diff options
author | Markus Klotzbuecher <mk@denx.de> | 2007-05-07 14:10:38 +0200 |
---|---|---|
committer | Markus Klotzbuecher <mk@pollux.denx.de> | 2007-05-07 14:10:38 +0200 |
commit | 6ede0c8b69ad1e6b16463ec75a6dccca152c4b17 (patch) | |
tree | 978dcbd6189998876bb227ae5bbea03000a2f9c5 | |
parent | 61ea75aa07838435ec570ac85a2e3fc038844596 (diff) | |
parent | ac4cd59d59c9bf3f89cb7a344abf8184d678f562 (diff) | |
download | u-boot-6ede0c8b69ad1e6b16463ec75a6dccca152c4b17.tar.gz |
Merge with git://www.denx.de/git/u-boot.git
75 files changed, 5103 insertions, 428 deletions
@@ -1,3 +1,453 @@ +commit 885ec89b648a899a2f32393fd3ffd9f7234c4402 +Author: Wolfgang Denk <wd@denx.de> +Date: Sat May 5 18:05:02 2007 +0200 + + Add STX GP3 SSA board to MAKEALL script; update CHANGELOG. + + Signed-off-by: Wolfgang Denk <wd@denx.de> + +commit 5499645b3fe17a548af9dfc479ca6e2455f179a2 +Author: Wolfgang Denk <wd@denx.de> +Date: Sat May 5 17:15:50 2007 +0200 + + Make "file" command happy with some config.mk files; update CHANGELOG + +commit e3b8c78bc2489c27ae020986ef0eaca684866cef +Author: Jeffrey Mann <mannj@embeddedplanet.com> +Date: Sat May 5 08:32:14 2007 +0200 + + ppc4xx: Detect if the sysclk on Sequoia is 33 or 33.333 MHz + + The AMCC Secquoia board has been changed in a new revision from using a + 33.000 MHz clock to a 33.333 MHz system clock. A bit in the CPLD + indicates the difference. This patch reads that bit and uses the correct + clock speed for the board. This code is backward compatable will all + prior boards. All prior boards will be read as 33.000. + + Signed-off-by: Jeffrey Mann <mannj@embeddedplanet.com> + Signed-off-by: Stefan Roese <sr@denx.de> + +commit f544ff6656fca263ed1ebe39899b6d95da67c8b8 +Author: Stefan Roese <sr@denx.de> +Date: Sat May 5 08:29:01 2007 +0200 + + ppc4xx: Sequoia: Remove cpu/ppc4xx/speed.c from NAND booting + + Using cpu/ppc4xx/speed.c to calculate the bus frequency is too big + for the 4k NAND boot image so define bus_frequency to 133MHz here + which is save for the refresh counter setup. + + Signed-off-by: Stefan Roese <sr@denx.de> + +commit a79886590593ba1d667c840caa4940c61639f18f +Author: Thomas Knobloch <knobloch@siemens.com> +Date: Sat May 5 07:04:42 2007 +0200 + + NAND: Wrong calculation of page number in nand_block_bad() + + In case that there is no memory based bad block table available the + function nand_block_checkbad() in drivers/mtd/nand/nand_base.c will call + nand_block_bad() directly. When parameter 'getchip' is set to zero, + nand_block_bad() will not right shift the offset to calculate the + correct page number. + + Signed-off-by: Thomas Knobloch <knobloch@siemens.com> + Signed-off-by: Stefan Roese <sr@denx.de> + +commit 9877d7dcd1eebe61aa5d8b8ffe9c048ea426e6f6 +Author: Wolfgang Denk <wd@denx.de> +Date: Fri May 4 10:02:33 2007 +0200 + + Fix initrd length corruption in bootm command. + + When using FDT Images, the length of an inital ramdisk was + overwritten (bug introduced by commit 87a449c8, 22 Aug 2006). + + Patches by Timur Tabi & Johns Daniel. + + Signed-off-by: Wolfgang Denk <wd@denx.de> + +commit c64a89d6ce8584b9fc64f4e85da9ecac3cfc2c2a +Author: Wolfgang Denk <wd@denx.de> +Date: Thu May 3 16:34:41 2007 +0200 + + Update board configuration for STX GP3SSA board: + + Enable hush shell, environment in flash rather in EEPROM, + more user-friendly default environment, etc. + The simple EEPROM environment can be selected easily in the board + config file. + + Signed-off-by: Wolfgang Denk <wd@denx.de> + +commit 2c6fb199dc5756fc72f49d1f4de105e089049d65 +Author: Wolfgang Denk <wd@denx.de> +Date: Tue Apr 24 14:37:49 2007 +0200 + + Cleanup STX GP3SSA code; fix build and compile problems. + +commit 35171dc04e028ecacc23ad916a66295472555dbf +Author: Dan Malek <dan@embeddedalley.com> +Date: Fri Jan 5 09:15:34 2007 +0100 + + Add support for STX GP3SSA (stxssa) Board + + Signed-off-by Dan Malek, <dan@embeddedalley.com> + +commit ffa621a0d12a1ccd81c936c567f8917a213787a8 +Author: Andy Fleming <afleming@freescale.com> +Date: Sat Feb 24 01:08:13 2007 -0600 + + Cleaned up some 85xx PCI bugs + + * Cleaned up the CDS PCI Config Tables and added NULL entries to + the end + * Fixed PCIe LAWBAR assignemt to use the cpu-relative address + * Fixed 85xx PCI code to assign powar region sizes based on the + config values (rather than hard-coding them) + * Fixed the 8548 CDS PCI2 IO to once again have 0 as the base address + + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 6743105988fc44d5b0d30388c790607835aae7a6 +Author: Andy Fleming <afleming@freescale.com> +Date: Mon Apr 23 02:54:25 2007 -0500 + + Add support for the 8568 MDS board + + This included some changes to common files: + * Add 8568 processor SVR to various places + * Add support for setting the qe bus-frequency value in the dts + * Add the 8568MDS target to the Makefile + + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit af1c2b84bf27c8565baddc82d1abb93700d10e2e +Author: David Updegraff <dave@cray.com> +Date: Fri Apr 20 14:34:48 2007 -0500 + + Add support for treating unknown PHYs as generic PHYs. + + When bringing up u-boot on new boards, PHY support sometimes gets + neglected. Most PHYs don't really need any special support, + though. By adding a generic entry that always matches if nothing + else does, we can provide support for "unsupported" PHYs for the + tsec. + + The generic PHY driver supports most PHYs, including gigabit. + + Signed-off-by: David Updegraff <dave@cray.com> + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit a75af9bfd8fff0499efdbb90601cec5a2afef117 +Author: James Yang <James.Yang@freescale.com> +Date: Wed Feb 7 15:28:04 2007 -0600 + + Conditionalize 8641 Rev1.0 MCM workarounds + + Signed-off-by: James Yang <James.Yang@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit c1ab82669d9525998c34e802a12cad662723f22a +Author: James Yang <James.Yang@freescale.com> +Date: Fri Mar 16 13:02:53 2007 -0500 + + Rewrote picos_to_clk() to avoid rounding errors. + Clarified that conversion is to DRAM clocks rather than platform clocks. + Made function static to spd_sdram.c. + + Signed-off-by: James Yang <James.Yang@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 8b39501d28754e72726ce7fb02310e56dbdf116a +Author: Stefan Roese <sr@denx.de> +Date: Sun Apr 29 14:13:01 2007 +0200 + + ppc4xx: Bamboo: Use current NAND driver and *not* the legacy driver + + Signed-off-by: Stefan Roese <sr@denx.de> + +commit 37ed6cdd4159195bfad68d8a237f6adda8f482cb +Author: Matthias Fuchs <matthias.fuchs@esd-electronics.com> +Date: Tue Apr 24 14:03:45 2007 +0200 + + ppc4xx: setup 440EPx/GRx ZMII/RGMII bridge depending on PFC register content. + + Signed-off-by: Matthias Fuchs <matthias.fuchs@esd-electronics.com> + +commit 66ed6cca3f340f7a8a06d9272ae2ef8e96f0273d +Author: Andy Fleming <afleming@freescale.com> +Date: Mon Apr 23 02:37:47 2007 -0500 + + Reworked 85xx speed detection code + + Changed the code to read the registers and calculate the clock + rates, rather than using a "switch" statement. + + Idea from Andrew Klossner <andrew@cesa.opbu.xerox.com> + + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 81f481ca708ed6a56bf9c410e3191dbad581c565 +Author: Andy Fleming <afleming@freescale.com> +Date: Mon Apr 23 02:24:28 2007 -0500 + + Enable 8544 support + + * Add support to the Makefile + * Add 8544 configuration support to the tsec driver + * Add 8544 SVR numbers to processor.h + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 0d8c3a2096eaff8d7de89d45e9af4d4b0d4868fe +Author: Andy Fleming <afleming@freescale.com> +Date: Fri Feb 23 17:12:25 2007 -0600 + + Support 1G size on 8548 + + e500v2 and newer cores support 1G page sizes. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 45cef612cc601d2d1c890fbbd7cdc9609a189a46 +Author: Andy Fleming <afleming@freescale.com> +Date: Fri Feb 23 17:11:16 2007 -0600 + + Changed BOOKE_PAGESZ_nGB to BOOKE_PAGESZ_nG + + The other pagesz constants use one letter to specify order of + magnitude. Also change the one reference to it in mpc8548cds/init.S + + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 1f9a318cea14272edd10d63739e2d326c90f430e +Author: Andy Fleming <afleming@freescale.com> +Date: Fri Feb 23 16:28:46 2007 -0600 + + Only set ddrioovcr for 8548 rev1. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 9343dbf85bc03033f2102d8e8543567c2c1ad2d2 +Author: Andy Fleming <afleming@freescale.com> +Date: Sat Feb 24 01:16:45 2007 -0600 + + Tweak DDR ECC error counter + + Enable single-bit error counter when memory was cleared by ddr controller. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Andy Fleming <afleming@freescale.com> + +commit 85e7c7a45e3dd9c7ce3e722352ba60f8df1a7a4b +Author: Timur Tabi <timur@freescale.com> +Date: Mon Feb 12 13:34:55 2007 -0600 + + 85xx: write MAC address to mac-address and local-mac-address + + Some device trees have a mac-address property, some have local-mac-address, + and some have both. To support all of these device trees, ftp_cpu_setup() + should write the MAC address to mac-address and local-mac-address, if they + exist. + + Signed-off-by: Timur Tabi <timur@freescale.com> + +commit 03b81b48eec0ad249ec97a4ae16c36fa2e014ff4 +Author: Andy Fleming <afleming@freescale.com> +Date: Mon Apr 23 01:44:44 2007 -0500 + + Some 85xx cpu cleanups + + * Cleaned up the TSR[WIS] clearing + * Cleaned up DMA initialization + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + Acked-by: Andy Fleming <afleming@freescale.com> + +commit 151d5d992eab8c497b24c816c73dc1ad8bffb4eb +Author: Andy Fleming <afleming@freescale.com> +Date: Mon Apr 23 01:32:22 2007 -0500 + + Add cpu support for the 8544 + + Recognize new SVR values, and add a few register definitions + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + Acked-by: Andy Fleming <afleming@freescale.com> + +commit 25d83d7f4ac65727182d8ddaf7ba42fa74cf65ae +Author: Jon Loeliger <jdl@freescale.com> +Date: Wed Apr 11 16:51:02 2007 -0500 + + Add MPC8544DS basic port board files. + + Add board port under new board/freescale directory + structure and reuse existing PIXIS FPGA support there. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 0cde4b00fc7393b89f379d83a9d436dcb1334bfa +Author: Jon Loeliger <jdl@freescale.com> +Date: Wed Apr 11 16:50:57 2007 -0500 + + Add MPC8544DS main configuration file. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 362dd83077ac04c0296bca3e824ec2fb3d44d9d6 +Author: Sergei Shtylyov <sshtylyov@ru.mvista.com> +Date: Wed Dec 27 22:07:15 2006 +0300 + + Fix PCI I/O space mapping on Freescale MPC85x0ADS + + The PCI I/O space mapping for Freescale MPC8540ADS board was broken by commit + 52c7a68b8d587ebcf5a6b051b58b3d3ffa377ddc which failed to update the #define's + describing the local address window used for the PCI I/O space accesses -- fix + this and carry over the necessary changes into the MPC8560ADS code since the + PCI I/O space mapping was also broken for this board (by the earlier commit + 087454609e47295443af793a282cddcd91a5f49c). Add the comments clarifying how + the PCI I/O space must be mapped to all the MPC85xx board config. headers. + + Signed-off-by: Sergei Shtylyov <sshtylyov@ru.mvista.com> + + board/mpc8540ads/init.S | 4 ++-- + board/mpc8560ads/init.S | 4 ++-- + include/configs/MPC8540ADS.h | 5 ++--- + include/configs/MPC8541CDS.h | 2 +- + include/configs/MPC8548CDS.h | 2 +- + include/configs/MPC8560ADS.h | 8 ++++---- + 6 files changed, 12 insertions(+), 13 deletions(-) + +commit 96629cbabdb727d4a5e62542deefc01d498db6dc +Author: Zang Roy-r61911 <tie-fei.zang@freescale.com> +Date: Tue Dec 5 16:42:30 2006 +0800 + + u-boot: Fix e500 v2 core reset bug + + The following patch fixes the e500 v2 core reset bug. + For e500 v2 core, a new reset control register is added to reset the + processor. + + Signed-off-by: Roy Zang <tie-fei.zang@freescale.com> + +commit 63247a5acd58032e6cf33f525bc3923b467bac88 +Author: Zang Roy-r61911 <tie-fei.zang@freescale.com> +Date: Wed Dec 20 11:01:00 2006 +0800 + + u-boot: v2: Remove the fixed TLB and LAW entrynubmer + + Remove the fixed TLB and LAW entry nubmer. Use actually TLB and LAW + entry number to control the loop. This can reduce the potential risk + for the 85xx processor increasing its TLB adn LAW entry number. + + Signed-off-by: Swarthout Edward <swarthout@freescale.com> + Signed-off-by: Roy Zang <tie-fei.zang@freescale.com> + +commit 0b1934ba12fd408fcc3b8bd9f4b04864c42a42bf +Author: Zang Roy-r61911 <tie-fei.zang@freescale.com> +Date: Mon Dec 18 17:01:04 2006 +0800 + + u-boot: Fix the 85xxcds tsec bug + + Fix the 85xxcds tsec bug. + When enable PCI, tsec.o should be added to u-boot.lds to make tsec work. + + Signed-off-by: Roy Zang <tie-fei.zang@freescale.com> + +commit 7337b237ffc4aaf1b9467024fe472a880d852598 +Author: Zang Roy-r61911 <tie-fei.zang@freescale.com> +Date: Fri Dec 15 14:43:31 2006 +0800 + + u-boot: Fix CPU2 errata on MPC8548CDS board + + This patch apply workaround of CPU2 errata on MPC8548CDS board. + + Signed-off-by:Ebony Zhu <ebony.zhu@freescale.com> + +commit 39b18c4f3e0b6d0dc00f4e68bad2da3766c85f09 +Author: ebony.zhu@freescale.com <ebony.zhu@freescale.com> +Date: Mon Dec 18 16:25:15 2006 +0800 + + u-boot: Disables MPC8548CDS 2T_TIMING for DDR by default + + This patch disables MPC8548CDS 2T_TIMING for DDR by default. + + Signed-off-by:Ebony Zhu <ebony.zhu@freescale.com> + +commit 41fb7e0f1ec9b91bdae2565bab5f2e3ee15039c7 +Author: Zang Roy-r61911 <tie-fei.zang@freescale.com> +Date: Thu Dec 14 14:14:55 2006 +0800 + + u-boot: Enable PCI function and add PEX & rapidio memory map on MPC8548CDS board + + Enable PCI function and add PEX & rapidio memory map on MPC8548CDS + board. + Signed-off-by: Roy Zang <tie-fei.zang@freescale.com> + +commit 323bfa8f436dc3bc57187c9b1488bc3146ff1522 +Author: Stefan Roese <sr@denx.de> +Date: Mon Apr 23 12:00:22 2007 +0200 + + Remove BOARDLIBS usage completely + + Signed-off-by: Stefan Roese <sr@denx.de> + +commit 2e343b9a57f32e1bd08c35c9976910333fb4e13d +Author: Ed Swarthout <Ed.Swarthout@freescale.com> +Date: Wed Feb 28 05:37:29 2007 -0600 + + mpc8641hpcn: Fix LAW and TLB setup to use the IO_PHYS #defines. + + Signed-off-by: Ed Swarthout <Ed.Swarthout@freescale.com> + +commit 79cb47391eebef85acadb3f6961ef6c55cace6ac +Author: Zhang Wei <wei.zhang@freescale.com> +Date: Fri Jan 19 10:42:37 2007 +0800 + + Enable LAWs for MPC8641 PCI-Ex2. + + Signed-off-by: Zhang Wei <wei.zhang@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit bd7851ce1e1f140665b520026abf1042968b1102 +Author: Jon Loeliger <jdl@freescale.com> +Date: Fri Apr 20 14:12:26 2007 -0500 + + mpc86xx; Write MAC address to mac-address and local-mac-address + + Some device trees have a mac-address property, some have local-mac-address, + and some have both. To support all of these device trees, ftp_cpu_setup() + should write the MAC address to mac-address and local-mac-address, if they + exist. + + Signed-off-by: Timur Tabi <timur@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 7dbdf28b8bd855a8530dc3292e4982575a197060 +Author: Jon Loeliger <jdl@freescale.com> +Date: Fri Apr 20 14:11:38 2007 -0500 + + mpc86xx: protect memcpy to bad address if a mac-address is missing from dt + + Signed-off-by: Kim Phillips <kim.phillips@freescale.com> + Signed-off-by: Jon Loeliger <jdl@freescale.com> + +commit 14da5f7675bbb427c469e3f45006e027b6e21db9 +Author: Wolfgang Denk <wd@denx.de> +Date: Fri Apr 20 17:43:28 2007 +0200 + + Cleanup compiler warnings, update CHANGELOG + + Signed-off-by: Wolfgang Denk <wd@denx.de> + commit 6923565db12af34fd5e02d354ee65a8c78ac460f Author: Detlev Zundel <dzu@denx.de> Date: Fri Apr 20 12:01:47 2007 +0200 @@ -30,6 +480,20 @@ Date: Thu Apr 19 23:14:39 2007 -0400 Also moved the libfdt.a requirement into the main Makefile. That is The U-Boot Way. +commit d21686263574e95cb3e9e9b0496f968b1b897fdb +Author: Stefan Roese <sr@denx.de> +Date: Thu Apr 19 09:53:52 2007 +0200 + + ppc4xx: Fix chip select timing for SysACE access on AMCC Katmai + + Previous versions used full wait states for the chip select #1 which + is connected to the Xilinix SystemACE controller on the AMCC Katmai + evaluation board. This leads to really slow access and therefore low + performance. This patch now sets up the chip select a lot faster + resulting in much better read/write performance of the Linux driver. + + Signed-off-by: Stefan Roese <sr@denx.de> + commit 37837828d89084879bee2f2b8c7c68d4695940df Author: Wolfgang Denk <wd@denx.de> Date: Wed Apr 18 17:49:29 2007 +0200 diff --git a/MAINTAINERS b/MAINTAINERS index c3c73da4f7..2eaef1784e 100644 --- a/MAINTAINERS +++ b/MAINTAINERS @@ -221,10 +221,11 @@ Jon Loeliger <jdl@freescale.com> MPC8641HPCN MPC8641D -Dan Malek <dan@embeddededge.com> +Dan Malek <dan@embeddedalley.com> - STxGP3 MPC85xx - STxXTc MPC8xx + stxgp3 MPC85xx + stxssa MPC85xx + stxxtc MPC8xx Eran Man <eran@nbase.co.il> @@ -142,10 +142,11 @@ LIST_83xx=" \ ######################################################################### LIST_85xx=" \ - MPC8540ADS MPC8540EVAL MPC8541CDS MPC8548CDS \ - MPC8555CDS MPC8560ADS PM854 PM856 \ - sbc8540 sbc8560 stxgp3 TQM8540 \ - TQM8541 TQM8555 TQM8560 \ + MPC8540ADS MPC8540EVAL MPC8541CDS MPC8544DS \ + MPC8548CDS MPC8555CDS MPC8560ADS PM854 \ + PM856 sbc8540 sbc8560 stxgp3 \ + stxssa TQM8540 TQM8541 TQM8555 \ + TQM8560 \ " ######################################################################### @@ -197,6 +197,9 @@ LIBS += cpu/$(CPU)/lib$(CPU).a ifdef SOC LIBS += cpu/$(CPU)/$(SOC)/lib$(SOC).a endif +ifeq ($(CPU),ixp) +LIBS += cpu/ixp/npe/libnpe.a +endif LIBS += lib_$(ARCH)/lib$(ARCH).a LIBS += fs/cramfs/libcramfs.a fs/fat/libfat.a fs/fdos/libfdos.a fs/jffs2/libjffs2.a \ fs/reiserfs/libreiserfs.a fs/ext2/libext2fs.a @@ -220,7 +223,6 @@ LIBS += $(shell if [ -d post/board/$(BOARDDIR) ]; then echo \ "post/board/$(BOARDDIR)/libpost$(BOARD).a"; fi) LIBS += common/libcommon.a LIBS += libfdt/libfdt.a -LIBS += $(BOARDLIBS) LIBS := $(addprefix $(obj),$(LIBS)) .PHONY : $(LIBS) @@ -1733,12 +1735,18 @@ MPC8560ADS_config: unconfig MPC8541CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8541cds cds +MPC8544DS_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8544ds freescale + MPC8548CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8548cds cds MPC8555CDS_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8555cds cds +MPC8568MDS_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx mpc8568mds + PM854_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx pm854 @@ -1774,6 +1782,9 @@ sbc8560_66_config: unconfig stxgp3_config: unconfig @$(MKCONFIG) $(@:_config=) ppc mpc85xx stxgp3 +stxssa_config: unconfig + @$(MKCONFIG) $(@:_config=) ppc mpc85xx stxssa + TQM8540_config \ TQM8541_config \ TQM8555_config \ diff --git a/board/amcc/bamboo/bamboo.c b/board/amcc/bamboo/bamboo.c index b5bb145808..6260b016df 100644 --- a/board/amcc/bamboo/bamboo.c +++ b/board/amcc/bamboo/bamboo.c @@ -277,87 +277,6 @@ int board_early_init_f(void) return 0; } -#if (CONFIG_COMMANDS & CFG_CMD_NAND) -#include <linux/mtd/nand_legacy.h> -extern struct nand_chip nand_dev_desc[CFG_MAX_NAND_DEVICE]; - -/*----------------------------------------------------------------------------+ - | nand_reset. - | Reset Nand flash - | This routine will abort previous cmd - +----------------------------------------------------------------------------*/ -int nand_reset(ulong addr) -{ - int wait=0, stat=0; - - out8(addr + NAND_CMD_REG, NAND0_CMD_RESET); - out8(addr + NAND_CMD_REG, NAND0_CMD_READ_STATUS); - - while ((stat != 0xc0) && (wait != 0xffff)) { - stat = in8(addr + NAND_DATA_REG); - wait++; - } - - if (stat == 0xc0) { - return 0; - } else { - printf("NAND Reset timeout.