summaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--COPYRIGHT18
-rw-r--r--Makefile11
-rw-r--r--README47
-rw-r--r--clients/lib/Makefile20
-rw-r--r--clients/lib/iolib.c220
-rw-r--r--clients/lib/mathlib.c182
-rw-r--r--clients/lib/mathlib.h2
-rw-r--r--clients/lib/strlib.c72
-rw-r--r--clients/lib/strlib.h2
-rw-r--r--clients/lua/Makefile12
-rw-r--r--clients/lua/lua.c58
-rw-r--r--doc/lua.dvibin40392 -> 0 bytes
-rw-r--r--doc/lua.ps1774
-rw-r--r--doc/manual.dvibin48832 -> 66972 bytes
-rw-r--r--doc/manual.ps4057
-rwxr-xr-xdomake6
-rw-r--r--include/Makefile8
-rw-r--r--include/lua.h102
-rw-r--r--include/lualib.h2
-rw-r--r--include/mm.h0
-rw-r--r--src/Makefile29
-rw-r--r--src/fallback.c171
-rw-r--r--src/fallback.h31
-rw-r--r--src/hash.c421
-rw-r--r--src/hash.h17
-rw-r--r--src/inout.c239
-rw-r--r--src/inout.h23
-rw-r--r--src/lex.c143
-rw-r--r--src/mem.c44
-rw-r--r--src/mem.h25
-rw-r--r--src/opcode.c1623
-rw-r--r--src/opcode.h92
-rw-r--r--src/parser.c (renamed from src/y.tab.c)1492
-rw-r--r--src/parser.h (renamed from src/y.tab.h)20
-rw-r--r--src/table.c402
-rw-r--r--src/table.h31
-rw-r--r--src/tree.c141
-rw-r--r--src/tree.h37
-rw-r--r--src/types.h31
-rw-r--r--src/ugly.h36
-rw-r--r--src/yacc/Makefile30
-rw-r--r--src/yacc/exscript3
-rw-r--r--src/yacc/lua.lex85
-rw-r--r--src/yacc/lua.stx847
-rw-r--r--test/array.lua2
-rw-r--r--test/dump.lua (renamed from test/dump)12
-rw-r--r--test/long.lua (renamed from test/teste.lua)2
-rw-r--r--test/save.lua14
-rw-r--r--test/sort.lua2
-rw-r--r--test/sort/q.lua51
-rw-r--r--test/sort/sort.lua51
-rw-r--r--test/type.lua10
52 files changed, 6205 insertions, 6545 deletions
diff --git a/COPYRIGHT b/COPYRIGHT
new file mode 100644
index 00000000..b730ccd7
--- /dev/null
+++ b/COPYRIGHT
@@ -0,0 +1,18 @@
+Copyright (c) 1994-1995
+Waldemar Celes Filho, Luiz Henrique de Figueiredo, Roberto Ierusalimschy.
+All rights reserved.
+
+Permission is hereby granted, without written agreement and without license
+or royalty fees, to use, copy, modify, and distribute this software and its
+documentation for any purpose, provided that the above copyright notice and
+the following two paragraphs appear in all copies of this software.
+
+In no event shall the authors be liable to any party for direct, indirect,
+special, incidental, or consequential damages arising out of the use of this
+software and its documentation.
+
+The authors specifically disclaims any warranties, including, but not limited
+to, the implied warranties of merchantability and fitness for a particular
+purpose. the software provided hereunder is on an "as is" basis, and the
+authors have no obligation to provide maintenance, support, updates,
+enhancements, or modifications.
diff --git a/Makefile b/Makefile
deleted file mode 100644
index 10640e0d..00000000
--- a/Makefile
+++ /dev/null
@@ -1,11 +0,0 @@
-# makefile for lua hierarchy
-
-all:
- (cd src; make)
- (cd clients/lib; make)
- (cd clients/lua; make)
-
-clean:
- (cd src; make clean)
- (cd clients/lib; make clean)
- (cd clients/lua; make clean)
diff --git a/README b/README
index 3b8ad6aa..6b349cec 100644
--- a/README
+++ b/README
@@ -5,43 +5,46 @@
Dozens of industrial products developed by TeCGraf use Lua.
* Some features of Lua
- Lua has a simple, pascal-like, syntax.
- Variables need no declaration, but Lua has user-controlled type constructors.
- Lua has powerful data description constructs (e.g., associative arrays).
- Functions can receive a variable number of arguments and can return multiple
- values.
- Lua programs are compiled into bytecodes, which are then interpreted to
- simulate a virtual machine.
- Lua is written in ANSI C and is completely portable.
+ + a simple, pascal-like, syntax;
+ + powerful data description constructs (e.g., associative arrays);
+ + user-controlled type constructors;
+ + fallbacks for extending the meaning of the language in unconventional ways;
+ + Lua programs are compiled into bytecodes, which are then interpreted to
+ simulate a virtual machine;
+ + portable, written in ANSI C.
-* Coming soon
- Object-oriented extensions.
- Lazy evaluation.
+* Availability
+ ftp://ftp.icad.puc-rio.br/pub/lua/lua-2.1.tar.gz
+ http://www.inf.puc-rio.br/projetos/roberto/lua.html
+
+* Changes since version 1.1 (current version is 2.1)
+ + object-oriented support;
+ + fallbacks;
+ + simplified syntax for tables;
+ + many internal improvements.
* Installing
To make, simply type domake.
If make succeeds, you get an interpreter in ./bin/lua.
The libraries are in ./lib. The include files are in ./include.
You don't need the other directories for development.
- There is documentation in ./doc and tests in ./test.
- The documentation includes a reference manual and an article on the
- design and implementation of Lua.
+ There is a reference manual in ./doc and tests in ./test.
This distribution is biased towards SunOS 4 with gcc but it is simple to
change the Makefiles for other systems.
+ If you are running SunOs, type also "domake dynamic" to build shared
+ libraries in ./lib.
* Legal matters
- Lua is not in the public domain; TeCGraf keeps its copyright.
- Nevertheless, Lua is freely available for academic purposes by anonymous ftp
- at ftp.icad.puc-rio.br:/pub/lua/lua-1.1.tar.Z.
- For commercial purposes, please contact us.
+ Lua is now freely available for both academic and commercial purposes.
+ Lua is not in the public domain; TeCGraf keeps its copyright.
* Contacting the authors
Send your comments, bug reports and anything else to lhf@icad.puc-rio.br.
Please send me email if you download Lua so that we can know how far it goes.
--
-Luiz Henrique de Figueiredo email: lhf@icad.puc-rio.br
-TeCGraf-Grupo de Tecnologia em Computacao Grafica, ITS, PUC-Rio
-Rua Marques de Sao Vicente 225 voice: +55 21 529-9424
-22453-900 Rio de Janeiro, RJ, Brasil fax: +55 21 511-5645
+Luiz Henrique de Figueiredo email: lhf@icad.puc-rio.br
+TeCGraf-Grupo de Tecnologia em Computacao Grafica, Dep. Informatica, PUC-Rio
+Rua Marques de Sao Vicente 225 voice: +55 21 529-9424
+22453-900 Rio de Janeiro, RJ, Brasil fax: +55 21 511-5645
--
diff --git a/clients/lib/Makefile b/clients/lib/Makefile
index 4110a62f..b191b750 100644
--- a/clients/lib/Makefile
+++ b/clients/lib/Makefile
@@ -3,17 +3,26 @@
INC= $(LUA)/include
LIB= $(LUA)/lib
+# in SunOs /usr/5include contains prototypes for standard lib
+INCS= -I/usr/5include -I$(INC)
+WARN= -Wall -Wmissing-prototypes -Wshadow -ansi
+
CC= gcc
-CFLAGS= -Wall -O2 -I$(INC) $(DEFS)
+CFLAGS= $(INCS) $(DEFS) $(WARN) -O2
OBJS= iolib.o mathlib.o strlib.o
+
SLIB= $(LIB)/liblualib.a
-DLIB= $(LIB)/liblualib.so.1.1
-libs: $(SLIB) $(DLIB)
+# dynamic libraries only work for SunOs
+DLIB= $(LIB)/liblualib.so.2.1
+
+all: $(SLIB)
+
+dynamic: $(DLIB)
$(SLIB): $(OBJS)
- ar ruvl $@ $(OBJS)
+ ar rcuv $@ $(OBJS)
ranlib $(SLIB)
$(DLIB): $(OBJS)
@@ -21,3 +30,6 @@ $(DLIB): $(OBJS)
clean:
rm -f $(OBJS) $(SLIB) $(DLIB)
+
+co:
+ co -M iolib.c mathlib.c mathlib.h strlib.c strlib.h
diff --git a/clients/lib/iolib.c b/clients/lib/iolib.c
index b972124b..bb3883ab 100644
--- a/clients/lib/iolib.c
+++ b/clients/lib/iolib.c
@@ -3,20 +3,18 @@
** Input/output library to LUA
*/
-char *rcs_iolib="$Id: iolib.c,v 1.4 1994/04/25 20:11:23 celes Exp $";
+char *rcs_iolib="$Id: iolib.c,v 1.21 1995/02/06 19:36:13 roberto Exp $";
-#include <stdlib.h>
-#include <string.h>
#include <stdio.h>
#include <ctype.h>
+#include <sys/types.h>
#include <sys/stat.h>
-#ifdef __GNUC__
-#include <floatingpoint.h>
-#endif
-
-#include "mm.h"
+#include <string.h>
+#include <time.h>
+#include <stdlib.h>
#include "lua.h"
+#include "lualib.h"
static FILE *in=stdin, *out=stdout;
@@ -31,7 +29,7 @@ static FILE *in=stdin, *out=stdout;
static void io_readfrom (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL) /* restore standart input */
+ if (o == LUA_NOOBJECT) /* restore standart input */
{
if (in != stdin)
{
@@ -76,7 +74,7 @@ static void io_readfrom (void)
static void io_writeto (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL) /* restore standart output */
+ if (o == LUA_NOOBJECT) /* restore standart output */
{
if (out != stdout)
{
@@ -122,7 +120,7 @@ static void io_writeto (void)
static void io_appendto (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL) /* restore standart output */
+ if (o == LUA_NOOBJECT) /* restore standart output */
{
if (out != stdout)
{
@@ -179,7 +177,7 @@ static void io_appendto (void)
static void io_read (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL || !lua_isstring(o)) /* free format */
+ if (o == LUA_NOOBJECT || !lua_isstring(o)) /* free format */
{
int c;
char s[256];
@@ -187,7 +185,7 @@ static void io_read (void)
;
if (c == '\"')
{
- int c, n=0;
+ int n=0;
while((c = fgetc(in)) != '\"')
{
if (c == EOF)
@@ -201,7 +199,7 @@ static void io_read (void)
}
else if (c == '\'')
{
- int c, n=0;
+ int n=0;
while((c = fgetc(in)) != '\'')
{
if (c == EOF)
@@ -215,7 +213,6 @@ static void io_read (void)
}
else
{
- char *ptr;
double d;
ungetc (c, in);
if (fscanf (in, "%s", s) != 1)
@@ -223,8 +220,7 @@ static void io_read (void)
lua_pushnil ();
return;
}
- d = strtod (s, &ptr);
- if (!(*ptr))
+ if (sscanf(s, "%lf %*c", &d) == 1)
{
lua_pushnumber (d);
return;
@@ -269,9 +265,9 @@ static void io_read (void)
break;
case 'f': case 'g': case 'e':
{
- float f;
- sscanf (s, "%f", &f);
- lua_pushnumber(f);
+ float fl;
+ sscanf (s, "%f", &fl);
+ lua_pushnumber(fl);
}
break;
default:
@@ -314,6 +310,38 @@ static void io_read (void)
/*
+** Read characters until a given one. The delimiter is not read.
+*/
+static void io_readuntil (void)
+{
+ int n=255,m=0;
+ int c,d;
+ char *s;
+ lua_Object lo = lua_getparam(1);
+ if (!lua_isstring(lo))
+ d = EOF;
+ else
+ d = *lua_getstring(lo);
+
+ s = (char *)malloc(n+1);
+ while((c = fgetc(in)) != EOF && c != d)
+ {
+ if (m==n)
+ {
+ n *= 2;
+ s = (char *)realloc(s, n+1);
+ }
+ s[m++] = c;
+ }
+ if (c != EOF) ungetc(c,in);
+ s[m] = 0;
+ lua_pushstring(s);
+ free(s);
+}
+
+
+
+/*
** Write a variable. On error put 0 on stack, otherwise put 1.
** LUA interface:
** status = write (variable [,format])
@@ -341,39 +369,49 @@ static void io_read (void)
*/
static char *buildformat (char *e, lua_Object o)
{
- static char buffer[512];
+ static char buffer[2048];
static char f[80];
char *string = &buffer[255];
+ char *fstart=e, *fspace, *send;
char t, j='r';
- int m=0, n=0, l;
+ int m=0, n=-1, l;
while (isspace(*e)) e++;
+ fspace = e;
t = *e++;
if (*e == '<' || *e == '|' || *e == '>') j = *e++;
while (isdigit(*e))
m = m*10 + (*e++ - '0');
- e++; /* skip point */
+ if (*e == '.') e++; /* skip point */
while (isdigit(*e))
- n = n*10 + (*e++ - '0');
+ if (n < 0) n = (*e++ - '0');
+ else n = n*10 + (*e++ - '0');
sprintf(f,"%%");
if (j == '<' || j == '|') sprintf(strchr(f,0),"-");
- if (m != 0) sprintf(strchr(f,0),"%d", m);
- if (n != 0) sprintf(strchr(f,0),".%d", n);
- sprintf(strchr(f,0), "%c", t);
- switch (tolower(t))
+ if (m > 0) sprintf(strchr(f,0),"%d", m);
+ if (n >= 0) sprintf(strchr(f,0),".%d", n);
+ switch (t)
{
- case 'i': t = 'i';
+ case 'i': case 'I': t = 'd';
+ sprintf(strchr(f,0), "%c", t);
sprintf (string, f, (long int)lua_getnumber(o));
break;
- case 'f': case 'g': case 'e': t = 'f';
+ case 'f': case 'g': case 'e': case 'G': case 'E':
+ sprintf(strchr(f,0), "%c", t);
sprintf (string, f, (float)lua_getnumber(o));
break;
- case 's': t = 's';
+ case 'F': t = 'f';
+ sprintf(strchr(f,0), "%c", t);
+ sprintf (string, f, (float)lua_getnumber(o));
+ break;
+ case 's': case 'S': t = 's';
+ sprintf(strchr(f,0), "%c", t);
sprintf (string, f, lua_getstring(o));
break;
default: return "";
}
l = strlen(string);
+ send = string+l;
if (m!=0 && l>m)
{
int i;
@@ -383,25 +421,34 @@ static char *buildformat (char *e, lua_Object o)
}
else if (m!=0 && j=='|')
{
+ int k;
int i=l-1;
- while (isspace(string[i])) i--;
- string -= (m-i) / 2;
- i=0;
- while (string[i]==0) string[i++] = ' ';
- string[l] = 0;
+ while (isspace(string[i]) || string[i]==0) i--;
+ string -= (m-i)/2;
+ for(k=0; k<(m-i)/2; k++)
+ string[k] = ' ';
+ }
+ /* add space characteres */
+ while (fspace != fstart)
+ {
+ string--;
+ fspace--;
+ *string = *fspace;
}
+ while (isspace(*e)) *send++ = *e++;
+ *send = 0;
return string;
}
static void io_write (void)
{
lua_Object o1 = lua_getparam (1);
lua_Object o2 = lua_getparam (2);
- if (o1 == NULL) /* new line */
+ if (o1 == LUA_NOOBJECT) /* new line */
{
fprintf (out, "\n");
lua_pushnumber(1);
}
- else if (o2 == NULL) /* free format */
+ else if (o2 == LUA_NOOBJECT) /* free format */
{
int status=0;
if (lua_isnumber(o1))
@@ -426,10 +473,10 @@ static void io_write (void)
** Execute a executable program using "system".
** Return the result of execution.
*/
-void io_execute (void)
+static void io_execute (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL || !lua_isstring (o))
+ if (o == LUA_NOOBJECT || !lua_isstring (o))
{
lua_error ("incorrect argument to function 'execute`");
lua_pushnumber (0);
@@ -446,10 +493,10 @@ void io_execute (void)
** Remove a file.
** On error put 0 on stack, otherwise put 1.
*/
-void io_remove (void)
+static void io_remove (void)
{
lua_Object o = lua_getparam (1);
- if (o == NULL || !lua_isstring (o))
+ if (o == LUA_NOOBJECT || !lua_isstring (o))
{
lua_error ("incorrect argument to function 'execute`");
lua_pushnumber (0);
@@ -464,6 +511,88 @@ void io_remove (void)
return;
}
+
+/*
+** To get a environment variables
+*/
+static void io_getenv (void)
+{
+ lua_Object s = lua_getparam(1);
+ if (!lua_isstring(s))
+ lua_pushnil();
+ else
+ {
+ char *env = getenv(lua_getstring(s));
+ if (env == NULL) lua_pushnil();
+ else lua_pushstring(env);
+ }
+}
+
+/*
+** Return time: hour, min, sec
+*/
+static void io_time (void)
+{
+ time_t t;
+ struct tm *s;
+
+ time(&t);
+ s = localtime(&t);
+ lua_pushnumber(s->tm_hour);
+ lua_pushnumber(s->tm_min);
+ lua_pushnumber(s->tm_sec);
+}
+
+/*
+** Return date: dd, mm, yyyy
+*/
+static void io_date (void)
+{
+ time_t t;
+ struct tm *s;
+
+ time(&t);
+ s = localtime(&t);
+ lua_pushnumber(s->tm_mday);
+ lua_pushnumber(s->tm_mon+1);
+ lua_pushnumber(s->tm_year+1900);
+}
+
+/*
+** Beep
+*/
+static void io_beep (void)
+{
+ printf("\a");
+}
+
+/*
+** To exit
+*/
+static void io_exit (void)
+{
+ lua_Object o = lua_getparam(1);
+ if (lua_isstring(o))
+ printf("%s\n", lua_getstring(o));
+ exit(1);
+}
+
+/*
+** To debug a lua program. Start a dialog with the user, interpreting
+ lua commands until an 'cont'.
+*/
+static void io_debug (void)
+{
+ while (1)
+ {
+ char buffer[250];
+ fprintf(stderr, "lua_debug> ");
+ if (gets(buffer) == 0) return;
+ if (strcmp(buffer, "cont") == 0) return;
+ lua_dostring(buffer);
+ }
+}
+
/*
** Open io library
*/
@@ -473,7 +602,14 @@ void iolib_open (void)
lua_register ("writeto", io_writeto);
lua_register ("appendto", io_appendto);
lua_register ("read", io_read);
+ lua_register ("readuntil",io_readuntil);
lua_register ("write", io_write);
lua_register ("execute", io_execute);
lua_register ("remove", io_remove);
+ lua_register ("getenv", io_getenv);
+ lua_register ("time", io_time);
+ lua_register ("date", io_date);
+ lua_register ("beep", io_beep);
+ lua_register ("exit", io_exit);
+ lua_register ("debug", io_debug);
}
diff --git a/clients/lib/mathlib.c b/clients/lib/mathlib.c
index c84af8cb..ca5ab780 100644
--- a/clients/lib/mathlib.c
+++ b/clients/lib/mathlib.c
@@ -3,24 +3,26 @@
** Mathematics library to LUA
*/
-char *rcs_mathlib="$Id: mathlib.c,v 1.1 1993/12/17 18:41:19 celes Exp $";
+char *rcs_mathlib="$Id: mathlib.c,v 1.9 1995/02/06 19:36:43 roberto Exp $";
#include <stdio.h> /* NULL */
#include <math.h>
+#include "lualib.h"
#include "lua.h"
-#define TODEGREE(a) ((a)*180.0/3.14159)
-#define TORAD(a) ((a)*3.14159/180.0)
+#define PI 3.14159265358979323846
+#define TODEGREE(a) ((a)*180.0/PI)
+#define TORAD(a) ((a)*PI/180.0)
static void math_abs (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `abs'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `abs'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `abs'"); return; }
+ lua_error ("incorrect arguments to function `abs'");
d = lua_getnumber(o);
if (d < 0) d = -d;
lua_pushnumber (d);
@@ -31,10 +33,10 @@ static void math_sin (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `sin'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `sin'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `sin'"); return; }
+ lua_error ("incorrect arguments to function `sin'");
d = lua_getnumber(o);
lua_pushnumber (sin(TORAD(d)));
}
@@ -45,10 +47,10 @@ static void math_cos (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `cos'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `cos'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `cos'"); return; }
+ lua_error ("incorrect arguments to function `cos'");
d = lua_getnumber(o);
lua_pushnumber (cos(TORAD(d)));
}
@@ -59,10 +61,10 @@ static void math_tan (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `tan'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `tan'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `tan'"); return; }
+ lua_error ("incorrect arguments to function `tan'");
d = lua_getnumber(o);
lua_pushnumber (tan(TORAD(d)));
}
@@ -72,10 +74,10 @@ static void math_asin (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `asin'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `asin'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `asin'"); return; }
+ lua_error ("incorrect arguments to function `asin'");
d = lua_getnumber(o);
lua_pushnumber (TODEGREE(asin(d)));
}
@@ -85,10 +87,10 @@ static void math_acos (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `acos'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `acos'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `acos'"); return; }
+ lua_error ("incorrect arguments to function `acos'");
d = lua_getnumber(o);
lua_pushnumber (TODEGREE(acos(d)));
}
@@ -99,10 +101,10 @@ static void math_atan (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `atan'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `atan'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `atan'"); return; }
+ lua_error ("incorrect arguments to function `atan'");
d = lua_getnumber(o);
lua_pushnumber (TODEGREE(atan(d)));
}
@@ -112,10 +114,10 @@ static void math_ceil (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `ceil'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `ceil'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `ceil'"); return; }
+ lua_error ("incorrect arguments to function `ceil'");
d = lua_getnumber(o);
lua_pushnumber (ceil(d));
}
@@ -125,10 +127,10 @@ static void math_floor (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `floor'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `floor'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `floor'"); return; }
+ lua_error ("incorrect arguments to function `floor'");
d = lua_getnumber(o);
lua_pushnumber (floor(d));
}
@@ -139,7 +141,7 @@ static void math_mod (void)
lua_Object o1 = lua_getparam (1);
lua_Object o2 = lua_getparam (2);
if (!lua_isnumber(o1) || !lua_isnumber(o2))
- { lua_error ("incorrect arguments to function `mod'"); return; }
+ lua_error ("incorrect arguments to function `mod'");
d1 = (int) lua_getnumber(o1);
d2 = (int) lua_getnumber(o2);
lua_pushnumber (d1%d2);
@@ -150,24 +152,36 @@ static void math_sqrt (void)
{
double d;
lua_Object o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `sqrt'"); return; }
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `sqrt'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `sqrt'"); return; }
+ lua_error ("incorrect arguments to function `sqrt'");
d = lua_getnumber(o);
lua_pushnumber (sqrt(d));
}
+static int old_pow;
+
static void math_pow (void)
{
- double d1, d2;
lua_Object o1 = lua_getparam (1);
lua_Object o2 = lua_getparam (2);
- if (!lua_isnumber(o1) || !lua_isnumber(o2))
- { lua_error ("incorrect arguments to function `pow'"); return; }
- d1 = lua_getnumber(o1);
- d2 = lua_getnumber(o2);
- lua_pushnumber (pow(d1,d2));
+ lua_Object op = lua_getparam(3);
+ if (!lua_isnumber(o1) || !lua_isnumber(o2) || *(lua_getstring(op)) != 'p')
+ {
+ lua_Object old = lua_getlocked(old_pow);
+ lua_pushobject(o1);
+ lua_pushobject(o2);
+ lua_pushobject(op);
+ if (lua_callfunction(old) != 0)
+ lua_error(NULL);
+ }
+ else
+ {
+ double d1 = lua_getnumber(o1);
+ double d2 = lua_getnumber(o2);
+ lua_pushnumber (pow(d1,d2));
+ }
}
static void math_min (void)
@@ -175,15 +189,15 @@ static void math_min (void)
int i=1;
double d, dmin;
lua_Object o;
- if ((o = lua_getparam(i++)) == NULL)
- { lua_error ("too few arguments to function `min'"); return; }
+ if ((o = lua_getparam(i++)) == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `min'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `min'"); return; }
+ lua_error ("incorrect arguments to function `min'");
dmin = lua_getnumber (o);
- while ((o = lua_getparam(i++)) != NULL)
+ while ((o = lua_getparam(i++)) != LUA_NOOBJECT)
{
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `min'"); return; }
+ lua_error ("incorrect arguments to function `min'");
d = lua_getnumber (o);
if (d < dmin) dmin = d;
}
@@ -196,15 +210,15 @@ static void math_max (void)
int i=1;
double d, dmax;
lua_Object o;
- if ((o = lua_getparam(i++)) == NULL)
- { lua_error ("too few arguments to function `max'"); return; }
+ if ((o = lua_getparam(i++)) == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `max'");
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `max'"); return; }
+ lua_error ("incorrect arguments to function `max'");
dmax = lua_getnumber (o);
- while ((o = lua_getparam(i++)) != NULL)
+ while ((o = lua_getparam(i++)) != LUA_NOOBJECT)
{
if (!lua_isnumber(o))
- { lua_error ("incorrect arguments to function `max'"); return; }
+ lua_error ("incorrect arguments to function `max'");
d = lua_getnumber (o);
if (d > dmax) dmax = d;
}
@@ -212,6 +226,67 @@ static void math_max (void)
}
+static void math_log (void)
+{
+ double d;
+ lua_Object o = lua_getparam (1);
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `log'");
+ if (!lua_isnumber(o))
+ lua_error ("incorrect arguments to function `log'");
+ d = lua_getnumber(o);
+ lua_pushnumber (log(d));
+}
+
+
+static void math_log10 (void)
+{
+ double d;
+ lua_Object o = lua_getparam (1);
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `log10'");
+ if (!lua_isnumber(o))
+ lua_error ("incorrect arguments to function `log10'");
+ d = lua_getnumber(o);
+ lua_pushnumber (log10(d));
+}
+
+
+static void math_exp (void)
+{
+ double d;
+ lua_Object o = lua_getparam (1);
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `exp'");
+ if (!lua_isnumber(o))
+ lua_error ("incorrect arguments to function `exp'");
+ d = lua_getnumber(o);
+ lua_pushnumber (exp(d));
+}
+
+static void math_deg (void)
+{
+ float d;
+ lua_Object o = lua_getparam (1);
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `deg'");
+ if (!lua_isnumber(o))
+ lua_error ("incorrect arguments to function `deg'");
+ d = lua_getnumber(o);
+ lua_pushnumber (d*180./PI);
+}
+
+static void math_rad (void)
+{
+ float d;
+ lua_Object o = lua_getparam (1);
+ if (o == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `rad'");
+ if (!lua_isnumber(o))
+ lua_error ("incorrect arguments to function `rad'");
+ d = lua_getnumber(o);
+ lua_pushnumber (d/180.*PI);
+}
/*
** Open math library
@@ -229,7 +304,12 @@ void mathlib_open (void)
lua_register ("floor", math_floor);
lua_register ("mod", math_mod);
lua_register ("sqrt", math_sqrt);
- lua_register ("pow", math_pow);
lua_register ("min", math_min);
lua_register ("max", math_max);
+ lua_register ("log", math_log);
+ lua_register ("log10", math_log10);
+ lua_register ("exp", math_exp);
+ lua_register ("deg", math_deg);
+ lua_register ("rad", math_rad);
+ old_pow = lua_lockobject(lua_setfallback("arith", math_pow));
}
diff --git a/clients/lib/mathlib.h b/clients/lib/mathlib.h
index bdf2b4b8..7630144a 100644
--- a/clients/lib/mathlib.h
+++ b/clients/lib/mathlib.h
@@ -1,7 +1,7 @@
/*
** Math library to LUA
** TeCGraf - PUC-Rio
-** $Id: mathlib.h,v 1.1 1993/12/17 18:41:19 celes Exp $
+** $Id: mathlib.h,v 1.1 1993/12/17 18:41:19 celes Stab $
*/
diff --git a/clients/lib/strlib.c b/clients/lib/strlib.c
index 037b84be..6b92a30b 100644
--- a/clients/lib/strlib.c
+++ b/clients/lib/strlib.c
@@ -3,34 +3,66 @@
** String library to LUA
*/
-char *rcs_strlib="$Id: strlib.c,v 1.2 1994/03/28 15:14:02 celes Exp $";
+char *rcs_strlib="$Id: strlib.c,v 1.12 1995/02/06 19:37:51 roberto Exp $";
-#include <stdlib.h>
#include <string.h>
+#include <stdlib.h>
#include <ctype.h>
-#include "mm.h"
+#include "lua.h"
+#include "lualib.h"
-#include "lua.h"
+static char *newstring (lua_Object o)
+{
+ char *s = lua_getstring(o);
+ char *ns = (char *)malloc(strlen(s)+1);
+ if (ns == 0)
+ lua_error("not enough memory for new string");
+ strcpy(ns, s);
+ return ns;
+}
+
/*
** Return the position of the first caracter of a substring into a string
** LUA interface:
-** n = strfind (string, substring)
+** n = strfind (string, substring, init, end)
*/
static void str_find (void)
{
char *s1, *s2, *f;
+ int init;
lua_Object o1 = lua_getparam (1);
lua_Object o2 = lua_getparam (2);
+ lua_Object o3 = lua_getparam (3);
+ lua_Object o4 = lua_getparam (4);
if (!lua_isstring(o1) || !lua_isstring(o2))
- { lua_error ("incorrect arguments to function `strfind'"); return; }
+ lua_error ("incorrect arguments to function `strfind'");
+ if (o3 == LUA_NOOBJECT)
+ init = 0;
+ else if (lua_isnumber(o3))
+ init = lua_getnumber(o3)-1;
+ else
+ {
+ lua_error ("incorrect arguments to function `strfind'");
+ return; /* to avoid warnings */
+ }
s1 = lua_getstring(o1);
s2 = lua_getstring(o2);
- f = strstr(s1,s2);
+ f = strstr(s1+init,s2);
if (f != NULL)
- lua_pushnumber (f-s1+1);
+ {
+ int pos = f-s1+1;
+ if (o4 == LUA_NOOBJECT)
+ lua_pushnumber (pos);
+ else if (!lua_isnumber(o4))
+ lua_error ("incorrect arguments to function `strfind'");
+ else if ((int)lua_getnumber(o4) >= pos+strlen(s2)-1)
+ lua_pushnumber (pos);
+ else
+ lua_pushnil();
+ }
else
lua_pushnil();
}
@@ -44,7 +76,7 @@ static void str_len (void)
{
lua_Object o = lua_getparam (1);
if (!lua_isstring(o))
- { lua_error ("incorrect arguments to function `strlen'"); return; }
+ lua_error ("incorrect arguments to function `strlen'");
lua_pushnumber(strlen(lua_getstring(o)));
}
@@ -62,20 +94,20 @@ static void str_sub (void)
lua_Object o2 = lua_getparam (2);
lua_Object o3 = lua_getparam (3);
if (!lua_isstring(o1) || !lua_isnumber(o2))
- { lua_error ("incorrect arguments to function `strsub'"); return; }
- if (o3 != NULL && !lua_isnumber(o3))
- { lua_error ("incorrect third argument to function `strsub'"); return; }
- s = lua_copystring(o1);
+ lua_error ("incorrect arguments to function `strsub'");
+ if (o3 != LUA_NOOBJECT && !lua_isnumber(o3))
+ lua_error ("incorrect third argument to function `strsub'");
+ s = newstring(o1);
start = lua_getnumber (o2);
- end = o3 == NULL ? strlen(s) : lua_getnumber (o3);
+ end = o3 == LUA_NOOBJECT ? strlen(s) : lua_getnumber (o3);
if (end < start || start < 1 || end > strlen(s))
- lua_pushstring("");
+ lua_pushliteral("");
else
{
s[end] = 0;
lua_pushstring (&s[start-1]);
}
- free (s);
+ free(s);
}
/*
@@ -88,8 +120,8 @@ static void str_lower (void)
char *s, *c;
lua_Object o = lua_getparam (1);
if (!lua_isstring(o))
- { lua_error ("incorrect arguments to function `strlower'"); return; }
- c = s = strdup(lua_getstring(o));
+ lua_error ("incorrect arguments to function `strlower'");
+ c = s = newstring(o);
while (*c != 0)
{
*c = tolower(*c);
@@ -110,8 +142,8 @@ static void str_upper (void)
char *s, *c;
lua_Object o = lua_getparam (1);
if (!lua_isstring(o))
- { lua_error ("incorrect arguments to function `strlower'"); return; }
- c = s = strdup(lua_getstring(o));
+ lua_error ("incorrect arguments to function `strlower'");
+ c = s = newstring(o);
while (*c != 0)
{
*c = toupper(*c);
diff --git a/clients/lib/strlib.h b/clients/lib/strlib.h
index daa1f603..db3d38c5 100644
--- a/clients/lib/strlib.h
+++ b/clients/lib/strlib.h
@@ -1,7 +1,7 @@
/*
** String library to LUA
** TeCGraf - PUC-Rio
-** $Id: strlib.h,v 1.1 1993/12/17 18:41:19 celes Exp $
+** $Id: strlib.h,v 1.1 1993/12/17 18:41:19 celes Stab $
*/
diff --git a/clients/lua/Makefile b/clients/lua/Makefile
index 7bb74208..10538d67 100644
--- a/clients/lua/Makefile
+++ b/clients/lua/Makefile
@@ -5,13 +5,23 @@ INC= $(LUA)/include
LIB= $(LUA)/lib
CC= gcc
-CFLAGS= -g -Wall -O2 -I$(INC)
+CFLAGS= $(INCS) $(DEFS) $(WARN) -O2
+
+# in SunOs /usr/5include contains prototypes for standard lib
+INCS= -I/usr/5include -I$(INC)
+WARN= -Wall -Wmissing-prototypes -Wshadow -ansi
OBJS= lua.o
+
T=$(BIN)/lua
$T: $(OBJS)
$(CC) -o $@ $(OBJS) -L$(LIB) -llua -llualib -lm
+dynamic:
+
clean:
rm -f $T $(OBJS)
+
+co:
+ co -M lua.c
diff --git a/clients/lua/lua.c b/clients/lua/lua.c
index c4b83cee..19836646 100644
--- a/clients/lua/lua.c
+++ b/clients/lua/lua.c
@@ -3,26 +3,72 @@
** Linguagem para Usuarios de Aplicacao
*/
-char *rcs_lua="$Id: lua.c,v 1.1 1993/12/17 18:41:19 celes Exp $";
+char *rcs_lua="$Id: lua.c,v 1.4 1995/02/07 16:04:15 lhf Exp $";
#include <stdio.h>
+#include <string.h>
#include "lua.h"
#include "lualib.h"
-void main (int argc, char *argv[])
+static int lua_argc;
+static char **lua_argv;
+
+/*
+%F Allow Lua code to access argv strings.
+%i Receive from Lua the argument number (starting with 1).
+%o Return to Lua the argument, or nil if it does not exist.
+*/
+static void lua_getargv (void)
+{
+ lua_Object lo = lua_getparam(1);
+ if (!lua_isnumber(lo))
+ lua_pushnil();
+ else
+ {
+ int n = (int)lua_getnumber(lo);
+ if (n < 1 || n > lua_argc) lua_pushnil();
+ else lua_pushstring(lua_argv[n]);
+ }
+}
+
+
+int main (int argc, char *argv[])
{
int i;
+ int result = 0;
iolib_open ();
strlib_open ();
mathlib_open ();
+
+ lua_register("argv", lua_getargv);
+
if (argc < 2)
{
- char buffer[2048];
+ char buffer[250];
while (gets(buffer) != 0)
- lua_dostring(buffer);
+ result = lua_dostring(buffer);
}
else
- for (i=1; i<argc; i++)
- lua_dofile (argv[i]);
+ {
+ for (i=1; i<argc; i++)
+ {
+ if (strcmp(argv[i], "--") == 0)
+ {
+ lua_argc = argc-i-1;
+ lua_argv = argv+i;
+ break;
+ }
+ }
+ for (i=1; i<argc; i++)
+ {
+ if (strcmp(argv[i], "--") == 0)
+ break;
+ else
+ result = lua_dofile (argv[i]);
+ }
+ }
+ return result;
}
+
+
diff --git a/doc/lua.dvi b/doc/lua.dvi
deleted file mode 100644
index 8aa7404f..00000000
--- a/doc/lua.dvi
+++ /dev/null
Binary files differ
diff --git a/doc/lua.ps b/doc/lua.ps
deleted file mode 100644
index 373b082a..00000000
--- a/doc/lua.ps
+++ /dev/null
@@ -1,1774 +0,0 @@
-%!PS-Adobe-2.0
-%%Creator: dvips, version 5.4 (C) 1986-90 Radical Eye Software
-%%Title: lua.dvi
-%%Pages: 11 1
-%%BoundingBox: 0 0 612 792
-%%EndComments
-%%BeginProcSet: tex.pro
-/TeXDict 200 dict def TeXDict begin /N /def load def /B{bind def}N /S /exch
-load def /X{S N}B /TR /translate load N /isls false N /vsize 10 N /@rigin{
-isls{[0 1 -1 0 0 0]concat}if 72 Resolution div 72 VResolution div neg scale
-Resolution VResolution vsize neg mul TR}B /@letter{/vsize 10 N}B /@landscape{
-/isls true N /vsize -1 N}B /@a4{/vsize 10.6929133858 N}B /@a3{/vsize 15.5531 N
-}B /@ledger{/vsize 16 N}B /@legal{/vsize 13 N}B /@manualfeed{statusdict
-/manualfeed true put}B /@copies{/#copies X}B /FMat[1 0 0 -1 0 0]N /FBB[0 0 0 0
-]N /df{/sf 1 N /fntrx FMat N df-tail}B /dfs{div /sf X /fntrx[sf 0 0 sf neg 0 0
-]N df-tail}B /df-tail{/nn 8 dict N nn begin /FontType 3 N /FontMatrix fntrx N
-/FontBBox FBB N string /base X array /BitMaps X /BuildChar{CharBuilder}N
-/Encoding IE N end dup{/foo setfont}2 array copy cvx N load 0 nn put /ctr 0 N[
-}B /E{pop nn dup definefont setfont}B /ch-image{ch-data dup type /stringtype
-ne{ctr get /ctr ctr 1 add N}if}B /ch-width{ch-data dup length 5 sub get}B
-/ch-height{ch-data dup length 4 sub get}B /ch-xoff{128 ch-data dup length 3
-sub get sub}B /ch-yoff{ch-data dup length 2 sub get 127 sub}B /ch-dx{ch-data
-dup length 1 sub get}B /ctr 0 N /CharBuilder{save 3 1 roll S dup /base get 2
-index get S /BitMaps get S get /ch-data X pop /ctr 0 N ch-dx 0 ch-xoff ch-yoff
-ch-height sub ch-xoff ch-width add ch-yoff setcachedevice ch-width ch-height
-true[1 0 0 -1 -.1 ch-xoff sub ch-yoff .1 add]{ch-image}imagemask restore}B /D{
-/cc X dup type /stringtype ne{]}if nn /base get cc ctr put nn /BitMaps get S
-ctr S sf 1 ne{dup dup length 1 sub dup 2 index S get sf div put}if put /ctr
-ctr 1 add N}B /I{cc 1 add D}B /bop{userdict /bop-hook known{bop-hook}if /SI
-save N @rigin 0 0 moveto}B /eop{clear SI restore showpage userdict /eop-hook
-known{eop-hook}if}B /@start{userdict /start-hook known{start-hook}if
-/VResolution X /Resolution X 1000 div /DVImag X /IE 256 array N 0 1 255{IE S 1
-string dup 0 3 index put cvn put}for}B /p /show load N /RMat[1 0 0 -1 0 0]N
-/BDot 8 string N /v{/ruley X /rulex X V}B /V{gsave TR -.1 -.1 TR rulex ruley
-scale 1 1 false RMat{BDot}imagemask grestore}B /a{moveto}B /delta 0 N /tail{
-dup /delta X 0 rmoveto}B /M{S p delta add tail}B /b{S p tail}B /c{-4 M}B /d{
--3 M}B /e{-2 M}B /f{-1 M}B /g{0 M}B /h{1 M}B /i{2 M}B /j{3 M}B /k{4 M}B /l{p
--4 w}B /m{p -3 w}B /n{p -2 w}B /o{p -1 w}B /q{p 1 w}B /r{p 2 w}B /s{p 3 w}B /t
-{p 4 w}B /w{0 rmoveto}B /x{0 S rmoveto}B /y{3 2 roll p a}B /bos{/SS save N}B
-/eos{clear SS restore}B end
-%%EndProcSet
-TeXDict begin 1200 300 300 @start /Fa 8 58 df<00000C00001C00001C00003800003800
-00700000700000700000E00000E00001C00001C0000380000380000380000700000700000E0000
-0E00000E00001C00001C0000380000380000700000700000700000E00000E00001C00001C00001
-C0000380000380000700000700000700000E00000E00001C00001C000038000038000038000070
-0000700000E00000E00000C0000016317DA41D>47 D<00380000780003F800FFF800FDF80001F8
-0001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F8
-0001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F8007FFFF07FFF
-F014207C9F1D>49 D<03FC000FFF803C0FE07007F07C03F8FE01F8FE01FCFE01FCFE01FC7C01FC
-3801FC0001FC0001F80003F80003F00007E0000FC0000F80001E00003C0000780000E00C01C00C
-03801C0300180600180FFFF81FFFF83FFFF87FFFF0FFFFF0FFFFF016207D9F1D>I<00FF0007FF
-C00F03F01E01F83F01F83F01FC3F81FC3F01FC1F01FC0C01F80001F80003F00003E0000FC000FF
-0000FF000003E00001F80001FC0000FE0000FE0000FF7C00FF7C00FFFE00FFFE00FFFE00FE7C01
-FC7801FC3C03F00FFFE001FF0018207E9F1D>I<0000E00001E00003E00003E00007E0000FE000
-1FE0001BE00033E00073E000E3E001C3E00183E00303E00703E00E03E00C03E01803E03803E070
-03E0E003E0FFFFFFFFFFFF0007E00007E00007E00007E00007E00007E00007E001FFFF01FFFF18
-207E9F1D>I<1000301E00F01FFFE01FFFE01FFFC01FFF001FFE001FF800180000180000180000
-18000019FE001FFF801E07E01C03F01801F00001F80001F80001FC0001FC7801FCFC01FCFC01FC
-FC01FCFC01F8F801F86003F03003E01C0FC00FFF0003FC0016207D9F1D>I<001FC000FFF001F0
-3807C0780F80FC1F00FC1F00FC3F00FC7E00787E00007E0000FE0000FE3FC0FE7FF0FE80F8FF80
-7CFF007EFF007EFE007FFE007FFE007FFE007F7E007F7E007F7E007F3E007E3E007E1F007C0F00
-F807C1F003FFE000FF0018207E9F1D>I<00FF0007FFC00F83E01F00F03E00F87E007C7E007CFE
-007EFE007EFE007EFE007FFE007FFE007FFE007F7E00FF7E00FF3E01FF1F017F0FFE7F03FC7F00
-007F00007E00007E1E007E3F00FC3F00FC3F00F83F01F01E03E01C0FC00FFF0003F80018207E9F
-1D>57 D E /Fb 1 16 df<03F0000FFC001FFE003FFF007FFF807FFF80FFFFC0FFFFC0FFFFC0FF
-FFC0FFFFC0FFFFC0FFFFC0FFFFC07FFF807FFF803FFF001FFE000FFC0003F00012147D9519>15
-D E /Fc 21 115 df<00030003000700060006000E000C001C0018001800380030003000700060
-00E000C000C001C001800180038003000300070006000E000C000C001C00180018003800300070
-0060006000E000C000C00010287E9D15>47 D<07E00FF01FF83C3C781E700E700EE007E007E007
-E007E007E007E007E007E007E007E007E007700E700E781E3C3C1FF80FF007E0101A7E9915>I<
-008003803F80FF80C3800380038003800380038003800380038003800380038003800380038003
-8003800380038003807FFC7FFC0E1A7D9915>I<0FE01FF0387C701EE00EE00F400F4007000700
-0F000F000E001E001C0038007000E001C0038007000E001C0038007000FFFFFFFF101A7E9915>
-I<07E03FF8783CE01E601E400E001E001E003C007C07F807E007F8003C001E001E000F000F000F
-800F800FC01E601E383C1FF807E0101A7E9915>I<00780000F80000B80001B80001B800033800
-0338000738000638000E38001E38001C38003C3800383800783800703800F03800FFFFC0FFFFC0
-003800003800003800003800003800003800003800121A7F9915>I<7FFC7FFC70007000700070
-00700070007000700073E07FF87FFC7C3E781E000F000F000F000F000F400FC01E601C38781FF0
-0FC0101A7E9915>I<00F803FC0F041C0018003800700070007000E1F0E7F8EFFCFC1EF00EF00F
-E007E007E007600770077007300E380C1C3C0FF003E0101A7E9915>I<FFFFFFFF0007000E001C
-003C00380078007000F000E001E001C003C003C0038007800780078007800F000F000F000F000F
-000F00101A7E9915>I<07E01FF8381C700EE007E007E007E007700E781E3FFC0FF00FF03E7C78
-1E700EE007E007E007E007E007700E700E3C3C1FF807E0101A7E9915>I<07E00FF01C38381C70
-0CE00EE00EE007E007E007E007F00F700F783F3FF71FE70F870006000E000E001C001C203870F0
-3FE00F80101A7E9915>I<001C0000003E0000003E0000002E0000006700000067000000E78000
-00C7800000C3800001C3C0000183C0000381E0000381E0000301E0000700F0000700F0000600F0
-000E0078000FFFF8001FFFFC001C003C0018003C0038001E0038001E0030001E0070000F007000
-0F00E0000780191C7F9B1C>65 D<003FC001FFF003C0F00700300E00001E00003C000038000078
-0000780000F00000F00000F00000F00000F00000F00000F00000F000007800007800003800003C
-00001E00000E000807001803C07801FFF0003F80151C7D9B1B>67 D<FFFC00FFFF80F007C0F001
-F0F000F8F00078F0003CF0001CF0001EF0001EF0000FF0000FF0000FF0000FF0000FF0000FF000
-0FF0000FF0000EF0001EF0001EF0003CF00078F00078F001F0F007E0FFFF80FFFE00181C7C9B1F
->I<003F8001FFF003C0F80700380E00181C00003C0000380000780000780000F00000F00000F0
-0000F00000F00000F007F8F007F8F000387800387800383800383C00381C00380E003807003803
-C0F801FFF0003F80151C7D9B1C>71 D<F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0
-F0F0F0F0F0041C7C9B0C>73 D<FFFFFFFFFFFF003C00003C00003C00003C00003C00003C00003C
-00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C
-00003C00003C00003C00003C00003C00003C00181C7E9B1D>84 D<0FC03FF07FF87038401C001C
-001C001C07FC3FFC7C1CE01CE01CE01CF07C7FFC7FDC3F1C0E127E9114>97
-D<07C01FF03FF83C3C700C700EFFFEFFFEFFFEE000E000E000700070003C061FFE0FFE07F80F12
-7E9113>101 D<00FC03FC07FC07000E000E000E000E000E000E00FFE0FFE00E000E000E000E00
-0E000E000E000E000E000E000E000E000E000E000E000E000E1C809B0D>I<E380E780EF80FC00
-F800F000F000E000E000E000E000E000E000E000E000E000E000E00009127D910E>114
-D E /Fd 24 122 df<00001FE0000070380000E01C0001C03C0001803C00038038000380000007
-000000070000000700000007000000070000000E0000000E000000FFFFE000FFFFE0000E00E000
-1E01C0001C01C0001C01C0001C01C0001C0380001C038000380380003803800038070000380700
-003807080070070C00700E1800700E1800700E180070063000E0062000E003C000E0000000E000
-0001C0000001C0000001C0000071800000F3800000F3000000620000003C0000001E2D82A21C>
-12 D<0000FC060007FF0C001F839C003E00DC0078007C00F0007801E0007803C0007807800038
-0F8000301F0000301E0000303E0000303E0000607C0000007C0000007C000000F8000000F80000
-00F8000000F8000000F8000000F0000000F0000180F0000180F0000300F0000300F0000600F800
-060078000C00780018003C0030001E0060000F81C00007FF000001FC00001F2478A224>67
-D<00F180038B80070F800E07001E07001C07003C0700380E00780E00780E00780E00F01C00F01C
-00F01C20F01C30F03860F0386070786070D8C03198801E0F0014157B9419>97
-D<03C03F803F800380038007000700070007000E000E000E000E001C001CF81D8C1E0E3C063C07
-3807380F700F700F700F700FE01EE01EE01EE03CE038E038607060E031C01F0010237BA217>I<
-007C01C2030307070E0F1C0F3C003800780078007800F000F000F000F000F00170037006301C18
-380FC010157B9417>I<0000780007F00007F00000700000700000E00000E00000E00000E00001
-C00001C00001C00001C000038000F380038B80070F800E07001E07001C07003C0700380E00780E
-00780E00780E00F01C00F01C00F01C20F01C30F03860F0386070786070D8C03198801E0F001523
-7BA219>I<00F803840E061C063C063806780CF038FFE0F000F000E000E000E000E000E002E006
-600C703830700F800F157A9417>I<00007C0000CE00019E00039E00038C000300000700000700
-000700000700000E00000E00000E00000E0001FFF001FFF0001C00001C00001C00001C00001C00
-00380000380000380000380000380000700000700000700000700000700000E00000E00000E000
-00E00001C00001C00001C00001C000038000738000F30000F300006600003C0000172D82A20F>
-I<001F180031B800E0F801C0F001C0700380700780700700E00F00E00F00E00F00E01E01C01E01
-C01E01C01E01C01E03800E03800E0780060F80061F0001E700000700000700000E00000E00000E
-00701C00F01800F0300060E0003F8000151F7E9417>I<00F0000FE0000FE00000E00000E00001
-C00001C00001C00001C000038000038000038000038000070000071E0007638007C1800F81C00F
-01C00E01C00E01C01C03801C03801C03801C0380380700380700380E08380E0C700E18701C1870
-1C30700C20E00C6060078016237DA219>I<00E000E001E000C000000000000000000000000000
-00000000001E00330063806380C380C700C70007000E000E000E001C001C001C40386038C070C0
-7080318031001E000C227CA10F>I<0001C00003C00003C0000180000000000000000000000000
-000000000000000000000000000000003C00004600008700018700030700030700030700000E00
-000E00000E00000E00001C00001C00001C00001C00003800003800003800003800007000007000
-00700000700000E00000E00000E00071C000F18000F380006600003C0000122C82A10F>I<00F0
-000FE0000FE00000E00000E00001C00001C00001C00001C0000380000380000380000380000700
-000701E00706300708700E10F00E20F00E20600E40001D80001E00001FC0001CE0003870003830
-003838203838307070607070607070407030C0E01880600F0014237DA217>I<01E01FC01FC001
-C001C0038003800380038007000700070007000E000E000E000E001C001C001C001C0038003800
-380038007000700071007180E300E300E300620066003C000B237CA20D>I<1E07C07C00331861
-860063B033030063E03E0380C3C03C0380C3C03C0380C380380380078078070007007007000700
-70070007007007000E00E00E000E00E00E000E00E01C100E00E01C181C01C01C301C01C038301C
-01C038601C01C0184038038018C01801800F0026157C9429>I<1E0780003318E00063B0600063
-E07000C3C07000C3807000C38070000700E0000700E0000700E0000700E0000E01C0000E01C000
-0E0382000E0383001C0386001C0706001C070C001C030800380318001801E00019157C941C>I<
-007C0001C6000303000603800E03C01C03C03C03C03803C07803C07803C07803C0F00780F00780
-F00780F00F00F00E00701E00701C003038001860000F800012157B9419>I<03C1E00666300C7C
-380C781818781C18701C18701C00E03C00E03C00E03C00E03C01C07801C07801C07801C0700380
-E003C0E003C1C003C380076700073C000700000700000E00000E00000E00000E00001C00001C00
-00FFC000FFC000161F7F9419>I<1E1F0033318063E1C063C3C0C3C3C0C38180C3800007000007
-00000700000700000E00000E00000E00000E00001C00001C00001C00001C000038000018000013
-157C9415>114 D<007801840306020E061E061E0608070007F007F803FC007C001E000E700EF0
-0CF00CE008601030601F800F157D9414>I<006000E000E000E000E001C001C001C001C00380FF
-F8FFF8038007000700070007000E000E000E000E001C001C001C101C18383038303860186018C0
-0F000D1F7C9E11>I<0F003011807021C07061C0E0C1C0E0C380E0C380E00381C00701C00701C0
-0701C00E03800E03800E03840E03860E070C0C070C0E070C0E0B1806131003E1E018157C941B>
-I<0F01C01183C021C3E061C1E0C1C0E0C380E0C380E00380C00700C00700C00700C00E01800E01
-800E01800E03000E03000E02000E04000E0C0006180001E00014157C9417>I<0F003011807021
-C07061C0E0C1C0E0C380E0C380E00381C00701C00701C00701C00E03800E03800E03800E03800E
-07000C07000E07000E0F00061E0003EE00000E00000E00001C00301C0078380078300070600060
-C0002180001E0000151F7C9418>121 D E /Fe 33 122 df<00003C007E3C00FE3C01FE3C03C0
-00038000078000078000078000078000078000078000078000078000FFFE3CFFFE3CFFFE3C0780
-3C07803C07803C07803C07803C07803C07803C07803C07803C07803C07803C07803C07803C0780
-3C07803C07803C07803C07803C07803C162480A31B>12 D<787878781830306060E0050A7CA20E
->39 D<000F0000001F8000001F8000001B8000003BC0000039C0000079E0000071E0000070E000
-00F0F00000F0F00000E0F00001E0780001E0780001C0780003C03C0003C03C0003803C0007801E
-0007801E0007001E000F000F000FFFFF001FFFFF801FFFFF801E0007803C0003C03C0003C03800
-03C0780001E0780001E0700001E0F00000F0F00000F0E00000F01D237EA221>65
-D<FFFF0000FFFFC000FFFFF000F001F800F0007C00F0003E00F0001F00F0000F00F0000780F000
-0780F00003C0F00003C0F00003C0F00001E0F00001E0F00001E0F00001E0F00001E0F00001E0F0
-0001E0F00001E0F00001E0F00001C0F00003C0F00003C0F00007C0F0000780F0000F80F0001F00
-F0003E00F0007C00F001F800FFFFF000FFFFE000FFFF00001B237BA224>68
-D<FFFFF8FFFFF8FFFFF8F00000F00000F00000F00000F00000F00000F00000F00000F00000F000
-00F00000F00000FFFFF0FFFFF0FFFFF0F00000F00000F00000F00000F00000F00000F00000F000
-00F00000F00000F00000F00000F00000F00000FFFFFCFFFFFCFFFFFC16237BA21E>I<F0F0F0F0
-F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F004237BA20E>73
-D<F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F000
-00F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F000
-00F00000F00000F00000F00000F00000F00000FFFFE0FFFFE0FFFFE013237BA21B>76
-D<FFFE00FFFFC0FFFFE0F003F0F00078F0003CF0003CF0001EF0001EF0001EF0001EF0001EF000
-1EF0003CF0003CF00078F003F0FFFFE0FFFFC0FFFE00F00000F00000F00000F00000F00000F000
-00F00000F00000F00000F00000F00000F00000F00000F00000F0000017237BA220>80
-D<00FF0003FFE007FFF00F81F01E00703C00003C00007800007800007800007800007800007C00
-003E00003F00001FE0000FFC0007FF8001FFC0003FE00003F00000F800007800007C00003C0000
-3C00003C00003C00003C00003CC00078E00078F800F07F03E01FFFC00FFF8001FE0016257EA31C
->83 D<FFFFFFF8FFFFFFF8FFFFFFF8000780000007800000078000000780000007800000078000
-000780000007800000078000000780000007800000078000000780000007800000078000000780
-000007800000078000000780000007800000078000000780000007800000078000000780000007
-80000007800000078000000780000007800000078000000780001D237EA222>I<03F0001FFC00
-3FFE00381F00200F00000780000780000780000780000F8003FF801FFF803F0780780780F00780
-F00780F00780F007807C1F807FFF803FF7801F878011167E9518>97 D<F00000F00000F00000F0
-0000F00000F00000F00000F00000F00000F00000F00000F00000F00000F0F800F3FE00FFFF00FE
-1F80F80780F003C0F003C0F001E0F001E0F001E0F001E0F001E0F001E0F001E0F003E0F003C0F0
-07C0F80780FC1F00FFFE00F7FC00F1F00013237CA21A>I<01FC0007FF000FFF801F03803C0180
-780000780000780000F00000F00000F00000F00000F00000F000007800007800007800003C0040
-1F03C00FFFC007FF8001FC0012167E9516>I<0001E00001E00001E00001E00001E00001E00001
-E00001E00001E00001E00001E00001E00001E003F1E007FDE00FFFE01F07E03C03E07C01E07801
-E0F801E0F001E0F001E0F001E0F001E0F001E0F001E0F001E07801E07803E03C03E03F0FE01FFD
-E00FF9E003E1E013237EA21A>I<03F00007FC001FFE003E0F003C0780780380780380F001C0FF
-FFC0FFFFC0FFFFC0F00000F00000F000007000007800007800003C00801F07800FFF8007FF0001
-F80012167E9516>I<003F00FF01FF03C0038007800780078007800780078007800780FFF8FFF8
-FFF807800780078007800780078007800780078007800780078007800780078007800780078007
-80102380A20F>I<01F07C07FFFC0FFFFC1F1F001E0F003C07803C07803C07803C07803C07801E
-0F001F1F000FFE001FFC0019F0003800003800003C00001FFF001FFFE01FFFF03FFFF87C01F878
-007CF0003CF0003CF0003CF8007C7C00F83F03F01FFFE00FFFC001FE0016217F9519>I<F00000
-F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F0F800
-F3FE00F7FF00FE1F00FC0F80F80780F80780F00780F00780F00780F00780F00780F00780F00780
-F00780F00780F00780F00780F00780F00780F00780F0078011237CA21A>I<F0F0F0F000000000
-0000000000F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F004237DA20B>I<F00000F000
-00F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00780F00F
-00F01E00F03C00F07800F0F000F1E000F3C000F7C000FFC000FFE000FFE000FDF000F8F800F078
-00F07C00F03E00F01E00F01F00F00F00F00F80F007C012237CA218>107
-D<F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F004237D
-A20B>I<F0FC03F0F3FF0FFCF7FF9FFEFE0FB83EFC07F01FF803E00FF803E00FF003C00FF003C0
-0FF003C00FF003C00FF003C00FF003C00FF003C00FF003C00FF003C00FF003C00FF003C00FF003
-C00FF003C00FF003C00FF003C00F20167C9529>I<F0F800F3FE00F7FF00FE1F00FC0F80F80780
-F80780F00780F00780F00780F00780F00780F00780F00780F00780F00780F00780F00780F00780
-F00780F00780F0078011167C951A>I<00FC0007FF800FFFC01F03E03E01F03C00F07800787000
-38F0003CF0003CF0003CF0003CF0003CF0003C7800787800787C00F83E01F01F03E00FFFC007FF
-8000FC0016167F9519>I<F0F800F3FE00FFFF00FE1F80F80780F007C0F003C0F003E0F001E0F0
-01E0F001E0F001E0F001E0F001E0F003E0F003C0F007C0F80F80FC1F00FFFE00F7FC00F1F000F0
-0000F00000F00000F00000F00000F00000F00000F00000F00000F0000013207C951A>I<F0E0F3
-E0F7E0FF00FE00FC00F800F800F000F000F000F000F000F000F000F000F000F000F000F000F000
-F0000B167C9511>114 D<07F01FFC3FFE3C0E7806780078007C003F003FF01FF80FFC01FE001F
-000F000F000FC00FF81EFFFE3FFC0FF010167F9513>I<0F000F000F000F000F000F00FFF8FFF8
-FFF80F000F000F000F000F000F000F000F000F000F000F000F000F000F000F080F1C07FC07F803
-E00E1C7F9B12>I<F00780F00780F00780F00780F00780F00780F00780F00780F00780F00780F0
-0780F00780F00780F00780F00780F00780F00780F00F80F83F807FFF807FE7801F878011167C95
-1A>I<F000F0F000F07801E07801E07801E03C03C03C03C03C03C01E07801E07800E07000F0F00
-0F0F00070E00079E00079E00039C00039C0003DC0001D80001F80001F80014167F9517>I<F007
-C01EF00FC01EF00EE01E780EE03C781CE03C781CF03C381CF0383C1C70783C3870783C3878781C
-3878701E3838F01E3038F01E7038F00E703CE00E701CE00F601DE007601DC007600DC007400DC0
-07C00FC003C00F801F167F9522>I<7800F83C00F03E01E01E03C00F07C007878003CF0001FE00
-01FC0000FC0000780000F80000FC0001DE0003CF000787800F03800F03C01E01E03C00F07800F8
-F8007C1616809517>I<F000F0F800F07801E07801E03C01E03C03C03E03C01E03801E07800F07
-800F0700070F00078F00078E00038E00039C0001DC0001DC0001D80000D80000F8000070000070
-0000E00000E00000E00001C00001C0000380007F80007F00007E000014207F9517>I
-E /Ff 81 127 df<001FC1F00070270C00C07E1E0180FC3E0380FC3E0700F81C07007800070038
-00070038000700380007003800070038000700380007003800FFFFFFE0FFFFFFE0070038000700
-380007003800070038000700380007003800070038000700380007003800070038000700380007
-00380007003800070038000700380007003800070038007FE1FFC07FE1FFC01F2380A21D>11
-D<000FC0000078300000E0080001803C0003807C0007007C0007007C0007003800070000000700
-000007000000070000000700000007000000FFFFFC00FFFFFC0007003C0007001C0007001C0007
-001C0007001C0007001C0007001C0007001C0007001C0007001C0007001C0007001C0007001C00
-07001C0007001C0007001C0007001C007FF1FFC07FF1FFC01A2380A21C>I<000FEC0000701C00
-00E07C0001807C0003807C0007003C0007001C0007001C0007001C0007001C0007001C0007001C
-0007001C0007001C00FFFFFC00FFFFFC0007001C0007001C0007001C0007001C0007001C000700
-1C0007001C0007001C0007001C0007001C0007001C0007001C0007001C0007001C0007001C0007
-001C0007001C007FF1FFC07FF1FFC01A2380A21C>I<000FC03F00007031E0C000E00B80200180
-3E00F003807E01F007007C01F007007C01F007003C00E007001C000007001C000007001C000007
-001C000007001C000007001C0000FFFFFFFFF0FFFFFFFFF007001C00F007001C007007001C0070
-07001C007007001C007007001C007007001C007007001C007007001C007007001C007007001C00
-7007001C007007001C007007001C007007001C007007001C007007001C00707FF1FFC7FF7FF1FF
-C7FF282380A22A>I<07070F0E1C383060C0080976A219>19 D<0E000F8001C000E0007000E000
-E07FC080000C097A7E16>24 D<701CF83EFC3FFC3F741D04010401040104010802080210041004
-20084010100F7EA219>34 D<0000C00C000000C00C000000C00C000001C01C0000018018000001
-801800000180180000038038000003003000000300300000030030000007007000000600600000
-060060000006006000000E00E000000C00C000FFFFFFFFE0FFFFFFFFE000180180000018018000
-001801800000380380000030030000003003000000300300000030030000FFFFFFFFE0FFFFFFFF
-E0006006000000E00E000000C00C000000C00C000000C00C000001C01C00000180180000018018
-000001801800000380380000030030000003003000000300300000070070000006006000000600
-600000232D7DA22A>I<70F8FCFC7404040404080810102040060F7CA20E>39
-D<001000200040008001000300060004000C001800180018003000300030007000600060006000
-E000E000E000E000E000E000E000E000E000E000E000E000600060006000700030003000300018
-00180018000C00040006000300010000800040002000100C327DA413>I<800040002000100008
-000C0006000200030001800180018000C000C000C000E000600060006000700070007000700070
-007000700070007000700070007000600060006000E000C000C000C00180018001800300020006
-000C00080010002000400080000C327DA413>I<70F8FCFC7404040404080810102040060F7C84
-0E>44 D<FFF0FFF00C027F8B11>I<70F8F8F87005057C840E>I<01F800070E000E07001C038038
-01C03801C07801E07000E07000E07000E0F000F0F000F0F000F0F000F0F000F0F000F0F000F0F0
-00F0F000F0F000F0F000F0F000F0F000F0F000F07000E07000E07000E07801E03801C03801C01C
-03800E0700070E0001F80014227EA019>48 D<004001C007C0FFC0F9C001C001C001C001C001C0
-01C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001
-C001C07FFF7FFF10217CA019>I<03F8000FFE00181F802007C04003C04001E0F801E0FC01F0FC
-00F0FC00F07800F03001F00001E00001E00003E00003C0000780000700000E00001C0000380000
-700000E0000080000100000200100400100800101000302000207FFFE0FFFFE0FFFFE014217EA0
-19>I<01F8000FFE001C0F803003C03803C07C03E07C01E07C01E03C03E01803E00003C0000380
-000780000E00001C0003F800000E000007800003C00003E00001E00001F00001F03001F07801F0
-FC01F0FC01F0FC01E0F803E04003C02007801C0F000FFE0003F80014227EA019>I<0003000003
-00000700000F00000F0000170000370000270000470000C7000087000107000307000207000407
-000C0700080700100700300700200700400700C00700FFFFFCFFFFFC0007000007000007000007
-0000070000070000070000FFF800FFF816217FA019>I<1800401E03801FFF801FFF001FFC0013
-F00010000010000010000010000010000010000010FC001306001403801801801001C00000E000
-00E00000F00000F00000F07000F0F800F0F800F0F800F0F800E0C001E04001C06003C03003801C
-0F000FFE0003F00014227EA019>I<003E0000FF8003C0C00700E00E01E01C03E01C03E03801C0
-380000780000700000700000F0F800F30600F40300F40180F801C0F800E0F000E0F000F0F000F0
-F000F0F000F0F000F07000F07000F07800E03800E03801E01C01C01C03800F070003FE0001F800
-14227EA019>I<4000006000007FFFF07FFFF07FFFE0400020C000408000808001008001000002
-0000040000040000080000180000100000300000300000700000700000E00000E00000E00001E0
-0001E00001E00001E00003E00003E00003E00003E00003E00003E00003E00001C00014237DA119
->I<01F80007FE000E07801801C03000C02000606000606000606000607000607800C03E00801F
-81001FC60007FC0003F80001FE00067F000C1F80100FC03003E06001E0600070C00070C00030C0
-0030C00030C000306000607000403800C01E07800FFE0001F80014227EA019>I<01F80007FE00
-0E0F001C03803803807801C07001C07001E0F000E0F000E0F000F0F000F0F000F0F000F0F000F0
-7000F07001F03801F01802F00C02F0060CF001F0F00000E00000E00001E00001C03801C07C0380
-7C0380780700300E00303C001FF80007E00014227EA019>I<70F8F8F870000000000000000000
-000070F8F8F87005157C940E>I<70F8F8F870000000000000000000000070F8F8F87808080808
-101010204040051F7C940E>I<0001800000018000000180000003C0000003C0000003C0000005
-E0000005E0000005E0000008F0000008F0000008F00000107800001078000010780000203C0000
-203C0000603E0000401E0000401E0000C01F0000800F0000FFFF0001FFFF800100078001000780
-020003C0020003C0020003C0040001E0040001E00C0001E01E0001F0FFC01FFFFFC01FFF20237E
-A225>65 D<FFFFF800FFFFFE0007800F80078007C0078003E0078001E0078001F0078001F00780
-01F0078001F0078001F0078001E0078003E0078007C007800F8007803E0007FFFE000780078007
-8003C0078001E0078001F0078000F0078000F8078000F8078000F8078000F8078000F8078000F8
-078001F0078003F0078007E007800FC0FFFFFF00FFFFFC001D227EA123>I<0007F008003FFC18
-00FC061801F0013803C000F8078000780F0000381E0000381E0000183C0000183C0000187C0000
-087C00000878000008F8000000F8000000F8000000F8000000F8000000F8000000F8000000F800
-0000780000007C0000087C0000083C0000083C0000081E0000101E0000100F0000200780002003
-C0004001F0018000FC0700003FFC000007F0001D247DA224>I<FFFFF800FFFFFE0007800F8007
-8003C0078001E0078000F007800078078000780780003C0780003C0780001E0780001E0780001E
-0780001F0780001F0780001F0780001F0780001F0780001F0780001F0780001F0780001F078000
-1E0780001E0780003E0780003C0780003C07800078078000F0078001E0078003C007800F80FFFF
-FF00FFFFF80020227EA126>I<FFFFFFE0FFFFFFE0078003E0078000E007800060078000200780
-0030078000300780001007802010078020100780201007802000078060000780E00007FFE00007
-FFE0000780E0000780600007802000078020000780200407802004078000040780000807800008
-0780000807800018078000180780003807800078078001F0FFFFFFF0FFFFFFF01E227EA122>I<
-FFFFFFE0FFFFFFE0078003E0078000E00780006007800020078000300780003007800010078000
-1007802010078020100780200007802000078060000780E00007FFE00007FFE0000780E0000780
-600007802000078020000780200007802000078000000780000007800000078000000780000007
-8000000780000007800000FFFE0000FFFE00001C227EA121>I<0007F008003FFC1800FC061801
-F0013803C000F8078000780F0000381E0000381E0000183C0000183C0000187C0000087C000008
-78000008F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8001FFF78001F
-FF7C0000787C0000783C0000783C0000781E0000781F0000780F0000780780007803C000B801F0
-01B800FC0718003FFC080007F00020247DA227>I<FFFC3FFFFFFC3FFF078001E0078001E00780
-01E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E007
-8001E007FFFFE007FFFFE0078001E0078001E0078001E0078001E0078001E0078001E0078001E0
-078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0FFFC3FFFFFFC3F
-FF20227EA125>I<FFFCFFFC078007800780078007800780078007800780078007800780078007
-800780078007800780078007800780078007800780078007800780078007800780FFFCFFFC0E22
-7EA112>I<07FFF007FFF0000F00000F00000F00000F00000F00000F00000F00000F00000F0000
-0F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F0000
-0F00300F00780F00FC0F00FC0F00FC0E00F81E00401C0020380018700007C00014237EA11A>I<
-FFFC01FF80FFFC01FF800780007800078000600007800040000780008000078001000007800200
-00078004000007800800000780100000078020000007804000000780C000000781C000000783E0
-00000784F000000788F00000079078000007A03C000007C03C000007801E000007800F00000780
-0F00000780078000078003C000078003C000078001E000078000F000078000F000078000780007
-8000FC00FFFC03FFC0FFFC03FFC022227EA127>I<FFFE0000FFFE000007800000078000000780
-000007800000078000000780000007800000078000000780000007800000078000000780000007
-800000078000000780000007800000078000000780000007800000078000400780004007800040
-07800040078000C0078000C00780008007800180078003800780078007801F80FFFFFF80FFFFFF
-801A227EA11F>I<FF800001FF80FF800001FF8007800001F00005C00002F00005C00002F00004
-E00004F00004E00004F00004E00004F00004700008F00004700008F00004380010F00004380010
-F00004380010F000041C0020F000041C0020F000041C0020F000040E0040F000040E0040F00004
-070080F00004070080F00004070080F00004038100F00004038100F00004038100F0000401C200
-F0000401C200F0000400E400F0000400E400F0000400E400F00004007800F00004007800F0001F
-003000F000FFE0301FFF80FFE0301FFF8029227EA12E>I<FF8007FFFFC007FF07C000F805E000
-2004F0002004F0002004780020047C0020043C0020041E0020041E0020040F0020040780200407
-80200403C0200401E0200401E0200400F0200400F8200400782004003C2004003C2004001E2004
-000F2004000F20040007A0040003E0040003E0040001E0040001E0040000E01F000060FFE00060
-FFE0002020227EA125>I<000FF00000381C0000E0070001C00380078001E0070000E00E000070
-1E0000783C00003C3C00003C7C00003E7C00003E7800001E7800001EF800001FF800001FF80000
-1FF800001FF800001FF800001FF800001FF800001FF800001F7C00003E7C00003E7C00003E3C00
-003C3E00007C1E0000780F0000F00F0000F0078001E003C003C000E0070000381C00000FF00020
-247DA227>I<FFFFF800FFFFFE0007801F00078007C0078003C0078001E0078001E0078001F007
-8001F0078001F0078001F0078001F0078001E0078003E0078003C00780078007801F0007FFFC00
-078000000780000007800000078000000780000007800000078000000780000007800000078000
-0007800000078000000780000007800000FFFC0000FFFC00001C227EA122>I<FFFFE00000FFFF
-FC000007801F00000780078000078003C000078003E000078001E000078001F000078001F00007
-8001F000078001F000078001E000078003E000078003C000078007000007803E000007FFF00000
-078038000007801C000007800E000007800F000007800700000780078000078007800007800780
-000780078000078007C000078007C000078007C000078007C040078007E040078003E040FFFC01
-E080FFFC00F1000000003E0022237EA125>82 D<03F8100FFE301E07303801F07000F0700070E0
-0030E00030E00010E00010E00010F00000F000007C00007F00003FF0001FFE000FFF8003FFC000
-3FE00003F00000F0000070000078000038800038800038800038800038C00030C00070E00060F8
-00E0CF03C0C7FF0080FE0015247DA21C>I<7FFFFFFC7FFFFFFC7803C03C6003C00C4003C00440
-03C004C003C006C003C0068003C0028003C0028003C0028003C0020003C0000003C0000003C000
-0003C0000003C0000003C0000003C0000003C0000003C0000003C0000003C0000003C0000003C0
-000003C0000003C0000003C0000003C0000003C0000003C0000003C00001FFFF8001FFFF801F22
-7EA124>I<FFFC07FFFFFC07FF078000F807800020078000200780002007800020078000200780
-002007800020078000200780002007800020078000200780002007800020078000200780002007
-800020078000200780002007800020078000200780002007800020078000200380004003C00040
-03C0004001C0008000E0018000700300003C0E00001FF8000003F00020237EA125>I<FFF800FF
-C0FFF800FFC00F80001E000780000800078000080003C000100003C000100003C000100001E000
-200001E000200001F000200000F000400000F0004000007800800000780080000078008000003C
-010000003C010000003C010000001E020000001E020000001F060000000F040000000F04000000
-07880000000788000000078800000003D000000003D000000003F000000001E000000001E00000
-0000C000000000C000000000C0000022237FA125>I<FFF83FFE03FFFFF83FFE03FF0F8003E000
-780F0001E00030078001E00020078001E00020078001F0002003C001F0004003C001F0004003C0
-0278004001E00278008001E00278008001E0043C008000F0043C010000F0043C010000F0081E01
-0000F8081E03000078081E02000078181F02000078100F0200003C100F0400003C100F0400003C
-20078400001E20078800001E20078800001E4003C800000F4003D000000F4003D000000F8001F0
-0000078001E00000078001E00000070000E00000070000E00000030000C0000002000040003023
-7FA133>I<7FFC0FFF007FFC0FFF0003E001F00003E000C00001F000800000F001000000F80200
-000078020000003C040000003E080000001E080000000F100000000FB000000007A000000003C0
-00000003E000000001E000000001F000000003F80000000278000000047C0000000C3C00000008
-1E000000101F000000300F00000020078000004007C00000C003C000008001E000010001F00003
-0000F0000F8001F800FFE007FFC0FFE007FFC022227FA125>I<FFF8007FC0FFF8007FC00F8000
-1E0007C000180003C000100003E000100001E000200001F000600000F00040000078008000007C
-008000003C010000003E030000001E020000000F040000000F84000000078800000007D8000000
-03D000000003E000000001E000000001E000000001E000000001E000000001E000000001E00000
-0001E000000001E000000001E000000001E000000001E000000001E00000003FFF0000003FFF00
-0022227FA125>I<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
-C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0FEFE07317BA40E>91 D<08021004200820084010401080
-20802080208020B82EFC3FFC3F7C1F380E100F7AA219>I<FEFE06060606060606060606060606
-0606060606060606060606060606060606060606060606060606060606060606FEFE07317FA40E
->I<1FF000381C007C06007C07007C0380380380000380000380007F8007C3801E03803C038078
-0380780380F00384F00384F00384F00784780B843C11C80FE0F016157E9419>97
-D<0E0000FE0000FE00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00
-000E00000E1F800E60E00E80300F00380E001C0E001E0E000E0E000F0E000F0E000F0E000F0E00
-0F0E000F0E000F0E000E0E001E0E001C0F00380C80700C60E0081F8018237FA21C>I<01FE0007
-07000C0F801C0F80380F80780700700000F00000F00000F00000F00000F00000F00000F0000070
-00007800403800401C00800C010007060001F80012157E9416>I<0000700007F00007F00000F0
-00007000007000007000007000007000007000007000007000007000007001F8700706700E0170
-1C00F0380070780070700070F00070F00070F00070F00070F00070F00070F00070700070780070
-3800701C00F00C017807067F01F87F18237EA21C>I<01FC000707000C03801C01C03801C07800
-E07000E0F000E0FFFFE0F00000F00000F00000F00000F000007000007800203800201C00400E00
-8007030000FC0013157F9416>I<003E0000E30001C780038F80030F8007070007000007000007
-0000070000070000070000070000070000FFF800FFF80007000007000007000007000007000007
-00000700000700000700000700000700000700000700000700000700000700000700007FF8007F
-F800112380A20F>I<00007801F08C071D1C0E0E1C1C07001C07003C07803C07803C07803C0780
-1C07001C07000E0E000F1C0019F0001000001000001800001C00001FFF000FFFE00FFFF03800F8
-60001840001CC0000CC0000CC0000C6000186000183800700E01C001FE0016217F9519>I<0E00
-0000FE000000FE0000001E0000000E0000000E0000000E0000000E0000000E0000000E0000000E
-0000000E0000000E0000000E0000000E1F80000E60E0000E8070000F0038000F0038000E003800
-0E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038
-000E0038000E0038000E003800FFE3FF80FFE3FF8019237FA21C>I<1C003E003E003E001C0000
-0000000000000000000000000000000E00FE00FE001E000E000E000E000E000E000E000E000E00
-0E000E000E000E000E000E000E00FFC0FFC00A227FA10E>I<00E001F001F001F000E000000000
-00000000000000000000000000F007F007F000F000700070007000700070007000700070007000
-70007000700070007000700070007000700070007000707070F870F8E0F8C071801F000C2C82A1
-0F>I<0E0000FE0000FE00001E00000E00000E00000E00000E00000E00000E00000E00000E0000
-0E00000E00000E03FC0E03FC0E01E00E01800E02000E04000E08000E10000E38000EF8000F1C00
-0E1E000E0E000E07000E07800E03C00E01C00E01E00E01F0FFE3FEFFE3FE17237FA21A>I<0E00
-FE00FE001E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E
-000E000E000E000E000E000E000E000E000E000E000E000E00FFE0FFE00B237FA20E>I<0E1FC0
-7F00FE60E18380FE807201C01F003C00E00F003C00E00E003800E00E003800E00E003800E00E00
-3800E00E003800E00E003800E00E003800E00E003800E00E003800E00E003800E00E003800E00E
-003800E00E003800E00E003800E0FFE3FF8FFEFFE3FF8FFE27157F942A>I<0E1F8000FE60E000
-FE8070001F0038000F0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038
-000E0038000E0038000E0038000E0038000E0038000E0038000E003800FFE3FF80FFE3FF801915
-7F941C>I<00FC000703800E01C01C00E0380070780078700038F0003CF0003CF0003CF0003CF0
-003CF0003CF0003C7000387800783800701C00E00E01C007038000FC0016157F9419>I<0E1F80
-FE60E0FE80700F00380E001C0E001E0E001E0E000F0E000F0E000F0E000F0E000F0E000F0E000F
-0E001E0E001E0E001C0F00380E80700E60E00E1F800E00000E00000E00000E00000E00000E0000
-0E00000E0000FFE000FFE000181F7F941C>I<01F8200704600E02601C01603801E07800E07800
-E0F000E0F000E0F000E0F000E0F000E0F000E0F000E07000E07800E03801E01C01E00C02E0070C
-E001F0E00000E00000E00000E00000E00000E00000E00000E00000E0000FFE000FFE171F7E941A
->I<0E1E00FE6300FE87801E87800F03000F00000E00000E00000E00000E00000E00000E00000E
-00000E00000E00000E00000E00000E00000E0000FFF000FFF00011157F9414>I<0FC4303C600C
-C00CC004C004E004F0007F803FF00FF800FC001E800E8006C006C006C004E00CD81887E00F157E
-9414>I<020002000200020002000600060006000E001E003FF8FFF80E000E000E000E000E000E
-000E000E000E000E000E040E040E040E040E040E040708030801F00E1F7F9E13>I<0E003800FE
-03F800FE03F8001E0078000E0038000E0038000E0038000E0038000E0038000E0038000E003800
-0E0038000E0038000E0038000E0038000E0038000E0078000E0078000700BC0003833F8000FC3F
-8019157F941C>I<FFC1FEFFC1FE1E00700E00200E002007004007004003808003808003808001
-C10001C10000E20000E20000E20000740000740000380000380000380000100017157F941A>I<
-FF8FF87F80FF8FF87F801E01C01E000E00C00C000E00E008000E01E00800070160100007017010
-0007023030000382382000038238200001C418400001C41C400001C41C400000E80C800000E80E
-800000E80E8000007007000000700700000070070000002002000021157F9424>I<FF83FEFF83
-FE0F01E007008003810003830001C20000E400007800007000003800003C00004E00008E000187
-000103800201C00601C01E00E0FF03FEFF03FE17157F941A>I<FFC1FEFFC1FE1E00700E00200E
-002007004007004003808003808003808001C10001C10000E20000E20000E20000740000740000
-3800003800003800001000001000002000002000002000F84000F84000F88000B980006300003E
-0000171F7F941A>I<3FFFC0380380300780200700600E00401C00403C0040380000700000E000
-01E00001C0000380400700400F00400E00C01C0080380080780180700780FFFF8012157F9416>
-I<FFFFFF1801808C19>I<0E011F02318C40F8807010057CA019>126 D E
-/Fg 25 121 df<F8F8F8F8F805057B8410>46 D<0003F000000003F000000007F800000007F800
-000007780000000F3C0000000F3C0000000F3C0000001E3E0000001E1E0000001E1E0000003E1F
-0000003C1F0000007C0F8000007C0F800000780F800000F807C00000F807C00000F007C00001F0
-03E00001F003E00001E003E00003E001F00003E001F00003C001F00007C000F80007FFFFF80007
-FFFFF8000FFFFFFC000F80007C000F00007C001F00003E001F00003E001E00003E003E00001F00
-3E00001F003C00001F007C00000F807C00000F80F800000FC0F8000007C0F8000007C0222A7EA9
-27>65 D<0003FE00000FFFC0003FFFF000FFFFF001FE03F003F8006007E0002007C000000F8000
-001F8000001F0000003E0000003E0000007C0000007C0000007C0000007C000000F8000000F800
-0000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F80000007C0000007C
-0000007C0000007C0000003E0000003E0000001F0000001F8000000F80000007C0000007E00008
-03F8003801FE01F800FFFFF8003FFFF0000FFFC00003FE001D2C7CAA25>67
-D<FFFFFFC0FFFFFFC0FFFFFFC0FFFFFFC0F8000000F8000000F8000000F8000000F8000000F800
-0000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000FFFFFF00FF
-FFFF00FFFFFF00FFFFFF00F8000000F8000000F8000000F8000000F8000000F8000000F8000000
-F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000FFFFFF
-E0FFFFFFE0FFFFFFE0FFFFFFE01B2A7BA923>69 D<F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8
-F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8052A7BA910>73
-D<F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F800
-00F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F800
-00F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000FFFF
-FFFFFFFFFFFFFFFFFFFF182A7BA920>76 D<FFFFE000FFFFFC00FFFFFF00F8003F80F8000FC0F8
-0003E0F80001F0F80001F0F80000F8F80000F8F80000F8F80000F8F80000F8F80000F8F80001F0
-F80001F0F80003E0F8000FE0F8003FC0FFFFFF80FFFFFE00FFFFF800FFFFE000F801F000F801F0
-00F800F800F800F800F8007C00F8003C00F8003E00F8001E00F8001F00F8000F80F8000F80F800
-07C0F80007C0F80003E0F80001E0F80001F0F80000F8F80000F8F800007C1E2A7BA926>82
-D<01FC000FFF003FFF803FFFC03C07E03003E00001F00001F00001F00001F00001F00003F001FF
-F007FFF01FFFF03FC1F07E01F0FC01F0F801F0F801F0F801F0FC03F07E0FF07FFFF03FFFF01FF9
-F00FE1F0141B7E9A1C>97 D<F80000F80000F80000F80000F80000F80000F80000F80000F80000
-F80000F80000F80000F80000F80000F80000F87E00F9FF80FFFFC0FFFFE0FF07E0FC03F0F801F8
-F800F8F800F8F8007CF8007CF8007CF8007CF8007CF8007CF8007CF8007CF800FCF800F8F800F8
-F801F0FC03F0FE0FE0FFFFC0FFFF80FBFF00F8FC00162A7BA91E>I<007F8001FFE007FFF80FFF
-F81FC0783F00103E00007C00007C00007C0000F80000F80000F80000F80000F80000F80000F800
-007C00007C00007C00003E00003F00181FC0780FFFF807FFF801FFE0007F80151B7E9A1A>I<00
-007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00
-007C00007C00FC7C03FF7C07FFFC0FFFFC1FC1FC3F00FC3E007C7C007C7C007CFC007CF8007CF8
-007CF8007CF8007CF8007CF8007CF8007CF8007C7C007C7C007C7E00FC3F00FC1F83FC1FFFFC0F
-FF7C03FE7C01F87C162A7EA91E>I<00FC0003FF0007FF800FFFC01F87E03F01E03E00F07C00F0
-7C0070F80078FFFFF8FFFFF8FFFFF8FFFFF8F80000F80000F800007800007C00007C00003E0000
-3F00181FC0F80FFFF807FFF801FFE0007F00151B7E9A1A>I<001FC0007FC000FFC001FFC003F0
-0003E00007C00007C00007C00007C00007C00007C00007C00007C00007C000FFFE00FFFE00FFFE
-0007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C0
-0007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C000122A7FA912
->I<00F80F0003FE7F800FFFFF801FFFFF801F07C0003E03E0003E03E0007C01F0007C01F0007C
-01F0007C01F0007C01F0003E03E0003E03E0001F07C0001FFFC0003FFF80003BFE000038F80000
-78000000780000007C0000003FFF80003FFFF0001FFFF8001FFFFC003FFFFE007C00FE007C003F
-00F8001F00F8001F00F8001F00F8001F00FC003F007E007E003F81FC001FFFF8000FFFF00007FF
-E00000FF000019287E9A1D>I<F8F8F8F8F800000000000000000000F8F8F8F8F8F8F8F8F8F8F8
-F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8052A7CA90E>105 D<F8F8F8F8F8F8F8F8F8F8F8F8F8F8
-F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8052A7CA90E>108
-D<F83F007E00F9FF83FF00FBFFC7FF80FFFFEFFFC0FF07FE0FC0FE03FC07E0FC01F803E0FC01F8
-03E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801
-F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F801F003E0F8
-01F003E0F801F003E0F801F003E0F801F003E0231B7B9A2E>I<F87E00F9FF00FBFF80FFFFC0FF
-0FC0FE07E0FC03E0FC03E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F8
-03E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0131B7B9A1E>I<007E00
-01FF8007FFE00FFFF01F81F83F00FC3E007C7C003E7C003E78001EF8001FF8001FF8001FF8001F
-F8001FF8001FF8001F7C003E7C003E7C003E3E007C3F00FC1FC3F80FFFF007FFE003FFC0007E00
-181B7E9A1D>I<F87E00F9FF80FFFFC0FFFFE0FF0FE0FC03F0F801F8F800F8F800F8F800FCF800
-7CF8007CF8007CF8007CF8007CF8007CF8007CF800FCF800F8F801F8F801F0FC03F0FE0FE0FFFF
-C0FFFF80FBFF00F8FC00F80000F80000F80000F80000F80000F80000F80000F80000F80000F800
-00F80000F8000016277B9A1E>I<F838F8F8F9F8FBF8FFC0FF00FE00FE00FC00FC00F800F800F8
-00F800F800F800F800F800F800F800F800F800F800F800F800F800F8000D1B7B9A14>114
-D<07F8001FFF003FFF807FFF807C0780F80100F80000F80000F80000FC00007F00007FF0003FFC
-001FFE0007FF0000FF80001FC0000FC00007C00007C04007C0E007C0FC1F80FFFF807FFF001FFE
-0007F800121B7E9A16>I<07C00007C00007C00007C00007C00007C00007C000FFFF80FFFF80FF
-FF8007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007
-C00007C00007C00007C00007C00007C00007C08007E38003FFC003FFC001FF0000FC0012227FA1
-15>I<F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0
-F803E0F803E0F803E0F803E0F803E0F803E0F803E0F803E0F807E0F807E0FC1FE0FFFFE07FFBE0
-3FF3E01F83E0131B7B9A1E>I<7C001F803E003F003F003E001F807C000F80FC0007C0F80007E1
-F00003F3E00001F7E00000FFC000007F8000007F0000003E0000003E0000003F0000007F800000
-FFC00001F3E00003E1E00003E1F00007C0F8000F807C001F807C001F003E003E001F007C001F80
-FC000FC01A1B809A1B>120 D E /Fh 69 126 df<701CF01EF01EF01EF01EF01EF01EF01EF01E
-701C701C701C701C600C0F0E7B9D1A>34 D<01818003C3C003C3C003C3C003C3C003C3C003C3C0
-7FFFF0FFFFF8FFFFF8FFFFF80787800787800787800F8F800F0F000F0F000F0F000F0F00FFFFF8
-FFFFF8FFFFF87FFFF01E1E001E1E001E1E001E1E001E1E001E1E000C0C00151E7E9D1A>I<1C3E
-3E3F1F070707070E0E1C3C78F0600810789D1A>39 D<0038007800F001E003C007800F000E001C
-001C0038003800700070007000E000E000E000E000E000E000E000E000E000E000700070007000
-380038001C001C000E000F00078003C001E000F8007800380D2878A21A>I<6000F00078003C00
-1E000F000780038001C001C000E000E00070007000700038003800380038003800380038003800
-38003800700070007000E000E001C001C0038007800F001E003C007800F00060000D287CA21A>
-I<00E00000E00000E00000E00040E040F0E1E0F8E3E07EEFC01FFF0007FC0003F80007FC001FFF
-007EEFC0F8E3E0F0E1E040E04000E00000E00000E00000E00013157D991A>I<00300000780000
-78000078000078000078000078000078000078007FFFF0FFFFF8FFFFF87FFFF000780000780000
-780000780000780000780000780000780000300015167E991A>I<183E7E7F3F1F070E0E1CFCF8
-E0080D77851A>I<7FFFC0FFFFE0FFFFE07FFFC013047D901A>I<3078FCFC7830060676851A>I<
-0000C00001E00001E00003E00003C00007C0000780000F80000F00000F00001F00001E00003E00
-003C00007C0000780000780000F80000F00001F00001E00003E00003C00003C00007C000078000
-0F80000F00001F00001E00001E00003E00003C00007C0000780000F80000F00000F00000600000
-13277DA21A>I<01F00007FC000FFE001F1F001C07003803803803807001C07001C07001C0E000
-E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C07001C07803C03803
-803C07801C07001F1F000FFE0007FC0001F000131E7D9D1A>I<00C001C001C003C007C00FC07F
-C0FDC071C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C0
-01C07FFFFFFF7FFF101E7B9D1A>I<03F0000FFC001FFF003C0F807803C07001C0E000E0F000E0
-F000E06000E00000E00000E00001C00001C0000380000780000F00000E00003C00007C0000F000
-01E00003C0000780000F00001E00E03C00E07FFFE0FFFFE07FFFE0131E7D9D1A>I<01FC0007FF
-001FFF801E03C03C01C03C00E03C00E00000E00000E00001C00003C000078001FF0001FF0001FF
-C00003E00000F0000070000038000038000038600038F00038F00038E000707000F07E03E03FFF
-C00FFF0001FC00151E7E9D1A>I<000F80001F80003F80003B80007B8000F38000E38001E38003
-C3800383800783800F03800E03801E03803C0380380380780380F00380FFFFFEFFFFFEFFFFFE00
-0380000380000380000380000380000380007FFC007FFC007FFC171E7F9D1A>I<3078FCFC7830
-0000000000000000003078FCFC7830061576941A>58 D<183C7E7E3C1800000000000000000018
-3C7E7E3E1E0E0E1C3CF8F0C0071C77941A>I<7FFFF0FFFFF8FFFFF87FFFF00000000000000000
-000000007FFFF0FFFFF8FFFFF87FFFF0150C7E941A>61 D<003E0001FF0003FF8007C3C00F01C0
-1E0EE03C3FE0387FE07071F070E0F070E0F0E1C070E1C070E1C070E1C070E1C070E1C070E1C070
-E1C07070E0E070E0E07071C0387FC03C3F801E0E000F007007C1F003FFE001FFC0003F00141E7E
-9D1A>64 D<003800007C00007C00006C0000EE0000EE0000EE0000EE0000C60001C70001C70001
-C70001C7000383800383800383800383800783C00701C007FFC007FFC007FFC00E00E00E00E00E
-00E00E00E01C00707F83FCFF83FE7F83FC171E7F9D1A>I<FFFE00FFFF80FFFFC01C03E01C00E0
-1C00F01C00701C00701C00701C00701C00E01C01E01C07C01FFF801FFF801FFFC01C01E01C00F0
-1C00701C00381C00381C00381C00381C00381C00781C00F01C01F0FFFFE0FFFFC0FFFF00151E7E
-9D1A>I<007C3801FF3807FFF80F83F81E00F81C0078380078380038700038700038700000E000
-00E00000E00000E00000E00000E00000E00000E000007000007000387000383800383800381C00
-701E00F00F83E007FFC001FF80007C00151E7E9D1A>I<FFFE00FFFF00FFFF801C07C01C01E01C
-00F01C00701C00781C00381C00381C003C1C001C1C001C1C001C1C001C1C001C1C001C1C001C1C
-001C1C003C1C00381C00381C00781C00701C00F01C01E01C07C0FFFFC0FFFF00FFFE00161E7F9D
-1A>I<7FFFFCFFFFFC7FFFFC0E001C0E001C0E001C0E001C0E001C0E00000E00000E07000E0700
-0E07000FFF000FFF000FFF000E07000E07000E07000E00000E00000E00000E000E0E000E0E000E
-0E000E0E000E7FFFFEFFFFFE7FFFFE171E7F9D1A>I<7FFFFCFFFFFC7FFFFC0E001C0E001C0E00
-1C0E001C0E001C0E00000E00000E07000E07000E07000FFF000FFF000FFF000E07000E07000E07
-000E00000E00000E00000E00000E00000E00000E00000E00007FE000FFF0007FE000161E7F9D1A
->I<00F8E003FEE007FFE00F07E01E03E03C01E03800E07000E07000E07000E0E00000E00000E0
-0000E00000E00000E00000E00FF8E00FF8E00FF8E000E07000E07000E07001E03801E03C03E01E
-03E00F07E007FFE003FEE000F8E0151E7E9D1A>I<FF8FF8FF8FF8FF8FF81C01C01C01C01C01C0
-1C01C01C01C01C01C01C01C01C01C01C01C01C01C01FFFC01FFFC01FFFC01C01C01C01C01C01C0
-1C01C01C01C01C01C01C01C01C01C01C01C01C01C01C01C0FF8FF8FF8FF8FF8FF8151E7E9D1A>
-I<FFFF80FFFF80FFFF8001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
-0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
-0001C000FFFF80FFFF80FFFF80111E7C9D1A>I<03FFC003FFE003FFC0000E00000E00000E0000
-0E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0000
-0E00000E00000E00000E00600E00F00E00F01E00F03C007FF8003FF0000FC000131E7C9D1A>I<
-FF83F8FF87FCFF83F81C01E01C03C01C03801C07001C0F001C1E001C1C001C38001C78001CF000
-1CF8001DF8001FDC001F9C001F0E001E0F001E07001C07801C03801C01C01C01C01C00E01C00E0
-1C0070FF81FCFF81FEFF81FC171E7F9D1A>I<7FE000FFF0007FE0000E00000E00000E00000E00
-000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00
-000E00000E00000E00380E00380E00380E00380E00387FFFF8FFFFF87FFFF8151E7E9D1A>I<7E
-003F00FF007F807F007F001D80DC001D80DC001D80DC001DC1DC001DC1DC001CC19C001CC19C00
-1CE39C001CE39C001C631C001C771C001C771C001C361C001C361C001C3E1C001C1C1C001C1C1C
-001C001C001C001C001C001C001C001C001C001C001C001C001C001C007F007F00FF80FF807F00
-7F00191E809D1A>I<FE0FF8FF0FF8FF0FF81D81C01D81C01D81C01D81C01DC1C01CC1C01CC1C0
-1CE1C01CE1C01C61C01C61C01C71C01C71C01C31C01C31C01C39C01C39C01C19C01C19C01C1DC0
-1C0DC01C0DC01C0DC01C0DC0FF87C0FF87C0FF83C0151E7E9D1A>I<0FFE003FFF807FFFC07C07
-C07001C0F001E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000
-E0E000E0E000E0E000E0E000E0E000E0E000E0F001E0F001E07001C07C07C07FFFC03FFF800FFE
-00131E7D9D1A>I<7FFF00FFFFC07FFFE00E01F00E00780E00380E003C0E001C0E001C0E001C0E
-001C0E003C0E00380E00780E01F00FFFE00FFFC00FFF000E00000E00000E00000E00000E00000E
-00000E00000E00000E00007FC000FFE0007FC000161E7F9D1A>I<FFF000FFFC00FFFF001C0F80
-1C07801C03C01C01C01C01C01C01C01C01C01C03C01C07801C0F801FFF001FFC001FFE001C0F00
