for(;t.length()>0;){var e=t.shift();if("function"==typeof e){var r=t.shift(),n=t.shift();e.call(r,n)}else e._settlePromises()}},r.prototype._drainQueues=function(){this._drainQueue(this._normalQueue),this._reset(),this._drainQueue(this._lateQueue)},r.prototype._queueTick=function(){this._isTickUsed||(this._isTickUsed=!0,this._schedule(this.drainQueues))},r.prototype._reset=function(){this._isTickUsed=!1},e.exports=new r,e.exports.firstLineError=n},{"./queue.js":28,"./schedule.js":31}],3:[function(t,e){"use strict";e.exports=function(t,e,r){var n=function(t,e){this._reject(e)},i=function(t,e){e.promiseRejectionQueued=!0,e.bindingPromise._then(n,n,null,this,t)},o=function(t,e){this._setBoundTo(t),this._isPending()&&this._resolveCallback(e.target)},s=function(t,e){e.promiseRejectionQueued||this._reject(t)};t.prototype.bind=function(n){var a=r(n),u=new t(e);u._propagateFrom(this,1);var c=this._target();if(a instanceof t){var l={promiseRejectionQueued:!1,promise:u,target:c,bindingPromise:a};c._then(e,i,u._progress,u,l),a._then(o,s,u._progress,u,l)}else u._setBoundTo(n),u._resolveCallback(c);return u},t.prototype._setBoundTo=function(t){void 0!==t?(this._bitField=131072|this._bitField,this._boundTo=t):this._bitField=-131073&this._bitField},t.prototype._isBound=function(){return 131072===(131072&this._bitField)},t.bind=function(n,i){var o=r(n),s=new t(e);return o instanceof t?o._then(function(t){s._setBoundTo(t),s._resolveCallback(i)},s._reject,s._progress,s,null):(s._setBoundTo(n),s._resolveCallback(i)),s}}},{}],4:[function(t,e){"use strict";function r(){try{Promise===i&&(Promise=n)}catch(t){}return i}var n;"undefined"!=typeof Promise&&(n=Promise);var i=t("./promise.js")();i.noConflict=r,e.exports=i},{"./promise.js":23}],5:[function(t,e){"use strict";var r=Object.create;if(r){var n=r(null),i=r(null);n[" size"]=i[" size"]=0}e.exports=function(e){function r(t,r){var n;if(null!=t&&(n=t[r]),"function"!=typeof n){var i="Object "+a.classString(t)+" has no method '"+a.toString(r)+"'";throw new e.TypeError(i)}return n}function n(t){var e=this.pop(),n=r(t,e);return n.apply(t,this)}function i(t){return t[this]}function o(t){var e=+this;return 0>e&&(e=Math.max(0,e+t.length)),t[e]}{var s,a=t("./util.js"),u=a.canEvaluate;a.isIdentifier}e.prototype.call=function(t){for(var e=arguments.length,r=new Array(e-1),i=1;e>i;++i)r[i-1]=arguments[i];return r.push(t),this._then(n,void 0,void 0,r,void 0)},e.prototype.get=function(t){var e,r="number"==typeof t;if(r)e=o;else if(u){var n=s(t);e=null!==n?n:i}else e=i;return this._then(e,void 0,void 0,t,void 0)}}},{"./util.js":38}],6:[function(t,e){"use strict";e.exports=function(e){var r=t("./errors.js"),n=t("./async.js"),i=r.CancellationError;e.prototype._cancel=function(t){if(!this.isCancellable())return this;for(var e,r=this;void 0!==(e=r._cancellationParent)&&e.isCancellable();)r=e;this._unsetCancellable(),r._target()._rejectCallback(t,!1,!0)},e.prototype.cancel=function(t){return this.isCancellable()?(void 0===t&&(t=new i),n.invokeLater(this._cancel,this,t),this):this},e.prototype.cancellable=function(){return this._cancellable()?this:(this._setCancellable(),this._cancellationParent=void 0,this)},e.prototype.uncancellable=function(){var t=this.then();return t._unsetCancellable(),t},e.prototype.fork=function(t,e,r){var n=this._then(t,e,r,void 0,void 0);return n._setCancellable(),n._cancellationParent=void 0,n}}},{"./async.js":2,"./errors.js":13}],7:[function(t,e){"use strict";e.exports=function(){function e(t){this._parent=t;var r=this._length=1+(void 0===t?0:t._length);j(this,e),r>32&&this.uncycle()}function r(t,e){for(var r=0;r<e.length-1;++r)e[r].push("From previous event:"),e[r]=e[r].join("\n");return r<e.length&&(e[r]=e[r].join("\n")),t+"\n"+e.join("\n")}function n(t){for(var e=0;e<t.length;++e)(0===t[e].length||e+1<t.length&&t[e][0]===t[e+1][0])&&(t.splice(e,1),e--)}function i(t){for(var e=t[0],r=1;r<t.length;++r){for(var n=t[r],i=e.length-1,o=e[i],s=-1,a=n.length-1;a>=0;--a)if(n[a]===o){s=a;break}for(var a=s;a>=0;--a){var u=n[a];if(e[i]!==u)break;e.pop(),i--}e=n}}function o(t){for(var e=[],r=0;r<t.length;++r){var n=t[r],i=_.test(n)||" (No stack trace)"===n,o=i&&y(n);i&&!o&&(v&&" "!==n.charAt(0)&&(n=" "+n),e.push(n))}return e}function s(t){for(var e=t.stack.replace(/\s+$/g,"").split("\n"),r=0;r<e.length;++r){var n=e[r];if(" (No stack trace)"===n||_.test(n))break}return r>0&&(e=e.slice(r)),e}function a(t){var e;if("function"==typeof t)e="[function "+(t.name||"anonymous")+"]";else{e=t.toString();var r=/\[object [a-zA-Z0-9$_]+\]/;if(r.test(e))try{var n=JSON.stringify(t);e=n}catch(i){}0===e.length&&(e="(empty array)")}return"(<"+u(e)+">, no stack trace)"}function u(t){var e=41;return t.length<e?t:t.substr(0,e-3)+"..."}function c(t){var e=t.match(g);return e?{fileName:e[1],line:parseInt(e[2],10)}:void 0}var l,h=t("./async.js"),p=t("./util.js"),f=/[\\\/]bluebird[\\\/]js[\\\/](main|debug|zalgo|instrumented)/,_=null,d=null,v=!1;p.inherits(e,Error),e.prototype.uncycle=function(){var t=this._length;if(!(2>t)){for(var e=[],r={},n=0,i=this;void 0!==i;++n)e.push(i),i=i._parent;t=this._length=n;for(var n=t-1;n>=0;--n){var o=e[n].stack;void 0===r[o]&&(r[o]=n)}for(var n=0;t>n;++n){var s=e[n].stack,a=r[s];if(void 0!==a&&a!==n){a>0&&(e[a-1]._parent=void 0,e[a-1]._length=1),e[n]._parent=void 0,e[n]._length=1;var u=n>0?e[n-1]:this;t-1>a?(u._parent=e[a+1],u._parent.uncycle(),u._length=u._parent._length+1):(u._parent=void 0,u._length=1);for(var c=u._length+1,l=n-2;l>=0;--l)e[l]._length=c,c++;return}}}},e.prototype.parent=function(){return this._parent},e.prototype.hasParent=function(){return void 0!==this._parent},e.prototype.attachExtraTrace=function(t){if(!t.__stackCleaned__){this.uncycle();for(var s=e.parseStackAndMessage(t),a=s.message,u=[s.stack],c=this;void 0!==c;)u.push(o(c.stack.split("\n"))),c=c._parent;i(u),n(u),t.stack=r(a,u),p.notEnumerableProp(t,"__stackCleaned__",!0)}},e.parseStackAndMessage=function(t){var e=t.stack,r=t.toString();return e="string"==typeof e&&e.length>0?s(t):[" (No stack trace)"],{message:r,stack:o(e)}},e.formatAndLogError=function(t,e){if("undefined"!=typeof console){var r;if("object"==typeof t||"function"==typeof t){var n=t.stack;r=e+d(n,t)}else r=e+String(t);"function"==typeof l?l(r):("function"==typeof console.log||"object"==typeof console.log)&&console.log(r)}},e.unhandledRejection=function(t){e.formatAndLogError(t,"^--- With additional stack trace: ")},e.isSupported=function(){return"function"==typeof j},e.fireRejectionEvent=function(t,r,n,i){var o=!1;try{"function"==typeof r&&(o=!0,"rejectionHandled"===t?r(i):r(n,i))}catch(s){h.throwLater(s)}var a=!1;try{a=b(t,n,i)}catch(s){a=!0,h.throwLater(s)}var u=!1;if(m)try{u=m(t.toLowerCase(),{reason:n,promise:i})}catch(s){u=!0,h.throwLater(s)}a||o||u||"unhandledRejection"!==t||e.formatAndLogError(n,"Unhandled rejection ")};var y=function(){return!1},g=/[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;e.setBounds=function(t,r){if(e.isSupported()){for(var n,i,o=t.stack.split("\n"),s=r.stack.split("\n"),a=-1,u=-1,l=0;l<o.length;++l){var h=c(o[l]);if(h){n=h.fileName,a=h.line;break}}for(var l=0;l<s.length;++l){var h=c(s[l]);if(h){i=h.fileName,u=h.line;break}}0>a||0>u||!n||!i||n!==i||a>=u||(y=function(t){if(f.test(t))return!0;var e=c(t);return e&&e.fileName===n&&a<=e.line&&e.line<=u?!0:!1})}};var m,j=function(){var t=/^\s*at\s*/,e=function(t,e){return"string"==typeof t?t:void 0!==e.name&&void 0!==e.message?e.toString():a(e)};if("number"==typeof Error.stackTraceLimit&&"function"==typeof Error.captureStackTrace){Error.stackTraceLimit=Error.stackTraceLimit+6,_=t,d=e;var r=Error.captureStackTrace;return y=function(t){return f.test(t)},function(t,e){Error.stackTraceLimit=Error.stackTraceLimit+6,r(t,e),Error.stackTraceLimit=Error.stackTraceLimit-6}}var n=new Error;if("string"==typeof n.stack&&n.stack.split("\n")[0].indexOf("stackDetection@")>=0)return _=/@/,d=e,v=!0,function(t){t.stack=(new Error).stack};var i;try{throw new Error}catch(o){i="stack"in o}return"stack"in n||!i?(d=function(t,e){return"string"==typeof t?t:"object"!=typeof e&&"function"!=typeof e||void 0===e.name||void 0===e.message?a(e):e.toString()},null):(_=t,d=e,function(t){Error.stackTraceLimit=Error.stackTraceLimit+6;try{throw new Error}catch(e){t.stack=e.stack}Error.stackTraceLimit=Error.stackTraceLimit-6})}([]),b=function(){if(p.isNode)return function(t,e,r){return"rejectionHandled"===t?process.emit(t,r):process.emit(t,e,r)};var t=!1,e=!0;try{var r=new self.CustomEvent("test");t=r instanceof CustomEvent}catch(n){}if(!t)try{var i=document.createEvent("CustomEvent");i.initCustomEvent("testingtheevent",!1,!0,{}),self.dispatchEvent(i)}catch(n){e=!1}e&&(m=function(e,r){var n;return t?n=new self.CustomEvent(e,{detail:r,bubbles:!1,cancelable:!0}):self.dispatchEvent&&(n=document.createEvent("CustomEvent"),n.initCustomEvent(e,!1,!0,r)),n?!self.dispatchEvent(n):!1});var o={};return o.unhandledRejection="onunhandledRejection".toLowerCase(),o.rejectionHandled="onrejectionHandled".toLowerCase(),function(t,e,r){var n=o[t],i=self[n];return i?("rejectionHandled"===t?i.call(self,r):i.call(self,e,r),!0):!1}}();return"undefined"!=typeof console&&"undefined"!=typeof console.warn&&(l=function(t){console.warn(t)},p.isNode&&process.stderr.isTTY?l=function(t){process.stderr.write(""+t+"\n")}:p.isNode||"string"!=typeof(new Error).stack||(l=function(t){console.warn("%c"+t,"color: red")})),e}},{"./async.js":2,"./util.js":38}],8:[function(t,e){"use strict";e.exports=function(e){function r(t,e,r){this._instances=t,this._callback=e,this._promise=r}function n(t,e){var r={},n=s(t).call(r,e);if(n===a)return n;var i=u(r);return i.length?(a.e=new c("Catch filter must inherit from Error or be a simple predicate function\n\n See http://goo.gl/o84o68\n"),a):n}var i=t("./util.js"),o=t("./errors.js"),s=i.tryCatch,a=i.errorObj,u=t("./es5.js").keys,c=o.TypeError;return r.prototype.doFilter=function(t){for(var r=this._callback,i=this._promise,o=i._boundTo,u=0,c=this._instances.length;c>u;++u){var l=this._instances[u],h=l===Error||null!=l&&l.prototype instanceof Error;if(h&&t instanceof l){var p=s(r).call(o,t);return p===a?(e.e=p.e,e):p}if("function"==typeof l&&!h){var f=n(l,t);if(f===a){t=a.e;break}if(f){var p=s(r).call(o,t);return p===a?(e.e=p.e,e):p}}}return e.e=t,e},r}},{"./errors.js":13,"./es5.js":14,"./util.js":38}],9:[function(t,e){"use strict";e.exports=function(t,e,r){function n(){this._trace=new e(o())}function i(){return r()?new n:void 0}function o(){var t=s.length-1;return t>=0?s[t]:void 0}var s=[];return n.prototype._pushContext=function(){r()&&void 0!==this._trace&&s.push(this._trace)},n.prototype._popContext=function(){r()&&void 0!==this._trace&&s.pop()},t.prototype._peekContext=o,t.prototype._pushContext=n.prototype._pushContext,t.prototype._popContext=n.prototype._popContext,i}},{}],10:[function(t,e){"use strict";e.exports=function(e,r){var n,i,o=t("./async.js"),s=t("./errors.js").Warning,a=t("./util.js"),u=a.canAttachTrace,c=!1||a.isNode&&(!!process.env.BLUEBIRD_DEBUG||"development"===process.env.NODE_ENV);return e.prototype._ensurePossibleRejectionHandled=function(){this._setRejectionIsUnhandled(),o.invokeLater(this._notifyUnhandledRejection,this,void 0)},e.prototype._notifyUnhandledRejectionIsHandled=function(){r.fireRejectionEvent("rejectionHandled",n,void 0,this)},e.prototype._notifyUnhandledRejection=function(){if(this._isRejectionUnhandled()){var t=this._getCarriedStackTrace()||this._settledValue;this._setUnhandledRejectionIsNotified(),r.fireRejectionEvent("unhandledRejection",i,t,this)}},e.prototype._setUnhandledRejectionIsNotified=function(){this._bitField=524288|this._bitField},e.prototype._unsetUnhandledRejectionIsNotified=function(){this._bitField=-524289&this._bitField},e.prototype._isUnhandledRejectionNotified=function(){return(524288&this._bitField)>0},e.prototype._setRejectionIsUnhandled=function(){this._bitField=2097152|this._bitField},e.prototype._unsetRejectionIsUnhandled=function(){this._bitField=-2097153&this._bitField,this._isUnhandledRejectionNotified()&&(this._unsetUnhandledRejectionIsNotified(),this._notifyUnhandledRejectionIsHandled())},e.prototype._isRejectionUnhandled=function(){return(2097152&this._bitField)>0},e.prototype._setCarriedStackTrace=function(t){this._bitField=1048576|this._bitField,this._fulfillmentHandler0=t},e.prototype._isCarryingStackTrace=function(){return(1048576&this._bitField)>0},e.prototype._getCarriedStackTrace=function(){return this._isCarryingStackTrace()?this._fulfillmentHandler0:void 0},e.prototype._captureStackTrace=function(){return c&&(this._trace=new r(this._peekContext())),this},e.prototype._attachExtraTrace=function(t,e){if(c&&u(t)){var n=this._trace;if(void 0!==n&&e&&(n=n._parent),void 0!==n)n.attachExtraTrace(t);else if(!t.__stackCleaned__){var i=r.parseStackAndMessage(t);t.stack=i.message+"\n"+i.stack.join("\n"),a.notEnumerableProp(t,"__stackCleaned__",!0)}}},e.prototype._warn=function(t){var e=new s(t),n=this._peekContext();if(n)n.attachExtraTrace(e);else{var i=r.parseStackAndMessage(e);e.stack=i.message+"\n"+i.stack.join("\n")}r.formatAndLogError(e,"")},e.onPossiblyUnhandledRejection=function(t){i="function"==typeof t?t:void 0},e.onUnhandledRejectionHandled=function(t){n="function"==typeof t?t:void 0},e.longStackTraces=function(){if(o.haveItemsQueued()&&c===!1)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/DT1qyG\n");c=r.isSupported()},e.hasLongStackTraces=function(){return c&&r.isSupported()},r.isSupported()||(e.longStackTraces=function(){},c=!1),function(){return c}}},{"./async.js":2,"./errors.js":13,"./util.js":38}],11:[function(t,e){"use strict";var r=t("./util.js"),n=r.isPrimitive,i=r.wrapsPrimitiveReceiver;e.exports=function(t){var e=function(){return this},r=function(){throw this},o=function(t,e){return 1===e?function(){throw t}:2===e?function(){return t}:void 0};t.prototype["return"]=t.prototype.thenReturn=function(t){return i&&n(t)?this._then(o(t,2),void 0,void 0,void 0,void 0):this._then(e,void 0,void 0,t,void 0)},t.prototype["throw"]=t.prototype.thenThrow=function(t){return i&&n(t)?this._then(o(t,1),void 0,void 0,void 0,void 0):this._then(r,void 0,void 0,t,void 0)}}},{"./util.js":38}],12:[function(t,e){"use strict";e.exports=function(t,e){var r=t.reduce;t.prototype.each=function(t){return r(this,t,null,e)},t.each=function(t,n){return r(t,n,null,e)}}},{}],13:[function(t,e){"use strict";function r(t,e){function r(n){return this instanceof r?(l(this,"message","string"==typeof n?n:e),l(this,"name",t),void(Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):Error.call(this))):new r(n)}return c(r,Error),r}function n(t){return this instanceof n?(l(this,"name","OperationalError"),l(this,"message",t),this.cause=t,this.isOperational=!0,void(t instanceof Error?(l(this,"message",t.message),l(this,"stack",t.stack)):Error.captureStackTrace&&Error.captureStackTrace(this,this.constructor))):new n(t)}var i,o,s=t("./es5.js"),a=s.freeze,u=t("./util.js"),c=u.inherits,l=u.notEnumerableProp,h=r("Warning","warning"),p=r("CancellationError","cancellation error"),f=r("TimeoutError","timeout error"),_=r("AggregateError","aggregate error");try{i=TypeError,o=RangeError}catch(d){i=r("TypeError","type error"),o=r("RangeError","range error")}for(var v="join pop push shift unshift slice filter forEach some every map indexOf lastIndexOf reduce reduceRight sort reverse".split(" "),y=0;y<v.length;++y)"function"==typeof Array.prototype[v[y]]&&(_.prototype[v[y]]=Array.prototype[v[y]]);s.defineProperty(_.prototype,"length",{value:0,configurable:!1,writable:!0,enumerable:!0}),_.prototype.isOperational=!0;var g=0;_.prototype.toString=function(){var t=Array(4*g+1).join(" "),e="\n"+t+"AggregateError of:\n";g++,t=Array(4*g+1).join(" ");for(var r=0;r<this.length;++r){for(var n=this[r]===this?"[Circular AggregateError]":this[r]+"",i=n.split("\n"),o=0;o<i.length;++o)i[o]=t+i[o];n=i.join("\n"),e+=n+"\n"}return g--,e},c(n,Error);var m=Error.__BluebirdErrorTypes__;m||(m=a({CancellationError:p,TimeoutError:f,OperationalError:n,RejectionError:n,AggregateError:_}),l(Error,"__BluebirdErrorTypes__",m)),e.exports={Error:Error,TypeError:i,RangeError:o,CancellationError:m.CancellationError,OperationalError:m.OperationalError,TimeoutError:m.TimeoutError,AggregateError:m.AggregateError,Warning:h}},{"./es5.js":14,"./util.js":38}],14:[function(t,e){var r=function(){"use strict";return void 0===this}();if(r)e.exports={freeze:Object.freeze,defineProperty:Object.defineProperty,getDescriptor:Object.getOwnPropertyDescriptor,keys:Object.keys,names:Object.getOwnPropertyNames,getPrototypeOf:Object.getPrototypeOf,isArray:Array.isArray,isES5:r,propertyIsWritable:function(t,e){var r=Object.getOwnPropertyDescriptor(t,e);return!(r&&!r.writable&&!r.set)}};else{var n={}.hasOwnProperty,i={}.toString,o={}.constructor.prototype,s=function(t){var e=[];for(var r in t)n.call(t,r)&&e.push(r);return e},a=function(t,e){return{value:t[e]}},u=function(t,e,r){return t[e]=r.value,t},c=function(t){return t},l=function(t){try{return Object(t).constructor.prototype}catch(e){return o}},h=function(t){try{return"[object Array]"===i.call(t)}catch(e){return!1}};e.exports={isArray:h,keys:s,names:s,defineProperty:u,getDescriptor:a,freeze:c,getPrototypeOf:l,isES5:r,propertyIsWritable:function(){return!0}}}},{}],15:[function(t,e){"use strict";e.exports=function(t,e){var r=t.map;t.prototype.filter=function(t,n){return r(this,t,n,e)},t.filter=function(t,n,i){return r(t,n,i,e)}}},{}],16:[function(t,e){"use strict";e.exports=function(e,r,n){function i(){return this}function o(){throw this}function s(t){return function(){return t}}function a(t){return function(){throw t}}function u(t,e,r){var n;return n=p&&f(e)?r?s(e):a(e):r?i:o,t._then(n,_,void 0,e,void 0)}function c(t){var i=this.promise,o=this.handler,s=i._isBound()?o.call(i._boundTo):o();if(void 0!==s){var a=n(s,i);if(a instanceof e)return a=a._target(),u(a,t,i.isFulfilled())}return i.isRejected()?(r.e=t,r):t}function l(t){var r=this.promise,i=this.handler,o=r._isBound()?i.call(r._boundTo,t):i(t);if(void 0!==o){var s=n(o,r);if(s instanceof e)return s=s._target(),u(s,t,!0)}return t}var h=t("./util.js"),p=h.wrapsPrimitiveReceiver,f=h.isPrimitive,_=h.thrower;e.prototype._passThroughHandler=function(t,e){if("function"!=typeof t)return this.then();var r={promise:this,handler:t};return this._then(e?c:l,e?c:void 0,void 0,r,void 0)},e.prototype.lastly=e.prototype["finally"]=function(t){return this._passThroughHandler(t,!0)},e.prototype.tap=function(t){return this._passThroughHandler(t,!1)}}},{"./util.js":38}],17:[function(t,e){"use strict";e.exports=function(e,r,n,i){function o(t,r,n){for(var o=0;o<r.length;++o){n._pushContext();var s=h(r[o])(t);if(n._popContext(),s===l){n._pushContext();var a=e.reject(l.e);return n._popContext(),a}var u=i(s,n);if(u instanceof e)return u}return null}function s(t,r,i,o){var s=this._promise=new e(n);s._captureStackTrace(),this._stack=o,this._generatorFunction=t,this._receiver=r,this._generator=void 0,this._yieldHandlers="function"==typeof i?[i].concat(p):p}var a=t("./errors.js"),u=a.TypeError,c=t("./util.js"),l=c.errorObj,h=c.tryCatch,p=[];s.prototype.promise=function(){return this._promise},s.prototype._run=function(){this._generator=this._generatorFunction.call(this._receiver),this._receiver=this._generatorFunction=void 0,this._next(void 0)},s.prototype._continue=function(t){if(t===l)return this._promise._rejectCallback(t.e,!1,!0);var r=t.value;if(t.done===!0)this._promise._resolveCallback(r);else{var n=i(r,this._promise);if(!(n instanceof e)&&(n=o(n,this._yieldHandlers,this._promise),null===n))return void this._throw(new u("A value %s was yielded that could not be treated as a promise\n\n See http://goo.gl/4Y4pDk\n\n".replace("%s",r)+"From coroutine:\n"+this._stack.split("\n").slice(1,-7).join("\n")));n._then(this._next,this._throw,void 0,this,null)}},s.prototype._throw=function(t){this._promise._attachExtraTrace(t),this._promise._pushContext();var e=h(this._generator["throw"]).call(this._generator,t);this._promise._popContext(),this._continue(e)},s.prototype._next=function(t){this._promise._pushContext();var e=h(this._generator.next).call(this._generator,t);this._promise._popContext(),this._continue(e)},e.coroutine=function(t,e){if("function"!=typeof t)throw new u("generatorFunction must be a function\n\n See http://goo.gl/6Vqhm0\n");var r=Object(e).yieldHandler,n=s,i=(new Error).stack;return function(){var e=t.apply(this,arguments),o=new n(void 0,void 0,r,i);return o._generator=e,o._next(void 0),o.promise()}},e.coroutine.addYieldHandler=function(t){if("function"!=typeof t)throw new u("fn must be a function\n\n See http://goo.gl/916lJJ\n");p.push(t)},e.spawn=function(t){if("function"!=typeof t)return r("generatorFunction must be a function\n\n See http://goo.gl/6Vqhm0\n");var n=new s(t,this),i=n.promise();return n._run(e.spawn),i}}},{"./errors.js":13,"./util.js":38}],18:[function(t,e){"use strict";e.exports=function(e,r,n,i){{var o=t("./util.js");o.canEvaluate,o.tryCatch,o.errorObj}e.join=function(){var t,e=arguments.length-1;if(e>0&&"function"==typeof arguments[e]){t=arguments[e];var n}for(var i=arguments.length,o=new Array(i),s=0;i>s;++s)o[s]=arguments[s];t&&o.pop();var n=new r(o).promise();return void 0!==t?n.spread(t):n}}},{"./util.js":38}],19:[function(t,e){"use strict";e.exports=function(e,r,n,i,o){function s(t,e,r,n){this.constructor$(t),this._promise._captureStackTrace(),this._callback=e,this._preservedValues=n===o?new Array(this.length()):null,this._limit=r,this._inFlight=0,this._queue=r>=1?[]:_,c.invoke(a,this,void 0)}function a(){this._init$(void 0,-2)}function u(t,e,r,n){var i="object"==typeof r&&null!==r?r.concurrency:0;return i="number"==typeof i&&isFinite(i)&&i>=1?i:0,new s(t,e,i,n)}var c=t("./async.js"),l=t("./util.js"),h=l.tryCatch,p=l.errorObj,f={},_=[];l.inherits(s,r),s.prototype._init=function(){},s.prototype._promiseFulfilled=function(t,r){var n=this._values,o=this.length(),s=this._preservedValues,a=this._limit;if(n[r]===f){if(n[r]=t,a>=1&&(this._inFlight--,this._drainQueue(),this._isResolved()))return}else{if(a>=1&&this._inFlight>=a)return n[r]=t,void this._queue.push(r);null!==s&&(s[r]=t);var u=this._callback,c=this._promise._boundTo;this._promise._pushContext();var l=h(u).call(c,t,r,o);if(this._promise._popContext(),l===p)return this._reject(l.e);var _=i(l,this._promise);if(_ instanceof e){if(_=_._target(),_._isPending())return a>=1&&this._inFlight++,n[r]=f,_._proxyPromiseArray(this,r);if(!_._isFulfilled())return this._reject(_._reason());l=_._value()}n[r]=l}var d=++this._totalResolved;d>=o&&(null!==s?this._filter(n,s):this._resolve(n))},s.prototype._drainQueue=function(){for(var t=this._queue,e=this._limit,r=this._values;t.length>0&&this._inFlight<e;){if(this._isResolved())return;var n=t.pop();this._promiseFulfilled(r[n],n)}},s.prototype._filter=function(t,e){for(var r=e.length,n=new Array(r),i=0,o=0;r>o;++o)t[o]&&(n[i++]=e[o]);n.length=i,this._resolve(n)},s.prototype.preservedValues=function(){return this._preservedValues},e.prototype.map=function(t,e){return"function"!=typeof t?n("fn must be a function\n\n See http://goo.gl/916lJJ\n"):u(this,t,e,null).promise()},e.map=function(t,e,r,i){return"function"!=typeof e?n("fn must be a function\n\n See http://goo.gl/916lJJ\n"):u(t,e,r,i).promise()}}},{"./async.js":2,"./util.js":38}],20:[function(t,e){"use strict";e.exports=function(e,r,n,i){var o=t("./util.js"),s=o.tryCatch;e.method=function(t){if("function"!=typeof t)throw new e.TypeError("fn must be a function\n\n See http://goo.gl/916lJJ\n");return function(){var n=new e(r);n._captureStackTrace(),n._pushContext();var i=s(t).apply(this,arguments);return n._popContext(),n._resolveFromSyncValue(i),n}},e.attempt=e["try"]=function(t,n,a){if("function"!=typeof t)return i("fn must be a function\n\n See http://goo.gl/916lJJ\n");var u=new e(r);u._captureStackTrace(),u._pushContext();var c=o.isArray(n)?s(t).apply(a,n):s(t).call(a,n);return u._popContext(),u._resolveFromSyncValue(c),u},e.prototype._resolveFromSyncValue=function(t){t===o.errorObj?this._rejectCallback(t.e,!1,!0):this._resolveCallback(t,!0)}}},{"./util.js":38}],21:[function(t,e){"use strict";e.exports=function(e){function r(t,e){var r=this;if(!o.isArray(t))return n.call(r,t,e);var i=a(e).apply(r._boundTo,[null].concat(t));i===u&&s.throwLater(i.e)}function n(t,e){var r=this,n=r._boundTo,i=void 0===t?a(e).call(n,null):a(e).call(n,null,t);i===u&&s.throwLater(i.e)}function i(t,e){var r=this;if(!t){var n=r._target(),i=n._getCarriedStackTrace();i.cause=t,t=i}var o=a(e).call(r._boundTo,t);o===u&&s.throwLater(o.e)}var o=t("./util.js"),s=t("./async.js"),a=o.tryCatch,u=o.errorObj;e.prototype.asCallback=e.prototype.nodeify=function(t,e){if("function"==typeof t){var o=n;void 0!==e&&Object(e).spread&&(o=r),this._then(o,i,void 0,this,t)}return this}}},{"./async.js":2,"./util.js":38}],22:[function(t,e){"use strict";e.exports=function(e,r){var n=t("./util.js"),i=t("./async.js"),o=n.tryCatch,s=n.errorObj;e.prototype.progressed=function(t){return this._then(void 0,void 0,t,void 0,void 0)},e.prototype._progress=function(t){this._isFollowingOrFulfilledOrRejected()||this._target()._progressUnchecked(t)},e.prototype._progressHandlerAt=function(t){return 0===t?this._progressHandler0:this[(t<<2)+t-5+2]},e.prototype._doProgressWith=function(t){var r=t.value,i=t.handler,a=t.promise,u=t.receiver,c=o(i).call(u,r);if(c===s){if(null!=c.e&&"StopProgressPropagation"!==c.e.name){var l=n.canAttachTrace(c.e)?c.e:new Error(n.toString(c.e));a._attachExtraTrace(l),a._progress(c.e)}}else c instanceof e?c._then(a._progress,null,null,a,void 0):a._progress(c)},e.prototype._progressUnchecked=function(t){for(var n=this._length(),o=this._progress,s=0;n>s;s++){var a=this._progressHandlerAt(s),u=this._promiseAt(s);if(u instanceof e)"function"==typeof a?i.invoke(this._doProgressWith,this,{handler:a,promise:u,receiver:this._receiverAt(s),value:t}):i.invoke(o,u,t);else{var c=this._receiverAt(s);"function"==typeof a?a.call(c,t,u):c instanceof r&&!c._isResolved()&&c._promiseProgressed(t,u)}}}}},{"./async.js":2,"./util.js":38}],23:[function(t,e){"use strict";e.exports=function(){function e(t){if("function"!=typeof t)throw new c("the promise constructor requires a resolver function\n\n See http://goo.gl/EC22Yn\n");if(this.constructor!==e)throw new c("the promise constructor cannot be invoked directly\n\n See http://goo.gl/KsIlge\n");this._bitField=0,this._fulfillmentHandler0=void 0,this._rejectionHandler0=void 0,this._progressHandler0=void 0,this._promise0=void 0,this._receiver0=void 0,this._settledValue=void 0,t!==l&&this._resolveFromResolver(t)}function r(t){var r=new e(l);r._fulfillmentHandler0=t,r._rejectionHandler0=t,r._progressHandler0=t,r._promise0=t,r._receiver0=t,r._settledValue=t}var n=function(){return new c("circular promise resolution chain\n\n See http://goo.gl/LhFpo0\n")},i=function(){return new e.PromiseInspection(this._target())},o=function(t){return e.reject(new c(t))},s=t("./util.js"),a=t("./async.js"),u=t("./errors.js"),c=e.TypeError=u.TypeError;e.RangeError=u.RangeError,e.CancellationError=u.CancellationError,e.TimeoutError=u.TimeoutError,e.OperationalError=u.OperationalError,e.RejectionError=u.OperationalError,e.AggregateError=u.AggregateError;var l=function(){},h={},p={e:null},f=t("./thenables.js")(e,l),_=t("./promise_array.js")(e,l,f,o),d=t("./captured_trace.js")(),v=t("./debuggability.js")(e,d),y=t("./context.js")(e,d,v),g=t("./catch_filter.js")(p),m=t("./promise_resolver.js"),j=m._nodebackForPromise,b=s.errorObj,w=s.tryCatch;return e.prototype.toString=function(){return"[object Promise]"},e.prototype.caught=e.prototype["catch"]=function(t){var r=arguments.length;if(r>1){var n,i=new Array(r-1),o=0;for(n=0;r-1>n;++n){var s=arguments[n];if("function"!=typeof s)return e.reject(new c("Catch filter must inherit from Error or be a simple predicate function\n\n See http://goo.gl/o84o68\n"));i[o++]=s}i.length=o,t=arguments[n];var a=new g(i,t,this);return this._then(void 0,a.doFilter,void 0,a,void 0)}return this._then(void 0,t,void 0,void 0,void 0)},e.prototype.reflect=function(){return this._then(i,i,void 0,this,void 0)},e.prototype.then=function(t,e,r){if(v()&&arguments.length>0&&"function"!=typeof t&&"function"!=typeof e){var n=".then() only accepts functions but was passed: "+s.classString(t);arguments.length>1&&(n+=", "+s.classString(e)),this._warn(n)}return this._then(t,e,r,void 0,void 0)},e.prototype.done=function(t,e,r){var n=this._then(t,e,r,void 0,void 0);n._setIsFinal()},e.prototype.spread=function(t,e){return this.all()._then(t,e,void 0,h,void 0)},e.prototype.isCancellable=function(){return!this.isResolved()&&this._cancellable()},e.prototype.toJSON=function(){var t={isFulfilled:!1,isRejected:!1,fulfillmentValue:void 0,rejectionReason:void 0};return this.isFulfilled()?(t.fulfillmentValue=this.value(),t.isFulfilled=!0):this.isRejected()&&(t.rejectionReason=this.reason(),t.isRejected=!0),t},e.prototype.all=function(){return new _(this).promise()},e.prototype.error=function(t){return this.caught(s.originatesFromRejection,t)},e.is=function(t){return t instanceof e},e.fromNode=function(t){var r=new e(l),n=w(t)(j(r));return n===b&&r._rejectCallback(n.e,!0,!0),r},e.all=function(t){return new _(t).promise()},e.defer=e.pending=function(){var t=new e(l);return new m(t)},e.cast=function(t){var r=f(t);if(!(r instanceof e)){var n=r;r=new e(l),r._fulfillUnchecked(n)}return r},e.resolve=e.fulfilled=e.cast,e.reject=e.rejected=function(t){var r=new e(l);return r._captureStackTrace(),r._rejectCallback(t,!0),r},e.setScheduler=function(t){if("function"!=typeof t)throw new c("fn must be a function\n\n See http://goo.gl/916lJJ\n");
+var e=a._schedule;return a._schedule=t,e},e.prototype._then=function(t,r,n,i,o){var s=void 0!==o,u=s?o:new e(l);s||(u._propagateFrom(this,5),u._captureStackTrace());var c=this._target();c!==this&&(void 0===i&&(i=this._boundTo),s||u._setIsMigrated());var h=c._addCallbacks(t,r,n,u,i);return c._isResolved()&&!c._isSettlePromisesQueued()&&a.invoke(c._settlePromiseAtPostResolution,c,h),u},e.prototype._settlePromiseAtPostResolution=function(t){this._isRejectionUnhandled()&&this._unsetRejectionIsUnhandled(),this._settlePromiseAt(t)},e.prototype._length=function(){return 131071&this._bitField},e.prototype._isFollowingOrFulfilledOrRejected=function(){return(939524096&this._bitField)>0},e.prototype._isFollowing=function(){return 536870912===(536870912&this._bitField)},e.prototype._setLength=function(t){this._bitField=-131072&this._bitField|131071&t},e.prototype._setFulfilled=function(){this._bitField=268435456|this._bitField},e.prototype._setRejected=function(){this._bitField=134217728|this._bitField},e.prototype._setFollowing=function(){this._bitField=536870912|this._bitField},e.prototype._setIsFinal=function(){this._bitField=33554432|this._bitField},e.prototype._isFinal=function(){return(33554432&this._bitField)>0},e.prototype._cancellable=function(){return(67108864&this._bitField)>0},e.prototype._setCancellable=function(){this._bitField=67108864|this._bitField},e.prototype._unsetCancellable=function(){this._bitField=-67108865&this._bitField},e.prototype._setIsMigrated=function(){this._bitField=4194304|this._bitField},e.prototype._unsetIsMigrated=function(){this._bitField=-4194305&this._bitField},e.prototype._isMigrated=function(){return(4194304&this._bitField)>0},e.prototype._receiverAt=function(t){var e=0===t?this._receiver0:this[5*t-5+4];return void 0===e&&this._isBound()?this._boundTo:e},e.prototype._promiseAt=function(t){return 0===t?this._promise0:this[5*t-5+3]},e.prototype._fulfillmentHandlerAt=function(t){return 0===t?this._fulfillmentHandler0:this[5*t-5+0]},e.prototype._rejectionHandlerAt=function(t){return 0===t?this._rejectionHandler0:this[5*t-5+1]},e.prototype._migrateCallbacks=function(t,r){var n=t._fulfillmentHandlerAt(r),i=t._rejectionHandlerAt(r),o=t._progressHandlerAt(r),s=t._promiseAt(r),a=t._receiverAt(r);s instanceof e&&s._setIsMigrated(),this._addCallbacks(n,i,o,s,a)},e.prototype._addCallbacks=function(t,e,r,n,i){var o=this._length();if(o>=131066&&(o=0,this._setLength(0)),0===o)this._promise0=n,void 0!==i&&(this._receiver0=i),"function"!=typeof t||this._isCarryingStackTrace()||(this._fulfillmentHandler0=t),"function"==typeof e&&(this._rejectionHandler0=e),"function"==typeof r&&(this._progressHandler0=r);else{var s=5*o-5;this[s+3]=n,this[s+4]=i,"function"==typeof t&&(this[s+0]=t),"function"==typeof e&&(this[s+1]=e),"function"==typeof r&&(this[s+2]=r)}return this._setLength(o+1),o},e.prototype._setProxyHandlers=function(t,e){var r=this._length();if(r>=131066&&(r=0,this._setLength(0)),0===r)this._promise0=e,this._receiver0=t;else{var n=5*r-5;this[n+3]=e,this[n+4]=t}this._setLength(r+1)},e.prototype._proxyPromiseArray=function(t,e){this._setProxyHandlers(t,e)},e.prototype._resolveCallback=function(t,r){if(!this._isFollowingOrFulfilledOrRejected()){if(t===this)return this._rejectCallback(n(),!1,!0);var i=f(t,this);if(!(i instanceof e))return this._fulfill(t);var o=1|(r?4:0);this._propagateFrom(i,o);var s=i._target();if(s._isPending()){for(var a=this._length(),u=0;a>u;++u)s._migrateCallbacks(this,u);this._setFollowing(),this._setLength(0),this._setFollowee(s)}else s._isFulfilled()?this._fulfillUnchecked(s._value()):this._rejectUnchecked(s._reason(),s._getCarriedStackTrace())}},e.prototype._rejectCallback=function(t,e,r){r||s.markAsOriginatingFromRejection(t);var n=s.ensureErrorObject(t),i=n===t;this._attachExtraTrace(n,e?i:!1),this._reject(t,i?void 0:n)},e.prototype._resolveFromResolver=function(t){var e=this;this._captureStackTrace(),this._pushContext();var r=!0,n=w(t)(function(t){null!==e&&(e._resolveCallback(t),e=null)},function(t){null!==e&&(e._rejectCallback(t,r),e=null)});r=!1,this._popContext(),void 0!==n&&n===b&&null!==e&&(e._rejectCallback(n.e,!0,!0),e=null)},e.prototype._settlePromiseFromHandler=function(t,e,r,i){if(!i._isRejected()){i._pushContext();var o;if(o=e!==h||this._isRejected()?w(t).call(e,r):w(t).apply(this._boundTo,r),i._popContext(),o===b||o===i||o===p){var s=o===i?n():o.e;i._rejectCallback(s,!1,!0)}else i._resolveCallback(o)}},e.prototype._target=function(){for(var t=this;t._isFollowing();)t=t._followee();return t},e.prototype._followee=function(){return this._rejectionHandler0},e.prototype._setFollowee=function(t){this._rejectionHandler0=t},e.prototype._cleanValues=function(){this._cancellable()&&(this._cancellationParent=void 0)},e.prototype._propagateFrom=function(t,e){(1&e)>0&&t._cancellable()&&(this._setCancellable(),this._cancellationParent=t),(4&e)>0&&t._isBound()&&this._setBoundTo(t._boundTo)},e.prototype._fulfill=function(t){this._isFollowingOrFulfilledOrRejected()||this._fulfillUnchecked(t)},e.prototype._reject=function(t,e){this._isFollowingOrFulfilledOrRejected()||this._rejectUnchecked(t,e)},e.prototype._settlePromiseAt=function(t){var r=this._promiseAt(t),n=r instanceof e;if(n&&r._isMigrated())return r._unsetIsMigrated(),a.invoke(this._settlePromiseAt,this,t);var i=this._isFulfilled()?this._fulfillmentHandlerAt(t):this._rejectionHandlerAt(t),o=this._isCarryingStackTrace()?this._getCarriedStackTrace():void 0,s=this._settledValue,u=this._receiverAt(t);this._clearCallbackDataAtIndex(t),"function"==typeof i?n?this._settlePromiseFromHandler(i,u,s,r):i.call(u,s,r):u instanceof _?u._isResolved()||(this._isFulfilled()?u._promiseFulfilled(s,r):u._promiseRejected(s,r)):n&&(this._isFulfilled()?r._fulfill(s):r._reject(s,o)),t>=4&&4===(31&t)&&a.invokeLater(this._setLength,this,0)},e.prototype._clearCallbackDataAtIndex=function(t){if(0===t)this._isCarryingStackTrace()||(this._fulfillmentHandler0=void 0),this._rejectionHandler0=this._progressHandler0=this._receiver0=this._promise0=void 0;else{var e=5*t-5;this[e+3]=this[e+4]=this[e+0]=this[e+1]=this[e+2]=void 0}},e.prototype._isSettlePromisesQueued=function(){return-1073741824===(-1073741824&this._bitField)},e.prototype._setSettlePromisesQueued=function(){this._bitField=-1073741824|this._bitField},e.prototype._unsetSettlePromisesQueued=function(){this._bitField=1073741823&this._bitField},e.prototype._queueSettlePromises=function(){a.settlePromises(this),this._setSettlePromisesQueued()},e.prototype._fulfillUnchecked=function(t){if(t===this){var e=n();return this._attachExtraTrace(e),this._rejectUnchecked(e,void 0)}this._setFulfilled(),this._settledValue=t,this._cleanValues(),this._length()>0&&this._queueSettlePromises()},e.prototype._rejectUncheckedCheckError=function(t){var e=s.ensureErrorObject(t);this._rejectUnchecked(t,e===t?void 0:e)},e.prototype._rejectUnchecked=function(t,e){if(t===this){var r=n();return this._attachExtraTrace(r),this._rejectUnchecked(r)}return this._setRejected(),this._settledValue=t,this._cleanValues(),this._isFinal()?void a.throwLater(function(t){throw"stack"in t&&a.invokeFirst(d.unhandledRejection,void 0,t),t},void 0===e?t:e):(void 0!==e&&e!==t&&this._setCarriedStackTrace(e),void(this._length()>0?this._queueSettlePromises():this._ensurePossibleRejectionHandled()))},e.prototype._settlePromises=function(){this._unsetSettlePromisesQueued();for(var t=this._length(),e=0;t>e;e++)this._settlePromiseAt(e)},e._makeSelfResolutionError=n,t("./progress.js")(e,_),t("./method.js")(e,l,f,o),t("./bind.js")(e,l,f),t("./finally.js")(e,p,f),t("./direct_resolve.js")(e),t("./synchronous_inspection.js")(e),t("./join.js")(e,_,f,l),e.Promise=e,t("./map.js")(e,_,o,f,l),t("./cancel.js")(e),t("./using.js")(e,o,f,y),t("./generators.js")(e,o,l,f),t("./nodeify.js")(e),t("./call_get.js")(e),t("./props.js")(e,_,f,o),t("./race.js")(e,l,f,o),t("./reduce.js")(e,_,o,f,l),t("./settle.js")(e,_),t("./some.js")(e,_,o),t("./promisify.js")(e,l),t("./any.js")(e),t("./each.js")(e,l),t("./timers.js")(e,l),t("./filter.js")(e,l),s.toFastProperties(e),s.toFastProperties(e.prototype),r({a:1}),r({b:2}),r({c:3}),r(1),r(function(){}),r(void 0),r(!1),r(new e(l)),d.setBounds(a.firstLineError,s.lastLineError),e}},{"./any.js":1,"./async.js":2,"./bind.js":3,"./call_get.js":5,"./cancel.js":6,"./captured_trace.js":7,"./catch_filter.js":8,"./context.js":9,"./debuggability.js":10,"./direct_resolve.js":11,"./each.js":12,"./errors.js":13,"./filter.js":15,"./finally.js":16,"./generators.js":17,"./join.js":18,"./map.js":19,"./method.js":20,"./nodeify.js":21,"./progress.js":22,"./promise_array.js":24,"./promise_resolver.js":25,"./promisify.js":26,"./props.js":27,"./race.js":29,"./reduce.js":30,"./settle.js":32,"./some.js":33,"./synchronous_inspection.js":34,"./thenables.js":35,"./timers.js":36,"./using.js":37,"./util.js":38}],24:[function(t,e){"use strict";e.exports=function(e,r,n,i){function o(t){switch(t){case-2:return[];case-3:return{}}}function s(t){var n,i=this._promise=new e(r);t instanceof e&&(n=t,i._propagateFrom(n,5)),this._values=t,this._length=0,this._totalResolved=0,this._init(void 0,-2)}var a=t("./util.js"),u=a.isArray;return s.prototype.length=function(){return this._length},s.prototype.promise=function(){return this._promise},s.prototype._init=function c(t,r){var s=n(this._values,this._promise);if(s instanceof e){if(s=s._target(),this._values=s,!s._isFulfilled())return s._isPending()?void s._then(c,this._reject,void 0,this,r):void this._reject(s._reason());if(s=s._value(),!u(s)){var a=new e.TypeError("expecting an array, a promise or a thenable\n\n See http://goo.gl/s8MMhc\n");return void this.__hardReject__(a)}}else if(!u(s))return void this._promise._reject(i("expecting an array, a promise or a thenable\n\n See http://goo.gl/s8MMhc\n")._reason());if(0===s.length)return void(-5===r?this._resolveEmptyArray():this._resolve(o(r)));var l=this.getActualLength(s.length);this._length=l,this._values=this.shouldCopyValues()?new Array(l):this._values;for(var h=this._promise,p=0;l>p;++p){var f=this._isResolved(),_=n(s[p],h);_ instanceof e?(_=_._target(),f?_._unsetRejectionIsUnhandled():_._isPending()?_._proxyPromiseArray(this,p):_._isFulfilled()?this._promiseFulfilled(_._value(),p):this._promiseRejected(_._reason(),p)):f||this._promiseFulfilled(_,p)}},s.prototype._isResolved=function(){return null===this._values},s.prototype._resolve=function(t){this._values=null,this._promise._fulfill(t)},s.prototype.__hardReject__=s.prototype._reject=function(t){this._values=null,this._promise._rejectCallback(t,!1,!0)},s.prototype._promiseProgressed=function(t,e){this._promise._progress({index:e,value:t})},s.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var r=++this._totalResolved;r>=this._length&&this._resolve(this._values)},s.prototype._promiseRejected=function(t){this._totalResolved++,this._reject(t)},s.prototype.shouldCopyValues=function(){return!0},s.prototype.getActualLength=function(t){return t},s}},{"./util.js":38}],25:[function(t,e){"use strict";function r(t){return t instanceof Error&&p.getPrototypeOf(t)===Error.prototype}function n(t){var e;if(r(t)){e=new l(t),e.name=t.name,e.message=t.message,e.stack=t.stack;for(var n=p.keys(t),i=0;i<n.length;++i){var o=n[i];f.test(o)||(e[o]=t[o])}return e}return s.markAsOriginatingFromRejection(t),t}function i(t){return function(e,r){if(null!==t){if(e){var i=n(a(e));t._attachExtraTrace(i),t._reject(i)}else if(arguments.length>2){for(var o=arguments.length,s=new Array(o-1),u=1;o>u;++u)s[u-1]=arguments[u];t._fulfill(s)}else t._fulfill(r);t=null}}}var o,s=t("./util.js"),a=s.maybeWrapAsError,u=t("./errors.js"),c=u.TimeoutError,l=u.OperationalError,h=s.haveGetters,p=t("./es5.js"),f=/^(?:name|message|stack|cause)$/;if(o=h?function(t){this.promise=t}:function(t){this.promise=t,this.asCallback=i(t),this.callback=this.asCallback},h){var _={get:function(){return i(this.promise)}};p.defineProperty(o.prototype,"asCallback",_),p.defineProperty(o.prototype,"callback",_)}o._nodebackForPromise=i,o.prototype.toString=function(){return"[object PromiseResolver]"},o.prototype.resolve=o.prototype.fulfill=function(t){if(!(this instanceof o))throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\n\n See http://goo.gl/sdkXL9\n");this.promise._resolveCallback(t)},o.prototype.reject=function(t){if(!(this instanceof o))throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\n\n See http://goo.gl/sdkXL9\n");this.promise._rejectCallback(t)},o.prototype.progress=function(t){if(!(this instanceof o))throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\n\n See http://goo.gl/sdkXL9\n");this.promise._progress(t)},o.prototype.cancel=function(t){this.promise.cancel(t)},o.prototype.timeout=function(){this.reject(new c("timeout"))},o.prototype.isResolved=function(){return this.promise.isResolved()},o.prototype.toJSON=function(){return this.promise.toJSON()},e.exports=o},{"./errors.js":13,"./es5.js":14,"./util.js":38}],26:[function(t,e){"use strict";e.exports=function(e,r){function n(t){return!b.test(t)}function i(t){try{return t.__isPromisified__===!0}catch(e){return!1}}function o(t,e,r){var n=f.getDataPropertyOrDefault(t,e+r,j);return n?i(n):!1}function s(t,e,r){for(var n=0;n<t.length;n+=2){var i=t[n];if(r.test(i))for(var o=i.replace(r,""),s=0;s<t.length;s+=2)if(t[s]===o)throw new g("Cannot promisify an API that has normal methods with '%s'-suffix\n\n See http://goo.gl/iWrZbw\n".replace("%s",e))}}function a(t,e,r,n){for(var a=f.inheritedDataKeys(t),u=[],c=0;c<a.length;++c){var l=a[c],h=t[l],p=n===w?!0:w(l,h,t);"function"!=typeof h||i(h)||o(t,l,e)||!n(l,h,t,p)||u.push(l,h)}return s(u,e,r),u}function u(t,n,i,o){function s(){var i=n;n===p&&(i=this);var o=new e(r);o._captureStackTrace();var s="string"==typeof u&&this!==a?this[u]:t,c=_(o);try{s.apply(i,d(arguments,c))}catch(l){o._rejectCallback(v(l),!0,!0)}return o}var a=function(){return this}(),u=t;return"string"==typeof u&&(t=o),s.__isPromisified__=!0,s}function c(t,e,r,n){for(var i=new RegExp(k(e)+"$"),o=a(t,e,i,r),s=0,u=o.length;u>s;s+=2){var c=o[s],l=o[s+1],h=c+e;t[h]=n===E?E(c,p,c,l,e):n(l,function(){return E(c,p,c,l,e)})}return f.toFastProperties(t),t}function l(t,e){return E(t,e,void 0,t)}var h,p={},f=t("./util.js"),_=t("./promise_resolver.js")._nodebackForPromise,d=f.withAppended,v=f.maybeWrapAsError,y=f.canEvaluate,g=t("./errors").TypeError,m="Async",j={__isPromisified__:!0},b=/^(?:length|name|arguments|caller|prototype|__isPromisified__)$/,w=function(t,e){return f.isIdentifier(t)&&"_"!==t.charAt(0)&&!f.isClass(e)},k=function(t){return t.replace(/([$])/,"\\$")},E=y?h:u;e.promisify=function(t,e){if("function"!=typeof t)throw new g("fn must be a function\n\n See http://goo.gl/916lJJ\n");if(i(t))return t;var r=l(t,arguments.length<2?p:e);return f.copyDescriptors(t,r,n),r},e.promisifyAll=function(t,e){if("function"!=typeof t&&"object"!=typeof t)throw new g("the target of promisifyAll must be an object or a function\n\n See http://goo.gl/9ITlV0\n");e=Object(e);var r=e.suffix;"string"!=typeof r&&(r=m);var n=e.filter;"function"!=typeof n&&(n=w);var i=e.promisifier;if("function"!=typeof i&&(i=E),!f.isIdentifier(r))throw new RangeError("suffix must be a valid identifier\n\n See http://goo.gl/8FZo5V\n");for(var o=f.inheritedDataKeys(t),s=0;s<o.length;++s){var a=t[o[s]];"constructor"!==o[s]&&f.isClass(a)&&(c(a.prototype,r,n,i),c(a,r,n,i))}return c(t,r,n,i)}}},{"./errors":13,"./promise_resolver.js":25,"./util.js":38}],27:[function(t,e){"use strict";e.exports=function(e,r,n,i){function o(t){for(var e=c.keys(t),r=e.length,n=new Array(2*r),i=0;r>i;++i){var o=e[i];n[i]=t[o],n[i+r]=o}this.constructor$(n)}function s(t){var r,s=n(t);return u(s)?(r=s instanceof e?s._then(e.props,void 0,void 0,void 0,void 0):new o(s).promise(),s instanceof e&&r._propagateFrom(s,4),r):i("cannot await properties of a non-object\n\n See http://goo.gl/OsFKC8\n")}var a=t("./util.js"),u=a.isObject,c=t("./es5.js");a.inherits(o,r),o.prototype._init=function(){this._init$(void 0,-3)},o.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var r=++this._totalResolved;if(r>=this._length){for(var n={},i=this.length(),o=0,s=this.length();s>o;++o)n[this._values[o+i]]=this._values[o];this._resolve(n)}},o.prototype._promiseProgressed=function(t,e){this._promise._progress({key:this._values[e+this.length()],value:t})},o.prototype.shouldCopyValues=function(){return!1},o.prototype.getActualLength=function(t){return t>>1},e.prototype.props=function(){return s(this)},e.props=function(t){return s(t)}}},{"./es5.js":14,"./util.js":38}],28:[function(t,e){"use strict";function r(t,e,r,n,i){for(var o=0;i>o;++o)r[o+n]=t[o+e],t[o+e]=void 0}function n(t){this._capacity=t,this._length=0,this._front=0}n.prototype._willBeOverCapacity=function(t){return this._capacity<t},n.prototype._pushOne=function(t){var e=this.length();this._checkCapacity(e+1);var r=this._front+e&this._capacity-1;this[r]=t,this._length=e+1},n.prototype._unshiftOne=function(t){var e=this._capacity;this._checkCapacity(this.length()+1);var r=this._front,n=(r-1&e-1^e)-e;this[n]=t,this._front=n,this._length=this.length()+1},n.prototype.unshift=function(t,e,r){this._unshiftOne(r),this._unshiftOne(e),this._unshiftOne(t)},n.prototype.push=function(t,e,r){var n=this.length()+3;if(this._willBeOverCapacity(n))return this._pushOne(t),this._pushOne(e),void this._pushOne(r);var i=this._front+n-3;this._checkCapacity(n);var o=this._capacity-1;this[i+0&o]=t,this[i+1&o]=e,this[i+2&o]=r,this._length=n},n.prototype.shift=function(){var t=this._front,e=this[t];return this[t]=void 0,this._front=t+1&this._capacity-1,this._length--,e},n.prototype.length=function(){return this._length},n.prototype._checkCapacity=function(t){this._capacity<t&&this._resizeTo(this._capacity<<1)},n.prototype._resizeTo=function(t){var e=this._capacity;this._capacity=t;var n=this._front,i=this._length,o=n+i&e-1;r(this,0,this,e,o)},e.exports=n},{}],29:[function(t,e){"use strict";e.exports=function(e,r,n,i){function o(t,o){var u=n(t);if(u instanceof e)return a(u);if(!s(t))return i("expecting an array, a promise or a thenable\n\n See http://goo.gl/s8MMhc\n");var c=new e(r);void 0!==o&&c._propagateFrom(o,5);for(var l=c._fulfill,h=c._reject,p=0,f=t.length;f>p;++p){var _=t[p];(void 0!==_||p in t)&&e.cast(_)._then(l,h,void 0,c,null)}return c}var s=t("./util.js").isArray,a=function(t){return t.then(function(e){return o(e,t)})};e.race=function(t){return o(t,void 0)},e.prototype.race=function(){return o(this,void 0)}}},{"./util.js":38}],30:[function(t,e){"use strict";e.exports=function(e,r,n,i,o){function s(t,r,n,s){this.constructor$(t),this._promise._captureStackTrace(),this._preservedValues=s===o?[]:null,this._zerothIsAccum=void 0===n,this._gotAccum=!1,this._reducingIndex=this._zerothIsAccum?1:0,this._valuesPhase=void 0;var u=i(n,this._promise),l=!1,h=u instanceof e;h&&(u=u._target(),u._isPending()?u._proxyPromiseArray(this,-1):u._isFulfilled()?(n=u._value(),this._gotAccum=!0):(this._reject(u._reason()),l=!0)),h||this._zerothIsAccum||(this._gotAccum=!0),this._callback=r,this._accum=n,l||c.invoke(a,this,void 0)}function a(){this._init$(void 0,-5)}function u(t,e,r,i){if("function"!=typeof e)return n("fn must be a function\n\n See http://goo.gl/916lJJ\n");var o=new s(t,e,r,i);return o.promise()}var c=t("./async.js"),l=t("./util.js"),h=l.tryCatch,p=l.errorObj;l.inherits(s,r),s.prototype._init=function(){},s.prototype._resolveEmptyArray=function(){(this._gotAccum||this._zerothIsAccum)&&this._resolve(null!==this._preservedValues?[]:this._accum)},s.prototype._promiseFulfilled=function(t,r){var n=this._values;n[r]=t;var o,s=this.length(),a=this._preservedValues,u=null!==a,c=this._gotAccum,l=this._valuesPhase;if(!l)for(l=this._valuesPhase=new Array(s),o=0;s>o;++o)l[o]=0;if(o=l[r],0===r&&this._zerothIsAccum?(this._accum=t,this._gotAccum=c=!0,l[r]=0===o?1:2):-1===r?(this._accum=t,this._gotAccum=c=!0):0===o?l[r]=1:(l[r]=2,this._accum=t),c){for(var f,_=this._callback,d=this._promise._boundTo,v=this._reducingIndex;s>v;++v)if(o=l[v],2!==o){if(1!==o)return;if(t=n[v],this._promise._pushContext(),u?(a.push(t),f=h(_).call(d,t,v,s)):f=h(_).call(d,this._accum,t,v,s),this._promise._popContext(),f===p)return this._reject(f.e);var y=i(f,this._promise);if(y instanceof e){if(y=y._target(),y._isPending())return l[v]=4,y._proxyPromiseArray(this,v);if(!y._isFulfilled())return this._reject(y._reason());f=y._value()}this._reducingIndex=v+1,this._accum=f}else this._reducingIndex=v+1;this._resolve(u?a:this._accum)}},e.prototype.reduce=function(t,e){return u(this,t,e,null)},e.reduce=function(t,e,r,n){return u(t,e,r,n)}}},{"./async.js":2,"./util.js":38}],31:[function(t,e){"use strict";var r,n=function(){throw new Error("No async scheduler available\n\n See http://goo.gl/m3OTXk\n")};if(t("./util.js").isNode){var i=process.versions.node.split(".").map(Number);r=0===i[0]&&i[1]>10||i[0]>0?global.setImmediate:process.nextTick,r||(r="undefined"!=typeof setImmediate?setImmediate:"undefined"!=typeof setTimeout?setTimeout:n)}else"undefined"!=typeof MutationObserver?(r=function(t){var e=document.createElement("div"),r=new MutationObserver(t);return r.observe(e,{attributes:!0}),function(){e.classList.toggle("foo")}},r.isStatic=!0):r="undefined"!=typeof setTimeout?function(t){setTimeout(t,0)}:n;e.exports=r},{"./util.js":38}],32:[function(t,e){"use strict";e.exports=function(e,r){function n(t){this.constructor$(t)}var i=e.PromiseInspection,o=t("./util.js");o.inherits(n,r),n.prototype._promiseResolved=function(t,e){this._values[t]=e;var r=++this._totalResolved;r>=this._length&&this._resolve(this._values)},n.prototype._promiseFulfilled=function(t,e){var r=new i;r._bitField=268435456,r._settledValue=t,this._promiseResolved(e,r)},n.prototype._promiseRejected=function(t,e){var r=new i;r._bitField=134217728,r._settledValue=t,this._promiseResolved(e,r)},e.settle=function(t){return new n(t).promise()},e.prototype.settle=function(){return new n(this).promise()}}},{"./util.js":38}],33:[function(t,e){"use strict";e.exports=function(e,r,n){function i(t){this.constructor$(t),this._howMany=0,this._unwrap=!1,this._initialized=!1}function o(t,e){if((0|e)!==e||0>e)return n("expecting a positive integer\n\n See http://goo.gl/1wAmHx\n");var r=new i(t),o=r.promise();return r.setHowMany(e),r.init(),o}var s=t("./util.js"),a=t("./errors.js").RangeError,u=t("./errors.js").AggregateError,c=s.isArray;s.inherits(i,r),i.prototype._init=function(){if(this._initialized){if(0===this._howMany)return void this._resolve([]);this._init$(void 0,-5);var t=c(this._values);!this._isResolved()&&t&&this._howMany>this._canPossiblyFulfill()&&this._reject(this._getRangeError(this.length()))}},i.prototype.init=function(){this._initialized=!0,this._init()},i.prototype.setUnwrap=function(){this._unwrap=!0},i.prototype.howMany=function(){return this._howMany},i.prototype.setHowMany=function(t){this._howMany=t},i.prototype._promiseFulfilled=function(t){this._addFulfilled(t),this._fulfilled()===this.howMany()&&(this._values.length=this.howMany(),this._resolve(1===this.howMany()&&this._unwrap?this._values[0]:this._values))},i.prototype._promiseRejected=function(t){if(this._addRejected(t),this.howMany()>this._canPossiblyFulfill()){for(var e=new u,r=this.length();r<this._values.length;++r)e.push(this._values[r]);this._reject(e)}},i.prototype._fulfilled=function(){return this._totalResolved},i.prototype._rejected=function(){return this._values.length-this.length()},i.prototype._addRejected=function(t){this._values.push(t)},i.prototype._addFulfilled=function(t){this._values[this._totalResolved++]=t},i.prototype._canPossiblyFulfill=function(){return this.length()-this._rejected()},i.prototype._getRangeError=function(t){var e="Input array must contain at least "+this._howMany+" items but contains only "+t+" items";return new a(e)},i.prototype._resolveEmptyArray=function(){this._reject(this._getRangeError(0))},e.some=function(t,e){return o(t,e)},e.prototype.some=function(t){return o(this,t)},e._SomePromiseArray=i}},{"./errors.js":13,"./util.js":38}],34:[function(t,e){"use strict";e.exports=function(t){function e(t){void 0!==t?(t=t._target(),this._bitField=t._bitField,this._settledValue=t._settledValue):(this._bitField=0,this._settledValue=void 0)}e.prototype.value=function(){if(!this.isFulfilled())throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\n\n See http://goo.gl/hc1DLj\n");return this._settledValue},e.prototype.error=e.prototype.reason=function(){if(!this.isRejected())throw new TypeError("cannot get rejection reason of a non-rejected promise\n\n See http://goo.gl/hPuiwB\n");return this._settledValue},e.prototype.isFulfilled=t.prototype._isFulfilled=function(){return(268435456&this._bitField)>0},e.prototype.isRejected=t.prototype._isRejected=function(){return(134217728&this._bitField)>0},e.prototype.isPending=t.prototype._isPending=function(){return 0===(402653184&this._bitField)},e.prototype.isResolved=t.prototype._isResolved=function(){return(402653184&this._bitField)>0},t.prototype.isPending=function(){return this._target()._isPending()},t.prototype.isRejected=function(){return this._target()._isRejected()},t.prototype.isFulfilled=function(){return this._target()._isFulfilled()},t.prototype.isResolved=function(){return this._target()._isResolved()},t.prototype._value=function(){return this._settledValue},t.prototype._reason=function(){return this._unsetRejectionIsUnhandled(),this._settledValue},t.prototype.value=function(){var t=this._target();if(!t.isFulfilled())throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\n\n See http://goo.gl/hc1DLj\n");return t._settledValue},t.prototype.reason=function(){var t=this._target();if(!t.isRejected())throw new TypeError("cannot get rejection reason of a non-rejected promise\n\n See http://goo.gl/hPuiwB\n");return t._unsetRejectionIsUnhandled(),t._settledValue},t.PromiseInspection=e}},{}],35:[function(t,e){"use strict";e.exports=function(e,r){function n(t,n){if(c(t)){if(t instanceof e)return t;if(o(t)){var l=new e(r);return t._then(l._fulfillUnchecked,l._rejectUncheckedCheckError,l._progressUnchecked,l,null),l}var h=a.tryCatch(i)(t);if(h===u){n&&n._pushContext();var l=e.reject(h.e);return n&&n._popContext(),l}if("function"==typeof h)return s(t,h,n)}return t}function i(t){return t.then}function o(t){return l.call(t,"_promise0")}function s(t,n,i){function o(r){l&&(t===r?l._rejectCallback(e._makeSelfResolutionError(),!1,!0):l._resolveCallback(r),l=null)}function s(t){l&&(l._rejectCallback(t,p,!0),l=null)}function c(t){l&&"function"==typeof l._progress&&l._progress(t)}var l=new e(r),h=l;i&&i._pushContext(),l._captureStackTrace(),i&&i._popContext();var p=!0,f=a.tryCatch(n).call(t,o,s,c);return p=!1,l&&f===u&&(l._rejectCallback(f.e,!0,!0),l=null),h}var a=t("./util.js"),u=a.errorObj,c=a.isObject,l={}.hasOwnProperty;return n}},{"./util.js":38}],36:[function(t,e){"use strict";e.exports=function(e,r){function n(t){var e=this;return e instanceof Number&&(e=+e),clearTimeout(e),t}function i(t){var e=this;throw e instanceof Number&&(e=+e),clearTimeout(e),t}var o=t("./util.js"),s=e.TimeoutError,a=function(t,e){if(t.isPending()){"string"!=typeof e&&(e="operation timed out");var r=new s(e);o.markAsOriginatingFromRejection(r),t._attachExtraTrace(r),t._cancel(r)}},u=function(t){return c(+this).thenReturn(t)},c=e.delay=function(t,n){if(void 0===n){n=t,t=void 0;var i=new e(r);return setTimeout(function(){i._fulfill()},n),i}return n=+n,e.resolve(t)._then(u,null,null,n,void 0)};e.prototype.delay=function(t){return c(this,t)},e.prototype.timeout=function(t,e){t=+t;var r=this.then().cancellable();r._cancellationParent=this;var o=setTimeout(function(){a(r,e)},t);return r._then(n,i,void 0,o,void 0)}}},{"./util.js":38}],37:[function(t,e){"use strict";e.exports=function(e,r,n,i){function o(t){for(var r=t.length,n=0;r>n;++n){var i=t[n];if(i.isRejected())return e.reject(i.error());t[n]=i._settledValue}return t}function s(t){setTimeout(function(){throw t},0)}function a(t){var e=n(t);return e!==t&&"function"==typeof t._isDisposable&&"function"==typeof t._getDisposer&&t._isDisposable()&&e._setDisposable(t._getDisposer()),e}function u(t,r){function i(){if(o>=u)return c.resolve();var l=a(t[o++]);if(l instanceof e&&l._isDisposable()){try{l=n(l._getDisposer().tryDispose(r),t.promise)}catch(h){return s(h)}if(l instanceof e)return l._then(i,s,null,null,null)}i()}var o=0,u=t.length,c=e.defer();return i(),c.promise}function c(t){var e=new v;return e._settledValue=t,e._bitField=268435456,u(this,e).thenReturn(t)}function l(t){var e=new v;return e._settledValue=t,e._bitField=134217728,u(this,e).thenThrow(t)}function h(t,e,r){this._data=t,this._promise=e,this._context=r}function p(t,e,r){this.constructor$(t,e,r)}function f(t){return h.isDisposer(t)?(this.resources[this.index]._setDisposable(t),t.promise()):t}var _=t("./errors.js").TypeError,d=t("./util.js").inherits,v=e.PromiseInspection;h.prototype.data=function(){return this._data},h.prototype.promise=function(){return this._promise},h.prototype.resource=function(){return this.promise().isFulfilled()?this.promise().value():null},h.prototype.tryDispose=function(t){var e=this.resource(),r=this._context;void 0!==r&&r._pushContext();var n=null!==e?this.doDispose(e,t):null;return void 0!==r&&r._popContext(),this._promise._unsetDisposable(),this._data=null,n},h.isDisposer=function(t){return null!=t&&"function"==typeof t.resource&&"function"==typeof t.tryDispose},d(p,h),p.prototype.doDispose=function(t,e){var r=this.data();return r.call(t,t,e)},e.using=function(){var t=arguments.length;if(2>t)return r("you must pass at least 2 arguments to Promise.using");var i=arguments[t-1];if("function"!=typeof i)return r("fn must be a function\n\n See http://goo.gl/916lJJ\n");t--;for(var s=new Array(t),a=0;t>a;++a){var u=arguments[a];if(h.isDisposer(u)){var p=u;u=u.promise(),u._setDisposable(p)}else{var _=n(u);_ instanceof e&&(u=_._then(f,null,null,{resources:s,index:a},void 0))}s[a]=u}var d=e.settle(s).then(o).then(function(t){d._pushContext();var e;try{e=i.apply(void 0,t)}finally{d._popContext()}return e})._then(c,l,void 0,s,void 0);return s.promise=d,d},e.prototype._setDisposable=function(t){this._bitField=262144|this._bitField,this._disposer=t},e.prototype._isDisposable=function(){return(262144&this._bitField)>0},e.prototype._getDisposer=function(){return this._disposer},e.prototype._unsetDisposable=function(){this._bitField=-262145&this._bitField,this._disposer=void 0},e.prototype.disposer=function(t){if("function"==typeof t)return new p(t,this,i());throw new _}}},{"./errors.js":13,"./util.js":38}],38:[function(t,e,r){"use strict";function n(){try{return C.apply(this,arguments)}catch(t){return F.e=t,F}}function i(t){return C=t,n}function o(t){return null==t||t===!0||t===!1||"string"==typeof t||"number"==typeof t}function s(t){return!o(t)}function a(t){return o(t)?new Error(v(t)):t}function u(t,e){var r,n=t.length,i=new Array(n+1);for(r=0;n>r;++r)i[r]=t[r];return i[r]=e,i}function c(t,e,r){if(!w.isES5)return{}.hasOwnProperty.call(t,e)?t[e]:void 0;var n=Object.getOwnPropertyDescriptor(t,e);return null!=n?null==n.get&&null==n.set?n.value:r:void 0}function l(t,e,r){if(o(t))return t;var n={value:r,configurable:!0,enumerable:!1,writable:!0};return w.defineProperty(t,e,n),t}function h(t){throw t}function p(t){try{if("function"==typeof t){var e=w.names(t.prototype);return w.isES5?e.length>1:e.length>0&&!(1===e.length&&"constructor"===e[0])}return!1}catch(r){return!1}}function f(t){function e(){}return e.prototype=t,e}function _(t){return R.test(t)}function d(t,e,r){for(var n=new Array(t),i=0;t>i;++i)n[i]=e+i+r;return n}function v(t){try{return t+""}catch(e){return"[no string representation]"}}function y(t){try{l(t,"isOperational",!0)
+}catch(e){}}function g(t){return null==t?!1:t instanceof Error.__BluebirdErrorTypes__.OperationalError||t.isOperational===!0}function m(t){return t instanceof Error&&w.propertyIsWritable(t,"stack")}function j(t){return{}.toString.call(t)}function b(t,e,r){for(var n=w.names(t),i=0;i<n.length;++i){var o=n[i];r(o)&&w.defineProperty(e,o,w.getDescriptor(t,o))}}var w=t("./es5.js"),k="undefined"==typeof navigator,E=function(){try{var t={};return w.defineProperty(t,"f",{get:function(){return 3}}),3===t.f}catch(e){return!1}}(),F={e:{}},C,T=function(t,e){function r(){this.constructor=t,this.constructor$=e;for(var r in e.prototype)n.call(e.prototype,r)&&"$"!==r.charAt(r.length-1)&&(this[r+"$"]=e.prototype[r])}var n={}.hasOwnProperty;return r.prototype=e.prototype,t.prototype=new r,t.prototype},x=function(){return"string"!==this}.call("string"),P=function(){if(w.isES5){var t=Object.prototype,e=Object.getOwnPropertyNames;return function(r){for(var n=[],i=Object.create(null);null!=r&&r!==t;){var o;try{o=e(r)}catch(s){return n}for(var a=0;a<o.length;++a){var u=o[a];if(!i[u]){i[u]=!0;var c=Object.getOwnPropertyDescriptor(r,u);null!=c&&null==c.get&&null==c.set&&n.push(u)}}r=w.getPrototypeOf(r)}return n}}return function(t){var e=[];for(var r in t)e.push(r);return e}}(),R=/^[a-z$_][a-z$_0-9]*$/i,S=function(){return"stack"in new Error?function(t){return m(t)?t:new Error(v(t))}:function(t){if(m(t))return t;try{throw new Error(v(t))}catch(e){return e}}}(),A={isClass:p,isIdentifier:_,inheritedDataKeys:P,getDataPropertyOrDefault:c,thrower:h,isArray:w.isArray,haveGetters:E,notEnumerableProp:l,isPrimitive:o,isObject:s,canEvaluate:k,errorObj:F,tryCatch:i,inherits:T,withAppended:u,maybeWrapAsError:a,wrapsPrimitiveReceiver:x,toFastProperties:f,filledRange:d,toString:v,canAttachTrace:m,ensureErrorObject:S,originatesFromRejection:g,markAsOriginatingFromRejection:y,classString:j,copyDescriptors:b,isNode:"undefined"!=typeof process&&"[object process]"===j(process).toLowerCase()};try{throw new Error}catch(O){A.lastLineError=O}e.exports=A},{"./es5.js":14}]},{},[4])(4)}),"undefined"!=typeof window&&null!==window?window.P=window.Promise:"undefined"!=typeof self&&null!==self&&(self.P=self.Promise); \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/any.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/any.js
new file mode 100644
index 0000000000..05a6228ef9
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/any.js
@@ -0,0 +1,21 @@
+"use strict";
+module.exports = function(Promise) {
+var SomePromiseArray = Promise._SomePromiseArray;
+function any(promises) {
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(1);
+ ret.setUnwrap();
+ ret.init();
+ return promise;
+}
+
+Promise.any = function (promises) {
+ return any(promises);
+};
+
+Promise.prototype.any = function () {
+ return any(this);
+};
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/assert.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/assert.js
new file mode 100644
index 0000000000..a98955c475
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/assert.js
@@ -0,0 +1,55 @@
+"use strict";
+module.exports = (function(){
+var AssertionError = (function() {
+ function AssertionError(a) {
+ this.constructor$(a);
+ this.message = a;
+ this.name = "AssertionError";
+ }
+ AssertionError.prototype = new Error();
+ AssertionError.prototype.constructor = AssertionError;
+ AssertionError.prototype.constructor$ = Error;
+ return AssertionError;
+})();
+
+function getParams(args) {
+ var params = [];
+ for (var i = 0; i < args.length; ++i) params.push("arg" + i);
+ return params;
+}
+
+function nativeAssert(callName, args, expect) {
+ try {
+ var params = getParams(args);
+ var constructorArgs = params;
+ constructorArgs.push("return " +
+ callName + "("+ params.join(",") + ");");
+ var fn = Function.apply(null, constructorArgs);
+ return fn.apply(null, args);
+ } catch (e) {
+ if (!(e instanceof SyntaxError)) {
+ throw e;
+ } else {
+ return expect;
+ }
+ }
+}
+
+return function assert(boolExpr, message) {
+ if (boolExpr === true) return;
+
+ if (typeof boolExpr === "string" &&
+ boolExpr.charAt(0) === "%") {
+ var nativeCallName = boolExpr;
+ var $_len = arguments.length;var args = new Array($_len - 2); for(var $_i = 2; $_i < $_len; ++$_i) {args[$_i - 2] = arguments[$_i];}
+ if (nativeAssert(nativeCallName, args, message) === message) return;
+ message = (nativeCallName + " !== " + message);
+ }
+
+ var ret = new AssertionError(message);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(ret, assert);
+ }
+ throw ret;
+};
+})();
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/async.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/async.js
new file mode 100644
index 0000000000..7917e0880a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/async.js
@@ -0,0 +1,106 @@
+"use strict";
+var firstLineError;
+try {throw new Error(); } catch (e) {firstLineError = e;}
+var schedule = require("./schedule.js");
+var Queue = require("./queue.js");
+var _process = typeof process !== "undefined" ? process : undefined;
+
+function Async() {
+ this._isTickUsed = false;
+ this._lateQueue = new Queue(16);
+ this._normalQueue = new Queue(16);
+ var self = this;
+ this.drainQueues = function () {
+ self._drainQueues();
+ };
+ this._schedule =
+ schedule.isStatic ? schedule(this.drainQueues) : schedule;
+}
+
+Async.prototype.haveItemsQueued = function () {
+ return this._normalQueue.length() > 0;
+};
+
+Async.prototype._withDomain = function(fn) {
+ if (_process !== undefined &&
+ _process.domain != null &&
+ !fn.domain) {
+ fn = _process.domain.bind(fn);
+ }
+ return fn;
+};
+
+Async.prototype.throwLater = function(fn, arg) {
+ if (arguments.length === 1) {
+ arg = fn;
+ fn = function () { throw arg; };
+ }
+ fn = this._withDomain(fn);
+ if (typeof setTimeout !== "undefined") {
+ setTimeout(function() {
+ fn(arg);
+ }, 0);
+ } else try {
+ this._schedule(function() {
+ fn(arg);
+ });
+ } catch (e) {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/m3OTXk\u000a");
+ }
+};
+
+Async.prototype.invokeLater = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._lateQueue.push(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.invokeFirst = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._normalQueue.unshift(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.invoke = function (fn, receiver, arg) {
+ fn = this._withDomain(fn);
+ this._normalQueue.push(fn, receiver, arg);
+ this._queueTick();
+};
+
+Async.prototype.settlePromises = function(promise) {
+ this._normalQueue._pushOne(promise);
+ this._queueTick();
+};
+
+Async.prototype._drainQueue = function(queue) {
+ while (queue.length() > 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = new Async();
+module.exports.firstLineError = firstLineError;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bind.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bind.js
new file mode 100644
index 0000000000..d6f6da2576
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bind.js
@@ -0,0 +1,73 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise) {
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ this._setBoundTo(thisArg);
+ if (this._isPending()) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, ret._progress, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, ret._progress, ret, context);
+ } else {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 131072;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~131072);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 131072) === 131072;
+};
+
+Promise.bind = function (thisArg, value) {
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise._then(function(thisArg) {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(value);
+ }, ret._reject, ret._progress, ret, null);
+ } else {
+ ret._setBoundTo(thisArg);
+ ret._resolveCallback(value);
+ }
+ return ret;
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bluebird.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bluebird.js
new file mode 100644
index 0000000000..ed6226e7ea
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/bluebird.js
@@ -0,0 +1,11 @@
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = require("./promise.js")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/call_get.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/call_get.js
new file mode 100644
index 0000000000..62c166d5c0
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/call_get.js
@@ -0,0 +1,123 @@
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = require("./util.js");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!false) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var $_len = arguments.length;var args = new Array($_len - 1); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];}
+ if (!false) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/cancel.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/cancel.js
new file mode 100644
index 0000000000..99c5b69473
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/cancel.js
@@ -0,0 +1,47 @@
+"use strict";
+module.exports = function(Promise) {
+var errors = require("./errors.js");
+var async = require("./async.js");
+var CancellationError = errors.CancellationError;
+
+Promise.prototype._cancel = function (reason) {
+ if (!this.isCancellable()) return this;
+ var parent;
+ var promiseToReject = this;