\n"); - return -1; - } -} - -void board_nand_set_device(int cs, ulong addr) -{ - /* Set NandFlash Core Configuration Register */ - out32(addr + NAND_CCR_REG, 0x00001000 | (cs << 24)); - - switch (cs) { - case 1: - /* ------- - * NAND0 - * ------- - * K9F1208U0A : 4 addr cyc, 1 col + 3 Row - * Set NDF1CR - Enable External CS1 in NAND FLASH controller - */ - out32(addr + NAND_CR1_REG, 0x80002222); - break; - - case 2: - /* ------- - * NAND1 - * ------- - * K9K2G0B : 5 addr cyc, 2 col + 3 Row - * Set NDF2CR : Enable External CS2 in NAND FLASH controller - */ - out32(addr + NAND_CR2_REG, 0xC0007777); - break; - } - - /* Perform Reset Command */ - if (nand_reset(addr) != 0) - return; -} - -void nand_init(void) -{ - board_nand_set_device(1, CFG_NAND_ADDR); - - nand_probe(CFG_NAND_ADDR); - if (nand_dev_desc[0].ChipID != NAND_ChipID_UNKNOWN) { - print_size(nand_dev_desc[0].totlen, "\n"); - } - -#if 0 /* NAND1 not supported yet */ - board_nand_set_device(2, CFG_NAND2_ADDR); - - nand_probe(CFG_NAND2_ADDR); - if (nand_dev_desc[0].ChipID != NAND_ChipID_UNKNOWN) { - print_size(nand_dev_desc[0].totlen, "\n"); - } -#endif -} -#endif /* (CONFIG_COMMANDS & CFG_CMD_NAND) */ - int checkboard(void) { char *s = getenv("serial#"); diff --git a/board/amcc/bamboo/u-boot.lds b/board/amcc/bamboo/u-boot.lds index 176900ec2f..f6d7183199 100644 --- a/board/amcc/bamboo/u-boot.lds +++ b/board/amcc/bamboo/u-boot.lds @@ -68,19 +68,7 @@ SECTIONS cpu/ppc4xx/start.o (.text) board/amcc/bamboo/init.o (.text) - cpu/ppc4xx/kgdb.o (.text) - cpu/ppc4xx/traps.o (.text) - cpu/ppc4xx/interrupts.o (.text) - cpu/ppc4xx/serial.o (.text) - cpu/ppc4xx/cpu_init.o (.text) - cpu/ppc4xx/speed.o (.text) - common/dlmalloc.o (.text) - lib_generic/crc32.o (.text) - lib_ppc/extable.o (.text) - lib_generic/zlib.o (.text) - -/* . = env_offset;*/ -/* common/environment.o(.text)*/ + board/amcc/bamboo/bamboo.o (.text) *(.text) *(.fixup) diff --git a/board/amcc/sequoia/sdram.c b/board/amcc/sequoia/sdram.c index f8b837ed28..d045df1872 100644 --- a/board/amcc/sequoia/sdram.c +++ b/board/amcc/sequoia/sdram.c @@ -371,6 +371,14 @@ void denali_core_search_data_eye(unsigned long memory_size) } #endif /* CONFIG_DDR_DATA_EYE */ +#if defined(CONFIG_NAND_SPL) +/* Using cpu/ppc4xx/speed.c to calculate the bus frequency is too big + * for the 4k NAND boot image so define bus_frequency to 133MHz here + * which is save for the refresh counter setup. + */ +#define get_bus_freq(val) 133000000 +#endif + /************************************************************************* * * initdram -- 440EPx's DDR controller is a DENALI Core @@ -404,7 +412,7 @@ long int initdram (int board_type) mtsdram(DDR0_22, 0x00267F0B); mtsdram(DDR0_23, 0x00000000); mtsdram(DDR0_24, 0x01010002); - if (speed > 133333333) + if (speed > 133333334) mtsdram(DDR0_26, 0x5B26050C); else mtsdram(DDR0_26, 0x5B260408); diff --git a/board/cds/mpc8541cds/mpc8541cds.c b/board/cds/mpc8541cds/mpc8541cds.c index a42904cf73..4192324836 100644 --- a/board/cds/mpc8541cds/mpc8541cds.c +++ b/board/cds/mpc8541cds/mpc8541cds.c @@ -477,11 +477,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; static struct pci_controller hose[] = { diff --git a/board/cds/mpc8541cds/u-boot.lds b/board/cds/mpc8541cds/u-boot.lds index 1bea0074fa..dc87a122a1 100644 --- a/board/cds/mpc8541cds/u-boot.lds +++ b/board/cds/mpc8541cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) diff --git a/board/cds/mpc8548cds/init.S b/board/cds/mpc8548cds/init.S index 978bda5e4d..d468f5b618 100644 --- a/board/cds/mpc8548cds/init.S +++ b/board/cds/mpc8548cds/init.S @@ -64,8 +64,9 @@ tlb1_entry: /* * Number of TLB0 and TLB1 entries in the following table */ - .long 13 + .long (2f-1f)/16 +1: #if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) /* * TLB0 4K Non-cacheable, guarded @@ -134,7 +135,7 @@ tlb1_entry: /* * TLB 1: 256M Non-cacheable, guarded - * 0x80000000 256M PCI1 MEM First half + * 0x80000000 256M PCI1 MEM */ .long TLB1_MAS0(1, 1, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) @@ -143,40 +144,37 @@ tlb1_entry: /* * TLB 2: 256M Non-cacheable, guarded - * 0x90000000 256M PCI1 MEM Second half + * 0x90000000 256M PCI2 MEM */ .long TLB1_MAS0(1, 2, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000), + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000), + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) /* - * TLB 3: 256M Non-cacheable, guarded - * 0xa0000000 256M PCI2 MEM First half + * TLB 3: 1GB Non-cacheable, guarded + * 0xa0000000 256M PEX MEM First half + * 0xb0000000 256M PEX MEM Second half + * 0xc0000000 256M Rapid IO MEM First half + * 0xd0000000 256M Rapid IO MEM Second half */ .long TLB1_MAS0(1, 3, 0) - .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1G) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PEX_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PEX_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) /* - * TLB 4: 256M Non-cacheable, guarded - * 0xb0000000 256M PCI2 MEM Second half + * TLB 4: Reserved for future usage */ - .long TLB1_MAS0(1, 4, 0) - .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) - .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000), - 0,0,0,0,1,0,1,0) - .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000), - 0,0,0,0,0,1,0,1,0,1) /* * TLB 5: 64M Non-cacheable, guarded * 0xe000_0000 1M CCSRBAR - * 0xe200_0000 16M PCI1 IO - * 0xe300_0000 16M PCI2 IO + * 0xe200_0000 8M PCI1 IO + * 0xe280_0000 8M PCI2 IO + * 0xe300_0000 16M PEX IO */ .long TLB1_MAS0(1, 5, 0) .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) @@ -200,19 +198,22 @@ tlb1_entry: .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1M) .long TLB1_MAS2(E500_TLB_EPN(CADMUS_BASE_ADDR), 0,0,0,0,1,0,1,0) .long TLB1_MAS3(E500_TLB_RPN(CADMUS_BASE_ADDR), 0,0,0,0,0,1,0,1,0,1) - +2: entry_end /* * LAW(Local Access Window) configuration: * * 0x0000_0000 0x7fff_ffff DDR 2G - * 0x8000_0000 0x9fff_ffff PCI1 MEM 512M - * 0xa000_0000 0xbfff_ffff PCI2 MEM 512M + * 0x8000_0000 0x8fff_ffff PCI1 MEM 256M + * 0x9000_0000 0x9fff_ffff PCI2 MEM 256M + * 0xa000_0000 0xbfff_ffff PEX MEM 512M + * 0xc000_0000 0xdfff_ffff RapidIO 512M * 0xe000_0000 0xe000_ffff CCSR 1M - * 0xe200_0000 0xe20f_ffff PCI1 IO 1M - * 0xe210_0000 0xe21f_ffff PCI2 IO 1M - * 0xf000_0000 0xf7ff_ffff SDRAM 128M + * 0xe200_0000 0xe27f_ffff PCI1 IO 8M + * 0xe280_0000 0xe2ff_ffff PCI2 IO 8M + * 0xe300_0000 0xe3ff_ffff PEX IO 16M + * 0xf000_0000 0xf3ff_ffff SDRAM 64M * 0xf800_0000 0xf80f_ffff NVRAM/CADMUS (*) 1M * 0xff00_0000 0xff7f_ffff FLASH (2nd bank) 8M * 0xff80_0000 0xffff_ffff FLASH (boot bank) 8M @@ -229,27 +230,39 @@ tlb1_entry: #define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) #define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) -#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_256M)) #define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff) -#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_256M)) #define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_1M)) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_8M)) #define LAWBAR4 ((CFG_PCI2_IO_PHYS>>12) & 0xfffff) -#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_1M)) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_8M)) /* LBC window - maps 256M 0xf0000000 -> 0xffffffff */ #define LAWBAR5 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) +#define LAWBAR6 ((CFG_PEX_MEM_BASE>>12) & 0xfffff) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR7 ((CFG_PEX_IO_PHYS>>12) & 0xfffff) +#define LAWAR7 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +#define LAWBAR8 ((CFG_RIO_MEM_BASE>>12) & 0xfffff) +#define LAWAR8 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_512M)) + .section .bootpg, "ax" .globl law_entry law_entry: entry_start - .long 6 + .long (4f-3f)/8 +3: .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 - .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5,LAWBAR6,LAWAR6,LAWBAR7,LAWAR7 + .long LAWBAR8,LAWAR8 +4: entry_end diff --git a/board/cds/mpc8548cds/mpc8548cds.c b/board/cds/mpc8548cds/mpc8548cds.c index 7433ebf25b..929ff2e662 100644 --- a/board/cds/mpc8548cds/mpc8548cds.c +++ b/board/cds/mpc8548cds/mpc8548cds.c @@ -51,6 +51,7 @@ int checkboard (void) { volatile immap_t *immap = (immap_t *) CFG_CCSRBAR; volatile ccsr_gur_t *gur = &immap->im_gur; + volatile ccsr_local_ecm_t *ecm = &immap->im_local_ecm; /* PCI slot in USER bits CSR[6:7] by convention. */ uint pci_slot = get_pci_slot (); @@ -89,6 +90,12 @@ int checkboard (void) */ local_bus_init (); + /* + * Fix CPU2 errata: A core hang possible while executing a + * msync instruction and a snoopable transaction from an I/O + * master tagged to make quick forward progress is present. + */ + ecm->eebpcr |= (1 << 16); /* * Hack TSEC 3 and 4 IO voltages. @@ -303,11 +310,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; static struct pci_controller hose[] = { diff --git a/board/cds/mpc8548cds/u-boot.lds b/board/cds/mpc8548cds/u-boot.lds index 2c8fe9603d..c1f3495d75 100644 --- a/board/cds/mpc8548cds/u-boot.lds +++ b/board/cds/mpc8548cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) diff --git a/board/cds/mpc8555cds/mpc8555cds.c b/board/cds/mpc8555cds/mpc8555cds.c index d980ea6310..704bf03164 100644 --- a/board/cds/mpc8555cds/mpc8555cds.c +++ b/board/cds/mpc8555cds/mpc8555cds.c @@ -474,11 +474,14 @@ void dummy_func(struct pci_controller* hose, pci_dev_t dev, struct pci_config_ta static struct pci_config_table pci_mpc85xxcds_config_table[] = { {0x10e3, 0x0513, PCI_ANY_ID, 1, 3, PCI_ANY_ID, dummy_func, {0,0,0}}, {0x1106, 0x0686, PCI_ANY_ID, 1, 2, 0, mpc85xx_config_via, {0,0,0}}, - {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, mpc85xx_config_via_usbide, {0,0,0}}, + {0x1106, 0x0571, PCI_ANY_ID, 1, 2, 1, + mpc85xx_config_via_usbide, {0,0,0}}, {0x1105, 0x3038, PCI_ANY_ID, 1, 2, 2, mpc85xx_config_via_usb, {0,0,0}}, {0x1106, 0x3038, PCI_ANY_ID, 1, 2, 3, mpc85xx_config_via_usb2, {0,0,0}}, - {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, mpc85xx_config_via_power, {0,0,0}}, - {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}} + {0x1106, 0x3058, PCI_ANY_ID, 1, 2, 5, + mpc85xx_config_via_power, {0,0,0}}, + {0x1106, 0x3068, PCI_ANY_ID, 1, 2, 6, mpc85xx_config_via_ac97, {0,0,0}}, + {}, }; @@ -487,7 +490,7 @@ static struct pci_controller hose[] = { config_table: pci_mpc85xxcds_config_table, }, #ifdef CONFIG_MPC85XX_PCI2 - { } + {}, #endif }; diff --git a/board/cds/mpc8555cds/u-boot.lds b/board/cds/mpc8555cds/u-boot.lds index 2aa2ad78fc..9285928dc4 100644 --- a/board/cds/mpc8555cds/u-boot.lds +++ b/board/cds/mpc8555cds/u-boot.lds @@ -69,6 +69,7 @@ SECTIONS cpu/mpc85xx/interrupts.o (.text) cpu/mpc85xx/cpu_init.o (.text) cpu/mpc85xx/cpu.o (.text) + drivers/tsec.o (.text) cpu/mpc85xx/speed.o (.text) cpu/mpc85xx/pci.o (.text) common/dlmalloc.o (.text) diff --git a/board/freescale/mpc8544ds/Makefile b/board/freescale/mpc8544ds/Makefile new file mode 100644 index 0000000000..bec2168639 --- /dev/null +++ b/board/freescale/mpc8544ds/Makefile @@ -0,0 +1,58 @@ +# +# Copyright 2007 Freescale Semiconductor, Inc. +# (C) Copyright 2001-2006 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk + +# ifneq ($(OBJTREE),$(SRCTREE)) +# $(shell mkdir -p $(obj)./common) +# endif + +LIB = $(obj)lib$(BOARD).a + +COBJS := $(BOARD).o \ + ../common/pixis.o + +SOBJS := init.o + +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) crv $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +# defines $(obj).depend target +include $(SRCTREE)/rules.mk + +sinclude $(obj).depend + +######################################################################### diff --git a/board/freescale/mpc8544ds/config.mk b/board/freescale/mpc8544ds/config.mk new file mode 100644 index 0000000000..85663ef02b --- /dev/null +++ b/board/freescale/mpc8544ds/config.mk @@ -0,0 +1,32 @@ +# +# Copyright 2007 Freescale Semiconductor, Inc. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# mpc8544ds board +# +ifndef TEXT_BASE +TEXT_BASE = 0xfff80000 +endif + +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC8544=1 diff --git a/board/freescale/mpc8544ds/init.S b/board/freescale/mpc8544ds/init.S new file mode 100644 index 0000000000..296fee5e60 --- /dev/null +++ b/board/freescale/mpc8544ds/init.S @@ -0,0 +1,243 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <ppc_asm.tmpl> +#include <ppc_defs.h> +#include <asm/cache.h> +#include <asm/mmu.h> +#include <config.h> +#include <mpc85xx.h> + +#define LAWAR_TRGT_PCI1 0x00000000 +#define LAWAR_TRGT_PCIE1 0x00200000 +#define LAWAR_TRGT_PCIE2 0x00100000 +#define LAWAR_TRGT_PCIE3 0x00300000 +#define LAWAR_TRGT_LBC 0x00400000 +#define LAWAR_TRGT_DDR 0x00f00000 + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ + +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long (2f-1f)/16 +1: + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB0 16K Cacheable, guarded + * Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + + /* + * TLB 0: 64M Non-cacheable, guarded + * 0xfc000000 64M Covers FLASH at 0xFE800000 and 0xFF800000 + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_BOOT_BLOCK), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_BOOT_BLOCK), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 1: 1G Non-cacheable, guarded + * 0x80000000 1G PCIE 8,9,a,b + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1G) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCIE_PHYS), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCIE_PHYS), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 2: 256M Non-cacheable, guarded + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI_PHYS), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI_PHYS), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 3: 256M Non-cacheable, guarded + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI_PHYS + 0x10000000), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI_PHYS + 0x10000000), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 4: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe100_0000 255M PCI IO range + */ + .long TLB1_MAS0(1, 4, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + +#ifdef CFG_LBC_CACHE_BASE + /* + * TLB 5: 64M Cacheable, non-guarded + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_CACHE_BASE), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_CACHE_BASE), 0,0,0,0,0,1,0,1,0,1) +#endif + /* + * TLB 6: 64M Non-cacheable, guarded + * 0xf8000000 64M PIXIS 0xF8000000 - 0xFBFFFFFF + */ + .long TLB1_MAS0(1, 6, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_NONCACHE_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_NONCACHE_BASE), 0,0,0,0,0,1,0,1,0,1) +2: + entry_end + +/* + * LAW(Local Access Window) configuration: + * + * + * Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + * + * LAW 0 is reserved for boot mapping + */ + + .section .bootpg, "ax" + .globl law_entry +law_entry: + entry_start + + .long (4f-3f)/8 +3: + .long 0 + .long (LAWAR_TRGT_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN + + .long (CFG_PCI1_MEM_BASE>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M) + + .long (CFG_PCI1_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M) + + .long (CFG_LBC_CACHE_BASE>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M) + + .long (CFG_PCIE1_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE1 | (LAWAR_SIZE & LAWAR_SIZE_256M) + + /* To keep to 10 LAWs, PCIE1_IO_PHYS must use top of mem region */ + + .long (CFG_PCIE2_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE2 | (LAWAR_SIZE & LAWAR_SIZE_512M) + + .long (CFG_PCIE2_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE2 | (LAWAR_SIZE & LAWAR_SIZE_16M) + + .long (CFG_PCIE3_MEM_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE3 | (LAWAR_SIZE & LAWAR_SIZE_256M) + + .long (CFG_PCIE3_IO_PHYS>>12) & 0xfffff + .long LAWAR_EN | LAWAR_TRGT_PCIE3 | (LAWAR_SIZE & LAWAR_SIZE_16M) +4: + entry_end diff --git a/board/freescale/mpc8544ds/mpc8544ds.c b/board/freescale/mpc8544ds/mpc8544ds.c new file mode 100644 index 0000000000..4ff1da9301 --- /dev/null +++ b/board/freescale/mpc8544ds/mpc8544ds.c @@ -0,0 +1,201 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <common.h> +#include <command.h> +#include <asm/processor.h> +#include <asm/immap_85xx.h> +#include <spd.h> +#include <miiphy.h> + +#include "../common/pixis.h" + +#if defined(CONFIG_OF_FLAT_TREE) +#include <ft_build.h> +extern void ft_cpu_setup(void *blob, bd_t *bd); +#endif + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +extern void ddr_enable_ecc(unsigned int dram_size); +#endif + +extern long int spd_sdram(void); + +void sdram_init(void); + +int board_early_init_f (void) +{ + return 0; +} + +int checkboard (void) +{ + volatile immap_t *immap = (immap_t *) CFG_CCSRBAR; + volatile ccsr_gur_t *gur = &immap->im_gur; + + if ((uint)&gur->porpllsr != 0xe00e0000) { + printf("immap size error %x\n",&gur->porpllsr); + } + printf ("Board: MPC8544DS\n"); + + return 0; +} + +long int +initdram(int board_type) +{ + long dram_size = 0; + + puts("Initializing\n"); + + dram_size = spd_sdram(); + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) + /* + * Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + puts(" DDR: "); + return dram_size; +} + +#if defined(CFG_DRAM_TEST) +int +testdram(void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("Testing DRAM from 0x%08x to 0x%08x\n", + CFG_MEMTEST_START, + CFG_MEMTEST_END); + + printf("DRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test passed.\n"); + return 0; +} +#endif + +int last_stage_init(void) +{ + return 0; +} + + +unsigned long +get_board_sys_clk(ulong dummy) +{ + u8 i, go_bit, rd_clks; + ulong val = 0; + + go_bit = in8(PIXIS_BASE + PIXIS_VCTL); + go_bit &= 0x01; + + rd_clks = in8(PIXIS_BASE + PIXIS_VCFGEN0); + rd_clks &= 0x1C; + + /* + * Only if both go bit and the SCLK bit in VCFGEN0 are set + * should we be using the AUX register. Remember, we also set the + * GO bit to boot from the alternate bank on the on-board flash + */ + + if (go_bit) { + if (rd_clks == 0x1c) + i = in8(PIXIS_BASE + PIXIS_AUX); + else + i = in8(PIXIS_BASE + PIXIS_SPD); + } else { + i = in8(PIXIS_BASE + PIXIS_SPD); + } + + i &= 0x07; + + switch (i) { + case 0: + val = 33333333; + break; + case 1: + val = 40000000; + break; + case 2: + val = 50000000; + break; + case 3: + val = 66666666; + break; + case 4: + val = 83000000; + break; + case 5: + val = 100000000; + break; + case 6: + val = 133333333; + break; + case 7: + val = 166666666; + break; + } + + return val; +} + +#if defined(CONFIG_OF_FLAT_TREE) && defined(CONFIG_OF_BOARD_SETUP) +void +ft_board_setup(void *blob, bd_t *bd) +{ + u32 *p; + int len; + + ft_cpu_setup(blob, bd); + + p = ft_get_prop(blob, "/memory/reg", &len); + if (p != NULL) { + *p++ = cpu_to_be32(bd->bi_memstart); + *p = cpu_to_be32(bd->bi_memsize); + } +} +#endif diff --git a/board/freescale/mpc8544ds/u-boot.lds b/board/freescale/mpc8544ds/u-boot.lds new file mode 100644 index 0000000000..1a8aaa9057 --- /dev/null +++ b/board/freescale/mpc8544ds/u-boot.lds @@ -0,0 +1,148 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ +SECTIONS +{ + .resetvec 0xFFFFFFFC : + { + *(.resetvec) + } = 0xffff + + .bootpg 0xFFFFF000 : + { + cpu/mpc85xx/start.o (.bootpg) + board/freescale/mpc8544ds/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/freescale/mpc8544ds/init.