-1C07001C03801C03801C03801C03801C03801C03841C038E1C038E1C038EFF81FCFF81FCFF8070
-171E7E9D1A>82 D<03F1C00FFDC03FFFC07C0FC07003C0E003C0E001C0E001C0E001C0E0000070
-00007800003F00001FF00007FE0000FF00000F800003C00001C00000E00000E06000E0E000E0E0
-00E0E001C0F001C0FC0780FFFF80EFFE00E3F800131E7D9D1A>I<7FFFFEFFFFFEFFFFFEE0380E
-E0380EE0380EE0380EE0380E003800003800003800003800003800003800003800003800003800
-00380000380000380000380000380000380000380000380000380000380003FF8007FFC003FF80
-171E7F9D1A>I<7FC1FF00FFE3FF807FC1FF000E0038000E0038000E0038000E0038000E003800
-0E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038000E0038
-000E0038000E0038000E0038000E0038000E00380007007000070070000380E00003C1E00001FF
-C00000FF8000003E0000191E809D1A>I<3FFFF87FFFF87FFFF87000707000E07001E07001C070
-0380000780000700000E00001E00001C0000380000780000F00000E00001C00003C00003800007
-00000F00380E00381C00383C0038380038700038FFFFF8FFFFF8FFFFF8151E7E9D1A>90
-D<FFF8FFF8FFF8E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000
-E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000FFF8FFF8FF
-F80D2776A21A>I<FFF8FFF8FFF800380038003800380038003800380038003800380038003800
-380038003800380038003800380038003800380038003800380038003800380038003800380038
-0038FFF8FFF8FFF80D277EA21A>93 D<7FFFC0FFFFE0FFFFE07FFFC013047D7E1A>95
-D<1FF0003FFC007FFE00780F00300700000380000380007F8007FF801FFF803F83807803807003
-80E00380E00380E00380700780780F803FFFFC1FFDFC07F0FC16157D941A>97
-D<FE0000FE0000FE00000E00000E00000E00000E00000E00000E00000E3E000EFF800FFFE00FC1
-F00F80700F00380E00380E001C0E001C0E001C0E001C0E001C0E001C0E001C0F00380F00780F80
-F00FC1E00FFFC00EFF80063E00161E7F9D1A>I<00FF8003FFC00FFFE01F01E03C00C078000070
-0000700000E00000E00000E00000E00000E000007000007000007800703C00701F01F00FFFE003
-FFC000FE0014157D941A>I<001FC0001FC0001FC00001C00001C00001C00001C00001C00001C0
-01F1C007FDC00FFFC01E0FC03C07C07803C07001C0E001C0E001C0E001C0E001C0E001C0E001C0
-E001C07003C07003C03807C03E0FC01FFFFC07FDFC01F1FC161E7E9D1A>I<01F80007FF000FFF
-801E07C03C01C07800E07000E0E00070E00070FFFFF0FFFFF0FFFFF0E000007000007000007800
-703C00701F01F00FFFE003FFC000FE0014157D941A>I<0007E0001FF0003FF800787800F03000
-E00000E00000E00000E0007FFFF0FFFFF0FFFFF000E00000E00000E00000E00000E00000E00000
-E00000E00000E00000E00000E00000E00000E00000E00000E0007FFFC07FFFC07FFFC0151E7F9D
-1A>I<00F87C03FFFE07FFFE0F078C0E03801C01C01C01C01C01C01C01C01C01C00E03800F0780
-0FFF000FFE001CF8001C00001C00000E00000FFF800FFFE03FFFF87C007C70001CE0000EE0000E
-E0000EE0000E70001C78003C3E00F81FFFF007FFC001FF0017217F941A>I<FE0000FE0000FE00
-000E00000E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00E00E00
-E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E0FFE3FEFFE3
-FEFFE3FE171E7F9D1A>I<01C00003E00003E00003E00001C00000000000000000000000000000
-00007FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000
-E00000E00000E00000E00000E00000E000FFFFC0FFFFC0FFFFC0121F7C9E1A>I<001C003E003E
-003E001C000000000000000000000FFE0FFE0FFE000E000E000E000E000E000E000E000E000E00
-0E000E000E000E000E000E000E000E000E000E000E000E000E000E001C601CF038FFF87FF01FC0
-0F2A7E9E1A>I<FFE000FFE000FFE00000E00000E00000E00000E00000E00000E00000E00000E0
-0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E0
-0000E00000E00000E000FFFFE0FFFFE0FFFFE0131E7D9D1A>108 D<7CE0E000FFFBF8007FFFF8
-001F1F1C001E1E1C001E1E1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C
-1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C007F1F1F00FF9F9F807F1F1F00191580941A
->I<FE3E00FEFF80FFFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E
-00E00E00E00E00E00E00E00E00E00E00E0FFE3FEFFE3FEFFE3FE17157F941A>I<01F00007FC00
-1FFF003E0F803C07807803C07001C0E000E0E000E0E000E0E000E0E000E0E000E0F001E07001C0
-7803C03C07803E0F801FFF0007FC0001F00013157D941A>I<FE3E00FEFF80FFFFE00FC1F00F80
-700F00380E00380E001C0E001C0E001C0E001C0E001C0E001C0E001C0F00380F00780F80F00FC1
-E00FFFC00EFF800E3E000E00000E00000E00000E00000E00000E00000E00000E0000FFE000FFE0
-00FFE00016207F941A>I<FF83F0FF8FF8FFBFFC03FC3C03F01803E00003C00003C00003800003
-8000038000038000038000038000038000038000038000038000FFFF00FFFF80FFFF0016157E94
-1A>114 D<07FB801FFF807FFF80780780E00380E00380E003807800007FC0003FFC0007FF0000
-3F800003806001C0E001C0E001C0F003C0FC0780FFFF00EFFE00E3F80012157C941A>I<00C000
-01C00001C00001C00001C00001C00001C0007FFFE0FFFFE0FFFFE001C00001C00001C00001C000
-01C00001C00001C00001C00001C00001C00001C07001C07001C07001C07000E0E000FFE0007FC0
-001F00141C7F9B1A>I<FE0FE0FE0FE0FE0FE00E00E00E00E00E00E00E00E00E00E00E00E00E00
-E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03E007FFFE03FFFE00FCFE17157F941A
->I<7FC7FCFFC7FE7FC7FC0E00E00E00E00F01E00701C00701C00783C003838003838003838001
-C70001C70001C70000EE0000EE0000EE00007C00007C0000380017157F941A>I<FF83FEFFC7FE
-FF83FE3800381C00701C00701C00701C00701C38701C7C700C7C600E6CE00E6CE00EEEE00EEEE0
-0EEEE006C6C006C6C007C7C007C7C003838017157F941A>I<7FC7F87FCFFC7FC7F80703C00387
-8003C70001EE0000FE00007C00007800003800007C0000EE0001EE0001C7000383800783C00701
-C07FC7FCFFC7FE7FC7FC17157F941A>I<7FC7FCFFC7FE7FC7FC0E00E00F00E00701E00701C007
-81C00381C003838001C38001C38001C70000E70000E70000E600006600006E00003C00003C0000
-3C00003C0000380000380000780000700030700078E00079E0007FC0003F80001E000017207F94
-1A>I<0007E0001FE0003FE000780000F00000E00000E00000E00000E00000E00000E00000E000
-00E00000E00000E00000E00001E00003C000FF8000FF0000FF800003C00001E00000E00000E000
-00E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007800003FE0001FE0
-0007E013277DA21A>123 D<7C0000FF0000FF800003C00001E00000E00000E00000E00000E000
-00E00000E00000E00000E00000E00000E00000E00000F000007800003FE0001FE0003FE0007800
-00F00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E000
-03C000FF8000FF00007C000013277DA21A>125 D E /Fi 62 127 df<0000FE0000038100000E
-0080001C03C0003807C0007007C0007007800070030000E0000000E0000000E0000000E0000000
-E0000000E000003FFFFF003FFFFF0001C00F0001C0070001C0070001C0070003800E0003800E00
-03800E0003800E0003800E0003800E0007001C0007001C0007001C0007001C0007001C0007001C
-000F003C00FFE3FF80FFE3FF801A237FA21C>12 D<0380078007000E001C003800700040008000
-0A0971A219>19 D<0700078001E000F0007000E001E0FF800C087B7E16>24
-D<0001E000000003100000000C080000000C080000001808000000380800000038080000003008
-00000030100000007010000000702000000070400000007080000000710000000072000000003C
-003FF00038003FF00038000F800038000600007C000800009C000800011C001000061E0020000C
-0E004000180F004000380700800078078100007003820000F003C40000F001C80000F001F00080
-F800F00180F800F001007801B803003E0F1E0E001FFC0FFC0007E003F00024257DA327>38
-D<1C3E7E7E3A02020404080810204080070F78A20E>I<1C3E7E7E3A0202040408081020408007
-0F7D840E>44 D<FFF0FFF00C027D8B11>I<3078F8787005057C840E>I<001F0000E1C001C06003
-80700700300E00380E00381E00381C00381C00383C00383C003838007878007878007878007878
-0078780078F000F0F000F0F000F0F000F0F000E0F001E0F001E0F001C0F001C0F0038070038070
-0700700600380C001C380007E00015227CA019>48 D<000FC0007FF000E0FC01003E02001E0400
-1F07800F0FC00F0FC00F0FC00F0F801F03001E00001E00003C00003C0000780000F00001E00003
-C0000700000E00001C0000300000600000C0000180080200080400080800103000107FFFF0FFFF
-E0FFFFE018217EA019>50 D<001FC0007FE001C0F803007C07803C07C03C0FC03C0FC03C07803C
-03007C0000780000F00000E00001C000070000FE000003800001C00001E00000F00000F00000F0
-0000F81000F87C01F0FC01F0FC01F0FC01E0F803E0C007C0600780381F001FFC0007F00016227D
-A019>I<0000200000600000E00001E00001E00002E00005C00009C00011C00031C00061C00041
-C00083800103800203800403800C0380080380100700200700400700800700FFFFFCFFFFFC000E
-00000E00000E00000E00000E00000E00001E0003FFE003FFE016217DA019>I<00800400E03C01
-FFF801FFF001FFC0017F00010000010000020000020000020000020000023F0002C1C00500E006
-00600400700000700000780000780000780000783800787C0078FC00F0F800F0F800E08001E040
-01C0400380200700381E000FFC0007E00016227DA019>I<001FC0007FE000E07801801802000C
-06000C04000C0C000C0C000C0E000C0F00180F803007E06003F0C001FF0000FE00007F00019FC0
-060FE00C03E01801F03000F0600070600030C00030C00030C00030C00020E000606000C0300180
-3C0F000FFC0003F00016227DA019>56 D<003F0000FFC001E0E00380700700700E00381E00381C
-00383C00383C00383C00383C00787800787800787800783800F83800F83801781C01F00C02F006
-0CF001F0E00001E00001E00001C00003C0700380F80700F80600F00E00803C00E070007FE0001F
-800015227CA019>I<060F1F1F0E00000000000000000000003078F8787008157C940E>I<000004
-0000000006000000000E000000000E000000001E000000001E000000003F000000006F00000000
-4F00000000CF000000008F000000018F000000010F800000020780000002078000000407800000
-040780000008078000000803C000001003C000001003C000002003C000003FFFC000007FFFC000
-004001E000008001E000008001E000010001E000010001E000020001F000020000F000060000F0
-001F0001F000FFC01FFF80FFC01FFF0021237EA225>65 D<07FFFFE007FFFFF8003C007C003C00
-3E003C001F003C001F003C000F0078000F0078000F0078001F0078001F0078003E0078003C00F0
-007800F001F000F007C000FFFFC000F001F000F000F801E0007C01E0007C01E0003C01E0003E01
-E0003E01E0003E03C0003C03C0007C03C0007C03C000F803C001F003C003E007C00FC0FFFFFF80
-FFFFFC0020227EA123>I<0000FE010007FF83001F81C6007C006E00F0003E01E0001E03C0001E
-0780000E0F00000C1F00000C1E0000043E0000043C0000047C0000047C000000F8000000F80000
-00F8000000F8000000F8000000F8000000F0000000F0000000F0000010F8000010F8000020F800
-0020780000207C0000403C0000801E0001800F0003000780060003E0380001FFF000003F800020
-247AA224>I<07FFFFE00007FFFFF800003C007C00003C001E00003C000F00003C000780003C00
-078000780003C000780003C000780003E000780003E000780003E000780003E000F00003E000F0
-0003E000F00003E000F00003E000F00003E000F00003E001E00003C001E00007C001E00007C001
-E000078001E0000F8001E0000F0003C0001F0003C0001E0003C0003C0003C000780003C000F000
-03C003E00007C00FC000FFFFFF0000FFFFF8000023227EA126>I<07FFFFFF8007FFFFFF80003C
-001F00003C000700003C000300003C000300003C00010000780001000078000100007802010000
-780201000078020100007806000000F004000000F01C000000FFFC000000FFFC000000F01C0000
-00F00C000001E008000001E008000001E008010001E008010001E000020001E000020003C00002
-0003C000040003C000040003C0000C0003C000180003C000380007C001F800FFFFFFF000FFFFFF
-F00021227EA122>I<0000FE010007FF83001F81C6007C006E00F0003E01E0001E03C0001E0780
-000E0F00000C1F00000C1E0000043E0000043C0000047C0000047C000000F8000000F8000000F8
-000000F8000000F8000000F8000000F0003FFFF0003FFFF00000F0F80000F0F80000F0F80001E0
-780001E07C0001E03C0001E01E0003E00F0003E0078004C003F038C001FFF040003F800020247A
-A227>71 D<07FFF007FFF0003E00003C00003C00003C00003C0000780000780000780000780000
-780000780000F00000F00000F00000F00000F00000F00001E00001E00001E00001E00001E00001
-E00003C00003C00003C00003C00003C00003C00007C000FFFE00FFFC0014227EA112>73
-D<003FFF003FFF0000F00000F00000F00000F00000F00001E00001E00001E00001E00001E00001
-E00003C00003C00003C00003C00003C00003C0000780000780000780000780000780000780300F
-007C0F00FC0F00FC0F00FC1E00F81E00803C0040380030E0000F800018237DA11A>I<07FFF00F
-FE07FFF00FFC003E0003E0003C000300003C000200003C000400003C0018000078002000007800
-4000007800800000780100000078020000007808000000F018000000F03C000000F07C000000F0
-9E000000F31E000000F40F000001E80F000001F00F800001E007800001E007C00001E003C00001
-E003E00003C001E00003C001F00003C000F00003C000F80003C000780003C0007C0007C0007E00
-FFFC03FFC0FFFC03FFC027227EA127>I<07FFF80007FFF800003E0000003C0000003C0000003C
-0000003C000000780000007800000078000000780000007800000078000000F0000000F0000000
-F0000000F0000000F0000000F0000001E0000001E0000001E0001001E0001001E0003001E00020
-03C0002003C0006003C0006003C000C003C001C003C003C007C00FC0FFFFFF80FFFFFF801C227E
-A11F>I<07FC000007FE07FC00000FFE002E00000FC0002E00001780002E00001780002E000027
-80002700002780004700004F00004700008F00004700008F00004700010F00004380010F000043
-80020F00008380021E00008380041E000081C0041E000081C0081E000081C0081E000081C0101E
-000101C0203C000100E0203C000100E0403C000100E0403C000100E0803C000100E0803C000200
-7100780002007100780002007200780002007200780002003C0078000600380078000F003800F8
-00FFE0301FFF80FFE0301FFF802F227EA12E>I<07FFFFC007FFFFF0003C00FC003C003E003C00
-1E003C001F003C001F0078001F0078001F0078001F0078001F0078001E0078003E00F0003C00F0
-007800F000F000F003E000FFFF8000F0000001E0000001E0000001E0000001E0000001E0000001
-E0000003C0000003C0000003C0000003C0000003C0000003C0000007C00000FFFC0000FFFC0000
-20227EA122>80 D<07FFFF800007FFFFF000003C00F800003C003C00003C001E00003C001F0000
-3C001F000078001F000078001F000078001F000078001F000078003E000078003C0000F0007800
-00F000F00000F007C00000FFFE000000F00E000000F003000001E003800001E001C00001E001C0
-0001E001E00001E001E00001E001E00003C003E00003C003E00003C003E00003C003E00003C003
-E02003C003E04007C003E040FFFC01F080FFFC00F1800000003E0023237EA125>82
-D<000FC040003FF0C000F0398001C00F80018003800300038007000180070001800E0001000E00
-01000E0001000F0000000F0000000F80000007E0000007FE000003FFC00001FFF000007FF80000
-07FC0000007C0000003C0000001E0000001E0000001E0020001E0040001C0040001C0060001C00
-600018006000380070007000F800E000EF03C000C7FF800080FE00001A247DA21C>I<1FFFFFFF
-3FFFFFFF3C01E01E3001E0062001E0026001E0024001E0024003C0024003C0028003C0028003C0
-028003C0020003C000000780000007800000078000000780000007800000078000000F0000000F
-0000000F0000000F0000000F0000000F0000001E0000001E0000001E0000001E0000001E000000
-1E0000003E00001FFFF8001FFFF80020227AA124>I<FFFE07FF80FFFE07FF8007C00078000780
-0020000780002000078000200007800020000F000040000F000040000F000040000F000040000F
-000040000F000040001E000080001E000080001E000080001E000080001E000080001E00008000
-3C000100003C000100003C000100003C000100003C000100003C000200003C000200003C000200
-003C000400003C000C00001C000800001E001000000E006000000781C0000003FF800000007E00
-0000212379A125>I<FFFC007FE0FFF8007FE00F80001E000780000C0007800008000780001000
-03C000100003C000200003C000200003C000400003C000C00001E000800001E001000001E00100
-0001E002000001E002000000F004000000F004000000F008000000F008000000F0100000007810
-00000078200000007860000000784000000078800000003C800000003D000000003D000000003E
-000000003E000000001C000000001C0000000018000000001800000023237AA125>I<FFF81FFF
-03FF80FFF81FFE03FF800F8003E00078000F8001E0003000078001E0002000078001E000200007
-8001E0004000078003F0004000078002F0008000078004F000800007C004F001000003C008F001
-000003C008F002000003C010F002000003C010F804000003C0307804000003C0207808000001E0
-207808000001E0407810000001E0407810000001E0807830000001E0803C20000001E1003C2000
-0001E1003C40000000F2003C40000000F2003C80000000F4003C80000000F4003D00000000F800
-1F00000000F8001E00000000F0001E0000000070001C0000000060001C00000000600018000000
-0040001800000031237AA133>I<03FFF03FF803FFE03FF8001F800F80000F000600000F000C00
-000780080000078010000007C020000003C040000003E0C0000001E080000001F100000000F200
-000000FC0000000078000000007C000000003C000000003E000000005E000000009F000000018F
-000000030F800000020780000004078000000803C000001003C000003003E000002001E0000040
-01F000008000F000018000F80007C000F800FFF007FFC0FFF007FFC025227FA125>I<FFF8007F
-E0FFF8007FE007C0001E0007C000180003C000100003C000200003E000200001E000400001F000
-800000F001000000F801000000780200000078040000007C080000003C180000003E100000001E
-200000001F400000001FC00000000F800000000F000000000F000000000F000000000F00000000
-0E000000001E000000001E000000001E000000001E000000001E000000001C000000003E000000
-07FFE0000007FFE0000023227AA125>I<0100038007C00CC018603030601080080D0876A219>
-94 D<03FC000E07001F01801F01C01E00C00C00E00001C00001C0003FC003E1C00F01C01E01C0
-380380780380F00384F00384F00784F00784F00B887833D01FC1E016157D9419>97
-D<0780003F80003F00000700000700000700000700000700000E00000E00000E00000E00000E00
-000E00001C3F001CC1C01D00601E00701C00381C003838003C38003C38003C38003C38003C3800
-3C7000787000787000707000F07000E06801C0E80380C60E0081F80016237BA21C>I<00FF0003
-83800607C00C07C01C0780380300780000700000F00000F00000F00000F00000F00000E00000F0
-0000F000807001007001003806001C180007E00012157C9416>I<00000F00007F00007E00000E
-00000E00000E00000E00000E00001C00001C00001C00001C00001C00001C007E3803C1380700B8
-0E00781C0038380038780070700070F00070F00070F00070F00070E000E0E000E0E000E0F000E0
-7001E07003E03805E01C19FC07E1FC18237CA21C>I<007E000383800701C00C00E01C00E03800
-E07800E07000E0FFFFE0F00000F00000F00000F00000E00000E00000F000407000803000801803
-000E0C0003F00013157D9416>I<0001E0000630001C780018F80038F800707000700000700000
-E00000E00000E00000E00000E00000E0003FFE003FFE0001C00001C00001C00001C00003800003
-80000380000380000380000380000700000700000700000700000700000700000F0000FFF000FF
-F00015237FA20F>I<00000380001F8CC00070D1C000E0E1C001C0700003C0700003C070000780
-F0000780F0000780F0000780E0000381E0000181C00002C30000027E0000040000000400000004
-0000000600000007FFC00007FFF00007FFF8001C007C0030000C0060000C0060000C00C0000C00
-C0000C004000180060003000300060000C03800003FE00001A21809519>I<0078000003F80000
-03F00000007000000070000000700000007000000070000000E0000000E0000000E0000000E000
-0000E0000000E0000001C1F80001C60C0001D80E0001E0070001E0070001C0070003C00E000380
-0E0003800E0003800E0003800E0003800E0007001C0007001C0007001C0007001C0007001C0007
-001C000F003C00FFE3FF80FFE3FF8019237FA21C>I<007000F001F000F000E000000000000000
-00000000000000000001C00FC01FC003C001C001C0038003800380038003800380070007000700
-0700070007000F00FFE0FFE00C227FA10E>I<0078000003F8000003F000000070000000700000
-00700000007000000070000000E0000000E0000000E0000000E0000000E0000000E0000001C07F
-C001C07FC001C03C0001C0300001C0400001C080000383000003840000038E000003BE000003CF
-00000387000007078000070380000701C0000701C0000700E0000700F0000F00F800FFE3FF00FF
-E3FE001A237FA21A>107 D<007803F803F00070007000700070007000E000E000E000E000E000
-E001C001C001C001C001C001C00380038003800380038003800700070007000700070007000F00
-FFE0FFE00D237FA20E>I<01C1F807E01FC60C18301FD80E603803E007801C01E007801C01C007
-001C03C00F003803800E003803800E003803800E003803800E003803800E003807001C00700700
-1C007007001C007007001C007007001C007007001C00700F003C00F0FFE3FF8FFEFFE3FF8FFE27
-157F942A>I<01C1F8001FC60C001FD80E0003E0070001E0070001C0070003C00E0003800E0003
-800E0003800E0003800E0003800E0007001C0007001C0007001C0007001C0007001C0007001C00
-0F003C00FFE3FF80FFE3FF8019157F941C>I<007F0001C1C00700E00E00701C00383800387800
-3C70003CF0003CF0003CF0003CF0003CE00078E00078E00070F000F07000E07001C03803800E0E
-0003F00016157D9419>I<00E1F8000FE60E000FE8070000F0038000E003C000E001C001C001E0
-01C001E001C001E001C001E001C001E001C001E0038003C0038003C0038007800380078003800F
-0003C00E0007403C0007307000070FC0000700000007000000070000000E0000000E0000000E00
-00000E0000000E000000FFC00000FFC000001B1F80941C>I<00FC100382100701300E00F01C00
-F03800F07800E07800E0F000E0F000E0F000E0F000E0F001C0F001C0F001C0F001C07003C07005
-C0380B801C338007C380000380000380000380000700000700000700000700000700007FE0007F
-E0141F7C941A>I<01C3E01FC4701FD8F003D0F001E06001C00003C00003800003800003800003
-80000380000700000700000700000700000700000700000F0000FFF000FFF00014157F9414>I<
-01FC800603800C01801801801801801800801801001E00001FE0000FFC0003FE00007E00000700
-400700400300400300600200600600F00400C8180087E00011157E9414>I<0080008000800180
-010001000300030007000F001FF8FFF80E000E000E000E001C001C001C001C001C001C00381038
-10381038103810382038201C4007800D1F7C9E13>I<0E0038FE03F8FE03F81E00780E00380E00
-381C00701C00701C00701C00701C00701C00703800E03800E03800E03800E03801E03802E01805
-E01C19FC07E1FC16157C941C>I<FFCFFC3FC0FFCFF87F801E01E01E000E00C008000E00C00800
-0E01E010000E03E010000E02E02000070660200007046040000708704000070870800007107180
-00079031000003A033000003A03A000003C03C000003C03C000003801800000180180000010010
-000022157C9424>119 D<1FF83FC01FF87FC001E03C0000E0100000E020000070400000388000
-00390000001E0000001C0000000E0000001F0000003700000063800000C380000181C0000101C0
-000600E0001E00F000FF03FF00FF03FF001A157F941A>I<0FFC0FE00FFC0FE000E0078000E002
-0000E0040000E00400007008000070080000701000007030000038200000384000003840000038
-8000003C8000001D0000001D0000001E0000001C0000000C000000080000000800000010000000
-1000000020000078400000F8400000F8800000F1000000420000003C0000001B1F80941A>I<FF
-FFFF18017E8C19>123 D<0E011F03318440F88070100577A019>126 D E
-/Fj 27 123 df<70F8FCFC7404040404080810102040060F7A8410>44 D<0003F802001FFF0600
-7E038601F000CE03E0003E0780001E0F00001E1F00000E1E0000063E0000063C0000067C000002
-7C00000278000002F8000000F8000000F8000000F8000000F8000000F8000000F8000000F80000
-00780000007C0000027C0000023C0000023E0000021E0000041F0000040F0000080780001803E0
-003001F00060007E03C0001FFF000003FC001F247CA227>67 D<FFFFFFE0FFFFFFE0078003E007
-8000E0078000600780002007800030078000300780001007800010078020100780201007802000
-07802000078060000780E00007FFE00007FFE0000780E000078060000780200007802000078020
-00078020000780000007800000078000000780000007800000078000000780000007800000FFFE
-0000FFFE00001C227CA123>70 D<FFFC1FFF80FFFC1FFF80078000F000078000F000078000F000
-078000F000078000F000078000F000078000F000078000F000078000F000078000F000078000F0
-00078000F000078000F00007FFFFF00007FFFFF000078000F000078000F000078000F000078000
-F000078000F000078000F000078000F000078000F000078000F000078000F000078000F0000780
-00F000078000F000078000F000078000F000FFFC1FFF80FFFC1FFF8021227CA129>72
-D<FFFCFFFC07800780078007800780078007800780078007800780078007800780078007800780
-0780078007800780078007800780078007800780078007800780FFFCFFFC0E227DA114>I<FFFE
-0000FFFE0000078000000780000007800000078000000780000007800000078000000780000007
-800000078000000780000007800000078000000780000007800000078000000780000007800000
-0780000007800020078000200780002007800020078000600780006007800040078000C0078001
-C0078003C007800FC0FFFFFFC0FFFFFFC01B227CA122>76 D<FFFFE00000FFFFFC000007801F00
-000780078000078003C000078003E000078001E000078001F000078001F000078001F000078001
-F000078001E000078003E000078003C000078007000007803E000007FFF0000007807800000780
-1C000007800E000007800F00000780070000078007800007800780000780078000078007800007
-8007C000078007C000078007C000078007C020078003E020078003E020FFFC01E040FFFC00F080
-0000003F0023237CA128>82 D<FFF80FFF807FE0FFF80FFF807FE00F8000F8000F000F80007800
-0600078000780004000780007C00040007C000BC000C0003C000BC00080003C000BE00080003E0
-011E00080001E0011E00100001E0011E00100001E0020F00100000F0020F00200000F0020F0020
-0000F00407802000007804078040000078040780400000780803C04000003C0803C08000003C08
-03C08000003C1001E08000001E1001E10000001E1001E10000001E2000F10000000F2000F20000
-000F2000F20000000F40007A00000007C0007C00000007C0007C0000000780003C000000038000
-38000000038000380000000300001800000001000010000033237EA137>87
-D<00040000000E0000000E0000000E0000001F0000001F0000003F800000278000002780000043
-C0000043C0000043C0000081E0000081E0000101F0000100F0000100F00003FFF8000200780006
-007C0004003C0004003C000C001E000C001E003C003F00FF00FFE01B1A7F991F>97
-D<FFFF800F00E00F00700F00380F003C0F003C0F003C0F003C0F003C0F00780F00700F01E00FFF
-C00F00F00F00380F003C0F001C0F001E0F001E0F001E0F001E0F001C0F003C0F00780F00F0FFFF
-C0171A7E991D>I<003F0201C0C603002E0E001E1C000E1C0006380006780002700002700002F0
-0000F00000F00000F00000F00000F000007000027000027800023800041C00041C00080E000803
-003001C0C0003F00171A7E991D>I<FFFF80000F01E0000F0070000F0038000F001C000F000E00
-0F000E000F0007000F0007000F0007800F0007800F0007800F0007800F0007800F0007800F0007
-800F0007800F0007000F0007000F000F000F000E000F001C000F0038000F0070000F01E000FFFF
-8000191A7E991F>I<FFFFF80F00380F00180F00080F000C0F00040F00040F00040F02000F0200
-0F02000F06000FFE000F06000F02000F02000F02000F00020F00020F00020F00060F00040F0004
-0F000C0F003CFFFFFC171A7E991C>I<003F810001E063000380170006000F000C0007001C0003
-0038000300780001007800010070000100F0000000F0000000F0000000F0000000F0000000F001
-FFE070001F0078000F0078000F0038000F001C000F000C000F0006000F000380170001E0630000
-3F81001B1A7E9920>103 D<FFE3FF800F0078000F0078000F0078000F0078000F0078000F0078
-000F0078000F0078000F0078000F0078000F0078000FFFF8000F0078000F0078000F0078000F00
-78000F0078000F0078000F0078000F0078000F0078000F0078000F0078000F007800FFE3FF8019
-1A7E991F>I<FFF00F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F
-000F000F000F000F000F000F000F000F00FFF00C1A7F990F>I<FFF0000F80000F00000F00000F
-00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F
-00100F00100F00100F00300F00200F00600F00600F01E0FFFFE0141A7E991A>108
-D<FF0003FE0F0003E00F0003E00B8005E00B8005E00B8005E009C009E009C009E009C009E008E0
-11E008E011E008E011E0087021E0087021E0083841E0083841E0083841E0081C81E0081C81E008
-1C81E0080F01E0080F01E0080F01E0080601E01C0601E0FF861FFE1F1A7E9925>I<FF00FF800F
-801C000F8008000BC0080009E0080009E0080008F0080008F8080008780800083C0800083C0800
-081E0800080F0800080F0800080788000803C8000803C8000801E8000800F8000800F800080078
-000800780008003800080018001C001800FF800800191A7E991F>I<007F800001C0E000070038
-000E001C001C000E003C000F0038000700780007807000038070000380F00003C0F00003C0F000
-03C0F00003C0F00003C0F00003C0F00003C07800078078000780380007003C000F001C000E000E
-001C000700380001C0E000007F80001A1A7E9920>I<007F800001C0E000070038000E001C001C
-000E003C000F0038000700780007807800078070000380F00003C0F00003C0F00003C0F00003C0
-F00003C0F00003C0F00003C07000038078000780380007003C1E0F001C310E000E209C000720B8
-0001E0E000007FC0400000404000006040000070C000007F8000003F8000003F0000001E001A21
-7E9920>113 D<FFFE00000F03C0000F00E0000F00F0000F0078000F0078000F0078000F007800
-0F0078000F00F0000F00E0000F03C0000FFE00000F0380000F01E0000F00E0000F00F0000F00F0
-000F00F0000F00F0000F00F0000F00F0000F00F0400F0070400F003880FFF01F001A1A7E991E>
-I<07E100181B00300700600300600300E00100E00100E00100F00000F800007F80003FF8001FFC
-000FFE0000FF00000F00000780000780800380800380800380C00300C00700E00600DC0C0083F0
-00111A7E9917>I<7FFFFF00701E0700601E0100401E0100C01E0180801E0080801E0080801E00
-80001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E
-0000001E0000001E0000001E0000001E0000001E0000001E0000003F000003FFF000191A7F991D
->I<FFF0FF800F001C000F0008000F0008000F0008000F0008000F0008000F0008000F0008000F
-0008000F0008000F0008000F0008000F0008000F0008000F0008000F0008000F0008000F000800
-0F00080007001000078010000380200001C0600000E08000003F0000191A7E991F>I<FFC00FF0
-1F0007801F0003000F8002000780040007C0040003E0080001E0080001F0100000F83000007820
-00007C4000003E4000001E8000001F8000000F0000000F0000000F0000000F0000000F0000000F
-0000000F0000000F0000000F0000000F000000FFE0001C1A7F991F>121
-D<7FFFE07803C07003C0600780400780400F00401E00401E00003C00003C0000780000F00000F0
-0001E00001E00003C0000780200780200F00200F00201E00603C00403C00C07801C07803C0FFFF
-C0131A7E9919>I E /Fk 19 121 df<FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
-FFFFFFFFFFFFFFFFFFFFFFFFFF000007F00000000007F00000000007F00000000007F000000000
-07F00000000007F00000000007F00000000007F00000000007F00000000007F00000000007F000
-00000007F00000000007F00000000007F00000000007F00000000007F00000000007F000000000
-07F00000000007F00000000007F00000000007F00000000007F00000000007F00000000007F000
-00000007F00000000007F00000000007F00000000007F00000000007F00000000007F000000000
-07F00000000007F00000000007F00000000007F00000000007F00000000007F00000000007F000
-00000007F00000000007F00000000007F00000000007F00000000007F00000000007F000000000
-07F00000000007F00000000007F00000000007F00000000007F00000000007F00000000007F000
-00000007F00000000007F00000000007F00000000007F00000303C7DBB37>84
-D<003FF00001FFFC0007FFFF001FFFFF801FFFFFC01FC01FE01E000FE0180007F0100007F00000
-03F8000003F8000003F8000003F8000003F8000003F8000003F80007FFF8007FFFF801FFFFF807
-FFFFF81FFF03F83FF003F87FC003F87F0003F8FF0003F8FE0003F8FE0003F8FE0003F8FE0003F8
-FF0007F87F800FF87FE07FF83FFFFFF83FFFFFF81FFFFBF807FFE3F803FE03F81D257DA427>97
-D<0007FE00003FFFC000FFFFF001FFFFF803FFFFF807FC03F80FF000701FE000301FC000003F80
-00003F8000007F0000007F0000007F000000FE000000FE000000FE000000FE000000FE000000FE
-000000FE000000FE000000FE0000007F0000007F0000007F0000003F8000003F8000001FC00004
-1FE0001C0FF0007C07FC03FC03FFFFFC01FFFFFC00FFFFF0003FFFC00007FC001E257DA424>99
-D<0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000
-007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F00
-00007F0000007F0000007F0000007F001FE07F007FF87F01FFFE7F03FFFFFF07FFFFFF0FFE07FF
-0FF001FF1FE000FF3FC0007F3F80007F7F80007F7F00007F7F00007F7F00007FFE00007FFE0000
-7FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007F7F00007F7F00007F7F00
-007F7F80007F3F80007F3FC000FF1FE001FF1FF003FF0FFC0FFF07FFFFFF03FFFF7F01FFFC7F00
-7FF87F001FC07F203C7DBB2A>I<0007F800003FFE0000FFFF8001FFFFC003FFFFE007FC1FF00F
-F007F01FE003F81FC001F83F8000FC3F8000FC7F0000FC7F00007E7FFFFFFEFFFFFFFEFFFFFFFE
-FFFFFFFEFFFFFFFEFE000000FE000000FE000000FE000000FE0000007E0000007F0000007F0000
-003F8000003F8000001FC000041FE0001C0FF8007C07FE03FC03FFFFFC01FFFFF8007FFFE0001F
-FF800003FC001F257EA424>I<0000FFC00003FFC00007FFC0001FFFC0003FFFC0003F8040007F
-000000FE000000FC000000FC000001FC000001FC000001FC000001FC000001FC000001FC000001
-FC000001FC000001FC000001FC000001FC000001FC000001FC0000FFFFFC00FFFFFC00FFFFFC00
-FFFFFC00FFFFFC0001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC00
-0001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC
-000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001
-FC000001FC000001FC000001FC000001FC00001A3C7FBB19>I<001FE007E0007FF83FE001FFFF
-FFF003FFFFFFF007FFFFFFF00FF87FE0000FE01FC0001FC00FE0001FC00FE0003F8007F0003F80
-07F0003F8007F0003F8007F0003F8007F0003F8007F0003F8007F0001F8007E0001FC00FE0001F
-C00FE0000FE01FC0000FF87FC00007FFFF80000FFFFF00001FFFFE00001E7FF800001E1FE00000
-3E000000003E000000003E000000003F000000001F800000001FFFFF00001FFFFFF0000FFFFFFC
-000FFFFFFE000FFFFFFF001FFFFFFF803FFFFFFFC03F8000FFC07E00001FC07E00000FE0FC0000
-07E0FC000007E0FC000007E0FC000007E0FC000007E07E00000FC07F00001FC03FC0007F801FF8
-03FF000FFFFFFE0007FFFFFC0001FFFFF000007FFFC000000FFE000024377EA428>I<FE000000
-FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE0000
-00FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00
-0000FE000000FE000000FE03FC00FE0FFF00FE3FFFC0FE7FFFE0FEFFFFE0FFF01FF0FFE00FF0FF
-C007F8FF8007F8FF0003F8FF0003F8FF0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8
-FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003
-F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE00
-03F81D3C7ABB2A>I<FEFEFEFEFEFEFE0000000000000000000000000000FEFEFEFEFEFEFEFEFE
-FEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFE073A7AB914>I<FEFEFEFE
-FEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFE
-FEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFEFE073C7ABB14>108 D<FE03FC000FF000FE0FFF003FFC
-00FE3FFFC0FFFF00FE7FFFE1FFFF80FEFFFFE3FFFF80FFF01FF7C07FC0FFE00FFF803FC0FFC007
-FF001FE0FF8007FE001FE0FF0003FC000FE0FF0003FC000FE0FF0003FC000FE0FE0003F8000FE0
-FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8
-000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE
-0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F800
-0FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE0003F8000FE0FE00
-03F8000FE0FE0003F8000FE033257AA440>I<FE03FC00FE0FFF00FE3FFFC0FE7FFFE0FEFFFFE0
-FFF01FF0FFE00FF0FFC007F8FF8007F8FF0003F8FF0003F8FF0003F8FE0003F8FE0003F8FE0003
-F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE00
-03F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE
-0003F8FE0003F8FE0003F81D257AA42A>I<0007FC0000001FFF0000007FFFC00001FFFFF00003
-FFFFF80007FC07FC000FF001FE001FE000FF001FC0007F003F80003F803F80003F807F00001FC0
-7F00001FC07E00000FC0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000F
-E0FE00000FE0FE00000FE0FE00000FE07F00001FC07F00001FC07F00001FC03F80003F803F8000
-3F801FC0007F001FE000FF000FF001FE0007FE0FFC0003FFFFF80001FFFFF000007FFFC000001F
-FF00000007FC000023257EA428>I<FE03FC00FE1FFF00FE7FFF80FEFFFFC0FFFFFFE0FFF03FF0
-FFC00FF8FF0007F8FE0003FCFE0001FCFE0001FEFE0000FEFE0000FEFE0000FFFE00007FFE0000
-7FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE0000FEFE0000FEFE00
-01FEFE0001FCFE0003FCFF0003FCFF0007F8FF801FF0FFE07FE0FFFFFFC0FEFFFF80FE7FFF00FE
-1FFE00FE07F000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000
-FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00000020367A
-A42A>I<FE00F0FE07F0FE1FF0FE3FF0FE7FF0FEFFF0FFFF00FFF800FFF000FFE000FFC000FF80
-00FF8000FF0000FF0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00
-00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00001425
-7AA41C>114 D<007FC00003FFFC0007FFFF000FFFFF801FFFFF803F803F803F000F007E000300
-7E0000007E0000007E0000007E0000007F0000007FC000003FFC00003FFFC0001FFFF0000FFFFC
-0007FFFE0001FFFF00007FFF000007FF8000007F8000001FC000001FC000000FC000000FC04000
-0FC060000FC078001F80FC001F80FF807F80FFFFFF007FFFFE001FFFFC0007FFF000007FC0001A
-257EA41F>I<01FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001
-FC000001FC000001FC0000FFFFFE00FFFFFE00FFFFFE00FFFFFE00FFFFFE0001FC000001FC0000
-01FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC00
-0001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC000001FC
-000001FC000001FC000001FC010001FE030001FE0F8000FFFF8000FFFF80007FFE00003FF80000
-1FC00019307FAF1D>I<FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE
-0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8
-FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003F8FE0003
-F8FE0007F8FE0007F8FE000FF8FF001FF8FF807FF87FFFFFF87FFFFBF83FFFE3F81FFF83F807FC
-03F81D257AA42A>I<7F80003FC03FC0003FC03FC0007F801FE000FF000FF001FE0007F801FC00
-03F803FC0003FC07F80001FE07F00000FF0FE000007F1FE000003FBFC000003FFF8000001FFF00
-00000FFF00000007FE00000007FC00000003F800000003F800000007FC00000007FE0000000FFF
-0000001FFF8000003F9F8000003F1FC000007F0FE00000FE07F00001FC07F80003FC03F80003F8
-01FC0007F001FE000FF000FF001FE0007F001FC0003F803FC0003FC07F80001FE0FF00000FF024
-2580A425>120 D E end
-%%EndProlog
-%%BeginSetup
-%%Feature: *Resolution 300
-TeXDict begin @letter /letter where {pop letter} if
-%%EndSetup
-%%Page: 1 1
-bop -5 173 a Fk(The)27 b(design)f(and)g(implementation)e(of)-5
-255 y(a)j(language)f(fo)n(r)h(extending)e(applications)-5 370
-y Fj(Luiz)18 b(Henrique)e(de)i(Figueiredo,)f(R)o(ober)m(to)f(Ier)o
-(usalimschy,)g(W)-6 b(aldemar)17 b(Celes)g(Filho)-5 454 y Fi(T)l(eCGraf{Grup)
-q(o)f(de)g(T)l(ecnologia)g(em)g(Computa\030)-22 b(c~)d(ao)16
-b(Gr\023)-25 b(a\014ca,)15 b(ITS,)h(PUC-Rio)-5 514 y(Pr)o(\023)-24
-b(edio)16 b(do)g(ITS,)g(Rua)g(Marqu)o(^)-24 b(es)15 b(de)i(S~)-25
-b(ao)16 b(Vicen)o(te)h(225,)f(22453-900)f(Rio)h(de)h(Janeiro,)e(RJ,)h(Brasil)
--5 574 y Fh({lhf,roberto,celes}@ic)q(ad.puc)q(-rio.br)-5 779
-y Fg(Abstract.)26 b Ff(W)l(e)16 b(describ)q(e)g(the)h(design)e(and)h(the)h
-(implemen)o(tation)d(of)j Fe(Lua)p Ff(,)f(a)g(simple,)f(y)o(et)i(p)q(o)o(w)o
-(erful,)-5 839 y(language)i(for)g(extending)g(applications.)29
-b(Although)19 b Fe(Lua)g Ff(is)g(a)h(pro)q(cedural)d(language,)i(it)h(has)f
-(data)-5 899 y(description)11 b(facilities,)h(and)g(has)f(b)q(een)h(extensiv)
-o(ely)g(used)f(in)h(pro)q(duction)f(for)g(sev)o(eral)h(tasks)f(including)-5
-959 y(user)i(con\014guration,)g(general-purp)q(ose)e(data-en)o(try)l(,)i
-(description)g(of)h(user)f(in)o(terfaces,)g(description)g(of)-5
-1019 y(application)j(ob)s(jects,)g(and)g(storage)g(of)h(structured)e
-(graphical)g(meta\014les.)-5 1133 y Fg(Resumo.)26 b Ff(Descrev)o(emos)11
-b(o)g(pro)s(jeto)h(e)f(a)h(implemen)o(ta\030)-22 b(c~)d(ao)10
-b(de)i Fe(Lua)p Ff(,)g(uma)f(linguagem)f(simples,)h(p)q(or)o(\023)-24
-b(em)-5 1193 y(p)q(o)q(derosa,)17 b(para)f(extens~)-25 b(ao)18
-b(de)f(aplica\030)-22 b(c~)d(oes.)24 b(Em)o(b)q(ora)16 b(pro)q(cedural,)f
-Fe(Lua)j Ff(con)o(t)o(\023)-24 b(em)16 b(mecanismos)g(para)-5
-1253 y(descri\030)-22 b(c~)d(ao)20 b(de)g(dados)f(e)i(tem)g(sido)e(largamen)o
-(te)g(utilizada)h(em)g(pro)q(du\030)-22 b(c~)d(ao)19 b(para)h
-(con\014gura\030)-22 b(c~)d(ao)19 b(p)q(elo)-5 1313 y(usu\023)-25
-b(ario,)24 b(en)o(trada)e(de)i(dados,)g(descri\030)-22 b(c~)d(ao)23
-b(de)h(in)o(terfaces,)g(descri\030)-22 b(c~)d(ao)23 b(de)h(ob)s(jetos)f(da)h
-(aplica\030)-22 b(c~)d(ao)23 b(e)-5 1373 y(armazenagem)15 b(de)i
-Fd(meta\014les)f Ff(gr\023)-25 b(a\014cos)15 b(estruturados.)-5
-1553 y Fg(Intro)r(duction)-5 1638 y Ff(There)k(is)h(increasing)e(demand)g
-(for)i(customizable)e(applications.)30 b(As)20 b(applications)e(b)q(ecame)i
-(more)-5 1698 y(complex,)k(customization)e(with)g(simple)g(parameters)f(b)q
-(ecame)i(imp)q(ossible:)32 b(users)22 b(no)o(w)f(w)o(an)o(t)h(to)-5
-1758 y(mak)o(e)14 b(con\014guration)e(decisions)g(at)i(execution)g(time;)h
-(users)d(also)h(w)o(an)o(t)g(to)i(write)e(macros)g(and)g(scripts)-5
-1817 y(to)18 b(increase)d(pro)q(ductivit)o(y)i(\(Ry)o(an)f(1990\).)24
-b(Therefore,)16 b(no)o(w)o(ada)o(ys,)e(larger)i(applications)f(almost)i(in-)
--5 1877 y(v)m(ariably)j(carry)g(their)h(o)o(wn)f(con\014guration)e(or)i
-(scripting)g(languages)f(for)h(end-user)f(programming.)-5 1937
-y(These)g(languages)f(are)h(usually)f(simple,)g(but)h(eac)o(h)g(has)f(its)h
-(o)o(wn)g(particular)f(syn)o(tax.)29 b(As)19 b(a)h(conse-)-5
-1997 y(quence,)e(users)f(ha)o(v)o(e)g(to)h(learn)f(\(and)h(dev)o(elop)q(ers)f
-(ha)o(v)o(e)g(to)h(design,)f(implemen)o(t)g(and)g(debug\))g(a)h(new)-5
-2056 y(language)e(for)g(eac)o(h)g(application.)-5 2141 y(Our)c(\014rst)g(exp)
-q(erience)h(with)g(a)g(proprietary)e(scripting)g(language)h(arose)g(in)g(a)h
-(data-en)o(try)f(application,)-5 2201 y(for)23 b(whic)o(h)f(a)h(v)o(ery)g
-(simple)f(declarativ)o(e)h(language)f(w)o(as)g(designed)g
-(\(Figueiredo{Souza{Gattass{)-5 2261 y(Co)q(elho)h(1992\).)41
-b(\(Data-en)o(try)23 b(is)f(an)h(area)f(where)h(user)f(de\014ned)g(actions)g
-(are)g(esp)q(ecially)h(needed)-5 2320 y(b)q(ecause)13 b(pre-co)q(ded)e(v)m
-(alidation)i(tests)g(can)f(hardly)g(b)q(e)h(adequate)f(for)h(all)f
-(applications.\))20 b(When)12 b(users)-5 2380 y(b)q(egan)i(to)g(demand)f
-(increasingly)f(more)h(p)q(o)o(w)o(er)g(in)g(this)g(language,)h(w)o(e)f
-(decided)h(that)g(a)g(more)f(general)-5 2440 y(approac)o(h)i(w)o(as)h(needed)
-h(and)f(started)g(the)h(design)f(of)h(a)g(general-purp)q(ose)d(em)o(b)q
-(edded)i(language.)21 b(A)o(t)-5 2500 y(the)16 b(same)f(time,)g(another)g
-(declarativ)o(e)g(language)f(w)o(as)h(b)q(eing)g(added)g(to)h(a)f(di\013eren)
-o(t)g(application)f(for)-5 2560 y(data)h(description.)k(Therefore,)14
-b(w)o(e)h(decided)e(to)i(merge)f(the)h(t)o(w)o(o)f(languages)f(in)o(to)h
-(one,)g(and)g(designed)-5 2619 y Fe(Lua)19 b Ff(to)g(b)q(e)g(a)g(pro)q
-(cedural)f(language)g(with)h(data)f(description)g(facilities.)29
-b Fe(Lua)18 b Ff(has)h(since)f(outgro)o(wn)-5 2679 y(its)f(original)e(ro)q
-(ots)h(and)g(is)g(b)q(eing)g(used)g(in)g(sev)o(eral)g(other)g(industrial)f
-(pro)s(jects.)-5 2764 y(This)h(pap)q(er)g(describ)q(es)f(the)i(design)f
-(decisions)f(and)h(the)g(details)g(of)h(our)f(implemen)o(tation)e(of)j
-Fe(Lua)p Ff(.)-5 2883 y Fc(T)l(eCGraf/ICAD)1674 b(1)p eop
-%%Page: 2 2
-bop -5 163 a Fg(Extension)20 b(languages)-5 248 y Ff(The)d(use)g(of)g
-(languages)f(for)g(extending)h(applications)f(is)g(no)o(w)h(recognized)f(as)g
-(an)h(imp)q(ortan)o(t)f(design)-5 308 y(tec)o(hnique:)k(it)13
-b(allo)o(ws)f(a)h(cleaner)f(design)g(for)h(the)g(application)f(and)g(it)h
-(pro)o(vides)f(con\014guration)f(b)o(y)i(the)-5 367 y(user.)26
-b(Because)18 b(most)f(extension)h(languages)f(are)g(simple,)g(sp)q(ecialized)
-h(to)g(a)g(task,)h(they)f(ha)o(v)o(e)g(b)q(een)-5 427 y(called)d(\\little)h
-(languages")d(\(Ben)o(tley)j(1986;)f(V)l(ald)o(\023)-24 b(es)15
-b(1991\),)g(in)g(con)o(trast)f(to)i(the)f(\\big",)g(mainstream)-5
-487 y(languages,)k(in)h(whic)o(h)e(applications)h(are)g(written.)32
-b(This)19 b(distinction)f(is)i(not)f(so)h(sharp)e(no)o(w)o(ada)o(ys,)-5
-547 y(since)f(a)g(ma)s(jor)f(part)g(of)h(sev)o(eral)g(applications)e(is)i
-(actually)g(written)g(using)f(an)g(extension)h(language.)-5
-607 y(Extension)f(languages)g(come)g(in)g(sev)o(eral)g(\015a)o(v)o(ors:)-5
-741 y Fb(\017)25 b Fi(con\014guration)d(languages)r Ff(:)34
-b(for)23 b(selecting)g(preferences,)g(usually)g(implemen)o(ted)e(as)i
-(parameter)45 801 y(lists)13 b(in)f(command)g(lines)g(or)g(as)h(v)m
-(ariable-v)m(alue)f(pairs)g(read)g(from)g(con\014guration)g(\014les)g
-(\(e.g.,)i(DOS's)45 861 y Fh(config.sys)p Ff(,)k(MS-Windo)o(ws')c
-Fh(.ini)j Ff(\014les,)f(X11)h(resource)e(\014les,)h(Motif)t('s)g(UIL)h
-(\014les\);)-5 930 y Fb(\017)25 b Fi(scripting)19 b(languages)r
-Ff(:)29 b(for)20 b(automating)f(tasks,)i(with)g(limited)e(\015o)o(w)h(con)o
-(trol,)g(suc)o(h)g(as)g(the)g(ones)45 990 y(used)c(in)g(DOS's)g(batc)o(h)f
-(\014les)h(or)g(in)h(the)f(v)m(arious)g(Unix)h(shells;)-5 1060
-y Fb(\017)25 b Fi(macro)15 b(languages)r Ff(:)21 b(also)15
-b(for)h(automating)g(tasks,)g(but)g(usually)f(only)h(as)f(a)i(sequence)f(of)g
-(primitiv)o(e)45 1120 y(op)q(erations,)f(with)i(no)f(\015o)o(w)g(con)o(trol;)
--5 1190 y Fb(\017)25 b Fi(em)o(b)q(edded)20 b(languages)r Ff(:)29
-b(for)21 b(extending)f(applications)f(with)i(user)f(de\014ned)g(functions)g
-(based)g(on)45 1249 y(primitiv)o(es)h(pro)o(vided)g(b)o(y)h(the)g
-(applications.)38 b(These)22 b(languages)f(are)h(usually)g(quite)g(p)q(o)o(w)
-o(erful,)45 1309 y(b)q(eing)16 b(simpli\014ed)f(v)m(arian)o(ts)g(of)i
-(mainstream)e(programming)e(languages)i(suc)o(h)h(as)g(LISP)g(and)g(C.)-5
-1459 y(What)21 b(mak)o(es)f(em)o(b)q(edded)f(languages)g(di\013eren)o(t)h
-(from)g(standalone)f(languages)g(is)h(that)h(em)o(b)q(edded)-5
-1518 y(languages)c(only)i(w)o(ork)e Fd(emb)m(e)m(dde)m(d)k
-Ff(in)d(a)h(host)f(clien)o(t,)g(called)g(the)h Fd(emb)m(e)m(dding)h
-Ff(program.)26 b(Moreo)o(v)o(er,)-5 1578 y(the)e(host)e(program)f(can)i
-(usually)f(pro)o(vide)g(domain-sp)q(eci\014c)f(extensions)h(to)i(the)f(em)o
-(b)q(edded)f(lan-)-5 1638 y(guage,)16 b(th)o(us)f(creating)h(a)g(v)o(ersion)f
-(of)i(the)f(em)o(b)q(edded)f(language)h(customized)f(for)h(its)g(o)o(wn)g
-(purp)q(oses,)-5 1698 y(p)q(ossibly)g(b)o(y)h(pro)o(viding)f(higher)g(lev)o
-(el)h(abstractions.)22 b(F)l(or)16 b(this,)h(an)g(em)o(b)q(edded)f(language)g
-(has)h(b)q(oth)-5 1758 y(a)h(syn)o(tax)f(for)h(its)f(o)o(wn)g(programs)e(and)
-i(an)h(application)e(program)g(in)o(terface)h(\(API\))i(for)e(in)o(terfacing)
--5 1817 y(with)i(hosts.)30 b(Th)o(us,)18 b(unlik)o(e)g(simpler)g(extension)h
-(languages,)f(whic)o(h)h(are)f(used)h(to)g(supply)f(parame-)-5
-1877 y(ter)i(v)m(alues)g(and)f(sequences)h(of)g(actions)f(to)i(hosts,)f
-(there)f(is)h(a)g(t)o(w)o(o-w)o(a)o(y)e(comm)o(unication)g(b)q(et)o(w)o(een)
--5 1937 y(em)o(b)q(edded)d(languages)f(and)i(host)f(programs.)20
-b(Note)c(that)h(the)f(application)e(programmer)g(in)o(terfaces)-5
-1997 y(with)j(an)g(em)o(b)q(edded)f(language)g(in)h(the)g(mainstream)f
-(language)g(used)g(for)h(host)g(programs,)e(whereas)-5 2056
-y(the)i(user)f(in)o(terfaces)f(with)i(the)g(application)e(using)g(solely)i
-(the)f(em)o(b)q(edded)g(language.)-5 2141 y(LISP)e(has)f(alw)o(a)o(ys)f(b)q
-(een)i(a)g(p)q(opular)e(c)o(hoice)h(for)h(extension)f(languages,)g(for)g(its)
-h(simple,)f(easily)g(parsed)-5 2201 y(syn)o(tax)j(and)g(built-in)f
-(extensibilit)o(y)h(\(Bec)o(kman)g(1991;)g(Nahab)q(o)q(o\).)22
-b(F)l(or)16 b(instance,)f(a)i(ma)s(jor)e(part)h(of)-5 2261
-y(Emacs)h(is)g(actually)g(written)h(in)f(its)g(o)o(wn)g(v)m(arian)o(t)g(of)h
-(LISP;)f(sev)o(eral)f(other)h(text)i(editors)e(follo)o(w)g(the)-5
-2320 y(same)e(path.)22 b(Ho)o(w)o(ev)o(er,)15 b(LISP)h(cannot)f(b)q(e)h
-(called)g(user-friendly)e(when)h(it)h(comes)g(to)g(customization.)-5
-2380 y(Neither)f(can)f(C)g(and)g(the)g(shell)g(languages;)f(the)i(latter)f
-(ev)o(en)h(ha)o(v)o(e)e(a)i(more)e(complicated,)h(unfamiliar)-5
-2440 y(syn)o(tax.)-5 2525 y(One)g(of)g(the)h(fundamen)o(tal)d(decisions)h
-(made)g(in)h(the)g(design)f(of)h Fe(Lua)g Ff(w)o(as)f(that)i(it)f(should)f
-(ha)o(v)o(e)g(a)h(clean)-5 2584 y(but)d(familiar)f(syn)o(tax:)20
-b(w)o(e)11 b(quic)o(kly)g(settled)h(for)f(a)g(simpli\014ed)f(P)o(ascal-lik)o
-(e)f(syn)o(tax.)20 b(W)l(e)12 b(a)o(v)o(oided)e(a)i(syn-)-5
-2644 y(tax)j(based)f(on)g(LISP)g(or)g(C)h(b)q(ecause)f(it)h(could)f(b)q(e)g
-(discouraging)f(to)h(outsiders)f(or)h(non-programmer)o(s.)-5
-2704 y(Th)o(us,)22 b Fe(Lua)f Ff(is)h(primarily)d(a)j(pro)q(cedural)e
-(language.)37 b(Nev)o(ertheless,)22 b(as)g(already)f(men)o(tioned,)g
-Fe(Lua)-5 2764 y Ff(acquired)16 b(data)h(description)e(facilities)h(to)h
-(increase)e(its)i(expression)e(p)q(o)o(w)o(er.)-5 2883 y Fc(T)l(eCGraf/ICAD)
-1674 b(2)p eop
-%%Page: 3 3
-bop -5 163 a Fg(Lua)19 b(concepts)-5 248 y Fe(Lua)c Ff(is)g(a)g(general)g
-(purp)q(ose)f(em)o(b)q(edded)g(programming)e(language)i(designed)h(to)g(supp)
-q(ort)f(pro)q(cedural)-5 308 y(programming)k(with)i(data)h(description)e
-(facilities.)34 b(Being)21 b(an)f(em)o(b)q(edded)f(language,)i
-Fe(Lua)f Ff(has)g(no)-5 367 y(notion)e(of)g(a)h(\\main")e(program;)g(it)h
-(only)g(w)o(orks)f(em)o(b)q(edded)g(in)h(a)h(host)e(clien)o(t)h(\()p
-Fe(Lua)h Ff(is)f(pro)o(vided)e(as)-5 427 y(a)i(library)e(of)i(C)f(functions)g
-(to)h(b)q(e)g(link)o(ed)f(to)h(host)f(applications\).)24 b(The)17
-b(host)h(can)f(in)o(v)o(ok)o(e)g(functions)-5 487 y(to)k(execute)h(a)f(piece)
-g(of)g(co)q(de)g(in)g Fe(Lua)p Ff(,)g(can)g(write)f(and)g(read)h
-Fe(Lua)f Ff(v)m(ariables,)h(and)f(can)h(register)f(C)-5 547
-y(functions)f(to)h(b)q(e)g(called)g(b)o(y)f Fe(Lua)g Ff(co)q(de.)32
-b(With)20 b(registered)f(C)h(functions,)f Fe(Lua)h Ff(can)f(b)q(e)h(augmen)o
-(ted)-5 607 y(to)h(cop)q(e)f(with)g(rather)g(di\013eren)o(t)f(domains,)g(th)o
-(us)g(creating)h(customized)f(programming)e(languages)-5 666
-y(sharing)e(a)i(syn)o(tactical)f(framew)o(ork)f(\(Bec)o(kman)i(1991\).)-5
-751 y(This)23 b(section)g(con)o(tains)f(a)h(brief)g(description)f(of)h(the)h
-(main)e(concepts)h(in)g Fe(Lua)p Ff(.)42 b(Some)23 b(examples)-5
-811 y(of)e(actual)f(co)q(de)g(are)g(included,)f(to)i(giv)o(e)f(a)g(\015a)o(v)
-o(or)f(of)h(the)h(language.)31 b(A)21 b(precise)e(de\014nition)g(of)i(the)-5
-871 y(language)16 b(can)g(b)q(e)h(found)f(in)g(its)g(reference)h(man)o(ual)d
-(\(Ierusalimsc)o(h)o(y{Figu)o(eiredo{Celes)f(1994\).)-5 990
-y Fe(Syntax)-5 1075 y Ff(As)g(men)o(tioned)d(b)q(efore,)j(w)o(e)f(explicitly)
-h(designed)e Fe(Lua)h Ff(to)g(ha)o(v)o(e)g(a)g(simple,)g(familiar)f(syn)o
-(tax.)20 b(As)12 b(a)g(con-)-5 1135 y(sequence,)17 b Fe(Lua)f
-Ff(supp)q(orts)g(an)g(almost)g(con)o(v)o(en)o(tional)f(set)i(of)g(statemen)o
-(ts,)f(with)h(implicit,)f(but)g(expli-)-5 1194 y(citly)g(terminated,)f(blo)q
-(c)o(k)h(structure.)21 b(The)15 b(con)o(v)o(en)o(tional)f(statemen)o(ts)h
-(include)g(simple)f(assignmen)o(t;)-5 1254 y(con)o(trol)f(structures)g(suc)o
-(h)g(as)h Fh(while-do-end)p Ff(,)i Fh(repeat-until)p Ff(,)g
-Fh(if-then-elseif-else-en)q(d)p Ff(;)h(and)-5 1314 y(function)22
-b(calls.)40 b(Non-con)o(v)o(en)o(tional)20 b(statemen)o(ts)i(include)g(m)o
-(ultiple)f(assignmen)o(t;)j(lo)q(cal)e(v)m(ariable)-5 1374
-y(declarations,)17 b(whic)o(h)g(can)h(b)q(e)g(placed)f(an)o(ywhere)g(inside)g
-(a)h(blo)q(c)o(k;)g(and)f(table)h(constructors,)f(whic)o(h)-5
-1434 y(ma)o(y)f(con)o(tain)g(user)f(de\014ned)h(v)m(alidation)g(functions)g
-(\(see)g(b)q(elo)o(w\).)22 b(Moreo)o(v)o(er,)15 b(functions)h(in)g
-Fe(Lua)g Ff(can)-5 1493 y(tak)o(e)j(a)g(v)m(ariable)f(n)o(um)o(b)q(er)e(of)j
-(parameters)e(and)h(can)g(return)g(man)o(y)f(v)m(alues.)28
-b(This)18 b(a)o(v)o(oids)f(the)i(need)-5 1553 y(for)e(passing)d(parameters)h
-(b)o(y)i(reference)f(when)g(more)f(than)i(one)f(result)g(need)g(to)h(b)q(e)g
-(returned.)-5 1673 y Fe(Environment)e(and)h(mo)q(dules)-5 1757
-y Ff(All)e(statemen)o(ts)e(in)h Fe(Lua)g Ff(are)g(executed)h(in)f(a)g(global)
-g(en)o(vironmen)o(t.)19 b(This)12 b(en)o(vironmen)o(t,)g(whic)o(h)g(k)o(eeps)
--5 1817 y(all)j(global)f(v)m(ariables)g(and)g(functions,)g(is)h(initialized)f
-(at)h(the)h(b)q(eginning)d(of)i(the)h(em)o(b)q(edding)d(program)-5
-1877 y(and)k(p)q(ersists)f(un)o(til)g(its)h(end.)23 b(The)17
-b(global)f(en)o(vironmen)o(t)f(can)i(b)q(e)g(manipulated)f(b)o(y)g
-Fe(Lua)h Ff(co)q(de)h(or)e(b)o(y)-5 1937 y(the)i(em)o(b)q(edding)e(program,)g
-(whic)o(h)g(can)i(read)e(and)h(write)h(global)f(v)m(ariables)f(using)h
-(functions)f(in)i(the)-5 1997 y(library)d(that)i(implemen)o(ts)e
-Fe(Lua)p Ff(.)-5 2081 y(The)20 b(unit)f(of)h(execution)g(of)g
-Fe(Lua)f Ff(is)h(called)f(a)h Fd(mo)m(dule)t Ff(.)31 b(A)20
-b(mo)q(dule)f(ma)o(y)g(con)o(tain)g(statemen)o(ts)g(and)-5
-2141 y(function)f(de\014nitions,)f(and)g(ma)o(y)h(b)q(e)g(in)g(a)g(\014le)g
-(or)f(in)h(a)g(string)f(inside)g(the)i(host)e(program.)25 b(When)18
-b(a)-5 2201 y(mo)q(dule)g(is)f(executed,)i(\014rst)f(all)f(its)h(functions)g
-(and)f(statemen)o(ts)h(are)g(compiled,)f(and)g(the)i(functions)-5
-2261 y(added)14 b(to)g(the)h(global)f(en)o(vironmen)o(t;)f(then)h(the)g
-(statemen)o(ts)g(are)g(executed)h(in)f(sequen)o(tial)g(order.)20
-b(All)-5 2320 y(mo)q(di\014cations)10 b(a)h(mo)q(dule)g(e\013ects)g(on)g(the)
-h(global)e(en)o(vironmen)o(t)f(p)q(ersist)i(after)g(its)g(end.)20
-b(Those)11 b(include)-5 2380 y(mo)q(di\014cations)17 b(to)h(global)f(v)m
-(ariables)g(and)g(de\014nitions)g(of)h(new)g(functions)f(\(a)h(function)f
-(de\014nition)g(is)-5 2440 y(actually)g(an)f(assignmen)o(t)f(to)h(a)h(global)
-f(v)m(ariable;)f(see)i(b)q(elo)o(w\).)-5 2560 y Fe(Data)g(t)o(yp)q(es)f(and)g
-(va)o(riables)-5 2644 y(Lua)22 b Ff(is)f(a)h(dynamically)f(t)o(yp)q(ed)h
-(language:)31 b(v)m(ariables)21 b(do)h(not)f(ha)o(v)o(e)h(t)o(yp)q(es;)i
-(only)e(v)m(alues)f(do.)38 b(All)-5 2704 y(v)m(alues)16 b(carry)g(their)g(o)o
-(wn)g(t)o(yp)q(e.)22 b(Therefore,)16 b(there)g(are)g(no)g(t)o(yp)q(e)h
-(de\014nitions)e(in)h(the)h(language.)k(The)-5 2764 y(absence)d(of)h(v)m
-(ariable)f(t)o(yp)q(e)g(declarations,)g(apparen)o(tly)f(a)h(minor)f(p)q(oin)o
-(t,)h(is)g(actually)h(an)f(imp)q(ortan)o(t)-5 2883 y Fc(T)l(eCGraf/ICAD)1674
-b(3)p eop
-%%Page: 4 4
-bop -5 163 a Ff(factor)20 b(in)f(simplifying)f(the)i(language;)g(it)g(is)f
-(frequen)o(tly)h(presen)o(ted)e(as)i(a)f(ma)s(jor)g(feature)g(in)h(man)o(y)-5
-223 y(v)m(arian)o(ts)14 b(of)g(t)o(yp)q(ed)h(languages)e(mo)q(di\014ed)h(to)h
-(b)q(e)f(used)g(as)g(extension)g(languages.)20 b(Moreo)o(v)o(er,)13
-b Fe(Lua)h Ff(has)-5 283 y(garbage)g(collection:)20 b(it)15
-b(k)o(eeps)f(trac)o(k)g(of)g(whic)o(h)g(v)m(alues)g(are)g(b)q(eing)g(used)f
-(and)h(discards)e(the)j(ones)e(that)-5 343 y(are)k(not.)23
-b(This)17 b(a)o(v)o(oids)e(the)j(need)e(for)h(explicit)g(managing)f(memory)g
-(allo)q(cation,)h(a)g(ma)s(jor)e(source)i(of)-5 402 y(programming)d(errors.)
-20 b(There)c(are)g(sev)o(en)g(basic)g(data)h(t)o(yp)q(es)f(in)g
-Fe(Lua)p Ff(:)-5 492 y Fb(\017)25 b Fi(nil)r Ff(:)c(the)c(t)o(yp)q(e)g(of)g
-(a)f(single)g(v)m(alue)h(called)f Fh(nil)p Ff(;)-5 552 y Fb(\017)25
-b Fi(n)o(um)o(b)q(er)t Ff(:)19 b(\015oating)d(p)q(oin)o(t)g(n)o(um)o(b)q
-(ers;)-5 612 y Fb(\017)25 b Fi(string)t Ff(:)c(arra)o(ys)15
-b(of)i(c)o(haracters;)-5 671 y Fb(\017)25 b Fi(function)p Ff(:)d(user)15
-b(de\014ned)h(functions;)-5 731 y Fb(\017)25 b Fi(Cfunction)p
-Ff(:)d(functions)15 b(pro)o(vided)g(b)o(y)h(the)h(host)f(program;)-5
-791 y Fb(\017)25 b Fi(userdata)p Ff(:)c(p)q(oin)o(ters)15 b(to)i(host)f
-(data;)-5 851 y Fb(\017)25 b Fi(table)s Ff(:)d(asso)q(ciativ)o(e)16
-b(arra)o(ys.)-5 966 y Fe(Lua)24 b Ff(pro)o(vides)f(some)g(automatic)h(t)o(yp)
-q(e)h(con)o(v)o(ersions.)42 b(A)25 b(string)e(taking)h(part)g(in)g(an)f
-(arithmetic)-5 1025 y(op)q(eration)d(is)g(con)o(v)o(erted)g(to)g(a)h(n)o(um)o
-(b)q(er,)e(if)h(p)q(ossible.)33 b(Con)o(v)o(ersely)l(,)19 b(whenev)o(er)h(a)g
-(n)o(um)o(b)q(er)f(is)h(used)-5 1085 y(when)g(a)g(string)f(is)h(exp)q(ected,)
-i(that)e(n)o(um)o(b)q(er)e(is)i(con)o(v)o(erted)f(to)h(a)g(string.)32
-b(This)19 b(co)q(ercion)h(is)g(useful)-5 1145 y(b)q(ecause)d(it)f
-(simpli\014es)f(programs)f(and)i(a)o(v)o(oids)f(the)i(need)f(for)g(explicit)h
-(con)o(v)o(ersion)e(functions.)-5 1230 y(Global)h(v)m(ariables)f(do)h(not)h
-(need)f(declaration;)f(only)h(lo)q(cal)h(v)m(ariables)e(do.)21
-b(An)o(y)c(v)m(ariable)f(is)g(assumed)-5 1289 y(to)24 b(b)q(e)f(global)f
-(unless)g(explicitly)h(declared)f(lo)q(cal.)42 b(Lo)q(cal)23
-b(v)m(ariable)g(declarations)e(can)i(b)q(e)g(placed)-5 1349
-y(an)o(ywhere)c(inside)f(a)i(blo)q(c)o(k.)31 b(Therefore,)20
-b(b)q(ecause)f(only)h(lo)q(cal)f(v)m(ariables)g(are)g(declared,)h(and)f
-(these)-5 1409 y(declarations)h(can)h(b)q(e)g(made)f(close)h(to)g(the)h(use)e
-(of)i(the)f(v)m(ariable,)g(it)g(is)g(usually)f(simple)g(to)h(decide)-5
-1469 y(whether)16 b(a)h(giv)o(en)f(v)m(ariable)g(is)g(lo)q(cal)h(or)f
-(global.)-5 1553 y(Before)j(the)g(\014rst)e(assignmen)o(t,)g(the)i(v)m(alue)g
-(of)f(a)h(v)m(ariable)f(is)g Fh(nil)p Ff(.)28 b(Therefore,)18
-b(there)g(are)g(no)g(unini-)-5 1613 y(tialized)h(v)m(ariables)g(in)g
-Fe(Lua)p Ff(,)g(another)g(ma)s(jor)f(source)g(of)i(programming)c(errors.)28
-b(Nev)o(ertheless,)20 b(the)-5 1673 y(only)f(v)m(alid)f(op)q(erations)g(on)h
-Fh(nil)g Ff(are)f(assignmen)o(t)f(and)h(equalit)o(y)h(test)g(\(the)h(main)d
-(prop)q(ert)o(y)h(of)h Fh(nil)-5 1733 y Ff(is)f(to)h(b)q(e)g(di\013eren)o(t)e
-(from)h(an)o(y)g(other)g(v)m(alue\).)28 b(Therefore,)18 b(using)f(an)h
-(\\uninitialized")f(v)m(ariable)h(in)g(a)-5 1792 y(con)o(text)k(where)f(an)g
-(\\actual")g(v)m(alue)g(is)g(needed)f(\(e.g.,)j(an)e(arithmetic)f
-(expression\))g(results)g(in)h(an)-5 1852 y(execution)h(error,)g(alerting)f
-(the)h(programmer)c(that)k(the)g(v)m(ariable)g(w)o(as)e(not)i(prop)q(erly)f
-(initialized.)-5 1912 y(Th)o(us,)c(the)g(purp)q(ose)f(of)i(automatically)f
-(initializing)g(v)m(ariables)f(with)h Fh(nil)i Ff(is)e(not)g(to)h(encourage)f
-(the)-5 1972 y(programmer)h(to)i(a)o(v)o(oid)g(initializing)f(v)m(ariables,)h
-(but)g(rather)f(to)i(enable)e Fe(Lua)h Ff(to)h(signal)e(the)i(use)f(of)-5
-2032 y(actually)d(uninitialized)e(v)m(ariables.)-5 2116 y(F)l(unctions)d(are)
-i(considered)e(\014rst-class)g(v)m(alues)h(in)h Fe(Lua)p Ff(:)20
-b(they)14 b(can)g(b)q(e)g(stored)f(in)g(v)m(ariables,)h(passed)e(as)-5
-2176 y(argumen)o(ts)k(to)i(other)g(functions)f(and)g(returned)g(as)g
-(results.)25 b(When)17 b(a)h(function)g(in)f Fe(Lua)h Ff(is)f(de\014ned,)-5
-2236 y(its)e(b)q(o)q(dy)g(is)f(compiled)f(and)h(stored)g(in)g(a)g(global)g(v)
-m(ariable)g(with)g(the)h(giv)o(en)f(name.)20 b Fe(Lua)15 b
-Ff(can)f(call)g(\(and)-5 2296 y(manipulate\))i(functions)g(written)g(in)g(b)q
-(oth)h Fe(Lua)f Ff(and)g(C;)g(the)h(latter)g(ha)o(v)o(e)f(t)o(yp)q(e)h
-Fd(Cfunction)t Ff(.)-5 2380 y(The)j(t)o(yp)q(e)g Fd(user)m(data)h
-Ff(is)e(pro)o(vided)f(to)i(allo)o(w)f(arbitrary)f(\()p Fh(void*)p
-Ff(\))k(C)d(p)q(oin)o(ters)g(to)h(b)q(e)g(stored)f(in)g Fe(Lua)-5
-2440 y Ff(v)m(ariables;)d(its)g(only)g(v)m(alid)h(op)q(erations)e(in)i
-Fe(Lua)f Ff(are)g(assignmen)o(t)e(and)i(equalit)o(y)h(test.)-5
-2525 y(The)d(t)o(yp)q(e)g Fd(table)g Ff(implemen)o(ts)e(asso)q(ciativ)o(e)h
-(arra)o(ys,)g(that)h(is,)g(arra)o(ys)e(that)j(can)e(b)q(e)i(indexed)e(with)h
-(b)q(oth)-5 2584 y(n)o(um)o(b)q(ers)20 b(and)h(strings.)37
-b(Therefore,)23 b(this)f(t)o(yp)q(e)g(ma)o(y)g(b)q(e)g(used)f(not)i(only)e
-(to)i(represen)o(t)d(ordinary)-5 2644 y(arra)o(ys,)j(but)g(also)g(sym)o(b)q
-(ol)f(tables,)i(sets,)h(records,)e(etc.)43 b(T)l(o)23 b(represen)o(t)e(a)j
-(record,)f Fe(Lua)g Ff(uses)g(the)-5 2704 y(\014eld)15 b(name)g(as)h(an)f
-(index.)21 b(The)16 b(language)e(supp)q(orts)h(this)g(represen)o(tation)f(b)o
-(y)h(pro)o(viding)f Fh(a.name)i Ff(as)-5 2764 y(syn)o(tactic)h(sugar)e(for)h
-Fh(a["name"])p Ff(.)-5 2883 y Fc(T)l(eCGraf/ICAD)1674 b(4)p
-eop
-%%Page: 5 5
-bop -5 163 a Ff(Asso)q(ciativ)o(e)21 b(arra)o(ys)e(are)h(a)h(p)q(o)o(w)o
-(erful)e(language)h(construct;)i(man)o(y)e(algorithms)f(are)h(simpli\014ed)e
-(to)-5 223 y(the)j(p)q(oin)o(t)f(of)h(trivialit)o(y)f(b)q(ecause)g(the)h
-(required)e(data)i(structures)e(and)h(algorithms)e(for)j(searc)o(hing)-5
-283 y(them)13 b(are)f(pro)o(vided)f(b)o(y)h(the)h(language)f
-(\(Aho{Kerninghan{W)l(ein)o(b)q(erg)o(er)e(1988;)j(Ben)o(tley)g(1988\).)21
-b(F)l(or)-5 343 y(example,)c(the)g(core)f(of)h(a)g(program)e(that)i(coun)o
-(ts)f(the)h(o)q(ccurrences)f(of)h(eac)o(h)g(w)o(ord)e(in)i(a)g(text)h(can)f
-(b)q(e)-5 402 y(written)195 499 y Fh(table[word])27 b(=)g(table[word])g(+)g
-(1)-5 583 y Ff(without)22 b(ha)o(ving)f(to)h(searc)o(h)e(the)i(list)g(of)g(w)
-o(ords.)36 b(\(Ho)o(w)o(ev)o(er,)22 b(an)g(alphab)q(etically)f(ordered)f(rep)
-q(ort)-5 643 y(requires)c(some)f(real)h(w)o(ork,)g(b)q(ecause)g(the)h
-(indices)f(in)g(a)g(table)h(are)f(ordered)f(arbitrarily)g(inside)h
-Fe(Lua)p Ff(.\))-5 728 y(T)l(ables)g(can)g(b)q(e)h(created)g(in)f(man)o(y)f
-(w)o(a)o(ys.)21 b(The)c(simplest)e(w)o(a)o(y)h(corresp)q(onds)e(to)j
-(ordinary)e(arra)o(ys:)195 824 y Fh(t)26 b(=)g(@\(100\))-5
-909 y Ff(Suc)o(h)12 b(an)g(expression)f(results)g(in)h(a)h(new)f(empt)o(y)g
-(table.)21 b(The)12 b(dimension)e(\(100)j(in)f(the)h(example)f(ab)q(o)o(v)o
-(e\))-5 969 y(is)j(optional)g(and)g(ma)o(y)f(b)q(e)i(giv)o(en)f(as)g(a)g(hin)
-o(t)g(to)h(the)f(initial)g(table)g(size.)22 b(Indep)q(enden)o(tly)14
-b(of)i(the)f(initial)-5 1028 y(dimension,)i(all)i(tables)f(in)g
-Fe(Lua)h Ff(expand)f(dynamically)f(as)i(needed.)28 b(Th)o(us,)17
-b(it)i(is)f(p)q(erfectly)i(v)m(alid)e(to)-5 1088 y(refer)e(to)h
-Fh(t[200])h Ff(or)e(ev)o(en)g(to)h Fh(t["day"])p Ff(.)-5 1173
-y(There)f(are)g(t)o(w)o(o)g(alternativ)o(e)g(syn)o(taxes)g(for)g(creating)g
-(tables)g(without)g(explicitly)g(\014lling)f(eac)o(h)h(en)o(try:)-5
-1233 y(one)f(for)h(lists)e(\()p Fh(@[])p Ff(\))j(and)e(one)g(for)g(records)f
-(\()p Fh(@{})p Ff(\).)23 b(F)l(or)14 b(instance,)h(it)h(is)f(m)o(uc)o(h)f
-(easier)g(to)i(create)g(a)f(list)-5 1293 y(b)o(y)h(pro)o(viding)f(its)h
-(elemen)o(ts,)g(as)g(in)195 1389 y Fh(t)26 b(=)g(@["red",)i("green",)f
-("blue",)g(3])-5 1474 y Ff(than)17 b(with)f(the)h(equiv)m(alen)o(t)f
-(explicit)h(co)q(de)195 1559 y Fh(t)26 b(=)g(@\(\))195 1619
-y(t[1])g(=)h("red")195 1679 y(t[2])f(=)h("green")195 1739 y(t[3])f(=)h
-("blue")195 1799 y(t[4])f(=)h(3)-5 1883 y Ff(Moreo)o(v)o(er,)15
-b(it)i(is)f(p)q(ossible)f(to)i(pro)o(vide)e(user)h(functions)g(when)g
-(creating)g(lists)g(and)g(records,)f(as)h(in)195 1969 y Fh(t)26
-b(=)g(@colors["red",)i("green",)g("blue",)f("yellow"])195 2029
-y(t)f(=)g(@employee{name="john)j(smith",)f(age=34})-5 2114
-y Ff(Here,)15 b Fh(colors)g Ff(and)f Fh(employee)h Ff(are)f(user)f(functions)
-h(that)g(are)g(automatically)g(called)g(after)g(the)h(table)-5
-2173 y(is)i(created.)22 b(Suc)o(h)16 b(functions)g(can)h(b)q(e)g(used)f(to)h
-(c)o(hec)o(k)f(\014eld)h(v)m(alues,)f(to)h(create)g(default)g(\014elds,)f(or)
-g(for)-5 2233 y(an)o(y)g(other)h(side-e\013ect.)k(Th)o(us,)15
-b(the)i(co)q(de)g(for)f(the)h Fh(employee)h Ff(record)d(is)h(equiv)m(alen)o
-(t)h(to:)195 2320 y Fh(t)26 b(=)g(@\(\))195 2380 y(t.name)h(=)f("john)h
-(smith")195 2440 y(t.age)53 b(=)26 b(34)195 2500 y(employee\(t\))-5
-2584 y Ff(Note)17 b(that,)g(ev)o(en)f(though)f Fe(Lua)h Ff(do)q(es)g(not)g
-(ha)o(v)o(e)f(t)o(yp)q(e)i(declarations,)d(the)j(p)q(ossibilit)o(y)d(of)j(ha)
-o(ving)e(user)-5 2644 y(functions)c(called)g(automatically)g(after)g(table)h
-(creation)e(actually)i(pro)o(vides)d Fe(Lua)i Ff(with)h(user)e(con)o(trolled)
--5 2704 y Fd(typ)m(e)21 b(c)m(onstructors)p Ff(.)30 b(This)19
-b(non-con)o(v)o(en)o(tional)d(construct)j(is)f(a)h(v)o(ery)g(p)q(o)o(w)o
-(erful)f(feature,)h(and)g(is)g(the)-5 2764 y(expression)c(of)i(declarativ)o
-(e)f(programming)e(using)h Fe(Lua)p Ff(.)-5 2883 y Fc(T)l(eCGraf/ICAD)1674
-b(5)p eop
-%%Page: 6 6
-bop -5 163 a Fe(The)17 b(application)h(p)o(rogram)c(interface)-5
-248 y Ff(The)24 b(library)e(that)i(implemen)o(ts)e Fe(Lua)h
-Ff(has)g(an)g(API,)h(i.e.,)h(a)e(set)h(of)g(C)g(functions)f(for)g(in)o
-(terfacing)-5 308 y Fe(Lua)h Ff(with)f(host)h(programs)d(\(there)j(are)f
-(appro)o(ximately)f(30)i(suc)o(h)e(functions\).)43 b(These)24
-b(functions)-5 367 y(c)o(haracterize)16 b Fe(Lua)h Ff(as)f(an)h(em)o(b)q
-(edded)f(language,)f(and)i(handle)f(the)h(follo)o(wing)e(tasks:)23
-b(executing)17 b Fe(Lua)-5 427 y Ff(co)q(de)25 b(con)o(tained)e(in)h(a)g
-(\014le)g(or)g(in)g(a)g(string;)j(con)o(v)o(erting)c(v)m(alues)h(b)q(et)o(w)o
-(een)g(C)g(and)f Fe(Lua)p Ff(;)28 b(reading)-5 487 y(and)17
-b(writing)g Fe(Lua)h Ff(ob)s(jects)g(con)o(tained)f(in)g(global)g(v)m
-(ariables;)g(calling)g Fe(Lua)h Ff(functions;)f(registering)g(C)-5
-547 y(functions)i(to)h(b)q(e)g(called)f(b)o(y)g Fe(Lua)p Ff(,)h(including)e
-(error)g(handlers.)29 b(A)20 b(simple)e Fe(Lua)h Ff(in)o(terpreter)f(can)i(b)
-q(e)-5 607 y(written)d(as)f(follo)o(ws:)195 668 y Fh(#include)27
-b("lua.h")195 728 y(int)f(main\(void\))195 787 y({)221 847
-y(char)g(s[1000];)221 907 y(while)h(\(gets\(s\)\))273 967 y
-(lua_dostring\(s\);)221 1026 y(return)g(0;)195 1086 y(})-5
-1171 y Ff(This)15 b(simple)f(in)o(terpreter)g(can)h(b)q(e)h(augmen)o(ted)e
-(with)i(domain)e(sp)q(eci\014c)h(functions)g(written)g(in)g(C)g(and)-5
-1231 y(made)h(a)o(v)m(ailable)g(to)h Fe(Lua)g Ff(with)f(the)h(API)g(function)
-f Fh(lua_register)p Ff(.)25 b(Extension)16 b(functions)g(follo)o(w)g(a)-5
-1290 y(proto)q(col)h(to)f(receiv)o(e)h(and)f(return)f(v)m(alues)h(to)h
-Fe(Lua)p Ff(.)-5 1402 y Fe(Prede\014ned)f(functions)h(and)f(lib)o(ra)o(ries)
--5 1486 y Ff(The)e(set)g(of)h(prede\014ned)d(functions)h(in)h
-Fe(Lua)g Ff(is)f(small)g(but)h(p)q(o)o(w)o(erful.)20 b(Most)13
-b(of)i(them)e(pro)o(vide)g(features)-5 1546 y(that)20 b(allo)o(w)e(some)g
-(degree)g(of)h(re\015exivit)o(y)g(in)g(the)g(language.)28 b(Suc)o(h)17
-b(features)i(cannot)f(b)q(e)i(sim)o(ulated)-5 1606 y(with)c(the)h(rest)f(of)g
-(the)h(language)e(nor)g(with)h(the)h(standard)d(API.)j(The)f(prede\014ned)e
-(functions)i(handle)-5 1666 y(the)j(follo)o(wing)d(tasks:)25
-b(executing)19 b(a)f Fe(Lua)f Ff(mo)q(dule)h(con)o(tained)f(in)g(a)h(\014le)g
-(or)f(string;)h(en)o(umerating)e(all)-5 1726 y(\014elds)g(of)h(a)f(table;)g
-(en)o(umerating)f(all)h(global)g(v)m(ariables;)f(t)o(yp)q(e)i(querying)f(and)
-g(con)o(v)o(ersion.)-5 1810 y(The)j(libraries,)f(on)g(the)i(other)e(hand,)h
-(pro)o(vide)f(useful)g(routines)g(whic)o(h)g(are)h(implemen)o(ted)e(directly)
--5 1870 y(through)22 b(the)h(standard)e(API.)h(Therefore,)i(they)f(are)f(not)
-h(necessary)e(to)i(the)g(language,)g(and)f(are)-5 1930 y(pro)o(vided)14
-b(as)g(separate)h(C)g(mo)q(dules,)f(whic)o(h)g(can)h(b)q(e)g(link)o(ed)f(to)h
-(applications)f(as)h(needed.)20 b(Curren)o(tly)l(,)-5 1990
-y(there)c(are)g(libraries)d(for)j(string)f(manipulation,)f(mathematical)h
-(functions,)g(and)g(input)g(and)g(output.)-5 2101 y Fe(P)o(ersistence)-5
-2186 y Ff(The)k(en)o(umeration)e(functions)h(can)g(b)q(e)i(used)e(to)h(pro)o
-(vide)e(p)q(ersistency)i(of)g(the)g(global)f(en)o(vironmen)o(t)-5
-2245 y(within)e Fe(Lua)p Ff(,)h(i.e.,)f(it)h(is)f(p)q(ossible)f(to)i(write)g
-Fe(Lua)f Ff(co)q(de)h(that)g(writes)f Fe(Lua)g Ff(co)q(de)h(that,)g(when)f
-(executed,)-5 2305 y(restores)i(the)h(v)m(alues)g(of)g(all)g(global)f(v)m
-(ariables.)28 b(W)l(e)20 b(no)o(w)e(sho)o(w)g(some)g(w)o(a)o(ys)g(to)h(store)
-g(and)f(retriev)o(e)-5 2365 y(v)m(alues)k(in)g Fe(Lua)p Ff(,)h(using)e(a)h
-(text)h(\014le)f(written)g(in)g(the)g(language)f(itself)i(as)e(the)i(storage)
-e(media.)38 b(T)l(o)-5 2425 y(restore)16 b(v)m(alues)g(sa)o(v)o(ed)g(in)g
-(this)g(w)o(a)o(y)l(,)g(it)h(is)f(enough)f(to)i(execute)h(the)f(output)f
-(\014le.)-5 2509 y(T)l(o)h(store)f(a)g(single)g(v)m(alue)h(with)f(a)h(name,)e
-(the)i(follo)o(wing)e(co)q(de)i(is)f(enough:)195 2584 y Fh(function)27
-b(store\(name,)h(value\))247 2644 y(write\(name)g(..)e('='\))247
-2704 y(write_value\(value\))195 2764 y(end)-5 2883 y Fc(T)l(eCGraf/ICAD)1674
-b(6)p eop
-%%Page: 7 7
-bop -5 163 a Ff(Here,)15 b(\\)p Fh(..)p Ff(")22 b(is)15 b(the)g(string)e
-(concatenation)i(op)q(erator)f(and)g Fh(write)i Ff(is)e(a)h(library)e
-(function)i(for)f(output.)-5 223 y(The)j(function)g Fh(write_value)i
-Ff(outputs)e(a)g(suitable)f(represen)o(tation)f(of)j(a)f(v)m(alue)g(based)f
-(on)h(its)g(t)o(yp)q(e,)-5 283 y(using)f(a)g(string)g(returned)f(b)o(y)h(the)
-h(prede\014ned)e(function)h Fh(type)p Ff(:)195 359 y Fh(function)27
-b(write_value\(value\))247 419 y(local)g(t)f(=)g(type\(value\))351
-478 y(if)h(t)f(=)h('nil')105 b(then)27 b(write\('nil'\))247
-538 y(elseif)g(t)f(=)h('number')g(then)g(write\(value\))247
-598 y(elseif)g(t)f(=)h('string')g(then)g(write\('"')g(..)g(value)g(..)f
-('"'\))247 658 y(end)195 718 y(end)-5 802 y Ff(Storing)16 b(tables)g(is)g(a)h
-(little)g(more)e(complex.)22 b(First,)15 b Fh(write_value)j
-Ff(is)e(augmen)o(ted)g(with)247 888 y Fh(elseif)27 b(t)f(=)h('table')g(then)f
-(write_record\(value\))-5 972 y Ff(Assuming)13 b(that)h(tables)g(are)f(b)q
-(eing)h(used)f(as)h(records)e(\(i.e.,)j(there)f(are)f(no)h(circular)f
-(references)g(and)g(all)-5 1032 y(indices)h(are)h(iden)o(ti\014ers\),)f(the)h
-(v)m(alue)h(of)f(a)g(table)g(can)g(b)q(e)g(written)g(directly)g(with)g(table)
-g(constructors:)195 1110 y Fh(function)27 b(write_record\(t\))247
-1169 y(local)g(i,)f(v)h(=)f(next\(t,)h(nil\))79 b(--)27 b("next")g
-(enumerates)g(the)g(fields)g(of)f(t)247 1229 y(write\('@{'\))446
-b(--)27 b(starts)g(constructor)247 1289 y(while)g(i)f(do)299
-1349 y(store\(i,v\))299 1408 y(i,)h(v)f(=)g(next\(t,)h(i\))299
-1468 y(if)g(i)f(then)h(write\(',)g('\))f(end)247 1528 y(end)247
-1588 y(write\('}'\))472 b(--)27 b(closes)g(constructor)195
-1648 y(end)-5 1810 y Fg(Implementation)-5 1894 y Ff(Extension)22
-b(languages)f(are)g(alw)o(a)o(ys)g(in)o(terpreted,)i(in)e(one)h(w)o(a)o(y)g
-(or)f(another,)i(b)o(y)f(the)g(application.)-5 1954 y(Simple)e(extension)h
-(languages)f(can)h(b)q(e)g(in)o(terpreted)f(directly)h(from)g(source)f(co)q
-(de.)36 b(On)21 b(the)g(other)-5 2014 y(hand,)j(em)o(b)q(edded)e(languages)f
-(are)i(usually)f(p)q(o)o(w)o(erful)g(programming)e(languages,)j(with)g
-(complex)-5 2074 y(syn)o(tax)11 b(and)g(seman)o(tics.)18 b(A)12
-b(more)e(e\016cien)o(t)g(implemen)o(tation)f(tec)o(hnique)i(for)g(em)o(b)q
-(edded)f(languages)f(is)-5 2133 y(to)k(design)f(a)h Fd(virtual)h(machine)g
-Ff(suited)e(to)i(the)f(needs)f(of)h(the)g(language,)g(compile)f(extension)g
-(programs)-5 2193 y(in)o(to)23 b Fd(byte)m(c)m(o)m(des)j Ff(for)d(this)h(mac)
-o(hine,)f(and)g(then)h(sim)o(ulate)e(the)i(virtual)f(mac)o(hine)f(b)o(y)h(in)
-o(terpreting)-5 2253 y(b)o(yteco)q(des)e(\(Betz)i(1988,)f(1991;)h(F)l(ranks)c
-(1991\).)36 b(W)l(e)21 b(ha)o(v)o(e)g(c)o(hosen)f(this)g(h)o(ybrid)g(arc)o
-(hitecture)g(for)-5 2313 y(implemen)o(ting)12 b Fe(Lua)p Ff(;)i(it)f(has)g
-(the)h(follo)o(wing)e(adv)m(an)o(tages)h(o)o(v)o(er)g(direct)g(in)o
-(terpretation)f(of)i(source)f(co)q(de:)-5 2395 y Fb(\017)25
-b Ff(b)q(ecause)19 b(lexical)g(and)g(syn)o(tactical)g(analysis)f(are)h(done)f
-(only)h(once,)h(p)q(ossibly)e(using)g(an)h(external)45 2455
-y(parser)j(b)q(efore)i(the)g(actual)g(em)o(b)q(edding,)g(simple)e(errors)g
-(are)i(iden)o(ti\014ed)e(early)l(,)j(resulting)d(in)i(a)45
-2515 y(shorter)15 b(dev)o(elopmen)o(t)h(cycle)h(and)f(faster)g(execution;)-5
-2584 y Fb(\017)25 b Ff(if)18 b(an)g(external)g(compiler)f(is)h(used,)f(there)
-h(is)g(the)g(p)q(ossibilit)o(y)f(of)h(pro)o(viding)e(extension)i(programs)45
-2644 y(in)f(b)o(yteco)q(de)g(form)f(only)l(,)h(i.e.,)f(pre-compiled,)f
-(resulting)h(in)g(faster)h(loading,)f(safer)g(en)o(vironmen)o(ts)45
-2704 y(and)e(smaller)e(run-time)h(supp)q(ort)g(\(ho)o(w)o(ev)o(er,)h(linking)
-f(sev)o(eral)g(pre-compiled)f(extension)i(programs)45 2764
-y(can)i(b)q(e)h(a)g(di\016cult)e(task\).)-5 2883 y Fc(T)l(eCGraf/ICAD)1674
-b(7)p eop
-%%Page: 8 8
-bop -5 163 a Ff(This)18 b(arc)o(hitecture)g(w)o(as)g(pioneered)g(in)h
-(Smalltalk)f(\(Goldb)q(erg{Robson)e(1983;)k(Budd)e(1987\))h(\(from)-5
-223 y(whic)o(h)k(the)h(term)f Fd(byte)m(c)m(o)m(des)j Ff(w)o(as)d(b)q(orro)o
-(w)o(ed\))f(and)h(also)g(used)f(in)i(the)g(successful)e(UCSD)i(P)o(ascal)-5
-283 y(system)e(based)g(on)f(P-co)q(de)h(\(Clark{Ko)q(ehler)g(1982\).)39
-b(In)22 b(these)g(systems,)h(b)o(yteco)q(des)f(for)g(virtual)-5
-343 y(mac)o(hines)14 b(w)o(ere)g(used)h(b)q(oth)g(for)g(reducing)e(complexit)
-o(y)i(and)g(for)g(increasing)e(p)q(ortabilit)o(y)l(.)21 b(This)14
-b(path)-5 402 y(w)o(as)i(also)g(used)g(in)g(p)q(orting)g(the)g(BCPL)h
-(compiler)f(\(Ric)o(hards{Whitb)o(y-S)o(trev)o(ens)d(1980\).)-5
-487 y(Co)q(de)19 b(for)e(compilation)g(of)h(extension)g(programs)e(can)i(b)q
-(e)g(built)g(with)g(standard)f(to)q(ols,)h(suc)o(h)f(as)h Fe(lex)-5
-547 y Ff(and)e Fe(y)o(acc)g Ff(\(Levine{Mason{Bro)o(wn)e(1992\).)22
-b(The)16 b(existence)h(of)f(go)q(o)q(d)g(to)q(ols)g(for)g(compiler)f
-(construc-)-5 607 y(tion,)25 b(whic)o(h)c(b)q(ecame)i(widely)g(a)o(v)m
-(ailable)f(in)h(the)g(late)g(sev)o(en)o(ties,)h(w)o(as)e(the)h(main)f(reason)
-g(for)h(the)-5 666 y(sprouting)16 b(of)h(sev)o(eral)f(little)i(languages,)e
-(sp)q(ecially)h(in)g(Unix)g(en)o(vironmen)o(ts.)22 b(Our)16
-b(implemen)o(tation)-5 726 y(of)i Fe(Lua)f Ff(uses)g Fe(y)o(acc)h
-Ff(for)f(syn)o(tactical)g(analysis.)24 b(Initially)l(,)17 b(w)o(e)g(wrote)h
-(the)g(lexical)f(analyzer)h(using)e Fe(lex)p Ff(.)-5 786 y(After)21
-b(p)q(erformance)e(pro\014les)f(with)i(pro)q(duction)f(programs,)g(w)o(e)g
-(detected)i(that)g(this)e(mo)q(dule)h(w)o(as)-5 846 y(resp)q(onsible)e(for)h
-(almost)g(half)g(of)g(the)h(time)f(required)f(for)h(loading)g(and)f
-(executing)i(extension)f(pro-)-5 905 y(grams.)24 b(W)l(e)18
-b(then)g(rewrote)f(this)h(mo)q(dule)f(directly)g(in)h(C;)f(the)h(new)g
-(lexical)g(analyzer)f(is)g(more)g(than)-5 965 y(t)o(wice)g(as)f(fast)h(as)f
-(the)h(old)f(one.)-5 1135 y Fe(Lua's)g(virtual)j(machine)-5
-1219 y Ff(The)h(virtual)f(mac)o(hine)f(used)h(in)g(our)g(implemen)o(tation)f
-(of)i Fe(Lua)f Ff(is)g(a)h Fd(stack)h(machine)p Ff(.)32 b(This)19
-b(means)-5 1279 y(that)e(it)f(do)q(es)g(not)g(ha)o(v)o(e)g(random)e(access)i
-(memory:)21 b(all)16 b(temp)q(orary)f(v)m(alues)h(and)g(lo)q(cal)g(v)m
-(ariables)f(are)-5 1339 y(k)o(ept)j(in)e(a)i(stac)o(k.)24 b(Moreo)o(v)o(er,)
-15 b(it)j(do)q(es)f(not)g(ha)o(v)o(e)g(general)f(purp)q(ose)g(registers,)g
-(only)h(sp)q(ecial)g(con)o(trol)-5 1399 y(registers,)f(whic)o(h)g(con)o(trol)
-h(the)g(stac)o(k)g(and)g(the)g(execution)h(of)f(programs.)22
-b(These)17 b(registers)f(are)h Fd(b)m(ase)-5 1458 y(of)i(stack)p
-Ff(,)d Fd(top)j(of)f(stack)f Ff(and)f Fd(pr)m(o)m(gr)m(am)k(c)m(ounter)p
-Ff(.)-5 1543 y(Programs)j(for)h(the)g(virtual)g(mac)o(hine)f(are)h(sequences)
-g(of)h(instructions,)f(called)g Fd(byte)m(c)m(o)m(des)p Ff(.)48
-b(The)-5 1603 y(execution)24 b(of)g(programs)d(is)i(ac)o(hiev)o(ed)g(b)o(y)g
-(in)o(terpreting)f(b)o(yteco)q(des,)k(eac)o(h)d(corresp)q(onding)e(to)j(an)-5
-1663 y(instruction)16 b(that)g(op)q(erates)h(on)f(the)h(top)f(p)q(ortion)g
-(of)h(the)g(stac)o(k.)22 b(F)l(or)15 b(example,)h(the)h(statemen)o(t)195
-1777 y Fh(a)26 b(=)g(b)g(+)h(f\(c\))-5 1862 y Ff(is)16 b(compiled)g(in)o(to)
-195 1962 y Fh(PUSHGLOBAL)80 b("b")195 2022 y(PUSHGLOBAL)g("f")195
-2081 y(PUSHMARK)195 2141 y(PUSHGLOBAL)g("c")195 2201 y(CALLFUNC)195
-2261 y(ADJUST)210 b(2)195 2320 y(ADD)195 2380 y(STOREGLOBAL)54
-b("a")-5 2465 y Fe(Lua)p Ff('s)13 b(virtual)f(mac)o(hine)g(has)g(ab)q(out)h
-(60)g(instructions;)g(accordingly)l(,)f(it)i(is)e(p)q(ossible)g(to)i(use)e
-(8-bit)h(b)o(yte-)-5 2525 y(co)q(des.)22 b(Man)o(y)15 b(instructions)f
-(\(e.g.,)h Fh(ADD)p Ff(\))i(do)e(not)h(need)f(additional)g(parameters;)f
-(these)h(instructions)-5 2584 y(op)q(erate)d(directly)g(on)f(the)h(stac)o(k)g
-(and)f(tak)o(e)h(exactly)h(one)f(b)o(yte)g(in)f(compiled)g(co)q(de.)20
-b(Other)11 b(instructions)-5 2644 y(\(e.g.,)16 b Fh(PUSHGLOBAL)i
-Ff(and)d Fh(STOREGLOBAL)p Ff(\))j(need)d(additional)g(parameters,)f(and)h
-(tak)o(e)h(more)f(than)h(one)-5 2704 y(b)o(yte.)22 b(Since)16
-b(parameters)e(tak)o(e)i(either)g(one,)f(t)o(w)o(o)h(or)f(four)g(b)o(ytes,)h
-(this)g(creates)f(alignmen)o(t)g(problems)-5 2764 y(in)h(some)g(arc)o
-(hitectures,)f(whic)o(h)h(are)g(solv)o(ed)g(b)o(y)g(padding)f(with)h
-Fh(NOP)p Ff(s)h(to)g(the)g(alignmen)o(t)e(b)q(oundary)l(.)-5
-2883 y Fc(T)l(eCGraf/ICAD)1674 b(8)p eop
-%%Page: 9 9
-bop -5 163 a Ff(Man)o(y)15 b(of)i(the)f(instructions)e(exist)i(for)g
-(optimization)f(only)l(.)21 b(F)l(or)15 b(instance,)g(there)h(is)g(a)g
-Fh(PUSH)g Ff(instruc-)-5 223 y(tion,)f(whic)o(h)g(tak)o(es)g(a)g(n)o(um)o(b)q
-(er)e(as)i(a)g(parameter)f(and)g(pushes)g(it)h(on)o(to)g(the)g(stac)o(k,)h
-(but)f(there)g(are)f(also)-5 283 y(single-b)o(yte)i(optimized)f(v)o(ersions)g
-(for)h(pushing)f(common)g(v)m(alues)h(suc)o(h)f(as)h(zero)h(and)e(one.)22
-b(Th)o(us,)15 b(w)o(e)-5 343 y(ha)o(v)o(e)k Fh(PUSHNIL)p Ff(,)h
-Fh(PUSH0)p Ff(,)h Fh(PUSH1)p Ff(,)g Fh(PUSH2)p Ff(.)31 b(Suc)o(h)18
-b(optimizations)g(reduce)h(b)q(oth)g(the)h(space)f(required)-5
-402 y(for)e(compiled)e(b)o(yteco)q(des)h(and)g(the)h(time)g(required)e(for)h
-(in)o(terpreting)f(instructions.)-5 487 y(Recall)k(that)h Fe(Lua)f
-Ff(supp)q(orts)f(m)o(ultiple)f(assignmen)o(t)h(and)g(m)o(ultiple)g(return)g
-(v)m(alues)h(from)g(functions.)-5 547 y(Therefore,)e(sometimes,)g(a)g(list)h
-(of)g(v)m(alues)f(m)o(ust)g(b)q(e)g Fd(adjuste)m(d)5 b Ff(,)20
-b(at)e(run)f(time,)g(to)h(a)g(giv)o(en)f(length:)24 b(if)-5
-607 y(there)c(are)g(more)f(v)m(alues)h(than)g(are)f(needed,)h(then)g(the)h
-(excess)f(v)m(alues)f(are)h(thro)o(wn)f(a)o(w)o(a)o(y;)i(if)f(more)-5
-666 y(v)m(alues)15 b(are)f(needed)g(than)g(are)g(presen)o(t,)g(then)g(the)h
-(list)f(is)g(extended)h(with)f(as)g(man)o(y)g Fh(nil)p Ff('s)g(as)g(needed.)
--5 726 y(Adjustmen)o(t)i(is)g(done)g(on)g(the)h(stac)o(k)g(with)f(the)h
-Fh(ADJUST)h Ff(instruction.)-5 811 y(Although)g(m)o(ultiple)f(assignmen)o(t)f
-(and)i(returns)e(are)i(a)g(p)q(o)o(w)o(erful)f(feature)i(of)f
-Fe(Lua)p Ff(,)g(they)h(are)f(an)g(im-)-5 871 y(p)q(ortan)o(t)g(source)e(of)i
-(complexit)o(y)g(in)f(b)q(oth)h(the)g(compiler)e(and)i(the)g(in)o(terpreter.)
-24 b(Because)17 b(there)h(are)-5 930 y(no)c(t)o(yp)q(e)h(declarations)e(for)h
-(functions,)g(the)h(compiler)d(do)q(es)j(not)f(kno)o(w)g(ho)o(w)f(man)o(y)h
-(v)m(alues)g(a)g(function)-5 990 y(will)j(return.)k(Th)o(us,)15
-b(adjustmen)o(t)h(m)o(ust)g(b)q(e)h(done)f(at)h(run)f(time.)22
-b(Similarly)l(,)15 b(the)i(compiler)e(do)q(es)i(not)-5 1050
-y(kno)o(w)f(ho)o(w)g(man)o(y)f(parameters)g(a)h(function)g(tak)o(es.)22
-b(Because)16 b(this)g(n)o(um)o(b)q(er)f(ma)o(y)g(v)m(ary)i(at)g(run)e(time,)
--5 1110 y(the)i(list)f(of)h(parameters)e(is)h(brac)o(k)o(eted)g(b)q(et)o(w)o
-(een)g(a)h Fh(PUSHMARK)g Ff(and)f(a)h Fh(CALLFUNC)h Ff(instruction.)-5
-1194 y(One)e(w)o(a)o(y)f(to)h(extend)g Fe(Lua)f Ff(with)h(functions)f(pro)o
-(vided)f(b)o(y)h(the)h(host)f(w)o(ould)g(b)q(e)g(to)h(assign)f(a)g(b)o(yteco)
-q(de)-5 1254 y(to)j(eac)o(h)f(suc)o(h)g(function)g(\(Betz)i(1988\).)25
-b(Although)17 b(this)g(strategy)h(w)o(ould)e(simplify)h(the)g(in)o
-(terpreter,)-5 1314 y(it)k(has)g(the)g(disadv)m(an)o(tage)e(that)i(few)o(er)g
-(than)g(200)f(external)h(functions)f(could)g(b)q(e)h(added,)g(b)q(ecause)-5
-1374 y Fe(Lua)e Ff(has)f(8-bit)g(b)o(yteco)q(des)h(and)f(already)g(uses)g(ab)
-q(out)g(60)h(of)g(them)f(for)h(its)f(primitiv)o(e)g(instructions.)-5
-1433 y(W)l(e)f(ha)o(v)o(e)f(c)o(hosen)g(to)h(ha)o(v)o(e)f(the)h(host)f
-(explicitly)h(register)f(external)h(functions,)f(and)g(handling)f(these)-5
-1493 y(functions)24 b(lik)o(e)g(nativ)o(e)h Fe(Lua)f Ff(functions.)45
-b(Th)o(us,)25 b(there)f(is)h(a)f(single)g Fh(CALLFUNC)h Ff(instruction;)j
-(the)-5 1553 y(in)o(terpreter)15 b(decides)h(what)h(to)g(do)f(based)f(on)i
-(the)f(t)o(yp)q(e)i(of)e(the)h(function)f(b)q(eing)g(called.)-5
-1638 y(A)21 b(rather)e(di\013eren)o(t)g(strategy)h(w)o(as)f(prop)q(osed)g(b)o
-(y)g(F)l(ranks)f(\(1991\):)30 b Fd(al)s(l)19 b Ff(external)h(functions)f(in)h
-(the)-5 1697 y(host)f(can)g(b)q(e)h(called)f(b)o(y)g(the)g(em)o(b)q(edded)f
-(language;)i(no)f(explicit)g(registration)f(is)h(needed.)30
-b(This)18 b(is)-5 1757 y(done)h(b)o(y)g(reading)f(and)g(in)o(terpreting)g
-(the)h(map)g(generated)f(b)o(y)h(the)h(link)o(er.)29 b(This)18
-b(solution)g(is)h(v)o(ery)-5 1817 y(con)o(v)o(enien)o(t)g(for)h(the)g
-(application)e(programmer,)g(but)i(is)f(not)h(p)q(ortable,)g(b)q(eing)g(dep)q
-(enden)o(t)f(on)h(the)-5 1877 y(format)14 b(of)g(the)h(map)e(\014le)h(and)g
-(on)g(the)g(relo)q(cation)g(strategy)h(used)e(b)o(y)h(the)g(op)q(erating)g
-(system)g(\(F)l(ranks)-5 1937 y(used)i(a)h(sp)q(eci\014c)f(compiler)f(for)h
-(DOS\).)-5 2091 y Fe(Internal)h(data)f(structures)-5 2176 y
-Ff(As)22 b(men)o(tioned)e(b)q(efore,)i(v)m(ariables)f(in)f
-Fe(Lua)i Ff(are)f(not)g(t)o(yp)q(ed;)j(only)d(v)m(alues)g(are.)36
-b(Th)o(us,)21 b(v)m(alues)g(are)-5 2236 y(implemen)o(ted)15
-b(in)g(a)h Fh(struct)i Ff(with)e(t)o(w)o(o)f(\014elds:)21 b(a)16
-b(t)o(yp)q(e)h(and)e(a)i Fh(union)g Ff(con)o(taining)d(the)j(actual)f(v)m
-(alue.)-5 2296 y(These)g Fh(struct)p Ff(s)g(o)q(ccur)g(in)g(the)g(stac)o(k)g
-(and)f(in)g(the)h(sym)o(b)q(ol)f(table,)h(whic)o(h)f(holds)g(all)g(global)g
-(sym)o(b)q(ols.)-5 2380 y(Num)o(b)q(ers)j(are)h(stored)f(directly)h(in)o(to)g
-(the)g Fh(union)p Ff(.)31 b(Strings)18 b(are)g(k)o(ept)i(in)e(a)h(single)g
-(arra)o(y;)g(v)m(alues)g(of)-5 2440 y(t)o(yp)q(e)i Fd(string)g
-Ff(con)o(tain)e(p)q(oin)o(ters)h(to)g(this)g(arra)o(y)l(.)32
-b(V)l(alues)20 b(of)h(t)o(yp)q(e)g Fd(function)f Ff(con)o(tain)g(p)q(oin)o
-(ters)f(to)i(a)-5 2500 y(b)o(yteco)q(de)d(arra)o(y)l(.)23 b(V)l(alues)17
-b(of)g(t)o(yp)q(e)h Fd(Cfunction)f Ff(con)o(tain)g(the)g(actual)g(p)q(oin)o
-(ter)g(to)g(the)h(C)f(function,)g(as)-5 2560 y(pro)o(vided)e(b)o(y)h(the)h
-(host)f(program;)f(the)i(same)e(happ)q(ens)h(for)g(v)m(alues)g(of)h(t)o(yp)q
-(e)g Fd(user)m(data)p Ff(.)-5 2644 y(T)l(ables)g(are)g(implemen)o(ted)f(as)h
-(hash)g(tables,)g(with)h(collisions)d(handled)i(b)o(y)g(separate)g(c)o
-(haining)f(\(this)-5 2704 y(explains)23 b(wh)o(y)g(indices)g(in)g(a)g(table)h
-(are)f(ordered)f(arbitrarily\).)41 b(If)24 b(a)g(dimension)d(is)i(giv)o(en)g
-(when)-5 2764 y(a)f(table)g(is)g(created,)h(then)f(this)g(dimension)e(is)i
-(used)f(as)h(the)g(size)g(of)g(the)h(hash)e(table.)38 b(Th)o(us,)22
-b(b)o(y)-5 2883 y Fc(T)l(eCGraf/ICAD)1674 b(9)p eop
-%%Page: 10 10
-bop -5 163 a Ff(pro)o(viding)13 b(a)i(dimension)e(appro)o(ximately)h(equal)h
-(to)g(the)g(exp)q(ected)h(n)o(um)o(b)q(er)d(of)i(indices)f(in)h(the)g(table,)
--5 223 y(few)i(collisions)d(will)i(o)q(ccur,)g(resulting)e(in)i(v)o(ery)g
-(e\016cien)o(t)g(index)f(lo)q(cation.)22 b(Moreo)o(v)o(er,)15
-b(if)h(the)g(table)g(is)-5 283 y(used)g(as)g(an)g(arra)o(y)l(,)e(with)j(n)o
-(umeric)d(indices)h(only)l(,)h(then)g(c)o(ho)q(osing)g(the)g(righ)o(t)f
-(dimension)g(at)h(creation)-5 343 y(time)h(guaran)o(tees)e(that)i(no)f
-(collisions)f(will)h(o)q(ccur.)-5 427 y(All)k(in)o(ternal)e(data)h
-(structures)f(in)h Fe(Lua)h Ff(are)f(dynamically)f(allo)q(cated)i(arra)o(ys.)