+ while ((parent = promiseToReject._cancellationParent) !== undefined &&
+ parent.isCancellable()) {
+ promiseToReject = parent;
+ }
+ this._unsetCancellable();
+ promiseToReject._target()._rejectCallback(reason, false, true);
+};
+
+Promise.prototype.cancel = function (reason) {
+ if (!this.isCancellable()) return this;
+ if (reason === undefined) reason = new CancellationError();
+ async.invokeLater(this._cancel, this, reason);
+ return this;
+};
+
+Promise.prototype.cancellable = function () {
+ if (this._cancellable()) return this;
+ this._setCancellable();
+ this._cancellationParent = undefined;
+ return this;
+};
+
+Promise.prototype.uncancellable = function () {
+ var ret = this.then();
+ ret._unsetCancellable();
+ return ret;
+};
+
+Promise.prototype.fork = function (didFulfill, didReject, didProgress) {
+ var ret = this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+
+ ret._setCancellable();
+ ret._cancellationParent = undefined;
+ return ret;
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/captured_trace.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/captured_trace.js
new file mode 100644
index 0000000000..4d678704c2
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/captured_trace.js
@@ -0,0 +1,492 @@
+"use strict";
+module.exports = function() {
+var async = require("./async.js");
+var util = require("./util.js");
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](main|debug|zalgo|instrumented)/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var warn;
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.parent = function() {
+ return this._parent;
+};
+
+CapturedTrace.prototype.hasParent = function() {
+ return this._parent !== undefined;
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = CapturedTrace.parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ error.stack = reconstructStack(message, stacks);
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = stackFramePattern.test(line) ||
+ " (No stack trace)" === line;
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0) {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+CapturedTrace.parseStackAndMessage = function(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: cleanStack(stack)
+ };
+};
+
+CapturedTrace.formatAndLogError = function(error, title) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (typeof error === "object" || typeof error === "function") {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof warn === "function") {
+ warn(message);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+};
+
+CapturedTrace.unhandledRejection = function (reason) {
+ CapturedTrace.formatAndLogError(reason, "^--- With additional stack trace: ");
+};
+
+CapturedTrace.isSupported = function () {
+ return typeof captureStackTrace === "function";
+};
+
+CapturedTrace.fireRejectionEvent =
+function(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent(name, reason, promise);
+ } catch (e) {
+ globalEventFired = true;
+ async.throwLater(e);
+ }
+
+ var domEventFired = false;
+ if (fireDomEvent) {
+ try {
+ domEventFired = fireDomEvent(name.toLowerCase(), {
+ reason: reason,
+ promise: promise
+ });
+ } catch (e) {
+ domEventFired = true;
+ async.throwLater(e);
+ }
+ }
+
+ if (!globalEventFired && !localEventFired && !domEventFired &&
+ name === "unhandledRejection") {
+ CapturedTrace.formatAndLogError(reason, "Unhandled rejection ");
+ }
+};
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj.toString();
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+CapturedTrace.setBounds = function(firstLineError, lastLineError) {
+ if (!CapturedTrace.isSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit = Error.stackTraceLimit - 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow) {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit = Error.stackTraceLimit + 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit = Error.stackTraceLimit - 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+var fireDomEvent;
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function(name, reason, promise) {
+ if (name === "rejectionHandled") {
+ return process.emit(name, promise);
+ } else {
+ return process.emit(name, reason, promise);
+ }
+ };
+ } else {
+ var customEventWorks = false;
+ var anyEventWorks = true;
+ try {
+ var ev = new self.CustomEvent("test");
+ customEventWorks = ev instanceof CustomEvent;
+ } catch (e) {}
+ if (!customEventWorks) {
+ try {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ self.dispatchEvent(event);
+ } catch (e) {
+ anyEventWorks = false;
+ }
+ }
+ if (anyEventWorks) {
+ fireDomEvent = function(type, detail) {
+ var event;
+ if (customEventWorks) {
+ event = new self.CustomEvent(type, {
+ detail: detail,
+ bubbles: false,
+ cancelable: true
+ });
+ } else if (self.dispatchEvent) {
+ event = document.createEvent("CustomEvent");
+ event.initCustomEvent(type, false, true, detail);
+ }
+
+ return event ? !self.dispatchEvent(event) : false;
+ };
+ }
+
+ var toWindowMethodNameMap = {};
+ toWindowMethodNameMap["unhandledRejection"] = ("on" +
+ "unhandledRejection").toLowerCase();
+ toWindowMethodNameMap["rejectionHandled"] = ("on" +
+ "rejectionHandled").toLowerCase();
+
+ return function(name, reason, promise) {
+ var methodName = toWindowMethodNameMap[name];
+ var method = self[methodName];
+ if (!method) return false;
+ if (name === "rejectionHandled") {
+ method.call(self, promise);
+ } else {
+ method.call(self, reason, promise);
+ }
+ return true;
+ };
+ }
+})();
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ warn = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ warn = function(message) {
+ process.stderr.write("\u001b[31m" + message + "\u001b[39m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ warn = function(message) {
+ console.warn("%c" + message, "color: red");
+ };
+ }
+}
+
+return CapturedTrace;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/catch_filter.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/catch_filter.js
new file mode 100644
index 0000000000..040f057202
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/catch_filter.js
@@ -0,0 +1,66 @@
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = require("./util.js");
+var errors = require("./errors.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var keys = require("./es5.js").keys;
+var TypeError = errors.TypeError;
+
+function CatchFilter(instances, callback, promise) {
+ this._instances = instances;
+ this._callback = callback;
+ this._promise = promise;
+}
+
+function safePredicate(predicate, e) {
+ var safeObject = {};
+ var retfilter = tryCatch(predicate).call(safeObject, e);
+
+ if (retfilter === errorObj) return retfilter;
+
+ var safeKeys = keys(safeObject);
+ if (safeKeys.length) {
+ errorObj.e = new TypeError("Catch filter must inherit from Error or be a simple predicate function\u000a\u000a See http://goo.gl/o84o68\u000a");
+ return errorObj;
+ }
+ return retfilter;
+}
+
+CatchFilter.prototype.doFilter = function (e) {
+ var cb = this._callback;
+ var promise = this._promise;
+ var boundTo = promise._boundTo;
+ for (var i = 0, len = this._instances.length; i < len; ++i) {
+ var item = this._instances[i];
+ var itemIsErrorType = item === Error ||
+ (item != null && item.prototype instanceof Error);
+
+ if (itemIsErrorType && e instanceof item) {
+ var ret = tryCatch(cb).call(boundTo, e);
+ if (ret === errorObj) {
+ NEXT_FILTER.e = ret.e;
+ return NEXT_FILTER;
+ }
+ return ret;
+ } else if (typeof item === "function" && !itemIsErrorType) {
+ var shouldHandle = safePredicate(item, e);
+ if (shouldHandle === errorObj) {
+ e = errorObj.e;
+ break;
+ } else if (shouldHandle) {
+ var ret = tryCatch(cb).call(boundTo, e);
+ if (ret === errorObj) {
+ NEXT_FILTER.e = ret.e;
+ return NEXT_FILTER;
+ }
+ return ret;
+ }
+ }
+ }
+ NEXT_FILTER.e = e;
+ return NEXT_FILTER;
+};
+
+return CatchFilter;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/context.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/context.js
new file mode 100644
index 0000000000..ccd7702b7e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/context.js
@@ -0,0 +1,38 @@
+"use strict";
+module.exports = function(Promise, CapturedTrace, isDebugging) {
+var contextStack = [];
+function Context() {
+ this._trace = new CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (!isDebugging()) return;
+ if (this._trace !== undefined) {
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (!isDebugging()) return;
+ if (this._trace !== undefined) {
+ contextStack.pop();
+ }
+};
+
+function createContext() {
+ if (isDebugging()) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+
+Promise.prototype._peekContext = peekContext;
+Promise.prototype._pushContext = Context.prototype._pushContext;
+Promise.prototype._popContext = Context.prototype._popContext;
+
+return createContext;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/debuggability.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/debuggability.js
new file mode 100644
index 0000000000..2cec5e7bad
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/debuggability.js
@@ -0,0 +1,139 @@
+"use strict";
+module.exports = function(Promise, CapturedTrace) {
+var async = require("./async.js");
+var Warning = require("./errors.js").Warning;
+var util = require("./util.js");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var debugging = false || (util.isNode &&
+ (!!process.env["BLUEBIRD_DEBUG"] ||
+ process.env["NODE_ENV"] === "development"));
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ this._setRejectionIsUnhandled();
+ async.invokeLater(this._notifyUnhandledRejection, this, undefined);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ CapturedTrace.fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._getCarriedStackTrace() || this._settledValue;
+ this._setUnhandledRejectionIsNotified();
+ CapturedTrace.fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 524288;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~524288);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 524288) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 2097152;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~2097152);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 2097152) > 0;
+};
+
+Promise.prototype._setCarriedStackTrace = function (capturedTrace) {
+ this._bitField = this._bitField | 1048576;
+ this._fulfillmentHandler0 = capturedTrace;
+};
+
+Promise.prototype._isCarryingStackTrace = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._getCarriedStackTrace = function () {
+ return this._isCarryingStackTrace()
+ ? this._fulfillmentHandler0
+ : undefined;
+};
+
+Promise.prototype._captureStackTrace = function () {
+ if (debugging) {
+ this._trace = new CapturedTrace(this._peekContext());
+ }
+ return this;
+};
+
+Promise.prototype._attachExtraTrace = function (error, ignoreSelf) {
+ if (debugging && canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = CapturedTrace.parseStackAndMessage(error);
+ error.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+};
+
+Promise.prototype._warn = function(message) {
+ var warning = new Warning(message);
+ var ctx = this._peekContext();
+ if (ctx) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = CapturedTrace.parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+ CapturedTrace.formatAndLogError(warning, "");
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ possiblyUnhandledRejection = typeof fn === "function" ? fn : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ unhandledRejectionHandled = typeof fn === "function" ? fn : undefined;
+};
+
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() &&
+ debugging === false
+ ) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/DT1qyG\u000a");
+ }
+ debugging = CapturedTrace.isSupported();
+};
+
+Promise.hasLongStackTraces = function () {
+ return debugging && CapturedTrace.isSupported();
+};
+
+if (!CapturedTrace.isSupported()) {
+ Promise.longStackTraces = function(){};
+ debugging = false;
+}
+
+return function() {
+ return debugging;
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/direct_resolve.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/direct_resolve.js
new file mode 100644
index 0000000000..c61a367f58
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/direct_resolve.js
@@ -0,0 +1,54 @@
+"use strict";
+var util = require("./util.js");
+var isPrimitive = util.isPrimitive;
+var wrapsPrimitiveReceiver = util.wrapsPrimitiveReceiver;
+
+module.exports = function(Promise) {
+var returner = function () {
+ return this;
+};
+var thrower = function () {
+ throw this;
+};
+
+var wrapper = function (value, action) {
+ if (action === 1) {
+ return function () {
+ throw value;
+ };
+ } else if (action === 2) {
+ return function () {
+ return value;
+ };
+ }
+};
+
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (wrapsPrimitiveReceiver && isPrimitive(value)) {
+ return this._then(
+ wrapper(value, 2),
+ undefined,
+ undefined,
+ undefined,
+ undefined
+ );
+ }
+ return this._then(returner, undefined, undefined, value, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ if (wrapsPrimitiveReceiver && isPrimitive(reason)) {
+ return this._then(
+ wrapper(reason, 1),
+ undefined,
+ undefined,
+ undefined,
+ undefined
+ );
+ }
+ return this._then(thrower, undefined, undefined, reason, undefined);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/each.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/each.js
new file mode 100644
index 0000000000..a37e22c058
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/each.js
@@ -0,0 +1,12 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, null, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, null, INTERNAL);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/errors.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/errors.js
new file mode 100644
index 0000000000..c334bb1c83
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/errors.js
@@ -0,0 +1,111 @@
+"use strict";
+var es5 = require("./es5.js");
+var Objectfreeze = es5.freeze;
+var util = require("./util.js");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ notEnumerableProp(Error, "__BluebirdErrorTypes__", errorTypes);
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/es5.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/es5.js
new file mode 100644
index 0000000000..ea41d5a566
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/es5.js
@@ -0,0 +1,80 @@
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/filter.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/filter.js
new file mode 100644
index 0000000000..ed57bf0159
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/filter.js
@@ -0,0 +1,12 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/finally.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/finally.js
new file mode 100644
index 0000000000..ed84a2a1f8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/finally.js
@@ -0,0 +1,99 @@
+"use strict";
+module.exports = function(Promise, NEXT_FILTER, tryConvertToPromise) {
+var util = require("./util.js");
+var wrapsPrimitiveReceiver = util.wrapsPrimitiveReceiver;
+var isPrimitive = util.isPrimitive;
+var thrower = util.thrower;
+
+function returnThis() {
+ return this;
+}
+function throwThis() {
+ throw this;
+}
+function return$(r) {
+ return function() {
+ return r;
+ };
+}
+function throw$(r) {
+ return function() {
+ throw r;
+ };
+}
+function promisedFinally(ret, reasonOrValue, isFulfilled) {
+ var then;
+ if (wrapsPrimitiveReceiver && isPrimitive(reasonOrValue)) {
+ then = isFulfilled ? return$(reasonOrValue) : throw$(reasonOrValue);
+ } else {
+ then = isFulfilled ? returnThis : throwThis;
+ }
+ return ret._then(then, thrower, undefined, reasonOrValue, undefined);
+}
+
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ var ret = promise._isBound()
+ ? handler.call(promise._boundTo)
+ : handler();
+
+ if (ret !== undefined) {
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ return promisedFinally(maybePromise, reasonOrValue,
+ promise.isFulfilled());
+ }
+ }
+
+ if (promise.isRejected()) {
+ NEXT_FILTER.e = reasonOrValue;
+ return NEXT_FILTER;
+ } else {
+ return reasonOrValue;
+ }
+}
+
+function tapHandler(value) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ var ret = promise._isBound()
+ ? handler.call(promise._boundTo, value)
+ : handler(value);
+
+ if (ret !== undefined) {
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ return promisedFinally(maybePromise, value, true);
+ }
+ }
+ return value;
+}
+
+Promise.prototype._passThroughHandler = function (handler, isFinally) {
+ if (typeof handler !== "function") return this.then();
+
+ var promiseAndHandler = {
+ promise: this,
+ handler: handler
+ };
+
+ return this._then(
+ isFinally ? finallyHandler : tapHandler,
+ isFinally ? finallyHandler : undefined, undefined,
+ promiseAndHandler, undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThroughHandler(handler, true);
+};
+
+Promise.prototype.tap = function (handler) {
+ return this._passThroughHandler(handler, false);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/generators.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/generators.js
new file mode 100644
index 0000000000..4c0568d21f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/generators.js
@@ -0,0 +1,136 @@
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise) {
+var errors = require("./errors.js");
+var TypeError = errors.TypeError;
+var util = require("./util.js");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+}
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._next(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ if (result === errorObj) {
+ return this._promise._rejectCallback(result.e, false, true);
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._promise._resolveCallback(value);
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._throw(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/4Y4pDk\u000a\u000a".replace("%s", value) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise._then(
+ this._next,
+ this._throw,
+ undefined,
+ this,
+ null
+ );
+ }
+};
+
+PromiseSpawn.prototype._throw = function (reason) {
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._next = function (value) {
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/6Vqhm0\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ spawn._generator = generator;
+ spawn._next(undefined);
+ return spawn.promise();
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/6Vqhm0\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/join.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/join.js
new file mode 100644
index 0000000000..cf33eb1d07
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/join.js
@@ -0,0 +1,107 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL) {
+var util = require("./util.js");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!false) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var caller = function(count) {
+ var values = [];
+ for (var i = 1; i <= count; ++i) values.push("holder.p" + i);
+ return new Function("holder", " \n\
+ 'use strict'; \n\
+ var callback = holder.fn; \n\
+ return callback(values); \n\
+ ".replace(/values/g, values.join(", ")));
+ };
+ var thenCallbacks = [];
+ var callers = [undefined];
+ for (var i = 1; i <= 5; ++i) {
+ thenCallbacks.push(thenCallback(i));
+ callers.push(caller(i));
+ }
+
+ var Holder = function(total, fn) {
+ this.p1 = this.p2 = this.p3 = this.p4 = this.p5 = null;
+ this.fn = fn;
+ this.total = total;
+ this.now = 0;
+ };
+
+ Holder.prototype.callers = callers;
+ Holder.prototype.checkFulfillment = function(promise) {
+ var now = this.now;
+ now++;
+ var total = this.total;
+ if (now >= total) {
+ var handler = this.callers[total];
+ promise._pushContext();
+ var ret = tryCatch(handler)(this);
+ promise._popContext();
+ if (ret === errorObj) {
+ promise._rejectCallback(ret.e, false, true);
+ } else {
+ promise._resolveCallback(ret);
+ }
+ } else {
+ this.now = now;
+ }
+ };
+
+ var reject = function (reason) {
+ this._reject(reason);
+ };
+}
+}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!false) {
+ if (last < 6 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var holder = new Holder(last, fn);
+ var callbacks = thenCallbacks;
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ } else if (maybePromise._isFulfilled()) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else {
+ ret._reject(maybePromise._reason());
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+ return ret;
+ }
+ }
+ }
+ var $_len = arguments.length;var args = new Array($_len); for(var $_i = 0; $_i < $_len; ++$_i) {args[$_i] = arguments[$_i];}
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/map.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/map.js
new file mode 100644
index 0000000000..66a5b179cf
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/map.js
@@ -0,0 +1,131 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL) {
+var async = require("./async.js");
+var util = require("./util.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var PENDING = {};
+var EMPTY_ARRAY = [];
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ this._callback = fn;
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = limit >= 1 ? [] : EMPTY_ARRAY;
+ async.invoke(init, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+function init() {this._init$(undefined, -2);}
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+ if (values[index] === PENDING) {
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var callback = this._callback;
+ var receiver = this._promise._boundTo;
+ this._promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ this._promise._popContext();
+ if (ret === errorObj) return this._reject(ret.e);
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = PENDING;
+ return maybePromise._proxyPromiseArray(this, index);
+ } else if (maybePromise._isFulfilled()) {
+ ret = maybePromise._value();
+ } else {
+ return this._reject(maybePromise._reason());
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+
+ }
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ var limit = typeof options === "object" && options !== null
+ ? options.concurrency
+ : 0;
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter);
+}
+
+Promise.prototype.map = function (fn, options) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+
+ return map(this, fn, options, null).promise();
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ return map(promises, fn, options, _filter).promise();
+};
+
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/method.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/method.js
new file mode 100644
index 0000000000..3d3eeb17c8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/method.js
@@ -0,0 +1,44 @@
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = require("./util.js");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ ret._popContext();
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn, args, ctx) {
+ if (typeof fn !== "function") {
+ return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = util.isArray(args)
+ ? tryCatch(fn).apply(ctx, args)
+ : tryCatch(fn).call(ctx, args);
+ ret._popContext();
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false, true);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/nodeify.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/nodeify.js
new file mode 100644
index 0000000000..1175f17641
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/nodeify.js
@@ -0,0 +1,58 @@
+"use strict";
+module.exports = function(Promise) {
+var util = require("./util.js");
+var async = require("./async.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret = tryCatch(nodeback).apply(promise._boundTo, [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundTo;
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var target = promise._target();
+ var newReason = target._getCarriedStackTrace();
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundTo, reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback =
+Promise.prototype.nodeify = function (nodeback, options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/progress.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/progress.js
new file mode 100644
index 0000000000..2e3e95e564
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/progress.js
@@ -0,0 +1,76 @@
+"use strict";
+module.exports = function(Promise, PromiseArray) {
+var util = require("./util.js");
+var async = require("./async.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+Promise.prototype.progressed = function (handler) {
+ return this._then(undefined, undefined, handler, undefined, undefined);
+};
+
+Promise.prototype._progress = function (progressValue) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._target()._progressUnchecked(progressValue);
+
+};
+
+Promise.prototype._progressHandlerAt = function (index) {
+ return index === 0
+ ? this._progressHandler0
+ : this[(index << 2) + index - 5 + 2];
+};
+
+Promise.prototype._doProgressWith = function (progression) {
+ var progressValue = progression.value;
+ var handler = progression.handler;
+ var promise = progression.promise;
+ var receiver = progression.receiver;
+
+ var ret = tryCatch(handler).call(receiver, progressValue);
+ if (ret === errorObj) {
+ if (ret.e != null &&
+ ret.e.name !== "StopProgressPropagation") {
+ var trace = util.canAttachTrace(ret.e)
+ ? ret.e : new Error(util.toString(ret.e));
+ promise._attachExtraTrace(trace);
+ promise._progress(ret.e);
+ }
+ } else if (ret instanceof Promise) {
+ ret._then(promise._progress, null, null, promise, undefined);
+ } else {
+ promise._progress(ret);
+ }
+};
+
+
+Promise.prototype._progressUnchecked = function (progressValue) {
+ var len = this._length();
+ var progress = this._progress;
+ for (var i = 0; i < len; i++) {
+ var handler = this._progressHandlerAt(i);
+ var promise = this._promiseAt(i);
+ if (!(promise instanceof Promise)) {
+ var receiver = this._receiverAt(i);
+ if (typeof handler === "function") {
+ handler.call(receiver, progressValue, promise);
+ } else if (receiver instanceof PromiseArray &&
+ !receiver._isResolved()) {
+ receiver._promiseProgressed(progressValue, promise);
+ }
+ continue;
+ }
+
+ if (typeof handler === "function") {
+ async.invoke(this._doProgressWith, this, {
+ handler: handler,
+ promise: promise,
+ receiver: this._receiverAt(i),
+ value: progressValue
+ });
+ } else {
+ async.invoke(progress, promise, progressValue);
+ }
+ }
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise.js
new file mode 100644
index 0000000000..433d844f69
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise.js
@@ -0,0 +1,700 @@
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/LhFpo0\u000a");
+};
+var reflect = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+var util = require("./util.js");
+var async = require("./async.js");
+var errors = require("./errors.js");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {e: null};
+var tryConvertToPromise = require("./thenables.js")(Promise, INTERNAL);
+var PromiseArray =
+ require("./promise_array.js")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection);
+var CapturedTrace = require("./captured_trace.js")();
+var isDebugging = require("./debuggability.js")(Promise, CapturedTrace);
+ /*jshint unused:false*/
+var createContext =
+ require("./context.js")(Promise, CapturedTrace, isDebugging);
+var CatchFilter = require("./catch_filter.js")(NEXT_FILTER);
+var PromiseResolver = require("./promise_resolver.js");
+var nodebackForPromise = PromiseResolver._nodebackForPromise;
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function Promise(resolver) {
+ if (typeof resolver !== "function") {
+ throw new TypeError("the promise constructor requires a resolver function\u000a\u000a See http://goo.gl/EC22Yn\u000a");
+ }
+ if (this.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/KsIlge\u000a");
+ }
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._progressHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settledValue = undefined;
+ if (resolver !== INTERNAL) this._resolveFromResolver(resolver);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (typeof item === "function") {
+ catchInstances[j++] = item;
+ } else {
+ return Promise.reject(
+ new TypeError("Catch filter must inherit from Error or be a simple predicate function\u000a\u000a See http://goo.gl/o84o68\u000a"));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ var catchFilter = new CatchFilter(catchInstances, fn, this);
+ return this._then(undefined, catchFilter.doFilter, undefined,
+ catchFilter, undefined);
+ }
+ return this._then(undefined, fn, undefined, undefined, undefined);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflect, reflect, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject, didProgress) {
+ if (isDebugging() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject, didProgress) {
+ var promise = this._then(didFulfill, didReject, didProgress,
+ undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (didFulfill, didReject) {
+ return this.all()._then(didFulfill, didReject, undefined, APPLY, undefined);
+};
+
+Promise.prototype.isCancellable = function () {
+ return !this.isResolved() &&
+ this._cancellable();
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = function(fn) {
+ var ret = new Promise(INTERNAL);
+ var result = tryCatch(fn)(nodebackForPromise(ret));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true, true);
+ }
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.defer = Promise.pending = function () {
+ var promise = new Promise(INTERNAL);
+ return new PromiseResolver(promise);
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ var val = ret;
+ ret = new Promise(INTERNAL);
+ ret._fulfillUnchecked(val);
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ var prev = async._schedule;
+ async._schedule = fn;
+ return prev;
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ didProgress,
+ receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var ret = haveInternalData ? internalData : new Promise(INTERNAL);
+
+ if (!haveInternalData) {
+ ret._propagateFrom(this, 4 | 1);
+ ret._captureStackTrace();
+ }
+
+ var target = this._target();
+ if (target !== this) {
+ if (receiver === undefined) receiver = this._boundTo;
+ if (!haveInternalData) ret._setIsMigrated();
+ }
+
+ var callbackIndex =
+ target._addCallbacks(didFulfill, didReject, didProgress, ret, receiver);
+
+ if (target._isResolved() && !target._isSettlePromisesQueued()) {
+ async.invoke(
+ target._settlePromiseAtPostResolution, target, callbackIndex);
+ }
+
+ return ret;
+};
+
+Promise.prototype._settlePromiseAtPostResolution = function (index) {
+ if (this._isRejectionUnhandled()) this._unsetRejectionIsUnhandled();
+ this._settlePromiseAt(index);
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 131071;
+};
+
+Promise.prototype._isFollowingOrFulfilledOrRejected = function () {
+ return (this._bitField & 939524096) > 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 536870912) === 536870912;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -131072) |
+ (len & 131071);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 536870912;
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 33554432;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 33554432) > 0;
+};
+
+Promise.prototype._cancellable = function () {
+ return (this._bitField & 67108864) > 0;
+};
+
+Promise.prototype._setCancellable = function () {
+ this._bitField = this._bitField | 67108864;
+};
+
+Promise.prototype._unsetCancellable = function () {
+ this._bitField = this._bitField & (~67108864);
+};
+
+Promise.prototype._setIsMigrated = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._unsetIsMigrated = function () {
+ this._bitField = this._bitField & (~4194304);
+};
+
+Promise.prototype._isMigrated = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0
+ ? this._receiver0
+ : this[
+ index * 5 - 5 + 4];
+ if (ret === undefined && this._isBound()) {
+ return this._boundTo;
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return index === 0
+ ? this._promise0
+ : this[index * 5 - 5 + 3];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return index === 0
+ ? this._fulfillmentHandler0
+ : this[index * 5 - 5 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return index === 0
+ ? this._rejectionHandler0
+ : this[index * 5 - 5 + 1];
+};
+
+Promise.prototype._migrateCallbacks = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var progress = follower._progressHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (promise instanceof Promise) promise._setIsMigrated();
+ this._addCallbacks(fulfill, reject, progress, promise, receiver);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ progress,
+ promise,
+ receiver
+) {
+ var index = this._length();
+
+ if (index >= 131071 - 5) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ if (receiver !== undefined) this._receiver0 = receiver;
+ if (typeof fulfill === "function" && !this._isCarryingStackTrace())
+ this._fulfillmentHandler0 = fulfill;
+ if (typeof reject === "function") this._rejectionHandler0 = reject;
+ if (typeof progress === "function") this._progressHandler0 = progress;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] = promise;
+ this[base + 4] = receiver;
+ if (typeof fulfill === "function")
+ this[base + 0] = fulfill;
+ if (typeof reject === "function")
+ this[base + 1] = reject;
+ if (typeof progress === "function")
+ this[base + 2] = progress;
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._setProxyHandlers = function (receiver, promiseSlotValue) {
+ var index = this._length();
+
+ if (index >= 131071 - 5) {
+ index = 0;
+ this._setLength(0);
+ }
+ if (index === 0) {
+ this._promise0 = promiseSlotValue;
+ this._receiver0 = receiver;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] = promiseSlotValue;
+ this[base + 4] = receiver;
+ }
+ this._setLength(index + 1);
+};
+
+Promise.prototype._proxyPromiseArray = function (promiseArray, index) {
+ this._setProxyHandlers(promiseArray, index);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false, true);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ var propagationFlags = 1 | (shouldBind ? 4 : 0);
+ this._propagateFrom(maybePromise, propagationFlags);
+ var promise = maybePromise._target();
+ if (promise._isPending()) {
+ var len = this._length();
+ for (var i = 0; i < len; ++i) {
+ promise._migrateCallbacks(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (promise._isFulfilled()) {
+ this._fulfillUnchecked(promise._value());
+ } else {
+ this._rejectUnchecked(promise._reason(),
+ promise._getCarriedStackTrace());
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, shouldNotMarkOriginatingFromRejection) {
+ if (!shouldNotMarkOriginatingFromRejection) {
+ util.markAsOriginatingFromRejection(reason);
+ }
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason, hasStack ? undefined : trace);
+};
+
+Promise.prototype._resolveFromResolver = function (resolver) {
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = tryCatch(resolver)(function(value) {
+ if (promise === null) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }, function (reason) {
+ if (promise === null) return;
+ promise._rejectCallback(reason, synchronous);
+ promise = null;
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined && r === errorObj && promise !== null) {
+ promise._rejectCallback(r.e, true, true);
+ promise = null;
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ if (promise._isRejected()) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY && !this._isRejected()) {
+ x = tryCatch(handler).apply(this._boundTo, value);
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ promise._popContext();
+
+ if (x === errorObj || x === promise || x === NEXT_FILTER) {
+ var err = x === promise ? makeSelfResolutionError() : x.e;
+ promise._rejectCallback(err, false, true);
+ } else {
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._cleanValues = function () {
+ if (this._cancellable()) {
+ this._cancellationParent = undefined;
+ }
+};
+
+Promise.prototype._propagateFrom = function (parent, flags) {
+ if ((flags & 1) > 0 && parent._cancellable()) {
+ this._setCancellable();
+ this._cancellationParent = parent;
+ }
+ if ((flags & 4) > 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+};
+
+Promise.prototype._fulfill = function (value) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._fulfillUnchecked(value);
+};
+
+Promise.prototype._reject = function (reason, carriedStackTrace) {
+ if (this._isFollowingOrFulfilledOrRejected()) return;
+ this._rejectUnchecked(reason, carriedStackTrace);
+};
+
+Promise.prototype._settlePromiseAt = function (index) {
+ var promise = this._promiseAt(index);
+ var isPromise = promise instanceof Promise;
+
+ if (isPromise && promise._isMigrated()) {
+ promise._unsetIsMigrated();
+ return async.invoke(this._settlePromiseAt, this, index);
+ }
+ var handler = this._isFulfilled()
+ ? this._fulfillmentHandlerAt(index)
+ : this._rejectionHandlerAt(index);
+
+ var carriedStackTrace =
+ this._isCarryingStackTrace() ? this._getCarriedStackTrace() : undefined;
+ var value = this._settledValue;
+ var receiver = this._receiverAt(index);
+
+
+ this._clearCallbackDataAtIndex(index);
+
+ if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof PromiseArray) {
+ if (!receiver._isResolved()) {
+ if (this._isFulfilled()) {
+ receiver._promiseFulfilled(value, promise);
+ }
+ else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (this._isFulfilled()) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value, carriedStackTrace);
+ }
+ }
+
+ if (index >= 4 && (index & 31) === 4)
+ async.invokeLater(this._setLength, this, 0);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ if (index === 0) {
+ if (!this._isCarryingStackTrace()) {
+ this._fulfillmentHandler0 = undefined;
+ }
+ this._rejectionHandler0 =
+ this._progressHandler0 =
+ this._receiver0 =
+ this._promise0 = undefined;
+ } else {
+ var base = index * 5 - 5;
+ this[base + 3] =
+ this[base + 4] =
+ this[base + 0] =
+ this[base + 1] =
+ this[base + 2] = undefined;
+ }
+};
+
+Promise.prototype._isSettlePromisesQueued = function () {
+ return (this._bitField &
+ -1073741824) === -1073741824;
+};
+
+Promise.prototype._setSettlePromisesQueued = function () {
+ this._bitField = this._bitField | -1073741824;
+};
+
+Promise.prototype._unsetSettlePromisesQueued = function () {
+ this._bitField = this._bitField & (~-1073741824);
+};
+
+Promise.prototype._queueSettlePromises = function() {
+ async.settlePromises(this);
+ this._setSettlePromisesQueued();
+};
+
+Promise.prototype._fulfillUnchecked = function (value) {
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._rejectUnchecked(err, undefined);
+ }
+ this._setFulfilled();
+ this._settledValue = value;
+ this._cleanValues();
+
+ if (this._length() > 0) {
+ this._queueSettlePromises();
+ }
+};
+
+Promise.prototype._rejectUncheckedCheckError = function (reason) {
+ var trace = util.ensureErrorObject(reason);
+ this._rejectUnchecked(reason, trace === reason ? undefined : trace);
+};
+
+Promise.prototype._rejectUnchecked = function (reason, trace) {
+ if (reason === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._rejectUnchecked(err);
+ }
+ this._setRejected();
+ this._settledValue = reason;
+ this._cleanValues();
+
+ if (this._isFinal()) {
+ async.throwLater(function(e) {
+ if ("stack" in e) {
+ async.invokeFirst(
+ CapturedTrace.unhandledRejection, undefined, e);
+ }
+ throw e;
+ }, trace === undefined ? reason : trace);
+ return;
+ }
+
+ if (trace !== undefined && trace !== reason) {
+ this._setCarriedStackTrace(trace);
+ }
+
+ if (this._length() > 0) {
+ this._queueSettlePromises();
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ this._unsetSettlePromisesQueued();
+ var len = this._length();
+ for (var i = 0; i < len; i++) {
+ this._settlePromiseAt(i);
+ }
+};
+
+Promise._makeSelfResolutionError = makeSelfResolutionError;
+require("./progress.js")(Promise, PromiseArray);
+require("./method.js")(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+require("./bind.js")(Promise, INTERNAL, tryConvertToPromise);
+require("./finally.js")(Promise, NEXT_FILTER, tryConvertToPromise);
+require("./direct_resolve.js")(Promise);
+require("./synchronous_inspection.js")(Promise);
+require("./join.js")(Promise, PromiseArray, tryConvertToPromise, INTERNAL);
+Promise.Promise = Promise;
+require('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL);
+require('./cancel.js')(Promise);
+require('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext);
+require('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise);
+require('./nodeify.js')(Promise);
+require('./call_get.js')(Promise);
+require('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+require('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+require('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL);
+require('./settle.js')(Promise, PromiseArray);
+require('./some.js')(Promise, PromiseArray, apiRejection);
+require('./promisify.js')(Promise, INTERNAL);
+require('./any.js')(Promise);
+require('./each.js')(Promise, INTERNAL);
+require('./timers.js')(Promise, INTERNAL);
+require('./filter.js')(Promise, INTERNAL);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._progressHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ p._settledValue = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ CapturedTrace.setBounds(async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_array.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_array.js
new file mode 100644
index 0000000000..6dac86640a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_array.js
@@ -0,0 +1,142 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection) {
+var util = require("./util.js");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ var parent;
+ if (values instanceof Promise) {
+ parent = values;
+ promise._propagateFrom(parent, 1 | 4);
+ }
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ this._values = values;
+ if (values._isFulfilled()) {
+ values = values._value();
+ if (!isArray(values)) {
+ var err = new Promise.TypeError("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a");
+ this.__hardReject__(err);
+ return;
+ }
+ } else if (values._isPending()) {
+ values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ return;
+ } else {
+ this._reject(values._reason());
+ return;
+ }
+ } else if (!isArray(values)) {
+ this._promise._reject(apiRejection("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a")._reason());
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var promise = this._promise;
+ for (var i = 0; i < len; ++i) {
+ var isResolved = this._isResolved();
+ var maybePromise = tryConvertToPromise(values[i], promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (isResolved) {
+ maybePromise._unsetRejectionIsUnhandled();
+ } else if (maybePromise._isPending()) {
+ maybePromise._proxyPromiseArray(this, i);
+ } else if (maybePromise._isFulfilled()) {
+ this._promiseFulfilled(maybePromise._value(), i);
+ } else {
+ this._promiseRejected(maybePromise._reason(), i);
+ }
+ } else if (!isResolved) {
+ this._promiseFulfilled(maybePromise, i);
+ }
+ }
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype.__hardReject__ =
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false, true);
+};
+
+PromiseArray.prototype._promiseProgressed = function (progressValue, index) {
+ this._promise._progress({
+ index: index,
+ value: progressValue
+ });
+};
+
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ }
+};
+
+PromiseArray.prototype._promiseRejected = function (reason, index) {
+ this._totalResolved++;
+ this._reject(reason);
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_resolver.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_resolver.js
new file mode 100644
index 0000000000..b180a32803
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promise_resolver.js
@@ -0,0 +1,123 @@
+"use strict";
+var util = require("./util.js");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = require("./errors.js");
+var TimeoutError = errors.TimeoutError;
+var OperationalError = errors.OperationalError;
+var haveGetters = util.haveGetters;
+var es5 = require("./es5.js");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise) {
+ return function(err, value) {
+ if (promise === null) return;
+
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (arguments.length > 2) {
+ var $_len = arguments.length;var args = new Array($_len - 1); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];}
+ promise._fulfill(args);
+ } else {
+ promise._fulfill(value);
+ }
+
+ promise = null;
+ };
+}
+
+
+var PromiseResolver;
+if (!haveGetters) {
+ PromiseResolver = function (promise) {
+ this.promise = promise;
+ this.asCallback = nodebackForPromise(promise);
+ this.callback = this.asCallback;
+ };
+}
+else {
+ PromiseResolver = function (promise) {
+ this.promise = promise;
+ };
+}
+if (haveGetters) {
+ var prop = {
+ get: function() {
+ return nodebackForPromise(this.promise);
+ }
+ };
+ es5.defineProperty(PromiseResolver.prototype, "asCallback", prop);
+ es5.defineProperty(PromiseResolver.prototype, "callback", prop);
+}
+
+PromiseResolver._nodebackForPromise = nodebackForPromise;
+
+PromiseResolver.prototype.toString = function () {
+ return "[object PromiseResolver]";
+};
+
+PromiseResolver.prototype.resolve =
+PromiseResolver.prototype.fulfill = function (value) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._resolveCallback(value);
+};
+
+PromiseResolver.prototype.reject = function (reason) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._rejectCallback(reason);
+};
+
+PromiseResolver.prototype.progress = function (value) {
+ if (!(this instanceof PromiseResolver)) {
+ throw new TypeError("Illegal invocation, resolver resolve/reject must be called within a resolver context. Consider using the promise constructor instead.\u000a\u000a See http://goo.gl/sdkXL9\u000a");
+ }
+ this.promise._progress(value);
+};
+
+PromiseResolver.prototype.cancel = function (err) {
+ this.promise.cancel(err);
+};
+
+PromiseResolver.prototype.timeout = function () {
+ this.reject(new TimeoutError("timeout"));
+};
+
+PromiseResolver.prototype.isResolved = function () {
+ return this.promise.isResolved();
+};
+
+PromiseResolver.prototype.toJSON = function () {
+ return this.promise.toJSON();
+};
+
+module.exports = PromiseResolver;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promisify.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promisify.js
new file mode 100644
index 0000000000..bf1114c3b0
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/promisify.js
@@ -0,0 +1,290 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = require("./util.js");
+var nodebackForPromise = require("./promise_resolver.js")
+ ._nodebackForPromise;
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = require("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyPropsPattern =
+ /^(?:length|name|arguments|caller|prototype|__isPromisified__)$/;
+var defaultFilter = function(name, func) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ !util.isClass(func);
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/iWrZbw\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!false) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "INTERNAL","'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ return promise; \n\
+ }; \n\
+ ret.__isPromisified__ = true; \n\
+ return ret; \n\
+ "
+ .replace("Parameters", parameterDeclaration(newParameterCount))
+ .replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode))(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ INTERNAL
+ );
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ return promise;
+ }
+ promisified.__isPromisified__ = true;
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ obj[promisifiedKey] = promisifier === makeNodePromisified
+ ? makeNodePromisified(key, THIS, key, fn, suffix)
+ : promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key, fn, suffix);
+ });
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver) {
+ return makeNodePromisified(callback, receiver, undefined, callback);
+}
+
+Promise.promisify = function (fn, receiver) {
+ if (typeof fn !== "function") {
+ throw new TypeError("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ var ret = promisify(fn, arguments.length < 2 ? THIS : receiver);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/9ITlV0\u000a");
+ }
+ options = Object(options);
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/8FZo5V\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier);
+ promisifyAll(value, suffix, filter, promisifier);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/props.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/props.js
new file mode 100644
index 0000000000..d6f9e64b07
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/props.js
@@ -0,0 +1,79 @@
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = require("./util.js");
+var isObject = util.isObject;
+var es5 = require("./es5.js");
+
+function PropertiesPromiseArray(obj) {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ var values = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ values[i] = obj[key];
+ values[i + len] = key;
+ }
+ this.constructor$(values);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {
+ this._init$(undefined, -3) ;
+};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ this._resolve(val);
+ }
+};
+
+PropertiesPromiseArray.prototype._promiseProgressed = function (value, index) {
+ this._promise._progress({
+ key: this._values[index + this.length()],
+ value: value
+ });
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/OsFKC8\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 4);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/queue.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/queue.js
new file mode 100644
index 0000000000..84d57d5f62
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/queue.js
@@ -0,0 +1,90 @@
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype._unshiftOne = function(value) {
+ var capacity = this._capacity;
+ this._checkCapacity(this.length() + 1);
+ var front = this._front;
+ var i = (((( front - 1 ) &
+ ( capacity - 1) ) ^ capacity ) - capacity );
+ this[i] = value;
+ this._front = i;
+ this._length = this.length() + 1;
+};
+
+Queue.prototype.unshift = function(fn, receiver, arg) {
+ this._unshiftOne(arg);
+ this._unshiftOne(receiver);
+ this._unshiftOne(fn);
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/race.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/race.js
new file mode 100644
index 0000000000..30e7bb094e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/race.js
@@ -0,0 +1,47 @@
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var isArray = require("./util.js").isArray;
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else if (!isArray(promises)) {
+ return apiRejection("expecting an array, a promise or a thenable\u000a\u000a See http://goo.gl/s8MMhc\u000a");
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 4 | 1);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/reduce.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/reduce.js
new file mode 100644
index 0000000000..319222012b
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/reduce.js
@@ -0,0 +1,146 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL) {
+var async = require("./async.js");
+var util = require("./util.js");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+function ReductionPromiseArray(promises, fn, accum, _each) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ this._preservedValues = _each === INTERNAL ? [] : null;
+ this._zerothIsAccum = (accum === undefined);
+ this._gotAccum = false;
+ this._reducingIndex = (this._zerothIsAccum ? 1 : 0);
+ this._valuesPhase = undefined;
+ var maybePromise = tryConvertToPromise(accum, this._promise);
+ var rejected = false;
+ var isPromise = maybePromise instanceof Promise;
+ if (isPromise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ maybePromise._proxyPromiseArray(this, -1);
+ } else if (maybePromise._isFulfilled()) {
+ accum = maybePromise._value();
+ this._gotAccum = true;
+ } else {
+ this._reject(maybePromise._reason());
+ rejected = true;
+ }
+ }
+ if (!(isPromise || this._zerothIsAccum)) this._gotAccum = true;
+ this._callback = fn;
+ this._accum = accum;
+ if (!rejected) async.invoke(init, this, undefined);
+}
+function init() {
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._init = function () {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function () {
+ if (this._gotAccum || this._zerothIsAccum) {
+ this._resolve(this._preservedValues !== null
+ ? [] : this._accum);
+ }
+};
+
+ReductionPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ values[index] = value;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var isEach = preservedValues !== null;
+ var gotAccum = this._gotAccum;
+ var valuesPhase = this._valuesPhase;
+ var valuesPhaseIndex;
+ if (!valuesPhase) {
+ valuesPhase = this._valuesPhase = new Array(length);
+ for (valuesPhaseIndex=0; valuesPhaseIndex<length; ++valuesPhaseIndex) {
+ valuesPhase[valuesPhaseIndex] = 0;
+ }
+ }
+ valuesPhaseIndex = valuesPhase[index];
+
+ if (index === 0 && this._zerothIsAccum) {
+ this._accum = value;
+ this._gotAccum = gotAccum = true;
+ valuesPhase[index] = ((valuesPhaseIndex === 0)
+ ? 1 : 2);
+ } else if (index === -1) {
+ this._accum = value;
+ this._gotAccum = gotAccum = true;
+ } else {
+ if (valuesPhaseIndex === 0) {
+ valuesPhase[index] = 1;
+ } else {
+ valuesPhase[index] = 2;
+ this._accum = value;
+ }
+ }
+ if (!gotAccum) return;
+
+ var callback = this._callback;
+ var receiver = this._promise._boundTo;
+ var ret;
+
+ for (var i = this._reducingIndex; i < length; ++i) {
+ valuesPhaseIndex = valuesPhase[i];
+ if (valuesPhaseIndex === 2) {
+ this._reducingIndex = i + 1;
+ continue;
+ }
+ if (valuesPhaseIndex !== 1) return;
+ value = values[i];
+ this._promise._pushContext();
+ if (isEach) {
+ preservedValues.push(value);
+ ret = tryCatch(callback).call(receiver, value, i, length);
+ }
+ else {
+ ret = tryCatch(callback)
+ .call(receiver, this._accum, value, i, length);
+ }
+ this._promise._popContext();
+
+ if (ret === errorObj) return this._reject(ret.e);
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ if (maybePromise._isPending()) {
+ valuesPhase[i] = 4;
+ return maybePromise._proxyPromiseArray(this, i);
+ } else if (maybePromise._isFulfilled()) {
+ ret = maybePromise._value();
+ } else {
+ return this._reject(maybePromise._reason());
+ }
+ }
+
+ this._reducingIndex = i + 1;
+ this._accum = ret;
+ }
+
+ this._resolve(isEach ? preservedValues : this._accum);
+};
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/schedule.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/schedule.js
new file mode 100644
index 0000000000..08e329926f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/schedule.js
@@ -0,0 +1,35 @@
+"use strict";
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/m3OTXk\u000a");
+};
+if (require("./util.js").isNode) {
+ var version = process.versions.node.split(".").map(Number);
+ schedule = (version[0] === 0 && version[1] > 10) || (version[0] > 0)
+ ? global.setImmediate : process.nextTick;
+
+ if (!schedule) {
+ if (typeof setImmediate !== "undefined") {
+ schedule = setImmediate;
+ } else if (typeof setTimeout !== "undefined") {
+ schedule = setTimeout;
+ } else {
+ schedule = noAsyncScheduler;
+ }
+ }
+} else if (typeof MutationObserver !== "undefined") {
+ schedule = function(fn) {
+ var div = document.createElement("div");
+ var observer = new MutationObserver(fn);
+ observer.observe(div, {attributes: true});
+ return function() { div.classList.toggle("foo"); };
+ };
+ schedule.isStatic = true;
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/settle.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/settle.js
new file mode 100644
index 0000000000..f9299c2589
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/settle.js
@@ -0,0 +1,40 @@
+"use strict";
+module.exports =
+ function(Promise, PromiseArray) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = require("./util.js");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ }
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 268435456;
+ ret._settledValue = value;
+ this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 134217728;
+ ret._settledValue = reason;
+ this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return new SettledPromiseArray(this).promise();
+};
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/some.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/some.js
new file mode 100644
index 0000000000..f3968cf1fa
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/some.js
@@ -0,0 +1,125 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = require("./util.js");
+var RangeError = require("./errors.js").RangeError;
+var AggregateError = require("./errors.js").AggregateError;
+var isArray = util.isArray;
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ }
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ e.push(this._values[i]);
+ }
+ this._reject(e);
+ }
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/1wAmHx\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/synchronous_inspection.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/synchronous_inspection.js
new file mode 100644
index 0000000000..7aac1496d5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/synchronous_inspection.js
@@ -0,0 +1,94 @@
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValue = promise._settledValue;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValue = undefined;
+ }
+}
+
+PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/hc1DLj\u000a");
+ }
+ return this._settledValue;
+};
+
+PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/hPuiwB\u000a");
+ }
+ return this._settledValue;
+};
+
+PromiseInspection.prototype.isFulfilled =
+Promise.prototype._isFulfilled = function () {
+ return (this._bitField & 268435456) > 0;
+};
+
+PromiseInspection.prototype.isRejected =
+Promise.prototype._isRejected = function () {
+ return (this._bitField & 134217728) > 0;
+};
+
+PromiseInspection.prototype.isPending =
+Promise.prototype._isPending = function () {
+ return (this._bitField & 402653184) === 0;
+};
+
+PromiseInspection.prototype.isResolved =
+Promise.prototype._isResolved = function () {
+ return (this._bitField & 402653184) > 0;
+};
+
+Promise.prototype.isPending = function() {
+ return this._target()._isPending();
+};
+
+Promise.prototype.isRejected = function() {
+ return this._target()._isRejected();
+};
+
+Promise.prototype.isFulfilled = function() {
+ return this._target()._isFulfilled();
+};
+
+Promise.prototype.isResolved = function() {
+ return this._target()._isResolved();
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue;
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue;
+};
+
+Promise.prototype.value = function() {
+ var target = this._target();
+ if (!target.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/hc1DLj\u000a");
+ }
+ return target._settledValue;
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ if (!target.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/hPuiwB\u000a");
+ }
+ target._unsetRejectionIsUnhandled();
+ return target._settledValue;
+};
+
+
+Promise.PromiseInspection = PromiseInspection;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/thenables.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/thenables.js
new file mode 100644
index 0000000000..c858f86ab5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/thenables.js
@@ -0,0 +1,89 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = require("./util.js");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) {
+ return obj;
+ }
+ else if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfillUnchecked,
+ ret._rejectUncheckedCheckError,
+ ret._progressUnchecked,
+ ret,
+ null
+ );
+ return ret;
+ }
+ var then = util.tryCatch(getThen)(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function getThen(obj) {
+ return obj.then;
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ return hasProp.call(obj, "_promise0");
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x,
+ resolveFromThenable,
+ rejectFromThenable,
+ progressFromThenable);
+ synchronous = false;
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolveFromThenable(value) {
+ if (!promise) return;
+ if (x === value) {
+ promise._rejectCallback(
+ Promise._makeSelfResolutionError(), false, true);
+ } else {
+ promise._resolveCallback(value);
+ }
+ promise = null;
+ }
+
+ function rejectFromThenable(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+
+ function progressFromThenable(value) {
+ if (!promise) return;
+ if (typeof promise._progress === "function") {
+ promise._progress(value);
+ }
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/timers.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/timers.js
new file mode 100644
index 0000000000..ecf1b57658
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/timers.js
@@ -0,0 +1,58 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = require("./util.js");
+var TimeoutError = Promise.TimeoutError;
+
+var afterTimeout = function (promise, message) {
+ if (!promise.isPending()) return;
+ if (typeof message !== "string") {
+ message = "operation timed out";
+ }
+ var err = new TimeoutError(message);
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._cancel(err);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (value, ms) {
+ if (ms === undefined) {
+ ms = value;
+ value = undefined;
+ var ret = new Promise(INTERNAL);
+ setTimeout(function() { ret._fulfill(); }, ms);
+ return ret;
+ }
+ ms = +ms;
+ return Promise.resolve(value)._then(afterValue, null, null, ms, undefined);
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(this, ms);
+};
+
+function successClear(value) {
+ var handle = this;
+ if (handle instanceof Number) handle = +handle;
+ clearTimeout(handle);
+ return value;
+}
+
+function failureClear(reason) {
+ var handle = this;
+ if (handle instanceof Number) handle = +handle;
+ clearTimeout(handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret = this.then().cancellable();
+ ret._cancellationParent = this;
+ var handle = setTimeout(function timeoutTimeout() {
+ afterTimeout(ret, message);
+ }, ms);
+ return ret._then(successClear, failureClear, undefined, handle, undefined);
+};
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/using.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/using.js
new file mode 100644
index 0000000000..40387117b6
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/using.js
@@ -0,0 +1,202 @@
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext) {
+ var TypeError = require("./errors.js").TypeError;
+ var inherits = require("./util.js").inherits;
+ var PromiseInspection = Promise.PromiseInspection;
+
+ function inspectionMapper(inspections) {
+ var len = inspections.length;
+ for (var i = 0; i < len; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ return Promise.reject(inspection.error());
+ }
+ inspections[i] = inspection._settledValue;
+ }
+ return inspections;
+ }
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = Promise.defer();
+ function iterator() {
+ if (i >= len) return ret.resolve();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret.promise;
+ }
+
+ function disposerSuccess(value) {
+ var inspection = new PromiseInspection();
+ inspection._settledValue = value;
+ inspection._bitField = 268435456;
+ return dispose(this, inspection).thenReturn(value);
+ }
+
+ function disposerFail(reason) {
+ var inspection = new PromiseInspection();
+ inspection._settledValue = reason;
+ inspection._bitField = 134217728;
+ return dispose(this, inspection).thenThrow(reason);
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return null;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== null
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") return apiRejection("fn must be a function\u000a\u000a See http://goo.gl/916lJJ\u000a");
+ len--;
+ var resources = new Array(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = arguments[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var promise = Promise.settle(resources)
+ .then(inspectionMapper)
+ .then(function(vals) {
+ promise._pushContext();
+ var ret;
+ try {
+ ret = fn.apply(undefined, vals);
+ } finally {
+ promise._popContext();
+ }
+ return ret;
+ })
+ ._then(
+ disposerSuccess, disposerFail, undefined, resources, undefined);
+ resources.promise = promise;
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 262144;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 262144) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~262144);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/util.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/util.js
new file mode 100644
index 0000000000..54d7a85562
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/js/main/util.js
@@ -0,0 +1,276 @@
+"use strict";
+var es5 = require("./es5.js");
+var canEvaluate = typeof navigator == "undefined";
+var haveGetters = (function(){
+ try {
+ var o = {};
+ es5.defineProperty(o, "f", {
+ get: function () {
+ return 3;
+ }
+ });
+ return o.f === 3;
+ }
+ catch (e) {
+ return false;
+ }
+
+})();
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+function tryCatcher() {
+ try {
+ return tryCatchTarget.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return !isPrimitive(value);
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+
+var wrapsPrimitiveReceiver = (function() {
+ return this !== "string";
+}).call("string");
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ if (es5.isES5) {
+ var oProto = Object.prototype;
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && obj !== oProto) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ return function(obj) {
+ var ret = [];
+ /*jshint forin:false */
+ for (var key in obj) {
+ ret.push(key);
+ }
+ return ret;
+ };
+ }
+
+})();
+
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+ if (es5.isES5) return keys.length > 1;
+ return keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027*/
+ function f() {}
+ f.prototype = obj;
+ return f;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return obj instanceof Error && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ }
+ }
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ haveGetters: haveGetters,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ wrapsPrimitiveReceiver: wrapsPrimitiveReceiver,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ isNode: typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]"
+};
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/package.json
new file mode 100644
index 0000000000..cbff8a8e01
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/bluebird/package.json
@@ -0,0 +1,96 @@
+{
+ "name": "bluebird",
+ "description": "Full featured Promises/A+ implementation with exceptionally good performance",
+ "version": "2.9.15",
+ "keywords": [
+ "promise",
+ "performance",
+ "promises",
+ "promises-a",
+ "promises-aplus",
+ "async",
+ "await",
+ "deferred",
+ "deferreds",
+ "future",
+ "flow control",
+ "dsl",
+ "fluent interface"
+ ],
+ "scripts": {
+ "lint": "node scripts/jshint.js",
+ "test": "node tools/test.js",
+ "istanbul": "istanbul",
+ "prepublish": "node tools/build.js --no-debug --main --zalgo --browser --minify"
+ },
+ "homepage": "https://github.com/petkaantonov/bluebird",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/petkaantonov/bluebird.git"
+ },
+ "bugs": {
+ "url": "http://github.com/petkaantonov/bluebird/issues"
+ },
+ "license": "MIT",
+ "author": {
+ "name": "Petka Antonov",
+ "email": "petka_antonov@hotmail.com",
+ "url": "http://github.com/petkaantonov/"
+ },
+ "devDependencies": {
+ "acorn": "~0.6.0",
+ "baconjs": "^0.7.43",
+ "bluebird": "^2.9.2",
+ "body-parser": "^1.10.2",
+ "browserify": "^8.1.1",
+ "cli-table": "~0.3.1",
+ "co": "^4.2.0",
+ "cross-spawn": "^0.2.3",
+ "glob": "^4.3.2",
+ "grunt-saucelabs": "~8.4.1",
+ "highland": "^2.3.0",
+ "istanbul": "^0.3.5",
+ "jshint": "^2.6.0",
+ "jshint-stylish": "~0.2.0",
+ "mkdirp": "~0.5.0",
+ "mocha": "~2.1",
+ "open": "~0.0.5",
+ "optimist": "~0.6.1",
+ "rimraf": "~2.2.6",
+ "rx": "^2.3.25",
+ "serve-static": "^1.7.1",
+ "sinon": "~1.7.3",
+ "uglify-js": "~2.4.16"
+ },
+ "main": "./js/main/bluebird.js",
+ "browser": "./js/browser/bluebird.js",
+ "files": [
+ "js/browser",
+ "js/main",
+ "js/zalgo",
+ "LICENSE",
+ "zalgo.js"
+ ],
+ "gitHead": "d5e06c2648b8be3c47cb5b6cb95f2bddf79c4c0a",
+ "_id": "bluebird@2.9.15",
+ "_shasum": "80b37137c1dee42efac86486b0afc5f858354ab0",
+ "_from": "bluebird@>=2.9.14 <3.0.0",
+ "_npmVersion": "2.7.0",
+ "_nodeVersion": "1.5.1",
+ "_npmUser": {
+ "name": "esailija",
+ "email": "petka_antonov@hotmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "esailija",
+ "email": "petka_antonov@hotmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "80b37137c1dee42efac86486b0afc5f858354ab0",
+ "tarball": "http://registry.npmjs.org/bluebird/-/bluebird-2.9.15.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/bluebird/-/bluebird-2.9.15.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/index.js
new file mode 100644
index 0000000000..4138a64dd9
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/index.js
@@ -0,0 +1,100 @@
+'use strict';
+var escapeStringRegexp = require('escape-string-regexp');
+var ansiStyles = require('ansi-styles');
+var stripAnsi = require('strip-ansi');
+var hasAnsi = require('has-ansi');
+var supportsColor = require('supports-color');
+var defineProps = Object.defineProperties;
+
+function Chalk(options) {
+ // detect mode if not set manually
+ this.enabled = !options || options.enabled === undefined ? supportsColor : options.enabled;
+}
+
+// use bright blue on Windows as the normal blue color is illegible
+if (process.platform === 'win32') {
+ ansiStyles.blue.open = '\u001b[94m';
+}
+
+function build(_styles) {
+ var builder = function builder() {
+ return applyStyle.apply(builder, arguments);
+ };
+ builder._styles = _styles;
+ builder.enabled = this.enabled;
+ // __proto__ is used because we must return a function, but there is
+ // no way to create a function with a different prototype.