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} diff --git a/board/ixdp425/config.mk b/board/ixdp425/config.mk index d49c0e7e6d..ecff8d7415 100644 --- a/board/ixdp425/config.mk +++ b/board/ixdp425/config.mk @@ -1,4 +1,2 @@ +# TEXT_BASE = 0x00f80000 - -# include NPE ethernet driver -BOARDLIBS = $(obj)cpu/ixp/npe/libnpe.a diff --git a/board/mpc8540ads/init.S b/board/mpc8540ads/init.S index 242cb9fbc1..544fde94c4 100644 --- a/board/mpc8540ads/init.S +++ b/board/mpc8540ads/init.S @@ -260,8 +260,8 @@ tlb1_entry: #define LAWBAR2 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) -#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_16M)) +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_1M)) /* * Rapid IO at 0xc000_0000 for 512 M diff --git a/board/mpc8560ads/init.S b/board/mpc8560ads/init.S index 242cb9fbc1..544fde94c4 100644 --- a/board/mpc8560ads/init.S +++ b/board/mpc8560ads/init.S @@ -260,8 +260,8 @@ tlb1_entry: #define LAWBAR2 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) -#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff) -#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_16M)) +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCIX | (LAWAR_SIZE & LAWAR_SIZE_1M)) /* * Rapid IO at 0xc000_0000 for 512 M diff --git a/board/mpc8568mds/Makefile b/board/mpc8568mds/Makefile new file mode 100644 index 0000000000..a799aa4cc5 --- /dev/null +++ b/board/mpc8568mds/Makefile @@ -0,0 +1,58 @@ +# +# Copyright 2004-2007 Freescale Semiconductor. +# (C) Copyright 2001-2006 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk +ifneq ($(OBJTREE),$(SRCTREE)) +$(shell mkdir -p $(obj)../common) +endif + +LIB = $(obj)lib$(BOARD).a + +COBJS := $(BOARD).o \ + bcsr.o \ + ft_board.o + +SOBJS := init.o + +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) $(ARFLAGS) $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +# defines $(obj).depend target +include $(SRCTREE)/rules.mk + +sinclude $(obj).depend + +######################################################################### diff --git a/board/mpc8568mds/bcsr.c b/board/mpc8568mds/bcsr.c new file mode 100644 index 0000000000..2e2e8cd18f --- /dev/null +++ b/board/mpc8568mds/bcsr.c @@ -0,0 +1,49 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <common.h> +#include "bcsr.h" + +void enable_8568mds_duart() +{ + volatile uint* duart_mux = (uint *)(CFG_CCSRBAR + 0xe0060); + volatile uint* devices = (uint *)(CFG_CCSRBAR + 0xe0070); + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + *duart_mux = 0x80000000; /* Set the mux to Duart on PMUXCR */ + *devices = 0; /* Enable all peripheral devices */ + bcsr[5] |= 0x01; /* Enable Duart in BCSR*/ +} + +void enable_8568mds_flash_write() +{ + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + bcsr[9] |= 0x01; +} + +void disable_8568mds_flash_write() +{ + volatile u8 *bcsr = (u8 *)(CFG_BCSR); + + bcsr[9] &= ~(0x01); +} diff --git a/board/mpc8568mds/bcsr.h b/board/mpc8568mds/bcsr.h new file mode 100644 index 0000000000..8d4cb2f141 --- /dev/null +++ b/board/mpc8568mds/bcsr.h @@ -0,0 +1,99 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#ifndef __BCSR_H_ +#define __BCSR_H_ + +#include <common.h> + +/* BCSR Bit definitions + * BCSR 0 * + 0:3 ccb sys pll + 4:6 cfg core pll + 7 cfg boot seq + + * BCSR 1 * + 0:2 cfg rom lock + 3:5 cfg host agent + 6 PCI IO + 7 cfg RIO size + + * BCSR 2 * + 0:4 QE PLL + 5 QE clock + 6 cfg PCI arbiter + + * BCSR 3 * + 0 TSEC1 reduce + 1 TSEC2 reduce + 2:3 TSEC1 protocol + 4:5 TSEC2 protocol + 6 PHY1 slave + 7 PHY2 slave + + * BCSR 4 * + 4 clock enable + 5 boot EPROM + 6 GETH transactive reset + 7 BRD write potect + + * BCSR 5 * + 1:3 Leds 1-3 + 4 UPC1 enable + 5 UPC2 enable + 6 UPC2 pos + 7 RS232 enable + + * BCSR 6 * + 0 CFG ver 0 + 1 CFG ver 1 + 6 Register config led + 7 Power on reset + + * BCSR 7 * + 2 board host mode indication + 5 enable TSEC1 PHY + 6 enable TSEC2 PHY + + * BCSR 8 * + 0 UCC GETH1 enable + 1 UCC GMII enable + 3 UCC TBI enable + 5 UCC MII enable + 7 Real time clock reset + + * BCSR 9 * + 0 UCC2 GETH enable + 1 UCC2 GMII enable + 3 UCC2 TBI enable + 5 UCC2 MII enable + 6 Ready only - indicate flash ready after burning + 7 Flash write protect +*/ + +/*BCSR Utils functions*/ + +void enable_8568mds_duart(void); +void enable_8568mds_flash_write(void); +void disable_8568mds_flash_write(void); + +#endif /* __BCSR_H_ */ diff --git a/board/mpc8568mds/config.mk b/board/mpc8568mds/config.mk new file mode 100644 index 0000000000..021522cafc --- /dev/null +++ b/board/mpc8568mds/config.mk @@ -0,0 +1,30 @@ +# +# Copyright 2007 Freescale Semiconductor. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# mpc8568mds board +# +TEXT_BASE = 0xfff80000 + +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_MPC8568=1 diff --git a/board/mpc8568mds/ft_board.c b/board/mpc8568mds/ft_board.c new file mode 100644 index 0000000000..36815ccfbb --- /dev/null +++ b/board/mpc8568mds/ft_board.c @@ -0,0 +1,45 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <common.h> + +#include <ft_build.h> + +extern void ft_cpu_setup(void *blob, bd_t *bd); + +#if defined(CONFIG_OF_FLAT_TREE) && defined(CONFIG_OF_BOARD_SETUP) +void +ft_board_setup(void *blob, bd_t *bd) +{ + u32 *p; + int len; +#ifdef CONFIG_PCI + ft_pci_setup(blob, bd); +#endif + ft_cpu_setup(blob, bd); + p = ft_get_prop(blob, "/memory/reg", &len); + if (p != NULL) { + *p++ = cpu_to_be32(bd->bi_memstart); + *p = cpu_to_be32(bd->bi_memsize); + } +} +#endif /* CONFIG_OF_FLAT_TREE && CONFIG_OF_BOARD_SETUP */ diff --git a/board/mpc8568mds/init.S b/board/mpc8568mds/init.S new file mode 100644 index 0000000000..0d879821e3 --- /dev/null +++ b/board/mpc8568mds/init.S @@ -0,0 +1,258 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * Copyright 2002,2003, Motorola Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <ppc_asm.tmpl> +#include <ppc_defs.h> +#include <asm/cache.h> +#include <asm/mmu.h> +#include <config.h> +#include <mpc85xx.h> + + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long (2f-1f)/16 + +1: +#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) +#else +#error("Update the number of table entries in tlb1_entry") +#endif + + /* + * TLB0 16K Cacheable, non-guarded + * 0xd001_0000 16K Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), + 0,0,0,0,0,1,0,1,0,1) + + /* TLB 1 Initializations */ + /* + * TLBe 0: 16M Non-cacheable, guarded + * 0xff000000 16M FLASH (upper half) + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE + 0x1000000), + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE + 0x1000000), + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 1: 16M Non-cacheable, guarded + * 0xfe000000 16M FLASH (lower half) + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 2: 256M Non-cacheable, guarded + * 0x80000000 256M PCI1 MEM + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 3: 256M Non-cacheable, guarded + * 0xa0000000 256M PCIe Mem + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PEX_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PEX_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 4: Reserved for future usage + */ + + /* + * TLBe 5: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe200_0000 8M PCI1 IO + * 0xe280_0000 8M PCIe IO + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 6: 64M Cacheable, non-guarded + * 0xf000_0000 64M LBC SDRAM + */ + .long TLB1_MAS0(1, 6, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLBe 7: 256K Non-cacheable, guarded + * 0xf8000000 32K BCSR + * 0xf8008000 32K PIB (CS4) + * 0xf8010000 32K PIB (CS5) + */ + .long TLB1_MAS0(1, 7, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256K) + .long TLB1_MAS2(E500_TLB_EPN(CFG_BCSR_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_BCSR_BASE), 0,0,0,0,0,1,0,1,0,1) + +2: + entry_end + +/* + * LAW(Local Access Window) configuration: + * + *0) 0x0000_0000 0x7fff_ffff DDR 2G + *1) 0x8000_0000 0x9fff_ffff PCI1 MEM 256MB + *2) 0xa000_0000 0xbfff_ffff PCIe MEM 256MB + *5) 0xc000_0000 0xdfff_ffff SRIO 256MB + *-) 0xe000_0000 0xe00f_ffff CCSR 1M + *3) 0xe200_0000 0xe27f_ffff PCI1 I/O 8M + *4) 0xe280_0000 0xe2ff_ffff PCIe I/0 8M + *6.a) 0xf000_0000 0xf3ff_ffff SDRAM 64MB + *6.b) 0xf800_0000 0xf800_7fff BCSR 32KB + *6.c) 0xf800_8000 0xf800_ffff PIB (CS4) 32KB + *6.d) 0xf801_0000 0xf801_7fff PIB (CS5) 32KB + *6.e) 0xfe00_0000 0xffff_ffff Flash 32MB + * + *Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + * + * The defines below are 1-off of the actual LAWAR0 usage. + * So LAWAR3 define uses the LAWAR4 register in the ECM. + */ + +#define LAWBAR0 0 +#define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) + +#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +#define LAWBAR2 ((CFG_PEX_MEM_BASE>>12) & 0xfffff) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_8M)) + +#define LAWBAR4 ((CFG_PEX_IO_PHYS>>12) & 0xfffff) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PEX | (LAWAR_SIZE & LAWAR_SIZE_16M)) + + +#define LAWBAR5 ((CFG_SRIO_MEM_BASE>>12) & 0xfffff) +#define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_256M)) + +/* LBC window - maps 256M. That's SDRAM, BCSR, PIBs, and Flash */ +#define LAWBAR6 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) + + .section .bootpg, "ax" + .globl law_entry + +law_entry: + entry_start + .long (4f-3f)/8 +3: + .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5,LAWBAR6,LAWAR6 +4: + entry_end diff --git a/board/mpc8568mds/mpc8568mds.c b/board/mpc8568mds/mpc8568mds.c new file mode 100644 index 0000000000..9c7960d47e --- /dev/null +++ b/board/mpc8568mds/mpc8568mds.c @@ -0,0 +1,288 @@ +/* + * Copyright 2007 Freescale Semiconductor. + * + * (C) Copyright 2002 Scott McNutt <smcnutt@artesyncp.com> + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <common.h> +#include <pci.h> +#include <asm/processor.h> +#include <asm/immap_85xx.h> +#include <spd.h> + +#include "bcsr.h" + + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +extern void ddr_enable_ecc(unsigned int dram_size); +#endif + +extern long int spd_sdram(void); + +void local_bus_init(void); +void sdram_init(void); + +int board_early_init_f (void) +{ + /* + * Initialize local bus. + */ + local_bus_init (); + + enable_8568mds_duart(); + enable_8568mds_flash_write(); + + return 0; +} + +int checkboard (void) +{ + printf ("Board: 8568 MDS\n"); + + return 0; +} + +long int +initdram(int board_type) +{ + long dram_size = 0; + volatile immap_t *immap = (immap_t *)CFG_IMMR; + + puts("Initializing\n"); + +#if defined(CONFIG_DDR_DLL) + { + /* + * Work around to stabilize DDR DLL MSYNC_IN. + * Errata DDR9 seems to have been fixed. + * This is now the workaround for Errata DDR11: + * Override DLL = 1, Course Adj = 1, Tap Select = 0 + */ + + volatile ccsr_gur_t *gur= &immap->im_gur; + + gur->ddrdllcr = 0x81000000; + asm("sync;isync;msync"); + udelay(200); + } +#endif + dram_size = spd_sdram(); + +#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) + /* + * Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + /* + * SDRAM Initialization + */ + sdram_init(); + + puts(" DDR: "); + return dram_size; +} + +/* + * Initialize Local Bus + */ +void +local_bus_init(void) +{ + volatile immap_t *immap = (immap_t *)CFG_IMMR; + volatile ccsr_gur_t *gur = &immap->im_gur; + volatile ccsr_lbc_t *lbc = &immap->im_lbc; + + uint clkdiv; + uint lbc_hz; + sys_info_t sysinfo; + + get_sys_info(&sysinfo); + clkdiv = (lbc->lcrr & 0x0f) * 2; + lbc_hz = sysinfo.freqSystemBus / 1000000 / clkdiv; + + gur->lbiuiplldcr1 = 0x00078080; + if (clkdiv == 16) { + gur->lbiuiplldcr0 = 0x7c0f1bf0; + } else if (clkdiv == 8) { + gur->lbiuiplldcr0 = 0x6c0f1bf0; + } else if (clkdiv == 4) { + gur->lbiuiplldcr0 = 0x5c0f1bf0; + } + + lbc->lcrr |= 0x00030000; + + asm("sync;isync;msync"); +} + +/* + * Initialize SDRAM memory on the Local Bus. + */ +void +sdram_init(void) +{ +#if defined(CFG_OR2_PRELIM) && defined(CFG_BR2_PRELIM) + + uint idx; + volatile immap_t *immap = (immap_t *)CFG_IMMR; + volatile ccsr_lbc_t *lbc = &immap->im_lbc; + uint *sdram_addr = (uint *)CFG_LBC_SDRAM_BASE; + uint lsdmr_common; + + puts(" SDRAM: "); + + print_size (CFG_LBC_SDRAM_SIZE * 1024 * 1024, "\n"); + + /* + * Setup SDRAM Base and Option Registers + */ + lbc->or2 = CFG_OR2_PRELIM; + asm("msync"); + + lbc->br2 = CFG_BR2_PRELIM; + asm("msync"); + + lbc->lbcr = CFG_LBC_LBCR; + asm("msync"); + + + lbc->lsrt = CFG_LBC_LSRT; + lbc->mrtpr = CFG_LBC_MRTPR; + asm("msync"); + + /* + * MPC8568 uses "new" 15-16 style addressing. + */ + lsdmr_common = CFG_LBC_LSDMR_COMMON; + lsdmr_common |= CFG_LBC_LSDMR_BSMA1516; + + /* + * Issue PRECHARGE ALL command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_PCHALL; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + + /* + * Issue 8 AUTO REFRESH commands. + */ + for (idx = 0; idx < 8; idx++) { + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_ARFRSH; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + } + + /* + * Issue 8 MODE-set command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_MRW; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(100); + + /* + * Issue NORMAL OP command. + */ + lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_NORMAL; + asm("sync;msync"); + *sdram_addr = 0xff; + ppcDcbf((unsigned long) sdram_addr); + udelay(200); /* Overkill. Must wait > 200 bus cycles */ + +#endif /* enable SDRAM init */ +} + +#if defined(CFG_DRAM_TEST) +int +testdram(void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("Testing DRAM from 0x%08x to 0x%08x\n", + CFG_MEMTEST_START, + CFG_MEMTEST_END); + + printf("DRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("DRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("DRAM test passed.\n"); + return 0; +} +#endif + +#if defined(CONFIG_PCI) +#ifndef CONFIG_PCI_PNP +static struct pci_config_table pci_mpc8568mds_config_table[] = { + { + PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, + pci_cfgfunc_config_device, + {PCI_ENET0_IOADDR, + PCI_ENET0_MEMADDR, + PCI_COMMON_MEMORY | PCI_COMMAND_MASTER} + }, + {} +}; +#endif + +static struct pci_controller hose[] = { +#ifndef CONFIG_PCI_PNP + { config_table: pci_mpc8568mds_config_table,}, +#endif +#ifdef CONFIG_MPC85XX_PCI2 + {}, +#endif +}; + +#endif /* CONFIG_PCI */ + +void +pci_init_board(void) +{ +#ifdef CONFIG_PCI + pci_mpc85xx_init(&hose); +#endif +} diff --git a/board/mpc8568mds/u-boot.lds b/board/mpc8568mds/u-boot.lds new file mode 100644 index 0000000000..71099f6f13 --- /dev/null +++ b/board/mpc8568mds/u-boot.lds @@ -0,0 +1,152 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ + +SECTIONS +{ + /* ELIOR - From RAM: From FLASH: 0xFFFFFFFC*/ + .resetvec 0xFFFFFFFC: + { + *(.resetvec) + } = 0xffff + + /*(ELIOR - From RAM: From FLASH: 0xFFFFF000*/ + .bootpg 0xFFFFF000: + { + cpu/mpc85xx/start.o (.bootpg) + board/mpc8568mds/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/mpc8568mds/init.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + cpu/mpc85xx/pci.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} diff --git a/board/mpc8641hpcn/init.S b/board/mpc8641hpcn/init.S index 6b3e2d275d..cb21ba6a75 100644 --- a/board/mpc8641hpcn/init.S +++ b/board/mpc8641hpcn/init.S @@ -59,7 +59,7 @@ #define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) #define LAWBAR3 ((CFG_PCI2_MEM_BASE>>12) & 0xffffff) -#define LAWAR3 (~LAWAR_EN & (LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M))) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) /* * This is not so much the SDRAM map as it is the whole localbus map. @@ -67,11 +67,11 @@ #define LAWBAR4 ((0xf8100000>>12) & 0xffffff) #define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_2M)) -#define LAWBAR5 ((CFG_PCI1_IO_BASE>>12) & 0xffffff) +#define LAWBAR5 ((CFG_PCI1_IO_PHYS>>12) & 0xffffff) #define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M)) -#define LAWBAR6 ((CFG_PCI2_IO_BASE>>12) & 0xffffff) -#define LAWAR6 (~LAWAR_EN &( LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M))) +#define LAWBAR6 ((CFG_PCI2_IO_PHYS>>12) & 0xffffff) +#define LAWAR6 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M)) #define LAWBAR7 ((0xfe000000 >>12) & 0xffffff) #define LAWAR7 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_32M)) @@ -84,7 +84,7 @@ #define LAWAR8 ((LAWAR_TRGT_IF_DDR2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) & ~LAWAR_EN) #endif -#define LAWBAR9 ((CFG_RIO_MEM_BASE>>12) & 0xfffff) +#define LAWBAR9 ((CFG_RIO_MEM_PHYS>>12) & 0xfffff) #define LAWAR9 (LAWAR_EN | LAWAR_TRGT_IF_RIO | (LAWAR_SIZE & LAWAR_SIZE_512M)) .section .bootpg, "ax" diff --git a/board/prodrive/pdnb3/config.mk b/board/prodrive/pdnb3/config.mk index 767075884a..51dee86ae5 100644 --- a/board/prodrive/pdnb3/config.mk +++ b/board/prodrive/pdnb3/config.mk @@ -1,4 +1,2 @@ +# TEXT_BASE = 0x01f00000 - -# include NPE ethernet driver -BOARDLIBS = $(obj)cpu/ixp/npe/libnpe.a diff --git a/board/stxssa/Makefile b/board/stxssa/Makefile new file mode 100644 index 0000000000..344ecdfd79 --- /dev/null +++ b/board/stxssa/Makefile @@ -0,0 +1,51 @@ +# +# (C) Copyright 2001 +# Wolfgang Denk, DENX Software Engineering, wd@denx.de. +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +include $(TOPDIR)/config.mk + +LIB = $(obj)lib$(BOARD).a + +COBJS := $(BOARD).o +SOBJS := init.o + +SRCS := $(SOBJS:.o=.S) $(COBJS:.o=.c) +OBJS := $(addprefix $(obj),$(COBJS)) +SOBJS := $(addprefix $(obj),$(SOBJS)) + +$(LIB): $(obj).depend $(OBJS) $(SOBJS) + $(AR) $(ARFLAGS) $@ $(OBJS) + +clean: + rm -f $(OBJS) $(SOBJS) + +distclean: clean + rm -f $(LIB) core *.bak .depend + +######################################################################### + +# defines $(obj).depend target +include $(SRCTREE)/rules.mk + +sinclude $(obj).depend + +######################################################################### diff --git a/board/stxssa/config.mk b/board/stxssa/config.mk new file mode 100644 index 0000000000..30f42c53aa --- /dev/null +++ b/board/stxssa/config.mk @@ -0,0 +1,34 @@ +# Modified by Xianghua Xiao, X.Xiao@motorola.com +# (C) Copyright 2002,2003 Motorola Inc. +# +# Copied from ADS85xx for STx GP3 - Dan Malek +# +# See file CREDITS for list of people who contributed to this +# project. +# +# This program is free software; you can redistribute it and/or +# modify it under the terms of the GNU General Public License as +# published by the Free Software Foundation; either version 2 of +# the License, or (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place, Suite 330, Boston, +# MA 02111-1307 USA +# + +# +# default CCARBAR is at 0xff700000 +# assume U-Boot is less than 0.5MB +# U-Boot is less than 256K, so push +# it further up into the flash +# +TEXT_BASE = 0xfffC0000 + +PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1 +PLATFORM_CPPFLAGS += -DCONFIG_E500=1 diff --git a/board/stxssa/init.S b/board/stxssa/init.S new file mode 100644 index 0000000000..a1a8d9e0cb --- /dev/null +++ b/board/stxssa/init.S @@ -0,0 +1,256 @@ +/* + * Copyright (C) 2005 Embedded Alley Solutions, Inc. + * Dan Malek <dan@embeddedalley.com> + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA. We only support 32-bit flash + * and DDR with SPD EEPROM configuration. + * + * Copyright 2004 Freescale Semiconductor. + * Copyright (C) 2002,2003, Motorola Inc. + * Xianghua Xiao <X.Xiao@motorola.com> + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +#include <ppc_asm.tmpl> +#include <ppc_defs.h> +#include <asm/cache.h> +#include <asm/mmu.h> +#include <config.h> +#include <mpc85xx.h> + + +/* + * TLB0 and TLB1 Entries + * + * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR. + * However, CCSRBAR is then relocated to CFG_CCSRBAR right after + * these TLB entries are established. + * + * The TLB entries for DDR are dynamically setup in spd_sdram() + * and use TLB1 Entries 8 through 15 as needed according to the + * size of DDR memory. + * + * MAS0: tlbsel, esel, nv + * MAS1: valid, iprot, tid, ts, tsize + * MAS2: epn, sharen, x0, x1, w, i, m, g, e + * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr + */ + +#define entry_start \ + mflr r1 ; \ + bl 0f ; + +#define entry_end \ +0: mflr r0 ; \ + mtlr r1 ; \ + blr ; + + + .section .bootpg, "ax" + .globl tlb1_entry +tlb1_entry: + entry_start + + /* + * Number of TLB0 and TLB1 entries in the following table + */ + .long 12 + +#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR) + /* + * TLB0 4K Non-cacheable, guarded + * 0xff700000 4K Initial CCSRBAR mapping + * + * This ends up at a TLB0 Index==0 entry, and must not collide + * with other TLB0 Entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1) +#else +#error("Update the number of table entries in tlb1_entry") +#endif + + /* + * TLB0 16K Cacheable, non-guarded + * 0xd001_0000 16K Temporary Global data for initialization + * + * Use four 4K TLB0 entries. These entries must be cacheable + * as they provide the bootstrap memory before the memory + * controler and real memory have been configured. + * + * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c, + * and must not collide with other TLB0 entries. + */ + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + .long TLB1_MAS0(0, 0, 0) + .long TLB1_MAS1(1, 0, 0, 0, 0) + .long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024), \ + 0,0,0,0,0,0,0,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024), \ + 0,0,0,0,0,1,0,1,0,1) + + + /* + * TLB 0: 64M Non-cacheable, guarded + * 0xfc000000 6M4 FLASH + * Out of reset this entry is only 4K. + */ + .long TLB1_MAS0(1, 0, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 1: 256M Non-cacheable, guarded + * 0x80000000 256M PCI1 MEM First half + */ + .long TLB1_MAS0(1, 1, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 2: 256M Non-cacheable, guarded + * 0x90000000 256M PCI1 MEM Second half + */ + .long TLB1_MAS0(1, 2, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000), \ + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000), \ + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 3: 256M Non-cacheable, guarded + * 0xa0000000 256M PCI2 MEM First half + */ + .long TLB1_MAS0(1, 3, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 4: 256M Non-cacheable, guarded + * 0xb0000000 256M PCI2 MEM Second half + */ + .long TLB1_MAS0(1, 4, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000), \ + 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000), \ + 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 5: 64M Non-cacheable, guarded + * 0xe000_0000 1M CCSRBAR + * 