summaryrefslogtreecommitdiff
path: root/ext
Commit message (Expand)AuthorAgeFilesLines
* - Added ob_flush and ob_clean functions, which do not end the buffer likeDerick Rethans2001-11-301-0/+2
* This is better way to configure. PDFlib 3/4 can be compiled with external lib...foobar2001-11-305-143/+99
* Adding ldap_set_rebind_proc() for APIs with V3 3 arg variant, need moreStig Venaas2001-11-293-0/+111
* Making the link resource point to a structure that contains the LDAPStig Venaas2001-11-291-110/+124
* i'm sure i had this compile before;-)Thies C. Arntzen2001-11-291-1/+2
* fix a crash in socket_connect (if hostname was not resolvable)Thies C. Arntzen2001-11-291-10/+13
* - introduced several macros to simply code (done by Markus Fischer)Uwe Steinmann2001-11-281-480/+344
* Removing winutil.c from this project. the functions needed are found in php4t...Frank M. Kromann2001-11-272-8/+0
* Show the registered ini entry in phpinfo()foobar2001-11-261-0/+2
* Updated file since .re changed.foobar2001-11-261-4/+4
* - Also patch the file from which var_unserializer.c is generatedDerick Rethans2001-11-261-4/+33
* - Adding a callback mechanism to the unserializer. (patch by BerndDerick Rethans2001-11-261-5/+34
* fixed a link error in configure script.Rui Hirokawa2001-11-251-2/+6
* Fixed some protos. If pi means processing instruction, it should be written I...Egon Schmid2001-11-251-47/+49
* Fixed some protos.Egon Schmid2001-11-251-3/+3
* Honor error_reporting (in general and @ in particular) for IMAP noticesZeev Suraski2001-11-241-0/+3
* Save entries in $_SESSION even if register_globals is onZeev Suraski2001-11-241-4/+4
* Entries registered with session_register() and altered by changingZeev Suraski2001-11-241-9/+9
* whitespaceZeev Suraski2001-11-241-9/+9
* - Reverse slight mistake (patch by Markus Fischer)Derick Rethans2001-11-231-1/+1
* restriction is relaxed because output handler couldn't be used even if zlib.o...Rui Hirokawa2001-11-231-1/+2
* - BeautifyingDerick Rethans2001-11-221-1/+1
* WS fix.foobar2001-11-221-6/+6
* - Fix crach bug if the parameter to shm_remove is not a valid identifier.Derick Rethans2001-11-221-0/+6
* - Added a parameter to mysql_connect to force a new database link to beDerick Rethans2001-11-221-4/+15
* - Fix for bug #14169Derick Rethans2001-11-221-0/+1
* Added ldap_sort() functionStig Venaas2001-11-212-0/+33
* - add functions clone_node(), is_blank_node(), create_entity_reference()Uwe Steinmann2001-11-212-8/+157
* Fix a crash bug in CURLOPT_POSTFIELDS by using curl_formadd instead ofSterling Hughes2001-11-201-6/+6
* Test before commit..test before commit..foobar2001-11-181-1/+1
* Now this might even work.foobar2001-11-181-10/+13
* AIX compiler doesn't like having a comma at the end of the enumDoug MacEachern2001-11-181-1/+1
* - Added md5_file(), which calculaties the MD5 sum of a file.Derick Rethans2001-11-183-6/+68
* Remove the sablotron extensionSterling Hughes2001-11-187-2015/+0
* - Fix build on FreeBSD (patch by Markus Fischer)Derick Rethans2001-11-181-1/+1
* WS fixfoobar2001-11-181-3/+3
* - Added support for parsing recordsets.Andrei Zmievski2001-11-181-25/+117
* Fix two incidents which have been reported about the new unserializer.Sascha Schumann2001-11-162-105/+207
* Add todo item.Andrei Zmievski2001-11-161-0/+1
* Use the macro here and add an E_NOTICERasmus Lerdorf2001-11-161-1/+3
* Check in ftok() function by Andrew Sitnikov <sitnikov@infonet.ee>Stanislav Malyshev2001-11-155-1/+105
* Fixed some memory leaks and removed some unnecessary checks due toStig Venaas2001-11-141-16/+4
* Prevent fbsql_num_rows from loopingFrank M. Kromann2001-11-141-1/+1
* Fixing debug buildFrank M. Kromann2001-11-141-4/+4
* Many other reasons that setvbuf can fail than "wrong arguments", returningSterling Hughes2001-11-141-3/+0
* - Fix crashbug on dtorDerick Rethans2001-11-141-6/+6
* Fixing compile errorFrank M. Kromann2001-11-131-1/+1
* Fixing debug buildFrank M. Kromann2001-11-131-2/+2
* Minor changes in ldap_connect(): fixed crash with OpenLDAP 2 libs whenStig Venaas2001-11-131-11/+9
* Removed some old cruft (some commented code and non-used globals), fixedStig Venaas2001-11-132-25/+4
View Lorry Controller Status