summaryrefslogtreecommitdiff
path: root/ext/zlib/zlib.c
Commit message (Collapse)AuthorAgeFilesLines
* Changed my mind.Yasuo Ohgaki2002-08-111-2/+0
| | | | | | | Let users decided whether users want larger chunk size or not. @ Changed zlib.output_compression behavior. If larger chunk is preferred, enable output_buffering also. (Marcus, Yasuo)
* Generally speaking, sending packets less than 1KB is not efficient.Yasuo Ohgaki2002-08-111-1/+3
| | | | | | We're better to take some benchmarks see if removing extra buffer is actually a good idea or not.
* corrected handling of internal output buffersMarcus Boerger2002-08-101-3/+1
| | | | | minor fixs
* no need to start additional first buffer when output compression is first bufferMarcus Boerger2002-08-101-1/+2
|
* should fix all windows warningsMarcus Boerger2002-08-101-2/+2
|
* Improved handling of output buffers (see news)\n#No trim for the string ↵Marcus Boerger2002-08-091-0/+18
| | | | parameter...
* Commit patch as discussed on LinuxTag and posted to php-dev in June.Stefan Roehrich2002-07-281-20/+31
| | | | | | | | | | Disables zlib.output_compression for scripts with image/ content-type header (fixes bug #16109) and makes it possible to switch zlib.output_compression during script execution before the headers are sent. @- zlib.output_compression is disabled for "image/" content-type @ headers and can be changed during script execution. (Stefan)
* - oops... read before commit :)Derick Rethans2002-06-181-1/+1
|
* - It doesn't work from within a script... so we disallow itDerick Rethans2002-06-181-1/+1
|
* Added "Vary: Accept-Encoding" header to zlib.output_compressionStefan Roehrich2002-06-021-0/+6
| | | | | | | | | | compressed output as with obgzhandler(). @ If zlib.output_compression is enabled and a page is compressed @ a "Vary: Accept-Encoding" header is added. (Stefan) # obgzhandler() sends this header, I think it is recommened by # RFC 2616. If there are problems (e.g. with some browsers) # it should be reverted.
* Move Content-Length: header handling from zlib.c to output.cYasuo Ohgaki2002-05-021-18/+3
| | | | | | When output buffer is enabled and header can be sent, Content-Length: header is added always from now on.
* s/len/xln/ was necessary hereSascha Schumann2002-04-271-2/+2
| | | | | Noticed by: Charles O Parks III
* Use a single macro to set cl headerSascha Schumann2002-04-271-12/+16
|
* @ - If possible set Content-Length header in zlib.output_compression mode. ↵Thies C. Arntzen2002-04-271-1/+8
| | | | (thies)
* Make scheme part decoding rfc2396 compliant.Wez Furlong2002-04-191-1/+1
| | | | | | Change zlib:// and bzip2:// to compress.zlib:// and compress.bzip2:// Tidy up old socket/network code/comments.
* Always initialize wrappers, regardless of PG(allow_url_fopen).Wez Furlong2002-04-161-5/+2
| | | | | | | | | | | | Add is_url field to wrapper structure; the stream wrapper openers will disallow opening is is_url && !PG(allow_url_fopen). Add infrastructure for stat($url) and opendir($url). Tidy up/centralize code that locates and instantiates wrappers for the various operations. Implement opendir for plain files. Make the PHP opendir and dir functions use the streams implementations. Add modelines for syntax highlighting the pear scripts in vim
* remove old codeWez Furlong2002-04-161-13/+0
|
* Do NOT use C++ comments in C code.foobar2002-04-121-2/+0
|
* Removing a unused local variable.Frank M. Kromann2002-04-121-2/+2
| | | | | Setting the size before returning the value in readgzfile
* Implement stream context and status notification system.Wez Furlong2002-04-101-3/+3
| | | | | | Bump the BC for zlib notice to a warning # See my RFC to php-dev a few days ago
* @Add zlib.output_compression_level option (Stig)Stig Bakken2002-04-051-6/+18
|
* Fix gzip/bz2 builds for WindowsZeev Suraski2002-04-051-21/+21
|
* Phase 1 of wrapper OO cleanup.Wez Furlong2002-03-241-3/+3
| | | | | # Collecting underpants
* really nuke it...Wez Furlong2002-03-211-3/+0
|
* Convert the gzfile related functions into aliases for their equivalentsWez Furlong2002-03-211-387/+32
| | | | | | | | | | in ext/standard/file.c, so a gzopen()ed file pointer can be used in fread, fseek etc. Improved behaviour of zlib stream. Moved passthru code into streams.c # I'm not happy about BG(mmap_file) Nuked gzgetss_state as no longer needed.