-29 b(When)19 b(there)g(are)g(no)-5 487 y(more)13 b(free)h(slots)g(in)f(one)h
-(of)g(these)g(arra)o(ys,)e(garbage)h(collection)h(is)f(automatically)h(p)q
-(erformed)e(using)h(a)-5 547 y(standard)i(mark-and-sw)n(eep)e(algorithm.)21
-b(If)16 b(no)f(space)h(is)f(reco)o(v)o(ered)g(\(b)q(ecause)h(all)f(v)m(alues)
-h(are)f(b)q(eing)-5 607 y(referenced\),)h(then)h(the)g(arra)o(y)e(is)h
-(reallo)q(cated)g(with)h(double)e(its)i(curren)o(t)e(size.)-5
-691 y(Garbage)h(collection)h(is)g(v)o(ery)g(con)o(v)o(enien)o(t)e(for)i(the)g
-(programmer)d(b)q(ecause)j(it)g(a)o(v)o(oids)f(explicit)h(mem-)-5
-751 y(ory)d(managemen)o(t.)20 b(When)14 b Fe(Lua)g Ff(is)g(used)g(as)g(a)g
-(standalone)f(language)h(\(whic)o(h)f(it)i(frequen)o(tly)f(is\),)h(then)-5
-811 y(garbage)20 b(collection)g(is)g(an)g(asset.)34 b(Ho)o(w)o(ev)o(er,)20
-b(when)g Fe(Lua)g Ff(is)g(used)g(em)o(b)q(edded)f(in)h(a)h(host)f(program)-5
-871 y(\(whic)o(h)13 b(is)g(its)h(main)e(purp)q(ose\),)h(then)h(garbage)e
-(collection)h(creates)h(a)f(new)h(w)o(orry)e(for)h(the)h(application)-5
-930 y(programmer)f(who)i(needs)g(to)h(in)o(terface)g(with)f
-Fe(Lua)p Ff(:)21 b(care)16 b(should)e(b)q(e)i(tak)o(en)g(not)f(to)h(store)g
-Fe(Lua)f Ff(tables)-5 990 y(and)g(strings)f(in)o(to)i(C)f(v)m(ariables,)g(b)q
-(ecause)g(these)h(v)m(alues)f(ma)o(y)g(b)q(e)h(reclaimed)f(during)e(garbage)i
-(collec-)-5 1050 y(tion,)i(if)g(they)h(do)f(not)g(ha)o(v)o(e)f(an)o(y)h
-(further)f(references)h(within)f Fe(Lua)p Ff('s)h(en)o(vironmen)o(t.)k(More)c
-(precisely)l(,)-5 1110 y(the)d(programmer)d(m)o(ust)i(explicitly)h(cop)o(y)f
-(these)h(v)m(alues)f(in)o(to)g(C)h(v)m(ariables,)f(b)q(efore)h(returning)e
-(con)o(trol)-5 1169 y(to)i Fe(Lua)p Ff(.)21 b(Although)12 b(this)h(is)g(a)h
-(di\013eren)o(t)e(paradigm,)g(it)h(is)g(not)h(w)o(orse)e(than)h(the)h
-(familiar)e Fh(malloc)p Ff(-)p Fh(free)-5 1229 y Ff(proto)q(col)17
-b(for)f(memory)f(managemen)o(t)g(using)h(the)g(standard)f(C)i(library)l(.)-5
-1397 y Fg(Conclusion)-5 1482 y Fe(Lua)g Ff(has)e(b)q(een)i(extensiv)o(ely)g
-(used)f(in)g(pro)q(duction)f(since)h(mid)g(93,)g(for)g(the)h(follo)o(wing)e
-(tasks:)-5 1560 y Fb(\017)25 b Ff(user)16 b(con\014guration)e(of)j
-(application)f(en)o(vironmen)o(t;)-5 1625 y Fb(\017)25 b Ff(general-purp)q
-(ose)14 b(data-en)o(try)l(,)h(with)i(user)e(de\014ned)h(dialogs)f(and)h(v)m
-(alidation)g(pro)q(cedures;)-5 1690 y Fb(\017)25 b Ff(description)15
-b(of)i(user)e(in)o(terfaces;)-5 1755 y Fb(\017)25 b Ff(programmer)14
-b(description)h(of)i(application)e(ob)s(jects;)-5 1819 y Fb(\017)25
-b Ff(storage)f(of)h(structured)e(graphical)g(meta\014les,)i(used)f(for)g
-(comm)o(unication)e(b)q(et)o(w)o(een)i(graphical)45 1879 y(editors)16
-b(and)g(application)f(programs.)-5 1977 y(Moreo)o(v)o(er,)g
-Fe(Lua)g Ff(is)h(curren)o(tly)e(b)q(eing)i(considered)e(as)i(the)g(basis)f
-(for)g(a)h(visual)f(programming)e(system.)-5 2062 y(The)k(abilit)o(y)g(to)g
-(load)f(and)h(execute)h Fe(Lua)f Ff(programs)d(at)k(run-time)d(has)h(pro)o(v)
-o(ed)g(to)h(b)q(e)h(a)f(ma)s(jor)f(com-)-5 2122 y(p)q(onen)o(t)g(in)f(making)
-g(con\014guration)f(an)i(easy)g(task)g(for)g(b)q(oth)g(users)e(and)i(dev)o
-(elop)q(ers.)k(Moreo)o(v)o(er,)15 b(the)-5 2182 y(existence)i(of)g(a)f
-(single)g(general)g(purp)q(ose)f(em)o(b)q(edded)g(language)h(discourages)e
-(the)j(m)o(ultiplication)e(of)-5 2241 y(incompatible)d(languages)g(and)h
-(encourages)f(a)h(b)q(etter)h(design,)f(one)g(that)h(clearly)f(separates)f
-(the)i(main)-5 2301 y(tec)o(hnology)i(con)o(tained)g(in)g(an)g(application)g
-(from)f(its)i(con\014guration)e(issues.)-5 2386 y(The)21 b(implemen)o(tation)
-e(of)i Fe(Lua)f Ff(describ)q(ed)g(in)g(this)h(pap)q(er)f(is)g(a)o(v)m
-(ailable)g(b)o(y)h(anon)o(ymous)d Fh(ftp)k Ff(from)-5 2446
-y Fh(ftp.icad.puc-rio.br:/p)q(ub/lua)q(/lua-1.)q(1.tar.Z)q
-Ff(.)-5 2560 y Fe(Ackno)o(wledgments)-5 2644 y Ff(W)l(e)f(w)o(ould)d(lik)o(e)
-i(to)h(thank)f(the)g(sta\013)g(at)h(ICAD)f(and)g(T)l(eCGraf)f(for)h(using)f
-(and)h(testing)g Fe(Lua)p Ff(.)32 b(The)-5 2704 y(industrial)16
-b(applications)g(men)o(tioned)g(in)h(the)h(text)h(are)e(b)q(eing)h(dev)o
-(elop)q(ed)f(in)g(patternship)f(with)i(the)-5 2764 y(researc)o(h)d(cen)o
-(ters)h(at)h(PETR)o(OBR)674 2751 y(\023)668 2764 y(AS)e(\(CENPES\))i(and)f
-(at)h(ELETR)o(OBR)1452 2751 y(\023)1446 2764 y(AS)f(\(CEPEL\).)-5
-2883 y Fc(T)l(eCGraf/ICAD)1652 b(10)p eop
-%%Page: 11 11
-bop -5 163 a Fg(References)-5 268 y Ff(M.)14 b(Abrash,)g(D.)g(Illo)o(wsky)l
-(,)g(\\Roll)g(y)o(our)f(o)o(wn)h(minilanguages)e(with)j(mini-in)o(terpreters)
-o(",)d Fi(Dr.)i(Dobb's)70 328 y(Journal)h Fa(14)h Ff(\(9\))h(\(Sep)f(1989\))h
-(52{72.)-5 402 y(A.)27 b(V.)h(Aho,)e(B.)i(W.)f(Kerninghan,)d(P)l(.)j(J.)f(W)l
-(ein)o(b)q(erger,)g Fi(The)g(A)-6 b(WK)28 b(programming)c(language)p
-Ff(,)70 462 y(Addison-W)l(esley)l(,)15 b(1988.)-5 537 y(B.)i(Bec)o(kman,)f
-(\\A)h(Sc)o(heme)f(for)g(little)h(languages)f(in)g(in)o(teractiv)o(e)g
-(graphics",)f Fi(Soft)o(w)o(are,)h(practice)g(&)70 597 y(exp)q(erience)h
-Fa(21)f Ff(\(1991\))h(187{207.)-5 671 y(J.)c(Ben)o(tley)l(,)f(\\Programming)e
-(p)q(earls:)i(little)h(languages",)f Fi(Comm)o(unications)e(of)j(the)g(A)o
-(CM)f Fa(29)g Ff(\(1986\))70 731 y(711{721.)-5 806 y(J.)k(Ben)o(tley)l(,)h
-Fi(More)f(programming)d(p)q(earls)p Ff(,)j(Addison-W)l(esley)l(,)f(1988.)-5
-881 y(D.)i(Betz,)g(\\Em)o(b)q(edded)e(languages",)g Fi(Byte)j
-Fa(13)e Ff(#12)f(\(No)o(v)j(1988\))e(409{416.)-5 955 y(D.)g(Betz,)h(\\Y)l
-(our)f(o)o(wn)f(tin)o(y)h(ob)s(ject-orien)o(ted)f(language",)g
-Fi(Dr.)h(Dobb's)f(Journal)f Fa(16)i Ff(\(9\))h(\(Sep)f(1991\))70
-1015 y(26{33.)-5 1090 y(T.)h(Budd,)e Fi(A)i(Little)h(Smalltalk)p
-Ff(,)d(Addison-W)l(esley)l(,)g(1987.)-5 1164 y(R.)e(Clark,)h(S.)f(Ko)q
-(ehler,)g Fi(The)g(UCSD)h(P)o(ascal)f(handb)q(o)q(ok:)g(a)g(reference)g(and)g
-(guideb)q(o)q(ok)h(for)f(program-)70 1224 y(mers)p Ff(,)i(Pren)o(tice-Hall,)h
-(1982.)-5 1299 y(M.)g(Co)o(wlisha)o(w,)f Fi(The)h(REXX)h(programming)d
-(language)p Ff(,)h(Pren)o(tice-Hall,)g(1990.)-5 1374 y(L.)j(H.)f(de)g
-(Figueiredo,)f(C.)h(S.)g(de)g(Souza,)g(M.)f(Gattass,)i(L.)f(C.)g(G.)g(Co)q
-(elho,)g(\\Gera\030)-22 b(c~)d(ao)17 b(de)h(in)o(terfaces)70
-1433 y(para)k(captura)g(de)h(dados)f(sobre)f(desenhos",)h Fi(Anais)g(do)h
-(SIBGRAPI)f(V)i Ff(\(1992\))f(169{175)f([in)70 1493 y(P)o(ortuguese].)-5
-1568 y(N.)e(F)l(ranks,)d(\\Adding)h(an)h(extension)g(language)f(to)i(y)o(our)
-e(soft)o(w)o(are",)g Fi(Dr.)g(Dobb's)g(Journal)g Fa(16)g Ff(\(9\))70
-1628 y(\(Sep)e(1991\))h(34{43.)-5 1702 y(A.)24 b(Goldb)q(erg,)f(D.)h(Robson,)
-e Fi(Smalltalk-80:)g(the)i(language)f(and)g(its)h(implemen)o(tation)p
-Ff(,)d(Addison-)70 1762 y(W)l(esley)l(,)16 b(1983.)-5 1837
-y(R.)g(Ierusalimsc)o(h)o(y)l(,)d(L.)j(H.)g(de)g(Figueiredo,)e(W.)i(Celes)f
-(Filho,)g(\\Reference)h(man)o(ual)e(of)i(the)g(program-)70
-1897 y(ming)g(language)f Fe(Lua)p Ff(",)h Fi(Monogra\014as)e(em)j(Ci)o(^)-24
-b(encia)16 b(da)g(Computa\030)-22 b(c~)d(ao)16 b Fa(4/94)p
-Ff(,)f(Departamen)o(to)g(de)70 1956 y(Inform\023)-25 b(atica,)15
-b(PUC-Rio,)h(1994.)-5 2031 y(J.)g(R.)g(Levine,)h(T.)f(Mason,)g(D.)g(Bro)o
-(wn,)g Fi(Lex)h(&)f(Y)l(acc)p Ff(,)h(O'Reilly)f(and)g(Asso)q(ciates,)g(1992.)
--5 2106 y(C.)h(Nahab)q(o)q(o,)f Fi(A)h(catalog)g(of)g(em)o(b)q(edded)e
-(languages)p Ff(,)g(a)o(v)m(ailable)h(from)f Fh(colas@indri.inria.fr)p
-Ff(.)-5 2181 y(M.)i(Ric)o(hards,)e(C.)j(Whitb)o(y-Strev)o(ens,)d
-Fi(BCPL:)j(the)g(language)e(and)h(its)g(compiler)p Ff(,)f(Cam)o(bridge)f
-(Uni-)70 2240 y(v)o(ersit)o(y)h(Press,)f(1980.)-5 2315 y(B.)i(Ry)o(an,)f
-(\\Scripts)f(un)o(b)q(ounded",)f Fi(Byte)k Fa(15)e Ff(\(8\))h(\(Aug)g(1990\))
-f(235{240.)-5 2390 y(R.)g(V)l(ald)o(\023)-24 b(es,)16 b(\\Little)h
-(languages,)e(big)i(questions",)e Fi(Dr.)h(Dobb's)f(Journal)g
-Fa(16)h Ff(\(9\))h(\(Sep)g(1991\))f(16{25.)-5 2883 y Fc(T)l(eCGraf/ICAD)1652
-b(11)p eop
-%%Trailer
-end
-userdict /end-hook known{end-hook}if
-%%EOF
diff --git a/doc/manual.dvi b/doc/manual.dvi
index 5baa7132..7ab7e9bc 100644
--- a/doc/manual.dvi
+++ b/doc/manual.dvi
Binary files differ
diff --git a/doc/manual.ps b/doc/manual.ps
index c507ae37..bfd0730c 100644
--- a/doc/manual.ps
+++ b/doc/manual.ps
@@ -1,7 +1,7 @@
%!PS-Adobe-2.0
%%Creator: dvips, version 5.4 (C) 1986-90 Radical Eye Software
%%Title: manual.dvi
-%%Pages: 19 1
+%%Pages: 24 1
%%BoundingBox: 0 0 596 843
%%EndComments
%%BeginProcSet: tex.pro
@@ -53,157 +53,169 @@ E0007FC0001F00141C7F9B1A>116 D<7F83FCFFC7FE7F83FC0E00E00E00E00E00E00701C00701
C00701C003838003838003838001C70001C70001C70000EE0000EE0000EE00007C00007C000038
0017157F941A>118 D<7FC7F87FCFFC7FC7F80703C003838003C70001EF0000FE00007C000078
00003800007C0000EE0001EE0001C7000383800783C00F01C07FC7FCFFC7FE7FC7FC17157F941A
->120 D E /Fb 46 121 df<000FF000007FFC0001F80E0003E01F0007C03F000F803F000F803F
-000F801E000F800C000F8000000F8000000F8000000F800000FFFFFF00FFFFFF000F801F000F80
-1F000F801F000F801F000F801F000F801F000F801F000F801F000F801F000F801F000F801F000F
-801F000F801F000F801F000F801F000F801F000F801F000F801F007FF0FFE07FF0FFE01B237FA2
-1F>12 D<387CFEFEFE7C3807077C8610>46 D<0000180000380000380000700000700000E00000
-E00000E00001C00001C0000380000380000380000700000700000700000E00000E00001C00001C
-00001C0000380000380000700000700000700000E00000E00001C00001C00001C0000380000380
-000700000700000700000E00000E00000E00001C00001C00003800003800003800007000007000
-00E00000E00000C0000015317DA41C>I<00180000780001F800FFF800FFF80001F80001F80001
+>120 D E /Fb 1 122 df<1C02260646064606860C0C0C0C0C0C0C18181818181818380C7007B0
+00300060706070C021801E000F147F8D11>121 D E /Fc 2 121 df<70F8F8F87005057C840D>
+58 D<03C1C00C62201034701038F02038F020386040700000700000700000700000E00000E000
+00E00000E02061C040F1C040F1C080E2C080446300383C0014147E931A>120
+D E /Fd 47 121 df<000FF000007FFC0001F80E0003E01F0007C03F000F803F000F803F000F80
+1E000F800C000F8000000F8000000F8000000F800000FFFFFF00FFFFFF000F801F000F801F000F
+801F000F801F000F801F000F801F000F801F000F801F000F801F000F801F000F801F000F801F00
+0F801F000F801F000F801F000F801F000F801F000F801F007FF0FFE07FF0FFE01B237FA21F>12
+D<387CFEFEFE7C3807077C8610>46 D<0000180000380000380000700000700000E00000E00000
+E00001C00001C0000380000380000380000700000700000700000E00000E00001C00001C00001C
+0000380000380000700000700000700000E00000E00001C00001C00001C0000380000380000700
+000700000700000E00000E00000E00001C00001C0000380000380000380000700000700000E000
+00E00000C0000015317DA41C>I<00180000780001F800FFF800FFF80001F80001F80001F80001
F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001F80001
-F80001F80001F80001F80001F80001F80001F80001F80001F80001F8007FFFE07FFFE013207C9F
-1C>49 D<03FC000FFF003C1FC07007E07C07F0FE03F0FE03F8FE03F8FE01F87C01F83803F80003
-F80003F00003F00007E00007C0000F80001F00003E0000380000700000E01801C0180380180700
-180E00380FFFF01FFFF03FFFF07FFFF0FFFFF0FFFFF015207D9F1C>I<00FE0007FFC00F07E01E
-03F03F03F03F81F83F81F83F81F81F03F81F03F00003F00003E00007C0001F8001FE0001FF0000
-07C00001F00001F80000FC0000FC3C00FE7E00FEFF00FEFF00FEFF00FEFF00FC7E01FC7801F81E
-07F00FFFC001FE0017207E9F1C>I<0000E00001E00003E00003E00007E0000FE0001FE0001FE0
-0037E00077E000E7E001C7E00187E00307E00707E00E07E00C07E01807E03807E07007E0E007E0
-FFFFFEFFFFFE0007E00007E00007E00007E00007E00007E00007E000FFFE00FFFE17207E9F1C>
-I<1000201E01E01FFFC01FFF801FFF001FFE001FF8001BC00018000018000018000018000019FC
-001FFF001E0FC01807E01803E00003F00003F00003F80003F83803F87C03F8FE03F8FE03F8FC03
-F0FC03F07007E03007C01C1F800FFF0003F80015207D9F1C>I<001F8000FFE003F07007C0F00F
-01F81F01F83E01F83E01F87E00F07C00007C0000FC0800FC7FC0FCFFE0FD80F0FF00F8FE007CFE
-007CFC007EFC007EFC007EFC007E7C007E7C007E7C007E3C007C3E007C1E00F80F00F00783E003
-FFC000FF0017207E9F1C>I<6000007800007FFFFE7FFFFE7FFFFC7FFFF87FFFF87FFFF0E00060
-E000C0C00180C00300C00300000600000C00001C0000180000380000780000780000F00000F000
-00F00001F00001F00001F00003F00003F00003F00003F00003F00003F00003F00001E00017227D
-A11C>I<000070000000007000000000F800000000F800000000F800000001FC00000001FC0000
-0003FE00000003FE00000003FE00000006FF000000067F0000000E7F8000000C3F8000000C3F80
-0000183FC00000181FC00000381FE00000300FE00000300FE00000600FF000006007F00000E007
-F80000FFFFF80000FFFFF800018001FC00018001FC00038001FE00030000FE00030000FE000600
-007F000600007F00FFE00FFFF8FFE00FFFF825227EA12A>65 D<0003FE0080001FFF818000FF01
-E38001F8003F8003E0001F8007C0000F800F800007801F800007803F000003803F000003807F00
-0001807E000001807E00000180FE00000000FE00000000FE00000000FE00000000FE00000000FE
-00000000FE00000000FE000000007E000000007E000001807F000001803F000001803F00000380
-1F800003000F8000030007C000060003F0000C0001F800380000FF00F000001FFFC0000003FE00
-0021227DA128>67 D<FFFFFF8000FFFFFFF00007F003FC0007F0007E0007F0003F0007F0001F80
-07F0000FC007F00007E007F00007E007F00007F007F00003F007F00003F007F00003F007F00003
-F807F00003F807F00003F807F00003F807F00003F807F00003F807F00003F807F00003F807F000
-03F807F00003F007F00003F007F00003F007F00007E007F00007E007F0000FC007F0001F8007F0
-003F0007F0007E0007F003FC00FFFFFFF000FFFFFF800025227EA12B>I<FFFFFFFCFFFFFFFC07
-F000FC07F0003C07F0001C07F0000C07F0000E07F0000E07F0000607F0180607F0180607F01806
-07F0180007F0380007F0780007FFF80007FFF80007F0780007F0380007F0180007F0180007F018
-0307F0180307F0000307F0000607F0000607F0000607F0000E07F0000E07F0001E07F0003E07F0
-01FCFFFFFFFCFFFFFFFC20227EA125>I<FFFFFFF8FFFFFFF807F001F807F0007807F0003807F0
-001807F0001C07F0001C07F0000C07F0000C07F0180C07F0180C07F0180007F0180007F0380007
-F0780007FFF80007FFF80007F0780007F0380007F0180007F0180007F0180007F0180007F00000
-07F0000007F0000007F0000007F0000007F0000007F0000007F00000FFFFE000FFFFE0001E227E
-A123>I<FFFF83FFFEFFFF83FFFE07F0001FC007F0001FC007F0001FC007F0001FC007F0001FC0
-07F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001F
-C007FFFFFFC007FFFFFFC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F000
-1FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0
-001FC007F0001FC0FFFF83FFFEFFFF83FFFE27227EA12C>72 D<FFFFE0FFFFE003F80003F80003
-F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003
-F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003
-F80003F800FFFFE0FFFFE013227FA115>I<FFFFE000FFFFE00007F0000007F0000007F0000007
+F80001F80001F80001F80001F80001F80001F80001F80001F8007FFFE07FFFE013207C9F1C>49
+D<03FC000FFF003C1FC07007E07C07F0FE03F0FE03F8FE03F8FE01F87C01F83803F80003F80003
+F00003F00007E00007C0000F80001F00003E0000380000700000E01801C0180380180700180E00
+380FFFF01FFFF03FFFF07FFFF0FFFFF0FFFFF015207D9F1C>I<00FE0007FFC00F07E01E03F03F
+03F03F81F83F81F83F81F81F03F81F03F00003F00003E00007C0001F8001FE0001FF000007C000
+01F00001F80000FC0000FC3C00FE7E00FEFF00FEFF00FEFF00FEFF00FC7E01FC7801F81E07F00F
+FFC001FE0017207E9F1C>I<0000E00001E00003E00003E00007E0000FE0001FE0001FE00037E0
+0077E000E7E001C7E00187E00307E00707E00E07E00C07E01807E03807E07007E0E007E0FFFFFE
+FFFFFE0007E00007E00007E00007E00007E00007E00007E000FFFE00FFFE17207E9F1C>I<1000
+201E01E01FFFC01FFF801FFF001FFE001FF8001BC00018000018000018000018000019FC001FFF
+001E0FC01807E01803E00003F00003F00003F80003F83803F87C03F8FE03F8FE03F8FC03F0FC03
+F07007E03007C01C1F800FFF0003F80015207D9F1C>I<001F8000FFE003F07007C0F00F01F81F
+01F83E01F83E01F87E00F07C00007C0000FC0800FC7FC0FCFFE0FD80F0FF00F8FE007CFE007CFC
+007EFC007EFC007EFC007E7C007E7C007E7C007E3C007C3E007C1E00F80F00F00783E003FFC000
+FF0017207E9F1C>I<6000007800007FFFFE7FFFFE7FFFFC7FFFF87FFFF87FFFF0E00060E000C0
+C00180C00300C00300000600000C00001C0000180000380000780000780000F00000F00000F000
+01F00001F00001F00003F00003F00003F00003F00003F00003F00003F00001E00017227DA11C>
+I<00FE0003FFC00601E00C00701800701800383800383C00383F00383F80783FE0701FF8E01FFF
+C00FFF8007FFC003FFE007FFF01E7FF83C1FFC7807FC7801FEF000FEF0003EF0001EF0001EF000
+1CF8001C7800383C00381F01F00FFFC001FF0017207E9F1C>I<000070000000007000000000F8
+00000000F800000000F800000001FC00000001FC00000003FE00000003FE00000003FE00000006
+FF000000067F0000000E7F8000000C3F8000000C3F800000183FC00000181FC00000381FE00000
+300FE00000300FE00000600FF000006007F00000E007F80000FFFFF80000FFFFF800018001FC00
+018001FC00038001FE00030000FE00030000FE000600007F000600007F00FFE00FFFF8FFE00FFF
+F825227EA12A>65 D<0003FE0080001FFF818000FF01E38001F8003F8003E0001F8007C0000F80
+0F800007801F800007803F000003803F000003807F000001807E000001807E00000180FE000000
+00FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE000000007E0000
+00007E000001807F000001803F000001803F000003801F800003000F8000030007C000060003F0
+000C0001F800380000FF00F000001FFFC0000003FE000021227DA128>67
+D<FFFFFF8000FFFFFFF00007F003FC0007F0007E0007F0003F0007F0001F8007F0000FC007F000
+07E007F00007E007F00007F007F00003F007F00003F007F00003F007F00003F807F00003F807F0
+0003F807F00003F807F00003F807F00003F807F00003F807F00003F807F00003F807F00003F007
+F00003F007F00003F007F00007E007F00007E007F0000FC007F0001F8007F0003F0007F0007E00
+07F003FC00FFFFFFF000FFFFFF800025227EA12B>I<FFFFFFFCFFFFFFFC07F000FC07F0003C07
+F0001C07F0000C07F0000E07F0000E07F0000607F0180607F0180607F0180607F0180007F03800
+07F0780007FFF80007FFF80007F0780007F0380007F0180007F0180007F0180307F0180307F000
+0307F0000607F0000607F0000607F0000E07F0000E07F0001E07F0003E07F001FCFFFFFFFCFFFF
+FFFC20227EA125>I<FFFFFFF8FFFFFFF807F001F807F0007807F0003807F0001807F0001C07F0
+001C07F0000C07F0000C07F0180C07F0180C07F0180007F0180007F0380007F0780007FFF80007
+FFF80007F0780007F0380007F0180007F0180007F0180007F0180007F0000007F0000007F00000
+07F0000007F0000007F0000007F0000007F00000FFFFE000FFFFE0001E227EA123>I<FFFF83FF
+FEFFFF83FFFE07F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F000
+1FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007FFFFFFC007FF
+FFFFC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007
+F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC007F0001FC0
+FFFF83FFFEFFFF83FFFE27227EA12C>72 D<FFFFE0FFFFE003F80003F80003F80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800
+03F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F80003F800FFFFE0
+FFFFE013227FA115>I<FFFFE000FFFFE00007F0000007F0000007F0000007F0000007F0000007
F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F00000
-07F0000007F0000007F0000007F0000007F0000007F0000007F0001807F0001807F0001807F000
-1807F0003807F0003807F0007007F0007007F000F007F001F007F007F0FFFFFFF0FFFFFFF01D22
-7EA122>76 D<FFF000000FFFFFF800001FFF07F800001FE006FC000037E006FC000037E006FC00
-0037E0067E000067E0067E000067E0063F0000C7E0063F0000C7E0061F800187E0061F800187E0
-060FC00307E0060FC00307E0060FC00307E00607E00607E00607E00607E00603F00C07E00603F0
-0C07E00601F81807E00601F81807E00601F81807E00600FC3007E00600FC3007E006007E6007E0
-06007E6007E006003FC007E006003FC007E006001F8007E006001F8007E006001F8007E006000F
-0007E0FFF00F00FFFFFFF00600FFFF30227EA135>I<0007FC0000003FFF800000FC07E00003F0
-01F80007E000FC000FC0007E001F80003F001F80003F003F00001F803F00001F807F00001FC07E
-00000FC07E00000FC0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0
-FE00000FE0FE00000FE0FE00000FE07E00000FC07F00001FC07F00001FC03F00001F803F80003F
-801F80003F000FC0007E0007E000FC0003F001F80000FC07E000003FFF80000007FC000023227D
-A12A>79 D<FFFFFF00FFFFFFE007F007F007F001FC07F000FC07F0007E07F0007E07F0007F07F0
-007F07F0007F07F0007F07F0007F07F0007E07F0007E07F000FC07F001FC07F007F007FFFFE007
-FFFF0007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F00000
-07F0000007F0000007F0000007F00000FFFF8000FFFF800020227EA126>I<01FC0407FF8C1F03
-FC3C007C7C003C78001C78001CF8000CF8000CFC000CFC0000FF0000FFE0007FFF007FFFC03FFF
-F01FFFF80FFFFC03FFFE003FFE0003FF00007F00003F00003FC0001FC0001FC0001FE0001EE000
-1EF0003CFC003CFF00F8C7FFE080FF8018227DA11F>83 D<7FFFFFFF807FFFFFFF807E03F80F80
-7803F807807003F803806003F80180E003F801C0E003F801C0C003F800C0C003F800C0C003F800
-C0C003F800C00003F800000003F800000003F800000003F800000003F800000003F800000003F8
-00000003F800000003F800000003F800000003F800000003F800000003F800000003F800000003
-F800000003F800000003F800000003F800000003F800000003F8000003FFFFF80003FFFFF80022
-227EA127>I<FFFF800FFEFFFF800FFE07F00000C007F80000C003F800018003F800018001FC00
-030001FC00030001FE00070000FE00060000FF000600007F000C00007F800C00003F801800003F
-801800003FC03800001FC03000001FE03000000FE06000000FF060000007F0C0000007F0C00000
-07F9C0000003F980000003FD80000001FF00000001FF00000000FE00000000FE00000000FE0000
-00007C000000007C00000000380000000038000027227FA12A>86 D<07FC001FFF803F07C03F03
-E03F01E03F01F01E01F00001F00001F0003FF003FDF01FC1F03F01F07E01F0FC01F0FC01F0FC01
-F0FC01F07E02F07E0CF81FF87F07E03F18167E951B>97 D<FF000000FF0000001F0000001F0000
-001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0F
-E0001F3FF8001FF07C001F801E001F001F001F000F801F000F801F000FC01F000FC01F000FC01F
-000FC01F000FC01F000FC01F000FC01F000FC01F000F801F001F801F801F001FC03E001EE07C00
-1C3FF800180FC0001A237EA21F>I<00FF8007FFE00F83F01F03F03E03F07E03F07C01E07C0000
-FC0000FC0000FC0000FC0000FC0000FC00007C00007E00007E00003E00301F00600FC0E007FF80
-00FE0014167E9519>I<0001FE000001FE0000003E0000003E0000003E0000003E0000003E0000
-003E0000003E0000003E0000003E0000003E0000003E0001FC3E0007FFBE000F81FE001F007E00
-3E003E007E003E007C003E00FC003E00FC003E00FC003E00FC003E00FC003E00FC003E00FC003E
-00FC003E007C003E007C003E003E007E001E00FE000F83BE0007FF3FC001FC3FC01A237EA21F>
-I<00FE0007FF800F87C01E01E03E01F07C00F07C00F8FC00F8FC00F8FFFFF8FFFFF8FC0000FC00
-00FC00007C00007C00007E00003E00181F00300FC07003FFC000FF0015167E951A>I<003F8000
-FFC001E3E003C7E007C7E00F87E00F83C00F80000F80000F80000F80000F80000F8000FFFC00FF
-FC000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F
-80000F80000F80000F80000F80000F80007FF8007FF80013237FA211>I<03FC1E0FFF7F1F0F8F
-3E07CF3C03C07C03E07C03E07C03E07C03E07C03E03C03C03E07C01F0F801FFF0013FC00300000
-3000003800003FFF801FFFF00FFFF81FFFFC3800FC70003EF0001EF0001EF0001EF0001E78003C
-7C007C3F01F80FFFE001FF0018217E951C>I<FF000000FF0000001F0000001F0000001F000000
-1F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F07E0001F1FF8
-001F307C001F403C001F803E001F803E001F003E001F003E001F003E001F003E001F003E001F00
-3E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E00FFE1FFC0FF
-E1FFC01A237EA21F>I<1C003F007F007F007F003F001C000000000000000000000000000000FF
-00FF001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F00
-FFE0FFE00B247EA310>I<0038007C00FE00FE00FE007C00380000000000000000000000000000
-03FE03FE003E003E003E003E003E003E003E003E003E003E003E003E003E003E003E003E003E00
-3E003E003E003E003E003E783EFC3EFC3CFC7C78F87FE01F800F2E83A311>I<FF00FF001F001F
+07F0000007F0000007F0000007F0000007F0001807F0001807F0001807F0001807F0003807F000
+3807F0007007F0007007F000F007F001F007F007F0FFFFFFF0FFFFFFF01D227EA122>76
+D<FFF000000FFFFFF800001FFF07F800001FE006FC000037E006FC000037E006FC000037E0067E
+000067E0067E000067E0063F0000C7E0063F0000C7E0061F800187E0061F800187E0060FC00307
+E0060FC00307E0060FC00307E00607E00607E00607E00607E00603F00C07E00603F00C07E00601
+F81807E00601F81807E00601F81807E00600FC3007E00600FC3007E006007E6007E006007E6007
+E006003FC007E006003FC007E006001F8007E006001F8007E006001F8007E006000F0007E0FFF0
+0F00FFFFFFF00600FFFF30227EA135>I<0007FC0000003FFF800000FC07E00003F001F80007E0
+00FC000FC0007E001F80003F001F80003F003F00001F803F00001F807F00001FC07E00000FC07E
+00000FC0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0FE00000FE0
+FE00000FE0FE00000FE07E00000FC07F00001FC07F00001FC03F00001F803F80003F801F80003F
+000FC0007E0007E000FC0003F001F80000FC07E000003FFF80000007FC000023227DA12A>79
+D<FFFFFF00FFFFFFE007F007F007F001FC07F000FC07F0007E07F0007E07F0007F07F0007F07F0
+007F07F0007F07F0007F07F0007E07F0007E07F000FC07F001FC07F007F007FFFFE007FFFF0007
+F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F0000007F00000
+07F0000007F0000007F00000FFFF8000FFFF800020227EA126>I<01FC0407FF8C1F03FC3C007C
+7C003C78001C78001CF8000CF8000CFC000CFC0000FF0000FFE0007FFF007FFFC03FFFF01FFFF8
+0FFFFC03FFFE003FFE0003FF00007F00003F00003FC0001FC0001FC0001FE0001EE0001EF0003C
+FC003CFF00F8C7FFE080FF8018227DA11F>83 D<7FFFFFFF807FFFFFFF807E03F80F807803F807
+807003F803806003F80180E003F801C0E003F801C0C003F800C0C003F800C0C003F800C0C003F8
+00C00003F800000003F800000003F800000003F800000003F800000003F800000003F800000003
+F800000003F800000003F800000003F800000003F800000003F800000003F800000003F8000000
+03F800000003F800000003F800000003F800000003F8000003FFFFF80003FFFFF80022227EA127
+>I<FFFF800FFEFFFF800FFE07F00000C007F80000C003F800018003F800018001FC00030001FC
+00030001FE00070000FE00060000FF000600007F000C00007F800C00003F801800003F80180000
+3FC03800001FC03000001FE03000000FE06000000FF060000007F0C0000007F0C0000007F9C000
+0003F980000003FD80000001FF00000001FF00000000FE00000000FE00000000FE000000007C00
+0000007C00000000380000000038000027227FA12A>86 D<07FC001FFF803F07C03F03E03F01E0
+3F01F01E01F00001F00001F0003FF003FDF01FC1F03F01F07E01F0FC01F0FC01F0FC01F0FC01F0
+7E02F07E0CF81FF87F07E03F18167E951B>97 D<FF000000FF0000001F0000001F0000001F0000
+001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0FE0001F3F
+F8001FF07C001F801E001F001F001F000F801F000F801F000FC01F000FC01F000FC01F000FC01F
+000FC01F000FC01F000FC01F000FC01F000F801F001F801F801F001FC03E001EE07C001C3FF800
+180FC0001A237EA21F>I<00FF8007FFE00F83F01F03F03E03F07E03F07C01E07C0000FC0000FC
+0000FC0000FC0000FC0000FC00007C00007E00007E00003E00301F00600FC0E007FF8000FE0014
+167E9519>I<0001FE000001FE0000003E0000003E0000003E0000003E0000003E0000003E0000
+003E0000003E0000003E0000003E0000003E0001FC3E0007FFBE000F81FE001F007E003E003E00
+7E003E007C003E00FC003E00FC003E00FC003E00FC003E00FC003E00FC003E00FC003E00FC003E
+007C003E007C003E003E007E001E00FE000F83BE0007FF3FC001FC3FC01A237EA21F>I<00FE00
+07FF800F87C01E01E03E01F07C00F07C00F8FC00F8FC00F8FFFFF8FFFFF8FC0000FC0000FC0000
+7C00007C00007E00003E00181F00300FC07003FFC000FF0015167E951A>I<03FC1E0FFF7F1F0F
+8F3E07CF3C03C07C03E07C03E07C03E07C03E07C03E03C03C03E07C01F0F801FFF0013FC003000
+003000003800003FFF801FFFF00FFFF81FFFFC3800FC70003EF0001EF0001EF0001EF0001E7800
+3C7C007C3F01F80FFFE001FF0018217E951C>103 D<FF000000FF0000001F0000001F0000001F
+0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F07E000
+1F1FF8001F307C001F403C001F803E001F803E001F003E001F003E001F003E001F003E001F003E
+001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E00FFE1
+FFC0FFE1FFC01A237EA21F>I<1C003F007F007F007F003F001C00000000000000000000000000
+0000FF00FF001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F
+001F00FFE0FFE00B247EA310>I<0038007C00FE00FE00FE007C00380000000000000000000000
+00000003FE03FE003E003E003E003E003E003E003E003E003E003E003E003E003E003E003E003E
+003E003E003E003E003E003E003E783EFC3EFC3CFC7C78F87FE01F800F2E83A311>I<FF000000
+FF0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F0000
+001F0000001F0000001F00FF801F00FF801F0038001F0060001F01C0001F0380001F0700001F0E
+00001F1C00001F7E00001FFF00001FCF00001F0F80001F07C0001F03E0001F01E0001F01F0001F
+00F8001F007C001F003C00FFE0FFC0FFE0FFC01A237EA21E>I<FF00FF001F001F001F001F001F
001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F00
-1F001F001F001F001F001F001F001F001F001F00FFE0FFE00B237EA210>108
-D<FF07F007F000FF1FFC1FFC001F303E303E001F403E403E001F801F801F001F801F801F001F00
-1F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F
+1F001F001F001F001F001F001F00FFE0FFE00B237EA210>I<FF07F007F000FF1FFC1FFC001F30
+3E303E001F403E403E001F801F801F001F801F801F001F001F001F001F001F001F001F001F001F
001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F00
-1F001F00FFE0FFE0FFE0FFE0FFE0FFE02B167E9530>I<FF07E000FF1FF8001F307C001F403C00
-1F803E001F803E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E
-001F003E001F003E001F003E001F003E001F003E001F003E00FFE1FFC0FFE1FFC01A167E951F>
-I<00FE0007FFC00F83E01E00F03E00F87C007C7C007C7C007CFC007EFC007EFC007EFC007EFC00
-7EFC007EFC007E7C007C7C007C3E00F81F01F00F83E007FFC000FE0017167E951C>I<FF0FE000
-FF3FF8001FF07C001F803E001F001F001F001F801F001F801F000FC01F000FC01F000FC01F000F
-C01F000FC01F000FC01F000FC01F000FC01F001F801F001F801F803F001FC03E001FE0FC001F3F
-F8001F0FC0001F0000001F0000001F0000001F0000001F0000001F0000001F0000001F000000FF
-E00000FFE000001A207E951F>I<FE1F00FE3FC01E67E01EC7E01E87E01E87E01F83C01F00001F
-00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F0000FFF000FF
-F00013167E9517>114 D<0FF3003FFF00781F00600700E00300E00300F00300FC00007FE0007F
-F8003FFE000FFF0001FF00000F80C00780C00380E00380E00380F00700FC0E00EFFC00C7F00011
-167E9516>I<0180000180000180000180000380000380000780000780000F80003F8000FFFF00
-FFFF000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F8180
-0F81800F81800F81800F81800F830007C30003FE0000F80011207F9F16>I<FF01FE00FF01FE00
-1F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E
-001F003E001F003E001F003E001F003E001F003E001F007E001F00FE000F81BE0007FF3FC001FC
-3FC01A167E951F>I<FFE01FE0FFE01FE00F8006000F8006000FC00E0007C00C0007E01C0003E0
-180003E0180001F0300001F0300000F8600000F86000007CC000007CC000007FC000003F800000
-3F8000001F0000001F0000000E0000000E00001B167F951E>I<FFE7FF07F8FFE7FF07F81F0078
-00C00F807801800F807C01800F807C018007C07E030007C0DE030007E0DE070003E0DF060003E1
-8F060001F18F0C0001F38F8C0001FB079C0000FB07D80000FE03D800007E03F000007E03F00000
-7C01F000003C01E000003800E000001800C00025167F9528>I<FFE07FC0FFE07FC00F801C0007
-C0380003E0700003F0600001F8C00000F98000007F8000003F0000001F0000001F8000003FC000
-0037C0000063E00000C1F00001C0F8000380FC0007007E000E003E00FF80FFE0FF80FFE01B167F
-951E>I E /Fc 1 98 df<03CC0E2E181C381C301C701CE038E038E038E038C072C072C07260F2
-61341E180F107C8F14>97 D E /Fd 2 104 df<007001C0038007000700070007000700070007
-000700070007000700070007000E001C00F0001C000E0007000700070007000700070007000700
-07000700070007000700038001C000700C257D9B13>102 D<F0001C000E000700070007000700
-070007000700070007000700070007000700038001C0007001C003800700070007000700070007
-0007000700070007000700070007000E001C00F0000C257D9B13>I E /Fe
-34 122 df<00FC000182000703000607000E02000E00000E00000E00000E00000E0000FFFF000E
-07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E
-07007F0FE0131A809915>12 D<60F0F868080808101020C0050B7D990B>39
+1F001F001F001F001F001F001F001F001F001F001F001F001F001F00FFE0FFE0FFE0FFE0FFE0FF
+E02B167E9530>I<FF07E000FF1FF8001F307C001F403C001F803E001F803E001F003E001F003E
+001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F00
+3E001F003E001F003E00FFE1FFC0FFE1FFC01A167E951F>I<00FE0007FFC00F83E01E00F03E00
+F87C007C7C007C7C007CFC007EFC007EFC007EFC007EFC007EFC007EFC007E7C007C7C007C3E00
+F81F01F00F83E007FFC000FE0017167E951C>I<FF0FE000FF3FF8001FF07C001F803E001F001F
+001F001F801F001F801F000FC01F000FC01F000FC01F000FC01F000FC01F000FC01F000FC01F00
+0FC01F001F801F001F801F803F001FC03E001FE0FC001F3FF8001F0FC0001F0000001F0000001F
+0000001F0000001F0000001F0000001F0000001F000000FFE00000FFE000001A207E951F>I<FE
+1F00FE3FC01E67E01EC7E01E87E01E87E01F83C01F00001F00001F00001F00001F00001F00001F
+00001F00001F00001F00001F00001F00001F0000FFF000FFF00013167E9517>114
+D<0FF3003FFF00781F00600700E00300E00300F00300FC00007FE0007FF8003FFE000FFF0001FF
+00000F80C00780C00380E00380E00380F00700FC0E00EFFC00C7F00011167E9516>I<01800001
+80000180000180000380000380000780000780000F80003F8000FFFF00FFFF000F80000F80000F
+80000F80000F80000F80000F80000F80000F80000F80000F80000F81800F81800F81800F81800F
+81800F830007C30003FE0000F80011207F9F16>I<FF01FE00FF01FE001F003E001F003E001F00
+3E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F003E001F
+003E001F003E001F003E001F007E001F00FE000F81BE0007FF3FC001FC3FC01A167E951F>I<FF
+E01FE0FFE01FE00F8006000F8006000FC00E0007C00C0007E01C0003E0180003E0180001F03000
+01F0300000F8600000F86000007CC000007CC000007FC000003F8000003F8000001F0000001F00
+00000E0000000E00001B167F951E>I<FFE7FF07F8FFE7FF07F81F007800C00F807801800F807C
+01800F807C018007C07E030007C0DE030007E0DE070003E0DF060003E18F060001F18F0C0001F3
+8F8C0001FB079C0000FB07D80000FE03D800007E03F000007E03F000007C01F000003C01E00000
+3800E000001800C00025167F9528>I<FFE07FC0FFE07FC00F801C0007C0380003E0700003F060
+0001F8C00000F98000007F8000003F0000001F0000001F8000003FC0000037C0000063E00000C1
+F00001C0F8000380FC0007007E000E003E00FF80FFE0FF80FFE01B167F951E>I
+E /Fe 4 112 df<03CC0E2E181C381C301C701CE038E038E038E038C072C072C07260F261341E
+180F107C8F14>97 D<307C1E00598663009E0783809E0703809C0703809C070380380E0700380E
+0700380E0700380E0E00701C0E40701C0E40701C1C40701C1C80E0380C80601807001A107C8F1F
+>109 D<307C005986009E07009E07009C07009C0700380E00380E00380E00381C00701C80701C
+80703880703900E01900600E0011107C8F16>I<01F006180C0C180E300E700E600EE00EE00EE0
+0CE01CE018E030606030C01F000F107C8F14>I E /Ff 2 104 df<007001C00380070007000700
+07000700070007000700070007000700070007000E001C00F0001C000E00070007000700070007
+0007000700070007000700070007000700038001C000700C257D9B13>102
+D<F0001C000E000700070007000700070007000700070007000700070007000700038001C00070
+01C0038007000700070007000700070007000700070007000700070007000E001C00F0000C257D
+9B13>I E /Fg 35 122 df<00FC000182000703000607000E02000E00000E00000E00000E0000
+0E0000FFFF000E07000E07000E07000E07000E07000E07000E07000E07000E07000E07000E0700
+0E07000E07000E07007F0FE0131A809915>12 D<60F0F868080808101020C0050B7D990B>39
D<60F0F07010101020204080040B7D830B>44 D<60F0F06004047D830B>46
D<078018603030303060186018E01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01CE01C6018
601870383030186007800E187E9713>48 D<0F8010E02070607870382038007800700070006000
@@ -214,419 +226,640 @@ D<000C0000000C0000000C0000001E0000001E0000003F00000027000000270000004380000043
007800040038000400380008001C0008001C001C001E00FF00FFC01A1A7F991D>65
D<FFFF000E01C00E00E00E00700E00780E00780E00780E00780E00780E00F00E00E00E03C00FFF
800E01E00E00700E00780E003C0E003C0E003C0E003C0E003C0E00380E00780E00F00E01E0FFFF
-80161A7E991B>I<FFFFE00E00E00E00600E00200E00300E00100E00100E00100E04000E04000E
-04000E0C000FFC000E0C000E04000E04000E04000E00000E00000E00000E00000E00000E00000E
-00000E0000FFF000141A7E9919>70 D<FE01FF0F00380F00100B80100B801009C01008E01008E0
-10087010087010083810081C10081C10080E10080E100807100803900803900801D00801D00800
-F00800700800700800301C0030FF8010181A7E991D>78 D<0FC21836200E6006C006C002C002C0
+80161A7E991B>I<FFF0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00000E00000E00000E00200E00200E00200E00600E00400E00400E
+00C00E03C0FFFFC0131A7E9918>76 D<FFFF000E03C00E00E00E00700E00700E00780E00780E00
+780E00780E00700E00700E00E00E03C00FFF000E00000E00000E00000E00000E00000E00000E00
+000E00000E00000E00000E0000FFE000151A7E991A>80 D<0FC21836200E6006C006C002C002C0
02E00070007E003FE01FF807FC003E000E00070003800380038003C002C006E004D81887E0101A
-7E9915>83 D<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
-C0C0FEFE07257D9B0B>91 D<FEFE06060606060606060606060606060606060606060606060606
-0606060606060606FEFE0725809B0B>93 D<3F8070C070E020700070007007F01C7030707070E0
-70E071E071E0F171FB1E3C10107E8F13>97 D<FC00001C00001C00001C00001C00001C00001C00
-001C00001C00001C00001CF8001F0E001E07001C03801C01801C01C01C01C01C01C01C01C01C01
-C01C01C01C03801C03001E07001B0C0010F000121A7F9915>I<07F80C1C381C30087000E000E0
-00E000E000E000E0007000300438080C1807E00E107F8F11>I<007E00000E00000E00000E0000
-0E00000E00000E00000E00000E00000E0003CE000C3E00380E00300E00700E00E00E00E00E00E0
-0E00E00E00E00E00E00E00600E00700E00381E001C2E0007CFC0121A7F9915>I<07C01C303018
-7018600CE00CFFFCE000E000E000E0006000300438080C1807E00E107F8F11>I<01F003180738
-0E100E000E000E000E000E000E00FFC00E000E000E000E000E000E000E000E000E000E000E000E
-000E000E007FE00D1A80990C>I<0FCE187330307038703870387038303018602FC02000600070
-003FF03FFC1FFE600FC003C003C003C0036006381C07E010187F8F13>I<18003C003C00180000
-0000000000000000000000FC001C001C001C001C001C001C001C001C001C001C001C001C001C00
-1C00FF80091A80990A>105 D<FC001C001C001C001C001C001C001C001C001C001C001C001C00
-1C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A>108
-D<FC7C1F001D8E63801E0781C01E0781C01C0701C01C0701C01C0701C01C0701C01C0701C01C07
-01C01C0701C01C0701C01C0701C01C0701C01C0701C0FF9FE7F81D107F8F20>I<FCF8001D0C00
-1E0E001E0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E00
-FF9FC012107F8F15>I<07E01C38300C700E6006E007E007E007E007E007E0076006700E381C1C
-3807E010107F8F13>I<FCF8001F0E001E07001C03801C03801C01C01C01C01C01C01C01C01C01
-C01C01C01C03801C03001E07001F0C001CF0001C00001C00001C00001C00001C00001C0000FF80
-0012177F8F15>I<FCE01D701E701E201C001C001C001C001C001C001C001C001C001C001C00FF
-C00C107F8F0F>114 D<1F2060E04020C020C020F0007F003FC01FE000F080708030C030C020F0
-408F800C107F8F0F>I<0400040004000C000C001C003C00FFC01C001C001C001C001C001C001C
-001C001C201C201C201C201C200E4003800B177F960F>I<FC7E001C0E001C0E001C0E001C0E00
-1C0E001C0E001C0E001C0E001C0E001C0E001C0E001C0E001C1E000C2E0007CFC012107F8F15>
-I<FF1F803C06001C04001C04001E0C000E08000E080007100007100007900003A00003A00001C0
-0001C00001C00000800011107F8F14>I<FF3F803C1C001C18000E100007200007600003C00001
-C00001E00003E000027000043800083800181C00381E00FC3FC012107F8F14>120
-D<FF1F803C06001C04001C04001E0C000E08000E080007100007100007900003A00003A00001C0
-0001C00001C000008000008000010000010000E10000E20000E4000078000011177F8F14>I
-E /Ff 3 51 df<00C00000C00000C00000C00000C00000C00000C00000C00000C000FFFF80FFFF
-8000C00000C00000C00000C00000C00000C00000C00000C00000C00011147E8F17>43
-D<0C003C00CC000C000C000C000C000C000C000C000C000C000C000C000C00FF8009107E8F0F>
-49 D<1F00618040C08060C0600060006000C00180030006000C00102020207FC0FFC00B107F8F
-0F>I E /Fg 5 107 df<07E01FF83FFC7FFE7FFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFE7F
-FE3FFC1FF807E010127D9317>15 D<000000040000000002000000000200000000010000000000
-8000000000400000000020FFFFFFFFFCFFFFFFFFFC000000002000000000400000000080000000
-010000000002000000000200000000040026107D922D>33 D<000F0038006000E001C001C001C0
-01C001C001C001C001C001C001C001C001C001C001C001C0038007001E00F8001E000700038001
-C001C001C001C001C001C001C001C001C001C001C001C001C001C001C000E000600038000F102D
-7DA117>102 D<F8001E000700038001C001C001C001C001C001C001C001C001C001C001C001C0
-01C001C001C000E000600038000F0038006000E001C001C001C001C001C001C001C001C001C001
-C001C001C001C001C001C0038007001E00F800102D7DA117>I<C0C0C0C0C0C0C0C0C0C0C0C0C0
-C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0022D7BA10D>
-106 D E /Fh 2 51 df<03000700FF000700070007000700070007000700070007000700070007
-00070007000700070007007FF00C157E9412>49 D<0F8030E040708030C038E038403800380070
-0070006000C00180030006000C08080810183FF07FF0FFF00D157E9412>I
-E /Fi 44 121 df<387CFEFFFF7F3B030306060E0C18702008107C9F0F>39
-D<387CFEFEFE7C3807077C860F>46 D<00E00001E0000FE000FFE000F3E00003E00003E00003E0
-0003E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E0
-0003E00003E00003E00003E00003E00003E000FFFF80FFFF80111D7C9C1A>49
-D<07F0001FFE00383F007C1F80FE0FC0FE0FC0FE0FE0FE07E07C07E03807E0000FE0000FC0000F
-C0001F80001F00003E0000780000F00000E00001C0000380600700600E00601C00E01FFFC03FFF
-C07FFFC0FFFFC0FFFFC0131D7D9C1A>I<01FC0007FF000E0F801E0FC03F07E03F07E03F07E03F
-07E01E0FC0000FC0000F80001F0001FC0001FC00000F800007C00003E00003F00003F83803F87C
-03F8FE03F8FE03F8FE03F0FC03F07807E03C0FC01FFF8003FC00151D7E9C1A>I<0001C00003C0
-0007C00007C0000FC0001FC0003BC00073C00063C000C3C00183C00383C00703C00E03C00C03C0
-1803C03803C07003C0E003C0FFFFFEFFFFFE0007C00007C00007C00007C00007C00007C000FFFE
-00FFFE171D7F9C1A>I<3803803FFF803FFF003FFE003FFC003FF0003F80003000003000003000
-0030000033F8003FFE003C1F00380F803007C00007C00007E00007E07807E0FC07E0FC07E0FC07
-E0FC07C0780FC0600F80381F001FFC0007F000131D7D9C1A>I<003F0001FFC007E0E00F81E01F
-03F01E03F03E03F07C03F07C01E07C0000FC1000FCFF00FDFFC0FD03E0FE01F0FE01F0FC01F8FC
-01F8FC01F8FC01F87C01F87C01F87C01F83C01F03E01F01E03E00F07C007FF8001FE00151D7E9C
-1A>I<6000007FFFF87FFFF87FFFF07FFFE07FFFE0E001C0C00380C00700C00E00000C00001C00
-00380000780000780000F00000F00000F00001F00001F00001F00003F00003F00003F00003F000
-03F00003F00003F00003F00001E000151E7D9D1A>I<01FC0007FF000E07801C01C01800E03800
-E03800E03C00E03F00E03FC1C01FE3801FFF000FFE0007FF8007FFC01FFFE03C3FF0780FF07803
-F8F001F8F000F8F00078F00078F000707800707C00E03E03C00FFF8003FC00151D7E9C1A>I<00
-00E000000000E000000001F000000001F000000001F000000003F800000003F800000006FC0000
-0006FC0000000EFE0000000C7E0000000C7E000000183F000000183F000000303F800000301F80
-0000701FC00000600FC00000600FC00000C007E00000FFFFE00001FFFFF000018003F000018003
-F000030001F800030001F800060001FC00060000FC000E0000FE00FFE00FFFE0FFE00FFFE0231F
-7E9E28>65 D<FFFFFE00FFFFFFC007C007E007C003F007C001F807C001FC07C001FC07C001FC07
-C001FC07C001FC07C001F807C003F807C007F007C00FE007FFFF8007FFFFC007C003F007C001F8
-07C001FC07C000FC07C000FE07C000FE07C000FE07C000FE07C000FE07C000FC07C001FC07C003
-F807C007F0FFFFFFE0FFFFFF001F1F7E9E25>I<0007FC02003FFF0E00FE03DE03F000FE07E000
-3E0FC0001E1F80001E3F00000E3F00000E7F0000067E0000067E000006FE000000FE000000FE00
-0000FE000000FE000000FE000000FE0000007E0000007E0000067F0000063F0000063F00000C1F
-80000C0FC0001807E0003803F0007000FE01C0003FFF800007FC001F1F7D9E26>I<FFFFFE0000
-FFFFFFC00007E007F00007E001F80007E000FC0007E0007E0007E0003F0007E0003F0007E0001F
-8007E0001F8007E0001F8007E0001FC007E0001FC007E0001FC007E0001FC007E0001FC007E000
-1FC007E0001FC007E0001FC007E0001FC007E0001F8007E0001F8007E0001F8007E0003F0007E0
-003F0007E0007E0007E000FC0007E001F80007E007F000FFFFFFC000FFFFFE0000221F7E9E28>
-I<FFFFFFE0FFFFFFE007E007E007E001E007E000E007E0006007E0007007E0003007E0003007E0
-603007E0603007E0600007E0E00007E1E00007FFE00007FFE00007E1E00007E0E00007E0600007
-E0600C07E0600C07E0000C07E0001807E0001807E0001807E0003807E0007807E000F807E003F0
-FFFFFFF0FFFFFFF01E1F7E9E22>I<FFFFFFE0FFFFFFE007E007E007E001E007E000E007E00060
-07E0007007E0003007E0003007E0603007E0603007E0600007E0E00007E1E00007FFE00007FFE0
-0007E1E00007E0E00007E0600007E0600007E0600007E0000007E0000007E0000007E0000007E0
-000007E0000007E0000007E00000FFFF8000FFFF80001C1F7E9E21>I<FFFFFFFF07E007E007E0
+7E9915>83 D<7FFFFF00701C0700401C0100401C0100C01C0180801C0080801C0080801C008000
+1C0000001C0000001C0000001C0000001C0000001C0000001C0000001C0000001C0000001C0000
+001C0000001C0000001C0000001C0000001C0000001C0000001C000003FFE000191A7F991C>I<
+FF83FF0FF03C007801C01C007800801C007800800E007801000E007801000E009C010007009C02
+0007009C020007010E020007010E020003810E04000382070400038207040001C207080001C403
+880001C403880000E403900000E403900000E801D000007801E000007801E000007000E0000070
+00E000003000C0000020004000241A7F9927>87 D<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
+C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0FEFE07257D9B0B>91 D<FEFE06060606060606060606
+0606060606060606060606060606060606060606060606FEFE0725809B0B>93
+D<3F8070C070E020700070007007F01C7030707070E070E071E071E0F171FB1E3C10107E8F13>
+97 D<FC00001C00001C00001C00001C00001C00001C00001C00001C00001C00001CF8001F0E00
+1E07001C03801C01801C01C01C01C01C01C01C01C01C01C01C01C01C03801C03001E07001B0C00
+10F000121A7F9915>I<07F80C1C381C30087000E000E000E000E000E000E0007000300438080C
+1807E00E107F8F11>I<007E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+0003CE000C3E00380E00300E00700E00E00E00E00E00E00E00E00E00E00E00E00E00600E00700E
+00381E001C2E0007CFC0121A7F9915>I<07C01C3030187018600CE00CFFFCE000E000E000E000
+6000300438080C1807E00E107F8F11>I<01F0031807380E100E000E000E000E000E000E00FFC0
+0E000E000E000E000E000E000E000E000E000E000E000E000E000E007FE00D1A80990C>I<0FCE
+187330307038703870387038303018602FC02000600070003FF03FFC1FFE600FC003C003C003C0
+036006381C07E010187F8F13>I<18003C003C001800000000000000000000000000FC001C001C
+001C001C001C001C001C001C001C001C001C001C001C001C00FF80091A80990A>105
+D<FC001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C00
+1C001C001C001C001C001C00FF80091A80990A>108 D<FC7C1F001D8E63801E0781C01E0781C0
+1C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701C01C0701
+C01C0701C0FF9FE7F81D107F8F20>I<FCF8001D0C001E0E001E0E001C0E001C0E001C0E001C0E
+001C0E001C0E001C0E001C0E001C0E001C0E001C0E00FF9FC012107F8F15>I<07E01C38300C70
+0E6006E007E007E007E007E007E0076006700E381C1C3807E010107F8F13>I<FCF8001F0E001E
+07001C03801C03801C01C01C01C01C01C01C01C01C01C01C01C01C03801C03001E07001F0C001C
+F0001C00001C00001C00001C00001C00001C0000FF800012177F8F15>I<FCE01D701E701E201C
+001C001C001C001C001C001C001C001C001C001C00FFC00C107F8F0F>114
+D<1F2060E04020C020C020F0007F003FC01FE000F080708030C030C020F0408F800C107F8F0F>
+I<0400040004000C000C001C003C00FFC01C001C001C001C001C001C001C001C001C201C201C20
+1C201C200E4003800B177F960F>I<FC7E001C0E001C0E001C0E001C0E001C0E001C0E001C0E00
+1C0E001C0E001C0E001C0E001C0E001C1E000C2E0007CFC012107F8F15>I<FF1F803C06001C04
+001C04001E0C000E08000E080007100007100007900003A00003A00001C00001C00001C0000080
+0011107F8F14>I<FF1F803C06001C04001C04001E0C000E08000E080007100007100007900003
+A00003A00001C00001C00001C000008000008000010000010000E10000E20000E4000078000011
+177F8F14>121 D E /Fh 4 52 df<00C00000C00000C00000C00000C00000C00000C00000C000
+00C000FFFF80FFFF8000C00000C00000C00000C00000C00000C00000C00000C00000C00011147E
+8F17>43 D<0C003C00CC000C000C000C000C000C000C000C000C000C000C000C000C00FF800910
+7E8F0F>49 D<1F00618040C08060C0600060006000C00180030006000C00102020207FC0FFC00B
+107F8F0F>I<1F00218060C060C000C0008001800F00008000400060C060C060804060801F000B
+107F8F0F>I E /Fi 5 107 df<07E01FF83FFC7FFE7FFEFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF
+7FFE7FFE3FFC1FF807E010127D9317>15 D<000000040000000002000000000200000000010000
+0000008000000000400000000020FFFFFFFFFCFFFFFFFFFC000000002000000000400000000080
+000000010000000002000000000200000000040026107D922D>33 D<000F0038006000E001C001
+C001C001C001C001C001C001C001C001C001C001C001C001C001C0038007001E00F8001E000700
+038001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C000E00060003800
+0F102D7DA117>102 D<F8001E000700038001C001C001C001C001C001C001C001C001C001C001
+C001C001C001C001C000E000600038000F0038006000E001C001C001C001C001C001C001C001C0
+01C001C001C001C001C001C001C0038007001E00F800102D7DA117>I<C0C0C0C0C0C0C0C0C0C0
+C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0022D7BA1
+0D>106 D E /Fj 3 52 df<03000700FF00070007000700070007000700070007000700070007
+000700070007000700070007007FF00C157E9412>49 D<0F8030E040708030C038E03840380038
+00700070006000C00180030006000C08080810183FF07FF0FFF00D157E9412>I<0FE030306018
+701C701C001C00180038006007E000300018000C000E000EE00EE00EC00C401830300FE00F157F
+9412>I E /Fk 46 121 df<3807007C0F80FE1FC0FF1FE0FF1FE07F0FE03B0760030060030060
+0600C00600C00E01C00C0180180300700E0020040013107E9F1B>34 D<387CFEFFFF7F3B030306
+060E0C18702008107C9F0F>39 D<387CFEFEFE7C3807077C860F>46 D<00E00001E0000FE000FF
+E000F3E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003
+E00003E00003E00003E00003E00003E00003E00003E00003E00003E00003E000FFFF80FFFF8011
+1D7C9C1A>49 D<07F0001FFE00383F007C1F80FE0FC0FE0FC0FE0FE0FE07E07C07E03807E0000F
+E0000FC0000FC0001F80001F00003E0000780000F00000E00001C0000380600700600E00601C00
+E01FFFC03FFFC07FFFC0FFFFC0FFFFC0131D7D9C1A>I<01FC0007FF000E0F801E0FC03F07E03F
+07E03F07E03F07E01E0FC0000FC0000F80001F0001FC0001FC00000F800007C00003E00003F000
+03F83803F87C03F8FE03F8FE03F8FE03F0FC03F07807E03C0FC01FFF8003FC00151D7E9C1A>I<
+0001C00003C00007C00007C0000FC0001FC0003BC00073C00063C000C3C00183C00383C00703C0
+0E03C00C03C01803C03803C07003C0E003C0FFFFFEFFFFFE0007C00007C00007C00007C00007C0
+0007C000FFFE00FFFE171D7F9C1A>I<3803803FFF803FFF003FFE003FFC003FF0003F80003000
+0030000030000030000033F8003FFE003C1F00380F803007C00007C00007E00007E07807E0FC07
+E0FC07E0FC07E0FC07C0780FC0600F80381F001FFC0007F000131D7D9C1A>I<003F0001FFC007
+E0E00F81E01F03F01E03F03E03F07C03F07C01E07C0000FC1000FCFF00FDFFC0FD03E0FE01F0FE
+01F0FC01F8FC01F8FC01F8FC01F87C01F87C01F87C01F83C01F03E01F01E03E00F07C007FF8001
+FE00151D7E9C1A>I<6000007FFFF87FFFF87FFFF07FFFE07FFFE0E001C0C00380C00700C00E00
+000C00001C0000380000780000780000F00000F00000F00001F00001F00001F00003F00003F000
+03F00003F00003F00003F00003F00003F00001E000151E7D9D1A>I<01FC0007FF000E07801C01
+C01800E03800E03800E03C00E03F00E03FC1C01FE3801FFF000FFE0007FF8007FFC01FFFE03C3F
+F0780FF07803F8F001F8F000F8F00078F00078F000707800707C00E03E03C00FFF8003FC00151D
+7E9C1A>I<0000E000000000E000000001F000000001F000000001F000000003F800000003F800
+000006FC00000006FC0000000EFE0000000C7E0000000C7E000000183F000000183F000000303F
+800000301F800000701FC00000600FC00000600FC00000C007E00000FFFFE00001FFFFF0000180
+03F000018003F000030001F800030001F800060001FC00060000FC000E0000FE00FFE00FFFE0FF
+E00FFFE0231F7E9E28>65 D<FFFFFE00FFFFFFC007C007E007C003F007C001F807C001FC07C001
+FC07C001FC07C001FC07C001FC07C001F807C003F807C007F007C00FE007FFFF8007FFFFC007C0
+03F007C001F807C001FC07C000FC07C000FE07C000FE07C000FE07C000FE07C000FE07C000FC07
+C001FC07C003F807C007F0FFFFFFE0FFFFFF001F1F7E9E25>I<0007FC02003FFF0E00FE03DE03
+F000FE07E0003E0FC0001E1F80001E3F00000E3F00000E7F0000067E0000067E000006FE000000
+FE000000FE000000FE000000FE000000FE000000FE0000007E0000007E0000067F0000063F0000
+063F00000C1F80000C0FC0001807E0003803F0007000FE01C0003FFF800007FC001F1F7D9E26>
+I<FFFFFE0000FFFFFFC00007E007F00007E001F80007E000FC0007E0007E0007E0003F0007E000
+3F0007E0001F8007E0001F8007E0001F8007E0001FC007E0001FC007E0001FC007E0001FC007E0
+001FC007E0001FC007E0001FC007E0001FC007E0001FC007E0001F8007E0001F8007E0001F8007
+E0003F0007E0003F0007E0007E0007E000FC0007E001F80007E007F000FFFFFFC000FFFFFE0000
+221F7E9E28>I<FFFFFFE0FFFFFFE007E007E007E001E007E000E007E0006007E0007007E00030
+07E0003007E0603007E0603007E0600007E0E00007E1E00007FFE00007FFE00007E1E00007E0E0
+0007E0600007E0600C07E0600C07E0000C07E0001807E0001807E0001807E0003807E0007807E0
+00F807E003F0FFFFFFF0FFFFFFF01E1F7E9E22>I<FFFFFFE0FFFFFFE007E007E007E001E007E0
+00E007E0006007E0007007E0003007E0003007E0603007E0603007E0600007E0E00007E1E00007
+FFE00007FFE00007E1E00007E0E00007E0600007E0600007E0600007E0000007E0000007E00000
+07E0000007E0000007E0000007E0000007E00000FFFF8000FFFF80001C1F7E9E21>I<FFFFFFFF
07E007E007E007E007E007E007E007E007E007E007E007E007E007E007E007E007E007E007E007
-E007E007E007E007E0FFFFFFFF101F7E9E14>73 D<FFFF8000FFFF800007E0000007E0000007E0
-000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007
-E0000007E0000007E0000007E0000007E0000007E000C007E000C007E000C007E001C007E001C0
-07E001C007E0038007E0038007E00F8007E01F80FFFFFF80FFFFFF801A1F7E9E1F>76
-D<001FF80000FFFF0001F81F8007E007E00FC003F01F8001F81F0000F83F0000FC7F0000FE7E00
-007E7E00007EFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE
-00007F7E00007E7F0000FE7F0000FE3F0000FC3F8001FC1F8001F80FC003F007E007E001F81F80
-00FFFF00001FF800201F7D9E27>79 D<FFFFFE00FFFFFF8007E00FE007E003F007E001F807E001
-F807E001FC07E001FC07E001FC07E001FC07E001FC07E001F807E001F807E003F007E00FE007FF
-FF8007FFFE0007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007
-E0000007E0000007E0000007E00000FFFF0000FFFF00001E1F7E9E24>I<FFFFF80000FFFFFF00
-0007E01FC00007E007E00007E003F00007E003F00007E003F80007E003F80007E003F80007E003
-F80007E003F00007E003F00007E007E00007E01FC00007FFFF000007FFFC000007E03E000007E0
-1F000007E01F800007E00FC00007E00FC00007E00FC00007E00FE00007E00FE00007E00FE00007
-E00FE03007E00FF03007E00FF07007E007F860FFFF01FFE0FFFF007F80241F7E9E27>82
+E007E007E007E007E007E007E007E0FFFFFFFF101F7E9E14>73 D<FFFF8000FFFF800007E00000
+07E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E000
+0007E0000007E0000007E0000007E0000007E0000007E0000007E000C007E000C007E000C007E0
+01C007E001C007E001C007E0038007E0038007E00F8007E01F80FFFFFF80FFFFFF801A1F7E9E1F
+>76 D<001FF80000FFFF0001F81F8007E007E00FC003F01F8001F81F0000F83F0000FC7F0000FE
+7E00007E7E00007EFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE00007FFE0000
+7FFE00007F7E00007E7F0000FE7F0000FE3F0000FC3F8001FC1F8001F80FC003F007E007E001F8
+1F8000FFFF00001FF800201F7D9E27>79 D<FFFFFE00FFFFFF8007E00FE007E003F007E001F807
+E001F807E001FC07E001FC07E001FC07E001FC07E001FC07E001F807E001F807E003F007E00FE0
+07FFFF8007FFFE0007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E000
+0007E0000007E0000007E0000007E00000FFFF0000FFFF00001E1F7E9E24>I<FFFFF80000FFFF
+FF000007E01FC00007E007E00007E003F00007E003F00007E003F80007E003F80007E003F80007
+E003F80007E003F00007E003F00007E007E00007E01FC00007FFFF000007FFFC000007E03E0000
+07E01F000007E01F800007E00FC00007E00FC00007E00FC00007E00FE00007E00FE00007E00FE0
+0007E00FE03007E00FF03007E00FF07007E007F860FFFF01FFE0FFFF007F80241F7E9E27>82
D<03FC080FFF381E03F83800F8700078700038F00038F00018F00018F80000FC00007FC0007FFE
003FFF801FFFE00FFFF007FFF000FFF80007F80000FC00007C00003CC0003CC0003CC0003CE000
38E00078F80070FE01E0E7FFC081FF00161F7D9E1D>I<7FFFFFFC7FFFFFFC7C07E07C7007E01C
6007E00C6007E00CE007E00EC007E006C007E006C007E006C007E0060007E0000007E0000007E0
000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007E0000007
-E0000007E0000007E0000007E0000007E00003FFFFC003FFFFC01F1E7E9D24>I<07FC001FFF00
-3F0F803F07C03F03E03F03E00C03E00003E0007FE007FBE01F03E03C03E07C03E0F803E0F803E0
-F803E0FC05E07E0DE03FF9FE0FE07E17147F9319>97 D<FF0000FF00001F00001F00001F00001F
-00001F00001F00001F00001F00001F00001F00001F1FC01F7FF01FE0F81F807C1F007E1F003E1F
-003E1F003F1F003F1F003F1F003F1F003F1F003F1F003E1F003E1F007C1F807C1EC1F81C7FE018
-1F8018207E9F1D>I<01FE0007FF801F0FC03E0FC03E0FC07C0FC07C0300FC0000FC0000FC0000
-FC0000FC0000FC00007C00007E00003E00603F00C01F81C007FF0001FC0013147E9317>I<0007
-F80007F80000F80000F80000F80000F80000F80000F80000F80000F80000F80000F801F8F80FFE
-F81F83F83E01F87E00F87C00F87C00F8FC00F8FC00F8FC00F8FC00F8FC00F8FC00F87C00F87C00
-F87E00F83E01F81F07F80FFEFF03F8FF18207E9F1D>I<01FE0007FF801F83E03F01F07E00F07E
-00F8FC00F8FC00F8FFFFF8FFFFF8FC0000FC0000FC00007C00007E00003E00183F00380F807007
-FFE000FF8015147F9318>I<001F8000FFC001F3E003E7E003C7E007C7E007C3C007C00007C000
-07C00007C00007C000FFFC00FFFC0007C00007C00007C00007C00007C00007C00007C00007C000
-07C00007C00007C00007C00007C00007C00007C00007C0003FFC003FFC0013207F9F10>I<01FC
-3C07FFFE0F079E1E03DE3E03E03E03E03E03E03E03E03E03E01E03C00F07800FFF0009FC001800
-001800001C00001FFF800FFFF007FFF81FFFFC3C007C70003EF0001EF0001EF0001E78003C7800
-3C3F01F80FFFE001FF00171E7F931A>I<FF0000FF00001F00001F00001F00001F00001F00001F
-00001F00001F00001F00001F00001F0FC01F3FE01F61F01FC0F81F80F81F00F81F00F81F00F81F
-00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F8FFE3FFFFE3FF18207D9F
-1D>I<1C003F007F007F007F003F001C00000000000000000000000000FF00FF001F001F001F00
-1F001F001F001F001F001F001F001F001F001F001F001F001F00FFE0FFE00B217EA00E>I<FF00
-00FF00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F01FE1F01
-FE1F00F01F01C01F03801F07001F1E001F38001F7C001FFE001FFF001F1F001E0F801E07C01E07
-E01E03F01E01F01E00F8FFC3FFFFC3FF18207E9F1C>107 D<FF00FF001F001F001F001F001F00
-1F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F
-001F001F001F00FFE0FFE00B207E9F0E>I<FE0FE03F80FE1FF07FC01E70F9C3E01E407D01F01E
-807E01F01F807E01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F0
-1F007C01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F0FFE3FF8FFEFFE3FF8F
-FE27147D932E>I<FE0FC0FE3FE01E61F01EC0F81E80F81F00F81F00F81F00F81F00F81F00F81F
-00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F8FFE3FFFFE3FF18147D931D>I<01FF00
-07FFC01F83F03E00F83E00F87C007C7C007CFC007EFC007EFC007EFC007EFC007EFC007E7C007C
-7C007C3E00F83E00F81F83F007FFC001FF0017147F931A>I<FF1FC0FF7FF01FE1F81F80FC1F00
-7E1F007E1F003E1F003F1F003F1F003F1F003F1F003F1F003F1F003E1F007E1F007C1F80FC1FC1
-F81F7FE01F1F801F00001F00001F00001F00001F00001F00001F0000FFE000FFE000181D7E931D
->I<FE3E00FE7F801ECFC01E8FC01E8FC01F8FC01F03001F00001F00001F00001F00001F00001F
-00001F00001F00001F00001F00001F0000FFF000FFF00012147E9316>114
-D<0FE63FFE701E600EE006E006F800FFC07FF83FFC1FFE03FE001FC007C007E007F006F81EFFFC
-C7F010147E9315>I<01800180018003800380038007800F803F80FFFCFFFC0F800F800F800F80
-0F800F800F800F800F800F800F860F860F860F860F8607CC03F801F00F1D7F9C14>I<FF07F8FF
-07F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F
-00F81F01F81F01F80F06F807FCFF03F8FF18147D931D>I<FFE7FE1FE0FFE7FE1FE01F00F00700
-1F00F803000F80F806000F80F8060007C1BC0C0007C1BC0C0007C1BE0C0003E31E180003E31E18
-0001F60F300001F60F300001F60FB00000FC07E00000FC07E000007803C000007803C000007803
-C000003001800023147F9326>119 D<FFE1FF00FFE1FF000F80700007C0E00007E0C00003E180
-0001F3800000FF0000007E0000003E0000003F0000007F8000006F800000C7C0000183E0000381
-F0000701F8000E00FC00FF81FF80FF81FF8019147F931C>I E /Fj 73 127
-df<70F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F870000000000070F8F8F870051C779B18>33
-D<4010E038F078E038E038E038E038E038E038E038E038E038E03860300D0E7B9C18>I<030600
-078F00078F00078F00078F00078F00078F007FFFC0FFFFE0FFFFE07FFFC00F1E000F1E000F1E00
-0F1E000F1E000F1E007FFFC0FFFFE0FFFFE07FFFC01E3C001E3C001E3C001E3C001E3C001E3C00
-0C1800131C7E9B18>I<3803007C07807C0780EE0F80EE0F00EE0F00EE1F00EE1E00EE1E00EE3E
-007C3C007C3C00387C0000780000780000F80000F00001F00001E00001E00003E00003C00003C0
-0007C0000783800787C00F87C00F0EE00F0EE01F0EE01E0EE01E0EE03E0EE03C07C03C07C01803
-8013247E9F18>37 D<387C7C7E3E0E0E0E1C1C38F8F0C0070E789B18>39
-D<007000F001E003C007800F001E001C00380038007000700070007000E000E000E000E000E000
-E000E000E0007000700070007000380038001C001E000F00078003C001F000F000700C24799F18
->I<6000F00078003C001E000F000780038001C001C000E000E000E000E0007000700070007000
-7000700070007000E000E000E000E001C001C0038007800F001E003C007800F00060000C247C9F
-18>I<01C00001C00001C00001C000C1C180F1C780F9CF807FFF001FFC0007F00007F0001FFC00
-7FFF00F9CF80F1C780C1C18001C00001C00001C00001C00011147D9718>I<00600000F00000F0
-0000F00000F00000F00000F00000F0007FFFC0FFFFE0FFFFE07FFFC000F00000F00000F00000F0
-0000F00000F00000F00000600013147E9718>I<1C3E7E7F3F1F070E1E7CF860080C788518>I<7F
-FF00FFFF80FFFF807FFF0011047D8F18>I<3078FCFC78300606778518>I<000300000780000780
-000F80000F00001F00001E00001E00003E00003C00007C0000780000780000F80000F00001F000
-01E00003E00003C00003C00007C0000780000F80000F00000F00001F00001E00003E00003C0000
-3C00007C0000780000F80000F00000F0000060000011247D9F18>I<01F00007FC000FFE001F1F
-001C07003803807803C07001C07001C0E000E0E000E0E000E0E000E0E000E0E000E0E000E0E000
-E0E000E0F001E07001C07001C07803C03803801C07001F1F000FFE0007FC0001F000131C7E9B18
->I<01800380038007800F803F80FF80FB80438003800380038003800380038003800380038003
-800380038003800380038003807FFCFFFE7FFC0F1C7B9B18>I<03F0000FFE003FFF007C0F8070
-03C0E001C0F000E0F000E06000E00000E00000E00001C00001C00003C0000780000F00001E0000
-3C0000780000F00001E00007C0000F80001E00E03C00E07FFFE0FFFFE07FFFE0131C7E9B18>I<
-07F8001FFE003FFF007807807803C07801C03001C00001C00003C0000380000F0003FF0003FE00
-03FF000007800003C00001C00000E00000E00000E0F000E0F000E0F001C0F003C07C07803FFF00
-1FFE0003F800131C7E9B18>I<001F00003F0000770000770000E70001E70001C7000387000787
-000707000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FFFFF80007000007000007
-00000700000700000700007FF000FFF8007FF0151C7F9B18>I<1FFF803FFF803FFF8038000038
-00003800003800003800003800003800003800003BF8003FFE003FFF003C07801803C00001C000
-00E00000E06000E0F000E0F000E0E001C07003C07C0F803FFF001FFC0003F000131C7E9B18>I<
-E00000FFFFE0FFFFE0FFFFE0E003C0E00780000700000E00001E00001C00003800003800007000
-00700000E00000E00000E00001C00001C00001C00001C00003C000038000038000038000038000
-038000038000038000131D7E9C18>55 D<3078FCFC783000000000000000003078FCFC78300614
-779318>58 D<183C7E7E3C180000000000000000183C7E7E3E1E0E1C3C78F060071A789318>I<
-000300000780001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000FC0000
-7E00003F00001FC00007E00003F00001FC00007E00003F00001F8000078000030011187D9918>
-I<7FFFC0FFFFE0FFFFE0FFFFE0000000000000000000000000FFFFE0FFFFE0FFFFE07FFFC0130C
-7E9318>I<600000F00000FC00007E00003F00001FC00007E00003F00001FC00007E00003F0000
-1F80001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000F0000060000011
-187D9918>I<0FF0003FFC007FFF00700F00F00380F00380600780000F00003E00007C0001F000
-01E00003C00003C00003C00003C00003C000038000000000000000000000000000000000038000
-07C00007C00007C000038000111C7D9B18>I<007C0001FE0007FF000F87801E03C03C1DC0387F
-C070FFE071E3E071C1E0E1C1E0E380E0E380E0E380E0E380E0E380E0E380E0E1C1C071C1C071E3
-C070FF80387F003C1C001E00E00F83E007FFC001FF80007E00131C7E9B18>I<00700000F80000
-F80000D80000D80001DC0001DC0001DC00018C00038E00038E00038E00038E0003060007070007
-07000707000707000FFF800FFF800FFF800E03800E03801C01C01C01C07F07F0FF8FF87F07F015
-1C7F9B18>I<00F8E003FEE007FFE00F07E01E03E03C01E03800E07000E07000E0700000E00000
-E00000E00000E00000E00000E00000E00000E000007000007000E07000E03800E03C00E01E01C0
-0F07C007FF8003FE0000F800131C7E9B18>67 D<FFFFF0FFFFF0FFFFF01C00701C00701C00701C
-00701C00001C00001C0E001C0E001C0E001FFE001FFE001FFE001C0E001C0E001C0E001C00001C
-00001C00381C00381C00381C00381C0038FFFFF8FFFFF8FFFFF8151C7F9B18>69
-D<FFFFE0FFFFE0FFFFE01C00E01C00E01C00E01C00E01C00001C00001C1C001C1C001C1C001FFC
-001FFC001FFC001C1C001C1C001C1C001C00001C00001C00001C00001C00001C00001C0000FFC0
-00FFC000FFC000131C7E9B18>I<01F1C003FDC00FFFC01F0FC01C03C03803C03801C07001C070
-01C0700000E00000E00000E00000E00000E00000E00FF0E01FF0E00FF07001C07001C07003C038
-03C03803C01C07C01F0FC00FFFC003FDC001F1C0141C7E9B18>I<7FFF00FFFF807FFF0001C000
-01C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C000
-01C00001C00001C00001C00001C00001C00001C00001C0007FFF00FFFF807FFF00111C7D9B18>
-73 D<7FE000FFE0007FE0000E00000E00000E00000E00000E00000E00000E00000E00000E0000
-0E00000E00000E00000E00000E00000E00000E00000E00000E00700E00700E00700E00700E0070
-7FFFF0FFFFF07FFFF0141C7F9B18>76 D<FC01F8FE03F8FE03F83B06E03B06E03B06E03B06E03B
-8EE03B8EE0398CE0398CE039DCE039DCE039DCE038D8E038D8E038F8E03870E03870E03800E038
-00E03800E03800E03800E03800E0FE03F8FE03F8FE03F8151C7F9B18>I<7E07F0FF0FF87F07F0
-1D81C01D81C01D81C01DC1C01CC1C01CC1C01CE1C01CE1C01CE1C01C61C01C71C01C71C01C31C0
-1C39C01C39C01C39C01C19C01C19C01C1DC01C0DC01C0DC01C0DC07F07C0FF87C07F03C0151C7F
-9B18>I<0FF8003FFE007FFF00780F00700700F00780E00380E00380E00380E00380E00380E003
-80E00380E00380E00380E00380E00380E00380E00380E00380E00380E00380F00780700700780F
-007FFF003FFE000FF800111C7D9B18>I<FF07F8FF07F8FF07F81C01C01C01C01C01C01C01C00E
-03800E03800E03800E03800F0780070700070700070700070700038E00038E00038E00038E0001
-8C0001DC0001DC0001DC0000D80000F80000F800007000151C7F9B18>86
-D<3FFFE07FFFE07FFFE07001C07003C0700780700700000F00001E00001C00003C000078000070
-0000F00001E00001C00003C0000780000700000F00001E00E01C00E03C00E07800E07000E0FFFF
-E0FFFFE0FFFFE0131C7E9B18>90 D<FFF8FFF8FFF8E000E000E000E000E000E000E000E000E000
+E0000007E0000007E0000007E0000007E00003FFFFC003FFFFC01F1E7E9D24>I<0400800E01C0
+180300300600700E00600C00600C00C01800C01800DC1B80FE1FC0FF1FE0FF1FE07F0FE03E07C0
+1C038013107B9F1B>92 D<07FC001FFF003F0F803F07C03F03E03F03E00C03E00003E0007FE007
+FBE01F03E03C03E07C03E0F803E0F803E0F803E0FC05E07E0DE03FF9FE0FE07E17147F9319>97
+D<FF0000FF00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F1F
+C01F7FF01FE0F81F807C1F007E1F003E1F003E1F003F1F003F1F003F1F003F1F003F1F003F1F00
+3E1F003E1F007C1F807C1EC1F81C7FE0181F8018207E9F1D>I<01FE0007FF801F0FC03E0FC03E
+0FC07C0FC07C0300FC0000FC0000FC0000FC0000FC0000FC00007C00007E00003E00603F00C01F
+81C007FF0001FC0013147E9317>I<0007F80007F80000F80000F80000F80000F80000F80000F8
+0000F80000F80000F80000F801F8F80FFEF81F83F83E01F87E00F87C00F87C00F8FC00F8FC00F8
+FC00F8FC00F8FC00F8FC00F87C00F87C00F87E00F83E01F81F07F80FFEFF03F8FF18207E9F1D>
+I<01FE0007FF801F83E03F01F07E00F07E00F8FC00F8FC00F8FFFFF8FFFFF8FC0000FC0000FC00
+007C00007E00003E00183F00380F807007FFE000FF8015147F9318>I<001F8000FFC001F3E003
+E7E003C7E007C7E007C3C007C00007C00007C00007C00007C000FFFC00FFFC0007C00007C00007
+C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007C00007
+C0003FFC003FFC0013207F9F10>I<01FC3C07FFFE0F079E1E03DE3E03E03E03E03E03E03E03E0
+3E03E01E03C00F07800FFF0009FC001800001800001C00001FFF800FFFF007FFF81FFFFC3C007C
+70003EF0001EF0001EF0001E78003C78003C3F01F80FFFE001FF00171E7F931A>I<FF0000FF00
+001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F0FC01F3FE01F61
+F01FC0F81F80F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00
+F81F00F81F00F8FFE3FFFFE3FF18207D9F1D>I<1C003F007F007F007F003F001C000000000000
+00000000000000FF00FF001F001F001F001F001F001F001F001F001F001F001F001F001F001F00
+1F001F00FFE0FFE00B217EA00E>I<FF0000FF00001F00001F00001F00001F00001F00001F0000
+1F00001F00001F00001F00001F01FE1F01FE1F00F01F01C01F03801F07001F1E001F38001F7C00
+1FFE001FFF001F1F001E0F801E07C01E07E01E03F01E01F01E00F8FFC3FFFFC3FF18207E9F1C>
+107 D<FF00FF001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F001F00
+1F001F001F001F001F001F001F001F001F001F001F001F00FFE0FFE00B207E9F0E>I<FE0FE03F
+80FE1FF07FC01E70F9C3E01E407D01F01E807E01F01F807E01F01F007C01F01F007C01F01F007C
+01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F01F007C01F01F00
+7C01F01F007C01F0FFE3FF8FFEFFE3FF8FFE27147D932E>I<FE0FC0FE3FE01E61F01EC0F81E80
+F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00
+F8FFE3FFFFE3FF18147D931D>I<01FF0007FFC01F83F03E00F83E00F87C007C7C007CFC007EFC
+007EFC007EFC007EFC007EFC007E7C007C7C007C3E00F83E00F81F83F007FFC001FF0017147F93
+1A>I<FF1FC0FF7FF01FE1F81F80FC1F007E1F007E1F003E1F003F1F003F1F003F1F003F1F003F
+1F003F1F003E1F007E1F007C1F80FC1FC1F81F7FE01F1F801F00001F00001F00001F00001F0000
+1F00001F0000FFE000FFE000181D7E931D>I<FE3E00FE7F801ECFC01E8FC01E8FC01F8FC01F03
+001F00001F00001F00001F00001F00001F00001F00001F00001F00001F00001F0000FFF000FFF0
+0012147E9316>114 D<0FE63FFE701E600EE006E006F800FFC07FF83FFC1FFE03FE001FC007C0
+07E007F006F81EFFFCC7F010147E9315>I<01800180018003800380038007800F803F80FFFCFF
+FC0F800F800F800F800F800F800F800F800F800F800F860F860F860F860F8607CC03F801F00F1D
+7F9C14>I<FF07F8FF07F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F
+00F81F00F81F00F81F00F81F01F81F01F80F06F807FCFF03F8FF18147D931D>I<FFE7FE1FE0FF
+E7FE1FE01F00F007001F00F803000F80F806000F80F8060007C1BC0C0007C1BC0C0007C1BE0C00
+03E31E180003E31E180001F60F300001F60F300001F60FB00000FC07E00000FC07E000007803C0
+00007803C000007803C000003001800023147F9326>119 D<FFE1FF00FFE1FF000F80700007C0
+E00007E0C00003E1800001F3800000FF0000007E0000003E0000003F0000007F8000006F800000
+C7C0000183E0000381F0000701F8000E00FC00FF81FF80FF81FF8019147F931C>I
+E /Fl 85 127 df<70F8F8F8F8F8F8F8F8F8F8F8F8F8F8F8F870000000000070F8F8F870051C77
+9B18>33 D<4010E038F078E038E038E038E038E038E038E038E038E038E03860300D0E7B9C18>
+I<030600078F00078F00078F00078F00078F00078F007FFFC0FFFFE0FFFFE07FFFC00F1E000F1E
+000F1E000F1E000F1E000F1E007FFFC0FFFFE0FFFFE07FFFC01E3C001E3C001E3C001E3C001E3C
+001E3C000C1800131C7E9B18>I<00C00001C00001C00001C00003F0000FFC003FFE007DCF0071
+C700E1C380E1C780E1C780E1C780F1C00079C0003DC0001FE0000FF80003FC0001DE0001CF0001
+C70061C380F1C380F1C380E1C380E1C70071C70079DE003FFE001FF80007E00001C00001C00001
+C00000C00011247D9F18>I<3803007C07807C0780EE0F80EE0F00EE0F00EE1F00EE1E00EE1E00
+EE3E007C3C007C3C00387C0000780000780000F80000F00001F00001E00001E00003E00003C000
+03C00007C0000783800787C00F87C00F0EE00F0EE01F0EE01E0EE01E0EE03E0EE03C07C03C07C0
+18038013247E9F18>I<01C00007E0000FF0000E70001C38001C38001C38001C38001C73F01C73
+F01CE3F00FE3800FC7000F87000F07001F0E003F0E007B8E0073DC00E1DC00E0F800E0F800E070
+70E0787070FC707FFFE03FCFE00F03C0141C7F9B18>I<387C7C7E3E0E0E0E1C1C38F8F0C0070E
+789B18>I<007000F001E003C007800F001E001C00380038007000700070007000E000E000E000
+E000E000E000E000E0007000700070007000380038001C001E000F00078003C001F000F000700C
+24799F18>I<6000F00078003C001E000F000780038001C001C000E000E000E000E00070007000
+700070007000700070007000E000E000E000E001C001C0038007800F001E003C007800F0006000
+0C247C9F18>I<01C00001C00001C00001C000C1C180F1C780F9CF807FFF001FFC0007F00007F0
+001FFC007FFF00F9CF80F1C780C1C18001C00001C00001C00001C00011147D9718>I<00600000
+F00000F00000F00000F00000F00000F00000F0007FFFC0FFFFE0FFFFE07FFFC000F00000F00000
+F00000F00000F00000F00000F00000600013147E9718>I<1C3E7E7F3F1F070E1E7CF860080C78
+8518>I<7FFF00FFFF80FFFF807FFF0011047D8F18>I<3078FCFC78300606778518>I<00030000
+0780000780000F80000F00001F00001E00001E00003E00003C00007C0000780000780000F80000
+F00001F00001E00003E00003C00003C00007C0000780000F80000F00000F00001F00001E00003E
+00003C00003C00007C0000780000F80000F00000F0000060000011247D9F18>I<01F00007FC00
+0FFE001F1F001C07003803807803C07001C07001C0E000E0E000E0E000E0E000E0E000E0E000E0
+E000E0E000E0E000E0F001E07001C07001C07803C03803801C07001F1F000FFE0007FC0001F000
+131C7E9B18>I<01800380038007800F803F80FF80FB8043800380038003800380038003800380
+0380038003800380038003800380038003807FFCFFFE7FFC0F1C7B9B18>I<03F0000FFE003FFF
+007C0F807003C0E001C0F000E0F000E06000E00000E00000E00001C00001C00003C0000780000F
+00001E00003C0000780000F00001E00007C0000F80001E00E03C00E07FFFE0FFFFE07FFFE0131C
+7E9B18>I<07F8001FFE003FFF007807807803C07801C03001C00001C00003C0000380000F0003
+FF0003FE0003FF000007800003C00001C00000E00000E00000E0F000E0F000E0F001C0F003C07C
+07803FFF001FFE0003F800131C7E9B18>I<001F00003F0000770000770000E70001E70001C700
+0387000787000707000E07001E07003C0700380700780700F00700FFFFF8FFFFF8FFFFF8000700
+000700000700000700000700000700007FF000FFF8007FF0151C7F9B18>I<1FFF803FFF803FFF
+803800003800003800003800003800003800003800003800003BF8003FFE003FFF003C07801803
+C00001C00000E00000E06000E0F000E0F000E0E001C07003C07C0F803FFF001FFC0003F000131C
+7E9B18>I<E00000FFFFE0FFFFE0FFFFE0E003C0E00780000700000E00001E00001C0000380000
+380000700000700000E00000E00000E00001C00001C00001C00001C00003C00003800003800003
+8000038000038000038000038000131D7E9C18>55 D<3078FCFC783000000000000000003078FC
+FC78300614779318>58 D<183C7E7E3C180000000000000000183C7E7E3E1E0E1C3C78F060071A
+789318>I<000300000780001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC
+0000FC00007E00003F00001FC00007E00003F00001FC00007E00003F00001F8000078000030011
+187D9918>I<7FFFC0FFFFE0FFFFE0FFFFE0000000000000000000000000FFFFE0FFFFE0FFFFE0
+7FFFC0130C7E9318>I<600000F00000FC00007E00003F00001FC00007E00003F00001FC00007E
+00003F00001F80001F80003F00007E0001FC0003F00007E0001FC0003F00007E0000FC0000F000
+0060000011187D9918>I<0FF0003FFC007FFF00700F00F00380F00380600780000F00003E0000
+7C0001F00001E00003C00003C00003C00003C00003C00003800000000000000000000000000000
+000003800007C00007C00007C000038000111C7D9B18>I<007C0001FE0007FF000F87801E03C0
+3C1DC0387FC070FFE071E3E071C1E0E1C1E0E380E0E380E0E380E0E380E0E380E0E380E0E1C1C0
+71C1C071E3C070FF80387F003C1C001E00E00F83E007FFC001FF80007E00131C7E9B18>I<0070
+0000F80000F80000D80000D80001DC0001DC0001DC00018C00038E00038E00038E00038E000306
+000707000707000707000707000FFF800FFF800FFF800E03800E03801C01C01C01C07F07F0FF8F
+F87F07F0151C7F9B18>I<FFFC00FFFF00FFFF801C03C01C01C01C00E01C00E01C00E01C00E01C
+01E01C01C01C07C01FFF801FFF001FFFC01C03C01C00E01C00F01C00701C00701C00701C00701C
+00F01C00E01C03E0FFFFC0FFFF80FFFE00141C7F9B18>I<00F8E003FEE007FFE00F07E01E03E0
+3C01E03800E07000E07000E0700000E00000E00000E00000E00000E00000E00000E00000E00000
+7000007000E07000E03800E03C00E01E01C00F07C007FF8003FE0000F800131C7E9B18>I<7FF8
+00FFFE007FFF001C0F801C03C01C03C01C01E01C00E01C00E01C00F01C00701C00701C00701C00
+701C00701C00701C00701C00701C00F01C00E01C00E01C01E01C01C01C03C01C0F807FFF00FFFE
+007FF800141C7F9B18>I<FFFFF0FFFFF0FFFFF01C00701C00701C00701C00701C00001C00001C
+0E001C0E001C0E001FFE001FFE001FFE001C0E001C0E001C0E001C00001C00001C00381C00381C
+00381C00381C0038FFFFF8FFFFF8FFFFF8151C7F9B18>I<FFFFE0FFFFE0FFFFE01C00E01C00E0
+1C00E01C00E01C00001C00001C1C001C1C001C1C001FFC001FFC001FFC001C1C001C1C001C1C00
+1C00001C00001C00001C00001C00001C00001C0000FFC000FFC000FFC000131C7E9B18>I<01F1
+C003FDC00FFFC01F0FC01C03C03803C03801C07001C07001C0700000E00000E00000E00000E000
+00E00000E00FF0E01FF0E00FF07001C07001C07003C03803C03803C01C07C01F0FC00FFFC003FD
+C001F1C0141C7E9B18>I<7FFF00FFFF807FFF0001C00001C00001C00001C00001C00001C00001
+C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001
+C00001C00001C0007FFF00FFFF807FFF00111C7D9B18>73 D<01FFC003FFC001FFC0000E00000E
+00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00F00E00F00E00F03C007FFC003FF0000FC000121C7D9B18>I<7F
+E000FFE0007FE0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
+00000E00000E00000E00000E00000E00000E00000E00700E00700E00700E00700E00707FFFF0FF
+FFF07FFFF0141C7F9B18>76 D<FC01F8FE03F8FE03F83B06E03B06E03B06E03B06E03B8EE03B8E
+E0398CE0398CE039DCE039DCE039DCE038D8E038D8E038F8E03870E03870E03800E03800E03800
+E03800E03800E03800E0FE03F8FE03F8FE03F8151C7F9B18>I<7E07F0FF0FF87F07F01D81C01D
+81C01D81C01DC1C01CC1C01CC1C01CE1C01CE1C01CE1C01C61C01C71C01C71C01C31C01C39C01C
+39C01C39C01C19C01C19C01C1DC01C0DC01C0DC01C0DC07F07C0FF87C07F03C0151C7F9B18>I<
+0FF8003FFE007FFF00780F00700700F00780E00380E00380E00380E00380E00380E00380E00380
+E00380E00380E00380E00380E00380E00380E00380E00380E00380F00780700700780F007FFF00
+3FFE000FF800111C7D9B18>I<FFFE00FFFF80FFFFC01C03C01C01E01C00E01C00701C00701C00
+701C00701C00701C00E01C01E01C03C01FFFC01FFF801FFE001C00001C00001C00001C00001C00
+001C00001C00001C0000FF8000FF8000FF8000141C7F9B18>I<7FF800FFFE007FFF001C0F801C
+03801C03C01C01C01C01C01C01C01C03C01C03801C0F801FFF001FFE001FFE001C0F001C07001C
+03801C03801C03801C03801C03801C039C1C039C1C039C7F01F8FF81F87F00F0161C7F9B18>82
+D<7FFFF8FFFFF8FFFFF8E07038E07038E07038E070380070000070000070000070000070000070
+0000700000700000700000700000700000700000700000700000700000700000700000700007FF
+0007FF0007FF00151C7F9B18>84 D<FF83FEFF83FEFF83FE1C00701C00701C00701C00701C0070
+1C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C00701C0070
+1C00700E00E00F01E00783C003FF8001FF00007C00171C809B18>I<FF07F8FF07F8FF07F81C01
+C01C01C01C01C01C01C00E03800E03800E03800E03800F0780070700070700070700070700038E
+00038E00038E00038E00018C0001DC0001DC0001DC0000D80000F80000F800007000151C7F9B18
+>I<FE03F8FE03F8FE03F87000707000707000703800E03800E03800E03800E03800E038F8E038
+F8E039DCE039DCE019DCC019DCC019DCC0198CC01D8DC01D8DC01D8DC01D8DC00D8D800D05800F
+07800F07800E0380151C7F9B18>I<3FFFE07FFFE07FFFE07001C07003C0700780700700000F00
+001E00001C00003C0000780000700000F00001E00001C00003C0000780000700000F00001E00E0
+1C00E03C00E07800E07000E0FFFFE0FFFFE0FFFFE0131C7E9B18>90 D<FFF8FFF8FFF8E000E000
E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E0
-00E000FFF8FFF8FFF80D24779F18>I<600000F00000F00000F800007800007C00003C00003C00
-003E00001E00001F00000F00000F00000F800007800007C00003C00003C00003E00001E00001F0
-0000F00000F800007800007800007C00003C00003E00001E00001E00001F00000F00000F800007
-8000078000030011247D9F18>I<FFF8FFF8FFF800380038003800380038003800380038003800
+00E000E000E000E000E000E000E000E000FFF8FFF8FFF80D24779F18>I<600000F00000F00000
+F800007800007C00003C00003C00003E00001E00001F00000F00000F00000F800007800007C000
+03C00003C00003E00001E00001F00000F00000F800007800007800007C00003C00003E00001E00
+001E00001F00000F00000F8000078000078000030011247D9F18>I<FFF8FFF8FFF80038003800
380038003800380038003800380038003800380038003800380038003800380038003800380038
-0038FFF8FFF8FFF80D247F9F18>I<7FFF00FFFF80FFFF807FFF0011047D7F18>95
-D<061E3E387070E0E0E0F8FC7C7C38070E789E18>I<1FE0003FF8007FFC00781E00300E000007
-0000070000FF0007FF001FFF007F0700780700E00700E00700E00700F00F00781F003FFFF01FFB
-F007E1F014147D9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000E
-FF800FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E00380E00380E00380F00700F
-00700F80E00FC1E00FFFC00EFF80063E00151C809B18>I<01FE0007FF001FFF803E0780380300
-700000700000E00000E00000E00000E00000E00000E000007000007001C03801C03E03C01FFF80
-07FF0001FC0012147D9318>I<001F80003F80001F8000038000038000038000038000038003E3
-800FFB801FFF803C1F80380F80700780700380E00380E00380E00380E00380E00380E003807007
-80700780380F803C1F801FFFF00FFBF803E3F0151C7E9B18>I<01F00007FC001FFE003E0F0038
-0780700380700380E001C0E001C0FFFFC0FFFFC0FFFFC0E000007000007001C03801C03E03C01F
-FF8007FF0001FC0012147D9318>I<001F80007FC000FFE000E1E001C0C001C00001C00001C000
-7FFFC0FFFFC0FFFFC001C00001C00001C00001C00001C00001C00001C00001C00001C00001C000
-01C00001C00001C00001C0007FFF007FFF007FFF00131C7F9B18>I<01E1F007FFF80FFFF81E1E
-301C0E003807003807003807003807003807001C0E001E1E001FFC001FF80039E0003800001C00
-001FFE001FFFC03FFFE07801F0700070E00038E00038E00038E000387800F07E03F01FFFC00FFF
-8001FC00151F7F9318>I<7E0000FE00007E00000E00000E00000E00000E00000E00000E3E000E
-FF800FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E
-00E00E00E00E00E07FC3FCFFE7FE7FC3FC171C809B18>I<03800007C00007C00007C000038000
-0000000000000000000000007FC000FFC0007FC00001C00001C00001C00001C00001C00001C000
-01C00001C00001C00001C00001C00001C00001C00001C000FFFF00FFFF80FFFF00111D7C9C18>
-I<0038007C007C007C003800000000000000000FFC1FFC0FFC001C001C001C001C001C001C001C
-001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C6038F078FFF07FE03F
-800E277E9C18>I<FE0000FE0000FE00000E00000E00000E00000E00000E00000E3FF00E7FF00E
-3FF00E07800E0F000E1E000E3C000E78000EF0000FF8000FFC000F9C000F0E000E0F000E07000E
-03800E03C0FFC7F8FFC7F8FFC7F8151C7F9B18>I<7FE000FFE0007FE00000E00000E00000E000
-00E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
-00E00000E00000E00000E00000E00000E0007FFFC0FFFFE07FFFC0131C7E9B18>I<7CE0E000FF
-FBF8007FFFF8001F1F1C001E1E1C001E1E1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C00
-1C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C007F1F1F00FFBFBF807F1F1F00191481
-9318>I<7E3E00FEFF807FFFC00FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00
-E00E00E00E00E00E00E00E00E00E00E07FC3FCFFE7FE7FC3FC1714809318>I<01F0000FFE001F
-FF003E0F803803807001C07001C0E000E0E000E0E000E0E000E0E000E0F001E07001C07803C03C
-07803E0F801FFF000FFE0001F00013147E9318>I<7E3E00FEFF807FFFC00FC1E00F80E00F0070
-0E00700E00380E00380E00380E00380E00380E00380F00700F00700F80E00FC1E00FFFC00EFF80
-0E3E000E00000E00000E00000E00000E00000E00000E00007FC000FFE0007FC000151E809318>
-I<01E38007FB801FFF803E1F80380F80700780700780E00380E00380E00380E00380E00380E003
-80700780700780380F803C1F801FFF800FFB8003E3800003800003800003800003800003800003
-80000380003FF8003FF8003FF8151E7E9318>I<7F87E0FF9FF07FBFF803F87803F03003E00003
-C00003C0000380000380000380000380000380000380000380000380000380007FFE00FFFF007F
-FE0015147F9318>I<07F7003FFF007FFF00780F00E00700E00700E007007C00007FE0001FFC00
-03FE00001F00600780E00380E00380F00380F80F00FFFF00FFFC00E7F00011147D9318>I<0180
-000380000380000380000380007FFFC0FFFFC0FFFFC00380000380000380000380000380000380
-000380000380000380000380400380E00380E00380E001C1C001FFC000FF80003E0013197F9818
->I<7E07E0FE0FE07E07E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E
-00E00E00E00E00E00E01E00F03E007FFFC03FFFE01FCFC1714809318>I<7F8FF0FF8FF87F8FF0
-1E03C00E03800E03800E0380070700070700070700038E00038E00038E00038E0001DC0001DC00
-01DC0000F80000F80000700015147F9318>I<FF8FF8FF8FF8FF8FF83800E03800E03800E01C01
-C01C01C01C71C01CF9C01CF9C01CD9C01CD9C00DDD800DDD800DDD800D8D800F8F800F8F800707
-0015147F9318>I<7F8FF07F9FF07F8FF0070700078E00039E0001DC0001F80000F80000700000
-F00000F80001DC00039E00038E000707000F07807F8FF0FF8FF87F8FF015147F9318>I<7F8FF0
-FF8FF87F8FF00E01C00E03800E0380070380070700070700038700038600038E0001CE0001CE00
-00CC0000CC0000DC0000780000780000780000700000700000700000F00000E00079E0007BC000
-7F80003F00001E0000151E7F9318>I<0007E0001FE0007FE000780000E00000E00000E00000E0
-0000E00000E00000E00000E00000E00000E00000E00001E0007FC000FF8000FF80007FC00001E0
-0000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000007800007F
-E0001FE00007E013247E9F18>123 D<60F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0
-F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000FFC00003C00000E00000E00000
-E00000E00000E00000E00000E00000E00000E00000E00000E00000F000007FC0003FE0003FE000
-7FC000F00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00003
-C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8F1F060C00F067C9B18>I
-E /Fk 27 121 df<00003FE00000E0100001803800038078000300780007003000070000000700
-0000070000000E0000000E0000000E000000FFFFE0000E00E0001C01C0001C01C0001C01C0001C
-01C0001C03800038038000380380003803800038070000380700007007000070071000700E2000
-700E2000700E2000E00E2000E0064000E0038000E0000000C0000001C0000001C0000031800000
-79800000F3000000620000003C0000001D29829F1A>12 D<00003FC0FF800000E0E38040000181
-E600E0000381EC01E0000300DC01E00007001C00C0000700180000000700380000000E00380000
-000E00380000000E00380000000E0070000000FFFFFFFF80001C00700380001C00700700001C00
-700700001C00700700001C00E00700001C00E00E00003800E00E00003800E00E00003800E00E00
-003801C01C00003801C01C00007001C01C00007001C01C40007001C03880007003803880007003
-80388000E00380388000E00380190000E003000E0000E00700000000C00700000001C006000000
-01C00600000031860E000000798F0C000000F31E18000000620C300000003C07C00000002B2982
-9F28>14 D<0E1F3F3F1D0102020404081020C0080E779F0E>39 D<000200020006000E003C00DC
-031C001C0038003800380038007000700070007000E000E000E000E001C001C001C001C0038003
-80038003800780FFF80F1E7B9D17>49 D<0000FE0200078186001C004C0038003C0060003C00C0
-001C01C0001803800018070000180F0000181E0000101E0000103C0000003C0000007800000078
-0000007800000078000000F0000000F0000000F0000000F0000000F00000807000008070000080
-700001003800010038000200180004000C001800060020000381C00000FE00001F217A9F21>67
-D<01FF007FE0001F000F00001F0004000017800400001780040000278008000023C008000023C0
-08000023C008000041E010000041E010000041F010000040F010000080F0200000807820000080
-782000008078200001003C400001003C400001003C400001001E400002001E800002001E800002
-000F800002000F800004000F0000040007000004000700000C000700001C00020000FF80020000
-231F7D9E22>78 D<00F1800389C00707800E03801C03803C0380380700780700780700780700F0
-0E00F00E00F00E00F00E20F01C40F01C40703C40705C40308C800F070013147C9317>97
-D<07803F8007000700070007000E000E000E000E001C001C001CF01D0C3A0E3C0E380F380F700F
-700F700F700FE01EE01EE01EE01CE03CE038607060E031C01F0010207B9F15>I<007E0001C100
-0300800E07801E07801C07003C0200780000780000780000F00000F00000F00000F00000F00000
-70010070020030040018380007C00011147C9315>I<0000780003F80000700000700000700000
-700000E00000E00000E00000E00001C00001C000F1C00389C00707800E03801C03803C03803807
-00780700780700780700F00E00F00E00F00E00F00E20F01C40F01C40703C40705C40308C800F07
-0015207C9F17>I<007C01C207010E011C013C013802780C7BF07C00F000F000F000F000700070
-0170023804183807C010147C9315>I<00007800019C00033C00033C000718000700000700000E
-00000E00000E00000E00000E0001FFE0001C00001C00001C00001C000038000038000038000038
-0000380000700000700000700000700000700000700000E00000E00000E00000E00000C00001C0
-0001C0000180003180007B0000F300006600003C00001629829F0E>I<003C6000E27001C1E003
-80E00700E00F00E00E01C01E01C01E01C01E01C03C03803C03803C03803C03803C07003C07001C
-0F001C17000C2E0003CE00000E00000E00001C00001C00301C00783800F0700060E0003F800014
-1D7E9315>I<00C001E001E001C000000000000000000000000000000E00330023004380430047
-0087000E000E000E001C001C001C003840388030807080310033001C000B1F7C9E0E>105
-D<0001800003C00003C0000380000000000000000000000000000000000000000000003C000046
-00008700008700010700010700020E00000E00000E00000E00001C00001C00001C00001C000038
-0000380000380000380000700000700000700000700000E00000E00030E00079C000F180006300
-003C00001228829E0E>I<01E0000FE00001C00001C00001C00001C00003800003800003800003
-80000700000700000703C00704200E08E00E11E00E21E00E40C01C80001D00001E00001FC00038
-E000387000387000383840707080707080707080703100E03100601E0013207D9F15>I<03C01F
-C0038003800380038007000700070007000E000E000E000E001C001C001C001C00380038003800
-38007000700070007100E200E200E200E200640038000A207C9F0C>I<1C0F80F0002630C31800
-4740640C004780680E004700700E004700700E008E00E01C000E00E01C000E00E01C000E00E01C
-001C01C038001C01C038001C01C038001C01C0708038038071003803806100380380E100380380
-62007007006600300300380021147C9325>I<1C0F802630C04740604780604700704700708E00
-E00E00E00E00E00E00E01C01C01C01C01C01C01C03843803883803083807083803107003303001
-C016147C931A>I<007C0001C3000301800E01C01E01C01C01E03C01E07801E07801E07801E0F0
-03C0F003C0F003C0F00780F00700700F00700E0030180018700007C00013147C9317>I<01C1E0
-02621804741C04781C04701E04701E08E01E00E01E00E01E00E01E01C03C01C03C01C03C01C038
-0380780380700380E003C1C0072380071E000700000700000E00000E00000E00000E00001C0000
-1C0000FFC000171D809317>I<1C1E002661004783804787804707804703008E00000E00000E00
-000E00001C00001C00001C00001C000038000038000038000038000070000030000011147C9313
->114 D<00FC030206010C030C070C060C000F800FF007F803FC003E000E700EF00CF00CE00840
-1020601F8010147D9313>I<018001C0038003800380038007000700FFF007000E000E000E000E
-001C001C001C001C003800380038003820704070407080708031001E000C1C7C9B0F>I<0E00C0
-3300E02301C04381C04301C04701C08703800E03800E03800E03801C07001C07001C07001C0710
-1C0E20180E20180E201C1E200C264007C38014147C9318>I<0E03803307802307C04383C04301
-C04700C08700800E00800E00800E00801C01001C01001C01001C02001C02001C04001C04001C08
-000E300003C00012147C9315>I<0383800CC4401068E01071E02071E02070C040E00000E00000
-E00000E00001C00001C00001C00001C040638080F38080F38100E5810084C60078780013147D93
-15>120 D E /Fl 40 122 df<0001FF0000001FFFC000007F80F00000FE00F80003FC01FC0003
-F803FC0007F003FC0007F003FC0007F003FC0007F001F80007F000F00007F000000007F0000000
-07F000000007F0000000FFFFFFFC00FFFFFFFC00FFFFFFFC0007F001FC0007F001FC0007F001FC
+00380038003800380038003800380038FFF8FFF8FFF80D247F9F18>I<018007C01FF07EFCF83E
+E00E0F067C9B18>I<7FFF00FFFF80FFFF807FFF0011047D7F18>I<061E3E387070E0E0E0F8FC7C
+7C38070E789E18>I<1FE0003FF8007FFC00781E00300E0000070000070000FF0007FF001FFF00
+7F0700780700E00700E00700E00700F00F00781F003FFFF01FFBF007E1F014147D9318>I<7E00
+00FE00007E00000E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1E00F80E00F00
+700E00700E00380E00380E00380E00380E00380E00380F00700F00700F80E00FC1E00FFFC00EFF
+80063E00151C809B18>I<01FE0007FF001FFF803E0780380300700000700000E00000E00000E0
+0000E00000E00000E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318>I<
+001F80003F80001F8000038000038000038000038000038003E3800FFB801FFF803C1F80380F80
+700780700380E00380E00380E00380E00380E00380E00380700780700780380F803C1F801FFFF0
+0FFBF803E3F0151C7E9B18>I<01F00007FC001FFE003E0F00380780700380700380E001C0E001
+C0FFFFC0FFFFC0FFFFC0E000007000007001C03801C03E03C01FFF8007FF0001FC0012147D9318
+>I<001F80007FC000FFE000E1E001C0C001C00001C00001C0007FFFC0FFFFC0FFFFC001C00001
+C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0007F
+FF007FFF007FFF00131C7F9B18>I<01E1F007FFF80FFFF81E1E301C0E00380700380700380700
+3807003807001C0E001E1E001FFC001FF80039E0003800001C00001FFE001FFFC03FFFE07801F0
+700070E00038E00038E00038E000387800F07E03F01FFFC00FFF8001FC00151F7F9318>I<7E00
+00FE00007E00000E00000E00000E00000E00000E00000E3E000EFF800FFFC00FC1C00F80E00F00
+E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E07FC3FCFFE7
+FE7FC3FC171C809B18>I<03800007C00007C00007C0000380000000000000000000000000007F
+C000FFC0007FC00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001
+C00001C00001C00001C000FFFF00FFFF80FFFF00111D7C9C18>I<0038007C007C007C00380000
+0000000000000FFC1FFC0FFC001C001C001C001C001C001C001C001C001C001C001C001C001C00
+1C001C001C001C001C001C001C001C001C6038F078FFF07FE03F800E277E9C18>I<FE0000FE00
+00FE00000E00000E00000E00000E00000E00000E3FF00E7FF00E3FF00E07800E0F000E1E000E3C
+000E78000EF0000FF8000FFC000F9C000F0E000E0F000E07000E03800E03C0FFC7F8FFC7F8FFC7
+F8151C7F9B18>I<7FE000FFE0007FE00000E00000E00000E00000E00000E00000E00000E00000
+E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000
+E00000E0007FFFC0FFFFE07FFFC0131C7E9B18>I<7CE0E000FFFBF8007FFFF8001F1F1C001E1E
+1C001E1E1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C1C1C001C
+1C1C001C1C1C001C1C1C007F1F1F00FFBFBF807F1F1F001914819318>I<7E3E00FEFF807FFFC0
+0FC1C00F80E00F00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E0
+0E00E07FC3FCFFE7FE7FC3FC1714809318>I<01F0000FFE001FFF003E0F803803807001C07001
+C0E000E0E000E0E000E0E000E0E000E0F001E07001C07803C03C07803E0F801FFF000FFE0001F0
+0013147E9318>I<7E3E00FEFF807FFFC00FC1E00F80E00F00700E00700E00380E00380E00380E
+00380E00380E00380F00700F00700F80E00FC1E00FFFC00EFF800E3E000E00000E00000E00000E
+00000E00000E00000E00007FC000FFE0007FC000151E809318>I<01E38007FB801FFF803E1F80
+380F80700780700780E00380E00380E00380E00380E00380E00380700780700780380F803C1F80
+1FFF800FFB8003E380000380000380000380000380000380000380000380003FF8003FF8003FF8
+151E7E9318>I<7F87E0FF9FF07FBFF803F87803F03003E00003C00003C0000380000380000380
+000380000380000380000380000380000380007FFE00FFFF007FFE0015147F9318>I<07F7003F
+FF007FFF00780F00E00700E00700E007007C00007FE0001FFC0003FE00001F00600780E00380E0
+0380F00380F80F00FFFF00FFFC00E7F00011147D9318>I<018000038000038000038000038000
+7FFFC0FFFFC0FFFFC0038000038000038000038000038000038000038000038000038000038040
+0380E00380E00380E001C1C001FFC000FF80003E0013197F9818>I<7E07E0FE0FE07E07E00E00
+E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E00E01E00F03
+E007FFFC03FFFE01FCFC1714809318>I<7F8FF0FF8FF87F8FF01E03C00E03800E03800E038007
+0700070700070700038E00038E00038E00038E0001DC0001DC0001DC0000F80000F80000700015
+147F9318>I<FF8FF8FF8FF8FF8FF83800E03800E03800E01C01C01C01C01C71C01CF9C01CF9C0
+1CD9C01CD9C00DDD800DDD800DDD800D8D800F8F800F8F8007070015147F9318>I<7F8FF07F9F
+F07F8FF0070700078E00039E0001DC0001F80000F80000700000F00000F80001DC00039E00038E
+000707000F07807F8FF0FF8FF87F8FF015147F9318>I<7F8FF0FF8FF87F8FF00E01C00E03800E
+0380070380070700070700038700038600038E0001CE0001CE0000CC0000CC0000DC0000780000
+780000780000700000700000700000F00000E00079E0007BC0007F80003F00001E0000151E7F93
+18>I<3FFFF07FFFF07FFFF07001E07003C0700780000F00001E00003C0000F80001F00003C000
+0780000F00701E00703C0070780070FFFFF0FFFFF0FFFFF014147F9318>I<0007E0001FE0007F
+E000780000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00001E0
+007FC000FF8000FF80007FC00001E00000E00000E00000E00000E00000E00000E00000E00000E0