+ builder.__proto__ = proto;
+ return builder;
+}
+
+var styles = (function () {
+ var ret = {};
+
+ Object.keys(ansiStyles).forEach(function (key) {
+ ansiStyles[key].closeRe = new RegExp(escapeStringRegexp(ansiStyles[key].close), 'g');
+
+ ret[key] = {
+ get: function () {
+ return build.call(this, this._styles.concat(key));
+ }
+ };
+ });
+
+ return ret;
+})();
+
+var proto = defineProps(function chalk() {}, styles);
+
+function applyStyle() {
+ // support varags, but simply cast to string in case there's only one arg
+ var args = arguments;
+ var argsLen = args.length;
+ var str = argsLen !== 0 && String(arguments[0]);
+ if (argsLen > 1) {
+ // don't slice `arguments`, it prevents v8 optimizations
+ for (var a = 1; a < argsLen; a++) {
+ str += ' ' + args[a];
+ }
+ }
+
+ if (!this.enabled || !str) {
+ return str;
+ }
+
+ /*jshint validthis: true */
+ var nestedStyles = this._styles;
+
+ var i = nestedStyles.length;
+ while (i--) {
+ var code = ansiStyles[nestedStyles[i]];
+ // Replace any instances already present with a re-opening code
+ // otherwise only the part of the string until said closing code
+ // will be colored, and the rest will simply be 'plain'.
+ str = code.open + str.replace(code.closeRe, code.open) + code.close;
+ }
+
+ return str;
+}
+
+function init() {
+ var ret = {};
+
+ Object.keys(styles).forEach(function (name) {
+ ret[name] = {
+ get: function () {
+ return build.call(this, [name]);
+ }
+ };
+ });
+
+ return ret;
+}
+
+defineProps(Chalk.prototype, init());
+
+module.exports = new Chalk();
+module.exports.styles = ansiStyles;
+module.exports.hasColor = hasAnsi;
+module.exports.stripColor = stripAnsi;
+module.exports.supportsColor = supportsColor;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/index.js
new file mode 100644
index 0000000000..caf9e119eb
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/index.js
@@ -0,0 +1,56 @@
+'use strict';
+
+var styles = module.exports = {
+ modifiers: {
+ reset: [0, 0],
+ bold: [1, 22], // 21 isn't widely supported and 22 does the same thing
+ dim: [2, 22],
+ italic: [3, 23],
+ underline: [4, 24],
+ inverse: [7, 27],
+ hidden: [8, 28],
+ strikethrough: [9, 29]
+ },
+ colors: {
+ black: [30, 39],
+ red: [31, 39],
+ green: [32, 39],
+ yellow: [33, 39],
+ blue: [34, 39],
+ magenta: [35, 39],
+ cyan: [36, 39],
+ white: [37, 39],
+ gray: [90, 39]
+ },
+ bgColors: {
+ bgBlack: [40, 49],
+ bgRed: [41, 49],
+ bgGreen: [42, 49],
+ bgYellow: [43, 49],
+ bgBlue: [44, 49],
+ bgMagenta: [45, 49],
+ bgCyan: [46, 49],
+ bgWhite: [47, 49]
+ }
+};
+
+// fix humans
+styles.colors.grey = styles.colors.gray;
+
+Object.keys(styles).forEach(function (groupName) {
+ var group = styles[groupName];
+
+ Object.keys(group).forEach(function (styleName) {
+ var style = group[styleName];
+
+ styles[styleName] = group[styleName] = {
+ open: '\u001b[' + style[0] + 'm',
+ close: '\u001b[' + style[1] + 'm'
+ };
+ });
+
+ Object.defineProperty(styles, groupName, {
+ value: group,
+ enumerable: false
+ });
+});
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/package.json
new file mode 100644
index 0000000000..e670f250a7
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "ansi-styles",
+ "version": "2.0.1",
+ "description": "ANSI escape codes for styling strings in the terminal",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/ansi-styles"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "log",
+ "logging",
+ "command-line",
+ "text"
+ ],
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "da6541334e1681cb803f891fab8abf4313cc4bc1",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/ansi-styles/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/ansi-styles",
+ "_id": "ansi-styles@2.0.1",
+ "_shasum": "b033f57f93e2d28adeb8bc11138fa13da0fd20a3",
+ "_from": "ansi-styles@>=2.0.1 <3.0.0",
+ "_npmVersion": "2.1.16",
+ "_nodeVersion": "0.10.35",
+ "_npmUser": {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ },
+ "dist": {
+ "shasum": "b033f57f93e2d28adeb8bc11138fa13da0fd20a3",
+ "tarball": "http://registry.npmjs.org/ansi-styles/-/ansi-styles-2.0.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ansi-styles/-/ansi-styles-2.0.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/readme.md
new file mode 100644
index 0000000000..89ec6a7c1e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/ansi-styles/readme.md
@@ -0,0 +1,86 @@
+# ansi-styles [![Build Status](https://travis-ci.org/sindresorhus/ansi-styles.svg?branch=master)](https://travis-ci.org/sindresorhus/ansi-styles)
+
+> [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code#Colors_and_Styles) for styling strings in the terminal
+
+You probably want the higher-level [chalk](https://github.com/sindresorhus/chalk) module for styling your strings.
+
+![](screenshot.png)
+
+
+## Install
+
+```sh
+$ npm install --save ansi-styles
+```
+
+
+## Usage
+
+```js
+var ansi = require('ansi-styles');
+
+console.log(ansi.green.open + 'Hello world!' + ansi.green.close);
+```
+
+
+## API
+
+Each style has an `open` and `close` property.
+
+
+## Styles
+
+### Modifiers
+
+- `reset`
+- `bold`
+- `dim`
+- `italic` *(not widely supported)*
+- `underline`
+- `inverse`
+- `hidden`
+- `strikethrough` *(not widely supported)*
+
+### Colors
+
+- `black`
+- `red`
+- `green`
+- `yellow`
+- `blue`
+- `magenta`
+- `cyan`
+- `white`
+- `gray`
+
+### Background colors
+
+- `bgBlack`
+- `bgRed`
+- `bgGreen`
+- `bgYellow`
+- `bgBlue`
+- `bgMagenta`
+- `bgCyan`
+- `bgWhite`
+
+
+## Advanced usage
+
+By default you get a map of styles, but the styles are also available as groups. They are non-enumerable so they don't show up unless you access them explicitly. This makes it easier to expose only a subset in a higher-level module.
+
+- `ansi.modifiers`
+- `ansi.colors`
+- `ansi.bgColors`
+
+
+###### Example
+
+```js
+console.log(ansi.colors.green.open);
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/index.js
new file mode 100644
index 0000000000..ac6572cabe
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/index.js
@@ -0,0 +1,11 @@
+'use strict';
+
+var matchOperatorsRe = /[|\\{}()[\]^$+*?.]/g;
+
+module.exports = function (str) {
+ if (typeof str !== 'string') {
+ throw new TypeError('Expected a string');
+ }
+
+ return str.replace(matchOperatorsRe, '\\$&');
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/package.json
new file mode 100644
index 0000000000..749f5ded2a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/package.json
@@ -0,0 +1,70 @@
+{
+ "name": "escape-string-regexp",
+ "version": "1.0.3",
+ "description": "Escape RegExp special characters",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/escape-string-regexp"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "engines": {
+ "node": ">=0.8.0"
+ },
+ "scripts": {
+ "test": "mocha"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "regex",
+ "regexp",
+ "re",
+ "regular",
+ "expression",
+ "escape",
+ "string",
+ "str",
+ "special",
+ "characters"
+ ],
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "1e446e6b4449b5f1f8868cd31bf8fd25ee37fb4b",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/escape-string-regexp/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/escape-string-regexp",
+ "_id": "escape-string-regexp@1.0.3",
+ "_shasum": "9e2d8b25bc2555c3336723750e03f099c2735bb5",
+ "_from": "escape-string-regexp@>=1.0.2 <2.0.0",
+ "_npmVersion": "2.1.16",
+ "_nodeVersion": "0.10.35",
+ "_npmUser": {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ },
+ "dist": {
+ "shasum": "9e2d8b25bc2555c3336723750e03f099c2735bb5",
+ "tarball": "http://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/escape-string-regexp/-/escape-string-regexp-1.0.3.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/readme.md
new file mode 100644
index 0000000000..808a963a86
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/escape-string-regexp/readme.md
@@ -0,0 +1,27 @@
+# escape-string-regexp [![Build Status](https://travis-ci.org/sindresorhus/escape-string-regexp.svg?branch=master)](https://travis-ci.org/sindresorhus/escape-string-regexp)
+
+> Escape RegExp special characters
+
+
+## Install
+
+```sh
+$ npm install --save escape-string-regexp
+```
+
+
+## Usage
+
+```js
+var escapeStringRegexp = require('escape-string-regexp');
+
+var escapedString = escapeStringRegexp('how much $ for a unicorn?');
+//=> how much \$ for a unicorn\?
+
+new RegExp(escapedString);
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/cli.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/cli.js
new file mode 100755
index 0000000000..0386a82423
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/cli.js
@@ -0,0 +1,45 @@
+#!/usr/bin/env node
+'use strict';
+var stdin = require('get-stdin');
+var pkg = require('./package.json');
+var hasAnsi = require('./');
+var argv = process.argv.slice(2);
+var input = argv[0];
+
+function help() {
+ console.log([
+ '',
+ ' ' + pkg.description,
+ '',
+ ' Usage',
+ ' has-ansi <string>',
+ ' echo <string> | has-ansi',
+ '',
+ ' Exits with code 0 if input has ANSI escape codes and 1 if not'
+ ].join('\n'));
+}
+
+function init(data) {
+ process.exit(hasAnsi(data) ? 0 : 1);
+}
+
+if (argv.indexOf('--help') !== -1) {
+ help();
+ return;
+}
+
+if (argv.indexOf('--version') !== -1) {
+ console.log(pkg.version);
+ return;
+}
+
+if (process.stdin.isTTY) {
+ if (!input) {
+ help();
+ return;
+ }
+
+ init(input);
+} else {
+ stdin(init);
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/index.js
new file mode 100644
index 0000000000..98fae06767
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/index.js
@@ -0,0 +1,4 @@
+'use strict';
+var ansiRegex = require('ansi-regex');
+var re = new RegExp(ansiRegex().source); // remove the `g` flag
+module.exports = re.test.bind(re);
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/index.js
new file mode 100644
index 0000000000..2fcdd1e472
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/index.js
@@ -0,0 +1,4 @@
+'use strict';
+module.exports = function () {
+ return /(?:(?:\u001b\[)|\u009b)(?:(?:[0-9]{1,3})?(?:(?:;[0-9]{0,3})*)?[A-M|f-m])|\u001b[A-M]/g;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/package.json
new file mode 100644
index 0000000000..7b31fa699c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/package.json
@@ -0,0 +1,86 @@
+{
+ "name": "ansi-regex",
+ "version": "1.1.1",
+ "description": "Regular expression for matching ANSI escape codes",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/ansi-regex"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha test/test.js",
+ "view-supported": "node test/viewCodes.js"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "command-line",
+ "text",
+ "regex",
+ "regexp",
+ "re",
+ "match",
+ "test",
+ "find",
+ "pattern"
+ ],
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "47fb974630af70998157b30fad6eb5e5bd7c7cd6",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/ansi-regex/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/ansi-regex",
+ "_id": "ansi-regex@1.1.1",
+ "_shasum": "41c847194646375e6a1a5d10c3ca054ef9fc980d",
+ "_from": "ansi-regex@>=1.1.0 <2.0.0",
+ "_npmVersion": "2.1.16",
+ "_nodeVersion": "0.10.35",
+ "_npmUser": {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ },
+ "dist": {
+ "shasum": "41c847194646375e6a1a5d10c3ca054ef9fc980d",
+ "tarball": "http://registry.npmjs.org/ansi-regex/-/ansi-regex-1.1.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-1.1.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/readme.md
new file mode 100644
index 0000000000..ae876e7292
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/ansi-regex/readme.md
@@ -0,0 +1,33 @@
+# ansi-regex [![Build Status](https://travis-ci.org/sindresorhus/ansi-regex.svg?branch=master)](https://travis-ci.org/sindresorhus/ansi-regex)
+
+> Regular expression for matching [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code)
+
+
+## Install
+
+```sh
+$ npm install --save ansi-regex
+```
+
+
+## Usage
+
+```js
+var ansiRegex = require('ansi-regex');
+
+ansiRegex().test('\u001b[4mcake\u001b[0m');
+//=> true
+
+ansiRegex().test('cake');
+//=> false
+
+'\u001b[4mcake\u001b[0m'.match(ansiRegex());
+//=> ['\u001b[4m', '\u001b[0m']
+```
+
+*It's a function so you can create multiple instances. Regexes with the global flag will have the `.lastIndex` property changed for each call to methods on the instance. Therefore reusing the instance with multiple calls will not work as expected for `.test()`.*
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/index.js
new file mode 100644
index 0000000000..0f1aeb3df4
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/index.js
@@ -0,0 +1,49 @@
+'use strict';
+
+module.exports = function (cb) {
+ var stdin = process.stdin;
+ var ret = '';
+
+ if (stdin.isTTY) {
+ setImmediate(cb, '');
+ return;
+ }
+
+ stdin.setEncoding('utf8');
+
+ stdin.on('readable', function () {
+ var chunk;
+
+ while (chunk = stdin.read()) {
+ ret += chunk;
+ }
+ });
+
+ stdin.on('end', function () {
+ cb(ret);
+ });
+};
+
+module.exports.buffer = function (cb) {
+ var stdin = process.stdin;
+ var ret = [];
+ var len = 0;
+
+ if (stdin.isTTY) {
+ setImmediate(cb, new Buffer(''));
+ return;
+ }
+
+ stdin.on('readable', function () {
+ var chunk;
+
+ while (chunk = stdin.read()) {
+ ret.push(chunk);
+ len += chunk.length;
+ }
+ });
+
+ stdin.on('end', function () {
+ cb(Buffer.concat(ret, len));
+ });
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/package.json
new file mode 100644
index 0000000000..e0e5c64a0f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/package.json
@@ -0,0 +1,64 @@
+{
+ "name": "get-stdin",
+ "version": "4.0.1",
+ "description": "Easier stdin",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/get-stdin"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "node test.js && node test-buffer.js && echo unicorns | node test-real.js"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "std",
+ "stdin",
+ "stdio",
+ "concat",
+ "buffer",
+ "stream",
+ "process",
+ "stream"
+ ],
+ "devDependencies": {
+ "ava": "0.0.4",
+ "buffer-equal": "0.0.1"
+ },
+ "gitHead": "65c744975229b25d6cc5c7546f49b6ad9099553f",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/get-stdin/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/get-stdin",
+ "_id": "get-stdin@4.0.1",
+ "_shasum": "b968c6b0a04384324902e8bf1a5df32579a450fe",
+ "_from": "get-stdin@>=4.0.1 <5.0.0",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "b968c6b0a04384324902e8bf1a5df32579a450fe",
+ "tarball": "http://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/get-stdin/-/get-stdin-4.0.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/readme.md
new file mode 100644
index 0000000000..bc1d32a8ad
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/node_modules/get-stdin/readme.md
@@ -0,0 +1,44 @@
+# get-stdin [![Build Status](https://travis-ci.org/sindresorhus/get-stdin.svg?branch=master)](https://travis-ci.org/sindresorhus/get-stdin)
+
+> Easier stdin
+
+
+## Install
+
+```sh
+$ npm install --save get-stdin
+```
+
+
+## Usage
+
+```js
+// example.js
+var stdin = require('get-stdin');
+
+stdin(function (data) {
+ console.log(data);
+ //=> unicorns
+});
+```
+
+```sh
+$ echo unicorns | node example.js
+unicorns
+```
+
+
+## API
+
+### stdin(callback)
+
+Get `stdin` as a string.
+
+### stdin.buffer(callback)
+
+Get `stdin` as a buffer.
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/package.json
new file mode 100644
index 0000000000..43582f8708
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/package.json
@@ -0,0 +1,92 @@
+{
+ "name": "has-ansi",
+ "version": "1.0.3",
+ "description": "Check if a string has ANSI escape codes",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/has-ansi"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "bin": {
+ "has-ansi": "cli.js"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha"
+ },
+ "files": [
+ "index.js",
+ "cli.js"
+ ],
+ "keywords": [
+ "cli",
+ "bin",
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "string",
+ "tty",
+ "escape",
+ "shell",
+ "xterm",
+ "command-line",
+ "text",
+ "regex",
+ "regexp",
+ "re",
+ "match",
+ "test",
+ "find",
+ "pattern",
+ "has"
+ ],
+ "dependencies": {
+ "ansi-regex": "^1.1.0",
+ "get-stdin": "^4.0.1"
+ },
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "416428ed16f8e9718aec54cea083173af6019917",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/has-ansi/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/has-ansi",
+ "_id": "has-ansi@1.0.3",
+ "_shasum": "c0b5b1615d9e382b0ff67169d967b425e48ca538",
+ "_from": "has-ansi@>=1.0.3 <2.0.0",
+ "_npmVersion": "2.1.16",
+ "_nodeVersion": "0.10.35",
+ "_npmUser": {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ },
+ "dist": {
+ "shasum": "c0b5b1615d9e382b0ff67169d967b425e48ca538",
+ "tarball": "http://registry.npmjs.org/has-ansi/-/has-ansi-1.0.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/has-ansi/-/has-ansi-1.0.3.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/readme.md
new file mode 100644
index 0000000000..0fa149a82a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/has-ansi/readme.md
@@ -0,0 +1,45 @@
+# has-ansi [![Build Status](https://travis-ci.org/sindresorhus/has-ansi.svg?branch=master)](https://travis-ci.org/sindresorhus/has-ansi)
+
+> Check if a string has [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code)
+
+
+## Install
+
+```sh
+$ npm install --save has-ansi
+```
+
+
+## Usage
+
+```js
+var hasAnsi = require('has-ansi');
+
+hasAnsi('\u001b[4mcake\u001b[0m');
+//=> true
+
+hasAnsi('cake');
+//=> false
+```
+
+
+## CLI
+
+```sh
+$ npm install --global has-ansi
+```
+
+```
+$ has-ansi --help
+
+ Usage
+ has-ansi <string>
+ echo <string> | has-ansi
+
+ Exits with code 0 if input has ANSI escape codes and 1 if not
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/cli.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/cli.js
new file mode 100755
index 0000000000..b83f63b907
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/cli.js
@@ -0,0 +1,47 @@
+#!/usr/bin/env node
+'use strict';
+var fs = require('fs');
+var pkg = require('./package.json');
+var stripAnsi = require('./');
+var argv = process.argv.slice(2);
+var input = argv[0];
+
+function help() {
+ console.log([
+ '',
+ ' ' + pkg.description,
+ '',
+ ' Usage',
+ ' strip-ansi <input-file> > <output-file>',
+ ' cat <input-file> | strip-ansi > <output-file>',
+ '',
+ ' Example',
+ ' strip-ansi unicorn.txt > unicorn-stripped.txt'
+ ].join('\n'));
+}
+
+function init(data) {
+ process.stdout.write(stripAnsi(data));
+}
+
+if (argv.indexOf('--help') !== -1) {
+ help();
+ return;
+}
+
+if (argv.indexOf('--version') !== -1) {
+ console.log(pkg.version);
+ return;
+}
+
+if (!input && process.stdin.isTTY) {
+ help();
+ return;
+}
+
+if (input) {
+ init(fs.readFileSync(input, 'utf8'));
+} else {
+ process.stdin.setEncoding('utf8');
+ process.stdin.on('data', init);
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/index.js
new file mode 100644
index 0000000000..099480fbfc
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/index.js
@@ -0,0 +1,6 @@
+'use strict';
+var ansiRegex = require('ansi-regex')();
+
+module.exports = function (str) {
+ return typeof str === 'string' ? str.replace(ansiRegex, '') : str;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/index.js
new file mode 100644
index 0000000000..2fcdd1e472
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/index.js
@@ -0,0 +1,4 @@
+'use strict';
+module.exports = function () {
+ return /(?:(?:\u001b\[)|\u009b)(?:(?:[0-9]{1,3})?(?:(?:;[0-9]{0,3})*)?[A-M|f-m])|\u001b[A-M]/g;
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/package.json
new file mode 100644
index 0000000000..7b31fa699c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/package.json
@@ -0,0 +1,86 @@
+{
+ "name": "ansi-regex",
+ "version": "1.1.1",
+ "description": "Regular expression for matching ANSI escape codes",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/ansi-regex"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha test/test.js",
+ "view-supported": "node test/viewCodes.js"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "command-line",
+ "text",
+ "regex",
+ "regexp",
+ "re",
+ "match",
+ "test",
+ "find",
+ "pattern"
+ ],
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "47fb974630af70998157b30fad6eb5e5bd7c7cd6",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/ansi-regex/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/ansi-regex",
+ "_id": "ansi-regex@1.1.1",
+ "_shasum": "41c847194646375e6a1a5d10c3ca054ef9fc980d",
+ "_from": "ansi-regex@>=1.1.0 <2.0.0",
+ "_npmVersion": "2.1.16",
+ "_nodeVersion": "0.10.35",
+ "_npmUser": {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ },
+ "dist": {
+ "shasum": "41c847194646375e6a1a5d10c3ca054ef9fc980d",
+ "tarball": "http://registry.npmjs.org/ansi-regex/-/ansi-regex-1.1.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ansi-regex/-/ansi-regex-1.1.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/readme.md
new file mode 100644
index 0000000000..ae876e7292
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/node_modules/ansi-regex/readme.md
@@ -0,0 +1,33 @@
+# ansi-regex [![Build Status](https://travis-ci.org/sindresorhus/ansi-regex.svg?branch=master)](https://travis-ci.org/sindresorhus/ansi-regex)
+
+> Regular expression for matching [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code)
+
+
+## Install
+
+```sh
+$ npm install --save ansi-regex
+```
+
+
+## Usage
+
+```js
+var ansiRegex = require('ansi-regex');
+
+ansiRegex().test('\u001b[4mcake\u001b[0m');
+//=> true
+
+ansiRegex().test('cake');
+//=> false
+
+'\u001b[4mcake\u001b[0m'.match(ansiRegex());
+//=> ['\u001b[4m', '\u001b[0m']
+```
+
+*It's a function so you can create multiple instances. Regexes with the global flag will have the `.lastIndex` property changed for each call to methods on the instance. Therefore reusing the instance with multiple calls will not work as expected for `.test()`.*
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/package.json
new file mode 100644
index 0000000000..44c71ffb20
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/package.json
@@ -0,0 +1,89 @@
+{
+ "name": "strip-ansi",
+ "version": "2.0.1",
+ "description": "Strip ANSI escape codes",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/strip-ansi"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "http://sindresorhus.com"
+ },
+ "bin": {
+ "strip-ansi": "cli.js"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha"
+ },
+ "files": [
+ "index.js",
+ "cli.js"
+ ],
+ "keywords": [
+ "strip",
+ "trim",
+ "remove",
+ "ansi",
+ "styles",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "tty",
+ "escape",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "log",
+ "logging",
+ "command-line",
+ "text"
+ ],
+ "dependencies": {
+ "ansi-regex": "^1.0.0"
+ },
+ "devDependencies": {
+ "mocha": "*"
+ },
+ "gitHead": "1eff0936c01f89efa312d9d51deed137259871a1",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/strip-ansi/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/strip-ansi",
+ "_id": "strip-ansi@2.0.1",
+ "_shasum": "df62c1aa94ed2f114e1d0f21fd1d50482b79a60e",
+ "_from": "strip-ansi@>=2.0.1 <3.0.0",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "dist": {
+ "shasum": "df62c1aa94ed2f114e1d0f21fd1d50482b79a60e",
+ "tarball": "http://registry.npmjs.org/strip-ansi/-/strip-ansi-2.0.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/strip-ansi/-/strip-ansi-2.0.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/readme.md
new file mode 100644
index 0000000000..53ec26436c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/strip-ansi/readme.md
@@ -0,0 +1,43 @@
+# strip-ansi [![Build Status](https://travis-ci.org/sindresorhus/strip-ansi.svg?branch=master)](https://travis-ci.org/sindresorhus/strip-ansi)
+
+> Strip [ANSI escape codes](http://en.wikipedia.org/wiki/ANSI_escape_code)
+
+
+## Install
+
+```sh
+$ npm install --save strip-ansi
+```
+
+
+## Usage
+
+```js
+var stripAnsi = require('strip-ansi');
+
+stripAnsi('\u001b[4mcake\u001b[0m');
+//=> 'cake'
+```
+
+
+## CLI
+
+```sh
+$ npm install --global strip-ansi
+```
+
+```sh
+$ strip-ansi --help
+
+ Usage
+ strip-ansi <input-file> > <output-file>
+ cat <input-file> | strip-ansi > <output-file>
+
+ Example
+ strip-ansi unicorn.txt > unicorn-stripped.txt
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/cli.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/cli.js
new file mode 100755
index 0000000000..e746987666
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/cli.js
@@ -0,0 +1,29 @@
+#!/usr/bin/env node
+'use strict';
+var pkg = require('./package.json');
+var supportsColor = require('./');
+var argv = process.argv.slice(2);
+
+function help() {
+ console.log([
+ '',
+ ' ' + pkg.description,
+ '',
+ ' Usage',
+ ' supports-color',
+ '',
+ ' Exits with code 0 if color is supported and 1 if not'
+ ].join('\n'));
+}
+
+if (argv.indexOf('--help') !== -1) {
+ help();
+ return;
+}
+
+if (argv.indexOf('--version') !== -1) {
+ console.log(pkg.version);
+ return;
+}
+
+process.exit(supportsColor ? 0 : 1);
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/index.js
new file mode 100644
index 0000000000..a17196485d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/index.js
@@ -0,0 +1,43 @@
+'use strict';
+var argv = process.argv;
+
+module.exports = (function () {
+ if ('FORCE_COLOR' in process.env) {
+ return true;
+ }
+
+ if (argv.indexOf('--no-color') !== -1 ||
+ argv.indexOf('--no-colors') !== -1 ||
+ argv.indexOf('--color=false') !== -1) {
+ return false;
+ }
+
+ if (argv.indexOf('--color') !== -1 ||
+ argv.indexOf('--colors') !== -1 ||
+ argv.indexOf('--color=true') !== -1 ||
+ argv.indexOf('--color=always') !== -1) {
+ return true;
+ }
+
+ if (process.stdout && !process.stdout.isTTY) {
+ return false;
+ }
+
+ if (process.platform === 'win32') {
+ return true;
+ }
+
+ if ('COLORTERM' in process.env) {
+ return true;
+ }
+
+ if (process.env.TERM === 'dumb') {
+ return false;
+ }
+
+ if (/^screen|^xterm|^vt100|color|ansi|cygwin|linux/i.test(process.env.TERM)) {
+ return true;
+ }
+
+ return false;
+})();
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/license b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/license
new file mode 100644
index 0000000000..654d0bfe94
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/license
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/package.json
new file mode 100644
index 0000000000..0a52c0d1ed
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/package.json
@@ -0,0 +1,85 @@
+{
+ "name": "supports-color",
+ "version": "1.3.1",
+ "description": "Detect whether a terminal supports color",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/supports-color"
+ },
+ "author": {
+ "name": "Sindre Sorhus",
+ "email": "sindresorhus@gmail.com",
+ "url": "sindresorhus.com"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "bin": {
+ "supports-color": "cli.js"
+ },
+ "engines": {
+ "node": ">=0.8.0"
+ },
+ "scripts": {
+ "test": "mocha"
+ },
+ "files": [
+ "index.js",
+ "cli.js"
+ ],
+ "keywords": [
+ "cli",
+ "bin",
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "ansi",
+ "styles",
+ "tty",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "command-line",
+ "support",
+ "supports",
+ "capability",
+ "detect"
+ ],
+ "devDependencies": {
+ "mocha": "*",
+ "require-uncached": "^1.0.2"
+ },
+ "gitHead": "09f1b4c336cee7269b4c8b3a8880054a23fcb35e",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/supports-color/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/supports-color",
+ "_id": "supports-color@1.3.1",
+ "_shasum": "15758df09d8ff3b4acc307539fabe27095e1042d",
+ "_from": "supports-color@>=1.3.0 <2.0.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ "dist": {
+ "shasum": "15758df09d8ff3b4acc307539fabe27095e1042d",
+ "tarball": "http://registry.npmjs.org/supports-color/-/supports-color-1.3.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/supports-color/-/supports-color-1.3.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/readme.md
new file mode 100644
index 0000000000..fe6016f9d0
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/node_modules/supports-color/readme.md
@@ -0,0 +1,46 @@
+# supports-color [![Build Status](https://travis-ci.org/sindresorhus/supports-color.svg?branch=master)](https://travis-ci.org/sindresorhus/supports-color)
+
+> Detect whether a terminal supports color
+
+
+## Install
+
+```
+$ npm install --save supports-color
+```
+
+
+## Usage
+
+```js
+var supportsColor = require('supports-color');
+
+if (supportsColor) {
+ console.log('Terminal supports color');
+}
+```
+
+It obeys the `--color` and `--no-color` CLI flags.
+
+For situations where using `--color` is not possible, add an environment variable `FORCE_COLOR` with any value to force color. Trumps `--no-color`.
+
+
+## CLI
+
+```
+$ npm install --global supports-color
+```
+
+```
+$ supports-color --help
+
+ Usage
+ supports-color
+
+ Exits with code 0 if color is supported and 1 if not
+```
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/package.json
new file mode 100644
index 0000000000..93055c07c0
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/package.json
@@ -0,0 +1,83 @@
+{
+ "name": "chalk",
+ "version": "1.0.0",
+ "description": "Terminal string styling done right. Much color.",
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/sindresorhus/chalk"
+ },
+ "maintainers": [
+ {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ {
+ "name": "jbnicolai",
+ "email": "jappelman@xebia.com"
+ }
+ ],
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "scripts": {
+ "test": "mocha",
+ "bench": "matcha benchmark.js"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "color",
+ "colour",
+ "colors",
+ "terminal",
+ "console",
+ "cli",
+ "string",
+ "ansi",
+ "styles",
+ "tty",
+ "formatting",
+ "rgb",
+ "256",
+ "shell",
+ "xterm",
+ "log",
+ "logging",
+ "command-line",
+ "text"
+ ],
+ "dependencies": {
+ "ansi-styles": "^2.0.1",
+ "escape-string-regexp": "^1.0.2",
+ "has-ansi": "^1.0.3",
+ "strip-ansi": "^2.0.1",
+ "supports-color": "^1.3.0"
+ },
+ "devDependencies": {
+ "matcha": "^0.6.0",
+ "mocha": "*"
+ },
+ "gitHead": "8864d3563313ed15574a38dd5c9d5966080c46ce",
+ "bugs": {
+ "url": "https://github.com/sindresorhus/chalk/issues"
+ },
+ "homepage": "https://github.com/sindresorhus/chalk",
+ "_id": "chalk@1.0.0",
+ "_shasum": "b3cf4ed0ff5397c99c75b8f679db2f52831f96dc",
+ "_from": "chalk@>=1.0.0 <2.0.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "sindresorhus",
+ "email": "sindresorhus@gmail.com"
+ },
+ "dist": {
+ "shasum": "b3cf4ed0ff5397c99c75b8f679db2f52831f96dc",
+ "tarball": "http://registry.npmjs.org/chalk/-/chalk-1.0.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/chalk/-/chalk-1.0.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/readme.md
new file mode 100644
index 0000000000..43c7064335
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/chalk/readme.md
@@ -0,0 +1,197 @@
+<h1 align="center">
+ <br>
+ <img width="360" src="https://cdn.rawgit.com/sindresorhus/chalk/19935d6484811c5e468817f846b7b3d417d7bf4a/logo.svg" alt="chalk">
+ <br>
+ <br>
+</h1>
+
+> Terminal string styling done right
+
+[![Build Status](https://travis-ci.org/sindresorhus/chalk.svg?branch=master)](https://travis-ci.org/sindresorhus/chalk) [![](http://img.shields.io/badge/unicorn-approved-ff69b4.svg?style=flat)](https://www.youtube.com/watch?v=Sm368W0OsHo)
+
+[colors.js](https://github.com/Marak/colors.js) used to be the most popular string styling module, but it has serious deficiencies like extending `String.prototype` which causes all kinds of [problems](https://github.com/yeoman/yo/issues/68). Although there are other ones, they either do too much or not enough.
+
+**Chalk is a clean and focused alternative.**
+
+![screenshot](https://github.com/sindresorhus/ansi-styles/raw/master/screenshot.png)
+
+
+## Why
+
+- Highly performant
+- Doesn't extend `String.prototype`
+- Expressive API
+- Ability to nest styles
+- Clean and focused
+- Auto-detects color support
+- Actively maintained
+- [Used by ~3000 modules](https://www.npmjs.com/browse/depended/chalk)
+
+
+## Install
+
+```
+$ npm install --save chalk
+```
+
+
+## Usage
+
+Chalk comes with an easy to use composable API where you just chain and nest the styles you want.
+
+```js
+var chalk = require('chalk');
+
+// style a string
+chalk.blue('Hello world!');
+
+// combine styled and normal strings
+chalk.blue('Hello') + 'World' + chalk.red('!');
+
+// compose multiple styles using the chainable API
+chalk.blue.bgRed.bold('Hello world!');
+
+// pass in multiple arguments
+chalk.blue('Hello', 'World!', 'Foo', 'bar', 'biz', 'baz');
+
+// nest styles
+chalk.red('Hello', chalk.underline.bgBlue('world') + '!');
+
+// nest styles of the same type even (color, underline, background)
+chalk.green(
+ 'I am a green line ' +
+ chalk.blue.underline.bold('with a blue substring') +
+ ' that becomes green again!'
+);
+```
+
+Easily define your own themes.
+
+```js
+var chalk = require('chalk');
+var error = chalk.bold.red;
+console.log(error('Error!'));
+```
+
+Take advantage of console.log [string substitution](http://nodejs.org/docs/latest/api/console.html#console_console_log_data).
+
+```js
+var name = 'Sindre';
+console.log(chalk.green('Hello %s'), name);
+//=> Hello Sindre
+```
+
+
+## API
+
+### chalk.`<style>[.<style>...](string, [string...])`
+
+Example: `chalk.red.bold.underline('Hello', 'world');`
+
+Chain [styles](#styles) and call the last one as a method with a string argument. Order doesn't matter, and later styles take precedent in case of a conflict. This simply means that `Chalk.red.yellow.green` is equivalent to `Chalk.green`.
+
+Multiple arguments will be separated by space.
+
+### chalk.enabled
+
+Color support is automatically detected, but you can override it by setting the `enabled` property. You should however only do this in your own code as it applies globally to all chalk consumers.
+
+If you need to change this in a reusable module create a new instance:
+
+```js
+var ctx = new chalk.constructor({enabled: false});
+```
+
+### chalk.supportsColor
+
+Detect whether the terminal [supports color](https://github.com/sindresorhus/supports-color). Used internally and handled for you, but exposed for convenience.
+
+Can be overridden by the user with the flags `--color` and `--no-color`. For situations where using `--color` is not possible, add an environment variable `FORCE_COLOR` with any value to force color. Trumps `--no-color`.
+
+### chalk.styles
+
+Exposes the styles as [ANSI escape codes](https://github.com/sindresorhus/ansi-styles).
+
+Generally not useful, but you might need just the `.open` or `.close` escape code if you're mixing externally styled strings with your own.
+
+```js
+var chalk = require('chalk');
+
+console.log(chalk.styles.red);
+//=> {open: '\u001b[31m', close: '\u001b[39m'}
+
+console.log(chalk.styles.red.open + 'Hello' + chalk.styles.red.close);
+```
+
+### chalk.hasColor(string)
+
+Check whether a string [has color](https://github.com/sindresorhus/has-ansi).
+
+### chalk.stripColor(string)
+
+[Strip color](https://github.com/sindresorhus/strip-ansi) from a string.
+
+Can be useful in combination with `.supportsColor` to strip color on externally styled text when it's not supported.
+
+Example:
+
+```js
+var chalk = require('chalk');
+var styledString = getText();
+
+if (!chalk.supportsColor) {
+ styledString = chalk.stripColor(styledString);
+}
+```
+
+
+## Styles
+
+### Modifiers
+
+- `reset`
+- `bold`
+- `dim`
+- `italic` *(not widely supported)*
+- `underline`
+- `inverse`
+- `hidden`
+- `strikethrough` *(not widely supported)*
+
+### Colors
+
+- `black`
+- `red`
+- `green`
+- `yellow`
+- `blue` *(on Windows the bright version is used as normal blue is illegible)*
+- `magenta`
+- `cyan`
+- `white`
+- `gray`
+
+### Background colors
+
+- `bgBlack`
+- `bgRed`
+- `bgGreen`
+- `bgYellow`
+- `bgBlue`
+- `bgMagenta`
+- `bgCyan`
+- `bgWhite`
+
+
+## 256-colors
+
+Chalk does not support support anything other than the base eight colors, which guarantees it will work on all terminals and systems. Some terminals, specifically `xterm` compliant ones, will support the full range of 8-bit colors. For this the lower level [ansi-256-colors](https://github.com/jbnicolai/ansi-256-colors) package can be used.
+
+
+## Windows
+
+If you're on Windows, do yourself a favor and use [`cmder`](http://bliker.github.io/cmder/) instead of `cmd.exe`.
+
+
+## License
+
+MIT © [Sindre Sorhus](http://sindresorhus.com)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/History.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/History.md
new file mode 100644
index 0000000000..3a69559eda
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/History.md
@@ -0,0 +1,239 @@
+
+2.7.1 / 2015-03-11
+==================
+
+ * Revert #347 (fix collisions when option and first arg have same name) which causes a bug in #367.
+
+2.7.0 / 2015-03-09
+==================
+
+ * Fix git-style bug when installed globally. Close #335 #349 @zhiyelee
+ * Fix collisions when option and first arg have same name. Close #346 #347 @tonylukasavage
+ * Add support for camelCase on `opts()`. Close #353 @nkzawa
+ * Add node.js 0.12 and io.js to travis.yml
+ * Allow RegEx options. #337 @palanik
+ * Fixes exit code when sub-command failing. Close #260 #332 @pirelenito
+ * git-style `bin` files in $PATH make sense. Close #196 #327 @zhiyelee
+
+2.6.0 / 2014-12-30
+==================
+
+ * added `Command#allowUnknownOption` method. Close #138 #318 @doozr @zhiyelee
+ * Add application description to the help msg. Close #112 @dalssoft
+
+2.5.1 / 2014-12-15
+==================
+
+ * fixed two bugs incurred by variadic arguments. Close #291 @Quentin01 #302 @zhiyelee
+
+2.5.0 / 2014-10-24
+==================
+
+ * add support for variadic arguments. Closes #277 @whitlockjc
+
+2.4.0 / 2014-10-17
+==================
+
+ * fixed a bug on executing the coercion function of subcommands option. Closes #270
+ * added `Command.prototype.name` to retrieve command name. Closes #264 #266 @tonylukasavage
+ * added `Command.prototype.opts` to retrieve all the options as a simple object of key-value pairs. Closes #262 @tonylukasavage
+ * fixed a bug on subcommand name. Closes #248 @jonathandelgado
+ * fixed function normalize doesn’t honor option terminator. Closes #216 @abbr
+
+2.3.0 / 2014-07-16
+==================
+
+ * add command alias'. Closes PR #210
+ * fix: Typos. Closes #99
+ * fix: Unused fs module. Closes #217
+
+2.2.0 / 2014-03-29
+==================
+
+ * add passing of previous option value
+ * fix: support subcommands on windows. Closes #142
+ * Now the defaultValue passed as the second argument of the coercion function.
+
+2.1.0 / 2013-11-21
+==================
+
+ * add: allow cflag style option params, unit test, fixes #174
+
+2.0.0 / 2013-07-18
+==================
+
+ * remove input methods (.prompt, .confirm, etc)
+
+1.3.2 / 2013-07-18
+==================
+
+ * add support for sub-commands to co-exist with the original command
+
+1.3.1 / 2013-07-18
+==================
+
+ * add quick .runningCommand hack so you can opt-out of other logic when running a sub command
+
+1.3.0 / 2013-07-09
+==================
+
+ * add EACCES error handling
+ * fix sub-command --help
+
+1.2.0 / 2013-06-13
+==================
+
+ * allow "-" hyphen as an option argument
+ * support for RegExp coercion
+
+1.1.1 / 2012-11-20
+==================
+
+ * add more sub-command padding
+ * fix .usage() when args are present. Closes #106
+
+1.1.0 / 2012-11-16
+==================
+
+ * add git-style executable subcommand support. Closes #94
+
+1.0.5 / 2012-10-09
+==================
+
+ * fix `--name` clobbering. Closes #92
+ * fix examples/help. Closes #89
+
+1.0.4 / 2012-09-03
+==================
+
+ * add `outputHelp()` method.
+
+1.0.3 / 2012-08-30
+==================
+
+ * remove invalid .version() defaulting
+
+1.0.2 / 2012-08-24
+==================
+
+ * add `--foo=bar` support [arv]
+ * fix password on node 0.8.8. Make backward compatible with 0.6 [focusaurus]
+
+1.0.1 / 2012-08-03
+==================
+
+ * fix issue #56
+ * fix tty.setRawMode(mode) was moved to tty.ReadStream#setRawMode() (i.e. process.stdin.setRawMode())
+
+1.0.0 / 2012-07-05
+==================
+
+ * add support for optional option descriptions
+ * add defaulting of `.version()` to package.json's version
+
+0.6.1 / 2012-06-01
+==================
+
+ * Added: append (yes or no) on confirmation
+ * Added: allow node.js v0.7.x
+
+0.6.0 / 2012-04-10
+==================
+
+ * Added `.prompt(obj, callback)` support. Closes #49
+ * Added default support to .choose(). Closes #41
+ * Fixed the choice example
+
+0.5.1 / 2011-12-20
+==================
+
+ * Fixed `password()` for recent nodes. Closes #36
+
+0.5.0 / 2011-12-04
+==================
+
+ * Added sub-command option support [itay]
+
+0.4.3 / 2011-12-04
+==================
+
+ * Fixed custom help ordering. Closes #32
+
+0.4.2 / 2011-11-24
+==================
+
+ * Added travis support
+ * Fixed: line-buffered input automatically trimmed. Closes #31
+
+0.4.1 / 2011-11-18
+==================
+
+ * Removed listening for "close" on --help
+
+0.4.0 / 2011-11-15
+==================
+
+ * Added support for `--`. Closes #24
+
+0.3.3 / 2011-11-14
+==================
+
+ * Fixed: wait for close event when writing help info [Jerry Hamlet]
+
+0.3.2 / 2011-11-01
+==================
+
+ * Fixed long flag definitions with values [felixge]
+
+0.3.1 / 2011-10-31
+==================
+
+ * Changed `--version` short flag to `-V` from `-v`
+ * Changed `.version()` so it's configurable [felixge]
+
+0.3.0 / 2011-10-31
+==================
+
+ * Added support for long flags only. Closes #18
+
+0.2.1 / 2011-10-24
+==================
+
+ * "node": ">= 0.4.x < 0.7.0". Closes #20
+
+0.2.0 / 2011-09-26
+==================
+
+ * Allow for defaults that are not just boolean. Default peassignment only occurs for --no-*, optional, and required arguments. [Jim Isaacs]
+
+0.1.0 / 2011-08-24
+==================
+
+ * Added support for custom `--help` output
+
+0.0.5 / 2011-08-18
+==================
+
+ * Changed: when the user enters nothing prompt for password again
+ * Fixed issue with passwords beginning with numbers [NuckChorris]
+
+0.0.4 / 2011-08-15
+==================
+
+ * Fixed `Commander#args`
+
+0.0.3 / 2011-08-15
+==================
+
+ * Added default option value support
+
+0.0.2 / 2011-08-15
+==================
+
+ * Added mask support to `Command#password(str[, mask], fn)`
+ * Added `Command#password(str, fn)`
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/LICENSE
new file mode 100644
index 0000000000..10f997ab10
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2011 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/Readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/Readme.md
new file mode 100644
index 0000000000..f38e4df9cf
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/Readme.md
@@ -0,0 +1,310 @@
+# Commander.js
+
+
+[![Build Status](https://api.travis-ci.org/tj/commander.js.svg)](http://travis-ci.org/tj/commander.js)
+[![NPM Version](http://img.shields.io/npm/v/commander.svg?style=flat)](https://www.npmjs.org/package/commander)
+[![NPM Downloads](https://img.shields.io/npm/dm/commander.svg?style=flat)](https://www.npmjs.org/package/commander)
+[![Join the chat at https://gitter.im/tj/commander.js](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/tj/commander.js?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+
+ The complete solution for [node.js](http://nodejs.org) command-line interfaces, inspired by Ruby's [commander](https://github.com/tj/commander).
+ [API documentation](http://tj.github.com/commander.js/)
+
+
+## Installation
+
+ $ npm install commander
+
+## Option parsing
+
+ Options with commander are defined with the `.option()` method, also serving as documentation for the options. The example below parses args and options from `process.argv`, leaving remaining args as the `program.args` array which were not consumed by options.
+
+```js
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('commander');
+
+program
+ .version('0.0.1')
+ .option('-p, --peppers', 'Add peppers')
+ .option('-P, --pineapple', 'Add pineapple')
+ .option('-b, --bbq', 'Add bbq sauce')
+ .option('-c, --cheese [type]', 'Add the specified type of cheese [marble]', 'marble')
+ .parse(process.argv);
+
+console.log('you ordered a pizza with:');
+if (program.peppers) console.log(' - peppers');
+if (program.pineapple) console.log(' - pineapple');
+if (program.bbq) console.log(' - bbq');
+console.log(' - %s cheese', program.cheese);
+```
+
+ Short flags may be passed as a single arg, for example `-abc` is equivalent to `-a -b -c`. Multi-word options such as "--template-engine" are camel-cased, becoming `program.templateEngine` etc.
+
+
+## Coercion
+
+```js
+function range(val) {
+ return val.split('..').map(Number);
+}
+
+function list(val) {
+ return val.split(',');
+}
+
+function collect(val, memo) {
+ memo.push(val);
+ return memo;
+}
+
+function increaseVerbosity(v, total) {
+ return total + 1;
+}
+
+program
+ .version('0.0.1')
+ .usage('[options] <file ...>')
+ .option('-i, --integer <n>', 'An integer argument', parseInt)
+ .option('-f, --float <n>', 'A float argument', parseFloat)
+ .option('-r, --range <a>..<b>', 'A range', range)
+ .option('-l, --list <items>', 'A list', list)
+ .option('-o, --optional [value]', 'An optional value')
+ .option('-c, --collect [value]', 'A repeatable value', collect, [])
+ .option('-v, --verbose', 'A value that can be increased', increaseVerbosity, 0)
+ .parse(process.argv);
+
+console.log(' int: %j', program.integer);
+console.log(' float: %j', program.float);
+console.log(' optional: %j', program.optional);
+program.range = program.range || [];
+console.log(' range: %j..%j', program.range[0], program.range[1]);
+console.log(' list: %j', program.list);
+console.log(' collect: %j', program.collect);
+console.log(' verbosity: %j', program.verbose);
+console.log(' args: %j', program.args);
+```
+
+## Regular Expression
+```js
+program
+ .version('0.0.1')
+ .option('-s --size <size>', 'Pizza size', /^(large|medium|small)$/i, 'medium')
+ .option('-d --drink [drink]', 'Drink', /^(coke|pepsi|izze)$/i)
+ .parse(process.argv);
+
+console.log(' size: %j', program.size);
+console.log(' drink: %j', program.drink);
+```
+
+## Variadic arguments
+
+ The last argument of a command can be variadic, and only the last argument. To make an argument variadic you have to
+ append `...` to the argument name. Here is an example:
+
+```js
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('commander');
+
+program
+ .version('0.0.1')
+ .command('rmdir <dir> [otherDirs...]')
+ .action(function (dir, otherDirs) {
+ console.log('rmdir %s', dir);
+ if (otherDirs) {
+ otherDirs.forEach(function (oDir) {
+ console.log('rmdir %s', oDir);
+ });
+ }
+ });
+
+program.parse(process.argv);
+```
+
+ An `Array` is used for the value of a variadic argument. This applies to `program.args` as well as the argument passed
+ to your action as demonstrated above.
+
+## Git-style sub-commands
+
+```js
+// file: ./examples/pm
+var program = require('..');
+
+program
+ .version('0.0.1')
+ .command('install [name]', 'install one or more packages')
+ .command('search [query]', 'search with optional query')
+ .command('list', 'list packages installed')
+ .parse(process.argv);
+```
+
+When `.command()` is invoked with a description argument, no `.action(callback)` should be called to handle sub-commands, otherwise there will be an error. This tells commander that you're going to use separate executables for sub-commands, much like `git(1)` and other popular tools.
+The commander will try to search the executables in the directory of the entry script (like `./examples/pm`) with the name `program-command`, like `pm-install`, `pm-search`.
+
+If the program is designed to installed globally, make sure the executables have proper modes, like `755`.
+
+## Automated --help
+
+ The help information is auto-generated based on the information commander already knows about your program, so the following `--help` info is for free:
+
+```
+ $ ./examples/pizza --help
+
+ Usage: pizza [options]
+
+ An application for pizzas ordering
+
+ Options:
+
+ -h, --help output usage information
+ -V, --version output the version number
+ -p, --peppers Add peppers
+ -P, --pineapple Add pineapple
+ -b, --bbq Add bbq sauce
+ -c, --cheese <type> Add the specified type of cheese [marble]
+ -C, --no-cheese You do not want any cheese
+
+```
+
+## Custom help
+
+ You can display arbitrary `-h, --help` information
+ by listening for "--help". Commander will automatically
+ exit once you are done so that the remainder of your program
+ does not execute causing undesired behaviours, for example
+ in the following executable "stuff" will not output when
+ `--help` is used.
+
+```js
+#!/usr/bin/env node
+
+/**
+ * Module dependencies.
+ */
+
+var program = require('commander');
+
+program
+ .version('0.0.1')
+ .option('-f, --foo', 'enable some foo')
+ .option('-b, --bar', 'enable some bar')
+ .option('-B, --baz', 'enable some baz');
+
+// must be before .parse() since
+// node's emit() is immediate
+
+program.on('--help', function(){
+ console.log(' Examples:');
+ console.log('');
+ console.log(' $ custom-help --help');
+ console.log(' $ custom-help -h');
+ console.log('');
+});
+
+program.parse(process.argv);
+
+console.log('stuff');
+```
+
+Yields the following help output when `node script-name.js -h` or `node script-name.js --help` are run:
+
+```
+
+Usage: custom-help [options]
+
+Options:
+
+ -h, --help output usage information
+ -V, --version output the version number
+ -f, --foo enable some foo
+ -b, --bar enable some bar
+ -B, --baz enable some baz
+
+Examples:
+
+ $ custom-help --help
+ $ custom-help -h
+
+```
+
+## .outputHelp()
+
+Output help information without exiting.
+
+If you want to display help by default (e.g. if no command was provided), you can use something like:
+
+```js
+var program = require('commander');
+
+program
+ .version('0.0.1')
+ .command('getstream [url]', 'get stream URL')
+ .parse(process.argv);
+
+ if (!process.argv.slice(2).length) {
+ program.outputHelp();
+ }
+```
+
+## .help()
+
+ Output help information and exit immediately.