0xe200_0000 16M PCI1 IO + * 0xe300_0000 16M PCI2 IO + */ + .long TLB1_MAS0(1, 5, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1) + + /* + * TLB 6: 256M Non-cacheable, guarded + * 0xf0000000 Local bus expansion option. + * 0xfb000000 Configuration Latch register (one word) + * 0xfc000000 Up to 64M flash + */ + .long TLB1_MAS0(1, 7, 0) + .long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M) + .long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_OPTION_BASE), 0,0,0,0,1,0,1,0) + .long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_OPTION_BASE), 0,0,0,0,0,1,0,1,0,1) + entry_end + +/* + * LAW(Local Access Window) configuration: + * + * 0x0000_0000 0x7fff_ffff DDR 2G + * 0x8000_0000 0x9fff_ffff PCI1 MEM 512M + * 0xa000_0000 0xbfff_ffff PCI2 MEM 512M + * 0xe000_0000 0xe000_ffff CCSR 1M + * 0xe200_0000 0xe2ff_ffff PCI1 IO 16M + * 0xe300_0000 0xe3ff_ffff PCI2 IO 16M + * 0xf000_0000 0xfaff_ffff Local bus 128M + * 0xfb00_0000 0xfb00_ffff Config Latch 64K + * 0xfc00_0000 0xffff_ffff FLASH (boot bank) 64M + * + * Notes: + * CCSRBAR and L2-as-SRAM don't need a configured Local Access Window. + * If flash is 8M at default position (last 8M), no LAW needed. + */ + +#if !defined(CONFIG_SPD_EEPROM) +#define LAWBAR0 ((CFG_DDR_SDRAM_BASE>>12) & 0xfffff) +#define LAWAR0 (LAWAR_EN | LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) +#else +#define LAWBAR0 0 +#define LAWAR0 ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN) +#endif + +#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff) +#define LAWAR1 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff) +#define LAWAR2 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M)) + +#define LAWBAR3 ((CFG_PCI1_IO_PHYS>>12) & 0xfffff) +#define LAWAR3 (LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +#define LAWBAR4 ((CFG_PCI2_IO_PHYS>>12) & 0xfffff) +#define LAWAR4 (LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M)) + +/* Map the whole localbus, including flash and reset latch. +*/ +#define LAWBAR5 ((CFG_LBC_OPTION_BASE>>12) & 0xfffff) +#define LAWAR5 (LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M)) + + + .section .bootpg, "ax" + .globl law_entry +law_entry: + entry_start + .long 6 + .long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3 + .long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5 + entry_end diff --git a/board/stxssa/stxssa.c b/board/stxssa/stxssa.c new file mode 100644 index 0000000000..0fb233d818 --- /dev/null +++ b/board/stxssa/stxssa.c @@ -0,0 +1,398 @@ +/* + * (C) Copyright 2005, Embedded Alley Solutions, Inc. + * Dan Malek, <dan@embeddedalley.com> + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA + * + * (C) Copyright 2003,Motorola Inc. + * Xianghua Xiao, (X.Xiao@motorola.com) + * + * (C) Copyright 2002 Scott McNutt <smcnutt@artesyncp.com> + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + + +extern long int spd_sdram (void); + +#include <common.h> +#include <pci.h> +#include <asm/processor.h> +#include <asm/immap_85xx.h> +#include <ioports.h> +#include <asm/io.h> +#include <spd.h> +#include <miiphy.h> + +long int fixed_sdram (void); + +/* + * I/O Port configuration table + * + * if conf is 1, then that port pin will be configured at boot time + * according to the five values podr/pdir/ppar/psor/pdat for that entry + */ + +const iop_conf_t iop_conf_tab[4][32] = { + + /* Port A configuration */ + { /* conf ppar psor pdir podr pdat */ + /* PA31 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 TxENB */ + /* PA30 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 TxClav */ + /* PA29 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 TxSOC */ + /* PA28 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 RxENB */ + /* PA27 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 RxSOC */ + /* PA26 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 RxClav */ + /* PA25 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[0] */ + /* PA24 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[1] */ + /* PA23 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[2] */ + /* PA22 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[3] */ + /* PA21 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[4] */ + /* PA20 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[5] */ + /* PA19 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[6] */ + /* PA18 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXD[7] */ + /* PA17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[7] */ + /* PA16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[6] */ + /* PA15 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[5] */ + /* PA14 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[4] */ + /* PA13 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[3] */ + /* PA12 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[2] */ + /* PA11 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[1] */ + /* PA10 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXD[0] */ + /* PA9 */ { 0, 1, 1, 1, 0, 0 }, /* FCC1 L1TXD */ + /* PA8 */ { 0, 1, 1, 0, 0, 0 }, /* FCC1 L1RXD */ + /* PA7 */ { 0, 0, 0, 1, 0, 0 }, /* PA7 */ + /* PA6 */ { 0, 1, 1, 1, 0, 0 }, /* TDM A1 L1RSYNC */ + /* PA5 */ { 0, 0, 0, 1, 0, 0 }, /* PA5 */ + /* PA4 */ { 0, 0, 0, 1, 0, 0 }, /* PA4 */ + /* PA3 */ { 0, 0, 0, 1, 0, 0 }, /* PA3 */ + /* PA2 */ { 0, 0, 0, 1, 0, 0 }, /* PA2 */ + /* PA1 */ { 1, 0, 0, 0, 0, 0 }, /* FREERUN */ + /* PA0 */ { 0, 0, 0, 1, 0, 0 } /* PA0 */ + }, + + /* Port B configuration */ + { /* conf ppar psor pdir podr pdat */ + /* PB31 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TX_ER */ + /* PB30 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_DV */ + /* PB29 */ { 1, 1, 1, 1, 0, 0 }, /* FCC2 MII TX_EN */ + /* PB28 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_ER */ + /* PB27 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII COL */ + /* PB26 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII CRS */ + /* PB25 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[3] */ + /* PB24 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[2] */ + /* PB23 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[1] */ + /* PB22 */ { 1, 1, 0, 1, 0, 0 }, /* FCC2 MII TxD[0] */ + /* PB21 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[0] */ + /* PB20 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[1] */ + /* PB19 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[2] */ + /* PB18 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RxD[3] */ + /* PB17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RX_DIV */ + /* PB16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RX_ERR */ + /* PB15 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TX_ERR */ + /* PB14 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TX_EN */ + /* PB13 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:COL */ + /* PB12 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:CRS */ + /* PB11 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB10 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB9 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB8 */ { 0, 1, 0, 0, 0, 0 }, /* FCC3:RXD */ + /* PB7 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB6 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB5 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB4 */ { 0, 1, 0, 1, 0, 0 }, /* FCC3:TXD */ + /* PB3 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB2 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB1 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PB0 */ { 0, 0, 0, 0, 0, 0 } /* pin doesn't exist */ + }, + + /* Port C */ + { /* conf ppar psor pdir podr pdat */ + /* PC31 */ { 0, 0, 0, 1, 0, 0 }, /* PC31 */ + /* PC30 */ { 0, 0, 0, 1, 0, 0 }, /* PC30 */ + /* PC29 */ { 0, 1, 1, 0, 0, 0 }, /* SCC1 EN *CLSN */ + /* PC28 */ { 0, 0, 0, 1, 0, 0 }, /* PC28 */ + /* PC27 */ { 0, 0, 0, 1, 0, 0 }, /* UART Clock in */ + /* PC26 */ { 0, 0, 0, 1, 0, 0 }, /* PC26 */ + /* PC25 */ { 0, 0, 0, 1, 0, 0 }, /* PC25 */ + /* PC24 */ { 0, 0, 0, 1, 0, 0 }, /* PC24 */ + /* PC23 */ { 0, 1, 0, 1, 0, 0 }, /* ATMTFCLK */ + /* PC22 */ { 0, 1, 0, 0, 0, 0 }, /* ATMRFCLK */ + /* PC21 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN RXCLK */ + /* PC20 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN TXCLK */ + /* PC19 */ { 1, 1, 0, 0, 0, 0 }, /* FCC2 MII RX_CLK CLK13 */ + /* PC18 */ { 1, 1, 0, 0, 0, 0 }, /* FCC Tx Clock (CLK14) */ + /* PC17 */ { 0, 0, 0, 1, 0, 0 }, /* PC17 */ + /* PC16 */ { 0, 1, 0, 0, 0, 0 }, /* FCC Tx Clock (CLK16) */ + /* PC15 */ { 0, 1, 0, 0, 0, 0 }, /* PC15 */ + /* PC14 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN *CD */ + /* PC13 */ { 0, 0, 0, 1, 0, 0 }, /* PC13 */ + /* PC12 */ { 0, 1, 0, 1, 0, 0 }, /* PC12 */ + /* PC11 */ { 0, 0, 0, 1, 0, 0 }, /* LXT971 transmit control */ + /* PC10 */ { 0, 0, 0, 1, 0, 0 }, /* FETHMDC */ + /* PC9 */ { 0, 0, 0, 0, 0, 0 }, /* FETHMDIO */ + /* PC8 */ { 0, 0, 0, 1, 0, 0 }, /* PC8 */ + /* PC7 */ { 0, 0, 0, 1, 0, 0 }, /* PC7 */ + /* PC6 */ { 0, 0, 0, 1, 0, 0 }, /* PC6 */ + /* PC5 */ { 0, 0, 0, 1, 0, 0 }, /* PC5 */ + /* PC4 */ { 0, 0, 0, 1, 0, 0 }, /* PC4 */ + /* PC3 */ { 0, 0, 0, 1, 0, 0 }, /* PC3 */ + /* PC2 */ { 0, 0, 0, 1, 0, 1 }, /* ENET FDE */ + /* PC1 */ { 0, 0, 0, 1, 0, 0 }, /* ENET DSQE */ + /* PC0 */ { 0, 0, 0, 1, 0, 0 }, /* ENET LBK */ + }, + + /* Port D */ + { /* conf ppar psor pdir podr pdat */ + /* PD31 */ { 0, 1, 0, 0, 0, 0 }, /* SCC1 EN RxD */ + /* PD30 */ { 0, 1, 1, 1, 0, 0 }, /* SCC1 EN TxD */ + /* PD29 */ { 0, 1, 0, 1, 0, 0 }, /* SCC1 EN TENA */ + /* PD28 */ { 1, 1, 0, 0, 0, 0 }, /* SCC2 RxD */ + /* PD27 */ { 1, 1, 0, 1, 0, 0 }, /* SCC2 TxD */ + /* PD26 */ { 0, 0, 0, 1, 0, 0 }, /* PD26 */ + /* PD25 */ { 0, 0, 0, 1, 0, 0 }, /* PD25 */ + /* PD24 */ { 0, 0, 0, 1, 0, 0 }, /* PD24 */ + /* PD23 */ { 0, 0, 0, 1, 0, 0 }, /* PD23 */ + /* PD22 */ { 0, 0, 0, 1, 0, 0 }, /* PD22 */ + /* PD21 */ { 0, 0, 0, 1, 0, 0 }, /* PD21 */ + /* PD20 */ { 0, 0, 0, 1, 0, 0 }, /* PD20 */ + /* PD19 */ { 0, 0, 0, 1, 0, 0 }, /* PD19 */ + /* PD18 */ { 0, 0, 0, 1, 0, 0 }, /* PD18 */ + /* PD17 */ { 0, 1, 0, 0, 0, 0 }, /* FCC1 ATMRXPRTY */ + /* PD16 */ { 0, 1, 0, 1, 0, 0 }, /* FCC1 ATMTXPRTY */ + /* PD15 */ { 1, 1, 1, 0, 1, 0 }, /* I2C SDA */ + /* PD14 */ { 1, 1, 1, 0, 0, 0 }, /* I2C CLK */ + /* PD13 */ { 0, 0, 0, 0, 0, 0 }, /* PD13 */ + /* PD12 */ { 0, 0, 0, 0, 0, 0 }, /* PD12 */ + /* PD11 */ { 0, 0, 0, 0, 0, 0 }, /* PD11 */ + /* PD10 */ { 0, 0, 0, 0, 0, 0 }, /* PD10 */ + /* PD9 */ { 0, 1, 0, 1, 0, 0 }, /* SMC1 TXD */ + /* PD8 */ { 0, 1, 0, 0, 0, 0 }, /* SMC1 RXD */ + /* PD7 */ { 0, 0, 0, 1, 0, 1 }, /* PD7 */ + /* PD6 */ { 0, 0, 0, 1, 0, 1 }, /* PD6 */ + /* PD5 */ { 0, 0, 0, 1, 0, 1 }, /* PD5 */ + /* PD4 */ { 0, 0, 0, 1, 0, 1 }, /* PD4 */ + /* PD3 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD2 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD1 */ { 0, 0, 0, 0, 0, 0 }, /* pin doesn't exist */ + /* PD0 */ { 0, 0, 0, 0, 0, 0 } /* pin doesn't exist */ + } +}; + +static uint64_t next_led_update; +static uint led_bit; + +void +reset_phy(void) +{ + volatile uint *blatch; +#if 0 + int i; +#endif + blatch = (volatile uint *)CFG_LBC_CFGLATCH_BASE; + + /* reset Giga bit Ethernet port if needed here */ + +#if 1 + *blatch &= ~0x000000c0; + udelay(100); +#else + *blatch = 0; + asm("eieio"); + for (i=0; i<1000; i++) + udelay(1000); +#endif + *blatch = 0x000000c1; /* Light one led, too */ + udelay(1000); + +#if 0 /* This is the port we really want to use for debugging. */ + /* reset the CPM FEC port */ +#if (CONFIG_ETHER_INDEX == 2) + bcsr->bcsr2 &= ~FETH2_RST; + udelay(2); + bcsr->bcsr2 |= FETH2_RST; + udelay(1000); +#elif (CONFIG_ETHER_INDEX == 3) + bcsr->bcsr3 &= ~FETH3_RST; + udelay(2); + bcsr->bcsr3 |= FETH3_RST; + udelay(1000); +#endif +#if defined(CONFIG_MII) && defined(CONFIG_ETHER_ON_FCC) + /* reset PHY */ + miiphy_reset("FCC1 ETHERNET", 0x0); + + /* change PHY address to 0x02 */ + bb_miiphy_write(NULL, 0, PHY_MIPSCR, 0xf028); + + bb_miiphy_write(NULL, 0x02, PHY_BMCR, + PHY_BMCR_AUTON | PHY_BMCR_RST_NEG); +#endif /* CONFIG_MII */ +#endif +} + +int +board_early_init_f(void) +{ +#if defined(CONFIG_PCI) + volatile immap_t *immr = (immap_t *)CFG_IMMR; + volatile ccsr_pcix_t *pci = &immr->im_pcix; + + pci->peer &= 0xfffffffdf; /* disable master abort */ +#endif + + /* Why is the phy reset done _after_ the ethernet + * initialization in lib_ppc/board.c? + * Do it here so it's done before the TSECs are used. + */ + reset_phy(); + + return 0; +} + +int +checkboard(void) +{ + printf ("Board: Silicon Tx GPPP SSA Board\n"); + return (0); +} + +/* Blinkin' LEDS for Robert. +*/ +void +show_activity(int flag) +{ + volatile uint *blatch; + + if (next_led_update > get_ticks()) + return; + + blatch = (volatile uint *)CFG_LBC_CFGLATCH_BASE; + + led_bit >>= 1; + if (led_bit == 0) + led_bit = 0x08; + *blatch = (0xc0 | led_bit); + eieio(); + next_led_update += (get_tbclk() / 4); +} + +long int +initdram (int board_type) +{ + long dram_size = 0; + extern long spd_sdram (void); + +#if defined(CONFIG_DDR_DLL) + { + volatile immap_t *immap = (immap_t *)CFG_IMMR; + volatile ccsr_gur_t *gur= &immap->im_gur; + uint temp_ddrdll = 0; + + /* Work around to stabilize DDR DLL */ + temp_ddrdll = gur->ddrdllcr; + gur->ddrdllcr = ((temp_ddrdll & 0xff) << 16) | 0x80000000; + asm("sync;isync;msync"); + } +#endif + + dram_size = spd_sdram (); + +#if defined(CONFIG_DDR_ECC) + /* Initialize and enable DDR ECC. + */ + ddr_enable_ecc(dram_size); +#endif + + return dram_size; +} + + +#if defined(CFG_DRAM_TEST) +int testdram (void) +{ + uint *pstart = (uint *) CFG_MEMTEST_START; + uint *pend = (uint *) CFG_MEMTEST_END; + uint *p; + + printf("SDRAM test phase 1:\n"); + for (p = pstart; p < pend; p++) + *p = 0xaaaaaaaa; + + for (p = pstart; p < pend; p++) { + if (*p != 0xaaaaaaaa) { + printf ("SDRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("SDRAM test phase 2:\n"); + for (p = pstart; p < pend; p++) + *p = 0x55555555; + + for (p = pstart; p < pend; p++) { + if (*p != 0x55555555) { + printf ("SDRAM test fails at: %08x\n", (uint) p); + return 1; + } + } + + printf("SDRAM test passed.\n"); + return 0; +} +#endif + +#if defined(CONFIG_PCI) + +/* + * Initialize PCI Devices, report devices found. + */ + +#ifndef CONFIG_PCI_PNP +static struct pci_config_table pci_stxgp3_config_table[] = { + { PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, + PCI_IDSEL_NUMBER, PCI_ANY_ID, + pci_cfgfunc_config_device, { PCI_ENET0_IOADDR, + PCI_ENET0_MEMADDR, + PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER + } }, + { } +}; +#endif + + +static struct pci_controller hose = { +#ifndef CONFIG_PCI_PNP + config_table: pci_stxgp3_config_table, +#endif +}; + +#endif /* CONFIG_PCI */ + + +void +pci_init_board(void) +{ +#ifdef CONFIG_PCI + extern void pci_mpc85xx_init(struct pci_controller *hose); + + pci_mpc85xx_init(&hose); +#endif /* CONFIG_PCI */ +} diff --git a/board/stxssa/u-boot.lds b/board/stxssa/u-boot.lds new file mode 100644 index 0000000000..95ecf66a8d --- /dev/null +++ b/board/stxssa/u-boot.lds @@ -0,0 +1,158 @@ +/* + * (C) Copyright 2005 Embedded Alley Solutions, Inc. + * Dan Malek, <dan@embeddedalley.com> + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA. + * + * (C) Copyright 2002,2003,Motorola,Inc. + * Xianghua Xiao, X.Xiao@motorola.com. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +OUTPUT_ARCH(powerpc) +SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib); +/* Do we need any of these for elf? + __DYNAMIC = 0; */ +SECTIONS +{ + .resetvec 0xFFFFFFFC : + { + *(.resetvec) + } = 0xffff + + .bootpg 0xFFFFF000 : + { + cpu/mpc85xx/start.o (.bootpg) + board/stxssa/init.o (.bootpg) + } = 0xffff + + /* Read-only sections, merged into text segment: */ + . = + SIZEOF_HEADERS; + .interp : { *(.interp) } + .hash : { *(.hash) } + .dynsym : { *(.dynsym) } + .dynstr : { *(.dynstr) } + .rel.text : { *(.rel.text) } + .rela.text : { *(.rela.text) } + .rel.data : { *(.rel.data) } + .rela.data : { *(.rela.data) } + .rel.rodata : { *(.rel.rodata) } + .rela.rodata : { *(.rela.rodata) } + .rel.got : { *(.rel.got) } + .rela.got : { *(.rela.got) } + .rel.ctors : { *(.rel.ctors) } + .rela.ctors : { *(.rela.ctors) } + .rel.dtors : { *(.rel.dtors) } + .rela.dtors : { *(.rela.dtors) } + .rel.bss : { *(.rel.bss) } + .rela.bss : { *(.rela.bss) } + .rel.plt : { *(.rel.plt) } + .rela.plt : { *(.rela.plt) } + .init : { *(.init) } + .plt : { *(.plt) } + .text : + { + cpu/mpc85xx/start.o (.text) + board/stxssa/init.o (.text) + cpu/mpc85xx/commproc.o (.text) + cpu/mpc85xx/traps.o (.text) + cpu/mpc85xx/interrupts.o (.text) + cpu/mpc85xx/serial_scc.o (.text) + cpu/mpc85xx/ether_fcc.o (.text) + cpu/mpc85xx/cpu_init.o (.text) + cpu/mpc85xx/cpu.o (.text) + cpu/mpc85xx/speed.o (.text) + cpu/mpc85xx/spd_sdram.o (.text) + common/dlmalloc.o (.text) + lib_generic/crc32.o (.text) + lib_ppc/extable.o (.text) + lib_generic/zlib.o (.text) + *(.text) + *(.fixup) + *(.got1) + } + _etext = .; + PROVIDE (etext = .); + .rodata : + { + *(.rodata) + *(.rodata1) + *(.rodata.str1.4) + *(.eh_frame) + } + .fini : { *(.fini) } =0 + .ctors : { *(.ctors) } + .dtors : { *(.dtors) } + + /* Read-write section, merged into data segment: */ + . = (. + 0x00FF) & 0xFFFFFF00; + _erotext = .; + PROVIDE (erotext = .); + .reloc : + { + *(.got) + _GOT2_TABLE_ = .; + *(.got2) + _FIXUP_TABLE_ = .; + *(.fixup) + } + __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2; + __fixup_entries = (. - _FIXUP_TABLE_) >> 2; + + .data : + { + *(.data) + *(.data1) + *(.sdata) + *(.sdata2) + *(.dynamic) + CONSTRUCTORS + } + _edata = .; + PROVIDE (edata = .); + + . = .; + __u_boot_cmd_start = .; + .u_boot_cmd : { *(.u_boot_cmd) } + __u_boot_cmd_end = .; + + . = .; + __start___ex_table = .; + __ex_table : { *(__ex_table) } + __stop___ex_table = .; + + . = ALIGN(256); + __init_begin = .; + .text.init : { *(.text.init) } + .data.init : { *(.data.init) } + . = ALIGN(256); + __init_end = .; + + __bss_start = .; + .bss : + { + *(.sbss) *(.scommon) + *(.dynbss) + *(.bss) + *(COMMON) + } + _end = . ; + PROVIDE (end = .); +} diff --git a/common/cmd_bootm.c b/common/cmd_bootm.c index 32c29e55a3..a6499e8dd9 100644 --- a/common/cmd_bootm.c +++ b/common/cmd_bootm.c @@ -779,9 +779,8 @@ do_bootm_linux (cmd_tbl_t *cmdtp, int flag, checksum = ntohl(hdr->ih_dcrc); addr = (ulong)((uchar *)(hdr) + sizeof(image_header_t)); - len = ntohl(hdr->ih_size); - if(checksum != crc32(0, (uchar *)addr, len)) { + if(checksum != crc32(0, (uchar *)addr, ntohl(hdr->ih_size))) { printf("ERROR: Flat Device Tree checksum is invalid\n"); return; } diff --git a/common/cmd_nvedit.c b/common/cmd_nvedit.c index 9834ba65b7..977ec5bae9 100644 --- a/common/cmd_nvedit.c +++ b/common/cmd_nvedit.c @@ -391,7 +391,10 @@ int _do_setenv (int flag, int argc, char *argv[]) void setenv (char *varname, char *varvalue) { char *argv[4] = { "setenv", varname, varvalue, NULL }; - _do_setenv (0, 3, argv); + if (varvalue == NULL) + _do_setenv (0, 2, argv); + else + _do_setenv (0, 3, argv); } int do_setenv ( cmd_tbl_t *cmdtp, int flag, int argc, char *argv[]) diff --git a/common/console.c b/common/console.c index e9f23bec18..d8a0cb6c7e 100644 --- a/common/console.c +++ b/common/console.c @@ -494,13 +494,7 @@ int console_init_r (void) /* suppress all output if splash screen is enabled and we have a bmp to display */ if (getenv("splashimage") != NULL) - outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev"); -#endif - -#ifdef CONFIG_SILENT_CONSOLE - /* Suppress all output if "silent" mode requested */ - if (gd->flags & GD_FLG_SILENT) - outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev"); + gd->flags |= GD_FLG_SILENT; #endif /* Scan devices looking for input and output devices */ diff --git a/common/main.c b/common/main.c index cc4b50f615..d8c0054954 100644 --- a/common/main.c +++ b/common/main.c @@ -112,14 +112,6 @@ static __inline__ int abortboot(int bootdelay) u_int presskey_max = 0; u_int i; -#ifdef CONFIG_SILENT_CONSOLE - if (gd->flags & GD_FLG_SILENT) { - /* Restore serial console */ - console_assign (stdout, "serial"); - console_assign (stderr, "serial"); - } -#endif - # ifdef CONFIG_AUTOBOOT_PROMPT printf (CONFIG_AUTOBOOT_PROMPT, bootdelay); # endif @@ -199,14 +191,8 @@ static __inline__ int abortboot(int bootdelay) # endif #ifdef CONFIG_SILENT_CONSOLE - if (abort) { - /* permanently enable normal console output */ - gd->flags &= ~(GD_FLG_SILENT); - } else if (gd->flags & GD_FLG_SILENT) { - /* Restore silent console */ - console_assign (stdout, "nulldev"); - console_assign (stderr, "nulldev"); - } + if (abort) + gd->flags &= ~GD_FLG_SILENT; #endif return abort; @@ -222,14 +208,6 @@ static __inline__ int abortboot(int bootdelay) { int abort = 0; -#ifdef CONFIG_SILENT_CONSOLE - if (gd->flags & GD_FLG_SILENT) { - /* Restore serial console */ - console_assign (stdout, "serial"); - console_assign (stderr, "serial"); - } -#endif - #ifdef CONFIG_MENUPROMPT printf(CONFIG_MENUPROMPT, bootdelay); #else @@ -245,7 +223,7 @@ static __inline__ int abortboot(int bootdelay) if (tstc()) { /* we got a key press */ (void) getc(); /* consume input */ puts ("\b\b\b 0"); - abort = 1; /* don't auto boot */ + abort = 1; /* don't auto boot */ } } #endif @@ -275,14 +253,8 @@ static __inline__ int abortboot(int bootdelay) putc ('\n'); #ifdef CONFIG_SILENT_CONSOLE - if (abort) { - /* permanently enable normal console output */ - gd->flags &= ~(GD_FLG_SILENT); - } else if (gd->flags & GD_FLG_SILENT) { - /* Restore silent console */ - console_assign (stdout, "nulldev"); - console_assign (stderr, "nulldev"); - } + if (abort) + gd->flags &= ~GD_FLG_SILENT; #endif return abort; diff --git a/cpu/ixp/npe/Makefile b/cpu/ixp/npe/Makefile index 4de34fd5b9..7f020b5d57 100644 --- a/cpu/ixp/npe/Makefile +++ b/cpu/ixp/npe/Makefile @@ -87,7 +87,7 @@ START := $(addprefix $(obj),$(START)) all: $(LIB) -$(LIB): $(obj).depend $(OBJS) +$(LIB): $(OBJS) $(AR) $(ARFLAGS) $@ $(OBJS) ######################################################################### diff --git a/cpu/mpc5xxx/cpu.c b/cpu/mpc5xxx/cpu.c index 813aa7935d..1eac2bbfbe 100644 --- a/cpu/mpc5xxx/cpu.c +++ b/cpu/mpc5xxx/cpu.c @@ -53,12 +53,16 @@ int checkcpu (void) #else svr = get_svr(); pvr = get_pvr(); - switch (SVR_VER (svr)) { - case SVR_MPC5200: - printf ("MPC5200"); + + switch (pvr) { + case PVR_5200: + printf("MPC5200"); + break; + case PVR_5200B: + printf("MPC5200B"); break; default: - printf ("MPC52?? (SVR %08x)", svr); + printf("Unknown MPC5xxx"); break; } @@ -127,5 +131,9 @@ ft_cpu_setup(void *blob, bd_t *bd) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@3000/mac-address", &len); if (p != NULL) memcpy(p, bd->bi_enetaddr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@3000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enetaddr, 6); } #endif diff --git a/cpu/mpc85xx/cpu.c b/cpu/mpc85xx/cpu.c index 0507c47e6e..7735a52ccf 100644 --- a/cpu/mpc85xx/cpu.c +++ b/cpu/mpc85xx/cpu.c @@ -1,5 +1,5 @@ /* - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004,2007 Freescale Semiconductor, Inc. * (C) Copyright 2002, 2003 Motorola Inc. * Xianghua Xiao (X.Xiao@motorola.com) * @@ -70,6 +70,15 @@ int checkcpu (void) case SVR_8548_E: puts("8548_E"); break; + case SVR_8544: + puts("8544"); + break; + case SVR_8544_E: + puts("8544_E"); + break; + case SVR_8568_E: + puts("8568_E"); + break; default: puts("Unknown"); break; @@ -112,7 +121,7 @@ int checkcpu (void) #endif clkdiv = lcrr & 0x0f; if (clkdiv == 2 || clkdiv == 4 || clkdiv == 8) { -#ifdef CONFIG_MPC8548 +#if defined(CONFIG_MPC8548) || defined(CONFIG_MPC8544) /* * Yes, the entire PQ38 family use the same * bit-representation for twice the clock divider values. @@ -140,16 +149,25 @@ int checkcpu (void) int do_reset (cmd_tbl_t *cmdtp, bd_t *bd, int flag, int argc, char *argv[]) { + uint pvr; + uint ver; + pvr = get_pvr(); + ver = PVR_VER(pvr); + if (ver & 1){ + /* e500 v2 core has reset control register */ + volatile unsigned int * rstcr; + rstcr = (volatile unsigned int *)(CFG_IMMR + 0xE00B0); + *rstcr = 0x2; /* HRESET_REQ */ + }else{ /* * Initiate hard reset in debug control register DBCR0 * Make sure MSR[DE] = 1 */ - unsigned long val; - - val = mfspr(DBCR0); - val |= 0x70000000; - mtspr(DBCR0,val); - + unsigned long val; + val = mfspr(DBCR0); + val |= 0x70000000; + mtspr(DBCR0,val); + } return 1; } @@ -183,9 +201,9 @@ reset_85xx_watchdog(void) * Clear TSR(WIS) bit by writing 1 */ unsigned long val; - val = mfspr(tsr); - val |= 0x40000000; - mtspr(tsr, val); + val = mfspr(SPRN_TSR); + val |= TSR_WIS; + mtspr(SPRN_TSR, val); } #endif /* CONFIG_WATCHDOG */ @@ -196,6 +214,7 @@ void dma_init(void) { dma->satr0 = 0x02c40000; dma->datr0 = 0x02c40000; + dma->sr0 = 0xfffffff; /* clear any errors */ asm("sync; isync; msync"); return; } @@ -210,6 +229,10 @@ uint dma_check(void) { status = dma->sr0; } + /* clear MR0[CS] channel start bit */ + dma->mr0 &= 0x00000001; + asm("sync;isync;msync"); + if (status != 0) { printf ("DMA Error: status = %x\n", status); } @@ -245,6 +268,10 @@ ft_cpu_setup(void *blob, bd_t *bd) if (p != NULL) *p = cpu_to_be32(clock); + p = ft_get_prop(blob, "/qe@e0080000/" OF_CPU "/bus-frequency", &len); + if (p != NULL) + *p = cpu_to_be32(clock); + p = ft_get_prop(blob, "/" OF_SOC "/serial@4500/clock-frequency", &len); if (p != NULL) *p = cpu_to_be32(clock); @@ -255,21 +282,41 @@ ft_cpu_setup(void *blob, bd_t *bd) #if defined(CONFIG_MPC85XX_TSEC1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enetaddr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enetaddr, 6); #endif #if defined(CONFIG_HAS_ETH1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet1addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet1addr, 6); #endif #if defined(CONFIG_HAS_ETH2) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet2addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet2addr, 6); #endif #if defined(CONFIG_HAS_ETH3) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/mac-address", &len); + if (p) + memcpy(p, bd->bi_enet3addr, 6); + + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/local-mac-address", &len); + if (p) memcpy(p, bd->bi_enet3addr, 6); #endif diff --git a/cpu/mpc85xx/cpu_init.c b/cpu/mpc85xx/cpu_init.c index 9f4d36c1ab..9517146ed2 100644 --- a/cpu/mpc85xx/cpu_init.c +++ b/cpu/mpc85xx/cpu_init.c @@ -143,12 +143,10 @@ void cpu_init_f (void) memctl->br1 = CFG_BR1_PRELIM; #endif -#if !defined(CONFIG_MPC85xx) #if defined(CFG_BR2_PRELIM) && defined(CFG_OR2_PRELIM) memctl->or2 = CFG_OR2_PRELIM; memctl->br2 = CFG_BR2_PRELIM; #endif -#endif #if defined(CFG_BR3_PRELIM) && defined(CFG_OR3_PRELIM) memctl->or3 = CFG_OR3_PRELIM; diff --git a/cpu/mpc85xx/pci.c b/cpu/mpc85xx/pci.c index 84f839ae1e..3c1a323aad 100644 --- a/cpu/mpc85xx/pci.c +++ b/cpu/mpc85xx/pci.c @@ -90,14 +90,14 @@ pci_mpc85xx_init(struct pci_controller *board_hose) pcix->powbar1 = (CFG_PCI1_MEM_PHYS >> 12) & 0x000fffff; pcix->powbear1 = 0x00000000; pcix->powar1 = (POWAR_EN | POWAR_MEM_READ | - POWAR_MEM_WRITE | POWAR_MEM_512M); + POWAR_MEM_WRITE | (__ilog2(CFG_PCI1_MEM_SIZE) - 1)); pcix->potar2 = (CFG_PCI1_IO_BASE >> 12) & 0x000fffff; pcix->potear2 = 0x00000000; pcix->powbar2 = (CFG_PCI1_IO_PHYS >> 12) & 0x000fffff; pcix->powbear2 = 0x00000000; pcix->powar2 = (POWAR_EN | POWAR_IO_READ | - POWAR_IO_WRITE | POWAR_IO_1M); + POWAR_IO_WRITE | (__ilog2(CFG_PCI1_IO_SIZE) - 1)); pcix->pitar1 = 0x00000000; pcix->piwbar1 = 0x00000000; @@ -175,14 +175,14 @@ pci_mpc85xx_init(struct pci_controller *board_hose) pcix2->powbar1 = (CFG_PCI2_MEM_PHYS >> 12) & 0x000fffff; pcix2->powbear1 = 0x00000000; pcix2->powar1 = (POWAR_EN | POWAR_MEM_READ | - POWAR_MEM_WRITE | POWAR_MEM_512M); + POWAR_MEM_WRITE | (__ilog2(CFG_PCI2_MEM_SIZE) - 1)); pcix2->potar2 = (CFG_PCI2_IO_BASE >> 12) & 0x000fffff; pcix2->potear2 = 0x00000000; pcix2->powbar2 = (CFG_PCI2_IO_PHYS >> 12) & 0x000fffff; pcix2->powbear2 = 0x00000000; pcix2->powar2 = (POWAR_EN | POWAR_IO_READ | - POWAR_IO_WRITE | POWAR_IO_1M); + POWAR_IO_WRITE | (__ilog2(CFG_PCI2_IO_SIZE) - 1)); pcix2->pitar1 = 0x00000000; pcix2->piwbar1 = 0x00000000; diff --git a/cpu/mpc85xx/spd_sdram.c b/cpu/mpc85xx/spd_sdram.c index 6da5367a70..3777f49adc 100644 --- a/cpu/mpc85xx/spd_sdram.c +++ b/cpu/mpc85xx/spd_sdram.c @@ -263,13 +263,14 @@ spd_sdram(void) } /* - * Adjust DDR II IO voltage biasing. It just makes it work. + * Adjust DDR II IO voltage biasing. + * Only 8548 rev 1 needs the fix */ - if (spd.mem_type == SPD_MEMTYPE_DDR2) { - gur->ddrioovcr = (0 - | 0x80000000 /* Enable */ - | 0x10000000 /* VSEL to 1.8V */ - ); + if ((SVR_VER(get_svr()) == SVR_8548_E) && + (SVR_MJREV(get_svr()) == 1) && + (spd.mem_type == SPD_MEMTYPE_DDR2)) { + gur->ddrioovcr = (0x80000000 /* Enable */ + | 0x10000000);/* VSEL to 1.8V */ } /* @@ -786,14 +787,17 @@ spd_sdram(void) * Is this an ECC DDR chip? * But don't mess with it if the DDR controller will init mem. */ -#if defined(CONFIG_DDR_ECC) && !defined(CONFIG_ECC_INIT_VIA_DDRCONTROLLER) +#ifdef CONFIG_DDR_ECC if (spd.config == 0x02) { +#ifndef CONFIG_ECC_INIT_VIA_DDRCONTROLLER ddr->err_disable = 0x0000000d; +#endif ddr->err_sbe = 0x00ff0000; } + debug("DDR: err_disable = 0x%08x\n", ddr->err_disable); debug("DDR: err_sbe = 0x%08x\n", ddr->err_sbe); -#endif +#endif /* CONFIG_DDR_ECC */ asm("sync;isync;msync"); udelay(500); @@ -991,17 +995,24 @@ setup_laws_and_tlbs(unsigned int memsize) break; case 256: case 512: + tlb_size = BOOKE_PAGESZ_256M; + break; case 1024: case 2048: - tlb_size = BOOKE_PAGESZ_256M; + if (PVR_VER(get_pvr()) > PVR_VER(PVR_85xx)) + tlb_size = BOOKE_PAGESZ_1G; + else + tlb_size = BOOKE_PAGESZ_256M; break; default: puts("DDR: only 16M,32M,64M,128M,256M,512M,1G and 2G are supported.\n"); /* * The memory was not able to be mapped. + * Default to a small size. */ - return 0; + tlb_size = BOOKE_PAGESZ_64M; + memsize=64; break; } diff --git a/cpu/mpc85xx/speed.c b/cpu/mpc85xx/speed.c index ca81ee7352..12359a2d64 100644 --- a/cpu/mpc85xx/speed.c +++ b/cpu/mpc85xx/speed.c @@ -37,49 +37,21 @@ void get_sys_info (sys_info_t * sysInfo) { volatile immap_t *immap = (immap_t *)CFG_IMMR; volatile ccsr_gur_t *gur = &immap->im_gur; - uint plat_ratio,e500_ratio; + uint plat_ratio,e500_ratio,half_freqSystemBus; plat_ratio = (gur->porpllsr) & 0x0000003e; plat_ratio >>= 1; - switch(plat_ratio) { - case 0x02: - case 0x03: - case 0x04: - case 0x05: - case 0x06: - case 0x08: - case 0x09: - case 0x0a: - case 0x0c: - case 0x10: - sysInfo->freqSystemBus = plat_ratio * CONFIG_SYS_CLK_FREQ; - break; - default: - sysInfo->freqSystemBus = 0; - break; - } - + sysInfo->freqSystemBus = plat_ratio * CONFIG_SYS_CLK_FREQ; e500_ratio = (gur->porpllsr) & 0x003f0000; e500_ratio >>= 16; - switch(e500_ratio) { - case 0x04: - sysInfo->freqProcessor = 2*sysInfo->freqSystemBus; - break; - case 0x05: - sysInfo->freqProcessor = 5*sysInfo->freqSystemBus/2; - break; - case 0x06: - sysInfo->freqProcessor = 3*sysInfo->freqSystemBus; - break; - case 0x07: - sysInfo->freqProcessor = 7*sysInfo->freqSystemBus/2; - break; - default: - sysInfo->freqProcessor = 0; - break; - } + + /* Divide before multiply to avoid integer + * overflow for processor speeds above 2GHz */ + half_freqSystemBus = sysInfo->freqSystemBus/2; + sysInfo->freqProcessor = e500_ratio*half_freqSystemBus; } + int get_clocks (void) { sys_info_t sys_info; diff --git a/cpu/mpc85xx/start.S b/cpu/mpc85xx/start.S index f96a4c3f8b..20c7ebc723 100644 --- a/cpu/mpc85xx/start.S +++ b/cpu/mpc85xx/start.S @@ -251,13 +251,10 @@ _start_e500: */ bl tlb1_entry mr r5,r0 - li r1,0x0020 /* max 16 TLB1 plus some TLB0 entries */ - mtctr r1 lwzu r4,0(r5) /* how many TLB1 entries we actually use */ + mtctr r4 -0: cmpwi r4,0 - beq 1f - lwzu r0,4(r5) +0: lwzu r0,4(r5) lwzu r1,4(r5) lwzu r2,4(r5) lwzu r3,4(r5) @@ -269,7 +266,6 @@ _start_e500: msync tlbwe isync - addi r4,r4,-1 bdnz 0b 1: @@ -301,20 +297,16 @@ _start_e500: bl law_entry mr r6,r0 - li r1,0x0007 /* 8 LAWs, but reserve one for boot-over-rio-or-pci */ - mtctr r1 lwzu r5,0(r6) /* how many windows we actually use */ + mtctr r5 li r2,0x0c28 /* the first pair is reserved for boot-over-rio-or-pci */ li r1,0x0c30 -0: cmpwi r5,0 - beq 1f - lwzu r4,4(r6) +0: lwzu r4,4(r6) lwzu r3,4(r6) stwx r4,r7,r2 stwx r3,r7,r1 - addi r5,r5,-1 addi r2,r2,0x0020 addi r1,r1,0x0020 bdnz 0b diff --git a/cpu/mpc86xx/cpu.c b/cpu/mpc86xx/cpu.c index 84f5bef508..a33acfec4d 100644 --- a/cpu/mpc86xx/cpu.c +++ b/cpu/mpc86xx/cpu.c @@ -280,22 +280,38 @@ ft_cpu_setup(void *blob, bd_t *bd) #if defined(CONFIG_MPC86XX_TSEC1) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/mac-address", &len); - memcpy(p, bd->bi_enetaddr, 6); + if (p != NULL) + memcpy(p, bd->bi_enetaddr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@24000/local-mac-address", &len); + if (p) + memcpy(p, bd->bi_enetaddr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC2) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/mac-address", &len); - memcpy(p, bd->bi_enet1addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet1addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@25000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet1addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC3) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/mac-address", &len); - memcpy(p, bd->bi_enet2addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet2addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@26000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet2addr, 6); #endif #if defined(CONFIG_MPC86XX_TSEC4) p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/mac-address", &len); - memcpy(p, bd->bi_enet3addr, 6); + if (p != NULL) + memcpy(p, bd->bi_enet3addr, 6); + p = ft_get_prop(blob, "/" OF_SOC "/ethernet@27000/local-mac-address", &len); + if (p != NULL) + memcpy(p, bd->bi_enet3addr, 6); #endif } diff --git a/cpu/mpc86xx/spd_sdram.c b/cpu/mpc86xx/spd_sdram.c index ac9ff81ce6..f37ab430b3 100644 --- a/cpu/mpc86xx/spd_sdram.c +++ b/cpu/mpc86xx/spd_sdram.c @@ -51,20 +51,32 @@ extern int dma_xfer(void *dest, uint count, void *src); #define CFG_SUPER_BANK_INTERLEAVING 0 /* - * Convert picoseconds into clock cycles (rounding up if needed). + * Convert picoseconds into DRAM clock cycles (rounding up if needed). */ -int -picos_to_clk(int picos) +static unsigned int +picos_to_clk(unsigned int picos) { - int clks; - - clks = picos / (2000000000 / (get_bus_freq(0) / 1000)); - if (picos % (2000000000 / (get_bus_freq(0) / 1000)) != 0) { + /* use unsigned long long to avoid rounding errors */ + const unsigned long long ULL_2e12 = 2000000000000ULL; + unsigned long long clks; + unsigned long long clks_temp; + + if (! picos) + return 0; + + clks = get_bus_freq(0) * (unsigned long long) picos; + clks_temp = clks; + clks = clks / ULL_2e12; + if (clks_temp % ULL_2e12) { clks++; } - return clks; + if (clks > 0xFFFFFFFFULL) { + clks = 0xFFFFFFFFULL; + } + + return (unsigned int) clks; } diff --git a/cpu/mpc86xx/start.S b/cpu/mpc86xx/start.S index 7406fe2248..67c56db1a3 100644 --- a/cpu/mpc86xx/start.S +++ b/cpu/mpc86xx/start.S @@ -241,26 +241,40 @@ in_flash: bl setup_ccsrbar #endif - /* Fix for SMP linux - Changing arbitration to round-robin */ - lis r3, CFG_CCSRBAR@h - ori r3, r3, 0x1000 - xor r4, r4, r4 - li r4, 0x1000 - stw r4, 0(r3) - /* setup the law entries */ - bl law_entry + /* -- MPC8641 Rev 1.0 MCM Errata fixups -- */ + + /* skip fixups if not Rev 1.0 */ + mfspr r4, SVR + rlwinm r4,r4,0,24,31 + cmpwi r4,0x10 + bne 1f + + lis r3,MCM_ABCR@ha + lwz r4,MCM_ABCR@l(r3) /* ABCR -> r4 */ + + /* set ABCR[A_STRM_CNT] = 0 */ + rlwinm r4,r4,0,0,29 + + /* set ABCR[ARB_POLICY] to 0x1 (round-robin) */ + addi r0,r0,1 + rlwimi r4,r0,12,18,19 + + stw r4,MCM_ABCR@l(r3) /* r4 -> ABCR */ sync - /* Don't use this feature due to bug in 8641D PD4 */ - /* Disable ERD_DIS */ - lis r3, CFG_CCSRBAR@h - ori r3, r3, 0x1008 - lwz r4, 0(r3) + /* Set DBCR[ERD_DIS] */ + lis r3,MCM_DBCR@ha + lwz r4,MCM_DBCR@l(r3) oris r4, r4, 0x4000 - stw r4, 0(r3) + stw r4,MCM_DBCR@l(r3) + sync +1: + /* setup the law entries */ + bl law_entry sync + #if (EMULATOR_RUN == 1) /* On the emulator we want to adjust these ASAP */ /* otherwise things are sloooow */ diff --git a/cpu/ppc4xx/4xx_enet.c b/cpu/ppc4xx/4xx_enet.c index cf56581d84..1200d021af 100644 --- a/cpu/ppc4xx/4xx_enet.c +++ b/cpu/ppc4xx/4xx_enet.c @@ -339,29 +339,41 @@ int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) int ppc_4xx_eth_setup_bridge(int devnum, bd_t * bis) { unsigned long zmiifer=0x0; + unsigned long pfc1; - /* - * Right now only 2*RGMII is supported. Please extend when needed. - * sr - 2006-08-29 - */ - switch (1) { - case 0: + mfsdr(sdr_pfc1, pfc1); + pfc1 &= SDR0_PFC1_SELECT_MASK; + + switch (pfc1) { + case SDR0_PFC1_SELECT_CONFIG_2: /* 1 x GMII port */ out32 (ZMII_FER, 0x00); out32 (RGMII_FER, 0x00000037); bis->bi_phymode[0] = BI_PHYMODE_GMII; bis->bi_phymode[1] = BI_PHYMODE_NONE; break; - case 1: + case SDR0_PFC1_SELECT_CONFIG_4: /* 2 x RGMII ports */ out32 (ZMII_FER, 0x00); out32 (RGMII_FER, 0x00000055); bis->bi_phymode[0] = BI_PHYMODE_RGMII; bis->bi_phymode[1] = BI_PHYMODE_RGMII; break; - case 2: + case SDR0_PFC1_SELECT_CONFIG_6: /* 2 x SMII ports */ - + out32 (ZMII_FER, + ((ZMII_FER_SMII) << ZMII_FER_V(0)) | + ((ZMII_FER_SMII) << ZMII_FER_V(1))); + out32 (RGMII_FER, 0x00000000); + bis->bi_phymode[0] = BI_PHYMODE_SMII; + bis->bi_phymode[1] = BI_PHYMODE_SMII; + break; + case SDR0_PFC1_SELECT_CONFIG_1_2: + /* only 1 x MII supported */ + out32 (ZMII_FER, (ZMII_FER_MII) << ZMII_FER_V(0)); + out32 (RGMII_FER, 0x00000000); + bis->bi_phymode[0] = BI_PHYMODE_MII; + bis->bi_phymode[1] = BI_PHYMODE_NONE; break; default: break; diff --git a/doc/README.nand b/doc/README.nand index b5171f4d40..5c31845a94 100644 --- a/doc/README.nand +++ b/doc/README.nand @@ -192,12 +192,7 @@ The old NAND handling code has been re-factored and is now confined to only board-specific files and - unfortunately - to the DoC code (see below). A new configuration variable has been introduced: CFG_NAND_LEGACY, which has to be defined in the board config file if -that board uses legacy code. If CFG_NAND_LEGACY is defined, the board -specific config.mk file should also have "BOARDLIBS = -drivers/nand_legacy/libnand_legacy.a". For boards using the new NAND -approach (PPChameleon and netstar at the moment) no variable is -necessary, but the config.mk should have "BOARDLIBS = -drivers/nand/libnand.a". +that board uses legacy code. The necessary changes have been made to all affected boards, and no build breakage has been introduced, except for NETTA and NETTA_ISDN diff --git a/drivers/nand/nand_base.c b/drivers/nand/nand_base.c index 8495829900..c6fee18222 100644 --- a/drivers/nand/nand_base.c +++ b/drivers/nand/nand_base.c @@ -427,8 +427,9 @@ static int nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) struct nand_chip *this = mtd->priv; u16 bad; + page = (int)(ofs >> this->page_shift) & this->pagemask; + if (getchip) { - page = (int)(ofs >> this->page_shift); chipnr = (int)(ofs >> this->chip_shift); /* Grab the lock and see if the device is available */ @@ -436,18 +437,17 @@ static int nand_block_bad(struct mtd_info *mtd, loff_t ofs, int getchip) /* Select the NAND device */ this->select_chip(mtd, chipnr); - } else - page = (int) ofs; + } if (this->options & NAND_BUSWIDTH_16) { - this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos & 0xFE, page & this->pagemask); + this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos & 0xFE, page); bad = cpu_to_le16(this->read_word(mtd)); if (this->badblockpos & 0x1) bad >>= 1; if ((bad & 0xFF) != 0xff) res = 1; } else { - this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos, page & this->pagemask); + this->cmdfunc (mtd, NAND_CMD_READOOB, this->badblockpos, page); if (this->read_byte(mtd) != 0xff) res = 1; } diff --git a/drivers/pci_auto.c b/drivers/pci_auto.c index 969167555e..f170c2db89 100644 --- a/drivers/pci_auto.c +++ b/drivers/pci_auto.c @@ -34,7 +34,12 @@ void pciauto_region_init(struct pci_region* res) { - res->bus_lower = res->bus_start; + /* + * Avoid allocating PCI resources from address 0 -- this is illegal + * according to PCI 2.1 and moreover, this is known to cause Linux IDE + * drivers to fail. Use a reasonable starting value of 0x1000 instead. + */ + res->bus_lower = res->bus_start ? res->bus_start : 0x1000; } void pciauto_region_align(struct pci_region *res, unsigned long size) diff --git a/drivers/smc91111.c b/drivers/smc91111.c index f91e4b9843..8061f12979 100644 --- a/drivers/smc91111.c +++ b/drivers/smc91111.c @@ -1538,9 +1538,9 @@ int eth_send(volatile void *packet, int length) { int smc_get_ethaddr (bd_t * bd) { int env_size, rom_valid, env_present = 0, reg; - char *s = NULL, *e, *v_mac, es[] = "11:22:33:44:55:66"; + char *s = NULL, *e, es[] = "11:22:33:44:55:66"; char s_env_mac[64]; - uchar v_env_mac[6], v_rom_mac[6]; + uchar v_env_mac[6], v_rom_mac[6], *v_mac; env_size = getenv_r ("ethaddr", s_env_mac, sizeof (s_env_mac)); if ((env_size > 0) && (env_size < sizeof (es))) { /* exit if env is bad */ @@ -1563,7 +1563,7 @@ int smc_get_ethaddr (bd_t * bd) if (!env_present) { /* if NO env */ if (rom_valid) { /* but ROM is valid */ - v_mac = (char *)v_rom_mac; + v_mac = v_rom_mac; sprintf (s_env_mac, "%02X:%02X:%02X:%02X:%02X:%02X", v_mac[0], v_mac[1], v_mac[2], v_mac[3], v_mac[4], v_mac[5]); @@ -1573,7 +1573,7 @@ int smc_get_ethaddr (bd_t * bd) return (-1); } } else { /* good env, don't care ROM */ - v_mac = (char *)v_env_mac; /* always use a good env over a ROM */ + v_mac = v_env_mac; /* always use a good env over a ROM */ } if (env_present && rom_valid) { /* if both env and ROM are good */ diff --git a/drivers/tsec.c b/drivers/tsec.c index 3f11eb03b4..b4187739cb 100644 --- a/drivers/tsec.c +++ b/drivers/tsec.c @@ -5,7 +5,7 @@ * terms of the GNU Public License, Version 2, incorporated * herein by reference. * - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004, 2007 Freescale Semiconductor, Inc. * (C) Copyright 2003, Motorola, Inc. * author Andy Fleming * @@ -66,7 +66,11 @@ struct tsec_info_struct { */ static struct tsec_info_struct tsec_info[] = { #if defined(CONFIG_MPC85XX_TSEC1) || defined(CONFIG_MPC83XX_TSEC1) +#if defined(CONFIG_MPC8544DS) + {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, +#else {TSEC1_PHY_ADDR, TSEC_GIGABIT, TSEC1_PHYIDX}, +#endif #elif defined(CONFIG_MPC86XX_TSEC1) {TSEC1_PHY_ADDR, TSEC_GIGABIT | TSEC_REDUCED, TSEC1_PHYIDX}, #else @@ -381,6 +385,76 @@ uint mii_parse_sr(uint mii_reg, struct tsec_private * priv) return 0; } +/* Generic function which updates the speed and duplex. If + * autonegotiation is enabled, it uses the AND of the link + * partner's advertised capabilities and our advertised + * capabilities. If autonegotiation is disabled, we use the + * appropriate bits in the control register. + * + * Stolen from Linux's mii.c and phy_device.c + */ +uint mii_parse_link(uint mii_reg, struct tsec_private *priv) +{ + /* We're using autonegotiation */ + if (mii_reg & PHY_BMSR_AUTN_ABLE) { + uint lpa = 0; + uint gblpa = 0; + + /* Check for gigabit capability */ + if (mii_reg & PHY_BMSR_EXT) { + /* We want a list of states supported by + * both PHYs in the link + */ + gblpa = read_phy_reg(priv, PHY_1000BTSR); + gblpa &= read_phy_reg(priv, PHY_1000BTCR) << 2; + } + + /* Set the baseline so we only have to set them + * if they're different + */ + priv->speed = 10; + priv->duplexity = 0; + + /* Check the gigabit fields */ + if (gblpa & (PHY_1000BTSR_1000FD | PHY_1000BTSR_1000HD)) { + priv->speed = 1000; + + if (gblpa & PHY_1000BTSR_1000FD) + priv->duplexity = 1; + + /* We're done! */ + return 0; + } + + lpa = read_phy_reg(priv, PHY_ANAR); + lpa &= read_phy_reg(priv, PHY_ANLPAR); + + if (lpa & (PHY_ANLPAR_TXFD | PHY_ANLPAR_TX)) { + priv->speed = 100; + + if (lpa & PHY_ANLPAR_TXFD) + priv->duplexity = 1; + + } else if (lpa & PHY_ANLPAR_10FD) + priv->duplexity = 1; + } else { + uint bmcr = read_phy_reg(priv, PHY_BMCR); + + priv->speed = 10; + priv->duplexity = 0; + + if (bmcr & PHY_BMCR_DPLX) + priv->duplexity = 1; + + if (bmcr & PHY_BMCR_1000_MBPS) + priv->speed = 1000; + else if (bmcr & PHY_BMCR_100_MBPS) + priv->speed = 100; + } + + return 0; +} + /* * Parse the BCM54xx status register for speed and duplex information. * The linux sungem_phy has this information, but in a table format. @@ -718,6 +792,7 @@ static void startup_tsec(struct eth_device *dev) /* Start up the PHY */ if(priv->phyinfo) phy_run_commands(priv, priv->phyinfo->startup); + adjust_link(dev); /* Enable Transmit and Receive */ @@ -1088,6 +1163,27 @@ struct phy_info phy_info_dm9161 = { {miim_end,} }, }; +/* a generic flavor. */ +struct phy_info phy_info_generic = { + 0, + "Unknown/Generic PHY", + 32, + (struct phy_cmd[]) { /* config */ + {PHY_BMCR, PHY_BMCR_RESET, NULL}, + {PHY_BMCR, PHY_BMCR_AUTON|PHY_BMCR_RST_NEG, NULL}, + {miim_end,} + }, + (struct phy_cmd[]) { /* startup */ + {PHY_BMSR, miim_read, NULL}, + {PHY_BMSR, miim_read, &mii_parse_sr}, + {PHY_BMSR, miim_read, &mii_parse_link}, + {miim_end,} + }, + (struct phy_cmd[]) { /* shutdown */ + {miim_end,} + } +}; + uint mii_parse_lxt971_sr2(uint mii_reg, struct tsec_private *priv) { @@ -1203,6 +1299,7 @@ struct phy_info *phy_info[] = { &phy_info_lxt971, &phy_info_VSC8244, &phy_info_dp83865, + &phy_info_generic, NULL }; diff --git a/drivers/tsec.h b/drivers/tsec.h index 422bc66922..7bf3dee2b6 100644 --- a/drivers/tsec.h +++ b/drivers/tsec.h @@ -7,7 +7,7 @@ * terms of the GNU Public License, Version 2, incorporated * herein by reference. * - * Copyright 2004 Freescale Semiconductor. + * Copyright 2004, 2007 Freescale Semiconductor, Inc. * (C) Copyright 2003, Motorola, Inc. * maintained by Xianghua Xiao (x.xiao@motorola.com) * author Andy Fleming @@ -65,6 +65,7 @@ #define ECNTRL_INIT_SETTINGS 0x00001000 #define ECNTRL_TBI_MODE 0x00000020 #define ECNTRL_R100 0x00000008 +#define ECNTRL_SGMII_MODE 0x00000002 #define miim_end -2 #define miim_read -1 diff --git a/include/asm-ppc/mmu.h b/include/asm-ppc/mmu.h index b226825ee2..48fd982950 100644 --- a/include/asm-ppc/mmu.h +++ b/include/asm-ppc/mmu.h @@ -396,8 +396,8 @@ extern int write_bat(ppc_bat_t bat, unsigned long upper, unsigned long lower); #define BOOKE_PAGESZ_16M 7 #define BOOKE_PAGESZ_64M 8 #define BOOKE_PAGESZ_256M 9 -#define BOOKE_PAGESZ_1GB 10 -#define BOOKE_PAGESZ_4GB 11 +#define BOOKE_PAGESZ_1G 10 +#define BOOKE_PAGESZ_4G 11 #if defined(CONFIG_MPC86xx) #define LAWBAR_BASE_ADDR 0x00FFFFFF @@ -413,6 +413,7 @@ extern int write_bat(ppc_bat_t bat, unsigned long upper, unsigned long lower); #define LAWAR_TRGT_IF_PCI1 0x00000000 #define LAWAR_TRGT_IF_PCIX 0x00000000 #define LAWAR_TRGT_IF_PCI2 0x00100000 +#define LAWAR_TRGT_IF_PEX 0x00200000 #define LAWAR_TRGT_IF_LBC 0x00400000 #define LAWAR_TRGT_IF_CCSR 0x00800000 #define LAWAR_TRGT_IF_DDR_INTERLEAVED 0x00B00000 diff --git a/include/asm-ppc/processor.h b/include/asm-ppc/processor.h index 058596275f..5efc3ee2ca 100644 --- a/include/asm-ppc/processor.h +++ b/include/asm-ppc/processor.h @@ -232,6 +232,9 @@ #define HID0_BHTE (1<<2) /* Branch History Table Enable */ #define HID0_BTCD (1<<1) /* Branch target cache disable */ #define SPRN_HID1 0x3F1 /* Hardware Implementation Register 1 */ +#define HID1_RFXE (1<<17) /* Read Fault Exception Enable */ +#define HID1_ASTME (1<<13) /* Address bus streaming mode */ +#define HID1_ABE (1<<12) /* Address broadcast enable */ #define SPRN_IABR 0x3F2 /* Instruction Address Breakpoint Register */ #ifndef CONFIG_BOOKE #define SPRN_IAC1 0x3F4 /* Instruction Address Compare 1 */ @@ -415,10 +418,12 @@ #define SPRN_IVOR15 0x19f /* Interrupt Vector Offset Register 15 */ /* e500 definitions */ -#define SPRN_L1CSR0 0x3f2 /* L1 Cache Control and Status Register 0 */ +#define SPRN_L1CSR0 0x3f2 /* L1 Data Cache Control and Status Register 0 */ +#define L1CSR0_CPE 0x00010000 /* Data Cache Parity Enable */ #define L1CSR0_DCFI 0x00000002 /* Data Cache Flash Invalidate */ #define L1CSR0_DCE 0x00000001 /* Data Cache Enable */ -#define SPRN_L1CSR1 0x3f3 /* L1 Cache Control and Status Register 1 */ +#define SPRN_L1CSR1 0x3f3 /* L1 Instruction Cache Control and Status Register 1 */ +#define L1CSR1_CPE 0x00010000 /* Instruction Cache Parity Enable */ #define L1CSR1_ICFI 0x00000002 /* Instruction Cache Flash Invalidate */ #define L1CSR1_ICE 0x00000001 /* Instruction Cache Enable */ @@ -701,8 +706,6 @@ #define SVR_MJREV(svr) (((svr) >> 4) & 0x0F) /* Major SOC design revision indicator */ #define SVR_MNREV(svr) (((svr) >> 0) & 0x0F) /* Minor SOC design revision indicator */ -/* System-On-Chip Version Numbers (version field only) */ -#define SVR_MPC5200 0x8011 /* Processor Version Register */ @@ -813,6 +816,12 @@ #define PVR_8260_HIP7R1 0x80822013 #define PVR_8260_HIP7RA 0x80822014 +/* + * MPC 52xx + */ +#define PVR_5200 0x80822011 +#define PVR_5200B 0x80822014 + /* * System Version Register @@ -840,9 +849,12 @@ #define SVR_8560 0x8070 #define SVR_8555 0x8079 #define SVR_8541 0x807A +#define SVR_8544 0x8034 +#define SVR_8544_E 0x803C #define SVR_8548 0x8031 #define SVR_8548_E 0x8039 #define SVR_8641 0x8090 +#define SVR_8568_E 0x807D /* I am just adding a single entry for 8260 boards. I think we may be diff --git a/include/configs/MPC8540ADS.h b/include/configs/MPC8540ADS.h index 74a84f4e86..5aeea58680 100644 --- a/include/configs/MPC8540ADS.h +++ b/include/configs/MPC8540ADS.h @@ -330,13 +330,12 @@ /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE #define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ - -#define CFG_PCI1_IO_BASE 0x0 +#define CFG_PCI1_IO_BASE 0x00000000 #define CFG_PCI1_IO_PHYS 0xe2000000 #define CFG_PCI1_IO_SIZE 0x100000 /* 1M */ diff --git a/include/configs/MPC8541CDS.h b/include/configs/MPC8541CDS.h index db389cfe67..fb360d282c 100644 --- a/include/configs/MPC8541CDS.h +++ b/include/configs/MPC8541CDS.h @@ -334,7 +334,7 @@ extern unsigned long get_clock_freq(void); /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE diff --git a/include/configs/MPC8544DS.h b/include/configs/MPC8544DS.h new file mode 100644 index 0000000000..4c3430897d --- /dev/null +++ b/include/configs/MPC8544DS.h @@ -0,0 +1,591 @@ +/* + * Copyright 2007 Freescale Semiconductor, Inc. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* + * mpc8544ds board configuration file + * + */ +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/60/55/41/48 */ +#define CONFIG_MPC8544 1 +#define CONFIG_MPC8544DS 1 + +#undef CONFIG_PCI /* Enable PCI/PCIE */ +#undef CONFIG_PCI1 /* PCI controller 1 */ +#undef CONFIG_PCIE1 /* PCIE controler 1 (slot 1) */ +#undef CONFIG_PCIE2 /* PCIE controler 2 (slot 2) */ +#undef CONFIG_PCIE3 /* PCIE controler 3 (ULI bridge) */ +#undef CONFIG_FSL_PCI_INIT /* Use common FSL init code */ + +#define CONFIG_TSEC_ENET /* tsec ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup */ +#undef CONFIG_DDR_DLL +#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ + +#define CONFIG_DDR_ECC /* only for ECC DDR module */ +#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER /* DDR controller or DMA? */ +#define CONFIG_MEM_INIT_VALUE 0xDeadBeef + +#define CONFIG_DDR_ECC_CMD + +/* + * When initializing flash, if we cannot find the manufacturer ID, + * assume this is the AMD flash associated with the CDS board. + * This allows booting from a promjet. + */ +#define CONFIG_ASSUME_AMD_FLASH + +#define MPC85xx_DDR_SDRAM_CLK_CNTL /* 85xx has clock control reg */ + +#ifndef __ASSEMBLY__ +extern unsigned long get_board_sys_clk(unsigned long dummy); +#endif +#define CONFIG_SYS_CLK_FREQ get_board_sys_clk(0) /* sysclk for MPC85xx */ + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +#define CONFIG_L2_CACHE /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ +#define CONFIG_CLEAR_LAW0 /* Clear LAW0 in cpu_init_r */ + +/* + * Only possible on E500 Version 2 or newer cores. + */ +#define CONFIG_ENABLE_36BIT_PHYS 1 + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest works on */ +#define CFG_MEMTEST_END 0x00400000 +#define CFG_ALT_MEMTEST +#define CONFIG_PANIC_HANG /* do not reset board on panic */ + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + +#define CFG_PCI1_ADDR (CFG_CCSRBAR+0x8000) +#define CFG_PCIE1_ADDR (CFG_CCSRBAR+0xa000) +#define CFG_PCIE2_ADDR (CFG_CCSRBAR+0x9000) +#define CFG_PCIE3_ADDR (CFG_CCSRBAR+0xb000) + +/* + * DDR Setup + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory*/ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x51 /* DDR DIMM */ + +/* + * Make sure required options are set + */ +#ifndef CONFIG_SPD_EEPROM +#error ("CONFIG_SPD_EEPROM is required") +#endif + +#undef CONFIG_CLOCKS_IN_MHZ + +/* + * Memory map + * + * 0x0000_0000 0x7fff_ffff DDR 2G Cacheable + * + * 0x8000_0000 0xbfff_ffff PCI Express Mem 1G non-cacheable + * + * 0xc000_0000 0xdfff_ffff PCI 512M non-cacheable + * + * 0xe000_0000 0xe00f_ffff CCSR 1M non-cacheable + * 0xe100_0000 0xe3ff_ffff PCI IO range 4M non-cacheable + * + * Localbus cacheable + * + * 0xf000_0000 0xf3ff_ffff SDRAM 64M Cacheable + * 0xf401_0000 0xf401_3fff L1 for stack 4K Cacheable TLB0 + * + * Localbus non-cacheable + * + * 0xf800_0000 0xf80f_ffff NVRAM/CADMUS (*) 1M non-cacheable + * 0xff00_0000 0xff7f_ffff FLASH (2nd bank) 8M non-cacheable + * 0xff80_0000 0xffff_ffff FLASH (boot bank) 8M non-cacheable + * + */ + +/* + * Local Bus Definitions + */ +#define CFG_BOOT_BLOCK 0xfc000000 /* boot TLB */ + +#define CFG_LBC_CACHE_BASE 0xf0000000 /* Localbus cacheable */ + +#define CFG_FLASH_BASE 0xff800000 /* start of FLASH 8M */ + +#define CFG_BR0_PRELIM 0xff801001 +#define CFG_BR1_PRELIM 0xfe801001 + +#define CFG_OR0_PRELIM 0xff806e65 +#define CFG_OR1_PRELIM 0xff806e65 + +#define CFG_FLASH_BANKS_LIST {0xfe800000,CFG_FLASH_BASE} + +#define CFG_MAX_FLASH_BANKS 2 /* number of banks */ +#define CFG_MAX_FLASH_SECT 128 /* sectors per device */ +#undef CFG_FLASH_CHECKSUM +#define CFG_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */ +#define CFG_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#define CFG_FLASH_CFI_DRIVER +#define CFG_FLASH_CFI +#define CFG_FLASH_EMPTY_INFO + +#define CFG_LBC_NONCACHE_BASE 0xf8000000 + +#define CFG_BR2_PRELIM 0xf8201001 /* port size 16bit */ +#define CFG_OR2_PRELIM 0xfff06ff7 /* 1MB Compact Flash area*/ + +#define CFG_BR3_PRELIM 0xf8100801 /* port size 8bit */ +#define CFG_OR3_PRELIM 0xfff06ff7 /* 1MB PIXIS area*/ + +#define PIXIS_BASE 0xf8100000 /* PIXIS registers */ +#define PIXIS_ID 0x0 /* Board ID at offset 0 */ +#define PIXIS_VER 0x1 /* Board version at offset 1 */ +#define PIXIS_PVER 0x2 /* PIXIS FPGA version at offset 2 */ +#define PIXIS_RST 0x4 /* PIXIS Reset Control register */ +#define PIXIS_AUX 0x6 /* PIXIS Auxiliary register; Scratch + * register */ +#define PIXIS_SPD 0x7 /* Register for SYSCLK speed */ +#define PIXIS_VCTL 0x10 /* VELA Control Register */ +#define PIXIS_VCFGEN0 0x12 /* VELA Config Enable 0 */ +#define PIXIS_VCFGEN1 0x13 /* VELA Config Enable 1 */ +#define PIXIS_VBOOT 0x16 /* VELA VBOOT Register */ +#define PIXIS_VSPEED0 0x17 /* VELA VSpeed 0 */ +#define PIXIS_VSPEED1 0x18 /* VELA VSpeed 1 */ +#define PIXIS_VCLKH 0x19 /* VELA VCLKH register */ +#define PIXIS_VCLKL 0x1A /* VELA VCLKL register */ + + +/* define to use L1 as initial stack */ +#define CONFIG_L1_INIT_RAM 1 +#define CFG_INIT_L1_LOCK 1 +#define CFG_INIT_L1_ADDR 0xf4010000 /* Initial L1 address */ +#define CFG_INIT_L1_END 0x00004000 /* End of used area in RAM */ + +/* define to use L2SRAM as initial stack */ +#undef CONFIG_L2_INIT_RAM +#define CFG_INIT_L2_ADDR 0xf8fc0000 +#define CFG_INIT_L2_END 0x00040000 /* End of used area in RAM */ + +#ifdef CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_ADDR CFG_INIT_L1_ADDR +#define CFG_INIT_RAM_END CFG_INIT_L1_END +#else +#define CFG_INIT_RAM_ADDR CFG_INIT_L2_ADDR +#define CFG_INIT_RAM_END CFG_INIT_L2_END +#endif + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ + +/* Serial Port - controlled on board with jumper J8 + * open - index 2 + * shorted - index 1 + */ +#define CONFIG_CONS_INDEX 1 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400,115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +/* Use the HUSH parser */ +#define CFG_HUSH_PARSER +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* pass open firmware flat tree */ +#define CONFIG_OF_FLAT_TREE 1 +#define CONFIG_OF_BOARD_SETUP 1 + +/* maximum size of the flat tree (8K) */ +#define OF_FLAT_TREE_MAX_SIZE 8192 + +#define OF_CPU "PowerPC,8544@0" +#define OF_SOC "soc8544@e0000000" +#define OF_TBCLK (bd->bi_busfreq / 8) +#define OF_STDOUT_PATH "/soc8544@e0000000/serial@4500" + +/* I2C */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support */ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_EEPROM_ADDR 0x57 +#define CFG_I2C_SLAVE 0x7F +#define CFG_I2C_NOPROBES {0x69} /* Don't probe these addrs */ +#define CFG_I2C_OFFSET 0x3100 + +/* + * General PCI + * Memory space is mapped 1-1, but I/O space must start from 0. + */ +#define CFG_PCIE_PHYS 0x80000000 /* 1G PCIE TLB */ +#define CFG_PCI_PHYS 0xc0000000 /* 512M PCI TLB */ + +#define CFG_PCI1_MEM_BASE 0xc0000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe1000000 +#define CFG_PCI1_IO_SIZE 0x00100000 /* 1M */ + +/* PCI view of System Memory */ +#define CFG_PCI_MEMORY_BUS 0x00000000 +#define CFG_PCI_MEMORY_PHYS 0x00000000 +#define CFG_PCI_MEMORY_SIZE 0x80000000 + +/* controller 2, Slot 1, tgtid 1, Base address 9000 */ +#define CFG_PCIE2_MEM_BASE 0x80000000 +#define CFG_PCIE2_MEM_PHYS CFG_PCIE2_MEM_BASE +#define CFG_PCIE2_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCIE2_IO_BASE 0x00000000 +#define CFG_PCIE2_IO_PHYS 0xe2000000 +#define CFG_PCIE2_IO_SIZE 0x00100000 /* 1M */ + +/* controller 1, Slot 2,tgtid 2, Base address a000 */ +#define CFG_PCIE1_MEM_BASE 0xa0000000 +#define CFG_PCIE1_MEM_PHYS CFG_PCIE1_MEM_BASE +#define CFG_PCIE1_MEM_SIZE 0x08000000 /* 128M */ +#define CFG_PCIE1_MEM_BASE2 0xa8000000 +#define CFG_PCIE1_MEM_PHYS2 CFG_PCIE1_MEM_BASE2 +#define CFG_PCIE1_MEM_SIZE2 0x04000000 /* 64M */ +#define CFG_PCIE1_IO_BASE 0x00000000 /* reuse mem LAW */ +#define CFG_PCIE1_IO_PHYS 0xaf000000 +#define CFG_PCIE1_IO_SIZE 0x00100000 /* 1M */ + +/* controller 3, direct to uli, tgtid 3, Base address b000 */ +#define CFG_PCIE3_MEM_BASE 0xb0000000 +#define CFG_PCIE3_MEM_PHYS CFG_PCIE3_MEM_BASE +#define CFG_PCIE3_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PCIE3_IO_BASE 0x00000000 +#define CFG_PCIE3_IO_PHYS 0xe3000000 +#define CFG_PCIE3_IO_SIZE 0x00100000 /* 1M */ + +#if defined(CONFIG_PCI) + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP +#define CONFIG_RTL8139 + +#ifdef CONFIG_RTL8139 +/* This macro is used by RTL8139 but not defined in PPC architecture */ +#define KSEG1ADDR(x) (x) +#define _IO_BASE 0x00000000 +#endif + +#ifndef CONFIG_PCI_PNP + #define PCI_ENET0_IOADDR CFG_PCI1_IO_BASE + #define PCI_ENET0_MEMADDR CFG_PCI1_IO_BASE + #define PCI_IDSEL_NUMBER 0x11 /* IDSEL = AD11 */ +#endif + +#define CONFIG_PCI_SCAN_SHOW /* show pci devices on startup */ +#define CONFIG_DOS_PARTITION +#define CONFIG_SCSI_AHCI + +#ifdef CONFIG_SCSI_AHCI +#define CONFIG_SATA_ULI5288 +#define CFG_SCSI_MAX_SCSI_ID 4 +#define CFG_SCSI_MAX_LUN 1 +#define CFG_SCSI_MAX_DEVICE (CFG_SCSI_MAX_SCSI_ID * CFG_SCSI_MAX_LUN) +#define CFG_SCSI_MAXDEVICE CFG_SCSI_MAX_DEVICE +#endif /* SCSCI */ + +#endif /* CONFIG_PCI */ + + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ +#define CONFIG_MII_DEFAULT_TSEC 1 /* Allow unregistered phys */ +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "eTSEC1" +#define CONFIG_MPC85XX_TSEC3 1 +#define CONFIG_MPC85XX_TSEC3_NAME "eTSEC3" +#undef CONFIG_MPC85XX_FEC + +#define TSEC1_PHY_ADDR 0 +#define TSEC3_PHY_ADDR 1 + +#define TSEC1_PHYIDX 0 +#define TSEC3_PHYIDX 0 + +#define CONFIG_ETHPRIME "eTSEC1" + +#define CONFIG_PHY_GIGE 1 /* Include GbE speed/duplex detection */ + +#endif /* CONFIG_TSEC_ENET */ + +/* + * Environment + */ +#define CFG_ENV_IS_IN_FLASH 1 +#if CFG_MONITOR_BASE > 0xfff80000 +#define CFG_ENV_ADDR 0xfff80000 +#else +#define CFG_ENV_ADDR (CFG_MONITOR_BASE + 0x40000) +#endif +#define CFG_ENV_SIZE 0x2000 +#define CFG_ENV_SECT_SIZE 0x10000 /* 64K (one sector) */ + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#if defined(CONFIG_PCI) +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PCI \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII \ + | CFG_CMD_BEDBUG \ + | CFG_CMD_NET) +#else +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#endif +#include <cmd_confdefs.h> + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_LOAD_ADDR 0x2000000 /* default load address */ +#define CFG_PROMPT "=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_HZ 1000 /* decrementer freq: 1ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux*/ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /*log base 2 of the above value*/ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/* + * Environment Configuration + */ + +/* The mac addresses for all ethernet interface */ +#if defined(CONFIG_TSEC_ENET) +#define CONFIG_ETHADDR 00:E0:0C:02:00:FD +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:E0:0C:02:01:FD +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:E0:0C:02:02:FD +#define CONFIG_HAS_ETH3 +#define CONFIG_ETH3ADDR 00:E0:0C:02:03:FD +#endif + +#define CONFIG_IPADDR 192.168.1.251 + +#define CONFIG_HOSTNAME 8544ds_unknown +#define CONFIG_ROOTPATH /nfs/mpc85xx +#define CONFIG_BOOTFILE 8544ds_tmt/uImage.uboot + +#define CONFIG_SERVERIP 192.168.0.1 +#define CONFIG_GATEWAYIP 192.168.0.1 +#define CONFIG_NETMASK 255.255.0.0 + +#define CONFIG_LOADADDR 1000000 /*default location for tftp and bootm*/ + +#define CONFIG_BOOTDELAY 10 /* -1 disables auto-boot */ +#undef CONFIG_BOOTARGS /* the boot command will set bootargs*/ + +#define CONFIG_BAUDRATE 115200 + +#if defined(CONFIG_PCIE1) || defined(CONFIG_PCIE2) || defined(CONFIG_PCIE3) +#define PCIE_ENV \ + "pciereg=md ${a}000 6; md ${a}020 4; md ${a}bf8 2; echo o;md ${a}c00 25;" \ + "echo i; md ${a}da0 15; echo e;md ${a}e00 e; echo d; md ${a}f00 c\0" \ + "pcie1regs=setenv a e000a; run pciereg\0" \ + "pcie2regs=setenv a e0009; run pciereg\0" \ + "pcie3regs=setenv a e000b; run pciereg\0" \ + "pcieerr=md ${a}020 1; md ${a}e00;" \ + "pci d.b $b.0 7 1; pci d.w $b.0 1e 1;" \ + "pci d.w $b.0 56 1;" \ + "pci d $b.0 104 1;pci d $b.0 110 1;pci d $b.0 130 1\0" \ + "pcieerrc=mw ${a}020 ffffffff; mw ${a}e00 ffffffff;" \ + "pci w.b $b.0 7 ff; pci w.w $b.0 1e ffff; pci w.w $b.0 56 ffff;" \ + "pci w $b.0 104 ffffffff; pci w $b.0 110 ffffffff;" \ + "pci w $b.0 130 ffffffff\0" \ + "pciecfg=pci d $b.0 0 20; pci d $b.0 100 e; pci d $b.0 400 69\0" \ + "pcie1err=setenv a e000a; run pcieerr\0" \ + "pcie2err=setenv a e0009; run pcieerr\0" \ + "pcie3err=setenv a e000b; run pcieerr\0" \ + "pcie1errc=setenv a e000a; run pcieerrc\0" \ + "pcie2errc=setenv a e0009; run pcieerrc\0" \ + "pcie3errc=setenv a e000b; run pcieerrc\0" +#else +#define PCIE_ENV "" +#endif + +#if defined(CONFIG_PCI1) +#define PCI_ENV \ + "pcireg=md ${a}000 3; echo o;md ${a}c00 25; echo i; md ${a}da0 15;" \ + "echo e;md ${a}e00 9\0" \ + "pci1regs=setenv a e0008; run pcireg\0" \ + "pcierr=md ${a}e00 8; pci d.b $b.0 7 1; pci d.w $b.0 1e 1;" \ + "pci d.w $b.0 56 1\0" \ + "pcierrc=mw ${a}e00 ffffffff; pci w.b $b.0 7 ff; pci w.w $b.0 1e ffff;" \ + "pci w.w $b.0 56 ffff\0" \ + "pci1err=setenv a e0008; run pcierr\0" \ + "pci1errc=setenv a e0008; run pcierrc\0" +#else +#define PCI_ENV "" +#endif + +#if defined(CONFIG_TSEC_ENET) +#define ENET_ENV \ + "enetreg1=md ${a}000 2; md ${a}010 9; md ${a}050 4; md ${a}08c 1;" \ + "md ${a}098 2\0" \ + "enetregt=echo t;md ${a}100 6; md ${a}140 2; md ${a}180 10; md ${a}200 10\0" \ + "enetregr=echo r;md ${a}300 6; md ${a}330 5; md ${a}380 10; md ${a}400 10\0" \ + "enetregm=echo mac;md ${a}500 5; md ${a}520 28;echo fifo;md ${a}a00 1;" \ + "echo mib;md ${a}680 31\0" \ + "enetreg=run enetreg1; run enetregm; run enetregt; run enetregr\0" \ + "enet1regs=setenv a e0024; run enetreg\0" \ + "enet3regs=setenv a e0026; run enetreg\0" +#else +#define ENET_ENV "" +#endif + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "netdev=eth0\0" \ + "consoledev=ttyS0\0" \ + "ramdiskaddr=2000000\0" \ + "ramdiskfile=8544ds_tmt/ramdisk.uboot\0" \ + "fdtaddr=400000\0" \ + "fdtfile=8544ds_tmt/mpc8544ds.dtb\0" \ + "eoi=mw e00400b0 0\0" \ + "iack=md e00400a0 1\0" \ + "ddrreg=md ${a}000 8; md ${a}080 8;md ${a}100 d; md ${a}140 4; md ${a}bf0 4;" \ + "md ${a}e00 3; md ${a}e20 3; md ${a}e40 7; md ${a}f00 5\0" \ + "ddrregs=setenv a e0002; run ddrreg\0" \ + "gureg=md ${a}000 2c; md ${a}0b0 1; md ${a}0c0 1; md ${a}b20 3;" \ + "md ${a}e00 1; md ${a}e60 1; md ${a}ef0 15\0" \ + "guregs=setenv a e00e0; run gureg\0" \ + "ecmreg=md ${a}000 1; md ${a}010 1; md ${a}bf8 2; md ${a}e00 6\0" \ + "ecmregs=setenv a e0001; run ecmreg\0" \ + PCIE_ENV \ + PCI_ENV \ + ENET_ENV + + +#define CONFIG_NFSBOOTCOMMAND \ + "setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask:$hostname:$netdev:off " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + + +#define CONFIG_RAMBOOTCOMMAND \ + "setenv bootargs root=/dev/ram rw " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $ramdiskaddr $ramdiskfile;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr $ramdiskaddr $fdtaddr" + +#define CONFIG_BOOTCOMMAND \ + "setenv bootargs root=/dev/sda3 rw " \ + "console=$consoledev,$baudrate $othbootargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + +#endif /* __CONFIG_H */ diff --git a/include/configs/MPC8548CDS.h b/include/configs/MPC8548CDS.h index 7c4849fadf..680009d600 100644 --- a/include/configs/MPC8548CDS.h +++ b/include/configs/MPC8548CDS.h @@ -36,12 +36,12 @@ #define CONFIG_MPC8548 1 /* MPC8548 specific */ #define CONFIG_MPC8548CDS 1 /* MPC8548CDS board specific */ -#undef CONFIG_PCI +#define CONFIG_PCI #define CONFIG_TSEC_ENET /* tsec ethernet support */ #define CONFIG_ENV_OVERWRITE #define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup*/ #define CONFIG_DDR_DLL /* possible DLL fix needed */ -#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ +#undef CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ #define CONFIG_DDR_ECC /* only for ECC DDR module */ #define CONFIG_ECC_INIT_VIA_DDRCONTROLLER /* DDR controller or DMA? */ @@ -340,22 +340,34 @@ extern unsigned long get_clock_freq(void); /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE -#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_MEM_SIZE 0x10000000 /* 256M */ #define CFG_PCI1_IO_BASE 0x00000000 #define CFG_PCI1_IO_PHYS 0xe2000000 -#define CFG_PCI1_IO_SIZE 0x00100000 /* 1M */ +#define CFG_PCI1_IO_SIZE 0x00800000 /* 8M */ -#define CFG_PCI2_MEM_BASE 0xa0000000 +#define CFG_PCI2_MEM_BASE 0x90000000 #define CFG_PCI2_MEM_PHYS CFG_PCI2_MEM_BASE -#define CFG_PCI2_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI2_MEM_SIZE 0x10000000 /* 256M */ #define CFG_PCI2_IO_BASE 0x00000000 -#define CFG_PCI2_IO_PHYS 0xe2100000 -#define CFG_PCI2_IO_SIZE 0x00100000 /* 1M */ +#define CFG_PCI2_IO_PHYS 0xe2800000 +#define CFG_PCI2_IO_SIZE 0x00800000 /* 8M */ +#define CFG_PEX_MEM_BASE 0xa0000000 +#define CFG_PEX_MEM_PHYS CFG_PEX_MEM_BASE +#define CFG_PEX_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PEX_IO_BASE 0x00000000 +#define CFG_PEX_IO_PHYS 0xe3000000 +#define CFG_PEX_IO_SIZE 0x01000000 /* 16M */ + +/* + * RapidIO MMU + */ +#define CFG_RIO_MEM_BASE 0xC0000000 +#define CFG_RIO_MEM_SIZE 0x20000000 /* 512M */ #if defined(CONFIG_PCI) diff --git a/include/configs/MPC8560ADS.h b/include/configs/MPC8560ADS.h index 835bf5cb64..21e6637680 100644 --- a/include/configs/MPC8560ADS.h +++ b/include/configs/MPC8560ADS.h @@ -320,14 +320,14 @@ /* * General PCI - * Addresses are mapped 1-1. + * Memory space is mapped 1-1, but I/O space must start from 0. */ #define CFG_PCI1_MEM_BASE 0x80000000 #define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE #define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ -#define CFG_PCI1_IO_BASE 0xe2000000 -#define CFG_PCI1_IO_PHYS CFG_PCI1_IO_BASE -#define CFG_PCI1_IO_SIZE 0x1000000 /* 16M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x100000 /* 1M */ #if defined(CONFIG_PCI) diff --git a/include/configs/MPC8568MDS.h b/include/configs/MPC8568MDS.h new file mode 100644 index 0000000000..3f65644fdd --- /dev/null +++ b/include/configs/MPC8568MDS.h @@ -0,0 +1,505 @@ +/* + * Copyright 2004-2007 Freescale Semiconductor. + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* + * mpc8568mds board configuration file + */ +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/60/55/41/48/68 */ +#define CONFIG_MPC8568 1 /* MPC8568 specific */ +#define CONFIG_MPC8568MDS 1 /* MPC8568MDS board specific */ + +#undef CONFIG_PCI +#define CONFIG_TSEC_ENET /* tsec ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup*/ +#define CONFIG_DDR_DLL /* possible DLL fix needed */ +/*#define CONFIG_DDR_2T_TIMING Sets the 2T timing bit */ + +/*#define CONFIG_DDR_ECC*/ /* only for ECC DDR module */ +/*#define CONFIG_ECC_INIT_VIA_DDRCONTROLLER*/ /* DDR controller or DMA? */ +#define CONFIG_MEM_INIT_VALUE 0xDeadBeef + + +/* + * When initializing flash, if we cannot find the manufacturer ID, + * assume this is the AMD flash associated with the MDS board. + * This allows booting from a promjet. + */ +#define CONFIG_ASSUME_AMD_FLASH + +#define MPC85xx_DDR_SDRAM_CLK_CNTL /* 85xx has clock control reg */ + +#ifndef __ASSEMBLY__ +extern unsigned long get_clock_freq(void); +#endif /*Replace a call to get_clock_freq (after it is implemented)*/ +#define CONFIG_SYS_CLK_FREQ 66000000 /*TODO: restore if wanting to read from BCSR: get_clock_freq()*/ /* sysclk for MPC85xx */ + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +/*#define CONFIG_L2_CACHE*/ /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ + +/* + * Only possible on E500 Version 2 or newer cores. + */ +#define CONFIG_ENABLE_36BIT_PHYS 1 + + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest works on */ +#define CFG_MEMTEST_END 0x00400000 + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + +/* + * DDR Setup + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory*/ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x51 /* DDR DIMM */ + +/* + * Make sure required options are set + */ +#ifndef CONFIG_SPD_EEPROM +#error ("CONFIG_SPD_EEPROM is required") +#endif + +#undef CONFIG_CLOCKS_IN_MHZ + + +/* + * Local Bus Definitions + */ + +/* + * FLASH on the Local Bus + * Two banks, 8M each, using the CFI driver. + * Boot from BR0/OR0 bank at 0xff00_0000 + * Alternate BR1/OR1 bank at 0xff80_0000 + * + * BR0, BR1: + * Base address 0 = 0xff00_0000 = BR0[0:16] = 1111 1111 0000 0000 0 + * Base address 1 = 0xff80_0000 = BR1[0:16] = 1111 1111 1000 0000 0 + * Port Size = 16 bits = BRx[19:20] = 10 + * Use GPCM = BRx[24:26] = 000 + * Valid = BRx[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1000 0000 0001 0000 0000 0001 = ff801001 BR0 + * 1111 1111 0000 0000 0001 0000 0000 0001 = ff001001 BR1 + * + * OR0, OR1: + * Addr Mask = 8M = ORx[0:16] = 1111 1111 1000 0000 0 + * Reserved ORx[17:18] = 11, confusion here? + * CSNT = ORx[20] = 1 + * ACS = half cycle delay = ORx[21:22] = 11 + * SCY = 6 = ORx[24:27] = 0110 + * TRLX = use relaxed timing = ORx[29] = 1 + * EAD = use external address latch delay = OR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1000 0000 0110 1110 0110 0101 = ff806e65 ORx + */ +#define CFG_BCSR_BASE 0xf8000000 + +#define CFG_FLASH_BASE 0xfe000000 /* start of FLASH 32M */ + +/*Chip select 0 - Flash*/ +#define CFG_BR0_PRELIM 0xfe001001 +#define CFG_OR0_PRELIM 0xfe006ff7 + +/*Chip slelect 1 - BCSR*/ +#define CFG_BR1_PRELIM 0xf8000801 +#define CFG_OR1_PRELIM 0xffffe9f7 + +/*#define CFG_FLASH_BANKS_LIST {0xff800000, CFG_FLASH_BASE} */ +#define CFG_MAX_FLASH_BANKS 1 /* number of banks */ +#define CFG_MAX_FLASH_SECT 512 /* sectors per device */ +#undef CFG_FLASH_CHECKSUM +#define CFG_FLASH_ERASE_TOUT 60000 /* Flash Erase Timeout (ms) */ +#define CFG_FLASH_WRITE_TOUT 500 /* Flash Write Timeout (ms) */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#define CFG_FLASH_CFI_DRIVER +#define CFG_FLASH_CFI +#define CFG_FLASH_EMPTY_INFO + + +/* + * SDRAM on the LocalBus + */ +#define CFG_LBC_SDRAM_BASE 0xf0000000 /* Localbus SDRAM */ +#define CFG_LBC_SDRAM_SIZE 64 /* LBC SDRAM is 64MB */ + + +/*Chip select 2 - SDRAM*/ +#define CFG_BR2_PRELIM 0xf0001861 +#define CFG_OR2_PRELIM 0xfc006901 + +#define CFG_LBC_LCRR 0x00030004 /* LB clock ratio reg */ +#define CFG_LBC_LBCR 0x00000000 /* LB config reg */ +#define CFG_LBC_LSRT 0x20000000 /* LB sdram refresh timer */ +#define CFG_LBC_MRTPR 0x00000000 /* LB refresh timer prescal*/ + +/* + * LSDMR masks + */ +#define CFG_LBC_LSDMR_RFEN (1 << (31 - 1)) +#define CFG_LBC_LSDMR_BSMA1516 (3 << (31 - 10)) +#define CFG_LBC_LSDMR_BSMA1617 (4 << (31 - 10)) +#define CFG_LBC_LSDMR_RFCR16 (7 << (31 - 16)) +#define CFG_LBC_LSDMR_PRETOACT7 (7 << (31 - 19)) +#define CFG_LBC_LSDMR_ACTTORW7 (7 << (31 - 22)) +#define CFG_LBC_LSDMR_ACTTORW6 (6 << (31 - 22)) +#define CFG_LBC_LSDMR_BL8 (1 << (31 - 23)) +#define CFG_LBC_LSDMR_WRC4 (0 << (31 - 27)) +#define CFG_LBC_LSDMR_CL3 (3 << (31 - 31)) + +#define CFG_LBC_LSDMR_OP_NORMAL (0 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_ARFRSH (1 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_SRFRSH (2 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_MRW (3 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_PRECH (4 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_PCHALL (5 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_ACTBNK (6 << (31 - 4)) +#define CFG_LBC_LSDMR_OP_RWINV (7 << (31 - 4)) + +/* + * Common settings for all Local Bus SDRAM commands. + * At run time, either BSMA1516 (for CPU 1.1) + * or BSMA1617 (for CPU 1.0) (old) + * is OR'ed in too. + */ +#define CFG_LBC_LSDMR_COMMON ( CFG_LBC_LSDMR_RFCR16 \ + | CFG_LBC_LSDMR_PRETOACT7 \ + | CFG_LBC_LSDMR_ACTTORW7 \ + | CFG_LBC_LSDMR_BL8 \ + | CFG_LBC_LSDMR_WRC4 \ + | CFG_LBC_LSDMR_CL3 \ + | CFG_LBC_LSDMR_RFEN \ + ) + +/* + * The bcsr registers are connected to CS3 on MDS. + * The new memory map places bcsr at 0xf8000000. + * + * For BR3, need: + * Base address of 0xf8000000 = BR[0:16] = 1111 1000 0000 0000 0 + * port-size = 8-bits = BR[19:20] = 01 + * no parity checking = BR[21:22] = 00 + * GPMC for MSEL = BR[24:26] = 000 + * Valid = BR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1000 0000 0000 0000 1000 0000 0001 = f8000801 + * + * For OR3, need: + * 1 MB mask for AM, OR[0:16] = 1111 1111 1111 0000 0 + * disable buffer ctrl OR[19] = 0 + * CSNT OR[20] = 1 + * ACS OR[21:22] = 11 + * XACS OR[23] = 1 + * SCY 15 wait states OR[24:27] = 1111 max is suboptimal but safe + * SETA OR[28] = 0 + * TRLX OR[29] = 1 + * EHTR OR[30] = 1 + * EAD extra time OR[31] = 1 + * + * 0 4 8 12 16 20 24 28 + * 1111 1111 1111 0000 0000 1111 1111 0111 = fff00ff7 + */ +#define CFG_BCSR (0xf8000000) + +/*Chip slelect 4 - PIB*/ +#define CFG_BR4_PRELIM 0xf8008801 +#define CFG_OR4_PRELIM 0xffffe9f7 + +/*Chip select 5 - PIB*/ +#define CFG_BR5_PRELIM 0xf8010801 +#define CFG_OR5_PRELIM 0xffff69f7 + +#define CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_LOCK 1 +#define CFG_INIT_RAM_ADDR 0xe4010000 /* Initial RAM address */ +#define CFG_INIT_RAM_END 0x4000 /* End of used area in RAM */ + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (128 * 1024) /* Reserved for malloc */ + +/* Serial Port */ +#define CONFIG_CONS_INDEX 1 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400,115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +/* Use the HUSH parser*/ +#define CFG_HUSH_PARSER +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* pass open firmware flat tree */ +#define CONFIG_OF_FLAT_TREE 1 +#define CONFIG_OF_BOARD_SETUP 1 + +/* maximum size of the flat tree (8K) */ +#define OF_FLAT_TREE_MAX_SIZE 8192 + +#define OF_CPU "PowerPC,8568@0" +#define OF_SOC "soc8568@e0000000" +#define OF_TBCLK (bd->bi_busfreq / 8) +#define OF_STDOUT_PATH "/soc8568@e0000000/serial@4600" + +/* + * I2C + */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support*/ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_EEPROM_ADDR 0x57 +#define CFG_I2C_SLAVE 0x7F +#define CFG_I2C_NOPROBES {0x69} /* Don't probe these addrs */ +#define CFG_I2C_OFFSET 0x3000 + +/* + * General PCI + * Memory Addresses are mapped 1-1. I/O is mapped from 0 + */ +#define CFG_PCI1_MEM_BASE 0x80000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x00800000 /* 8M */ + +#define CFG_PEX_MEM_BASE 0xa0000000 +#define CFG_PEX_MEM_PHYS CFG_PEX_MEM_BASE +#define CFG_PEX_MEM_SIZE 0x10000000 /* 256M */ +#define CFG_PEX_IO_BASE 0x00000000 +#define CFG_PEX_IO_PHYS 0xe2800000 +#define CFG_PEX_IO_SIZE 0x00800000 /* 8M */ + +#define CFG_SRIO_MEM_BASE 0xc0000000 + +#if defined(CONFIG_PCI) + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP + +#undef CONFIG_PCI_SCAN_SHOW /* show pci devices on startup */ +#define CFG_PCI_SUBSYS_VENDORID 0x1057 /* Motorola */ + +#endif /* CONFIG_PCI */ + + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "eTSEC0" +#define CONFIG_MPC85XX_TSEC2 1 +#define CONFIG_MPC85XX_TSEC2_NAME "eTSEC1" +#undef CONFIG_MPC85XX_TSEC3 +#undef CONFIG_MPC85XX_TSEC4 +#undef CONFIG_MPC85XX_FEC + +#define TSEC1_PHY_ADDR 2 +#define TSEC2_PHY_ADDR 3 + +#define TSEC1_PHYIDX 0 +#define TSEC2_PHYIDX 0 + +/* Options are: eTSEC[0-3] */ +#define CONFIG_ETHPRIME "eTSEC0" + +#endif /* CONFIG_TSEC_ENET */ + +/* + * Environment + */ +#define CFG_ENV_IS_IN_FLASH 1 +#define CFG_ENV_ADDR (CFG_MONITOR_BASE + 0x40000) +#define CFG_ENV_SECT_SIZE 0x40000 /* 256K(one sector) for env */ +#define CFG_ENV_SIZE 0x2000 + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#if defined(CONFIG_PCI) +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PCI \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#else +#define CONFIG_COMMANDS (CONFIG_CMD_DFL \ + | CFG_CMD_PING \ + | CFG_CMD_I2C \ + | CFG_CMD_MII) +#endif +#include <cmd_confdefs.h> + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_LOAD_ADDR 0x2000000 /* default load address */ +#define CFG_PROMPT "=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_HZ 1000 /* decrementer freq: 1ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux*/ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /*log base 2 of the above value*/ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/* + * Environment Configuration + */ + +/* The mac addresses for all ethernet interface */ +#if defined(CONFIG_TSEC_ENET) +#define CONFIG_ETHADDR 00:E0:0C:00:00:FD +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:E0:0C:00:01:FD +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:E0:0C:00:02:FD +#endif + +#define CONFIG_IPADDR 192.168.1.253 + +#define CONFIG_HOSTNAME unknown +#define CONFIG_ROOTPATH /nfsroot +#define CONFIG_BOOTFILE your.uImage + +#define CONFIG_SERVERIP 192.168.1.1 +#define CONFIG_GATEWAYIP 192.168.1.1 +#define CONFIG_NETMASK 255.255.255.0 + +#define CONFIG_LOADADDR 200000 /*default location for tftp and bootm*/ + +#define CONFIG_BOOTDELAY 10 /* -1 disables auto-boot */ +#undef CONFIG_BOOTARGS /* the boot command will set bootargs*/ + +#define CONFIG_BAUDRATE 115200 + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "netdev=eth0\0" \ + "consoledev=ttyS0\0" \ + "ramdiskaddr=600000\0" \ + "ramdiskfile=your.ramdisk.u-boot\0" \ + "fdtaddr=400000\0" \ + "fdtfile=your.fdt.dtb\0" \ + "nfsargs=setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask:$hostname:$netdev:off " \ + "console=$consoledev,$baudrate $othbootargs\0" \ + "ramargs=setenv bootargs root=/dev/ram rw " \ + "console=$consoledev,$baudrate $othbootargs\0" \ + + +#define CONFIG_NFSBOOTCOMMAND \ + "run nfsargs;" \ + "tftp $loadaddr $bootfile;" \ + "tftp $fdtaddr $fdtfile;" \ + "bootm $loadaddr - $fdtaddr" + + +#define CONFIG_RAMBOOTCOMMAND \ + "run ramargs;" \ + "tftp $ramdiskaddr $ramdiskfile;" \ + "tftp $loadaddr $bootfile;" \ + "bootm $loadaddr $ramdiskaddr" + +#define CONFIG_BOOTCOMMAND CONFIG_NFSBOOTCOMMAND + +#endif /* __CONFIG_H */ diff --git a/include/configs/bamboo.h b/include/configs/bamboo.h index bcc736ceb5..db58a9fa74 100644 --- a/include/configs/bamboo.h +++ b/include/configs/bamboo.h @@ -1,5 +1,5 @@ /* - * (C) Copyright 2005-2006 + * (C) Copyright 2005-2007 * Stefan Roese, DENX Software Engineering, sr@denx.de. * * See file CREDITS for list of people who contributed to this @@ -43,7 +43,6 @@ * 2nd ethernet port you have to "undef" the following define. */ #define CONFIG_BAMBOO_NAND 1 /* enable nand flash support */ -#define CFG_NAND_LEGACY /*----------------------------------------------------------------------- * Base addresses -- Note these are effective addresses where the @@ -143,65 +142,13 @@ #endif /* CFG_ENV_IS_IN_FLASH */ /*----------------------------------------------------------------------- - * NAND-FLASH related + * NAND FLASH *----------------------------------------------------------------------*/ -#define NAND_CMD_REG (0x00) /* NandFlash Command Register */ -#define NAND_ADDR_REG (0x04) /* NandFlash Address Register */ -#define NAND_DATA_REG (0x08) /* NandFlash Data Register */ -#define NAND_ECC0_REG (0x10) /* NandFlash ECC Register0 */ -#define NAND_ECC1_REG (0x14) /* NandFlash ECC Register1 */ -#define NAND_ECC2_REG (0x18) /* NandFlash ECC Register2 */ -#define NAND_ECC3_REG (0x1C) /* NandFlash ECC Register3 */ -#define NAND_ECC4_REG (0x20) /* NandFlash ECC Register4 */ -#define NAND_ECC5_REG (0x24) /* NandFlash ECC Register5 */ -#define NAND_ECC6_REG (0x28) /* NandFlash ECC Register6 */ -#define NAND_ECC7_REG (0x2C) /* NandFlash ECC Register7 */ -#define NAND_CR0_REG (0x30) /* NandFlash Device Bank0 Config Register */ -#define NAND_CR1_REG (0x34) /* NandFlash Device Bank1 Config Register */ -#define NAND_CR2_REG (0x38) /* NandFlash Device Bank2 Config Register */ -#define NAND_CR3_REG (0x3C) /* NandFlash Device Bank3 Config Register */ -#define NAND_CCR_REG (0x40) /* NandFlash Core Configuration Register */ -#define NAND_STAT_REG (0x44) /* NandFlash Device Status Register */ -#define NAND_HWCTL_REG (0x48) /* NandFlash Direct Hwd Control Register */ -#define NAND_REVID_REG (0x50) /* NandFlash Core Revision Id Register */ - -/* Nand Flash K9F1208U0A Command Set => Nand Flash 0 */ -#define NAND0_CMD_READ1_HALF1 0x00 /* Starting addr for 1rst half of registers */ -#define NAND0_CMD_READ1_HALF2 0x01 /* Starting addr for 2nd half of registers */ -#define NAND0_CMD_READ2 0x50 -#define NAND0_CMD_READ_ID 0x90 -#define NAND0_CMD_READ_STATUS 0x70 -#define NAND0_CMD_RESET 0xFF -#define NAND0_CMD_PAGE_PROG 0x80 -#define NAND0_CMD_PAGE_PROG_TRUE 0x10 -#define NAND0_CMD_PAGE_PROG_DUMMY 0x11 -#define NAND0_CMD_BLOCK_ERASE 0x60 -#define NAND0_CMD_BLOCK_ERASE_END 0xD0 - -#define CFG_MAX_NAND_DEVICE 1 /* Max number of NAND devices */ -#define SECTORSIZE 512 - -#define ADDR_COLUMN 1 -#define ADDR_PAGE 2 -#define ADDR_COLUMN_PAGE 3 - -#define NAND_ChipID_UNKNOWN 0x00 -#define NAND_MAX_FLOORS 1 -#define NAND_MAX_CHIPS 1 - -#define WRITE_NAND_COMMAND(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_CMD_REG) = d;} while(0) -#define WRITE_NAND_ADDRESS(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_ADDR_REG) = d;} while(0) -#define WRITE_NAND(d, adr) do {*(volatile u8 *)((ulong)adr+NAND_DATA_REG) = d;} while(0) -#define READ_NAND(adr) (*(volatile u8 *)((ulong)adr+NAND_DATA_REG)) -#define NAND_WAIT_READY(nand) while (!