+0000E00000E00000E000007800007FE0001FE00007E013247E9F18>I<60F0F0F0F0F0F0F0F0F0
+F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0F0600424769F18>I<7C0000FF0000
+FFC00003C00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E000
+00F000007FC0003FE0003FE0007FC000F00000E00000E00000E00000E00000E00000E00000E000
+00E00000E00000E00000E00003C000FFC000FF00007C000013247E9F18>I<060C1F1E3FBEFBF8
+F1F060C00F067C9B18>I E /Fm 33 122 df<00003FE00000E010000180380003807800030078
+00070030000700000007000000070000000E0000000E0000000E000000FFFFE0000E00E0001C01
+C0001C01C0001C01C0001C01C0001C038000380380003803800038038000380700003807000070
+07000070071000700E2000700E2000700E2000E00E2000E0064000E0038000E0000000C0000001
+C0000001C000003180000079800000F3000000620000003C0000001D29829F1A>12
+D<00003FC0FF800000E0E38040000181E600E0000381EC01E0000300DC01E00007001C00C00007
+00180000000700380000000E00380000000E00380000000E00380000000E0070000000FFFFFFFF
+80001C00700380001C00700700001C00700700001C00700700001C00E00700001C00E00E000038
+00E00E00003800E00E00003800E00E00003801C01C00003801C01C00007001C01C00007001C01C
+40007001C0388000700380388000700380388000E00380388000E00380190000E003000E0000E0
+0700000000C00700000001C00600000001C00600000031860E000000798F0C000000F31E180000
+00620C300000003C07C00000002B29829F28>14 D<0E1F3F3F1D0102020404081020C0080E779F
+0E>39 D<000200020006000E003C00DC031C001C0038003800380038007000700070007000E000
+E000E000E001C001C001C001C003800380038003800780FFF80F1E7B9D17>49
+D<070F1F1F0E0000000000000000000070F8F8F0E008147B930E>58 D<0000FE0200078186001C
+004C0038003C0060003C00C0001C01C0001803800018070000180F0000181E0000101E0000103C
+0000003C00000078000000780000007800000078000000F0000000F0000000F0000000F0000000
+F00000807000008070000080700001003800010038000200180004000C001800060020000381C0
+0000FE00001F217A9F21>67 D<01FFFFFC001E0038001E0018001E0008001E0008003C0008003C
+0008003C0008003C00080078001000780800007808000078080000F0100000F0300000FFF00000
+F0300001E0200001E0200001E0200001E0200003C0000003C0000003C0000003C0000007800000
+0780000007800000078000000F800000FFF800001E1F7D9E1E>70 D<01FF007FE0001F000F0000
+1F0004000017800400001780040000278008000023C008000023C008000023C008000041E01000
+0041E010000041F010000040F010000080F0200000807820000080782000008078200001003C40
+0001003C400001003C400001001E400002001E800002001E800002000F800002000F800004000F
+0000040007000004000700000C000700001C00020000FF80020000231F7D9E22>78
+D<01FFFF80001E00E0001E0070001E0038001E003C003C003C003C003C003C003C003C003C0078
+007800780078007800F0007800E000F003C000F00F0000FFFC0000F0000001E0000001E0000001
+E0000001E0000003C0000003C0000003C0000003C0000007800000078000000780000007800000
+0F800000FFF000001E1F7D9E1F>80 D<00F1800389C00707800E03801C03803C03803807007807
+00780700780700F00E00F00E00F00E00F00E20F01C40F01C40703C40705C40308C800F07001314
+7C9317>97 D<07803F8007000700070007000E000E000E000E001C001C001CF01D0C3A0E3C0E38
+0F380F700F700F700F700FE01EE01EE01EE01CE03CE038607060E031C01F0010207B9F15>I<00
+7E0001C1000300800E07801E07801C07003C0200780000780000780000F00000F00000F00000F0
+0000F0000070010070020030040018380007C00011147C9315>I<0000780003F8000070000070
+0000700000700000E00000E00000E00000E00001C00001C000F1C00389C00707800E03801C0380
+3C0380380700780700780700780700F00E00F00E00F00E00F00E20F01C40F01C40703C40705C40
+308C800F070015207C9F17>I<007C01C207010E011C013C013802780C7BF07C00F000F000F000
+F0007000700170023804183807C010147C9315>I<00007800019C00033C00033C000718000700
+000700000E00000E00000E00000E00000E0001FFE0001C00001C00001C00001C00003800003800
+00380000380000380000700000700000700000700000700000700000E00000E00000E00000E000
+00C00001C00001C0000180003180007B0000F300006600003C00001629829F0E>I<003C6000E2
+7001C1E00380E00700E00F00E00E01C01E01C01E01C01E01C03C03803C03803C03803C03803C07
+003C07001C0F001C17000C2E0003CE00000E00000E00001C00001C00301C00783800F0700060E0
+003F8000141D7E9315>I<01E0000FE00001C00001C00001C00001C00003800003800003800003
+8000070000070000071E000763000E81800F01C00E01C00E01C01C03801C03801C03801C038038
+0700380700380700380E10700E20700C20701C20700C40E00CC060070014207D9F17>I<00C001
+E001E001C000000000000000000000000000000E003300230043804300470087000E000E000E00
+1C001C001C003840388030807080310033001C000B1F7C9E0E>I<0001800003C00003C0000380
+000000000000000000000000000000000000000000003C00004600008700008700010700010700
+020E00000E00000E00000E00001C00001C00001C00001C00003800003800003800003800007000
+00700000700000700000E00000E00030E00079C000F180006300003C00001228829E0E>I<01E0
+000FE00001C00001C00001C00001C0000380000380000380000380000700000700000703C00704
+200E08E00E11E00E21E00E40C01C80001D00001E00001FC00038E0003870003870003838407070
+80707080707080703100E03100601E0013207D9F15>I<03C01FC0038003800380038007000700
+070007000E000E000E000E001C001C001C001C0038003800380038007000700070007100E200E2
+00E200E200640038000A207C9F0C>I<1C0F80F0002630C318004740640C004780680E00470070
+0E004700700E008E00E01C000E00E01C000E00E01C000E00E01C001C01C038001C01C038001C01
+C038001C01C0708038038071003803806100380380E10038038062007007006600300300380021
+147C9325>I<1C0F802630C04740604780604700704700708E00E00E00E00E00E00E00E01C01C0
+1C01C01C01C01C03843803883803083807083803107003303001C016147C931A>I<007C0001C3
+000301800E01C01E01C01C01E03C01E07801E07801E07801E0F003C0F003C0F003C0F00780F007
+00700F00700E0030180018700007C00013147C9317>I<01C1E002621804741C04781C04701E04
+701E08E01E00E01E00E01E00E01E01C03C01C03C01C03C01C0380380780380700380E003C1C007
+2380071E000700000700000E00000E00000E00000E00001C00001C0000FFC000171D809317>I<
+1C1E002661004783804787804707804703008E00000E00000E00000E00001C00001C00001C0000
+1C000038000038000038000038000070000030000011147C9313>114 D<00FC030206010C030C
+070C060C000F800FF007F803FC003E000E700EF00CF00CE008401020601F8010147D9313>I<01
+8001C0038003800380038007000700FFF007000E000E000E000E001C001C001C001C0038003800
+38003820704070407080708031001E000C1C7C9B0F>I<0E00C03300E02301C04381C04301C047
+01C08703800E03800E03800E03801C07001C07001C07001C07101C0E20180E20180E201C1E200C
+264007C38014147C9318>I<0E03803307802307C04383C04301C04700C08700800E00800E0080
+0E00801C01001C01001C01001C02001C02001C04001C04001C08000E300003C00012147C9315>
+I<0E00C1C03300E3C02301C3E04381C1E04301C0E04701C060870380400E0380400E0380400E03
+80401C0700801C0700801C0700801C0701001C0701001C0602001C0F02000C0F04000E13080003
+E1F0001B147C931E>I<0383800CC4401068E01071E02071E02070C040E00000E00000E00000E0
+0001C00001C00001C00001C040638080F38080F38100E5810084C60078780013147D9315>I<0E
+00C03300E02301C04381C04301C04701C08703800E03800E03800E03801C07001C07001C07001C
+07001C0E00180E00180E001C1E000C3C0007DC00001C00001C00003800F03800F07000E06000C0
+C0004380003E0000131D7C9316>I E /Fn 74 123 df<001F83E000F06E3001C078780380F878
+0300F03007007000070070000700700007007000070070000700700007007000FFFFFF80070070
+000700700007007000070070000700700007007000070070000700700007007000070070000700
+7000070070000700700007007000070070000700700007007000070070007FE3FF001D20809F1B
+>11 D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000
+FFFFE00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E0
+0700E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381
+E00700E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700
+E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700
+E00700E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F00
+0700F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF
+000700700700070070070007007007000700700700070070070007007007000700700700070070
+070007007007000700700700070070070007007007000700700700070070070007007007000700
+700700070070070007007007007FE3FE3FF02420809F26>I<07070F1C383060C00808779F17>
+19 D<7038F87CFC7EFC7E743A0402040204020804080410081008201040200F0E7E9F17>34
+D<70F8FCFC74040404080810102040060E7C9F0D>39 D<0020004000800100020006000C000C00
+180018003000300030007000600060006000E000E000E000E000E000E000E000E000E000E000E0
+00E0006000600060007000300030003000180018000C000C000600020001000080004000200B2E
+7DA112>I<800040002000100008000C00060006000300030001800180018001C000C000C000C0
+00E000E000E000E000E000E000E000E000E000E000E000E000C000C000C001C001800180018003
+000300060006000C00080010002000400080000B2E7DA112>I<70F8FCFC740404040808101020
+40060E7C840D>44 D<FFC0FFC00A027F8A0F>I<70F8F8F87005057C840D>I<0003000300070006
+0006000E000C000C001C0018001800380030003000700060006000E000C000C001C00180018001
+800380030003000700060006000E000C000C001C0018001800380030003000700060006000E000
+C000C000102D7DA117>I<03F0000E1C001C0E00180600380700700380700380700380700380F0
+03C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C070
+03807003807003807807803807001806001C0E000E1C0003F000121F7E9D17>I<018003800F80
+F38003800380038003800380038003800380038003800380038003800380038003800380038003
+800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C1C00100E002007004007808007
+80F007C0F803C0F803C0F803C02007C00007C0000780000780000F00000E00001C000038000070
+0000600000C0000180000300000600400C00401800401000803FFF807FFF80FFFF80121E7E9D17
+>I<03F0000C1C00100E00200F00780F80780780780780380F80000F80000F00000F00000E0000
+1C0000380003F000003C00000E00000F000007800007800007C02007C0F807C0F807C0F807C0F0
+0780400780400F00200E001C3C0003F000121F7E9D17>I<000600000600000E00000E00001E00
+002E00002E00004E00008E00008E00010E00020E00020E00040E00080E00080E00100E00200E00
+200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E00000E00000E0000FFE0141E7F
+9D17>I<1803001FFE001FFC001FF8001FE00010000010000010000010000010000010000011F0
+00161C00180E001007001007800003800003800003C00003C00003C07003C0F003C0F003C0E003
+80400380400700200600100E000C380003E000121F7E9D17>I<007C000182000701000E03800C
+07801C0780380300380000780000700000700000F1F000F21C00F40600F80700F80380F80380F0
+03C0F003C0F003C0F003C0F003C07003C07003C07003803803803807001807000C0E00061C0001
+F000121F7E9D17>I<4000007FFFC07FFF807FFF80400100800200800200800400000800000800
+00100000200000200000400000400000C00000C00001C000018000038000038000038000038000
+078000078000078000078000078000078000078000030000121F7D9D17>I<03F0000C0C001006
+003003002001806001806001806001807001807803003E03003F06001FC8000FF00003F80007FC
+000C7E00103F00300F806003804001C0C001C0C000C0C000C0C000C0C000806001802001001002
+000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600380700700700700380F00380F0
+0380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0180BC00E13C003E3C000038000
+0380000380000700300700780600780E00700C002018001070000FC000121F7E9D17>I<70F8F8
+F8700000000000000000000070F8F8F87005147C930D>I<70F8F8F87000000000000000000000
+70F0F8F878080808101010202040051D7C930D>I<7FFFFFE0FFFFFFF000000000000000000000
+00000000000000000000000000000000000000000000FFFFFFF07FFFFFE01C0C7D9023>61
+D<000100000003800000038000000380000007C0000007C0000007C0000009E0000009E0000009
+E0000010F0000010F0000010F00000207800002078000020780000403C0000403C0000403C0000
+801E0000801E0000FFFE0001000F0001000F0001000F00020007800200078002000780040003C0
+0E0003C01F0007E0FFC03FFE1F207F9F22>65 D<FFFFE0000F80380007801E0007801F0007800F
+0007800F8007800F8007800F8007800F8007800F8007800F0007801F0007801E0007803C0007FF
+F00007803C0007801E0007800F0007800F8007800780078007C0078007C0078007C0078007C007
+8007C00780078007800F8007800F0007801F000F803C00FFFFF0001A1F7E9E20>I<000FC04000
+7030C001C009C0038005C0070003C00E0001C01E0000C01C0000C03C0000C07C0000407C000040
+78000040F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8000000F80000
+00780000007C0000407C0000403C0000401C0000401E0000800E000080070001000380020001C0
+040000703800000FC0001A217D9F21>I<FFFFFF000F800F000780030007800300078001000780
+0180078000800780008007800080078080800780800007808000078080000781800007FF800007
+818000078080000780800007808000078080000780002007800020078000200780004007800040
+07800040078000C0078000C0078001800F800F80FFFFFF801B1F7E9E1F>69
+D<FFFFFF000F800F00078003000780030007800100078001800780008007800080078000800780
+0080078080000780800007808000078080000781800007FF800007818000078080000780800007
+808000078080000780000007800000078000000780000007800000078000000780000007800000
+0FC00000FFFE0000191F7E9E1E>I<000FE0200078186000E004E0038002E0070001E00F0000E0
+1E0000601E0000603C0000603C0000207C00002078000020F8000000F8000000F8000000F80000
+00F8000000F8000000F8000000F8007FFCF80003E0780001E07C0001E03C0001E03C0001E01E00
+01E01E0001E00F0001E0070001E0038002E000E0046000781820000FE0001E217D9F24>I<FFF8
+FFF80F800F8007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007
+800F0007800F0007800F0007800F0007FFFF0007800F0007800F0007800F0007800F0007800F00
+07800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F000F800F
+80FFF8FFF81D1F7E9E22>I<FFFC0FC00780078007800780078007800780078007800780078007
+800780078007800780078007800780078007800780078007800780078007800FC0FFFC0E1F7F9E
+10>I<FFFE000FC000078000078000078000078000078000078000078000078000078000078000
+078000078000078000078000078000078000078000078000078002078002078002078002078006
+07800407800407800C07801C0F807CFFFFFC171F7E9E1C>76 D<FF80001FF80F80001F80078000
+1F0005C0002F0005C0002F0005C0002F0004E0004F0004E0004F000470008F000470008F000470
+008F000438010F000438010F000438010F00041C020F00041C020F00041C020F00040E040F0004
+0E040F00040E040F000407080F000407080F000407080F000403900F000403900F000401E00F00
+0401E00F000401E00F000E00C00F001F00C01F80FFE0C1FFF8251F7E9E2A>I<FF803FF807C007
+C007C0038005E0010005E0010004F001000478010004780100043C0100043C0100041E0100040F
+0100040F010004078100040781000403C1000401E1000401E1000400F1000400F1000400790004
+003D0004003D0004001F0004001F0004000F0004000700040007000E0003001F000300FFE00100
+1D1F7E9E22>I<001F800000F0F00001C0380007801E000F000F000E0007001E0007803C0003C0
+3C0003C07C0003E0780001E0780001E0F80001F0F80001F0F80001F0F80001F0F80001F0F80001
+F0F80001F0F80001F0F80001F0780001E07C0003E07C0003E03C0003C03C0003C01E0007800E00
+07000F000F0007801E0001C0380000F0F000001F80001C217D9F23>I<FFFFE0000F8078000780
+1C0007801E0007800F0007800F8007800F8007800F8007800F8007800F8007800F8007800F0007
+801E0007801C000780780007FFE000078000000780000007800000078000000780000007800000
+078000000780000007800000078000000780000007800000078000000FC00000FFFC0000191F7E
+9E1F>I<FFFF80000F80F0000780780007803C0007801E0007801E0007801F0007801F0007801F
+0007801F0007801E0007801E0007803C00078078000780F00007FF80000781C0000780E0000780
+F0000780700007807800078078000780780007807C0007807C0007807C0007807C0407807E0407
+803E040FC01E08FFFC0F10000003E01E207E9E21>82 D<07E0800C198010078030038060018060
+0180E00180E00080E00080E00080F00000F000007800007F00003FF0001FFC000FFE0003FF0000
+1F800007800003C00003C00001C08001C08001C08001C08001C0C00180C00380E00300F00600CE
+0C0081F80012217D9F19>I<7FFFFFE0780F01E0600F0060400F0020400F0020C00F0030800F00
+10800F0010800F0010800F0010000F0000000F0000000F0000000F0000000F0000000F0000000F
+0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F000000
+0F0000000F0000000F0000001F800007FFFE001C1F7E9E21>I<FFFC3FF80FC007C00780038007
+800100078001000780010007800100078001000780010007800100078001000780010007800100
+078001000780010007800100078001000780010007800100078001000780010007800100078001
+0007800100038002000380020001C0020001C0040000E008000070180000382000000FC0001D20
+7E9E22>I<FFF003FE1F8000F80F0000600F800060078000400780004003C0008003C0008003C0
+008001E0010001E0010001F0010000F0020000F0020000F806000078040000780400003C080000
+3C0800003C0800001E1000001E1000001F3000000F2000000F20000007C0000007C0000007C000
+000380000003800000038000000100001F207F9E22>I<FFF07FF81FF01F800FC007C00F000780
+03800F00078001000F0007C00100078007C00200078007C00200078007C0020003C009E0040003
+C009E0040003C009E0040003E010F00C0001E010F0080001E010F0080001F02078080000F02078
+100000F02078100000F0403C10000078403C20000078403C20000078C03E2000003C801E400000
+3C801E4000003C801E4000001F000F8000001F000F8000001F000F8000001E00078000000E0007
+0000000E00070000000C000300000004000200002C207F9E2F>I<FEFEC0C0C0C0C0C0C0C0C0C0
+C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0FEFE072D7CA10D>
+91 D<080410082010201040204020804080408040B85CFC7EFC7E7C3E381C0F0E7B9F17>I<FEFE
+060606060606060606060606060606060606060606060606060606060606060606060606060606
+0606FEFE072D7FA10D>I<1FE000303000781800781C00300E00000E00000E00000E0000FE0007
+8E001E0E00380E00780E00F00E10F00E10F00E10F01E10781E103867200F83C014147E9317>97
+D<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E3E
+000EC3800F01C00F00E00E00E00E00700E00700E00780E00780E00780E00780E00780E00780E00
+700E00700E00E00F00E00D01C00CC300083E0015207F9F19>I<03F80E0C1C1E381E380C700070
+00F000F000F000F000F000F00070007000380138011C020E0C03F010147E9314>I<000380003F
+8000038000038000038000038000038000038000038000038000038000038003E380061B801C07
+80380380380380700380700380F00380F00380F00380F00380F00380F003807003807003803803
+803807801C07800E1B8003E3F815207E9F19>I<03F0000E1C001C0E0038070038070070070070
+0380F00380F00380FFFF80F00000F00000F000007000007000003800801800800C010007060001
+F80011147F9314>I<007C00C6018F038F07060700070007000700070007000700FFF007000700
+07000700070007000700070007000700070007000700070007000700070007007FF01020809F0E
+>I<0000E003E3300E3C301C1C30380E00780F00780F00780F00780F00780F00380E001C1C001E
+380033E0002000002000003000003000003FFE001FFF800FFFC03001E0600070C00030C00030C0
+0030C000306000603000C01C038003FC00141F7F9417>I<0E0000FE00000E00000E00000E0000
+0E00000E00000E00000E00000E00000E00000E00000E3E000E43000E81800F01C00F01C00E01C0
+0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0
+FFE7FC16207F9F19>I<1C001E003E001E001C000000000000000000000000000E007E000E000E
+000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00FFC00A1F809E0C>
+I<00E001F001F001F000E0000000000000000000000000007007F000F000700070007000700070
+00700070007000700070007000700070007000700070007000700070007000706070F060F0C061
+803F000C28829E0E>I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00
+000E00000E00000E0FF00E03C00E03000E02000E04000E08000E10000E30000E70000EF8000F38
+000E1C000E1E000E0E000E07000E07800E03800E03C00E03E0FFCFF815207F9F18>I<0E00FE00
+0E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E
+000E000E000E000E000E000E000E000E000E00FFE00B20809F0C>I<0E1F01F000FE618618000E
+81C81C000F00F00E000F00F00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E00
+0E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E
+000E00E00E00FFE7FE7FE023147F9326>I<0E3E00FE43000E81800F01C00F01C00E01C00E01C0
+0E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C0FFE7FC
+16147F9319>I<01F800070E001C03803801C03801C07000E07000E0F000F0F000F0F000F0F000
+F0F000F0F000F07000E07000E03801C03801C01C0380070E0001F80014147F9317>I<0E3E00FE
+C3800F01C00F00E00E00E00E00F00E00700E00780E00780E00780E00780E00780E00780E00700E
+00F00E00E00F01E00F01C00EC3000E3E000E00000E00000E00000E00000E00000E00000E00000E
+0000FFE000151D7F9319>I<03E0800619801C05803C0780380380780380700380F00380F00380
+F00380F00380F00380F003807003807803803803803807801C0B800E138003E380000380000380
+000380000380000380000380000380000380003FF8151D7E9318>I<0E78FE8C0F1E0F1E0F0C0E
+000E000E000E000E000E000E000E000E000E000E000E000E000E00FFE00F147F9312>I<1F9030
+704030C010C010C010E00078007F803FE00FF00070803880188018C018C018E030D0608F800D14
+7E9312>I<020002000200060006000E000E003E00FFF80E000E000E000E000E000E000E000E00
+0E000E000E000E080E080E080E080E080610031001E00D1C7F9B12>I<0E01C0FE1FC00E01C00E
+01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E
+03C00603C0030DC001F1FC16147F9319>I<FF83F81E01E01C00C00E00800E00800E0080070100
+07010003820003820003820001C40001C40001EC0000E80000E800007000007000007000002000
+15147F9318>I<FF9FE1FC3C0780701C0300601C0380200E0380400E0380400E03C0400707C080
+0704C0800704E080038861000388710003C8730001D0320001D03A0000F03C0000E01C0000E01C
+0000601800004008001E147F9321>I<7FC3FC0F01E00701C007018003810001C20000E40000EC
+00007800003800003C00007C00004E000087000107000303800201C00601E01E01E0FF07FE1714
+809318>I<FF83F81E01E01C00C00E00800E00800E008007010007010003820003820003820001
+C40001C40001EC0000E80000E800007000007000007000002000002000004000004000004000F0
+8000F08000F100006200003C0000151D7F9318>I<3FFF380E200E201C40384078407000E001E0
+01C00380078007010E011E011C0338027006700EFFFE10147F9314>I E
+/Fo 41 122 df<0001FF0000001FFFC000007F80F00000FE00F80003FC01FC0003F803FC0007F0
+03FC0007F003FC0007F003FC0007F001F80007F000F00007F000000007F000000007F000000007
+F0000000FFFFFFFC00FFFFFFFC00FFFFFFFC0007F001FC0007F001FC0007F001FC0007F001FC00
+07F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC
0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001
-FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F001FC0007F0
-01FC0007F001FC0007F001FC007FFF1FFFC07FFF1FFFC07FFF1FFFC0222A7FA926>12
-D<000E00001E00007E0007FE00FFFE00FFFE00F8FE0000FE0000FE0000FE0000FE0000FE0000FE
-0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE
-0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE007FFFFE7FFFFE7FFF
-FE17277BA622>49 D<00FF800003FFF0000FFFFC003F03FF007C00FF807C007FC0FE007FC0FF00
-3FE0FF003FE0FF003FE0FF001FE07E001FE03C003FE000003FE000003FC000003FC000007F8000
-007F800000FF000001FE000001FC000003F0000007E000000FC000001F0000003E0000007C00E0
-007800E000F000E001E001C0038001C0070001C00FFFFFC01FFFFFC03FFFFFC07FFFFFC0FFFFFF
-80FFFFFF80FFFFFF801B277DA622>I<007F800003FFF00007FFFC001F81FE001F00FF003F80FF
-003F807F803FC07F803F807F803F807F801F007F800000FF800000FF000000FF000001FE000003
-F8000007F00000FFC00000FFF0000001FC000000FF0000007F8000007FC000003FC000003FE000
-003FE000003FE03C003FE07E003FE0FF003FE0FF003FE0FF003FC0FF007FC0FE007F807C00FF80
-3F01FF001FFFFC0007FFF00000FF80001B277DA622>I<00000E0000001E0000003E0000007E00
-0000FE000000FE000001FE000003FE0000077E00000E7E00000E7E00001C7E0000387E0000707E
-0000E07E0000E07E0001C07E0003807E0007007E000E007E000E007E001C007E0038007E007000
-7E00E0007E00FFFFFFF8FFFFFFF8FFFFFFF80000FE000000FE000000FE000000FE000000FE0000
-00FE000000FE000000FE00007FFFF8007FFFF8007FFFF81D277EA622>I<0C0003000F803F000F
-FFFE000FFFFE000FFFFC000FFFF8000FFFE0000FFFC0000FFE00000E0000000E0000000E000000
-0E0000000E0000000E0000000E7FC0000FFFF8000F80FE000E007F000C003F8000003F8000001F
-C000001FC000001FE000001FE018001FE07E001FE0FE001FE0FE001FE0FE001FE0FE001FE0FE00
-1FC078003FC078003F803C007F001F01FE000FFFFC0003FFF00000FF80001B277DA622>I<0007
-F000003FFC0000FFFF0001FC0F0007F01F800FE03F800FC03F801FC03F803F803F803F801F007F
-8000007F0000007F0000007F000000FF000000FF0FC000FF3FF800FF70FE00FFE03F00FFC03F80
-FF801FC0FF801FC0FF801FC0FF001FE0FF001FE0FF001FE0FF001FE07F001FE07F001FE07F001F
-E07F001FE03F801FC03F801FC01F803F800FC03F8007E0FF0003FFFC0000FFF000003FC0001B27
-7DA622>I<380000003E0000003FFFFFF03FFFFFF03FFFFFF07FFFFFE07FFFFFC07FFFFFC07FFF
-FF8070000F0070001E0070003C00E0003800E0007800E000F0000001E0000003C0000003C00000
-07800000078000000F0000001F0000001F0000001F0000003F0000003F0000003E0000007E0000
-007E0000007E0000007E000000FE000000FE000000FE000000FE000000FE000000FE000000FE00
-0000FE000000FE0000003800001C297CA822>I<000003800000000007C00000000007C0000000
-000FE0000000000FE0000000000FE0000000001FF0000000001FF0000000003FF8000000003FF8
-000000003FF80000000073FC0000000073FC00000000F3FE00000000E1FE00000000E1FE000000
-01C0FF00000001C0FF00000003C0FF80000003807F80000007807FC0000007003FC0000007003F
-C000000E003FE000000E001FE000001E001FF000001C000FF000001FFFFFF000003FFFFFF80000
-3FFFFFF80000780007FC0000700003FC0000700003FC0000E00001FE0000E00001FE0001E00001
-FF0001C00000FF0001C00000FF00FFFE001FFFFEFFFE001FFFFEFFFE001FFFFE2F297EA834>65
+FC0007F001FC007FFF1FFFC07FFF1FFFC07FFF1FFFC0222A7FA926>12 D<000E00001E00007E00
+07FE00FFFE00FFFE00F8FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00
+00FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE00
+00FE0000FE0000FE0000FE0000FE0000FE0000FE007FFFFE7FFFFE7FFFFE17277BA622>49
+D<00FF800003FFF0000FFFFC003F03FF007C00FF807C007FC0FE007FC0FF003FE0FF003FE0FF00
+3FE0FF001FE07E001FE03C003FE000003FE000003FC000003FC000007F8000007F800000FF0000
+01FE000001FC000003F0000007E000000FC000001F0000003E0000007C00E0007800E000F000E0
+01E001C0038001C0070001C00FFFFFC01FFFFFC03FFFFFC07FFFFFC0FFFFFF80FFFFFF80FFFFFF
+801B277DA622>I<007F800003FFF00007FFFC001F81FE001F00FF003F80FF003F807F803FC07F
+803F807F803F807F801F007F800000FF800000FF000000FF000001FE000003F8000007F00000FF
+C00000FFF0000001FC000000FF0000007F8000007FC000003FC000003FE000003FE000003FE03C
+003FE07E003FE0FF003FE0FF003FE0FF003FC0FF007FC0FE007F807C00FF803F01FF001FFFFC00
+07FFF00000FF80001B277DA622>I<00000E0000001E0000003E0000007E000000FE000000FE00
+0001FE000003FE0000077E00000E7E00000E7E00001C7E0000387E0000707E0000E07E0000E07E
+0001C07E0003807E0007007E000E007E000E007E001C007E0038007E0070007E00E0007E00FFFF
+FFF8FFFFFFF8FFFFFFF80000FE000000FE000000FE000000FE000000FE000000FE000000FE0000
+00FE00007FFFF8007FFFF8007FFFF81D277EA622>I<0C0003000F803F000FFFFE000FFFFE000F
+FFFC000FFFF8000FFFE0000FFFC0000FFE00000E0000000E0000000E0000000E0000000E000000
+0E0000000E7FC0000FFFF8000F80FE000E007F000C003F8000003F8000001FC000001FC000001F
+E000001FE018001FE07E001FE0FE001FE0FE001FE0FE001FE0FE001FE0FE001FC078003FC07800
+3F803C007F001F01FE000FFFFC0003FFF00000FF80001B277DA622>I<0007F000003FFC0000FF
+FF0001FC0F0007F01F800FE03F800FC03F801FC03F803F803F803F801F007F8000007F0000007F
+0000007F000000FF000000FF0FC000FF3FF800FF70FE00FFE03F00FFC03F80FF801FC0FF801FC0
+FF801FC0FF001FE0FF001FE0FF001FE0FF001FE07F001FE07F001FE07F001FE07F001FE03F801F
+C03F801FC01F803F800FC03F8007E0FF0003FFFC0000FFF000003FC0001B277DA622>I<380000
+003E0000003FFFFFF03FFFFFF03FFFFFF07FFFFFE07FFFFFC07FFFFFC07FFFFF8070000F007000
+1E0070003C00E0003800E0007800E000F0000001E0000003C0000003C000000780000007800000
+0F0000001F0000001F0000001F0000003F0000003F0000003E0000007E0000007E0000007E0000
+007E000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00
+00003800001C297CA822>I<000003800000000007C00000000007C0000000000FE0000000000F
+E0000000000FE0000000001FF0000000001FF0000000003FF8000000003FF8000000003FF80000
+000073FC0000000073FC00000000F3FE00000000E1FE00000000E1FE00000001C0FF00000001C0
+FF00000003C0FF80000003807F80000007807FC0000007003FC0000007003FC000000E003FE000
+000E001FE000001E001FF000001C000FF000001FFFFFF000003FFFFFF800003FFFFFF800007800
+07FC0000700003FC0000700003FC0000E00001FE0000E00001FE0001E00001FF0001C00000FF00
+01C00000FF00FFFE001FFFFEFFFE001FFFFEFFFE001FFFFE2F297EA834>65
D<FFFFFFFFE0FFFFFFFFE0FFFFFFFFE003FC001FE003FC0007F003FC0001F003FC0001F003FC00
00F003FC00007003FC00007003FC00007003FC01C07803FC01C03803FC01C03803FC01C03803FC
03C00003FC03C00003FC0FC00003FFFFC00003FFFFC00003FFFFC00003FC0FC00003FC03C00003
@@ -671,270 +904,103 @@ E00001F8E00001F8E00001F8F00001F8F00001F0F80003F0FC0003E0FF0007E0FFE01FC0FFFFFF
000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000
003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0
000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000003FC0000000
-003FC00000007FFFFFE000007FFFFFE000007FFFFFE0002B287EA730>I<01FF800007FFF0000F
-81FC001FC0FE001FC07F001FC07F001FC03F800F803F8000003F8000003F8000003F80000FFF80
-00FFFF8007FC3F801FE03F803F803F807F803F807F003F80FE003F80FE003F80FE003F80FE007F
-80FF007F807F00FFC03F83DFFC0FFF0FFC01FC03FC1E1B7E9A21>97 D<FFE0000000FFE0000000
-FFE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000
-000FE00000000FE00000000FE00000000FE00000000FE00000000FE1FE00000FE7FF80000FFE07
-E0000FF803F8000FF001FC000FE000FE000FE000FE000FE0007F000FE0007F000FE0007F800FE0
-007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800F
-E0007F000FE000FF000FE000FE000FF000FE000FF001FC000FF803F8000F9E07E0000F0FFF8000
-0E01FC0000212A7EA926>I<001FF80000FFFE0003F01F000FE03F801FC03F803F803F803F803F
-807F801F007F000000FF000000FF000000FF000000FF000000FF000000FF000000FF000000FF00
-0000FF0000007F0000007F8000003F8001C03FC001C01FC003C00FE0078003F01F0000FFFC0000
-1FE0001A1B7E9A1F>I<00003FF80000003FF80000003FF800000003F800000003F800000003F8
-00000003F800000003F800000003F800000003F800000003F800000003F800000003F800000003
-F800000003F800001FE3F80000FFFBF80003F03FF8000FE00FF8001FC007F8003F8003F8003F80
-03F8007F8003F8007F0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF
-0003F800FF0003F800FF0003F800FF0003F8007F0003F8007F0003F8003F8003F8003F8007F800
-1FC00FF8000FE01FF80003F03FFF8000FFF3FF80003FC3FF80212A7EA926>I<003FE00001FFF8
-0003F07E000FE03F001FC01F803F800FC03F800FC07F000FC07F0007E0FF0007E0FF0007E0FF00
-07E0FFFFFFE0FFFFFFE0FF000000FF000000FF000000FF0000007F0000007F8000003F8000E03F
-8001E01FC001C00FE003C003F81F8000FFFE00001FF0001B1B7E9A20>I<0007F0003FFC00FE3E
-01FC7F03F87F03F87F07F07F07F03E07F00007F00007F00007F00007F00007F00007F000FFFFC0
-FFFFC0FFFFC007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F000
-07F00007F00007F00007F00007F00007F00007F00007F00007F00007F0007FFF807FFF807FFF80
-182A7EA915>I<00FF81F003FFE7FC0FC1FE7C1F80FC7C3F80FE7C3F007E107F007F007F007F00
-7F007F007F007F007F007F007F007F003F007E003F80FE001F80FC000FC1F8001FFFE00018FF80
-00380000003C0000003C0000003E0000003FFFF8003FFFFF001FFFFFC00FFFFFE007FFFFF01FFF
-FFF07E0007F87C0001F8F80001F8F80000F8F80000F8F80000F8FC0001F87E0003F03F0007E00F
-C01F8003FFFE00007FF0001E287E9A22>I<FFE0000000FFE0000000FFE00000000FE00000000F
-E00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE0000000
-0FE00000000FE00000000FE00000000FE07F00000FE1FFC0000FE787E0000FEE07F0000FFC03F8
-000FF803F8000FF003F8000FF003F8000FF003F8000FE003F8000FE003F8000FE003F8000FE003
-F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE0
-03F8000FE003F8000FE003F8000FE003F800FFFE3FFF80FFFE3FFF80FFFE3FFF80212A7DA926>
-I<07001FC01FE03FE03FE03FE01FE01FC007000000000000000000000000000000FFE0FFE0FFE0
-0FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00F
-E00FE0FFFEFFFEFFFE0F2B7DAA14>I<FFE00000FFE00000FFE000000FE000000FE000000FE000
-000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE000000FE0
-1FFC0FE01FFC0FE01FFC0FE007C00FE00F800FE01E000FE07C000FE0F8000FE1F0000FE3E0000F
-E7C0000FEFE0000FFFF0000FFFF0000FFFF8000FF3FC000FE1FE000FC0FE000FC0FF000FC07F80
-0FC03F800FC03FC00FC01FE00FC00FF0FFFC3FFEFFFC3FFEFFFC3FFE1F2A7EA924>107
-D<FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0
-0FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00F
-E0FFFEFFFEFFFE0F2A7DA914>I<FFC07F800FF000FFC1FFE03FFC00FFC783F0F07E000FCE03F9
-C07F000FDC01FB803F000FF801FF003F800FF001FE003F800FF001FE003F800FF001FE003F800F
-E001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC00
-3F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE0
-01FC003F800FE001FC003F800FE001FC003F800FE001FC003F80FFFE1FFFC3FFF8FFFE1FFFC3FF
-F8FFFE1FFFC3FFF8351B7D9A3C>I<FFC07F0000FFC1FFC000FFC787E0000FCE07F0000FDC03F8
-000FF803F8000FF003F8000FF003F8000FF003F8000FE003F8000FE003F8000FE003F8000FE003
+003FC00000007FFFFFE000007FFFFFE000007FFFFFE0002B287EA730>I<FFFFF0003FFF80FFFF
+F0003FFF80FFFFF0003FFF8003FE000001E00001FE000001C00001FF000003C00000FF00000380
+0000FF0000038000007F8000070000007F8000070000007FC0000F0000003FC0000E0000003FE0
+001E0000001FE0001C0000001FF0001C0000000FF000380000000FF0003800000007F800700000
+0007F8007000000007FC00F000000003FC00E000000003FE01E000000001FE01C000000001FF01
+C000000000FF038000000000FF038000000000FF8780000000007F8700000000007FCF00000000
+003FCE00000000003FFE00000000001FFC00000000001FFC00000000000FF800000000000FF800
+000000000FF8000000000007F0000000000007F0000000000003E0000000000003E00000000000
+01C000000031297FA834>86 D<01FF800007FFF0000F81FC001FC0FE001FC07F001FC07F001FC0
+3F800F803F8000003F8000003F8000003F80000FFF8000FFFF8007FC3F801FE03F803F803F807F
+803F807F003F80FE003F80FE003F80FE003F80FE007F80FF007F807F00FFC03F83DFFC0FFF0FFC
+01FC03FC1E1B7E9A21>97 D<FFE0000000FFE0000000FFE00000000FE00000000FE00000000FE0
+0000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000F
+E00000000FE00000000FE1FE00000FE7FF80000FFE07E0000FF803F8000FF001FC000FE000FE00
+0FE000FE000FE0007F000FE0007F000FE0007F800FE0007F800FE0007F800FE0007F800FE0007F
+800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F000FE000FF000FE000FE000FF000
+FE000FF001FC000FF803F8000F9E07E0000F0FFF80000E01FC0000212A7EA926>I<001FF80000
+FFFE0003F01F000FE03F801FC03F803F803F803F803F807F801F007F000000FF000000FF000000
+FF000000FF000000FF000000FF000000FF000000FF000000FF0000007F0000007F8000003F8001
+C03FC001C01FC003C00FE0078003F01F0000FFFC00001FE0001A1B7E9A1F>I<00003FF8000000
+3FF80000003FF800000003F800000003F800000003F800000003F800000003F800000003F80000
+0003F800000003F800000003F800000003F800000003F800000003F800001FE3F80000FFFBF800
+03F03FF8000FE00FF8001FC007F8003F8003F8003F8003F8007F8003F8007F0003F800FF0003F8
+00FF0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003F800FF0003
+F8007F0003F8007F0003F8003F8003F8003F8007F8001FC00FF8000FE01FF80003F03FFF8000FF
+F3FF80003FC3FF80212A7EA926>I<003FE00001FFF80003F07E000FE03F001FC01F803F800FC0
+3F800FC07F000FC07F0007E0FF0007E0FF0007E0FF0007E0FFFFFFE0FFFFFFE0FF000000FF0000
+00FF000000FF0000007F0000007F8000003F8000E03F8001E01FC001C00FE003C003F81F8000FF
+FE00001FF0001B1B7E9A20>I<0007F0003FFC00FE3E01FC7F03F87F03F87F07F07F07F03E07F0
+0007F00007F00007F00007F00007F00007F000FFFFC0FFFFC0FFFFC007F00007F00007F00007F0
+0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F0
+0007F00007F00007F00007F0007FFF807FFF807FFF80182A7EA915>I<00FF81F003FFE7FC0FC1
+FE7C1F80FC7C3F80FE7C3F007E107F007F007F007F007F007F007F007F007F007F007F007F003F
+007E003F80FE001F80FC000FC1F8001FFFE00018FF8000380000003C0000003C0000003E000000
+3FFFF8003FFFFF001FFFFFC00FFFFFE007FFFFF01FFFFFF07E0007F87C0001F8F80001F8F80000
+F8F80000F8F80000F8FC0001F87E0003F03F0007E00FC01F8003FFFE00007FF0001E287E9A22>
+I<FFE0000000FFE0000000FFE00000000FE00000000FE00000000FE00000000FE00000000FE000
+00000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE0
+7F00000FE1FFC0000FE787E0000FEE07F0000FFC03F8000FF803F8000FF003F8000FF003F8000F
+F003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F800
+0FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8
+00FFFE3FFF80FFFE3FFF80FFFE3FFF80212A7DA926>I<07001FC01FE03FE03FE03FE01FE01FC0
+07000000000000000000000000000000FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00FE00FE00F
+E00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2B7DAA14>I<FF
+E00000FFE00000FFE000000FE000000FE000000FE000000FE000000FE000000FE000000FE00000
+0FE000000FE000000FE000000FE000000FE000000FE01FFC0FE01FFC0FE01FFC0FE007C00FE00F
+800FE01E000FE07C000FE0F8000FE1F0000FE3E0000FE7C0000FEFE0000FFFF0000FFFF0000FFF
+F8000FF3FC000FE1FE000FC0FE000FC0FF000FC07F800FC03F800FC03FC00FC01FE00FC00FF0FF
+FC3FFEFFFC3FFEFFFC3FFE1F2A7EA924>107 D<FFE0FFE0FFE00FE00FE00FE00FE00FE00FE00F
+E00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0
+0FE00FE00FE00FE00FE00FE00FE00FE00FE00FE0FFFEFFFEFFFE0F2A7DA914>I<FFC07F800FF0
+00FFC1FFE03FFC00FFC783F0F07E000FCE03F9C07F000FDC01FB803F000FF801FF003F800FF001
+FE003F800FF001FE003F800FF001FE003F800FE001FC003F800FE001FC003F800FE001FC003F80
+0FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC
+003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800FE001FC003F800F
+E001FC003F80FFFE1FFFC3FFF8FFFE1FFFC3FFF8FFFE1FFFC3FFF8351B7D9A3C>I<FFC07F0000
+FFC1FFC000FFC787E0000FCE07F0000FDC03F8000FF803F8000FF003F8000FF003F8000FF003F8
+000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003
+F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F800FFFE
+3FFF80FFFE3FFF80FFFE3FFF80211B7D9A26>I<003FE00001FFFC0003F07E000FC01F801F800F
+C03F800FE03F0007E07F0007F07F0007F07F0007F0FF0007F8FF0007F8FF0007F8FF0007F8FF00
+07F8FF0007F8FF0007F8FF0007F87F0007F07F0007F03F800FE03F800FE01F800FC00FC01F8007
+F07F0001FFFC00003FE0001D1B7E9A22>I<FFE1FE0000FFE7FF8000FFFE07E0000FF803F8000F
+F001FC000FE001FE000FE000FE000FE000FF000FE000FF000FE0007F800FE0007F800FE0007F80
+0FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE000FF000FE000FF
+000FE000FE000FF001FE000FF003FC000FF803F8000FFE0FE0000FEFFF80000FE1FC00000FE000
+00000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE00000000FE0
+000000FFFE000000FFFE000000FFFE00000021277E9A26>I<FFC1F0FFC7FCFFCE3E0FDC7F0FD8
+7F0FF87F0FF07F0FF03E0FF0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0
+000FE0000FE0000FE0000FE0000FE0000FE000FFFF00FFFF00FFFF00181B7E9A1C>114
+D<03FE300FFFF03E03F07800F07000F0F00070F00070F80070FC0000FFE000FFFE007FFFC03FFF
+E01FFFF007FFF800FFFC0003FC0000FCE0007CE0003CF0003CF0003CF80078FC0078FF01F0F7FF
+C0C1FF00161B7E9A1B>I<00700000700000700000700000F00000F00000F00001F00003F00003
+F00007F0001FFFF0FFFFF0FFFFF007F00007F00007F00007F00007F00007F00007F00007F00007
+F00007F00007F00007F00007F00007F03807F03807F03807F03807F03807F03807F03803F87001
+F8F000FFE0001F8015267FA51B>I<FFE03FF800FFE03FF800FFE03FF8000FE003F8000FE003F8
+000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003
F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE0
-03F8000FE003F8000FE003F8000FE003F800FFFE3FFF80FFFE3FFF80FFFE3FFF80211B7D9A26>
-I<003FE00001FFFC0003F07E000FC01F801F800FC03F800FE03F0007E07F0007F07F0007F07F00
-07F0FF0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F8FF0007F87F0007F07F
-0007F03F800FE03F800FE01F800FC00FC01F8007F07F0001FFFC00003FE0001D1B7E9A22>I<FF
-E1FE0000FFE7FF8000FFFE07E0000FF803F8000FF001FC000FE001FE000FE000FE000FE000FF00
-0FE000FF000FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F800FE0007F
-800FE0007F800FE0007F800FE000FF000FE000FF000FE000FE000FF001FE000FF003FC000FF803
-F8000FFE0FE0000FEFFF80000FE1FC00000FE00000000FE00000000FE00000000FE00000000FE0
-0000000FE00000000FE00000000FE00000000FE0000000FFFE000000FFFE000000FFFE00000021
-277E9A26>I<FFC1F0FFC7FCFFCE3E0FDC7F0FD87F0FF87F0FF07F0FF03E0FF0000FE0000FE000
-0FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE0000FE000
-FFFF00FFFF00FFFF00181B7E9A1C>114 D<03FE300FFFF03E03F07800F07000F0F00070F00070
-F80070FC0000FFE000FFFE007FFFC03FFFE01FFFF007FFF800FFFC0003FC0000FCE0007CE0003C
-F0003CF0003CF80078FC0078FF01F0F7FFC0C1FF00161B7E9A1B>I<0070000070000070000070
-0000F00000F00000F00001F00003F00003F00007F0001FFFF0FFFFF0FFFFF007F00007F00007F0
-0007F00007F00007F00007F00007F00007F00007F00007F00007F00007F00007F03807F03807F0
-3807F03807F03807F03807F03803F87001F8F000FFE0001F8015267FA51B>I<FFE03FF800FFE0
-3FF800FFE03FF8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000F
-E003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F8000FE003F800
-0FE003F8000FE003F8000FE003F8000FE007F8000FE007F8000FE00FF80007E01FF80003F03BFF
-8001FFF3FF80003FC3FF80211B7D9A26>I<FFFE03FF80FFFE03FF80FFFE03FF8007F000700007
-F000700007F800F00003F800E00003FC01E00001FC01C00001FC01C00000FE03800000FE038000
-007F070000007F070000007F8F0000003F8E0000003FDE0000001FDC0000001FDC0000000FF800
-00000FF80000000FF800000007F000000007F000000003E000000003E000000001C00000211B7F
-9A24>I<FFFE7FFC0FFEFFFE7FFC0FFEFFFE7FFC0FFE0FE007E000E007F003F001C007F003F001
-C007F807F803C003F807F8038003F807F8038001FC0EFC070001FC0EFC070001FE1EFC0F0000FE
-1C7E0E0000FE1C7E0E0000FF383F1E00007F383F1C00007F783F3C00003FF01FB800003FF01FB8
-00003FF01FF800001FE00FF000001FE00FF000000FC007E000000FC007E000000FC007E0000007
-8003C00000078003C0002F1B7F9A32>I<FFFC0FFF00FFFC0FFF00FFFC0FFF0007F003C00003F8
-07800001FC07800000FE0F000000FF1E0000007F3C0000003FF80000001FF00000000FF0000000
-0FF000000007F000000007F80000000FFC0000001FFE0000001EFE0000003C7F000000783F8000
-00F01FC00001E01FE00001C00FE00003C007F000FFF01FFF80FFF01FFF80FFF01FFF80211B7F9A
-24>I<FFFE03FF80FFFE03FF80FFFE03FF8007F000700007F000700007F800F00003F800E00003
-FC01E00001FC01C00001FC01C00000FE03800000FE038000007F070000007F070000007F8F0000
-003F8E0000003FDE0000001FDC0000001FDC0000000FF80000000FF80000000FF800000007F000
-000007F000000003E000000003E000000001C000000001C0000000038000000003800000380780
-00007C07000000FE0F000000FE0E000000FE1E000000FE3C0000007C780000003FE00000000FC0
-00000021277F9A24>I E /Fm 75 123 df<001F83E000F06E3001C078780380F8780300F03007
-007000070070000700700007007000070070000700700007007000FFFFFF800700700007007000
-070070000700700007007000070070000700700007007000070070000700700007007000070070
-000700700007007000070070000700700007007000070070007FE3FF001D20809F1B>11
-D<003F0000E0C001C0C00381E00701E00701E0070000070000070000070000070000070000FFFF
-E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700
-E00700E00700E00700E00700E00700E07FC3FE1720809F19>I<003FE000E0E001C1E00381E007
-00E00700E00700E00700E00700E00700E00700E00700E0FFFFE00700E00700E00700E00700E007
-00E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E00700E007
-00E07FE7FE1720809F19>I<001F81F80000F04F040001C07C06000380F80F000300F00F000700
-F00F00070070000007007000000700700000070070000007007000000700700000FFFFFFFF0007
-007007000700700700070070070007007007000700700700070070070007007007000700700700
-070070070007007007000700700700070070070007007007000700700700070070070007007007
-00070070070007007007007FE3FE3FF02420809F26>I<07070F1C383060C00808779F17>19
-D<7038F87CFC7EFC7E743A0402040204020804080410081008201040200F0E7E9F17>34
-D<70F8FCFC74040404080810102040060E7C9F0D>39 D<0020004000800100020006000C000C00
-180018003000300030007000600060006000E000E000E000E000E000E000E000E000E000E000E0
-00E0006000600060007000300030003000180018000C000C000600020001000080004000200B2E
-7DA112>I<800040002000100008000C00060006000300030001800180018001C000C000C000C0
-00E000E000E000E000E000E000E000E000E000E000E000E000C000C000C001C001800180018003
-000300060006000C00080010002000400080000B2E7DA112>I<70F8FCFC740404040808101020
-40060E7C840D>44 D<FFC0FFC00A027F8A0F>I<70F8F8F87005057C840D>I<0003000300070006
-0006000E000C000C001C0018001800380030003000700060006000E000C000C001C00180018001
-800380030003000700060006000E000C000C001C0018001800380030003000700060006000E000
-C000C000102D7DA117>I<03F0000E1C001C0E00180600380700700380700380700380700380F0
-03C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C0F003C070
-03807003807003807807803807001806001C0E000E1C0003F000121F7E9D17>I<018003800F80
-F38003800380038003800380038003800380038003800380038003800380038003800380038003
-800380038003800380038007C0FFFE0F1E7C9D17>I<03F0000C1C00100E002007004007808007
-80F007C0F803C0F803C0F803C02007C00007C0000780000780000F00000E00001C000038000070
-0000600000C0000180000300000600400C00401800401000803FFF807FFF80FFFF80121E7E9D17
->I<03F0000C1C00100E00200F00780F80780780780780380F80000F80000F00000F00000E0000
-1C0000380003F000003C00000E00000F000007800007800007C02007C0F807C0F807C0F807C0F0
-0780400780400F00200E001C3C0003F000121F7E9D17>I<000600000600000E00000E00001E00
-002E00002E00004E00008E00008E00010E00020E00020E00040E00080E00080E00100E00200E00
-200E00400E00C00E00FFFFF0000E00000E00000E00000E00000E00000E00000E0000FFE0141E7F
-9D17>I<1803001FFE001FFC001FF8001FE00010000010000010000010000010000010000011F0
-00161C00180E001007001007800003800003800003C00003C00003C07003C0F003C0F003C0E003
-80400380400700200600100E000C380003E000121F7E9D17>I<007C000182000701000E03800C
-07801C0780380300380000780000700000700000F1F000F21C00F40600F80700F80380F80380F0
-03C0F003C0F003C0F003C0F003C07003C07003C07003803803803807001807000C0E00061C0001
-F000121F7E9D17>I<4000007FFFC07FFF807FFF80400100800200800200800400000800000800
-00100000200000200000400000400000C00000C00001C000018000038000038000038000038000
-078000078000078000078000078000078000078000030000121F7D9D17>I<03F0000C0C001006
-003003002001806001806001806001807001807803003E03003F06001FC8000FF00003F80007FC
-000C7E00103F00300F806003804001C0C001C0C000C0C000C0C000C0C000806001802001001002
-000C0C0003F000121F7E9D17>I<03F0000E18001C0C00380600380700700700700380F00380F0
-0380F003C0F003C0F003C0F003C0F003C07007C07007C03807C0180BC00E13C003E3C000038000
-0380000380000700300700780600780E00700C002018001070000FC000121F7E9D17>I<70F8F8
-F8700000000000000000000070F8F8F87005147C930D>I<70F8F8F87000000000000000000000
-70F0F8F878080808101010202040051D7C930D>I<7FFFFFE0FFFFFFF000000000000000000000
-00000000000000000000000000000000000000000000FFFFFFF07FFFFFE01C0C7D9023>61
-D<001F800000E0700001000800060006000800010008000100100F00802030C0402060404040C0
-202041C01C2041C01C2081801C1083801C1083801C1083801C1083801C1083801C1083801C1081
-801C1041C01C1041C01C1040C03C2020605C202030CC40100F0780080000000800000006000070
-010001C000E01F00001FF0001C207D9F23>64 D<000100000003800000038000000380000007C0
-000007C0000007C0000009E0000009E0000009E0000010F0000010F0000010F000002078000020
-78000020780000403C0000403C0000403C0000801E0000801E0000FFFE0001000F0001000F0001
-000F00020007800200078002000780040003C00E0003C01F0007E0FFC03FFE1F207F9F22>I<FF
-FFE0000F80380007801E0007801F0007800F0007800F8007800F8007800F8007800F8007800F80
-07800F0007801F0007801E0007803C0007FFF00007803C0007801E0007800F0007800F80078007
-80078007C0078007C0078007C0078007C0078007C00780078007800F8007800F0007801F000F80
-3C00FFFFF0001A1F7E9E20>I<000FC040007030C001C009C0038005C0070003C00E0001C01E00
-00C01C0000C03C0000C07C0000407C00004078000040F8000000F8000000F8000000F8000000F8
-000000F8000000F8000000F8000000F8000000780000007C0000407C0000403C0000401C000040
-1E0000800E000080070001000380020001C0040000703800000FC0001A217D9F21>I<FFFFFF00
-0F800F000780030007800300078001000780018007800080078000800780008007808080078080
-0007808000078080000781800007FF800007818000078080000780800007808000078080000780
-00200780002007800020078000400780004007800040078000C0078000C0078001800F800F80FF
-FFFF801B1F7E9E1F>69 D<FFFFFF000F800F000780030007800300078001000780018007800080
-078000800780008007800080078080000780800007808000078080000781800007FF8000078180
-000780800007808000078080000780800007800000078000000780000007800000078000000780
-000007800000078000000FC00000FFFE0000191F7E9E1E>I<000FE0200078186000E004E00380
-02E0070001E00F0000E01E0000601E0000603C0000603C0000207C00002078000020F8000000F8
-000000F8000000F8000000F8000000F8000000F8000000F8007FFCF80003E0780001E07C0001E0
-3C0001E03C0001E01E0001E01E0001E00F0001E0070001E0038002E000E0046000781820000FE0
-001E217D9F24>I<FFF8FFF80F800F8007800F0007800F0007800F0007800F0007800F0007800F
-0007800F0007800F0007800F0007800F0007800F0007800F0007FFFF0007800F0007800F000780
-0F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007800F0007
-800F0007800F000F800F80FFF8FFF81D1F7E9E22>I<FFFC0FC007800780078007800780078007
-800780078007800780078007800780078007800780078007800780078007800780078007800780
-07800FC0FFFC0E1F7F9E10>I<FFFE000FC0000780000780000780000780000780000780000780
-000780000780000780000780000780000780000780000780000780000780000780000780020780
-0207800207800207800607800407800407800C07801C0F807CFFFFFC171F7E9E1C>76
-D<FF80001FF80F80001F800780001F0005C0002F0005C0002F0005C0002F0004E0004F0004E000
-4F000470008F000470008F000470008F000438010F000438010F000438010F00041C020F00041C
-020F00041C020F00040E040F00040E040F00040E040F000407080F000407080F000407080F0004
-03900F000403900F000401E00F000401E00F000401E00F000E00C00F001F00C01F80FFE0C1FFF8
-251F7E9E2A>I<FF803FF807C007C007C0038005E0010005E0010004F001000478010004780100
-043C0100043C0100041E0100040F0100040F010004078100040781000403C1000401E1000401E1
-000400F1000400F1000400790004003D0004003D0004001F0004001F0004000F00040007000400
-07000E0003001F000300FFE001001D1F7E9E22>I<001F800000F0F00001C0380007801E000F00
-0F000E0007001E0007803C0003C03C0003C07C0003E0780001E0780001E0F80001F0F80001F0F8
-0001F0F80001F0F80001F0F80001F0F80001F0F80001F0F80001F0780001E07C0003E07C0003E0
-3C0003C03C0003C01E0007800E0007000F000F0007801E0001C0380000F0F000001F80001C217D
-9F23>I<FFFFE0000F80780007801C0007801E0007800F0007800F8007800F8007800F8007800F
-8007800F8007800F8007800F0007801E0007801C000780780007FFE00007800000078000000780
-000007800000078000000780000007800000078000000780000007800000078000000780000007
-8000000FC00000FFFC0000191F7E9E1F>I<FFFF80000F80F0000780780007803C0007801E0007
-801E0007801F0007801F0007801F0007801F0007801E0007801E0007803C00078078000780F000
-07FF80000781C0000780E0000780F0000780700007807800078078000780780007807C0007807C
-0007807C0007807C0407807E0407803E040FC01E08FFFC0F10000003E01E207E9E21>82
-D<07E0800C1980100780300380600180600180E00180E00080E00080E00080F00000F000007800
-007F00003FF0001FFC000FFE0003FF00001F800007800003C00003C00001C08001C08001C08001
-C08001C0C00180C00380E00300F00600CE0C0081F80012217D9F19>I<7FFFFFE0780F01E0600F
-0060400F0020400F0020C00F0030800F0010800F0010800F0010800F0010000F0000000F000000
-0F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000000F0000
-000F0000000F0000000F0000000F0000000F0000000F0000000F0000001F800007FFFE001C1F7E
-9E21>I<FFFC3FF80FC007C0078003800780010007800100078001000780010007800100078001
-000780010007800100078001000780010007800100078001000780010007800100078001000780
-01000780010007800100078001000780010007800100038002000380020001C0020001C0040000
-E008000070180000382000000FC0001D207E9E22>I<FFF003FE1F8000F80F0000600F80006007
-8000400780004003C0008003C0008003C0008001E0010001E0010001F0010000F0020000F00200
-00F806000078040000780400003C0800003C0800003C0800001E1000001E1000001F3000000F20
-00000F20000007C0000007C0000007C000000380000003800000038000000100001F207F9E22>
-I<FFF07FF81FF01F800FC007C00F00078003800F00078001000F0007C00100078007C002000780
-07C00200078007C0020003C009E0040003C009E0040003C009E0040003E010F00C0001E010F008
-0001E010F0080001F02078080000F02078100000F02078100000F0403C10000078403C20000078
-403C20000078C03E2000003C801E4000003C801E4000003C801E4000001F000F8000001F000F80
-00001F000F8000001E00078000000E00070000000E00070000000C000300000004000200002C20
-7F9E2F>I<FEFEC0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0C0
-C0C0C0C0C0C0C0C0C0FEFE072D7CA10D>91 D<080410082010201040204020804080408040B85C
-FC7EFC7E7C3E381C0F0E7B9F17>I<FEFE06060606060606060606060606060606060606060606
-06060606060606060606060606060606060606FEFE072D7FA10D>I<1FE000303000781800781C
-00300E00000E00000E00000E0000FE00078E001E0E00380E00780E00F00E10F00E10F00E10F01E
-10781E103867200F83C014147E9317>97 D<0E0000FE00000E00000E00000E00000E00000E0000
-0E00000E00000E00000E00000E00000E3E000EC3800F01C00F00E00E00E00E00700E00700E0078
-0E00780E00780E00780E00780E00780E00700E00700E00E00F00E00D01C00CC300083E0015207F
-9F19>I<03F80E0C1C1E381E380C70007000F000F000F000F000F000F00070007000380138011C
-020E0C03F010147E9314>I<000380003F80000380000380000380000380000380000380000380
-00038000038000038003E380061B801C0780380380380380700380700380F00380F00380F00380
-F00380F00380F003807003807003803803803807801C07800E1B8003E3F815207E9F19>I<03F0
-000E1C001C0E00380700380700700700700380F00380F00380FFFF80F00000F00000F000007000
-007000003800801800800C010007060001F80011147F9314>I<007C00C6018F038F0706070007
-0007000700070007000700FFF00700070007000700070007000700070007000700070007000700
-070007000700070007007FF01020809F0E>I<0000E003E3300E3C301C1C30380E00780F00780F
-00780F00780F00780F00380E001C1C001E380033E0002000002000003000003000003FFE001FFF
-800FFFC03001E0600070C00030C00030C00030C000306000603000C01C038003FC00141F7F9417
->I<0E0000FE00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E
-3E000E43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E
-01C00E01C00E01C00E01C00E01C00E01C0FFE7FC16207F9F19>I<1C001E003E001E001C000000
-000000000000000000000E007E000E000E000E000E000E000E000E000E000E000E000E000E000E
-000E000E000E000E00FFC00A1F809E0C>I<00E001F001F001F000E00000000000000000000000
-00007007F000F00070007000700070007000700070007000700070007000700070007000700070
-007000700070007000706070F060F0C061803F000C28829E0E>I<0E0000FE00000E00000E0000
-0E00000E00000E00000E00000E00000E00000E00000E00000E0FF00E03C00E03000E02000E0400
-0E08000E10000E30000E70000EF8000F38000E1C000E1E000E0E000E07000E07800E03800E03C0
-0E03E0FFCFF815207F9F18>I<0E00FE000E000E000E000E000E000E000E000E000E000E000E00
-0E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E000E00FFE00B
-20809F0C>I<0E1F01F000FE618618000E81C81C000F00F00E000F00F00E000E00E00E000E00E0
-0E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00E00E000E00
-E00E000E00E00E000E00E00E000E00E00E000E00E00E00FFE7FE7FE023147F9326>I<0E3E00FE
-43000E81800F01C00F01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E
-01C00E01C00E01C00E01C00E01C0FFE7FC16147F9319>I<01F800070E001C03803801C03801C0
-7000E07000E0F000F0F000F0F000F0F000F0F000F0F000F07000E07000E03801C03801C01C0380
-070E0001F80014147F9317>I<0E3E00FEC3800F01C00F00E00E00E00E00F00E00700E00780E00
-780E00780E00780E00780E00780E00700E00F00E00E00F01E00F01C00EC3000E3E000E00000E00
-000E00000E00000E00000E00000E00000E0000FFE000151D7F9319>I<03E0800619801C05803C
-0780380380780380700380F00380F00380F00380F00380F00380F0038070038078038038038038
-07801C0B800E138003E380000380000380000380000380000380000380000380000380003FF815
-1D7E9318>I<0E78FE8C0F1E0F1E0F0C0E000E000E000E000E000E000E000E000E000E000E000E
-000E000E00FFE00F147F9312>I<1F9030704030C010C010C010E00078007F803FE00FF0007080
-3880188018C018C018E030D0608F800D147E9312>I<020002000200060006000E000E003E00FF
-F80E000E000E000E000E000E000E000E000E000E000E000E080E080E080E080E080610031001E0
-0D1C7F9B12>I<0E01C0FE1FC00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01
-C00E01C00E01C00E01C00E01C00E01C00E03C00603C0030DC001F1FC16147F9319>I<FF83F81E
-01E01C00C00E00800E00800E008007010007010003820003820003820001C40001C40001EC0000
-E80000E80000700000700000700000200015147F9318>I<FF9FE1FC3C0780701C0300601C0380
-200E0380400E0380400E03C0400707C0800704C0800704E080038861000388710003C8730001D0
-320001D03A0000F03C0000E01C0000E01C0000601800004008001E147F9321>I<7FC3FC0F01E0
-0701C007018003810001C20000E40000EC00007800003800003C00007C00004E00008700010700
-0303800201C00601E01E01E0FF07FE1714809318>I<FF83F81E01E01C00C00E00800E00800E00
-8007010007010003820003820003820001C40001C40001EC0000E80000E8000070000070000070
-00002000002000004000004000004000F08000F08000F100006200003C0000151D7F9318>I<3F
-FF380E200E201C40384078407000E001E001C00380078007010E011E011C0338027006700EFFFE
-10147F9314>I E /Fn 13 118 df<0F001F003F803F007E00F800F000C0000A08769C18>19
+07F8000FE007F8000FE00FF80007E01FF80003F03BFF8001FFF3FF80003FC3FF80211B7D9A26>
+I<FFFE03FF80FFFE03FF80FFFE03FF8007F000700007F000700007F800F00003F800E00003FC01
+E00001FC01C00001FC01C00000FE03800000FE038000007F070000007F070000007F8F0000003F
+8E0000003FDE0000001FDC0000001FDC0000000FF80000000FF80000000FF800000007F0000000
+07F000000003E000000003E000000001C00000211B7F9A24>I<FFFE7FFC0FFEFFFE7FFC0FFEFF
+FE7FFC0FFE0FE007E000E007F003F001C007F003F001C007F807F803C003F807F8038003F807F8
+038001FC0EFC070001FC0EFC070001FE1EFC0F0000FE1C7E0E0000FE1C7E0E0000FF383F1E0000
+7F383F1C00007F783F3C00003FF01FB800003FF01FB800003FF01FF800001FE00FF000001FE00F
+F000000FC007E000000FC007E000000FC007E00000078003C00000078003C0002F1B7F9A32>I<
+FFFC0FFF00FFFC0FFF00FFFC0FFF0007F003C00003F807800001FC07800000FE0F000000FF1E00
+00007F3C0000003FF80000001FF00000000FF00000000FF000000007F000000007F80000000FFC
+0000001FFE0000001EFE0000003C7F000000783F800000F01FC00001E01FE00001C00FE00003C0
+07F000FFF01FFF80FFF01FFF80FFF01FFF80211B7F9A24>I<FFFE03FF80FFFE03FF80FFFE03FF
+8007F000700007F000700007F800F00003F800E00003FC01E00001FC01C00001FC01C00000FE03
+800000FE038000007F070000007F070000007F8F0000003F8E0000003FDE0000001FDC0000001F
+DC0000000FF80000000FF80000000FF800000007F000000007F000000003E000000003E0000000
+01C000000001C000000003800000000380000038078000007C07000000FE0F000000FE0E000000
+FE1E000000FE3C0000007C780000003FE00000000FC000000021277F9A24>I
+E /Fp 13 118 df<0F001F003F803F007E00F800F000C0000A08769C18>19
D<00038000000380000007C0000007C0000007C000000FE000000FE000001FF000001BF000001B
F0000031F8000031F8000061FC000060FC0000E0FE0000C07E0000C07E0001803F0001FFFF0003
FFFF8003001F8003001F8006000FC006000FC00E000FE00C0007E0FFC07FFEFFC07FFE1F1C7E9B
@@ -958,35 +1024,61 @@ D<1FD830786018E018E018F000FF807FE07FF01FF807FC007CC01CC01CE01CE018F830CFC00E12
7E9113>I<0300030003000300070007000F000F003FFCFFFC1F001F001F001F001F001F001F00
1F001F001F0C1F0C1F0C1F0C0F08079803F00E1A7F9913>I<FF07F8FF07F81F00F81F00F81F00
F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F00F81F01F80F01F80786FF01F8
-FF18127F911B>I E /Fo 45 127 df<007E0001C1800301800703C00E03C00E01800E00000E00
-000E00000E00000E0000FFFFC00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01
-C00E01C00E01C00E01C00E01C00E01C00E01C00E01C07F87F8151D809C17>12
-D<FC001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C001C00FF800912
-7F910C>16 D<1C1C3C3870C0800707779C15>19 D<1C001E00078003C001C00380FF000A077B7E
-12>24 D<60F0F0701010101020204080040C7C830C>44 D<FFE0FFE00B0280890E>I<60F0F060
-04047C830C>I<003F800000C0600003001800040004000800020010000100201F008020708080
-40E0404040C0384041C03840818038208380382083803820838038208380382083803820818038
-2041C0382040C0384040E0784020709880201F0F00100000000800000004000000030001E000C0
-1F80003FF0001B1D7E9C20>64 D<000600000006000000060000000F0000000F0000000F000000
-17800000178000001780000023C0000023C0000023C0000041E0000041E0000041E0000080F000
-0080F0000180F8000100780001FFF80003007C0002003C0002003C0006003E0004001E0004001E
-000C001F001E001F00FF80FFF01C1D7F9C1F>I<001F808000E0618001801980070007800E0003
-801C0003801C00018038000180780000807800008070000080F0000000F0000000F0000000F000
-0000F0000000F0000000F0000000F0000000700000807800008078000080380000801C0001001C
-0001000E000200070004000180080000E03000001FC000191E7E9C1E>67
-D<FFFFFC0F003C0F000C0F00040F00040F00060F00020F00020F02020F02000F02000F02000F06
-000FFE000F06000F02000F02000F02000F02010F00010F00020F00020F00020F00060F00060F00
-0C0F003CFFFFFC181C7E9B1C>69 D<001F808000E0618001801980070007800E0003801C000380
-1C00018038000180780000807800008070000080F0000000F0000000F0000000F0000000F00000
-00F0000000F000FFF0F0000F80700007807800078078000780380007801C0007801C0007800E00
-078007000B800180118000E06080001F80001C1E7E9C21>71 D<FFF00F000F000F000F000F000F
+FF18127F911B>I E /Fq 19 118 df<387C7E7E3E0E1E3C7CF860070B798416>44
+D<FFFF80FFFF80FFFF8011037E8D16>I<70F8F8F8700505788416>I<00F80003FE000FFF001F0F
+803E3F803C7F8078FFC071E7C0F1C3C0E3C3C0E381C0E381C0E381C0E381C0E381C0E3C3C0F1C3
+8071E78078FF003C7E003E3C001F03C00FFFC003FF0000FC0012197E9816>64
+D<1FE0007FF8007FFC00783C00301E00000E00000E0003FE001FFE007E0E00F00E00E00E00E00E
+00F01E00F83E007FFFE03FE7E00F83E013127E9116>97 D<7E0000FE00007E00000E00000E0000
+0E00000E00000E3E000EFF800FFFC00F83E00F01E00E00F00E00F00E00700E00700E00700E0070
+0E00F00F00E00F01E00F83C00FFFC00EFF00063C001419809816>I<03F80FFE1FFE3C1E780C70
+00F000E000E000E000E000F000700778073E0F1FFE0FFC03F010127D9116>I<003F00007F0000
+3F0000070000070000070000070003C7000FF7003FFF003C1F00780F00F00700F00700E00700E0
+0700E00700E00700F00700F00F00781F007C3F003FFFE01FF7F007C7E014197F9816>I<03E00F
+F81FFC3C1E780E7007E007FFFFFFFFFFFFE000E000700778073C0F1FFE0FFC03F010127D9116>
+I<001F00007F8000FF8001E78001C30001C00001C0007FFF00FFFF00FFFF0001C00001C00001C0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C0003FFE007FFF003FFE001119
+7F9816>I<7E0000FE00007E00000E00000E00000E00000E00000E3C000EFF000FFF800F87800F
+03800F03800E03800E03800E03800E03800E03800E03800E03800E03800E03807FC7F0FFE7F87F
+C7F01519809816>104 D<018003C003C0018000000000000000007FC07FC07FC001C001C001C0
+01C001C001C001C001C001C001C001C001C07FFFFFFF7FFF101A7D9916>I<FFC000FFC000FFC0
+0001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C00001C0
+0001C00001C00001C00001C00001C00001C000FFFF80FFFF80FFFF8011197E9816>108
+D<03E0000FF8001FFC003C1E00780F00700700E00380E00380E00380E00380E00380F007807007
+00780F003C1E001FFC000FF80003E00011127E9116>111 D<7E3E00FEFF807FFFC00F83E00F01
+E00E00F00E00F00E00700E00700E00700E00700E00F00F00E00F01E00F83C00FFFC00EFF000E3C
+000E00000E00000E00000E00000E00000E00007FC000FFE0007FC000141B809116>I<FF0FC0FF
+3FE0FF7FE007F04007E00007C00007800007800007000007000007000007000007000007000007
+0000FFFC00FFFC00FFFC0013127F9116>114 D<0FEC3FFC7FFCF03CE01CE01CF0007F801FF007
+FC003EE00EE00EF00EF81EFFFCFFF8C7E00F127D9116>I<030000070000070000070000070000
+7FFF00FFFF00FFFF00070000070000070000070000070000070000070000070100070380070380
+07078007878003FF0003FE0000F80011177F9616>I<7E1F80FE3F807E1F800E03800E03800E03
+800E03800E03800E03800E03800E03800E03800E03800E07800F0F800FFFF007FFF803E3F01512
+809116>I E /Fr 44 127 df<007E0001C1800301800703C00E03C00E01800E00000E00000E00
+000E00000E0000FFFFC00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01C00E01
+C00E01C00E01C00E01C00E01C00E01C00E01C07F87F8151D809C17>12 D<FC001C001C001C001C
+001C001C001C001C001C001C001C001C001C001C001C001C00FF8009127F910C>16
+D<1C1C3C3870C0800707779C15>19 D<1C001E00078003C001C00380FF000A077B7E12>24
+D<FFE0FFE00B0280890E>45 D<60F0F06004047C830C>I<030007003F00C70007000700070007
+000700070007000700070007000700070007000700070007000700070007000700070007000F80
+FFF80D1C7C9B15>49 D<07C01830201C400C400EF00FF80FF807F8077007000F000E000E001C00
+1C00380070006000C00180030006010C01180110023FFE7FFEFFFE101C7E9B15>I<0006000000
+06000000060000000F0000000F0000000F00000017800000178000001780000023C0000023C000
+0023C0000041E0000041E0000041E0000080F0000080F0000180F8000100780001FFF80003007C
+0002003C0002003C0006003E0004001E0004001E000C001F001E001F00FF80FFF01C1D7F9C1F>
+65 D<001F808000E0618001801980070007800E0003801C0003801C0001803800018078000080
+7800008070000080F0000000F0000000F0000000F0000000F0000000F0000000F0000000F00000
+00700000807800008078000080380000801C0001001C0001000E000200070004000180080000E0
+3000001FC000191E7E9C1E>67 D<FFFFFC0F003C0F000C0F00040F00040F00060F00020F00020F
+02020F02000F02000F02000F06000FFE000F06000F02000F02000F02000F02010F00010F00020F
+00020F00020F00060F00060F000C0F003CFFFFFC181C7E9B1C>69 D<FFF00F000F000F000F000F
000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F000F00
-0F00FFF00C1C7F9B0F>73 D<FFF8000F80000F00000F00000F00000F00000F00000F00000F0000
-0F00000F00000F00000F00000F00000F00000F00000F00000F00000F00080F00080F00080F0018
-0F00180F00100F00300F00700F01F0FFFFF0151C7E9B1A>76 D<003F800000E0E0000380380007
-001C000E000E001C0007003C00078038000380780003C0780003C0700001C0F00001E0F00001E0
-F00001E0F00001E0F00001E0F00001E0F00001E0F00001E0700001C0780003C0780003C0380003
-803C0007801C0007000E000E0007001C000380380000E0E000003F80001B1E7E9C20>79
+0F000F00FFF00C1C7F9B0F>73 D<FFF8000F80000F00000F00000F00000F00000F00000F00000F
+00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00080F00080F00080F
+00180F00180F00100F00300F00700F01F0FFFFF0151C7E9B1A>76 D<003F800000E0E000038038
+0007001C000E000E001C0007003C00078038000380780003C0780003C0700001C0F00001E0F000
+01E0F00001E0F00001E0F00001E0F00001E0F00001E0F00001E0700001C0780003C0780003C038
+0003803C0007801C0007000E000E0007001C000380380000E0E000003F80001B1E7E9C20>79
D<FFFF800F00E00F00780F003C0F001C0F001E0F001E0F001E0F001E0F001E0F001C0F003C0F00
780F00E00FFF800F00000F00000F00000F00000F00000F00000F00000F00000F00000F00000F00
000F0000FFF000171C7E9B1C>I<FFFF00000F01E0000F0078000F003C000F001C000F001E000F
@@ -1042,53 +1134,59 @@ C018C018E010D0608FC00D127F9110>I<04000400040004000C000C001C003C00FFE01C001C00
00010E00020E000607000403801E07C0FF0FF81512809116>I<FF07E03C03801C01001C01000E
02000E020007040007040007040003880003880003D80001D00001D00000E00000E00000E00000
4000004000008000008000F08000F10000F300006600003C0000131A7F9116>I<FFFFFFFFFF80
-2901808B2A>124 D<1C043F0843F080E00E047D9B15>126 D E /Fp 33
-123 df<70F8FCFC7404040404080810102040060F7C840E>44 D<008003800F80F38003800380
-038003800380038003800380038003800380038003800380038003800380038003800380038003
-800380038003800380038007C0FFFE0F217CA018>49 D<03F0000C1C001007002007804003C040
-03C08003E0F003E0F801E0F801E0F801E02003E00003E00003C00003C0000780000700000E0000
-1C0000180000300000600000C0000180000100000200200400200800201800603000403FFFC07F
-FFC0FFFFC013217EA018>I<000200000600000E00000E00001E00001E00002E00004E00004E00
-008E00008E00010E00020E00020E00040E00040E00080E00100E00100E00200E00200E00400E00
-800E00FFFFF8000E00000E00000E00000E00000E00000E00000E00001F0001FFF015217FA018>
-52 D<4000006000007FFFE07FFFC07FFFC0400080C00100800100800200800200000400000800
-00080000100000300000200000600000600000600000E00000C00000C00001C00001C00001C000
-01C00003C00003C00003C00003C00003C00003C00003C00003C00001800013237DA118>55
+2901808B2A>124 D<1C043F0843F080E00E047D9B15>126 D E /Fs 7 115
+df<003FC000FFF003C0F00780300F00001E00003C00003C0000780000780000780000F00000F0
+0000F00000F00000F00000F00000F00000F00000F000007800007800007800003C00003C00001E
+00000F000807801803C07800FFF0003F80151F7D9D1B>67 D<003F8001FFF003C0F80780380F00
+181E00003C00003C0000780000780000780000F00000F00000F00000F00000F00000F00000F007
+F8F007F8F000387800387800387800383C00383C00381E00380F003807803803C0F801FFF0003F
+80151F7D9D1C>71 D<FFFFFF80FFFFFF80001E0000001E0000001E0000001E0000001E0000001E
+0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E000000
+1E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000001E0000
+001E0000001E0000191D7F9C1C>84 D<0FC03FF07FF87038401C001C001C00FC0FFC3FFC781CE0
+1CE01CE01CF07C7FFC7FDC3F1C0E127E9114>97 D<07C01FE03FF078787018601CFFFCFFFCFFFC
+E000E000E000700070043C1C3FFC1FF807E00E127E9112>101 D<00FC01FC03FC07000E000E00
+0E000E000E000E000E00FFE0FFE00E000E000E000E000E000E000E000E000E000E000E000E000E
+000E000E000E000E1D809C0D>I<E380E780EF80FC00F800F000F000E000E000E000E000E000E0
+00E000E000E000E000E00009127D910E>114 D E /Ft 31 123 df<70F8FCFC74040404040808
+10102040060F7C840E>44 D<008003800F80F38003800380038003800380038003800380038003
+800380038003800380038003800380038003800380038003800380038003800380038007C0FFFE
+0F217CA018>49 D<1000801E07001FFF001FFE001FF80013E00010000010000010000010000010
+000010000010F800130E001407001803801003800001C00001C00001E00001E00001E00001E070
+01E0F001E0F001E0E001C08001C04003C04003802007001006000C1C0003F00013227EA018>53
+D<01F800060E000803001001802001802000C06000C06000C06000C07000C07801803E01003F02
+001FC4000FF80003F80003FC00067F00083F80100F803007C06001C06000E0C000E0C00060C000
+60C00060C000606000406000C03000801803000E0E0003F00013227EA018>56
D<01F000060C000C0600180700380380700380700380F001C0F001C0F001C0F001E0F001E0F001
E0F001E0F001E07001E07003E03803E01805E00C05E00619E003E1E00001C00001C00001C00003
-80000380300300780700780600700C002018001030000FC00013227EA018>57
-D<0007E0100038183000E0063001C00170038000F0070000F00E0000701E0000701C0000303C00
-00303C0000307C0000107800001078000010F8000000F8000000F8000000F8000000F8000000F8
-000000F8000000F800000078000000780000107C0000103C0000103C0000101C0000201E000020
-0E000040070000400380008001C0010000E0020000381C000007E0001C247DA223>67
-D<FFFFFFC00F8007C0078001C0078000C007800040078000400780006007800020078000200780
-002007802020078020000780200007802000078060000780E00007FFE0000780E0000780600007
-802000078020000780200007802000078000000780000007800000078000000780000007800000
-0780000007800000078000000FC00000FFFE00001B227EA120>70 D<FFFC3FFF0FC003F0078001
+80000380300300780700780600700C002018001030000FC00013227EA018>I<0007E010003818
+3000E0063001C00170038000F0070000F00E0000701E0000701C0000303C0000303C0000307C00
+00107800001078000010F8000000F8000000F8000000F8000000F8000000F8000000F8000000F8
+00000078000000780000107C0000103C0000103C0000101C0000201E0000200E00004007000040
+0380008001C0010000E0020000381C000007E0001C247DA223>67 D<FFFFFFC00F8007C0078001
+C0078000C007800040078000400780006007800020078000200780002007802020078020000780
+200007802000078060000780E00007FFE0000780E0000780600007802000078020000780200007
+802000078000000780000007800000078000000780000007800000078000000780000007800000
+0FC00000FFFE00001B227EA120>70 D<FFFC3FFF0FC003F0078001E0078001E0078001E0078001
E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E00780
-01E0078001E0078001E0078001E007FFFFE0078001E0078001E0078001E0078001E0078001E007
-8001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E0
-0FC003F0FFFC3FFF20227EA125>72 D<FFFC0FC007800780078007800780078007800780078007
-800780078007800780078007800780078007800780078007800780078007800780078007800780
-07800FC0FFFC0E227EA112>I<FFFE00000FC00000078000000780000007800000078000000780
+01E007FFFFE0078001E0078001E0078001E0078001E0078001E0078001E0078001E0078001E007
+8001E0078001E0078001E0078001E0078001E0078001E0078001E00FC003F0FFFC3FFF20227EA1
+25>72 D<FFFC0FC007800780078007800780078007800780078007800780078007800780078007
+80078007800780078007800780078007800780078007800780078007800FC0FFFC0E227EA112>
+I<FFFE00000FC00000078000000780000007800000078000000780000007800000078000000780
000007800000078000000780000007800000078000000780000007800000078000000780000007
-800000078000000780000007800000078000000780000007800080078000800780008007800080
-078001800780018007800100078003000780030007800F000F803F00FFFFFF0019227EA11E>76
-D<FFC00003FF0FC00003F007C00003E005E00005E005E00005E004F00009E004F00009E004F000
-09E004780011E004780011E004780011E0043C0021E0043C0021E0043C0021E0041E0041E0041E
-0041E0040F0081E0040F0081E0040F0081E004078101E004078101E004078101E00403C201E004
-03C201E00401E401E00401E401E00401E401E00400F801E00400F801E00400F801E004007001E0
-0E007001E01F007003F0FFE0203FFF28227EA12D>I<FFFFE000000F803C000007800E00000780
-078000078007C000078003C000078003E000078003E000078003E000078003E000078003E00007
-8003C000078007C000078007800007800E000007803C000007FFE0000007807000000780380000
-07801C000007801E000007800E000007800F000007800F000007800F000007800F000007800F80
-0007800F800007800F800007800F808007800FC080078007C0800FC003C100FFFC01E200000000
-7C0021237EA124>82 D<FFF03FFC03FE1F8007E000F80F0003C000700F0003C000200F0003C000
-20078001E00040078001E00040078001E0004003C002F0008003C002F0008003C002F0008001E0
-0478010001E00478010001E00478010000F0083C020000F0083C020000F0083C020000F8183E06
-000078101E04000078101E0400007C101E0400003C200F0800003C200F0800003C200F0800001E
-40079000001E40079000001E40079000000F8003E000000F8003E000000F8003E00000070001C0
-0000070001C00000070001C0000003000180000002000080002F237FA132>87
+800000078000000780000007800080078000800780008007800080078001800780018007800100
+078003000780030007800F000F803F00FFFFFF0019227EA11E>76 D<FFFFE000000F803C000007
+800E00000780078000078007C000078003C000078003E000078003E000078003E000078003E000
+078003E000078003C000078007C000078007800007800E000007803C000007FFE0000007807000
+00078038000007801C000007801E000007800E000007800F000007800F000007800F000007800F
+000007800F800007800F800007800F800007800F808007800FC080078007C0800FC003C100FFFC
+01E2000000007C0021237EA124>82 D<FFF03FFC03FE1F8007E000F80F0003C000700F0003C000
+200F0003C00020078001E00040078001E00040078001E0004003C002F0008003C002F0008003C0
+02F0008001E00478010001E00478010001E00478010000F0083C020000F0083C020000F0083C02
+0000F8183E06000078101E04000078101E0400007C101E0400003C200F0800003C200F0800003C
+200F0800001E40079000001E40079000001E40079000000F8003E000000F8003E000000F8003E0
+0000070001C00000070001C00000070001C0000003000180000002000080002F237FA132>87
D<0FE0001838003C0C003C0E0018070000070000070000070000FF0007C7001E07003C07007807
00700700F00708F00708F00708F00F087817083C23900FC1E015157E9418>97
D<0E0000FE00001E00000E00000E00000E00000E00000E00000E00000E00000E00000E00000E00
@@ -1130,995 +1228,1344 @@ E001F0E00000E00000E00000E00000E00000E00000E00000E00000E00000E0000FFE171F7E941A
00002000004000F04000F08000F180004300003C0000171F7F941A>121
D<3FFFC0380380300780200700600E00401C00403C0040380000700000E00001E00001C0000380
400700400F00400E00C01C0080380080780180700780FFFF8012157F9416>I
-E /Fq 18 118 df<FFFFC00000FFFFC0000007F000000003E000000003E000000003E000000003
-E000000003E000000003E000000003E000000003E000000003E000000003E000000003E0000000
-03E000000003E000000003E000000003E000000003E000000003E000000003E000000003E00000
+E /Fu 21 118 df<78FCFCFCFC7806067A8512>46 D<00080000380000780001F8003FF800FE78
+00C078000078000078000078000078000078000078000078000078000078000078000078000078
+000078000078000078000078000078000078000078000078000078000078000078000078000078
+0000780000780000780000780000780000780000780000780000780000780000780000780000FC
+007FFFF87FFFF8152F7AAE21>49 D<007F800001FFF0000701F8000C007E0018003F0010001F00
+20000F8040000FC0400007C0400007E0B00007E0F80003E0FC0003E0FC0003E0FC0003E0780007
+E0000007E0000007C0000007C000000F8000000F8000001F0000001F0000003E0000003C000000
+78000000F0000000E0000001C0000003800000070000000E0000001C0000001800000030000000
+60000000C000200180002003000020060000400C00004008000040100000C03FFFFFC07FFFFF80
+FFFFFF80FFFFFF801B2F7DAE21>I<FFFFC00000FFFFC0000007F000000003E000000003E00000
0003E000000003E000000003E000000003E000000003E000000003E000000003E000000003E000
-000003E000000003E000004003E000004003E000004003E000004003E000008003E000008003E0
-00008003E000008003E000018003E000018003E000038003E000038003E000078003E0000F0003
-E0003F0007E000FF00FFFFFFFF00FFFFFFFF0022317CB029>76 D<FFF00000007FF8FFF0000000
-7FF807F00000007F0002F8000000BE0002F8000000BE0002F8000000BE00027C0000013E00027C
-0000013E00023E0000023E00023E0000023E00023E0000023E00021F0000043E00021F0000043E
-00021F0000043E00020F8000083E00020F8000083E00020F8000083E000207C000103E000207C0
-00103E000207C000103E000203E000203E000203E000203E000201F000403E000201F000403E00
-0201F000403E000200F800803E000200F800803E000200F800803E0002007C01003E0002007C01
-003E0002007C01003E0002003E02003E0002003E02003E0002003E02003E0002001F04003E0002
-001F04003E0002000F88003E0002000F88003E0002000F88003E00020007D0003E00020007D000
-3E00020007D0003E00020003E0003E00020003E0003E00020003E0003E00070001C0003E000F80
-01C0007F00FFF801C00FFFF8FFF800800FFFF835317CB03D>I<FFFFFFC000FFFFFFF80007E000
-FE0003E0001F0003E0000F8003E00007C003E00003E003E00003F003E00001F003E00001F003E0
-0001F803E00001F803E00001F803E00001F803E00001F803E00001F803E00001F003E00001F003
-E00003E003E00003E003E00007C003E0000F8003E0001F0003E000FC0003FFFFF00003E0000000
-03E000000003E000000003E000000003E000000003E000000003E000000003E000000003E00000
-0003E000000003E000000003E000000003E000000003E000000003E000000003E000000003E000
-000003E000000003E000000003E000000003E000000007F0000000FFFF800000FFFF8000002531
-7CB02D>80 D<FFFFFF000000FFFFFFF0000007E001FC000003E0003E000003E0001F800003E000
-07C00003E00007E00003E00003E00003E00003F00003E00001F00003E00001F80003E00001F800
-03E00001F80003E00001F80003E00001F80003E00001F80003E00001F00003E00003F00003E000
-03E00003E00007C00003E0000F800003E0001F000003E0003C000003E001F0000003FFFF000000
-03E003E0000003E00078000003E0003C000003E0001E000003E0000F000003E0000F800003E000
-07800003E00007C00003E00007C00003E00007C00003E00007C00003E00007C00003E00007E000
-03E00007E00003E00007E00003E00007E00003E00007E00003E00007E00803E00007F00803E000
-03F00803E00003F00807F00001F010FFFF8000F810FFFF80007C60000000000F802D327CB031>
-82 D<00FE00000303C0000C00E00010007000100038003C003C003E001C003E001E003E001E00
-08001E0000001E0000001E0000001E00000FFE0000FC1E0003E01E000F801E001F001E003E001E
-003C001E007C001E00F8001E04F8001E04F8001E04F8003E04F8003E0478003E047C005E043E00
-8F080F0307F003FC03E01E1F7D9E21>97 D<003F8000E0600380180700040F00041E001E1C003E
-3C003E7C003E7C0008780000F80000F80000F80000F80000F80000F80000F80000F80000F80000
-7800007C00007C00003C00011E00011E00020F000207000403801800E060003F80181F7D9E1D>
-99 D<003F800000E0E0000380380007003C000E001E001E001E001C000F003C000F007C000F00
-78000F8078000780F8000780F8000780FFFFFF80F8000000F8000000F8000000F8000000F80000
-00F8000000780000007C0000003C0000003C0000801E0000800E0001000F0002000780020001C0
-0C0000F03000001FC000191F7E9E1D>101 D<0007E0001C1000383800707C00E07C01E07C01C0
-3803C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C000FFFF
-C0FFFFC003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C0
-0003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C0
-0003C00007E0007FFF007FFF0016327FB114>I<000000F0007F030801C1C41C0380E81C070070
-080F0078001E003C001E003C003E003E003E003E003E003E003E003E003E003E003E003E001E00
-3C001E003C000F007800070070000780E00009C1C000087F000018000000180000001800000018
-000000180000001C0000000E0000000FFFF80007FFFF0003FFFF800E000FC0180001E0300000F0
-70000070E0000038E0000038E0000038E0000038E00000387000007070000070380000E01C0001
-C00700070001C01C00003FE0001E2F7E9F21>I<01800000003F80000000FF80000000FF800000
-000F80000000078000000007800000000780000000078000000007800000000780000000078000
-000007800000000780000000078000000007800000000780000000078000000007800000000780
-FE00000783078000078C03C000079001E00007A001E00007A000F00007C000F00007C000F00007
-8000F000078000F000078000F000078000F000078000F000078000F000078000F000078000F000
-078000F000078000F000078000F000078000F000078000F000078000F000078000F000078000F0
-00078000F000078000F000078000F000078000F0000FC001F800FFFC1FFF80FFFC1FFF8021327E
-B125>I<07000F801F801F800F8007000000000000000000000000000000000000000000000001
-801F80FF80FF800F80078007800780078007800780078007800780078007800780078007800780
-078007800780078007800780078007800FC0FFF8FFF80D307EAF12>I<01803F80FF80FF800F80
+000003E000000003E000000003E000000003E000000003E000000003E000000003E000000003E0
+00000003E000000003E000000003E000000003E000000003E000000003E000000003E000000003
+E000000003E000000003E000000003E000004003E000004003E000004003E000004003E0000080
+03E000008003E000008003E000008003E000018003E000018003E000038003E000038003E00007
+8003E0000F0003E0003F0007E000FF00FFFFFFFF00FFFFFFFF0022317CB029>76
+D<FFF00000007FF8FFF00000007FF807F00000007F0002F8000000BE0002F8000000BE0002F800
+0000BE00027C0000013E00027C0000013E00023E0000023E00023E0000023E00023E0000023E00
+021F0000043E00021F0000043E00021F0000043E00020F8000083E00020F8000083E00020F8000
+083E000207C000103E000207C000103E000207C000103E000203E000203E000203E000203E0002
+01F000403E000201F000403E000201F000403E000200F800803E000200F800803E000200F80080
+3E0002007C01003E0002007C01003E0002007C01003E0002003E02003E0002003E02003E000200
+3E02003E0002001F04003E0002001F04003E0002000F88003E0002000F88003E0002000F88003E
+00020007D0003E00020007D0003E00020007D0003E00020003E0003E00020003E0003E00020003
+E0003E00070001C0003E000F8001C0007F00FFF801C00FFFF8FFF800800FFFF835317CB03D>I<
+FFFFFFC000FFFFFFF80007E000FE0003E0001F0003E0000F8003E00007C003E00003E003E00003
+F003E00001F003E00001F003E00001F803E00001F803E00001F803E00001F803E00001F803E000
+01F803E00001F003E00001F003E00003E003E00003E003E00007C003E0000F8003E0001F0003E0
+00FC0003FFFFF00003E000000003E000000003E000000003E000000003E000000003E000000003
+E000000003E000000003E000000003E000000003E000000003E000000003E000000003E0000000
+03E000000003E000000003E000000003E000000003E000000003E000000003E000000007F00000
+00FFFF800000FFFF80000025317CB02D>80 D<FFFFFF000000FFFFFFF0000007E001FC000003E0
+003E000003E0001F800003E00007C00003E00007E00003E00003E00003E00003F00003E00001F0
+0003E00001F80003E00001F80003E00001F80003E00001F80003E00001F80003E00001F80003E0
+0001F00003E00003F00003E00003E00003E00007C00003E0000F800003E0001F000003E0003C00
+0003E001F0000003FFFF00000003E003E0000003E00078000003E0003C000003E0001E000003E0
+000F000003E0000F800003E00007800003E00007C00003E00007C00003E00007C00003E00007C0
+0003E00007C00003E00007E00003E00007E00003E00007E00003E00007E00003E00007E00003E0
+0007E00803E00007F00803E00003F00803E00003F00807F00001F010FFFF8000F810FFFF80007C
+60000000000F802D327CB031>82 D<00FE00000303C0000C00E00010007000100038003C003C00
+3E001C003E001E003E001E0008001E0000001E0000001E0000001E00000FFE0000FC1E0003E01E
+000F801E001F001E003E001E003C001E007C001E00F8001E04F8001E04F8001E04F8003E04F800
+3E0478003E047C005E043E008F080F0307F003FC03E01E1F7D9E21>97 D<003F8000E060038018
+0700040F00041E001E1C003E3C003E7C003E7C0008780000F80000F80000F80000F80000F80000
+F80000F80000F80000F800007800007C00007C00003C00011E00011E00020F0002070004038018
+00E060003F80181F7D9E1D>99 D<003F800000E0E0000380380007003C000E001E001E001E001C
+000F003C000F007C000F0078000F8078000780F8000780F8000780FFFFFF80F8000000F8000000
+F8000000F8000000F8000000F8000000780000007C0000003C0000003C0000801E0000800E0001
+000F0002000780020001C00C0000F03000001FC000191F7E9E1D>101 D<0007E0001C10003838
+00707C00E07C01E07C01C03803C00003C00003C00003C00003C00003C00003C00003C00003C000
+03C00003C00003C000FFFFC0FFFFC003C00003C00003C00003C00003C00003C00003C00003C000
+03C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C000
+03C00003C00003C00003C00003C00007E0007FFF007FFF0016327FB114>I<000000F0007F0308
+01C1C41C0380E81C070070080F0078001E003C001E003C003E003E003E003E003E003E003E003E
+003E003E003E003E001E003C001E003C000F007800070070000780E00009C1C000087F00001800
+0000180000001800000018000000180000001C0000000E0000000FFFF80007FFFF0003FFFF800E
+000FC0180001E0300000F070000070E0000038E0000038E0000038E0000038E000003870000070
+70000070380000E01C0001C00700070001C01C00003FE0001E2F7E9F21>I<01800000003F8000
+0000FF80000000FF800000000F8000000007800000000780000000078000000007800000000780
+000000078000000007800000000780000000078000000007800000000780000000078000000007
+8000000007800000000780FE00000783078000078C03C000079001E00007A001E00007A000F000
+07C000F00007C000F000078000F000078000F000078000F000078000F000078000F000078000F0
+00078000F000078000F000078000F000078000F000078000F000078000F000078000F000078000
+F000078000F000078000F000078000F000078000F000078000F000078000F0000FC001F800FFFC
+1FFF80FFFC1FFF8021327EB125>I<07000F801F801F800F800700000000000000000000000000
+0000000000000000000001801F80FF80FF800F8007800780078007800780078007800780078007
+8007800780078007800780078007800780078007800780078007800FC0FFF8FFF80D307EAF12>
+I<01803F80FF80FF800F8007800780078007800780078007800780078007800780078007800780
078007800780078007800780078007800780078007800780078007800780078007800780078007
-800780078007800780078007800780078007800780078007800780078007800780078007800780
-0780078007800FC0FFFCFFFC0E327EB112>108 D<0180FE001FC0003F83078060F000FF8C03C1
-807800FF9001E2003C000FA001E4003C0007A000F4001E0007C000F8001E0007C000F8001E0007
+80078007800780078007800780078007800FC0FFFCFFFC0E327EB112>108
+D<0180FE001FC0003F83078060F000FF8C03C1807800FF9001E2003C000FA001E4003C0007A000
+F4001E0007C000F8001E0007C000F8001E00078000F0001E00078000F0001E00078000F0001E00
+078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0
+001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E0007
8000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F000
-1E00078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E000780
-00F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E00078000F0001E
-00078000F0001E00078000F0001E00078000F0001E000FC001F8003F00FFFC1FFF83FFF0FFFC1F
-FF83FFF0341F7E9E38>I<0180FE00003F83078000FF8C03C000FF9001E0000FA001E00007A000
-F00007C000F00007C000F000078000F000078000F000078000F000078000F000078000F0000780
-00F000078000F000078000F000078000F000078000F000078000F000078000F000078000F00007
-8000F000078000F000078000F000078000F000078000F000078000F000078000F0000FC001F800
-FFFC1FFF80FFFC1FFF80211F7E9E25>I<001FC00000F0780001C01C00070007000F0007801E00
-03C01C0001C03C0001E03C0001E0780000F0780000F0780000F0F80000F8F80000F8F80000F8F8
-0000F8F80000F8F80000F8F80000F8F80000F8780000F07C0001F03C0001E03C0001E01E0003C0
-1E0003C00F00078007800F0001C01C0000F07800001FC0001D1F7E9E21>I<0183E03F8C18FF90
-7CFF907C0FA07C07C03807C00007C00007C0000780000780000780000780000780000780000780
-000780000780000780000780000780000780000780000780000780000780000780000780000FC0
-00FFFE00FFFE00161F7E9E19>114 D<00400000400000400000400000400000C00000C00000C0
-0001C00001C00003C00007C0000FC0001FFFE0FFFFE003C00003C00003C00003C00003C00003C0
-0003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C01003C01003C0
-1003C01003C01003C01003C01003C01001C02001E02000E0400078C0001F00142C7FAB19>116
-D<01800030003F8007F000FF801FF000FF801FF0000F8001F000078000F000078000F000078000
+1E000FC001F8003F00FFFC1FFF83FFF0FFFC1FFF83FFF0341F7E9E38>I<0180FE00003F830780
+00FF8C03C000FF9001E0000FA001E00007A000F00007C000F00007C000F000078000F000078000
F000078000F000078000F000078000F000078000F000078000F000078000F000078000F0000780
00F000078000F000078000F000078000F000078000F000078000F000078000F000078000F00007
-8001F000078001F000078001F000038002F00003C004F00001C008F800007030FF80001FC0FF80
-211F7E9E25>I E end
+8000F000078000F000078000F0000FC001F800FFFC1FFF80FFFC1FFF80211F7E9E25>I<001FC0
+0000F0780001C01C00070007000F0007801E0003C01C0001C03C0001E03C0001E0780000F07800
+00F0780000F0F80000F8F80000F8F80000F8F80000F8F80000F8F80000F8F80000F8F80000F878
+0000F07C0001F03C0001E03C0001E01E0003C01E0003C00F00078007800F0001C01C0000F07800
+001FC0001D1F7E9E21>I<0183E03F8C18FF907CFF907C0FA07C07C03807C00007C00007C00007
+800007800007800007800007800007800007800007800007800007800007800007800007800007
+80000780000780000780000780000780000FC000FFFE00FFFE00161F7E9E19>114
+D<00400000400000400000400000400000C00000C00000C00001C00001C00003C00007C0000FC0
+001FFFE0FFFFE003C00003C00003C00003C00003C00003C00003C00003C00003C00003C00003C0
+0003C00003C00003C00003C00003C00003C01003C01003C01003C01003C01003C01003C01003C0
+1001C02001E02000E0400078C0001F00142C7FAB19>116 D<01800030003F8007F000FF801FF0
+00FF801FF0000F8001F000078000F000078000F000078000F000078000F000078000F000078000
+F000078000F000078000F000078000F000078000F000078000F000078000F000078000F0000780
+00F000078000F000078000F000078000F000078000F000078001F000078001F000078001F00003
+8002F00003C004F00001C008F800007030FF80001FC0FF80211F7E9E25>I
+E end
%%EndProlog
%%BeginSetup
%%Feature: *Resolution 300
TeXDict begin @a4 /a4 where {pop a4} if
%%EndSetup
%%Page: 1 1
-bop 149 342 a Fq(Reference)22 b(Man)n(ual)e(of)i(the)g(Programming)e
-(Language)h(Lua)683 468 y Fp(Rob)q(erto)c(Ierusalimsc)o(h)o(y)618
-526 y(Luiz)f(Henrique)e(de)j(Figueiredo)678 584 y(W)l(aldemar)e(Celes)g
-(Filho)725 664 y Fo(T)m(eCGraf)e(|)g(PUC-Rio)616 722 y(rob)q(erto,)i(lhf,)d
-(celes@icad.puc-rio.br)778 823 y Fp(Ma)o(y)k(27,)h(1994)830
-991 y Fn(Abstract)164 1067 y Fo(Lua)j(is)g(an)g(em)o(b)q(edded)g(programming)
-c(language)k(designed)g(to)g(b)q(e)h(used)g(as)f(a)g(con\014guration)102
-1117 y(language)13 b(for)h(an)o(y)f(program)f(that)j(needs)g(one.)j(This)c
-(do)q(cumen)o(t)g(describ)q(es)i(the)f(Lua)e(programming)102
-1166 y(language)c(and)g(the)h(API)g(that)g(allo)o(ws)e(in)o(teraction)i(b)q
-(et)o(w)o(een)h(Lua)e(programs)f(and)i(its)f(host)h(C)g(program.)102
-1216 y(It)k(also)f(presen)o(ts)j(some)d(examples)g(of)g(using)h(the)g(main)e
-(features)j(of)e(the)i(system.)869 1471 y Fn(Sum\023)-24 b(ario)102
-1538 y Fo(Lua)9 b(\023)-20 b(e)11 b(uma)d(linguagem)g(de)j(extens~)-21
-b(ao)11 b(pro)r(jetada)f(para)h(ser)g(usada)f(como)f(linguagem)f(de)j
-(con\014gura\030)-18 b(c~)d(ao)102 1588 y(em)19 b(qualquer)i(programa)d(que)j
-(precise)h(de)f(uma.)37 b(Este)21 b(do)q(cumen)o(to)f(descrev)o(e)j(a)d
-(linguagem)e(de)102 1638 y(programa\030)-18 b(c~)d(ao)14 b(Lua)h(e)h(a)g(In)o
-(terface)h(de)f(Programa\030)-18 b(c~)d(ao)14 b(que)i(p)q(ermite)g(a)f(in)o
-(tera\030)-18 b(c~)d(ao)16 b(en)o(tre)h(programas)102 1688
-y(Lua)d(e)h(o)f(programa)e(C)i(hosp)q(edeiro.)20 b(O)15 b(do)q(cumen)o(to)e
-(tam)o(b)o(\023)-20 b(em)12 b(apresen)o(ta)k(alguns)d(exemplos)h(de)h(uso)102
-1737 y(das)f(principais)f(caracter)-5 b(\023)-16 b(\020sticas)16
-b(do)d(sistema.)910 2976 y Fm(1)p eop
-%%Page: 2 2
-bop -12 160 a Fl(1)69 b(In)n(tro)r(duction)-12 261 y Fm(Lua)16
-b(is)h(an)f(em)o(b)q(edded)h(programming)e(language)h(designed)i(to)d(supp)q
-(ort)h(general)g(pro)q(cedural)h(program-)-12 318 y(ming)k(features)f(with)g
-(data)g(description)h(facilities.)37 b(It)20 b(is)h(supp)q(osed)g(to)f(b)q(e)
-h(used)f(as)g(a)g(con\014guration)-12 374 y(language)g(for)f(an)o(y)g
-(program)f(that)g(needs)j(one.)32 b(Lua)20 b(w)o(as)e(designed)j(b)o(y)f(R.)f
-(Ierusalimsc)o(h)o(y)l(,)i(L.)f(H.)f(de)-12 430 y(Figueiredo)d(and)g(W.)e
-(Celes,)i(and)f(implemen)o(ted)i(b)o(y)e(W.)g(Celes.)59 487
-y(Lua)j(is)g(implemen)o(ted)h(as)e(a)h(library)l(,)h(written)e(in)i(C.)e
-(Being)h(an)g(em)o(b)q(edded)h(language,)f(Lua)g(has)f(no)-12
-543 y(notion)j(of)f(a)g(\\main")g(program:)28 b(it)19 b(only)h(w)o(orks)f
-Fk(emb)n(e)n(dde)n(d)g Fm(in)h(a)f(host)g(clien)o(t,)j(called)f(the)e
-Fk(emb)n(e)n(dding)-12 600 y Fm(program.)g(This)c(host)g(program)e(can)i(in)o
-(v)o(ok)o(e)g(functions)h(to)e(execute)h(a)g(piece)h(of)e(co)q(de)i(in)f
-(Lua,)g(can)g(write)-12 656 y(and)i(read)g(Lua)h(v)m(ariables,)g(and)f(can)g
+bop 96 342 a Fu(Reference)22 b(Man)n(ual)f(of)g(the)h(Programming)e(Language)
+h(Lua)h(2.1)87 468 y Ft(Rob)q(erto)17 b(Ierusalimsc)o(h)o(y)46
+b(Luiz)16 b(Henrique)e(de)i(Figueiredo)48 b(W)l(aldemar)15
+b(Celes)h(Filho)736 548 y Fs(T)m(eC)797 561 y(Graf)885 548
+y Fr(|)e(PUC-Rio)562 606 y Fq(roberto,lhf,cele)o(s@ica)o(d.puc)o(-rio)o(.br)
+741 720 y Ft(F)l(ebruary)i(8,)h(1995)830 888 y Fp(Abstract)102
+963 y Fr(Lua)12 b(is)g(an)f(extension)i(programming)c(language)i(designed)h
+(to)g(b)q(e)h(used)g(as)f(a)g(con\014guration)g(language)102
+1013 y(for)h(an)o(y)g(program)f(that)i(needs)h(one.)j(This)13
+b(do)q(cumen)o(t)g(describ)q(es)j(v)o(ersion)e(2.1)e(of)h(the)h(Lua)f
+(program-)102 1063 y(ming)g(language)h(and)g(the)i(API)f(that)g(allo)o(ws)f
+(in)o(teraction)g(b)q(et)o(w)o(een)j(Lua)d(programs)g(and)h(its)g(host)g(C)
+102 1113 y(program.)h(It)e(also)f(presen)o(ts)j(some)d(examples)g(of)h(using)
+f(the)i(main)c(features)k(of)f(the)g(system.)869 1328 y Fp(Sum\023)-24
+b(ario)102 1396 y Fr(Lua)9 b(\023)-20 b(e)11 b(uma)d(linguagem)g(de)j
+(extens~)-21 b(ao)11 b(pro)r(jetada)f(para)h(ser)g(usada)f(como)f(linguagem)f
+(de)j(con\014gura\030)-18 b(c~)d(ao)102 1446 y(em)19 b(qualquer)h(programa)f
+(que)h(precise)i(de)f(uma.)35 b(Este)21 b(do)q(cumen)o(to)f(descrev)o(e)i(a)e
+(v)o(ers~)-21 b(ao)21 b(2.1)e(da)102 1496 y(linguagem)f(de)i(programa\030)-18
+b(c~)d(ao)19 b(Lua)h(e)h(a)f(In)o(terface)h(de)g(Programa\030)-18
+b(c~)d(ao)19 b(que)i(p)q(ermite)f(a)g(in)o(tera\030)-18 b(c~)d(ao)102
+1545 y(en)o(tre)15 b(programas)e(Lua)h(e)h(o)f(programa)e(C)j(hosp)q(edeiro.)