+
+## Examples
+
+```js
+var program = require('commander');
+
+program
+ .version('0.0.1')
+ .option('-C, --chdir <path>', 'change the working directory')
+ .option('-c, --config <path>', 'set config path. defaults to ./deploy.conf')
+ .option('-T, --no-tests', 'ignore test hook')
+
+program
+ .command('setup [env]')
+ .description('run setup commands for all envs')
+ .option("-s, --setup_mode [mode]", "Which setup mode to use")
+ .action(function(env, options){
+ var mode = options.setup_mode || "normal";
+ env = env || 'all';
+ console.log('setup for %s env(s) with %s mode', env, mode);
+ });
+
+program
+ .command('exec <cmd>')
+ .alias('ex')
+ .description('execute the given remote cmd')
+ .option("-e, --exec_mode <mode>", "Which exec mode to use")
+ .action(function(cmd, options){
+ console.log('exec "%s" using %s mode', cmd, options.exec_mode);
+ }).on('--help', function() {
+ console.log(' Examples:');
+ console.log();
+ console.log(' $ deploy exec sequential');
+ console.log(' $ deploy exec async');
+ console.log();
+ });
+
+program
+ .command('*')
+ .action(function(env){
+ console.log('deploying "%s"', env);
+ });
+
+program.parse(process.argv);
+```
+
+More Demos can be found in the [examples](https://github.com/tj/commander.js/tree/master/examples) directory.
+
+## License
+
+MIT
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/index.js
new file mode 100644
index 0000000000..1abf4df9d5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/index.js
@@ -0,0 +1,1051 @@
+
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var spawn = require('child_process').spawn;
+var readlink = require('graceful-readlink').readlinkSync;
+var path = require('path');
+var dirname = path.dirname;
+var basename = path.basename;
+var fs = require('fs');
+
+/**
+ * Expose the root command.
+ */
+
+exports = module.exports = new Command();
+
+/**
+ * Expose `Command`.
+ */
+
+exports.Command = Command;
+
+/**
+ * Expose `Option`.
+ */
+
+exports.Option = Option;
+
+/**
+ * Initialize a new `Option` with the given `flags` and `description`.
+ *
+ * @param {String} flags
+ * @param {String} description
+ * @api public
+ */
+
+function Option(flags, description) {
+ this.flags = flags;
+ this.required = ~flags.indexOf('<');
+ this.optional = ~flags.indexOf('[');
+ this.bool = !~flags.indexOf('-no-');
+ flags = flags.split(/[ ,|]+/);
+ if (flags.length > 1 && !/^[[<]/.test(flags[1])) this.short = flags.shift();
+ this.long = flags.shift();
+ this.description = description || '';
+}
+
+/**
+ * Return option name.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Option.prototype.name = function() {
+ return this.long
+ .replace('--', '')
+ .replace('no-', '');
+};
+
+/**
+ * Check if `arg` matches the short or long flag.
+ *
+ * @param {String} arg
+ * @return {Boolean}
+ * @api private
+ */
+
+Option.prototype.is = function(arg) {
+ return arg == this.short || arg == this.long;
+};
+
+/**
+ * Initialize a new `Command`.
+ *
+ * @param {String} name
+ * @api public
+ */
+
+function Command(name) {
+ this.commands = [];
+ this.options = [];
+ this._execs = [];
+ this._allowUnknownOption = false;
+ this._args = [];
+ this._name = name;
+}
+
+/**
+ * Inherit from `EventEmitter.prototype`.
+ */
+
+Command.prototype.__proto__ = EventEmitter.prototype;
+
+/**
+ * Add command `name`.
+ *
+ * The `.action()` callback is invoked when the
+ * command `name` is specified via __ARGV__,
+ * and the remaining arguments are applied to the
+ * function for access.
+ *
+ * When the `name` is "*" an un-matched command
+ * will be passed as the first arg, followed by
+ * the rest of __ARGV__ remaining.
+ *
+ * Examples:
+ *
+ * program
+ * .version('0.0.1')
+ * .option('-C, --chdir <path>', 'change the working directory')
+ * .option('-c, --config <path>', 'set config path. defaults to ./deploy.conf')
+ * .option('-T, --no-tests', 'ignore test hook')
+ *
+ * program
+ * .command('setup')
+ * .description('run remote setup commands')
+ * .action(function() {
+ * console.log('setup');
+ * });
+ *
+ * program
+ * .command('exec <cmd>')
+ * .description('run the given remote command')
+ * .action(function(cmd) {
+ * console.log('exec "%s"', cmd);
+ * });
+ *
+ * program
+ * .command('teardown <dir> [otherDirs...]')
+ * .description('run teardown commands')
+ * .action(function(dir, otherDirs) {
+ * console.log('dir "%s"', dir);
+ * if (otherDirs) {
+ * otherDirs.forEach(function (oDir) {
+ * console.log('dir "%s"', oDir);
+ * });
+ * }
+ * });
+ *
+ * program
+ * .command('*')
+ * .description('deploy the given env')
+ * .action(function(env) {
+ * console.log('deploying "%s"', env);
+ * });
+ *
+ * program.parse(process.argv);
+ *
+ * @param {String} name
+ * @param {String} [desc] for git-style sub-commands
+ * @return {Command} the new command
+ * @api public
+ */
+
+Command.prototype.command = function(name, desc) {
+ var args = name.split(/ +/);
+ var cmd = new Command(args.shift());
+
+ if (desc) {
+ cmd.description(desc);
+ this.executables = true;
+ this._execs[cmd._name] = true;
+ }
+
+ this.commands.push(cmd);
+ cmd.parseExpectedArgs(args);
+ cmd.parent = this;
+
+ if (desc) return this;
+ return cmd;
+};
+
+/**
+ * Add an implicit `help [cmd]` subcommand
+ * which invokes `--help` for the given command.
+ *
+ * @api private
+ */
+
+Command.prototype.addImplicitHelpCommand = function() {
+ this.command('help [cmd]', 'display help for [cmd]');
+};
+
+/**
+ * Parse expected `args`.
+ *
+ * For example `["[type]"]` becomes `[{ required: false, name: 'type' }]`.
+ *
+ * @param {Array} args
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.parseExpectedArgs = function(args) {
+ if (!args.length) return;
+ var self = this;
+ args.forEach(function(arg) {
+ var argDetails = {
+ required: false,
+ name: '',
+ variadic: false
+ };
+
+ switch (arg[0]) {
+ case '<':
+ argDetails.required = true;
+ argDetails.name = arg.slice(1, -1);
+ break;
+ case '[':
+ argDetails.name = arg.slice(1, -1);
+ break;
+ }
+
+ if (argDetails.name.length > 3 && argDetails.name.slice(-3) === '...') {
+ argDetails.variadic = true;
+ argDetails.name = argDetails.name.slice(0, -3);
+ }
+ if (argDetails.name) {
+ self._args.push(argDetails);
+ }
+ });
+ return this;
+};
+
+/**
+ * Register callback `fn` for the command.
+ *
+ * Examples:
+ *
+ * program
+ * .command('help')
+ * .description('display verbose help')
+ * .action(function() {
+ * // output help here
+ * });
+ *
+ * @param {Function} fn
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.action = function(fn) {
+ var self = this;
+ var listener = function(args, unknown) {
+ // Parse any so-far unknown options
+ args = args || [];
+ unknown = unknown || [];
+
+ var parsed = self.parseOptions(unknown);
+
+ // Output help if necessary
+ outputHelpIfNecessary(self, parsed.unknown);
+
+ // If there are still any unknown options, then we simply
+ // die, unless someone asked for help, in which case we give it
+ // to them, and then we die.
+ if (parsed.unknown.length > 0) {
+ self.unknownOption(parsed.unknown[0]);
+ }
+
+ // Leftover arguments need to be pushed back. Fixes issue #56
+ if (parsed.args.length) args = parsed.args.concat(args);
+
+ self._args.forEach(function(arg, i) {
+ if (arg.required && null == args[i]) {
+ self.missingArgument(arg.name);
+ } else if (arg.variadic) {
+ if (i !== self._args.length - 1) {
+ self.variadicArgNotLast(arg.name);
+ }
+
+ args[i] = args.splice(i);
+ }
+ });
+
+ // Always append ourselves to the end of the arguments,
+ // to make sure we match the number of arguments the user
+ // expects
+ if (self._args.length) {
+ args[self._args.length] = self;
+ } else {
+ args.push(self);
+ }
+
+ fn.apply(self, args);
+ };
+ this.parent.on(this._name, listener);
+ if (this._alias) this.parent.on(this._alias, listener);
+ return this;
+};
+
+/**
+ * Define option with `flags`, `description` and optional
+ * coercion `fn`.
+ *
+ * The `flags` string should contain both the short and long flags,
+ * separated by comma, a pipe or space. The following are all valid
+ * all will output this way when `--help` is used.
+ *
+ * "-p, --pepper"
+ * "-p|--pepper"
+ * "-p --pepper"
+ *
+ * Examples:
+ *
+ * // simple boolean defaulting to false
+ * program.option('-p, --pepper', 'add pepper');
+ *
+ * --pepper
+ * program.pepper
+ * // => Boolean
+ *
+ * // simple boolean defaulting to true
+ * program.option('-C, --no-cheese', 'remove cheese');
+ *
+ * program.cheese
+ * // => true
+ *
+ * --no-cheese
+ * program.cheese
+ * // => false
+ *
+ * // required argument
+ * program.option('-C, --chdir <path>', 'change the working directory');
+ *
+ * --chdir /tmp
+ * program.chdir
+ * // => "/tmp"
+ *
+ * // optional argument
+ * program.option('-c, --cheese [type]', 'add cheese [marble]');
+ *
+ * @param {String} flags
+ * @param {String} description
+ * @param {Function|Mixed} fn or default
+ * @param {Mixed} defaultValue
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.option = function(flags, description, fn, defaultValue) {
+ var self = this
+ , option = new Option(flags, description)
+ , oname = option.name()
+ , name = camelcase(oname);
+
+ // default as 3rd arg
+ if (typeof fn != 'function') {
+ if (fn instanceof RegExp) {
+ var regex = fn;
+ fn = function(val, def) {
+ var m = regex.exec(val);
+ return m ? m[0] : def;
+ }
+ }
+ else {
+ defaultValue = fn;
+ fn = null;
+ }
+ }
+
+ // preassign default value only for --no-*, [optional], or <required>
+ if (false == option.bool || option.optional || option.required) {
+ // when --no-* we make sure default is true
+ if (false == option.bool) defaultValue = true;
+ // preassign only if we have a default
+ if (undefined !== defaultValue) self[name] = defaultValue;
+ }
+
+ // register the option
+ this.options.push(option);
+
+ // when it's passed assign the value
+ // and conditionally invoke the callback
+ this.on(oname, function(val) {
+ // coercion
+ if (null !== val && fn) val = fn(val, undefined === self[name]
+ ? defaultValue
+ : self[name]);
+
+ // unassigned or bool
+ if ('boolean' == typeof self[name] || 'undefined' == typeof self[name]) {
+ // if no value, bool true, and we have a default, then use it!
+ if (null == val) {
+ self[name] = option.bool
+ ? defaultValue || true
+ : false;
+ } else {
+ self[name] = val;
+ }
+ } else if (null !== val) {
+ // reassign
+ self[name] = val;
+ }
+ });
+
+ return this;
+};
+
+/**
+ * Allow unknown options on the command line.
+ *
+ * @param {Boolean} arg if `true` or omitted, no error will be thrown
+ * for unknown options.
+ * @api public
+ */
+Command.prototype.allowUnknownOption = function(arg) {
+ this._allowUnknownOption = arguments.length === 0 || arg;
+ return this;
+};
+
+/**
+ * Parse `argv`, settings options and invoking commands when defined.
+ *
+ * @param {Array} argv
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.parse = function(argv) {
+ // implicit help
+ if (this.executables) this.addImplicitHelpCommand();
+
+ // store raw args
+ this.rawArgs = argv;
+
+ // guess name
+ this._name = this._name || basename(argv[1], '.js');
+
+ // process argv
+ var parsed = this.parseOptions(this.normalize(argv.slice(2)));
+ var args = this.args = parsed.args;
+
+ var result = this.parseArgs(this.args, parsed.unknown);
+
+ // executable sub-commands
+ var name = result.args[0];
+ if (this._execs[name] && typeof this._execs[name] != "function") {
+ return this.executeSubCommand(argv, args, parsed.unknown);
+ }
+
+ return result;
+};
+
+/**
+ * Execute a sub-command executable.
+ *
+ * @param {Array} argv
+ * @param {Array} args
+ * @param {Array} unknown
+ * @api private
+ */
+
+Command.prototype.executeSubCommand = function(argv, args, unknown) {
+ args = args.concat(unknown);
+
+ if (!args.length) this.help();
+ if ('help' == args[0] && 1 == args.length) this.help();
+
+ // <cmd> --help
+ if ('help' == args[0]) {
+ args[0] = args[1];
+ args[1] = '--help';
+ }
+
+ // executable
+ var f = argv[1];
+ var link = readlink(f);
+ if (link !== f && link.charAt(0) !== '/') {
+ link = path.join(dirname(f), link)
+ }
+ var dir = dirname(link);
+ var bin = basename(f, '.js') + '-' + args[0];
+
+ // prefer local `./<bin>` to bin in the $PATH
+ var local = path.join(dir, bin);
+ try {
+ // for versions before node v0.8 when there weren't `fs.existsSync`
+ if (fs.statSync(local).isFile()) {
+ bin = local;
+ }
+ } catch (e) {}
+
+ // run it
+ args = args.slice(1);
+
+ var proc;
+ if (process.platform !== 'win32') {
+ proc = spawn(bin, args, { stdio: 'inherit', customFds: [0, 1, 2] });
+ } else {
+ args.unshift(local);
+ proc = spawn(process.execPath, args, { stdio: 'inherit'});
+ }
+
+ proc.on('close', process.exit.bind(process));
+ proc.on('error', function(err) {
+ if (err.code == "ENOENT") {
+ console.error('\n %s(1) does not exist, try --help\n', bin);
+ } else if (err.code == "EACCES") {
+ console.error('\n %s(1) not executable. try chmod or run with root\n', bin);
+ }
+ process.exit(1);
+ });
+
+ this.runningCommand = proc;
+};
+
+/**
+ * Normalize `args`, splitting joined short flags. For example
+ * the arg "-abc" is equivalent to "-a -b -c".
+ * This also normalizes equal sign and splits "--abc=def" into "--abc def".
+ *
+ * @param {Array} args
+ * @return {Array}
+ * @api private
+ */
+
+Command.prototype.normalize = function(args) {
+ var ret = []
+ , arg
+ , lastOpt
+ , index;
+
+ for (var i = 0, len = args.length; i < len; ++i) {
+ arg = args[i];
+ if (i > 0) {
+ lastOpt = this.optionFor(args[i-1]);
+ }
+
+ if (arg === '--') {
+ // Honor option terminator
+ ret = ret.concat(args.slice(i));
+ break;
+ } else if (lastOpt && lastOpt.required) {
+ ret.push(arg);
+ } else if (arg.length > 1 && '-' == arg[0] && '-' != arg[1]) {
+ arg.slice(1).split('').forEach(function(c) {
+ ret.push('-' + c);
+ });
+ } else if (/^--/.test(arg) && ~(index = arg.indexOf('='))) {
+ ret.push(arg.slice(0, index), arg.slice(index + 1));
+ } else {
+ ret.push(arg);
+ }
+ }
+
+ return ret;
+};
+
+/**
+ * Parse command `args`.
+ *
+ * When listener(s) are available those
+ * callbacks are invoked, otherwise the "*"
+ * event is emitted and those actions are invoked.
+ *
+ * @param {Array} args
+ * @return {Command} for chaining
+ * @api private
+ */
+
+Command.prototype.parseArgs = function(args, unknown) {
+ var name;
+
+ if (args.length) {
+ name = args[0];
+ if (this.listeners(name).length) {
+ this.emit(args.shift(), args, unknown);
+ } else {
+ this.emit('*', args);
+ }
+ } else {
+ outputHelpIfNecessary(this, unknown);
+
+ // If there were no args and we have unknown options,
+ // then they are extraneous and we need to error.
+ if (unknown.length > 0) {
+ this.unknownOption(unknown[0]);
+ }
+ }
+
+ return this;
+};
+
+/**
+ * Return an option matching `arg` if any.
+ *
+ * @param {String} arg
+ * @return {Option}
+ * @api private
+ */
+
+Command.prototype.optionFor = function(arg) {
+ for (var i = 0, len = this.options.length; i < len; ++i) {
+ if (this.options[i].is(arg)) {
+ return this.options[i];
+ }
+ }
+};
+
+/**
+ * Parse options from `argv` returning `argv`
+ * void of these options.
+ *
+ * @param {Array} argv
+ * @return {Array}
+ * @api public
+ */
+
+Command.prototype.parseOptions = function(argv) {
+ var args = []
+ , len = argv.length
+ , literal
+ , option
+ , arg;
+
+ var unknownOptions = [];
+
+ // parse options
+ for (var i = 0; i < len; ++i) {
+ arg = argv[i];
+
+ // literal args after --
+ if ('--' == arg) {
+ literal = true;
+ continue;
+ }
+
+ if (literal) {
+ args.push(arg);
+ continue;
+ }
+
+ // find matching Option
+ option = this.optionFor(arg);
+
+ // option is defined
+ if (option) {
+ // requires arg
+ if (option.required) {
+ arg = argv[++i];
+ if (null == arg) return this.optionMissingArgument(option);
+ this.emit(option.name(), arg);
+ // optional arg
+ } else if (option.optional) {
+ arg = argv[i+1];
+ if (null == arg || ('-' == arg[0] && '-' != arg)) {
+ arg = null;
+ } else {
+ ++i;
+ }
+ this.emit(option.name(), arg);
+ // bool
+ } else {
+ this.emit(option.name());
+ }
+ continue;
+ }
+
+ // looks like an option
+ if (arg.length > 1 && '-' == arg[0]) {
+ unknownOptions.push(arg);
+
+ // If the next argument looks like it might be
+ // an argument for this option, we pass it on.
+ // If it isn't, then it'll simply be ignored
+ if (argv[i+1] && '-' != argv[i+1][0]) {
+ unknownOptions.push(argv[++i]);
+ }
+ continue;
+ }
+
+ // arg
+ args.push(arg);
+ }
+
+ return { args: args, unknown: unknownOptions };
+};
+
+/**
+ * Return an object containing options as key-value pairs
+ *
+ * @return {Object}
+ * @api public
+ */
+Command.prototype.opts = function() {
+ var result = {}
+ , len = this.options.length;
+
+ for (var i = 0 ; i < len; i++) {
+ var key = camelcase(this.options[i].name());
+ result[key] = key === 'version' ? this._version : this[key];
+ }
+ return result;
+};
+
+/**
+ * Argument `name` is missing.
+ *
+ * @param {String} name
+ * @api private
+ */
+
+Command.prototype.missingArgument = function(name) {
+ console.error();
+ console.error(" error: missing required argument `%s'", name);
+ console.error();
+ process.exit(1);
+};
+
+/**
+ * `Option` is missing an argument, but received `flag` or nothing.
+ *
+ * @param {String} option
+ * @param {String} flag
+ * @api private
+ */
+
+Command.prototype.optionMissingArgument = function(option, flag) {
+ console.error();
+ if (flag) {
+ console.error(" error: option `%s' argument missing, got `%s'", option.flags, flag);
+ } else {
+ console.error(" error: option `%s' argument missing", option.flags);
+ }
+ console.error();
+ process.exit(1);
+};
+
+/**
+ * Unknown option `flag`.
+ *
+ * @param {String} flag
+ * @api private
+ */
+
+Command.prototype.unknownOption = function(flag) {
+ if (this._allowUnknownOption) return;
+ console.error();
+ console.error(" error: unknown option `%s'", flag);
+ console.error();
+ process.exit(1);
+};
+
+/**
+ * Variadic argument with `name` is not the last argument as required.
+ *
+ * @param {String} name
+ * @api private
+ */
+
+Command.prototype.variadicArgNotLast = function(name) {
+ console.error();
+ console.error(" error: variadic arguments must be last `%s'", name);
+ console.error();
+ process.exit(1);
+};
+
+/**
+ * Set the program version to `str`.
+ *
+ * This method auto-registers the "-V, --version" flag
+ * which will print the version number when passed.
+ *
+ * @param {String} str
+ * @param {String} flags
+ * @return {Command} for chaining
+ * @api public
+ */
+
+Command.prototype.version = function(str, flags) {
+ if (0 == arguments.length) return this._version;
+ this._version = str;
+ flags = flags || '-V, --version';
+ this.option(flags, 'output the version number');
+ this.on('version', function() {
+ process.stdout.write(str + '\n');
+ process.exit(0);
+ });
+ return this;
+};
+
+/**
+ * Set the description to `str`.
+ *
+ * @param {String} str
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.description = function(str) {
+ if (0 == arguments.length) return this._description;
+ this._description = str;
+ return this;
+};
+
+/**
+ * Set an alias for the command
+ *
+ * @param {String} alias
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.alias = function(alias) {
+ if (0 == arguments.length) return this._alias;
+ this._alias = alias;
+ return this;
+};
+
+/**
+ * Set / get the command usage `str`.
+ *
+ * @param {String} str
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.usage = function(str) {
+ var args = this._args.map(function(arg) {
+ return humanReadableArgName(arg);
+ });
+
+ var usage = '[options]'
+ + (this.commands.length ? ' [command]' : '')
+ + (this._args.length ? ' ' + args.join(' ') : '');
+
+ if (0 == arguments.length) return this._usage || usage;
+ this._usage = str;
+
+ return this;
+};
+
+/**
+ * Get the name of the command
+ *
+ * @param {String} name
+ * @return {String|Command}
+ * @api public
+ */
+
+Command.prototype.name = function() {
+ return this._name;
+};
+
+/**
+ * Return the largest option length.
+ *
+ * @return {Number}
+ * @api private
+ */
+
+Command.prototype.largestOptionLength = function() {
+ return this.options.reduce(function(max, option) {
+ return Math.max(max, option.flags.length);
+ }, 0);
+};
+
+/**
+ * Return help for options.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.optionHelp = function() {
+ var width = this.largestOptionLength();
+
+ // Prepend the help information
+ return [pad('-h, --help', width) + ' ' + 'output usage information']
+ .concat(this.options.map(function(option) {
+ return pad(option.flags, width) + ' ' + option.description;
+ }))
+ .join('\n');
+};
+
+/**
+ * Return command help documentation.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.commandHelp = function() {
+ if (!this.commands.length) return '';
+
+ var commands = this.commands.map(function(cmd) {
+ var args = cmd._args.map(function(arg) {
+ return humanReadableArgName(arg);
+ }).join(' ');
+
+ return [
+ cmd._name
+ + (cmd._alias
+ ? '|' + cmd._alias
+ : '')
+ + (cmd.options.length
+ ? ' [options]'
+ : '')
+ + ' ' + args
+ , cmd.description()
+ ];
+ });
+
+ var width = commands.reduce(function(max, command) {
+ return Math.max(max, command[0].length);
+ }, 0);
+
+ return [
+ ''
+ , ' Commands:'
+ , ''
+ , commands.map(function(cmd) {
+ return pad(cmd[0], width) + ' ' + cmd[1];
+ }).join('\n').replace(/^/gm, ' ')
+ , ''
+ ].join('\n');
+};
+
+/**
+ * Return program help documentation.
+ *
+ * @return {String}
+ * @api private
+ */
+
+Command.prototype.helpInformation = function() {
+ var desc = [];
+ if (this._description) {
+ desc = [
+ ' ' + this._description
+ , ''
+ ];
+ }
+
+ var cmdName = this._name;
+ if (this._alias) {
+ cmdName = cmdName + '|' + this._alias;
+ }
+ var usage = [
+ ''
+ ,' Usage: ' + cmdName + ' ' + this.usage()
+ , ''
+ ];
+
+ var cmds = [];
+ var commandHelp = this.commandHelp();
+ if (commandHelp) cmds = [commandHelp];
+
+ var options = [
+ ' Options:'
+ , ''
+ , '' + this.optionHelp().replace(/^/gm, ' ')
+ , ''
+ , ''
+ ];
+
+ return usage
+ .concat(cmds)
+ .concat(desc)
+ .concat(options)
+ .join('\n');
+};
+
+/**
+ * Output help information for this command
+ *
+ * @api public
+ */
+
+Command.prototype.outputHelp = function() {
+ process.stdout.write(this.helpInformation());
+ this.emit('--help');
+};
+
+/**
+ * Output help information and exit.
+ *
+ * @api public
+ */
+
+Command.prototype.help = function() {
+ this.outputHelp();
+ process.exit();
+};
+
+/**
+ * Camel-case the given `flag`
+ *
+ * @param {String} flag
+ * @return {String}
+ * @api private
+ */
+
+function camelcase(flag) {
+ return flag.split('-').reduce(function(str, word) {
+ return str + word[0].toUpperCase() + word.slice(1);
+ });
+}
+
+/**
+ * Pad `str` to `width`.
+ *
+ * @param {String} str
+ * @param {Number} width
+ * @return {String}
+ * @api private
+ */
+
+function pad(str, width) {
+ var len = Math.max(0, width - str.length);
+ return str + Array(len + 1).join(' ');
+}
+
+/**
+ * Output help information if necessary
+ *
+ * @param {Command} command to output help for
+ * @param {Array} array of options to search for -h or --help
+ * @api private
+ */
+
+function outputHelpIfNecessary(cmd, options) {
+ options = options || [];
+ for (var i = 0; i < options.length; i++) {
+ if (options[i] == '--help' || options[i] == '-h') {
+ cmd.outputHelp();
+ process.exit(0);
+ }
+ }
+}
+
+/**
+ * Takes an argument an returns its human readable equivalent for help usage.
+ *
+ * @param {Object} arg
+ * @return {String}
+ * @api private
+ */
+
+function humanReadableArgName(arg) {
+ var nameOutput = arg.name + (arg.variadic === true ? '...' : '');
+
+ return arg.required
+ ? '<' + nameOutput + '>'
+ : '[' + nameOutput + ']'
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.npmignore
new file mode 100644
index 0000000000..3ac7d16c6d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.npmignore
@@ -0,0 +1,3 @@
+.idea/
+.DS_Store
+node_modules/
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.travis.yml
new file mode 100644
index 0000000000..baf9be7f6c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/.travis.yml
@@ -0,0 +1,5 @@
+language: node_js
+node_js:
+ - "0.10"
+ - "0.12"
+ - "io.js"
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/LICENSE
new file mode 100644
index 0000000000..50d1e5c666
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Zhiye Li
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/README.md
new file mode 100644
index 0000000000..fc63b505a5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/README.md
@@ -0,0 +1,17 @@
+# graceful-readlink
+[![NPM Version](http://img.shields.io/npm/v/graceful-readlink.svg?style=flat)](https://www.npmjs.org/package/graceful-readlink)
+[![NPM Downloads](https://img.shields.io/npm/dm/graceful-readlink.svg?style=flat)](https://www.npmjs.org/package/graceful-readlink)
+
+
+## Usage
+
+```js
+var readlinkSync = require('graceful-readlink').readlinkSync;
+console.log(readlinkSync(f));
+// output
+// the file pointed to when `f` is a symbolic link
+// the `f` itself when `f` is not a symbolic link
+```
+## Licence
+
+MIT License
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/index.js
new file mode 100644
index 0000000000..c4a79d1afa
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/index.js
@@ -0,0 +1,10 @@
+var fs = require('fs')
+ , lstat = fs.lstatSync;
+
+exports.readlinkSync = function (p) {
+ if (lstat(p).isSymbolicLink()) {
+ return fs.readlinkSync(p);
+ } else {
+ return p;
+ }
+};
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/package.json
new file mode 100644
index 0000000000..6f38f45aae
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/node_modules/graceful-readlink/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "graceful-readlink",
+ "version": "1.0.1",
+ "description": "graceful fs.readlink",
+ "main": "index.js",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/zhiyelee/graceful-readlink.git"
+ },
+ "homepage": "https://github.com/zhiyelee/graceful-readlink",
+ "bugs": {
+ "url": "https://github.com/zhiyelee/graceful-readlink/issues"
+ },
+ "keywords": [
+ "fs.readlink",
+ "readlink"
+ ],
+ "author": {
+ "name": "zhiyelee"
+ },
+ "license": "MIT",
+ "scripts": {
+ "test": "echo \"Error: no test specified\" && exit 1"
+ },
+ "gitHead": "f6655275bebef706fb63fd01b5f062a7052419a5",
+ "_id": "graceful-readlink@1.0.1",
+ "_shasum": "4cafad76bc62f02fa039b2f94e9a3dd3a391a725",
+ "_from": "graceful-readlink@>=1.0.0",
+ "_npmVersion": "2.1.17",
+ "_nodeVersion": "0.11.14",
+ "_npmUser": {
+ "name": "zhiyelee",
+ "email": "zhiyelee@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "zhiyelee",
+ "email": "zhiyelee@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "4cafad76bc62f02fa039b2f94e9a3dd3a391a725",
+ "tarball": "http://registry.npmjs.org/graceful-readlink/-/graceful-readlink-1.0.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/graceful-readlink/-/graceful-readlink-1.0.1.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/package.json
new file mode 100644
index 0000000000..25ba0464a7
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/commander/package.json
@@ -0,0 +1,73 @@
+{
+ "name": "commander",
+ "version": "2.7.1",
+ "description": "the complete solution for node.js command-line programs",
+ "keywords": [
+ "command",
+ "option",
+ "parser"
+ ],
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/tj/commander.js.git"
+ },
+ "devDependencies": {
+ "should": ">= 0.0.1"
+ },
+ "scripts": {
+ "test": "make test"
+ },
+ "main": "index",
+ "engines": {
+ "node": ">= 0.6.x"
+ },
+ "files": [
+ "index.js"
+ ],
+ "dependencies": {
+ "graceful-readlink": ">= 1.0.0"
+ },
+ "gitHead": "103654f8f32c010ad1e62cefc9ab92d7c8d18c8e",
+ "bugs": {
+ "url": "https://github.com/tj/commander.js/issues"
+ },
+ "homepage": "https://github.com/tj/commander.js",
+ "_id": "commander@2.7.1",
+ "_shasum": "5d419a2bbed2c32ee3e4dca9bb45ab83ecc3065a",
+ "_from": "commander@>=2.7.1 <3.0.0",
+ "_npmVersion": "2.1.17",
+ "_nodeVersion": "0.11.14",
+ "_npmUser": {
+ "name": "zhiyelee",
+ "email": "zhiyelee@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "somekittens",
+ "email": "rkoutnik@gmail.com"
+ },
+ {
+ "name": "zhiyelee",
+ "email": "zhiyelee@gmail.com"
+ },
+ {
+ "name": "thethomaseffect",
+ "email": "thethomaseffect@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "5d419a2bbed2c32ee3e4dca9bb45ab83ecc3065a",
+ "tarball": "http://registry.npmjs.org/commander/-/commander-2.7.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/commander/-/commander-2.7.1.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/.npmignore
new file mode 100644
index 0000000000..7e6163db02
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/.npmignore
@@ -0,0 +1,6 @@
+support
+test
+examples
+example
+*.sock
+dist
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/History.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/History.md
new file mode 100644
index 0000000000..770e4832d9
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/History.md
@@ -0,0 +1,186 @@
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Makefile b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Makefile
new file mode 100644
index 0000000000..b0bde6e63f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Makefile
@@ -0,0 +1,33 @@
+
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# applications
+NODE ?= $(shell which node)
+NPM ?= $(NODE) $(shell which npm)
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+all: dist/debug.js
+
+install: node_modules
+
+clean:
+ @rm -rf node_modules dist
+
+dist:
+ @mkdir -p $@
+
+dist/debug.js: node_modules browser.js debug.js dist
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > $@
+
+node_modules: package.json
+ @NODE_ENV= $(NPM) install
+ @touch node_modules
+
+.PHONY: all install clean
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Readme.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Readme.md
new file mode 100644
index 0000000000..14222e0c24
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/Readme.md
@@ -0,0 +1,178 @@
+# debug
+
+ tiny node.js debugging utility modelled after node core's debugging technique.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+ With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)
+
+ ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect.compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Browser support
+
+ Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:
+
+```js
+window.myDebug = require("debug");
+```
+
+ ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:
+
+```js
+myDebug.enable("worker:*")
+```
+
+ Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)
+
+### stderr vs stdout
+
+You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/bower.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/bower.json
new file mode 100644
index 0000000000..f7d3f6dc10
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/bower.json
@@ -0,0 +1,28 @@
+{
+ "name": "visionmedia-debug",
+ "main": "dist/debug.js",
+ "version": "2.1.3",
+ "homepage": "https://github.com/visionmedia/debug",
+ "authors": [
+ "TJ Holowaychuk <tj@vision-media.ca>"
+ ],
+ "description": "visionmedia-debug",
+ "moduleType": [
+ "amd",
+ "es6",
+ "globals",
+ "node"
+ ],
+ "keywords": [
+ "visionmedia",
+ "debug"
+ ],
+ "license": "MIT",
+ "ignore": [
+ "**/.*",
+ "node_modules",
+ "bower_components",
+ "test",
+ "tests"
+ ]
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/browser.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/browser.js
new file mode 100644
index 0000000000..55f4cf9261
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/browser.js
@@ -0,0 +1,175 @@
+
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Use chrome.storage.local if we are in an app
+ */
+
+var storage;
+
+if (typeof chrome !== 'undefined' && typeof chrome.storage !== 'undefined')
+ storage = chrome.storage.local;
+else
+ storage = localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ return ('WebkitAppearance' in document.documentElement.style) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (window.console && (console.firebug || (console.exception && console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31);
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ return JSON.stringify(v);
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+ var args = arguments;
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return args;
+
+ var c = 'color: ' + this.color;
+ args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1));
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+ return args;
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ storage.removeItem('debug');
+ } else {
+ storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = storage.debug;
+ } catch(e) {}
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage(){
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/component.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/component.json
new file mode 100644
index 0000000000..52ffd4224e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+ "name": "debug",
+ "repo": "visionmedia/debug",
+ "description": "small debugging utility",
+ "version": "2.1.3",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "main": "browser.js",
+ "scripts": [
+ "browser.js",
+ "debug.js"
+ ],
+ "dependencies": {
+ "rauchg/ms.js": "0.7.0"
+ }
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/debug.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/debug.js
new file mode 100644
index 0000000000..7571a86058
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/debug.js
@@ -0,0 +1,197 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = debug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lowercased letter, i.e. "n".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previously assigned color.
+ */
+
+var prevColor = 0;
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ *
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor() {
+ return exports.colors[prevColor++ % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function debug(namespace) {
+
+ // define the `disabled` version
+ function disabled() {
+ }
+ disabled.enabled = false;
+
+ // define the `enabled` version
+ function enabled() {
+
+ var self = enabled;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // add the `color` if not set
+ if (null == self.useColors) self.useColors = exports.useColors();
+ if (null == self.color && self.useColors) self.color = selectColor();
+
+ var args = Array.prototype.slice.call(arguments);
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %o
+ args = ['%o'].concat(args);
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ if ('function' === typeof exports.formatArgs) {
+ args = exports.formatArgs.apply(self, args);
+ }
+ var logFn = enabled.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+ enabled.enabled = true;
+
+ var fn = exports.enabled(namespace) ? enabled : disabled;
+
+ fn.namespace = namespace;
+
+ return fn;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ var split = (namespaces || '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node.js
new file mode 100644
index 0000000000..1d392a81d6
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node.js
@@ -0,0 +1,209 @@
+
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase();
+ if (0 === debugColors.length) {
+ return tty.isatty(fd);
+ } else {
+ return '0' !== debugColors
+ && 'no' !== debugColors
+ && 'false' !== debugColors
+ && 'disabled' !== debugColors;
+ }
+}
+
+/**
+ * Map %o to `util.inspect()`, since Node doesn't do that out of the box.
+ */
+
+var inspect = (4 === util.inspect.length ?
+ // node <= 0.8.x
+ function (v, colors) {
+ return util.inspect(v, void 0, void 0, colors);
+ } :
+ // node > 0.8.x
+ function (v, colors) {
+ return util.inspect(v, { colors: colors });
+ }
+);
+
+exports.formatters.o = function(v) {
+ return inspect(v, this.useColors)
+ .replace(/\s*\n\s*/g, ' ');
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+ var args = arguments;
+ var useColors = this.useColors;
+ var name = this.namespace;
+
+ if (useColors) {
+ var c = this.color;
+
+ args[0] = ' \u001b[3' + c + ';1m' + name + ' '
+ + '\u001b[0m'
+ + args[0] + '\u001b[3' + c + 'm'
+ + ' +' + exports.humanize(this.diff) + '\u001b[0m';
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+ return args;
+}
+
+/**
+ * Invokes `console.error()` with the specified arguments.
+ */
+
+function log() {
+ return stream.write(util.format.apply(this, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/.npmignore
new file mode 100644
index 0000000000..d1aa0ce42e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/.npmignore
@@ -0,0 +1,5 @@
+node_modules
+test
+History.md
+Makefile
+component.json
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/LICENSE
new file mode 100644
index 0000000000..6c07561b62
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014 Guillermo Rauch <rauchg@gmail.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/README.md
new file mode 100644
index 0000000000..0fd54fdc72
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/README.md
@@ -0,0 +1,35 @@
+# ms.js: miliseconds conversion utility
+
+```js
+ms('2 days') // 172800000
+ms('1d') // 86400000
+ms('10h') // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h') // 7200000
+ms('1m') // 60000
+ms('5s') // 5000
+ms('100') // 100
+```
+
+```js
+ms(60000) // "1m"
+ms(2 * 60000) // "2m"
+ms(ms('10 hours')) // "10h"
+```
+
+```js
+ms(60000, { long: true }) // "1 minute"
+ms(2 * 60000, { long: true }) // "2 minutes"
+ms(ms('10 hours'), { long: true }) // "10 hours"
+```
+
+- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](nodejs.org/download).
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as
+a number (e.g: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of
+equivalent ms is returned.
+
+## License
+
+MIT
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/index.js
new file mode 100644
index 0000000000..e79bfa18c1
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/index.js
@@ -0,0 +1,123 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ * - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} options
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options){
+ options = options || {};
+ if ('string' == typeof val) return parse(val);
+ return options.long
+ ? long(val)
+ : short(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+ var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str);
+ if (!match) return;
+ var n = parseFloat(match[1]);
+ var type = (match[2] || 'ms').toLowerCase();
+ switch (type) {
+ case 'years':
+ case 'year':
+ case 'yrs':
+ case 'yr':
+ case 'y':
+ return n * y;
+ case 'days':
+ case 'day':
+ case 'd':
+ return n * d;
+ case 'hours':
+ case 'hour':
+ case 'hrs':
+ case 'hr':
+ case 'h':
+ return n * h;
+ case 'minutes':
+ case 'minute':
+ case 'mins':
+ case 'min':
+ case 'm':
+ return n * m;
+ case 'seconds':
+ case 'second':
+ case 'secs':
+ case 'sec':
+ case 's':
+ return n * s;
+ case 'milliseconds':
+ case 'millisecond':
+ case 'msecs':
+ case 'msec':
+ case 'ms':
+ return n;
+ }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function short(ms) {
+ if (ms >= d) return Math.round(ms / d) + 'd';
+ if (ms >= h) return Math.round(ms / h) + 'h';
+ if (ms >= m) return Math.round(ms / m) + 'm';
+ if (ms >= s) return Math.round(ms / s) + 's';
+ return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function long(ms) {
+ return plural(ms, d, 'day')
+ || plural(ms, h, 'hour')
+ || plural(ms, m, 'minute')
+ || plural(ms, s, 'second')
+ || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+ if (ms < n) return;
+ if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name;
+ return Math.ceil(ms / n) + ' ' + name + 's';
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/package.json
new file mode 100644
index 0000000000..ec3ea9b008
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/node_modules/ms/package.json
@@ -0,0 +1,47 @@
+{
+ "name": "ms",
+ "version": "0.7.0",
+ "description": "Tiny ms conversion utility",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/guille/ms.js.git"
+ },
+ "main": "./index",
+ "devDependencies": {
+ "mocha": "*",
+ "expect.js": "*",
+ "serve": "*"
+ },
+ "component": {
+ "scripts": {
+ "ms/index.js": "index.js"
+ }
+ },
+ "gitHead": "1e9cd9b05ef0dc26f765434d2bfee42394376e52",
+ "bugs": {
+ "url": "https://github.com/guille/ms.js/issues"
+ },
+ "homepage": "https://github.com/guille/ms.js",
+ "_id": "ms@0.7.0",
+ "scripts": {},
+ "_shasum": "865be94c2e7397ad8a57da6a633a6e2f30798b83",
+ "_from": "ms@0.7.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "865be94c2e7397ad8a57da6a633a6e2f30798b83",
+ "tarball": "http://registry.npmjs.org/ms/-/ms-0.7.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/package.json
new file mode 100644
index 0000000000..902f40c581
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/debug/package.json
@@ -0,0 +1,73 @@
+{
+ "name": "debug",
+ "version": "2.1.3",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/debug.git"
+ },
+ "description": "small debugging utility",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "contributors": [
+ {
+ "name": "Nathan Rajlich",
+ "email": "nathan@tootallnate.net",
+ "url": "http://n8.io"
+ }
+ ],
+ "license": "MIT",
+ "dependencies": {
+ "ms": "0.7.0"
+ },
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "mocha": "*"
+ },
+ "main": "./node.js",
+ "browser": "./browser.js",
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ },
+ "gitHead": "0a8e4b7e0d2d1b55ef4e7422498ca24c677ae63a",
+ "bugs": {
+ "url": "https://github.com/visionmedia/debug/issues"
+ },
+ "homepage": "https://github.com/visionmedia/debug",
+ "_id": "debug@2.1.3",
+ "scripts": {},
+ "_shasum": "ce8ab1b5ee8fbee2bfa3b633cab93d366b63418e",
+ "_from": "debug@>=2.1.3 <3.0.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "tootallnate",
+ "email": "nathan@tootallnate.net"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "tootallnate",
+ "email": "nathan@tootallnate.net"
+ }
+ ],
+ "dist": {
+ "shasum": "ce8ab1b5ee8fbee2bfa3b633cab93d366b63418e",
+ "tarball": "http://registry.npmjs.org/debug/-/debug-2.1.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/debug/-/debug-2.1.3.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.npmignore
new file mode 100644
index 0000000000..dbb0721ce5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.npmignore
@@ -0,0 +1,2 @@
+node_modules
+cosmicrealms.com
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.travis.yml
new file mode 100644
index 0000000000..6e5919de39
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+ - "0.10"
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/LICENSE
new file mode 100644
index 0000000000..757562ec59
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Mathias Buus
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE. \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/README.md
new file mode 100644
index 0000000000..47350d84fa
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/README.md
@@ -0,0 +1,173 @@
+# is-my-json-valid
+
+A [JSONSchema](http://json-schema.org/) validator that uses code generation
+to be extremely fast
+
+```
+npm install is-my-json-valid
+```
+
+It passes the entire JSONSchema v4 test suite except for `remoteRefs` and `maxLength`/`minLength` when using unicode surrogate pairs.
+
+[![build status](http://img.shields.io/travis/mafintosh/is-my-json-valid.svg?style=flat)](http://travis-ci.org/mafintosh/is-my-json-valid)
+
+## Usage
+
+Simply pass a schema to compile it
+
+``` js
+var validator = require('is-my-json-valid')
+
+var validate = validator({
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {
+ required: true,
+ type: 'string'
+ }
+ }
+})
+
+console.log('should be valid', validate({hello: 'world'}))
+console.log('should not be valid', validate({}))
+
+// get the last list of errors by checking validate.errors
+// the following will print [{field: 'data.hello', message: 'is required'}]
+console.log(validate.errors)
+```
+
+You can also pass the schema as a string
+
+``` js
+var validate = validate('{"type": ... }')
+```
+
+Optionally you can use the require submodule to load a schema from `__dirname`
+
+``` js
+var validator = require('is-my-json-valid/require')
+var validate = validator('my-schema.json')
+```
+
+## Custom formats
+
+is-my-json-valid supports the formats specified in JSON schema v4 (such as date-time).
+If you want to add your own custom formats pass them as the formats options to the validator
+
+``` js
+var validate = validator({
+ type: 'string',
+ required: true,
+ format: 'only-a'
+}, {
+ formats: {
+ 'only-a': /^a+$/
+ }
+})
+
+console.log(validate('aa')) // true
+console.log(validate('ab')) // false
+```
+
+## External schemas
+
+You can pass in external schemas that you reference using the `$ref` attribute as the `schemas` option
+
+``` js
+var ext = {
+ required: true,
+ type: 'string'
+}
+
+var schema = {
+ $ref: '#ext' // references another schema called ext
+}
+
+// pass the external schemas as an option
+var validate = validate(schema, {schemas: {ext: ext}})
+
+validate('hello') // returns true
+validate(42) // return false
+```
+
+## Filtering away additional properties
+
+is-my-json-valid supports filtering away properties not in the schema
+
+``` js
+var filter = validator.filter({
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {type: 'string', required: true}
+ },
+ additionalProperties: false
+})
+
+var doc = {hello: 'world', notInSchema: true}
+console.log(filter(doc)) // {hello: 'world'}
+```
+
+## Verbose mode outputs the value on errors
+
+is-my-json-valid outputs the value causing an error when verbose is set to true
+
+``` js
+var validate = validator({
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {
+ required: true,
+ type: 'string'
+ }
+ }
+}, {
+ verbose: true
+})
+
+validate({hello: 100});
+console.log(validate.errors) // {field: 'data.hello', message: 'is the wrong type', value: 100}
+```
+
+## Greedy mode tries to validate as much as possible
+
+By default is-my-json-valid bails on first validation error but when greedy is
+set to true it tries to validate as much as possible:
+
+``` js
+var validate = validator({
+ type: 'object',
+ properties: {
+ x: {
+ type: 'number'
+ }
+ },
+ required: ['x', 'y']
+}, {
+ greedy: true
+});
+
+validate({x: 'string'});
+console.log(validate.errors) // [{field: 'data.y', message: 'is required'},
+ // {field: 'data.x', message: 'is the wrong type'}]
+```
+
+## Performance
+
+is-my-json-valid uses code generation to turn your JSON schema into basic javascript code that is easily optimizeable by v8.
+
+At the time of writing, is-my-json-valid is the __fastest validator__ when running
+
+* [json-schema-benchmark](https://github.com/Muscula/json-schema-benchmark)
+* [cosmicreals.com benchmark](http://cosmicrealms.com/blog/2014/08/29/benchmark-of-node-dot-js-json-validation-modules-part-3/)
+* [jsck benchmark](https://github.com/pandastrike/jsck/issues/72#issuecomment-70992684)
+* [themis benchmark](https://cdn.rawgit.com/playlyfe/themis/master/benchmark/results.html)
+* [z-schema benchmark](https://rawgit.com/zaggino/z-schema/master/benchmark/results.html)
+
+If you know any other relevant benchmarks open a PR and I'll add them.
+
+## License
+
+MIT
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/example.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/example.js
new file mode 100644
index 0000000000..f70f4dfb5c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/example.js
@@ -0,0 +1,18 @@
+var validator = require('./')
+
+var validate = validator({
+ type: 'object',
+ properties: {
+ hello: {
+ required: true,
+ type: 'string'
+ }
+ }
+})
+
+console.log('should be valid', validate({hello: 'world'}))
+console.log('should not be valid', validate({}))
+
+// get the last error message by checking validate.error
+// the following will print "data.hello is required"
+console.log('the errors were:', validate.errors)
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/formats.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/formats.js
new file mode 100644
index 0000000000..3038daea92
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/formats.js
@@ -0,0 +1,14 @@
+exports['date-time'] = /^\d{4}-(?:0[0-9]{1}|1[0-2]{1})-[0-9]{2}[tT ]\d{2}:\d{2}:\d{2}(\.\d+)?([zZ]|[+-]\d{2}:\d{2})$/
+exports['date'] = /^\d{4}-(?:0[0-9]{1}|1[0-2]{1})-[0-9]{2}$/
+exports['time'] = /^\d{2}:\d{2}:\d{2}$/
+exports['email'] = /^\S+@\S+$/
+exports['ip-address'] = exports['ipv4'] = /^(?:(?:25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\.){3}(?:25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)$/
+exports['ipv6'] = /^\s*((([0-9A-Fa-f]{1,4}:){7}([0-9A-Fa-f]{1,4}|:))|(([0-9A-Fa-f]{1,4}:){6}(:[0-9A-Fa-f]{1,4}|((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(([0-9A-Fa-f]{1,4}:){5}(((:[0-9A-Fa-f]{1,4}){1,2})|:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(([0-9A-Fa-f]{1,4}:){4}(((:[0-9A-Fa-f]{1,4}){1,3})|((:[0-9A-Fa-f]{1,4})?:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){3}(((:[0-9A-Fa-f]{1,4}){1,4})|((:[0-9A-Fa-f]{1,4}){0,2}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){2}(((:[0-9A-Fa-f]{1,4}){1,5})|((:[0-9A-Fa-f]{1,4}){0,3}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(([0-9A-Fa-f]{1,4}:){1}(((:[0-9A-Fa-f]{1,4}){1,6})|((:[0-9A-Fa-f]{1,4}){0,4}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(:(((:[0-9A-Fa-f]{1,4}){1,7})|((:[0-9A-Fa-f]{1,4}){0,5}:((25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(\.(25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(%.+)?\s*$/
+exports['uri'] = /^[a-zA-Z][a-zA-Z0-9+-.]*:[^\s]*$/
+exports['color'] = /(#?([0-9A-Fa-f]{3,6})\b)|(aqua)|(black)|(blue)|(fuchsia)|(gray)|(green)|(lime)|(maroon)|(navy)|(olive)|(orange)|(purple)|(red)|(silver)|(teal)|(white)|(yellow)|(rgb\(\s*\b([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\b\s*,\s*\b([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\b\s*,\s*\b([0-9]|[1-9][0-9]|1[0-9][0-9]|2[0-4][0-9]|25[0-5])\b\s*\))|(rgb\(\s*(\d?\d%|100%)+\s*,\s*(\d?\d%|100%)+\s*,\s*(\d?\d%|100%)+\s*\))/
+exports['hostname'] = /^([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9\-]{0,61}[a-zA-Z0-9])(\.([a-zA-Z0-9]|[a-zA-Z0-9][a-zA-Z0-9\-]{0,61}[a-zA-Z0-9]))*$/
+exports['alpha'] = /^[a-zA-Z]+$/
+exports['alphanumeric'] = /^[a-zA-Z0-9]+$/
+exports['style'] = /\s*(.+?):\s*([^;]+);?/g
+exports['phone'] = /^\+(?:[0-9] ?){6,14}[0-9]$/
+exports['utc-millisec'] = /^[0-9]+(\.?[0-9]+)?$/
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js
new file mode 100644
index 0000000000..79d7ed1cd3
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/index.js
@@ -0,0 +1,553 @@
+var genobj = require('generate-object-property')
+var genfun = require('generate-function')
+var jsonpointer = require('jsonpointer')
+var xtend = require('xtend')
+var formats = require('./formats')
+
+var get = function(obj, additionalSchemas, ptr) {
+ if (/^https?:\/\//.test(ptr)) return null
+
+ var visit = function(sub) {
+ if (sub && sub.id === ptr) return sub
+ if (typeof sub !== 'object' || !sub) return null
+ return Object.keys(sub).reduce(function(res, k) {
+ return res || visit(sub[k])
+ }, null)
+ }
+
+ var res = visit(obj)
+ if (res) return res
+
+ ptr = ptr.replace(/^#/, '')
+ ptr = ptr.replace(/\/$/, '')
+
+ try {
+ return jsonpointer.get(obj, decodeURI(ptr))
+ } catch (err) {
+ var other = additionalSchemas[ptr] || additionalSchemas[ptr.replace(/^#/, '')]
+ return other || null
+ }
+}
+
+var formatName = function(field) {
+ var pattern = /\[[^\[\]"]+\]/
+ while (pattern.test(field)) field = field.replace(pattern, '.*')
+ return field
+}
+
+var types = {}
+
+types.any = function() {
+ return 'true'
+}
+
+types.null = function(name) {
+ return name+' === null'
+}
+
+types.boolean = function(name) {
+ return 'typeof '+name+' === "boolean"'
+}
+
+types.array = function(name) {
+ return 'Array.isArray('+name+')'
+}
+
+types.object = function(name) {
+ return 'typeof '+name+' === "object" && '+name+' && !Array.isArray('+name+')'
+}
+
+types.number = function(name) {
+ return 'typeof '+name+' === "number"'
+}
+
+types.integer = function(name) {
+ return 'typeof '+name+' === "number" && (Math.floor('+name+') === '+name+' || '+name+' > 9007199254740992 || '+name+' < -9007199254740992)'
+}
+
+types.string = function(name) {
+ return 'typeof '+name+' === "string"'
+}
+
+var unique = function(array) {
+ var list = []
+ for (var i = 0; i < array.length; i++) {
+ list.push(typeof array[i] === 'object' ? JSON.stringify(array[i]) : array[i])
+ }
+ for (var i = 1; i < list.length; i++) {
+ if (list.indexOf(list[i]) !== i) return false
+ }
+ return true
+}
+
+var toType = function(node) {
+ return node.type
+}
+
+var compile = function(schema, cache, root, reporter, opts) {
+ var fmts = opts ? xtend(formats, opts.formats) : formats
+ var scope = {unique:unique, formats:fmts}
+ var verbose = opts ? !!opts.verbose : false;
+ var greedy = opts && opts.greedy !== undefined ?
+ opts.greedy : false;
+
+ var syms = {}
+ var gensym = function(name) {
+ return name+(syms[name] = (syms[name] || 0)+1)
+ }
+
+ var reversePatterns = {}
+ var patterns = function(p) {
+ if (reversePatterns[p]) return reversePatterns[p]
+ var n = gensym('pattern')
+ scope[n] = new RegExp(p)
+ reversePatterns[p] = n
+ return n
+ }
+
+ var vars = ['i','j','k','l','m','n','o','p','q','r','s','t','u','v','x','y','z']
+ var genloop = function() {
+ var v = vars.shift()
+ vars.push(v+v[0])
+ return v
+ }
+
+ var visit = function(name, node, reporter, filter) {
+ var properties = node.properties
+ var type = node.type
+ var tuple = false
+
+ if (Array.isArray(node.items)) { // tuple type
+ properties = {}
+ node.items.forEach(function(item, i) {
+ properties[i] = item
+ })
+ type = 'array'
+ tuple = true
+ }
+
+ var indent = 0
+ var error = function(msg, prop, value) {
+ validate('errors++')
+ if (reporter === true) {
+ validate('if (validate.errors === null) validate.errors = []')
+ if (verbose) {
+ validate('validate.errors.push({field:%s,message:%s,value:%s})', JSON.stringify(formatName(prop || name)), JSON.stringify(msg), value || name)
+ } else {
+ var n = gensym('error')
+ scope[n] = {field:formatName(prop || name), message:msg}
+ validate('validate.errors.push(%s)', n)
+ }
+ }
+ }
+
+ if (node.required === true) {
+ indent++
+ validate('if (%s === undefined) {', name)
+ error('is required')
+ validate('} else {')
+ } else {
+ indent++
+ validate('if (%s !== undefined) {', name)
+ }
+
+ var valid = [].concat(type)
+ .map(function(t) {
+ return types[t || 'any'](name)
+ })
+ .join(' || ') || 'true'
+
+ if (valid !== 'true') {
+ indent++
+ validate('if (!(%s)) {', valid)
+ error('is the wrong type')
+ validate('} else {')
+ }
+
+ if (tuple) {
+ if (node.additionalItems === false) {
+ validate('if (%s.length > %d) {', name, node.items.length)
+ error('has additional items')
+ validate('}')
+ } else if (node.additionalItems) {
+ var i = genloop()
+ validate('for (var %s = %d; %s < %s.length; %s++) {', i, node.items.length, i, name, i)
+ visit(name+'['+i+']', node.additionalItems, reporter, filter)
+ validate('}')
+ }
+ }
+
+ if (node.format && fmts[node.format]) {
+ if (type !== 'string' && formats[node.format]) validate('if (%s) {', types.string(name))
+ var n = gensym('format')
+ scope[n] = fmts[node.format]
+
+ if (typeof scope[n] === 'function') validate('if (!%s(%s)) {', n, name)
+ else validate('if (!%s.test(%s)) {', n, name)
+ error('must be '+node.format+' format')
+ validate('}')
+ if (type !== 'string' && formats[node.format]) validate('}')
+ }
+
+ if (Array.isArray(node.required)) {
+ var isUndefined = function(req) {
+ return genobj(name, req) + ' === undefined'
+ }
+
+ var checkRequired = function (req) {
+ var prop = genobj(name, req);
+ validate('if (%s === undefined) {', prop)
+ error('is required', prop)
+ validate('missing++')
+ validate('}')
+ }
+ validate('if ((%s)) {', type !== 'object' ? types.object(name) : 'true')
+ validate('var missing = 0')
+ node.required.map(checkRequired)
+ validate('}');
+ if (!greedy) {
+ validate('if (missing === 0) {')
+ indent++
+ }
+ }
+
+ if (node.uniqueItems) {
+ if (type !== 'array') validate('if (%s) {', types.array(name))
+ validate('if (!(unique(%s))) {', name)
+ error('must be unique')
+ validate('}')
+ if (type !== 'array') validate('}')
+ }
+
+ if (node.enum) {
+ var complex = node.enum.some(function(e) {
+ return typeof e === 'object'
+ })
+
+ var compare = complex ?
+ function(e) {
+ return 'JSON.stringify('+name+')'+' !== JSON.stringify('+JSON.stringify(e)+')'
+ } :
+ function(e) {
+ return name+' !== '+JSON.stringify(e)
+ }
+
+ validate('if (%s) {', node.enum.map(compare).join(' && ') || 'false')
+ error('must be an enum value')
+ validate('}')
+ }
+
+ if (node.dependencies) {
+ if (type !== 'object') validate('if (%s) {', types.object(name))
+
+ Object.keys(node.dependencies).forEach(function(key) {
+ var deps = node.dependencies[key]
+ if (typeof deps === 'string') deps = [deps]
+
+ var exists = function(k) {
+ return genobj(name, k) + ' !== undefined'
+ }
+
+ if (Array.isArray(deps)) {
+ validate('if (%s !== undefined && !(%s)) {', genobj(name, key), deps.map(exists).join(' && ') || 'true')
+ error('dependencies not set')
+ validate('}')
+ }
+ if (typeof deps === 'object') {
+ validate('if (%s !== undefined) {', genobj(name, key))
+ visit(name, deps, reporter, filter)
+ validate('}')
+ }
+ })
+
+ if (type !== 'object') validate('}')
+ }
+
+ if (node.additionalProperties || node.additionalProperties === false) {
+ if (type !== 'object') validate('if (%s) {', types.object(name))
+
+ var i = genloop()
+ var keys = gensym('keys')
+
+ var toCompare = function(p) {
+ return keys+'['+i+'] !== '+JSON.stringify(p)
+ }
+
+ var toTest = function(p) {
+ return '!'+patterns(p)+'.test('+keys+'['+i+'])'
+ }
+
+ var additionalProp = Object.keys(properties || {}).map(toCompare)
+ .concat(Object.keys(node.patternProperties || {}).map(toTest))
+ .join(' && ') || 'true'
+
+ validate('var %s = Object.keys(%s)', keys, name)
+ ('for (var %s = 0; %s < %s.length; %s++) {', i, i, keys, i)
+ ('if (%s) {', additionalProp)
+
+ if (node.additionalProperties === false) {
+ if (filter) validate('delete %s', name+'['+keys+'['+i+']]')
+ error('has additional properties', null, JSON.stringify(name+'.') + ' + ' + keys + '['+i+']')
+ } else {
+ visit(name+'['+keys+'['+i+']]', node.additionalProperties, reporter, filter)
+ }
+
+ validate
+ ('}')
+ ('}')
+
+ if (type !== 'object') validate('}')
+ }
+
+ if (node.$ref) {
+ var sub = get(root, opts && opts.schemas || {}, node.$ref)
+ if (sub) {
+ var fn = cache[node.$ref]
+ if (!fn) {
+ cache[node.$ref] = function proxy(data) {
+ return fn(data)
+ }
+ fn = compile(sub, cache, root, false, opts)
+ }
+ var n = gensym('ref')
+ scope[n] = fn
+ validate('if (!(%s(%s))) {', n, name)
+ error('referenced schema does not match')
+ validate('}')
+ }
+ }
+
+ if (node.not) {
+ var prev = gensym('prev')
+ validate('var %s = errors', prev)
+ visit(name, node.not, false, filter)
+ validate('if (%s === errors) {', prev)
+ error('negative schema matches')
+ validate('} else {')
+ ('errors = %s', prev)
+ ('}')
+ }
+
+ if (node.items && !tuple) {
+ if (type !== 'array') validate('if (%s) {', types.array(name))
+
+ var i = genloop()
+ validate('for (var %s = 0; %s < %s.length; %s++) {', i, i, name, i)
+ visit(name+'['+i+']', node.items, reporter, filter)
+ validate('}')
+
+ if (type !== 'array') validate('}')
+ }
+
+ if (node.patternProperties) {
+ if (type !== 'object') validate('if (%s) {', types.object(name))
+ var keys = gensym('keys')
+ var i = genloop()
+ validate
+ ('var %s = Object.keys(%s)', keys, name)
+ ('for (var %s = 0; %s < %s.length; %s++) {', i, i, keys, i)
+
+ Object.keys(node.patternProperties).forEach(function(key) {
+ var p = patterns(key)
+ validate('if (%s.test(%s)) {', p, keys+'['+i+']')
+ visit(name+'['+keys+'['+i+']]', node.patternProperties[key], reporter, filter)
+ validate('}')
+ })
+
+ validate('}')
+ if (type !== 'object') validate('}')
+ }
+
+ if (node.pattern) {
+ var p = patterns(node.pattern)
+ if (type !== 'string') validate('if (%s) {', types.string(name))
+ validate('if (!(%s.test(%s))) {', p, name)
+ error('pattern mismatch')
+ validate('}')
+ if (type !== 'string') validate('}')
+ }
+
+ if (node.allOf) {
+ node.allOf.forEach(function(sch) {
+ visit(name, sch, reporter, filter)
+ })
+ }
+
+ if (node.anyOf && node.anyOf.length) {
+ var prev = gensym('prev')
+
+ node.anyOf.forEach(function(sch, i) {
+ if (i === 0) {
+ validate('var %s = errors', prev)
+ } else {
+ validate('if (errors !== %s) {', prev)
+ ('errors = %s', prev)
+ }
+ visit(name, sch, false, false)
+ })
+ node.anyOf.forEach(function(sch, i) {
+ if (i) validate('}')
+ })
+ validate('if (%s !== errors) {', prev)
+ error('no schemas match')
+ validate('}')
+ }
+
+ if (node.oneOf && node.oneOf.length) {
+ var prev = gensym('prev')
+ var passes = gensym('passes')
+
+ validate
+ ('var %s = errors', prev)
+ ('var %s = 0', passes)
+
+ node.oneOf.forEach(function(sch, i) {
+ visit(name, sch, false, false)
+ validate('if (%s === errors) {', prev)
+ ('%s++', passes)
+ ('} else {')
+ ('errors = %s', prev)
+ ('}')
+ })
+
+ validate('if (%s !== 1) {', passes)
+ error('no (or more than one) schemas match')
+ validate('}')
+ }
+
+ if (node.multipleOf !== undefined) {
+ if (type !== 'number' && type !== 'integer') validate('if (%s) {', types.number(name))
+
+ var factor = ((node.multipleOf | 0) !== node.multipleOf) ? Math.pow(10, node.multipleOf.toString().split('.').pop().length) : 1
+ if (factor > 1) validate('if ((%d*%s) % %d) {', factor, name, factor*node.multipleOf)
+ else validate('if (%s % %d) {', name, node.multipleOf)
+
+ error('has a remainder')
+ validate('}')
+
+ if (type !== 'number' && type !== 'integer') validate('}')
+ }
+
+ if (node.maxProperties !== undefined) {
+ if (type !== 'object') validate('if (%s) {', types.object(name))
+
+ validate('if (Object.keys(%s).length > %d) {', name, node.maxProperties)
+ error('has more properties than allowed')
+ validate('}')
+
+ if (type !== 'object') validate('}')
+ }
+
+ if (node.minProperties !== undefined) {
+ if (type !== 'object') validate('if (%s) {', types.object(name))
+
+ validate('if (Object.keys(%s).length < %d) {', name, node.minProperties)
+ error('has less properties than allowed')
+ validate('}')
+
+ if (type !== 'object') validate('}')
+ }
+
+ if (node.maxItems !== undefined) {
+ if (type !== 'array') validate('if (%s) {', types.array(name))
+
+ validate('if (%s.length > %d) {', name, node.maxItems)
+ error('has more items than allowed')
+ validate('}')
+
+ if (type !== 'array') validate('}')
+ }
+
+ if (node.minItems !== undefined) {
+ if (type !== 'array') validate('if (%s) {', types.array(name))
+
+ validate('if (%s.length < %d) {', name, node.minItems)
+ error('has less items than allowed')
+ validate('}')
+
+ if (type !== 'array') validate('}')
+ }
+
+ if (node.maxLength !== undefined) {
+ if (type !== 'string') validate('if (%s) {', types.string(name))
+
+ validate('if (%s.length > %d) {', name, node.maxLength)
+ error('has longer length than allowed')
+ validate('}')
+
+ if (type !== 'string') validate('}')
+ }
+
+ if (node.minLength !== undefined) {
+ if (type !== 'string') validate('if (%s) {', types.string(name))
+
+ validate('if (%s.length < %d) {', name, node.minLength)
+ error('has less length than allowed')
+ validate('}')
+
+ if (type !== 'string') validate('}')
+ }
+
+ if (node.minimum !== undefined) {
+ validate('if (%s %s %d) {', name, node.exclusiveMinimum ? '<=' : '<', node.minimum)
+ error('is less than minimum')
+ validate('}')
+ }
+
+ if (node.maximum !== undefined) {
+ validate('if (%s %s %d) {', name, node.exclusiveMaximum ? '>=' : '>', node.maximum)
+ error('is more than maximum')
+ validate('}')
+ }
+
+ if (properties) {
+ Object.keys(properties).forEach(function(p) {
+ visit(genobj(name, p), properties[p], reporter, filter)
+ })
+ }
+
+ while (indent--) validate('}')
+ }
+
+ var validate = genfun
+ ('function validate(data) {')
+ ('validate.errors = null')
+ ('var errors = 0')
+
+ visit('data', schema, reporter, opts && opts.filter)
+
+ validate
+ ('return errors === 0')
+ ('}')
+
+ validate = validate.toFunction(scope)
+ validate.errors = null
+
+ validate.__defineGetter__('error', function() {
+ if (!validate.errors) return ''
+ return validate.errors
+ .map(function(err) {
+ return err.field+' '+err.message
+ })
+ .join('\n')
+ })
+
+ validate.toJSON = function() {
+ return schema
+ }
+
+ return validate
+}
+
+module.exports = function(schema, opts) {
+ if (typeof schema === 'string') schema = JSON.parse(schema)
+ return compile(schema, {}, schema, true, opts)
+}
+
+module.exports.filter = function(schema, opts) {
+ var validate = module.exports(schema, xtend(opts, {filter: true}))
+ return function(sch) {
+ validate(sch)
+ return sch
+ }
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.npmignore
new file mode 100644
index 0000000000..3c3629e647
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.npmignore
@@ -0,0 +1 @@
+node_modules
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.travis.yml
new file mode 100644
index 0000000000..6e5919de39
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+ - "0.10"
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/README.md
new file mode 100644
index 0000000000..693bff87cf
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/README.md
@@ -0,0 +1,72 @@
+# generate-function
+
+Module that helps you write generated functions in Node
+
+```
+npm install generate-function
+```
+
+[![build status](http://img.shields.io/travis/mafintosh/generate-function.svg?style=flat)](http://travis-ci.org/mafintosh/generate-function)
+
+## Disclamer
+
+Writing code that generates code is hard.