(*(volatile u8 *)((ulong)nand->IO_ADDR+NAND_STAT_REG) & 0x01)) - -/* not needed with 440EP NAND controller */ -#define NAND_CTL_CLRALE(nandptr) -#define NAND_CTL_SETALE(nandptr) -#define NAND_CTL_CLRCLE(nandptr) -#define NAND_CTL_SETCLE(nandptr) -#define NAND_DISABLE_CE(nand) -#define NAND_ENABLE_CE(nand) +#define CFG_MAX_NAND_DEVICE 1 +#define NAND_MAX_CHIPS 1 +#define CFG_NAND_CS 1 +#define CFG_NAND_BASE (CFG_NAND_ADDR + CFG_NAND_CS) +#define CFG_NAND_SELECT_DEVICE 1 /* nand driver supports mutipl. chips */ /*----------------------------------------------------------------------- * DDR SDRAM diff --git a/include/configs/delta.h b/include/configs/delta.h index 4038f21960..25ba06e5d9 100644 --- a/include/configs/delta.h +++ b/include/configs/delta.h @@ -202,7 +202,6 @@ /* * NAND Flash */ -/* Use the new NAND code. (BOARDLIBS = drivers/nand/libnand.a required) */ #undef CFG_NAND_LEGACY #define CFG_NAND0_BASE 0x0 /* 0x43100040 */ /* 0x10000000 */ diff --git a/include/configs/katmai.h b/include/configs/katmai.h index 7f55366ca5..cc47a168ed 100644 --- a/include/configs/katmai.h +++ b/include/configs/katmai.h @@ -360,7 +360,19 @@ EBC_BXCR_BW_16BIT) /* Memory Bank 1 (Xilinx System ACE controller) initialization */ -#define CFG_EBC_PB1AP 0x7F8FFE80 +#define CFG_EBC_PB1AP (EBC_BXAP_BME_DISABLED | \ + EBC_BXAP_TWT_ENCODE(4) | \ + EBC_BXAP_BCE_DISABLE | \ + EBC_BXAP_BCT_2TRANS | \ + EBC_BXAP_CSN_ENCODE(0) | \ + EBC_BXAP_OEN_ENCODE(0) | \ + EBC_BXAP_WBN_ENCODE(0) | \ + EBC_BXAP_WBF_ENCODE(0) | \ + EBC_BXAP_TH_ENCODE(0) | \ + EBC_BXAP_RE_DISABLED | \ + EBC_BXAP_SOR_NONDELAYED | \ + EBC_BXAP_BEM_WRITEONLY | \ + EBC_BXAP_PEN_DISABLED) #define CFG_EBC_PB1CR (EBC_BXCR_BAS_ENCODE(CFG_ACE_BASE) | \ EBC_BXCR_BS_1MB | \ EBC_BXCR_BU_RW | \ diff --git a/include/configs/sequoia.h b/include/configs/sequoia.h index 1f19621f44..b7f79c26eb 100644 --- a/include/configs/sequoia.h +++ b/include/configs/sequoia.h @@ -38,7 +38,9 @@ #define CONFIG_440GRX 1 /* Specific PPC440GRx */ #endif #define CONFIG_4xx 1 /* ... PPC4xx family */ -#define CONFIG_SYS_CLK_FREQ 33000000 /* external freq to pll */ +/* Detect Sequoia PLL input clock automatically via CPLD bit */ +#define CONFIG_SYS_CLK_FREQ ((in8(CFG_BCSR_BASE + 3) & 0x80) ? \ + 3333333 : 33000000) #define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_early_init_f */ #define CONFIG_MISC_INIT_R 1 /* Call misc_init_r */ diff --git a/include/configs/stxssa.h b/include/configs/stxssa.h new file mode 100644 index 0000000000..8624f4b74b --- /dev/null +++ b/include/configs/stxssa.h @@ -0,0 +1,465 @@ +/* + * (C) Copyright 2005 Embedded Alley Solutions, Inc. + * Dan Malek <dan@embeddedalley.com> + * Copied from STx GP3. + * Updates for Silicon Tx GP3 SSA board. + * + * (C) Copyright 2002,2003 Motorola,Inc. + * Xianghua Xiao <X.Xiao@motorola.com> + * + * See file CREDITS for list of people who contributed to this + * project. + * + * This program is free software; you can redistribute it and/or + * modify it under the terms of the GNU General Public License as + * published by the Free Software Foundation; either version 2 of + * the License, or (at your option) any later version. + * + * This program is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the + * GNU General Public License for more details. + * + * You should have received a copy of the GNU General Public License + * along with this program; if not, write to the Free Software + * Foundation, Inc., 59 Temple Place, Suite 330, Boston, + * MA 02111-1307 USA + */ + +/* mpc8560ads board configuration file */ +/* please refer to doc/README.mpc85xx for more info */ +/* make sure you change the MAC address and other network params first, + * search for CONFIG_ETHADDR,CONFIG_SERVERIP,etc in this file + */ + +#ifndef __CONFIG_H +#define __CONFIG_H + +/* High Level Configuration Options */ +#define CONFIG_BOOKE 1 /* BOOKE */ +#define CONFIG_E500 1 /* BOOKE e500 family */ +#define CONFIG_MPC85xx 1 /* MPC8540/MPC8560 */ +#define CONFIG_CPM2 1 /* has CPM2 */ +#define CONFIG_STXSSA 1 /* Silicon Tx GPPP SSA board specific*/ + +#undef CONFIG_PCI /* pci ethernet support */ +#define CONFIG_TSEC_ENET /* tsec ethernet support*/ +#undef CONFIG_ETHER_ON_FCC /* cpm FCC ethernet support */ +#define CONFIG_ENV_OVERWRITE +#define CONFIG_SPD_EEPROM /* Use SPD EEPROM for DDR setup */ +#undef CONFIG_DDR_ECC /* only for ECC DDR module */ +#undef CONFIG_DDR_DLL /* possible DLL fix needed */ +#define CONFIG_DDR_2T_TIMING /* Sets the 2T timing bit */ + + +/* sysclk for MPC85xx + */ + +#define CONFIG_SYS_CLK_FREQ 33000000 /* most pci cards are 33Mhz */ + +/* Blinkin' LEDs for Robert :-) +*/ +#define CONFIG_SHOW_ACTIVITY 1 + +/* + * These can be toggled for performance analysis, otherwise use default. + */ +#define CONFIG_L2_CACHE /* toggle L2 cache */ +#define CONFIG_BTB /* toggle branch predition */ +#define CONFIG_ADDR_STREAMING /* toggle addr streaming */ + +#define CONFIG_BOARD_EARLY_INIT_F 1 /* Call board_pre_init */ + +#undef CFG_DRAM_TEST /* memory test, takes time */ +#define CFG_MEMTEST_START 0x00200000 /* memtest region */ +#define CFG_MEMTEST_END 0x00400000 + + +/* Localbus connector. There are many options that can be + * connected here, including sdram or lots of flash. + * This address, however, is used to configure a 256M local bus + * window that includes the Config latch below. + */ +#define CFG_LBC_OPTION_BASE 0xf0000000 /* Localbus Extension */ +#define CFG_LBC_OPTION_SIZE 256 /* 256MB */ + +/* There are various flash options used, we configure for the largest, + * which is 64Mbytes. The CFI works fine and will discover the proper + * sizes. + */ +#define CFG_FLASH_BASE 0xFC000000 /* start of FLASH 64M */ +#define CFG_BR0_PRELIM 0xFC001801 /* port size 32bit */ +#define CFG_OR0_PRELIM 0xFC000FF7 /* 64 MB Flash */ + +#define CFG_FLASH_CFI 1 +#define CFG_FLASH_CFI_DRIVER 1 +#undef CFG_FLASH_USE_BUFFER_WRITE /* use buffered writes (20x faster) */ +#define CFG_MAX_FLASH_SECT 256 /* max number of sectors on one chip */ +#define CFG_MAX_FLASH_BANKS 1 /* max number of memory banks */ + +#define CFG_FLASH_BANKS_LIST { CFG_FLASH_BASE } + +#define CFG_FLASH_PROTECTION + +/* The configuration latch is Chip Select 1. + * It's an 8-bit latch in the lower 8 bits of the word. + */ +#define CFG_LBC_CFGLATCH_BASE 0xfb000000 /* Base of config latch */ +#define CFG_BR1_PRELIM 0xfb001801 /* 32-bit port */ +#define CFG_OR1_PRELIM 0xffff0ff7 /* 64K is enough */ + +#define CFG_MONITOR_BASE TEXT_BASE /* start of monitor */ + +#if (CFG_MONITOR_BASE < CFG_FLASH_BASE) +#define CFG_RAMBOOT +#else +#undef CFG_RAMBOOT +#endif + +#ifdef CFG_RAMBOOT +#define CFG_CCSRBAR_DEFAULT 0x40000000 /* CCSRBAR by BDI cfg */ +#else +#define CFG_CCSRBAR_DEFAULT 0xff700000 /* CCSRBAR Default */ +#endif +#define CFG_CCSRBAR 0xe0000000 /* relocated CCSRBAR */ +#define CFG_IMMR CFG_CCSRBAR /* PQII uses CFG_IMMR */ + + +/* + * DDR Setup + */ + +/* + * Base addresses -- Note these are effective addresses where the + * actual resources get mapped (not physical addresses) + */ +#define CFG_DDR_SDRAM_BASE 0x00000000 /* DDR is system memory */ +#define CFG_SDRAM_BASE CFG_DDR_SDRAM_BASE + +#define SPD_EEPROM_ADDRESS 0x54 /* DDR DIMM */ + +#undef CONFIG_CLOCKS_IN_MHZ + +/* local bus definitions */ +#define CFG_BR2_PRELIM 0xf8001861 /* 64MB localbus SDRAM */ +#define CFG_OR2_PRELIM 0xfc006901 +#define CFG_LBC_LCRR 0x00030004 /* local bus freq */ +#define CFG_LBC_LBCR 0x00000000 +#define CFG_LBC_LSRT 0x20000000 +#define CFG_LBC_MRTPR 0x20000000 +#define CFG_LBC_LSDMR_1 0x2861b723 +#define CFG_LBC_LSDMR_2 0x0861b723 +#define CFG_LBC_LSDMR_3 0x0861b723 +#define CFG_LBC_LSDMR_4 0x1861b723 +#define CFG_LBC_LSDMR_5 0x4061b723 + +#define CONFIG_L1_INIT_RAM +#define CFG_INIT_RAM_LOCK 1 +#define CFG_INIT_RAM_ADDR 0x60000000 /* Initial RAM address */ +#define CFG_INIT_RAM_END 0x4000 /* End of used area in RAM */ + +#define CFG_GBL_DATA_SIZE 128 /* num bytes initial data */ +#define CFG_GBL_DATA_OFFSET (CFG_INIT_RAM_END - CFG_GBL_DATA_SIZE) +#define CFG_INIT_SP_OFFSET CFG_GBL_DATA_OFFSET + +#define CFG_MONITOR_LEN (256 * 1024) /* Reserve 256 kB for Mon */ +#define CFG_MALLOC_LEN (512 * 1024) /* Reserved for malloc */ + +/* Serial Port */ +#define CONFIG_CONS_INDEX 2 +#undef CONFIG_SERIAL_SOFTWARE_FIFO +#define CFG_NS16550 +#define CFG_NS16550_SERIAL +#define CFG_NS16550_REG_SIZE 1 +#define CFG_NS16550_CLK get_bus_freq(0) + +#define CFG_BAUDRATE_TABLE \ + {300, 600, 1200, 2400, 4800, 9600, 19200, 38400, 115200} + +#define CFG_NS16550_COM1 (CFG_CCSRBAR+0x4500) +#define CFG_NS16550_COM2 (CFG_CCSRBAR+0x4600) + +#define CONFIG_CMDLINE_EDITING 1 /* add command line history */ +#define CFG_HUSH_PARSER 1 /* Use the HUSH parser */ +#ifdef CFG_HUSH_PARSER +#define CFG_PROMPT_HUSH_PS2 "> " +#endif + +/* I2C */ +#define CONFIG_FSL_I2C /* Use FSL common I2C driver */ +#define CONFIG_HARD_I2C /* I2C with hardware support*/ +#undef CONFIG_SOFT_I2C /* I2C bit-banged */ +#define CFG_I2C_SPEED 400000 /* I2C speed and slave address */ +#define CFG_I2C_SLAVE 0x7F +#if 0 +#define CFG_I2C_NOPROBES {0x00} /* Don't probe these addrs */ +#else +/* I did the 'if 0' so we could keep the syntax above if ever needed. */ +#undef CFG_I2C_NOPROBES +#endif +#define CFG_I2C_OFFSET 0x3000 + +/* I2C EEPROM. AT24C32, we keep our environment in here. +*/ +#define CFG_I2C_EEPROM_ADDR 0x51 /* 1010001x */ +#define CFG_I2C_EEPROM_ADDR_LEN 2 +#define CFG_EEPROM_PAGE_WRITE_BITS 5 /* =32 Bytes per write */ +#define CFG_EEPROM_PAGE_WRITE_ENABLE +#define CFG_EEPROM_PAGE_WRITE_DELAY_MS 20 + +/* + * Standard 8555 PCI mapping. + * Addresses are mapped 1-1. + */ +#define CFG_PCI1_MEM_BASE 0x80000000 +#define CFG_PCI1_MEM_PHYS CFG_PCI1_MEM_BASE +#define CFG_PCI1_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI1_IO_BASE 0x00000000 +#define CFG_PCI1_IO_PHYS 0xe2000000 +#define CFG_PCI1_IO_SIZE 0x01000000 /* 16M */ + +#define CFG_PCI2_MEM_BASE 0xa0000000 +#define CFG_PCI2_MEM_PHYS CFG_PCI2_MEM_BASE +#define CFG_PCI2_MEM_SIZE 0x20000000 /* 512M */ +#define CFG_PCI2_IO_BASE 0x00000000 +#define CFG_PCI2_IO_PHYS 0xe3000000 +#define CFG_PCI2_IO_SIZE 0x01000000 /* 16M */ + +#if defined(CONFIG_PCI) /* PCI Ethernet card */ + +#define CONFIG_NET_MULTI +#define CONFIG_PCI_PNP /* do pci plug-and-play */ + +#undef CONFIG_EEPRO100 +#undef CONFIG_TULIP + +#if !defined(CONFIG_PCI_PNP) + #define PCI_ENET0_IOADDR 0xe0000000 + #define PCI_ENET0_MEMADDR 0xe0000000 + #define PCI_IDSEL_NUMBER 0x0c /* slot0->3(IDSEL)=12->15 */ +#endif + +#undef CONFIG_PCI_SCAN_SHOW +#define CFG_PCI_SUBSYS_VENDORID 0x1057 /* Motorola */ + +#endif /* CONFIG_PCI */ + +#if defined(CONFIG_TSEC_ENET) + +#ifndef CONFIG_NET_MULTI +#define CONFIG_NET_MULTI 1 +#endif + +#define CONFIG_MII 1 /* MII PHY management */ + +#define CONFIG_MPC85XX_TSEC1 1 +#define CONFIG_MPC85XX_TSEC1_NAME "TSEC0" +#define CONFIG_MPC85XX_TSEC2 1 +#define CONFIG_MPC85XX_TSEC2_NAME "TSEC1" +#undef CONFIG_MPS85XX_FEC + +#define TSEC1_PHY_ADDR 2 +#define TSEC2_PHY_ADDR 4 +#define TSEC1_PHYIDX 0 +#define TSEC2_PHYIDX 0 +#define CONFIG_ETHPRIME "TSEC0" + +#elif defined(CONFIG_ETHER_ON_FCC) /* CPM FCC Ethernet */ + +#define CONFIG_ETHER_ON_FCC2 /* define if ether on FCC */ +#undef CONFIG_ETHER_NONE /* define if ether on something else */ +#define CONFIG_ETHER_INDEX 2 /* which channel for ether */ + +#if (CONFIG_ETHER_INDEX == 2) + /* + * - Rx-CLK is CLK13 + * - Tx-CLK is CLK14 + * - Select bus for bd/buffers + * - Full duplex + */ + #define CFG_CMXFCR_MASK (CMXFCR_FC2 | CMXFCR_RF2CS_MSK | CMXFCR_TF2CS_MSK) + #define CFG_CMXFCR_VALUE (CMXFCR_RF2CS_CLK13 | CMXFCR_TF2CS_CLK14) + #define CFG_CPMFCR_RAMTYPE 0 +#if 0 + #define CFG_FCC_PSMR (FCC_PSMR_FDE) +#else + #define CFG_FCC_PSMR 0 +#endif + #define FETH2_RST 0x01 +#elif (CONFIG_ETHER_INDEX == 3) + /* need more definitions here for FE3 */ + #define FETH3_RST 0x80 +#endif /* CONFIG_ETHER_INDEX */ + +/* MDIO is done through the TSEC0 control. +*/ +#define CONFIG_MII /* MII PHY management */ +#undef CONFIG_BITBANGMII /* bit-bang MII PHY management */ + +#endif + +/* Environment - default config is in flash, see below */ +#if 0 /* in EEPROM */ +#define CFG_ENV_IS_IN_EEPROM 1 +#define CFG_ENV_OFFSET 0 +#define CFG_ENV_SIZE 2048 +#else /* in flash */ +#define CFG_ENV_IS_IN_FLASH 1 +#define CFG_ENV_SECT_SIZE 0x40000 + +#define CFG_ENV_ADDR (CFG_MONITOR_BASE - CFG_ENV_SECT_SIZE) +#define CFG_ENV_SIZE 0x4000 +#define CFG_ENV_ADDR_REDUND (CFG_ENV_ADDR - CFG_ENV_SECT_SIZE) +#define CFG_ENV_SIZE_REDUND (CFG_ENV_SIZE) +#endif + +#define CONFIG_LOADS_ECHO 1 /* echo on for serial download */ +#define CFG_LOADS_BAUD_CHANGE 1 /* allow baudrate change */ + +#define CONFIG_TIMESTAMP /* Print image info with ts */ + +#if defined(CFG_RAMBOOT) + #if defined(CONFIG_PCI) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_PCI | \ + CFG_CMD_PING | CFG_CMD_I2C) & \ + ~(CFG_CMD_ENV | \ + CFG_CMD_LOADS )) + #elif defined(CONFIG_TSEC_ENET) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_PING | \ + CFG_CMD_MII | CFG_CMD_I2C ) & \ + ~(CFG_CMD_ENV)) + #elif defined(CONFIG_ETHER_ON_FCC) + #define CONFIG_COMMANDS ((CONFIG_CMD_DFL | CFG_CMD_MII | \ + CFG_CMD_PING | CFG_CMD_I2C) & \ + ~(CFG_CMD_ENV)) + #endif +#else + #if defined(CONFIG_PCI) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_PCI | \ + CFG_CMD_ELF | CFG_CMD_PING | CFG_CMD_I2C) + #elif defined(CONFIG_TSEC_ENET) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_PING | \ + CFG_CMD_ELF | CFG_CMD_MII | CFG_CMD_I2C) + #elif defined(CONFIG_ETHER_ON_FCC) + #define CONFIG_COMMANDS (CONFIG_CMD_DFL | CFG_CMD_MII | \ + CFG_CMD_ELF | CFG_CMD_PING | CFG_CMD_I2C) + #endif +#endif +#include <cmd_confdefs.h> + +#undef CONFIG_WATCHDOG /* watchdog disabled */ + +/* + * Miscellaneous configurable options + */ +#define CFG_LONGHELP /* undef to save memory */ +#define CFG_PROMPT "SSA=> " /* Monitor Command Prompt */ +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CBSIZE 1024 /* Console I/O Buffer Size */ +#else +#define CFG_CBSIZE 256 /* Console I/O Buffer Size */ +#endif +#define CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16) /* Print Buffer Size */ +#define CFG_MAXARGS 16 /* max number of command args */ +#define CFG_BARGSIZE CFG_CBSIZE /* Boot Argument Buffer Size */ +#define CFG_LOAD_ADDR 0x1000000 /* default load address */ +#define CFG_HZ 1000 /* decrementer freq: 1 ms ticks */ + +/* + * For booting Linux, the board info and command line data + * have to be in the first 8 MB of memory, since this is + * the maximum mapped by the Linux kernel during initialization. + */ +#define CFG_BOOTMAPSZ (8 << 20) /* Initial Memory map for Linux */ + +/* Cache Configuration */ +#define CFG_DCACHE_SIZE 32768 +#define CFG_CACHELINE_SIZE 32 +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CFG_CACHELINE_SHIFT 5 /* log base 2 of the above value */ +#endif + +/* + * Internal Definitions + * + * Boot Flags + */ +#define BOOTFLAG_COLD 0x01 /* Normal Power-On: Boot from FLASH */ +#define BOOTFLAG_WARM 0x02 /* Software reboot */ + +#if (CONFIG_COMMANDS & CFG_CMD_KGDB) +#define CONFIG_KGDB_BAUDRATE 230400 /* speed to run kgdb serial port */ +#define CONFIG_KGDB_SER_INDEX 2 /* which serial port to use */ +#endif + +/*Note: change below for your network setting!!! */ +#if defined(CONFIG_TSEC_ENET) || defined(CONFIG_ETHER_ON_FCC) +#define CONFIG_ETHADDR 00:e0:0c:07:9b:8a +#define CONFIG_HAS_ETH1 +#define CONFIG_ETH1ADDR 00:e0:0c:07:9b:8b +#define CONFIG_HAS_ETH2 +#define CONFIG_ETH2ADDR 00:e0:0c:07:9b:8c +#endif + +/* + * Environment in EEPROM is compatible with different flash sector sizes, + * but only little space is available, so we use a very simple setup. + * With environment in flash, we use a more powerful default configuration. + */ +#ifdef CFG_ENV_IS_IN_EEPROM /* use restricted "standard" environment */ + +#define CONFIG_BAUDRATE 38400 + +#define CONFIG_BOOTDELAY 3 /* -1 disable autoboot */ +#define CONFIG_BOOTCOMMAND "bootm 0xffc00000 0xffd00000" +#define CONFIG_BOOTARGS "root=/dev/nfs rw ip=any console=ttyS1,$baudrate" +#define CONFIG_SERVERIP 192.168.85.1 +#define CONFIG_IPADDR 192.168.85.60 +#define CONFIG_GATEWAYIP 192.168.85.1 +#define CONFIG_NETMASK 255.255.255.0 +#define CONFIG_HOSTNAME STX_SSA +#define CONFIG_ROOTPATH /gppproot +#define CONFIG_BOOTFILE uImage +#define CONFIG_LOADADDR 0x1000000 + +#else /* ENV IS IN FLASH -- use a full-blown envionment */ + +#define CONFIG_BAUDRATE 115200 + +#define CONFIG_BOOTDELAY 5 /* -1 disable autoboot */ + +#define CONFIG_PREBOOT "echo;" \ + "echo Type \\\"run flash_nfs\\\" to mount root filesystem over NFS;" \ + "echo" + +#undef CONFIG_BOOTARGS /* the boot command will set bootargs */ + +#define CONFIG_EXTRA_ENV_SETTINGS \ + "hostname=gp3ssa\0" \ + "bootfile=/tftpboot/gp3ssa/uImage\0" \ + "loadaddr=400000\0" \ + "netdev=eth0\0" \ + "consdev=ttyS1\0" \ + "nfsargs=setenv bootargs root=/dev/nfs rw " \ + "nfsroot=$serverip:$rootpath\0" \ + "ramargs=setenv bootargs root=/dev/ram rw\0" \ + "addip=setenv bootargs $bootargs " \ + "ip=$ipaddr:$serverip:$gatewayip:$netmask" \ + ":$hostname:$netdev:off panic=1\0" \ + "addcons=setenv bootargs $bootargs " \ + "console=$consdev,$baudrate\0" \ + "flash_nfs=run nfsargs addip addcons;" \ + "bootm $kernel_addr\0" \ + "flash_self=run ramargs addip addcons;" \ + "bootm $kernel_addr $ramdisk_addr\0" \ + "net_nfs=tftp $loadaddr $bootfile;" \ + "run nfsargs addip addcons;bootm\0" \ + "rootpath=/opt/eldk/ppc_85xx\0" \ + "kernel_addr=FC000000\0" \ + "ramdisk_addr=FC200000\0" \ + "" +#define CONFIG_BOOTCOMMAND "run flash_self" + +#endif /* CFG_ENV_IS_IN_EEPROM */ + +#endif /* __CONFIG_H */ diff --git a/include/configs/zylonite.h b/include/configs/zylonite.h index c6aa8ece5b..1e8ed7abdf 100644 --- a/include/configs/zylonite.h +++ b/include/configs/zylonite.h @@ -174,7 +174,6 @@ /* * NAND Flash */ -/* Use the new NAND code. (BOARDLIBS = drivers/nand/libnand.a required) */ #define CONFIG_NEW_NAND_CODE #define CFG_NAND0_BASE 0x0 #undef CFG_NAND1_BASE diff --git a/include/mpc86xx.h b/include/mpc86xx.h index bc8ba3f2da..673bfed16e 100644 --- a/include/mpc86xx.h +++ b/include/mpc86xx.h @@ -9,6 +9,15 @@ #define EXC_OFF_SYS_RESET 0x0100 /* System reset offset */ + +/* + * platform register addresses + */ + +#define GUTS_SVR (CFG_CCSRBAR + 0xE00A4) +#define MCM_ABCR (CFG_CCSRBAR + 0x01000) +#define MCM_DBCR (CFG_CCSRBAR + 0x01008) + /* * l2cr values. Look in config_<BOARD>.h for the actual setup */ diff --git a/nand_spl/board/amcc/sequoia/Makefile b/nand_spl/board/amcc/sequoia/Makefile index 510999db03..b42da8cf68 100644 --- a/nand_spl/board/amcc/sequoia/Makefile +++ b/nand_spl/board/amcc/sequoia/Makefile @@ -30,7 +30,7 @@ AFLAGS += -DCONFIG_NAND_SPL CFLAGS += -DCONFIG_NAND_SPL SOBJS = start.o init.o resetvec.o -COBJS = nand_boot.o ndfc.o sdram.o speed.o +COBJS = nand_boot.o ndfc.o sdram.o SRCS := $(addprefix $(obj),$(SOBJS:.o=.S) $(COBJS:.o=.c)) OBJS := $(addprefix $(obj),$(SOBJS) $(COBJS)) @@ -69,10 +69,6 @@ $(obj)start.S: @rm -f $(obj)start.S ln -s $(SRCTREE)/cpu/ppc4xx/start.S $(obj)start.S -$(obj)speed.c: - @rm -f $(obj)speed.c - ln -s $(SRCTREE)/cpu/ppc4xx/speed.c $(obj)speed.c - # from board directory $(obj)init.S: @rm -f $(obj)init.S |