+20 b(O)14 b(do)q(cumen)o(to)g(tam)o(b)o(\023)-20 b(em)12 b(apresen)o(ta)j
+(alguns)102 1595 y(exemplos)e(de)h(uso)g(das)g(principais)g(caracter)-5
+b(\023)-16 b(\020sticas)15 b(do)f(sistema.)-12 1738 y Fo(1)69
+b(In)n(tro)r(duction)-12 1840 y Fn(Lua)18 b(is)f(an)g(extension)h
+(programming)f(language)g(designed)i(to)d(supp)q(ort)h(general)h(pro)q
+(cedural)g(program-)-12 1896 y(ming)j(features)f(with)g(data)g(description)h
+(facilities.)37 b(It)20 b(is)h(supp)q(osed)g(to)f(b)q(e)h(used)f(as)g(a)g
+(con\014guration)-12 1953 y(language)e(for)f(an)o(y)g(program)f(that)h(needs)
+h(one.)27 b(Its)18 b(main)g(extensions)g(are)f(related)h(to)f(ob)s
+(ject-orien)o(ted)-12 2009 y(facilities,)f(and)e(fallbac)o(ks,)g(but)g(it)g
+(has)g(some)g(other)f(minor)h(con)o(tributions.)20 b(Lua)14
+b(has)g(b)q(een)h(designed)g(and)-12 2066 y(implemen)o(ted)i(b)o(y)e(W.)g
+(Celes)h(F.,)e(L.)h(H.)g(de)g(Figueiredo)i(and)e(R.)g(Ierusalimsc)o(h)o(y)l
+(.)59 2122 y(Lua)k(is)g(implemen)o(ted)h(as)e(a)g(library)l(,)i(written)f(in)
+g(C.)f(Being)h(an)g(extension)g(language,)g(Lua)g(has)f(no)-12
+2179 y(notion)i(of)f(a)g(\\main")g(program:)28 b(it)19 b(only)h(w)o(orks)f
+Fm(emb)n(e)n(dde)n(d)g Fn(in)h(a)f(host)g(clien)o(t,)j(called)f(the)e
+Fm(emb)n(e)n(dding)-12 2235 y Fn(program.)g(This)c(host)g(program)e(can)i(in)
+o(v)o(ok)o(e)g(functions)h(to)e(execute)h(a)g(piece)h(of)e(co)q(de)i(in)f
+(Lua,)g(can)g(write)-12 2291 y(and)i(read)g(Lua)h(v)m(ariables,)g(and)f(can)g
(register)g(C)g(functions)h(to)e(b)q(e)i(called)g(b)o(y)f(Lua)h(co)q(de.)25
-b(Through)17 b(the)-12 713 y(use)d(of)g(C)f(functions,)i(Lua)f(can)g(b)q(e)h
+b(Through)17 b(the)-12 2348 y(use)d(of)g(C)f(functions,)i(Lua)f(can)g(b)q(e)h
(augmen)o(ted)e(to)g(cop)q(e)i(with)f(rather)f(di\013eren)o(t)h(domains,)g
-(th)o(us)g(creating)-12 769 y(customized)i(programming)f(languages)g(sharing)
-h(a)f(syn)o(tactical)g(framew)o(ork.)59 826 y(Lua)k(is)g(free)g(distribution)
-h(soft)o(w)o(are,)e(and)h(pro)o(vided)g(as)g(usual)g(with)g(no)g(guaran)o
-(tees.)30 b(The)19 b(imple-)-12 882 y(men)o(tation)c(describ)q(ed)i(in)f
-(this)g(man)o(ual)f(is)h(a)o(v)m(ailable)h(b)o(y)e(anon)o(ymous)g(ftp)g(from)
-60 976 y Fj(ftp.icad.puc-rio.br:/pub)o(/lua/lua)o(_1.0.ta)o(r.Z)-12
-1119 y Fl(2)69 b(En)n(vironmen)n(t)21 b(and)i(Mo)r(dules)-12
-1221 y Fm(All)15 b(statemen)o(ts)d(in)j(Lua)e(are)h(executed)g(in)g(a)f
-Fk(glob)n(al)h(envir)n(onment)t Fm(.)k(This)d(en)o(vironmen)o(t,)e(whic)o(h)i
-(k)o(eeps)e(all)-12 1277 y(global)19 b(v)m(ariables)g(and)f(functions,)g(is)h
+(th)o(us)g(creating)-12 2404 y(customized)i(programming)f(languages)g
+(sharing)h(a)f(syn)o(tactical)g(framew)o(ork.)59 2461 y(Lua)k(is)g(free)g
+(distribution)h(soft)o(w)o(are,)e(and)h(pro)o(vided)g(as)g(usual)g(with)g(no)
+g(guaran)o(tees.)30 b(The)19 b(imple-)-12 2517 y(men)o(tation)c(describ)q(ed)
+i(in)f(this)g(man)o(ual)f(is)h(a)o(v)m(ailable)h(b)o(y)e(anon)o(ymous)g(ftp)g
+(from)60 2611 y Fl(ftp.icad.puc-rio.br:/pub)o(/lua/lua)o(-2.1.ta)o(r.Z)-12
+2705 y Fn(or)g(b)o(y)g(WWW)f(\(W)l(orld)h(Wide)h(W)l(eb\))g(from)60
+2799 y Fl(http://www.inf.puc-rio.b)o(r/projet)o(os/robe)o(rto/lua)o(.html)910
+2976 y Fn(1)p eop
+%%Page: 2 2
+bop -12 160 a Fo(2)69 b(En)n(vironmen)n(t)21 b(and)i(Mo)r(dules)-12
+261 y Fn(All)15 b(statemen)o(ts)d(in)j(Lua)e(are)h(executed)g(in)g(a)f
+Fm(glob)n(al)h(envir)n(onment)t Fn(.)k(This)d(en)o(vironmen)o(t,)e(whic)o(h)i
+(k)o(eeps)e(all)-12 318 y(global)19 b(v)m(ariables)g(and)f(functions,)g(is)h
(initialized)i(at)c(the)h(b)q(eginning)i(of)d(the)h(em)o(b)q(edding)h
-(program)e(and)-12 1334 y(p)q(ersists)f(un)o(til)g(its)g(end.)59
-1390 y(The)i(global)g(en)o(vironmen)o(t)g(can)g(b)q(e)g(manipulated)i(b)o(y)d
+(program)e(and)-12 374 y(p)q(ersists)f(un)o(til)g(its)g(end.)59
+430 y(The)i(global)g(en)o(vironmen)o(t)g(can)g(b)q(e)g(manipulated)i(b)o(y)d
(Lua)h(co)q(de)h(or)e(b)o(y)h(the)f(em)o(b)q(edding)j(program,)-12
-1446 y(whic)o(h)c(can)g(read)f(and)g(write)g(global)h(v)m(ariables)h(using)f
+487 y(whic)o(h)c(can)g(read)f(and)g(write)g(global)h(v)m(ariables)h(using)f
(functions)g(in)g(the)f(library)h(that)e(implemen)o(ts)j(Lua.)59
-1503 y(Global)22 b(v)m(ariables)g(do)f(not)g(need)h(declaration.)39
+543 y(Global)22 b(v)m(ariables)g(do)f(not)g(need)h(declaration.)39
b(An)o(y)22 b(v)m(ariable)g(is)g(assumed)g(to)e(b)q(e)i(global)g(unless)-12
-1559 y(explicitly)17 b(declared)f(lo)q(cal)g(\(see)e(lo)q(cal)h
-(declarations,)g(Section)h(4.4.5\).)h(Before)e(the)f(\014rst)g(assignmen)o
-(t,)g(the)-12 1616 y(v)m(alue)j(of)d(a)h(global)h(v)m(ariable)h(is)e
-Fi(nil)p Fm(.)59 1672 y(The)g(unit)h(of)f(execution)h(of)f(Lua)h(is)f(called)
-i(a)e Fk(mo)n(dule)s Fm(.)20 b(The)c(syn)o(tax)e(for)h(mo)q(dules)h(is:)1563
-1656 y Fh(1)72 1744 y Fk(mo)n(dule)50 b Fg(!)g(f)p Fk(statement)32
-b Fg(j)16 b Fk(function)s Fg(g)-1 1816 y Fm(A)10 b(mo)q(dule)i(ma)o(y)e(con)o
-(tain)h(statemen)o(ts)e(and/or)h(function)i(de\014nitions,)g(and)f(ma)o(y)f
-(b)q(e)h(in)h(a)e(\014le)i(or)e(in)h(a)f(string)-12 1873 y(inside)16
-b(the)f(host)f(program.)k(When)d(a)f(mo)q(dule)i(is)f(executed,)g(\014rst)f
-(all)h(its)g(functions)g(and)f(statemen)o(ts)g(are)-12 1929
-y(compiled,)g(and)f(the)f(functions)h(added)g(to)f(the)g(global)h(en)o
-(vironmen)o(t;)g(then)g(the)f(statemen)o(ts)f(are)h(executed)-12
-1986 y(in)k(sequen)o(tial)g(order.)k(All)d(mo)q(di\014cations)f(a)f(mo)q
-(dule)h(e\013ects)f(on)g(the)g(global)h(en)o(vironmen)o(t)f(p)q(ersist)h
-(after)-12 2042 y(its)g(end.)k(Those)15 b(include)j(mo)q(di\014cations)e(to)f
-(global)g(v)m(ariables)i(and)e(de\014nitions)i(of)e(new)g(functions)1736
-2026 y Fh(2)1757 2042 y Fm(.)-12 2185 y Fl(3)69 b(T)n(yp)r(es)-12
-2287 y Fm(Lua)16 b(is)h(a)e(dynamically)j(t)o(yp)q(ed)e(language.)22
-b(V)l(ariables)17 b(do)f(not)f(ha)o(v)o(e)g(t)o(yp)q(es;)h(only)g(v)m(alues)h
-(do.)22 b(All)17 b(v)m(alues)-12 2343 y(carry)e(their)h(o)o(wn)e(t)o(yp)q(e.)
-20 b(Therefore,)15 b(there)g(are)g(no)g(t)o(yp)q(e)g(de\014nitions)i(in)f
-(the)g(language.)59 2400 y(There)f(are)g(sev)o(en)g(basic)g(t)o(yp)q(es)g(in)
-h(Lua:)k Fk(nil)p Fm(,)14 b Fk(numb)n(er)p Fm(,)g Fk(string)p
-Fm(,)g Fk(function)p Fm(,)g Fk(Cfunction)p Fm(,)g Fk(user)n(data)p
-Fm(,)h(and)-12 2456 y Fk(table)p Fm(.)25 b Fk(Nil)16 b Fm(is)h(the)g(t)o(yp)q
-(e)g(of)g(the)g(v)m(alue)h Fi(nil)p Fm(,)g(whose)f(main)g(prop)q(ert)o(y)g
+600 y(explicitly)17 b(declared)f(lo)q(cal)g(\(see)e(lo)q(cal)h(declarations,)
+g(Section)h(4.4.5\).)h(Before)e(the)f(\014rst)g(assignmen)o(t,)g(the)-12
+656 y(v)m(alue)j(of)d(a)h(global)h(v)m(ariable)h(is)e Fk(nil)p
+Fn(.)59 713 y(The)g(unit)h(of)f(execution)h(of)f(Lua)h(is)f(called)i(a)e
+Fm(mo)n(dule)s Fn(.)20 b(The)c(syn)o(tax)e(for)h(mo)q(dules)h(is:)1563
+696 y Fj(1)72 785 y Fm(mo)n(dule)50 b Fi(!)g(f)p Fm(statement)32
+b Fi(j)16 b Fm(function)s Fi(g)-12 857 y Fn(A)f(mo)q(dule)h(ma)o(y)f(con)o
+(tain)g(statemen)o(ts)f(and)h(function)g(de\014nitions,)i(and)e(ma)o(y)f(b)q
+(e)i(in)g(a)e(\014le)i(or)f(in)h(a)e(string)-12 913 y(inside)i(the)f(host)f
+(program.)k(When)d(a)f(mo)q(dule)i(is)f(executed,)g(\014rst)f(all)h(its)g
+(functions)g(and)f(statemen)o(ts)g(are)-12 970 y(compiled,)g(and)f(the)f
+(functions)h(added)g(to)f(the)g(global)h(en)o(vironmen)o(t;)g(then)g(the)f
+(statemen)o(ts)f(are)h(executed)-12 1026 y(in)k(sequen)o(tial)g(order.)k(All)
+d(mo)q(di\014cations)f(a)f(mo)q(dule)h(e\013ects)f(on)g(the)g(global)h(en)o
+(vironmen)o(t)f(p)q(ersist)h(after)-12 1083 y(its)g(end.)k(Those)15
+b(include)j(mo)q(di\014cations)e(to)f(global)g(v)m(ariables)i(and)e
+(de\014nitions)i(of)e(new)g(functions)1736 1066 y Fj(2)1757
+1083 y Fn(.)-12 1226 y Fo(3)69 b(T)n(yp)r(es)-12 1327 y Fn(Lua)16
+b(is)h(a)e(dynamically)j(t)o(yp)q(ed)e(language.)22 b(V)l(ariables)17
+b(do)f(not)f(ha)o(v)o(e)g(t)o(yp)q(es;)h(only)g(v)m(alues)h(do.)22
+b(All)17 b(v)m(alues)-12 1384 y(carry)e(their)h(o)o(wn)e(t)o(yp)q(e.)20
+b(Therefore,)15 b(there)g(are)g(no)g(t)o(yp)q(e)g(de\014nitions)i(in)f(the)g
+(language.)59 1440 y(There)e(are)f(sev)o(en)i(basic)f(t)o(yp)q(es)g(in)h
+(Lua:)k Fm(nil)p Fn(,)13 b Fm(numb)n(er)p Fn(,)g Fm(string)p
+Fn(,)g Fm(function)p Fn(,)h Fm(CF)m(unction)p Fn(,)e Fm(user)n(data)p
+Fn(,)i(and)-12 1497 y Fm(table)p Fn(.)25 b Fm(Nil)16 b Fn(is)h(the)g(t)o(yp)q
+(e)g(of)g(the)g(v)m(alue)h Fk(nil)p Fn(,)g(whose)f(main)g(prop)q(ert)o(y)g
(is)g(to)f(b)q(e)i(di\013eren)o(t)f(from)f(an)o(y)h(other)-12
-2513 y(v)m(alue.)k Fk(Numb)n(er)15 b Fm(represen)o(ts)h(real)f(\(\015oating)g
-(p)q(oin)o(t\))g(n)o(um)o(b)q(ers,)g(while)i Fk(string)d Fm(has)i(the)f
-(usual)h(meaning.)59 2569 y(F)l(unctions)f(are)e(considered)j(\014rst-class)e
+1553 y(v)m(alue.)k Fm(Numb)n(er)15 b Fn(represen)o(ts)h(real)f(\(\015oating)g
+(p)q(oin)o(t\))g(n)o(um)o(b)q(ers,)g(while)i Fm(string)d Fn(has)i(the)f
+(usual)h(meaning.)59 1610 y(F)l(unctions)f(are)e(considered)j(\014rst-class)e
(v)m(alues)i(in)f(Lua.)k(This)c(means)f(that)g(functions)h(can)f(b)q(e)h
-(stored)-12 2626 y(in)h(v)m(ariables,)g(passed)f(as)f(argumen)o(ts)g(to)h
+(stored)-12 1666 y(in)h(v)m(ariables,)g(passed)f(as)f(argumen)o(ts)g(to)h
(other)f(functions)i(and)f(returned)g(as)g(results.)20 b(When)15
-b(a)f(function)-12 2682 y(in)19 b(Lua)g(is)f(de\014ned,)i(its)f(b)q(o)q(dy)f
-(is)h(compiled)h(and)e(stored)g(in)h(a)f(global)h(v)m(ariable)g(with)g(the)f
-(giv)o(en)h(name.)p -12 2722 747 2 v 40 2749 a Ff(1)57 2764
-y Fe(As)12 b(usual)i(in)g(extended)f(BNF,)f Fd(f)p Fc(a)s Fd(g)g
-Fe(means)h(0)g(or)f(more)h Fc(a)s Fe('s,)e([)p Fc(a)s Fe(])g(means)i(an)g
-(optional)h Fc(a)e Fe(and)h Fd(f)p Fc(a)s Fd(g)1500 2749 y
-Ff(+)1538 2764 y Fe(means)g(one)g(or)f(more)-12 2810 y Fc(a)s
-Fe('s.)40 2840 y Ff(2)57 2856 y Fe(Actually)m(,)i(a)f(function)i
+b(a)f(function)-12 1723 y(is)j(de\014ned)h(in)g(Lua,)e(its)h(b)q(o)q(dy)h(is)
+f(compiled)h(and)f(stored)f(in)h(a)f(giv)o(en)h(v)m(ariable.)26
+b(Lua)17 b(can)f(call)i(\(and)f(ma-)-12 1779 y(nipulate\))e(functions)g
+(written)f(in)h(Lua)f(and)g(functions)h(written)f(in)g(C;)g(the)g(latter)f
+(ha)o(v)o(e)h(t)o(yp)q(e)g Fm(CF)m(unction)s Fn(.)59 1836 y(The)i(t)o(yp)q(e)
+g Fm(user)n(data)h Fn(is)f(pro)o(vided)h(to)e(allo)o(w)i(arbitrary)e(C)h(p)q
+(oin)o(ters)g(to)g(b)q(e)h(stored)e(in)i(Lua)f(v)m(ariables.)-12
+1892 y(It)21 b(corresp)q(onds)f(to)g Fl(void*)g Fn(and)g(has)g(no)h
+(pre-de\014ned)h(op)q(erations)e(in)h(Lua,)h(b)q(esides)g(assignmen)o(t)e
+(and)-12 1948 y(equalit)o(y)15 b(test.)k(Ho)o(w)o(ev)o(er,)13
+b(b)o(y)h(using)h(fallbac)o(ks,)f(the)h(programmer)d(ma)o(y)i(de\014ne)h(op)q
+(erations)f(for)g Fm(user)n(data)-12 2005 y Fn(v)m(alues;)i(see)g(Section)g
+(4.7.)59 2061 y(The)d(t)o(yp)q(e)h Fm(table)e Fn(implemen)o(ts)j(asso)q
+(ciativ)o(e)e(arra)o(ys,)f(that)h(is,)h(arra)o(ys)e(whic)o(h)i(can)f(b)q(e)h
+(indexed)h(not)e(only)-12 2118 y(with)20 b(n)o(um)o(b)q(ers,)g(but)f(with)g
+(an)o(y)g(v)m(alue)h(\(except)g Fk(nil)p Fn(\).)32 b(Therefore,)19
+b(this)h(t)o(yp)q(e)f(ma)o(y)g(b)q(e)g(used)h(not)f(only)-12
+2174 y(to)c(represen)o(t)h(ordinary)g(arra)o(ys,)e(but)h(also)h(sym)o(b)q(ol)
+g(tables,)g(sets,)f(records,)g(etc.)21 b(T)l(o)16 b(represen)o(t)f(a)h
+(record,)-12 2231 y(Lua)h(uses)f(the)g(\014eld)i(name)e(as)g(an)g(index.)24
+b(The)17 b(language)f(supp)q(orts)g(this)h(represen)o(tation)f(b)o(y)g(pro)o
+(viding)-12 2287 y Fl(a.name)f Fn(as)h(syn)o(tactic)g(sugar)g(for)f
+Fl(a["name"])p Fn(.)22 b(T)l(ables)17 b(ma)o(y)e(also)h(carry)g(metho)q(ds.)
+23 b(Because)17 b(functions)-12 2344 y(are)g(\014rst)g(class)h(v)m(alues,)h
+(table)f(\014elds)g(ma)o(y)f(con)o(tain)h(functions.)27 b(The)17
+b(form)g Fl(t:f\(x\))g Fn(is)h(syn)o(tactic)f(sugar)-12 2400
+y(for)e Fl(t.f\(t,x\))p Fn(,)e(whic)o(h)j(calls)h(the)e(metho)q(d)g
+Fl(f)g Fn(from)g(the)g(table)h Fl(t)f Fn(passing)g(itself)i(as)d(the)i
+(\014rst)e(parameter.)59 2457 y(It)i(is)g(imp)q(ortan)o(t)f(to)g(notice)i
+(that)e(tables)h(are)f(ob)s(jects,)g(and)h(not)f(v)m(alues.)23
+b(V)l(ariables)17 b(cannot)e(con)o(tain)-12 2513 y(tables,)e(only)h
+(references)f(to)f(them.)19 b(Assignmen)o(t,)13 b(parameter)f(passing)i(and)e
+(returns)h(alw)o(a)o(ys)f(manipulate)-12 2569 y(references)18
+b(to)f(tables,)h(and)f(do)h(not)f(imply)h(an)o(y)f(kind)i(of)e(cop)o(y)l(.)26
+b(Moreo)o(v)o(er,)16 b(tables)i(m)o(ust)e(b)q(e)j(explicitly)-12
+2626 y(created)c(b)q(efore)h(used;)f(see)h(Section)g(4.5.7.)p
+-12 2665 747 2 v 40 2692 a Fh(1)57 2708 y Fg(As)d(usual,)h
+Ff(f)p Fe(a)s Ff(g)f Fg(means)g(0)g(or)h(more)f Fe(a)s Fg('s,)e([)p
+Fe(a)s Fg(])h(means)i(an)f(optional)i Fe(a)e Fg(and)g Ff(f)p
+Fe(a)s Ff(g)1208 2692 y Fh(+)1247 2708 y Fg(means)g(one)g(or)g(more)h
+Fe(a)s Fg('s.)40 2738 y Fh(2)57 2754 y Fg(Actually)m(,)g(a)f(function)i
(de\014nition)h(is)d(an)g(assignmen)o(t)i(to)e(a)g(global)i(v)n(ariable;)g
-(see)e(Section)i(3.)910 2976 y Fm(2)p eop
+(see)e(Section)i(3.)910 2976 y Fn(2)p eop
%%Page: 3 3
-bop -12 160 a Fm(Lua)16 b(can)f(call)i(\(and)e(manipulate\))h(functions)h
-(written)e(in)h(Lua)g(and)g(functions)g(written)f(in)h(C;)f(the)h(latter)-12
-216 y(ha)o(v)o(e)f(t)o(yp)q(e)g Fk(Cfunction)s Fm(.)59 273
-y(The)h(t)o(yp)q(e)g Fk(user)n(data)h Fm(is)f(pro)o(vided)h(to)e(allo)o(w)i
-(arbitrary)e(C)h(p)q(oin)o(ters)g(to)g(b)q(e)h(stored)e(in)i(Lua)f(v)m
-(ariables.)-12 329 y(It)h(corresp)q(onds)g(to)f Fj(void*)g
-Fm(and)g(has)h(no)g(v)m(alid)h(op)q(erations)f(in)g(Lua,)g(b)q(esides)h
-(assignmen)o(t)f(and)g(equalit)o(y)-12 385 y(test.)59 442 y(The)c(t)o(yp)q(e)
-h Fk(table)f Fm(implemen)o(ts)h(asso)q(ciativ)o(e)g(arra)o(ys,)e(that)h(is,)g
-(arra)o(ys)f(that)h(can)g(b)q(e)h(indexed)h(b)q(oth)f(with)-12
-498 y(n)o(um)o(b)q(ers)19 b(and)f(with)h(strings.)29 b(Therefore,)19
-b(this)g(t)o(yp)q(e)f(ma)o(y)g(b)q(e)h(used)g(not)f(only)h(to)f(represen)o(t)
-g(ordinary)-12 555 y(arra)o(ys,)h(but)h(also)f(sym)o(b)q(ol)h(tables,)g
-(sets,)g(records,)g(etc.)33 b(T)l(o)19 b(represen)o(t)h(a)f(record,)h(Lua)g
-(uses)f(the)h(\014eld)-12 611 y(name)13 b(as)g(an)g(index.)21
-b(The)13 b(language)g(supp)q(orts)g(this)h(represen)o(tation)f(b)o(y)g(pro)o
-(viding)h Fj(a.name)f Fm(as)f(syn)o(tactic)-12 668 y(sugar)j(for)f
-Fj(a["name"])p Fm(.)59 724 y(It)i(is)g(imp)q(ortan)o(t)f(to)g(notice)i(that)e
-(tables)h(are)f(ob)s(jects,)g(and)h(not)f(v)m(alues.)23 b(V)l(ariables)17
-b(cannot)e(con)o(tain)-12 781 y(tables,)e(only)h(references)f(to)f(them.)19
-b(Assignmen)o(t,)13 b(parameter)f(passing)i(and)e(returns)h(alw)o(a)o(ys)f
-(manipulate)-12 837 y(references)18 b(to)f(tables,)h(and)f(do)h(not)f(imply)h
-(an)o(y)f(kind)i(of)e(cop)o(y)l(.)26 b(Moreo)o(v)o(er,)16 b(tables)i(m)o(ust)
-e(b)q(e)j(explicitly)-12 894 y(created)c(b)q(efore)h(used;)f(see)h(Section)g
-(4.5.7.)-12 1037 y Fl(4)69 b(The)23 b(Language)-12 1138 y Fm(This)16
+bop -12 160 a Fo(4)69 b(The)23 b(Language)-12 261 y Fn(This)16
b(section)g(describ)q(es)h(the)e(lexis,)h(syn)o(tax)e(and)i(seman)o(tics)f
-(of)g(Lua.)-12 1260 y Fb(4.1)56 b(Lexical)17 b(Con)n(v)n(en)n(tions)-12
-1346 y Fm(Lua)c(is)g(a)f(case)g(sensitiv)o(e)i(language.)19
+(of)g(Lua.)-12 383 y Fd(4.1)56 b(Lexical)17 b(Con)n(v)n(en)n(tions)-12
+469 y Fn(Lua)c(is)g(a)f(case)g(sensitiv)o(e)i(language.)19
b(Iden)o(ti\014ers)14 b(can)e(b)q(e)h(an)o(y)f(string)h(of)f(letters,)g
-(digits,)i(and)e(underscores,)-12 1402 y(not)h(b)q(eginning)h(with)f(a)g
+(digits,)i(and)e(underscores,)-12 525 y(not)h(b)q(eginning)h(with)f(a)g
(digit.)20 b(The)13 b(follo)o(wing)g(w)o(ords)f(are)h(reserv)o(ed,)g(and)g
-(cannot)f(b)q(e)h(used)h(as)e(iden)o(ti\014ers:)203 1496 y
-Fj(and)143 b(do)190 b(else)143 b(elseif)95 b(end)203 1552 y(function)23
-b(if)190 b(local)119 b(nil)167 b(not)203 1609 y(or)g(repeat)94
-b(return)h(until)119 b(then)95 b(while)59 1703 y Fm(The)15
-b(follo)o(wing)h(strings)f(denote)h(other)e(tok)o(ens:)203
-1797 y Fj(~=)47 b(<=)h(>=)f(<)72 b(>)f(=)h(..)47 b(+)72 b(-)f(*)g(/)h(\045)
-203 1853 y(\()f(\))h({)f(})h([)f(])h(@)f(;)h(,)f(.)59 1947
-y Fm(Literal)17 b(strings)f(can)h(b)q(e)g(delimited)h(b)o(y)f(matc)o(hing)f
-(single)i(or)d(double)j(quotes,)e(and)g(can)h(con)o(tain)f(the)-12
-2003 y(C-lik)o(e)f(escap)q(e)g(sequences)g Fj('\\n')p Fm(,)e
-Fj('\\t')h Fm(and)g Fj('\\r')p Fm(.)19 b(Commen)o(ts)13 b(start)g(an)o
-(ywhere)h(outside)g(a)g(string)g(with)-12 2060 y(a)h(double)i(h)o(yphen)f(\()
-p Fj(--)p Fm(\))e(and)h(run)h(un)o(til)g(the)f(end)h(of)f(the)g(line.)59
-2116 y(Numerical)e(constan)o(ts)e(ma)o(y)g(b)q(e)h(written)g(with)g(an)f
-(optional)h(decimal)i(part,)d(and)h(an)g(optional)g(decimal)-12
-2173 y(exp)q(onen)o(t.)21 b(Examples)15 b(of)g(v)m(alid)i(n)o(umerical)f
-(constan)o(ts)f(are:)155 2266 y Fj(4)119 b(4.)g(.4)g(4.57e-3)g(.3e12)-12
-2388 y Fb(4.2)56 b(Co)r(ercion)-12 2474 y Fm(Lua)17 b(pro)o(vides)g(some)g
-(automatic)f(con)o(v)o(ersions.)24 b(An)o(y)17 b(arithmetic)g(op)q(eration)g
-(applied)i(to)d(a)g(string)h(tries)-12 2530 y(to)g(con)o(v)o(ert)g(that)g
-(string)g(to)g(a)g(n)o(um)o(b)q(er,)h(follo)o(wing)h(the)e(usual)h(rules.)28
-b(More)17 b(sp)q(eci\014cally)l(,)k(the)c(string)h(is)-12 2587
-y(con)o(v)o(erted)c(to)f(a)h(n)o(um)o(b)q(er)g(using)h(the)f(standard)g
-Fj(strtod)f Fm(C)h(function.)20 b(Con)o(v)o(ersely)l(,)14 b(whenev)o(er)g(a)g
-(n)o(um)o(b)q(er)-12 2643 y(is)22 b(used)h(when)f(a)g(string)f(is)i(exp)q
-(ected,)h(that)d(n)o(um)o(b)q(er)h(is)h(con)o(v)o(erted)e(to)g(a)h(string,)h
-(according)f(to)f(the)-12 2700 y(follo)o(wing)e(rule:)28 b(if)19
-b(the)g(n)o(um)o(b)q(er)f(is)h(an)g(in)o(teger,)g(it)g(is)g(written)g
-(without)f(exp)q(onen)o(t)h(or)f(decimal)i(p)q(oin)o(t;)-12
-2756 y(otherwise,)e(it)g(is)g(formatted)e(follo)o(wing)i(the)f(\\)p
-Fj(\045g)p Fm(")g(con)o(v)o(ersion)g(sp)q(eci\014cation)j(of)d(the)g
-(standard)g Fj(printf)-12 2813 y Fm(C)e(function.)910 2976
-y(3)p eop
+(cannot)f(b)q(e)h(used)h(as)e(iden)o(ti\014ers:)203 619 y Fl(and)143
+b(do)190 b(else)143 b(elseif)95 b(end)203 675 y(function)23
+b(if)190 b(local)119 b(nil)167 b(not)203 732 y(or)g(repeat)94
+b(return)h(until)119 b(then)95 b(while)59 826 y Fn(The)15 b(follo)o(wing)h
+(strings)f(denote)h(other)e(tok)o(ens:)203 919 y Fl(~=)47 b(<=)h(>=)f(<)72
+b(>)f(==)48 b(=)71 b(..)48 b(+)71 b(-)g(*)h(/)203 976 y(\045)f(\()h(\))f({)h
+(})f([)h(])f(;)h(,)f(.)59 1070 y Fn(Literal)17 b(strings)f(can)h(b)q(e)g
+(delimited)h(b)o(y)f(matc)o(hing)f(single)i(or)d(double)j(quotes,)e(and)g
+(can)h(con)o(tain)f(the)-12 1126 y(C-lik)o(e)f(escap)q(e)g(sequences)g
+Fl('\\n')p Fn(,)e Fl('\\t')h Fn(and)g Fl('\\r')p Fn(.)19 b(Commen)o(ts)13
+b(start)g(an)o(ywhere)h(outside)g(a)g(string)g(with)-12 1183
+y(a)h(double)i(h)o(yphen)f(\()p Fl(--)p Fn(\))e(and)h(run)h(un)o(til)g(the)f
+(end)h(of)f(the)g(line.)59 1239 y(Numerical)e(constan)o(ts)e(ma)o(y)g(b)q(e)h
+(written)g(with)g(an)f(optional)h(decimal)i(part,)d(and)h(an)g(optional)g
+(decimal)-12 1296 y(exp)q(onen)o(t.)21 b(Examples)15 b(of)g(v)m(alid)i(n)o
+(umerical)f(constan)o(ts)f(are:)155 1389 y Fl(4)119 b(4.)g(.4)g(4.57e-3)g
+(.3e12)-12 1511 y Fd(4.2)56 b(Co)r(ercion)-12 1597 y Fn(Lua)17
+b(pro)o(vides)g(some)g(automatic)f(con)o(v)o(ersions.)24 b(An)o(y)17
+b(arithmetic)g(op)q(eration)g(applied)i(to)d(a)g(string)h(tries)-12
+1653 y(to)12 b(con)o(v)o(ert)g(that)g(string)g(to)g(a)g(n)o(um)o(b)q(er,)h
+(follo)o(wing)g(the)g(usual)g(rules.)20 b(Con)o(v)o(ersely)l(,)13
+b(whenev)o(er)g(a)f(n)o(um)o(b)q(er)h(is)-12 1710 y(used)h(when)f(a)f(string)
+h(is)g(exp)q(ected,)i(that)d(n)o(um)o(b)q(er)h(is)g(con)o(v)o(erted)g(to)f(a)
+g(string,)h(according)h(to)e(the)h(follo)o(wing)-12 1766 y(rule:)20
+b(if)15 b(the)f(n)o(um)o(b)q(er)h(is)g(an)f(in)o(teger,)g(it)h(is)f(written)h
+(without)f(exp)q(onen)o(t)h(or)e(decimal)j(p)q(oin)o(t;)f(otherwise,)f(it)-12
+1823 y(is)i(formatted)e(follo)o(wing)i(the)f(\\)p Fl(\045g)p
+Fn(")f(con)o(v)o(ersion)i(sp)q(eci\014cation)h(of)e(the)g(standard)g
+Fl(printf)f Fn(C)h(function.)-12 1944 y Fd(4.3)56 b(Adjustmen)n(t)-12
+2030 y Fn(F)l(unctions)16 b(in)h(Lua)e(can)h(return)f(man)o(y)g(v)m(alues.)22
+b(Because)16 b(there)f(are)h(no)f(t)o(yp)q(e)g(declarations,)h(the)g(system)
+-12 2087 y(do)q(es)21 b(not)f(kno)o(w)g(ho)o(w)g(man)o(y)g(v)m(alues)i(a)e
+(function)h(will)h(return,)g(or)e(ho)o(w)g(man)o(y)g(parameters)f(it)i
+(needs.)-12 2143 y(Therefore,)14 b(sometimes,)f(a)h(list)g(of)f(v)m(alues)i
+(m)o(ust)e(b)q(e)h Fm(adjuste)n(d)5 b Fn(,)14 b(at)f(run)h(time,)g(to)f(a)g
+(giv)o(en)h(length.)20 b(If)14 b(there)-12 2200 y(are)19 b(more)g(v)m(alues)i
+(than)e(are)g(needed,)i(the)f(last)f(v)m(alues)i(are)e(thro)o(wn)f(a)o(w)o(a)
+o(y)l(.)31 b(If)20 b(there)f(are)h(more)e(needs)-12 2256 y(than)d(v)m(alues,)
+h(the)g(list)g(is)g(extended)g(with)g(as)f(man)o(y)f Fk(nil)p
+Fn('s)i(as)f(needed.)22 b(Adjustmen)o(t)15 b(o)q(ccurs)g(in)h(m)o(ultiple)-12
+2312 y(assignmen)o(t)f(and)h(function)g(calls.)-12 2434 y Fd(4.4)56
+b(Statemen)n(ts)-12 2520 y Fn(Lua)18 b(supp)q(orts)f(an)g(almost)f(con)o(v)o
+(en)o(tional)i(set)e(of)h(statemen)o(ts.)24 b(The)18 b(con)o(v)o(en)o(tional)
+f(commands)g(include)-12 2576 y(assignmen)o(t,)d(con)o(trol)h(structures)f
+(and)h(pro)q(cedure)g(calls.)21 b(Non-con)o(v)o(en)o(tional)15
+b(commands)g(include)i(table)-12 2633 y(constructors,)d(explained)j(in)f
+(Section)h(4.5.7,)c(and)i(lo)q(cal)h(v)m(ariable)h(declarations.)910
+2976 y(3)p eop
%%Page: 4 4
-bop -12 160 a Fb(4.3)56 b(Adjustmen)n(t)-12 245 y Fm(F)l(unctions)16
-b(in)h(Lua)e(can)h(return)f(man)o(y)g(v)m(alues.)22 b(Because)16
-b(there)f(are)h(no)f(t)o(yp)q(e)g(declarations,)h(the)g(system)-12
-302 y(do)q(es)h(not)e(kno)o(w)h(ho)o(w)f(man)o(y)h(v)m(alues)h(a)f(function)g
-(will)i(return.)k(Therefore,)16 b(sometimes,)g(a)g(list)h(of)e(v)m(alues)-12
-358 y(m)o(ust)f(b)q(e)g Fk(adjuste)n(d)5 b Fm(,)14 b(at)f(run)h(time,)h(to)e
-(a)h(giv)o(en)g(length.)20 b(If)14 b(there)g(are)g(more)g(v)m(alues)h(than)e
-(are)h(needed,)h(the)-12 415 y(last)h(v)m(alues)i(are)e(thro)o(wn)f(a)o(w)o
-(a)o(y)l(.)21 b(If)c(there)f(are)g(more)g(needs)h(than)f(v)m(alues,)h(the)f
-(list)h(is)g(extended)g(with)g(as)-12 471 y(man)o(y)e Fi(nil)p
-Fm('s)h(as)f(needed.)21 b(Adjustmen)o(t)15 b(also)g(o)q(ccurs)g(in)h(other)f
-(con)o(texts,)f(suc)o(h)i(as)f(m)o(ultiple)i(assignmen)o(t.)-12
-593 y Fb(4.4)56 b(Statemen)n(ts)-12 679 y Fm(Lua)18 b(supp)q(orts)f(an)g
-(almost)f(con)o(v)o(en)o(tional)i(set)e(of)h(statemen)o(ts.)24
-b(The)18 b(con)o(v)o(en)o(tional)f(commands)g(include)-12 735
-y(assignmen)o(t,)d(con)o(trol)h(structures)f(and)h(pro)q(cedure)g(calls.)21
-b(Non-con)o(v)o(en)o(tional)15 b(commands)g(include)i(table)-12
-792 y(constructors,)d(explained)j(in)f(Section)h(4.5.7,)c(and)i(lo)q(cal)h(v)
-m(ariable)h(declarations.)-12 912 y Fi(4.4.1)52 b(Blo)q(c)o(ks)-12
-998 y Fm(A)13 b(blo)q(c)o(k)g(is)g(a)f(list)i(of)e(statemen)o(ts,)g(executed)
-h(sequen)o(tially)l(.)21 b(An)o(y)13 b(statemen)o(t)e(can)i(b)q(e)g
-(optionally)h(follo)o(w)o(ed)-12 1054 y(b)o(y)h(a)g(semicolon.)72
-1122 y Fk(blo)n(ck)49 b Fg(!)h(f)p Fk(stat)16 b(sc)s Fg(g)f
-Fm([)p Fk(r)n(et)h(sc)s Fm(])128 1179 y Fk(sc)49 b Fg(!)h Fm([';'])2
-1247 y(F)l(or)13 b(syn)o(tactic)g(reasons,)h(a)f(return)h(statemen)o(t)e(can)
-i(only)g(b)q(e)g(written)g(as)f(the)h(last)g(statemen)o(t)e(of)i(a)f(blo)q(c)
-o(k.)-12 1303 y(This)j(restriction)g(also)f(a)o(v)o(oids)g(some)g(\\statemen)
-o(t)e(not)i(reac)o(hed")g(errors.)-12 1423 y Fi(4.4.2)52 b(Assignmen)n(t)-12
-1509 y Fm(The)17 b(language)g(allo)o(ws)g(m)o(ultiple)i(assignmen)o(t.)24
+bop -12 160 a Fk(4.4.1)52 b(Blo)q(c)o(ks)-12 245 y Fn(A)13
+b(blo)q(c)o(k)g(is)g(a)f(list)i(of)e(statemen)o(ts,)g(executed)h(sequen)o
+(tially)l(.)21 b(An)o(y)13 b(statemen)o(t)e(can)i(b)q(e)g(optionally)h(follo)
+o(w)o(ed)-12 302 y(b)o(y)h(a)g(semicolon.)72 370 y Fm(blo)n(ck)49
+b Fi(!)h(f)p Fm(stat)16 b(sc)s Fi(g)f Fn([)p Fm(r)n(et)h(sc)s
+Fn(])128 427 y Fm(sc)49 b Fi(!)h Fn([';'])-12 495 y(F)l(or)14
+b(syn)o(tactic)h(reasons,)e(a)i(return)f(statemen)o(t)g(can)g(only)h(b)q(e)g
+(written)g(as)f(the)h(last)f(statemen)o(t)g(of)g(a)g(blo)q(c)o(k.)-12
+551 y(This)i(restriction)g(also)f(a)o(v)o(oids)g(some)g(\\statemen)o(t)e(not)
+i(reac)o(hed")g(errors.)-12 671 y Fk(4.4.2)52 b(Assignmen)n(t)-12
+757 y Fn(The)17 b(language)g(allo)o(ws)g(m)o(ultiple)i(assignmen)o(t.)24
b(Therefore,)17 b(the)g(syn)o(tax)f(de\014nes)i(a)e(list)i(of)e(v)m(ariables)
-i(on)-12 1566 y(the)13 b(left)g(side,)g(and)g(a)f(list)i(of)e(expressions)h
+i(on)-12 814 y(the)13 b(left)g(side,)g(and)g(a)f(list)i(of)e(expressions)h
(on)g(the)f(righ)o(t)h(side.)20 b(Both)12 b(lists)h(ha)o(v)o(e)f(their)h
-(elemen)o(ts)h(separated)-12 1622 y(b)o(y)h(commas.)146 1690
-y Fk(stat)49 b Fg(!)i Fk(varlist1)16 b Fm('=')g Fk(explist1)72
-1747 y(varlist1)49 b Fg(!)i Fk(var)16 b Fg(f)p Fm(',')f Fk(var)5
-b Fg(g)2 1815 y Fm(This)14 b(statemen)o(t)f(\014rst)h(ev)m(aluates)g(all)h(v)
-m(alues)g(on)f(the)g(righ)o(t)g(side)g(and)h(ev)o(en)o(tual)f(indices)i(on)e
-(the)f(left)i(side,)-12 1872 y(and)h(then)f(mak)o(es)g(the)g(assignmen)o(ts.)
-20 b(Therefore,)14 b(it)i(can)f(b)q(e)h(used)g(to)e(exc)o(hange)i(t)o(w)o(o)e
-(v)m(alues,)i(as)e(in)60 1965 y Fj(x,)23 b(y)h(=)g(y,)f(x)-12
-2059 y Fm(Before)18 b(the)f(assignmen)o(t,)h(the)g(list)g(of)f(v)m(alues)i
-(is)f Fk(adjuste)n(d)g Fm(to)f(the)h(length)g(of)f(the)h(list)g(of)f(v)m
-(ariables)i(\(see)-12 2116 y(Section)d(4.3\).)59 2172 y(A)f(single)i(name)e
-(can)g(denote)h(a)e(global)i(or)f(a)g(lo)q(cal)h(v)m(ariable.)72
-2240 y Fk(var)50 b Fg(!)g Fk(name)72 2297 y(var)g Fg(!)g Fk(var)17
-b Fm('[')e Fk(exp1)i Fm(']')31 b Fg(j)16 b Fk(var)g Fm('.')k
-Fk(name)4 2365 y Fm(Brac)o(k)o(ets)c(are)g(used)h(to)f(index)h(a)f(table.)24
-b(In)17 b(this)g(case,)f Fj(var)g Fm(m)o(ust)g(result)h(in)g(a)f(table)h(v)m
-(alue;)g(otherwise,)-12 2421 y(there)e(is)h(an)f(execution)i(error.)i(The)c
-(syn)o(tax)g Fj(var.NAME)f Fm(is)h(just)g(syn)o(tactic)g(sugar)g(for)g
-Fj(var["NAME"])p Fm(.)-12 2542 y Fi(4.4.3)52 b(Con)o(trol)17
-b(Structures)-12 2627 y Fm(The)e(condition)h(expression)f(of)f(a)h(con)o
-(trol)f(structure)g(can)h(return)g(an)o(y)f(v)m(alue.)21 b(All)16
-b(v)m(alues)f(di\013eren)o(t)g(from)-12 2684 y Fi(nil)i Fm(are)e(considered)i
-(true,)f(while)h Fi(nil)f Fm(is)h(considered)g(false.)k Fj(If)p
-Fm(s,)15 b Fj(while)p Fm(s)g(and)h Fj(repeat)p Fm(s)f(ha)o(v)o(e)g(the)h
-(usual)-12 2740 y(meaning.)910 2976 y(4)p eop
+(elemen)o(ts)h(separated)-12 870 y(b)o(y)h(commas.)146 938
+y Fm(stat)49 b Fi(!)i Fm(varlist1)16 b Fn('=')g Fm(explist1)72
+995 y(varlist1)49 b Fi(!)i Fm(var)16 b Fi(f)p Fn(',')f Fm(var)5
+b Fi(g)-12 1063 y Fn(This)16 b(statemen)o(t)d(\014rst)i(ev)m(aluates)g(all)h
+(v)m(alues)g(on)e(the)h(righ)o(t)g(side)g(and)g(ev)o(en)o(tual)g(indices)i
+(on)e(the)g(left)g(side,)-12 1119 y(and)h(then)f(mak)o(es)g(the)g(assignmen)o
+(ts.)20 b(Therefore,)14 b(it)i(can)f(b)q(e)h(used)g(to)e(exc)o(hange)i(t)o(w)
+o(o)e(v)m(alues,)i(as)e(in)60 1213 y Fl(x,)23 b(y)h(=)g(y,)f(x)-12
+1307 y Fn(Before)18 b(the)g(assignmen)o(t,)g(the)g(list)g(of)g(v)m(alues)h
+(is)f Fm(adjuste)n(d)g Fn(to)f(the)h(length)h(of)e(the)h(list)h(of)e(v)m
+(ariables;)j(see)-12 1364 y(Section)c(4.3.)72 1436 y Fm(var)50
+b Fi(!)g Fm(name)-12 1508 y Fn(A)15 b(single)i(name)e(can)g(denote)h(a)f
+(global)h(or)e(a)h(lo)q(cal)i(v)m(ariable,)f(or)e(a)h(formal)g(parameter.)72
+1580 y Fm(var)50 b Fi(!)g Fm(var)17 b Fn('[')e Fm(exp1)i Fn(']')-12
+1652 y(Square)f(brac)o(k)o(ets)f(are)g(used)h(to)f(index)i(a)e(table.)21
+b(If)16 b Fl(var)f Fn(results)h(in)g(a)f(table)h(v)m(alue,)h(the)e(\014eld)i
+(indexed)g(b)o(y)-12 1708 y(the)i(expression)g(v)m(alue)h(gets)e(the)h
+(assigned)g(v)m(alue.)32 b(Otherwise,)20 b(the)f(fallbac)o(k)g
+Fm(settable)f Fn(is)h(called,)i(with)-12 1765 y(three)15 b(parameters:)j(the)
+c(v)m(alue)i(of)e Fl(var)p Fn(,)f(the)i(v)m(alue)g(of)f(expression,)h(and)g
+(the)f(v)m(alue)h(b)q(eing)h(assigned)f(to)e(it;)-12 1821 y(see)j(Section)g
+(4.7.)72 1893 y Fm(var)50 b Fi(!)g Fm(var)17 b Fn('.')j Fm(name)-12
+1966 y Fn(The)c(syn)o(tax)e Fl(var.NAME)g Fn(is)i(just)f(syn)o(tactic)g
+(sugar)g(for)f Fl(var["NAME"])p Fn(.)-12 2086 y Fk(4.4.3)52
+b(Con)o(trol)17 b(Structures)-12 2171 y Fn(The)e(condition)h(expression)f(of)
+f(a)h(con)o(trol)f(structure)g(can)h(return)g(an)o(y)f(v)m(alue.)21
+b(All)16 b(v)m(alues)f(di\013eren)o(t)g(from)-12 2228 y Fk(nil)f
+Fn(are)f(considered)h(true,)f(while)i Fk(nil)f Fn(is)g(considered)g(false.)20
+b Fl(if)p Fn('s,)12 b Fl(while)p Fn('s)g(and)h Fl(repeat)p
+Fn('s)f(ha)o(v)o(e)g(the)i(usual)-12 2284 y(meaning.)100 2352
+y Fm(stat)50 b Fi(!)g Fk(while)17 b Fm(exp1)g Fk(do)f Fm(blo)n(ck)g
+Fk(end)275 2409 y Fi(j)32 b Fk(rep)q(eat)17 b Fm(blo)n(ck)f
+Fk(un)o(til)h Fm(exp1)275 2465 y Fi(j)32 b Fk(if)17 b Fm(exp1)g
+Fk(then)f Fm(blo)n(ck)g Fi(f)p Fm(elseif)8 b Fi(g)16 b Fn([)p
+Fk(else)g Fm(blo)n(ck)5 b Fn(])15 b Fk(end)72 2522 y Fm(elseif)49
+b Fi(!)h Fk(elseif)17 b Fm(exp1)f Fk(then)h Fm(blo)n(ck)59
+2615 y Fn(A)g Fl(return)g Fn(is)h(used)h(to)e(return)g(v)m(alues)i(from)e(a)g
+(function.)28 b(Because)18 b(a)g(function)g(ma)o(y)f(return)h(more)-12
+2672 y(than)d(one)h(v)m(alue,)g(the)f(syn)o(tax)f(for)h(a)g(return)g
+(statemen)o(t)f(is:)72 2744 y Fm(r)n(et)49 b Fi(!)i Fk(return)15
+b Fm(explist)910 2976 y Fn(4)p eop
%%Page: 5 5
-bop 100 158 a Fk(stat)50 b Fg(!)g Fi(while)17 b Fk(exp1)g Fi(do)f
-Fk(blo)n(ck)g Fi(end)100 214 y Fk(stat)50 b Fg(!)g Fi(rep)q(eat)17
-b Fk(blo)n(ck)e Fi(un)o(til)i Fk(exp1)100 271 y(stat)50 b Fg(!)g
-Fi(if)17 b Fk(exp1)f Fi(then)h Fk(blo)n(ck)e Fg(f)p Fk(elseif)9
-b Fg(g)16 b Fm([)p Fi(else)g Fk(blo)n(ck)5 b Fm(])15 b Fi(end)72
-327 y Fk(elseif)49 b Fg(!)h Fi(elseif)17 b Fk(exp1)f Fi(then)h
-Fk(blo)n(ck)59 420 y Fm(A)g Fj(return)g Fm(is)h(used)h(to)e(return)g(v)m
-(alues)i(from)e(a)g(function.)28 b(Because)18 b(a)g(function)g(ma)o(y)f
-(return)h(more)-12 477 y(than)d(one)h(v)m(alue,)g(the)f(syn)o(tax)f(for)h(a)g
-(return)g(statemen)o(t)f(is:)72 549 y Fk(r)n(et)49 b Fg(!)i
-Fi(return)15 b Fk(explist)-12 741 y Fi(4.4.4)52 b(Expressions)16
-b(as)i(Statemen)o(ts)-12 827 y Fm(All)c(expressions)e(with)h(p)q(ossible)h
-(side-e\013ects)e(can)h(b)q(e)f(executed)h(as)f(statemen)o(ts.)18
-b(These)12 b(include)i(function)-12 883 y(calls)i(and)g(table)f
-(constructors:)72 943 y Fk(stat)50 b Fg(!)g Fk(functionc)n(al)r(l)72
-999 y(stat)g Fg(!)g Fk(table)n(c)n(onstructor)1 1067 y Fm(Ev)o(en)o(tual)14
-b(returned)f(v)m(alues)i(are)d(thro)o(wn)h(a)o(w)o(a)o(y)l(.)18
-b(F)l(unction)c(calls)g(are)f(explained)i(in)f(Section)g(4.5.8,)e(while)-12
-1124 y(constructors)j(are)f(the)i(sub)s(ject)f(of)g(Section)h(4.5.7.)-12
-1244 y Fi(4.4.5)52 b(Lo)q(cal)20 b(Declarations)-12 1330 y
-Fm(Lo)q(cal)h(v)m(ariables)g(can)e(b)q(e)h(declared)h(an)o(ywhere)f(inside)h
-(a)e(blo)q(c)o(k.)34 b(Their)20 b(scop)q(e)g(b)q(egins)h(after)e(the)h(dec-)
--12 1386 y(laration)h(and)g(lasts)g(un)o(til)h(the)f(blo)q(c)o(k)h(end.)38
-b(The)21 b(declaration)g(ma)o(y)g(include)i(an)e(initial)i(assignmen)o(t:)122
-1502 y Fk(stat)50 b Fg(!)g Fi(lo)q(cal)18 b Fk(de)n(clist)e
-Fm([)p Fk(init)t Fm(])72 1558 y Fk(de)n(clist)49 b Fg(!)h Fk(name)16
-b Fg(f)p Fm(',')f Fk(name)s Fg(g)125 1615 y Fk(init)50 b Fg(!)g
-Fm('=')16 b Fk(explist1)0 1683 y Fm(If)c(there)f(is)h(an)g(initial)i
-(assignmen)o(t,)d(it)h(has)g(the)f(same)h(seman)o(tics)f(of)h(a)f(m)o
-(ultiple)i(assignmen)o(t.)19 b(Otherwise,)-12 1740 y(all)d(v)m(ariables)h
-(are)e(initialized)j(with)e Fi(nil)p Fm(.)-12 1861 y Fb(4.5)56
-b(Expressions)-12 1947 y Fi(4.5.1)c(Simple)16 b(Expressions)-12
-2033 y Fm(Simple)h(expressions)f(are:)72 2101 y Fk(exp)50 b
-Fg(!)g Fm('\(')15 b Fk(exp)i Fm('\)')72 2157 y Fk(exp)50 b
-Fg(!)g Fi(nil)72 2214 y Fk(exp)g Fg(!)g Fm('n)o(um)o(b)q(er')72
-2270 y Fk(exp)g Fg(!)g Fm('literal')72 2327 y Fk(exp)g Fg(!)g
-Fk(var)4 2398 y Fm(Num)o(b)q(ers)16 b(\(n)o(umerical)g(constan)o(ts\))e(and)i
-(string)g(literals)g(are)g(explained)h(in)g(Section)f(4.1.)k(V)l(ariables)d
-(are)-12 2454 y(explained)g(in)g(Section)f(4.4.2.)-12 2574
-y Fi(4.5.2)52 b(Arithmetic)16 b(Op)q(erators)-12 2660 y Fm(Lua)f(supp)q(orts)
-f(the)g(usual)g(arithmetic)h(op)q(erators,)e(with)h(the)g(usual)h(meaning.)20
-b(These)14 b(op)q(erators)g(are)f(the)-12 2716 y(binary)k Fj(+)p
-Fm(,)e Fj(-)p Fm(,)h Fj(*)g Fm(and)g Fj(/)p Fm(,)f(and)h(the)h(unary)e
-Fj(+)h Fm(and)g Fj(-)p Fm(.)22 b(The)16 b(op)q(erands)h(m)o(ust)e(b)q(e)i(n)o
-(um)o(b)q(ers,)f(or)f(strings)h(that)-12 2773 y(can)g(b)q(e)f(con)o(v)o
-(erted)g(to)g(n)o(um)o(b)q(ers,)g(according)h(to)e(the)h(rules)h(giv)o(en)g
-(in)g(Section)g(4.2.)910 2976 y(5)p eop
-%%Page: 6 6
-bop -12 160 a Fi(4.5.3)52 b(Relational)20 b(Op)q(erators)-12
-245 y Fm(Lua)c(o\013ers)e(the)h(follo)o(wing)h(relational)g(op)q(erators:)155
-339 y Fj(<)72 b(>)f(<=)48 b(>=)f(~=)g(=)-12 433 y Fm(All)17
-b(return)e Fi(nil)h Fm(as)f(false)g(and)h(1)f(as)f(true.)59
-490 y(Equalit)o(y)19 b(\014rst)f(compares)g(the)g(t)o(yp)q(es)h(of)f(its)h
+bop -12 160 a Fk(4.4.4)52 b(Expressions)16 b(as)i(Statemen)o(ts)-12
+245 y Fn(All)c(expressions)e(with)h(p)q(ossible)h(side-e\013ects)e(can)h(b)q
+(e)f(executed)h(as)f(statemen)o(ts.)18 b(These)12 b(include)i(function)-12
+302 y(calls)i(and)g(table)f(constructors:)72 361 y Fm(stat)50
+b Fi(!)g Fm(functionc)n(al)r(l)72 418 y(stat)g Fi(!)g Fm(table)n(c)n
+(onstructor)-12 486 y Fn(Ev)o(en)o(tual)16 b(returned)g(v)m(alues)h(are)f
+(thro)o(wn)f(a)o(w)o(a)o(y)l(.)20 b(F)l(unction)c(calls)h(are)f(explained)i
+(in)e(Section)h(4.5.8;)d(con-)-12 542 y(structors)g(are)h(the)h(sub)s(ject)f
+(of)f(Section)i(4.5.7.)-12 662 y Fk(4.4.5)52 b(Lo)q(cal)20
+b(Declarations)-12 748 y Fn(Lo)q(cal)c(v)m(ariables)g(can)f(b)q(e)g(declared)
+h(an)o(ywhere)f(inside)h(a)f(blo)q(c)o(k.)20 b(Their)c(scop)q(e)f(b)q(egins)h
+(after)e(the)h(declara-)-12 805 y(tion)i(and)h(lasts)f(un)o(til)h(the)f(end)h
+(of)e(the)h(blo)q(c)o(k.)27 b(The)17 b(declaration)h(ma)o(y)e(include)k(an)d
+(initial)i(assignmen)o(t:)122 921 y Fm(stat)50 b Fi(!)g Fk(lo)q(cal)18
+b Fm(de)n(clist)e Fn([)p Fm(init)t Fn(])72 977 y Fm(de)n(clist)49
+b Fi(!)h Fm(name)16 b Fi(f)p Fn(',')f Fm(name)s Fi(g)125 1033
+y Fm(init)50 b Fi(!)g Fn('=')16 b Fm(explist1)-12 1102 y Fn(If)d(there)f(is)h
+(an)g(initial)h(assignmen)o(t,)f(it)f(has)h(the)f(same)g(seman)o(tics)h(of)f
+(a)g(m)o(ultiple)i(assignmen)o(t.)19 b(Otherwise,)-12 1158
+y(all)d(v)m(ariables)h(are)e(initialized)j(with)e Fk(nil)p
+Fn(.)-12 1280 y Fd(4.5)56 b(Expressions)-12 1366 y Fk(4.5.1)c(Simple)16
+b(Expressions)-12 1452 y Fn(Simple)h(expressions)f(are:)72
+1520 y Fm(exp)50 b Fi(!)g Fn('\(')15 b Fm(exp)i Fn('\)')72
+1576 y Fm(exp)50 b Fi(!)g Fk(nil)72 1633 y Fm(exp)g Fi(!)g
+Fn('n)o(um)o(b)q(er')72 1689 y Fm(exp)g Fi(!)g Fn('literal')72
+1746 y Fm(exp)g Fi(!)g Fm(var)-12 1816 y Fn(Num)o(b)q(ers)17
+b(\(n)o(umerical)h(constan)o(ts\))d(and)i(string)g(literals)g(are)g
+(explained)i(in)e(Section)h(4.1.)23 b(V)l(ariables)18 b(are)-12
+1873 y(explained)f(in)g(Section)f(4.4.2.)-12 1993 y Fk(4.5.2)52
+b(Arithmetic)16 b(Op)q(erators)-12 2079 y Fn(Lua)j(supp)q(orts)f(the)h(usual)
+g(arithmetic)g(op)q(erators.)28 b(These)19 b(op)q(erators)e(are)h(the)g
+(binary)h Fl(+)p Fn(,)g Fl(-)p Fn(,)f Fl(*)p Fn(,)h Fl(/)f
+Fn(and)-12 2135 y Fl(^)j Fn(\(exp)q(onen)o(tiation\),)h(and)f(the)f(unary)h
+Fl(-)p Fn(.)36 b(If)21 b(the)g(op)q(erands)g(are)f(n)o(um)o(b)q(ers,)i(or)e
+(strings)h(that)f(can)h(b)q(e)-12 2192 y(con)o(v)o(erted)15
+b(to)f(n)o(um)o(b)q(ers,)h(according)h(to)e(the)h(rules)h(giv)o(en)f(in)h
+(Section)g(4.2,)e(all)i(op)q(erations)f(but)g(exp)q(onen-)-12
+2248 y(tiation)i(ha)o(v)o(e)e(the)i(usual)f(meaning.)24 b(Otherwise,)17
+b(the)f(fallbac)o(k)h(\\arith")e(is)i(called;)h(see)e(Section)h(4.7.)22
+b(An)-12 2305 y(exp)q(onen)o(tiation)17 b(alw)o(a)o(ys)d(calls)i(this)g
+(fallbac)o(k.)-12 2425 y Fk(4.5.3)52 b(Relational)20 b(Op)q(erators)-12
+2510 y Fn(Lua)c(o\013ers)e(the)h(follo)o(wing)h(relational)g(op)q(erators:)
+155 2604 y Fl(<)72 b(>)f(<=)48 b(>=)f(~=)g(==)-12 2698 y Fn(All)17
+b(return)e Fk(nil)h Fn(as)f(false)g(and)h(1)f(as)f(true.)59
+2754 y(Equalit)o(y)19 b(\014rst)f(compares)g(the)g(t)o(yp)q(es)h(of)f(its)h
(op)q(erands.)30 b(If)18 b(they)h(are)f(di\013eren)o(t,)h(the)g(result)g(is)g
-Fi(nil)p Fm(.)-12 546 y(Otherwise,)h(their)e(v)m(alues)i(are)d(compared.)29
+Fk(nil)p Fn(.)-12 2811 y(Otherwise,)h(their)e(v)m(alues)i(are)d(compared.)29
b(Num)o(b)q(ers)19 b(and)f(strings)g(are)g(compared)g(in)h(the)g(usual)f(w)o
-(a)o(y)l(.)-12 602 y(T)l(ables,)c(Cfunctions,)g(and)g(functions)g(are)f
-(compared)g(b)o(y)h(reference,)g(that)e(is,)i(t)o(w)o(o)e(tables)i(are)f
-(considered)-12 659 y(equal)j(only)g(if)g(they)f(are)g(the)g(same)g(table.)20
-b(The)c(op)q(erator)e Fj(~=)h Fm(is)h(exactly)f(the)g(negation)h(of)f
-(equalit)o(y)g(\()p Fj(=)p Fm(\).)59 715 y(The)f(other)f(op)q(erators)f(can)i
-(only)g(b)q(e)g(applied)i(to)d(strings)g(and)h(n)o(um)o(b)q(ers.)20
-b(If)14 b(one)f(of)g(the)h(argumen)o(ts)f(is)-12 772 y(a)g(string,)h(the)f
-(other)g(is)h(con)o(v)o(erted)f(to)g(a)g(string,)g(and)h(their)g(v)m(alues)g
-(are)f(compared)h(using)g(lexicographical)-12 828 y(order.)20
-b(Otherwise,)15 b(b)q(oth)h(are)f(n)o(um)o(b)q(ers)g(and)h(are)e(compared)i
-(as)e(suc)o(h.)-12 948 y Fi(4.5.4)52 b(Logical)20 b(Op)q(erators)-12
-1034 y Fm(All)g(logical)g(op)q(erators,)f(lik)o(e)h(con)o(trol)e(structures,)
-h(consider)h Fi(nil)g Fm(as)e(false)i(and)f(an)o(ything)g(else)g(as)g(true.)
--12 1091 y(Lik)o(e)d(relational)g(op)q(erators,)e(they)i(return)f
-Fi(nil)h Fm(as)f(false)g(and)h(1)f(as)f(true.)20 b(The)c(logical)g(op)q
-(erators)e(are:)298 1184 y Fj(and)72 b(or)f(not)-12 1278 y
-Fm(The)18 b(op)q(erators)f Fj(and)g Fm(and)h Fj(or)g Fm(use)g(short-cut)f(ev)
-m(aluation,)j(that)d(is,)h(the)g(second)h(op)q(erand)f(is)g(ev)m(aluated)-12
-1335 y(only)e(if)g(necessary)l(.)-12 1455 y Fi(4.5.5)52 b(Concatenation)-12
-1541 y Fm(Lua)15 b(o\013ers)f(a)g(string)g(concatenation)h(op)q(erator,)e
-(denoted)i(b)o(y)g(\\)p Fj(..)p Fm(".)k(The)14 b(op)q(erands)h(m)o(ust)f(b)q
-(e)h(strings)g(or)-12 1597 y(n)o(um)o(b)q(ers,)g(whic)o(h)h(are)f(con)o(v)o
-(erted)g(to)g(strings)g(according)g(to)g(the)g(rules)h(in)g(Section)g(4.2.)
--12 1717 y Fi(4.5.6)52 b(Precedence)-12 1803 y Fm(Op)q(erator)15
+(a)o(y)l(.)910 2976 y(5)p eop
+%%Page: 6 6
+bop -12 160 a Fn(T)l(ables,)13 b(CF)l(unctions,)h(and)e(functions)h(are)f
+(compared)h(b)o(y)f(reference,)h(that)f(is,)h(t)o(w)o(o)e(tables)i(are)f
+(considered)-12 216 y(equal)k(only)g(if)g(they)f(are)g(the)g(same)g(table.)20
+b(The)c(op)q(erator)e Fl(~=)h Fn(is)h(exactly)f(the)g(negation)h(of)f
+(equalit)o(y)g(\()p Fl(=)p Fn(\).)59 273 y(The)i(other)g(op)q(erators)g(w)o
+(ork)f(as)h(follo)o(ws.)26 b(If)17 b(b)q(oth)h(argumen)o(ts)e(are)h(n)o(um)o
+(b)q(ers,)h(they)f(are)g(compared)-12 329 y(as)f(suc)o(h.)23
+b(Otherwise,)16 b(if)h(b)q(oth)f(argumen)o(ts)f(can)h(b)q(e)h(con)o(v)o
+(erted)f(to)f(strings,)h(their)g(v)m(alues)i(are)d(compared)-12
+385 y(using)h(lexicographical)i(order.)h(Otherwise,)d(the)f(fallbac)o(k)h
+(\\order")e(is)i(called;)h(see)e(Section)h(4.7.)-12 505 y Fk(4.5.4)52
+b(Logical)20 b(Op)q(erators)-12 590 y Fn(All)g(logical)g(op)q(erators,)f(lik)
+o(e)h(con)o(trol)e(structures,)h(consider)h Fk(nil)g Fn(as)e(false)i(and)f
+(an)o(ything)g(else)g(as)g(true.)-12 647 y(Lik)o(e)d(relational)g(op)q
+(erators,)e(they)i(return)f Fk(nil)h Fn(as)f(false)g(and)h(1)f(as)f(true.)20
+b(The)c(logical)g(op)q(erators)e(are:)298 736 y Fl(and)72 b(or)f(not)-12
+825 y Fn(The)18 b(op)q(erators)f Fl(and)g Fn(and)h Fl(or)g
+Fn(use)g(short-cut)f(ev)m(aluation,)j(that)d(is,)h(the)g(second)h(op)q(erand)
+f(is)g(ev)m(aluated)-12 881 y(only)e(if)g(necessary)l(.)-12
+1000 y Fk(4.5.5)52 b(Concatenation)-12 1086 y Fn(Lua)11 b(o\013ers)f(a)h
+(string)f(concatenation)h(op)q(erator,)g(denoted)g(b)o(y)g(\\)p
+Fl(..)p Fn(".)17 b(If)11 b(op)q(erands)g(are)g(strings)f(or)g(n)o(um)o(b)q
+(ers,)-12 1142 y(they)20 b(are)f(con)o(v)o(erted)g(to)g(strings)h(according)g
+(to)e(the)i(rules)g(in)h(Section)f(4.2.)32 b(Otherwise,)21
+b(the)f(fallbac)o(k)-12 1199 y(\\concat")15 b(is)g(called;)i(see)e(Section)h
+(4.7.)-12 1318 y Fk(4.5.6)52 b(Precedence)-12 1404 y Fn(Op)q(erator)15
b(precedence)i(follo)o(ws)e(the)h(table)f(b)q(elo)o(w,)h(from)e(the)h(lo)o(w)
-o(er)g(to)g(the)g(higher)h(priorit)o(y:)298 1897 y Fj(and)72
-b(or)298 1953 y(<)g(>)f(<=)48 b(>=)f(~=)h(=)298 2010 y(..)298
-2066 y(+)72 b(-)298 2122 y(*)g(/)298 2179 y(not)48 b(+)23 b(\(unary\))47
-b(-)24 b(\(unary\))-12 2273 y Fm(All)17 b(binary)e(op)q(erators)g(are)g(left)
-g(asso)q(ciativ)o(e.)-12 2393 y Fi(4.5.7)52 b(T)l(able)18 b(Constructors)-12
-2479 y Fm(T)l(able)13 b(constructors)e(are)h(expressions)h(that)e(create)h
-(tables.)19 b(T)l(able)13 b(constructors)e(are)h(o\013ered)f(in)i(di\013eren)
-o(t)-12 2535 y(\015a)o(v)o(ors.)19 b(The)c(simplest)i(one)e(is:)72
-2607 y Fk(table)n(c)n(onstructor)49 b Fg(!)h Fm('@')16 b('\(')f([)p
-Fk(exp1)6 b Fm(])17 b('\)')5 2679 y(Suc)o(h)h(an)f(expression)h(results)f(in)
-h(a)f(new)g(empt)o(y)g(table.)26 b(An)18 b(optional)f(dimension)i(ma)o(y)e(b)
-q(e)g(giv)o(en)h(as)f(a)-12 2736 y(hin)o(t)g(to)f(the)h(initial)h(table)f
-(size.)25 b(Indep)q(enden)o(tly)19 b(of)d(the)g(initial)j(dimension,)f(all)g
-(arra)o(ys)d(in)i(Lua)g(stretc)o(h)-12 2792 y(dynamically)g(as)e(needed.)59
-2849 y(T)l(o)g(construct)g(a)f(table)i(and)f(initialize)k(some)c(\014elds,)h
-(the)f(follo)o(wing)h(syn)o(tax)e(is)i(a)o(v)m(ailable:)910
-2976 y(6)p eop
+o(er)g(to)g(the)g(higher)h(priorit)o(y:)298 1493 y Fl(and)72
+b(or)298 1549 y(<)g(>)f(<=)48 b(>=)f(~=)h(=)298 1606 y(..)298
+1662 y(+)72 b(-)298 1718 y(*)g(/)298 1775 y(not)48 b(-)23 b(\(unary\))298
+1831 y(^)-12 1920 y Fn(All)17 b(binary)e(op)q(erators)g(are)g(left)g(asso)q
+(ciativ)o(e,)g(except)h(for)f Fl(^)p Fn(,)f(whic)o(h)i(is)g(righ)o(t)f(asso)q
+(ciativ)o(e.)-12 2039 y Fk(4.5.7)52 b(T)l(able)18 b(Constructors)-12
+2125 y Fn(T)l(able)c(constructors)d(are)h(expressions)i(that)e(create)g
+(tables.)19 b(They)13 b(can)g(b)q(e)g(used)g(to)f(create)g(empt)o(y)g
+(tables,)-12 2182 y(or)j(to)f(create)h(a)g(table)h(and)f(initialize)k(some)c
+(\014elds.)59 2238 y(The)g(general)h(syn)o(tax)e(for)h(constructors)f(is:)72
+2306 y Fm(table)n(c)n(onstructor)49 b Fi(!)h Fn(')p Fi(f)p
+Fn(')16 b([)p Fm(\014eld)r(list)t Fn(])e(')p Fi(g)p Fn(')241
+2363 y Fm(\014eld)r(list)49 b Fi(!)h Fm(l\014eld)r(list1)15
+b Fn([','])241 2419 y Fm(\014eld)r(list)49 b Fi(!)h Fm(\016eld)r(list1)16
+b Fn([','])241 2476 y Fm(\014eld)r(list)49 b Fi(!)h Fm(l\014eld)r(list1)15
+b Fn(';')g Fm(\016eld)r(list1)h Fn([','])59 2569 y(The)f(form)g
+Fm(l\014eld)r(list1)f Fn(is)h(used)h(to)f(initialize)j(lists.)72
+2641 y Fm(l\014eld)r(list1)48 b Fi(!)j Fm(exp)16 b Fi(f)p Fn(',')f
+Fm(exp)s Fi(g)-12 2713 y Fn(The)i(expressions)f(in)h(the)g(list)f(are)g
+(assigned)h(to)e(consecutiv)o(e)i(n)o(umerical)h(indexes,)f(starting)f(with)g
+(1.)22 b(As)-12 2769 y(an)15 b(example:)60 2858 y Fl(a)24 b(=)f({"v1",)g
+("v2",)g(34})910 2976 y Fn(6)p eop
%%Page: 7 7
-bop 72 160 a Fk(table)n(c)n(onstructor)49 b Fg(!)h Fm('@')16
-b([)p Fk(name)s Fm(])g Fk(\014eld)r(list)8 232 y Fm(Suc)o(h)k(an)g
-(expression)g(creates)g(a)f(new)h(table,)h(whic)o(h)g(will)g(b)q(e)f(its)g
-(\014nal)h(v)m(alue,)h(initialize)g(some)e(of)f(its)-12 288
-y(\014elds)i(according)g(to)e Fj(fieldlist)g Fm(\(see)h(b)q(elo)o(w\),)h
-(and,)g(if)f Fj(name)g Fm(is)g(giv)o(en,)h(calls)g(a)f(function)h(with)f
-(that)-12 345 y(name)14 b(passing)f(the)h(table)g(as)f(parameter.)18
-b(This)c(function)g(can)g(b)q(e)g(used)g(to)f(c)o(hec)o(k)h(\014eld)g(v)m
-(alues,)h(to)e(create)-12 401 y(default)j(\014elds,)g(or)f(for)f(an)o(y)h
-(other)g(side-e\013ect.)110 469 y Fk(\014eld)r(list)48 b Fg(!)j
-Fm(')p Fg(f)p Fm(')15 b([)p Fk(\016eld)r(list1)6 b Fm(])15
-b(')p Fg(g)p Fm(')72 526 y Fk(\016eld)r(list1)49 b Fg(!)i Fk(\016eld)16
-b Fg(f)p Fm(',')e Fk(\016eld)5 b Fg(g)157 582 y Fk(\016eld)49
-b Fg(!)i Fk(name)16 b Fm('=')g Fk(exp)3 650 y Fm(This)g(\014eld)h(list)f
-(initializes)i(named)d(\014elds)i(in)f(a)f(table.)20 b(As)15
-b(an)g(example:)60 730 y Fj(a)24 b(=)f(@f{x)h(=)f(1,)h(y)g(=)f(3})-12
-809 y Fm(is)16 b(equiv)m(alen)o(t)h(to:)60 888 y Fj(temp)23
-b(=)h(@\(2\))60 945 y(temp.x)f(=)h(1)60 1001 y(temp.y)f(=)h(3)60
-1058 y(f\(temp\))60 1114 y(a)g(=)f(temp)59 1193 y Fm(In)16
-b(order)f(to)f(initialize)k(a)d(list,)h(one)f(can)h(use)f(the)g(follo)o(wing)
-h(syn)o(tax:)107 1261 y Fk(\014eld)r(list)48 b Fg(!)j Fm('[')15
-b([)p Fk(l\014eld)r(list1)6 b Fm(])14 b(']')72 1318 y Fk(l\014eld)r(list1)48
-b Fg(!)j Fk(exp)16 b Fg(f)p Fm(',')f Fk(exp)s Fg(g)3 1386 y
-Fm(As)h(an)f(example:)60 1465 y Fj(a)24 b(=)f(@["v1",)g("vv"])-12
-1545 y Fm(is)16 b(equiv)m(alen)o(t)h(to:)60 1624 y Fj(temp)23
-b(=)h(@\(2\))60 1680 y(temp[1])f(=)g("v1")60 1737 y(temp[2])g(=)g("v2")60
-1793 y(a)h(=)f(temp)59 1872 y Fm(As)15 b(particular)h(cases,)f(the)g(follo)o
-(wing)h(t)o(w)o(o)e(expressions)i(are)e(completely)j(equiv)m(alen)o(t:)84
-1952 y Fj(@f{)23 b(})215 b(@f[)23 b(])-12 2069 y Fi(4.5.8)52
-b(F)l(unction)18 b(Calls)-12 2155 y Fm(A)d(function)h(call)h(has)e(the)g
-(follo)o(wing)h(syn)o(tax:)72 2223 y Fk(functionc)n(al)r(l)49
-b Fg(!)h Fk(var)16 b Fm('\(')g([)p Fk(explist1)6 b Fm(])15
-b('\)')154 2279 y Fk(explist1)50 b Fg(!)g(f)p Fk(exp1)16 b
-Fm(',')p Fg(g)f Fk(exp)5 2350 y Fm(Here,)i Fj(var)g Fm(can)g(b)q(e)h(an)o(y)e
-(v)m(ariable)j(\(global,)e(lo)q(cal,)h(indexed,)h(etc\))e(whose)g(v)m(alue)h
-(has)f(t)o(yp)q(e)g Fk(function)j Fm(or)-12 2407 y Fk(Cfunction)s
-Fm(.)g(All)c(argumen)o(t)e(expressions)i(are)f(ev)m(aluated)h(b)q(efore)f
-(the)g(call,)h(from)f(left)g(to)f(righ)o(t;)h(then)g(the)-12
-2463 y(list)k(of)f(argumen)o(ts)f(is)h(adjusted)g(to)g(the)g(length)g(of)g
-(the)g(list)h(of)e(parameters)g(\(see)h(Section)h(4.3\);)f(\014nally)-12
-2520 y(this)e(list)g(is)g(assigned)f(to)g(the)g(parameters.)59
-2576 y(Because)20 b(a)g(function)g(can)g(return)g(an)o(y)g(n)o(um)o(b)q(er)g
-(of)f(results)h(\(see)g(Section)h(4.4.3\),)e(the)h(n)o(um)o(b)q(er)g(of)-12
-2632 y(results)11 b(m)o(ust)f(b)q(e)h(adjusted)f(b)q(efore)h(used.)19
-b(If)10 b(the)h(function)g(is)g(called)h(as)e(an)g(statemen)o(t)f(\(see)h
-(Section)i(4.4.4\),)-12 2689 y(its)19 b(return)g(list)g(is)h(adjusted)f(to)f
-(0.)30 b(If)19 b(the)g(function)g(is)h(called)g(in)g(a)e(place)i(that)e
-(needs)i(a)e(single)i(v)m(alue)-12 2745 y(\(syn)o(tactically)13
-b(denoted)f(b)o(y)g(the)g(non-terminal)h Fj(exp1)p Fm(\),)f(its)g(return)g
-(list)h(is)f(adjusted)g(to)g(1.)18 b(If)12 b(the)g(function)-12
-2802 y(is)i(called)h(in)g(a)e(place)i(that)d(can)i(hold)h(man)o(y)e(v)m
-(alues)h(\(syn)o(tactically)h(denoted)f(b)o(y)f(the)h(non-terminal)g
-Fj(exp)p Fm(\),)-12 2858 y(no)h(adjustmen)o(t)g(is)h(done.)910
-2976 y(7)p eop
+bop -12 160 a Fn(is)16 b(equiv)m(alen)o(t)h(to:)60 253 y Fl(temp)23
+b(=)h({})60 310 y(temp[1])f(=)g("v1")60 366 y(temp[2])g(=)g("v2")60
+423 y(temp[3])g(=)g(34)60 479 y(a)h(=)f(temp)59 573 y Fn(The)15
+b(next)g(form)g(initializes)j(named)e(\014elds)g(in)g(a)f(table.)72
+632 y Fm(\016eld)r(list1)49 b Fi(!)i Fm(\016eld)16 b Fi(f)p
+Fn(',')e Fm(\016eld)5 b Fi(g)157 689 y Fm(\016eld)49 b Fi(!)i
+Fm(name)16 b Fn('=')g Fm(exp)-12 757 y Fn(As)f(an)g(example:)60
+851 y Fl(a)24 b(=)f({x)h(=)g(1,)f(y)h(=)g(3})-12 945 y Fn(is)16
+b(equiv)m(alen)o(t)h(to:)60 1039 y Fl(temp)23 b(=)h({})60 1095
+y(temp.x)f(=)h(1)60 1152 y(temp.y)f(=)h(3)60 1208 y(a)g(=)f(temp)-12
+1328 y Fk(4.5.8)52 b(F)l(unction)18 b(Calls)-12 1414 y Fn(A)d(function)h
+(call)h(has)e(the)g(follo)o(wing)h(syn)o(tax:)72 1486 y Fm(functionc)n(al)r
+(l)49 b Fi(!)h Fm(var)16 b(r)n(e)n(alPar)n(ams)-12 1558 y Fn(Here,)d
+Fl(var)g Fn(can)g(b)q(e)h(an)o(y)e(v)m(ariable)j(\(global,)e(lo)q(cal,)h
+(indexed,)h(etc\).)k(If)13 b(its)g(t)o(yp)q(e)g(is)g Fm(function)j
+Fn(or)d Fm(CF)m(unction)s Fn(,)-12 1615 y(this)k(function)h(is)f(called.)27
+b(Otherwise,)17 b(the)g(fallbac)o(k)g(\\function")h(is)f(called,)h(ha)o(ving)
+f(as)g(\014rst)f(parameter)-12 1671 y(the)f(v)m(alue)i(of)e
+Fl(var)p Fn(,)f(and)h(then)h(the)f(original)i(call)f(parameters.)59
+1727 y(The)f(form:)72 1800 y Fm(functionc)n(al)r(l)49 b Fi(!)h
+Fm(var)16 b Fn(':')k Fm(name)c(r)n(e)n(alPar)n(ams)-12 1872
+y Fn(can)g(b)q(e)f(used)h(to)f(call)h(\\metho)q(ds".)k(A)15
+b(call)h Fl(var:name\(...\))d Fn(is)j(syn)o(tactic)f(sugar)g(for)36
+1965 y Fl(var.name\(var,)22 b(...\))-12 2059 y Fn(except)16
+b(that)e Fl(var)h Fn(is)h(ev)m(aluated)g(only)g(once.)72 2127
+y Fm(r)n(e)n(alPar)n(ams)49 b Fi(!)h Fn('\(')15 b([)p Fm(explist1)6
+b Fn(])16 b('\)')72 2184 y Fm(r)n(e)n(alPar)n(ams)49 b Fi(!)h
+Fm(table)n(c)n(onstructor)144 2240 y(explist1)g Fi(!)g Fm(exp1)17
+b Fi(f)p Fn(',')e Fm(exp1)6 b Fi(g)-12 2309 y Fn(All)14 b(argumen)o(t)e
+(expressions)h(are)f(ev)m(aluated)i(b)q(efore)f(the)f(call;)j(then)d(the)h
+(list)g(of)g(argumen)o(ts)e(is)i(adjusted)g(to)-12 2365 y(the)j(length)g(of)f
+(the)g(list)i(of)e(parameters)f(\(see)h(Section)i(4.3\);)d(\014nally)l(,)i
+(this)g(list)g(is)g(assigned)g(to)f(the)h(formal)-12 2422 y(parameters.)j(A)c
+(call)i(of)d(the)i(form)e Fl(f{...})g Fn(is)i(syn)o(tactic)f(sugar)g(for)f
+Fl(f\({...}\))p Fn(,)g(that)g(is,)i(the)f(parameter)-12 2478
+y(list)h(is)g(a)f(single)h(new)g(table.)59 2534 y(Because)k(a)g(function)g
+(can)g(return)g(an)o(y)g(n)o(um)o(b)q(er)g(of)f(results)h(\(see)g(Section)h
+(4.4.3\),)e(the)h(n)o(um)o(b)q(er)g(of)-12 2591 y(results)11
+b(m)o(ust)f(b)q(e)h(adjusted)f(b)q(efore)h(used.)19 b(If)10
+b(the)h(function)g(is)g(called)h(as)e(an)g(statemen)o(t)f(\(see)h(Section)i
+(4.4.4\),)-12 2647 y(its)19 b(return)g(list)g(is)h(adjusted)f(to)f(0.)30
+b(If)19 b(the)g(function)g(is)h(called)g(in)g(a)e(place)i(that)e(needs)i(a)e
+(single)i(v)m(alue)-12 2704 y(\(syn)o(tactically)13 b(denoted)f(b)o(y)g(the)g
+(non-terminal)h Fl(exp1)p Fn(\),)f(its)g(return)g(list)h(is)f(adjusted)g(to)g
+(1.)18 b(If)12 b(the)g(function)-12 2760 y(is)i(called)h(in)g(a)e(place)i
+(that)d(can)i(hold)h(man)o(y)e(v)m(alues)h(\(syn)o(tactically)h(denoted)f(b)o
+(y)f(the)h(non-terminal)g Fl(exp)p Fn(\),)-12 2817 y(no)h(adjustmen)o(t)g(is)
+h(done.)910 2976 y(7)p eop
%%Page: 8 8
-bop -12 160 a Fb(4.6)56 b(F)-5 b(unction)19 b(De\014nitions)-12
-245 y Fm(F)l(unctions)c(in)g(Lua)g(can)g(b)q(e)g(de\014ned)g(an)o(ywhere)g
-(in)g(the)f(global)h(lev)o(el)h(of)e(a)g(mo)q(dule;)h(functions)g(cannot)g(b)
-q(e)-12 302 y(de\014ned)i(inside)g(other)e(functions.)20 b(The)c(syn)o(tax)e
-(for)h(function)h(de\014nition)h(is:)72 374 y Fk(function)49
-b Fg(!)i Fi(function)17 b Fk(name)f Fm('\(')f([)p Fk(p)n(arlist1)6
-b Fm(])16 b('\)')f Fk(blo)n(ck)h Fi(end)59 503 y Fm(When)d(Lua)g(\014nds)h(a)
-f(function)g(de\014nition,)i(its)e(b)q(o)q(dy)h(is)g(compiled)g(to)f(in)o
-(termediate)g(co)q(de)h(and)f(stored,)-12 559 y(with)j(t)o(yp)q(e)f
-Fk(function)p Fm(,)f(in)o(to)i(the)f(global)h(v)m(ariable)g
-Fj(name)p Fm(.)59 615 y(P)o(arameters)e(act)g(as)h(lo)q(cal)h(v)m(ariables,)h
-(initialized)h(with)e(the)f(argumen)o(t)f(v)m(alues.)72 688
-y Fk(p)n(arlist1)49 b Fg(!)i Fk('name')16 b Fg(f)p Fm(',')f
-Fk(name)s Fg(g)59 816 y Fm(Results)h(are)e(returned)h(using)h(the)e
-Fj(return)g Fm(statemen)o(t)g(\(see)h(Section)g(4.4.3\).)j(If)d(the)g(con)o
-(trol)f(reac)o(hes)-12 873 y(the)h(end)h(of)f(a)g(function)h(without)f(a)g
-(return)g(instruction,)h(the)f(function)h(returns)f(with)h(no)f(results.)-12
-1016 y Fl(5)69 b(The)23 b(Application)e(Program)h(In)n(terface)-12
-1117 y Fm(This)e(section)f(describ)q(es)h(the)f(API)g(for)f(Lua,)i(that)e
-(is,)i(the)f(set)f(of)g(C)h(functions)g(a)o(v)m(ailable)i(to)d(the)h(host)-12
-1174 y(program)13 b(to)g(comm)o(unicate)h(with)g(the)f(library)l(.)21
-b(The)14 b(API)g(functions)g(can)g(b)q(e)g(classi\014ed)h(in)g(the)f(follo)o
-(wing)-12 1230 y(categories:)44 1324 y(1.)22 b(executing)16
-b(Lua)g(co)q(de;)44 1418 y(2.)22 b(con)o(v)o(erting)15 b(v)m(alues)h(b)q(et)o
-(w)o(een)g(C)f(and)g(Lua;)44 1512 y(3.)22 b(manipulating)17
-b(\(reading)e(and)g(writing\))h(Lua)f(ob)s(jects;)44 1605 y(4.)22
-b(calling)17 b(Lua)e(functions;)44 1699 y(5.)22 b(C)15 b(functions)h(to)e(b)q
-(e)i(called)h(b)o(y)e(Lua;)44 1793 y(6.)22 b(error)14 b(handling.)-12
-1887 y(All)h(API)f(functions)g(are)f(declared)h(in)g(the)g(\014le)g
-Fj(lua.h)p Fm(.)19 b(Unless)14 b(stated)f(otherwise,)g(API)h(functions)g
-(return)-12 1943 y(an)h(error)g(co)q(de:)20 b(0)15 b(in)h(case)f(of)g
-(success,)h(non)f(0)g(in)h(case)f(of)g(errors.)-12 2065 y Fb(5.1)56
-b(Executing)17 b(Lua)i(Co)r(de)-12 2151 y Fm(A)d(host)g(program)e(can)i
-(execute)h(Lua)f(programs)f(written)h(in)h(a)e(\014le)i(or)f(in)h(a)e
-(string,)h(using)h(the)f(follo)o(wing)-12 2207 y(functions:)-12
-2301 y Fj(int)286 b(lua_dofile)357 b(\(char)23 b(*filename\);)-12
-2358 y(int)286 b(lua_dostring)309 b(\(char)23 b(*string\);)-12
-2479 y Fb(5.2)56 b(Con)n(v)n(erting)19 b(V)-5 b(alues)19 b(b)r(et)n(w)n(een)f
-(C)h(and)g(Lua)-12 2565 y Fm(Because)24 b(Lua)g(has)g(no)g(static)f(t)o(yp)q
-(e)h(system,)h(all)f(v)m(alues)h(passed)f(b)q(et)o(w)o(een)g(Lua)g(and)g(C)f
-(ha)o(v)o(e)g(t)o(yp)q(e)-12 2622 y Fj(lua_Object)p Fm(,)12
-b(whic)o(h)j(w)o(orks)e(lik)o(e)i(an)e(abstract)g(t)o(yp)q(e)h(in)h(C)e(that)
-g(can)h(hold)h(an)o(y)e(Lua)h(v)m(alue.)21 b Fj(lua_Object)-12
-2678 y Fm(is)16 b(declared)g(as:)-12 2772 y Fj(typedef)23 b(struct)g(Object)g
-(*lua_Object;)910 2976 y Fm(8)p eop
+bop -12 160 a Fd(4.6)56 b(F)-5 b(unction)19 b(De\014nitions)-12
+245 y Fn(F)l(unctions)i(in)f(Lua)g(can)g(b)q(e)g(de\014ned)h(an)o(ywhere)f
+(in)g(the)g(global)g(lev)o(el)h(of)e(a)h(mo)q(dule.)34 b(The)20
+b(syn)o(tax)f(for)-12 302 y(function)d(de\014nition)h(is:)72
+374 y Fm(function)49 b Fi(!)i Fk(function)17 b Fm(name)f Fn('\(')f([)p
+Fm(p)n(arlist1)6 b Fn(])16 b('\)')f Fm(blo)n(ck)h Fk(end)59
+503 y Fn(When)d(Lua)g(\014nds)h(a)f(function)g(de\014nition,)i(its)e(b)q(o)q
+(dy)h(is)g(compiled)g(to)f(in)o(termediate)g(co)q(de)h(and)f(stored,)-12
+559 y(with)j(t)o(yp)q(e)f Fm(function)p Fn(,)f(in)o(to)i(the)f(global)h(v)m
+(ariable)g Fl(name)p Fn(.)59 615 y(P)o(arameters)e(act)g(as)h(lo)q(cal)h(v)m
+(ariables,)h(initialized)h(with)e(the)f(argumen)o(t)f(v)m(alues.)72
+688 y Fm(p)n(arlist1)49 b Fi(!)i Fm('name')16 b Fi(f)p Fn(',')f
+Fm(name)s Fi(g)59 816 y Fn(Results)h(are)e(returned)h(using)h(the)e
+Fl(return)g Fn(statemen)o(t)g(\(see)h(Section)g(4.4.3\).)j(If)d(con)o(trol)f
+(reac)o(hes)h(the)-12 873 y(end)h(of)f(a)g(function)h(without)f(a)g(return)g
+(instruction,)h(the)f(function)h(returns)f(with)h(no)f(results.)59
+929 y(There)e(is)h(a)f(sp)q(ecial)i(syn)o(tax)e(for)f(de\014nition)j(of)e
+(metho)q(ds,)h(that)e(is,)i(functions)g(whic)o(h)g(are)f(to)g(b)q(e)h(stored)
+-12 986 y(in)i(table)g(\014elds.)72 1058 y Fm(function)49 b
+Fi(!)i Fk(function)17 b Fm(name)f Fn(':')k Fm(name)c Fn('\(')f([)p
+Fm(p)n(arlist1)6 b Fn(])16 b('\)')f Fm(blo)n(ck)g Fk(end)-12
+1130 y Fn(A)g(declaration)h(lik)o(e)-12 1224 y Fl(function)23
+b(t:f)g(\(...\))36 1280 y(...)-12 1336 y(end)-12 1430 y Fn(is)16
+b(equiv)m(alen)o(t)h(to)-12 1524 y Fl(function)23 b(temp)g(\(self,)g(...\))36
+1581 y(...)-12 1637 y(end)-12 1693 y(t.f)h(=)f(temp)-12 1787
+y Fn(that)18 b(is,)i(the)f(function)g(is)g(created)g(with)g(a)f(dumm)o(y)h
+(name)g(and)f(then)h(assigned)h(to)e(the)h(\014eld)g Fl(f)g
+Fn(of)f(the)-12 1844 y(table)g Fl(t)p Fn(.)24 b(Moreo)o(v)o(er,)16
+b(the)h(function)h(gets)e(an)h(extra)f(formal)h(parameter)f(called)i
+Fl(self)p Fn(.)25 b(Notice)17 b(that)f(the)-12 1900 y(v)m(ariable)h
+Fl(t)e Fn(m)o(ust)f(b)q(e)i(previously)h(initialized)h(with)e(a)f(table)g(v)m
+(alue.)-12 2022 y Fd(4.7)56 b(F)-5 b(allbac)n(ks)-12 2108 y
+Fn(Lua)23 b(pro)o(vides)f(a)g(p)q(o)o(w)o(erful)h(mec)o(hanism)g(to)e(extend)
+i(its)g(seman)o(tics,)g(called)h Fm(fal)r(lb)n(acks)p Fn(.)40
+b(Basically)l(,)26 b(a)-12 2164 y(fallbac)o(k)15 b(is)g(a)g(programmer)e
+(de\014ned)j(function)f(whic)o(h)g(is)g(called)h(whenev)o(er)f(Lua)g(do)q(es)
+g(not)f(kno)o(w)g(ho)o(w)g(to)-12 2221 y(pro)q(ceed.)59 2277
+y(Lua)h(supp)q(orts)h(the)f(follo)o(wing)h(fallbac)o(ks,)f(iden)o(ti\014ed)i
+(b)o(y)f(the)f(giv)o(en)h(strings:)-12 2371 y Fk(\\arith")25
+b Fn(called)18 b(when)g(an)e(arithmetic)i(op)q(eration)f(is)h(applied)g(to)f
+(non)g(n)o(umerical)h(op)q(erands,)f(or)g(when)102 2427 y(the)c(binary)g
+Fl(^)g Fn(op)q(eration)g(is)h(called.)21 b(Receiv)o(es)14 b(three)f(argumen)o
+(ts:)18 b(the)13 b(t)o(w)o(o)f(op)q(erands)h(\(the)g(second)102
+2484 y(one)i(is)g(nil)h(when)f(the)f(op)q(eration)h(is)g(unary)g(min)o(us\))g
+(and)f(one)h(of)f(the)h(follo)o(wing)g(strings)f(describing)102
+2540 y(the)h(o\013ended)h(op)q(erator:)150 2653 y Fl(add)47
+b(sub)g(mul)h(div)f(pow)g(unm)102 2765 y Fn(Its)13 b(return)g(v)m(alue)h(is)f
+(the)g(\014nal)h(result)f(of)g(the)g(arithmetic)h(op)q(eration.)19
+b(The)13 b(default)h(function)f(issues)102 2822 y(an)i(error.)910
+2976 y(8)p eop
%%Page: 9 9
-bop -12 160 a Fm(where)16 b Fj(Object)e Fm(is)i(not)e(declared)j(in)f
-Fj(lua.h)p Fm(.)59 216 y(Lua)j(has)g(garbage)f(collection.)34
-b(Therefore,)19 b(there)g(is)h(no)f(guaran)o(tee)f(that)g(a)h
-Fj(lua_Object)f Fm(will)j(b)q(e)-12 273 y(v)m(alid)f(after)e(another)g
-(execution)h(of)f(Lua)h(co)q(de.)30 b(A)19 b(go)q(o)q(d)f(programming)g
-(practice)h(is)g(to)e(con)o(v)o(ert)h(suc)o(h)-12 329 y(ob)s(jects)d(to)f(C)h
-(v)m(alues)i(as)d(so)q(on)h(as)g(they)h(are)e(a)o(v)m(ailable,)j(and)e(nev)o
-(er)h(store)e(them)h(in)h(global)g(v)m(ariables.)59 385 y(T)l(o)f(c)o(hec)o
-(k)g(the)g(t)o(yp)q(e)h(of)e(a)h Fj(lua_Object)p Fm(,)f(the)h(follo)o(wing)h
-(functions)g(are)f(a)o(v)m(ailable:)-12 479 y Fj(int)286 b(lua_isnil)381
-b(\(lua_Object)22 b(object\);)-12 536 y(int)286 b(lua_isnumber)309
-b(\(lua_Object)22 b(object\);)-12 592 y(int)286 b(lua_isstring)309
-b(\(lua_Object)22 b(object\);)-12 649 y(int)286 b(lua_istable)333
-b(\(lua_Object)22 b(object\);)-12 705 y(int)286 b(lua_iscfunction)237
-b(\(lua_Object)22 b(object\);)-12 762 y(int)286 b(lua_isuserdata)261
-b(\(lua_Object)22 b(object\);)-12 855 y Fm(All)17 b(return)e(1)g(if)g(the)h
-(ob)s(ject)e(has)h(the)h(giv)o(en)f(t)o(yp)q(e,)g(0)g(otherwise.)59
-912 y(T)l(o)g(translate)f(a)h(v)m(alue)i(from)d(t)o(yp)q(e)h
-Fj(lua_Object)f Fm(to)h(a)g(sp)q(eci\014c)i(C)e(t)o(yp)q(e,)g(the)g
-(programmer)f(can)h(use:)-12 1006 y Fj(float)238 b(lua_getnumber)285
-b(\(lua_Object)22 b(object\);)-12 1062 y(char)238 b(*lua_getstring)285
-b(\(lua_Object)22 b(object\);)-12 1119 y(char)238 b(*lua_copystring)261
-b(\(lua_Object)22 b(object\);)-12 1175 y(lua_CFunction)46 b(lua_getcfunction)
-213 b(\(lua_Object)22 b(object\);)-12 1231 y(void)238 b(*lua_getuserdata)f
-(\(lua_Object)22 b(object\);)-12 1325 y(lua_getnumber)16 b
-Fm(con)o(v)o(erts)h(a)h Fj(lua_Object)e Fm(to)h(a)h(\015oat.)27
-b(This)18 b Fj(lua_Object)f Fm(m)o(ust)g(b)q(e)i(a)e(n)o(um)o(b)q(er)h(or)g
-(a)-12 1382 y(string)d(con)o(v)o(ertible)i(to)d(n)o(um)o(b)q(er)i(\(see)f
+bop -12 160 a Fk(\\order")23 b Fn(called)15 b(when)f(an)f(order)g(comparison)
+g(is)h(applied)h(to)e(non)g(n)o(umerical)i(or)e(non)g(string)g(op)q(erands.)