+You should only use this if you really, really, really need this for performance reasons (like schema validators / parsers etc).
+
+## Usage
+
+``` js
+var genfun = require('generate-function')
+
+var addNumber = function(val) {
+ var fn = genfun()
+ ('function add(n) {')
+ ('return n + %d', val) // supports format strings to insert values
+ ('}')
+
+ return fn.toFunction() // will compile the function
+}
+
+var add2 = addNumber(2)
+
+console.log('1+2=', add2(1))
+console.log(add2.toString()) // prints the generated function
+```
+
+If you need to close over variables in your generated function pass them to `toFunction(scope)`
+
+``` js
+var multiply = function(a, b) {
+ return a * b
+}
+
+var addAndMultiplyNumber = function(val) {
+ var fn = genfun()
+ ('function(n) {')
+ ('if (typeof n !== "number") {') // ending a line with { will indent the source
+ ('throw new Error("argument should be a number")')
+ ('}')
+ ('var result = multiply(%d, n+%d)', val, val)
+ ('return result')
+ ('}')
+
+ // use fn.toString() if you want to see the generated source
+
+ return fn.toFunction({
+ multiply: multiply
+ })
+}
+
+var addAndMultiply2 = addAndMultiplyNumber(2)
+
+console.log('(3 + 2) * 2 =', addAndMultiply2(3))
+```
+
+## Related
+
+See [generate-object-property](https://github.com/mafintosh/generate-object-property) if you need to safely generate code that
+can be used to reference an object property
+
+## License
+
+MIT \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/example.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/example.js
new file mode 100644
index 0000000000..8d1fee1626
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/example.js
@@ -0,0 +1,27 @@
+var genfun = require('./')
+
+var multiply = function(a, b) {
+ return a * b
+}
+
+var addAndMultiplyNumber = function(val) {
+ var fn = genfun()
+ ('function(n) {')
+ ('if (typeof n !== "number") {') // ending a line with { will indent the source
+ ('throw new Error("argument should be a number")')
+ ('}')
+ ('var result = multiply(%d, n+%d)', val, val)
+ ('return result')
+ ('}')
+
+ // use fn.toString() if you want to see the generated source
+
+ return fn.toFunction({
+ multiply: multiply
+ })
+}
+
+var addAndMultiply2 = addAndMultiplyNumber(2)
+
+console.log(addAndMultiply2.toString())
+console.log('(3 + 2) * 2 =', addAndMultiply2(3)) \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/index.js
new file mode 100644
index 0000000000..37e064bb47
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/index.js
@@ -0,0 +1,61 @@
+var util = require('util')
+
+var INDENT_START = /[\{\[]/
+var INDENT_END = /[\}\]]/
+
+module.exports = function() {
+ var lines = []
+ var indent = 0
+
+ var push = function(str) {
+ var spaces = ''
+ while (spaces.length < indent*2) spaces += ' '
+ lines.push(spaces+str)
+ }
+
+ var line = function(fmt) {
+ if (!fmt) return line
+
+ if (INDENT_END.test(fmt.trim()[0]) && INDENT_START.test(fmt[fmt.length-1])) {
+ indent--
+ push(util.format.apply(util, arguments))
+ indent++
+ return line
+ }
+ if (INDENT_START.test(fmt[fmt.length-1])) {
+ push(util.format.apply(util, arguments))
+ indent++
+ return line
+ }
+ if (INDENT_END.test(fmt.trim()[0])) {
+ indent--
+ push(util.format.apply(util, arguments))
+ return line
+ }
+
+ push(util.format.apply(util, arguments))
+ return line
+ }
+
+ line.toString = function() {
+ return lines.join('\n')
+ }
+
+ line.toFunction = function(scope) {
+ var src = 'return ('+line.toString()+')'
+
+ var keys = Object.keys(scope || {}).map(function(key) {
+ return key
+ })
+
+ var vals = keys.map(function(key) {
+ return scope[key]
+ })
+
+ return Function.apply(null, keys.concat(src)).apply(null, vals)
+ }
+
+ if (arguments.length) line.apply(null, arguments)
+
+ return line
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/package.json
new file mode 100644
index 0000000000..c09cb992b3
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/package.json
@@ -0,0 +1,52 @@
+{
+ "name": "generate-function",
+ "version": "2.0.0",
+ "description": "Module that helps you write generated functions in Node",
+ "main": "index.js",
+ "scripts": {
+ "test": "tape test.js"
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/mafintosh/generate-function"
+ },
+ "keywords": [
+ "generate",
+ "code",
+ "generation",
+ "function",
+ "performance"
+ ],
+ "author": {
+ "name": "Mathias Buus"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/mafintosh/generate-function/issues"
+ },
+ "homepage": "https://github.com/mafintosh/generate-function",
+ "devDependencies": {
+ "tape": "^2.13.4"
+ },
+ "gitHead": "3d5fc8de5859be95f58e3af9bfb5f663edd95149",
+ "_id": "generate-function@2.0.0",
+ "_shasum": "6858fe7c0969b7d4e9093337647ac79f60dfbe74",
+ "_from": "generate-function@>=2.0.0 <3.0.0",
+ "_npmVersion": "1.4.23",
+ "_npmUser": {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "6858fe7c0969b7d4e9093337647ac79f60dfbe74",
+ "tarball": "http://registry.npmjs.org/generate-function/-/generate-function-2.0.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/generate-function/-/generate-function-2.0.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/test.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/test.js
new file mode 100644
index 0000000000..2768893eb1
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-function/test.js
@@ -0,0 +1,33 @@
+var tape = require('tape')
+var genfun = require('./')
+
+tape('generate add function', function(t) {
+ var fn = genfun()
+ ('function add(n) {')
+ ('return n + %d', 42)
+ ('}')
+
+ t.same(fn.toString(), 'function add(n) {\n return n + 42\n}', 'code is indented')
+ t.same(fn.toFunction()(10), 52, 'function works')
+ t.end()
+})
+
+tape('generate function + closed variables', function(t) {
+ var fn = genfun()
+ ('function add(n) {')
+ ('return n + %d + number', 42)
+ ('}')
+
+ var notGood = fn.toFunction()
+ var good = fn.toFunction({number:10})
+
+ try {
+ notGood(10)
+ t.ok(false, 'function should not work')
+ } catch (err) {
+ t.same(err.message, 'number is not defined', 'throws reference error')
+ }
+
+ t.same(good(11), 63, 'function with closed var works')
+ t.end()
+}) \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.npmignore
new file mode 100644
index 0000000000..3c3629e647
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.npmignore
@@ -0,0 +1 @@
+node_modules
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.travis.yml
new file mode 100644
index 0000000000..6e5919de39
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+ - "0.10"
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/README.md
new file mode 100644
index 0000000000..0ee04613de
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/README.md
@@ -0,0 +1,19 @@
+# generate-object-property
+
+Generate safe JS code that can used to reference a object property
+
+ npm install generate-object-property
+
+[![build status](http://img.shields.io/travis/mafintosh/generate-object-property.svg?style=flat)](http://travis-ci.org/mafintosh/generate-object-property)
+
+## Usage
+
+``` js
+var gen = require('generate-object-property');
+console.log(gen('a','b')); // prints a.b
+console.log(gen('a', 'foo-bar')); // prints a["foo-bar"]
+```
+
+## License
+
+MIT \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/index.js
new file mode 100644
index 0000000000..8337c183d8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/index.js
@@ -0,0 +1,8 @@
+var isProperty = require('is-property')
+
+var gen = function(obj, prop) {
+ return isProperty(prop) ? obj+'.'+prop : obj+'['+JSON.stringify(prop)+']'
+}
+
+gen.valid = isProperty
+module.exports = gen \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/.npmignore
new file mode 100644
index 0000000000..8ecfa25a86
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/.npmignore
@@ -0,0 +1,17 @@
+lib-cov
+*.seed
+*.log
+*.csv
+*.dat
+*.out
+*.pid
+*.gz
+
+pids
+logs
+results
+
+npm-debug.log
+node_modules/*
+*.DS_Store
+test/* \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/LICENSE
new file mode 100644
index 0000000000..8ce206a845
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2013 Mikola Lysenko
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/README.md
new file mode 100644
index 0000000000..9846a8bb9f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/README.md
@@ -0,0 +1,28 @@
+is-property
+===========
+Tests if a property of a JavaScript object can be accessed using the dot (.) notation or if it must be enclosed in brackets, (ie use x[" ... "])
+
+Example
+-------
+
+```javascript
+var isProperty = require("is-property")
+
+console.log(isProperty("foo")) //Prints true
+console.log(isProperty("0")) //Prints false
+```
+
+Install
+-------
+
+ npm install is-property
+
+### `require("is-property")(str)`
+Checks if str is a property
+
+* `str` is a string which we will test if it is a property or not
+
+**Returns** true or false depending if str is a property
+
+## Credits
+(c) 2013 Mikola Lysenko. MIT License \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/is-property.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/is-property.js
new file mode 100644
index 0000000000..db58b47b27
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/is-property.js
@@ -0,0 +1,5 @@
+"use strict"
+function isProperty(str) {
+ return /^[$A-Z\_a-z\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u05d0-\u05ea\u05f0-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u08a0\u08a2-\u08ac\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0977\u0979-\u097f\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d\u0c58\u0c59\u0c60\u0c61\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d60\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1877\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191c\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19c1-\u19c7\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2e2f\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua697\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa80-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc][$A-Z\_a-z\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376\u0377\u037a-\u037d\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u0527\u0531-\u0556\u0559\u0561-\u0587\u05d0-\u05ea\u05f0-\u05f2\u0620-\u064a\u066e\u066f\u0671-\u06d3\u06d5\u06e5\u06e6\u06ee\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u08a0\u08a2-\u08ac\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0977\u0979-\u097f\u0985-\u098c\u098f\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc\u09dd\u09df-\u09e1\u09f0\u09f1\u0a05-\u0a0a\u0a0f\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32\u0a33\u0a35\u0a36\u0a38\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0\u0ae1\u0b05-\u0b0c\u0b0f\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32\u0b33\u0b35-\u0b39\u0b3d\u0b5c\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99\u0b9a\u0b9c\u0b9e\u0b9f\u0ba3\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c33\u0c35-\u0c39\u0c3d\u0c58\u0c59\u0c60\u0c61\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0\u0ce1\u0cf1\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d60\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e33\u0e40-\u0e46\u0e81\u0e82\u0e84\u0e87\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa\u0eab\u0ead-\u0eb0\u0eb2\u0eb3\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f4\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f0\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1877\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191c\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19c1-\u19c7\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u212f-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2e2f\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312d\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fcc\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a\ua62b\ua640-\ua66e\ua67f-\ua697\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua78e\ua790-\ua793\ua7a0-\ua7aa\ua7f8-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa80-\uaaaf\uaab1\uaab5\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40\ufb41\ufb43\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc0-9\u0300-\u036f\u0483-\u0487\u0591-\u05bd\u05bf\u05c1\u05c2\u05c4\u05c5\u05c7\u0610-\u061a\u064b-\u0669\u0670\u06d6-\u06dc\u06df-\u06e4\u06e7\u06e8\u06ea-\u06ed\u06f0-\u06f9\u0711\u0730-\u074a\u07a6-\u07b0\u07c0-\u07c9\u07eb-\u07f3\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0859-\u085b\u08e4-\u08fe\u0900-\u0903\u093a-\u093c\u093e-\u094f\u0951-\u0957\u0962\u0963\u0966-\u096f\u0981-\u0983\u09bc\u09be-\u09c4\u09c7\u09c8\u09cb-\u09cd\u09d7\u09e2\u09e3\u09e6-\u09ef\u0a01-\u0a03\u0a3c\u0a3e-\u0a42\u0a47\u0a48\u0a4b-\u0a4d\u0a51\u0a66-\u0a71\u0a75\u0a81-\u0a83\u0abc\u0abe-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ae2\u0ae3\u0ae6-\u0aef\u0b01-\u0b03\u0b3c\u0b3e-\u0b44\u0b47\u0b48\u0b4b-\u0b4d\u0b56\u0b57\u0b62\u0b63\u0b66-\u0b6f\u0b82\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd7\u0be6-\u0bef\u0c01-\u0c03\u0c3e-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55\u0c56\u0c62\u0c63\u0c66-\u0c6f\u0c82\u0c83\u0cbc\u0cbe-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5\u0cd6\u0ce2\u0ce3\u0ce6-\u0cef\u0d02\u0d03\u0d3e-\u0d44\u0d46-\u0d48\u0d4a-\u0d4d\u0d57\u0d62\u0d63\u0d66-\u0d6f\u0d82\u0d83\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0df2\u0df3\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0e50-\u0e59\u0eb1\u0eb4-\u0eb9\u0ebb\u0ebc\u0ec8-\u0ecd\u0ed0-\u0ed9\u0f18\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e\u0f3f\u0f71-\u0f84\u0f86\u0f87\u0f8d-\u0f97\u0f99-\u0fbc\u0fc6\u102b-\u103e\u1040-\u1049\u1056-\u1059\u105e-\u1060\u1062-\u1064\u1067-\u106d\u1071-\u1074\u1082-\u108d\u108f-\u109d\u135d-\u135f\u1712-\u1714\u1732-\u1734\u1752\u1753\u1772\u1773\u17b4-\u17d3\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u18a9\u1920-\u192b\u1930-\u193b\u1946-\u194f\u19b0-\u19c0\u19c8\u19c9\u19d0-\u19d9\u1a17-\u1a1b\u1a55-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1b00-\u1b04\u1b34-\u1b44\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1b82\u1ba1-\u1bad\u1bb0-\u1bb9\u1be6-\u1bf3\u1c24-\u1c37\u1c40-\u1c49\u1c50-\u1c59\u1cd0-\u1cd2\u1cd4-\u1ce8\u1ced\u1cf2-\u1cf4\u1dc0-\u1de6\u1dfc-\u1dff\u200c\u200d\u203f\u2040\u2054\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2cef-\u2cf1\u2d7f\u2de0-\u2dff\u302a-\u302f\u3099\u309a\ua620-\ua629\ua66f\ua674-\ua67d\ua69f\ua6f0\ua6f1\ua802\ua806\ua80b\ua823-\ua827\ua880\ua881\ua8b4-\ua8c4\ua8d0-\ua8d9\ua8e0-\ua8f1\ua900-\ua909\ua926-\ua92d\ua947-\ua953\ua980-\ua983\ua9b3-\ua9c0\ua9d0-\ua9d9\uaa29-\uaa36\uaa43\uaa4c\uaa4d\uaa50-\uaa59\uaa7b\uaab0\uaab2-\uaab4\uaab7\uaab8\uaabe\uaabf\uaac1\uaaeb-\uaaef\uaaf5\uaaf6\uabe3-\uabea\uabec\uabed\uabf0-\uabf9\ufb1e\ufe00-\ufe0f\ufe20-\ufe26\ufe33\ufe34\ufe4d-\ufe4f\uff10-\uff19\uff3f]*$/.test(str)
+}
+module.exports = isProperty \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/package.json
new file mode 100644
index 0000000000..fda11c85e5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/node_modules/is-property/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "is-property",
+ "version": "1.0.2",
+ "description": "Tests if a JSON property can be accessed using . syntax",
+ "main": "is-property.js",
+ "directories": {
+ "test": "test"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "tape": "~1.0.4"
+ },
+ "scripts": {
+ "test": "tap test/*.js"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/mikolalysenko/is-property.git"
+ },
+ "keywords": [
+ "is",
+ "property",
+ "json",
+ "dot",
+ "bracket",
+ ".",
+ "[]"
+ ],
+ "author": {
+ "name": "Mikola Lysenko"
+ },
+ "license": "MIT",
+ "gitHead": "0a85ea5b6b1264ea1cdecc6e5cf186adbb3ffc50",
+ "bugs": {
+ "url": "https://github.com/mikolalysenko/is-property/issues"
+ },
+ "homepage": "https://github.com/mikolalysenko/is-property",
+ "_id": "is-property@1.0.2",
+ "_shasum": "57fe1c4e48474edd65b09911f26b1cd4095dda84",
+ "_from": "is-property@>=1.0.0 <2.0.0",
+ "_npmVersion": "2.1.4",
+ "_nodeVersion": "0.10.26",
+ "_npmUser": {
+ "name": "mikolalysenko",
+ "email": "mikolalysenko@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "mikolalysenko",
+ "email": "mikolalysenko@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "57fe1c4e48474edd65b09911f26b1cd4095dda84",
+ "tarball": "http://registry.npmjs.org/is-property/-/is-property-1.0.2.tgz"
+ },
+ "_resolved": "https://registry.npmjs.org/is-property/-/is-property-1.0.2.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/package.json
new file mode 100644
index 0000000000..5a6cb3b553
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/package.json
@@ -0,0 +1,43 @@
+{
+ "name": "generate-object-property",
+ "version": "1.1.0",
+ "description": "Generate safe JS code that can used to reference a object property",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/mafintosh/generate-object-property"
+ },
+ "devDependencies": {
+ "tape": "^2.13.0"
+ },
+ "scripts": {
+ "test": "tape test.js"
+ },
+ "dependencies": {
+ "is-property": "^1.0.0"
+ },
+ "gitHead": "836774061a38438800ebd8cb103f322ddbd1f118",
+ "bugs": {
+ "url": "https://github.com/mafintosh/generate-object-property/issues"
+ },
+ "homepage": "https://github.com/mafintosh/generate-object-property",
+ "_id": "generate-object-property@1.1.0",
+ "_shasum": "d9b9beccc3ce7e9fc6053d3bdf46c1dd9a0d8b34",
+ "_from": "generate-object-property@>=1.1.0 <2.0.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "d9b9beccc3ce7e9fc6053d3bdf46c1dd9a0d8b34",
+ "tarball": "http://registry.npmjs.org/generate-object-property/-/generate-object-property-1.1.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/generate-object-property/-/generate-object-property-1.1.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/test.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/test.js
new file mode 100644
index 0000000000..6c299c67fd
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/generate-object-property/test.js
@@ -0,0 +1,12 @@
+var tape = require('tape')
+var gen = require('./')
+
+tape('valid', function(t) {
+ t.same(gen('a', 'b'), 'a.b')
+ t.end()
+})
+
+tape('invalid', function(t) {
+ t.same(gen('a', '-b'), 'a["-b"]')
+ t.end()
+}) \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml
new file mode 100644
index 0000000000..a057a7c637
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/.travis.yml
@@ -0,0 +1,6 @@
+language: "node_js"
+node_js:
+ - 0.4
+ - 0.5
+ - 0.6
+ - 0.8
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md
new file mode 100644
index 0000000000..bcfdb1a4ec
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/README.md
@@ -0,0 +1,31 @@
+# JSON Pointer for nodejs
+
+This is an implementation of [JSON Pointer](http://tools.ietf.org/html/draft-ietf-appsawg-json-pointer-08).
+
+## Usage
+
+ var jsonpointer = require("jsonpointer");
+ var obj = { foo: 1, bar: { baz: 2}, qux: [3, 4, 5]};
+ var one = jsonpointer.get(obj, "/foo");
+ var two = jsonpointer.get(obj, "/bar/baz");
+ var three = jsonpointer.get(obj, "/qux/0");
+ var four = jsonpointer.get(obj, "/qux/1");
+ var five = jsonpointer.get(obj, "/qux/2");
+
+ jsonpointer.set(obj, "/foo", 6); // obj.foo = 6;
+
+## Testing
+
+ $ node test.js
+ All tests pass.
+ $
+
+[![Build Status](https://travis-ci.org/janl/node-jsonpointer.png?branch=master)](undefined)
+
+## Author
+
+(c) 2011 Jan Lehnardt <jan@apache.org>
+
+## License
+
+MIT License. \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js
new file mode 100644
index 0000000000..3f53026efd
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/jsonpointer.js
@@ -0,0 +1,79 @@
+var console = require("console");
+
+var untilde = function(str) {
+ return str.replace(/~./g, function(m) {
+ switch (m) {
+ case "~0":
+ return "~";
+ case "~1":
+ return "/";
+ }
+ throw("Invalid tilde escape: " + m);
+ });
+}
+
+var traverse = function(obj, pointer, value) {
+ // assert(isArray(pointer))
+ var part = untilde(pointer.shift());
+ if(typeof obj[part] === "undefined") {
+ throw("Value for pointer '" + pointer + "' not found.");
+ return;
+ }
+ if(pointer.length !== 0) { // keep traversin!
+ return traverse(obj[part], pointer, value);
+ }
+ // we're done
+ if(typeof value === "undefined") {
+ // just reading
+ return obj[part];
+ }
+ // set new value, return old value
+ var old_value = obj[part];
+ if(value === null) {
+ delete obj[part];
+ } else {
+ obj[part] = value;
+ }
+ return old_value;
+}
+
+var validate_input = function(obj, pointer) {
+ if(typeof obj !== "object") {
+ throw("Invalid input object.");
+ }
+
+ if(pointer === "") {
+ return [];
+ }
+
+ if(!pointer) {
+ throw("Invalid JSON pointer.");
+ }
+
+ pointer = pointer.split("/");
+ var first = pointer.shift();
+ if (first !== "") {
+ throw("Invalid JSON pointer.");
+ }
+
+ return pointer;
+}
+
+var get = function(obj, pointer) {
+ pointer = validate_input(obj, pointer);
+ if (pointer.length === 0) {
+ return obj;
+ }
+ return traverse(obj, pointer);
+}
+
+var set = function(obj, pointer, value) {
+ pointer = validate_input(obj, pointer);
+ if (pointer.length === 0) {
+ throw("Invalid JSON pointer for set.")
+ }
+ return traverse(obj, pointer, value);
+}
+
+exports.get = get
+exports.set = set
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json
new file mode 100644
index 0000000000..1c5623b462
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/package.json
@@ -0,0 +1,60 @@
+{
+ "name": "jsonpointer",
+ "description": "Simple JSON Addressing.",
+ "tags": [
+ "util",
+ "simple",
+ "util",
+ "utility"
+ ],
+ "version": "1.1.0",
+ "author": {
+ "name": "Jan Lehnardt",
+ "email": "jan@apache.org"
+ },
+ "contributors": [
+ {
+ "name": "Joe Hildebrand",
+ "email": "joe-github@cursive.net"
+ },
+ {
+ "name": "Filip Noetzel"
+ }
+ ],
+ "repository": {
+ "type": "git",
+ "url": "http://github.com/janl/node-jsonpointer.git"
+ },
+ "bugs": {
+ "url": "http://github.com/janl/node-jsonpointer/issues"
+ },
+ "engines": [
+ "node >= 0.4.9"
+ ],
+ "main": "./jsonpointer",
+ "scripts": {
+ "test": "node test.js"
+ },
+ "readme": "# JSON Pointer for nodejs\n\nThis is an implementation of [JSON Pointer](http://tools.ietf.org/html/draft-ietf-appsawg-json-pointer-08).\n\n## Usage\n\n var jsonpointer = require(\"jsonpointer\");\n var obj = { foo: 1, bar: { baz: 2}, qux: [3, 4, 5]};\n var one = jsonpointer.get(obj, \"/foo\");\n var two = jsonpointer.get(obj, \"/bar/baz\");\n var three = jsonpointer.get(obj, \"/qux/0\");\n var four = jsonpointer.get(obj, \"/qux/1\");\n var five = jsonpointer.get(obj, \"/qux/2\");\n\n jsonpointer.set(obj, \"/foo\", 6); // obj.foo = 6;\n\n## Testing\n\n $ node test.js\n All tests pass.\n $\n\n[![Build Status](https://travis-ci.org/janl/node-jsonpointer.png?branch=master)](undefined)\n\n## Author\n\n(c) 2011 Jan Lehnardt <jan@apache.org>\n\n## License\n\nMIT License.",
+ "readmeFilename": "README.md",
+ "_id": "jsonpointer@1.1.0",
+ "dist": {
+ "shasum": "c3c72efaed3b97154163dc01dd349e1cfe0f80fc",
+ "tarball": "http://registry.npmjs.org/jsonpointer/-/jsonpointer-1.1.0.tgz"
+ },
+ "_npmVersion": "1.1.69",
+ "_npmUser": {
+ "name": "jan",
+ "email": "jan@apache.org"
+ },
+ "maintainers": [
+ {
+ "name": "jan",
+ "email": "jan@apache.org"
+ }
+ ],
+ "directories": {},
+ "_shasum": "c3c72efaed3b97154163dc01dd349e1cfe0f80fc",
+ "_resolved": "https://registry.npmjs.org/jsonpointer/-/jsonpointer-1.1.0.tgz",
+ "_from": "jsonpointer@>=1.1.0 <2.0.0"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js
new file mode 100644
index 0000000000..cdb8ec506c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/jsonpointer/test.js
@@ -0,0 +1,100 @@
+var assert = require("assert");
+var console = require("console");
+var jsonpointer = require("./jsonpointer");
+
+var obj = {
+ a: 1,
+ b: {
+ c: 2
+ },
+ d: {
+ e: [{a:3}, {b:4}, {c:5}]
+ }
+};
+
+assert.equal(jsonpointer.get(obj, "/a"), 1);
+assert.equal(jsonpointer.get(obj, "/b/c"), 2);
+assert.equal(jsonpointer.get(obj, "/d/e/0/a"), 3);
+assert.equal(jsonpointer.get(obj, "/d/e/1/b"), 4);
+assert.equal(jsonpointer.get(obj, "/d/e/2/c"), 5);
+
+// set returns old value
+assert.equal(jsonpointer.set(obj, "/a", 2), 1);
+assert.equal(jsonpointer.set(obj, "/b/c", 3), 2);
+assert.equal(jsonpointer.set(obj, "/d/e/0/a", 4), 3);
+assert.equal(jsonpointer.set(obj, "/d/e/1/b", 5), 4);
+assert.equal(jsonpointer.set(obj, "/d/e/2/c", 6), 5);
+
+assert.equal(jsonpointer.get(obj, "/a"), 2);
+assert.equal(jsonpointer.get(obj, "/b/c"), 3);
+assert.equal(jsonpointer.get(obj, "/d/e/0/a"), 4);
+assert.equal(jsonpointer.get(obj, "/d/e/1/b"), 5);
+assert.equal(jsonpointer.get(obj, "/d/e/2/c"), 6);
+
+assert.equal(jsonpointer.get(obj, ""), obj);
+assert.throws(function() {
+ assert.equal(jsonpointer.get(obj, "a"), 3);
+});
+
+var complexKeys = {
+ "a/b": {
+ c: 1
+ },
+ d: {
+ "e/f": 2
+ },
+ "~1": 3,
+ "01": 4
+}
+
+assert.equal(jsonpointer.get(complexKeys, "/a~1b/c"), 1);
+assert.equal(jsonpointer.get(complexKeys, "/d/e~1f"), 2);
+assert.equal(jsonpointer.get(complexKeys, "/~01"), 3);
+assert.equal(jsonpointer.get(complexKeys, "/01"), 4);
+assert.throws(function() {
+ assert.equal(jsonpointer.get(complexKeys, "/a/b/c"), 1);
+});
+assert.throws(function() {
+ assert.equal(jsonpointer.get(complexKeys, "/~1"), 3);
+});
+
+// draft-ietf-appsawg-json-pointer-08 has special array rules
+var ary = [ "zero", "one", "two" ];
+
+assert.throws(function() {
+ assert.equal(jsonpointer.get(ary, "/01"), "one");
+});
+//assert.equal(jsonpointer.set(ary, "/-", "three"), null);
+//assert.equal(ary[3], "three");
+
+// Examples from the draft:
+var example = {
+ "foo": ["bar", "baz"],
+ "": 0,
+ "a/b": 1,
+ "c%d": 2,
+ "e^f": 3,
+ "g|h": 4,
+ "i\\j": 5,
+ "k\"l": 6,
+ " ": 7,
+ "m~n": 8
+};
+
+assert.equal(jsonpointer.get(example, ""), example);
+var ans = jsonpointer.get(example, "/foo");
+assert.equal(ans.length, 2);
+assert.equal(ans[0], "bar");
+assert.equal(ans[1], "baz");
+assert.equal(jsonpointer.get(example, "/foo/0"), "bar");
+assert.equal(jsonpointer.get(example, "/"), 0);
+assert.equal(jsonpointer.get(example, "/a~1b"), 1);
+assert.equal(jsonpointer.get(example, "/c%d"), 2);
+assert.equal(jsonpointer.get(example, "/e^f"), 3);
+assert.equal(jsonpointer.get(example, "/g|h"), 4);
+assert.equal(jsonpointer.get(example, "/i\\j"), 5);
+assert.equal(jsonpointer.get(example, "/k\"l"), 6);
+assert.equal(jsonpointer.get(example, "/ "), 7);
+assert.equal(jsonpointer.get(example, "/m~0n"), 8);
+
+console.log("All tests pass.");
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.jshintrc b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.jshintrc
deleted file mode 100644
index 77887b5f0f..0000000000
--- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.jshintrc
+++ /dev/null
@@ -1,30 +0,0 @@
-{
- "maxdepth": 4,
- "maxstatements": 200,
- "maxcomplexity": 12,
- "maxlen": 80,
- "maxparams": 5,
-
- "curly": true,
- "eqeqeq": true,
- "immed": true,
- "latedef": false,
- "noarg": true,
- "noempty": true,
- "nonew": true,
- "undef": true,
- "unused": "vars",
- "trailing": true,
-
- "quotmark": true,
- "expr": true,
- "asi": true,
-
- "browser": false,
- "esnext": true,
- "devel": false,
- "node": false,
- "nonstandard": false,
-
- "predef": ["require", "module", "__dirname", "__filename"]
-}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.npmignore
new file mode 100644
index 0000000000..3c3629e647
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/.npmignore
@@ -0,0 +1 @@
+node_modules
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/LICENCE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/LICENCE
new file mode 100644
index 0000000000..1a14b437e8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/LICENCE
@@ -0,0 +1,19 @@
+Copyright (c) 2012-2014 Raynos.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/Makefile b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/Makefile
new file mode 100644
index 0000000000..d583fcf49d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/Makefile
@@ -0,0 +1,4 @@
+browser:
+ node ./support/compile
+
+.PHONY: browser \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/README.md b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/README.md
new file mode 100644
index 0000000000..093cb2978e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/README.md
@@ -0,0 +1,32 @@
+# xtend
+
+[![browser support][3]][4]
+
+[![locked](http://badges.github.io/stability-badges/dist/locked.svg)](http://github.com/badges/stability-badges)
+
+Extend like a boss
+
+xtend is a basic utility library which allows you to extend an object by appending all of the properties from each object in a list. When there are identical properties, the right-most property takes precedence.
+
+## Examples
+
+```js
+var extend = require("xtend")
+
+// extend returns a new object. Does not mutate arguments
+var combination = extend({
+ a: "a",
+ b: 'c'
+}, {
+ b: "b"
+})
+// { a: "a", b: "b" }
+```
+
+## Stability status: Locked
+
+## MIT Licenced
+
+
+ [3]: http://ci.testling.com/Raynos/xtend.png
+ [4]: http://ci.testling.com/Raynos/xtend
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/immutable.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/immutable.js
new file mode 100644
index 0000000000..5b760152b7
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/immutable.js
@@ -0,0 +1,17 @@
+module.exports = extend
+
+function extend() {
+ var target = {}
+
+ for (var i = 0; i < arguments.length; i++) {
+ var source = arguments[i]
+
+ for (var key in source) {
+ if (source.hasOwnProperty(key)) {
+ target[key] = source[key]
+ }
+ }
+ }
+
+ return target
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/mutable.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/mutable.js
new file mode 100644
index 0000000000..a34475ebdd
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/mutable.js
@@ -0,0 +1,15 @@
+module.exports = extend
+
+function extend(target) {
+ for (var i = 1; i < arguments.length; i++) {
+ var source = arguments[i]
+
+ for (var key in source) {
+ if (source.hasOwnProperty(key)) {
+ target[key] = source[key]
+ }
+ }
+ }
+
+ return target
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/package.json
new file mode 100644
index 0000000000..ef934eff32
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/package.json
@@ -0,0 +1,87 @@
+{
+ "name": "xtend",
+ "version": "4.0.0",
+ "description": "extend like a boss",
+ "keywords": [
+ "extend",
+ "merge",
+ "options",
+ "opts",
+ "object",
+ "array"
+ ],
+ "author": {
+ "name": "Raynos",
+ "email": "raynos2@gmail.com"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/Raynos/xtend.git"
+ },
+ "main": "immutable",
+ "scripts": {
+ "test": "node test"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "tape": "~1.1.0"
+ },
+ "homepage": "https://github.com/Raynos/xtend",
+ "contributors": [
+ {
+ "name": "Jake Verbaten"
+ },
+ {
+ "name": "Matt Esch"
+ }
+ ],
+ "bugs": {
+ "url": "https://github.com/Raynos/xtend/issues",
+ "email": "raynos2@gmail.com"
+ },
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "http://github.com/raynos/xtend/raw/master/LICENSE"
+ }
+ ],
+ "testling": {
+ "files": "test.js",
+ "browsers": [
+ "ie/7..latest",
+ "firefox/16..latest",
+ "firefox/nightly",
+ "chrome/22..latest",
+ "chrome/canary",
+ "opera/12..latest",
+ "opera/next",
+ "safari/5.1..latest",
+ "ipad/6.0..latest",
+ "iphone/6.0..latest"
+ ]
+ },
+ "engines": {
+ "node": ">=0.4"
+ },
+ "gitHead": "94a95d76154103290533b2c55ffa0fe4be16bfef",
+ "_id": "xtend@4.0.0",
+ "_shasum": "8bc36ff87aedbe7ce9eaf0bca36b2354a743840f",
+ "_from": "xtend@>=4.0.0 <5.0.0",
+ "_npmVersion": "1.4.15",
+ "_npmUser": {
+ "name": "raynos",
+ "email": "raynos2@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "raynos",
+ "email": "raynos2@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "8bc36ff87aedbe7ce9eaf0bca36b2354a743840f",
+ "tarball": "http://registry.npmjs.org/xtend/-/xtend-4.0.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/xtend/-/xtend-4.0.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/test.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/test.js
new file mode 100644
index 0000000000..3369d79660
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/node_modules/xtend/test.js
@@ -0,0 +1,63 @@
+var test = require("tape")
+var extend = require("./")
+var mutableExtend = require("./mutable")
+
+test("merge", function(assert) {
+ var a = { a: "foo" }
+ var b = { b: "bar" }
+
+ assert.deepEqual(extend(a, b), { a: "foo", b: "bar" })
+ assert.end()
+})
+
+test("replace", function(assert) {
+ var a = { a: "foo" }
+ var b = { a: "bar" }
+
+ assert.deepEqual(extend(a, b), { a: "bar" })
+ assert.end()
+})
+
+test("undefined", function(assert) {
+ var a = { a: undefined }
+ var b = { b: "foo" }
+
+ assert.deepEqual(extend(a, b), { a: undefined, b: "foo" })
+ assert.deepEqual(extend(b, a), { a: undefined, b: "foo" })
+ assert.end()
+})
+
+test("handle 0", function(assert) {
+ var a = { a: "default" }
+ var b = { a: 0 }
+
+ assert.deepEqual(extend(a, b), { a: 0 })
+ assert.deepEqual(extend(b, a), { a: "default" })
+ assert.end()
+})
+
+test("is immutable", function (assert) {
+ var record = {}
+
+ extend(record, { foo: "bar" })
+ assert.equal(record.foo, undefined)
+ assert.end()
+})
+
+test("null as argument", function (assert) {
+ var a = { foo: "bar" }
+ var b = null
+ var c = void 0
+
+ assert.deepEqual(extend(b, a, c), { foo: "bar" })
+ assert.end()
+})
+
+test("mutable", function (assert) {
+ var a = { foo: "bar" }
+
+ mutableExtend(a, { bar: "baz" })
+
+ assert.equal(a.bar, "baz")
+ assert.end()
+})
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json
new file mode 100644
index 0000000000..06126ba370
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/package.json
@@ -0,0 +1,62 @@
+{
+ "name": "is-my-json-valid",
+ "version": "2.10.0",
+ "description": "A JSONSchema validator that uses code generation to be extremely fast",
+ "main": "index.js",
+ "dependencies": {
+ "generate-function": "^2.0.0",
+ "generate-object-property": "^1.1.0",
+ "jsonpointer": "^1.1.0",
+ "xtend": "^4.0.0"
+ },
+ "devDependencies": {
+ "tape": "^2.13.4"
+ },
+ "scripts": {
+ "test": "tape test/*.js"
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/mafintosh/is-my-json-valid"
+ },
+ "keywords": [
+ "json",
+ "schema",
+ "orderly",
+ "jsonschema"
+ ],
+ "author": {
+ "name": "Mathias Buus"
+ },
+ "license": "MIT",
+ "bugs": {
+ "url": "https://github.com/mafintosh/is-my-json-valid/issues"
+ },
+ "homepage": "https://github.com/mafintosh/is-my-json-valid",
+ "gitHead": "21aa9b8916a2efb3172d17d2d3d1b517668834c7",
+ "_id": "is-my-json-valid@2.10.0",
+ "_shasum": "49755a8ecb2fe90baf922243cbaa245f910d2483",
+ "_from": "is-my-json-valid@>=2.10.0 <3.0.0",
+ "_npmVersion": "2.7.0",
+ "_nodeVersion": "1.5.1",
+ "_npmUser": {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "mafintosh",
+ "email": "mathiasbuus@gmail.com"
+ },
+ {
+ "name": "watson",
+ "email": "w@tson.dk"
+ }
+ ],
+ "dist": {
+ "shasum": "49755a8ecb2fe90baf922243cbaa245f910d2483",
+ "tarball": "http://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.10.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/is-my-json-valid/-/is-my-json-valid-2.10.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/require.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/require.js
new file mode 100644
index 0000000000..0bfb8a29d4
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/require.js
@@ -0,0 +1,12 @@
+var fs = require('fs')
+var path = require('path')
+var compile = require('./')
+
+delete require.cache[require.resolve(__filename)]
+
+module.exports = function(file, opts) {
+ file = path.join(path.dirname(module.parent.filename), file)
+ if (!fs.existsSync(file) && fs.existsSync(file+'.schema')) file += '.schema'
+ if (!fs.existsSync(file) && fs.existsSync(file+'.json')) file += '.json'
+ return compile(fs.readFileSync(file, 'utf-8'), opts)
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/fixtures/cosmic.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/fixtures/cosmic.js
new file mode 100644
index 0000000000..4e0a34b210
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/fixtures/cosmic.js
@@ -0,0 +1,84 @@
+exports.valid = {
+ fullName : "John Doe",
+ age : 47,
+ state : "Massachusetts",
+ city : "Boston",
+ zip : 16417,
+ married : false,
+ dozen : 12,
+ dozenOrBakersDozen : 13,
+ favoriteEvenNumber : 14,
+ topThreeFavoriteColors : [ "red", "blue", "green" ],
+ favoriteSingleDigitWholeNumbers : [ 7 ],
+ favoriteFiveLetterWord : "coder",
+ emailAddresses :
+ [
+ "abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ@letters-in-local.org",
+ "01234567890@numbers-in-local.net",
+ "&'*+-./=?^_{}~@other-valid-characters-in-local.net",
+ "mixed-1234-in-{+^}-local@sld.net",
+ "a@single-character-in-local.org",
+ "\"quoted\"@sld.com",
+ "\"\\e\\s\\c\\a\\p\\e\\d\"@sld.com",
+ "\"quoted-at-sign@sld.org\"@sld.com",
+ "\"escaped\\\"quote\"@sld.com",
+ "\"back\\slash\"@sld.com",
+ "one-character-third-level@a.example.com",
+ "single-character-in-sld@x.org",
+ "local@dash-in-sld.com",
+ "letters-in-sld@123.com",
+ "one-letter-sld@x.org",
+ "uncommon-tld@sld.museum",
+ "uncommon-tld@sld.travel",
+ "uncommon-tld@sld.mobi",
+ "country-code-tld@sld.uk",
+ "country-code-tld@sld.rw",
+ "local@sld.newTLD",
+ "the-total-length@of-an-entire-address.cannot-be-longer-than-two-hundred-and-fifty-four-characters.and-this-address-is-254-characters-exactly.so-it-should-be-valid.and-im-going-to-add-some-more-words-here.to-increase-the-lenght-blah-blah-blah-blah-bla.org",
+ "the-character-limit@for-each-part.of-the-domain.is-sixty-three-characters.this-is-exactly-sixty-three-characters-so-it-is-valid-blah-blah.com",
+ "local@sub.domains.com"
+ ],
+ ipAddresses : [ "127.0.0.1", "24.48.64.2", "192.168.1.1", "209.68.44.3", "2.2.2.2" ]
+}
+
+exports.invalid = {
+ fullName : null,
+ age : -1,
+ state : 47,
+ city : false,
+ zip : [null],
+ married : "yes",
+ dozen : 50,
+ dozenOrBakersDozen : "over 9000",
+ favoriteEvenNumber : 15,
+ topThreeFavoriteColors : [ "red", 5 ],
+ favoriteSingleDigitWholeNumbers : [ 78, 2, 999 ],
+ favoriteFiveLetterWord : "codernaut",
+ emailAddresses : [],
+ ipAddresses : [ "999.0.099.1", "294.48.64.2346", false, "2221409.64214128.42414.235233", "124124.12412412" ]
+}
+
+exports.schema = { // from cosmic thingy
+ name : "test",
+ type : "object",
+ additionalProperties : false,
+ required : ["fullName", "age", "zip", "married", "dozen", "dozenOrBakersDozen", "favoriteEvenNumber", "topThreeFavoriteColors", "favoriteSingleDigitWholeNumbers", "favoriteFiveLetterWord", "emailAddresses", "ipAddresses"],
+ properties :
+ {
+ fullName : { type : "string" },
+ age : { type : "integer", minimum : 0 },
+ optionalItem : { type : "string" },
+ state : { type : "string" },
+ city : { type : "string" },
+ zip : { type : "integer", minimum : 0, maximum : 99999 },
+ married : { type : "boolean" },
+ dozen : { type : "integer", minimum : 12, maximum : 12 },
+ dozenOrBakersDozen : { type : "integer", minimum : 12, maximum : 13 },
+ favoriteEvenNumber : { type : "integer", multipleOf : 2 },
+ topThreeFavoriteColors : { type : "array", minItems : 3, maxItems : 3, uniqueItems : true, items : { type : "string" }},
+ favoriteSingleDigitWholeNumbers : { type : "array", minItems : 1, maxItems : 10, uniqueItems : true, items : { type : "integer", minimum : 0, maximum : 9 }},
+ favoriteFiveLetterWord : { type : "string", minLength : 5, maxLength : 5 },
+ emailAddresses : { type : "array", minItems : 1, uniqueItems : true, items : { type : "string", format : "email" }},
+ ipAddresses : { type : "array", uniqueItems : true, items : { type : "string", format : "ipv4" }},
+ }
+ } \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalItems.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalItems.json
new file mode 100644
index 0000000000..521745c8d6
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalItems.json
@@ -0,0 +1,82 @@
+[
+ {
+ "description": "additionalItems as schema",
+ "schema": {
+ "items": [{}],
+ "additionalItems": {"type": "integer"}
+ },
+ "tests": [
+ {
+ "description": "additional items match schema",
+ "data": [ null, 2, 3, 4 ],
+ "valid": true
+ },
+ {
+ "description": "additional items do not match schema",
+ "data": [ null, 2, 3, "foo" ],
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "items is schema, no additionalItems",
+ "schema": {
+ "items": {},
+ "additionalItems": false
+ },
+ "tests": [
+ {
+ "description": "all items match schema",
+ "data": [ 1, 2, 3, 4, 5 ],
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "array of items with no additionalItems",
+ "schema": {
+ "items": [{}, {}, {}],
+ "additionalItems": false
+ },
+ "tests": [
+ {
+ "description": "no additional items present",
+ "data": [ 1, 2, 3 ],
+ "valid": true
+ },
+ {
+ "description": "additional items are not permitted",
+ "data": [ 1, 2, 3, 4 ],
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "additionalItems as false without items",
+ "schema": {"additionalItems": false},
+ "tests": [
+ {
+ "description":
+ "items defaults to empty schema so everything is valid",
+ "data": [ 1, 2, 3, 4, 5 ],
+ "valid": true
+ },
+ {
+ "description": "ignores non-arrays",
+ "data": {"foo" : "bar"},
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "additionalItems are allowed by default",
+ "schema": {"items": [{"type": "integer"}]},
+ "tests": [
+ {
+ "description": "only the first item is validated",
+ "data": [1, "foo", false],
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalProperties.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalProperties.json
new file mode 100644
index 0000000000..40831f9e9a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/additionalProperties.json
@@ -0,0 +1,88 @@
+[
+ {
+ "description":
+ "additionalProperties being false does not allow other properties",
+ "schema": {
+ "properties": {"foo": {}, "bar": {}},
+ "patternProperties": { "^v": {} },
+ "additionalProperties": false
+ },
+ "tests": [
+ {
+ "description": "no additional properties is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "an additional property is invalid",
+ "data": {"foo" : 1, "bar" : 2, "quux" : "boom"},
+ "valid": false
+ },
+ {
+ "description": "ignores non-objects",
+ "data": [1, 2, 3],
+ "valid": true
+ },
+ {
+ "description": "patternProperties are not additional properties",
+ "data": {"foo":1, "vroom": 2},
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description":
+ "additionalProperties allows a schema which should validate",
+ "schema": {
+ "properties": {"foo": {}, "bar": {}},
+ "additionalProperties": {"type": "boolean"}
+ },
+ "tests": [
+ {
+ "description": "no additional properties is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "an additional valid property is valid",
+ "data": {"foo" : 1, "bar" : 2, "quux" : true},
+ "valid": true
+ },
+ {
+ "description": "an additional invalid property is invalid",
+ "data": {"foo" : 1, "bar" : 2, "quux" : 12},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description":
+ "additionalProperties can exist by itself",
+ "schema": {
+ "additionalProperties": {"type": "boolean"}
+ },
+ "tests": [
+ {
+ "description": "an additional valid property is valid",
+ "data": {"foo" : true},
+ "valid": true
+ },
+ {
+ "description": "an additional invalid property is invalid",
+ "data": {"foo" : 1},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "additionalProperties are allowed by default",
+ "schema": {"properties": {"foo": {}, "bar": {}}},
+ "tests": [
+ {
+ "description": "additional properties are allowed",
+ "data": {"foo": 1, "bar": 2, "quux": true},
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/allOf.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/allOf.json
new file mode 100644
index 0000000000..bbb5f89e4b
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/allOf.json
@@ -0,0 +1,112 @@
+[
+ {
+ "description": "allOf",
+ "schema": {
+ "allOf": [
+ {
+ "properties": {
+ "bar": {"type": "integer"}
+ },
+ "required": ["bar"]
+ },
+ {
+ "properties": {
+ "foo": {"type": "string"}
+ },
+ "required": ["foo"]
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "allOf",
+ "data": {"foo": "baz", "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "mismatch second",
+ "data": {"foo": "baz"},
+ "valid": false
+ },
+ {
+ "description": "mismatch first",
+ "data": {"bar": 2},
+ "valid": false
+ },
+ {
+ "description": "wrong type",
+ "data": {"foo": "baz", "bar": "quux"},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "allOf with base schema",
+ "schema": {
+ "properties": {"bar": {"type": "integer"}},
+ "required": ["bar"],
+ "allOf" : [
+ {
+ "properties": {
+ "foo": {"type": "string"}
+ },
+ "required": ["foo"]
+ },
+ {
+ "properties": {
+ "baz": {"type": "null"}
+ },
+ "required": ["baz"]
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "valid",
+ "data": {"foo": "quux", "bar": 2, "baz": null},
+ "valid": true
+ },
+ {
+ "description": "mismatch base schema",
+ "data": {"foo": "quux", "baz": null},
+ "valid": false
+ },
+ {
+ "description": "mismatch first allOf",
+ "data": {"bar": 2, "baz": null},
+ "valid": false
+ },
+ {
+ "description": "mismatch second allOf",
+ "data": {"foo": "quux", "bar": 2},
+ "valid": false
+ },
+ {
+ "description": "mismatch both",
+ "data": {"bar": 2},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "allOf simple types",
+ "schema": {
+ "allOf": [
+ {"maximum": 30},
+ {"minimum": 20}
+ ]
+ },
+ "tests": [
+ {
+ "description": "valid",
+ "data": 25,
+ "valid": true
+ },
+ {
+ "description": "mismatch one",
+ "data": 35,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/anyOf.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/anyOf.json
new file mode 100644
index 0000000000..a58714afd8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/anyOf.json
@@ -0,0 +1,68 @@
+[
+ {
+ "description": "anyOf",
+ "schema": {
+ "anyOf": [
+ {
+ "type": "integer"
+ },
+ {
+ "minimum": 2
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "first anyOf valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "second anyOf valid",
+ "data": 2.5,
+ "valid": true
+ },
+ {
+ "description": "both anyOf valid",
+ "data": 3,
+ "valid": true
+ },
+ {
+ "description": "neither anyOf valid",
+ "data": 1.5,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "anyOf with base schema",
+ "schema": {
+ "type": "string",
+ "anyOf" : [
+ {
+ "maxLength": 2
+ },
+ {
+ "minLength": 4
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "mismatch base schema",
+ "data": 3,
+ "valid": false
+ },
+ {
+ "description": "one anyOf valid",
+ "data": "foobar",
+ "valid": true
+ },
+ {
+ "description": "both anyOf invalid",
+ "data": "foo",
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/bignum.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/bignum.json
new file mode 100644
index 0000000000..ccc7c17fe8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/bignum.json
@@ -0,0 +1,107 @@
+[
+ {
+ "description": "integer",
+ "schema": {"type": "integer"},
+ "tests": [
+ {
+ "description": "a bignum is an integer",
+ "data": 12345678910111213141516171819202122232425262728293031,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "number",
+ "schema": {"type": "number"},
+ "tests": [
+ {
+ "description": "a bignum is a number",
+ "data": 98249283749234923498293171823948729348710298301928331,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "integer",
+ "schema": {"type": "integer"},
+ "tests": [
+ {
+ "description": "a negative bignum is an integer",
+ "data": -12345678910111213141516171819202122232425262728293031,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "number",
+ "schema": {"type": "number"},
+ "tests": [
+ {
+ "description": "a negative bignum is a number",
+ "data": -98249283749234923498293171823948729348710298301928331,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "string",
+ "schema": {"type": "string"},
+ "tests": [
+ {
+ "description": "a bignum is not a string",
+ "data": 98249283749234923498293171823948729348710298301928331,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "integer comparison",
+ "schema": {"maximum": 18446744073709551615},
+ "tests": [
+ {
+ "description": "comparison works for high numbers",
+ "data": 18446744073709551600,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "float comparison with high precision",
+ "schema": {
+ "maximum": 972783798187987123879878123.18878137,
+ "exclusiveMaximum": true
+ },
+ "tests": [
+ {
+ "description": "comparison works for high numbers",
+ "data": 972783798187987123879878123.188781371,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "integer comparison",
+ "schema": {"minimum": -18446744073709551615},
+ "tests": [
+ {
+ "description": "comparison works for very negative numbers",
+ "data": -18446744073709551600,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "float comparison with high precision on negative numbers",
+ "schema": {
+ "minimum": -972783798187987123879878123.18878137,
+ "exclusiveMinimum": true
+ },
+ "tests": [
+ {
+ "description": "comparison works for very negative numbers",
+ "data": -972783798187987123879878123.188781371,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/default.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/default.json
new file mode 100644
index 0000000000..17629779fb
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/default.json
@@ -0,0 +1,49 @@
+[
+ {
+ "description": "invalid type for default",
+ "schema": {
+ "properties": {
+ "foo": {
+ "type": "integer",
+ "default": []
+ }
+ }
+ },
+ "tests": [
+ {
+ "description": "valid when property is specified",
+ "data": {"foo": 13},
+ "valid": true
+ },
+ {
+ "description": "still valid when the invalid default is used",
+ "data": {},
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "invalid string value for default",
+ "schema": {
+ "properties": {
+ "bar": {
+ "type": "string",
+ "minLength": 4,
+ "default": "bad"
+ }
+ }
+ },
+ "tests": [
+ {
+ "description": "valid when property is specified",
+ "data": {"bar": "good"},
+ "valid": true
+ },
+ {
+ "description": "still valid when the invalid default is used",
+ "data": {},
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/definitions.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/definitions.json
new file mode 100644
index 0000000000..cf935a3215
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/definitions.json
@@ -0,0 +1,32 @@
+[
+ {
+ "description": "valid definition",
+ "schema": {"$ref": "http://json-schema.org/draft-04/schema#"},
+ "tests": [
+ {
+ "description": "valid definition schema",
+ "data": {
+ "definitions": {
+ "foo": {"type": "integer"}
+ }
+ },
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "invalid definition",
+ "schema": {"$ref": "http://json-schema.org/draft-04/schema#"},
+ "tests": [
+ {
+ "description": "invalid definition schema",
+ "data": {
+ "definitions": {
+ "foo": {"type": 1}
+ }
+ },
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/dependencies.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/dependencies.json
new file mode 100644
index 0000000000..7b9b16a7e1
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/dependencies.json
@@ -0,0 +1,113 @@
+[
+ {
+ "description": "dependencies",
+ "schema": {
+ "dependencies": {"bar": ["foo"]}
+ },
+ "tests": [
+ {
+ "description": "neither",
+ "data": {},
+ "valid": true
+ },
+ {
+ "description": "nondependant",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "with dependency",
+ "data": {"foo": 1, "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "missing dependency",
+ "data": {"bar": 2},
+ "valid": false
+ },
+ {
+ "description": "ignores non-objects",
+ "data": "foo",
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "multiple dependencies",
+ "schema": {
+ "dependencies": {"quux": ["foo", "bar"]}
+ },
+ "tests": [
+ {
+ "description": "neither",
+ "data": {},
+ "valid": true
+ },
+ {
+ "description": "nondependants",
+ "data": {"foo": 1, "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "with dependencies",
+ "data": {"foo": 1, "bar": 2, "quux": 3},
+ "valid": true
+ },
+ {
+ "description": "missing dependency",
+ "data": {"foo": 1, "quux": 2},
+ "valid": false
+ },
+ {
+ "description": "missing other dependency",
+ "data": {"bar": 1, "quux": 2},
+ "valid": false
+ },
+ {
+ "description": "missing both dependencies",
+ "data": {"quux": 1},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "multiple dependencies subschema",
+ "schema": {
+ "dependencies": {
+ "bar": {
+ "properties": {
+ "foo": {"type": "integer"},
+ "bar": {"type": "integer"}
+ }
+ }
+ }
+ },
+ "tests": [
+ {
+ "description": "valid",
+ "data": {"foo": 1, "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "no dependency",
+ "data": {"foo": "quux"},
+ "valid": true
+ },
+ {
+ "description": "wrong type",
+ "data": {"foo": "quux", "bar": 2},
+ "valid": false
+ },
+ {
+ "description": "wrong type other",
+ "data": {"foo": 2, "bar": "quux"},
+ "valid": false
+ },
+ {
+ "description": "wrong type both",
+ "data": {"foo": "quux", "bar": "quux"},
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/enum.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/enum.json
new file mode 100644
index 0000000000..f124436a7d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/enum.json
@@ -0,0 +1,72 @@
+[
+ {
+ "description": "simple enum validation",
+ "schema": {"enum": [1, 2, 3]},
+ "tests": [
+ {
+ "description": "one of the enum is valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "something else is invalid",
+ "data": 4,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "heterogeneous enum validation",
+ "schema": {"enum": [6, "foo", [], true, {"foo": 12}]},
+ "tests": [
+ {
+ "description": "one of the enum is valid",
+ "data": [],
+ "valid": true
+ },
+ {
+ "description": "something else is invalid",
+ "data": null,
+ "valid": false
+ },
+ {
+ "description": "objects are deep compared",
+ "data": {"foo": false},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "enums in properties",
+ "schema": {
+ "type":"object",
+ "properties": {
+ "foo": {"enum":["foo"]},
+ "bar": {"enum":["bar"]}
+ },
+ "required": ["bar"]
+ },
+ "tests": [
+ {
+ "description": "both properties are valid",
+ "data": {"foo":"foo", "bar":"bar"},
+ "valid": true
+ },
+ {
+ "description": "missing optional property is valid",
+ "data": {"bar":"bar"},
+ "valid": true
+ },
+ {
+ "description": "missing required property is invalid",
+ "data": {"foo":"foo"},
+ "valid": false
+ },
+ {
+ "description": "missing all properties is invalid",
+ "data": {},
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/format.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/format.json
new file mode 100644
index 0000000000..53c5d25190
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/format.json
@@ -0,0 +1,143 @@
+[
+ {
+ "description": "validation of date-time strings",
+ "schema": {"format": "date-time"},
+ "tests": [
+ {
+ "description": "a valid date-time string",
+ "data": "1963-06-19T08:30:06.283185Z",
+ "valid": true
+ },
+ {
+ "description": "an invalid date-time string",
+ "data": "06/19/1963 08:30:06 PST",
+ "valid": false
+ },
+ {
+ "description": "only RFC3339 not all of ISO 8601 are valid",
+ "data": "2013-350T01:01:01",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "validation of URIs",
+ "schema": {"format": "uri"},
+ "tests": [
+ {
+ "description": "a valid URI",
+ "data": "http://foo.bar/?baz=qux#quux",
+ "valid": true
+ },
+ {
+ "description": "an invalid URI",
+ "data": "\\\\WINDOWS\\fileshare",
+ "valid": false
+ },
+ {
+ "description": "an invalid URI though valid URI reference",
+ "data": "abc",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "validation of e-mail addresses",
+ "schema": {"format": "email"},
+ "tests": [
+ {
+ "description": "a valid e-mail address",
+ "data": "joe.bloggs@example.com",
+ "valid": true
+ },
+ {
+ "description": "an invalid e-mail address",
+ "data": "2962",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "validation of IP addresses",
+ "schema": {"format": "ipv4"},
+ "tests": [
+ {
+ "description": "a valid IP address",
+ "data": "192.168.0.1",
+ "valid": true
+ },
+ {
+ "description": "an IP address with too many components",
+ "data": "127.0.0.0.1",
+ "valid": false
+ },
+ {
+ "description": "an IP address with out-of-range values",
+ "data": "256.256.256.256",
+ "valid": false
+ },
+ {
+ "description": "an IP address without 4 components",
+ "data": "127.0",
+ "valid": false
+ },
+ {
+ "description": "an IP address as an integer",
+ "data": "0x7f000001",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "validation of IPv6 addresses",
+ "schema": {"format": "ipv6"},
+ "tests": [
+ {
+ "description": "a valid IPv6 address",
+ "data": "::1",
+ "valid": true
+ },
+ {
+ "description": "an IPv6 address with out-of-range values",
+ "data": "12345::",
+ "valid": false
+ },
+ {
+ "description": "an IPv6 address with too many components",
+ "data": "1:1:1:1:1:1:1:1:1:1:1:1:1:1:1:1",
+ "valid": false
+ },
+ {
+ "description": "an IPv6 address containing illegal characters",
+ "data": "::laptop",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "validation of host names",
+ "schema": {"format": "hostname"},
+ "tests": [
+ {
+ "description": "a valid host name",
+ "data": "www.example.com",
+ "valid": true
+ },
+ {
+ "description": "a host name starting with an illegal character",
+ "data": "-a-host-name-that-starts-with--",
+ "valid": false
+ },
+ {
+ "description": "a host name containing illegal characters",
+ "data": "not_a_valid_host_name",
+ "valid": false
+ },
+ {
+ "description": "a host name with a component too long",
+ "data": "a-vvvvvvvvvvvvvvvveeeeeeeeeeeeeeeerrrrrrrrrrrrrrrryyyyyyyyyyyyyyyy-long-host-name-component",
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/items.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/items.json
new file mode 100644
index 0000000000..f5e18a1384
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/items.json
@@ -0,0 +1,46 @@
+[
+ {
+ "description": "a schema given for items",
+ "schema": {
+ "items": {"type": "integer"}
+ },
+ "tests": [
+ {
+ "description": "valid items",
+ "data": [ 1, 2, 3 ],
+ "valid": true
+ },
+ {
+ "description": "wrong type of items",
+ "data": [1, "x"],
+ "valid": false
+ },
+ {
+ "description": "ignores non-arrays",
+ "data": {"foo" : "bar"},
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "an array of schemas for items",
+ "schema": {
+ "items": [
+ {"type": "integer"},
+ {"type": "string"}
+ ]
+ },
+ "tests": [
+ {
+ "description": "correct types",
+ "data": [ 1, "foo" ],
+ "valid": true
+ },
+ {
+ "description": "wrong types",
+ "data": [ "foo", 1 ],
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxItems.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxItems.json
new file mode 100644
index 0000000000..3b53a6b371
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxItems.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "maxItems validation",
+ "schema": {"maxItems": 2},
+ "tests": [
+ {
+ "description": "shorter is valid",
+ "data": [1],
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": [1, 2],
+ "valid": true
+ },
+ {
+ "description": "too long is invalid",
+ "data": [1, 2, 3],
+ "valid": false
+ },
+ {
+ "description": "ignores non-arrays",
+ "data": "foobar",
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxLength.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxLength.json
new file mode 100644
index 0000000000..48eb1296d2
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxLength.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "maxLength validation",
+ "schema": {"maxLength": 2},
+ "tests": [
+ {
+ "description": "shorter is valid",
+ "data": "f",
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": "fo",
+ "valid": true
+ },
+ {
+ "description": "too long is invalid",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "ignores non-strings",
+ "data": 100,
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxProperties.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxProperties.json
new file mode 100644
index 0000000000..d282446ad6
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maxProperties.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "maxProperties validation",
+ "schema": {"maxProperties": 2},
+ "tests": [
+ {
+ "description": "shorter is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": {"foo": 1, "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "too long is invalid",
+ "data": {"foo": 1, "bar": 2, "baz": 3},
+ "valid": false
+ },
+ {
+ "description": "ignores non-objects",
+ "data": "foobar",
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maximum.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maximum.json
new file mode 100644
index 0000000000..86c7b89c9a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/maximum.json
@@ -0,0 +1,42 @@
+[
+ {
+ "description": "maximum validation",
+ "schema": {"maximum": 3.0},
+ "tests": [
+ {
+ "description": "below the maximum is valid",
+ "data": 2.6,
+ "valid": true
+ },
+ {
+ "description": "above the maximum is invalid",
+ "data": 3.5,
+ "valid": false
+ },
+ {
+ "description": "ignores non-numbers",
+ "data": "x",
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "exclusiveMaximum validation",
+ "schema": {
+ "maximum": 3.0,
+ "exclusiveMaximum": true
+ },
+ "tests": [
+ {
+ "description": "below the maximum is still valid",
+ "data": 2.2,
+ "valid": true
+ },
+ {
+ "description": "boundary point is invalid",
+ "data": 3.0,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minItems.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minItems.json
new file mode 100644
index 0000000000..ed5118815e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minItems.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "minItems validation",
+ "schema": {"minItems": 1},
+ "tests": [
+ {
+ "description": "longer is valid",
+ "data": [1, 2],
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": [1],
+ "valid": true
+ },
+ {
+ "description": "too short is invalid",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "ignores non-arrays",
+ "data": "",
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minLength.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minLength.json
new file mode 100644
index 0000000000..e9c14b1723
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minLength.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "minLength validation",
+ "schema": {"minLength": 2},
+ "tests": [
+ {
+ "description": "longer is valid",
+ "data": "foo",
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": "fo",
+ "valid": true
+ },
+ {
+ "description": "too short is invalid",
+ "data": "f",
+ "valid": false
+ },
+ {
+ "description": "ignores non-strings",
+ "data": 1,
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minProperties.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minProperties.json
new file mode 100644
index 0000000000..a72c7d293e
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minProperties.json
@@ -0,0 +1,28 @@
+[
+ {
+ "description": "minProperties validation",
+ "schema": {"minProperties": 1},
+ "tests": [
+ {
+ "description": "longer is valid",
+ "data": {"foo": 1, "bar": 2},
+ "valid": true
+ },
+ {
+ "description": "exact length is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "too short is invalid",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "ignores non-objects",
+ "data": "",
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minimum.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minimum.json
new file mode 100644
index 0000000000..d5bf000bcc
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/minimum.json
@@ -0,0 +1,42 @@
+[
+ {
+ "description": "minimum validation",
+ "schema": {"minimum": 1.1},
+ "tests": [
+ {
+ "description": "above the minimum is valid",
+ "data": 2.6,
+ "valid": true
+ },
+ {
+ "description": "below the minimum is invalid",
+ "data": 0.6,
+ "valid": false
+ },
+ {
+ "description": "ignores non-numbers",
+ "data": "x",
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "exclusiveMinimum validation",
+ "schema": {
+ "minimum": 1.1,
+ "exclusiveMinimum": true
+ },
+ "tests": [
+ {
+ "description": "above the minimum is still valid",
+ "data": 1.2,
+ "valid": true
+ },
+ {
+ "description": "boundary point is invalid",
+ "data": 1.1,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/multipleOf.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/multipleOf.json
new file mode 100644
index 0000000000..ca3b761805
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/multipleOf.json
@@ -0,0 +1,60 @@
+[
+ {
+ "description": "by int",
+ "schema": {"multipleOf": 2},
+ "tests": [
+ {
+ "description": "int by int",
+ "data": 10,
+ "valid": true
+ },
+ {
+ "description": "int by int fail",
+ "data": 7,
+ "valid": false
+ },
+ {
+ "description": "ignores non-numbers",
+ "data": "foo",
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "by number",
+ "schema": {"multipleOf": 1.5},
+ "tests": [
+ {
+ "description": "zero is multiple of anything",
+ "data": 0,
+ "valid": true
+ },
+ {
+ "description": "4.5 is multiple of 1.5",
+ "data": 4.5,
+ "valid": true
+ },
+ {
+ "description": "35 is not multiple of 1.5",
