summaryrefslogtreecommitdiff
path: root/ext/dba/dba.c
Commit message (Collapse)AuthorAgeFilesLines
* Add Berkeley db4 supportMarcus Boerger2002-11-261-0/+4
|
* Make magic_quotes_runtime work bidirectional for dbaMarcus Boerger2002-11-221-2/+15
|
* Add magic_quotes_runtime supportMarcus Boerger2002-11-141-0/+4
|
* Fix locking behaviour: On some systems read during write is permitted butMarcus Boerger2002-11-141-2/+43
| | | | | | most libraries are not capable of that. GDBM is system dependant so there we only test that we do not deadlock.
* Use php_flock instead of flockMarcus Boerger2002-11-111-2/+2
|
* -fix file open mode when modifier 'd' is usedMarcus Boerger2002-11-111-5/+9
| | | | | #Add my name to authors
* Emit a warning when open mode modifier t is used wrong.Marcus Boerger2002-11-101-1/+13
|
* -Centralise open stream for builtin modules that use streamsMarcus Boerger2002-11-101-20/+48
| | | | | -If locks work on database file then only one stream open call is used
* finish work on lockingMarcus Boerger2002-11-101-16/+42
| | | | | | | -all but gdbm do internal locking now since only gdbm has internal locking -you can force locking on database or lck file (with gdbm this makes no sense so a notice is generated)
* -lock support moved from dba_flatfile.c to dba.cMarcus Boerger2002-11-081-25/+72
| | | | | | | | | -flatfile, cdb, cdb_make use locking now #locking is blocking per default use 'rt', 'wt', ct' or 'nt' for non blocking alias #test access to a database file. #locking uses flock() which will be emulated or warned if that is not eally #possible in ext/standard/flock_compat.c
* emalloc never returns 0, so we can simplify the code paths.Sascha Schumann2002-11-061-2/+2
| | | | | also replace ecalloc with emalloc+memset, so that the latter can be inlined.
* Use the the name 'flatfile' correctly so the handler support can be built now.Marcus Boerger2002-11-061-0/+1
| | | | | | #I do not like the lock solution since a crashed php would leave the *lck #file locked now.
* move newly introduced flatfile support from dbm to new flatfile handlerMarcus Boerger2002-11-061-0/+3
| | | | | | # do not make the same mistake as with ext/db where it was not clear # which format was used.
* -use of emalloc functionsMarcus Boerger2002-11-051-6/+5
| | | | | | -info was not initialised fulle due to memset parameters now that the whole structure is initialised we can stop putting 0 in it.
* Why did open fail?Marcus Boerger2002-11-051-6/+6
|
* incorporate cdb-0.75 as suggested by D. J. BernsteinMarcus Boerger2002-11-041-2/+7
| | | | | #dba now supports cdb_make
* passing around TSRMMarcus Boerger2002-11-041-21/+21
| | | | | #going to add CDB_MAKE support
* cdb now allows multiple key-value pairs with same keyMarcus Boerger2002-11-031-6/+32
|
* php_error -> php_error_docrefMarcus Boerger2002-11-011-4/+4
|
* Implemented dba_list() that returns an array rsrcid=>filename and a test.Marcus Boerger2002-10-251-1/+32
|
* implemented dba_handlers()Marcus Boerger2002-10-241-0/+22
| | | | | @Added dba_handlers() that lists all installed handlers in an array. (marcus)
* Made this extension to use the resource stufffoobar2002-08-231-56/+56
|
* Unify error messagesDerick Rethans2002-06-261-7/+8
|
* Maintain headers.Sebastian Bergmann2002-02-281-1/+1
|
* Update headers.Sebastian Bergmann2001-12-111-2/+2
|
* * zend_module_entry change: apino, debug and zts are moved first,Stig Bakken2001-10-111-2/+6
| | | | | | see README.EXTENSIONS file for upgrade help. @Introduced extension version numbers (Stig)
* 2nd phase in back-substitution those macro'sJeroen van Wolffelaar2001-09-251-5/+5
| | | | | I've got pretty much everything now...
* - Don't wrap lines... this is annoying while coding.Derick Rethans2001-09-091-2/+2
|
* Another TSRMLS_FETCH() nuke.foobar2001-08-141-2/+2
|
* WhitespaceZeev Suraski2001-08-111-3/+3
|
* More TSRMLS_FETCH annihilationZeev Suraski2001-07-311-1/+2
|
* Fix folding and clean up some extensionsRasmus Lerdorf2001-06-061-21/+11
|
* vim-6 does folding - clean up a bunch of missing folding tags plusRasmus Lerdorf2001-06-051-6/+31
| | | | | some misguided RINIT and RSHUTDOWN calls in a few fringe extensions
* * include "config.h" if HAVE_CONFIG_H is defined (for standalone dso build)Stig Bakken2001-05-241-0/+4
|
* - How did CVS let me commit this? Probably it confused with the branchAndi Gutmans2000-12-161-10/+0
| | | | | merge
* - Make all places use MAXPATHLEN in the same way. It includes theAndi Gutmans2000-12-161-0/+10
| | | | | terminating NULL.
* Handle the case of no-handlers properly and make handlers a proper C "string".Sascha Schumann2000-12-041-2/+7
|
* Please avoid potential buffer overflows in new code. If you dealSascha Schumann2000-12-011-4/+6
| | | | | | with strings, consider storing the string length along with the string data. That will make your life easier.
* Beautifying of phpinfo().foobar2000-12-011-8/+12
|
* Run through conv_z_macrosSascha Schumann2000-11-221-6/+6
|
* Fix dba after resources patch.Andrei Zmievski2000-10-261-4/+9
|
* Use zend_register_list_destructors_ex() instead.Andrei Zmievski2000-10-251-2/+2
|
* Gremlins?Rasmus Lerdorf2000-10-211-1/+1
|
* Mega-patch to get better resource information for modules.Andrei Zmievski2000-10-201-3/+4
| | | | | | | | | | | | | * Fixed a bug in zend_rsrc_list_get_rsrc_type() * Switched register_list_destructors() to use zend_register_list_destructors_ex() instead * Updated all relevant modules to provide the resource type name to register_list_destructors() call * Updated var_dump() to output resource type name instead of number @- Made resource type names visible, e.g. var_dump() and @ get_resource_type() display "file" for file resources. (Andrei)
* Fixed protos.Egon Schmid2000-07-131-2/+2
|
* Unify use of my email addressSascha Schumann2000-07-101-1/+1
|
* # Reverting as requested.Jouni Ahto2000-06-271-3/+0
|
* - dba_[p]open accepts now a new parameter, which kind of database to createJouni Ahto2000-06-271-0/+3
| | | | | | | | (DBA_BTREE or DBA_HASH), if the handler is either 'db2' or 'db3' and mode 'c' or 'n'. It is ignored if mode is 'c' and the db already exists. # Asked on the list 4 1/2 hours ago if anyone's got to say something to this, # no response, so I'm assuming it's ok. And yes, I did test this.
* - ARG_COUNT(ht) -> ZEND_NUM_ARGS() mega patchAndi Gutmans2000-06-051-2/+2
|
* Make dba compilable as shared moduleSascha Schumann2000-05-021-0/+4
|
View Lorry Controller Status