+102 216 y(Receiv)o(es)18 b(three)e(argumen)o(ts:)22 b(the)16
+b(t)o(w)o(o)f(op)q(erands)i(and)g(one)f(of)g(the)h(follo)o(wing)g(strings)f
+(describing)102 273 y(the)f(o\013ended)h(op)q(erator:)150 383
+y Fl(lt)23 b(gt)h(le)f(ge)102 494 y Fn(Its)d(return)g(v)m(alue)i(is)f(the)f
+(\014nal)h(result)g(of)f(the)g(comparison)h(op)q(eration.)35
+b(The)21 b(default)f(function)102 551 y(issues)c(an)f(error.)-12
+644 y Fk(\\concat")25 b Fn(called)20 b(when)f(a)f(concatenation)h(is)g
+(applied)h(to)e(non)g(string)g(op)q(erands.)30 b(Receiv)o(es)20
+b(the)f(t)o(w)o(o)102 700 y(op)q(erands)13 b(as)f(argumen)o(ts.)18
+b(Its)13 b(return)f(v)m(alue)i(is)f(the)g(\014nal)g(result)g(of)f(the)h
+(concatenation)f(op)q(eration.)102 757 y(The)j(default)h(function)g(issues)g
+(an)f(error.)-12 850 y Fk(\\index")24 b Fn(called)13 b(when)f(Lua)g(tries)f
+(to)g(retriev)o(e)h(the)f(v)m(alue)i(of)e(an)g(index)i(not)e(presen)o(t)g(in)
+i(a)e(table.)19 b(Receiv)o(es)102 907 y(as)c(argumen)o(ts)f(the)i(table)g
+(and)f(the)h(index.)21 b(Its)16 b(return)f(v)m(alue)i(is)f(the)f(\014nal)h
+(result)g(of)f(the)g(indexing)102 963 y(op)q(eration.)20 b(The)15
+b(default)h(function)g(returns)f(nil.)-12 1056 y Fk(\\gettable")25
+b Fn(called)17 b(when)f(Lua)f(tries)h(to)e(index)j(a)e(non)g(table)h(v)m
+(alue.)21 b(Receiv)o(es)c(as)d(argumen)o(ts)h(the)g(non)102
+1113 y(table)i(v)m(alue)h(and)f(the)f(index.)26 b(Its)17 b(return)f(v)m(alue)
+i(is)f(the)g(\014nal)h(result)f(of)f(the)h(indexing)h(op)q(eration.)102
+1169 y(The)d(default)h(function)g(issues)g(an)f(error.)-12
+1263 y Fk(\\settable")25 b Fn(called)16 b(when)f(Lua)g(tries)g(to)f(assign)h
+(indexed)h(a)e(non)h(table)g(v)m(alue.)21 b(Receiv)o(es)16
+b(as)e(argumen)o(ts)102 1319 y(the)k(non)g(table)h(v)m(alue,)h(the)e(index,)h
+(and)g(the)f(assigned)h(v)m(alue.)29 b(The)19 b(default)f(function)h(issues)g
+(an)102 1375 y(error.)-12 1469 y Fk(\\function")25 b Fn(called)15
+b(when)e(Lua)h(tries)f(to)f(call)i(a)f(non)g(function)h(v)m(alue.)21
+b(Receiv)o(es)14 b(as)f(argumen)o(ts)f(the)h(non)102 1525 y(function)h(v)m
+(alue)g(and)g(the)f(argumen)o(ts)g(giv)o(en)g(in)h(the)g(original)g(call.)20
+b(Its)14 b(return)f(v)m(alues)h(are)f(the)g(\014nal)102 1582
+y(results)i(of)g(the)g(call)i(op)q(eration.)j(The)15 b(default)h(function)g
+(issues)g(an)f(error.)-12 1675 y Fk(\\gc")24 b Fn(called)18
+b(during)f(garbage)e(collection.)24 b(Receiv)o(es)18 b(as)d(argumen)o(t)h
+(the)g(table)g(b)q(eing)i(collected.)24 b(After)102 1731 y(eac)o(h)15
+b(run)g(of)g(the)g(collector)h(this)f(function)h(is)g(called)g(with)g
+(argumen)o(t)e(nil.)21 b(Because)16 b(this)f(function)102 1788
+y(op)q(erates)j(during)i(garbage)d(collection,)k(it)e(m)o(ust)f(b)q(e)h(used)
+g(with)g(great)f(care,)h(and)g(programmers)102 1844 y(should)d(a)o(v)o(oid)e
+(the)i(creation)f(of)f(new)h(ob)s(jects)g(\(tables)g(or)f(strings\))h(in)g
+(this)h(function.)21 b(The)15 b(default)102 1901 y(function)h(do)q(es)f
+(nothing.)-12 1994 y Fk(\\error")22 b Fn(called)16 b(when)e(an)g(error)f(o)q
+(ccurs.)20 b(Receiv)o(es)15 b(as)e(argumen)o(t)h(a)f(string)h(describing)h
+(the)f(error.)19 b(The)102 2050 y(default)d(function)g(prin)o(ts)f(the)g
+(message)g(on)g(the)h(standard)e(error)h(output.)59 2143 y(The)e(function)h
+Fl(setfallback)d Fn(is)j(used)g(to)e(c)o(hange)h(a)g(fallbac)o(k)h(action.)19
+b(Its)13 b(\014rst)g(argumen)o(t)f(is)i(a)e(string)-12 2199
+y(describing)h(the)f(fallbac)o(k,)g(and)g(the)f(second)h(the)g(new)f
+(function)h(to)f(b)q(e)h(called.)20 b(It)12 b(returns)f(the)h(old)f(function)
+-12 2256 y(for)k(the)g(giv)o(en)h(fallbac)o(k,)f(or)g(nil)i(on)e(error.)59
+2312 y(Section)h(7.4)e(sho)o(ws)h(an)g(example)h(of)f(the)g(use)g(of)g
+(fallbac)o(ks.)-12 2434 y Fd(4.8)56 b(Error)18 b(Handling)-12
+2520 y Fn(Because)i(Lua)g(is)g(an)g(extension)g(language,)h(all)f(Lua)g
+(actions)f(start)g(from)g(C)g(co)q(de)h(calling)h(a)e(function)-12
+2576 y(from)13 b(the)i(Lua)f(library)l(.)20 b(Whenev)o(er)15
+b(an)f(error)f(o)q(ccurs)h(during)h(Lua)f(compilation)i(or)d(execution,)i(an)
+f(error)-12 2632 y(fallbac)o(k)h(function)g(is)g(called,)h(and)e(then)h(the)f
+(corresp)q(onden)o(t)g(function)i(from)d(the)h(library)h(\()p
+Fl(lua_dofile)p Fn(,)-12 2689 y Fl(lua_dostring)p Fn(,)d Fl(lua_call)p
+Fn(,)f(and)j Fl(lua_callfunction)p Fn(\))c(is)j(terminated)h(returning)f(an)g
+(error)f(condition.)59 2745 y(The)j(only)h(argumen)o(t)f(to)g(the)g(error)g
+(fallbac)o(k)h(function)g(is)g(a)f(string)h(describing)h(the)e(error)g(and)h
+(some)-12 2802 y(extra)k(informations,)i(lik)o(e)g(curren)o(t)f(line)i
+(\(when)e(the)g(error)f(is)h(at)g(compilation\))g(or)g(curren)o(t)f(function)
+-12 2858 y(\(when)d(the)f(error)g(is)h(at)f(execution\).)24
+b(F)l(or)16 b(more)g(information)g(ab)q(out)h(an)f(error,)g(the)g(Lua)h
+(program)e(can)910 2976 y(9)p eop
+%%Page: 10 10
+bop -12 160 a Fn(include)24 b(the)d(compilation)h(pragma)e
+Fl($debug)p Fn(.)37 b(This)22 b(pragma)e(m)o(ust)g(b)q(e)i(written)f(in)h(a)f
+(line)i(b)o(y)e(itself.)-12 216 y(When)13 b(an)g(error)f(o)q(ccurs)i(in)f(a)g
+(program)f(compiled)i(with)g(this)f(option,)g(the)g(error)f(message)h
+(includes)i(extra)-12 273 y(information)h(sho)o(wing)f(the)g(stac)o(k)f(of)h
+(calls.)59 329 y(The)d(standard)g(error)g(routine)h(only)g(prin)o(ts)g(the)f
+(error)g(message)g(to)g Fl(stderr)p Fn(.)18 b(If)13 b(needed,)h(it)f(is)g(p)q
+(ossible)-12 385 y(to)i(c)o(hange)g(the)g(error)g(fallbac)o(k)h(routine;)f
+(see)h(Section)g(4.7.)59 442 y(Lua)g(co)q(de)h(can)f(generate)g(an)g(error)f
+(b)o(y)h(calling)i(the)e(function)h Fl(error)p Fn(.)k(Its)16
+b(optional)h(parameter)e(is)i(a)-12 498 y(string,)e(whic)o(h)h(is)g(used)g
+(as)e(the)i(error)e(message.)-12 641 y Fo(5)69 b(The)23 b(Application)e
+(Program)h(In)n(terface)-12 742 y Fn(This)e(section)f(describ)q(es)h(the)f
+(API)g(for)f(Lua,)i(that)e(is,)i(the)f(set)f(of)g(C)h(functions)g(a)o(v)m
+(ailable)i(to)d(the)h(host)-12 799 y(program)13 b(to)g(comm)o(unicate)h(with)
+g(the)f(library)l(.)21 b(The)14 b(API)g(functions)g(can)g(b)q(e)g
+(classi\014ed)h(in)g(the)f(follo)o(wing)-12 855 y(categories:)44
+945 y(1.)22 b(executing)16 b(Lua)g(co)q(de;)44 1038 y(2.)22
+b(con)o(v)o(erting)15 b(v)m(alues)h(b)q(et)o(w)o(een)g(C)f(and)g(Lua;)44
+1130 y(3.)22 b(manipulating)17 b(\(reading)e(and)g(writing\))h(Lua)f(ob)s
+(jects;)44 1222 y(4.)22 b(calling)17 b(Lua)e(functions;)44
+1315 y(5.)22 b(C)15 b(functions)h(to)e(b)q(e)i(called)h(b)o(y)e(Lua;)44
+1407 y(6.)22 b(lo)q(c)o(king)16 b(Lua)g(Ob)s(jects.)-12 1497
+y(All)h(API)e(functions)h(are)f(declared)i(in)f(the)f(\014le)h
+Fl(lua.h)p Fn(.)-12 1618 y Fd(5.1)56 b(Executing)17 b(Lua)i(Co)r(de)-12
+1704 y Fn(A)d(host)g(program)e(can)i(execute)h(Lua)f(programs)f(written)h(in)
+h(a)e(\014le)i(or)f(in)h(a)e(string,)h(using)h(the)f(follo)o(wing)-12
+1760 y(functions:)-12 1850 y Fl(int)286 b(lua_dofile)357 b(\(char)23
+b(*filename\);)-12 1907 y(int)286 b(lua_dostring)309 b(\(char)23
+b(*string\);)-12 1997 y Fn(Both)15 b(functions)h(return)f(an)g(error)g(co)q
+(de:)20 b(0,)15 b(in)h(case)f(of)g(success;)g(non)h(zero,)e(in)i(case)g(of)e
+(errors.)-12 2118 y Fd(5.2)56 b(Con)n(v)n(erting)19 b(V)-5
+b(alues)19 b(b)r(et)n(w)n(een)f(C)h(and)g(Lua)-12 2204 y Fn(Because)24
+b(Lua)g(has)g(no)g(static)f(t)o(yp)q(e)h(system,)h(all)f(v)m(alues)h(passed)f
+(b)q(et)o(w)o(een)g(Lua)g(and)g(C)f(ha)o(v)o(e)g(t)o(yp)q(e)-12
+2260 y Fl(lua_Object)p Fn(,)14 b(whic)o(h)i(w)o(orks)e(lik)o(e)i(an)f
+(abstract)f(t)o(yp)q(e)i(in)g(C)f(that)f(can)i(hold)g(an)o(y)e(Lua)i(v)m
+(alue.)59 2317 y(Lua)24 b(has)g(automatic)f(memory)g(managemen)o(t,)i(and)f
+(garbage)f(collection.)48 b(Because)24 b(of)g(that,)h(a)-12
+2373 y Fl(lua_Object)15 b Fn(has)h(a)f(limited)j(scop)q(e,)e(and)g(is)h(only)
+f(v)m(alid)i(inside)g(the)e Fm(blo)n(ck)k Fn(where)c(it)g(w)o(as)f(created.)
+23 b(A)16 b(C)-12 2429 y(function)j(called)g(from)f(Lua)g(is)g(a)g(blo)q(c)o
+(k,)h(and)f(its)g(parameters)f(are)h(v)m(alid)h(only)g(un)o(til)g(its)f(end.)
+28 b(A)18 b(go)q(o)q(d)-12 2486 y(programming)d(practice)g(is)h(to)e(con)o(v)
+o(ert)h(Lua)g(ob)s(jects)g(to)f(C)h(v)m(alues)h(as)f(so)q(on)g(as)g(they)g
+(are)g(a)o(v)m(ailable,)h(and)-12 2542 y(nev)o(er)g(to)e(store)h
+Fl(lua_Object)p Fn(s)e(in)j(global)g(v)m(ariables.)59 2599
+y(When)h(C)f(co)q(de)i(calls)f(Lua)g(rep)q(eatedly)l(,)h(as)f(in)g(a)g(lo)q
+(op,)g(ob)s(jects)f(returned)h(b)o(y)g(there)f(calls)i(ma)o(y)e(acu-)-12
+2655 y(m)o(ulate,)21 b(creating)g(a)f(memory)g(problem.)36
+b(T)l(o)20 b(a)o(v)o(oid)g(this,)i(nested)e(blo)q(c)o(ks)h(can)g(b)q(e)g
+(de\014ned)h(with)e(the)-12 2712 y(functions:)-12 2802 y Fl(void)262
+b(lua_beginblock)f(\(void\);)-12 2858 y(void)h(lua_endblock)309
+b(\(void\);)899 2976 y Fn(10)p eop
+%%Page: 11 11
+bop -12 160 a Fn(After)15 b(the)g(end)h(of)f(the)g(blo)q(c)o(k,)h(all)g
+Fl(lua_Object)p Fn('s)d(created)i(inside)i(it)f(are)f(released.)59
+216 y(T)l(o)g(c)o(hec)o(k)g(the)g(t)o(yp)q(e)h(of)e(a)h Fl(lua_Object)p
+Fn(,)f(the)h(follo)o(wing)h(function)g(is)g(a)o(v)m(ailable:)-12
+310 y Fl(int)286 b(lua_type)405 b(\(lua_Object)22 b(object\);)-12
+404 y Fn(plus)16 b(the)g(follo)o(wing)g(macros:)-12 498 y Fl(int)286
+b(lua_isnil)381 b(\(lua_Object)22 b(object\);)-12 554 y(int)286
+b(lua_isnumber)309 b(\(lua_Object)22 b(object\);)-12 610 y(int)286
+b(lua_isstring)309 b(\(lua_Object)22 b(object\);)-12 667 y(int)286
+b(lua_istable)333 b(\(lua_Object)22 b(object\);)-12 723 y(int)286
+b(lua_iscfunction)237 b(\(lua_Object)22 b(object\);)-12 780
+y(int)286 b(lua_isuserdata)261 b(\(lua_Object)22 b(object\);)-12
+874 y Fn(All)17 b(macros)d(return)h(1)g(if)h(the)f(ob)s(ject)g(has)g(the)g
+(giv)o(en)h(t)o(yp)q(e,)f(and)g(0)g(otherwise.)59 930 y(The)f(function)h
+Fl(lua_type)e Fn(can)h(b)q(e)h(used)g(to)e(distinguish)k(b)q(et)o(w)o(een)d
+(di\013eren)o(t)g(kinds)i(of)d(user)i(data;)e(see)-12 987 y(b)q(elo)o(w.)59
+1043 y(T)l(o)i(translate)f(a)h(v)m(alue)i(from)d(t)o(yp)q(e)h
+Fl(lua_Object)f Fn(to)h(a)g(sp)q(eci\014c)i(C)e(t)o(yp)q(e,)g(the)g
+(programmer)f(can)h(use:)-12 1137 y Fl(double)214 b(lua_getnumber)285
+b(\(lua_Object)22 b(object\);)-12 1193 y(char)238 b(*lua_getstring)285
+b(\(lua_Object)22 b(object\);)-12 1250 y(lua_CFunction)46 b(lua_getcfunction)
+213 b(\(lua_Object)22 b(object\);)-12 1306 y(void)238 b(*lua_getuserdata)f
+(\(lua_Object)22 b(object\);)-12 1400 y(lua_getnumber)16 b
+Fn(con)o(v)o(erts)h(a)h Fl(lua_Object)e Fn(to)h(a)h(\015oat.)27
+b(This)18 b Fl(lua_Object)f Fn(m)o(ust)g(b)q(e)i(a)e(n)o(um)o(b)q(er)h(or)g
+(a)-12 1456 y(string)d(con)o(v)o(ertible)i(to)d(n)o(um)o(b)q(er)i(\(see)f
(Section)h(4.2\);)d(otherwise,)i(the)h(function)g(returns)f(0.)59
-1438 y Fj(lua_getstring)f Fm(con)o(v)o(erts)h(a)h Fj(lua_Object)e
-Fm(to)i(a)g(string)f(\()p Fj(char)23 b(*)p Fm(\).)f(This)17
-b Fj(lua_Object)d Fm(m)o(ust)i(b)q(e)h(a)-12 1495 y(string)h(or)g(a)g(n)o(um)
+1513 y Fl(lua_getstring)f Fn(con)o(v)o(erts)h(a)h Fl(lua_Object)e
+Fn(to)i(a)g(string)f(\()p Fl(char)23 b(*)p Fn(\).)f(This)17
+b Fl(lua_Object)d Fn(m)o(ust)i(b)q(e)h(a)-12 1569 y(string)h(or)g(a)g(n)o(um)
o(b)q(er;)i(otherwise,)f(the)f(function)i(returns)e(0)g(\(the)g(n)o(ull)i(p)q
-(oin)o(ter\).)29 b(This)19 b(function)g(do)q(es)-12 1551 y(not)14
+(oin)o(ter\).)29 b(This)19 b(function)g(do)q(es)-12 1626 y(not)14
b(create)g(a)g(new)g(string,)g(but)g(returns)g(a)g(p)q(oin)o(ter)h(to)e(a)h
(string)g(inside)i(the)e(Lua)h(en)o(vironmen)o(t.)20 b(Because)-12
-1608 y(Lua)c(has)f(garbage)f(collection,)j(there)f(is)f(no)h(guaran)o(tee)e
-(that)h(suc)o(h)g(p)q(oin)o(ter)h(will)h(b)q(e)f(v)m(alid)h(after)e(another)
--12 1664 y(execution)20 b(of)f(Lua)g(co)q(de.)31 b(The)19 b(function)h
-Fj(lua_copystring)d Fm(b)q(eha)o(v)o(es)i(exactly)g(lik)o(e)h
-Fj(lua_getstring)p Fm(,)-12 1720 y(but)c(returns)f(a)f(fresh)i(cop)o(y)f(of)g
-(the)g(string.)59 1777 y Fj(lua_getcfunction)g Fm(con)o(v)o(erts)i(a)g
-Fj(lua_Object)g Fm(to)f(a)i(C)f(function.)28 b(This)18 b Fj(lua_Object)f
-Fm(m)o(ust)g(ha)o(v)o(e)-12 1833 y(t)o(yp)q(e)d Fk(Cfunction)s
-Fm(;)g(otherwise,)g(the)g(function)h(returns)f(0)g(\(the)g(n)o(ull)h(p)q(oin)
-o(ter\).)20 b(The)14 b(t)o(yp)q(e)g Fj(lua_CFunction)-12 1890
-y Fm(is)i(explained)h(in)f(Section)g(5.5.)59 1946 y Fj(lua_getuserdata)k
-Fm(con)o(v)o(erts)h(a)h Fj(lua_Object)e Fm(to)i Fj(void*)p
-Fm(.)40 b(This)22 b Fj(lua_Object)f Fm(m)o(ust)h(ha)o(v)o(e)f(t)o(yp)q(e)-12
-2003 y Fk(user)n(data)s Fm(;)16 b(otherwise,)f(the)g(function)h(returns)f(0)g
-(\(the)g(n)o(ull)i(p)q(oin)o(ter\).)59 2059 y(The)d(rev)o(erse)g(pro)q(cess,)
-g(that)f(is,)h(the)g(con)o(v)o(ersion)g(from)g(a)f(sp)q(eci\014c)j(C)e(t)o
-(yp)q(e)g(to)f(the)h(t)o(yp)q(e)g Fj(lua_Object)p Fm(,)-12
-2116 y(is)i(done)f(b)o(y)h(using)g(the)f(follo)o(wing)h(functions:)-12
-2209 y Fj(int)286 b(lua_pushnumber)261 b(\(float)23 b(n\);)-12
-2266 y(int)286 b(lua_pushstring)261 b(\(char)23 b(*s\);)-12
-2322 y(int)286 b(lua_pushcfunction)189 b(\(lua_CFunction)22
-b(f\);)-12 2379 y(int)286 b(lua_pushuserdata)213 b(\(void)23
-b(*u\);)-12 2473 y Fm(All)16 b(of)d(them)h(receiv)o(e)h(a)f(C)g(v)m(alue,)h
-(con)o(v)o(ert)f(it)g(to)g(a)f Fj(lua_Object)p Fm(,)g(and)h(lea)o(v)o(e)h
-(their)f(results)h(on)f(the)g(top)g(of)-12 2529 y(the)h(Lua)f(stac)o(k,)g
-(where)g(it)h(can)g(b)q(e)g(assigned)g(to)e(a)h(v)m(ariable,)i(passed)f(as)f
-(paramen)o(ter)f(to)h(a)g(Lua)h(function,)-12 2586 y(etc)i(\(see)f(b)q(elo)o
-(w\).)24 b(T)l(o)16 b(complete)h(the)f(set,)g(the)h(v)m(alue)g
-Fi(nil)h Fm(or)e(a)g Fj(lua_Object)f Fm(can)h(also)h(b)q(e)g(pushed)g(on)o
-(to)-12 2642 y(the)e(stac)o(k,)g(with:)-12 2736 y Fj(int)286
-b(lua_pushnil)333 b(\(void\);)-12 2792 y(int)286 b(lua_pushobject)261
-b(\(lua_Object)22 b(object\);)910 2976 y Fm(9)p eop
-%%Page: 10 10
-bop -12 160 a Fb(5.3)56 b(Manipulating)18 b(Lua)h(Ob)s(jects)-12
-245 y Fm(T)l(o)c(read)g(the)h(v)m(alue)g(of)f(an)o(y)g(global)g(Lua)h(v)m
-(ariable,)g(one)f(can)h(use)f(the)h(function:)-12 338 y Fj(lua_Object)118
-b(lua_getglobal)285 b(\(char)23 b(*varname\);)-12 430 y Fm(T)l(o)15
+1682 y(Lua)14 b(has)f(garbage)f(collection,)k(there)d(is)h(no)f(guaran)o(tee)
+g(that)f(suc)o(h)i(p)q(oin)o(ter)g(will)h(b)q(e)f(v)m(alid)h(after)d(the)i
+(blo)q(c)o(k)-12 1739 y(ends.)59 1795 y Fl(lua_getcfunction)h
+Fn(con)o(v)o(erts)i(a)g Fl(lua_Object)g Fn(to)f(a)i(C)f(function.)28
+b(This)18 b Fl(lua_Object)f Fn(m)o(ust)g(ha)o(v)o(e)-12 1852
+y(t)o(yp)q(e)c Fm(CF)m(unction)s Fn(;)f(otherwise,)i(the)f(function)g
+(returns)g(0)g(\(the)f(n)o(ull)j(p)q(oin)o(ter\).)k(The)13
+b(t)o(yp)q(e)g Fl(lua_CFunction)-12 1908 y Fn(is)j(explained)h(in)f(Section)g
+(5.5.)59 1965 y Fl(lua_getuserdata)k Fn(con)o(v)o(erts)h(a)h
+Fl(lua_Object)e Fn(to)i Fl(void*)p Fn(.)40 b(This)22 b Fl(lua_Object)f
+Fn(m)o(ust)h(ha)o(v)o(e)f(t)o(yp)q(e)-12 2021 y Fm(user)n(data)s
+Fn(;)16 b(otherwise,)f(the)g(function)h(returns)f(0)g(\(the)g(n)o(ull)i(p)q
+(oin)o(ter\).)59 2077 y(The)12 b(rev)o(erse)g(pro)q(cess,)h(that)e(is,)i
+(passing)g(a)f(sp)q(eci\014c)i(C)d(v)m(alue)j(to)d(Lua,)i(is)g(done)f(b)o(y)g
+(using)h(the)g(follo)o(wing)-12 2134 y(functions:)-12 2228
+y Fl(void)262 b(lua_pushnumber)f(\(double)23 b(n\);)-12 2284
+y(void)262 b(lua_pushstring)f(\(char)23 b(*s\);)-12 2341 y(void)262
+b(lua_pushliteral)237 b(\(char)23 b(*s\);)-12 2397 y(void)262
+b(lua_pushcfunction)189 b(\(lua_CFunction)22 b(f\);)-12 2454
+y(void)262 b(lua_pushusertag)237 b(\(void)23 b(*u,)g(int)h(tag\);)-12
+2547 y Fn(plus)16 b(the)g(macro:)-12 2641 y Fl(void)262 b(lua_pushuserdata)
+213 b(\(void)23 b(*u\);)-12 2735 y Fn(All)16 b(of)d(them)h(receiv)o(e)h(a)f
+(C)g(v)m(alue,)h(con)o(v)o(ert)f(it)g(to)g(a)f Fl(lua_Object)p
+Fn(,)g(and)h(lea)o(v)o(e)h(their)f(results)h(on)f(the)g(top)g(of)-12
+2791 y(the)h(Lua)f(stac)o(k,)g(where)g(it)h(can)g(b)q(e)g(assigned)g(to)e(a)h
+(v)m(ariable,)i(passed)f(as)f(paramen)o(ter)f(to)h(a)g(Lua)h(function,)-12
+2848 y(etc)f(\(see)g(b)q(elo)o(w\).)20 b Fl(lua_pushliteral)11
+b Fn(is)k(lik)o(e)g Fl(lua_pushstring)p Fn(,)d(but)i(also)g(puts)f(the)h
+(string)g(in)h(the)f(Lua)899 2976 y(11)p eop
+%%Page: 12 12
+bop -12 160 a Fn(literal)17 b(table.)k(This)16 b(a)o(v)o(oids)f(the)h(string)
+f(to)g(b)q(e)h(garbage)f(collected,)h(and)g(therefore)f(has)h(a)f(b)q(etter)g
+(o)o(v)o(erall)-12 216 y(p)q(erformance.)20 b(As)14 b(a)h(rule,)g(when)g(the)
+f(string)h(to)e(b)q(e)j(pushed)f(is)g(a)f(literal,)i Fl(lua_pushliteral)c
+Fn(should)k(b)q(e)-12 273 y(used.)59 329 y(User)g(data)f(can)i(ha)o(v)o(e)e
+(di\013eren)o(t)i(tags,)e(whose)h(seman)o(tics)g(are)g(de\014ned)i(b)o(y)e
+(the)g(host)g(program.)21 b(An)o(y)-12 385 y(p)q(ositiv)o(e)e(in)o(teger)f
+(can)g(b)q(e)g(used)h(to)e(tag)g(a)g(user)h(data.)27 b(When)18
+b(a)g(user)g(data)f(is)h(retriev)o(ed,)h(the)e(function)-12
+442 y Fl(lua_type)d Fn(can)i(b)q(e)f(used)h(to)f(get)g(its)g(tag.)59
+498 y(T)l(o)d(complete)h(the)g(set,)g(the)f(v)m(alue)i Fk(nil)g
+Fn(or)e(a)g Fl(lua_Object)g Fn(can)g(also)h(b)q(e)g(pushed)h(on)o(to)e(the)g
+(stac)o(k,)g(with:)-12 588 y Fl(void)262 b(lua_pushnil)333
+b(\(void\);)-12 644 y(void)262 b(lua_pushobject)f(\(lua_Object)22
+b(object\);)-12 765 y Fd(5.3)56 b(Manipulating)18 b(Lua)h(Ob)s(jects)-12
+851 y Fn(T)l(o)c(read)g(the)h(v)m(alue)g(of)f(an)o(y)g(global)g(Lua)h(v)m
+(ariable,)g(one)f(can)h(use)f(the)h(function:)-12 940 y Fl(lua_Object)118
+b(lua_getglobal)285 b(\(char)23 b(*varname\);)-12 1029 y Fn(T)l(o)15
b(store)g(a)f(v)m(alue)j(previously)f(pushed)h(on)o(to)d(the)h(stac)o(k)g(in)
h(a)f(global)g(v)m(ariable,)i(there)e(is)h(the)f(function:)-12
-523 y Fj(int)286 b(lua_storeglobal)237 b(\(char)23 b(*varname\);)59
-615 y Fm(T)l(ables)16 b(can)f(also)g(b)q(e)h(manipulated)h(via)e(the)g(API.)h
-(Giv)o(en)f(a)g(table,)g(the)h(functions)-12 708 y Fj(lua_Object)118
-b(lua_getindexed)261 b(\(lua_Object)22 b(table,)h(float)g(index\);)-12
-764 y(lua_Object)118 b(lua_getfield)309 b(\(lua_Object)22 b(table,)h(char)g
-(*field\);)-12 857 y Fm(return)c(the)f(con)o(ten)o(ts)g(of)g(an)h(index.)31
-b(The)19 b(\014rst)f(one)h(is)g(used)g(for)f(n)o(umeric)h(indices,)i(while)f
-(the)f(second)-12 913 y(can)d(b)q(e)h(used)f(for)g(an)o(y)f(string)h(index.)
-24 b(As)15 b(in)i(Lua,)f(if)h(the)f(index)h(is)f(not)g(presen)o(t)g(in)h(the)
-f(table,)g(then)g(the)-12 970 y(returned)g Fj(lua_Object)e
-Fm(has)h(v)m(alue)h Fi(nil)p Fm(.)59 1026 y(T)l(o)h(store)f(a)h(v)m(alue,)h
-(previously)h(pushed)f(on)o(to)e(the)i(stac)o(k,)e(in)i(a)f(p)q(osition)h(of)
-f(a)g(table,)g(the)h(follo)o(wing)-12 1083 y(functions)e(are)f(a)o(v)m
-(ailable:)-12 1175 y Fj(int)286 b(lua_storeindexed)213 b(\(lua_Object)22
-b(object,)h(float)g(index\);)-12 1232 y(int)286 b(lua_storefield)261
-b(\(lua_Object)22 b(object,)h(char)g(*field\);)-12 1324 y Fm(Again,)c(the)f
-(\014rst)g(one)g(is)g(used)h(for)e(n)o(umeric)i(indices,)i(while)e(the)f
-(second)h(can)f(b)q(e)h(used)f(for)g(an)o(y)f(string)-12 1381
-y(index.)-12 1502 y Fb(5.4)56 b(Calling)18 b(Lua)h(F)-5 b(unctions)-12
-1588 y Fm(F)l(unctions)12 b(de\014ned)h(in)f(Lua)g(b)o(y)f(a)h(mo)q(dule)g
-(executed)g(with)g Fj(dofile)f Fm(or)g Fj(dostring)f Fm(can)h(b)q(e)i(called)
-g(from)d(the)-12 1644 y(host)16 b(program.)23 b(This)17 b(is)g(done)g(using)g
-(the)f(follo)o(wing)i(proto)q(col:)k(\014rst,)16 b(the)g(argumen)o(ts)g(to)g
-(the)g(function)-12 1701 y(are)k(pushed)i(on)o(to)d(the)i(Lua)g(stac)o(k)e
-(\(see)i(Section)g(5.2\),)f(in)i(direct)f(order,)g(i.e.,)g(the)g(\014rst)f
-(argumen)o(t)g(is)-12 1757 y(pushed)c(\014rst.)k(Then,)15 b(the)h(function)g
-(is)f(called)i(using:)-12 1850 y Fj(int)286 b(lua_call)405
-b(\(char)23 b(*functionname,)f(int)h(nparam\);)-12 1942 y Fm(where)17
-b(the)f(second)h(argumen)o(t)f(\()p Fj(nparam)p Fm(\))f(is)h(the)h(n)o(um)o
-(b)q(er)g(of)f(v)m(alues)h(pushed)g(on)o(to)f(the)g(stac)o(k.)23
-b(Finally)l(,)-12 1999 y(the)c(returned)g(v)m(alues)h(\(a)e(Lua)g(function)i
-(ma)o(y)e(return)g(man)o(y)g(v)m(alues\))i(are)e(p)q(opp)q(ed)i(from)e(the)h
-(stac)o(k)e(in)-12 2055 y(rev)o(erse)e(order,)g(i.e.,)g(the)g(last)g(result)h
-(is)f(p)q(opp)q(ed)i(\014rst.)i(P)o(opping)d(is)g(done)f(with)h(the)f
-(function)-12 2148 y Fj(lua_Object)118 b(lua_pop)429 b(\(void\);)-12
-2240 y Fm(When)16 b(there)f(are)g(no)g(more)g(results)g(to)g(b)q(e)h(p)q(opp)
-q(ed,)g(this)g(function)g(returns)f(0.)59 2297 y(An)g(example)h(of)f(C)g(co)q
-(de)h(calling)h(a)e(Lua)g(function)h(is)g(sho)o(wn)f(in)h(7.5.)-12
-2418 y Fb(5.5)56 b(C)19 b(F)-5 b(unctions)-12 2504 y Fm(T)l(o)15
-b(register)g(a)g(C)g(function)h(to)f(Lua,)g(there)g(is)h(the)f(follo)o(wing)h
-(macro:)-12 2596 y Fj(#define)23 b(lua_register\(n,f\))165
+1119 y Fl(void)262 b(lua_storeglobal)237 b(\(char)23 b(*varname\);)59
+1208 y Fn(T)l(ables)16 b(can)f(also)g(b)q(e)h(manipulated)h(via)e(the)g(API.)
+h(The)f(function)-12 1297 y Fl(lua_Object)118 b(lua_getsubscript)213
+b(\(void\);)-12 1386 y Fn(exp)q(ects)15 b(on)g(the)f(stac)o(k)g(a)g(table)h
+(and)g(an)f(index,)i(and)e(returns)h(the)f(con)o(ten)o(ts)g(of)g(the)h(table)
+g(at)f(that)f(index.)-12 1443 y(As)22 b(in)h(Lua,)g(if)f(the)g(\014rst)g(ob)s
+(ject)f(is)h(not)g(a)f(table,)j(or)d(the)h(index)h(is)g(not)e(presen)o(t)h
+(in)h(the)f(table,)h(the)-12 1499 y(corresp)q(onden)o(t)16
+b(fallbac)o(k)g(is)f(called.)59 1556 y(F)l(or)f(compatibilit)o(y)j(with)f
+(previous)g(v)o(ersions)f(of)g(the)g(API,)g(the)g(follo)o(wing)h(macros)f
+(are)g(supp)q(orted:)-12 1645 y Fl(lua_Object)118 b(lua_getindexed)261
+b(\(lua_Object)22 b(table,)h(float)g(index\);)-12 1702 y(lua_Object)118
+b(lua_getfield)309 b(\(lua_Object)22 b(table,)h(char)g(*field\);)-12
+1791 y Fn(The)16 b(\014rst)e(one)i(is)f(used)h(for)f(n)o(umeric)h(indices,)h
+(while)f(the)g(second)f(can)h(b)q(e)g(used)f(for)g(an)o(y)g(string)g(index.)
+59 1847 y(T)l(o)h(store)g(a)h(v)m(alue)h(in)g(an)f(index,)h(the)f(program)e
+(m)o(ust)i(push)g(on)o(to)f(the)h(stac)o(k)f(the)h(table,)g(the)g(index,)-12
+1904 y(and)f(the)f(v)m(alue,)h(and)f(then)h(call)g(the)f(function:)-12
+1993 y Fl(void)24 b(lua_storesubscript)d(\(void\);)-12 2082
+y Fn(Again,)15 b(the)h(corresp)q(onden)o(t)f(fallbac)o(k)h(is)g(called)h(if)e
+(needed.)59 2139 y(Finally)l(,)h(the)g(function)-12 2228 y
+Fl(lua_Object)118 b(lua_createtable)237 b(\(void\);)-12 2317
+y Fn(creates)15 b(a)g(new)g(table.)59 2374 y Fm(Ple)n(ase)g(Notic)n(e:)24
+b Fn(Most)15 b(functions)h(from)g(the)f(Lua)i(library)f(receiv)o(e)h
+(parameters)e(through)h(the)f(stac)o(k.)-12 2430 y(Because)k(other)f
+(functions)h(also)f(use)h(the)f(stac)o(k,)g(it)g(is)h(imp)q(ortan)o(t)f(that)
+f(these)i(parameters)e(b)q(e)i(pushed)-12 2487 y(just)c(b)q(efore)g(the)f
+(corresp)q(onden)o(t)h(call,)h(without)f(in)o(termediate)g(calls)h(to)e(the)h
+(Lua)g(library)l(.)21 b(F)l(or)14 b(instance,)-12 2543 y(supp)q(ose)i(the)f
+(user)h(w)o(an)o(ts)e(the)h(v)m(alue)i(of)d Fl(a[i])p Fn(.)20
+b(A)15 b(simplistic)i(solution)f(w)o(ould)g(b)q(e:)36 2632
+y Fl(/*)24 b(Warning:)e(WRONG)h(CODE)h(*/)36 2689 y(lua_Object)e(result;)36
+2745 y(lua_pushobject\(lua_getglo)o(bal\("a"\))o(\);)45 b(/*)23
+b(push)h(table)f(*/)36 2802 y(lua_pushobject\(lua_getglo)o(bal\("i"\))o(\);)
+45 b(/*)23 b(push)h(index)f(*/)36 2858 y(result)g(=)h(lua_getsubscript\(\);)
+899 2976 y Fn(12)p eop
+%%Page: 13 13
+bop -12 160 a Fn(Ho)o(w)o(ev)o(er,)12 b(the)g(call)h Fl(lua_getglobal\("i"\))
+c Fn(mo)q(di\014es)14 b(the)e(stac)o(k,)f(and)h(in)o(v)m(alidates)i(the)e
+(previous)h(pushed)-12 216 y(v)m(alue.)21 b(A)16 b(correct)e(solution)i
+(could)g(b)q(e:)36 310 y Fl(lua_Object)22 b(index,)h(result;)36
+366 y(index)g(=)h(lua_getglobal\("i"\);)36 423 y(lua_pushobject\(lua_getglo)o
+(bal\("a"\))o(\);)45 b(/*)23 b(push)h(table)f(*/)36 479 y
+(lua_pushobject\(index\);)355 b(/*)23 b(push)h(index)f(*/)36
+536 y(result)g(=)h(lua_getsubscript\(\);)-12 657 y Fd(5.4)56
+b(Calling)18 b(Lua)h(F)-5 b(unctions)-12 743 y Fn(F)l(unctions)12
+b(de\014ned)h(in)f(Lua)g(b)o(y)f(a)h(mo)q(dule)g(executed)g(with)g
+Fl(dofile)f Fn(or)g Fl(dostring)f Fn(can)h(b)q(e)i(called)g(from)d(the)-12
+800 y(host)h(program.)17 b(This)12 b(is)g(done)g(using)g(the)f(follo)o(wing)h
+(proto)q(col:)18 b(\014rst,)11 b(the)g(argumen)o(ts)g(to)f(the)i(function)g
+(are)-12 856 y(pushed)17 b(on)o(to)e(the)h(Lua)g(stac)o(k)f(\(see)h(Section)g
+(5.2\),)f(in)h(direct)h(order,)e(i.e.,)h(the)f(\014rst)h(argumen)o(t)f(is)h
+(pushed)-12 913 y(\014rst.)24 b(Again,)18 b(it)f(is)g(imp)q(ortan)o(t)f(to)g
+(emphasize)i(that,)e(during)i(this)f(phase,)g(no)g(other)f(Lua)i(function)f
+(can)-12 969 y(b)q(e)f(called.)59 1026 y(Then,)f(the)g(function)h(is)g
+(called)h(using)-12 1119 y Fl(int)286 b(lua_call)405 b(\(char)23
+b(*functionname\);)-12 1213 y Fn(or)-12 1307 y Fl(int)286 b(lua_callfunction)
+213 b(\(lua_Object)22 b(function\);)-12 1401 y Fn(Both)16 b(functions)g
+(return)g(an)f(error)g(co)q(de:)21 b(0,)15 b(in)i(case)e(of)g(success;)h(non)
+g(zero,)f(in)i(case)f(of)f(errors.)20 b(Finally)l(,)-12 1457
+y(the)15 b(returned)g(v)m(alues)g(\(a)f(Lua)h(function)h(ma)o(y)e(return)g
+(man)o(y)g(v)m(alues\))i(can)e(b)q(e)h(retriev)o(ed)g(with)g(the)g(macro)-12
+1551 y Fl(lua_Object)118 b(lua_getresult)309 b(\(int)23 b(number\);)-12
+1645 y(number)15 b Fn(is)g(the)h(order)f(of)f(the)i(result,)f(starting)f
+(with)i(1.)k(When)15 b(called)i(with)f(a)f(n)o(um)o(b)q(er)g(larger)g(than)g
+(the)-12 1701 y(actual)h(n)o(um)o(b)q(er)f(of)g(results,)g(this)h(function)g
+(returns)f Fl(LUA_NOOBJECT)p Fn(.)59 1758 y(Tw)o(o)c(sp)q(ecial)i(Lua)g
+(functions)f(ha)o(v)o(e)g(exclusiv)o(e)h(in)o(terfaces:)19
+b Fl(error)11 b Fn(and)h Fl(setfallback)p Fn(.)17 b(A)12 b(C)f(function)-12
+1814 y(can)16 b(generate)e(a)h(Lua)h(error)e(calling)j(the)f(function)-12
+1908 y Fl(void)24 b(lua_error)e(\(char)h(*message\);)-12 2002
+y Fn(This)c(function)h(nev)o(er)e(returns.)30 b(If)19 b(the)g(C)f(function)h
+(has)g(b)q(een)g(called)i(from)c(Lua,)j(the)e(corresp)q(onding)-12
+2058 y(Lua)g(execution)h(terminates,)f(as)f(if)i(an)e(error)g(had)h(o)q
+(ccured)h(inside)h(Lua)e(co)q(de.)28 b(Otherwise,)19 b(the)f(whole)-12
+2115 y(program)c(terminates.)59 2171 y(F)l(allbac)o(ks)i(can)f(b)q(e)h(c)o
+(hanged)f(with:)-12 2265 y Fl(lua_Object)23 b(lua_setfallback)e(\(char)j
+(*name,)f(lua_CFunction)f(fallback\);)-12 2359 y Fn(The)17
+b(\014rst)g(parameter)f(is)h(the)g(fallbac)o(k)h(name,)e(and)h(the)g(second)h
+(a)e(CF)l(unction)i(to)e(b)q(e)h(used)h(as)e(the)h(new)-12
+2415 y(fallbac)o(k.)32 b(This)19 b(function)h(returns)e(a)h
+Fl(lua_Object)p Fn(,)f(whic)o(h)h(is)h(the)f(old)g(fallbac)o(k)h(v)m(alue,)g
+(or)e(nil)j(on)d(fail)-12 2472 y(\(in)o(v)m(alid)f(fallbac)o(k)f(name\).)k
+(This)c(old)f(v)m(alue)i(can)e(b)q(e)h(used)g(for)e(c)o(haining)j(fallbac)o
+(ks.)59 2528 y(An)e(example)h(of)f(C)g(co)q(de)h(calling)h(a)e(Lua)g
+(function)h(is)g(sho)o(wn)f(in)h(Section)g(7.6.)899 2976 y(13)p
+eop
+%%Page: 14 14
+bop -12 160 a Fd(5.5)56 b(C)19 b(F)-5 b(unctions)-12 245 y
+Fn(T)l(o)15 b(register)g(a)g(C)g(function)h(to)f(Lua,)g(there)g(is)h(the)f
+(follo)o(wing)h(macro:)-12 322 y Fl(#define)23 b(lua_register\(n,f\))165
b(\(lua_pushcfunction\(f\),)21 b(lua_storeglobal\(n\)\))-12
-2653 y(/*)j(char)f(*n;)214 b(*/)-12 2709 y(/*)24 b(lua_CFunction)e(f;)h(*/)
--12 2802 y Fm(whic)o(h)d(receiv)o(es)f(the)g(name)g(the)g(function)g(will)i
-(ha)o(v)o(e)d(in)h(Lua,)h(and)f(a)f(p)q(oin)o(ter)i(to)e(the)g(function.)32
-b(This)-12 2858 y(p)q(oin)o(ter)16 b(m)o(ust)f(ha)o(v)o(e)f(t)o(yp)q(e)i
-Fj(lua_CFunction)p Fm(,)d(whic)o(h)j(is)f(de\014ned)i(as)899
-2976 y(10)p eop
-%%Page: 11 11
-bop -12 160 a Fj(typedef)23 b(void)g(\(*lua_CFunction\))f(\(void\);)-12
-253 y Fm(that)15 b(is,)g(a)g(p)q(oin)o(ter)h(to)e(a)h(function)h(with)g(no)f
-(parameters)f(and)h(no)h(results.)59 310 y(In)j(order)f(to)g(comm)o(unicate)g
+378 y(/*)j(char)f(*n;)214 b(*/)-12 435 y(/*)24 b(lua_CFunction)e(f;)h(*/)-12
+511 y Fn(whic)o(h)d(receiv)o(es)f(the)g(name)g(the)g(function)g(will)i(ha)o
+(v)o(e)d(in)h(Lua,)h(and)f(a)f(p)q(oin)o(ter)i(to)e(the)g(function.)32
+b(This)-12 567 y(p)q(oin)o(ter)16 b(m)o(ust)f(ha)o(v)o(e)f(t)o(yp)q(e)i
+Fl(lua_CFunction)p Fn(,)d(whic)o(h)j(is)f(de\014ned)i(as)-12
+644 y Fl(typedef)23 b(void)g(\(*lua_CFunction\))f(\(void\);)-12
+720 y Fn(that)15 b(is,)g(a)g(p)q(oin)o(ter)h(to)e(a)h(function)h(with)g(no)f
+(parameters)f(and)h(no)h(results.)59 776 y(In)j(order)f(to)g(comm)o(unicate)g
(prop)q(erly)i(with)e(Lua,)i(a)e(C)g(function)h(m)o(ust)f(follo)o(w)h(a)f
-(proto)q(col,)g(whic)o(h)-12 366 y(de\014nes)e(the)g(w)o(a)o(y)e(parameters)g
-(and)i(results)f(are)g(passed.)59 423 y(T)l(o)g(access)g(its)g(argumen)o(ts,)
-f(a)h(C)g(function)h(calls:)-12 517 y Fj(lua_Object)118 b(lua_getparam)309
-b(\(int)23 b(number\);)-12 610 y(number)17 b Fm(starts)g(with)h(1)g(to)f(get)
-g(the)h(\014rst)g(argumen)o(t.)27 b(When)18 b(called)i(with)e(a)f(n)o(um)o(b)
-q(er)i(larger)e(than)h(the)-12 667 y(actual)11 b(n)o(um)o(b)q(er)h(of)e
-(argumen)o(ts,)h(this)h(function)f(returns)g(0.)18 b(In)12
-b(this)g(w)o(a)o(y)l(,)e(it)i(is)f(p)q(ossible)i(to)d(write)i(functions)-12
-723 y(that)j(w)o(ork)f(with)h(a)g(v)m(ariable)i(n)o(um)o(b)q(er)e(of)g
-(parameters.)59 780 y(T)l(o)i(return)h(v)m(alues,)i(a)d(C)h(function)h(just)f
-(pushes)g(them)g(on)o(to)f(the)i(stac)o(k,)e(in)i(direct)g(order;)f(see)h
-(Sec-)-12 836 y(tion)d(5.2.)j(Lik)o(e)d(a)f(Lua)g(function,)h(a)f(C)g
-(function)h(called)g(b)o(y)g(Lua)f(can)g(also)h(return)f(man)o(y)f(results.)
-59 893 y(Section)i(7.4)e(presen)o(ts)h(an)g(example)h(of)f(a)g(Cfunction.)-12
-1014 y Fb(5.6)56 b(Error)18 b(Handling)-12 1100 y Fm(Whenev)o(er)d(an)g
-(error)e(o)q(ccurs)i(during)h(Lua)f(compilation)g(or)f(execution,)i(an)e
-(error)g(routine)h(is)g(called,)h(and)-12 1157 y(the)f(corresp)q(onding)i
-Fj(lua_dofile)c Fm(or)i Fj(lua_dostring)f Fm(is)h(terminated)h(returning)g
-(an)f(error)f(condition.)59 1213 y(The)20 b(only)h(argumen)o(t)e(to)h(the)g
-(error)g(routine)g(is)h(a)f(string)g(describing)i(the)e(error)g(and)g(some)g
-(extra)-12 1270 y(informations,)14 b(lik)o(e)h(curren)o(t)e(line)i(\(when)f
-(the)g(error)f(is)h(at)f(compilation\))h(or)f(curren)o(t)h(function)g(\(when)
-g(the)-12 1326 y(error)19 b(is)g(at)g(execution\).)33 b(The)19
-b(standard)g(error)f(routine)i(only)g(prin)o(ts)f(this)h(message)e(in)i(the)g
-(standard)-12 1383 y(error)15 b(output.)k(If)d(needed,)g(it)f(is)h(p)q
-(ossible)h(to)e(set)g(another)f(error)h(routine,)g(using)h(the)f(function:)
--12 1476 y Fj(void)262 b(lua_errorfunction)189 b(\(void)23
-b(\(*fn\))g(\(char)g(*s\)\);)-12 1570 y Fm(whose)15 b(argumen)o(t)g(is)g(the)
-h(address)f(of)g(the)g(new)g(error)g(function.)-12 1713 y Fl(6)69
-b(Prede\014ned)23 b(F)-6 b(unctions)23 b(and)g(Libraries)-12
-1815 y Fm(The)18 b(set)f(of)g(prede\014ned)i(functions)g(in)f(Lua)g(is)g
-(small)g(but)g(p)q(o)o(w)o(erful.)27 b(Most)16 b(of)h(them)h(pro)o(vide)g
-(features)-12 1871 y(that)c(allo)o(ws)g(some)g(degree)h(of)f(re\015exivit)o
-(y)h(in)g(the)g(language.)20 b(Suc)o(h)15 b(features)f(cannot)g(b)q(e)h(sim)o
-(ulated)g(with)-12 1928 y(the)g(rest)g(of)g(the)g(Language)g(nor)g(with)h
-(the)f(standard)g(API.)59 1984 y(The)21 b(libraries,)i(on)d(the)h(other)f
+(proto)q(col,)g(whic)o(h)-12 833 y(de\014nes)e(the)g(w)o(a)o(y)e(parameters)g
+(and)i(results)f(are)g(passed.)59 889 y(T)l(o)g(access)g(its)g(argumen)o(ts,)
+f(a)h(C)g(function)h(calls:)-12 965 y Fl(lua_Object)118 b(lua_getparam)309
+b(\(int)23 b(number\);)-12 1042 y(number)17 b Fn(starts)g(with)h(1)g(to)f
+(get)g(the)h(\014rst)g(argumen)o(t.)27 b(When)18 b(called)i(with)e(a)f(n)o
+(um)o(b)q(er)i(larger)e(than)h(the)-12 1098 y(actual)d(n)o(um)o(b)q(er)g(of)f
+(argumen)o(ts,)f(this)j(function)f(returns)f Fl(LUA_NOOBJECT)p
+Fn(.)f(In)i(this)g(w)o(a)o(y)l(,)f(it)g(is)i(p)q(ossible)g(to)-12
+1155 y(write)f(functions)h(that)f(w)o(ork)f(with)i(a)f(v)m(ariable)h(n)o(um)o
+(b)q(er)g(of)e(parameters.)59 1211 y(T)l(o)j(return)h(v)m(alues,)i(a)d(C)h
+(function)h(just)f(pushes)g(them)g(on)o(to)f(the)i(stac)o(k,)e(in)i(direct)g
+(order;)f(see)h(Sec-)-12 1268 y(tion)d(5.2.)j(Lik)o(e)d(a)f(Lua)g(function,)h
+(a)f(C)g(function)h(called)g(b)o(y)g(Lua)f(can)g(also)h(return)f(man)o(y)f
+(results.)59 1324 y(Section)i(7.5)e(presen)o(ts)h(an)g(example)h(of)f(a)g(CF)
+l(unction.)-12 1442 y Fd(5.6)56 b(Lo)r(c)n(king)17 b(Lua)i(Ob)s(jects)-12
+1528 y Fn(As)14 b(already)g(noted,)g Fl(lua_Object)p Fn(s)f(are)g(v)o
+(olatile.)21 b(If)14 b(the)g(C)g(co)q(de)g(needs)h(to)e(k)o(eep)i(a)e
+Fl(lua_Object)g Fn(outside)-12 1585 y(blo)q(c)o(k)f(b)q(oundaries,)g(it)f
+(has)g(to)f Fm(lo)n(ck)g Fn(the)h(ob)s(ject.)18 b(The)11 b(routines)g(to)f
+(manipulate)i(lo)q(c)o(king)g(are)e(the)h(follo)o(wing:)-12
+1661 y Fl(int)191 b(lua_lock)22 b(\(void\);)-12 1717 y(lua_Object)h
+(lua_getlocked)46 b(\(int)23 b(ref\);)-12 1774 y(void)167 b(lua_pushlocked)22
+b(\(int)h(ref\);)-12 1830 y(void)167 b(lua_unlock)22 b(\(int)h(ref\);)-12
+1907 y Fn(The)f(function)h Fl(lua_lock)d Fn(lo)q(c)o(ks)i(the)g(ob)s(ject)f
+(whic)o(h)h(are)g(on)f(the)h(top)f(of)g(the)h(stac)o(k,)g(and)g(returns)g(a)
+-12 1963 y(reference)g(to)f(it.)37 b(Whenev)o(er)22 b(the)f(lo)q(c)o(k)o(ed)h
+(ob)s(ject)f(is)g(needed,)j(a)d(call)h(to)e Fl(lua_getlocked)g
+Fn(returns)h(a)-12 2019 y(handle)c(to)f(it,)g(while)h Fl(lua_pushlocked)d
+Fn(pushes)j(the)f(handle)h(on)f(the)g(stac)o(k.)22 b(When)16
+b(a)g(lo)q(c)o(k)o(ed)g(ob)s(ject)g(is)-12 2076 y(no)f(longer)h(needed,)g(it)
+f(can)h(b)q(e)g(unlo)q(c)o(k)o(ed)g(with)g(a)e(call)j(to)d
+Fl(lua_unlock)p Fn(.)-12 2216 y Fo(6)69 b(Prede\014ned)23 b(F)-6
+b(unctions)23 b(and)g(Libraries)-12 2317 y Fn(The)12 b(set)f(of)g
+(prede\014ned)i(functions)f(in)g(Lua)g(is)f(small)h(but)g(p)q(o)o(w)o(erful.)
+19 b(Most)10 b(of)h(them)g(pro)o(vide)h(features)f(that)-12
+2374 y(allo)o(ws)16 b(some)f(degree)h(of)f(re\015exivit)o(y)h(in)h(the)e
+(language.)21 b(Man)o(y)15 b(of)g(these)h(features)f(cannot)g(b)q(e)h(sim)o
+(ulated)-12 2430 y(with)g(the)f(rest)g(of)g(the)g(Language)g(nor)g(with)g
+(the)h(standard)f(API.)59 2487 y(The)21 b(libraries,)i(on)d(the)h(other)f
(hand,)i(pro)o(vide)g(useful)f(routines)g(that)f(are)h(implemen)o(ted)h
-(directly)-12 2041 y(through)13 b(the)f(standard)h(API.)f(Therefore,)h(they)g
+(directly)-12 2543 y(through)13 b(the)f(standard)h(API.)f(Therefore,)h(they)g
(are)f(not)g(necessary)h(to)f(the)h(language,)g(and)g(are)f(pro)o(vided)-12
-2097 y(as)j(separated)g(C)g(mo)q(dules.)21 b(Curren)o(tly)15
-b(there)g(are)g(three)h(libraries:)56 2191 y Fg(\017)23 b Fm(string)15
-b(manipulation;)56 2285 y Fg(\017)23 b Fm(mathematical)15 b(functions)h
-(\(sin,)f(cos,)g(etc\);)56 2379 y Fg(\017)23 b Fm(input)16
-b(and)f(output;)-12 2500 y Fb(6.1)56 b(Prede\014ned)18 b(F)-5
-b(unctions)-12 2586 y Fj(dofile)23 b(\(filename\))-12 2672
-y Fm(This)e(function)g(receiv)o(es)g(a)f(\014le)h(name,)g(op)q(ens)f(it)h
-(and)f(executes)h(its)f(con)o(ten)o(ts)g(as)f(a)h(Lua)g(mo)q(dule.)36
-b(It)-12 2728 y(returns)15 b(1)g(if)h(there)f(are)g(no)g(errors,)f
-Fi(nil)i Fm(otherwise.)899 2976 y(11)p eop
-%%Page: 12 12
-bop -12 160 a Fj(dostring)23 b(\(string\))-12 245 y Fm(This)17
-b(function)f(executes)h(a)e(giv)o(en)i(string)e(as)h(a)f(Lua)i(mo)q(dule.)23
-b(It)16 b(returns)f(1)h(if)g(there)g(are)g(no)f(errors,)g Fi(nil)-12
-302 y Fm(otherwise.)-12 422 y Fj(next)24 b(\(table,)e(index\))-12
-508 y Fm(This)16 b(function)h(allo)o(ws)e(a)g(program)g(to)g(en)o(umerate)g
-(all)h(\014elds)h(of)e(a)g(table.)21 b(Its)16 b(\014rst)f(argumen)o(t)g(is)h
-(a)f(table)-12 564 y(and)i(its)g(second)g(argumen)o(t)f(is)h(an)g(index)g(in)
-h(this)f(table;)g(this)g(index)h(can)f(b)q(e)g(a)g(n)o(um)o(b)q(er)g(or)f(a)g
-(string.)24 b(It)-12 621 y(returns)15 b(the)f(next)h(index)h(of)e(the)g
-(table)h(and)g(the)g(v)m(alue)h(asso)q(ciated)e(with)h(the)g(index.)21
-b(When)15 b(called)h(with)-12 677 y Fi(nil)g Fm(as)e(its)g(second)h(argumen)o
-(t,)f(the)g(function)i(returns)e(the)h(\014rst)f(index)i(of)e(the)g(table)h
-(\(and)f(its)h(asso)q(ciated)-12 734 y(v)m(alue\).)21 b(When)16
-b(called)g(with)g(the)f(last)g(index,)h(or)f(with)h Fi(nil)g
-Fm(in)g(an)f(empt)o(y)g(table,)g(it)h(returns)f Fi(nil)p Fm(.)59
-790 y(In)h(Lua)h(there)f(is)g(no)g(declaration)h(of)e(\014elds;)i(seman)o
-(tically)l(,)h(there)e(is)g(no)g(di\013erence)h(b)q(et)o(w)o(een)f(a)g
-(\014eld)-12 846 y(not)i(presen)o(t)f(in)i(a)f(table)g(or)f(a)h(\014eld)h
-(with)f(v)m(alue)h Fi(nil)p Fm(.)29 b(Therefore,)18 b(the)f(function)i(only)f
-(considers)h(\014elds)-12 903 y(with)d(non)f(nil)i(v)m(alues.)k(The)16
-b(order)f(the)g(indices)j(are)d(en)o(umerated)g(are)g(not)g(sp)q(eci\014ed,)i
-Fk(even)f(for)g(numeric)-12 959 y(indic)n(es)p Fm(.)59 1016
-y(See)g(Section)g(7.1)e(for)g(an)i(example)g(of)e(the)i(use)f(of)g(this)h
-(function.)-12 1136 y Fj(nextvar)23 b(\(name\))-12 1222 y Fm(This)14
-b(function)g(is)g(similar)g(to)e(the)i(function)g Fj(next)p
-Fm(,)e(but)i(it)f(iterates)g(o)o(v)o(er)f(the)i(global)f(v)m(ariables.)21
-b(Its)13 b(single)-12 1278 y(argumen)o(t)18 b(is)i(the)f(name)g(of)g(a)f
-(global)i(v)m(ariable,)h(or)d Fi(nil)i Fm(to)f(get)f(a)h(\014rst)f(name.)32
-b(Similarly)21 b(to)d Fj(next)p Fm(,)h(it)-12 1335 y(returns)e(the)f(name)h
-(of)f(another)g(v)m(ariable)i(and)f(its)g(v)m(alue,)h(or)e
-Fi(nil)h Fm(if)h(there)e(are)h(no)f(more)g(v)m(ariables.)26
-b(See)-12 1391 y(Section)16 b(7.1)f(for)f(an)h(example)h(of)f(the)g(use)h(of)
-f(this)g(function.)-12 1511 y Fj(print)23 b(\(e1,)h(e2,)f(...\))-12
-1597 y Fm(This)13 b(function)g(receiv)o(es)g(an)o(y)f(n)o(um)o(b)q(er)g(of)g
+2600 y(as)j(separated)g(C)g(mo)q(dules.)21 b(Curren)o(tly)15
+b(there)g(are)g(three)h(standard)e(libraries:)56 2676 y Fi(\017)23
+b Fn(string)15 b(manipulation;)56 2763 y Fi(\017)23 b Fn(mathematical)15
+b(functions)h(\(sin,)f(cos,)g(etc\);)56 2849 y Fi(\017)23 b
+Fn(input)16 b(and)f(output;)899 2976 y(14)p eop
+%%Page: 15 15
+bop -12 160 a Fd(6.1)56 b(Prede\014ned)18 b(F)-5 b(unctions)-12
+245 y Fl(dofile)23 b(\(filename\))-12 331 y Fn(This)e(function)g(receiv)o(es)
+g(a)f(\014le)h(name,)g(op)q(ens)f(it)h(and)f(executes)h(its)f(con)o(ten)o(ts)
+g(as)f(a)h(Lua)g(mo)q(dule.)36 b(It)-12 388 y(returns)15 b(1)g(if)h(there)f
+(are)g(no)g(errors,)f Fk(nil)i Fn(otherwise.)-12 508 y Fl(dostring)23
+b(\(string\))-12 594 y Fn(This)17 b(function)f(executes)h(a)e(giv)o(en)i
+(string)e(as)h(a)f(Lua)i(mo)q(dule.)23 b(It)16 b(returns)f(1)h(if)g(there)g
+(are)g(no)f(errors,)g Fk(nil)-12 650 y Fn(otherwise.)-12 770
+y Fl(next)24 b(\(table,)e(index\))-12 856 y Fn(This)16 b(function)h(allo)o
+(ws)e(a)g(program)g(to)g(en)o(umerate)g(all)h(\014elds)h(of)e(a)g(table.)21
+b(Its)16 b(\014rst)f(argumen)o(t)g(is)h(a)f(table)-12 912 y(and)i(its)g
+(second)g(argumen)o(t)f(is)h(an)g(index)g(in)h(this)f(table;)g(this)g(index)h
+(can)f(b)q(e)g(a)g(n)o(um)o(b)q(er)g(or)f(a)g(string.)24 b(It)-12
+969 y(returns)15 b(the)f(next)h(index)h(of)e(the)g(table)h(and)g(the)g(v)m
+(alue)h(asso)q(ciated)e(with)h(the)g(index.)21 b(When)15 b(called)h(with)-12
+1025 y Fk(nil)g Fn(as)e(its)g(second)h(argumen)o(t,)f(the)g(function)i
+(returns)e(the)h(\014rst)f(index)i(of)e(the)g(table)h(\(and)f(its)h(asso)q
+(ciated)-12 1082 y(v)m(alue\).)21 b(When)16 b(called)g(with)g(the)f(last)g
+(index,)h(or)f(with)h Fk(nil)g Fn(in)g(an)f(empt)o(y)g(table,)g(it)h(returns)
+f Fk(nil)p Fn(.)59 1138 y(In)h(Lua)h(there)f(is)g(no)g(declaration)h(of)e
+(\014elds;)i(seman)o(tically)l(,)h(there)e(is)g(no)g(di\013erence)h(b)q(et)o
+(w)o(een)f(a)g(\014eld)-12 1195 y(not)i(presen)o(t)f(in)i(a)f(table)g(or)f(a)
+h(\014eld)h(with)f(v)m(alue)h Fk(nil)p Fn(.)29 b(Therefore,)18
+b(the)f(function)i(only)f(considers)h(\014elds)-12 1251 y(with)d(non)f(nil)i
+(v)m(alues.)k(The)16 b(order)f(the)g(indices)j(are)d(en)o(umerated)g(are)g
+(not)g(sp)q(eci\014ed,)i Fm(even)f(for)g(numeric)-12 1308 y(indic)n(es)p
+Fn(.)59 1364 y(See)g(Section)g(7.1)e(for)g(an)i(example)g(of)e(the)i(use)f
+(of)g(this)h(function.)-12 1484 y Fl(nextvar)23 b(\(name\))-12
+1570 y Fn(This)14 b(function)g(is)g(similar)g(to)e(the)i(function)g
+Fl(next)p Fn(,)e(but)i(it)f(iterates)g(o)o(v)o(er)f(the)i(global)f(v)m
+(ariables.)21 b(Its)13 b(single)-12 1626 y(argumen)o(t)18 b(is)i(the)f(name)g
+(of)g(a)f(global)i(v)m(ariable,)h(or)d Fk(nil)i Fn(to)f(get)f(a)h(\014rst)f
+(name.)32 b(Similarly)21 b(to)d Fl(next)p Fn(,)h(it)-12 1683
+y(returns)e(the)f(name)h(of)f(another)g(v)m(ariable)i(and)f(its)g(v)m(alue,)h
+(or)e Fk(nil)h Fn(if)h(there)e(are)h(no)f(more)g(v)m(ariables.)26
+b(See)-12 1739 y(Section)16 b(7.1)f(for)f(an)h(example)h(of)f(the)g(use)h(of)
+f(this)g(function.)-12 1859 y Fl(print)23 b(\(e1,)h(e2,)f(...\))-12
+1945 y Fn(This)13 b(function)g(receiv)o(es)g(an)o(y)f(n)o(um)o(b)q(er)g(of)g
(argumen)o(ts,)g(and)g(prin)o(ts)g(their)h(v)m(alues)h(in)f(a)e(reasonable)i
-(format.)-12 1653 y(Eac)o(h)h(v)m(alue)i(is)e(prin)o(ted)h(in)g(a)f(new)h
+(format.)-12 2002 y(Eac)o(h)h(v)m(alue)i(is)e(prin)o(ted)h(in)g(a)f(new)h
(line.)21 b(This)15 b(function)g(is)f(not)g(in)o(tended)i(for)e(formatted)f
-(output,)g(but)i(as)-12 1710 y(a)g(quic)o(k)h(w)o(a)o(y)e(to)h(sho)o(w)g(a)g
+(output,)g(but)i(as)-12 2058 y(a)g(quic)o(k)h(w)o(a)o(y)e(to)h(sho)o(w)g(a)g
(v)m(alue,)h(for)f(instance)h(for)e(error)h(messages)g(or)f(debugging.)22
-b(See)15 b(Section)i(6.4)d(for)-12 1766 y(functions)i(for)f(formatted)f
-(output.)-12 1886 y Fj(tonumber)23 b(\(e\))-12 1972 y Fm(This)18
+b(See)15 b(Section)i(6.4)d(for)-12 2114 y(functions)i(for)f(formatted)f
+(output.)-12 2235 y Fl(tonumber)23 b(\(e\))-12 2320 y Fn(This)18
b(function)g(receiv)o(es)f(one)g(argumen)o(t,)g(and)g(tries)g(to)f(con)o(v)o
(ert)h(it)g(to)f(a)h(n)o(um)o(b)q(er.)25 b(If)18 b(the)f(argumen)o(t)f(is)-12
-2029 y(already)e(a)f(n)o(um)o(b)q(er)h(or)f(a)g(string)g(con)o(v)o(ertible)h
+2377 y(already)e(a)f(n)o(um)o(b)q(er)h(or)f(a)g(string)g(con)o(v)o(ertible)h
(to)f(a)g(n)o(um)o(b)q(er)h(\(see)f(Section)i(4.2\),)d(it)h(returns)h(that)e
-(n)o(um)o(b)q(er;)-12 2085 y(otherwise,)j(it)h(returns)f Fi(nil)p
-Fm(.)-12 2205 y Fj(type)24 b(\(v\))-12 2291 y Fm(This)16 b(function)g(allo)o
+(n)o(um)o(b)q(er;)-12 2433 y(otherwise,)j(it)h(returns)f Fk(nil)p
+Fn(.)-12 2553 y Fl(type)24 b(\(v\))-12 2639 y Fn(This)16 b(function)g(allo)o
(ws)f(Lua)h(to)e(test)h(the)g(t)o(yp)q(e)g(of)g(a)f(v)m(alue.)21
b(It)16 b(receiv)o(es)g(one)f(argumen)o(t,)f(and)h(returns)g(its)-12
-2347 y(t)o(yp)q(e,)g(co)q(ded)h(as)f(a)g(string.)20 b(The)15
-b(p)q(ossible)i(results)f(of)e(this)i(function)g(are:)56 2441
-y Fg(\017)23 b Fj('nil')56 2535 y Fg(\017)g Fj('number')56
-2629 y Fg(\017)g Fj('string')56 2723 y Fg(\017)g Fj('table')56
-2817 y Fg(\017)g Fj('cfunction')899 2976 y Fm(12)p eop
-%%Page: 13 13
-bop 56 160 a Fg(\017)23 b Fj('function')56 253 y Fg(\017)g
-Fj('userdata')-12 375 y Fb(6.2)56 b(String)18 b(Manipulation)-12
-461 y Fm(This)e(library)f(pro)o(vides)h(generic)g(functions)f(for)f(string)h
-(manipulation,)h(suc)o(h)g(as)e(\014nding)i(and)f(extracting)-12
-517 y(substrings.)20 b(When)14 b(indexing)h(a)e(string,)g(the)h(\014rst)f(c)o
-(haracter)f(has)i(p)q(osition)g(1.)19 b(See)14 b(Section)g(7.2)f(for)g(some)
--12 574 y(examples)j(on)f(string)g(manipulation)i(in)f(Lua.)-12
-694 y Fj(strfind)23 b(\(str,)g(substr\))-12 780 y Fm(Receiv)o(es)15
-b(t)o(w)o(o)d(string)i(argumen)o(ts,)e(and)i(returns)f(a)g(n)o(um)o(b)q(er.)
-20 b(This)14 b(n)o(um)o(b)q(er)g(indicates)h(the)e(\014rst)g(p)q(osition)-12
-836 y(where)20 b(the)f(second)h(argumen)o(t)e(app)q(ears)i(in)g(the)f
+2696 y(t)o(yp)q(e,)h(co)q(ded)g(as)g(a)f(string.)21 b(The)16
+b(p)q(ossible)i(results)e(of)f(this)h(function)g(are)g Fl('nil')p
+Fn(,)f Fl('number')p Fn(,)f Fl('string')p Fn(,)-12 2752 y Fl('table')p
+Fn(,)g Fl('cfunction')p Fn(,)f Fl('function')p Fn(,)h(and)h
+Fl('userdata')p Fn(.)899 2976 y(15)p eop
+%%Page: 16 16
+bop -12 160 a Fl(error)23 b(\(message\))-12 245 y Fn(This)16
+b(function)h(issues)f(an)f(error)g(message)g(and)h(terminates)g(the)f(last)h
+(called)h(function)f(from)f(the)h(library)-12 302 y(\()p Fl(lua_dofile)p
+Fn(,)d Fl(lua_dostring)p Fn(,)g Fc(:)8 b(:)g(:)e Fn(\).)20
+b(It)15 b(nev)o(er)g(returns.)-12 422 y Fl(setglobal)23 b(\(name,)g(value\))
+-12 508 y Fn(This)18 b(function)g(assigns)g(the)f(giv)o(en)h(v)m(alue)h(to)d
+(a)h(global)i(v)m(ariable.)27 b(The)18 b(string)f Fl(name)g
+Fn(do)q(es)h(not)f(need)h(to)-12 564 y(b)q(e)g(a)f(syn)o(tactically)h(v)m
+(alid)h(v)m(ariable)g(name.)26 b(Therefore,)18 b(this)g(function)g(can)f(set)
+g(global)h(v)m(ariables)h(with)-12 621 y(strange)c(names)g(lik)o(e)h
+Fl(m)24 b(v)g(1)15 b Fn(or)f Fl(34)p Fn(.)-12 741 y Fl(getglobal)23
+b(\(name\))-12 827 y Fn(This)18 b(function)f(retriev)o(es)g(the)g(v)m(alue)h
+(of)f(a)f(global)i(v)m(ariable.)26 b(The)17 b(string)g Fl(name)f
+Fn(do)q(es)i(not)e(need)i(to)e(b)q(e)i(a)-12 883 y(syn)o(tactically)e(v)m
+(alid)h(v)m(ariable)g(name.)-12 1003 y Fl(setfallback)23 b(\(fallbackname,)e
+(newfallback\))-12 1089 y Fn(This)f(function)g(sets)f(a)g(new)g(fallbac)o(k)h
+(function)g(to)e(the)h(giv)o(en)h(fallbac)o(k.)32 b(It)20 b(returns)f(the)g
+(old)h(fallbac)o(k)-12 1145 y(function,)c(or)f(nil)h(in)g(case)f(of)g(error)g
+(\(in)o(v)m(alid)i(fallbac)o(k)f(name,)f(or)f Fl(newfallback)g
+Fn(is)i(not)e(a)h(function\).)-12 1267 y Fd(6.2)56 b(String)18
+b(Manipulation)-12 1353 y Fn(This)e(library)f(pro)o(vides)h(generic)g
+(functions)f(for)f(string)h(manipulation,)h(suc)o(h)g(as)e(\014nding)i(and)f
+(extracting)-12 1409 y(substrings.)20 b(When)14 b(indexing)h(a)e(string,)g
+(the)h(\014rst)f(c)o(haracter)f(has)i(p)q(osition)g(1.)19 b(See)14
+b(Section)g(7.2)f(for)g(some)-12 1466 y(examples)j(on)f(string)g
+(manipulation)i(in)f(Lua.)-12 1586 y Fl(strfind)23 b(\(str,)g(substr,)g
+([init,)g([end]]\))-12 1672 y Fn(Receiv)o(es)15 b(t)o(w)o(o)d(string)i
+(argumen)o(ts,)e(and)i(returns)f(a)g(n)o(um)o(b)q(er.)20 b(This)14
+b(n)o(um)o(b)q(er)g(indicates)h(the)e(\014rst)g(p)q(osition)-12
+1728 y(where)20 b(the)f(second)h(argumen)o(t)e(app)q(ears)i(in)g(the)f
(\014rst)g(argumen)o(t.)31 b(If)19 b(the)h(second)g(argumen)o(t)e(is)i(not)f
-(a)-12 893 y(substring)d(of)f(the)g(\014rst)g(one,)g(then)g
-Fj(strfind)f Fm(returns)h Fi(nil)p Fm(.)-12 1013 y Fj(strlen)23
-b(\(s\))-12 1099 y Fm(Receiv)o(es)17 b(a)e(string)g(and)g(returns)g(its)h
-(length.)-12 1219 y Fj(strsub)23 b(\(s,)h(i,)f(j\))-12 1304
-y Fm(Returns)13 b(another)f(string,)h(whic)o(h)g(is)g(a)f(substring)h(of)f
-Fj(s)p Fm(,)h(starting)f(at)g Fj(i)g Fm(and)h(runing)g(un)o(til)h
-Fj(j)p Fm(.)k(If)13 b Fj(j)g Fm(is)g(absen)o(t)-12 1361 y(or)18
-b(is)g Fi(nil)p Fm(,)i(it)e(is)g(assumed)h(to)e(b)q(e)i(equal)g(to)e(the)h
-(length)h(of)e Fj(s)p Fm(.)29 b(P)o(articularly)l(,)19 b(the)f(call)h
-Fj(strsub\(s,1,j\))-12 1417 y Fm(returns)c(a)g(pre\014x)h(of)f
-Fj(s)g Fm(with)g(length)h Fj(j)p Fm(,)f(while)h(the)g(call)g
-Fj(strsub\(s,i\))e Fm(returns)h(a)g(su\014x)g(of)g Fj(s)p Fm(.)-12
-1537 y Fj(strlower)23 b(\(s\))-12 1623 y Fm(Receiv)o(es)16
-b(a)d(string)i(and)f(returns)g(a)f(cop)o(y)h(of)g(that)f(string)h(with)h(all)
-g(upp)q(er)g(case)f(letters)g(c)o(hanged)g(to)g(lo)o(w)o(er)-12
-1680 y(case.)20 b(All)d(other)d(c)o(haracters)h(are)g(left)g(unc)o(hanged.)
--12 1800 y Fj(strupper)23 b(\(s\))-12 1886 y Fm(Receiv)o(es)16
+(a)-12 1785 y(substring)i(of)f(the)g(\014rst)g(one,)i(then)e
+Fl(strfind)g Fn(returns)g Fk(nil)p Fn(.)36 b(A)21 b(third)g(optional)f(n)o
+(umerical)i(argumen)o(t)-12 1841 y(sp)q(eci\014es)e(where)f(to)f(start)f(the)
+i(searc)o(h.)29 b(Another)19 b(optional)g(n)o(umerical)g(argumen)o(t)f(sp)q
+(eci\014es)i(where)f(to)-12 1897 y(stop)c(it.)-12 2018 y Fl(strlen)23
+b(\(s\))-12 2103 y Fn(Receiv)o(es)17 b(a)e(string)g(and)g(returns)g(its)h
+(length.)-12 2223 y Fl(strsub)23 b(\(s,)h(i,)f(j\))-12 2309
+y Fn(Returns)13 b(another)f(string,)h(whic)o(h)g(is)g(a)f(substring)h(of)f
+Fl(s)p Fn(,)h(starting)f(at)g Fl(i)g Fn(and)h(runing)g(un)o(til)h
+Fl(j)p Fn(.)k(If)13 b Fl(j)g Fn(is)g(absen)o(t)-12 2366 y(or)18
+b(is)g Fk(nil)p Fn(,)i(it)e(is)g(assumed)h(to)e(b)q(e)i(equal)g(to)e(the)h
+(length)h(of)e Fl(s)p Fn(.)29 b(P)o(articularly)l(,)19 b(the)f(call)h
+Fl(strsub\(s,1,j\))-12 2422 y Fn(returns)e(a)f(pre\014x)i(of)e
+Fl(s)h Fn(with)g(length)g Fl(j)p Fn(,)g(while)h(the)f(call)h
+Fl(strsub\(s,i\))d Fn(returns)i(a)f(su\016x)h(of)f Fl(s)p Fn(,)h(starting)-12
+2479 y(at)e Fl(i)p Fn(..)-12 2599 y Fl(strlower)23 b(\(s\))-12
+2684 y Fn(Receiv)o(es)16 b(a)d(string)i(and)f(returns)g(a)f(cop)o(y)h(of)g
+(that)f(string)h(with)h(all)g(upp)q(er)g(case)f(letters)g(c)o(hanged)g(to)g
+(lo)o(w)o(er)-12 2741 y(case.)20 b(All)d(other)d(c)o(haracters)h(are)g(left)g
+(unc)o(hanged.)899 2976 y(16)p eop
+%%Page: 17 17
+bop -12 160 a Fl(strupper)23 b(\(s\))-12 245 y Fn(Receiv)o(es)16
b(a)d(string)i(and)f(returns)g(a)f(cop)o(y)h(of)g(that)f(string)h(with)h(all)
g(lo)o(w)o(er)e(case)h(letters)h(c)o(hanged)f(to)f(upp)q(er)-12
-1942 y(case.)20 b(All)d(other)d(c)o(haracters)h(are)g(left)g(unc)o(hanged.)
--12 2064 y Fb(6.3)56 b(Mathematical)16 b(F)-5 b(unctions)-12
-2149 y Fm(This)17 b(library)g(is)f(an)g(in)o(terface)h(to)e(some)h(functions)
-g(of)g(the)g(standard)g(C)g(math)f(library)l(.)24 b(It)16 b(pro)o(vides)g
-(the)-12 2206 y(follo)o(wing)g(functions:)-12 2300 y Fj(abs)48
-b(acos)23 b(asin)g(atan)g(ceil)h(cos)f(floor)g(max)h(min)-12
-2356 y(mod)48 b(pow)f(sin)g(sqrt)23 b(tan)59 2450 y Fm(The)f(functions)h
-Fj(floor)p Fm(,)f Fj(sqrt)p Fm(,)h Fj(pow)p Fm(,)f Fj(ceil)p
-Fm(,)h Fj(sin)p Fm(,)g Fj(cos)p Fm(,)g Fj(tan)p Fm(,)f Fj(asin)p
-Fm(,)h Fj(acos)p Fm(,)g(and)f Fj(atan)f Fm(are)h(only)-12 2506
-y(in)o(terfaces)h(to)f(the)h(homon)o(ymous)f(functions)i(in)f(the)g(C)g
-(library)l(,)i(with)e(the)g(di\013erence)h(that,)g(in)f(the)-12
-2563 y(trigonometric)15 b(functions,)h(all)g(angles)g(are)e(expressed)i(in)g
-(degrees.)59 2619 y(The)d(function)g Fj(max)g Fm(returns)f(the)h(maxim)o(um)g
-(v)m(alue)h(in)f(a)g(list)g(of)g(n)o(umeric)g(argumen)o(ts.)19
-b(Similarly)l(,)c Fj(min)-12 2676 y Fm(computes)g(the)h(minim)o(um.)21
-b(Both)15 b(can)g(b)q(e)h(used)g(with)f(an)g(unlimited)j(n)o(um)o(b)q(er)d
-(of)g(argumen)o(ts.)59 2732 y(The)g(function)h Fj(mod)f Fm(is)h(equiv)m(alen)
-o(t)h(to)d(the)h Fj(\045)g Fm(op)q(erator)g(in)h(C.)899 2976
-y(13)p eop
-%%Page: 14 14
-bop -12 160 a Fb(6.4)56 b(I/O)18 b(F)-5 b(acilities)-12 245
-y Fm(All)16 b(I/O)g(op)q(erations)f(in)h(Lua)f(are)g(done)g(o)o(v)o(er)f(t)o
-(w)o(o)g Fk(curr)n(ent)h Fm(\014les,)g(one)h(for)e(reading)i(and)f(one)g(for)
-f(writing.)-12 302 y(Initially)l(,)k(the)d(curren)o(t)g(input)h(\014le)h(is)e
-Fj(stdin)p Fm(,)f(and)i(the)f(curren)o(t)g(output)g(\014le)h(is)g
-Fj(stdout)p Fm(.)59 358 y(Unless)g(otherwised)g(stated,)e(all)i(I/O)g
-(functions)g(return)f(1)g(on)g(success)h(and)f Fi(nil)h Fm(on)f(failure.)-12
-477 y Fj(readfrom)23 b(\(filename\))-12 563 y Fm(This)17 b(function)g(op)q
-(ens)g(a)f(\014le)h(named)g Fj(filename)e Fm(and)i(sets)f(it)g(as)g(the)g
-Fk(curr)n(ent)h Fm(input)g(\014le.)24 b(When)17 b(called)-12
-620 y(without)e(parameters,)f(this)i(function)g(restores)e
-Fj(stdin)h Fm(as)g(the)g(curren)o(t)g(input)h(\014le.)-12 739
-y Fj(writeto)23 b(\(filename\))-12 825 y Fm(This)16 b(function)g(op)q(ens)g
-(a)f(\014le)h(named)f Fj(filename)f Fm(and)i(sets)e(it)i(as)f(the)g
-Fk(curr)n(ent)g Fm(output)g(\014le.)21 b(Notice)15 b(that,)-12
-881 y(if)21 b(the)g(\014le)g(already)g(exists,)h(it)f(is)g(completely)h
+302 y(case.)20 b(All)d(other)d(c)o(haracters)h(are)g(left)g(unc)o(hanged.)-12
+424 y Fd(6.3)56 b(Mathematical)16 b(F)-5 b(unctions)-12 509
+y Fn(This)20 b(library)f(is)h(an)f(in)o(terface)g(to)f(some)h(functions)h(of)
+e(the)h(standard)g(C)f(math)h(library)l(.)32 b(Moreo)o(v)o(er,)18
+b(it)-12 566 y(registers)d(a)f(fallbac)o(k)h(for)f(the)h(binary)g(op)q
+(erator)f Fl(^)h Fn(whic)o(h,)g(when)g(applied)i(to)d(n)o(um)o(b)q(ers)h
+Fl(x^y)p Fn(,)e(returns)i Fc(x)1821 549 y Fb(y)1842 566 y Fn(.)59
+622 y(The)g(library)h(pro)o(vides)g(the)f(follo)o(wing)h(functions:)-12
+716 y Fl(abs)24 b(acos)f(asin)g(atan)h(ceil)f(cos)g(floor)h(log)f(log10)-12
+773 y(max)h(min)47 b(mod)g(sin)h(sqrt)23 b(tan)-12 866 y Fn(Most)16
+b(of)g(them)h(are)g(only)g(in)o(terfaces)g(to)f(the)h(homon)o(ymous)f
+(functions)i(in)g(the)f(C)f(library)l(,)i(except)f(that,)-12
+923 y(for)e(the)g(trigonometric)g(functions,)h(all)g(angles)f(are)g
+(expressed)h(in)g(degrees.)59 979 y(The)d(function)g Fl(max)g
+Fn(returns)f(the)h(maxim)o(um)g(v)m(alue)h(in)f(a)g(list)g(of)g(n)o(umeric)g
+(argumen)o(ts.)19 b(Similarly)l(,)c Fl(min)-12 1036 y Fn(computes)g(the)h
+(minim)o(um.)21 b(Both)15 b(can)g(b)q(e)h(used)g(with)f(an)g(unlimited)j(n)o
+(um)o(b)q(er)d(of)g(argumen)o(ts.)59 1092 y(The)g(function)h
+Fl(mod)f Fn(is)h(equiv)m(alen)o(t)h(to)d(the)h Fl(\045)g Fn(op)q(erator)g(in)
+h(C.)-12 1214 y Fd(6.4)56 b(I/O)18 b(F)-5 b(acilities)-12 1300
+y Fn(All)16 b(I/O)g(op)q(erations)f(in)h(Lua)f(are)g(done)g(o)o(v)o(er)f(t)o
+(w)o(o)g Fm(curr)n(ent)h Fn(\014les,)g(one)h(for)e(reading)i(and)f(one)g(for)
+f(writing.)-12 1356 y(Initially)l(,)k(the)d(curren)o(t)g(input)h(\014le)h(is)
+e Fl(stdin)p Fn(,)f(and)i(the)f(curren)o(t)g(output)g(\014le)h(is)g
+Fl(stdout)p Fn(.)59 1413 y(Unless)g(otherwised)g(stated,)e(all)i(I/O)g
+(functions)g(return)f(1)g(on)g(success)h(and)f Fk(nil)h Fn(on)f(failure.)-12
+1533 y Fl(readfrom)23 b(\(filename\))-12 1619 y Fn(This)17
+b(function)g(op)q(ens)g(a)f(\014le)h(named)g Fl(filename)e
+Fn(and)i(sets)f(it)g(as)g(the)g Fm(curr)n(ent)h Fn(input)g(\014le.)24
+b(When)17 b(called)-12 1675 y(without)e(parameters,)f(this)i(function)g
+(restores)e Fl(stdin)h Fn(as)g(the)g(curren)o(t)g(input)h(\014le.)-12
+1795 y Fl(writeto)23 b(\(filename\))-12 1881 y Fn(This)16 b(function)g(op)q
+(ens)g(a)f(\014le)h(named)f Fl(filename)f Fn(and)i(sets)e(it)i(as)f(the)g
+Fm(curr)n(ent)g Fn(output)g(\014le.)21 b(Notice)15 b(that,)-12
+1937 y(if)21 b(the)g(\014le)g(already)g(exists,)h(it)f(is)g(completely)h
(erased)e(with)h(this)g(op)q(eration.)36 b(When)21 b(called)h(without)-12
-938 y(parameters,)14 b(this)i(function)g(restores)e Fj(stdout)h
-Fm(as)f(the)i(curren)o(t)f(output)g(\014le.)-12 1057 y Fj(appendto)23
-b(\(filename\))-12 1143 y Fm(This)18 b(function)g(op)q(ens)f(a)g(\014le)h
-(named)f Fj(filename)f Fm(and)h(sets)g(it)g(as)g(the)g Fk(curr)n(ent)g
-Fm(output)f(\014le.)27 b(Unlik)o(e)18 b(the)-12 1199 y Fj(writeto)d
-Fm(op)q(eration,)h(this)g(function)g(do)q(es)g(not)g(erase)f(an)o(y)h
+1994 y(parameters,)14 b(this)i(function)g(restores)e Fl(stdout)h
+Fn(as)f(the)i(curren)o(t)f(output)g(\014le.)-12 2114 y Fl(appendto)23
+b(\(filename\))-12 2200 y Fn(This)18 b(function)g(op)q(ens)f(a)g(\014le)h
+(named)f Fl(filename)f Fn(and)h(sets)g(it)g(as)g(the)g Fm(curr)n(ent)g
+Fn(output)f(\014le.)27 b(Unlik)o(e)18 b(the)-12 2256 y Fl(writeto)d
+Fn(op)q(eration,)h(this)g(function)g(do)q(es)g(not)g(erase)f(an)o(y)h
(previous)g(con)o(ten)o(t)f(of)g(the)h(\014le.)23 b(When)16
-b(called)-12 1255 y(without)j(parameters,)g(this)h(function)g(restores)f
-Fj(stdout)f Fm(as)h(the)g(curren)o(t)g(output)h(\014le.)33
-b(This)19 b(function)-12 1312 y(returns)c(2)g(if)h(the)f(\014le)h(already)g
+b(called)-12 2313 y(without)j(parameters,)g(this)h(function)g(restores)f
+Fl(stdout)f Fn(as)h(the)g(curren)o(t)g(output)h(\014le.)33
+b(This)19 b(function)-12 2369 y(returns)c(2)g(if)h(the)f(\014le)h(already)g
(exists,)f(1)g(if)g(it)h(creates)f(a)g(new)g(\014le,)h(and)f
-Fi(nil)i Fm(on)e(failure.)-12 1431 y Fj(read)24 b(\([format]\))-12
-1517 y Fm(This)12 b(function)g(returns)e(a)h(v)m(alue)h(read)f(from)f(the)h
+Fk(nil)i Fn(on)e(failure.)-12 2489 y Fl(read)24 b(\([format]\))-12
+2575 y Fn(This)12 b(function)g(returns)e(a)h(v)m(alue)h(read)f(from)f(the)h
(curren)o(t)g(input.)20 b(An)11 b(optional)g(string)g(argumen)o(t)f(sp)q
-(eci\014es)-12 1573 y(the)15 b(w)o(a)o(y)g(the)g(input)h(is)g(in)o
-(terpreted.)59 1630 y(Without)j(a)g(format)e(argumen)o(t,)i
-Fj(read)g Fm(\014rst)g(skips)h(blanks,)g(tabs)f(and)g(newlines.)34
-b(Then)20 b(it)f(c)o(hec)o(ks)-12 1686 y(whether)g(the)h(curren)o(t)e(c)o
-(haracter)h(is)g Fj(")g Fm(or)g Fj(')p Fm(.)31 b(If)19 b(so,)g(it)h(reads)f
-(a)f(string)h(up)h(to)e(the)h(ending)i(quotation)-12 1743 y(mark,)14
+(eci\014es)-12 2631 y(the)15 b(w)o(a)o(y)g(the)g(input)h(is)g(in)o
+(terpreted.)59 2688 y(Without)j(a)g(format)e(argumen)o(t,)i
+Fl(read)g Fn(\014rst)g(skips)h(blanks,)g(tabs)f(and)g(newlines.)34
+b(Then)20 b(it)f(c)o(hec)o(ks)-12 2744 y(whether)g(the)h(curren)o(t)e(c)o
+(haracter)h(is)g Fl(")g Fn(or)g Fl(')p Fn(.)31 b(If)19 b(so,)g(it)h(reads)f
+(a)f(string)h(up)h(to)e(the)h(ending)i(quotation)-12 2801 y(mark,)14
b(and)h(returns)f(this)h(string,)g(without)f(the)h(quotation)f(marks.)19
-b(Otherwise)d(it)f(reads)f(up)h(to)g(a)f(blank,)-12 1799 y(tab)h(or)g
-(newline.)59 1856 y(The)g(format)f(string)h(can)h(ha)o(v)o(e)e(the)i(follo)o
-(wing)g(format:)60 1945 y Fj(?[n])-12 2033 y Fm(where)g Fj(?)f
-Fm(can)g(b)q(e:)-12 2122 y Fi('s')h(or)h('S')22 b Fm(to)15
-b(read)g(a)g(string;)-12 2214 y Fi('f)5 b(')17 b(or)g('F')k
-Fm(to)15 b(read)g(a)g(real)g(n)o(um)o(b)q(er;)-12 2306 y Fi('i')i(or)g('I')22
-b Fm(to)14 b(read)i(an)f(in)o(teger.)-12 2395 y(The)g(optional)g
-Fj(n)f Fm(is)h(a)g(n)o(um)o(b)q(er)f(whic)o(h)i(sp)q(eci\014es)g(ho)o(w)e
-(man)o(y)g(c)o(haracters)g(m)o(ust)g(b)q(e)h(read)g(to)f(comp)q(ose)g(the)-12
-2451 y(input)i(v)m(alue.)-12 2571 y Fj(write)23 b(\(value,)g([format]\))-12
-2656 y Fm(This)16 b(function)g(writes)f(the)h(v)m(alue)g(of)f(its)g(\014rst)g
+b(Otherwise)d(it)f(reads)f(up)h(to)g(a)f(blank,)-12 2857 y(tab)h(or)g
+(newline.)899 2976 y(17)p eop
+%%Page: 18 18
+bop 59 160 a Fn(The)15 b(format)f(string)h(can)h(ha)o(v)o(e)e(the)i(follo)o
+(wing)g(format:)60 253 y Fl(?[n])-12 347 y Fn(where)g Fl(?)f
+Fn(can)g(b)q(e:)-12 441 y Fk('s')h(or)h('S')22 b Fn(to)15 b(read)g(a)g
+(string;)-12 535 y Fk('f)5 b(')17 b(or)g('F')k Fn(to)15 b(read)g(a)g(real)g
+(n)o(um)o(b)q(er;)-12 629 y Fk('i')i(or)g('I')22 b Fn(to)14
+b(read)i(an)f(in)o(teger.)-12 723 y(The)g(optional)g Fl(n)f
+Fn(is)h(a)g(n)o(um)o(b)q(er)f(whic)o(h)i(sp)q(eci\014es)g(ho)o(w)e(man)o(y)g
+(c)o(haracters)g(m)o(ust)g(b)q(e)h(read)g(to)f(comp)q(ose)g(the)-12
+779 y(input)i(v)m(alue.)-12 899 y Fl(write)23 b(\(value,)g([format]\))-12
+985 y Fn(This)16 b(function)g(writes)f(the)h(v)m(alue)g(of)f(its)g(\014rst)g
(argumen)o(t)g(to)f(the)i(curren)o(t)f(output.)k(An)d(optional)g(second)-12
-2713 y(argumen)o(t)g(sp)q(eci\014es)j(the)e(format)e(to)i(b)q(e)g(used.)26
+1041 y(argumen)o(t)g(sp)q(eci\014es)j(the)e(format)e(to)i(b)q(e)g(used.)26
b(This)17 b(format)e(is)j(giv)o(en)f(as)g(a)f(string,)h(comp)q(osed)g(of)g
-(four)-12 2769 y(parts.)i(The)d(\014rst)f(part)f(is)i(the)f(only)h(not)f
+(four)-12 1098 y(parts.)i(The)d(\014rst)f(part)f(is)i(the)f(only)h(not)f
(optional,)g(and)h(m)o(ust)e(b)q(e)i(one)f(of)g(the)g(follo)o(wing)h(c)o
-(haracters:)-12 2858 y Fi('s')g(or)h('S')22 b Fm(to)15 b(write)g(strings;)899
-2976 y(14)p eop
-%%Page: 15 15
-bop -12 160 a Fi('f)5 b(')17 b(or)g('F')k Fm(to)15 b(write)g(\015oats;)-12
-253 y Fi('i')i(or)g('I')22 b Fm(to)14 b(write)i(in)o(tegers.)-12
-347 y(These)g(c)o(haracters)e(can)i(b)q(e)f(follo)o(w)o(ed)h(b)o(y)60
-441 y Fj([?][m][.n])-12 535 y Fm(where:)-12 629 y Fj(?)23 b
-Fm(indicates)16 b(justi\014cation)g(inside)h(the)f(\014eld.)130
-723 y(')p Fj(<)p Fm(')22 b(righ)o(t)15 b(justi\014cation;)130
-796 y(')p Fj(>)p Fm(')22 b(left)15 b(justi\014cation;)130 869
-y(')p Fj(|)p Fm(')22 b(cen)o(ter)15 b(justi\014cation.)-12
-962 y Fj(m)23 b Fm(Indicates)16 b(the)f(\014eld)i(size)f(in)g(c)o(haracters.)
--12 1056 y Fj(.n)23 b Fm(F)l(or)16 b(reals,)i(indicates)g(the)f(n)o(um)o(b)q
-(er)h(of)e(digital)j(places.)26 b(F)l(or)16 b(in)o(tegers,)i(it)f(is)h(the)f
-(minim)o(um)h(n)o(um)o(b)q(er)102 1113 y(of)d(digits.)20 b(This)c(option)f
-(has)h(no)f(meaning)g(for)g(strings.)59 1207 y(When)e(called)i(without)e(a)g
-(format)f(string,)h(this)h(function)g(writes)f(n)o(um)o(b)q(ers)g(using)h
-(the)f Fj(\045g)g Fm(format)f(and)-12 1263 y(strings)j(with)h
-Fj(\045s)p Fm(.)-12 1406 y Fl(7)69 b(Some)21 b(Examples)-12
-1508 y Fm(This)f(section)h(giv)o(es)e(examples)i(sho)o(wing)e(some)h
-(features)f(of)g(Lua.)34 b(It)19 b(do)q(es)h(not)g(in)o(tend)g(to)f(co)o(v)o
-(er)g(the)-12 1564 y(whole)d(language,)f(but)g(only)h(to)f(illustrate)h(some)
-f(in)o(teresting)h(uses)f(of)g(the)g(system.)-12 1686 y Fb(7.1)56
-b(The)18 b(F)-5 b(unctions)19 b Fa(next)e Fb(and)j Fa(nextvar)-12
-1772 y Fm(This)c(example)g(sho)o(ws)f(ho)o(w)f(to)h(use)g(the)h(function)g
-Fj(next)e Fm(to)h(iterate)g(o)o(v)o(er)f(the)i(\014elds)g(of)f(a)g(table.)-12
-1865 y Fj(function)23 b(f)h(\(t\))357 b(--)24 b(t)g(is)f(a)h(table)36
-1922 y(local)f(i,)h(v)f(=)h(next\(t,)f(nil\))47 b(--)24 b(i)g(is)f(an)h
-(index)f(of)g(t,)h(v)g(=)g(t[i])36 1978 y(while)f(i)h(do)84
-2035 y(--)f(do)h(something)e(with)i(i)f(and)h(v)84 2091 y(i,)f(v)h(=)g
-(next\(t,)f(i\))190 b(--)24 b(get)f(next)h(index)36 2148 y(end)-12
-2204 y(end)59 2298 y Fm(The)13 b(next)g(example)h(prin)o(ts)f(the)g(names)g
-(of)f(all)i(global)g(v)m(ariables)g(in)g(the)f(system)g(with)g(non)g(nil)i(v)
-m(alues:)-12 2392 y Fj(function)23 b(printGlobalVariables)e(\(\))36
-2448 y(local)i(i,)h(v)f(=)h(nextvar\(nil\))36 2505 y(while)f(i)h(do)84
-2561 y(print\(i\))84 2618 y(i,)f(v)h(=)g(nextvar\(i\))36 2674
-y(end)-12 2731 y(end)899 2976 y Fm(15)p eop
-%%Page: 16 16
-bop -12 160 a Fb(7.2)56 b(String)18 b(Manipulation)-12 245
-y Fm(The)e(\014rst)e(example)i(is)g(a)f(function)h(to)f(trim)g(extra)f
+(haracters:)-12 1192 y Fk('s')g(or)h('S')22 b Fn(to)15 b(write)g(strings;)-12
+1285 y Fk('f)5 b(')17 b(or)g('F')k Fn(to)15 b(write)g(\015oats;)-12
+1379 y Fk('i')i(or)g('I')22 b Fn(to)14 b(write)i(in)o(tegers.)-12
+1473 y(These)g(c)o(haracters)e(can)i(b)q(e)f(follo)o(w)o(ed)h(b)o(y)60
+1567 y Fl([?][m][.n])-12 1661 y Fn(where:)-12 1754 y Fl(?)23
+b Fn(indicates)16 b(justi\014cation)g(inside)h(the)f(\014eld.)130
+1848 y(')p Fl(<)p Fn(')22 b(righ)o(t)15 b(justi\014cation;)130
+1921 y(')p Fl(>)p Fn(')22 b(left)15 b(justi\014cation;)130
+1994 y(')p Fl(|)p Fn(')22 b(cen)o(ter)15 b(justi\014cation.)-12
+2088 y Fl(m)23 b Fn(Indicates)16 b(the)f(\014eld)i(size)f(in)g(c)o
+(haracters.)-12 2182 y Fl(.n)23 b Fn(F)l(or)16 b(reals,)i(indicates)g(the)f
+(n)o(um)o(b)q(er)h(of)e(digital)j(places.)26 b(F)l(or)16 b(in)o(tegers,)i(it)
+f(is)h(the)f(minim)o(um)h(n)o(um)o(b)q(er)102 2238 y(of)d(digits.)20
+b(This)c(option)f(has)h(no)f(meaning)g(for)g(strings.)59 2332
+y(When)e(called)i(without)e(a)g(format)f(string,)h(this)h(function)g(writes)f
+(n)o(um)o(b)q(ers)g(using)h(the)f Fl(\045g)g Fn(format)f(and)-12
+2389 y(strings)j(with)h Fl(\045s)p Fn(.)-12 2509 y Fl(debug)23
+b(\(\))-12 2595 y Fn(This)e(function,)g(when)g(called,)h(rep)q(eatedly)f
+(presen)o(ts)f(a)g(prompt)f Fl(lua_debug>)42 b Fn(in)21 b(the)f(error)f
+(output)-12 2651 y(stream)h(\()p Fl(stderr)p Fn(\),)f(reads)i(a)f(line)i
+(from)d(the)i(standard)f(input,)i(and)e(executes)h(\(\\dostring"\))f(the)g
+(line.)-12 2708 y(The)e(lo)q(op)g(ends)f(when)h(the)g(user)f(t)o(yp)q(es)g
+Fl(cont)g Fn(to)g(the)g(prompt.)26 b(This)18 b(function)g(then)g(returns)f
+(and)g(the)-12 2764 y(execution)f(of)f(the)h(program)e(con)o(tin)o(ues.)899
+2976 y(18)p eop
+%%Page: 19 19
+bop -12 160 a Fo(7)69 b(Some)21 b(Examples)-12 261 y Fn(This)f(section)h(giv)
+o(es)e(examples)i(sho)o(wing)e(some)h(features)f(of)g(Lua.)34
+b(It)19 b(do)q(es)h(not)g(in)o(tend)g(to)f(co)o(v)o(er)g(the)-12
+318 y(whole)d(language,)f(but)g(only)h(to)f(illustrate)h(some)f(in)o
+(teresting)h(uses)f(of)g(the)g(system.)-12 437 y Fd(7.1)56
+b(The)18 b(F)-5 b(unctions)19 b Fa(next)e Fd(and)j Fa(nextvar)-12
+523 y Fn(This)c(example)g(sho)o(ws)f(ho)o(w)f(to)h(use)g(the)h(function)g
+Fl(next)e Fn(to)h(iterate)g(o)o(v)o(er)f(the)i(\014elds)g(of)f(a)g(table.)-12
+605 y Fl(function)23 b(f)h(\(t\))357 b(--)24 b(t)g(is)f(a)h(table)36
+661 y(local)f(i,)h(v)f(=)h(next\(t,)f(nil\))47 b(--)24 b(i)g(is)f(an)h(index)
+f(of)g(t,)h(v)g(=)g(t[i])36 718 y(while)f(i)h(do)84 774 y(...)524
+b(--)24 b(do)f(something)g(with)g(i)h(and)g(v)84 831 y(i,)f(v)h(=)g(next\(t,)
+f(i\))190 b(--)24 b(get)f(next)h(index)36 887 y(end)-12 944
+y(end)59 1026 y Fn(The)13 b(next)g(example)h(prin)o(ts)f(the)g(names)g(of)f
+(all)i(global)g(v)m(ariables)g(in)g(the)f(system)g(with)g(non)g(nil)i(v)m
+(alues:)-12 1108 y Fl(function)23 b(printGlobalVariables)e(\(\))36
+1164 y(local)i(i,)h(v)f(=)h(nextvar\(nil\))36 1221 y(while)f(i)h(do)84
+1277 y(print\(i\))84 1334 y(i,)f(v)h(=)g(nextvar\(i\))36 1390
+y(end)-12 1447 y(end)-12 1566 y Fd(7.2)56 b(String)18 b(Manipulation)-12
+1652 y Fn(The)e(\014rst)e(example)i(is)g(a)f(function)h(to)f(trim)g(extra)f
(blanks)i(at)f(the)g(b)q(eginning)i(and)f(end)g(of)e(a)h(string.)-12
-339 y Fj(function)23 b(trim\(s\))36 396 y(local)g(i)h(=)g(1)36
-452 y(while)f(strsub\(s,i,i\))f(=)i(')g(')f(do)84 509 y(i)g(=)h(i+1)36
-565 y(end)36 622 y(local)f(l)h(=)g(strlen\(s\))36 678 y(while)f
-(strsub\(s,l,l\))f(=)i(')g(')f(do)84 734 y(l)g(=)h(l-1)36 791
-y(end)36 847 y(return)f(strsub\(s,i,l\))-12 904 y(end)59 998
-y Fm(The)15 b(second)h(example)g(sho)o(ws)e(a)h(function)h(that)f(eliminates)
-i(all)f(blanks)g(of)f(a)f(string.)899 2976 y(16)p eop
-%%Page: 17 17
-bop -12 160 a Fj(function)23 b(remove_blanks)f(\(s\))36 216
-y(local)h(b)h(=)g(strfind\(s,)e(')i('\))36 273 y(while)f(b)h(do)84
-329 y(s)f(=)h(strsub\(s,)f(1,)g(b-1\))h(..)f(strsub\(s,)g(b+1\))84
-385 y(b)g(=)h(strfind\(s,)f(')g('\))36 442 y(end)36 498 y(return)g(s)-12
-555 y(end)-12 677 y Fb(7.3)56 b(P)n(ersistence)-12 762 y Fm(Because)19
+1734 y Fl(function)23 b(trim\(s\))36 1791 y(local)g(l)h(=)g(1)36
+1847 y(while)f(strsub\(s,l,l\))f(==)i(')f(')h(do)84 1904 y(l)f(=)h(l+1)36
+1960 y(end)36 2017 y(local)f(r)h(=)g(strlen\(s\))36 2073 y(while)f
+(strsub\(s,r,r\))f(==)i(')f(')h(do)84 2129 y(r)f(=)h(r-1)36
+2186 y(end)36 2242 y(return)f(strsub\(s,l,r\))-12 2299 y(end)59
+2381 y Fn(The)15 b(second)h(example)g(sho)o(ws)e(a)h(function)h(that)f
+(eliminates)i(all)f(blanks)g(of)f(a)f(string.)-12 2463 y Fl(function)23
+b(remove_blanks)f(\(s\))36 2520 y(local)h(b)h(=)g(strfind\(s,)e(')i('\))36
+2576 y(while)f(b)h(do)84 2632 y(s)f(=)h(strsub\(s,)f(1,)g(b-1\))h(..)f
+(strsub\(s,)g(b+1\))84 2689 y(b)g(=)h(strfind\(s,)f(')g('\))36
+2745 y(end)36 2802 y(return)g(s)-12 2858 y(end)899 2976 y Fn(19)p
+eop
+%%Page: 20 20
+bop -12 160 a Fd(7.3)56 b(P)n(ersistence)-12 245 y Fn(Because)19
b(of)f(its)h(re\015exiv)o(e)g(facilities,)i(p)q(ersistence)e(in)g(Lua)g(can)g
(b)q(e)f(ac)o(hiev)o(ed)i(with)e(Lua.)30 b(This)19 b(section)-12
-819 y(sho)o(ws)c(some)h(w)o(a)o(ys)e(to)i(store)f(and)h(retriev)o(e)f(v)m
+302 y(sho)o(ws)c(some)h(w)o(a)o(ys)e(to)i(store)f(and)h(retriev)o(e)f(v)m
(alues)i(in)g(Lua,)f(using)g(a)g(text)f(\014le)i(written)f(in)g(the)g
-(language)-12 875 y(itself)g(as)f(the)g(storage)f(media.)59
-932 y(T)l(o)h(store)f(a)h(single)i(v)m(alue)f(with)g(a)e(name,)h(the)h(follo)
-o(wing)f(co)q(de)h(is)g(enough:)-12 1026 y Fj(function)23 b(store)g(\(name,)g
-(value\))36 1082 y(write\('\\n')f(..)i(name)f(..)h('='\))36
-1138 y(write_value\(value\))-12 1195 y(end)-12 1301 y(function)f(write_value)
-f(\(value\))36 1358 y(local)h(t)h(=)g(type\(value\))131 1414
-y(if)g(t)g(=)f('nil')95 b(then)23 b(write\('nil'\))36 1471
-y(elseif)g(t)h(=)f('number')g(then)g(write\(value\))36 1527
-y(elseif)g(t)h(=)f('string')g(then)g(write\('"')g(..)h(value)f(..)g('"'\))36
-1583 y(end)-12 1640 y(end)-12 1746 y Fm(In)16 b(order)f(to)g(restore)f(this)i
-(v)m(alue,)g(a)f Fj(lua_dofile)e Fm(su\016ces.)59 1803 y(Storing)k(tables)g
-(is)g(a)g(little)h(more)f(complex.)25 b(Assuming)18 b(that)e(the)h(table)h
-(is)f(a)g(tree,)f(and)h(all)h(indices)-12 1859 y(are)e(iden)o(ti\014ers)i
-(\(that)d(is,)h(the)h(tables)f(are)g(b)q(eing)i(used)e(as)g(records\),)g(its)
-g(v)m(alue)i(can)e(b)q(e)h(written)f(directly)-12 1916 y(with)g(table)f
-(constructors.)k(First,)c(the)g(function)h Fj(write_value)e
-Fm(is)i(c)o(hanged)f(to)-12 2009 y Fj(function)23 b(write_value)f(\(value\))
-36 2066 y(local)h(t)h(=)g(type\(value\))131 2122 y(if)g(t)g(=)f('nil')95
-b(then)23 b(write\('nil'\))36 2179 y(elseif)g(t)h(=)f('number')g(then)g
-(write\(value\))36 2235 y(elseif)g(t)h(=)f('string')g(then)g(write\('"')g(..)