+ "data": 35,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "by small number",
+ "schema": {"multipleOf": 0.0001},
+ "tests": [
+ {
+ "description": "0.0075 is multiple of 0.0001",
+ "data": 0.0075,
+ "valid": true
+ },
+ {
+ "description": "0.00751 is not multiple of 0.0001",
+ "data": 0.00751,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/not.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/not.json
new file mode 100644
index 0000000000..f66690fe1b
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/not.json
@@ -0,0 +1,96 @@
+[
+ {
+ "description": "not",
+ "schema": {
+ "not": {"type": "integer"}
+ },
+ "tests": [
+ {
+ "description": "allowed",
+ "data": "foo",
+ "valid": true
+ },
+ {
+ "description": "disallowed",
+ "data": 1,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "not multiple types",
+ "schema": {
+ "not": {"type": ["integer", "boolean"]}
+ },
+ "tests": [
+ {
+ "description": "valid",
+ "data": "foo",
+ "valid": true
+ },
+ {
+ "description": "mismatch",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "other mismatch",
+ "data": true,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "not more complex schema",
+ "schema": {
+ "not": {
+ "type": "object",
+ "properties": {
+ "foo": {
+ "type": "string"
+ }
+ }
+ }
+ },
+ "tests": [
+ {
+ "description": "match",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "other match",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "mismatch",
+ "data": {"foo": "bar"},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "forbidden property",
+ "schema": {
+ "properties": {
+ "foo": {
+ "not": {}
+ }
+ }
+ },
+ "tests": [
+ {
+ "description": "property present",
+ "data": {"foo": 1, "bar": 2},
+ "valid": false
+ },
+ {
+ "description": "property absent",
+ "data": {"bar": 1, "baz": 2},
+ "valid": true
+ }
+ ]
+ }
+
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/nullAndFormat.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/nullAndFormat.json
new file mode 100644
index 0000000000..d7fce9f509
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/nullAndFormat.json
@@ -0,0 +1,18 @@
+[
+ {
+ "description": "validation of null and format",
+ "schema": {"type": ["null", "string"], "format": "date-time"},
+ "tests": [
+ {
+ "description": "a valid date-time string",
+ "data": "1963-06-19T08:30:06.283185Z",
+ "valid": true
+ },
+ {
+ "description": "allow null",
+ "data": null,
+ "valid": true
+ }
+ ]
+ }
+] \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/oneOf.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/oneOf.json
new file mode 100644
index 0000000000..1eaa4e4794
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/oneOf.json
@@ -0,0 +1,68 @@
+[
+ {
+ "description": "oneOf",
+ "schema": {
+ "oneOf": [
+ {
+ "type": "integer"
+ },
+ {
+ "minimum": 2
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "first oneOf valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "second oneOf valid",
+ "data": 2.5,
+ "valid": true
+ },
+ {
+ "description": "both oneOf valid",
+ "data": 3,
+ "valid": false
+ },
+ {
+ "description": "neither oneOf valid",
+ "data": 1.5,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "oneOf with base schema",
+ "schema": {
+ "type": "string",
+ "oneOf" : [
+ {
+ "minLength": 2
+ },
+ {
+ "maxLength": 4
+ }
+ ]
+ },
+ "tests": [
+ {
+ "description": "mismatch base schema",
+ "data": 3,
+ "valid": false
+ },
+ {
+ "description": "one oneOf valid",
+ "data": "foobar",
+ "valid": true
+ },
+ {
+ "description": "both oneOf valid",
+ "data": "foo",
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/pattern.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/pattern.json
new file mode 100644
index 0000000000..befc4b560f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/pattern.json
@@ -0,0 +1,23 @@
+[
+ {
+ "description": "pattern validation",
+ "schema": {"pattern": "^a*$"},
+ "tests": [
+ {
+ "description": "a matching pattern is valid",
+ "data": "aaa",
+ "valid": true
+ },
+ {
+ "description": "a non-matching pattern is invalid",
+ "data": "abc",
+ "valid": false
+ },
+ {
+ "description": "ignores non-strings",
+ "data": true,
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/patternProperties.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/patternProperties.json
new file mode 100644
index 0000000000..18586e5dab
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/patternProperties.json
@@ -0,0 +1,110 @@
+[
+ {
+ "description":
+ "patternProperties validates properties matching a regex",
+ "schema": {
+ "patternProperties": {
+ "f.*o": {"type": "integer"}
+ }
+ },
+ "tests": [
+ {
+ "description": "a single valid match is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "multiple valid matches is valid",
+ "data": {"foo": 1, "foooooo" : 2},
+ "valid": true
+ },
+ {
+ "description": "a single invalid match is invalid",
+ "data": {"foo": "bar", "fooooo": 2},
+ "valid": false
+ },
+ {
+ "description": "multiple invalid matches is invalid",
+ "data": {"foo": "bar", "foooooo" : "baz"},
+ "valid": false
+ },
+ {
+ "description": "ignores non-objects",
+ "data": 12,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "multiple simultaneous patternProperties are validated",
+ "schema": {
+ "patternProperties": {
+ "a*": {"type": "integer"},
+ "aaa*": {"maximum": 20}
+ }
+ },
+ "tests": [
+ {
+ "description": "a single valid match is valid",
+ "data": {"a": 21},
+ "valid": true
+ },
+ {
+ "description": "a simultaneous match is valid",
+ "data": {"aaaa": 18},
+ "valid": true
+ },
+ {
+ "description": "multiple matches is valid",
+ "data": {"a": 21, "aaaa": 18},
+ "valid": true
+ },
+ {
+ "description": "an invalid due to one is invalid",
+ "data": {"a": "bar"},
+ "valid": false
+ },
+ {
+ "description": "an invalid due to the other is invalid",
+ "data": {"aaaa": 31},
+ "valid": false
+ },
+ {
+ "description": "an invalid due to both is invalid",
+ "data": {"aaa": "foo", "aaaa": 31},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "regexes are not anchored by default and are case sensitive",
+ "schema": {
+ "patternProperties": {
+ "[0-9]{2,}": { "type": "boolean" },
+ "X_": { "type": "string" }
+ }
+ },
+ "tests": [
+ {
+ "description": "non recognized members are ignored",
+ "data": { "answer 1": "42" },
+ "valid": true
+ },
+ {
+ "description": "recognized members are accounted for",
+ "data": { "a31b": null },
+ "valid": false
+ },
+ {
+ "description": "regexes are case sensitive",
+ "data": { "a_x_3": 3 },
+ "valid": true
+ },
+ {
+ "description": "regexes are case sensitive, 2",
+ "data": { "a_X_3": 3 },
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/properties.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/properties.json
new file mode 100644
index 0000000000..cd1644dcd9
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/properties.json
@@ -0,0 +1,92 @@
+[
+ {
+ "description": "object properties validation",
+ "schema": {
+ "properties": {
+ "foo": {"type": "integer"},
+ "bar": {"type": "string"}
+ }
+ },
+ "tests": [
+ {
+ "description": "both properties present and valid is valid",
+ "data": {"foo": 1, "bar": "baz"},
+ "valid": true
+ },
+ {
+ "description": "one property invalid is invalid",
+ "data": {"foo": 1, "bar": {}},
+ "valid": false
+ },
+ {
+ "description": "both properties invalid is invalid",
+ "data": {"foo": [], "bar": {}},
+ "valid": false
+ },
+ {
+ "description": "doesn't invalidate other properties",
+ "data": {"quux": []},
+ "valid": true
+ },
+ {
+ "description": "ignores non-objects",
+ "data": [],
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description":
+ "properties, patternProperties, additionalProperties interaction",
+ "schema": {
+ "properties": {
+ "foo": {"type": "array", "maxItems": 3},
+ "bar": {"type": "array"}
+ },
+ "patternProperties": {"f.o": {"minItems": 2}},
+ "additionalProperties": {"type": "integer"}
+ },
+ "tests": [
+ {
+ "description": "property validates property",
+ "data": {"foo": [1, 2]},
+ "valid": true
+ },
+ {
+ "description": "property invalidates property",
+ "data": {"foo": [1, 2, 3, 4]},
+ "valid": false
+ },
+ {
+ "description": "patternProperty invalidates property",
+ "data": {"foo": []},
+ "valid": false
+ },
+ {
+ "description": "patternProperty validates nonproperty",
+ "data": {"fxo": [1, 2]},
+ "valid": true
+ },
+ {
+ "description": "patternProperty invalidates nonproperty",
+ "data": {"fxo": []},
+ "valid": false
+ },
+ {
+ "description": "additionalProperty ignores property",
+ "data": {"bar": []},
+ "valid": true
+ },
+ {
+ "description": "additionalProperty validates others",
+ "data": {"quux": 3},
+ "valid": true
+ },
+ {
+ "description": "additionalProperty invalidates others",
+ "data": {"quux": "foo"},
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/ref.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/ref.json
new file mode 100644
index 0000000000..d8214bc2b3
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/ref.json
@@ -0,0 +1,128 @@
+[
+ {
+ "description": "root pointer ref",
+ "schema": {
+ "properties": {
+ "foo": {"$ref": "#"}
+ },
+ "additionalProperties": false
+ },
+ "tests": [
+ {
+ "description": "match",
+ "data": {"foo": false},
+ "valid": true
+ },
+ {
+ "description": "recursive match",
+ "data": {"foo": {"foo": false}},
+ "valid": true
+ },
+ {
+ "description": "mismatch",
+ "data": {"bar": false},
+ "valid": false
+ },
+ {
+ "description": "recursive mismatch",
+ "data": {"foo": {"bar": false}},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "relative pointer ref to object",
+ "schema": {
+ "properties": {
+ "foo": {"type": "integer"},
+ "bar": {"$ref": "#/properties/foo"}
+ }
+ },
+ "tests": [
+ {
+ "description": "match",
+ "data": {"bar": 3},
+ "valid": true
+ },
+ {
+ "description": "mismatch",
+ "data": {"bar": true},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "relative pointer ref to array",
+ "schema": {
+ "items": [
+ {"type": "integer"},
+ {"$ref": "#/items/0"}
+ ]
+ },
+ "tests": [
+ {
+ "description": "match array",
+ "data": [1, 2],
+ "valid": true
+ },
+ {
+ "description": "mismatch array",
+ "data": [1, "foo"],
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "escaped pointer ref",
+ "schema": {
+ "tilda~field": {"type": "integer"},
+ "slash/field": {"type": "integer"},
+ "percent%field": {"type": "integer"},
+ "properties": {
+ "tilda": {"$ref": "#/tilda~0field"},
+ "slash": {"$ref": "#/slash~1field"},
+ "percent": {"$ref": "#/percent%25field"}
+ }
+ },
+ "tests": [
+ {
+ "description": "slash",
+ "data": {"slash": "aoeu"},
+ "valid": false
+ },
+ {
+ "description": "tilda",
+ "data": {"tilda": "aoeu"},
+ "valid": false
+ },
+ {
+ "description": "percent",
+ "data": {"percent": "aoeu"},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "nested refs",
+ "schema": {
+ "definitions": {
+ "a": {"type": "integer"},
+ "b": {"$ref": "#/definitions/a"},
+ "c": {"$ref": "#/definitions/b"}
+ },
+ "$ref": "#/definitions/c"
+ },
+ "tests": [
+ {
+ "description": "nested ref valid",
+ "data": 5,
+ "valid": true
+ },
+ {
+ "description": "nested ref invalid",
+ "data": "a",
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/refRemote.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/refRemote.json
new file mode 100644
index 0000000000..4ca804732c
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/refRemote.json
@@ -0,0 +1,74 @@
+[
+ {
+ "description": "remote ref",
+ "schema": {"$ref": "http://localhost:1234/integer.json"},
+ "tests": [
+ {
+ "description": "remote ref valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "remote ref invalid",
+ "data": "a",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "fragment within remote ref",
+ "schema": {"$ref": "http://localhost:1234/subSchemas.json#/integer"},
+ "tests": [
+ {
+ "description": "remote fragment valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "remote fragment invalid",
+ "data": "a",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "ref within remote ref",
+ "schema": {
+ "$ref": "http://localhost:1234/subSchemas.json#/refToInteger"
+ },
+ "tests": [
+ {
+ "description": "ref within ref valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "ref within ref invalid",
+ "data": "a",
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "change resolution scope",
+ "schema": {
+ "id": "http://localhost:1234/",
+ "items": {
+ "id": "folder/",
+ "items": {"$ref": "folderInteger.json"}
+ }
+ },
+ "tests": [
+ {
+ "description": "changed scope ref valid",
+ "data": [[1]],
+ "valid": true
+ },
+ {
+ "description": "changed scope ref invalid",
+ "data": [["a"]],
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/required.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/required.json
new file mode 100644
index 0000000000..612f73f347
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/required.json
@@ -0,0 +1,39 @@
+[
+ {
+ "description": "required validation",
+ "schema": {
+ "properties": {
+ "foo": {},
+ "bar": {}
+ },
+ "required": ["foo"]
+ },
+ "tests": [
+ {
+ "description": "present required property is valid",
+ "data": {"foo": 1},
+ "valid": true
+ },
+ {
+ "description": "non-present required property is invalid",
+ "data": {"bar": 1},
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "required default validation",
+ "schema": {
+ "properties": {
+ "foo": {}
+ }
+ },
+ "tests": [
+ {
+ "description": "not required by default",
+ "data": {},
+ "valid": true
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/type.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/type.json
new file mode 100644
index 0000000000..257f051292
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/type.json
@@ -0,0 +1,330 @@
+[
+ {
+ "description": "integer type matches integers",
+ "schema": {"type": "integer"},
+ "tests": [
+ {
+ "description": "an integer is an integer",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "a float is not an integer",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is not an integer",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is not an integer",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not an integer",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not an integer",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is not an integer",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "number type matches numbers",
+ "schema": {"type": "number"},
+ "tests": [
+ {
+ "description": "an integer is a number",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "a float is a number",
+ "data": 1.1,
+ "valid": true
+ },
+ {
+ "description": "a string is not a number",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is not a number",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not a number",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not a number",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is not a number",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "string type matches strings",
+ "schema": {"type": "string"},
+ "tests": [
+ {
+ "description": "1 is not a string",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "a float is not a string",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is a string",
+ "data": "foo",
+ "valid": true
+ },
+ {
+ "description": "an object is not a string",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not a string",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not a string",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is not a string",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "object type matches objects",
+ "schema": {"type": "object"},
+ "tests": [
+ {
+ "description": "an integer is not an object",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "a float is not an object",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is not an object",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is an object",
+ "data": {},
+ "valid": true
+ },
+ {
+ "description": "an array is not an object",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not an object",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is not an object",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "array type matches arrays",
+ "schema": {"type": "array"},
+ "tests": [
+ {
+ "description": "an integer is not an array",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "a float is not an array",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is not an array",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is not an array",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not an array",
+ "data": [],
+ "valid": true
+ },
+ {
+ "description": "a boolean is not an array",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is not an array",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "boolean type matches booleans",
+ "schema": {"type": "boolean"},
+ "tests": [
+ {
+ "description": "an integer is not a boolean",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "a float is not a boolean",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is not a boolean",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is not a boolean",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not a boolean",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not a boolean",
+ "data": true,
+ "valid": true
+ },
+ {
+ "description": "null is not a boolean",
+ "data": null,
+ "valid": false
+ }
+ ]
+ },
+ {
+ "description": "null type matches only the null object",
+ "schema": {"type": "null"},
+ "tests": [
+ {
+ "description": "an integer is not null",
+ "data": 1,
+ "valid": false
+ },
+ {
+ "description": "a float is not null",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "a string is not null",
+ "data": "foo",
+ "valid": false
+ },
+ {
+ "description": "an object is not null",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is not null",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is not null",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is null",
+ "data": null,
+ "valid": true
+ }
+ ]
+ },
+ {
+ "description": "multiple types can be specified in an array",
+ "schema": {"type": ["integer", "string"]},
+ "tests": [
+ {
+ "description": "an integer is valid",
+ "data": 1,
+ "valid": true
+ },
+ {
+ "description": "a string is valid",
+ "data": "foo",
+ "valid": true
+ },
+ {
+ "description": "a float is invalid",
+ "data": 1.1,
+ "valid": false
+ },
+ {
+ "description": "an object is invalid",
+ "data": {},
+ "valid": false
+ },
+ {
+ "description": "an array is invalid",
+ "data": [],
+ "valid": false
+ },
+ {
+ "description": "a boolean is invalid",
+ "data": true,
+ "valid": false
+ },
+ {
+ "description": "null is invalid",
+ "data": null,
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/uniqueItems.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/uniqueItems.json
new file mode 100644
index 0000000000..c1f4ab99c9
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema-draft4/uniqueItems.json
@@ -0,0 +1,79 @@
+[
+ {
+ "description": "uniqueItems validation",
+ "schema": {"uniqueItems": true},
+ "tests": [
+ {
+ "description": "unique array of integers is valid",
+ "data": [1, 2],
+ "valid": true
+ },
+ {
+ "description": "non-unique array of integers is invalid",
+ "data": [1, 1],
+ "valid": false
+ },
+ {
+ "description": "numbers are unique if mathematically unequal",
+ "data": [1.0, 1.00, 1],
+ "valid": false
+ },
+ {
+ "description": "unique array of objects is valid",
+ "data": [{"foo": "bar"}, {"foo": "baz"}],
+ "valid": true
+ },
+ {
+ "description": "non-unique array of objects is invalid",
+ "data": [{"foo": "bar"}, {"foo": "bar"}],
+ "valid": false
+ },
+ {
+ "description": "unique array of nested objects is valid",
+ "data": [
+ {"foo": {"bar" : {"baz" : true}}},
+ {"foo": {"bar" : {"baz" : false}}}
+ ],
+ "valid": true
+ },
+ {
+ "description": "non-unique array of nested objects is invalid",
+ "data": [
+ {"foo": {"bar" : {"baz" : true}}},
+ {"foo": {"bar" : {"baz" : true}}}
+ ],
+ "valid": false
+ },
+ {
+ "description": "unique array of arrays is valid",
+ "data": [["foo"], ["bar"]],
+ "valid": true
+ },
+ {
+ "description": "non-unique array of arrays is invalid",
+ "data": [["foo"], ["foo"]],
+ "valid": false
+ },
+ {
+ "description": "1 and true are unique",
+ "data": [1, true],
+ "valid": true
+ },
+ {
+ "description": "0 and false are unique",
+ "data": [0, false],
+ "valid": true
+ },
+ {
+ "description": "unique heterogeneous types are valid",
+ "data": [{}, [1], true, null, 1],
+ "valid": true
+ },
+ {
+ "description": "non-unique heterogeneous types are invalid",
+ "data": [{}, [1], true, null, {}, 1],
+ "valid": false
+ }
+ ]
+ }
+]
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema.js
new file mode 100644
index 0000000000..e68a263a27
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/json-schema.js
@@ -0,0 +1,23 @@
+var tape = require('tape')
+var fs = require('fs')
+var validator = require('../')
+
+var files = fs.readdirSync(__dirname+'/json-schema-draft4')
+ .map(function(file) {
+ if (file === 'definitions.json') return null
+ if (file === 'refRemote.json') return null
+ return require('./json-schema-draft4/'+file)
+ })
+ .filter(Boolean)
+
+files.forEach(function(file) {
+ file.forEach(function(f) {
+ tape('json-schema-test-suite '+f.description, function(t) {
+ var validate = validator(f.schema)
+ f.tests.forEach(function(test) {
+ t.same(validate(test.data), test.valid, test.description)
+ })
+ t.end()
+ })
+ })
+})
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js
new file mode 100644
index 0000000000..6f22d007ff
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/is-my-json-valid/test/misc.js
@@ -0,0 +1,366 @@
+var tape = require('tape')
+var cosmic = require('./fixtures/cosmic')
+var validator = require('../')
+var validatorRequire = require('../require')
+
+tape('simple', function(t) {
+ var schema = {
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {type:'string', required:true}
+ }
+ }
+
+ var validate = validator(schema)
+
+ t.ok(validate({hello: 'world'}), 'should be valid')
+ t.notOk(validate(), 'should be invalid')
+ t.notOk(validate({}), 'should be invalid')
+ t.end()
+})
+
+tape('advanced', function(t) {
+ var validate = validator(cosmic.schema)
+
+ t.ok(validate(cosmic.valid), 'should be valid')
+ t.notOk(validate(cosmic.invalid), 'should be invalid')
+ t.end()
+})
+
+tape('greedy/false', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ x: {
+ type: 'number'
+ }
+ },
+ required: ['x', 'y']
+ });
+ t.notOk(validate({}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 2);
+ t.strictEqual(validate.errors[0].field, 'data.x')
+ t.strictEqual(validate.errors[0].message, 'is required')
+ t.strictEqual(validate.errors[1].field, 'data.y')
+ t.strictEqual(validate.errors[1].message, 'is required')
+ t.notOk(validate({x: 'string'}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 1);
+ t.strictEqual(validate.errors[0].field, 'data.y')
+ t.strictEqual(validate.errors[0].message, 'is required')
+ t.notOk(validate({x: 'string', y: 'value'}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 1);
+ t.strictEqual(validate.errors[0].field, 'data.x')
+ t.strictEqual(validate.errors[0].message, 'is the wrong type')
+ t.end();
+});
+
+tape('greedy/true', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ x: {
+ type: 'number'
+ }
+ },
+ required: ['x', 'y']
+ }, {
+ greedy: true
+ });
+ t.notOk(validate({}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 2);
+ t.strictEqual(validate.errors[0].field, 'data.x')
+ t.strictEqual(validate.errors[0].message, 'is required')
+ t.strictEqual(validate.errors[1].field, 'data.y')
+ t.strictEqual(validate.errors[1].message, 'is required')
+ t.notOk(validate({x: 'string'}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 2);
+ t.strictEqual(validate.errors[0].field, 'data.y')
+ t.strictEqual(validate.errors[0].message, 'is required')
+ t.strictEqual(validate.errors[1].field, 'data.x')
+ t.strictEqual(validate.errors[1].message, 'is the wrong type')
+ t.notOk(validate({x: 'string', y: 'value'}), 'should be invalid')
+ t.strictEqual(validate.errors.length, 1);
+ t.strictEqual(validate.errors[0].field, 'data.x')
+ t.strictEqual(validate.errors[0].message, 'is the wrong type')
+ t.ok(validate({x: 1, y: 'value'}), 'should be invalid')
+ t.end();
+});
+
+tape('additional props', function(t) {
+ var validate = validator({
+ type: 'object',
+ additionalProperties: false
+ }, {
+ verbose: true
+ })
+
+ t.ok(validate({}))
+ t.notOk(validate({foo:'bar'}))
+ t.ok(validate.errors[0].value === 'data.foo', 'should output the property not allowed in verbose mode')
+ t.end()
+})
+
+tape('array', function(t) {
+ var validate = validator({
+ type: 'array',
+ required: true,
+ items: {
+ type: 'string'
+ }
+ })
+
+ t.notOk(validate({}), 'wrong type')
+ t.notOk(validate(), 'is required')
+ t.ok(validate(['test']))
+ t.end()
+})
+
+tape('nested array', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ list: {
+ type: 'array',
+ required: true,
+ items: {
+ type: 'string'
+ }
+ }
+ }
+ })
+
+ t.notOk(validate({}), 'is required')
+ t.ok(validate({list:['test']}))
+ t.notOk(validate({list:[1]}))
+ t.end()
+})
+
+tape('enum', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ foo: {
+ type: 'number',
+ required: true,
+ enum: [42]
+ }
+ }
+ })
+
+ t.notOk(validate({}), 'is required')
+ t.ok(validate({foo:42}))
+ t.notOk(validate({foo:43}))
+ t.end()
+})
+
+tape('minimum/maximum', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ foo: {
+ type: 'number',
+ minimum: 0,
+ maximum: 0
+ }
+ }
+ })
+
+ t.notOk(validate({foo:-42}))
+ t.ok(validate({foo:0}))
+ t.notOk(validate({foo:42}))
+ t.end()
+})
+
+tape('exclusiveMinimum/exclusiveMaximum', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ foo: {
+ type: 'number',
+ minimum: 10,
+ maximum: 20,
+ exclusiveMinimum: true,
+ exclusiveMaximum: true
+ }
+ }
+ })
+
+ t.notOk(validate({foo:10}))
+ t.ok(validate({foo:11}))
+ t.notOk(validate({foo:20}))
+ t.ok(validate({foo:19}))
+ t.end()
+})
+
+tape('custom format', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ foo: {
+ type: 'string',
+ format: 'as'
+ }
+ }
+ }, {formats: {as:/^a+$/}})
+
+ t.notOk(validate({foo:''}), 'not as')
+ t.notOk(validate({foo:'b'}), 'not as')
+ t.notOk(validate({foo:'aaab'}), 'not as')
+ t.ok(validate({foo:'a'}), 'as')
+ t.ok(validate({foo:'aaaaaa'}), 'as')
+ t.end()
+})
+
+tape('custom format function', function(t) {
+ var validate = validator({
+ type: 'object',
+ properties: {
+ foo: {
+ type: 'string',
+ format: 'as'
+ }
+ }
+ }, {formats: {as:function(s) { return /^a+$/.test(s) } }})
+
+ t.notOk(validate({foo:''}), 'not as')
+ t.notOk(validate({foo:'b'}), 'not as')
+ t.notOk(validate({foo:'aaab'}), 'not as')
+ t.ok(validate({foo:'a'}), 'as')
+ t.ok(validate({foo:'aaaaaa'}), 'as')
+ t.end()
+})
+
+tape('do not mutate schema', function(t) {
+ var sch = {
+ items: [
+ {}
+ ],
+ additionalItems: {
+ type: 'integer'
+ }
+ }
+
+ var copy = JSON.parse(JSON.stringify(sch))
+
+ validator(sch)
+
+ t.same(sch, copy, 'did not mutate')
+ t.end()
+})
+
+tape('#toJSON()', function(t) {
+ var schema = {
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {type:'string', required:true}
+ }
+ }
+
+ var validate = validator(schema)
+
+ t.deepEqual(validate.toJSON(), schema, 'should return original schema')
+ t.end()
+})
+
+tape('external schemas', function(t) {
+ var ext = {type: 'string'}
+ var schema = {
+ required: true,
+ $ref: '#ext'
+ }
+
+ var validate = validator(schema, {schemas: {ext:ext}})
+
+ t.ok(validate('hello string'), 'is a string')
+ t.notOk(validate(42), 'not a string')
+ t.end()
+})
+
+tape('nested required array decl', function(t) {
+ var schema = {
+ properties: {
+ x: {
+ type: 'object',
+ properties: {
+ y: {
+ type: 'object',
+ properties: {
+ z: {
+ type: 'string'
+ }
+ },
+ required: ['z']
+ }
+ }
+ }
+ },
+ required: ['x']
+ }
+
+ var validate = validator(schema)
+
+ t.ok(validate({x: {}}), 'should be valid')
+ t.notOk(validate({}), 'should not be valid')
+ t.strictEqual(validate.errors[0].field, 'data.x', 'should output the missing field')
+ t.end()
+})
+
+tape('verbose mode', function(t) {
+ var schema = {
+ required: true,
+ type: 'object',
+ properties: {
+ hello: {
+ required: true,
+ type: 'string'
+ }
+ }
+ };
+
+ var validate = validator(schema, {verbose: true})
+
+ t.ok(validate({hello: 'string'}), 'should be valid')
+ t.notOk(validate({hello: 100}), 'should not be valid')
+ t.strictEqual(validate.errors[0].value, 100, 'error object should contain the invalid value')
+ t.end()
+})
+
+tape('additional props in verbose mode', function(t) {
+ var schema = {
+ type: 'object',
+ required: true,
+ additionalProperties: false,
+ properties: {
+ foo: {
+ type: 'string'
+ },
+ 'hello world': {
+ type: 'object',
+ required: true,
+ additionalProperties: false,
+ properties: {
+ foo: {
+ type: 'string'
+ }
+ }
+ }
+ }
+ };
+
+ var validate = validator(schema, {verbose: true})
+
+ validate({'hello world': {bar: 'string'}});
+
+ t.strictEqual(validate.errors[0].value, 'data["hello world"].bar', 'should output the path to the additional prop in the error')
+ t.end()
+})
+
+tape('Date.now() is an integer', function(t) {
+ var schema = {type: 'integer'}
+ var validate = validator(schema)
+
+ t.ok(validate(Date.now()), 'is integer')
+ t.end()
+})
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.jshintrc b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.jshintrc
deleted file mode 100644
index e14e4dcbd2..0000000000
--- a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.jshintrc
+++ /dev/null
@@ -1,67 +0,0 @@
-{
- "maxerr" : 50,
- "bitwise" : true,
- "camelcase" : true,
- "curly" : true,
- "eqeqeq" : true,
- "forin" : true,
- "immed" : true,
- "indent" : 2,
- "latedef" : true,
- "newcap" : true,
- "noarg" : true,
- "noempty" : true,
- "nonew" : true,
- "plusplus" : true,
- "quotmark" : true,
- "undef" : true,
- "unused" : true,
- "strict" : true,
- "trailing" : true,
- "maxparams" : false,
- "maxdepth" : false,
- "maxstatements" : false,
- "maxcomplexity" : false,
- "maxlen" : false,
- "asi" : false,
- "boss" : false,
- "debug" : false,
- "eqnull" : true,
- "es5" : false,
- "esnext" : false,
- "moz" : false,
- "evil" : false,
- "expr" : true,
- "funcscope" : true,
- "globalstrict" : true,
- "iterator" : true,
- "lastsemic" : false,
- "laxbreak" : false,
- "laxcomma" : false,
- "loopfunc" : false,
- "multistr" : false,
- "proto" : false,
- "scripturl" : false,
- "smarttabs" : false,
- "shadow" : false,
- "sub" : false,
- "supernew" : false,
- "validthis" : false,
- "browser" : true,
- "couch" : false,
- "devel" : true,
- "dojo" : false,
- "jquery" : false,
- "mootools" : false,
- "node" : true,
- "nonstandard" : false,
- "prototypejs" : false,
- "rhino" : false,
- "worker" : false,
- "wsh" : false,
- "yui" : false,
- "nomen" : true,
- "onevar" : true,
- "passfail" : false,
- "white" : true
-}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.npmignore b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.npmignore
new file mode 100644
index 0000000000..47cf365a07
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.npmignore
@@ -0,0 +1 @@
+test/**
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.travis.yml b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.travis.yml
new file mode 100644
index 0000000000..20fd86b6a5
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/.travis.yml
@@ -0,0 +1,3 @@
+language: node_js
+node_js:
+ - 0.10
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/LICENSE b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/LICENSE
new file mode 100644
index 0000000000..a70f253aa4
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/LICENSE
@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2011 Troy Goode <troygoode@gmail.com>
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be included
+in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/README.markdown b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/README.markdown
new file mode 100644
index 0000000000..879844560f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/README.markdown
@@ -0,0 +1,183 @@
+# require-directory
+
+Recursively iterates over specified directory, `require()`'ing each file, and returning a nested hash structure containing those modules.
+
+**[Follow me (@troygoode) on Twitter!](https://twitter.com/intent/user?screen_name=troygoode)**
+
+[![NPM](https://nodei.co/npm/require-directory.png?downloads=true&stars=true)](https://nodei.co/npm/require-directory/)
+
+[![build status](https://secure.travis-ci.org/troygoode/node-require-directory.png)](http://travis-ci.org/troygoode/node-require-directory)
+
+## How To Use
+
+### Installation (via [npm](https://npmjs.org/package/require-directory))
+
+```bash
+$ npm install require-directory
+```
+
+### Usage
+
+A common pattern in node.js is to include an index file which creates a hash of the files in its current directory. Given a directory structure like so:
+
+* app.js
+* routes/
+ * index.js
+ * home.js
+ * auth/
+ * login.js
+ * logout.js
+ * register.js
+
+`routes/index.js` uses `require-directory` to build the hash (rather than doing so manually) like so:
+
+```javascript
+var requireDirectory = require('require-directory');
+module.exports = requireDirectory(module);
+```
+
+`app.js` references `routes/index.js` like any other module, but it now has a hash/tree of the exports from the `./routes/` directory:
+
+```javascript
+var routes = require('./routes');
+
+// snip
+
+app.get('/', routes.home);
+app.get('/register', routes.auth.register);
+app.get('/login', routes.auth.login);
+app.get('/logout', routes.auth.logout);
+```
+
+The `routes` variable above is the equivalent of this:
+
+```javascript
+var routes = {
+ home: require('routes/home.js'),
+ auth: {
+ login: require('routes/auth/login.js'),
+ logout: require('routes/auth/logout.js'),
+ register: require('routes/auth/register.js')
+ }
+};
+```
+
+*Note that `routes.index` will be `undefined` as you would hope.*
+
+### Specifying Another Directory
+
+You can specify which directory you want to build a tree of (if it isn't the current directory for whatever reason) by passing it as the second parameter. Not specifying the path (`requireDirectory(module)`) is the equivelant of `requireDirectory(module, __dirname)`:
+
+```javascript
+var requireDirectory = require('require-directory');
+module.exports = requireDirectory(module, './some/subdirectory');
+```
+
+For example, in the [example in the Usage section](#usage) we could have avoided creating `routes/index.js` and instead changed the first lines of `app.js` to:
+
+```javascript
+var requireDirectory = require('require-directory');
+var routes = requireDirectory(module, './routes');
+```
+
+## Options
+
+You can pass an options hash to `require-directory` as the 2nd parameter (or 3rd if you're passing the path to another directory as the 2nd parameter already). Here are the available options:
+
+### Whitelisting
+
+Whitelisting (either via RegExp or function) allows you to specify that only certain files be loaded.
+
+```javascript
+var requireDirectory = require('require-directory'),
+ whitelist = /onlyinclude.js$/,
+ hash = requireDirectory(module, {include: whitelist});
+```
+
+```javascript
+var requireDirectory = require('require-directory'),
+ check = function(path){
+ if(/onlyinclude.js$/.test(path)){
+ return true; // don't include
+ }else{
+ return false; // go ahead and include
+ }
+ },
+ hash = requireDirectory(module, {include: check});
+```
+
+### Blacklisting
+
+Blacklisting (either via RegExp or function) allows you to specify that all but certain files should be loaded.
+
+```javascript
+var requireDirectory = require('require-directory'),
+ blacklist = /dontinclude\.js$/,
+ hash = requireDirectory(module, {exclude: blacklist});
+```
+
+```javascript
+var requireDirectory = require('require-directory'),
+ check = function(path){
+ if(/dontinclude\.js$/.test(path)){
+ return false; // don't include
+ }else{
+ return true; // go ahead and include
+ }
+ },
+ hash = requireDirectory(module, {exclude: check});
+```
+
+### Visiting Objects As They're Loaded
+
+`require-directory` takes a function as the `visit` option that will be called for each module that is added to module.exports.
+
+```javascript
+var requireDirectory = require('require-directory'),
+ visitor = function(obj) {
+ console.log(obj); // will be called for every module that is loaded
+ },
+ hash = requireDirectory(module, {visit: visitor});
+```
+
+The visitor can also transform the objects by returning a value:
+
+```javascript
+var requireDirectory = require('require-directory'),
+ visitor = function(obj) {
+ return obj(new Date());
+ },
+ hash = requireDirectory(module, {visit: visitor});
+```
+
+### Renaming Keys
+
+```javascript
+var requireDirectory = require('require-directory'),
+ renamer = function(name) {
+ return name.toUpperCase();
+ },
+ hash = requireDirectory(module, {rename: renamer});
+```
+
+### No Recursion
+
+```javascript
+var requireDirectory = require('require-directory'),
+ hash = requireDirectory(module, {recurse: false});
+```
+
+## Run Unit Tests
+
+```bash
+$ npm run lint
+$ npm test
+```
+
+## License
+
+[MIT License](http://www.opensource.org/licenses/mit-license.php)
+
+## Author
+
+[Troy Goode](https://github.com/TroyGoode) ([troygoode@gmail.com](mailto:troygoode@gmail.com))
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/index.js b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/index.js
new file mode 100644
index 0000000000..cd37da7ea8
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/index.js
@@ -0,0 +1,86 @@
+'use strict';
+
+var fs = require('fs'),
+ join = require('path').join,
+ resolve = require('path').resolve,
+ dirname = require('path').dirname,
+ defaultOptions = {
+ extensions: ['js', 'json', 'coffee'],
+ recurse: true,
+ rename: function (name) {
+ return name;
+ },
+ visit: function (obj) {
+ return obj;
+ }
+ };
+
+function checkFileInclusion(path, filename, options) {
+ return (
+ // verify file has valid extension
+ (new RegExp('\\.(' + options.extensions.join('|') + ')$', 'i').test(filename)) &&
+
+ // if options.include is a RegExp, evaluate it and make sure the path passes
+ !(options.include && options.include instanceof RegExp && !options.include.test(path)) &&
+
+ // if options.include is a function, evaluate it and make sure the path passes
+ !(options.include && typeof options.include === 'function' && !options.include(path, filename)) &&
+
+ // if options.exclude is a RegExp, evaluate it and make sure the path doesn't pass
+ !(options.exclude && options.exclude instanceof RegExp && options.exclude.test(path)) &&
+
+ // if options.exclude is a function, evaluate it and make sure the path doesn't pass
+ !(options.exclude && typeof options.exclude === 'function' && options.exclude(path, filename))
+ );
+}
+
+function requireDirectory(m, path, options) {
+ var retval = {};
+
+ // path is optional
+ if (path && !options && typeof path !== 'string') {
+ options = path;
+ path = null;
+ }
+
+ // default options
+ options = options || {};
+ for (var prop in defaultOptions) {
+ if (typeof options[prop] === 'undefined') {
+ options[prop] = defaultOptions[prop];
+ }
+ }
+
+ // if no path was passed in, assume the equivelant of __dirname from caller
+ // otherwise, resolve path relative to the equivalent of __dirname
+ path = !path ? dirname(m.filename) : resolve(dirname(m.filename), path);
+
+ // get the path of each file in specified directory, append to current tree node, recurse
+ fs.readdirSync(path).forEach(function (filename) {
+ var joined = join(path, filename),
+ files,
+ key,
+ obj;
+
+ if (fs.statSync(joined).isDirectory() && options.recurse) {
+ // this node is a directory; recurse
+ files = requireDirectory(m, joined, options);
+ // exclude empty directories
+ if (Object.keys(files).length) {
+ retval[options.rename(filename, joined, filename)] = files;
+ }
+ } else {
+ if (joined !== m.filename && checkFileInclusion(joined, filename, options)) {
+ // hash node key shouldn't include file extension
+ key = filename.substring(0, filename.lastIndexOf('.'));
+ obj = m.require(joined);
+ retval[options.rename(key, joined, filename)] = options.visit(obj, joined, filename) || obj;
+ }
+ }
+ });
+
+ return retval;
+}
+
+module.exports = requireDirectory;
+module.exports.defaults = defaultOptions;
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/package.json b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/package.json
new file mode 100644
index 0000000000..edfc23bf4a
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/node_modules/require-directory/package.json
@@ -0,0 +1,71 @@
+{
+ "author": {
+ "name": "Troy Goode",
+ "email": "troygoode@gmail.com",
+ "url": "http://github.com/troygoode/"
+ },
+ "name": "require-directory",
+ "version": "2.1.0",
+ "description": "Recursively iterates over specified directory, require()'ing each file, and returning a nested hash structure containing those modules.",
+ "keywords": [
+ "require",
+ "directory",
+ "library",
+ "recursive"
+ ],
+ "homepage": "https://github.com/troygoode/node-require-directory/",
+ "main": "index.js",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/troygoode/node-require-directory.git"
+ },
+ "contributors": [
+ {
+ "name": "Troy Goode",
+ "email": "troygoode@gmail.com",
+ "url": "http://github.com/troygoode/"
+ }
+ ],
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "http://www.opensource.org/licenses/mit-license.php"
+ }
+ ],
+ "bugs": {
+ "url": "http://github.com/troygoode/node-require-directory/issues/"
+ },
+ "engines": {
+ "node": ">=0.10.0"
+ },
+ "devDependencies": {
+ "jshint": "^2.6.0",
+ "mocha": "^2.1.0"
+ },
+ "scripts": {
+ "test": "mocha",
+ "lint": "jshint index.js test/test.js"
+ },
+ "gitHead": "08f75bb9e14aa33834519c4788c5618e318925db",
+ "_id": "require-directory@2.1.0",
+ "_shasum": "707ab5d99b3e819ccf3f2bc77195bdcea0f0e61b",
+ "_from": "require-directory@>=2.1.0 <3.0.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "troygoode",
+ "email": "troygoode@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "troygoode",
+ "email": "troygoode@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "707ab5d99b3e819ccf3f2bc77195bdcea0f0e61b",
+ "tarball": "http://registry.npmjs.org/require-directory/-/require-directory-2.1.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/require-directory/-/require-directory-2.1.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/package.json b/deps/npm/node_modules/request/node_modules/har-validator/package.json
new file mode 100644
index 0000000000..c1e9c83a55
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/package.json
@@ -0,0 +1,80 @@
+{
+ "version": "1.4.0",
+ "name": "har-validator",
+ "description": "Extremely fast HTTP Archive (HAR) validator using JSON Schema",
+ "author": {
+ "name": "Ahmad Nassri",
+ "email": "ahmad@ahmadnassri.com",
+ "url": "https://www.ahmadnassri.com/"
+ },
+ "homepage": "https://github.com/ahmadnassri/har-validator",
+ "license": "MIT",
+ "main": "./src/index.js",
+ "bin": {
+ "har-validator": "./bin/har-validator"
+ },
+ "keywords": [
+ "har",
+ "http",
+ "archive",
+ "validate",
+ "validator"
+ ],
+ "engines": {
+ "node": ">=0.10"
+ },
+ "files": [
+ "bin",
+ "src"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/ahmadnassri/har-validator"
+ },
+ "bugs": {
+ "url": "https://github.com/ahmadnassri/har-validator/issues"
+ },
+ "scripts": {
+ "test": "standard && mocha --reporter spec",
+ "coverage": "istanbul cover ./node_modules/mocha/bin/_mocha",
+ "codeclimate": "codeclimate < coverage/lcov.info"
+ },
+ "devDependencies": {
+ "codeclimate-test-reporter": "0.0.4",
+ "istanbul": "^0.3.8",
+ "mocha": "^2.2.1",
+ "should": "^5.2.0",
+ "standard": "^3.2.0"
+ },
+ "dependencies": {
+ "async": "^0.9.0",
+ "bluebird": "^2.9.14",
+ "chalk": "^1.0.0",
+ "commander": "^2.7.1",
+ "debug": "^2.1.3",
+ "is-my-json-valid": "^2.10.0",
+ "require-directory": "^2.1.0"
+ },
+ "gitHead": "6d7268e7bb929aaa98d1c919dcba231ea5e81084",
+ "_id": "har-validator@1.4.0",
+ "_shasum": "845924893a05602a9791c319f81d628948b1b2af",
+ "_from": "har-validator@>=1.4.0 <2.0.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "ahmadnassri",
+ "email": "ahmad@ahmadnassri.com"
+ },
+ "maintainers": [
+ {
+ "name": "ahmadnassri",
+ "email": "ahmad@ahmadnassri.com"
+ }
+ ],
+ "dist": {
+ "shasum": "845924893a05602a9791c319f81d628948b1b2af",
+ "tarball": "http://registry.npmjs.org/har-validator/-/har-validator-1.4.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/har-validator/-/har-validator-1.4.0.tgz"
+}
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/src/index.js b/deps/npm/node_modules/request/node_modules/har-validator/src/index.js
new file mode 100644
index 0000000000..4a505e618d
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/src/index.js
@@ -0,0 +1,45 @@
+'use strict'
+
+var validator = require('is-my-json-valid')
+var schemas = require('./schemas.json')
+
+function ValidationError (errors) {
+ this.name = 'ValidationError'
+ this.errors = errors
+}
+
+ValidationError.prototype = Error.prototype
+
+var runner = function (schema, data, cb) {
+ var validate = validator(schema, {
+ greedy: true,
+ verbose: true,
+ schemas: schemas
+ })
+
+ var valid = false
+
+ if (data !== undefined) {
+ // execute is-my-json-valid
+ valid = validate(data)
+ }
+
+ // callback?
+ if (!cb) {
+ return validate.errors ? false : true
+ } else {
+ return cb(validate.errors ? new ValidationError(validate.errors) : null, valid)
+ }
+
+ return valid
+}
+
+module.exports = function (data, cb) {
+ return runner(schemas.log, data, cb)
+}
+
+Object.keys(schemas).map(function (name) {
+ module.exports[name] = function (data, cb) {
+ return runner(schemas[name], data, cb)
+ }
+})
diff --git a/deps/npm/node_modules/request/node_modules/har-validator/src/schemas.json b/deps/npm/node_modules/request/node_modules/har-validator/src/schemas.json
new file mode 100644
index 0000000000..3a16c738ab
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/har-validator/src/schemas.json
@@ -0,0 +1,222 @@
+{
+ "log": {
+ "type": "object",
+ "required": ["log"],
+ "properties": {
+ "log": {
+ "type": "object",
+ "required": ["version", "creator", "entries"],
+ "properties": {
+ "version": { "type": "string" },
+ "creator": { "$ref": "#creator" },
+ "browser": { "$ref": "#creator" },
+ "pages": {
+ "type": "array",
+ "items": { "$ref": "#page" }
+ },
+ "entries": {
+ "type": "array",
+ "items": { "$ref": "#entry" }
+ },
+ "comment": { "type": "string" }
+ }
+ }
+ }
+ },
+
+ "creator": {
+ "type": "object",
+ "required": ["name", "version"],
+ "properties": {
+ "name": { "type": "string" },
+ "version": { "type": "string" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "page": {
+ "type": "object",
+ "optional": true,
+ "required": ["startedDateTime", "id", "title", "pageTimings"],
+ "properties": {
+ "startedDateTime": { "type": "string", "format": "date-time" },
+ "id": { "type": "string", "unique": true },
+ "title": { "type": "string" },
+ "pageTimings": { "$ref": "#pageTimings" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "pageTimings": {
+ "type": "object",
+ "properties": {
+ "onContentLoad": { "type": "number", "min": -1 },
+ "onLoad": { "type": "number", "min": -1 },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "entry": {
+ "type": "object",
+ "optional": true,
+ "required": ["startedDateTime", "time", "request", "response", "cache", "timings"],
+ "properties": {
+ "pageref": { "type": "string" },
+ "startedDateTime": { "type": "string", "format": "date-time" },
+ "time": { "type": "number", "min": 0 },
+ "request": { "$ref": "#request" },
+ "response": { "$ref": "#response" },
+ "cache": { "$ref": "#cache" },
+ "timings": { "$ref": "#timings" },
+ "serverIPAddress": { "type": "string", "format": "ipv4" },
+ "connection": { "type": "string" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "request": {
+ "type": "object",
+ "required": ["method", "url", "httpVersion", "cookies", "headers", "queryString", "headersSize", "bodySize"],
+ "properties": {
+ "method": { "type": "string" },
+ "url": { "type": "string", "format": "uri" },
+ "httpVersion": { "type": "string" },
+ "cookies": {
+ "type": "array",
+ "items": { "$ref": "#cookie" }
+ },
+ "headers": {
+ "type": "array",
+ "items": { "$ref": "#record" }
+ },
+ "queryString": {
+ "type": "array",
+ "items": { "$ref": "#record" }
+ },
+ "postData": { "$ref": "#postData" },
+ "headersSize": { "type": "number" },
+ "bodySize": { "type": "number" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "record": {
+ "type": "object",
+ "required": ["name", "value"],
+ "properties": {
+ "name": { "type": "string" },
+ "value": { "type": "string" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "response": {
+ "type": "object",
+ "required": ["status", "statusText", "httpVersion", "cookies", "headers", "content", "redirectURL", "headersSize", "bodySize"],
+ "properties": {
+ "status": { "type": "number" },
+ "statusText": { "type": "string" },
+ "httpVersion": { "type": "string" },
+ "cookies": {
+ "type": "array",
+ "items": { "$ref": "#cookie" }
+ },
+ "headers": {
+ "type": "array",
+ "items": { "$ref": "#record" }
+ },
+ "content": { "$ref": "#content" },
+ "redirectURL": { "type": "string" },
+ "headersSize": { "type": "number" },
+ "bodySize": { "type": "number" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "cookie": {
+ "type": "object",
+ "required": ["name", "value"],
+ "properties": {
+ "name": { "type": "string" },
+ "value": { "type": "string" },
+ "path": { "type": "string" },
+ "domain": { "type": "string" },
+ "expires": {
+ "type": "string",
+ "format": "date-time"
+ },
+ "httpOnly": { "type": "boolean" },
+ "secure": { "type": "boolean" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "postData": {
+ "type": "object",
+ "optional": true,
+ "required": ["mimeType"],
+ "properties": {
+ "mimeType": { "type": "string" },
+ "text": { "type": "string" },
+ "params": {
+ "type": "array",
+ "required": ["name"],
+ "properties": {
+ "name": { "type": "string" },
+ "value": { "type": "string" },
+ "fileName": { "type": "string" },
+ "contentType": { "type": "string" },
+ "comment": { "type": "string" }
+ }
+ },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "content": {
+ "type": "object",
+ "required": ["size", "mimeType"],
+ "properties": {
+ "size": { "type": "number" },
+ "compression": { "type": "number" },
+ "mimeType": { "type": "string" },
+ "text": { "type": "string" },
+ "encoding": { "type": "string" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "cache": {
+ "properties": {
+ "beforeRequest": { "$ref": "#cacheEntry" },
+ "afterRequest": { "$ref": "#cacheEntry" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "cacheEntry": {
+ "optional": true,
+ "required": ["lastAccess", "eTag", "hitCount"],
+ "properties": {
+ "expires": { "type": "string" },
+ "lastAccess": { "type": "string" },
+ "eTag": { "type": "string" },
+ "hitCount": { "type": "number" },
+ "comment": { "type": "string" }
+ }
+ },
+
+ "timings": {
+ "required": ["send", "wait", "receive"],
+ "properties": {
+ "dns": { "type": "number", "min": -1 },
+ "connect": { "type": "number", "min": -1 },
+ "blocked": { "type": "number", "min": -1 },
+ "send": { "type": "number", "min": -1 },
+ "wait": { "type": "number", "min": -1 },
+ "receive": { "type": "number", "min": -1 },
+ "ssl": { "type": "number", "min": -1 },
+ "comment": { "type": "string" }
+ }
+ }
+}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/boom/package.json b/deps/npm/node_modules/request/node_modules/hawk/node_modules/boom/package.json
index c5f765de26..abca707f57 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/boom/package.json
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/boom/package.json
@@ -62,6 +62,5 @@
"tarball": "http://registry.npmjs.org/boom/-/boom-2.6.1.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/boom/-/boom-2.6.1.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/boom/-/boom-2.6.1.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/package.json b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/package.json
index 18fee925f1..3d56485df1 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/package.json
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/cryptiles/package.json
@@ -60,6 +60,5 @@
"tarball": "http://registry.npmjs.org/cryptiles/-/cryptiles-2.0.4.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/cryptiles/-/cryptiles-2.0.4.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/cryptiles/-/cryptiles-2.0.4.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/.travis.yml b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/.travis.yml
index 047f7e3d5e..c84aade8c3 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/.travis.yml
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/.travis.yml
@@ -2,4 +2,6 @@ language: node_js
node_js:
- 0.10
+ - 0.12
+ - iojs
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/README.md b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/README.md
index a22fa06e97..b5f4d8a20f 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/README.md
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/README.md
@@ -72,7 +72,7 @@ Hoek provides several helpful methods for objects and arrays.
### clone(obj)
-This method is used to clone an object or an array. A *deep copy* is made (duplicates everything, including values that are objects).
+This method is used to clone an object or an array. A *deep copy* is made (duplicates everything, including values that are objects, as well as non-enumerable properties).
```javascript
@@ -179,12 +179,14 @@ var options = { server: { port: 8080 } };
var config = Hoek.applyToDefaults(defaults, options); // results in { server: { port: 8080 }, name: 'example' }
```
-### deepEqual(b, a)
+### deepEqual(b, a, [options])
-Performs a deep comparison of the two values including support for circular dependencies, prototype, and properties.
+Performs a deep comparison of the two values including support for circular dependencies, prototype, and properties. To skip prototype comparisons, use `options.prototype = false`
```javascript
-Hoek.deepEqual({ a: [1, 2], b: 'string', c: { d: true } }, { a: [1, 2], b: 'string', c: { d: true } });
+Hoek.deepEqual({ a: [1, 2], b: 'string', c: { d: true } }, { a: [1, 2], b: 'string', c: { d: true } }); //results in true
+Hoek.deepEqual(Object.create(null), {}, { prototype: false }); //results in true
+Hoek.deepEqual(Object.create(null), {}); //results in false
```
### unique(array, key)
@@ -499,7 +501,7 @@ nextFn();
console.log('Do this first');
// Results in:
-//
+//
// Do this first
// Do this later
```
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/lib/index.js b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/lib/index.js
index 9afabcddb3..02f8f42be9 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/lib/index.js
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/lib/index.js
@@ -61,17 +61,17 @@ exports.clone = function (obj, seen) {
seen.copy.push(newObj);
if (cloneDeep) {
- for (var i in obj) {
- if (obj.hasOwnProperty(i)) {
- var descriptor = Object.getOwnPropertyDescriptor(obj, i);
- if (descriptor.get ||
- descriptor.set) {
+ var keys = Object.getOwnPropertyNames(obj);
+ for (var i = 0, il = keys.length; i < il; ++i) {
+ var key = keys[i];
+ var descriptor = Object.getOwnPropertyDescriptor(obj, key);
+ if (descriptor.get ||
+ descriptor.set) {
- Object.defineProperty(newObj, i, descriptor);
- }
- else {
- newObj[i] = exports.clone(obj[i], seen);
- }
+ Object.defineProperty(newObj, key, descriptor);
+ }
+ else {
+ newObj[key] = exports.clone(obj[key], seen);
}
}
}
@@ -81,9 +81,9 @@ exports.clone = function (obj, seen) {
// Merge all the properties of source into target, source wins in conflict, and by default null and undefined from source are applied
-
+/*eslint-disable */
exports.merge = function (target, source, isNullOverride /* = true */, isMergeArrays /* = true */) {
-
+/*eslint-enable */
exports.assert(target && typeof target === 'object', 'Invalid target value: must be an object');
exports.assert(source === null || source === undefined || typeof source === 'object', 'Invalid source value: must be null, undefined, or an object');
@@ -247,9 +247,12 @@ exports.applyToDefaultsWithShallow = function (defaults, options, keys) {
// Deep object or array comparison
-exports.deepEqual = function (obj, ref, seen) {
+exports.deepEqual = function (obj, ref, options, seen) {
+
+ options = options || { prototype: true };
var type = typeof obj;
+
if (type !== typeof ref) {
return false;
}
@@ -316,20 +319,27 @@ exports.deepEqual = function (obj, ref, seen) {
return (ref instanceof RegExp && obj.toString() === ref.toString());
}
- if (Object.getPrototypeOf(obj) !== Object.getPrototypeOf(ref)) {
+ if (options.prototype) {
+ if (Object.getPrototypeOf(obj) !== Object.getPrototypeOf(ref)) {
+ return false;
+ }
+ }
+
+ var keys = Object.getOwnPropertyNames(obj);
+
+ if (keys.length !== Object.getOwnPropertyNames(ref).length) {
return false;
}
- var keys = Object.keys(obj);
for (var k = 0, kl = keys.length; k < kl; ++k) {
var key = keys[k];
var descriptor = Object.getOwnPropertyDescriptor(obj, key);
if (descriptor.get) {
- if (!exports.deepEqual(descriptor, Object.getOwnPropertyDescriptor(ref, key), seen)) {
+ if (!exports.deepEqual(descriptor, Object.getOwnPropertyDescriptor(ref, key), options, seen)) {
return false;
}
}
- else if (!exports.deepEqual(obj[key], ref[key], seen)) {
+ else if (!exports.deepEqual(obj[key], ref[key], options, seen)) {
return false;
}
}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/package.json b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/package.json
index 53b174e956..c2f8514e95 100644
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/package.json
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/package.json
@@ -1,7 +1,7 @@
{
"name": "hoek",
"description": "General purpose node utilities",
- "version": "2.11.0",
+ "version": "2.12.0",
"repository": {
"type": "git",
"url": "git://github.com/hapijs/hoek"
@@ -27,16 +27,16 @@
"url": "http://github.com/hapijs/hoek/raw/master/LICENSE"
}
],
- "gitHead": "6f034aa12206f2ab740a9ea6ca64a4d5c7b7dfba",
+ "gitHead": "9bbb8f149b5b824f66b47ae4cf3afb1e2877396f",
"bugs": {
"url": "https://github.com/hapijs/hoek/issues"
},
"homepage": "https://github.com/hapijs/hoek",
- "_id": "hoek@2.11.0",
- "_shasum": "e588ec66a6b405b0e7140308720e1e1cd4f035b7",
+ "_id": "hoek@2.12.0",
+ "_shasum": "5d1196e0bf20c5cec957e8927101164effdaf1c9",
"_from": "hoek@>=2.0.0 <3.0.0",
- "_npmVersion": "2.1.9",
- "_nodeVersion": "0.10.32",
+ "_npmVersion": "2.6.1",
+ "_nodeVersion": "0.10.36",
"_npmUser": {
"name": "nlf",
"email": "quitlahok@gmail.com"
@@ -56,10 +56,9 @@
}
],
"dist": {
- "shasum": "e588ec66a6b405b0e7140308720e1e1cd4f035b7",
- "tarball": "http://registry.npmjs.org/hoek/-/hoek-2.11.0.tgz"
+ "shasum": "5d1196e0bf20c5cec957e8927101164effdaf1c9",
+ "tarball": "http://registry.npmjs.org/hoek/-/hoek-2.12.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/hoek/-/hoek-2.11.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/hoek/-/hoek-2.12.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/test/index.js b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/test/index.js
index aad04356d5..1c45a601a1 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/test/index.js
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/hoek/test/index.js
@@ -331,6 +331,28 @@ describe('clone()', function () {
expect(copy._test).to.equal(4);
done();
});
+
+ it('clones an object with non-enumerable properties', function (done) {
+
+ var obj = {
+ _test: 0
+ };
+
+ Object.defineProperty(obj, 'test', {
+ enumerable: false,
+ configurable: true,
+ set: function (value) {
+
+ this._test = value - 1;
+ }
+ });
+
+ var copy = Hoek.clone(obj);
+ expect(copy._test).to.equal(0);
+ copy.test = 5;
+ expect(copy._test).to.equal(4);
+ done();
+ });
});
describe('merge()', function () {
@@ -986,7 +1008,7 @@ describe('deepEqual()', function () {
var inner = function () {
- expect(Hoek.deepEqual(arg1, arguments)).to.be.true();
+ expect(Hoek.deepEqual(arg1, arguments)).to.be.false(); // callee is not the same
};
inner();
@@ -998,7 +1020,7 @@ describe('deepEqual()', function () {
it('compares dates', function (done) {
- expect(Hoek.deepEqual(new Date(), new Date())).to.be.true();
+ expect(Hoek.deepEqual(new Date(2015, 1, 1), new Date(2015, 1, 1))).to.be.true();
expect(Hoek.deepEqual(new Date(100), new Date(101))).to.be.false();
expect(Hoek.deepEqual(new Date(), {})).to.be.false();
done();
@@ -1130,6 +1152,24 @@ describe('deepEqual()', function () {
expect(Hoek.deepEqual(a, { b: 'c' })).to.be.false();
done();
});
+
+ it('compares an object with an empty object', function (done) {
+
+ var a = { a: 1, b: 2 };
+
+ expect(Hoek.deepEqual({}, a)).to.be.false();
+ expect(Hoek.deepEqual(a, {})).to.be.false();
+ done();
+ });
+
+ it('compares an object ignoring the prototype', function (done) {
+
+ var a = Object.create(null);
+ var b = {};
+
+ expect(Hoek.deepEqual(a, b, { prototype: false})).to.be.true();
+ done();
+ });
});
describe('unique()', function () {
diff --git a/deps/npm/node_modules/request/node_modules/hawk/node_modules/sntp/package.json b/deps/npm/node_modules/request/node_modules/hawk/node_modules/sntp/package.json
index 45356c8c7a..6fe68c1b2a 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/node_modules/sntp/package.json
+++ b/deps/npm/node_modules/request/node_modules/hawk/node_modules/sntp/package.json
@@ -60,6 +60,5 @@
"tarball": "http://registry.npmjs.org/sntp/-/sntp-1.0.9.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/sntp/-/sntp-1.0.9.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/sntp/-/sntp-1.0.9.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/hawk/package.json b/deps/npm/node_modules/request/node_modules/hawk/package.json
index 4fe0064cae..3986e1172e 100755
--- a/deps/npm/node_modules/request/node_modules/hawk/package.json
+++ b/deps/npm/node_modules/request/node_modules/hawk/package.json
@@ -66,6 +66,5 @@
"tarball": "http://registry.npmjs.org/hawk/-/hawk-2.3.1.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/hawk/-/hawk-2.3.1.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/hawk/-/hawk-2.3.1.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/asn1/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/asn1/package.json
index 8c68193cd1..aca7cedeb9 100644
--- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/asn1/package.json
+++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/asn1/package.json
@@ -30,7 +30,7 @@
},
"scripts": {
"pretest": "which gjslint; if [[ \"$?\" = 0 ]] ; then gjslint --nojsdoc -r lib -r tst; else echo \"Missing gjslint. Skipping lint\"; fi",
- "test": "tap ./tst"
+ "test": "./node_modules/.bin/tap ./tst"
},
"_npmUser": {
"name": "mcavage",
@@ -54,10 +54,5 @@
"directories": {},
"_shasum": "559be18376d08a4ec4dbe80877d27818639b2df7",
"_resolved": "https://registry.npmjs.org/asn1/-/asn1-0.1.11.tgz",
- "_from": "asn1@0.1.11",
- "bugs": {
- "url": "https://github.com/mcavage/node-asn1/issues"
- },
- "readme": "ERROR: No README data found!",
- "homepage": "https://github.com/mcavage/node-asn1"
+ "_from": "asn1@0.1.11"
}
diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/assert-plus/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/assert-plus/package.json
index 1b935b6b42..0950815821 100644
--- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/assert-plus/package.json
+++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/assert-plus/package.json
@@ -39,8 +39,5 @@
],
"directories": {},
"_shasum": "ee74009413002d84cec7219c6ac811812e723160",
- "_resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-0.1.5.tgz",
- "readme": "ERROR: No README data found!",
- "homepage": "https://github.com/mcavage/node-assert-plus",
- "scripts": {}
+ "_resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-0.1.5.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/ctype/package.json b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/ctype/package.json
index 4e1d86768d..9395bfcf8c 100644
--- a/deps/npm/node_modules/request/node_modules/http-signature/node_modules/ctype/package.json
+++ b/deps/npm/node_modules/request/node_modules/http-signature/node_modules/ctype/package.json
@@ -34,10 +34,5 @@
"directories": {},
"_shasum": "82c18c2461f74114ef16c135224ad0b9144ca12f",
"_resolved": "https://registry.npmjs.org/ctype/-/ctype-0.5.3.tgz",
- "_from": "ctype@0.5.3",
- "bugs": {
- "url": "https://github.com/rmustacc/node-ctype/issues"
- },
- "readme": "ERROR: No README data found!",
- "scripts": {}
+ "_from": "ctype@0.5.3"
}
diff --git a/deps/npm/node_modules/request/node_modules/http-signature/package.json b/deps/npm/node_modules/request/node_modules/http-signature/package.json
index 2dd58f537f..d93952bd37 100644
--- a/deps/npm/node_modules/request/node_modules/http-signature/package.json
+++ b/deps/npm/node_modules/request/node_modules/http-signature/package.json
@@ -67,6 +67,5 @@
"shasum": "4fbdac132559aa8323121e540779c0a012b27e66",
"tarball": "http://registry.npmjs.org/http-signature/-/http-signature-0.10.1.tgz"
},
- "directories": {},
- "readme": "ERROR: No README data found!"