* Make state parameter of php_strip_tags passed by reference.Wez Furlong2002-03-201-1/+1
| | | | | Move state tracking to stream structure.
* Streams are all tracked as resources now.Wez Furlong2002-03-201-8/+2
| | | | | | Add some logic that will help track down leaks when debug is enabled.
* Add parameter here too...Wez Furlong2002-03-201-1/+2
|
* Implement user-space streams.Wez Furlong2002-03-191-2/+0
| | | | | | There's probably room for improvement, docs will following some time this week.
* TSRMLS related work on streams, as discussed with Zeev.Wez Furlong2002-03-181-1/+1
| | | | | | # Should be the last "broad" commit for a while # Don't forget to make clean ; make
* Fix the build and all of the outstanding VC++ warningsZeev Suraski2002-03-181-1/+1
|
* Streams now make more use of the memory manager, so tracking downWez Furlong2002-03-171-3/+3
| | | | | | leaking streams should be easier. # I hate these big commits
* Fix some issues with gzFile and fsockopen.Wez Furlong2002-03-161-3/+3
|
* change * formattingWez Furlong2002-03-161-2/+2
|
* New PHP streams...Wez Furlong2002-03-151-23/+26
|
* (PHP gzencode) Reimplementation of gzencode(). Now works as documentedStefan Roehrich2002-03-121-21/+91
| | | | | | | | | | | (gzencode(string data [, int level [, int encoding_mode]])), should fix #15930. @- The second parameter of gzencode() now is the compression level like @ in the documentation. The encoding mode is a third (optional) parameter. # Rework of gzencode(), output should be closer to real gzip output. # I think in the old version there could be some problems with # this function and output compression, should be fixed, too.
* (PHP gzinflate) Workaround for bug #14939 (buffer error in gzinflate()).Stefan Roehrich2002-03-121-2/+2
| | | | | | | | | | | Fixed prototype and added test for #14939. # We have extra \0 if the input comes directly from gzdeflate() # so give one extra byte as length to workaround behaviour of zlib. # I want to avoid copying the input, but if there are problems, # please tell (see my message <20020310175611.GA4472@stefan.roehri.ch> to # php-dev).
* Added ob_get_status() to get array of buffers and it's status.Yasuo Ohgaki2002-03-011-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | (DO NOT document this function yet) Fixed crash bug with ob_end_*() function. ob_end_*() will not delete buffers that may not be deleted. php_start_ob_buffer() and php_ob_set_internal_handler() takes parameter for if the buffer created may be deleted or not. Added 3rd parameter "bool erase" to ob_start(). If FALSE, buffer may not be deleted until script finshes. Changed ob_*() function that have void return type to bool. All ob_*() functions return TRUE for success, FALSE for failure. @ - Added ob_get_status() to get array of buffers and it's status. (Yasuo) @ - Fixed crash bug with ob_end_*() function. ob_end_*() will not delete @ buffers that may not be deleted. (Yasuo) @ - Added 3rd parameter "bool erase" to ob_start(). If FALSE, buffer may not be @ deleted until script finshes. (Yasuo) @ - Changed ob_*() function that have void return type to bool. All ob_*() @ functions return TRUE for success, FALSE for failure. (Yasuo)
* Update headers.Sebastian Bergmann2001-12-111-2/+2
|
* Show the registered ini entry in phpinfo()foobar2001-11-261-0/+2
|
* restriction is relaxed because output handler couldn't be used even if ↵Rui Hirokawa2001-11-231-1/+2
| | | | zlib.output_compression is set to off.
* - fix crash bugDerick Rethans2001-10-271-2/+1
|
* Modified the error message a bit. Happy now Andi? :)foobar2001-10-271-1/+1
|
* - Prevent PHP from starting if output_handler is set andfoobar2001-10-271-1/+20
| | | | | | zlib.output_compression is on - Added notes to the bundled php.ini files about this.
* * zend_module_entry change: apino, debug and zts are moved first,Stig Bakken2001-10-111-0/+2
| | | | | | see README.EXTENSIONS file for upgrade help. @Introduced extension version numbers (Stig)
* 2nd phase in back-substitution those macro'sJeroen van Wolffelaar2001-09-251-16/+16
| | | | | I've got pretty much everything now...
* Back-substitute for Z_* macro's. If it breaks some extension (the script ↵Jeroen van Wolffelaar2001-09-251-33/+33
| | | | isn't optimal, it parses for example var->zval.value incorrect) please let me know.
* - Don't wrap lines... this is annoying while coding.Derick Rethans2001-09-091-2/+2
|
* Send Content-Length if we're sending just one chunkZeev Suraski2001-08-161-3/+3
|
* more tsrm cleanupSascha Schumann2001-08-061-4/+4
|
View Lorry Controller Status