-h(value)f(..)g('"'\))36 2292 y(elseif)g(t)h(=)f('table')47
-b(then)23 b(write_record\(value\))36 2348 y(end)-12 2405 y(end)-12
-2498 y Fm(The)16 b(function)g Fj(write_record)d Fm(is:)899
-2976 y(17)p eop
-%%Page: 18 18
-bop -12 160 a Fj(function)23 b(write_record\(t\))36 216 y(local)g(i,)h(v)f(=)
-h(next\(t,)f(nil\))36 273 y(write\('@{'\))46 b(--)24 b(starts)f(constructor)
-36 329 y(while)g(i)h(do)84 385 y(store\(i,)e(v\))84 442 y(i,)h(v)h(=)g
-(next\(t,)f(i\))84 498 y(if)g(i)h(then)f(write\(',)g('\))h(end)36
-555 y(end)36 611 y(write\('}'\))46 b(--)24 b(closes)f(constructor)-12
-668 y(end)-12 789 y Fb(7.4)56 b(A)19 b(Cfunction)-12 875 y
-Fm(A)c(Cfunction)h(to)f(compute)g(the)g(maxim)o(um)h(of)e(a)h(v)m(ariable)i
-(n)o(um)o(b)q(er)e(of)g(argumen)o(ts)f(ma)o(y)h(b)q(e)h(written)f(as:)-12
-969 y Fj(void)24 b(math_max)e(\(void\))-12 1026 y({)12 1082
-y(int)i(i=1;)71 b(/*)23 b(number)g(of)h(arguments)e(*/)12 1138
-y(double)h(d,)h(dmax;)12 1195 y(lua_Object)f(o;)12 1251 y(/*)h(the)f
-(function)g(must)g(get)h(at)f(least)g(one)h(argument)f(*/)12
-1308 y(if)h(\(\(o)f(=)h(lua_getparam\(i++\)\))d(==)j(0\))12
-1364 y({)g(lua_error)e(\("too)i(few)f(arguments)g(to)g(function)g(`max'"\);)g
-(return;)g(})12 1421 y(/*)h(and)f(this)g(argument)g(must)g(be)h(a)g(number)f
-(*/)12 1477 y(if)h(\(!lua_isnumber\(o\)\))12 1534 y({)g(lua_error)e
-(\("incorrect)h(arguments)f(to)i(function)f(`max'"\);)g(return;)f(})12
-1590 y(dmax)h(=)h(lua_getnumber)e(\(o\);)12 1647 y(/*)i(loops)f(until)g
-(there)g(is)h(no)f(more)h(arguments)e(*/)12 1703 y(while)h(\(\(o)h(=)f
-(lua_getparam\(i++\)\))f(!=)h(0\))12 1759 y({)36 1816 y(if)h
-(\(!lua_isnumber\(o\)\))36 1872 y({)g(lua_error)e(\("incorrect)h(arguments)f
-(to)i(function)f(`max'"\);)f(return;)h(})36 1929 y(d)h(=)f(lua_getnumber)f
-(\(o\);)36 1985 y(if)i(\(d)f(>)h(dmax\))f(dmax)g(=)h(d;)12
-2042 y(})12 2098 y(/*)g(push)f(the)g(result)g(to)h(be)g(returned)e(*/)12
-2155 y(lua_pushnumber)g(\(dmax\);)-12 2211 y(})59 2305 y Fm(After)15
-b(registered)g(with)-12 2399 y Fj(lua_register)22 b(\("max",)71
-b(math_max\);)-12 2493 y Fm(this)16 b(function)g(is)g(a)o(v)m(ailable)g(in)g
-(Lua,)g(as)e(follo)o(ws:)-12 2586 y Fj(i)24 b(=)g(max\(4,)f(5,)g(10,)h(-34\))
-47 b(--)23 b(i)h(receives)f(10)-12 2708 y Fb(7.5)56 b(Calling)18
-b(Lua)h(F)-5 b(unctions)-12 2794 y Fm(This)15 b(example)g(illustrates)g(ho)o
-(w)f(a)g(C)g(function)h(can)f(call)i(the)e(Lua)g(function)h
-Fj(remove_blanks)e Fm(presen)o(ted)-12 2850 y(in)j(Section)g(7.2.)899
-2976 y(18)p eop
-%%Page: 19 19
-bop -12 160 a Fj(void)24 b(remove_blanks)e(\(char)h(*s\))-12
-216 y({)36 273 y(lua_pushstring\(s\);)45 b(/*)24 b(prepare)f(parameter)f(*/)
-36 329 y(lua_call\("remove_blanks",)e(1\);)48 b(/*)23 b(call)h(Lua)f
-(function)g(with)g(1)h(parameter)e(*/)36 385 y(strcpy\(s,)h
-(lua_getstring\(lua_pop\(\))o(\)\);)45 b(/*)23 b(copy)h(result)f(back)g(to)h
-('s')f(*/)-12 442 y(})-12 585 y Fl(Ac)n(kno)n(wledgme)o(n)n(ts)-12
-687 y Fm(The)17 b(authors)f(w)o(ould)i(lik)o(e)g(to)e(thank)h(CENPES/PETR)o
-(OBR)1099 675 y(\023)1093 687 y(AS)g(whic)o(h,)h(join)o(tly)f(with)h(T)l
-(eCGraf,)e(used)-12 743 y(extensiv)o(ely)g(early)f(v)o(ersions)f(of)g(this)h
-(system)f(and)h(ga)o(v)o(e)f(v)m(aluable)i(commen)o(ts.)j(The)c(authors)e(w)o
-(ould)i(also)-12 799 y(lik)o(e)i(to)d(thank)h(Carlos)g(Henrique)h(Levy)l(,)g
-(who)f(found)h(the)f(name)g(of)g(the)g(game.)899 2976 y(19)p
+(language)-12 358 y(itself)g(as)f(the)g(storage)f(media.)59
+415 y(T)l(o)h(store)f(a)h(single)i(v)m(alue)f(with)g(a)e(name,)h(the)h(follo)
+o(wing)f(co)q(de)h(is)g(enough:)-12 509 y Fl(function)23 b(store)g(\(name,)g
+(value\))36 565 y(write\('\\n')f(..)i(name)f(..)h('='\))36
+622 y(write_value\(value\))-12 678 y(end)-12 784 y(function)f(write_value)f
+(\(value\))36 841 y(local)h(t)h(=)g(type\(value\))131 897 y(if)g(t)g(==)f
+('nil')95 b(then)23 b(write\('nil'\))36 954 y(elseif)g(t)h(==)f('number')g
+(then)g(write\(value\))36 1010 y(elseif)g(t)h(==)f('string')g(then)g
+(write\('"')g(..)h(value)f(..)g('"'\))36 1067 y(end)-12 1123
+y(end)-12 1229 y Fn(In)16 b(order)f(to)g(restore)f(this)i(v)m(alue,)g(a)f
+Fl(lua_dofile)e Fn(su\016ces.)59 1286 y(Storing)k(tables)g(is)g(a)g(little)h
+(more)f(complex.)25 b(Assuming)18 b(that)e(the)h(table)h(is)f(a)g(tree,)f
+(and)h(all)h(indices)-12 1342 y(are)e(iden)o(ti\014ers)i(\(that)d(is,)h(the)h
+(tables)f(are)g(b)q(eing)i(used)e(as)g(records\),)g(its)g(v)m(alue)i(can)e(b)
+q(e)h(written)f(directly)-12 1399 y(with)g(table)f(constructors.)k(First,)c
+(the)g(function)h Fl(write_value)e Fn(is)i(c)o(hanged)f(to)-12
+1492 y Fl(function)23 b(write_value)f(\(value\))36 1549 y(local)h(t)h(=)g
+(type\(value\))131 1605 y(if)g(t)g(==)f('nil')95 b(then)23
+b(write\('nil'\))36 1662 y(elseif)g(t)h(==)f('number')g(then)g
+(write\(value\))36 1718 y(elseif)g(t)h(==)f('string')g(then)g(write\('"')g
+(..)h(value)f(..)g('"'\))36 1775 y(elseif)g(t)h(==)f('table')47
+b(then)23 b(write_record\(value\))36 1831 y(end)-12 1888 y(end)-12
+1981 y Fn(The)16 b(function)g Fl(write_record)d Fn(is:)-12
+2075 y Fl(function)23 b(write_record\(t\))36 2132 y(local)g(i,)h(v)f(=)h
+(next\(t,)f(nil\))36 2188 y(write\('{'\))46 b(--)24 b(starts)f(constructor)36
+2245 y(while)g(i)h(do)84 2301 y(store\(i,)e(v\))84 2358 y(write\(',)g('\))84
+2414 y(i,)h(v)h(=)g(next\(t,)f(i\))36 2470 y(end)36 2527 y(write\('}'\))46
+b(--)24 b(closes)f(constructor)-12 2583 y(end)-12 2705 y Fd(7.4)56
+b(Inheritance)-12 2791 y Fn(The)18 b(fallbac)o(k)h(for)f(absen)o(t)f(indices)
+j(can)f(b)q(e)f(used)h(to)e(implemen)o(t)j(man)o(y)d(kinds)i(of)f
+(inheritance)h(in)g(Lua.)-12 2847 y(As)c(an)g(example,)h(the)f(follo)o(wing)h
+(co)q(de)g(implemen)o(ts)h(single)f(inheritance:)899 2976 y(20)p
+eop
+%%Page: 21 21
+bop -12 160 a Fl(function)23 b(Index)g(\(t,f\))36 216 y(if)h(f)f(==)h
+('parent')f(then)47 b(--)23 b(to)h(avoid)f(loop)84 273 y(return)g
+(OldIndex\(t,f\))36 329 y(end)36 385 y(local)g(p)h(=)g(t.parent)36
+442 y(if)g(type\(p\))e(==)i('table')f(then)84 498 y(return)g(p[f])36
+555 y(else)84 611 y(return)g(OldIndex\(t,f\))36 668 y(end)-12
+724 y(end)-12 837 y(OldIndex)g(=)h(setfallback\("index",)d(Index\))-12
+931 y Fn(Whenev)o(er)13 b(Lua)f(attempts)g(to)f(access)i(an)f(absen)o(t)g
+(\014eld)i(in)f(a)f(table,)h(it)f(calls)i(the)e(fallbac)o(k)h(function)g
+Fl(Index)p Fn(.)-12 987 y(If)h(the)g(table)g(has)g(a)f(\014eld)i
+Fl(parent)e Fn(with)h(a)g(table)g(v)m(alue,)h(then)f(Lua)g(attempts)f(to)g
+(access)h(the)g(desired)h(\014eld)-12 1044 y(in)g(this)g(paren)o(t)f(ob)s
+(ject.)19 b(This)c(pro)q(cess)f(is)h(rep)q(eated)g(\\up)o(w)o(ards")e(un)o
+(til)i(a)f(v)m(alue)i(for)e(the)g(\014eld)h(is)g(found)g(or)-12
+1100 y(the)i(ob)s(ject)g(has)g(no)g(paren)o(t.)24 b(In)18 b(the)f(latter)g
+(case,)g(the)g(previous)h(fallbac)o(k)g(is)f(called)i(to)d(supply)i(a)f(v)m
+(alue)-12 1157 y(for)e(the)g(\014eld.)59 1213 y(When)h(b)q(etter)h(p)q
+(erformance)f(is)h(needed,)g(the)g(same)f(fallbac)o(k)h(ma)o(y)e(b)q(e)i
+(implemen)o(ted)h(in)f(C,)f(as)g(ilus-)-12 1270 y(trated)f(in)h(Figure)f(1.)
+20 b(This)15 b(co)q(de)h(m)o(ust)f(b)q(e)h(registered)f(with:)36
+1363 y Fl(lua_pushliteral\("parent"\))o(;)36 1420 y(lockedParentName)22
+b(=)h(lua_lock\(\);)36 1476 y(lua_pushobject\(lua_setfal)o(lback\("i)o
+(ndex",)d(Index\)\);)36 1533 y(lockedOldIndex)i(=)i(lua_lock\(\);)-12
+1627 y Fn(Notice)16 b(that)e(the)i(string)f Fl("parent")f Fn(is)i(k)o(ept)f
+(lo)q(c)o(k)o(ed)g(in)h(Lua)g(for)f(optimal)g(p)q(erformace.)-12
+1748 y Fd(7.5)56 b(A)19 b(CF)-5 b(unction)-12 1834 y Fn(A)12
+b(CF)l(unction)h(to)e(compute)i(the)f(maxim)o(um)g(of)f(a)h(v)m(ariable)h(n)o
+(um)o(b)q(er)g(of)e(argumen)o(ts)h(is)g(sho)o(wn)g(in)h(Figure)f(2.)-12
+1891 y(After)j(registered)h(with)-12 1984 y Fl(lua_register)22
+b(\("max",)h(math_max\);)-12 2078 y Fn(this)16 b(function)g(is)g(a)o(v)m
+(ailable)g(in)g(Lua,)g(as)e(follo)o(ws:)-12 2172 y Fl(i)24
+b(=)g(max\(4,)f(5,)g(10,)h(-34\))47 b(--)23 b(i)h(receives)f(10)-12
+2294 y Fd(7.6)56 b(Calling)18 b(Lua)h(F)-5 b(unctions)-12 2380
+y Fn(This)15 b(example)g(illustrates)g(ho)o(w)f(a)g(C)g(function)h(can)f
+(call)i(the)e(Lua)g(function)h Fl(remove_blanks)e Fn(presen)o(ted)-12
+2436 y(in)j(Section)g(7.2.)-12 2530 y Fl(void)24 b(remove_blanks)e(\(char)h
+(*s\))-12 2586 y({)36 2643 y(lua_pushstring\(s\);)45 b(/*)24
+b(prepare)f(parameter)f(*/)36 2699 y(lua_call\("remove_blanks"\))o(;)45
+b(/*)24 b(call)f(Lua)g(function)g(*/)36 2756 y(strcpy\(s,)g
+(lua_getstring\(lua_getre)o(sult\(1\))o(\)\);)45 b(/*)23 b(copy)h(result)f
+(back)g(to)h('s')f(*/)-12 2812 y(})899 2976 y Fn(21)p eop
+%%Page: 22 22
+bop -12 417 1867 6 v -12 511 a Fl(int)24 b(lockedParentName;)45
+b(/*)24 b(stores)f(the)g(lock)g(index)h(for)f(the)h(string)f("parent")f(*/)
+-12 567 y(int)i(lockedOldIndex;)93 b(/*)24 b(previous)e(fallback)h(function)g
+(*/)-12 680 y(void)h(callOldFallback)d(\(lua_Object)i(table,)g(lua_Object)f
+(index\))-12 736 y({)36 793 y(lua_Object)g(oldIndex)h(=)h
+(lua_getlocked\(lockedOldIn)o(dex\);)36 849 y(lua_pushobject\(table\);)36
+906 y(lua_pushobject\(index\);)36 962 y(lua_callfunction\(oldIndex)o(\);)-12
+1019 y(})-12 1132 y(void)g(Index)f(\(void\))-12 1188 y({)36
+1245 y(lua_Object)f(table)i(=)f(lua_getparam\(1\);)36 1301
+y(lua_Object)f(index)i(=)f(lua_getparam\(2\);)36 1357 y(lua_Object)f(parent;)
+36 1414 y(if)i(\(lua_isstring\(index\))d(&&)i
+(strcmp\(lua_getstring\(index\),)d("parent"\))j(==)g(0\))36
+1470 y({)84 1527 y(callOldFallback\(table,)d(index\);)84 1583
+y(return;)36 1640 y(})36 1696 y(lua_pushobject\(table\);)36
+1753 y(lua_pushlocked\(lockedPare)o(ntName\);)36 1809 y(parent)j(=)h
+(lua_getsubscript\(\);)36 1866 y(if)g(\(lua_istable\(parent\)\))36
+1922 y({)84 1978 y(lua_pushobject\(parent\);)84 2035 y
+(lua_pushobject\(index\);)84 2091 y(/*)f(return)g(result)g(from)h
+(getsubscript)e(*/)84 2148 y(lua_pushobject\(lua_gets)o(ubscript)o(\(\)\);)36
+2204 y(})36 2261 y(else)84 2317 y(callOldFallback\(table,)e(index\);)-12
+2374 y(})653 2509 y Fn(Figure)c(1:)j(Inheritance)e(in)f(C.)p
+-12 2565 V 899 2976 a(22)p eop
+%%Page: 23 23
+bop -12 727 1867 6 v -12 821 a Fl(void)24 b(math_max)e(\(void\))-12
+878 y({)12 934 y(int)i(i=1;)71 b(/*)23 b(number)g(of)h(arguments)e(*/)12
+991 y(double)h(d,)h(dmax;)12 1047 y(lua_Object)f(o;)12 1103
+y(/*)h(the)f(function)g(must)g(get)h(at)f(least)g(one)h(argument)f(*/)12
+1160 y(if)h(\(\(o)f(=)h(lua_getparam\(i++\)\))d(==)j(LUA_NOOBJECT\))60
+1216 y(lua_error)e(\("too)i(few)f(arguments)g(to)g(function)g(`max'"\);)12
+1273 y(/*)h(and)f(this)g(argument)g(must)g(be)h(a)g(number)f(*/)12
+1329 y(if)h(\(!lua_isnumber\(o\)\))60 1386 y(lua_error)e(\("incorrect)h
+(argument)g(to)g(function)g(`max'"\);)12 1442 y(dmax)g(=)h(lua_getnumber)e
+(\(o\);)12 1499 y(/*)i(loops)f(until)g(there)g(is)h(no)f(more)h(arguments)e
+(*/)12 1555 y(while)h(\(\(o)h(=)f(lua_getparam\(i++\)\))f(!=)h
+(LUA_NOOBJECT\))12 1612 y({)36 1668 y(if)h(\(!lua_isnumber\(o\)\))84
+1724 y(lua_error)e(\("incorrect)h(argument)f(to)i(function)f(`max'"\);)36
+1781 y(d)h(=)f(lua_getnumber)f(\(o\);)36 1837 y(if)i(\(d)f(>)h(dmax\))f(dmax)
+g(=)h(d;)12 1894 y(})12 1950 y(/*)g(push)f(the)g(result)g(to)h(be)g(returned)
+e(*/)12 2007 y(lua_pushnumber)g(\(dmax\);)-12 2063 y(})610
+2198 y Fn(Figure)16 b(2:)j(C)c(function)h Fl(math)p 1134 2198
+15 2 v 17 w(max)p Fn(.)p -12 2255 1867 6 v 899 2976 a(23)p
eop
+%%Page: 24 24
+bop -12 160 a Fo(Ac)n(kno)n(wledgme)o(n)n(ts)-12 261 y Fn(The)17
+b(authors)f(w)o(ould)i(lik)o(e)g(to)e(thank)h(CENPES/PETR)o(OBR)1099
+250 y(\023)1093 261 y(AS)g(whic)o(h,)h(join)o(tly)f(with)h(T)l(eCGraf,)e
+(used)-12 318 y(extensiv)o(ely)g(early)f(v)o(ersions)f(of)g(this)h(system)f
+(and)h(ga)o(v)o(e)f(v)m(aluable)i(commen)o(ts.)j(The)c(authors)e(w)o(ould)i
+(also)-12 374 y(lik)o(e)i(to)d(thank)h(Carlos)g(Henrique)h(Levy)l(,)g(who)f
+(found)h(the)f(name)g(of)g(the)g(game)1371 358 y Fj(3)1390
+374 y Fn(.)-12 517 y Fo(A)69 b(Incompatibi)o(l)o(i)o(ti)o(es)20
+b(with)h(Previous)i(V)-6 b(ersions)-12 619 y Fn(Although)13
+b(great)f(care)g(has)h(b)q(een)g(tak)o(en)f(to)g(a)o(v)o(oid)h
+(incompatibilities)j(with)d(the)f(previous)h(public)i(v)o(ersions)-12
+675 y(of)g(Lua,)g(some)g(di\013erences)h(had)g(to)e(b)q(e)i(in)o(tro)q
+(duced.)21 b(Here)16 b(is)f(a)g(list)h(of)f(all)h(these)g(di\013erences.)-12
+797 y Fd(Incompatibilitie)o(s)g(in)i(the)h(Language)56 883
+y Fi(\017)k Fn(The)15 b(equalit)o(y)h(test)f(op)q(erator)f(no)o(w)h(is)h
+(denoted)f(b)o(y)g Fl(==)p Fn(,)g(instead)h(of)f Fl(=)p Fn(.)56
+976 y Fi(\017)23 b Fn(The)14 b(syn)o(tax)f(for)g(table)h(construction)g(has)f
+(b)q(een)i(greatly)f(simpli\014ed.)22 b(The)14 b(old)g Fl(@\(size\))f
+Fn(has)g(b)q(een)102 1033 y(substituted)20 b(b)o(y)f Fl({})p
+Fn(.)32 b(The)20 b(list)g(constructor)f(\(formerly)g Fl(@[...])p
+Fn(\))f(and)h(the)h(record)f(constructor)102 1089 y(\(formerly)g
+Fl(@{...})p Fn(\))g(no)o(w)h(are)g(b)q(oth)g(co)q(ded)h(lik)o(e)g
+Fl({...})p Fn(.)34 b(When)20 b(the)h(construction)f(in)o(v)o(olv)o(es)h(a)102
+1146 y(function)15 b(call,)h(lik)o(e)g(in)f Fl(@func{...})p
+Fn(,)e(the)i(new)g(syn)o(tax)f(do)q(es)h(not)g(use)g(the)f
+Fl(@)p Fn(.)20 b(More)14 b(imp)q(ortan)o(t,)g Fm(a)102 1202
+y(c)n(onstruction)h(function)h(must)h(now)f(explicitly)g(r)n(eturn)g(the)h(c)
+n(onstructe)n(d)e(table)p Fn(.)-12 1324 y Fd(Incompatibilitie)o(s)h(in)i(the)
+h(API)56 1410 y Fi(\017)k Fn(The)15 b(function)h Fl(lua_call)e
+Fn(no)h(longer)h(has)f(the)g(parameter)g Fl(nparam)p Fn(.)56
+1504 y Fi(\017)23 b Fn(The)16 b(function)i Fl(lua_pop)d Fn(is)i(no)f(longer)h
+(a)o(v)m(ailable,)h(since)g(it)e(could)i(lead)f(to)f(strange)g(b)q(eha)o
+(vior.)24 b(In)102 1560 y(particular,)13 b(to)e(access)i(results)f(returned)h
+(from)e(a)h(Lua)h(function,)g(the)f(new)h(macro)e Fl(lua_getresult)102
+1617 y Fn(should)16 b(b)q(e)g(used.)56 1710 y Fi(\017)23 b
+Fn(The)15 b(old)h(functions)g Fl(lua_storefield)d Fn(and)j
+Fl(lua_storeindexed)d Fn(ha)o(v)o(e)h(b)q(een)j(replaced)f(b)o(y)102
+1823 y Fl(int)23 b(lua_storesubscript)f(\(void\);)102 1935
+y Fn(with)15 b(the)h(parameters)e(explicitly)k(pushed)e(on)f(the)h(stac)o(k.)
+56 2029 y Fi(\017)23 b Fn(The)16 b(functionalit)o(y)h(of)f(the)g(function)g
+Fl(lua_errorfunction)e Fn(has)i(b)q(een)h(replaced)g(b)o(y)f(the)g
+Fm(fal)r(lb)n(ack)102 2086 y Fn(mec)o(hanism;)f(see)h(Section)g(4.8.)56
+2179 y Fi(\017)23 b Fn(When)14 b(calling)i(a)d(function)i(from)e(the)h(Lua)g
+(library)l(,)g(parameters)f(passed)h(through)g(the)g(stac)o(k)f(m)o(ust)102
+2236 y(b)q(e)j(pushed)h(just)e(b)q(efore)h(the)f(corresp)q(onden)o(t)h(call,)
+h(with)f(no)f(in)o(termediate)h(calls)h(to)e(Lua.)21 b(Sp)q(ecial)102
+2292 y(care)15 b(should)h(b)q(e)g(tak)o(en)f(with)g(macros)g(lik)o(e)h
+Fl(lua_getindexed)d Fn(and)j Fl(lua_getfield)p Fn(.)p -12 2815
+747 2 v 40 2842 a Fh(3)57 2858 y Fg(BTW,)d(Lua)g(means)h Fe(mo)n(on)e
+Fg(in)i(P)o(ortuguese.)899 2976 y Fn(24)p eop
%%Trailer
end
userdict /end-hook known{end-hook}if
diff --git a/domake b/domake
index 3acff092..56d58250 100755
--- a/domake
+++ b/domake
@@ -1,6 +1,10 @@
#!/bin/sh
+# makefile for lua hierarchy
LUA=`pwd`
export LUA
-make $*
+cd $LUA/src; make $*
+cd $LUA/include; make $*
+cd $LUA/clients/lib; make $*
+cd $LUA/clients/lua; make $*
diff --git a/include/Makefile b/include/Makefile
new file mode 100644
index 00000000..5ef4d4b5
--- /dev/null
+++ b/include/Makefile
@@ -0,0 +1,8 @@
+# makefile for lua distribution
+
+all:
+
+clean:
+
+co:
+ co -M lua.h lualib.h
diff --git a/include/lua.h b/include/lua.h
index 2bafd209..09a0909e 100644
--- a/include/lua.h
+++ b/include/lua.h
@@ -2,53 +2,99 @@
** LUA - Linguagem para Usuarios de Aplicacao
** Grupo de Tecnologia em Computacao Grafica
** TeCGraf - PUC-Rio
-** $Id: lua.h,v 1.1 1993/12/17 18:41:19 celes Exp $
+** $Id: lua.h,v 3.16 1995/01/27 17:19:06 celes Exp $
*/
#ifndef lua_h
#define lua_h
-typedef void (*lua_CFunction) (void);
-typedef struct Object *lua_Object;
+/* Private Part */
+
+typedef enum
+{
+ LUA_T_NIL = -1,
+ LUA_T_NUMBER = -2,
+ LUA_T_STRING = -3,
+ LUA_T_ARRAY = -4,
+ LUA_T_FUNCTION = -5,
+ LUA_T_CFUNCTION= -6,
+ LUA_T_USERDATA = 0
+} lua_Type;
+
-#define lua_register(n,f) (lua_pushcfunction(f), lua_storeglobal(n))
+/* Public Part */
+
+#define LUA_NOOBJECT 0
+typedef void (*lua_CFunction) (void);
+typedef unsigned int lua_Object;
+
+lua_Object lua_setfallback (char *name, lua_CFunction fallback);
-void lua_errorfunction (void (*fn) (char *s));
void lua_error (char *s);
int lua_dofile (char *filename);
int lua_dostring (char *string);
-int lua_call (char *functionname, int nparam);
+int lua_callfunction (lua_Object function);
+int lua_call (char *funcname);
+
+void lua_beginblock (void);
+void lua_endblock (void);
lua_Object lua_getparam (int number);
+#define lua_getresult(_) lua_getparam(_)
+
float lua_getnumber (lua_Object object);
char *lua_getstring (lua_Object object);
-char *lua_copystring (lua_Object object);
lua_CFunction lua_getcfunction (lua_Object object);
void *lua_getuserdata (lua_Object object);
-lua_Object lua_getfield (lua_Object object, char *field);
-lua_Object lua_getindexed (lua_Object object, float index);
+
+void lua_pushnil (void);
+void lua_pushnumber (float n);
+void lua_pushstring (char *s);
+void lua_pushliteral (char *s);
+void lua_pushcfunction (lua_CFunction fn);
+void lua_pushusertag (void *u, int tag);
+void lua_pushobject (lua_Object object);
+
lua_Object lua_getglobal (char *name);
+void lua_storeglobal (char *name);
+
+void lua_storesubscript (void);
+lua_Object lua_getsubscript (void);
+
+int lua_type (lua_Object object);
+
+int lua_lock (void);
+lua_Object lua_getlocked (int ref);
+void lua_pushlocked (int ref);
+void lua_unlock (int ref);
+
+lua_Object lua_createtable (void);
+
+
+/* some useful macros */
+
+#define lua_lockobject(o) (lua_pushobject(o), lua_lock())
+
+#define lua_register(n,f) (lua_pushcfunction(f), lua_storeglobal(n))
+
+#define lua_pushuserdata(u) lua_pushusertag(u, LUA_T_USERDATA)
+
+#define lua_isnil(_) (lua_type(_)==LUA_T_NIL)
+#define lua_isnumber(_) (lua_type(_)==LUA_T_NUMBER)
+#define lua_isstring(_) (lua_type(_)==LUA_T_STRING)
+#define lua_istable(_) (lua_type(_)==LUA_T_ARRAY)
+#define lua_isfunction(_) (lua_type(_)==LUA_T_FUNCTION)
+#define lua_iscfunction(_) (lua_type(_)==LUA_T_CFUNCTION)
+#define lua_isuserdata(_) (lua_type(_)>=LUA_T_USERDATA)
+
+
+/* for lua 1.1 compatibility. Avoid using these macros */
+
+#define lua_getindexed(o,n) (lua_pushobject(o), lua_pushnumber(n), lua_getsubscript())
+#define lua_getfield(o,f) (lua_pushobject(o), lua_pushliteral(f), lua_getsubscript())
-lua_Object lua_pop (void);
-
-int lua_pushnil (void);
-int lua_pushnumber (float n);
-int lua_pushstring (char *s);
-int lua_pushcfunction (lua_CFunction fn);
-int lua_pushuserdata (void *u);
-int lua_pushobject (lua_Object object);
-
-int lua_storeglobal (char *name);
-int lua_storefield (lua_Object object, char *field);
-int lua_storeindexed (lua_Object object, float index);
-
-int lua_isnil (lua_Object object);
-int lua_isnumber (lua_Object object);
-int lua_isstring (lua_Object object);
-int lua_istable (lua_Object object);
-int lua_iscfunction (lua_Object object);
-int lua_isuserdata (lua_Object object);
+#define lua_copystring(o) (strdup(lua_getstring(o)))
#endif
diff --git a/include/lualib.h b/include/lualib.h
index 37b23094..9ce7e44a 100644
--- a/include/lualib.h
+++ b/include/lualib.h
@@ -2,7 +2,7 @@
** Libraries to be used in LUA programs
** Grupo de Tecnologia em Computacao Grafica
** TeCGraf - PUC-Rio
-** $Id: lualib.h,v 1.1 1993/12/17 19:01:46 celes Exp $
+** $Id: lualib.h,v 1.3 1994/12/13 15:59:16 roberto Exp $
*/
#ifndef lualib_h
diff --git a/include/mm.h b/include/mm.h
deleted file mode 100644
index e69de29b..00000000
--- a/include/mm.h
+++ /dev/null
diff --git a/src/Makefile b/src/Makefile
index 7e833d4f..6d1f1bb1 100644
--- a/src/Makefile
+++ b/src/Makefile
@@ -1,24 +1,35 @@
-# makefile for lua
+# makefile for lua distribution
-LIB= $(LUA)/lib
INC= $(LUA)/include
+LIB= $(LUA)/lib
+
+# in SunOs /usr/5include contains prototypes for standard lib
+INCS= -I/usr/5include -I$(INC)
+WARN= -Wall -Wmissing-prototypes -Wshadow -ansi
CC= gcc
-CFLAGS= -g -Wall -O2 -I$(INC) $(DEFS)
-DEFS= -DMAXCODE=64000 -DMAXCONSTANT=1024 -DMAXSYMBOL=1024 -DMAXARRAY=1024
+CFLAGS= $(INCS) $(DEFS) $(WARN) -O2
+
+OBJS= fallback.o hash.o inout.o lex.o mem.o opcode.o parser.o table.o tree.o
-OBJS= hash.o inout.o lex.o opcode.o table.o y.tab.o
SLIB= $(LIB)/liblua.a
-DLIB= $(LIB)/liblua.so.1.1
-libs: $(SLIB) $(DLIB)
+# dynamic libraries only work for SunOs
+DLIB= $(LIB)/liblua.so.2.1
+
+all: $(SLIB)
+
+dynamic: $(DLIB)
$(SLIB): $(OBJS)
- ar ruvl $@ $(OBJS)
- ranlib $(SLIB)
+ ar rcuv $@ $(OBJS)
+ ranlib $@
$(DLIB): $(OBJS)
ld -o $@ $(OBJS)
clean:
rm -f $(OBJS) $(SLIB) $(DLIB)
+
+co:
+ co -M fallback.c hash.c inout.c lex.c mem.c opcode.c table.c tree.c fallback.h hash.h inout.h mem.h opcode.h table.h tree.h types.h ugly.h
diff --git a/src/fallback.c b/src/fallback.c
new file mode 100644
index 00000000..d5bbbba1
--- /dev/null
+++ b/src/fallback.c
@@ -0,0 +1,171 @@
+/*
+** fallback.c
+** TecCGraf - PUC-Rio
+*/
+
+char *rcs_fallback="$Id: fallback.c,v 1.11 1995/02/06 19:34:03 roberto Exp $";
+
+#include <stdio.h>
+#include <string.h>
+
+#include "mem.h"
+#include "fallback.h"
+#include "opcode.h"
+#include "inout.h"
+#include "lua.h"
+
+
+static void errorFB (void);
+static void indexFB (void);
+static void gettableFB (void);
+static void arithFB (void);
+static void concatFB (void);
+static void orderFB (void);
+static void GDFB (void);
+static void funcFB (void);
+
+
+/*
+** Warning: This list must be in the same order as the #define's
+*/
+struct FB luaI_fallBacks[] = {
+{"error", {LUA_T_CFUNCTION, errorFB}},
+{"index", {LUA_T_CFUNCTION, indexFB}},
+{"gettable", {LUA_T_CFUNCTION, gettableFB}},
+{"arith", {LUA_T_CFUNCTION, arithFB}},
+{"order", {LUA_T_CFUNCTION, orderFB}},
+{"concat", {LUA_T_CFUNCTION, concatFB}},
+{"settable", {LUA_T_CFUNCTION, gettableFB}},
+{"gc", {LUA_T_CFUNCTION, GDFB}},
+{"function", {LUA_T_CFUNCTION, funcFB}}
+};
+
+#define N_FB (sizeof(luaI_fallBacks)/sizeof(struct FB))
+
+void luaI_setfallback (void)
+{
+ int i;
+ char *name = lua_getstring(lua_getparam(1));
+ lua_Object func = lua_getparam(2);
+ if (name == NULL || !(lua_isfunction(func) || lua_iscfunction(func)))
+ {
+ lua_pushnil();
+ return;
+ }
+ for (i=0; i<N_FB; i++)
+ {
+ if (strcmp(luaI_fallBacks[i].kind, name) == 0)
+ {
+ luaI_pushobject(&luaI_fallBacks[i].function);
+ luaI_fallBacks[i].function = *luaI_Address(func);
+ return;
+ }
+ }
+ /* name not found */
+ lua_pushnil();
+}
+
+
+static void errorFB (void)
+{
+ lua_Object o = lua_getparam(1);
+ if (lua_isstring(o))
+ fprintf (stderr, "lua: %s\n", lua_getstring(o));
+ else
+ fprintf(stderr, "lua: unknown error\n");
+}
+
+
+static void indexFB (void)
+{
+ lua_pushnil();
+}
+
+
+static void gettableFB (void)
+{
+ lua_reportbug("indexed expression not a table");
+}
+
+
+static void arithFB (void)
+{
+ lua_reportbug("unexpected type at conversion to number");
+}
+
+static void concatFB (void)
+{
+ lua_reportbug("unexpected type at conversion to string");
+}
+
+
+static void orderFB (void)
+{
+ lua_reportbug("unexpected type at comparison");
+}
+
+static void GDFB (void) { }
+
+static void funcFB (void)
+{
+ lua_reportbug("call expression not a function");
+}
+
+
+/*
+** Lock routines
+*/
+
+static Object *lockArray = NULL;
+static Word lockSize = 0;
+
+int luaI_lock (Object *object)
+{
+ Word i;
+ Word oldSize;
+ if (tag(object) == LUA_T_NIL)
+ return -1;
+ for (i=0; i<lockSize; i++)
+ if (tag(&lockArray[i]) == LUA_T_NIL)
+ {
+ lockArray[i] = *object;
+ return i;
+ }
+ /* no more empty spaces */
+ oldSize = lockSize;
+ if (lockArray == NULL)
+ {
+ lockSize = 10;
+ lockArray = newvector(lockSize, Object);
+ }
+ else
+ {
+ lockSize = 3*oldSize/2 + 5;
+ lockArray = growvector(lockArray, lockSize, Object);
+ }
+ for (i=oldSize; i<lockSize; i++)
+ tag(&lockArray[i]) = LUA_T_NIL;
+ lockArray[oldSize] = *object;
+ return oldSize;
+}
+
+
+void lua_unlock (int ref)
+{
+ tag(&lockArray[ref]) = LUA_T_NIL;
+}
+
+
+Object *luaI_getlocked (int ref)
+{
+ return &lockArray[ref];
+}
+
+
+void luaI_travlock (void (*fn)(Object *))
+{
+ Word i;
+ for (i=0; i<lockSize; i++)
+ fn(&lockArray[i]);
+}
+
diff --git a/src/fallback.h b/src/fallback.h
new file mode 100644
index 00000000..225a9063
--- /dev/null
+++ b/src/fallback.h
@@ -0,0 +1,31 @@
+/*
+** $Id: fallback.h,v 1.7 1994/11/21 18:22:58 roberto Stab $
+*/
+
+#ifndef fallback_h
+#define fallback_h
+
+#include "opcode.h"
+
+extern struct FB {
+ char *kind;
+ Object function;
+} luaI_fallBacks[];
+
+#define FB_ERROR 0
+#define FB_INDEX 1
+#define FB_GETTABLE 2
+#define FB_ARITH 3
+#define FB_ORDER 4
+#define FB_CONCAT 5
+#define FB_SETTABLE 6
+#define FB_GC 7
+#define FB_FUNCTION 8
+
+void luaI_setfallback (void);
+int luaI_lock (Object *object);
+Object *luaI_getlocked (int ref);
+void luaI_travlock (void (*fn)(Object *));
+
+#endif
+
diff --git a/src/hash.c b/src/hash.c
index 287c1316..2f227d25 100644
--- a/src/hash.c
+++ b/src/hash.c
@@ -1,138 +1,147 @@
/*
** hash.c
** hash manager for lua
-** Luiz Henrique de Figueiredo - 17 Aug 90
*/
-char *rcs_hash="$Id: hash.c,v 2.1 1994/04/20 22:07:57 celes Exp $";
+char *rcs_hash="$Id: hash.c,v 2.24 1995/02/06 19:34:03 roberto Exp $";
#include <string.h>
-#include <stdlib.h>
-
-#include "mm.h"
+#include "mem.h"
#include "opcode.h"
#include "hash.h"
#include "inout.h"
#include "table.h"
#include "lua.h"
-#define streq(s1,s2) (strcmp(s1,s2)==0)
-#define strneq(s1,s2) (strcmp(s1,s2)!=0)
-
-#define new(s) ((s *)malloc(sizeof(s)))
-#define newvector(n,s) ((s *)calloc(n,sizeof(s)))
+#define streq(s1,s2) (s1 == s2 || (*(s1) == *(s2) && strcmp(s1,s2)==0))
#define nhash(t) ((t)->nhash)
-#define nodelist(t) ((t)->list)
-#define list(t,i) ((t)->list[i])
+#define nuse(t) ((t)->nuse)
#define markarray(t) ((t)->mark)
-#define ref_tag(n) (tag(&(n)->ref))
-#define ref_nvalue(n) (nvalue(&(n)->ref))
-#define ref_svalue(n) (svalue(&(n)->ref))
+#define nodevector(t) ((t)->node)
+#define node(t,i) (&(t)->node[i])
+#define ref(n) (&(n)->ref)
+#define val(n) (&(n)->val)
-#ifndef ARRAYBLOCK
-#define ARRAYBLOCK 50
-#endif
-typedef struct ArrayList
-{
- Hash *array;
- struct ArrayList *next;
-} ArrayList;
+#define REHASH_LIMIT 0.70 /* avoid more than this % full */
+
-static ArrayList *listhead = NULL;
+static Hash *listhead = NULL;
-static int head (Hash *t, Object *ref) /* hash function */
+
+
+/* hash dimensions values */
+static Word dimensions[] =
+ {3, 5, 7, 11, 23, 47, 97, 197, 397, 797, 1597, 3203, 6421,
+ 12853, 25717, 51437, 65521, 0}; /* 65521 == last prime < MAX_WORD */
+
+static Word redimension (Word nhash)
{
- if (tag(ref) == T_NUMBER) return (((int)nvalue(ref))%nhash(t));
- else if (tag(ref) == T_STRING)
+ Word i;
+ for (i=0; dimensions[i]!=0; i++)
{
- int h;
- char *name = svalue(ref);
- for (h=0; *name!=0; name++) /* interpret name as binary number */
- {
- h <<= 8;
- h += (unsigned char) *name; /* avoid sign extension */
- h %= nhash(t); /* make it a valid index */
- }
- return h;
- }
- else
- {
- lua_reportbug ("unexpected type to index table");
- return -1;
+ if (dimensions[i] > nhash)
+ return dimensions[i];
}
+ lua_error("table overflow");
+ return 0; /* to avoid warnings */
}
-static Node *present(Hash *t, Object *ref, int h)
+static Word hashindex (Hash *t, Object *ref) /* hash function */
{
- Node *n=NULL, *p;
- if (tag(ref) == T_NUMBER)
- {
- for (p=NULL,n=list(t,h); n!=NULL; p=n, n=n->next)
- if (ref_tag(n) == T_NUMBER && nvalue(ref) == ref_nvalue(n)) break;
- }
- else if (tag(ref) == T_STRING)
- {
- for (p=NULL,n=list(t,h); n!=NULL; p=n, n=n->next)
- if (ref_tag(n) == T_STRING && streq(svalue(ref),ref_svalue(n))) break;
- }
- if (n==NULL) /* name not present */
- return NULL;
-#if 0
- if (p!=NULL) /* name present but not first */
+ switch (tag(ref))
{
- p->next=n->next; /* move-to-front self-organization */
- n->next=list(t,h);
- list(t,h)=n;
+ case LUA_T_NIL:
+ lua_reportbug ("unexpected type to index table");
+ return -1; /* UNREACHEABLE */
+ case LUA_T_NUMBER:
+ return (((Word)nvalue(ref))%nhash(t));
+ case LUA_T_STRING:
+ {
+ unsigned long h = tsvalue(ref)->hash;
+ if (h == 0)
+ {
+ char *name = svalue(ref);
+ while (*name)
+ h = ((h<<5)-h)^(unsigned char)*(name++);
+ tsvalue(ref)->hash = h;
+ }
+ return (Word)h%nhash(t); /* make it a valid index */
+ }
+ case LUA_T_FUNCTION:
+ return (((IntPoint)bvalue(ref))%nhash(t));
+ case LUA_T_CFUNCTION:
+ return (((IntPoint)fvalue(ref))%nhash(t));
+ case LUA_T_ARRAY:
+ return (((IntPoint)avalue(ref))%nhash(t));
+ default: /* user data */
+ return (((IntPoint)uvalue(ref))%nhash(t));
}
-#endif
- return n;
}
-static void freelist (Node *n)
+Bool lua_equalObj (Object *t1, Object *t2)
{
- while (n)
+ if (tag(t1) != tag(t2)) return 0;
+ switch (tag(t1))
+ {
+ case LUA_T_NIL: return 1;
+ case LUA_T_NUMBER: return nvalue(t1) == nvalue(t2);
+ case LUA_T_STRING: return streq(svalue(t1), svalue(t2));
+ case LUA_T_ARRAY: return avalue(t1) == avalue(t2);
+ case LUA_T_FUNCTION: return bvalue(t1) == bvalue(t2);
+ case LUA_T_CFUNCTION: return fvalue(t1) == fvalue(t2);
+ default: return uvalue(t1) == uvalue(t2);
+ }
+}
+
+static Word present (Hash *t, Object *ref)
+{
+ Word h = hashindex(t, ref);
+ while (tag(ref(node(t, h))) != LUA_T_NIL)
{
- Node *next = n->next;
- free (n);
- n = next;
+ if (lua_equalObj(ref, ref(node(t, h))))
+ return h;
+ h = (h+1) % nhash(t);
}
+ return h;
+}
+
+
+/*
+** Alloc a vector node
+*/
+static Node *hashnodecreate (Word nhash)
+{
+ Word i;
+ Node *v = newvector (nhash, Node);
+ for (i=0; i<nhash; i++)
+ tag(ref(&v[i])) = LUA_T_NIL;
+ return v;
}
/*
** Create a new hash. Return the hash pointer or NULL on error.
*/
-static Hash *hashcreate (unsigned int nhash)
+static Hash *hashcreate (Word nhash)
{
- Hash *t = new (Hash);
- if (t == NULL)
- {
- lua_error ("not enough memory");
- return NULL;
- }
+ Hash *t = new(Hash);
+ nhash = redimension((Word)((float)nhash/REHASH_LIMIT));
+ nodevector(t) = hashnodecreate(nhash);
nhash(t) = nhash;
+ nuse(t) = 0;
markarray(t) = 0;
- nodelist(t) = newvector (nhash, Node*);
- if (nodelist(t) == NULL)
- {
- lua_error ("not enough memory");
- return NULL;
- }
return t;
}
/*
** Delete a hash
*/
-static void hashdelete (Hash *h)
+static void hashdelete (Hash *t)
{
- int i;
- for (i=0; i<nhash(h); i++)
- freelist (list(h,i));
- free (nodelist(h));
- free(h);
+ luaI_free (nodevector(t));
+ luaI_free(t);
}
@@ -143,12 +152,12 @@ void lua_hashmark (Hash *h)
{
if (markarray(h) == 0)
{
- int i;
+ Word i;
markarray(h) = 1;
for (i=0; i<nhash(h); i++)
{
- Node *n;
- for (n = list(h,i); n != NULL; n = n->next)
+ Node *n = node(h,i);
+ if (tag(ref(n)) != LUA_T_NIL)
{
lua_markobject(&n->ref);
lua_markobject(&n->val);
@@ -156,92 +165,125 @@ void lua_hashmark (Hash *h)
}
}
}
+
+
+static void call_fallbacks (void)
+{
+ Hash *curr_array;
+ Object t;
+ tag(&t) = LUA_T_ARRAY;
+ for (curr_array = listhead; curr_array; curr_array = curr_array->next)
+ if (markarray(curr_array) != 1)
+ {
+ avalue(&t) = curr_array;
+ luaI_gcFB(&t);
+ }
+ tag(&t) = LUA_T_NIL;
+ luaI_gcFB(&t); /* end of list */
+}
+
/*
** Garbage collection to arrays
** Delete all unmarked arrays.
*/
-void lua_hashcollector (void)
+Long lua_hashcollector (void)
{
- ArrayList *curr = listhead, *prev = NULL;
- while (curr != NULL)
+ Hash *curr_array = listhead, *prev = NULL;
+ Long counter = 0;
+ call_fallbacks();
+ while (curr_array != NULL)
{
- ArrayList *next = curr->next;
- if (markarray(curr->array) != 1)
+ Hash *next = curr_array->next;
+ if (markarray(curr_array) != 1)
{
if (prev == NULL) listhead = next;
else prev->next = next;
- hashdelete(curr->array);
- free(curr);
+ hashdelete(curr_array);
+ ++counter;
}
else
{
- markarray(curr->array) = 0;
- prev = curr;
+ markarray(curr_array) = 0;
+ prev = curr_array;
}
- curr = next;
+ curr_array = next;
}
+ return counter;
}
/*
** Create a new array
-** This function insert the new array at array list. It also
-** execute garbage collection if the number of array created
+** This function inserts the new array in the array list. It also
+** executes garbage collection if the number of arrays created
** exceed a pre-defined range.
*/
-Hash *lua_createarray (int nhash)
+Hash *lua_createarray (Word nhash)
{
- ArrayList *new = new(ArrayList);
- if (new == NULL)
- {
- lua_error ("not enough memory");
- return NULL;
- }
- new->array = hashcreate(nhash);
- if (new->array == NULL)
+ Hash *array;
+ lua_pack();
+ array = hashcreate(nhash);
+ array->next = listhead;
+ listhead = array;
+ return array;
+}
+
+
+/*
+** Re-hash
+*/
+static void rehash (Hash *t)
+{
+ Word i;
+ Word nold = nhash(t);
+ Node *vold = nodevector(t);
+ nhash(t) = redimension(nhash(t));
+ nodevector(t) = hashnodecreate(nhash(t));
+ for (i=0; i<nold; i++)
{
- lua_error ("not enough memory");
- return NULL;
+ Node *n = vold+i;
+ if (tag(ref(n)) != LUA_T_NIL && tag(val(n)) != LUA_T_NIL)
+ *node(t, present(t, ref(n))) = *n; /* copy old node to new hahs */
}
+ luaI_free(vold);
+}
- if (lua_nentity == lua_block)
- lua_pack();
-
- lua_nentity++;
- new->next = listhead;
- listhead = new;
- return new->array;
+/*
+** If the hash node is present, return its pointer, otherwise return
+** null.
+*/
+Object *lua_hashget (Hash *t, Object *ref)
+{
+ Word h = present(t, ref);
+ if (tag(ref(node(t, h))) != LUA_T_NIL) return val(node(t, h));
+ else return NULL;
}
/*
** If the hash node is present, return its pointer, otherwise create a new
** node for the given reference and also return its pointer.
-** On error, return NULL.
*/
Object *lua_hashdefine (Hash *t, Object *ref)
{
- int h;
+ Word h;
Node *n;
- h = head (t, ref);
- if (h < 0) return NULL;
-
- n = present(t, ref, h);
- if (n == NULL)
+ h = present(t, ref);
+ n = node(t, h);
+ if (tag(ref(n)) == LUA_T_NIL)
{
- n = new(Node);
- if (n == NULL)
+ nuse(t)++;
+ if ((float)nuse(t) > (float)nhash(t)*REHASH_LIMIT)
{
- lua_error ("not enough memory");
- return NULL;
+ rehash(t);
+ h = present(t, ref);
+ n = node(t, h);
}
- n->ref = *ref;
- tag(&n->val) = T_NIL;
- n->next = list(t,h); /* link node to head of list */
- list(t,h) = n;
+ *ref(n) = *ref;
+ tag(val(n)) = LUA_T_NIL;
}
- return (&n->val);
+ return (val(n));
}
@@ -251,97 +293,44 @@ Object *lua_hashdefine (Hash *t, Object *ref)
** in the hash.
** This function pushs the element value and its reference to the stack.
*/
-static void firstnode (Hash *a, int h)
+static void hashnext (Hash *t, Word i)
{
- if (h < nhash(a))
- {
- int i;
- for (i=h; i<nhash(a); i++)
+ if (i >= nhash(t))
+ {
+ lua_pushnil(); lua_pushnil();
+ return;
+ }
+ while (tag(ref(node(t,i))) == LUA_T_NIL || tag(val(node(t,i))) == LUA_T_NIL)
+ {
+ if (++i >= nhash(t))
{
- if (list(a,i) != NULL)
- {
- if (tag(&list(a,i)->val) != T_NIL)
- {
- lua_pushobject (&list(a,i)->ref);
- lua_pushobject (&list(a,i)->val);
- return;
- }
- else
- {
- Node *next = list(a,i)->next;
- while (next != NULL && tag(&next->val) == T_NIL) next = next->next;
- if (next != NULL)
- {
- lua_pushobject (&next->ref);
- lua_pushobject (&next->val);
- return;
- }
- }
- }
+ lua_pushnil(); lua_pushnil();
+ return;
}
}
- lua_pushnil();
- lua_pushnil();
+ luaI_pushobject(ref(node(t,i)));
+ luaI_pushobject(val(node(t,i)));
}
+
void lua_next (void)
{
- Hash *a;
- Object *o = lua_getparam (1);
- Object *r = lua_getparam (2);
- if (o == NULL || r == NULL)
- { lua_error ("too few arguments to function `next'"); return; }
- if (lua_getparam (3) != NULL)
- { lua_error ("too many arguments to function `next'"); return; }
- if (tag(o) != T_ARRAY)
- { lua_error ("first argument of function `next' is not a table"); return; }
- a = avalue(o);
- if (tag(r) == T_NIL)
+ Hash *t;
+ lua_Object o = lua_getparam(1);
+ lua_Object r = lua_getparam(2);
+ if (o == LUA_NOOBJECT || r == LUA_NOOBJECT)
+ lua_error ("too few arguments to function `next'");
+ if (lua_getparam(3) != LUA_NOOBJECT)
+ lua_error ("too many arguments to function `next'");
+ if (!lua_istable(o))
+ lua_error ("first argument of function `next' is not a table");
+ t = avalue(luaI_Address(o));
+ if (lua_isnil(r))
{
- firstnode (a, 0);
- return;
+ hashnext(t, 0);
}
else
{
- int h = head (a, r);
- if (h >= 0)
- {
- Node *n = list(a,h);
- while (n)
- {
- if (memcmp(&n->ref,r,sizeof(Object)) == 0)
- {
- if (n->next == NULL)
- {
- firstnode (a, h+1);
- return;
- }
- else if (tag(&n->next->val) != T_NIL)
- {
- lua_pushobject (&n->next->ref);
- lua_pushobject (&n->next->val);
- return;
- }
- else
- {
- Node *next = n->next->next;
- while (next != NULL && tag(&next->val) == T_NIL) next = next->next;
- if (next == NULL)
- {
- firstnode (a, h+1);
- return;
- }
- else
- {
- lua_pushobject (&next->ref);
- lua_pushobject (&next->val);
- }
- return;
- }
- }
- n = n->next;
- }
- if (n == NULL)
- lua_error ("error in function 'next': reference not found");
- }
+ Word h = present (t, luaI_Address(r));
+ hashnext(t, h+1);
}
}
diff --git a/src/hash.h b/src/hash.h
index 060031a5..2af6ce16 100644
--- a/src/hash.h
+++ b/src/hash.h
@@ -2,30 +2,35 @@
** hash.h
** hash manager for lua
** Luiz Henrique de Figueiredo - 17 Aug 90
-** $Id: hash.h,v 2.1 1994/04/20 22:07:57 celes Exp $
+** $Id: hash.h,v 2.8 1995/01/12 14:19:04 roberto Exp $
*/
#ifndef hash_h
#define hash_h
+#include "types.h"
+
typedef struct node
{
Object ref;
Object val;
- struct node *next;
} Node;
typedef struct Hash
{
+ struct Hash *next;
char mark;
- unsigned int nhash;
- Node **list;
+ Word nhash;
+ Word nuse;
+ Node *node;
} Hash;
-Hash *lua_createarray (int nhash);
+Bool lua_equalObj (Object *t1, Object *t2);
+Hash *lua_createarray (Word nhash);
void lua_hashmark (Hash *h);
-void lua_hashcollector (void);
+Long lua_hashcollector (void);
+Object *lua_hashget (Hash *t, Object *ref);
Object *lua_hashdefine (Hash *t, Object *ref);
void lua_next (void);
diff --git a/src/inout.c b/src/inout.c
index d985c1b7..7bd7c235 100644
--- a/src/inout.c
+++ b/src/inout.c
@@ -2,49 +2,54 @@
** inout.c
** Provide function to realise the input/output function and debugger
** facilities.
+** Also provides some predefined lua functions.
*/
-char *rcs_inout="$Id: inout.c,v 1.2 1993/12/22 21:15:16 roberto Exp $";
+char *rcs_inout="$Id: inout.c,v 2.16 1994/12/20 21:20:36 roberto Exp $";
#include <stdio.h>
+#include <stdlib.h>
#include <string.h>
+#include "mem.h"
#include "opcode.h"
#include "hash.h"
#include "inout.h"
#include "table.h"
+#include "tree.h"
+#include "lua.h"
/* Exported variables */
-int lua_linenumber;
-int lua_debug;
-int lua_debugline;
+Word lua_linenumber;
+Bool lua_debug;
+Word lua_debugline = 0;
+
/* Internal variables */
+
#ifndef MAXFUNCSTACK
-#define MAXFUNCSTACK 32
+#define MAXFUNCSTACK 100
#endif
-static struct { int file; int function; } funcstack[MAXFUNCSTACK];
-static int nfuncstack=0;
+
+typedef struct FuncStackNode {
+ struct FuncStackNode *next;
+ char *file;
+ Word function;
+ Word line;
+} FuncStackNode;
+
+static FuncStackNode *funcStack = NULL;
+static Word nfuncstack=0;
static FILE *fp;
static char *st;
-static void (*usererror) (char *s);
-
-/*
-** Function to set user function to handle errors.
-*/
-void lua_errorfunction (void (*fn) (char *s))
-{
- usererror = fn;
-}
/*
** Function to get the next character from the input file
*/
static int fileinput (void)
{
- int c = fgetc (fp);
- return (c == EOF ? 0 : c);
+ return fgetc (fp);
}
/*
@@ -52,22 +57,25 @@ static int fileinput (void)
*/
static int stringinput (void)
{
- st++;
- return (*(st-1));
+ return *st++;
}
/*
** Function to open a file to be input unit.
-** Return 0 on success or 1 on error.
+** Return 0 on success or error message on error.
*/
-int lua_openfile (char *fn)
+char *lua_openfile (char *fn)
{
lua_linenumber = 1;
lua_setinput (fileinput);
fp = fopen (fn, "r");
- if (fp == NULL) return 1;
- if (lua_addfile (fn)) return 1;
- return 0;
+ if (fp == NULL)
+ {
+ static char buff[32];
+ sprintf(buff, "unable to open file %.10s", fn);
+ return buff;
+ }
+ return lua_addfile (fn);
}
/*
@@ -86,7 +94,7 @@ void lua_closefile (void)
/*
** Function to open a string to be input unit
*/
-int lua_openstring (char *s)
+char *lua_openstring (char *s)
{
lua_linenumber = 1;
lua_setinput (stringinput);
@@ -94,9 +102,8 @@ int lua_openstring (char *s)
{
char sn[64];
sprintf (sn, "String: %10.10s...", s);
- if (lua_addfile (sn)) return 1;
+ return lua_addfile (sn);
}
- return 0;
}
/*
@@ -107,40 +114,38 @@ void lua_closestring (void)
lua_delfile();
}
-/*
-** Call user function to handle error messages, if registred. Or report error
-** using standard function (fprintf).
-*/
-void lua_error (char *s)
-{
- if (usererror != NULL) usererror (s);
- else fprintf (stderr, "lua: %s\n", s);
-}
/*
** Called to execute SETFUNCTION opcode, this function pushs a function into
-** function stack. Return 0 on success or 1 on error.
+** function stack.
*/
-int lua_pushfunction (int file, int function)
+void lua_pushfunction (char *file, Word function)
{
- if (nfuncstack >= MAXFUNCSTACK-1)
+ FuncStackNode *newNode;
+ if (nfuncstack++ >= MAXFUNCSTACK)
{
- lua_error ("function stack overflow");
- return 1;
+ lua_reportbug("function stack overflow");
}
- funcstack[nfuncstack].file = file;
- funcstack[nfuncstack].function = function;
- nfuncstack++;
- return 0;
+ newNode = new(FuncStackNode);
+ newNode->function = function;
+ newNode->file = file;
+ newNode->line= lua_debugline;
+ newNode->next = funcStack;
+ funcStack = newNode;
}
/*
-** Called to execute RESET opcode, this function pops a function from
+** Called to execute RESET opcode, this function pops a function from
** function stack.
*/
void lua_popfunction (void)
{
- nfuncstack--;
+ FuncStackNode *temp = funcStack;
+ if (temp == NULL) return;
+ --nfuncstack;
+ lua_debugline = temp->line;
+ funcStack = temp->next;
+ luaI_free(temp);
}
/*
@@ -148,30 +153,142 @@ void lua_popfunction (void)
*/
void lua_reportbug (char *s)
{
- char msg[1024];
+ char msg[MAXFUNCSTACK*80];
strcpy (msg, s);
if (lua_debugline != 0)
{
- int i;
- if (nfuncstack > 0)
+ if (funcStack)
{
- sprintf (strchr(msg,0),
- "\n\tin statement begining at line %d in function \"%s\" of file \"%s\"",
- lua_debugline, s_name(funcstack[nfuncstack-1].function),
- lua_file[funcstack[nfuncstack-1].file]);
- sprintf (strchr(msg,0), "\n\tactive stack\n");
- for (i=nfuncstack-1; i>=0; i--)
- sprintf (strchr(msg,0), "\t-> function \"%s\" of file \"%s\"\n",
- s_name(funcstack[i].function),
- lua_file[funcstack[i].file]);
+ FuncStackNode *func = funcStack;
+ int line = lua_debugline;
+ sprintf (strchr(msg,0), "\n\tactive stack:\n");
+ do
+ {
+ sprintf (strchr(msg,0),
+ "\t-> function \"%s\" at file \"%s\":%u\n",
+ lua_constant[func->function]->str, func->file, line);
+ line = func->line;
+ func = func->next;
+ lua_popfunction();
+ } while (func);
}
else
{
sprintf (strchr(msg,0),
- "\n\tin statement begining at line %d of file \"%s\"",
+ "\n\tin statement begining at line %u of file \"%s\"",
lua_debugline, lua_filename());
}
}
lua_error (msg);
}
+
+/*
+** Internal function: do a string
+*/
+void lua_internaldostring (void)
+{
+ lua_Object obj = lua_getparam (1);
+ if (lua_isstring(obj) && !lua_dostring(lua_getstring(obj)))
+ lua_pushnumber(1);
+ else
+ lua_pushnil();
+}
+
+/*
+** Internal function: do a file
+*/
+void lua_internaldofile (void)
+{
+ lua_Object obj = lua_getparam (1);
+ if (lua_isstring(obj) && !lua_dofile(lua_getstring(obj)))
+ lua_pushnumber(1);
+ else
+ lua_pushnil();
+}
+
+/*
+** Internal function: print object values
+*/
+void lua_print (void)
+{
+ int i=1;
+ lua_Object obj;
+ while ((obj=lua_getparam (i++)) != LUA_NOOBJECT)
+ {
+ if (lua_isnumber(obj)) printf("%g\n",lua_getnumber(obj));
+ else if (lua_isstring(obj)) printf("%s\n",lua_getstring(obj));
+ else if (lua_isfunction(obj)) printf("function: %p\n",bvalue(luaI_Address(obj)));
+ else if (lua_iscfunction(obj)) printf("cfunction: %p\n",lua_getcfunction(obj)
+);
+ else if (lua_isuserdata(obj)) printf("userdata: %p\n",lua_getuserdata(obj));
+ else if (lua_istable(obj)) printf("table: %p\n",avalue(luaI_Address(obj)));
+ else if (lua_isnil(obj)) printf("nil\n");
+ else printf("invalid value to print\n");
+ }
+}
+
+
+/*
+** Internal function: return an object type.
+*/
+void luaI_type (void)
+{
+ lua_Object o = lua_getparam(1);
+ if (o == LUA_NOOBJECT)
+ lua_error("no parameter to function 'type'");
+ switch (lua_type(o))
+ {
+ case LUA_T_NIL :
+ lua_pushliteral("nil");
+ break;
+ case LUA_T_NUMBER :
+ lua_pushliteral("number");
+ break;
+ case LUA_T_STRING :
+ lua_pushliteral("string");
+ break;
+ case LUA_T_ARRAY :
+ lua_pushliteral("table");
+ break;
+ case LUA_T_FUNCTION :
+ lua_pushliteral("function");
+ break;
+ case LUA_T_CFUNCTION :
+ lua_pushliteral("cfunction");
+ break;
+ default :
+ lua_pushliteral("userdata");
+ break;
+ }
+}
+
+/*
+** Internal function: convert an object to a number
+*/
+void lua_obj2number (void)
+{
+ lua_Object o = lua_getparam(1);
+ if (lua_isnumber(o))
+ lua_pushobject(o);
+ else if (lua_isstring(o))
+ {
+ char c;
+ float f;
+ if (sscanf(lua_getstring(o),"%f %c",&f,&c) == 1)
+ lua_pushnumber(f);
+ else
+ lua_pushnil();
+ }
+ else
+ lua_pushnil();
+}
+
+
+void luaI_error (void)
+{
+ char *s = lua_getstring(lua_getparam(1));
+ if (s == NULL) s = "(no message)";
+ lua_reportbug(s);
+}
+
diff --git a/src/inout.h b/src/inout.h
index ca5920ca..22093020 100644
--- a/src/inout.h
+++ b/src/inout.h
@@ -1,21 +1,30 @@
/*
-** $Id: inout.h,v 1.1 1993/12/17 18:41:19 celes Exp $
+** $Id: inout.h,v 1.7 1994/12/20 21:20:36 roberto Exp $
*/
#ifndef inout_h
#define inout_h
-extern int lua_linenumber;
-extern int lua_debug;
-extern int lua_debugline;
+#include "types.h"
-int lua_openfile (char *fn);
+extern Word lua_linenumber;
+extern Bool lua_debug;
+extern Word lua_debugline;
+
+char *lua_openfile (char *fn);
void lua_closefile (void);
-int lua_openstring (char *s);
+char *lua_openstring (char *s);
void lua_closestring (void);
-int lua_pushfunction (int file, int function);
+void lua_pushfunction (char *file, Word function);
void lua_popfunction (void);
void lua_reportbug (char *s);
+void lua_internaldofile (void);
+void lua_internaldostring (void);
+void lua_print (void);
+void luaI_type (void);
+void lua_obj2number (void);
+void luaI_error (void);
+
#endif
diff --git a/src/lex.c b/src/lex.c
index 14f41434..2916084f 100644
--- a/src/lex.c
+++ b/src/lex.c
@@ -1,30 +1,20 @@
-char *rcs_lex = "$Id: lex.c,v 2.1 1994/04/15 19:00:28 celes Exp $";
-/*$Log: lex.c,v $
- * Revision 2.1 1994/04/15 19:00:28 celes
- * Retirar chamada da funcao lua_findsymbol associada a cada
- * token NAME. A decisao de chamar lua_findsymbol ou lua_findconstant
- * fica a cargo do modulo "lua.stx".
- *
- * Revision 1.3 1993/12/28 16:42:29 roberto
- * "include"s de string.h e stdlib.h para evitar warnings
- *
- * Revision 1.2 1993/12/22 21:39:15 celes
- * Tratamento do token $debug e $nodebug
- *
- * Revision 1.1 1993/12/22 21:15:16 roberto
- * Initial revision
- **/
+char *rcs_lex = "$Id: lex.c,v 2.14 1994/12/27 20:50:38 celes Exp $";
+
#include <ctype.h>
#include <math.h>
+#include <stdio.h>
#include <stdlib.h>
#include <string.h>
+#include "tree.h"
+#include "table.h"
#include "opcode.h"
-#include "hash.h"
#include "inout.h"
-#include "table.h"
-#include "y.tab.h"
+#include "parser.h"
+#include "ugly.h"
+
+#define lua_strcmp(a,b) (a[0]<b[0]?(-1):(a[0]>b[0]?(1):strcmp(a,b)))
#define next() { current = input(); }
#define save(x) { *yytextLast++ = (x); }
@@ -49,7 +39,8 @@ char *lua_lasttext (void)
}
-static struct
+/* The reserved words must be listed in lexicographic order */
+static struct
{
char *name;
int token;
@@ -71,17 +62,18 @@ static struct
{"until", UNTIL},
{"while", WHILE} };
+
#define RESERVEDSIZE (sizeof(reserved)/sizeof(reserved[0]))
-int findReserved (char *name)
+static int findReserved (char *name)
{
int l = 0;
int h = RESERVEDSIZE - 1;
while (l <= h)
{
int m = (l+h)/2;
- int comp = strcmp(name, reserved[m].name);
+ int comp = lua_strcmp(name, reserved[m].name);
if (comp < 0)
h = m-1;
else if (comp == 0)
@@ -93,13 +85,20 @@ int findReserved (char *name)
}
-int yylex ()
+int yylex (void)
{
+ float a;
while (1)
{
yytextLast = yytext;
+#if 0
+ fprintf(stderr,"'%c' %d\n",current,current);
+#endif
switch (current)
{
+ case EOF:
+ case 0:
+ return 0;
case '\n': lua_linenumber++;
case ' ':
case '\t':
@@ -111,34 +110,39 @@ int yylex ()
while (isalnum(current) || current == '_')
save_and_next();
*yytextLast = 0;
- if (strcmp(yytext, "debug") == 0)
+ if (lua_strcmp(yytext, "debug") == 0)
{
yylval.vInt = 1;
return DEBUG;
}
- else if (strcmp(yytext, "nodebug") == 0)
+ else if (lua_strcmp(yytext, "nodebug") == 0)
{
yylval.vInt = 0;
return DEBUG;
}
return WRONGTOKEN;
-
+
case '-':
save_and_next();
if (current != '-') return '-';
do { next(); } while (current != '\n' && current != 0);
continue;
-
+
+ case '=':
+ save_and_next();
+ if (current != '=') return '=';
+ else { save_and_next(); return EQ; }
+
case '<':
save_and_next();
if (current != '=') return '<';
else { save_and_next(); return LE; }
-
+
case '>':
save_and_next();
if (current != '=') return '>';
else { save_and_next(); return GE; }
-
+
case '~':
save_and_next();
if (current != '=') return '~';
@@ -149,12 +153,13 @@ int yylex ()
{
int del = current;
next(); /* skip the delimiter */
- while (current != del)
+ while (current != del)
{
switch (current)
{
- case 0:
- case '\n':
+ case EOF:
+ case 0:
+ case '\n':
return WRONGTOKEN;
case '\\':
next(); /* do not save the '\' */
@@ -163,16 +168,16 @@ int yylex ()
case 'n': save('\n'); next(); break;
case 't': save('\t'); next(); break;
case 'r': save('\r'); next(); break;
- default : save('\\'); break;
+ default : save(current); next(); break;
}
break;
- default:
+ default:
save_and_next();
}
}
next(); /* skip the delimiter */
*yytextLast = 0;
- yylval.vWord = lua_findconstant (yytext);
+ yylval.vWord = luaI_findconstant(lua_constcreate(yytext));
return STRING;
}
@@ -190,49 +195,77 @@ int yylex ()
case 'Z':
case '_':
{
- int res;
+ Word res;
do { save_and_next(); } while (isalnum(current) || current == '_');
*yytextLast = 0;
res = findReserved(yytext);
if (res) return res;
- yylval.pChar = yytext;
+ yylval.pNode = lua_constcreate(yytext);
return NAME;
}
-
+
case '.':
save_and_next();
- if (current == '.')
- {
- save_and_next();
+ if (current == '.')
+ {
+ save_and_next();
return CONC;
}
else if (!isdigit(current)) return '.';
/* current is a digit: goes through to number */
+ a=0.0;
goto fraction;
case '0': case '1': case '2': case '3': case '4':
case '5': case '6': case '7': case '8': case '9':
-
- do { save_and_next(); } while (isdigit(current));
+ a=0.0;
+ do { a=10*a+current-'0'; save_and_next(); } while (isdigit(current));
if (current == '.') save_and_next();
-fraction: while (isdigit(current)) save_and_next();
- if (current == 'e' || current == 'E')
- {
- save_and_next();
- if (current == '+' || current == '-') save_and_next();
- if (!isdigit(current)) return WRONGTOKEN;
- do { save_and_next(); } while (isdigit(current));
+fraction:
+ { float da=0.1;
+ while (isdigit(current))
+ {a+=(current-'0')*da; da/=10.0; save_and_next()};
+ if (current == 'e' || current == 'E')
+ {
+ int e=0;
+ int neg;
+ float ea;
+ save_and_next();
+ neg=(current=='-');
+ if (current == '+' || current == '-') save_and_next();
+ if (!isdigit(current)) return WRONGTOKEN;
+ do { e=10*e+current-'0'; save_and_next(); } while (isdigit(current));
+ for (ea=neg?0.1:10.0; e>0; e>>=1)
+ {
+ if (e & 1) a*=ea;
+ ea*=ea;
+ }
+ }
+ yylval.vFloat = a;
+ return NUMBER;
}
- *yytextLast = 0;
- yylval.vFloat = atof(yytext);
- return NUMBER;
+
+ case U_and: case U_do: case U_else: case U_elseif: case U_end:
+ case U_function: case U_if: case U_local: case U_nil: case U_not:
+ case U_or: case U_repeat: case U_return: case U_then:
+ case U_until: case U_while:
+ {
+ int old = current;
+ next();
+ return reserved[old-U_and].token;
+ }
+
+ case U_eq: next(); return EQ;
+ case U_le: next(); return LE;
+ case U_ge: next(); return GE;
+ case U_ne: next(); return NE;
+ case U_sc: next(); return CONC;
default: /* also end of file */
{
save_and_next();
- return *yytext;
+ return yytext[0];
}
}
}
}
-
diff --git a/src/mem.c b/src/mem.c
new file mode 100644
index 00000000..90369720
--- /dev/null
+++ b/src/mem.c
@@ -0,0 +1,44 @@
+/*
+** mem.c
+** TecCGraf - PUC-Rio
+*/
+
+char *rcs_mem = "$Id: mem.c,v 1.5 1995/02/06 19:34:03 roberto Exp $";
+
+#include <stdlib.h>
+#include <string.h>
+
+#include "mem.h"
+#include "lua.h"
+
+void luaI_free (void *block)
+{
+ *((int *)block) = -1; /* to catch errors */
+ free(block);
+}
+
+
+void *luaI_malloc (unsigned long size)
+{
+ void *block = malloc((size_t)size);
+ if (block == NULL)
+ lua_error("not enough memory");
+ return block;
+}
+
+
+void *luaI_realloc (void *oldblock, unsigned long size)
+{
+ void *block = realloc(oldblock, (size_t)size);
+ if (block == NULL)
+ lua_error("not enough memory");
+ return block;
+}
+
+
+char *luaI_strdup (char *str)
+{
+ char *newstr = luaI_malloc(strlen(str)+1);
+ strcpy(newstr, str);
+ return newstr;
+}
diff --git a/src/mem.h b/src/mem.h
new file mode 100644
index 00000000..bae5b4d3
--- /dev/null
+++ b/src/mem.h
@@ -0,0 +1,25 @@
+/*
+** mem.c
+** memory manager for lua
+** $Id: mem.h,v 1.2 1995/01/13 22:11:12 roberto Exp $
+*/
+
+#ifndef mem_h
+#define mem_h
+
+#ifndef NULL
+#define NULL 0
+#endif
+
+void luaI_free (void *block);
+void *luaI_malloc (unsigned long size);
+void *luaI_realloc (void *oldblock, unsigned long size);
+
+char *luaI_strdup (char *str);
+
+#define new(s) ((s *)luaI_malloc(sizeof(s)))
+#define newvector(n,s) ((s *)luaI_malloc((n)*sizeof(s)))
+#define growvector(old,n,s) ((s *)luaI_realloc(old,(n)*sizeof(s)))
+
+#endif
+
diff --git a/src/opcode.c b/src/opcode.c
index 6006f7ac..7ce5b2a6 100644
--- a/src/opcode.c
+++ b/src/opcode.c
@@ -3,171 +3,763 @@
** TecCGraf - PUC-Rio
*/
-char *rcs_opcode="$Id: opcode.c,v 2.1 1994/04/20 22:07:57 celes Exp $";
+char *rcs_opcode="$Id: opcode.c,v 3.34 1995/02/06 19:35:09 roberto Exp $";
-#include <stdio.h>
+#include <setjmp.h>
#include <stdlib.h>
+#include <stdio.h>
#include <string.h>
+#include <math.h>
-/* stdlib.h does not have this in SunOS */
-extern double strtod(const char *, char **);
-
-#include "mm.h"
-
+#include "mem.h"
#include "opcode.h"
#include "hash.h"
#include "inout.h"
#include "table.h"
#include "lua.h"
+#include "fallback.h"
+
+#define tonumber(o) ((tag(o) != LUA_T_NUMBER) && (lua_tonumber(o) != 0))
+#define tostring(o) ((tag(o) != LUA_T_STRING) && (lua_tostring(o) != 0))
+
+
+#define STACK_BUFFER (STACKGAP+128)
+
+typedef int StkId; /* index to stack elements */
+
+static Long maxstack = 0L;
+static Object *stack = NULL;
+static Object *top = NULL;
+
+
+/* macros to convert from lua_Object to (Object *) and back */
+
+#define Address(lo) ((lo)+stack-1)
+#define Ref(st) ((st)-stack+1)
+
+
+static StkId CBase = 0; /* when Lua calls C or C calls Lua, points to */
+ /* the first slot after the last parameter. */
+static int CnResults = 0; /* when Lua calls C, has the number of parameters; */
+ /* when C calls Lua, has the number of results. */
-#define tonumber(o) ((tag(o) != T_NUMBER) && (lua_tonumber(o) != 0))
-#define tostring(o) ((tag(o) != T_STRING) && (lua_tostring(o) != 0))
+static jmp_buf *errorJmp = NULL; /* current error recover point */
-#ifndef MAXSTACK
-#define MAXSTACK 256
-#endif
-static Object stack[MAXSTACK] = {{T_MARK, {NULL}}};
-static Object *top=stack+1, *base=stack+1;
+
+static StkId lua_execute (Byte *pc, StkId base);
+static void do_call (Object *func, StkId base, int nResults, StkId whereRes);
+
+
+
+Object *luaI_Address (lua_Object o)
+{
+ return Address(o);
+}
/*
-** Concatenate two given string, creating a mark space at the beginning.
-** Return the new string pointer.
+** Error messages
*/
-static char *lua_strconc (char *l, char *r)
+
+static void lua_message (char *s)
{
- char *s = calloc (strlen(l)+strlen(r)+2, sizeof(char));
- if (s == NULL)
- {
- lua_error ("not enough memory");
- return NULL;
- }
- *s++ = 0; /* create mark space */
- return strcat(strcpy(s,l),r);
+ lua_pushstring(s);
+ do_call(&luaI_fallBacks[FB_ERROR].function, (top-stack)-1, 0, (top-stack)-1);
}
/*
-** Duplicate a string, creating a mark space at the beginning.
-** Return the new string pointer.
+** Reports an error, and jumps up to the available recover label
*/
-char *lua_strdup (char *l)
+void lua_error (char *s)
{
- char *s = calloc (strlen(l)+2, sizeof(char));
- if (s == NULL)
- {
- lua_error ("not enough memory");
- return NULL;
- }
- *s++ = 0; /* create mark space */
- return strcpy(s,l);
+ if (s) lua_message(s);
+ if (errorJmp)
+ longjmp(*errorJmp, 1);
+ else
+ {
+ fprintf (stderr, "lua: exit(1). Unable to recover\n");
+ exit(1);
+ }
}
+
/*
-** Convert, if possible, to a number tag.
-** Return 0 in success or not 0 on error.
-*/
-static int lua_tonumber (Object *obj)
+** Init stack
+*/
+static void lua_initstack (void)
{
- char *ptr;
- if (tag(obj) != T_STRING)
- {
- lua_reportbug ("unexpected type at conversion to number");
- return 1;
- }
- nvalue(obj) = strtod(svalue(obj), &ptr);
- if (*ptr)
- {
- lua_reportbug ("string to number convertion failed");
- return 2;
- }
- tag(obj) = T_NUMBER;
- return 0;
+ maxstack = STACK_BUFFER;
+ stack = newvector(maxstack, Object);
+ top = stack;
}
+
/*
-** Test if is possible to convert an object to a number one.
-** If possible, return the converted object, otherwise return nil object.
-*/
-static Object *lua_convtonumber (Object *obj)
+** Check stack overflow and, if necessary, realloc vector
+*/
+#define lua_checkstack(n) if ((Long)(n) > maxstack) checkstack(n)
+
+static void checkstack (StkId n)
{
- static Object cvt;
-
- if (tag(obj) == T_NUMBER)
- {
- cvt = *obj;
- return &cvt;
- }
-
- tag(&cvt) = T_NIL;
- if (tag(obj) == T_STRING)
+ StkId t;
+ if (stack == NULL)
+ lua_initstack();
+ if (maxstack >= MAX_INT)
+ lua_error("stack size overflow");
+ t = top-stack;
+ maxstack *= 2;
+ if (maxstack >= MAX_INT)
+ maxstack = MAX_INT;
+ stack = growvector(stack, maxstack, Object);
+ top = stack + t;
+}
+
+
+/*
+** Concatenate two given strings. Return the new string pointer.
+*/
+static char *lua_strconc (char *l, char *r)
+{
+ static char *buffer = NULL;
+ static int buffer_size = 0;
+ int nl = strlen(l);
+ int n = nl+strlen(r)+1;
+ if (n > buffer_size)
+ {
+ buffer_size = n;
+ if (buffer != NULL)
+ luaI_free(buffer);
+ buffer = newvector(buffer_size, char);
+ }
+ strcpy(buffer,l);
+ strcpy(buffer+nl, r);
+ return buffer;
+}
+
+
+/*
+** Convert, if possible, to a number object.
+** Return 0 if success, not 0 if error.
+*/
+static int lua_tonumber (Object *obj)
+{
+ float t;
+ char c;
+ if (tag(obj) != LUA_T_STRING)
+ return 1;
+ else if (sscanf(svalue(obj), "%f %c",&t, &c) == 1)
{
- char *ptr;
- nvalue(&cvt) = strtod(svalue(obj), &ptr);
- if (*ptr == 0)
- tag(&cvt) = T_NUMBER;
+ nvalue(obj) = t;
+ tag(obj) = LUA_T_NUMBER;
+ return 0;
}
- return &cvt;
+ else
+ return 2;
}
-
/*
** Convert, if possible, to a string tag
** Return 0 in success or not 0 on error.
-*/
+*/
static int lua_tostring (Object *obj)
{
static char s[256];
- if (tag(obj) != T_NUMBER)
- {
- lua_reportbug ("unexpected type at conversion to string");
- return 1;
- }
+ if (tag(obj) != LUA_T_NUMBER)
+ return 1;
if ((int) nvalue(obj) == nvalue(obj))
- sprintf (s, "%d", (int) nvalue(obj));
+ sprintf (s, "%d", (int) nvalue(obj));
else
- sprintf (s, "%g", nvalue(obj));
- svalue(obj) = lua_createstring(lua_strdup(s));
- if (svalue(obj) == NULL)
+ sprintf (s, "%g", nvalue(obj));
+ tsvalue(obj) = lua_createstring(s);
+ if (tsvalue(obj) == NULL)
return 1;
- tag(obj) = T_STRING;
+ tag(obj) = LUA_T_STRING;
return 0;
}
/*
-** Execute the given opcode. Return 0 in success or 1 on error.
+** Adjust stack. Set top to the given value, pushing NILs if needed.
+*/
+static void adjust_top (StkId newtop)
+{
+ Object *nt = stack+newtop;
+ while (top < nt) tag(top++) = LUA_T_NIL;
+ top = nt; /* top could be bigger than newtop */
+}
+
+
+static void adjustC (int nParams)
+{
+ adjust_top(CBase+nParams);
+}
+
+
+/*
+** Call a C function. CBase will point to the top of the stack,
+** and CnResults is the number of parameters. Returns an index
+** to the first result from C.
+*/
+static StkId callC (lua_CFunction func, StkId base)
+{
+ StkId oldBase = CBase;
+ int oldCnResults = CnResults;
+ StkId firstResult;
+ CnResults = (top-stack) - base;
+ /* incorporate parameters on the stack */
+ CBase = base+CnResults;
+ (*func)();
+ firstResult = CBase;
+ CBase = oldBase;
+ CnResults = oldCnResults;
+ return firstResult;
+}
+
+/*
+** Call the fallback for invalid functions (see do_call)
+*/
+static void call_funcFB (Object *func, StkId base, int nResults, StkId whereRes)
+{
+ StkId i;
+ /* open space for first parameter (func) */
+ for (i=top-stack; i>base; i--)
+ stack[i] = stack[i-1];
+ top++;
+ stack[base] = *func;
+ do_call(&luaI_fallBacks[FB_FUNCTION].function, base, nResults, whereRes);
+}
+
+
+/*
+** Call a function (C or Lua). The parameters must be on the stack,
+** between [stack+base,top). When returns, the results are on the stack,
+** between [stack+whereRes,top). The number of results is nResults, unless
+** nResults=MULT_RET.
+*/
+static void do_call (Object *func, StkId base, int nResults, StkId whereRes)
+{
+ StkId firstResult;
+ if (tag(func) == LUA_T_CFUNCTION)
+ firstResult = callC(fvalue(func), base);
+ else if (tag(func) == LUA_T_FUNCTION)
+ firstResult = lua_execute(bvalue(func), base);
+ else
+ { /* func is not a function */
+ call_funcFB(func, base, nResults, whereRes);
+ return;
+ }
+ /* adjust the number of results */
+ if (nResults != MULT_RET && top - (stack+firstResult) != nResults)
+ adjust_top(firstResult+nResults);
+ /* move results to the given position */
+ if (firstResult != whereRes)
+ {
+ int i;
+ nResults = top - (stack+firstResult); /* actual number of results */
+ for (i=0; i<nResults; i++)
+ *(stack+whereRes+i) = *(stack+firstResult+i);
+ top -= firstResult-whereRes;
+ }
+}
+
+
+/*
+** Function to index a table. Receives the table at top-2 and the index
+** at top-1.
+*/
+static void pushsubscript (void)
+{
+ if (tag(top-2) != LUA_T_ARRAY)
+ do_call(&luaI_fallBacks[FB_GETTABLE].function, (top-stack)-2, 1, (top-stack)-2);
+ else
+ {
+ Object *h = lua_hashget(avalue(top-2), top-1);
+ if (h == NULL || tag(h) == LUA_T_NIL)
+ do_call(&luaI_fallBacks[FB_INDEX].function, (top-stack)-2, 1, (top-stack)-2);
+ else
+ {
+ --top;
+ *(top-1) = *h;
+ }
+ }
+}
+
+
+/*
+** Function to store indexed based on values at the top
+*/
+static void storesubscript (void)
+{
+ if (tag(top-3) != LUA_T_ARRAY)
+ do_call(&luaI_fallBacks[FB_SETTABLE].function, (top-stack)-3, 0, (top-stack)-3);
+ else
+ {
+ Object *h = lua_hashdefine (avalue(top-3), top-2);
+ *h = *(top-1);
+ top -= 3;
+ }
+}
+
+
+/*
+** Traverse all objects on stack
+*/
+void lua_travstack (void (*fn)(Object *))
+{
+ Object *o;
+ for (o = top-1; o >= stack; o--)
+ fn (o);
+}
+
+
+/*
+** Execute a protected call. If function is null compiles the pre-set input.
+** Leave nResults on the stack.
+*/
+static int do_protectedrun (Object *function, int nResults)
+{
+ jmp_buf myErrorJmp;
+ int status;
+ StkId oldCBase = CBase;
+ jmp_buf *oldErr = errorJmp;
+ errorJmp = &myErrorJmp;
+ if (setjmp(myErrorJmp) == 0)
+ {
+ do_call(function, CBase, nResults, CBase);
+ CnResults = (top-stack) - CBase; /* number of results */
+ CBase += CnResults; /* incorporate results on the stack */
+ status = 0;
+ }
+ else
+ {
+ CBase = oldCBase;
+ top = stack+CBase;
+ status = 1;
+ }
+ errorJmp = oldErr;
+ return status;
+}
+
+
+static int do_protectedmain (void)
+{
+ Byte *code = NULL;
+ int status;
+ StkId oldCBase = CBase;
+ jmp_buf myErrorJmp;
+ jmp_buf *oldErr = errorJmp;
+ errorJmp = &myErrorJmp;
+ if (setjmp(myErrorJmp) == 0)
+ {
+ Object f;
+ lua_parse(&code);
+ tag(&f) = LUA_T_FUNCTION; bvalue(&f) = code;
+ do_call(&f, CBase, 0, CBase);
+ status = 0;
+ }
+ else
+ status = 1;
+ if (code)
+ luaI_free(code);
+ errorJmp = oldErr;
+ CBase = oldCBase;
+ top = stack+CBase;
+ return status;
+}
+
+
+/*
+** Execute the given lua function. Return 0 on success or 1 on error.
+*/
+int lua_callfunction (lua_Object function)
+{
+ if (function == LUA_NOOBJECT)
+ return 1;
+ else
+ return do_protectedrun (Address(function), MULT_RET);
+}
+
+
+int lua_call (char *funcname)
+{
+ Word n = luaI_findsymbolbyname(funcname);
+ return do_protectedrun(&s_object(n), MULT_RET);
+}
+
+
+/*
+** Open file, generate opcode and execute global statement. Return 0 on
+** success or 1 on error.
+*/
+int lua_dofile (char *filename)
+{
+ int status;
+ char *message = lua_openfile (filename);
+ if (message)
+ {
+ lua_message(message);
+ return 1;
+ }
+ status = do_protectedmain();
+ lua_closefile();
+ return status;
+}
+
+/*
+** Generate opcode stored on string and execute global statement. Return 0 on
+** success or 1 on error.
+*/
+int lua_dostring (char *string)
+{
+ int status;
+ char *message = lua_openstring(string);
+ if (message)
+ {
+ lua_message(message);
+ return 1;
+ }
+ status = do_protectedmain();
+ lua_closestring();
+ return status;
+}
+
+
+/*
+** API: set a function as a fallback
+*/
+lua_Object lua_setfallback (char *name, lua_CFunction fallback)
+{
+ static Object func = {LUA_T_CFUNCTION, luaI_setfallback};
+ adjustC(0);
+ lua_pushstring(name);
+ lua_pushcfunction(fallback);
+ do_protectedrun(&func, 1);
+ return (Ref(top-1));
+}
+
+
+/*
+** API: receives on the stack the table and the index.
+** returns the value.
+*/
+lua_Object lua_getsubscript (void)
+{
+ adjustC(2);
+ pushsubscript();
+ CBase++; /* incorporate object in the stack */
+ return (Ref(top-1));
+}
+
+
+#define MAX_C_BLOCKS 10
+
+static int numCblocks = 0;
+static StkId Cblocks[MAX_C_BLOCKS];
+
+/*
+** API: starts a new block
+*/
+void lua_beginblock (void)
+{
+ if (numCblocks < MAX_C_BLOCKS)
+ Cblocks[numCblocks] = CBase;
+ numCblocks++;
+}
+
+/*
+** API: ends a block
+*/
+void lua_endblock (void)
+{
+ --numCblocks;
+ if (numCblocks < MAX_C_BLOCKS)
+ {
+ CBase = Cblocks[numCblocks];
+ adjustC(0);
+ }
+}
+
+/*
+** API: receives on the stack the table, the index, and the new value.
+*/
+void lua_storesubscript (void)
+{
+ adjustC(3);
+ storesubscript();
+}
+
+/*
+** API: creates a new table
+*/
+lua_Object lua_createtable (void)
+{
+ adjustC(0);
+ avalue(top) = lua_createarray(0);
+ tag(top) = LUA_T_ARRAY;
+ top++;
+ CBase++; /* incorporate object in the stack */
+ return Ref(top-1);
+}
+
+/*
+** Get a parameter, returning the object handle or LUA_NOOBJECT on error.
+** 'number' must be 1 to get the first parameter.
+*/
+lua_Object lua_getparam (int number)
+{
+ if (number <= 0 || number > CnResults) return LUA_NOOBJECT;
+ /* Ref(stack+(CBase-CnResults+number-1)) ==
+ stack+(CBase-CnResults+number-1)-stack+1 == */
+ return CBase-CnResults+number;
+}
+
+/*
+** Given an object handle, return its number value. On error, return 0.0.
+*/
+real lua_getnumber (lua_Object object)
+{
+ if (object == LUA_NOOBJECT || tag(Address(object)) == LUA_T_NIL) return 0.0;
+ if (tonumber (Address(object))) return 0.0;
+ else return (nvalue(Address(object)));
+}
+
+/*
+** Given an object handle, return its string pointer. On error, return NULL.
+*/
+char *lua_getstring (lua_Object object)
+{
+ if (object == LUA_NOOBJECT || tag(Address(object)) == LUA_T_NIL) return NULL;
+ if (tostring (Address(object))) return NULL;
+ else return (svalue(Address(object)));
+}
+
+/*
+** Given an object handle, return its cfuntion pointer. On error, return NULL.
+*/
+lua_CFunction lua_getcfunction (lua_Object object)
+{
+ if (object == LUA_NOOBJECT || tag(Address(object)) != LUA_T_CFUNCTION)
+ return NULL;
+ else return (fvalue(Address(object)));
+}
+
+/*
+** Given an object handle, return its user data. On error, return NULL.
+*/
+void *lua_getuserdata (lua_Object object)
+{
+ if (object == LUA_NOOBJECT || tag(Address(object)) < LUA_T_USERDATA)
+ return NULL;
+ else return (uvalue(Address(object)));
+}
+
+
+lua_Object lua_getlocked (int ref)
+{
+ adjustC(0);
+ *top = *luaI_getlocked(ref);
+ top++;
+ CBase++; /* incorporate object in the stack */
+ return Ref(top-1);
+}
+
+
+void lua_pushlocked (int ref)
+{
+ lua_checkstack(top-stack+1);
+ *top = *luaI_getlocked(ref);
+ top++;
+}
+
+
+int lua_lock (void)
+{
+ adjustC(1);
+ return luaI_lock(--top);
+}
+
+
+/*
+** Get a global object. Return the object handle or NULL on error.
+*/
+lua_Object lua_getglobal (char *name)
+{
+ Word n = luaI_findsymbolbyname(name);
+ adjustC(0);
+ *top = s_object(n);
+ top++;
+ CBase++; /* incorporate object in the stack */
+ return Ref(top-1);
+}
+
+/*
+** Store top of the stack at a global variable array field.
+*/
+void lua_storeglobal (char *name)
+{
+ Word n = luaI_findsymbolbyname(name);
+ adjustC(1);
+ s_object(n) = *(--top);
+}
+
+/*
+** Push a nil object
+*/
+void lua_pushnil (void)
+{
+ lua_checkstack(top-stack+1);
+ tag(top++) = LUA_T_NIL;
+}
+
+/*
+** Push an object (tag=number) to stack.
+*/
+void lua_pushnumber (real n)
+{
+ lua_checkstack(top-stack+1);
+ tag(top) = LUA_T_NUMBER; nvalue(top++) = n;
+}
+
+/*
+** Push an object (tag=string) to stack.
+*/
+void lua_pushstring (char *s)
+{
+ lua_checkstack(top-stack+1);
+ tsvalue(top) = lua_createstring(s);
+ tag(top) = LUA_T_STRING;
+ top++;
+}
+
+/*
+** Push an object (tag=string) on stack and register it on the constant table.
+*/
+void lua_pushliteral (char *s)
+{
+ lua_checkstack(top-stack+1);
+ tsvalue(top) = lua_constant[luaI_findconstant(lua_constcreate(s))];
+ tag(top) = LUA_T_STRING;
+ top++;
+}
+
+/*
+** Push an object (tag=cfunction) to stack.
+*/
+void lua_pushcfunction (lua_CFunction fn)
+{
+ lua_checkstack(top-stack+1);
+ tag(top) = LUA_T_CFUNCTION; fvalue(top++) = fn;
+}
+
+/*
+** Push an object (tag=userdata) to stack.
+*/
+void lua_pushusertag (void *u, int tag)
+{
+ if (tag < LUA_T_USERDATA) return;
+ lua_checkstack(top-stack+1);
+ tag(top) = tag; uvalue(top++) = u;
+}
+
+/*
+** Push a lua_Object to stack.
+*/
+void lua_pushobject (lua_Object o)
+{
+ lua_checkstack(top-stack+1);
+ *top++ = *Address(o);
+}
+
+/*
+** Push an object on the stack.
+*/
+void luaI_pushobject (Object *o)
+{
+ lua_checkstack(top-stack+1);
+ *top++ = *o;
+}
+
+int lua_type (lua_Object o)
+{
+ if (o == LUA_NOOBJECT)
+ return LUA_T_NIL;
+ else
+ return tag(Address(o));
+}
+
+
+void luaI_gcFB (Object *o)
+{
+ *(top++) = *o;
+ do_call(&luaI_fallBacks[FB_GC].function, (top-stack)-1, 0, (top-stack)-1);
+}
+
+
+static void call_arith (char *op)
+{
+ lua_pushstring(op);
+ do_call(&luaI_fallBacks[FB_ARITH].function, (top-stack)-3, 1, (top-stack)-3);
+}
+
+static void comparison (lua_Type tag_less, lua_Type tag_equal,
+ lua_Type tag_great, char *op)
+{
+ Object *l = top-2;
+ Object *r = top-1;
+ int result;
+ if (tag(l) == LUA_T_NUMBER && tag(r) == LUA_T_NUMBER)
+ result = (nvalue(l) < nvalue(r)) ? -1 : (nvalue(l) == nvalue(r)) ? 0 : 1;
+ else if (tostring(l) || tostring(r))
+ {
+ lua_pushstring(op);
+ do_call(&luaI_fallBacks[FB_ORDER].function, (top-stack)-3, 1, (top-stack)-3);
+ return;
+ }
+ else
+ result = strcmp(svalue(l), svalue(r));
+ top--;
+ nvalue(top-1) = 1;
+ tag(top-1) = (result < 0) ? tag_less : (result == 0) ? tag_equal : tag_great;
+}
+
+
+
+/*
+** Execute the given opcode, until a RET. Parameters are between
+** [stack+base,top). Returns n such that the the results are between
+** [stack+n,top).
*/
-int lua_execute (Byte *pc)
+static StkId lua_execute (Byte *pc, StkId base)
{
- Object *oldbase = base;
- base = top;
+ lua_checkstack(STACKGAP+MAX_TEMPS+base);
while (1)
{
OpCode opcode;
switch (opcode = (OpCode)*pc++)
{
- case PUSHNIL: tag(top++) = T_NIL; break;
-
- case PUSH0: tag(top) = T_NUMBER; nvalue(top++) = 0; break;
- case PUSH1: tag(top) = T_NUMBER; nvalue(top++) = 1; break;
- case PUSH2: tag(top) = T_NUMBER; nvalue(top++) = 2; break;
-
- case PUSHBYTE: tag(top) = T_NUMBER; nvalue(top++) = *pc++; break;
-
- case PUSHWORD:
+ case PUSHNIL: tag(top++) = LUA_T_NIL; break;
+
+ case PUSH0: case PUSH1: case PUSH2:
+ tag(top) = LUA_T_NUMBER;
+ nvalue(top++) = opcode-PUSH0;
+ break;
+
+ case PUSHBYTE: tag(top) = LUA_T_NUMBER; nvalue(top++) = *pc++; break;
+
+ case PUSHWORD:
{
CodeWord code;
get_word(code,pc);
- tag(top) = T_NUMBER; nvalue(top++) = code.w;
+ tag(top) = LUA_T_NUMBER; nvalue(top++) = code.w;
}
break;
-
+
case PUSHFLOAT:
{
CodeFloat code;
get_float(code,pc);
- tag(top) = T_NUMBER; nvalue(top++) = code.f;
+ tag(top) = LUA_T_NUMBER; nvalue(top++) = code.f;
}
break;
@@ -175,50 +767,57 @@ int lua_execute (Byte *pc)
{
CodeWord code;
get_word(code,pc);
- tag(top) = T_STRING; svalue(top++) = lua_constant[code.w];
+ tag(top) = LUA_T_STRING; tsvalue(top++) = lua_constant[code.w];
}
break;
-
+
+ case PUSHFUNCTION:
+ {
+ CodeCode code;
+ get_code(code,pc);
+ tag(top) = LUA_T_FUNCTION; bvalue(top++) = code.b;
+ }
+ break;
+
case PUSHLOCAL0: case PUSHLOCAL1: case PUSHLOCAL2:
case PUSHLOCAL3: case PUSHLOCAL4: case PUSHLOCAL5:
case PUSHLOCAL6: case PUSHLOCAL7: case PUSHLOCAL8:
- case PUSHLOCAL9: *top++ = *(base + (int)(opcode-PUSHLOCAL0)); break;
-
- case PUSHLOCAL: *top++ = *(base + (*pc++)); break;
-
- case PUSHGLOBAL:
+ case PUSHLOCAL9: *top++ = *((stack+base) + (int)(opcode-PUSHLOCAL0)); break;
+
+ case PUSHLOCAL: *top++ = *((stack+base) + (*pc++)); break;
+
+ case PUSHGLOBAL:
{
CodeWord code;
get_word(code,pc);
*top++ = s_object(code.w);
}
break;
-
+
case PUSHINDEXED:
- --top;
- if (tag(top-1) != T_ARRAY)
- {
- lua_reportbug ("indexed expression not a table");
- return 1;
- }
- {
- Object *h = lua_hashdefine (avalue(top-1), top);
- if (h == NULL) return 1;
- *(top-1) = *h;
- }
- break;
-
- case PUSHMARK: tag(top++) = T_MARK; break;
-
- case PUSHOBJECT: *top = *(top-3); top++; break;
-
+ pushsubscript();
+ break;
+
+ case PUSHSELF:
+ {
+ Object receiver = *(top-1);
+ CodeWord code;
+ get_word(code,pc);
+ tag(top) = LUA_T_STRING; tsvalue(top++) = lua_constant[code.w];
+ pushsubscript();
+ *(top++) = receiver;
+ break;
+ }
+
case STORELOCAL0: case STORELOCAL1: case STORELOCAL2:
case STORELOCAL3: case STORELOCAL4: case STORELOCAL5:
case STORELOCAL6: case STORELOCAL7: case STORELOCAL8:
- case STORELOCAL9: *(base + (int)(opcode-STORELOCAL0)) = *(--top); break;
-
- case STORELOCAL: *(base + (*pc++)) = *(--top); break;
-
+ case STORELOCAL9:
+ *((stack+base) + (int)(opcode-STORELOCAL0)) = *(--top);
+ break;
+
+ case STORELOCAL: *((stack+base) + (*pc++)) = *(--top); break;
+
case STOREGLOBAL:
{
CodeWord code;
@@ -228,36 +827,29 @@ int lua_execute (Byte *pc)
break;
case STOREINDEXED0:
- if (tag(top-3) != T_ARRAY)
- {
- lua_reportbug ("indexed expression not a table");
- return 1;
- }
- {
- Object *h = lua_hashdefine (avalue(top-3), top-2);
- if (h == NULL) return 1;
- *h = *(top-1);
- }
- top -= 3;
- break;
-
+ storesubscript();
+ break;
+
case STOREINDEXED:
{
int n = *pc++;
- if (tag(top-3-n) != T_ARRAY)
+ if (tag(top-3-n) != LUA_T_ARRAY)
{
- lua_reportbug ("indexed expression not a table");
- return 1;
+ *(top+1) = *(top-1);
+ *(top) = *(top-2-n);
+ *(top-1) = *(top-3-n);
+ top += 2;
+ do_call(&luaI_fallBacks[FB_SETTABLE].function, (top-stack)-3, 0, (top-stack)-3);
}
+ else
{
Object *h = lua_hashdefine (avalue(top-3-n), top-2-n);
- if (h == NULL) return 1;
*h = *(top-1);
+ top--;
}
- top--;
}
break;
-
+
case STORELIST0:
case STORELIST:
{
@@ -267,206 +859,180 @@ int lua_execute (Byte *pc)
else m = *(pc++) * FIELDS_PER_FLUSH;
n = *(pc++);
arr = top-n-1;
- if (tag(arr) != T_ARRAY)
- {
- lua_reportbug ("internal error - table expected");
- return 1;
- }
while (n)
{
- tag(top) = T_NUMBER; nvalue(top) = n+m;
+ tag(top) = LUA_T_NUMBER; nvalue(top) = n+m;
*(lua_hashdefine (avalue(arr), top)) = *(top-1);
top--;
n--;
}
}
break;
-
+
case STORERECORD:
{
int n = *(pc++);
Object *arr = top-n-1;
- if (tag(arr) != T_ARRAY)
- {
- lua_reportbug ("internal error - table expected");
- return 1;
- }
while (n)
{
CodeWord code;
get_word(code,pc);
- tag(top) = T_STRING; svalue(top) = lua_constant[code.w];
+ tag(top) = LUA_T_STRING; tsvalue(top) = lua_constant[code.w];
*(lua_hashdefine (avalue(arr), top)) = *(top-1);
top--;
n--;
}
}
break;
-
+
+ case ADJUST0:
+ adjust_top(base);
+ break;
+
case ADJUST:
+ adjust_top(base + *(pc++));
+ break;
+
+ case CREATEARRAY:
{
- Object *newtop = base + *(pc++);
- while (top < newtop) tag(top++) = T_NIL;
- top = newtop; /* top could be bigger than newtop */
+ CodeWord size;
+ get_word(size,pc);
+ avalue(top) = lua_createarray(size.w);
+ tag(top) = LUA_T_ARRAY;
+ top++;
}
break;
-
- case CREATEARRAY:
- if (tag(top-1) == T_NIL)
- nvalue(top-1) = 101;
- else
- {
- if (tonumber(top-1)) return 1;
- if (nvalue(top-1) <= 0) nvalue(top-1) = 101;
- }
- avalue(top-1) = lua_createarray(nvalue(top-1));
- if (avalue(top-1) == NULL)
- return 1;
- tag(top-1) = T_ARRAY;
- break;
-
+
case EQOP:
{
- Object *l = top-2;
- Object *r = top-1;
+ int res = lua_equalObj(top-2, top-1);
--top;
- if (tag(l) != tag(r))
- tag(top-1) = T_NIL;
- else
- {
- switch (tag(l))
- {
- case T_NIL: tag(top-1) = T_NUMBER; break;
- case T_NUMBER: tag(top-1) = (nvalue(l) == nvalue(r)) ? T_NUMBER : T_NIL; break;
- case T_ARRAY: tag(top-1) = (avalue(l) == avalue(r)) ? T_NUMBER : T_NIL; break;
- case T_FUNCTION: tag(top-1) = (bvalue(l) == bvalue(r)) ? T_NUMBER : T_NIL; break;
- case T_CFUNCTION: tag(top-1) = (fvalue(l) == fvalue(r)) ? T_NUMBER : T_NIL; break;
- case T_USERDATA: tag(top-1) = (uvalue(l) == uvalue(r)) ? T_NUMBER : T_NIL; break;
- case T_STRING: tag(top-1) = (strcmp (svalue(l), svalue(r)) == 0) ? T_NUMBER : T_NIL; break;
- case T_MARK: return 1;
- }
- }
+ tag(top-1) = res ? LUA_T_NUMBER : LUA_T_NIL;
nvalue(top-1) = 1;
}
break;
-
- case LTOP:
+
+ case LTOP:
+ comparison(LUA_T_NUMBER, LUA_T_NIL, LUA_T_NIL, "lt");
+ break;
+
+ case LEOP:
+ comparison(LUA_T_NUMBER, LUA_T_NUMBER, LUA_T_NIL, "le");
+ break;
+
+ case GTOP:
+ comparison(LUA_T_NIL, LUA_T_NIL, LUA_T_NUMBER, "gt");
+ break;
+
+ case GEOP:
+ comparison(LUA_T_NIL, LUA_T_NUMBER, LUA_T_NUMBER, "ge");
+ break;
+
+ case ADDOP:
{
Object *l = top-2;
Object *r = top-1;
- --top;
- if (tag(l) == T_NUMBER && tag(r) == T_NUMBER)
- tag(top-1) = (nvalue(l) < nvalue(r)) ? T_NUMBER : T_NIL;
+ if (tonumber(r) || tonumber(l))
+ call_arith("add");
else
{
- if (tostring(l) || tostring(r))
- return 1;
- tag(top-1) = (strcmp (svalue(l), svalue(r)) < 0) ? T_NUMBER : T_NIL;
+ nvalue(l) += nvalue(r);
+ --top;
}
- nvalue(top-1) = 1;
}
break;
-
- case LEOP:
+
+ case SUBOP:
{
Object *l = top-2;
Object *r = top-1;
- --top;
- if (tag(l) == T_NUMBER && tag(r) == T_NUMBER)
- tag(top-1) = (nvalue(l) <= nvalue(r)) ? T_NUMBER : T_NIL;
+ if (tonumber(r) || tonumber(l))
+ call_arith("sub");
else
{
- if (tostring(l) || tostring(r))
- return 1;
- tag(top-1) = (strcmp (svalue(l), svalue(r)) <= 0) ? T_NUMBER : T_NIL;
+ nvalue(l) -= nvalue(r);
+ --top;
}
- nvalue(top-1) = 1;
}
break;
-
- case ADDOP:
- {
- Object *l = top-2;
- Object *r = top-1;
- if (tonumber(r) || tonumber(l))
- return 1;
- nvalue(l) += nvalue(r);
- --top;
- }
- break;
-
- case SUBOP:
- {
- Object *l = top-2;
- Object *r = top-1;
- if (tonumber(r) || tonumber(l))
- return 1;
- nvalue(l) -= nvalue(r);
- --top;
- }
- break;
-
+
case MULTOP:
{
Object *l = top-2;
Object *r = top-1;
if (tonumber(r) || tonumber(l))
- return 1;
- nvalue(l) *= nvalue(r);
- --top;
+ call_arith("mul");
+ else
+ {
+ nvalue(l) *= nvalue(r);
+ --top;
+ }
}
- break;
-
+ break;
+
case DIVOP:
{
Object *l = top-2;
Object *r = top-1;
if (tonumber(r) || tonumber(l))
- return 1;
- nvalue(l) /= nvalue(r);
- --top;
+ call_arith("div");
+ else
+ {
+ nvalue(l) /= nvalue(r);
+ --top;
+ }
}
- break;
-
+ break;
+
+ case POWOP:
+ call_arith("pow");
+ break;
+
case CONCOP:
{
Object *l = top-2;
Object *r = top-1;
if (tostring(r) || tostring(l))
- return 1;
- svalue(l) = lua_createstring (lua_strconc(svalue(l),svalue(r)));
- if (svalue(l) == NULL)
- return 1;
- --top;
+ do_call(&luaI_fallBacks[FB_CONCAT].function, (top-stack)-2, 1, (top-stack)-2);
+ else
+ {
+ tsvalue(l) = lua_createstring (lua_strconc(svalue(l),svalue(r)));
+ --top;
+ }
}
- break;
-
+ break;
+
case MINUSOP:
if (tonumber(top-1))
- return 1;
- nvalue(top-1) = - nvalue(top-1);
- break;
-
+ {
+ tag(top++) = LUA_T_NIL;
+ call_arith("unm");
+ }
+ else
+ nvalue(top-1) = - nvalue(top-1);
+ break;
+
case NOTOP:
- tag(top-1) = tag(top-1) == T_NIL ? T_NUMBER : T_NIL;
- break;
-
+ tag(top-1) = (tag(top-1) == LUA_T_NIL) ? LUA_T_NUMBER : LUA_T_NIL;
+ nvalue(top-1) = 1;
+ break;
+
case ONTJMP:
{
CodeWord code;
get_word(code,pc);
- if (tag(top-1) != T_NIL) pc += code.w;
+ if (tag(top-1) != LUA_T_NIL) pc += code.w;
}
break;
-
- case ONFJMP:
+
+ case ONFJMP:
{
CodeWord code;
get_word(code,pc);
- if (tag(top-1) == T_NIL) pc += code.w;
+ if (tag(top-1) == LUA_T_NIL) pc += code.w;
}
break;
-
+
case JMP:
{
CodeWord code;
@@ -474,7 +1040,7 @@ int lua_execute (Byte *pc)
pc += code.w;
}
break;
-
+
case UPJMP:
{
CodeWord code;
@@ -482,13 +1048,13 @@ int lua_execute (Byte *pc)
pc -= code.w;
}
break;
-
+
case IFFJMP:
{
CodeWord code;
get_word(code,pc);
top--;
- if (tag(top) == T_NIL) pc += code.w;
+ if (tag(top) == LUA_T_NIL) pc += code.w;
}
break;
@@ -497,91 +1063,38 @@ int lua_execute (Byte *pc)
CodeWord code;
get_word(code,pc);
top--;
- if (tag(top) == T_NIL) pc -= code.w;
+ if (tag(top) == LUA_T_NIL) pc -= code.w;
}
break;
case POP: --top; break;
-
+
case CALLFUNC:
{
- Byte *newpc;
- Object *b = top-1;
- while (tag(b) != T_MARK) b--;
- if (tag(b-1) == T_FUNCTION)
- {
- lua_debugline = 0; /* always reset debug flag */
- newpc = bvalue(b-1);
- bvalue(b-1) = pc; /* store return code */
- nvalue(b) = (base-stack); /* store base value */
- base = b+1;
- pc = newpc;
- if (MAXSTACK-(base-stack) < STACKGAP)
- {
- lua_error ("stack overflow");
- return 1;
- }
- }
- else if (tag(b-1) == T_CFUNCTION)
- {
- int nparam;
- lua_debugline = 0; /* always reset debug flag */
- nvalue(b) = (base-stack); /* store base value */
- base = b+1;
- nparam = top-base; /* number of parameters */
- (fvalue(b-1))(); /* call C function */
-
- /* shift returned values */
- {
- int i;
- int nretval = top - base - nparam;
- top = base - 2;
- base = stack + (int) nvalue(base-1);
- for (i=0; i<nretval; i++)
- {
- *top = *(top+nparam+2);
- ++top;
- }
- }
- }
- else
- {
- lua_reportbug ("call expression not a function");
- return 1;
- }
+ int nParams = *(pc++);
+ int nResults = *(pc++);
+ Object *func = top-1-nParams; /* function is below parameters */
+ StkId newBase = (top-stack)-nParams;
+ do_call(func, newBase, nResults, newBase-1);
}
break;
-
+
+ case RETCODE0:
+ return base;
+
case RETCODE:
- {
- int i;
- int shift = *pc++;
- int nretval = top - base - shift;
- top = base - 2;
- pc = bvalue(base-2);
- base = stack + (int) nvalue(base-1);
- for (i=0; i<nretval; i++)
- {
- *top = *(top+shift+2);
- ++top;
- }
- }
- break;
-
- case HALT:
- base = oldbase;
- return 0; /* success */
-
+ return base+*pc;
+
case SETFUNCTION:
{
- CodeWord file, func;
- get_word(file,pc);
+ CodeCode file;
+ CodeWord func;
+ get_code(file,pc);
get_word(func,pc);
- if (lua_pushfunction (file.w, func.w))
- return 1;
+ lua_pushfunction ((char *)file.b, func.w);
}
break;
-
+
case SETLINE:
{
CodeWord code;
@@ -589,433 +1102,15 @@ int lua_execute (Byte *pc)
lua_debugline = code.w;
}
break;
-
+
case RESET:
lua_popfunction ();
break;
-
+
default:
- lua_error ("internal error - opcode didn't match");
- return 1;
+ lua_error ("internal error - opcode doesn't match");
}
}
}
-/*
-** Traverse all objects on stack
-*/
-void lua_travstack (void (*fn)(Object *))
-{
- Object *o;
- for (o = top-1; o >= stack; o--)
- fn (o);
-}
-
-/*
-** Open file, generate opcode and execute global statement. Return 0 on
-** success or 1 on error.