+ "directories": {}
}
diff --git a/deps/npm/node_modules/request/node_modules/isstream/.jshintrc b/deps/npm/node_modules/request/node_modules/isstream/.jshintrc
deleted file mode 100644
index c8ef3ca409..0000000000
--- a/deps/npm/node_modules/request/node_modules/isstream/.jshintrc
+++ /dev/null
@@ -1,59 +0,0 @@
-{
- "predef": [ ]
- , "bitwise": false
- , "camelcase": false
- , "curly": false
- , "eqeqeq": false
- , "forin": false
- , "immed": false
- , "latedef": false
- , "noarg": true
- , "noempty": true
- , "nonew": true
- , "plusplus": false
- , "quotmark": true
- , "regexp": false
- , "undef": true
- , "unused": true
- , "strict": false
- , "trailing": true
- , "maxlen": 120
- , "asi": true
- , "boss": true
- , "debug": true
- , "eqnull": true
- , "esnext": true
- , "evil": true
- , "expr": true
- , "funcscope": false
- , "globalstrict": false
- , "iterator": false
- , "lastsemic": true
- , "laxbreak": true
- , "laxcomma": true
- , "loopfunc": true
- , "multistr": false
- , "onecase": false
- , "proto": false
- , "regexdash": false
- , "scripturl": true
- , "smarttabs": false
- , "shadow": false
- , "sub": true
- , "supernew": false
- , "validthis": true
- , "browser": true
- , "couch": false
- , "devel": false
- , "dojo": false
- , "mootools": false
- , "node": true
- , "nonstandard": true
- , "prototypejs": false
- , "rhino": false
- , "worker": true
- , "wsh": false
- , "nomen": false
- , "onevar": false
- , "passfail": false
-} \ No newline at end of file
diff --git a/deps/npm/node_modules/request/node_modules/isstream/LICENSE b/deps/npm/node_modules/request/node_modules/isstream/LICENSE
deleted file mode 100644
index e7554b50ca..0000000000
--- a/deps/npm/node_modules/request/node_modules/isstream/LICENSE
+++ /dev/null
@@ -1,39 +0,0 @@
-Copyright 2014, Rod Vagg (the "Original Author")
-All rights reserved.
-
-MIT +no-false-attribs License
-
-Permission is hereby granted, free of charge, to any person
-obtaining a copy of this software and associated documentation
-files (the "Software"), to deal in the Software without
-restriction, including without limitation the rights to use,
-copy, modify, merge, publish, distribute, sublicense, and/or sell
-copies of the Software, and to permit persons to whom the
-Software is furnished to do so, subject to the following
-conditions:
-
-The above copyright notice and this permission notice shall be
-included in all copies or substantial portions of the Software.
-
-Distributions of all or part of the Software intended to be used
-by the recipients as they would use the unmodified Software,
-containing modifications that substantially alter, remove, or
-disable functionality of the Software, outside of the documented
-configuration mechanisms provided by the Software, shall be
-modified such that the Original Author's bug reporting email
-addresses and urls are either replaced with the contact information
-of the parties responsible for the changes, or removed entirely.
-
-THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
-EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
-OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
-NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
-HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
-WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
-FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
-OTHER DEALINGS IN THE SOFTWARE.
-
-
-Except where noted, this license applies to any and all software
-programs and associated documentation files created by the
-Original Author, when distributed with the Software.
diff --git a/deps/npm/node_modules/request/node_modules/isstream/LICENSE.md b/deps/npm/node_modules/request/node_modules/isstream/LICENSE.md
new file mode 100644
index 0000000000..43f7153f9f
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/isstream/LICENSE.md
@@ -0,0 +1,11 @@
+The MIT License (MIT)
+=====================
+
+Copyright (c) 2015 Rod Vagg
+---------------------------
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/deps/npm/node_modules/request/node_modules/isstream/README.md b/deps/npm/node_modules/request/node_modules/isstream/README.md
index e60fc8acf3..06770e82f2 100644
--- a/deps/npm/node_modules/request/node_modules/isstream/README.md
+++ b/deps/npm/node_modules/request/node_modules/isstream/README.md
@@ -63,4 +63,4 @@ isDuplex(new Stream.PassThrough()) // true
## License
-**isStream** is Copyright (c) 2014 Rod Vagg [@rvagg](https://twitter.com/rvagg) and licenced under the MIT licence. All rights not explicitly granted in the MIT license are reserved. See the included LICENSE file for more details.
+**isStream** is Copyright (c) 2015 Rod Vagg [@rvagg](https://twitter.com/rvagg) and licenced under the MIT licence. All rights not explicitly granted in the MIT license are reserved. See the included LICENSE.md file for more details.
diff --git a/deps/npm/node_modules/request/node_modules/isstream/package.json b/deps/npm/node_modules/request/node_modules/isstream/package.json
index c3c796d773..7fdfa0a2fa 100644
--- a/deps/npm/node_modules/request/node_modules/isstream/package.json
+++ b/deps/npm/node_modules/request/node_modules/isstream/package.json
@@ -1,6 +1,6 @@
{
"name": "isstream",
- "version": "0.1.1",
+ "version": "0.1.2",
"description": "Determine if an object is a Stream",
"main": "isstream.js",
"scripts": {
@@ -33,11 +33,12 @@
"url": "https://github.com/rvagg/isstream/issues"
},
"homepage": "https://github.com/rvagg/isstream",
- "gitHead": "0406cfe2677231b7b23a229a61b15999bf60ce67",
- "_id": "isstream@0.1.1",
- "_shasum": "48332c5999893996ba253c81c7bd6e7ae0905c4f",
+ "gitHead": "cd39cba6da939b4fc9110825203adc506422c3dc",
+ "_id": "isstream@0.1.2",
+ "_shasum": "47e63f7af55afa6f92e1500e690eb8b8529c099a",
"_from": "isstream@>=0.1.1 <0.2.0",
- "_npmVersion": "1.4.28",
+ "_npmVersion": "2.6.1",
+ "_nodeVersion": "1.4.3",
"_npmUser": {
"name": "rvagg",
"email": "rod@vagg.org"
@@ -49,10 +50,10 @@
}
],
"dist": {
- "shasum": "48332c5999893996ba253c81c7bd6e7ae0905c4f",
- "tarball": "http://registry.npmjs.org/isstream/-/isstream-0.1.1.tgz"
+ "shasum": "47e63f7af55afa6f92e1500e690eb8b8529c099a",
+ "tarball": "http://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.1.tgz",
+ "_resolved": "https://registry.npmjs.org/isstream/-/isstream-0.1.2.tgz",
"readme": "ERROR: No README data found!"
}
diff --git a/deps/npm/node_modules/request/node_modules/json-stringify-safe/package.json b/deps/npm/node_modules/request/node_modules/json-stringify-safe/package.json
index 90549cb6a6..7551573fd7 100644
--- a/deps/npm/node_modules/request/node_modules/json-stringify-safe/package.json
+++ b/deps/npm/node_modules/request/node_modules/json-stringify-safe/package.json
@@ -44,7 +44,5 @@
],
"directories": {},
"_shasum": "4c1f228b5050837eba9d21f50c2e6e320624566e",
- "_resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.0.tgz",
- "readme": "ERROR: No README data found!",
- "homepage": "https://github.com/isaacs/json-stringify-safe"
+ "_resolved": "https://registry.npmjs.org/json-stringify-safe/-/json-stringify-safe-5.0.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md b/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md
index 5487d0d4c9..aa7cdf1691 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md
+++ b/deps/npm/node_modules/request/node_modules/mime-types/HISTORY.md
@@ -1,3 +1,16 @@
+2.0.10 / 2015-03-13
+===================
+
+ * deps: mime-db@~1.8.0
+ - Add new mime types
+
+2.0.9 / 2015-02-09
+==================
+
+ * deps: mime-db@~1.7.0
+ - Add new mime types
+ - Community extensions ownership transferred from `node-mime`
+
2.0.8 / 2015-01-29
==================
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/README.md b/deps/npm/node_modules/request/node_modules/mime-types/README.md
index 99d658b8b3..8fea7ff4c2 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/README.md
+++ b/deps/npm/node_modules/request/node_modules/mime-types/README.md
@@ -57,6 +57,9 @@ Create a full content-type header given a content-type or extension.
```js
mime.contentType('markdown') // 'text/x-markdown; charset=utf-8'
mime.contentType('file.json') // 'application/json; charset=utf-8'
+
+// from a full path
+mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8'
```
### mime.extension(type)
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md
index bd218ebf4d..3c6674819a 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md
+++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/HISTORY.md
@@ -1,3 +1,17 @@
+1.8.0 / 2015-03-13
+==================
+
+ * Add `application/vnd.citationstyles.style+xml`
+ * Add `application/vnd.fastcopy-disk-image`
+ * Add `application/vnd.gov.sk.xmldatacontainer+xml`
+ * Add extension `.jsonld` to `application/ld+json`
+
+1.7.0 / 2015-02-08
+==================
+
+ * Add `application/vnd.gerber`
+ * Add `application/vnd.msa-disk-image`
+
1.6.1 / 2015-02-05
==================
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/README.md b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/README.md
index 25c2a3a3b7..1dde234905 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/README.md
+++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/README.md
@@ -51,16 +51,11 @@ Each mime type has the following properties:
If unknown, every property could be `undefined`.
-## Repository Structure
-
-- `scripts` - these are scripts to run to build the database
-- `src/` - this is a folder of files created from remote sources like Apache and IANA
-- `lib/` - this is a folder of our own custom sources and db, which will be merged into `db.json`
-- `db.json` - the final built JSON file for end-user usage
-
## Contributing
-To edit the database, only make PRs against files in the `lib/` folder.
+To edit the database, only make PRs against `src/custom.json` or
+`src/custom-suffix.json`.
+
To update the build, run `npm run update`.
## Adding Custom Media Types
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json
index 35682db874..f9f3515b03 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json
+++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/db.json
@@ -479,7 +479,8 @@
},
"application/ld+json": {
"source": "iana",
- "compressible": true
+ "compressible": true,
+ "extensions": ["jsonld"]
},
"application/link-format": {
"source": "iana"
@@ -1358,6 +1359,9 @@
"application/vnd.cirpack.isdn-ext": {
"source": "iana"
},
+ "application/vnd.citationstyles.style+xml": {
+ "source": "iana"
+ },
"application/vnd.claymore": {
"source": "iana",
"extensions": ["cla"]
@@ -1769,6 +1773,9 @@
"application/vnd.f-secure.mobile": {
"source": "iana"
},
+ "application/vnd.fastcopy-disk-image": {
+ "source": "iana"
+ },
"application/vnd.fdf": {
"source": "iana",
"extensions": ["fdf"]
@@ -1900,6 +1907,9 @@
"source": "iana",
"extensions": ["g3w"]
},
+ "application/vnd.gerber": {
+ "source": "iana"
+ },
"application/vnd.globalplatform.card-content-mgt": {
"source": "iana"
},
@@ -1926,6 +1936,9 @@
"application/vnd.gov.sk.e-form+zip": {
"source": "iana"
},
+ "application/vnd.gov.sk.xmldatacontainer+xml": {
+ "source": "iana"
+ },
"application/vnd.grafeq": {
"source": "iana",
"extensions": ["gqf","gqs"]
@@ -2599,6 +2612,9 @@
"compressible": false,
"extensions": ["xps"]
},
+ "application/vnd.msa-disk-image": {
+ "source": "iana"
+ },
"application/vnd.mseq": {
"source": "iana",
"extensions": ["mseq"]
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json
index 9b73a7cea4..63b57485ce 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json
+++ b/deps/npm/node_modules/request/node_modules/mime-types/node_modules/mime-db/package.json
@@ -1,18 +1,18 @@
{
"name": "mime-db",
"description": "Media Type Database",
- "version": "1.6.1",
- "author": {
- "name": "Jonathan Ong",
- "email": "me@jongleberry.com",
- "url": "http://jongleberry.com"
- },
+ "version": "1.8.0",
"contributors": [
{
"name": "Douglas Christopher Wilson",
"email": "doug@somethingdoug.com"
},
{
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ {
"name": "Robert Kieffer",
"email": "robert@broofa.com",
"url": "http://github.com/broofa"
@@ -33,13 +33,14 @@
"url": "https://github.com/jshttp/mime-db"
},
"devDependencies": {
- "co": "4",
+ "bluebird": "~2.9.14",
+ "co": "~4.4.0",
"cogent": "1",
- "csv-parse": "0",
- "gnode": "0.1.0",
- "istanbul": "0.3.5",
+ "csv-parse": "0.0.9",
+ "gnode": "0.1.1",
+ "istanbul": "0.3.7",
"mocha": "~1.21.4",
- "raw-body": "~1.3.2",
+ "raw-body": "~1.3.3",
"stream-to-array": "2"
},
"files": [
@@ -53,20 +54,21 @@
"node": ">= 0.6"
},
"scripts": {
- "update": "gnode scripts/extensions && gnode scripts/types && node scripts/build",
- "clean": "rm src/*",
+ "build": "node scripts/build",
+ "fetch": "gnode scripts/extensions && gnode scripts/types",
"test": "mocha --reporter spec --bail --check-leaks test/",
"test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
- "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "update": "npm run fetch && npm run build"
},
- "gitHead": "7f07ff87267625b73dcf73b97b2530a37a85d079",
+ "gitHead": "cd5730a475ff03d2ef49fc571d5510a548b63494",
"bugs": {
"url": "https://github.com/jshttp/mime-db/issues"
},
"homepage": "https://github.com/jshttp/mime-db",
- "_id": "mime-db@1.6.1",
- "_shasum": "6e85cd87c961d130d6ebd37efdfc2c0e06fdfcd3",
- "_from": "mime-db@>=1.6.0 <1.7.0",
+ "_id": "mime-db@1.8.0",
+ "_shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "_from": "mime-db@>=1.8.0 <1.9.0",
"_npmVersion": "1.4.28",
"_npmUser": {
"name": "dougwilson",
@@ -83,10 +85,9 @@
}
],
"dist": {
- "shasum": "6e85cd87c961d130d6ebd37efdfc2c0e06fdfcd3",
- "tarball": "http://registry.npmjs.org/mime-db/-/mime-db-1.6.1.tgz"
+ "shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "tarball": "http://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.6.1.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/mime-types/package.json b/deps/npm/node_modules/request/node_modules/mime-types/package.json
index 060586bd77..df71018dc4 100644
--- a/deps/npm/node_modules/request/node_modules/mime-types/package.json
+++ b/deps/npm/node_modules/request/node_modules/mime-types/package.json
@@ -1,7 +1,7 @@
{
"name": "mime-types",
"description": "The ultimate javascript content-type utility.",
- "version": "2.0.8",
+ "version": "2.0.10",
"contributors": [
{
"name": "Douglas Christopher Wilson",
@@ -28,10 +28,10 @@
"url": "https://github.com/jshttp/mime-types"
},
"dependencies": {
- "mime-db": "~1.6.0"
+ "mime-db": "~1.8.0"
},
"devDependencies": {
- "istanbul": "0.3.5",
+ "istanbul": "0.3.7",
"mocha": "~1.21.5"
},
"files": [
@@ -47,13 +47,13 @@
"test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js",
"test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js"
},
- "gitHead": "19e01e8bd630a1719ada4a3e3e9b7192b4ddb034",
+ "gitHead": "9d4533a2b3a68af48a7f3ded9f8f525648e7bcc1",
"bugs": {
"url": "https://github.com/jshttp/mime-types/issues"
},
"homepage": "https://github.com/jshttp/mime-types",
- "_id": "mime-types@2.0.8",
- "_shasum": "5612bf6b9ec8a1285a81184fa4237fbfdbb89a7e",
+ "_id": "mime-types@2.0.10",
+ "_shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
"_from": "mime-types@>=2.0.1 <2.1.0",
"_npmVersion": "1.4.28",
"_npmUser": {
@@ -75,10 +75,9 @@
}
],
"dist": {
- "shasum": "5612bf6b9ec8a1285a81184fa4237fbfdbb89a7e",
- "tarball": "http://registry.npmjs.org/mime-types/-/mime-types-2.0.8.tgz"
+ "shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
+ "tarball": "http://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.0.8.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/node-uuid/bower.json b/deps/npm/node_modules/request/node_modules/node-uuid/bower.json
new file mode 100644
index 0000000000..1656dc8197
--- /dev/null
+++ b/deps/npm/node_modules/request/node_modules/node-uuid/bower.json
@@ -0,0 +1,23 @@
+{
+ "name": "node-uuid",
+ "version": "1.4.3",
+ "homepage": "https://github.com/broofa/node-uuid",
+ "authors": [
+ "Robert Kieffer <robert@broofa.com>"
+ ],
+ "description": "Rigorous implementation of RFC4122 (v1 and v4) UUIDs.",
+ "main": "uuid.js",
+ "keywords": [
+ "uuid",
+ "gid",
+ "rfc4122"
+ ],
+ "license": "MIT",
+ "ignore": [
+ "**/.*",
+ "node_modules",
+ "bower_components",
+ "test",
+ "tests"
+ ]
+}
diff --git a/deps/npm/node_modules/request/node_modules/node-uuid/component.json b/deps/npm/node_modules/request/node_modules/node-uuid/component.json
index ace213481c..149f84b22b 100644
--- a/deps/npm/node_modules/request/node_modules/node-uuid/component.json
+++ b/deps/npm/node_modules/request/node_modules/node-uuid/component.json
@@ -2,7 +2,7 @@
"name": "node-uuid",
"repo": "broofa/node-uuid",
"description": "Rigorous implementation of RFC4122 (v1 and v4) UUIDs.",
- "version": "1.4.0",
+ "version": "1.4.3",
"author": "Robert Kieffer <robert@broofa.com>",
"contributors": [
{"name": "Christoph Tavan <dev@tavan.de>", "github": "https://github.com/ctavan"}
@@ -15,4 +15,4 @@
"uuid.js"
],
"license": "MIT"
-} \ No newline at end of file
+}
diff --git a/deps/npm/node_modules/request/node_modules/node-uuid/package.json b/deps/npm/node_modules/request/node_modules/node-uuid/package.json
index 9753671020..a273d8f455 100644
--- a/deps/npm/node_modules/request/node_modules/node-uuid/package.json
+++ b/deps/npm/node_modules/request/node_modules/node-uuid/package.json
@@ -29,20 +29,20 @@
"type": "git",
"url": "https://github.com/broofa/node-uuid.git"
},
- "version": "1.4.2",
+ "version": "1.4.3",
"licenses": [
{
"type": "MIT",
"url": "https://raw.github.com/broofa/node-uuid/master/LICENSE.md"
}
],
- "gitHead": "14c42d2568977f7ddfc02399bd2a6b09e2cfbe5f",
+ "gitHead": "886463c660a095dfebfa69603921a8d156fdb12c",
"bugs": {
"url": "https://github.com/broofa/node-uuid/issues"
},
"homepage": "https://github.com/broofa/node-uuid",
- "_id": "node-uuid@1.4.2",
- "_shasum": "907db3d11b7b6a2cf4f905fb7199f14ae7379ba0",
+ "_id": "node-uuid@1.4.3",
+ "_shasum": "319bb7a56e7cb63f00b5c0cd7851cd4b4ddf1df9",
"_from": "node-uuid@>=1.4.0 <1.5.0",
"_npmVersion": "1.4.28",
"_npmUser": {
@@ -56,10 +56,10 @@
}
],
"dist": {
- "shasum": "907db3d11b7b6a2cf4f905fb7199f14ae7379ba0",
- "tarball": "http://registry.npmjs.org/node-uuid/-/node-uuid-1.4.2.tgz"
+ "shasum": "319bb7a56e7cb63f00b5c0cd7851cd4b4ddf1df9",
+ "tarball": "http://registry.npmjs.org/node-uuid/-/node-uuid-1.4.3.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/node-uuid/-/node-uuid-1.4.2.tgz",
+ "_resolved": "https://registry.npmjs.org/node-uuid/-/node-uuid-1.4.3.tgz",
"readme": "ERROR: No README data found!"
}
diff --git a/deps/npm/node_modules/request/node_modules/node-uuid/uuid.js b/deps/npm/node_modules/request/node_modules/node-uuid/uuid.js
index 5e2257f093..80ed720db3 100644
--- a/deps/npm/node_modules/request/node_modules/node-uuid/uuid.js
+++ b/deps/npm/node_modules/request/node_modules/node-uuid/uuid.js
@@ -224,12 +224,14 @@
uuid.unparse = unparse;
uuid.BufferClass = BufferClass;
- if (typeof define === 'function' && define.amd) {
- // Publish as AMD module
- define(function() {return uuid;});
- } else if (typeof(module) != 'undefined' && module.exports) {
+ if (typeof(module) != 'undefined' && module.exports) {
// Publish as node.js module
module.exports = uuid;
+ } else if (typeof define === 'function' && define.amd) {
+ // Publish as AMD module
+ define(function() {return uuid;});
+
+
} else {
// Publish as global (in browsers)
var _previousRoot = _global.uuid;
diff --git a/deps/npm/node_modules/request/node_modules/oauth-sign/package.json b/deps/npm/node_modules/request/node_modules/oauth-sign/package.json
index 019eff0cd5..bb5b0e11c4 100644
--- a/deps/npm/node_modules/request/node_modules/oauth-sign/package.json
+++ b/deps/npm/node_modules/request/node_modules/oauth-sign/package.json
@@ -48,6 +48,5 @@
"tarball": "http://registry.npmjs.org/oauth-sign/-/oauth-sign-0.6.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.6.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/oauth-sign/-/oauth-sign-0.6.0.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/qs/.jshintrc b/deps/npm/node_modules/request/node_modules/qs/.jshintrc
deleted file mode 100644
index 997b3f7d45..0000000000
--- a/deps/npm/node_modules/request/node_modules/qs/.jshintrc
+++ /dev/null
@@ -1,10 +0,0 @@
-{
- "node": true,
-
- "curly": true,
- "latedef": true,
- "quotmark": true,
- "undef": true,
- "unused": true,
- "trailing": true
-}
diff --git a/deps/npm/node_modules/request/node_modules/qs/.travis.yml b/deps/npm/node_modules/request/node_modules/qs/.travis.yml
index c891dd0e04..f50217888e 100644
--- a/deps/npm/node_modules/request/node_modules/qs/.travis.yml
+++ b/deps/npm/node_modules/request/node_modules/qs/.travis.yml
@@ -1,4 +1,6 @@
language: node_js
node_js:
- - 0.10 \ No newline at end of file
+ - 0.10
+ - 0.12
+ - iojs
diff --git a/deps/npm/node_modules/request/node_modules/qs/Readme.md b/deps/npm/node_modules/request/node_modules/qs/Readme.md
index 21bf3faf3e..2d7e7f5a0d 100755
--- a/deps/npm/node_modules/request/node_modules/qs/Readme.md
+++ b/deps/npm/node_modules/request/node_modules/qs/Readme.md
@@ -200,6 +200,17 @@ Qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false });
// 'a=b&a=c&a=d'
```
+You may use the `arrayFormat` option to specify the format of the output array
+
+```javascript
+Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' })
+// 'a[0]=b&a[1]=c'
+Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' })
+// 'a[]=b&a[]=c'
+Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' })
+// 'a=b&a=c'
+```
+
Empty strings and null values will omit the value, but the equals sign (=) remains in place:
```javascript
diff --git a/deps/npm/node_modules/request/node_modules/qs/lib/parse.js b/deps/npm/node_modules/request/node_modules/qs/lib/parse.js
index 4e7d02a1bf..55a0613c8e 100755
--- a/deps/npm/node_modules/request/node_modules/qs/lib/parse.js
+++ b/deps/npm/node_modules/request/node_modules/qs/lib/parse.js
@@ -29,6 +29,10 @@ internals.parseValues = function (str, options) {
var key = Utils.decode(part.slice(0, pos));
var val = Utils.decode(part.slice(pos + 1));
+ if (Object.prototype.hasOwnProperty(key)) {
+ continue;
+ }
+
if (!obj.hasOwnProperty(key)) {
obj[key] = val;
}
diff --git a/deps/npm/node_modules/request/node_modules/qs/lib/stringify.js b/deps/npm/node_modules/request/node_modules/qs/lib/stringify.js
index b4411047fd..3ce6cc19d8 100755
--- a/deps/npm/node_modules/request/node_modules/qs/lib/stringify.js
+++ b/deps/npm/node_modules/request/node_modules/qs/lib/stringify.js
@@ -7,11 +7,21 @@ var Utils = require('./utils');
var internals = {
delimiter: '&',
- indices: true
+ arrayPrefixGenerators: {
+ brackets: function (prefix, key) {
+ return prefix + '[]';
+ },
+ indices: function (prefix, key) {
+ return prefix + '[' + key + ']';
+ },
+ repeat: function (prefix, key) {
+ return prefix;
+ }
+ }
};
-internals.stringify = function (obj, prefix, options) {
+internals.stringify = function (obj, prefix, generateArrayPrefix) {
if (Utils.isBuffer(obj)) {
obj = obj.toString();
@@ -39,13 +49,11 @@ internals.stringify = function (obj, prefix, options) {
var objKeys = Object.keys(obj);
for (var i = 0, il = objKeys.length; i < il; ++i) {
var key = objKeys[i];
- if (!options.indices &&
- Array.isArray(obj)) {
-
- values = values.concat(internals.stringify(obj[key], prefix, options));
+ if (Array.isArray(obj)) {
+ values = values.concat(internals.stringify(obj[key], generateArrayPrefix(prefix, key), generateArrayPrefix));
}
else {
- values = values.concat(internals.stringify(obj[key], prefix + '[' + key + ']', options));
+ values = values.concat(internals.stringify(obj[key], prefix + '[' + key + ']', generateArrayPrefix));
}
}
@@ -57,7 +65,6 @@ module.exports = function (obj, options) {
options = options || {};
var delimiter = typeof options.delimiter === 'undefined' ? internals.delimiter : options.delimiter;
- options.indices = typeof options.indices === 'boolean' ? options.indices : internals.indices;
var keys = [];
@@ -67,10 +74,23 @@ module.exports = function (obj, options) {
return '';
}
+ var arrayFormat;
+ if (options.arrayFormat in internals.arrayPrefixGenerators) {
+ arrayFormat = options.arrayFormat;
+ }
+ else if ('indices' in options) {
+ arrayFormat = options.indices ? 'indices' : 'repeat';
+ }
+ else {
+ arrayFormat = 'indices';
+ }
+
+ var generateArrayPrefix = internals.arrayPrefixGenerators[arrayFormat];
+
var objKeys = Object.keys(obj);
for (var i = 0, il = objKeys.length; i < il; ++i) {
var key = objKeys[i];
- keys = keys.concat(internals.stringify(obj[key], key, options));
+ keys = keys.concat(internals.stringify(obj[key], key, generateArrayPrefix));
}
return keys.join(delimiter);
diff --git a/deps/npm/node_modules/request/node_modules/qs/package.json b/deps/npm/node_modules/request/node_modules/qs/package.json
index 8d17dfce16..980ada8b4b 100644
--- a/deps/npm/node_modules/request/node_modules/qs/package.json
+++ b/deps/npm/node_modules/request/node_modules/qs/package.json
@@ -1,6 +1,6 @@
{
"name": "qs",
- "version": "2.3.3",
+ "version": "2.4.1",
"description": "A querystring parser that supports nesting and arrays, with a depth limit",
"homepage": "https://github.com/hapijs/qs",
"main": "index.js",
@@ -26,15 +26,15 @@
"url": "http://github.com/hapijs/qs/raw/master/LICENSE"
}
],
- "gitHead": "9250c4cda5102fcf72441445816e6d311fc6813d",
+ "gitHead": "58c6540418954867822c1af3e45fb4c26708b07e",
"bugs": {
"url": "https://github.com/hapijs/qs/issues"
},
- "_id": "qs@2.3.3",
- "_shasum": "e9e85adbe75da0bbe4c8e0476a086290f863b404",
- "_from": "qs@>=2.3.1 <2.4.0",
- "_npmVersion": "2.1.6",
- "_nodeVersion": "0.10.32",
+ "_id": "qs@2.4.1",
+ "_shasum": "68cbaea971013426a80c1404fad6b1a6b1175245",
+ "_from": "qs@>=2.4.0 <2.5.0",
+ "_npmVersion": "2.6.1",
+ "_nodeVersion": "0.10.36",
"_npmUser": {
"name": "nlf",
"email": "quitlahok@gmail.com"
@@ -50,10 +50,9 @@
}
],
"dist": {
- "shasum": "e9e85adbe75da0bbe4c8e0476a086290f863b404",
- "tarball": "http://registry.npmjs.org/qs/-/qs-2.3.3.tgz"
+ "shasum": "68cbaea971013426a80c1404fad6b1a6b1175245",
+ "tarball": "http://registry.npmjs.org/qs/-/qs-2.4.1.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/qs/-/qs-2.3.3.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/qs/-/qs-2.4.1.tgz"
}
diff --git a/deps/npm/node_modules/request/node_modules/qs/test/parse.js b/deps/npm/node_modules/request/node_modules/qs/test/parse.js
index 6c20cc1be0..f06788a89c 100755
--- a/deps/npm/node_modules/request/node_modules/qs/test/parse.js
+++ b/deps/npm/node_modules/request/node_modules/qs/test/parse.js
@@ -187,7 +187,7 @@ describe('parse()', function () {
it('cannot override prototypes', function (done) {
- var obj = Qs.parse('toString=bad&bad[toString]=bad&constructor=bad');
+ var obj = Qs.parse('hasOwnProperty=bad&toString=bad&bad[toString]=bad&constructor=bad');
expect(typeof obj.toString).to.equal('function');
expect(typeof obj.bad.toString).to.equal('function');
expect(typeof obj.constructor).to.equal('function');
diff --git a/deps/npm/node_modules/request/node_modules/qs/test/stringify.js b/deps/npm/node_modules/request/node_modules/qs/test/stringify.js
index 75e397a749..7bdec32948 100755
--- a/deps/npm/node_modules/request/node_modules/qs/test/stringify.js
+++ b/deps/npm/node_modules/request/node_modules/qs/test/stringify.js
@@ -67,6 +67,36 @@ describe('stringify()', function () {
done();
});
+ it('uses indices notation for arrays when indices=true', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c'] }, { indices: true })).to.equal('a%5B0%5D=b&a%5B1%5D=c');
+ done();
+ });
+
+ it('uses indices notation for arrays when no arrayFormat is specified', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c'] })).to.equal('a%5B0%5D=b&a%5B1%5D=c');
+ done();
+ });
+
+ it('uses indices notation for arrays when no arrayFormat=indices', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'indices' })).to.equal('a%5B0%5D=b&a%5B1%5D=c');
+ done();
+ });
+
+ it('uses repeat notation for arrays when no arrayFormat=repeat', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'repeat' })).to.equal('a=b&a=c');
+ done();
+ });
+
+ it('uses brackets notation for arrays when no arrayFormat=brackets', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c'] }, { arrayFormat: 'brackets' })).to.equal('a%5B%5D=b&a%5B%5D=c');
+ done();
+ });
+
it('stringifies a complicated object', function (done) {
expect(Qs.stringify({ a: { b: 'c', d: 'e' } })).to.equal('a%5Bb%5D=c&a%5Bd%5D=e');
diff --git a/deps/npm/node_modules/request/node_modules/stringstream/package.json b/deps/npm/node_modules/request/node_modules/stringstream/package.json
index b71cf2859c..ed9a306741 100644
--- a/deps/npm/node_modules/request/node_modules/stringstream/package.json
+++ b/deps/npm/node_modules/request/node_modules/stringstream/package.json
@@ -40,10 +40,5 @@
"directories": {},
"_shasum": "0f0e3423f942960b5692ac324a57dd093bc41a92",
"_resolved": "https://registry.npmjs.org/stringstream/-/stringstream-0.0.4.tgz",
- "_from": "stringstream@>=0.0.4 <0.1.0",
- "bugs": {
- "url": "https://github.com/mhart/StringStream/issues"
- },
- "homepage": "https://github.com/mhart/StringStream",
- "scripts": {}
+ "_from": "stringstream@>=0.0.4 <0.1.0"
}
diff --git a/deps/npm/node_modules/request/node_modules/tunnel-agent/.jshintrc b/deps/npm/node_modules/request/node_modules/tunnel-agent/.jshintrc
deleted file mode 100644
index 4c1c8d4972..0000000000
--- a/deps/npm/node_modules/request/node_modules/tunnel-agent/.jshintrc
+++ /dev/null
@@ -1,5 +0,0 @@
-{
- "node": true,
- "asi": true,
- "laxcomma": true
-}
diff --git a/deps/npm/node_modules/request/node_modules/tunnel-agent/package.json b/deps/npm/node_modules/request/node_modules/tunnel-agent/package.json
index 5b1ebba150..2a9e6ed3fa 100644
--- a/deps/npm/node_modules/request/node_modules/tunnel-agent/package.json
+++ b/deps/npm/node_modules/request/node_modules/tunnel-agent/package.json
@@ -40,7 +40,5 @@
],
"directories": {},
"_shasum": "b1184e312ffbcf70b3b4c78e8c219de7ebb1c550",
- "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.4.0.tgz",
- "readme": "ERROR: No README data found!",
- "scripts": {}
+ "_resolved": "https://registry.npmjs.org/tunnel-agent/-/tunnel-agent-0.4.0.tgz"
}
diff --git a/deps/npm/node_modules/request/package.json b/deps/npm/node_modules/request/package.json
index 0f021a5d13..20b7321426 100644
--- a/deps/npm/node_modules/request/package.json
+++ b/deps/npm/node_modules/request/package.json
@@ -7,7 +7,7 @@
"util",
"utility"
],
- "version": "2.53.0",
+ "version": "2.54.0",
"author": {
"name": "Mikeal Rogers",
"email": "mikeal.rogers@gmail.com"
@@ -27,12 +27,12 @@
"dependencies": {
"bl": "~0.9.0",
"caseless": "~0.9.0",
- "forever-agent": "~0.5.0",
+ "forever-agent": "~0.6.0",
"form-data": "~0.2.0",
"json-stringify-safe": "~5.0.0",
"mime-types": "~2.0.1",
"node-uuid": "~1.4.0",
- "qs": "~2.3.1",
+ "qs": "~2.4.0",
"tunnel-agent": "~0.4.0",
"tough-cookie": ">=0.12.0",
"http-signature": "~0.10.0",
@@ -41,10 +41,11 @@
"aws-sign2": "~0.5.0",
"stringstream": "~0.0.4",
"combined-stream": "~0.0.5",
- "isstream": "~0.1.1"
+ "isstream": "~0.1.1",
+ "har-validator": "^1.4.0"
},
"scripts": {
- "test": "npm run lint && node node_modules/.bin/taper tests/test-*.js && npm run test-browser && npm run clean",
+ "test": "npm run lint && node node_modules/.bin/taper tests/test-*.js && npm run test-browser",
"test-browser": "node tests/browser/start.js",
"lint": "node node_modules/.bin/eslint lib/ *.js tests/ && echo Lint passed."
},
@@ -52,7 +53,7 @@
"browserify": "~5.9.1",
"browserify-istanbul": "~0.1.3",
"coveralls": "~2.11.2",
- "eslint": "0.5.1",
+ "eslint": "0.17.1",
"function-bind": "~1.0.0",
"istanbul": "~0.3.2",
"karma": "~0.12.21",
@@ -66,15 +67,15 @@
"tape": "~3.0.0",
"taper": "~0.4.0"
},
- "gitHead": "541ce25648bc2ecab924d7d7197a2685fa16d348",
+ "gitHead": "12080382de2b0e57f3dbaafadc8109af7bbc85ed",
"homepage": "https://github.com/request/request",
- "_id": "request@2.53.0",
- "_shasum": "180a3ae92b7b639802e4f9545dd8fcdeb71d760c",
- "_from": "request@>=2.53.0 <2.54.0",
- "_npmVersion": "1.4.14",
+ "_id": "request@2.54.0",
+ "_shasum": "a13917cd8e8fa73332da0bf2f84a30181def1953",
+ "_from": "request@>=2.54.0 <2.55.0",
+ "_npmVersion": "1.4.28",
"_npmUser": {
- "name": "nylen",
- "email": "jnylen@gmail.com"
+ "name": "simov",
+ "email": "simeonvelichkov@gmail.com"
},
"maintainers": [
{
@@ -88,13 +89,16 @@
{
"name": "fredkschott",
"email": "fkschott@gmail.com"
+ },
+ {
+ "name": "simov",
+ "email": "simeonvelichkov@gmail.com"
}
],
"dist": {
- "shasum": "180a3ae92b7b639802e4f9545dd8fcdeb71d760c",
- "tarball": "http://registry.npmjs.org/request/-/request-2.53.0.tgz"
+ "shasum": "a13917cd8e8fa73332da0bf2f84a30181def1953",
+ "tarball": "http://registry.npmjs.org/request/-/request-2.54.0.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/request/-/request-2.53.0.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/request/-/request-2.54.0.tgz"
}
diff --git a/deps/npm/node_modules/request/request.js b/deps/npm/node_modules/request/request.js
index f43c8c6b5b..0737033dd8 100644
--- a/deps/npm/node_modules/request/request.js
+++ b/deps/npm/node_modules/request/request.js
@@ -13,7 +13,6 @@ var http = require('http')
, hawk = require('hawk')
, aws = require('aws-sign2')
, httpSignature = require('http-signature')
- , uuid = require('node-uuid')
, mime = require('mime-types')
, tunnel = require('tunnel-agent')
, stringstream = require('stringstream')
@@ -22,15 +21,14 @@ var http = require('http')
, FormData = require('form-data')
, cookies = require('./lib/cookies')
, copy = require('./lib/copy')
- , net = require('net')
- , CombinedStream = require('combined-stream')
- , isstream = require('isstream')
, getProxyFromURI = require('./lib/getProxyFromURI')
+ , Har = require('./lib/har').Har
, Auth = require('./lib/auth').Auth
- , oauth = require('./lib/oauth')
+ , OAuth = require('./lib/oauth').OAuth
+ , Multipart = require('./lib/multipart').Multipart
+ , Redirect = require('./lib/redirect').Redirect
var safeStringify = helpers.safeStringify
- , md5 = helpers.md5
, isReadStream = helpers.isReadStream
, toBase64 = helpers.toBase64
, defer = helpers.defer
@@ -38,7 +36,6 @@ var safeStringify = helpers.safeStringify
var globalPool = {}
- , isUrl = /^https?:/
var defaultProxyHeaderWhiteList = [
'accept',
@@ -248,6 +245,13 @@ function Request (options) {
// call init
var self = this
+
+ // start with HAR, then override with additional options
+ if (options.har) {
+ self._har = new Har(self)
+ options = self._har.options(options)
+ }
+
stream.Stream.call(self)
var reserved = Object.keys(Request.prototype)
var nonReserved = filterForNonReserved(reserved, options)
@@ -261,6 +265,10 @@ function Request (options) {
if (options.method) {
self.explicitMethod = true
}
+ self._auth = new Auth(self)
+ self._oauth = new OAuth(self)
+ self._multipart = new Multipart(self)
+ self._redirect = new Redirect(self)
self.init(options)
}
@@ -280,7 +288,7 @@ Request.prototype.setupTunnel = function () {
if (typeof self.proxy === 'string') {
self.proxy = url.parse(self.proxy)
}
-
+
if (!self.proxy || !self.tunnel) {
return false
}
@@ -296,7 +304,7 @@ Request.prototype.setupTunnel = function () {
self.proxyHeaders = constructProxyHeaderWhiteList(self.headers, proxyHeaderWhiteList)
self.proxyHeaders.host = constructProxyHost(self.uri)
proxyHeaderExclusiveList.forEach(self.removeHeader, self)
-
+
// Set Agent from Tunnel Data
var tunnelFn = getTunnelFn(self)
var tunnelOptions = constructTunnelOptions(self)
@@ -320,11 +328,19 @@ Request.prototype.init = function (options) {
if (!self.method) {
self.method = options.method || 'GET'
}
- self.localAddress = options.localAddress
+ if (!self.localAddress) {
+ self.localAddress = options.localAddress
+ }
if (!self.qsLib) {
self.qsLib = (options.useQuerystring ? querystring : qs)
}
+ if (!self.qsParseOptions) {
+ self.qsParseOptions = options.qsParseOptions
+ }
+ if (!self.qsStringifyOptions) {
+ self.qsStringifyOptions = options.qsStringifyOptions
+ }
debug(options)
if (!self.pool && self.pool !== false) {
@@ -353,6 +369,38 @@ Request.prototype.init = function (options) {
delete self.url
}
+ // If there's a baseUrl, then use it as the base URL (i.e. uri must be
+ // specified as a relative path and is appended to baseUrl).
+ if (self.baseUrl) {
+ if (typeof self.baseUrl !== 'string') {
+ return self.emit('error', new Error('options.baseUrl must be a string'))
+ }
+
+ if (typeof self.uri !== 'string') {
+ return self.emit('error', new Error('options.uri must be a string when using options.baseUrl'))
+ }
+
+ if (self.uri.indexOf('//') === 0 || self.uri.indexOf('://') !== -1) {
+ return self.emit('error', new Error('options.uri must be a path when using options.baseUrl'))
+ }
+
+ // Handle all cases to make sure that there's only one slash between
+ // baseUrl and uri.
+ var baseUrlEndsWithSlash = self.baseUrl.lastIndexOf('/') === self.baseUrl.length - 1
+ var uriStartsWithSlash = self.uri.indexOf('/') === 0
+
+ if (baseUrlEndsWithSlash && uriStartsWithSlash) {
+ self.uri = self.baseUrl + self.uri.slice(1)
+ } else if (baseUrlEndsWithSlash || uriStartsWithSlash) {
+ self.uri = self.baseUrl + self.uri
+ } else if (self.uri === '') {
+ self.uri = self.baseUrl
+ } else {
+ self.uri = self.baseUrl + '/' + self.uri
+ }
+ delete self.baseUrl
+ }
+
// A URI is needed by this point, throw if we haven't been able to get one
if (!self.uri) {
return self.emit('error', new Error('options.uri is a required argument'))
@@ -413,16 +461,7 @@ Request.prototype.init = function (options) {
return self.emit('error', new Error(message))
}
- self._redirectsFollowed = self._redirectsFollowed || 0
- self.maxRedirects = (self.maxRedirects !== undefined) ? self.maxRedirects : 10
- self.allowRedirect = (typeof self.followRedirect === 'function') ? self.followRedirect : function(response) {
- return true
- }
- self.followRedirects = (self.followRedirect !== undefined) ? !!self.followRedirect : true
- self.followAllRedirects = (self.followAllRedirects !== undefined) ? self.followAllRedirects : false
- if (self.followRedirects || self.followAllRedirects) {
- self.redirects = self.redirects || []
- }
+ self._redirect.onRequest()
self.setHost = false
if (!self.hasHeader('host')) {
@@ -495,8 +534,6 @@ Request.prototype.init = function (options) {
}
// Auth must happen last in case signing is dependent on other headers
- self._auth = new Auth()
-
if (options.oauth) {
self.oauth(options.oauth)
}
@@ -554,10 +591,14 @@ Request.prototype.init = function (options) {
self.json(options.json)
}
if (options.multipart) {
- self.boundary = uuid()
self.multipart(options.multipart)
}
+ if (options.time) {
+ self.timing = true
+ self.elapsedTime = self.elapsedTime || 0
+ }
+
if (self.body) {
var length = 0
if (!Buffer.isBuffer(self.body)) {
@@ -654,8 +695,8 @@ Request.prototype.init = function (options) {
if (self._form) {
self._form.pipe(self)
}
- if (self._multipart) {
- self._multipart.pipe(self)
+ if (self._multipart && self._multipart.chunked) {
+ self._multipart.body.pipe(self)
}
if (self.body) {
if (Array.isArray(self.body)) {
@@ -901,20 +942,26 @@ Request.prototype.start = function () {
delete reqOptions.auth
debug('make request', self.uri.href)
+
self.req = self.httpModule.request(reqOptions)
+ if (self.timing) {
+ self.startTime = new Date().getTime()
+ }
+
if (self.timeout && !self.timeoutTimer) {
+ var timeout = self.timeout < 0 ? 0 : self.timeout
self.timeoutTimer = setTimeout(function () {
self.abort()
var e = new Error('ETIMEDOUT')
e.code = 'ETIMEDOUT'
self.emit('error', e)
- }, self.timeout)
+ }, timeout)
// Set additional timeout on socket - in case if remote
// server freeze after sending headers
if (self.req.setTimeout) { // only works on node 0.6+
- self.req.setTimeout(self.timeout, function () {
+ self.req.setTimeout(timeout, function () {
if (self.req) {
self.req.abort()
var e = new Error('ESOCKETTIMEDOUT')
@@ -965,6 +1012,11 @@ Request.prototype.onRequestResponse = function (response) {
var self = this
debug('onRequestResponse', self.uri.href, response.statusCode, response.headers)
response.on('end', function() {
+ if (self.timing) {
+ self.elapsedTime += (new Date().getTime() - self.startTime)
+ debug('elapsed time', self.elapsedTime)
+ response.elapsedTime = self.elapsedTime
+ }
debug('response end', self.uri.href, response.statusCode, response.headers)
})
@@ -1036,98 +1088,9 @@ Request.prototype.onRequestResponse = function (response) {
}
}
- var redirectTo = null
- if (response.statusCode >= 300 && response.statusCode < 400 && response.caseless.has('location')) {
- var location = response.caseless.get('location')
- debug('redirect', location)
-
- if (self.followAllRedirects) {
- redirectTo = location
- } else if (self.followRedirects) {
- switch (self.method) {
- case 'PATCH':
- case 'PUT':
- case 'POST':
- case 'DELETE':
- // Do not follow redirects
- break
- default:
- redirectTo = location
- break
- }
- }
- } else if (response.statusCode === 401) {
- var authHeader = self._auth.response(self.method, self.uri.path, response.headers)
- if (authHeader) {
- self.setHeader('authorization', authHeader)
- redirectTo = self.uri
- }
- }
-
- if (redirectTo && self.allowRedirect.call(self, response)) {
- debug('redirect to', redirectTo)
-
- // ignore any potential response body. it cannot possibly be useful
- // to us at this point.
- if (self._paused) {
- response.resume()
- }
-
- if (self._redirectsFollowed >= self.maxRedirects) {
- self.emit('error', new Error('Exceeded maxRedirects. Probably stuck in a redirect loop ' + self.uri.href))
- return
- }
- self._redirectsFollowed += 1
-
- if (!isUrl.test(redirectTo)) {
- redirectTo = url.resolve(self.uri.href, redirectTo)
- }
-
- var uriPrev = self.uri
- self.uri = url.parse(redirectTo)
-
- // handle the case where we change protocol from https to http or vice versa
- if (self.uri.protocol !== uriPrev.protocol) {
- self._updateProtocol()
- }
-
- self.redirects.push(
- { statusCode : response.statusCode
- , redirectUri: redirectTo
- }
- )
- if (self.followAllRedirects && response.statusCode !== 401 && response.statusCode !== 307) {
- self.method = 'GET'
- }
- // self.method = 'GET' // Force all redirects to use GET || commented out fixes #215
- delete self.src
- delete self.req
- delete self.agent
- delete self._started
- if (response.statusCode !== 401 && response.statusCode !== 307) {
- // Remove parameters from the previous response, unless this is the second request
- // for a server that requires digest authentication.
- delete self.body
- delete self._form
- if (self.headers) {
- self.removeHeader('host')
- self.removeHeader('content-type')
- self.removeHeader('content-length')
- if (self.uri.hostname !== self.originalHost.split(':')[0]) {
- // Remove authorization if changing hostnames (but not if just
- // changing ports or protocols). This matches the behavior of curl:
- // https://github.com/bagder/curl/blob/6beb0eee/lib/http.c#L710
- self.removeHeader('authorization')
- }
- }
- }
-
- self.emit('redirect')
-
- self.init()
+ if (self._redirect.onResponse(response)) {
return // Ignore the rest of the response
} else {
- self._redirectsFollowed = self._redirectsFollowed || 0
// Be a good stream and emit end when the response is finished.
// Hack to emit end on close because of a core bug that never fires end
response.on('close', function () {
@@ -1310,7 +1273,7 @@ Request.prototype.qs = function (q, clobber) {
var self = this
var base
if (!clobber && self.uri.query) {
- base = self.qsLib.parse(self.uri.query)
+ base = self.qsLib.parse(self.uri.query, self.qsParseOptions)
} else {
base = {}
}
@@ -1319,11 +1282,11 @@ Request.prototype.qs = function (q, clobber) {
base[i] = q[i]
}
- if (self.qsLib.stringify(base) === ''){
+ if (self.qsLib.stringify(base, self.qsStringifyOptions) === ''){
return self
}
- var qs = self.qsLib.stringify(base)
+ var qs = self.qsLib.stringify(base, self.qsStringifyOptions)
self.uri = url.parse(self.uri.href.split('?')[0] + '?' + rfc3986(qs))
self.url = self.uri
@@ -1335,13 +1298,15 @@ Request.prototype.form = function (form) {
var self = this
if (form) {
self.setHeader('content-type', 'application/x-www-form-urlencoded')
- self.body = (typeof form === 'string') ? form.toString('utf8') : self.qsLib.stringify(form).toString('utf8')
+ self.body = (typeof form === 'string')
+ ? form.toString('utf8')
+ : self.qsLib.stringify(form, self.qsStringifyOptions).toString('utf8')
self.body = rfc3986(self.body)
return self
}
// create form-data object
self._form = new FormData()
- self._form.on('error',function(err) {
+ self._form.on('error', function(err) {
err.message = 'form-data: ' + err.message
self.emit('error', err)
self.abort()
@@ -1351,69 +1316,12 @@ Request.prototype.form = function (form) {
Request.prototype.multipart = function (multipart) {
var self = this
- var chunked = false
- var _multipart = multipart.data || multipart
-
- if (!_multipart.forEach) {
- throw new Error('Argument error, options.multipart.')
- }
-
- if (self.getHeader('transfer-encoding') === 'chunked') {
- chunked = true
- }
- if (multipart.chunked !== undefined) {
- chunked = multipart.chunked
- }
- if (!chunked) {
- _multipart.forEach(function (part) {
- if(typeof part.body === 'undefined') {
- throw new Error('Body attribute missing in multipart.')
- }
- if (isstream(part.body)) {
- chunked = true
- }
- })
- }
-
- if (chunked && !self.hasHeader('transfer-encoding')) {
- self.setHeader('transfer-encoding', 'chunked')
- }
-
- var headerName = self.hasHeader('content-type')
- if (!headerName || self.headers[headerName].indexOf('multipart') === -1) {
- self.setHeader('content-type', 'multipart/related; boundary=' + self.boundary)
- } else {
- self.setHeader(headerName, self.headers[headerName].split(';')[0] + '; boundary=' + self.boundary)
- }
-
- var parts = chunked ? new CombinedStream() : []
- function add (part) {
- return chunked ? parts.append(part) : parts.push(new Buffer(part))
- }
+ self._multipart.onRequest(multipart)
- if (self.preambleCRLF) {
- add('\r\n')
+ if (!self._multipart.chunked) {
+ self.body = self._multipart.body
}
- _multipart.forEach(function (part) {
- var body = part.body
- var preamble = '--' + self.boundary + '\r\n'
- Object.keys(part).forEach(function (key) {
- if (key === 'body') { return }
- preamble += key + ': ' + part[key] + '\r\n'
- })
- preamble += '\r\n'
- add(preamble)
- add(body)
- add('\r\n')
- })
- add('--' + self.boundary + '--')
-
- if (self.postambleCRLF) {
- add('\r\n')
- }
-
- self[chunked ? '_multipart' : 'body'] = parts
return self
}
Request.prototype.json = function (val) {
@@ -1466,24 +1374,14 @@ Request.prototype.getHeader = function (name, headers) {
})
return result
}
-var getHeader = Request.prototype.getHeader
Request.prototype.auth = function (user, pass, sendImmediately, bearer) {
var self = this
- var authHeader
- if (bearer !== undefined) {
- authHeader = self._auth.bearer(bearer, sendImmediately)
- } else {
- authHeader = self._auth.basic(user, pass, sendImmediately)
- }
- if (authHeader) {
- self.setHeader('authorization', authHeader)
- }
+ self._auth.onRequest(user, pass, sendImmediately, bearer)
return self
}
-
Request.prototype.aws = function (opts, now) {
var self = this
@@ -1521,7 +1419,7 @@ Request.prototype.httpSignature = function (opts) {
var self = this
httpSignature.signRequest({
getHeader: function(header) {
- return getHeader(header, self.headers)
+ return self.getHeader(header, self.headers)
},
setHeader: function(header, value) {
self.setHeader(header, value)
@@ -1533,33 +1431,14 @@ Request.prototype.httpSignature = function (opts) {
return self
}
-
Request.prototype.hawk = function (opts) {
var self = this
self.setHeader('Authorization', hawk.client.header(self.uri, self.method, opts).field)
}
-
Request.prototype.oauth = function (_oauth) {
var self = this
- var result = oauth.oauth({
- uri: self.uri,
- method: self.method,
- headers: self.headers,
- body: self.body,
- oauth: _oauth,
- qsLib: self.qsLib
- })
-
- if (result.transport === 'header') {
- self.setHeader('Authorization', result.oauth)
- }
- else if (result.transport === 'query') {
- self.path += result.oauth
- }
- else if (result.transport === 'body') {
- self.body = result.oauth
- }
+ self._oauth.onRequest(_oauth)
return self
}
@@ -1568,7 +1447,7 @@ Request.prototype.jar = function (jar) {
var self = this
var cookies
- if (self._redirectsFollowed === 0) {
+ if (self._redirect.redirectsFollowed === 0) {
self.originalCookieHeader = self.getHeader('cookie')
}
diff --git a/deps/npm/node_modules/semver/package.json b/deps/npm/node_modules/semver/package.json
index cbd761b48e..ba63fc2fd4 100644
--- a/deps/npm/node_modules/semver/package.json
+++ b/deps/npm/node_modules/semver/package.json
@@ -1,6 +1,6 @@
{
"name": "semver",
- "version": "4.3.1",
+ "version": "4.3.2",
"description": "The semantic version parser used by npm.",
"main": "semver.js",
"browser": "semver.browser.js",
@@ -21,19 +21,19 @@
"bin": {
"semver": "./bin/semver"
},
- "gitHead": "fa9be2b231666f7485e832f84d2fe99afc033e22",
+ "gitHead": "22e583cc12d21b80bd7175b64ebe55890aa34e46",
"bugs": {
"url": "https://github.com/npm/node-semver/issues"
},
"homepage": "https://github.com/npm/node-semver",
- "_id": "semver@4.3.1",
- "_shasum": "beb0129575b95f76110b29af08d370fd9eeb34bf",
- "_from": "semver@>=4.3.1 <4.4.0",
- "_npmVersion": "2.6.0",
- "_nodeVersion": "1.1.0",
+ "_id": "semver@4.3.2",
+ "_shasum": "c7a07158a80bedd052355b770d82d6640f803be7",
+ "_from": "semver@>=4.3.2 <4.4.0",
+ "_npmVersion": "2.7.4",
+ "_nodeVersion": "1.4.2",
"_npmUser": {
"name": "isaacs",
- "email": "i@izs.me"
+ "email": "isaacs@npmjs.com"
},
"maintainers": [
{
@@ -46,10 +46,9 @@
}
],
"dist": {
- "shasum": "beb0129575b95f76110b29af08d370fd9eeb34bf",
- "tarball": "http://registry.npmjs.org/semver/-/semver-4.3.1.tgz"
+ "shasum": "c7a07158a80bedd052355b770d82d6640f803be7",
+ "tarball": "http://registry.npmjs.org/semver/-/semver-4.3.2.tgz"
},
"directories": {},
- "_resolved": "https://registry.npmjs.org/semver/-/semver-4.3.1.tgz",
- "readme": "ERROR: No README data found!"
