summaryrefslogtreecommitdiff
path: root/client
Commit message (Expand)AuthorAgeFilesLines
* Fix inconsistencies between signed and unsigned character declarations. Acc...Ted Lemon1998-06-251-4/+6
* network_number, not network_address.Ted Lemon1998-05-181-2/+2
* Don't use statmsg socket or handle network location notification in 2.0Ted Lemon1997-12-061-47/+1
* Cast pid_t up to long so that printf will work on systems where it's long and...Ted Lemon1997-12-061-2/+2
* new catted man pageTed Lemon1997-11-221-6/+6
* new catted man pagesTed Lemon1997-11-221-12/+540
* Fix errors mentioned by cgd. s/dhcp(5)/dhcp-options(5)/ Fix SEE ALSO.Ted Lemon1997-11-221-18/+21
* Move BUGS up. Add FILES section documenting location of script files in dis...Ted Lemon1997-11-221-3/+10
* globalize sed commands on man pagesTed Lemon1997-11-221-6/+6
* catted man pages, for machines that don't have troff/nroffTed Lemon1997-11-222-0/+330
* Build and install dhclient.leases man pageTed Lemon1997-11-221-2/+18
* DHCP Client lease database descriptionTed Lemon1997-11-221-0/+62
* Don't echo ifconfig parameters - that was for debugging.Ted Lemon1997-11-223-3/+0
* DHCP client configuration scriptTed Lemon1997-11-221-0/+184
* Write an actual manual pageTed Lemon1997-11-221-4/+481
* bsd/os client script (pretty much identical to NetBSD)Ted Lemon1997-11-201-0/+175
* Check if variables have value before doing set $variableTed Lemon1997-11-202-88/+116
* Don't need to compute network number or broadcast address anymoreTed Lemon1997-11-201-10/+0
* Compute network number and (if not offered by server) broadcast address for l...Ted Lemon1997-11-201-1/+41
* fix up nameTed Lemon1997-10-291-1/+1
* Fix spellingTed Lemon1997-10-271-2/+2
* systat -> sysconfTed Lemon1997-10-201-4/+4
* By default, do not leave scripts lying around in /tmpTed Lemon1997-10-201-2/+6
* Add support for static routesTed Lemon1997-10-202-4/+52
* NextStep client scriptTed Lemon1997-09-171-0/+37
* Chmod resolv.conf in case umask is bogusTed Lemon1997-09-161-0/+2
* Add support for interfaces_requested flag. NUL-terminate copied lease optio...Ted Lemon1997-09-161-16/+123
* Add support for interfaces_requested flagTed Lemon1997-09-161-1/+4
* Install dhcp client in CLIENTBINDIRTed Lemon1997-09-161-1/+2
* Enclose prototype in PROTO.Ted Lemon1997-06-031-2/+2
* Solaris client scriptTed Lemon1997-06-031-0/+148
* Linux client scriptTed Lemon1997-06-031-0/+156
* FreeBSD client scriptTed Lemon1997-06-021-0/+136
* Fix typoTed Lemon1997-06-021-1/+1
* Sample dhclient.conf takes advantage of some new features.Ted Lemon1997-06-021-15/+20
* Try to renew active lease in REBOOT state even if it's expired.Ted Lemon1997-06-021-2/+2
* Support rejection of messages from rogue servers; print IP addr of server ins...Ted Lemon1997-06-021-21/+47
* Handle the REJECT statementTed Lemon1997-06-021-1/+38
* Cygwin32 compatibility. Handle prepend, append and supersede option modifie...Ted Lemon1997-05-091-31/+150
* Make parse_option_decl return the option structure it parsed. parse_ip_addr...Ted Lemon1997-05-091-28/+52
* Cast malloc so that we don't get an error on SunOSTed Lemon1997-03-291-2/+3
* Update copyrightTed Lemon1997-03-291-1/+2
* ip -> client -> packet is a struct, not a pointer to a structTed Lemon1997-03-291-5/+5
* Add backoff_cutoff and initial_interval parse keywords; fix send_options thinkoTed Lemon1997-03-291-3/+11
* Don't have ARP code look up names; net_netmask_arg, not new_subnet_argTed Lemon1997-03-281-4/+7
* Move top_level_config to clparse.c; use more defaults from client config stru...Ted Lemon1997-03-281-52/+78
* Set up enough defaults that we can actually boot without a configuration file.Ted Lemon1997-03-281-1/+40
* Send client identifier when declining.Ted Lemon1997-03-061-1/+17
* When we toss all our leases, just go back to init state - don't try to get fancyTed Lemon1997-03-061-2/+3
* change prototypes to functions called by timeouts; initialize bootp_handler t...Ted Lemon1997-03-061-28/+45
View Lorry Controller Status