+ "_resolved": "https://registry.npmjs.org/semver/-/semver-4.3.2.tgz"
}
diff --git a/deps/npm/node_modules/semver/semver.browser.js b/deps/npm/node_modules/semver/semver.browser.js
index 1ee7204222..250885a7e7 100644
--- a/deps/npm/node_modules/semver/semver.browser.js
+++ b/deps/npm/node_modules/semver/semver.browser.js
@@ -10,6 +10,9 @@ if (typeof module === 'object' && module.exports === exports)
// Not necessarily the package version of this code.
exports.SEMVER_SPEC_VERSION = '2.0.0';
+var MAX_LENGTH = 256;
+var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991;
+
// The actual regexps go on exports.re
var re = exports.re = [];
var src = exports.src = [];
@@ -223,8 +226,18 @@ for (var i = 0; i < R; i++) {
exports.parse = parse;
function parse(version, loose) {
+ if (version.length > MAX_LENGTH)
+ return null;
+
var r = loose ? re[LOOSE] : re[FULL];
- return (r.test(version)) ? new SemVer(version, loose) : null;
+ if (!r.test(version))
+ return null;
+
+ try {
+ return new SemVer(version, loose);
+ } catch (er) {
+ return null;
+ }
}
exports.valid = valid;
@@ -252,6 +265,9 @@ function SemVer(version, loose) {
throw new TypeError('Invalid Version: ' + version);
}
+ if (version.length > MAX_LENGTH)
+ throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters')
+
if (!(this instanceof SemVer))
return new SemVer(version, loose);
@@ -269,6 +285,15 @@ function SemVer(version, loose) {
this.minor = +m[2];
this.patch = +m[3];
+ if (this.major > MAX_SAFE_INTEGER || this.major < 0)
+ throw new TypeError('Invalid major version')
+
+ if (this.minor > MAX_SAFE_INTEGER || this.minor < 0)
+ throw new TypeError('Invalid minor version')
+
+ if (this.patch > MAX_SAFE_INTEGER || this.patch < 0)
+ throw new TypeError('Invalid patch version')
+
// numberify any prerelease numeric ids
if (!m[4])
this.prerelease = [];
diff --git a/deps/npm/node_modules/semver/semver.browser.js.gz b/deps/npm/node_modules/semver/semver.browser.js.gz
index 4bd16d689c..6a8cf09559 100644
--- a/deps/npm/node_modules/semver/semver.browser.js.gz
+++ b/deps/npm/node_modules/semver/semver.browser.js.gz
Binary files differ
diff --git a/deps/npm/node_modules/semver/semver.js b/deps/npm/node_modules/semver/semver.js
index 544bc83123..d265b568ed 100644
--- a/deps/npm/node_modules/semver/semver.js
+++ b/deps/npm/node_modules/semver/semver.js
@@ -20,6 +20,9 @@ if (typeof module === 'object' && module.exports === exports)
// Not necessarily the package version of this code.
exports.SEMVER_SPEC_VERSION = '2.0.0';
+var MAX_LENGTH = 256;
+var MAX_SAFE_INTEGER = Number.MAX_SAFE_INTEGER || 9007199254740991;
+
// The actual regexps go on exports.re
var re = exports.re = [];
var src = exports.src = [];
@@ -233,8 +236,18 @@ for (var i = 0; i < R; i++) {
exports.parse = parse;
function parse(version, loose) {
+ if (version.length > MAX_LENGTH)
+ return null;
+
var r = loose ? re[LOOSE] : re[FULL];
- return (r.test(version)) ? new SemVer(version, loose) : null;
+ if (!r.test(version))
+ return null;
+
+ try {
+ return new SemVer(version, loose);
+ } catch (er) {
+ return null;
+ }
}
exports.valid = valid;
@@ -262,6 +275,9 @@ function SemVer(version, loose) {
throw new TypeError('Invalid Version: ' + version);
}
+ if (version.length > MAX_LENGTH)
+ throw new TypeError('version is longer than ' + MAX_LENGTH + ' characters')
+
if (!(this instanceof SemVer))
return new SemVer(version, loose);
@@ -279,6 +295,15 @@ function SemVer(version, loose) {
this.minor = +m[2];
this.patch = +m[3];
+ if (this.major > MAX_SAFE_INTEGER || this.major < 0)
+ throw new TypeError('Invalid major version')
+
+ if (this.minor > MAX_SAFE_INTEGER || this.minor < 0)
+ throw new TypeError('Invalid minor version')
+
+ if (this.patch > MAX_SAFE_INTEGER || this.patch < 0)
+ throw new TypeError('Invalid patch version')
+
// numberify any prerelease numeric ids
if (!m[4])
this.prerelease = [];
diff --git a/deps/npm/node_modules/semver/semver.min.js b/deps/npm/node_modules/semver/semver.min.js
index 6de8c73459..abe2d81843 100644
--- a/deps/npm/node_modules/semver/semver.min.js
+++ b/deps/npm/node_modules/semver/semver.min.js
@@ -1 +1 @@
-(function(e){if(typeof module==="object"&&module.exports===e)e=module.exports=H;e.SEMVER_SPEC_VERSION="2.0.0";var r=e.re=[];var t=e.src=[];var n=0;var i=n++;t[i]="0|[1-9]\\d*";var s=n++;t[s]="[0-9]+";var a=n++;t[a]="\\d*[a-zA-Z-][a-zA-Z0-9-]*";var o=n++;t[o]="("+t[i]+")\\."+"("+t[i]+")\\."+"("+t[i]+")";var f=n++;t[f]="("+t[s]+")\\."+"("+t[s]+")\\."+"("+t[s]+")";var u=n++;t[u]="(?:"+t[i]+"|"+t[a]+")";var l=n++;t[l]="(?:"+t[s]+"|"+t[a]+")";var p=n++;t[p]="(?:-("+t[u]+"(?:\\."+t[u]+")*))";var c=n++;t[c]="(?:-?("+t[l]+"(?:\\."+t[l]+")*))";var h=n++;t[h]="[0-9A-Za-z-]+";var v=n++;t[v]="(?:\\+("+t[h]+"(?:\\."+t[h]+")*))";var m=n++;var g="v?"+t[o]+t[p]+"?"+t[v]+"?";t[m]="^"+g+"$";var w="[v=\\s]*"+t[f]+t[c]+"?"+t[v]+"?";var d=n++;t[d]="^"+w+"$";var y=n++;t[y]="((?:<|>)?=?)";var j=n++;t[j]=t[s]+"|x|X|\\*";var b=n++;t[b]=t[i]+"|x|X|\\*";var $=n++;t[$]="[v=\\s]*("+t[b]+")"+"(?:\\.("+t[b]+")"+"(?:\\.("+t[b]+")"+"(?:"+t[p]+")?"+t[v]+"?"+")?)?";var k=n++;t[k]="[v=\\s]*("+t[j]+")"+"(?:\\.("+t[j]+")"+"(?:\\.("+t[j]+")"+"(?:"+t[c]+")?"+t[v]+"?"+")?)?";var E=n++;t[E]="^"+t[y]+"\\s*"+t[$]+"$";var x=n++;t[x]="^"+t[y]+"\\s*"+t[k]+"$";var R=n++;t[R]="(?:~>?)";var S=n++;t[S]="(\\s*)"+t[R]+"\\s+";r[S]=new RegExp(t[S],"g");var V="$1~";var I=n++;t[I]="^"+t[R]+t[$]+"$";var T=n++;t[T]="^"+t[R]+t[k]+"$";var A=n++;t[A]="(?:\\^)";var C=n++;t[C]="(\\s*)"+t[A]+"\\s+";r[C]=new RegExp(t[C],"g");var M="$1^";var z=n++;t[z]="^"+t[A]+t[$]+"$";var N=n++;t[N]="^"+t[A]+t[k]+"$";var P=n++;t[P]="^"+t[y]+"\\s*("+w+")$|^$";var Z=n++;t[Z]="^"+t[y]+"\\s*("+g+")$|^$";var q=n++;t[q]="(\\s*)"+t[y]+"\\s*("+w+"|"+t[$]+")";r[q]=new RegExp(t[q],"g");var L="$1$2$3";var X=n++;t[X]="^\\s*("+t[$]+")"+"\\s+-\\s+"+"("+t[$]+")"+"\\s*$";var _=n++;t[_]="^\\s*("+t[k]+")"+"\\s+-\\s+"+"("+t[k]+")"+"\\s*$";var O=n++;t[O]="(<|>)?=?\\s*\\*";for(var B=0;B<n;B++){if(!r[B])r[B]=new RegExp(t[B])}e.parse=D;function D(e,t){var n=t?r[d]:r[m];return n.test(e)?new H(e,t):null}e.valid=F;function F(e,r){var t=D(e,r);return t?t.version:null}e.clean=G;function G(e,r){var t=D(e.trim().replace(/^[=v]+/,""),r);return t?t.version:null}e.SemVer=H;function H(e,t){if(e instanceof H){if(e.loose===t)return e;else e=e.version}else if(typeof e!=="string"){throw new TypeError("Invalid Version: "+e)}if(!(this instanceof H))return new H(e,t);this.loose=t;var n=e.trim().match(t?r[d]:r[m]);if(!n)throw new TypeError("Invalid Version: "+e);this.raw=e;this.major=+n[1];this.minor=+n[2];this.patch=+n[3];if(!n[4])this.prerelease=[];else this.prerelease=n[4].split(".").map(function(e){return/^[0-9]+$/.test(e)?+e:e});this.build=n[5]?n[5].split("."):[];this.format()}H.prototype.format=function(){this.version=this.major+"."+this.minor+"."+this.patch;if(this.prerelease.length)this.version+="-"+this.prerelease.join(".");return this.version};H.prototype.inspect=function(){return'<SemVer "'+this+'">'};H.prototype.toString=function(){return this.version};H.prototype.compare=function(e){if(!(e instanceof H))e=new H(e,this.loose);return this.compareMain(e)||this.comparePre(e)};H.prototype.compareMain=function(e){if(!(e instanceof H))e=new H(e,this.loose);return U(this.major,e.major)||U(this.minor,e.minor)||U(this.patch,e.patch)};H.prototype.comparePre=function(e){if(!(e instanceof H))e=new H(e,this.loose);if(this.prerelease.length&&!e.prerelease.length)return-1;else if(!this.prerelease.length&&e.prerelease.length)return 1;else if(!this.prerelease.length&&!e.prerelease.length)return 0;var r=0;do{var t=this.prerelease[r];var n=e.prerelease[r];if(t===undefined&&n===undefined)return 0;else if(n===undefined)return 1;else if(t===undefined)return-1;else if(t===n)continue;else return U(t,n)}while(++r)};H.prototype.inc=function(e,r){switch(e){case"premajor":this.prerelease.length=0;this.patch=0;this.minor=0;this.major++;this.inc("pre",r);break;case"preminor":this.prerelease.length=0;this.patch=0;this.minor++;this.inc("pre",r);break;case"prepatch":this.prerelease.length=0;this.inc("patch",r);this.inc("pre",r);break;case"prerelease":if(this.prerelease.length===0)this.inc("patch",r);this.inc("pre",r);break;case"major":if(this.minor!==0||this.patch!==0||this.prerelease.length===0)this.major++;this.minor=0;this.patch=0;this.prerelease=[];break;case"minor":if(this.patch!==0||this.prerelease.length===0)this.minor++;this.patch=0;this.prerelease=[];break;case"patch":if(this.prerelease.length===0)this.patch++;this.prerelease=[];break;case"pre":if(this.prerelease.length===0)this.prerelease=[0];else{var t=this.prerelease.length;while(--t>=0){if(typeof this.prerelease[t]==="number"){this.prerelease[t]++;t=-2}}if(t===-1)this.prerelease.push(0)}if(r){if(this.prerelease[0]===r){if(isNaN(this.prerelease[1]))this.prerelease=[r,0]}else this.prerelease=[r,0]}break;default:throw new Error("invalid increment argument: "+e)}this.format();return this};e.inc=J;function J(e,r,t,n){if(typeof t==="string"){n=t;t=undefined}try{return new H(e,t).inc(r,n).version}catch(i){return null}}e.diff=K;function K(e,r){if(ur(e,r)){return null}else{var t=D(e);var n=D(r);if(t.prerelease.length||n.prerelease.length){for(var i in t){if(i==="major"||i==="minor"||i==="patch"){if(t[i]!==n[i]){return"pre"+i}}}return"prerelease"}for(var i in t){if(i==="major"||i==="minor"||i==="patch"){if(t[i]!==n[i]){return i}}}}}e.compareIdentifiers=U;var Q=/^[0-9]+$/;function U(e,r){var t=Q.test(e);var n=Q.test(r);if(t&&n){e=+e;r=+r}return t&&!n?-1:n&&!t?1:e<r?-1:e>r?1:0}e.rcompareIdentifiers=W;function W(e,r){return U(r,e)}e.major=Y;function Y(e,r){return new H(e,r).major}e.minor=er;function er(e,r){return new H(e,r).minor}e.patch=rr;function rr(e,r){return new H(e,r).patch}e.compare=tr;function tr(e,r,t){return new H(e,t).compare(r)}e.compareLoose=nr;function nr(e,r){return tr(e,r,true)}e.rcompare=ir;function ir(e,r,t){return tr(r,e,t)}e.sort=sr;function sr(r,t){return r.sort(function(r,n){return e.compare(r,n,t)})}e.rsort=ar;function ar(r,t){return r.sort(function(r,n){return e.rcompare(r,n,t)})}e.gt=or;function or(e,r,t){return tr(e,r,t)>0}e.lt=fr;function fr(e,r,t){return tr(e,r,t)<0}e.eq=ur;function ur(e,r,t){return tr(e,r,t)===0}e.neq=lr;function lr(e,r,t){return tr(e,r,t)!==0}e.gte=pr;function pr(e,r,t){return tr(e,r,t)>=0}e.lte=cr;function cr(e,r,t){return tr(e,r,t)<=0}e.cmp=hr;function hr(e,r,t,n){var i;switch(r){case"===":if(typeof e==="object")e=e.version;if(typeof t==="object")t=t.version;i=e===t;break;case"!==":if(typeof e==="object")e=e.version;if(typeof t==="object")t=t.version;i=e!==t;break;case"":case"=":case"==":i=ur(e,t,n);break;case"!=":i=lr(e,t,n);break;case">":i=or(e,t,n);break;case">=":i=pr(e,t,n);break;case"<":i=fr(e,t,n);break;case"<=":i=cr(e,t,n);break;default:throw new TypeError("Invalid operator: "+r)}return i}e.Comparator=vr;function vr(e,r){if(e instanceof vr){if(e.loose===r)return e;else e=e.value}if(!(this instanceof vr))return new vr(e,r);this.loose=r;this.parse(e);if(this.semver===mr)this.value="";else this.value=this.operator+this.semver.version}var mr={};vr.prototype.parse=function(e){var t=this.loose?r[P]:r[Z];var n=e.match(t);if(!n)throw new TypeError("Invalid comparator: "+e);this.operator=n[1];if(this.operator==="=")this.operator="";if(!n[2])this.semver=mr;else this.semver=new H(n[2],this.loose)};vr.prototype.inspect=function(){return'<SemVer Comparator "'+this+'">'};vr.prototype.toString=function(){return this.value};vr.prototype.test=function(e){if(this.semver===mr)return true;if(typeof e==="string")e=new H(e,this.loose);return hr(e,this.operator,this.semver,this.loose)};e.Range=gr;function gr(e,r){if(e instanceof gr&&e.loose===r)return e;if(!(this instanceof gr))return new gr(e,r);this.loose=r;this.raw=e;this.set=e.split(/\s*\|\|\s*/).map(function(e){return this.parseRange(e.trim())},this).filter(function(e){return e.length});if(!this.set.length){throw new TypeError("Invalid SemVer Range: "+e)}this.format()}gr.prototype.inspect=function(){return'<SemVer Range "'+this.range+'">'};gr.prototype.format=function(){this.range=this.set.map(function(e){return e.join(" ").trim()}).join("||").trim();return this.range};gr.prototype.toString=function(){return this.range};gr.prototype.parseRange=function(e){var t=this.loose;e=e.trim();var n=t?r[_]:r[X];e=e.replace(n,Sr);e=e.replace(r[q],L);e=e.replace(r[S],V);e=e.replace(r[C],M);e=e.split(/\s+/).join(" ");var i=t?r[P]:r[Z];var s=e.split(" ").map(function(e){return dr(e,t)}).join(" ").split(/\s+/);if(this.loose){s=s.filter(function(e){return!!e.match(i)})}s=s.map(function(e){return new vr(e,t)});return s};e.toComparators=wr;function wr(e,r){return new gr(e,r).set.map(function(e){return e.map(function(e){return e.value}).join(" ").trim().split(" ")})}function dr(e,r){e=$r(e,r);e=jr(e,r);e=Er(e,r);e=Rr(e,r);return e}function yr(e){return!e||e.toLowerCase()==="x"||e==="*"}function jr(e,r){return e.trim().split(/\s+/).map(function(e){return br(e,r)}).join(" ")}function br(e,t){var n=t?r[T]:r[I];return e.replace(n,function(e,r,t,n,i){var s;if(yr(r))s="";else if(yr(t))s=">="+r+".0.0 <"+(+r+1)+".0.0";else if(yr(n))s=">="+r+"."+t+".0 <"+r+"."+(+t+1)+".0";else if(i){if(i.charAt(0)!=="-")i="-"+i;s=">="+r+"."+t+"."+n+i+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+" <"+r+"."+(+t+1)+".0";return s})}function $r(e,r){return e.trim().split(/\s+/).map(function(e){return kr(e,r)}).join(" ")}function kr(e,t){var n=t?r[N]:r[z];return e.replace(n,function(e,r,t,n,i){var s;if(yr(r))s="";else if(yr(t))s=">="+r+".0.0 <"+(+r+1)+".0.0";else if(yr(n)){if(r==="0")s=">="+r+"."+t+".0 <"+r+"."+(+t+1)+".0";else s=">="+r+"."+t+".0 <"+(+r+1)+".0.0"}else if(i){if(i.charAt(0)!=="-")i="-"+i;if(r==="0"){if(t==="0")s=">="+r+"."+t+"."+n+i+" <"+r+"."+t+"."+(+n+1);else s=">="+r+"."+t+"."+n+i+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+i+" <"+(+r+1)+".0.0"}else{if(r==="0"){if(t==="0")s=">="+r+"."+t+"."+n+" <"+r+"."+t+"."+(+n+1);else s=">="+r+"."+t+"."+n+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+" <"+(+r+1)+".0.0"}return s})}function Er(e,r){return e.split(/\s+/).map(function(e){return xr(e,r)}).join(" ")}function xr(e,t){e=e.trim();var n=t?r[x]:r[E];return e.replace(n,function(e,r,t,n,i,s){var a=yr(t);var o=a||yr(n);var f=o||yr(i);var u=f;if(r==="="&&u)r="";if(a){if(r===">"||r==="<"){e="<0.0.0"}else{e="*"}}else if(r&&u){if(o)n=0;if(f)i=0;if(r===">"){r=">=";if(o){t=+t+1;n=0;i=0}else if(f){n=+n+1;i=0}}else if(r==="<="){r="<";if(o)t=+t+1;else n=+n+1}e=r+t+"."+n+"."+i}else if(o){e=">="+t+".0.0 <"+(+t+1)+".0.0"}else if(f){e=">="+t+"."+n+".0 <"+t+"."+(+n+1)+".0"}return e})}function Rr(e,t){return e.trim().replace(r[O],"")}function Sr(e,r,t,n,i,s,a,o,f,u,l,p,c){if(yr(t))r="";else if(yr(n))r=">="+t+".0.0";else if(yr(i))r=">="+t+"."+n+".0";else r=">="+r;if(yr(f))o="";else if(yr(u))o="<"+(+f+1)+".0.0";else if(yr(l))o="<"+f+"."+(+u+1)+".0";else if(p)o="<="+f+"."+u+"."+l+"-"+p;else o="<="+o;return(r+" "+o).trim()}gr.prototype.test=function(e){if(!e)return false;if(typeof e==="string")e=new H(e,this.loose);for(var r=0;r<this.set.length;r++){if(Vr(this.set[r],e))return true}return false};function Vr(e,r){for(var t=0;t<e.length;t++){if(!e[t].test(r))return false}if(r.prerelease.length){for(var t=0;t<e.length;t++){if(e[t].semver===mr)return true;if(e[t].semver.prerelease.length>0){var n=e[t].semver;if(n.major===r.major&&n.minor===r.minor&&n.patch===r.patch)return true}}return false}return true}e.satisfies=Ir;function Ir(e,r,t){try{r=new gr(r,t)}catch(n){return false}return r.test(e)}e.maxSatisfying=Tr;function Tr(e,r,t){return e.filter(function(e){return Ir(e,r,t)}).sort(function(e,r){return ir(e,r,t)})[0]||null}e.validRange=Ar;function Ar(e,r){try{return new gr(e,r).range||"*"}catch(t){return null}}e.ltr=Cr;function Cr(e,r,t){return zr(e,r,"<",t)}e.gtr=Mr;function Mr(e,r,t){return zr(e,r,">",t)}e.outside=zr;function zr(e,r,t,n){e=new H(e,n);r=new gr(r,n);var i,s,a,o,f;switch(t){case">":i=or;s=cr;a=fr;o=">";f=">=";break;case"<":i=fr;s=pr;a=or;o="<";f="<=";break;default:throw new TypeError('Must provide a hilo val of "<" or ">"')}if(Ir(e,r,n)){return false}for(var u=0;u<r.set.length;++u){var l=r.set[u];var p=null;var c=null;l.forEach(function(e){p=p||e;c=c||e;if(i(e.semver,p.semver,n)){p=e}else if(a(e.semver,c.semver,n)){c=e}});if(p.operator===o||p.operator===f){return false}if((!c.operator||c.operator===o)&&s(e,c.semver)){return false}else if(c.operator===f&&a(e,c.semver)){return false}}return true}if(typeof define==="function"&&define.amd)define(e)})(typeof exports==="object"?exports:typeof define==="function"&&define.amd?{}:semver={}); \ No newline at end of file
+(function(e){if(typeof module==="object"&&module.exports===e)e=module.exports=K;e.SEMVER_SPEC_VERSION="2.0.0";var r=256;var t=Number.MAX_SAFE_INTEGER||9007199254740991;var n=e.re=[];var i=e.src=[];var s=0;var o=s++;i[o]="0|[1-9]\\d*";var a=s++;i[a]="[0-9]+";var f=s++;i[f]="\\d*[a-zA-Z-][a-zA-Z0-9-]*";var u=s++;i[u]="("+i[o]+")\\."+"("+i[o]+")\\."+"("+i[o]+")";var l=s++;i[l]="("+i[a]+")\\."+"("+i[a]+")\\."+"("+i[a]+")";var h=s++;i[h]="(?:"+i[o]+"|"+i[f]+")";var p=s++;i[p]="(?:"+i[a]+"|"+i[f]+")";var c=s++;i[c]="(?:-("+i[h]+"(?:\\."+i[h]+")*))";var v=s++;i[v]="(?:-?("+i[p]+"(?:\\."+i[p]+")*))";var m=s++;i[m]="[0-9A-Za-z-]+";var g=s++;i[g]="(?:\\+("+i[m]+"(?:\\."+i[m]+")*))";var w=s++;var y="v?"+i[u]+i[c]+"?"+i[g]+"?";i[w]="^"+y+"$";var d="[v=\\s]*"+i[l]+i[v]+"?"+i[g]+"?";var j=s++;i[j]="^"+d+"$";var b=s++;i[b]="((?:<|>)?=?)";var E=s++;i[E]=i[a]+"|x|X|\\*";var $=s++;i[$]=i[o]+"|x|X|\\*";var k=s++;i[k]="[v=\\s]*("+i[$]+")"+"(?:\\.("+i[$]+")"+"(?:\\.("+i[$]+")"+"(?:"+i[c]+")?"+i[g]+"?"+")?)?";var R=s++;i[R]="[v=\\s]*("+i[E]+")"+"(?:\\.("+i[E]+")"+"(?:\\.("+i[E]+")"+"(?:"+i[v]+")?"+i[g]+"?"+")?)?";var S=s++;i[S]="^"+i[b]+"\\s*"+i[k]+"$";var x=s++;i[x]="^"+i[b]+"\\s*"+i[R]+"$";var I=s++;i[I]="(?:~>?)";var T=s++;i[T]="(\\s*)"+i[I]+"\\s+";n[T]=new RegExp(i[T],"g");var V="$1~";var A=s++;i[A]="^"+i[I]+i[k]+"$";var C=s++;i[C]="^"+i[I]+i[R]+"$";var M=s++;i[M]="(?:\\^)";var N=s++;i[N]="(\\s*)"+i[M]+"\\s+";n[N]=new RegExp(i[N],"g");var _="$1^";var z=s++;i[z]="^"+i[M]+i[k]+"$";var P=s++;i[P]="^"+i[M]+i[R]+"$";var X=s++;i[X]="^"+i[b]+"\\s*("+d+")$|^$";var Z=s++;i[Z]="^"+i[b]+"\\s*("+y+")$|^$";var q=s++;i[q]="(\\s*)"+i[b]+"\\s*("+d+"|"+i[k]+")";n[q]=new RegExp(i[q],"g");var L="$1$2$3";var F=s++;i[F]="^\\s*("+i[k]+")"+"\\s+-\\s+"+"("+i[k]+")"+"\\s*$";var G=s++;i[G]="^\\s*("+i[R]+")"+"\\s+-\\s+"+"("+i[R]+")"+"\\s*$";var O=s++;i[O]="(<|>)?=?\\s*\\*";for(var B=0;B<s;B++){if(!n[B])n[B]=new RegExp(i[B])}e.parse=D;function D(e,t){if(e.length>r)return null;var i=t?n[j]:n[w];if(!i.test(e))return null;try{return new K(e,t)}catch(s){return null}}e.valid=H;function H(e,r){var t=D(e,r);return t?t.version:null}e.clean=J;function J(e,r){var t=D(e.trim().replace(/^[=v]+/,""),r);return t?t.version:null}e.SemVer=K;function K(e,i){if(e instanceof K){if(e.loose===i)return e;else e=e.version}else if(typeof e!=="string"){throw new TypeError("Invalid Version: "+e)}if(e.length>r)throw new TypeError("version is longer than "+r+" characters");if(!(this instanceof K))return new K(e,i);this.loose=i;var s=e.trim().match(i?n[j]:n[w]);if(!s)throw new TypeError("Invalid Version: "+e);this.raw=e;this.major=+s[1];this.minor=+s[2];this.patch=+s[3];if(this.major>t||this.major<0)throw new TypeError("Invalid major version");if(this.minor>t||this.minor<0)throw new TypeError("Invalid minor version");if(this.patch>t||this.patch<0)throw new TypeError("Invalid patch version");if(!s[4])this.prerelease=[];else this.prerelease=s[4].split(".").map(function(e){return/^[0-9]+$/.test(e)?+e:e});this.build=s[5]?s[5].split("."):[];this.format()}K.prototype.format=function(){this.version=this.major+"."+this.minor+"."+this.patch;if(this.prerelease.length)this.version+="-"+this.prerelease.join(".");return this.version};K.prototype.inspect=function(){return'<SemVer "'+this+'">'};K.prototype.toString=function(){return this.version};K.prototype.compare=function(e){if(!(e instanceof K))e=new K(e,this.loose);return this.compareMain(e)||this.comparePre(e)};K.prototype.compareMain=function(e){if(!(e instanceof K))e=new K(e,this.loose);return Y(this.major,e.major)||Y(this.minor,e.minor)||Y(this.patch,e.patch)};K.prototype.comparePre=function(e){if(!(e instanceof K))e=new K(e,this.loose);if(this.prerelease.length&&!e.prerelease.length)return-1;else if(!this.prerelease.length&&e.prerelease.length)return 1;else if(!this.prerelease.length&&!e.prerelease.length)return 0;var r=0;do{var t=this.prerelease[r];var n=e.prerelease[r];if(t===undefined&&n===undefined)return 0;else if(n===undefined)return 1;else if(t===undefined)return-1;else if(t===n)continue;else return Y(t,n)}while(++r)};K.prototype.inc=function(e,r){switch(e){case"premajor":this.prerelease.length=0;this.patch=0;this.minor=0;this.major++;this.inc("pre",r);break;case"preminor":this.prerelease.length=0;this.patch=0;this.minor++;this.inc("pre",r);break;case"prepatch":this.prerelease.length=0;this.inc("patch",r);this.inc("pre",r);break;case"prerelease":if(this.prerelease.length===0)this.inc("patch",r);this.inc("pre",r);break;case"major":if(this.minor!==0||this.patch!==0||this.prerelease.length===0)this.major++;this.minor=0;this.patch=0;this.prerelease=[];break;case"minor":if(this.patch!==0||this.prerelease.length===0)this.minor++;this.patch=0;this.prerelease=[];break;case"patch":if(this.prerelease.length===0)this.patch++;this.prerelease=[];break;case"pre":if(this.prerelease.length===0)this.prerelease=[0];else{var t=this.prerelease.length;while(--t>=0){if(typeof this.prerelease[t]==="number"){this.prerelease[t]++;t=-2}}if(t===-1)this.prerelease.push(0)}if(r){if(this.prerelease[0]===r){if(isNaN(this.prerelease[1]))this.prerelease=[r,0]}else this.prerelease=[r,0]}break;default:throw new Error("invalid increment argument: "+e)}this.format();return this};e.inc=Q;function Q(e,r,t,n){if(typeof t==="string"){n=t;t=undefined}try{return new K(e,t).inc(r,n).version}catch(i){return null}}e.diff=U;function U(e,r){if(hr(e,r)){return null}else{var t=D(e);var n=D(r);if(t.prerelease.length||n.prerelease.length){for(var i in t){if(i==="major"||i==="minor"||i==="patch"){if(t[i]!==n[i]){return"pre"+i}}}return"prerelease"}for(var i in t){if(i==="major"||i==="minor"||i==="patch"){if(t[i]!==n[i]){return i}}}}}e.compareIdentifiers=Y;var W=/^[0-9]+$/;function Y(e,r){var t=W.test(e);var n=W.test(r);if(t&&n){e=+e;r=+r}return t&&!n?-1:n&&!t?1:e<r?-1:e>r?1:0}e.rcompareIdentifiers=er;function er(e,r){return Y(r,e)}e.major=rr;function rr(e,r){return new K(e,r).major}e.minor=tr;function tr(e,r){return new K(e,r).minor}e.patch=nr;function nr(e,r){return new K(e,r).patch}e.compare=ir;function ir(e,r,t){return new K(e,t).compare(r)}e.compareLoose=sr;function sr(e,r){return ir(e,r,true)}e.rcompare=or;function or(e,r,t){return ir(r,e,t)}e.sort=ar;function ar(r,t){return r.sort(function(r,n){return e.compare(r,n,t)})}e.rsort=fr;function fr(r,t){return r.sort(function(r,n){return e.rcompare(r,n,t)})}e.gt=ur;function ur(e,r,t){return ir(e,r,t)>0}e.lt=lr;function lr(e,r,t){return ir(e,r,t)<0}e.eq=hr;function hr(e,r,t){return ir(e,r,t)===0}e.neq=pr;function pr(e,r,t){return ir(e,r,t)!==0}e.gte=cr;function cr(e,r,t){return ir(e,r,t)>=0}e.lte=vr;function vr(e,r,t){return ir(e,r,t)<=0}e.cmp=mr;function mr(e,r,t,n){var i;switch(r){case"===":if(typeof e==="object")e=e.version;if(typeof t==="object")t=t.version;i=e===t;break;case"!==":if(typeof e==="object")e=e.version;if(typeof t==="object")t=t.version;i=e!==t;break;case"":case"=":case"==":i=hr(e,t,n);break;case"!=":i=pr(e,t,n);break;case">":i=ur(e,t,n);break;case">=":i=cr(e,t,n);break;case"<":i=lr(e,t,n);break;case"<=":i=vr(e,t,n);break;default:throw new TypeError("Invalid operator: "+r)}return i}e.Comparator=gr;function gr(e,r){if(e instanceof gr){if(e.loose===r)return e;else e=e.value}if(!(this instanceof gr))return new gr(e,r);this.loose=r;this.parse(e);if(this.semver===wr)this.value="";else this.value=this.operator+this.semver.version}var wr={};gr.prototype.parse=function(e){var r=this.loose?n[X]:n[Z];var t=e.match(r);if(!t)throw new TypeError("Invalid comparator: "+e);this.operator=t[1];if(this.operator==="=")this.operator="";if(!t[2])this.semver=wr;else this.semver=new K(t[2],this.loose)};gr.prototype.inspect=function(){return'<SemVer Comparator "'+this+'">'};gr.prototype.toString=function(){return this.value};gr.prototype.test=function(e){if(this.semver===wr)return true;if(typeof e==="string")e=new K(e,this.loose);return mr(e,this.operator,this.semver,this.loose)};e.Range=yr;function yr(e,r){if(e instanceof yr&&e.loose===r)return e;if(!(this instanceof yr))return new yr(e,r);this.loose=r;this.raw=e;this.set=e.split(/\s*\|\|\s*/).map(function(e){return this.parseRange(e.trim())},this).filter(function(e){return e.length});if(!this.set.length){throw new TypeError("Invalid SemVer Range: "+e)}this.format()}yr.prototype.inspect=function(){return'<SemVer Range "'+this.range+'">'};yr.prototype.format=function(){this.range=this.set.map(function(e){return e.join(" ").trim()}).join("||").trim();return this.range};yr.prototype.toString=function(){return this.range};yr.prototype.parseRange=function(e){var r=this.loose;e=e.trim();var t=r?n[G]:n[F];e=e.replace(t,Tr);e=e.replace(n[q],L);e=e.replace(n[T],V);e=e.replace(n[N],_);e=e.split(/\s+/).join(" ");var i=r?n[X]:n[Z];var s=e.split(" ").map(function(e){return jr(e,r)}).join(" ").split(/\s+/);if(this.loose){s=s.filter(function(e){return!!e.match(i)})}s=s.map(function(e){return new gr(e,r)});return s};e.toComparators=dr;function dr(e,r){return new yr(e,r).set.map(function(e){return e.map(function(e){return e.value}).join(" ").trim().split(" ")})}function jr(e,r){e=kr(e,r);e=Er(e,r);e=Sr(e,r);e=Ir(e,r);return e}function br(e){return!e||e.toLowerCase()==="x"||e==="*"}function Er(e,r){return e.trim().split(/\s+/).map(function(e){return $r(e,r)}).join(" ")}function $r(e,r){var t=r?n[C]:n[A];return e.replace(t,function(e,r,t,n,i){var s;if(br(r))s="";else if(br(t))s=">="+r+".0.0 <"+(+r+1)+".0.0";else if(br(n))s=">="+r+"."+t+".0 <"+r+"."+(+t+1)+".0";else if(i){if(i.charAt(0)!=="-")i="-"+i;s=">="+r+"."+t+"."+n+i+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+" <"+r+"."+(+t+1)+".0";return s})}function kr(e,r){return e.trim().split(/\s+/).map(function(e){return Rr(e,r)}).join(" ")}function Rr(e,r){var t=r?n[P]:n[z];return e.replace(t,function(e,r,t,n,i){var s;if(br(r))s="";else if(br(t))s=">="+r+".0.0 <"+(+r+1)+".0.0";else if(br(n)){if(r==="0")s=">="+r+"."+t+".0 <"+r+"."+(+t+1)+".0";else s=">="+r+"."+t+".0 <"+(+r+1)+".0.0"}else if(i){if(i.charAt(0)!=="-")i="-"+i;if(r==="0"){if(t==="0")s=">="+r+"."+t+"."+n+i+" <"+r+"."+t+"."+(+n+1);else s=">="+r+"."+t+"."+n+i+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+i+" <"+(+r+1)+".0.0"}else{if(r==="0"){if(t==="0")s=">="+r+"."+t+"."+n+" <"+r+"."+t+"."+(+n+1);else s=">="+r+"."+t+"."+n+" <"+r+"."+(+t+1)+".0"}else s=">="+r+"."+t+"."+n+" <"+(+r+1)+".0.0"}return s})}function Sr(e,r){return e.split(/\s+/).map(function(e){return xr(e,r)}).join(" ")}function xr(e,r){e=e.trim();var t=r?n[x]:n[S];return e.replace(t,function(e,r,t,n,i,s){var o=br(t);var a=o||br(n);var f=a||br(i);var u=f;if(r==="="&&u)r="";if(o){if(r===">"||r==="<"){e="<0.0.0"}else{e="*"}}else if(r&&u){if(a)n=0;if(f)i=0;if(r===">"){r=">=";if(a){t=+t+1;n=0;i=0}else if(f){n=+n+1;i=0}}else if(r==="<="){r="<";if(a)t=+t+1;else n=+n+1}e=r+t+"."+n+"."+i}else if(a){e=">="+t+".0.0 <"+(+t+1)+".0.0"}else if(f){e=">="+t+"."+n+".0 <"+t+"."+(+n+1)+".0"}return e})}function Ir(e,r){return e.trim().replace(n[O],"")}function Tr(e,r,t,n,i,s,o,a,f,u,l,h,p){if(br(t))r="";else if(br(n))r=">="+t+".0.0";else if(br(i))r=">="+t+"."+n+".0";else r=">="+r;if(br(f))a="";else if(br(u))a="<"+(+f+1)+".0.0";else if(br(l))a="<"+f+"."+(+u+1)+".0";else if(h)a="<="+f+"."+u+"."+l+"-"+h;else a="<="+a;return(r+" "+a).trim()}yr.prototype.test=function(e){if(!e)return false;if(typeof e==="string")e=new K(e,this.loose);for(var r=0;r<this.set.length;r++){if(Vr(this.set[r],e))return true}return false};function Vr(e,r){for(var t=0;t<e.length;t++){if(!e[t].test(r))return false}if(r.prerelease.length){for(var t=0;t<e.length;t++){if(e[t].semver===wr)return true;if(e[t].semver.prerelease.length>0){var n=e[t].semver;if(n.major===r.major&&n.minor===r.minor&&n.patch===r.patch)return true}}return false}return true}e.satisfies=Ar;function Ar(e,r,t){try{r=new yr(r,t)}catch(n){return false}return r.test(e)}e.maxSatisfying=Cr;function Cr(e,r,t){return e.filter(function(e){return Ar(e,r,t)}).sort(function(e,r){return or(e,r,t)})[0]||null}e.validRange=Mr;function Mr(e,r){try{return new yr(e,r).range||"*"}catch(t){return null}}e.ltr=Nr;function Nr(e,r,t){return zr(e,r,"<",t)}e.gtr=_r;function _r(e,r,t){return zr(e,r,">",t)}e.outside=zr;function zr(e,r,t,n){e=new K(e,n);r=new yr(r,n);var i,s,o,a,f;switch(t){case">":i=ur;s=vr;o=lr;a=">";f=">=";break;case"<":i=lr;s=cr;o=ur;a="<";f="<=";break;default:throw new TypeError('Must provide a hilo val of "<" or ">"')}if(Ar(e,r,n)){return false}for(var u=0;u<r.set.length;++u){var l=r.set[u];var h=null;var p=null;l.forEach(function(e){h=h||e;p=p||e;if(i(e.semver,h.semver,n)){h=e}else if(o(e.semver,p.semver,n)){p=e}});if(h.operator===a||h.operator===f){return false}if((!p.operator||p.operator===a)&&s(e,p.semver)){return false}else if(p.operator===f&&o(e,p.semver)){return false}}return true}if(typeof define==="function"&&define.amd)define(e)})(typeof exports==="object"?exports:typeof define==="function"&&define.amd?{}:semver={}); \ No newline at end of file
diff --git a/deps/npm/node_modules/semver/semver.min.js.gz b/deps/npm/node_modules/semver/semver.min.js.gz
index 966dc9404b..fbe42dd593 100644
--- a/deps/npm/node_modules/semver/semver.min.js.gz
+++ b/deps/npm/node_modules/semver/semver.min.js.gz
Binary files differ
diff --git a/deps/npm/node_modules/semver/test/big-numbers.js b/deps/npm/node_modules/semver/test/big-numbers.js
new file mode 100644
index 0000000000..692aa24146
--- /dev/null
+++ b/deps/npm/node_modules/semver/test/big-numbers.js
@@ -0,0 +1,24 @@
+var test = require('tap').test
+var semver = require('../')
+
+test('long version is too long', function (t) {
+ var v = '1.2.' + new Array(256).join('1')
+ t.throws(function () {
+ new semver.SemVer(v)
+ })
+ t.equal(semver.valid(v, false), null)
+ t.equal(semver.valid(v, true), null)
+ t.equal(semver.inc(v, 'patch'), null)
+ t.end()
+})
+
+test('big number is like too long version', function (t) {
+ var v = '1.2.' + new Array(100).join('1')
+ t.throws(function () {
+ new semver.SemVer(v)
+ })
+ t.equal(semver.valid(v, false), null)
+ t.equal(semver.valid(v, true), null)
+ t.equal(semver.inc(v, 'patch'), null)
+ t.end()
+})
diff --git a/deps/npm/node_modules/tar/lib/extract.js b/deps/npm/node_modules/tar/lib/extract.js
index 9fb1e6fb1b..ca82a65ce9 100644
--- a/deps/npm/node_modules/tar/lib/extract.js
+++ b/deps/npm/node_modules/tar/lib/extract.js
@@ -11,16 +11,13 @@ function Extract (opts) {
if (!(this instanceof Extract)) return new Extract(opts)
tar.Parse.apply(this)
- // have to dump into a directory
- opts.type = "Directory"
- opts.Directory = true
-
if (typeof opts !== "object") {
opts = { path: opts }
}
// better to drop in cwd? seems more standard.
opts.path = opts.path || path.resolve("node-tar-extract")
+ // have to dump into a directory
opts.type = "Directory"
opts.Directory = true
@@ -47,9 +44,20 @@ function Extract (opts) {
entry.linkpath = entry.props.linkpath = lp
}
}
- if (entry.type !== "Link") return
- entry.linkpath = entry.props.linkpath =
- path.join(opts.path, path.join("/", entry.props.linkpath))
+
+ if (entry.type === "Link") {
+ entry.linkpath = entry.props.linkpath = path.join(
+ opts.path, path.join("/", entry.props.linkpath)
+ )
+ }
+
+ if (entry.props && entry.props.linkpath) {
+ var linkpath = entry.props.linkpath
+ // normalize paths that point outside the extraction root
+ if (path.resolve(opts.path, linkpath).indexOf(opts.path) !== 0) {
+ entry.props.linkpath = path.join(opts.path, path.join("/", linkpath))
+ }
+ }
})
this._fst.on("ready", function () {
@@ -71,6 +79,7 @@ function Extract (opts) {
this._fst.on("close", function () {
// console.error("\nEEEE Extract End", me._fst.path)
+ me.emit("finish")
me.emit("end")
me.emit("close")
})
diff --git a/deps/npm/node_modules/tar/package.json b/deps/npm/node_modules/tar/package.json
index b4a1209921..2387a15fb8 100644
--- a/deps/npm/node_modules/tar/package.json
+++ b/deps/npm/node_modules/tar/package.json
@@ -6,7 +6,7 @@
},
"name": "tar",
"description": "tar for node",
- "version": "1.0.3",
+ "version": "2.0.0",
"repository": {
"type": "git",
"url": "git://github.com/isaacs/node-tar.git"
@@ -29,12 +29,12 @@
"license": "BSD",
"readme": "# node-tar\n\nTar for Node.js.\n\n[![NPM](https://nodei.co/npm/tar.png)](https://nodei.co/npm/tar/)\n\n## API\n\nSee `examples/` for usage examples.\n\n### var tar = require('tar')\n\nReturns an object with `.Pack`, `.Extract` and `.Parse` methods.\n\n### tar.Pack([properties])\n\nReturns a through stream. Use\n[fstream](https://npmjs.org/package/fstream) to write files into the\npack stream and you will receive tar archive data from the pack\nstream.\n\nThis only works with directories, it does not work with individual files.\n\nThe optional `properties` object are used to set properties in the tar\n'Global Extended Header'.\n\n### tar.Extract([options])\n\nReturns a through stream. Write tar data to the stream and the files\nin the tarball will be extracted onto the filesystem.\n\n`options` can be:\n\n```js\n{\n path: '/path/to/extract/tar/into',\n strip: 0, // how many path segments to strip from the root when extracting\n}\n```\n\n`options` also get passed to the `fstream.Writer` instance that `tar`\nuses internally.\n\n### tar.Parse()\n\nReturns a writable stream. Write tar data to it and it will emit\n`entry` events for each entry parsed from the tarball. This is used by\n`tar.Extract`.\n",
"readmeFilename": "README.md",
- "gitHead": "f4151128c585da236c6b1e278b762ecaedc20c15",
+ "gitHead": "9bde260b9ebe6808837a85bedf9c6f7bb04e004f",
"bugs": {
"url": "https://github.com/isaacs/node-tar/issues"
},
"homepage": "https://github.com/isaacs/node-tar",
- "_id": "tar@1.0.3",
- "_shasum": "15bcdab244fa4add44e4244a0176edb8aa9a2b44",
- "_from": "tar@>=1.0.3 <1.1.0"
+ "_id": "tar@2.0.0",
+ "_shasum": "7cf627bc632167766ce2a5a1f23e4ecb8e3f28bc",
+ "_from": "tar@>=2.0.0 <2.1.0"
}
diff --git a/deps/npm/node_modules/tar/test/dir-normalization.js b/deps/npm/node_modules/tar/test/dir-normalization.js
new file mode 100644
index 0000000000..cdaa55353d
--- /dev/null
+++ b/deps/npm/node_modules/tar/test/dir-normalization.js
@@ -0,0 +1,141 @@
+// Set the umask, so that it works the same everywhere.
+process.umask(parseInt('22', 8))
+
+var fs = require('fs')
+var path = require('path')
+
+var fstream = require('fstream')
+var test = require('tap').test
+
+var tar = require('../tar.js')
+var file = path.resolve(__dirname, 'dir-normalization.tar')
+var target = path.resolve(__dirname, 'tmp/dir-normalization-test')
+var ee = 0
+
+var expectEntries = [
+ { path: 'fixtures/',
+ mode: '755',
+ type: '5',
+ depth: undefined,
+ size: 0,
+ linkpath: '',
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined
+ },
+ { path: 'fixtures/the-chumbler',
+ mode: '755',
+ type: '2',
+ depth: undefined,
+ size: 0,
+ linkpath: path.resolve(target, 'a/b/c/d/the-chumbler'),
+ nlink: undefined,
+ dev: undefined,
+ ino: undefined
+ }
+]
+
+var ef = 0
+var expectFiles = [
+ { path: '',
+ mode: '40755',
+ type: 'Directory',
+ depth: 0,
+ linkpath: undefined
+ },
+ { path: '/fixtures',
+ mode: '40755',
+ type: 'Directory',
+ depth: 1,
+ linkpath: undefined
+ },
+ { path: '/fixtures/the-chumbler',
+ mode: '120755',
+ type: 'SymbolicLink',
+ depth: 2,
+ size: 95,
+ linkpath: path.resolve(target, 'a/b/c/d/the-chumbler'),
+ nlink: 1
+ }
+]
+
+test('preclean', function (t) {
+ require('rimraf').sync(path.join(__dirname, '/tmp/dir-normalization-test'))
+ t.pass('cleaned!')
+ t.end()
+})
+
+test('extract test', function (t) {
+ var extract = tar.Extract(target)
+ var inp = fs.createReadStream(file)
+
+ inp.pipe(extract)
+
+ extract.on('end', function () {
+ t.equal(ee, expectEntries.length, 'should see ' + expectEntries.length + ' entries')
+
+ // should get no more entries after end
+ extract.removeAllListeners('entry')
+ extract.on('entry', function (e) {
+ t.fail('Should not get entries after end!')
+ })
+
+ next()
+ })
+
+ extract.on('entry', function (entry) {
+ var found = {
+ path: entry.path,
+ mode: entry.props.mode.toString(8),
+ type: entry.props.type,
+ depth: entry.props.depth,
+ size: entry.props.size,
+ linkpath: entry.props.linkpath,
+ nlink: entry.props.nlink,
+ dev: entry.props.dev,
+ ino: entry.props.ino
+ }
+
+ var wanted = expectEntries[ee++]
+
+ t.equivalent(found, wanted, 'tar entry ' + ee + ' ' + wanted.path)
+ })
+
+ function next () {
+ var r = fstream.Reader({
+ path: target,
+ type: 'Directory',
+ sort: 'alpha'
+ })
+
+ r.on('ready', function () {
+ foundEntry(r)
+ })
+
+ r.on('end', finish)
+
+ function foundEntry (entry) {
+ var p = entry.path.substr(target.length)
+ var found = {
+ path: p,
+ mode: entry.props.mode.toString(8),
+ type: entry.props.type,
+ depth: entry.props.depth,
+ size: entry.props.size,
+ linkpath: entry.props.linkpath,
+ nlink: entry.props.nlink
+ }
+
+ var wanted = expectFiles[ef++]
+
+ t.has(found, wanted, 'unpacked file ' + ef + ' ' + wanted.path)
+
+ entry.on('entry', foundEntry)
+ }
+
+ function finish () {
+ t.equal(ef, expectFiles.length, 'should have ' + ef + ' items')
+ t.end()
+ }
+ }
+})
diff --git a/deps/npm/node_modules/tar/test/dir-normalization.tar b/deps/npm/node_modules/tar/test/dir-normalization.tar
new file mode 100644
index 0000000000..d11d4eb8d7
--- /dev/null
+++ b/deps/npm/node_modules/tar/test/dir-normalization.tar
Binary files differ
diff --git a/deps/npm/package.json b/deps/npm/package.json
index 0a75480c7a..676e656721 100644
--- a/deps/npm/package.json
+++ b/deps/npm/package.json
@@ -1,5 +1,5 @@
{
- "version": "2.7.4",
+ "version": "2.7.5",
"name": "npm",
"description": "a package manager for JavaScript",
"keywords": [
@@ -75,7 +75,7 @@
"npm-user-validate": "~0.1.1",
"npmlog": "~1.2.0",
"once": "~1.3.1",
- "opener": "~1.4.0",
+ "opener": "~1.4.1",
"osenv": "~0.1.0",
"path-is-inside": "~1.0.0",
"read": "~1.0.4",
@@ -83,14 +83,14 @@
"read-package-json": "~1.3.2",
"readable-stream": "~1.0.33",
"realize-package-specifier": "~2.2.0",
- "request": "~2.53.0",
+ "request": "~2.54.0",
"retry": "~0.6.1",
"rimraf": "~2.3.2",
- "semver": "~4.3.1",
+ "semver": "~4.3.2",
"sha": "~1.3.0",
"slide": "~1.1.6",
"sorted-object": "~1.0.0",
- "tar": "~1.0.3",
+ "tar": "~2.0.0",
"text-table": "~0.2.0",
"uid-number": "0.0.6",
"umask": "~1.1.0",
@@ -172,7 +172,7 @@
"nock": "~1.2.0",
"npm-registry-couchapp": "~2.6.7",
"npm-registry-mock": "~1.0.0",
- "require-inject": "~1.1.0",
+ "require-inject": "~1.2.0",
"sprintf-js": "~1.0.2",
"tap": "~0.7.1"
},
diff --git a/deps/npm/scripts/doc-build.sh b/deps/npm/scripts/doc-build.sh
index 79629c63dc..6a5c7aa70f 100755
--- a/deps/npm/scripts/doc-build.sh
+++ b/deps/npm/scripts/doc-build.sh
@@ -61,7 +61,7 @@ fi
src=$1
dest=$2
name=$(basename ${src%.*})
-date=$(date -u +'%Y-%M-%d %H:%m:%S')
+date=$(date -u +'%Y-%m-%d %H:%M:%S')
version=$(node cli.js -v)
mkdir -p $(dirname $dest)
diff --git a/deps/npm/test/tap/config-new-cafile.js b/deps/npm/test/tap/config-new-cafile.js
new file mode 100644
index 0000000000..9cffb19008
--- /dev/null
+++ b/deps/npm/test/tap/config-new-cafile.js
@@ -0,0 +1,56 @@
+require('./00-config-setup.js')
+
+var path = require('path')
+var fs = require('graceful-fs')
+var test = require('tap').test
+var mkdirp = require('mkdirp')
+var rimraf = require('rimraf')
+var osenv = require('osenv')
+var npmconf = require('../../lib/config/core.js')
+
+var dir = path.resolve(__dirname, 'config-new-cafile')
+var beep = path.resolve(dir, 'beep.pem')
+
+test('setup', function (t) {
+ bootstrap()
+ t.end()
+})
+
+test('can set new cafile when old is gone', function (t) {
+ t.plan(5)
+ npmconf.load(function (error, conf) {
+ npmconf.loaded = false
+ t.ifError(error)
+ conf.set('cafile', beep, 'user')
+ conf.save('user', function (error) {
+ t.ifError(error)
+ t.equal(conf.get('cafile'), beep)
+ rimraf.sync(beep)
+ npmconf.load(function (error, conf) {
+ if (error) {
+ throw error
+ }
+ t.equal(conf.get('cafile'), beep)
+ conf.del('cafile')
+ conf.save('user', function (error) {
+ t.ifError(error)
+ })
+ })
+ })
+ })
+})
+
+test('cleanup', function (t) {
+ cleanup()
+ t.end()
+})
+
+function bootstrap () {
+ mkdirp.sync(dir)
+ fs.writeFileSync(beep, '')
+}
+
+function cleanup () {
+ process.chdir(osenv.tmpdir())
+ rimraf.sync(dir)
+}
diff --git a/deps/npm/test/tap/github-shortcut.js b/deps/npm/test/tap/github-shortcut.js
new file mode 100644
index 0000000000..accc16f397
--- /dev/null
+++ b/deps/npm/test/tap/github-shortcut.js
@@ -0,0 +1,32 @@
+'use strict'
+var requireInject = require('require-inject')
+var test = require('tap').test
+
+test('github-shortcut', function (t) {
+ var cloneUrls = [
+ ['git://github.com/foo/private.git', 'github shortcuts try git:// first'],
+ ['ssh://git@github.com/foo/private.git', 'github shortcuts try ssh:// urls second']
+ ]
+ var npm = requireInject.installGlobally('../../lib/npm.js', {
+ 'child_process': {
+ 'execFile': function (cmd, args, options, cb) {
+ process.nextTick(function () {
+ if (args[0] !== 'clone') return cb(null, '', '')
+ var cloneUrl = cloneUrls.shift()
+ if (cloneUrl) {
+ t.is(args[3], cloneUrl[0], cloneUrl[1])
+ } else {
+ t.fail('too many attempts to clone')
+ }
+ cb(new Error())
+ })
+ }
+ }
+ })
+
+ npm.load({loglevel: 'silent'}, function () {
+ npm.commands.install(['foo/private'], function (er, result) {
+ t.end()
+ })
+ })
+})
diff --git a/deps/npm/test/tap/link.js b/deps/npm/test/tap/link.js
new file mode 100644
index 0000000000..6562e35fd3
--- /dev/null
+++ b/deps/npm/test/tap/link.js
@@ -0,0 +1,119 @@
+var mkdirp = require('mkdirp')
+var osenv = require('osenv')
+var path = require('path')
+var rimraf = require('rimraf')
+var test = require('tap').test
+var writeFileSync = require('fs').writeFileSync
+
+var common = require('../common-tap.js')
+
+var link = path.join(__dirname, 'link')
+var linkInstall = path.join(__dirname, 'link-install')
+var linkRoot = path.join(__dirname, 'link-root')
+
+var config = 'prefix = ' + linkRoot
+var configPath = path.join(link, '_npmrc')
+
+var OPTS = {
+ env: {
+ 'npm_config_userconfig': configPath
+ }
+}
+
+test('setup', function (t) {
+ setup()
+ common.npm(['ls', '-g', '--depth=0'], OPTS, function (err, c, out) {
+ t.ifError(err)
+ t.equal(c, 0, 'set up ok')
+ t.notOk(out.match(/UNMET DEPENDENCY foo@/), "foo isn't in global")
+ t.end()
+ })
+})
+
+test('creates global link', function (t) {
+ process.chdir(link)
+ common.npm(['link'], OPTS, function (err, c, out) {
+ t.ifError(err, 'link has no error')
+ common.npm(['ls', '-g'], OPTS, function (err, c, out, stderr) {
+ t.ifError(err)
+ t.equal(c, 0)
+ t.equal(stderr, '', 'got expected stderr')
+ t.has(out, /foo@1.0.0/, 'creates global link ok')
+ t.end()
+ })
+ })
+})
+
+test('link-install the package', function (t) {
+ process.chdir(linkInstall)
+ common.npm(['link', 'foo'], OPTS, function (err) {
+ t.ifError(err, 'link-install has no error')
+ common.npm(['ls'], OPTS, function (err, c, out) {
+ t.ifError(err)
+ t.equal(c, 1)
+ t.has(out, /foo@1.0.0/, 'link-install ok')
+ t.end()
+ })
+ })
+})
+
+test('cleanup', function (t) {
+ process.chdir(osenv.tmpdir())
+ common.npm(['rm', 'foo'], OPTS, function (err, code) {
+ t.ifError(err, 'npm removed the linked package without error')
+ t.equal(code, 0, 'cleanup foo in local ok')
+ common.npm(['rm', '-g', 'foo'], OPTS, function (err, code) {
+ t.ifError(err, 'npm removed the global package without error')
+ t.equal(code, 0, 'cleanup foo in global ok')
+
+ cleanup()
+ t.end()
+ })
+ })
+})
+
+var readJSON = {
+ name: 'foo',
+ version: '1.0.0',
+ description: '',
+ main: 'index.js',
+ scripts: {
+ test: 'echo \"Error: no test specified\" && exit 1'
+ },
+ author: '',
+ license: 'ISC'
+}
+
+var installJSON = {
+ name: 'bar',
+ version: '1.0.0',
+ description: '',
+ main: 'index.js',
+ scripts: {
+ test: 'echo \"Error: no test specified\" && exit 1'
+ },
+ author: '',
+ license: 'ISC'
+}
+
+function cleanup () {
+ rimraf.sync(linkRoot)
+ rimraf.sync(link)
+ rimraf.sync(linkInstall)
+}
+
+function setup () {
+ cleanup()
+ mkdirp.sync(linkRoot)
+ mkdirp.sync(link)
+ writeFileSync(
+ path.join(link, 'package.json'),
+ JSON.stringify(readJSON, null, 2)
+ )
+ mkdirp.sync(linkInstall)
+ writeFileSync(
+ path.join(linkInstall, 'package.json'),
+ JSON.stringify(installJSON, null, 2)
+ )
+ writeFileSync(configPath, config)
+}
diff --git a/deps/npm/test/tap/update-index.js b/deps/npm/test/tap/update-index.js
index cf305900c7..0586269722 100644
--- a/deps/npm/test/tap/update-index.js
+++ b/deps/npm/test/tap/update-index.js
@@ -1,23 +1,28 @@
-var common = require("../common-tap.js")
-var test = require("tap").test
-var npm = require("../../")
-var mkdirp = require("mkdirp")
-var rimraf = require("rimraf")
-var path = require("path")
-var mr = require("npm-registry-mock")
+var common = require('../common-tap.js')
+var test = require('tap').test
+var npm = require('../../')
+var mkdirp = require('mkdirp')
+var rimraf = require('rimraf')
+var path = require('path')
+var mr = require('npm-registry-mock')
-var updateIndex = require("../../lib/cache/update-index.js")
+var updateIndex = require('../../lib/cache/update-index.js')
-var PKG_DIR = path.resolve(__dirname, "get-basic")
-var CACHE_DIR = path.resolve(PKG_DIR, "cache")
+var PKG_DIR = path.resolve(__dirname, 'get-basic')
+var CACHE_DIR = path.resolve(PKG_DIR, 'cache')
var server
-function setup (t, mock) {
+function setup (t, mock, extra) {
mkdirp.sync(CACHE_DIR)
mr({ port: common.port, plugin: mock }, function (er, s) {
npm.load({ cache: CACHE_DIR, registry: common.registry }, function (err) {
- t.ifError(err, "no error")
+ if (extra) {
+ Object.keys(extra).forEach(function (k) {
+ npm.config.set(k, extra[k], 'user')
+ })
+ }
+ t.ifError(err, 'no error')
server = s
t.end()
})
@@ -32,158 +37,159 @@ function cleanup (t) {
})
}
-test("setup basic", function (t) {
+test('setup basic', function (t) {
setup(t, mocks.basic)
})
-test("request basic", function (t) {
- updateIndex("http://localhost:1337/-/all", {}, function (er) {
- t.ifError(er, "no error")
+test('request basic', function (t) {
+ updateIndex(0, function (er) {
+ t.ifError(er, 'no error')
t.end()
})
})
-test("cleanup basic", cleanup)
+test('cleanup basic', cleanup)
-test("setup auth", function (t) {
+test('setup auth', function (t) {
setup(t, mocks.auth)
})
-test("request auth failure", function (t) {
- updateIndex("http://localhost:1337/-/all", {}, function (er) {
- t.ok(er.code, "E401")
- t.ok(/^unauthorized/.test(er.message), "unauthorized message")
+test('request auth failure', function (t) {
+ updateIndex(0, function (er) {
+ t.equals(er.code, 'E401', 'gotta get that auth')
+ t.ok(/^unauthorized/.test(er.message), 'unauthorized message')
t.end()
})
})
-test("request auth success", function (t) {
+test('cleanup auth failure', cleanup)
+
+test('setup auth', function (t) {
// mimic as if alwaysAuth had been set
- var params = {
- auth: {
- username: "bobby",
- password: "tables",
- alwaysAuth: true
- }
- }
+ setup(t, mocks.auth, {
+ _auth: new Buffer('bobby:tables').toString('base64'),
+ 'always-auth': true
+ })
+})
- updateIndex("http://localhost:1337/-/all", params, function (er) {
- t.ifError(er, "no error")
+test('request auth success', function (t) {
+ updateIndex(0, function (er) {
+ t.ifError(er, 'no error')
t.end()
})
})
-test("cleanup auth", cleanup)
+test('cleanup auth', cleanup)
var mocks = {
basic: function (mock) {
- mock.get("/-/all").reply(200, allMock)
+ mock.get('/-/all').reply(200, allMock)
},
auth: function (mock) {
- var littleBobbyTablesAuth = new Buffer("bobby:tables").toString("base64")
- var auth = "Basic " + littleBobbyTablesAuth
- mock.get("/-/all", { authorization: auth }).reply(200, allMock)
- mock.get("/-/all").reply(401, {
- error: "unauthorized",
- reason: "You are not authorized to access this db."
+ var littleBobbyTablesAuth = new Buffer('bobby:tables').toString('base64')
+ var auth = 'Basic ' + littleBobbyTablesAuth
+ mock.get('/-/all', { authorization: auth }).reply(200, allMock)
+ mock.get('/-/all').reply(401, {
+ error: 'unauthorized',
+ reason: 'You are not authorized to access this db.'
})
}
}
var allMock = {
- "_updated": 1411727900+25,
- "generator-frontcow": {
- "name": "generator-frontcow",
- "description": "f36b6a6123da50959741e2ce4d634f96ec668c56 This is a fake description to ensure we do not accidentally search the real npm registry or use some kind of cache",
- "dist-tags": {
- "latest": "0.1.19"
+ '_updated': 1411727900 + 25,
+ 'generator-frontcow': {
+ 'name': 'generator-frontcow',
+ 'description': 'f36b6a6123da50959741e2ce4d634f96ec668c56 This is a fake description to ensure we do not accidentally search the real npm registry or use some kind of cache',
+ 'dist-tags': {
+ 'latest': '0.1.19'
},
- "maintainers": [
+ 'maintainers': [
{
- "name": "bcabanes",
- "email": "contact@benjamincabanes.com"
+ 'name': 'bcabanes',
+ 'email': 'contact@benjamincabanes.com'
}
],
- "homepage": "https://github.com/bcabanes/generator-frontcow",
- "keywords": [
- "sass",
- "frontend",
- "yeoman-generator",
- "atomic",
- "design",
- "sass",
- "foundation",
- "foundation5",
- "atomic design",
- "bourbon",
- "polyfill",
- "font awesome"
+ 'homepage': 'https://github.com/bcabanes/generator-frontcow',
+ 'keywords': [
+ 'sass',
+ 'frontend',
+ 'yeoman-generator',
+ 'atomic',
+ 'design',
+ 'sass',
+ 'foundation',
+ 'foundation5',
+ 'atomic design',
+ 'bourbon',
+ 'polyfill',
+ 'font awesome'
],
- "repository": {
- "type": "git",
- "url": "https://github.com/bcabanes/generator-frontcow"
+ 'repository': {
+ 'type': 'git',
+ 'url': 'https://github.com/bcabanes/generator-frontcow'
},
- "author": {
- "name": "ben",
- "email": "contact@benjamincabanes.com",
- "url": "https://github.com/bcabanes"
+ 'author': {
+ 'name': 'ben',
+ 'email': 'contact@benjamincabanes.com',
+ 'url': 'https://github.com/bcabanes'
},
- "bugs": {
- "url": "https://github.com/bcabanes/generator-frontcow/issues"
+ 'bugs': {
+ 'url': 'https://github.com/bcabanes/generator-frontcow/issues'
},
- "license": "MIT",
- "readmeFilename": "README.md",
- "time": {
- "modified": "2014-10-03T02:26:18.406Z"
+ 'license': 'MIT',
+ 'readmeFilename': 'README.md',
+ 'time': {
+ 'modified': '2014-10-03T02:26:18.406Z'
},
- "versions": {
- "0.1.19": "latest"
+ 'versions': {
+ '0.1.19': 'latest'
}
},
- "marko": {
- "name": "marko",
- "description": "Marko is an extensible, streaming, asynchronous, high performance, HTML-based templating language that can be used in Node.js or in the browser.",
- "dist-tags": {
- "latest": "1.2.16"
+ 'marko': {
+ 'name': 'marko',
+ 'description': 'Marko is an extensible, streaming, asynchronous, high performance, HTML-based templating language that can be used in Node.js or in the browser.',
+ 'dist-tags': {
+ 'latest': '1.2.16'
},
- "maintainers": [
+ 'maintainers': [
{
- "name": "pnidem",
- "email": "pnidem@gmail.com"
+ 'name': 'pnidem',
+ 'email': 'pnidem@gmail.com'
},
{
- "name": "philidem",
- "email": "phillip.idem@gmail.com"
+ 'name': 'philidem',
+ 'email': 'phillip.idem@gmail.com'
}
],
- "homepage": "https://github.com/raptorjs/marko",
- "keywords": [
- "templating",
- "template",
- "async",
- "streaming"
+ 'homepage': 'https://github.com/raptorjs/marko',
+ 'keywords': [
+ 'templating',
+ 'template',
+ 'async',
+ 'streaming'
],
- "repository": {
- "type": "git",
- "url": "https://github.com/raptorjs/marko.git"
+ 'repository': {
+ 'type': 'git',
+ 'url': 'https://github.com/raptorjs/marko.git'
},
- "author": {
- "name": "Patrick Steele-Idem",
- "email": "pnidem@gmail.com"
+ 'author': {
+ 'name': 'Patrick Steele-Idem',
+ 'email': 'pnidem@gmail.com'
},
- "bugs": {
- "url": "https://github.com/raptorjs/marko/issues"
+ 'bugs': {
+ 'url': 'https://github.com/raptorjs/marko/issues'
},
- "license": "Apache License v2.0",
- "readmeFilename": "README.md",
- "users": {
- "pnidem": true
+ 'license': 'Apache License v2.0',
+ 'readmeFilename': 'README.md',
+ 'users': {
+ 'pnidem': true
},
- "time": {
- "modified": "2014-10-03T02:27:31.775Z"
+ 'time': {
+ 'modified': '2014-10-03T02:27:31.775Z'
},
- "versions": {
- "1.2.16": "latest"
+ 'versions': {
+ '1.2.16': 'latest'
}
}
}