-*/
-int lua_dofile (char *filename)
-{
- if (lua_openfile (filename)) return 1;
- if (lua_parse ()) { lua_closefile (); return 1; }
- lua_closefile ();
- return 0;
-}
-
-/*
-** Generate opcode stored on string and execute global statement. Return 0 on
-** success or 1 on error.
-*/
-int lua_dostring (char *string)
-{
- if (lua_openstring (string)) return 1;
- if (lua_parse ()) return 1;
- lua_closestring();
- return 0;
-}
-
-/*
-** Execute the given function. Return 0 on success or 1 on error.
-*/
-int lua_call (char *functionname, int nparam)
-{
- static Byte startcode[] = {CALLFUNC, HALT};
- int i;
- Object func = s_object(lua_findsymbol(functionname));
- if (tag(&func) != T_FUNCTION) return 1;
- for (i=1; i<=nparam; i++)
- *(top-i+2) = *(top-i);
- top += 2;
- tag(top-nparam-1) = T_MARK;
- *(top-nparam-2) = func;
- return (lua_execute (startcode));
-}
-
-/*
-** Get a parameter, returning the object handle or NULL on error.
-** 'number' must be 1 to get the first parameter.
-*/
-Object *lua_getparam (int number)
-{
- if (number <= 0 || number > top-base) return NULL;
- return (base+number-1);
-}
-
-/*
-** Given an object handle, return its number value. On error, return 0.0.
-*/
-real lua_getnumber (Object *object)
-{
- if (object == NULL || tag(object) == T_NIL) return 0.0;
- if (tonumber (object)) return 0.0;
- else return (nvalue(object));
-}
-
-/*
-** Given an object handle, return its string pointer. On error, return NULL.
-*/
-char *lua_getstring (Object *object)
-{
- if (object == NULL || tag(object) == T_NIL) return NULL;
- if (tostring (object)) return NULL;
- else return (svalue(object));
-}
-
-/*
-** Given an object handle, return a copy of its string. On error, return NULL.
-*/
-char *lua_copystring (Object *object)
-{
- if (object == NULL || tag(object) == T_NIL) return NULL;
- if (tostring (object)) return NULL;
- else return (strdup(svalue(object)));
-}
-
-/*
-** Given an object handle, return its cfuntion pointer. On error, return NULL.
-*/
-lua_CFunction lua_getcfunction (Object *object)
-{
- if (object == NULL) return NULL;
- if (tag(object) != T_CFUNCTION) return NULL;
- else return (fvalue(object));
-}
-
-/*
-** Given an object handle, return its user data. On error, return NULL.
-*/
-void *lua_getuserdata (Object *object)
-{
- if (object == NULL) return NULL;
- if (tag(object) != T_USERDATA) return NULL;
- else return (uvalue(object));
-}
-
-/*
-** Given an object handle and a field name, return its field object.
-** On error, return NULL.
-*/
-Object *lua_getfield (Object *object, char *field)
-{
- if (object == NULL) return NULL;
- if (tag(object) != T_ARRAY)
- return NULL;
- else
- {
- Object ref;
- tag(&ref) = T_STRING;
- svalue(&ref) = lua_createstring(lua_strdup(field));
- return (lua_hashdefine(avalue(object), &ref));
- }
-}
-
-/*
-** Given an object handle and an index, return its indexed object.
-** On error, return NULL.
-*/
-Object *lua_getindexed (Object *object, float index)
-{
- if (object == NULL) return NULL;
- if (tag(object) != T_ARRAY)
- return NULL;
- else
- {
- Object ref;
- tag(&ref) = T_NUMBER;
- nvalue(&ref) = index;
- return (lua_hashdefine(avalue(object), &ref));
- }
-}
-
-/*
-** Get a global object. Return the object handle or NULL on error.
-*/
-Object *lua_getglobal (char *name)
-{
- int n = lua_findsymbol(name);
- if (n < 0) return NULL;
- return &s_object(n);
-}
-
-/*
-** Pop and return an object
-*/
-Object *lua_pop (void)
-{
- if (top <= base) return NULL;
- top--;
- return top;
-}
-
-/*
-** Push a nil object
-*/
-int lua_pushnil (void)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- tag(top) = T_NIL;
- return 0;
-}
-
-/*
-** Push an object (tag=number) to stack. Return 0 on success or 1 on error.
-*/
-int lua_pushnumber (real n)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- tag(top) = T_NUMBER; nvalue(top++) = n;
- return 0;
-}
-
-/*
-** Push an object (tag=string) to stack. Return 0 on success or 1 on error.
-*/
-int lua_pushstring (char *s)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- tag(top) = T_STRING;
- svalue(top++) = lua_createstring(lua_strdup(s));
- return 0;
-}
-
-/*
-** Push an object (tag=cfunction) to stack. Return 0 on success or 1 on error.
-*/
-int lua_pushcfunction (lua_CFunction fn)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- tag(top) = T_CFUNCTION; fvalue(top++) = fn;
- return 0;
-}
-
-/*
-** Push an object (tag=userdata) to stack. Return 0 on success or 1 on error.
-*/
-int lua_pushuserdata (void *u)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- tag(top) = T_USERDATA; uvalue(top++) = u;
- return 0;
-}
-
-/*
-** Push an object to stack.
-*/
-int lua_pushobject (Object *o)
-{
- if ((top-stack) >= MAXSTACK-1)
- {
- lua_error ("stack overflow");
- return 1;
- }
- *top++ = *o;
- return 0;
-}
-
-/*
-** Store top of the stack at a global variable array field.
-** Return 1 on error, 0 on success.
-*/
-int lua_storeglobal (char *name)
-{
- int n = lua_findsymbol (name);
- if (n < 0) return 1;
- if (tag(top-1) == T_MARK) return 1;
- s_object(n) = *(--top);
- return 0;
-}
-
-/*
-** Store top of the stack at an array field. Return 1 on error, 0 on success.
-*/
-int lua_storefield (lua_Object object, char *field)
-{
- if (tag(object) != T_ARRAY)
- return 1;
- else
- {
- Object ref, *h;
- tag(&ref) = T_STRING;
- svalue(&ref) = lua_createstring(lua_strdup(field));
- h = lua_hashdefine(avalue(object), &ref);
- if (h == NULL) return 1;
- if (tag(top-1) == T_MARK) return 1;
- *h = *(--top);
- }
- return 0;
-}
-
-
-/*
-** Store top of the stack at an array index. Return 1 on error, 0 on success.
-*/
-int lua_storeindexed (lua_Object object, float index)
-{
- if (tag(object) != T_ARRAY)
- return 1;
- else
- {
- Object ref, *h;
- tag(&ref) = T_NUMBER;
- nvalue(&ref) = index;
- h = lua_hashdefine(avalue(object), &ref);
- if (h == NULL) return 1;
- if (tag(top-1) == T_MARK) return 1;
- *h = *(--top);
- }
- return 0;
-}
-
-
-/*
-** Given an object handle, return if it is nil.
-*/
-int lua_isnil (Object *object)
-{
- return (object != NULL && tag(object) == T_NIL);
-}
-
-/*
-** Given an object handle, return if it is a number one.
-*/
-int lua_isnumber (Object *object)
-{
- return (object != NULL && tag(object) == T_NUMBER);
-}
-
-/*
-** Given an object handle, return if it is a string one.
-*/
-int lua_isstring (Object *object)
-{
- return (object != NULL && tag(object) == T_STRING);
-}
-
-/*
-** Given an object handle, return if it is an array one.
-*/
-int lua_istable (Object *object)
-{
- return (object != NULL && tag(object) == T_ARRAY);
-}
-
-/*
-** Given an object handle, return if it is a cfunction one.
-*/
-int lua_iscfunction (Object *object)
-{
- return (object != NULL && tag(object) == T_CFUNCTION);
-}
-
-/*
-** Given an object handle, return if it is an user data one.
-*/
-int lua_isuserdata (Object *object)
-{
- return (object != NULL && tag(object) == T_USERDATA);
-}
-
-/*
-** Internal function: return an object type.
-*/
-void lua_type (void)
-{
- Object *o = lua_getparam(1);
- lua_pushstring (lua_constant[tag(o)]);
-}
-
-/*
-** Internal function: convert an object to a number
-*/
-void lua_obj2number (void)
-{
- Object *o = lua_getparam(1);
- lua_pushobject (lua_convtonumber(o));
-}
-
-/*
-** Internal function: print object values
-*/
-void lua_print (void)
-{
- int i=1;
- void *obj;
- while ((obj=lua_getparam (i++)) != NULL)
- {
- if (lua_isnumber(obj)) printf("%g\n",lua_getnumber (obj));
- else if (lua_isstring(obj)) printf("%s\n",lua_getstring (obj));
- else if (lua_iscfunction(obj)) printf("cfunction: %p\n",lua_getcfunction (obj));
- else if (lua_isuserdata(obj)) printf("userdata: %p\n",lua_getuserdata (obj));
- else if (lua_istable(obj)) printf("table: %p\n",obj);
- else if (lua_isnil(obj)) printf("nil\n");
- else printf("invalid value to print\n");
- }
-}
-
-/*
-** Internal function: do a file
-*/
-void lua_internaldofile (void)
-{
- lua_Object obj = lua_getparam (1);
- if (lua_isstring(obj) && !lua_dofile(lua_getstring(obj)))
- lua_pushnumber(1);
- else
- lua_pushnil();
-}
-
-/*
-** Internal function: do a string
-*/
-void lua_internaldostring (void)
-{
- lua_Object obj = lua_getparam (1);
- if (lua_isstring(obj) && !lua_dostring(lua_getstring(obj)))
- lua_pushnumber(1);
- else
- lua_pushnil();
-}
-
-
diff --git a/src/opcode.h b/src/opcode.h
index abf284c4..e3a6d37c 100644
--- a/src/opcode.h
+++ b/src/opcode.h
@@ -1,11 +1,15 @@
/*
** TeCGraf - PUC-Rio
-** $Id: opcode.h,v 2.1 1994/04/20 22:07:57 celes Exp $
+** $Id: opcode.h,v 3.10 1994/12/20 21:20:36 roberto Exp $
*/
#ifndef opcode_h
#define opcode_h
+#include "lua.h"
+#include "types.h"
+#include "tree.h"
+
#ifndef STACKGAP
#define STACKGAP 128
#endif
@@ -16,21 +20,8 @@
#define FIELDS_PER_FLUSH 40
-typedef unsigned char Byte;
-
-typedef unsigned short Word;
-
-typedef union
-{
- struct {char c1; char c2;} m;
- Word w;
-} CodeWord;
+#define MAX_TEMPS 20
-typedef union
-{
- struct {char c1; char c2; char c3; char c4;} m;
- float f;
-} CodeFloat;
typedef enum
{
@@ -40,13 +31,13 @@ typedef enum
PUSHWORD,
PUSHFLOAT,
PUSHSTRING,
+ PUSHFUNCTION,
PUSHLOCAL0, PUSHLOCAL1, PUSHLOCAL2, PUSHLOCAL3, PUSHLOCAL4,
PUSHLOCAL5, PUSHLOCAL6, PUSHLOCAL7, PUSHLOCAL8, PUSHLOCAL9,
PUSHLOCAL,
PUSHGLOBAL,
PUSHINDEXED,
- PUSHMARK,
- PUSHOBJECT,
+ PUSHSELF,
STORELOCAL0, STORELOCAL1, STORELOCAL2, STORELOCAL3, STORELOCAL4,
STORELOCAL5, STORELOCAL6, STORELOCAL7, STORELOCAL8, STORELOCAL9,
STORELOCAL,
@@ -56,15 +47,19 @@ typedef enum
STORELIST0,
STORELIST,
STORERECORD,
+ ADJUST0,
ADJUST,
CREATEARRAY,
EQOP,
LTOP,
LEOP,
+ GTOP,
+ GEOP,
ADDOP,
SUBOP,
MULTOP,
DIVOP,
+ POWOP,
CONCOP,
MINUSOP,
NOTOP,
@@ -76,61 +71,51 @@ typedef enum
IFFUPJMP,
POP,
CALLFUNC,
+ RETCODE0,
RETCODE,
- HALT,
SETFUNCTION,
SETLINE,
RESET
} OpCode;
-typedef enum
-{
- T_MARK,
- T_NIL,
- T_NUMBER,
- T_STRING,
- T_ARRAY,
- T_FUNCTION,
- T_CFUNCTION,
- T_USERDATA
-} Type;
+#define MULT_RET 255
+
typedef void (*Cfunction) (void);
typedef int (*Input) (void);
typedef union
{
- Cfunction f;
- real n;
- char *s;
- Byte *b;
+ Cfunction f;
+ real n;
+ TaggedString *ts;
+ Byte *b;
struct Hash *a;
void *u;
} Value;
typedef struct Object
{
- Type tag;
+ lua_Type tag;
Value value;
} Object;
typedef struct
{
- char *name;
Object object;
} Symbol;
/* Macros to access structure members */
#define tag(o) ((o)->tag)
#define nvalue(o) ((o)->value.n)
-#define svalue(o) ((o)->value.s)
+#define svalue(o) ((o)->value.ts->str)
+#define tsvalue(o) ((o)->value.ts)
#define bvalue(o) ((o)->value.b)
#define avalue(o) ((o)->value.a)
#define fvalue(o) ((o)->value.f)
#define uvalue(o) ((o)->value.u)
/* Macros to access symbol table */
-#define s_name(i) (lua_table[i].name)
#define s_object(i) (lua_table[i].object)
#define s_tag(i) (tag(&s_object(i)))
#define s_nvalue(i) (nvalue(&s_object(i)))
@@ -140,25 +125,40 @@ typedef struct
#define s_fvalue(i) (fvalue(&s_object(i)))
#define s_uvalue(i) (uvalue(&s_object(i)))
+typedef union
+{
+ struct {char c1; char c2;} m;
+ Word w;
+} CodeWord;
#define get_word(code,pc) {code.m.c1 = *pc++; code.m.c2 = *pc++;}
+
+typedef union
+{
+ struct {char c1; char c2; char c3; char c4;} m;
+ float f;
+} CodeFloat;
#define get_float(code,pc) {code.m.c1 = *pc++; code.m.c2 = *pc++;\
code.m.c3 = *pc++; code.m.c4 = *pc++;}
-
+
+typedef union
+{
+ struct {char c1; char c2; char c3; char c4;} m;
+ Byte *b;
+} CodeCode;
+#define get_code(code,pc) {code.m.c1 = *pc++; code.m.c2 = *pc++;\
+ code.m.c3 = *pc++; code.m.c4 = *pc++;}
/* Exported functions */
-int lua_execute (Byte *pc);
-void lua_markstack (void);
char *lua_strdup (char *l);
void lua_setinput (Input fn); /* from "lex.c" module */
char *lua_lasttext (void); /* from "lex.c" module */
-int lua_parse (void); /* from "lua.stx" module */
-void lua_type (void);
-void lua_obj2number (void);
-void lua_print (void);
-void lua_internaldofile (void);
-void lua_internaldostring (void);
+int yylex (void); /* from "lex.c" module */
+void lua_parse (Byte **code); /* from "lua.stx" module */
void lua_travstack (void (*fn)(Object *));
+Object *luaI_Address (lua_Object o);
+void luaI_pushobject (Object *o);
+void luaI_gcFB (Object *o);
#endif
diff --git a/src/y.tab.c b/src/parser.c
index 70dbd3cd..47b77fb0 100644
--- a/src/y.tab.c
+++ b/src/parser.c
@@ -1,36 +1,56 @@
+#if defined (__cplusplus) || defined (c_plusplus)
+#include <c_varieties.h>
+#ifdef __EXTERN_C__
+ EXTERN_FUNCTION ( extern int yylex, ());
+#else
+ extern int yylex();
+#endif
+ extern void yyerror(char *);
+ extern int yyparse();
+#endif
+
+#include <malloc.h>
# line 2 "lua.stx"
-char *rcs_luastx = "$Id: lua.stx,v 2.4 1994/04/20 16:22:21 celes Exp $";
+char *rcs_luastx = "$Id: lua.stx,v 3.17 1995/01/13 22:11:12 roberto Exp $";
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
-#include "mm.h"
-
+#include "mem.h"
#include "opcode.h"
#include "hash.h"
#include "inout.h"
+#include "tree.h"
#include "table.h"
#include "lua.h"
+/* to avoid warnings generated by yacc */
+int yyparse (void);
+#define malloc luaI_malloc
+#define realloc luaI_realloc
+#define free luaI_free
+
+#ifndef LISTING
#define LISTING 0
+#endif
-#ifndef GAPCODE
-#define GAPCODE 50
+#ifndef CODE_BLOCK
+#define CODE_BLOCK 256
#endif
-static Word maxcode;
-static Word maxmain;
-static Word maxcurr ;
-static Byte *code = NULL;
-static Byte *initcode;
+static int maxcode;
+static int maxmain;
+static Long maxcurr; /* to allow maxcurr *= 2 without overflow */
+static Byte *funcCode = NULL;
+static Byte **initcode;
static Byte *basepc;
-static Word maincode;
-static Word pc;
+static int maincode;
+static int pc;
#define MAXVAR 32
-static long varbuffer[MAXVAR]; /* variables in an assignment list;
+static Long varbuffer[MAXVAR]; /* variables in an assignment list;
it's long to store negative Word values */
static int nvarbuffer=0; /* number of variables at a list */
@@ -40,8 +60,7 @@ static int nlocalvar=0; /* number of local variables */
#define MAXFIELDS FIELDS_PER_FLUSH*2
static Word fields[MAXFIELDS]; /* fieldnames to be flushed */
static int nfields=0;
-static int ntemp; /* number of temporary var into stack */
-static int err; /* flag to indicate error */
+
/* Internal functions */
@@ -49,13 +68,12 @@ static void code_byte (Byte c)
{
if (pc>maxcurr-2) /* 1 byte free to code HALT of main code */
{
- maxcurr += GAPCODE;
- basepc = (Byte *)realloc(basepc, maxcurr*sizeof(Byte));
- if (basepc == NULL)
- {
- lua_error ("not enough memory");
- err = 1;
- }
+ if (maxcurr >= MAX_INT)
+ lua_error("code size overflow");
+ maxcurr *= 2;
+ if (maxcurr >= MAX_INT)
+ maxcurr = MAX_INT;
+ basepc = growvector(basepc, maxcurr, Byte);
}
basepc[pc++] = c;
}
@@ -78,6 +96,16 @@ static void code_float (float n)
code_byte(code.m.c4);
}
+static void code_code (Byte *b)
+{
+ CodeCode code;
+ code.b = b;
+ code_byte(code.m.c1);
+ code_byte(code.m.c2);
+ code_byte(code.m.c3);
+ code_byte(code.m.c4);
+}
+
static void code_word_at (Byte *p, Word n)
{
CodeWord code;
@@ -91,10 +119,7 @@ static void push_field (Word name)
if (nfields < STACKGAP-1)
fields[nfields++] = name;
else
- {
lua_error ("too many fields in a constructor");
- err = 1;
- }
}
static void flush_record (int n)
@@ -105,7 +130,6 @@ static void flush_record (int n)
code_byte(n);
for (i=0; i<n; i++)
code_word(fields[--nfields]);
- ntemp -= n;
}
static void flush_list (int m, int n)
@@ -114,34 +138,22 @@ static void flush_list (int m, int n)
if (m == 0)
code_byte(STORELIST0);
else
+ if (m < 255)
{
code_byte(STORELIST);
code_byte(m);
}
+ else
+ lua_error ("list constructor too long");
code_byte(n);
- ntemp-=n;
-}
-
-static void incr_ntemp (void)
-{
- if (ntemp+nlocalvar+MAXVAR+1 < STACKGAP)
- ntemp++;
- else
- {
- lua_error ("stack overflow");
- err = 1;
- }
}
static void add_nlocalvar (int n)
{
- if (ntemp+nlocalvar+MAXVAR+n < STACKGAP)
+ if (MAX_TEMPS+nlocalvar+MAXVAR+n < STACKGAP)
nlocalvar += n;
else
- {
- lua_error ("too many local variables or expression too complicate");
- err = 1;
- }
+ lua_error ("too many local variables");
}
static void incr_nvarbuffer (void)
@@ -149,14 +161,12 @@ static void incr_nvarbuffer (void)
if (nvarbuffer < MAXVAR-1)
nvarbuffer++;
else
- {
lua_error ("variable buffer overflow");
- err = 1;
- }
}
static void code_number (float f)
-{ Word i = (Word)f;
+{
+ Word i = (Word)f;
if (f == (float)i) /* f has an (short) integer value */
{
if (i <= 2) code_byte(PUSH0 + i);
@@ -176,59 +186,8 @@ static void code_number (float f)
code_byte(PUSHFLOAT);
code_float(f);
}
- incr_ntemp();
}
-
-# line 184 "lua.stx"
-typedef union
-{
- int vInt;
- long vLong;
- float vFloat;
- char *pChar;
- Word vWord;
- Byte *pByte;
-} YYSTYPE;
-# define WRONGTOKEN 257
-# define NIL 258
-# define IF 259
-# define THEN 260
-# define ELSE 261
-# define ELSEIF 262
-# define WHILE 263
-# define DO 264
-# define REPEAT 265
-# define UNTIL 266
-# define END 267
-# define RETURN 268
-# define LOCAL 269
-# define NUMBER 270
-# define FUNCTION 271
-# define STRING 272
-# define NAME 273
-# define DEBUG 274
-# define AND 275
-# define OR 276
-# define NE 277
-# define LE 278
-# define GE 279
-# define CONC 280
-# define UNARY 281
-# define NOT 282
-#define yyclearin yychar = -1
-#define yyerrok yyerrflag = 0
-extern int yychar;
-extern int yyerrflag;
-#ifndef YYMAXDEPTH
-#define YYMAXDEPTH 150
-#endif
-YYSTYPE yylval, yyval;
-# define YYERRCODE 256
-
-# line 622 "lua.stx"
-
-
/*
** Search a local name and if find return its index. If do not find return -1
*/
@@ -245,13 +204,12 @@ static int lua_localname (Word n)
** indexed by (number -1). If negative, push local indexed by ABS(number)-1.
** Otherwise, if zero, push indexed variable (record).
*/
-static void lua_pushvar (long number)
+static void lua_pushvar (Long number)
{
if (number > 0) /* global var */
{
code_byte(PUSHGLOBAL);
code_word(number-1);
- incr_ntemp();
}
else if (number < 0) /* local var */
{
@@ -262,19 +220,77 @@ static void lua_pushvar (long number)
code_byte(PUSHLOCAL);
code_byte(number);
}
- incr_ntemp();
}
else
{
code_byte(PUSHINDEXED);
- ntemp--;
}
}
static void lua_codeadjust (int n)
{
- code_byte(ADJUST);
- code_byte(n + nlocalvar);
+ if (n+nlocalvar == 0)
+ code_byte(ADJUST0);
+ else
+ {
+ code_byte(ADJUST);
+ code_byte(n+nlocalvar);
+ }
+}
+
+static void init_function (TreeNode *func)
+{
+ if (funcCode == NULL) /* first function */
+ {
+ funcCode = newvector(CODE_BLOCK, Byte);
+ maxcode = CODE_BLOCK;
+ }
+ pc=0; basepc=funcCode; maxcurr=maxcode;
+ nlocalvar=0;
+ if (lua_debug)
+ {
+ code_byte(SETFUNCTION);
+ code_code((Byte *)luaI_strdup(lua_file[lua_nfile-1]));
+ code_word(luaI_findconstant(func));
+ }
+}
+
+static void codereturn (void)
+{
+ if (lua_debug) code_byte(RESET);
+ if (nlocalvar == 0)
+ code_byte(RETCODE0);
+ else
+ {
+ code_byte(RETCODE);
+ code_byte(nlocalvar);
+ }
+}
+
+static void codedebugline (void)
+{
+ if (lua_debug)
+ {
+ code_byte(SETLINE);
+ code_word(lua_linenumber);
+ }
+}
+
+static void adjust_mult_assign (int vars, int exps, int temps)
+{
+ if (exps < 0)
+ {
+ int r = vars - (-exps-1);
+ if (r >= 0)
+ code_byte(r);
+ else
+ {
+ code_byte(0);
+ lua_codeadjust(temps);
+ }
+ }
+ else if (vars != exps)
+ lua_codeadjust(temps);
}
static void lua_codestore (int i)
@@ -312,48 +328,102 @@ static void lua_codestore (int i)
}
}
-void yyerror (char *s)
+static void codeIf (Long thenAdd, Long elseAdd)
+{
+ Long elseinit = elseAdd+sizeof(Word)+1;
+ if (pc == elseinit) /* no else */
+ {
+ pc -= sizeof(Word)+1;
+ elseinit = pc;
+ }
+ else
+ {
+ basepc[elseAdd] = JMP;
+ code_word_at(basepc+elseAdd+1, pc-elseinit);
+ }
+ basepc[thenAdd] = IFFJMP;
+ code_word_at(basepc+thenAdd+1,elseinit-(thenAdd+sizeof(Word)+1));
+}
+
+static void yyerror (char *s)
{
static char msg[256];
sprintf (msg,"%s near \"%s\" at line %d in file \"%s\"",
s, lua_lasttext (), lua_linenumber, lua_filename());
lua_error (msg);
- err = 1;
-}
-
-int yywrap (void)
-{
- return 1;
}
/*
-** Parse LUA code and execute global statement.
-** Return 0 on success or 1 on error.
+** Parse LUA code.
*/
-int lua_parse (void)
+void lua_parse (Byte **code)
{
- Byte *init = initcode = (Byte *) calloc(GAPCODE, sizeof(Byte));
+ initcode = code;
+ *initcode = newvector(CODE_BLOCK, Byte);
maincode = 0;
- maxmain = GAPCODE;
- if (init == NULL)
- {
- lua_error("not enough memory");
- return 1;
- }
- err = 0;
- if (yyparse () || (err==1)) return 1;
- initcode[maincode++] = HALT;
- init = initcode;
+ maxmain = CODE_BLOCK;
+ if (yyparse ()) lua_error("parse error");
+ (*initcode)[maincode++] = RETCODE0;
#if LISTING
- PrintCode(init,init+maincode);
+{ static void PrintCode (Byte *c, Byte *end);
+ PrintCode(*initcode,*initcode+maincode); }
#endif
- if (lua_execute (init)) return 1;
- free(init);
- return 0;
}
+
+# line 365 "lua.stx"
+typedef union
+{
+ int vInt;
+ float vFloat;
+ char *pChar;
+ Word vWord;
+ Long vLong;
+ Byte *pByte;
+ TreeNode *pNode;
+} YYSTYPE;
+# define WRONGTOKEN 257
+# define NIL 258
+# define IF 259
+# define THEN 260
+# define ELSE 261
+# define ELSEIF 262
+# define WHILE 263
+# define DO 264
+# define REPEAT 265
+# define UNTIL 266
+# define END 267
+# define RETURN 268
+# define LOCAL 269
+# define FUNCTION 270
+# define NUMBER 271
+# define STRING 272
+# define NAME 273
+# define DEBUG 274
+# define AND 275
+# define OR 276
+# define EQ 277
+# define NE 278
+# define LE 279
+# define GE 280
+# define CONC 281
+# define UNARY 282
+# define NOT 283
+#define yyclearin yychar = -1
+#define yyerrok yyerrflag = 0
+extern int yychar;
+extern int yyerrflag;
+#ifndef YYMAXDEPTH
+#define YYMAXDEPTH 150
+#endif
+YYSTYPE yylval, yyval;
+# define YYERRCODE 256
+
+# line 737 "lua.stx"
+
+
#if LISTING
static void PrintCode (Byte *code, Byte *end)
@@ -400,6 +470,16 @@ static void PrintCode (Byte *code, Byte *end)
printf ("%d PUSHSTRING %d\n", n, c.w);
}
break;
+ case PUSHFUNCTION:
+ {
+ CodeCode c;
+ int n = p-code;
+ p++;
+ get_code(c,p);
+ printf ("%d PUSHFUNCTION %p\n", n, c.b);
+ }
+ break;
+
case PUSHLOCAL0: case PUSHLOCAL1: case PUSHLOCAL2: case PUSHLOCAL3:
case PUSHLOCAL4: case PUSHLOCAL5: case PUSHLOCAL6: case PUSHLOCAL7:
case PUSHLOCAL8: case PUSHLOCAL9:
@@ -419,8 +499,6 @@ static void PrintCode (Byte *code, Byte *end)
}
break;
case PUSHINDEXED: printf ("%d PUSHINDEXED\n", (p++)-code); break;
- case PUSHMARK: printf ("%d PUSHMARK\n", (p++)-code); break;
- case PUSHOBJECT: printf ("%d PUSHOBJECT\n", (p++)-code); break;
case STORELOCAL0: case STORELOCAL1: case STORELOCAL2: case STORELOCAL3:
case STORELOCAL4: case STORELOCAL5: case STORELOCAL6: case STORELOCAL7:
case STORELOCAL8: case STORELOCAL9:
@@ -440,6 +518,15 @@ static void PrintCode (Byte *code, Byte *end)
printf ("%d STOREGLOBAL %d\n", n, c.w);
}
break;
+ case PUSHSELF:
+ {
+ CodeWord c;
+ int n = p-code;
+ p++;
+ get_word(c,p);
+ printf ("%d PUSHSELF %d\n", n, c.w);
+ }
+ break;
case STOREINDEXED0: printf ("%d STOREINDEXED0\n", (p++)-code); break;
case STOREINDEXED: printf ("%d STOREINDEXED %d\n", p-code, *(++p));
p++;
@@ -456,11 +543,20 @@ static void PrintCode (Byte *code, Byte *end)
printf("%d STORERECORD %d\n", p-code, *(++p));
p += *p*sizeof(Word) + 1;
break;
+ case ADJUST0: printf ("%d ADJUST0\n", (p++)-code); break;
case ADJUST:
printf ("%d ADJUST %d\n", p-code, *(++p));
p++;
break;
- case CREATEARRAY: printf ("%d CREATEARRAY\n", (p++)-code); break;
+ case CREATEARRAY:
+ {
+ CodeWord c;
+ int n = p-code;
+ p++;
+ get_word(c,p);
+ printf ("%d CREATEARRAY %d\n", n, c.w);
+ break;
+ }
case EQOP: printf ("%d EQOP\n", (p++)-code); break;
case LTOP: printf ("%d LTOP\n", (p++)-code); break;
case LEOP: printf ("%d LEOP\n", (p++)-code); break;
@@ -468,6 +564,7 @@ static void PrintCode (Byte *code, Byte *end)
case SUBOP: printf ("%d SUBOP\n", (p++)-code); break;
case MULTOP: printf ("%d MULTOP\n", (p++)-code); break;
case DIVOP: printf ("%d DIVOP\n", (p++)-code); break;
+ case POWOP: printf ("%d POWOP\n", (p++)-code); break;
case CONCOP: printf ("%d CONCOP\n", (p++)-code); break;
case MINUSOP: printf ("%d MINUSOP\n", (p++)-code); break;
case NOTOP: printf ("%d NOTOP\n", (p++)-code); break;
@@ -526,20 +623,24 @@ static void PrintCode (Byte *code, Byte *end)
}
break;
case POP: printf ("%d POP\n", (p++)-code); break;
- case CALLFUNC: printf ("%d CALLFUNC\n", (p++)-code); break;
+ case CALLFUNC:
+ printf ("%d CALLFUNC %d %d\n", p-code, *(p+1), *(p+2));
+ p+=3;
+ break;
+ case RETCODE0: printf ("%d RETCODE0\n", (p++)-code); break;
case RETCODE:
printf ("%d RETCODE %d\n", p-code, *(++p));
p++;
break;
- case HALT: printf ("%d HALT\n", (p++)-code); break;
case SETFUNCTION:
{
- CodeWord c1, c2;
+ CodeCode c1;
+ CodeWord c2;
int n = p-code;
p++;
- get_word(c1,p);
+ get_code(c1,p);
get_word(c2,p);
- printf ("%d SETFUNCTION %d %d\n", n, c1.w, c2.w);
+ printf ("%d SETFUNCTION %s %d\n", n, (char *)c1.b, c2.w);
}
break;
case SETLINE:
@@ -564,194 +665,201 @@ int yyexca[] ={
0, -1,
-2, 2,
-1, 20,
- 40, 67,
- 91, 94,
- 46, 96,
- -2, 91,
+ 61, 91,
+ 44, 91,
+ -2, 97,
-1, 32,
- 40, 67,
- 91, 94,
- 46, 96,
- -2, 51,
--1, 73,
- 275, 34,
- 276, 34,
- 61, 34,
- 277, 34,
- 62, 34,
- 60, 34,
- 278, 34,
- 279, 34,
- 280, 34,
- 43, 34,
- 45, 34,
- 42, 34,
- 47, 34,
+ 40, 66,
+ 123, 66,
+ -2, 53,
+-1, 47,
+ 123, 63,
-2, 70,
-1, 74,
- 91, 94,
- 46, 96,
- -2, 92,
--1, 105,
- 261, 28,
- 262, 28,
- 266, 28,
- 267, 28,
- 268, 28,
- -2, 11,
--1, 125,
- 268, 31,
- -2, 30,
--1, 146,
- 275, 34,
- 276, 34,
- 61, 34,
- 277, 34,
- 62, 34,
- 60, 34,
- 278, 34,
- 279, 34,
- 280, 34,
- 43, 34,
- 45, 34,
- 42, 34,
- 47, 34,
+ 125, 79,
+ -2, 63,
+-1, 79,
+ 275, 37,
+ 276, 37,
+ 277, 37,
+ 278, 37,
+ 62, 37,
+ 60, 37,
+ 279, 37,
+ 280, 37,
+ 281, 37,
+ 43, 37,
+ 45, 37,
+ 42, 37,
+ 47, 37,
+ 94, 37,
-2, 72,
+-1, 80,
+ 91, 97,
+ 46, 97,
+ -2, 92,
+-1, 118,
+ 261, 33,
+ 262, 33,
+ 266, 33,
+ 267, 33,
+ -2, 16,
+-1, 133,
+ 125, 85,
+ -2, 63,
+-1, 158,
+ 123, 63,
+ -2, 70,
+-1, 159,
+ 275, 37,
+ 276, 37,
+ 277, 37,
+ 278, 37,
+ 62, 37,
+ 60, 37,
+ 279, 37,
+ 280, 37,
+ 281, 37,
+ 43, 37,
+ 45, 37,
+ 42, 37,
+ 47, 37,
+ 94, 37,
+ -2, 74,
};
# define YYNPROD 103
-# define YYLAST 364
+# define YYLAST 351
int yyact[]={
- 58, 56, 22, 57, 132, 59, 58, 56, 137, 57,
- 110, 59, 58, 56, 107, 57, 85, 59, 51, 50,
- 52, 82, 23, 43, 51, 50, 52, 58, 56, 9,
- 57, 157, 59, 58, 56, 165, 57, 5, 59, 162,
- 6, 161, 104, 154, 155, 51, 50, 52, 64, 153,
- 70, 51, 50, 52, 26, 58, 56, 127, 57, 10,
- 59, 111, 25, 78, 27, 58, 56, 28, 57, 29,
- 59, 131, 147, 51, 50, 52, 7, 65, 66, 115,
- 150, 112, 63, 51, 50, 52, 68, 69, 31, 159,
- 11, 79, 58, 76, 128, 73, 41, 59, 151, 87,
- 88, 89, 90, 91, 92, 93, 94, 95, 96, 97,
- 77, 114, 148, 40, 58, 56, 102, 57, 106, 59,
- 117, 32, 72, 121, 116, 100, 80, 109, 67, 48,
- 20, 36, 73, 30, 45, 73, 44, 118, 149, 84,
- 17, 126, 18, 46, 21, 47, 120, 119, 101, 145,
- 144, 125, 71, 123, 75, 39, 38, 12, 8, 108,
- 105, 136, 83, 74, 135, 24, 4, 3, 139, 140,
- 2, 81, 134, 141, 133, 130, 129, 42, 113, 16,
- 1, 146, 124, 0, 143, 0, 0, 152, 0, 0,
- 0, 86, 0, 0, 0, 0, 0, 13, 0, 0,
- 160, 14, 0, 15, 164, 163, 0, 19, 167, 0,
- 0, 23, 73, 0, 0, 0, 0, 0, 168, 166,
- 158, 171, 173, 0, 0, 0, 169, 0, 0, 0,
- 0, 0, 0, 61, 62, 53, 54, 55, 60, 61,
- 62, 53, 54, 55, 60, 0, 0, 0, 0, 103,
- 60, 49, 0, 98, 99, 0, 0, 0, 0, 0,
- 61, 62, 53, 54, 55, 60, 61, 62, 53, 54,
- 55, 60, 0, 0, 0, 0, 0, 0, 0, 0,
- 0, 0, 35, 0, 0, 0, 0, 0, 61, 62,
- 53, 54, 55, 60, 33, 122, 34, 23, 0, 0,
- 53, 54, 55, 60, 0, 0, 37, 0, 0, 0,
- 138, 0, 0, 0, 0, 142, 0, 0, 0, 0,
- 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
- 0, 0, 0, 156, 0, 0, 0, 0, 0, 0,
+ 64, 62, 6, 63, 152, 65, 7, 64, 62, 145,
+ 63, 120, 65, 92, 64, 62, 89, 63, 57, 65,
+ 58, 64, 62, 87, 63, 57, 65, 58, 64, 62,
+ 24, 63, 57, 65, 58, 64, 62, 54, 63, 57,
+ 65, 58, 45, 10, 29, 142, 57, 171, 58, 30,
+ 29, 123, 66, 167, 14, 30, 160, 117, 15, 66,
+ 16, 162, 163, 173, 19, 131, 66, 138, 24, 28,
+ 112, 114, 130, 66, 74, 71, 8, 64, 66, 52,
+ 66, 86, 65, 51, 161, 83, 51, 66, 43, 136,
+ 27, 12, 64, 62, 26, 63, 133, 65, 49, 70,
+ 135, 119, 84, 125, 124, 42, 72, 122, 109, 32,
+ 53, 132, 79, 73, 85, 39, 75, 79, 47, 23,
+ 149, 91, 143, 31, 78, 20, 88, 38, 50, 66,
+ 11, 50, 95, 96, 97, 98, 99, 100, 101, 102,
+ 103, 104, 105, 106, 66, 48, 36, 129, 128, 158,
+ 113, 141, 94, 81, 79, 77, 18, 41, 40, 80,
+ 139, 13, 9, 118, 90, 93, 121, 25, 5, 4,
+ 3, 2, 22, 126, 111, 76, 82, 44, 134, 110,
+ 21, 46, 17, 1, 0, 0, 0, 0, 0, 0,
+ 0, 0, 0, 0, 0, 140, 0, 0, 0, 0,
+ 0, 0, 0, 0, 147, 148, 0, 151, 0, 150,
+ 0, 0, 153, 159, 0, 156, 0, 0, 0, 0,
+ 164, 107, 108, 0, 0, 0, 0, 0, 79, 116,
+ 170, 169, 55, 68, 69, 56, 59, 60, 61, 67,
+ 68, 69, 56, 59, 60, 61, 67, 68, 69, 56,
+ 59, 60, 61, 67, 68, 69, 56, 59, 60, 61,
+ 67, 177, 35, 56, 59, 60, 61, 67, 35, 137,
+ 127, 157, 0, 166, 67, 33, 34, 24, 0, 0,
+ 146, 33, 34, 115, 0, 0, 0, 37, 0, 0,
+ 0, 155, 0, 37, 0, 0, 0, 172, 0, 0,
+ 144, 0, 0, 0, 0, 0, 0, 165, 0, 0,
+ 0, 0, 0, 154, 0, 0, 0, 0, 0, 0,
+ 0, 0, 0, 0, 0, 0, 174, 0, 176, 0,
+ 0, 0, 0, 0, 0, 0, 0, 0, 168, 0,
0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
- 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
- 170, 0, 0, 172 };
+ 175 };
int yypact[]={
- -1000, -234, -1000, -1000, -1000, -244, -1000, 31, -62, -1000,
- -1000, -1000, -1000, 24, -1000, -1000, 52, -1000, -1000, -250,
- -1000, -1000, -1000, -1000, 89, -9, -1000, 24, 24, 24,
- -1000, 88, -1000, -1000, -1000, -1000, -1000, 24, 24, -1000,
- 24, -251, 49, -1000, -28, 45, 86, -252, -257, -1000,
- 24, 24, 24, 24, 24, 24, 24, 24, 24, 24,
- 24, -1000, -1000, 84, 13, -1000, -1000, 24, -1000, -15,
- -224, -1000, 74, -1000, -1000, -1000, -259, 24, 24, -263,
- 24, -12, -1000, 83, 76, -1000, -1000, -30, -30, -30,
- -30, -30, -30, 50, 50, -1000, -1000, 72, -1000, -1000,
- -1000, 82, 13, -1000, 24, -1000, -1000, -1000, 74, -36,
- -1000, 53, 74, -1000, -269, 24, -1000, -265, -1000, 24,
- 24, -1000, -1000, 13, 31, -1000, 24, -1000, -1000, -53,
- 68, -1000, -1000, -13, 54, 13, -1000, -1000, -218, 23,
- 23, -1000, -1000, -1000, -1000, -237, -1000, -1000, -269, 28,
- -1000, 24, -226, -228, -1000, 24, -232, 24, -1000, 24,
- 13, -1000, -1000, -1000, -42, -1000, 31, 13, -1000, -1000,
- -1000, -1000, -218, -1000 };
+ -1000, -268, -1000, -1000, -1000, -1000, -230, -1000, 32, -205,
+ 36, -1000, -1000, -1000, 4, -1000, -1000, 44, -1000, -231,
+ -1000, 78, -1000, 40, -1000, 70, -236, -28, -1000, 4,
+ 4, -1000, 40, -1000, -1000, -1000, -1000, 4, -49, -1000,
+ 4, -1000, 4, -243, 41, -1000, -1000, 4, -1000, -250,
+ 4, -257, -1000, -260, -1000, -1000, 4, 4, 4, 4,
+ 4, 4, 4, 4, 4, 4, 4, 4, -1000, -1000,
+ 67, -21, -16, -16, 10, -35, -209, -1000, 57, -1000,
+ -1000, 37, -1000, -262, 4, 66, 57, -1000, -42, -1000,
+ 63, 59, -1000, 70, -1000, -7, -7, -7, -7, -7,
+ -7, 35, 35, -16, -16, -16, 50, -1000, -1000, -1000,
+ -53, 52, 56, -21, -1000, 28, -1000, -1000, -223, -1000,
+ -1000, 57, -1000, -1000, -1000, -264, -1000, -1000, 4, 4,
+ -1000, -1000, -1000, 4, -1000, -269, 4, -1000, -1000, 4,
+ 32, -1000, -1000, 4, -211, -1000, -200, -14, -14, -269,
+ -21, -1000, 28, -21, -1000, -1000, -21, -1000, 4, -1000,
+ -1000, -214, -1000, -1000, 56, -220, 32, -1000, -1000, -197,
+ -1000, -1000, -1000, -1000, -1000, -1000, -200, -1000 };
int yypgo[]={
- 0, 180, 191, 54, 61, 81, 179, 133, 178, 177,
- 176, 175, 174, 172, 121, 171, 170, 76, 59, 167,
- 166, 165, 162, 161, 50, 160, 158, 157, 48, 49,
- 156, 155, 131, 154, 152, 151, 150, 149, 148, 147,
- 146, 145, 144, 143, 141, 139, 71, 138, 136, 134 };
+ 0, 183, 152, 69, 114, 81, 182, 181, 180, 179,
+ 177, 176, 70, 174, 115, 172, 79, 171, 76, 130,
+ 170, 169, 168, 167, 165, 164, 175, 163, 162, 161,
+ 67, 160, 75, 84, 158, 157, 146, 155, 151, 149,
+ 123, 109, 148, 147, 127, 122, 121, 65, 120, 71 };
int yyr1[]={
- 0, 1, 16, 1, 1, 1, 21, 23, 19, 25,
- 25, 26, 17, 18, 18, 27, 30, 27, 31, 27,
- 27, 27, 27, 27, 29, 29, 29, 34, 35, 24,
- 36, 37, 36, 2, 28, 3, 3, 3, 3, 3,
+ 0, 1, 17, 1, 1, 1, 1, 23, 20, 24,
+ 21, 16, 27, 27, 19, 19, 28, 18, 31, 30,
+ 29, 34, 29, 35, 29, 29, 29, 29, 33, 33,
+ 33, 37, 26, 38, 39, 38, 2, 32, 3, 3,
3, 3, 3, 3, 3, 3, 3, 3, 3, 3,
- 3, 3, 3, 3, 3, 3, 3, 39, 3, 40,
- 3, 41, 7, 38, 38, 43, 32, 42, 4, 4,
- 5, 44, 5, 22, 22, 45, 45, 15, 15, 8,
- 8, 10, 10, 11, 11, 47, 46, 12, 12, 13,
- 13, 6, 6, 14, 48, 14, 49, 14, 9, 9,
- 33, 33, 20 };
+ 3, 3, 3, 3, 3, 3, 3, 3, 3, 42,
+ 3, 43, 3, 44, 40, 36, 8, 8, 7, 7,
+ 4, 4, 5, 45, 5, 25, 25, 46, 46, 9,
+ 9, 9, 48, 9, 47, 47, 12, 12, 49, 13,
+ 13, 6, 6, 14, 14, 14, 15, 41, 10, 10,
+ 11, 11, 22 };
int yyr2[]={
- 0, 0, 1, 9, 4, 4, 1, 1, 19, 0,
- 6, 1, 4, 0, 2, 17, 1, 17, 1, 13,
- 7, 3, 3, 7, 0, 4, 15, 1, 1, 9,
- 0, 1, 9, 1, 3, 7, 7, 7, 7, 7,
- 7, 7, 7, 7, 7, 7, 7, 5, 5, 3,
- 9, 3, 3, 3, 3, 3, 5, 1, 11, 1,
- 11, 1, 9, 1, 2, 1, 11, 3, 1, 3,
- 3, 1, 9, 0, 2, 3, 7, 1, 3, 7,
- 7, 1, 3, 3, 7, 1, 9, 1, 3, 3,
- 7, 3, 7, 3, 1, 11, 1, 9, 3, 7,
- 0, 4, 3 };
+ 0, 0, 1, 9, 4, 4, 4, 1, 9, 1,
+ 13, 11, 0, 6, 0, 2, 1, 4, 1, 4,
+ 17, 1, 17, 1, 13, 7, 3, 7, 0, 4,
+ 15, 1, 7, 0, 1, 9, 1, 3, 7, 7,
+ 7, 7, 7, 7, 7, 7, 7, 7, 7, 7,
+ 7, 5, 3, 3, 3, 3, 3, 3, 5, 1,
+ 11, 1, 11, 1, 9, 5, 3, 7, 7, 3,
+ 1, 3, 3, 1, 9, 1, 3, 3, 7, 1,
+ 5, 5, 1, 11, 0, 2, 3, 7, 7, 3,
+ 7, 3, 7, 3, 9, 7, 3, 3, 3, 7,
+ 1, 5, 3 };
int yychk[]={
- -1000, -1, -16, -19, -20, 271, 274, -17, -26, 273,
- -18, 59, -27, 259, 263, 265, -6, -32, -7, 269,
- -14, -42, 64, 273, -21, -28, -3, 40, 43, 45,
- -7, 64, -14, 270, 272, 258, -32, 282, -30, -31,
- 61, 44, -9, 273, -48, -49, -43, -41, 40, 260,
- 61, 60, 62, 277, 278, 279, 43, 45, 42, 47,
- 280, 275, 276, -3, -28, -28, -28, 40, -28, -28,
- -24, -34, -5, -3, -14, -33, 44, 61, 91, 46,
- 40, -15, 273, -22, -45, 273, -2, -28, -28, -28,
- -28, -28, -28, -28, -28, -28, -28, -28, -2, -2,
- 41, -38, -28, 264, 266, -25, 44, 273, -5, -28,
- 273, -4, -5, -8, 123, 91, 41, 44, -24, -39,
- -40, 41, -2, -28, -17, -35, -44, 93, 41, -10,
- -11, -46, 273, -12, -13, -28, -23, 273, -2, -28,
- -28, -24, -2, -18, -36, -37, -3, 125, 44, -47,
- 93, 44, -24, -29, 261, 262, -2, 268, -46, 61,
- -28, 267, 267, -24, -28, 267, -4, -28, 260, -18,
- -2, -24, -2, -29 };
+ -1000, -1, -17, -20, -21, -22, 270, 274, -18, -28,
+ 273, -19, 59, -29, 259, 263, 265, -6, -36, 269,
+ -14, -8, -15, -41, 273, -23, 58, -32, -3, 40,
+ 45, -40, -41, 271, 272, 258, -36, 283, -44, -14,
+ -34, -35, 61, 44, -10, 273, -7, 40, -40, 58,
+ 91, 46, -16, 40, 273, 260, 277, 60, 62, 278,
+ 279, 280, 43, 45, 42, 47, 94, 281, 275, 276,
+ -3, -32, -32, -32, 123, -32, -26, -37, -5, -3,
+ -14, -41, -11, 44, 61, -4, -5, 273, -32, 273,
+ -25, -46, 273, -24, -2, -32, -32, -32, -32, -32,
+ -32, -32, -32, -32, -32, -32, -32, -2, -2, 41,
+ -9, -13, -12, -32, -49, 273, 264, 266, -27, 44,
+ 273, -5, 41, 93, 41, 44, -16, -26, -42, -43,
+ 125, -47, 59, 44, -47, 44, 61, -2, -30, -31,
+ -18, -38, 268, -45, -26, 273, -2, -32, -32, -48,
+ -32, -49, 273, -32, -26, -2, -32, -19, -39, -3,
+ 267, -33, 261, 262, -12, -2, -4, 267, -26, -30,
+ -47, 267, -19, 260, -2, -26, -2, -33 };
int yydef[]={
- 1, -2, 11, 4, 5, 0, 102, 13, 0, 6,
- 3, 14, 12, 0, 16, 18, 0, 21, 22, 0,
- -2, 65, 61, 93, 0, 0, 34, 0, 0, 0,
- 49, 61, -2, 52, 53, 54, 55, 0, 0, 27,
- 0, 0, 100, 98, 0, 0, 0, 77, 73, 33,
- 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,
- 0, 33, 33, 34, 0, 47, 48, 63, 56, 0,
- 0, 9, 20, -2, -2, 23, 0, 0, 0, 0,
- 68, 0, 78, 0, 74, 75, 27, 36, 37, 38,
- 39, 40, 41, 42, 43, 44, 45, 46, 57, 59,
- 35, 0, 64, 33, 0, -2, 71, 99, 101, 0,
- 97, 0, 69, 62, 81, 87, 7, 0, 33, 0,
- 0, 50, 27, 33, 13, -2, 0, 95, 66, 0,
- 82, 83, 85, 0, 88, 89, 27, 76, 24, 58,
- 60, 33, 19, 10, 29, 0, -2, 79, 0, 0,
- 80, 0, 0, 0, 27, 0, 0, 68, 84, 0,
- 90, 8, 15, 25, 0, 17, 13, 86, 33, 32,
- 27, 33, 24, 26 };
+ 1, -2, 16, 4, 5, 6, 0, 102, 14, 0,
+ 7, 3, 15, 17, 63, 21, 23, 0, 26, 0,
+ -2, 63, 93, 66, 96, 0, 0, 0, 37, 63,
+ 63, 52, -2, 54, 55, 56, 57, 63, 0, 97,
+ 63, 31, 63, 0, 100, 98, 65, -2, 69, 0,
+ 63, 0, 8, 75, 9, 36, 63, 63, 63, 63,
+ 63, 63, 63, 63, 63, 63, 63, 63, 36, 36,
+ 37, 0, 51, 58, -2, 0, 0, 12, 25, -2,
+ -2, 0, 27, 0, 63, 0, 71, 67, 0, 95,
+ 0, 76, 77, 0, 31, 39, 40, 41, 42, 43,
+ 44, 45, 46, 47, 48, 49, 50, 59, 61, 38,
+ 0, 84, 84, 89, 86, 96, 36, 18, -2, 73,
+ 99, 101, 68, 94, 31, 0, 10, 36, 63, 63,
+ 64, 80, 82, -2, 81, 85, 63, 31, 36, 63,
+ 14, 32, 34, 63, 0, 78, 28, 60, 62, 0,
+ 90, 87, 0, 88, 36, 24, 19, 13, -2, -2,
+ 11, 0, 31, 18, 84, 0, 14, 20, 29, 0,
+ 83, 22, 35, 36, 31, 36, 28, 30 };
typedef struct { char *t_name; int t_val; } yytoktype;
#ifndef YYDEBUG
# define YYDEBUG 0 /* don't allow debugging */
@@ -774,26 +882,27 @@ yytoktype yytoks[] =
"END", 267,
"RETURN", 268,
"LOCAL", 269,
- "NUMBER", 270,
- "FUNCTION", 271,
+ "FUNCTION", 270,
+ "NUMBER", 271,
"STRING", 272,
"NAME", 273,
"DEBUG", 274,
"AND", 275,
"OR", 276,
- "=", 61,
- "NE", 277,
+ "EQ", 277,
+ "NE", 278,
">", 62,
"<", 60,
- "LE", 278,
- "GE", 279,
- "CONC", 280,
+ "LE", 279,
+ "GE", 280,
+ "CONC", 281,
"+", 43,
"-", 45,
"*", 42,
"/", 47,
- "UNARY", 281,
- "NOT", 282,
+ "UNARY", 282,
+ "NOT", 283,
+ "^", 94,
"-unknown-", -1 /* ends search */
};
@@ -804,38 +913,41 @@ char * yyreds[] =
"functionlist : functionlist",
"functionlist : functionlist stat sc",
"functionlist : functionlist function",
+ "functionlist : functionlist method",
"functionlist : functionlist setdebug",
"function : FUNCTION NAME",
- "function : FUNCTION NAME '(' parlist ')'",
- "function : FUNCTION NAME '(' parlist ')' block END",
+ "function : FUNCTION NAME body",
+ "method : FUNCTION NAME ':' NAME",
+ "method : FUNCTION NAME ':' NAME body",
+ "body : '(' parlist ')' block END",
"statlist : /* empty */",
"statlist : statlist stat sc",
- "stat : /* empty */",
- "stat : stat1",
"sc : /* empty */",
"sc : ';'",
+ "stat : /* empty */",
+ "stat : stat1",
+ "cond : /* empty */",
+ "cond : expr1",
"stat1 : IF expr1 THEN PrepJump block PrepJump elsepart END",
"stat1 : WHILE",
"stat1 : WHILE expr1 DO PrepJump block PrepJump END",
"stat1 : REPEAT",
- "stat1 : REPEAT block UNTIL expr1 PrepJump",
+ "stat1 : REPEAT block UNTIL cond PrepJump",
"stat1 : varlist1 '=' exprlist1",
"stat1 : functioncall",
- "stat1 : typeconstructor",
"stat1 : LOCAL localdeclist decinit",
"elsepart : /* empty */",
"elsepart : ELSE block",
- "elsepart : ELSEIF expr1 THEN PrepJump block PrepJump elsepart",
+ "elsepart : ELSEIF cond THEN PrepJump block PrepJump elsepart",
"block : /* empty */",
- "block : statlist",
"block : statlist ret",
"ret : /* empty */",
- "ret : /* empty */",
+ "ret : RETURN",
"ret : RETURN exprlist sc",
"PrepJump : /* empty */",
"expr1 : expr",
"expr : '(' expr ')'",
- "expr : expr1 '=' expr1",
+ "expr : expr1 EQ expr1",
"expr : expr1 '<' expr1",
"expr : expr1 '>' expr1",
"expr : expr1 NE expr1",
@@ -845,12 +957,11 @@ char * yyreds[] =
"expr : expr1 '-' expr1",
"expr : expr1 '*' expr1",
"expr : expr1 '/' expr1",
+ "expr : expr1 '^' expr1",
"expr : expr1 CONC expr1",
- "expr : '+' expr1",
"expr : '-' expr1",
- "expr : typeconstructor",
- "expr : '@' '(' dimension ')'",
- "expr : var",
+ "expr : table",
+ "expr : varexp",
"expr : NUMBER",
"expr : STRING",
"expr : NIL",
@@ -860,13 +971,13 @@ char * yyreds[] =
"expr : expr1 AND PrepJump expr1",
"expr : expr1 OR PrepJump",
"expr : expr1 OR PrepJump expr1",
- "typeconstructor : '@'",
- "typeconstructor : '@' objectname fieldlist",
- "dimension : /* empty */",
- "dimension : expr1",
- "functioncall : functionvalue",
- "functioncall : functionvalue '(' exprlist ')'",
- "functionvalue : var",
+ "table : /* empty */",
+ "table : '{' fieldlist '}'",
+ "functioncall : funcvalue funcParams",
+ "funcvalue : varexp",
+ "funcvalue : varexp ':' NAME",
+ "funcParams : '(' exprlist ')'",
+ "funcParams : table",
"exprlist : /* empty */",
"exprlist : exprlist1",
"exprlist1 : expr",
@@ -876,27 +987,25 @@ char * yyreds[] =
"parlist : parlist1",
"parlist1 : NAME",
"parlist1 : parlist1 ',' NAME",
- "objectname : /* empty */",
- "objectname : NAME",
- "fieldlist : '{' ffieldlist '}'",
- "fieldlist : '[' lfieldlist ']'",
- "ffieldlist : /* empty */",
- "ffieldlist : ffieldlist1",
+ "fieldlist : /* empty */",
+ "fieldlist : lfieldlist1 lastcomma",
+ "fieldlist : ffieldlist1 lastcomma",
+ "fieldlist : lfieldlist1 ';'",
+ "fieldlist : lfieldlist1 ';' ffieldlist1 lastcomma",
+ "lastcomma : /* empty */",
+ "lastcomma : ','",
"ffieldlist1 : ffield",
"ffieldlist1 : ffieldlist1 ',' ffield",
- "ffield : NAME",
"ffield : NAME '=' expr1",
- "lfieldlist : /* empty */",
- "lfieldlist : lfieldlist1",
"lfieldlist1 : expr1",
"lfieldlist1 : lfieldlist1 ',' expr1",
"varlist1 : var",
"varlist1 : varlist1 ',' var",
- "var : NAME",
- "var : var",
- "var : var '[' expr1 ']'",
- "var : var",
- "var : var '.' NAME",
+ "var : singlevar",
+ "var : varexp '[' expr1 ']'",
+ "var : varexp '.' NAME",
+ "singlevar : NAME",
+ "varexp : var",
"localdeclist : NAME",
"localdeclist : localdeclist ',' NAME",
"decinit : /* empty */",
@@ -904,19 +1013,22 @@ char * yyreds[] =
"setdebug : DEBUG",
};
#endif /* YYDEBUG */
-#line 1 "/usr/lib/yaccpar"
+#line 1 "/usr/lang/SC1.0/yaccpar"
/* @(#)yaccpar 1.10 89/04/04 SMI; from S5R3 1.10 */
/*
** Skeleton parser driver for yacc output
*/
+/*
+ @(#)RELEASE SC1.0 C++ 2.1 1Mar1991
+*/
/*
** yacc user known macros and defines
*/
#define YYERROR goto yyerrlab
-#define YYACCEPT { free(yys); free(yyv); return(0); }
-#define YYABORT { free(yys); free(yyv); return(1); }
+#define YYACCEPT return(0)
+#define YYABORT return(1)
#define YYBACKUP( newtoken, newvalue )\
{\
if ( yychar >= 0 || ( yyr2[ yytmp ] >> 1 ) != 1 )\
@@ -930,10 +1042,24 @@ char * yyreds[] =
goto yynewstate;\
}
#define YYRECOVERING() (!!yyerrflag)
+#define YYCOPY(to, from, type) \
+ (type *) memcpy(to, (char *) from, yynewmax * sizeof(type))
#ifndef YYDEBUG
# define YYDEBUG 1 /* make debugging available */
#endif
+
+/*
+** extern declarations for C++ - check your own code for correctness
+** if you have function redefined error messages here.
+*/
+
+#ifdef __cplusplus
+EXTERN_FUNCTION ( extern int printf, (const char*, DOTDOTDOT) );
+EXTERN_FUNCTION ( extern void *memcpy, (void *, const void *, int) );
+#endif
+
+
/*
** user known globals
*/
@@ -947,8 +1073,8 @@ int yydebug; /* set to 1 to get debugging */
/*
** static variables used by the parser
*/
-static YYSTYPE *yyv; /* value stack */
-static int *yys; /* state stack */
+static YYSTYPE yy_yyv[YYMAXDEPTH], *yyv = yy_yyv; /* value stack */
+static int yy_yys[YYMAXDEPTH], *yys = yy_yys; /* state stack */
static YYSTYPE *yypv; /* top of value stack */
static int *yyps; /* top of state stack */
@@ -956,10 +1082,20 @@ static int *yyps; /* top of state stack */
static int yystate; /* current state */
static int yytmp; /* extra var (lasts between blocks) */
+#if defined(__cplusplus) || defined(__STDC__) || defined(lint)
+static int __yaccpar_lint_hack__ = 0;
+ /* if you change the value from 0 to
+ something else, make sure you know
+ what to do with yyerrlab reference.
+ This is a hack - to make sure C++ and
+ lint are happy with the 4.1 yacc code. */
+#endif
+
int yynerrs; /* number of errors */
int yyerrflag; /* error recovery flag */
int yychar; /* current input token number */
+static unsigned yymaxdepth = YYMAXDEPTH;
/*
@@ -968,19 +1104,12 @@ int yychar; /* current input token number */
int
yyparse()
{
- register YYSTYPE *yypvt; /* top of value stack for $vars */
- unsigned yymaxdepth = YYMAXDEPTH;
+ register YYSTYPE *yypvt = (YYSTYPE*)0 ; /* top of value stack for
+$vars */
/*
** Initialize externals - yyparse may be called more than once
*/
- yyv = (YYSTYPE*)malloc(yymaxdepth*sizeof(YYSTYPE));
- yys = (int*)malloc(yymaxdepth*sizeof(int));
- if (!yyv || !yys)
- {
- yyerror( "out of memory" );
- return(1);
- }
yypv = &yyv[-1];
yyps = &yys[-1];
yystate = 0;
@@ -989,13 +1118,26 @@ yyparse()
yyerrflag = 0;
yychar = -1;
- goto yystack;
+#if defined(__cplusplus) || defined(__STDC__) || defined(lint)
+/*
+ Note that the following can never be executed but simply to please
+ lint and C++
+ */
+ switch (__yaccpar_lint_hack__)
+ {
+ case 1: goto yyerrlab;
+ case 2: goto yynewstate;
+ }
+#endif
+
{
register YYSTYPE *yy_pv; /* top of value stack */
register int *yy_ps; /* top of state stack */
register int yy_state; /* current state */
register int yy_n; /* internal state number info */
+ goto yystack;
+
/*
** get globals into registers.
** branch to here only if YYBACKUP was called.
@@ -1052,26 +1194,47 @@ yyparse()
#endif /* YYDEBUG */
if ( ++yy_ps >= &yys[ yymaxdepth ] ) /* room on stack? */
{
- /*
- ** reallocate and recover. Note that pointers
- ** have to be reset, or bad things will happen
- */
- int yyps_index = (yy_ps - yys);
- int yypv_index = (yy_pv - yyv);
- int yypvt_index = (yypvt - yyv);
- yymaxdepth += YYMAXDEPTH;
- yyv = (YYSTYPE*)realloc((char*)yyv,
- yymaxdepth * sizeof(YYSTYPE));
- yys = (int*)realloc((char*)yys,
- yymaxdepth * sizeof(int));
- if (!yyv || !yys)
+ /*
+ ** reallocate and recover. Note that pointers
+ ** have to be reset, or bad things will happen
+ */
+ int yyps_index = (yy_ps - yys);
+ int yypv_index = (yy_pv - yyv);
+ int yypvt_index = (yypvt - yyv);
+ int yynewmax;
+
+ yynewmax = yymaxdepth + YYMAXDEPTH;
+ if (yymaxdepth == YYMAXDEPTH) /* first time growth */
+ {
+ YYSTYPE *newyyv = (YYSTYPE*)malloc(yynewmax*sizeof(YYSTYPE));
+ int *newyys = (int*)malloc(yynewmax*sizeof(int));
+ if (newyys != 0 && newyyv != 0)
+ {
+ yys = YYCOPY(newyys, yys, int);
+ yyv = YYCOPY(newyyv, yyv, YYSTYPE);
+ }
+ else
+ yynewmax = 0; /* failed */
+ }
+ else /* not first time */
+ {
+ yyv = (YYSTYPE*)realloc((char*)yyv,
+ yynewmax * sizeof(YYSTYPE));
+ yys = (int*)realloc((char*)yys,
+ yynewmax * sizeof(int));
+ if (yys == 0 || yyv == 0)
+ yynewmax = 0; /* failed */
+ }
+ if (yynewmax <= yymaxdepth) /* tables not expanded */
{
yyerror( "yacc stack overflow" );
- return(1);
+ YYABORT;
}
- yy_ps = yys + yyps_index;
- yy_pv = yyv + yypv_index;
- yypvt = yyv + yypvt_index;
+ yymaxdepth = yynewmax;
+
+ yy_ps = yys + yyps_index;
+ yy_pv = yyv + yypv_index;
+ yypvt = yyv + yypvt_index;
}
*yy_ps = yy_state;
*++yy_pv = yyval;
@@ -1292,7 +1455,7 @@ yyparse()
yy_n, yyreds[ yy_n ] );
#endif
yytmp = yy_n; /* value to switch over */
- yypvt = yy_pv; /* $vars top of value stack */
+ yypvt = yy_pv; /* $vars top of value stack */
/*
** Look in goto table for next state
** Sorry about using yy_state here as temporary
@@ -1345,466 +1508,393 @@ yyparse()
{
case 2:
-# line 227 "lua.stx"
+# line 411 "lua.stx"
{
- pc=maincode; basepc=initcode; maxcurr=maxmain;
+ pc=maincode; basepc=*initcode; maxcurr=maxmain;
nlocalvar=0;
} break;
case 3:
-# line 232 "lua.stx"
+# line 416 "lua.stx"
{
- maincode=pc; initcode=basepc; maxmain=maxcurr;
+ maincode=pc; *initcode=basepc; maxmain=maxcurr;
} break;
-case 6:
-# line 240 "lua.stx"
-{
- if (code == NULL) /* first function */
- {
- code = (Byte *) calloc(GAPCODE, sizeof(Byte));
- if (code == NULL)
- {
- lua_error("not enough memory");
- err = 1;
- }
- maxcode = GAPCODE;
- }
- pc=0; basepc=code; maxcurr=maxcode;
- nlocalvar=0;
- yyval.vWord = lua_findsymbol(yypvt[-0].pChar);
- } break;
case 7:
-# line 256 "lua.stx"
+# line 425 "lua.stx"
{
- if (lua_debug)
- {
- code_byte(SETFUNCTION);
- code_word(lua_nfile-1);
- code_word(yypvt[-3].vWord);
- }
- lua_codeadjust (0);
+ init_function(yypvt[-0].pNode);
} break;
case 8:
-# line 267 "lua.stx"
+# line 429 "lua.stx"
{
- if (lua_debug) code_byte(RESET);
- code_byte(RETCODE); code_byte(nlocalvar);
- s_tag(yypvt[-6].vWord) = T_FUNCTION;
- s_bvalue(yypvt[-6].vWord) = calloc (pc, sizeof(Byte));
- if (s_bvalue(yypvt[-6].vWord) == NULL)
- {
- lua_error("not enough memory");
- err = 1;
- }
- memcpy (s_bvalue(yypvt[-6].vWord), basepc, pc*sizeof(Byte));
- code = basepc; maxcode=maxcurr;
-#if LISTING
-PrintCode(code,code+pc);
-#endif
+ Word func = luaI_findsymbol(yypvt[-2].pNode);
+ s_tag(func) = LUA_T_FUNCTION;
+ s_bvalue(func) = yypvt[-0].pByte;
} break;
-case 11:
-# line 289 "lua.stx"
+case 9:
+# line 437 "lua.stx"
{
- ntemp = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
- } break;
-case 15:
-# line 302 "lua.stx"
+ init_function(yypvt[-0].pNode);
+ localvar[nlocalvar]=luaI_findsymbolbyname("self");
+ add_nlocalvar(1);
+ } break;
+case 10:
+# line 443 "lua.stx"
{
- {
- Word elseinit = yypvt[-2].vWord+sizeof(Word)+1;
- if (pc - elseinit == 0) /* no else */
- {
- pc -= sizeof(Word)+1;
- elseinit = pc;
- }
- else
- {
- basepc[yypvt[-2].vWord] = JMP;
- code_word_at(basepc+yypvt[-2].vWord+1, pc - elseinit);
- }
- basepc[yypvt[-4].vWord] = IFFJMP;
- code_word_at(basepc+yypvt[-4].vWord+1,elseinit-(yypvt[-4].vWord+sizeof(Word)+1));
- }
- } break;
+ /* assign function to table field */
+ pc=maincode; basepc=*initcode; maxcurr=maxmain;
+ nlocalvar=0;
+ lua_pushvar(luaI_findsymbol(yypvt[-4].pNode)+1);
+ code_byte(PUSHSTRING);
+ code_word(luaI_findconstant(yypvt[-2].pNode));
+ code_byte(PUSHFUNCTION);
+ code_code(yypvt[-0].pByte);
+ code_byte(STOREINDEXED0);
+ maincode=pc; *initcode=basepc; maxmain=maxcurr;
+ } break;
+case 11:
+# line 458 "lua.stx"
+{
+ codereturn();
+ yyval.pByte = newvector(pc, Byte);
+ memcpy(yyval.pByte, basepc, pc*sizeof(Byte));
+ funcCode = basepc; maxcode=maxcurr;
+#if LISTING
+ PrintCode(funcCode,funcCode+pc);
+#endif
+ } break;
case 16:
-# line 320 "lua.stx"
-{yyval.vWord=pc;} break;
-case 17:
-# line 322 "lua.stx"
+# line 475 "lua.stx"
+{ codedebugline(); } break;
+case 18:
+# line 477 "lua.stx"
+{ codedebugline(); } break;
+case 20:
+# line 480 "lua.stx"
+{ codeIf(yypvt[-4].vLong, yypvt[-2].vLong); } break;
+case 21:
+# line 482 "lua.stx"
+{yyval.vLong=pc;} break;
+case 22:
+# line 483 "lua.stx"
{
- basepc[yypvt[-3].vWord] = IFFJMP;
- code_word_at(basepc+yypvt[-3].vWord+1, pc - (yypvt[-3].vWord + sizeof(Word)+1));
-
- basepc[yypvt[-1].vWord] = UPJMP;
- code_word_at(basepc+yypvt[-1].vWord+1, pc - (yypvt[-6].vWord));
+ basepc[yypvt[-3].vLong] = IFFJMP;
+ code_word_at(basepc+yypvt[-3].vLong+1, pc - (yypvt[-3].vLong + sizeof(Word)+1));
+ basepc[yypvt[-1].vLong] = UPJMP;
+ code_word_at(basepc+yypvt[-1].vLong+1, pc - (yypvt[-6].vLong));
} break;
-case 18:
-# line 330 "lua.stx"
-{yyval.vWord=pc;} break;
-case 19:
-# line 332 "lua.stx"
+case 23:
+# line 490 "lua.stx"
+{yyval.vLong=pc;} break;
+case 24:
+# line 491 "lua.stx"
{
- basepc[yypvt[-0].vWord] = IFFUPJMP;
- code_word_at(basepc+yypvt[-0].vWord+1, pc - (yypvt[-4].vWord));
+ basepc[yypvt[-0].vLong] = IFFUPJMP;
+ code_word_at(basepc+yypvt[-0].vLong+1, pc - (yypvt[-4].vLong));
} break;
-case 20:
-# line 339 "lua.stx"
+case 25:
+# line 497 "lua.stx"
{
{
int i;
- if (yypvt[-0].vInt == 0 || nvarbuffer != ntemp - yypvt[-2].vInt * 2)
- lua_codeadjust (yypvt[-2].vInt * 2 + nvarbuffer);
+ adjust_mult_assign(nvarbuffer, yypvt[-0].vInt, yypvt[-2].vInt * 2 + nvarbuffer);
for (i=nvarbuffer-1; i>=0; i--)
lua_codestore (i);
if (yypvt[-2].vInt > 1 || (yypvt[-2].vInt == 1 && varbuffer[0] != 0))
lua_codeadjust (0);
}
} break;
-case 21:
-# line 350 "lua.stx"
-{ lua_codeadjust (0); } break;
-case 22:
-# line 351 "lua.stx"
-{ lua_codeadjust (0); } break;
-case 23:
-# line 352 "lua.stx"
-{ add_nlocalvar(yypvt[-1].vInt); lua_codeadjust (0); } break;
case 26:
-# line 358 "lua.stx"
-{
- {
- Word elseinit = yypvt[-1].vWord+sizeof(Word)+1;
- if (pc - elseinit == 0) /* no else */
- {
- pc -= sizeof(Word)+1;
- elseinit = pc;
- }
- else
- {
- basepc[yypvt[-1].vWord] = JMP;
- code_word_at(basepc+yypvt[-1].vWord+1, pc - elseinit);
- }
- basepc[yypvt[-3].vWord] = IFFJMP;
- code_word_at(basepc+yypvt[-3].vWord+1, elseinit - (yypvt[-3].vWord + sizeof(Word)+1));
- }
- } break;
+# line 507 "lua.stx"
+{ code_byte(0); } break;
case 27:
-# line 377 "lua.stx"
+# line 509 "lua.stx"
+{ add_nlocalvar(yypvt[-1].vInt);
+ adjust_mult_assign(yypvt[-1].vInt, yypvt[-0].vInt, 0);
+ } break;
+case 30:
+# line 517 "lua.stx"
+{ codeIf(yypvt[-3].vLong, yypvt[-1].vLong); } break;
+case 31:
+# line 520 "lua.stx"
{yyval.vInt = nlocalvar;} break;
-case 28:
-# line 377 "lua.stx"
-{ntemp = 0;} break;
-case 29:
-# line 378 "lua.stx"
+case 32:
+# line 521 "lua.stx"
{
- if (nlocalvar != yypvt[-3].vInt)
+ if (nlocalvar != yypvt[-2].vInt)
{
- nlocalvar = yypvt[-3].vInt;
+ nlocalvar = yypvt[-2].vInt;
lua_codeadjust (0);
}
} break;
-case 31:
-# line 388 "lua.stx"
-{ if (lua_debug){code_byte(SETLINE);code_word(lua_linenumber);}} break;
-case 32:
-# line 390 "lua.stx"
-{
- if (lua_debug) code_byte(RESET);
- code_byte(RETCODE); code_byte(nlocalvar);
+case 34:
+# line 531 "lua.stx"
+{ codedebugline(); } break;
+case 35:
+# line 532 "lua.stx"
+{
+ if (yypvt[-1].vInt < 0) code_byte(MULT_RET);
+ codereturn();
} break;
-case 33:
-# line 397 "lua.stx"
+case 36:
+# line 539 "lua.stx"
{
- yyval.vWord = pc;
+ yyval.vLong = pc;
code_byte(0); /* open space */
code_word (0);
} break;
-case 34:
-# line 403 "lua.stx"
-{ if (yypvt[-0].vInt == 0) {lua_codeadjust (ntemp+1); incr_ntemp();}} break;
-case 35:
-# line 406 "lua.stx"
-{ yyval.vInt = yypvt[-1].vInt; } break;
-case 36:
-# line 407 "lua.stx"
-{ code_byte(EQOP); yyval.vInt = 1; ntemp--;} break;
case 37:
-# line 408 "lua.stx"
-{ code_byte(LTOP); yyval.vInt = 1; ntemp--;} break;
+# line 545 "lua.stx"
+{ if (yypvt[-0].vInt == 0) code_byte(1); } break;
case 38:
-# line 409 "lua.stx"
-{ code_byte(LEOP); code_byte(NOTOP); yyval.vInt = 1; ntemp--;} break;
+# line 548 "lua.stx"
+{ yyval.vInt = yypvt[-1].vInt; } break;
case 39:
-# line 410 "lua.stx"
-{ code_byte(EQOP); code_byte(NOTOP); yyval.vInt = 1; ntemp--;} break;
+# line 549 "lua.stx"
+{ code_byte(EQOP); yyval.vInt = 1; } break;
case 40:
-# line 411 "lua.stx"
-{ code_byte(LEOP); yyval.vInt = 1; ntemp--;} break;
+# line 550 "lua.stx"
+{ code_byte(LTOP); yyval.vInt = 1; } break;
case 41:
-# line 412 "lua.stx"
-{ code_byte(LTOP); code_byte(NOTOP); yyval.vInt = 1; ntemp--;} break;
+# line 551 "lua.stx"
+{ code_byte(GTOP); yyval.vInt = 1; } break;
case 42:
-# line 413 "lua.stx"
-{ code_byte(ADDOP); yyval.vInt = 1; ntemp--;} break;
+# line 552 "lua.stx"
+{ code_byte(EQOP); code_byte(NOTOP); yyval.vInt = 1; } break;
case 43:
-# line 414 "lua.stx"
-{ code_byte(SUBOP); yyval.vInt = 1; ntemp--;} break;
+# line 553 "lua.stx"
+{ code_byte(LEOP); yyval.vInt = 1; } break;
case 44:
-# line 415 "lua.stx"
-{ code_byte(MULTOP); yyval.vInt = 1; ntemp--;} break;
+# line 554 "lua.stx"
+{ code_byte(GEOP); yyval.vInt = 1; } break;
case 45:
-# line 416 "lua.stx"
-{ code_byte(DIVOP); yyval.vInt = 1; ntemp--;} break;
+# line 555 "lua.stx"
+{ code_byte(ADDOP); yyval.vInt = 1; } break;
case 46:
-# line 417 "lua.stx"
-{ code_byte(CONCOP); yyval.vInt = 1; ntemp--;} break;
+# line 556 "lua.stx"
+{ code_byte(SUBOP); yyval.vInt = 1; } break;
case 47:
-# line 418 "lua.stx"
-{ yyval.vInt = 1; } break;
+# line 557 "lua.stx"
+{ code_byte(MULTOP); yyval.vInt = 1; } break;
case 48:
-# line 419 "lua.stx"
-{ code_byte(MINUSOP); yyval.vInt = 1;} break;
+# line 558 "lua.stx"
+{ code_byte(DIVOP); yyval.vInt = 1; } break;
case 49:
-# line 420 "lua.stx"
-{ yyval.vInt = yypvt[-0].vInt; } break;
+# line 559 "lua.stx"
+{ code_byte(POWOP); yyval.vInt = 1; } break;
case 50:
-# line 422 "lua.stx"
-{
- code_byte(CREATEARRAY);
- yyval.vInt = 1;
- } break;
+# line 560 "lua.stx"
+{ code_byte(CONCOP); yyval.vInt = 1; } break;
case 51:
-# line 426 "lua.stx"
-{ lua_pushvar (yypvt[-0].vLong); yyval.vInt = 1;} break;
+# line 561 "lua.stx"
+{ code_byte(MINUSOP); yyval.vInt = 1;} break;
case 52:
-# line 427 "lua.stx"
-{ code_number(yypvt[-0].vFloat); yyval.vInt = 1; } break;
+# line 562 "lua.stx"
+{ yyval.vInt = 1; } break;
case 53:
-# line 429 "lua.stx"
+# line 563 "lua.stx"
+{ yyval.vInt = 1;} break;
+case 54:
+# line 564 "lua.stx"
+{ code_number(yypvt[-0].vFloat); yyval.vInt = 1; } break;
+case 55:
+# line 566 "lua.stx"
{
code_byte(PUSHSTRING);
code_word(yypvt[-0].vWord);
yyval.vInt = 1;
- incr_ntemp();
- } break;
-case 54:
-# line 435 "lua.stx"
-{code_byte(PUSHNIL); yyval.vInt = 1; incr_ntemp();} break;
-case 55:
-# line 437 "lua.stx"
-{
- yyval.vInt = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
} break;
case 56:
-# line 444 "lua.stx"
-{ code_byte(NOTOP); yyval.vInt = 1;} break;
+# line 571 "lua.stx"
+{code_byte(PUSHNIL); yyval.vInt = 1; } break;
case 57:
-# line 445 "lua.stx"
-{code_byte(POP); ntemp--;} break;
+# line 572 "lua.stx"
+{ yyval.vInt = 0; } break;
case 58:
-# line 446 "lua.stx"
-{
- basepc[yypvt[-2].vWord] = ONFJMP;
- code_word_at(basepc+yypvt[-2].vWord+1, pc - (yypvt[-2].vWord + sizeof(Word)+1));
- yyval.vInt = 1;
- } break;
+# line 573 "lua.stx"
+{ code_byte(NOTOP); yyval.vInt = 1;} break;
case 59:
-# line 451 "lua.stx"
-{code_byte(POP); ntemp--;} break;
+# line 574 "lua.stx"
+{code_byte(POP); } break;
case 60:
-# line 452 "lua.stx"
+# line 575 "lua.stx"
{
- basepc[yypvt[-2].vWord] = ONTJMP;
- code_word_at(basepc+yypvt[-2].vWord+1, pc - (yypvt[-2].vWord + sizeof(Word)+1));
+ basepc[yypvt[-2].vLong] = ONFJMP;
+ code_word_at(basepc+yypvt[-2].vLong+1, pc - (yypvt[-2].vLong + sizeof(Word)+1));
yyval.vInt = 1;
} break;
case 61:
-# line 460 "lua.stx"
+# line 580 "lua.stx"
+{code_byte(POP); } break;
+case 62:
+# line 581 "lua.stx"
+{
+ basepc[yypvt[-2].vLong] = ONTJMP;
+ code_word_at(basepc+yypvt[-2].vLong+1, pc - (yypvt[-2].vLong + sizeof(Word)+1));
+ yyval.vInt = 1;
+ } break;
+case 63:
+# line 589 "lua.stx"
{
- code_byte(PUSHBYTE);
- yyval.vWord = pc; code_byte(0);
- incr_ntemp();
code_byte(CREATEARRAY);
+ yyval.vLong = pc; code_word(0);
} break;
-case 62:
-# line 467 "lua.stx"
+case 64:
+# line 594 "lua.stx"
{
- basepc[yypvt[-2].vWord] = yypvt[-0].vInt;
- if (yypvt[-1].vLong < 0) /* there is no function to be called */
- {
- yyval.vInt = 1;
- }
- else
- {
- lua_pushvar (yypvt[-1].vLong+1);
- code_byte(PUSHMARK);
- incr_ntemp();
- code_byte(PUSHOBJECT);
- incr_ntemp();
- code_byte(CALLFUNC);
- ntemp -= 4;
- yyval.vInt = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
- }
+ code_word_at(basepc+yypvt[-3].vLong, yypvt[-1].vInt);
} break;
-case 63:
-# line 491 "lua.stx"
-{ code_byte(PUSHNIL); incr_ntemp();} break;
case 65:
-# line 495 "lua.stx"
-{code_byte(PUSHMARK); yyval.vInt = ntemp; incr_ntemp();} break;
+# line 600 "lua.stx"
+{ code_byte(CALLFUNC); code_byte(yypvt[-1].vInt+yypvt[-0].vInt); } break;
case 66:
-# line 496 "lua.stx"
-{ code_byte(CALLFUNC); ntemp = yypvt[-3].vInt-1;} break;
+# line 603 "lua.stx"
+{ yyval.vInt = 0; } break;
case 67:
-# line 498 "lua.stx"
-{lua_pushvar (yypvt[-0].vLong); } break;
+# line 605 "lua.stx"
+{
+ code_byte(PUSHSELF);
+ code_word(luaI_findconstant(yypvt[-0].pNode));
+ yyval.vInt = 1;
+ } break;
case 68:
-# line 501 "lua.stx"
-{ yyval.vInt = 1; } break;
+# line 613 "lua.stx"
+{ if (yypvt[-1].vInt<0) { code_byte(1); yyval.vInt = -yypvt[-1].vInt; } else yyval.vInt = yypvt[-1].vInt; } break;
case 69:
-# line 502 "lua.stx"
-{ yyval.vInt = yypvt[-0].vInt; } break;
+# line 614 "lua.stx"
+{ yyval.vInt = 1; } break;
case 70:
-# line 505 "lua.stx"
-{ yyval.vInt = yypvt[-0].vInt; } break;
+# line 617 "lua.stx"
+{ yyval.vInt = 0; } break;
case 71:
-# line 506 "lua.stx"
-{if (!yypvt[-1].vInt){lua_codeadjust (ntemp+1); incr_ntemp();}} break;
+# line 618 "lua.stx"
+{ yyval.vInt = yypvt[-0].vInt; } break;
case 72:
-# line 507 "lua.stx"
-{yyval.vInt = yypvt[-0].vInt;} break;
+# line 621 "lua.stx"
+{ if (yypvt[-0].vInt == 0) yyval.vInt = -1; else yyval.vInt = 1; } break;
+case 73:
+# line 622 "lua.stx"
+{ if (yypvt[-1].vInt < 0) code_byte(1); } break;
+case 74:
+# line 623 "lua.stx"
+{
+ int r = yypvt[-3].vInt < 0 ? -yypvt[-3].vInt : yypvt[-3].vInt;
+ yyval.vInt = (yypvt[-0].vInt == 0) ? -(r+1) : r+1;
+ } break;
case 75:
-# line 515 "lua.stx"
+# line 629 "lua.stx"
+{ lua_codeadjust(0); } break;
+case 76:
+# line 630 "lua.stx"
+{ lua_codeadjust(0); } break;
+case 77:
+# line 634 "lua.stx"
{
- localvar[nlocalvar]=lua_findsymbol(yypvt[-0].pChar);
+ localvar[nlocalvar]=luaI_findsymbol(yypvt[-0].pNode);
add_nlocalvar(1);
} break;
-case 76:
-# line 520 "lua.stx"
+case 78:
+# line 639 "lua.stx"
{
- localvar[nlocalvar]=lua_findsymbol(yypvt[-0].pChar);
+ localvar[nlocalvar]=luaI_findsymbol(yypvt[-0].pNode);
add_nlocalvar(1);
} break;
-case 77:
-# line 526 "lua.stx"
-{yyval.vLong=-1;} break;
-case 78:
-# line 527 "lua.stx"
-{yyval.vLong=lua_findsymbol(yypvt[-0].pChar);} break;
case 79:
-# line 531 "lua.stx"
-{
- flush_record(yypvt[-1].vInt%FIELDS_PER_FLUSH);
- yyval.vInt = yypvt[-1].vInt;
- } break;
+# line 645 "lua.stx"
+{ yyval.vInt = 0; } break;
case 80:
-# line 536 "lua.stx"
-{
- flush_list(yypvt[-1].vInt/FIELDS_PER_FLUSH, yypvt[-1].vInt%FIELDS_PER_FLUSH);
- yyval.vInt = yypvt[-1].vInt;
- } break;
+# line 647 "lua.stx"
+{ yyval.vInt = yypvt[-1].vInt; flush_list(yypvt[-1].vInt/FIELDS_PER_FLUSH, yypvt[-1].vInt%FIELDS_PER_FLUSH); } break;
case 81:
-# line 542 "lua.stx"
-{ yyval.vInt = 0; } break;
+# line 649 "lua.stx"
+{ yyval.vInt = yypvt[-1].vInt; flush_record(yypvt[-1].vInt%FIELDS_PER_FLUSH); } break;
case 82:
-# line 543 "lua.stx"
-{ yyval.vInt = yypvt[-0].vInt; } break;
+# line 651 "lua.stx"
+{ flush_list(yypvt[-1].vInt/FIELDS_PER_FLUSH, yypvt[-1].vInt%FIELDS_PER_FLUSH); } break;
case 83:
-# line 546 "lua.stx"
+# line 653 "lua.stx"
+{ yyval.vInt = yypvt[-4].vInt+yypvt[-1].vInt; flush_record(yypvt[-1].vInt%FIELDS_PER_FLUSH); } break;
+case 86:
+# line 660 "lua.stx"
{yyval.vInt=1;} break;
-case 84:
-# line 548 "lua.stx"
+case 87:
+# line 662 "lua.stx"
{
yyval.vInt=yypvt[-2].vInt+1;
if (yyval.vInt%FIELDS_PER_FLUSH == 0) flush_record(FIELDS_PER_FLUSH);
} break;
-case 85:
-# line 554 "lua.stx"
-{yyval.vWord = lua_findconstant(yypvt[-0].pChar);} break;
-case 86:
-# line 555 "lua.stx"
+case 88:
+# line 669 "lua.stx"
{
- push_field(yypvt[-2].vWord);
+ push_field(luaI_findconstant(yypvt[-2].pNode));
} break;
-case 87:
-# line 560 "lua.stx"
-{ yyval.vInt = 0; } break;
-case 88:
-# line 561 "lua.stx"
-{ yyval.vInt = yypvt[-0].vInt; } break;
case 89:
-# line 564 "lua.stx"
+# line 674 "lua.stx"
{yyval.vInt=1;} break;
case 90:
-# line 566 "lua.stx"
+# line 676 "lua.stx"
{
yyval.vInt=yypvt[-2].vInt+1;
if (yyval.vInt%FIELDS_PER_FLUSH == 0)
flush_list(yyval.vInt/FIELDS_PER_FLUSH - 1, FIELDS_PER_FLUSH);
} break;
case 91:
-# line 574 "lua.stx"
+# line 684 "lua.stx"
{
nvarbuffer = 0;
varbuffer[nvarbuffer] = yypvt[-0].vLong; incr_nvarbuffer();
yyval.vInt = (yypvt[-0].vLong == 0) ? 1 : 0;
} break;
case 92:
-# line 580 "lua.stx"
+# line 690 "lua.stx"
{
varbuffer[nvarbuffer] = yypvt[-0].vLong; incr_nvarbuffer();
yyval.vInt = (yypvt[-0].vLong == 0) ? yypvt[-2].vInt + 1 : yypvt[-2].vInt;
} break;
case 93:
-# line 587 "lua.stx"
+# line 696 "lua.stx"
+{ yyval.vLong = yypvt[-0].vLong; } break;
+case 94:
+# line 698 "lua.stx"
{
- Word s = lua_findsymbol(yypvt[-0].pChar);
- int local = lua_localname (s);
- if (local == -1) /* global var */
- yyval.vLong = s + 1; /* return positive value */
- else
- yyval.vLong = -(local+1); /* return negative value */
+ yyval.vLong = 0; /* indexed variable */
} break;
-case 94:
-# line 596 "lua.stx"
-{lua_pushvar (yypvt[-0].vLong);} break;
case 95:
-# line 597 "lua.stx"
+# line 702 "lua.stx"
{
+ code_byte(PUSHSTRING);
+ code_word(luaI_findconstant(yypvt[-0].pNode));
yyval.vLong = 0; /* indexed variable */
} break;
case 96:
-# line 600 "lua.stx"
-{lua_pushvar (yypvt[-0].vLong);} break;
-case 97:
-# line 601 "lua.stx"
+# line 710 "lua.stx"
{
- code_byte(PUSHSTRING);
- code_word(lua_findconstant(yypvt[-0].pChar)); incr_ntemp();
- yyval.vLong = 0; /* indexed variable */
+ Word s = luaI_findsymbol(yypvt[-0].pNode);
+ int local = lua_localname (s);
+ if (local == -1) /* global var */
+ yyval.vLong = s + 1; /* return positive value */
+ else
+ yyval.vLong = -(local+1); /* return negative value */
} break;
+case 97:
+# line 720 "lua.stx"
+{ lua_pushvar(yypvt[-0].vLong); } break;
case 98:
-# line 608 "lua.stx"
-{localvar[nlocalvar]=lua_findsymbol(yypvt[-0].pChar); yyval.vInt = 1;} break;
+# line 723 "lua.stx"
+{localvar[nlocalvar]=luaI_findsymbol(yypvt[-0].pNode); yyval.vInt = 1;} break;
case 99:
-# line 610 "lua.stx"
+# line 725 "lua.stx"
{
- localvar[nlocalvar+yypvt[-2].vInt]=lua_findsymbol(yypvt[-0].pChar);
+ localvar[nlocalvar+yypvt[-2].vInt]=luaI_findsymbol(yypvt[-0].pNode);
yyval.vInt = yypvt[-2].vInt+1;
} break;
+case 100:
+# line 731 "lua.stx"
+{ yyval.vInt = 0; } break;
+case 101:
+# line 732 "lua.stx"
+{ yyval.vInt = yypvt[-0].vInt; } break;
case 102:
-# line 620 "lua.stx"
+# line 735 "lua.stx"
{lua_debug = yypvt[-0].vInt;} break;
}
goto yystack; /* reset registers in driver code */
diff --git a/src/y.tab.h b/src/parser.h
index 5bee29f9..4c125dad 100644
--- a/src/y.tab.h
+++ b/src/parser.h
@@ -2,11 +2,12 @@
typedef union
{
int vInt;
- long vLong;
float vFloat;
char *pChar;
Word vWord;
+ Long vLong;
Byte *pByte;
+ TreeNode *pNode;
} YYSTYPE;
extern YYSTYPE yylval;
# define WRONGTOKEN 257
@@ -22,16 +23,17 @@ extern YYSTYPE yylval;
# define END 267
# define RETURN 268
# define LOCAL 269
-# define NUMBER 270
-# define FUNCTION 271
+# define FUNCTION 270
+# define NUMBER 271
# define STRING 272
# define NAME 273
# define DEBUG 274
# define AND 275
# define OR 276
-# define NE 277
-# define LE 278
-# define GE 279
-# define CONC 280
-# define UNARY 281
-# define NOT 282
+# define EQ 277
+# define NE 278
+# define LE 279
+# define GE 280
+# define CONC 281
+# define UNARY 282
+# define NOT 283
diff --git a/src/table.c b/src/table.c
index 7b93df76..cedbf31c 100644
--- a/src/table.c
+++ b/src/table.c
@@ -3,159 +3,144 @@
** Module to control static tables
*/
-char *rcs_table="$Id: table.c,v 2.1 1994/04/20 22:07:57 celes Exp $";
+char *rcs_table="$Id: table.c,v 2.28 1995/01/18 20:15:54 celes Exp $";
-#include <stdlib.h>
#include <string.h>
-#include "mm.h"
-
+#include "mem.h"
#include "opcode.h"
+#include "tree.h"
#include "hash.h"
#include "inout.h"
#include "table.h"
#include "lua.h"
+#include "fallback.h"
+
+
+#define BUFFER_BLOCK 256
+
+Symbol *lua_table;
+static Word lua_ntable = 0;
+static Long lua_maxsymbol = 0;
+
+TaggedString **lua_constant;
+static Word lua_nconstant = 0;
+static Long lua_maxconstant = 0;
+
-#define streq(s1,s2) (s1[0]==s2[0]&&strcmp(s1+1,s2+1)==0)
-
-#ifndef MAXSYMBOL
-#define MAXSYMBOL 512
-#endif
-static Symbol tablebuffer[MAXSYMBOL] = {
- {"type",{T_CFUNCTION,{lua_type}}},
- {"tonumber",{T_CFUNCTION,{lua_obj2number}}},
- {"next",{T_CFUNCTION,{lua_next}}},
- {"nextvar",{T_CFUNCTION,{lua_nextvar}}},
- {"print",{T_CFUNCTION,{lua_print}}},
- {"dofile",{T_CFUNCTION,{lua_internaldofile}}},
- {"dostring",{T_CFUNCTION,{lua_internaldostring}}}
- };
-Symbol *lua_table=tablebuffer;
-Word lua_ntable=7;
-
-struct List
-{
- Symbol *s;
- struct List *next;
-};
-
-static struct List o6={ tablebuffer+6, 0};
-static struct List o5={ tablebuffer+5, &o6 };
-static struct List o4={ tablebuffer+4, &o5 };
-static struct List o3={ tablebuffer+3, &o4 };
-static struct List o2={ tablebuffer+2, &o3 };
-static struct List o1={ tablebuffer+1, &o2 };
-static struct List o0={ tablebuffer+0, &o1 };
-static struct List *searchlist=&o0;
-
-#ifndef MAXCONSTANT
-#define MAXCONSTANT 256
-#endif
-/* pre-defined constants need garbage collection extra byte */
-static char tm[] = " mark";
-static char ti[] = " nil";
-static char tn[] = " number";
-static char ts[] = " string";
-static char tt[] = " table";
-static char tf[] = " function";
-static char tc[] = " cfunction";
-static char tu[] = " userdata";
-static char *constantbuffer[MAXCONSTANT] = {tm+1, ti+1,
- tn+1, ts+1,
- tt+1, tf+1,
- tc+1, tu+1
- };
-char **lua_constant = constantbuffer;
-Word lua_nconstant=T_USERDATA+1;
-
-#ifndef MAXSTRING
-#define MAXSTRING 512
-#endif
-static char *stringbuffer[MAXSTRING];
-char **lua_string = stringbuffer;
-Word lua_nstring=0;
#define MAXFILE 20
char *lua_file[MAXFILE];
int lua_nfile;
+#define GARBAGE_BLOCK 256
+#define MIN_GARBAGE_BLOCK 10
-#define markstring(s) (*((s)-1))
+static void lua_nextvar (void);
+static void setglobal (void);
+static void getglobal (void);
+
+/*
+** Initialise symbol table with internal functions
+*/
+static void lua_initsymbol (void)
+{
+ Word n;
+ lua_maxsymbol = BUFFER_BLOCK;
+ lua_table = newvector(lua_maxsymbol, Symbol);
+ n = luaI_findsymbolbyname("next");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_next;
+ n = luaI_findsymbolbyname("dofile");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_internaldofile;
+ n = luaI_findsymbolbyname("setglobal");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = setglobal;
+ n = luaI_findsymbolbyname("getglobal");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = getglobal;
+ n = luaI_findsymbolbyname("nextvar");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_nextvar;
+ n = luaI_findsymbolbyname("type");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = luaI_type;
+ n = luaI_findsymbolbyname("tonumber");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_obj2number;
+ n = luaI_findsymbolbyname("print");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_print;
+ n = luaI_findsymbolbyname("dostring");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = lua_internaldostring;
+ n = luaI_findsymbolbyname("setfallback");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = luaI_setfallback;
+ n = luaI_findsymbolbyname("error");
+ s_tag(n) = LUA_T_CFUNCTION; s_fvalue(n) = luaI_error;
+}
-/* Variables to controll garbage collection */
-Word lua_block=10; /* to check when garbage collector will be called */
-Word lua_nentity; /* counter of new entities (strings and arrays) */
+/*
+** Initialise constant table with pre-defined constants
+*/
+void lua_initconstant (void)
+{
+ lua_maxconstant = BUFFER_BLOCK;
+ lua_constant = newvector(lua_maxconstant, TaggedString *);
+}
/*
** Given a name, search it at symbol table and return its index. If not
-** found, allocate at end of table, checking oveflow and return its index.
-** On error, return -1.
+** found, allocate it.
*/
-int lua_findsymbol (char *s)
+Word luaI_findsymbol (TreeNode *t)
{
- struct List *l, *p;
- for (p=NULL, l=searchlist; l!=NULL; p=l, l=l->next)
- if (streq(s,l->s->name))
+ if (lua_table == NULL)
+ lua_initsymbol();
+ if (t->varindex == NOT_USED)
+ {
+ if (lua_ntable == lua_maxsymbol)
{
- if (p!=NULL)
- {
- p->next = l->next;
- l->next = searchlist;
- searchlist = l;
- }
- return (l->s-lua_table);
+ if (lua_maxsymbol >= MAX_WORD)
+ lua_error("symbol table overflow");
+ lua_maxsymbol *= 2;
+ if (lua_maxsymbol >= MAX_WORD)
+ lua_maxsymbol = MAX_WORD;
+ lua_table = growvector(lua_table, lua_maxsymbol, Symbol);
}
-
- if (lua_ntable >= MAXSYMBOL-1)
- {
- lua_error ("symbol table overflow");
- return -1;
+ t->varindex = lua_ntable;
+ s_tag(lua_ntable) = LUA_T_NIL;
+ lua_ntable++;
}
- s_name(lua_ntable) = strdup(s);
- if (s_name(lua_ntable) == NULL)
- {
- lua_error ("not enough memory");
- return -1;
- }
- s_tag(lua_ntable) = T_NIL;
- p = malloc(sizeof(*p));
- p->s = lua_table+lua_ntable;
- p->next = searchlist;
- searchlist = p;
+ return t->varindex;
+}
- return lua_ntable++;
+
+Word luaI_findsymbolbyname (char *name)
+{
+ return luaI_findsymbol(lua_constcreate(name));
}
+
/*
-** Given a constant string, search it at constant table and return its index.
-** If not found, allocate at end of the table, checking oveflow and return
-** its index.
-**
-** For each allocation, the function allocate a extra char to be used to
-** mark used string (it's necessary to deal with constant and string
-** uniformily). The function store at the table the second position allocated,
-** that represents the beginning of the real string. On error, return -1.
-**
+** Given a name, search it at constant table and return its index. If not
+** found, allocate it.
+** On error, return -1.
*/
-int lua_findconstant (char *s)
+Word luaI_findconstant (TreeNode *t)
{
- int i;
- for (i=0; i<lua_nconstant; i++)
- if (streq(s,lua_constant[i]))
- return i;
- if (lua_nconstant >= MAXCONSTANT-1)
+ if (lua_constant == NULL)
+ lua_initconstant();
+ if (t->constindex == NOT_USED)
{
- lua_error ("lua: constant string table overflow");
- return -1;
- }
- {
- char *c = calloc(strlen(s)+2,sizeof(char));
- c++; /* create mark space */
- lua_constant[lua_nconstant++] = strcpy(c,s);
+ if (lua_nconstant == lua_maxconstant)
+ {
+ if (lua_maxconstant >= MAX_WORD)
+ lua_error("constant table overflow");
+ lua_maxconstant *= 2;
+ if (lua_maxconstant >= MAX_WORD)
+ lua_maxconstant = MAX_WORD;
+ lua_constant = growvector(lua_constant, lua_maxconstant, TaggedString *);
+ }
+ t->constindex = lua_nconstant;
+ lua_constant[lua_nconstant] = &(t->ts);
+ lua_nconstant++;
}
- return (lua_nconstant-1);
+ return t->constindex;
}
@@ -164,7 +149,7 @@ int lua_findconstant (char *s)
*/
void lua_travsymbol (void (*fn)(Object *))
{
- int i;
+ Word i;
for (i=0; i<lua_ntable; i++)
fn(&s_object(i));
}
@@ -175,9 +160,9 @@ void lua_travsymbol (void (*fn)(Object *))
*/
void lua_markobject (Object *o)
{
- if (tag(o) == T_STRING)
- markstring (svalue(o)) = 1;
- else if (tag(o) == T_ARRAY)
+ if (tag(o) == LUA_T_STRING && !tsvalue(o)->marked)
+ tsvalue(o)->marked = 1;
+ else if (tag(o) == LUA_T_ARRAY)
lua_hashmark (avalue(o));
}
@@ -188,87 +173,33 @@ void lua_markobject (Object *o)
*/
void lua_pack (void)
{
- /* mark stack strings */
- lua_travstack(lua_markobject);
-
- /* mark symbol table strings */
- lua_travsymbol(lua_markobject);
-
- lua_stringcollector();
- lua_hashcollector();
-
- lua_nentity = 0; /* reset counter */
+ static Long block = GARBAGE_BLOCK; /* when garbage collector will be called */
+ static Long nentity = 0; /* counter of new entities (strings and arrays) */
+ Long recovered = 0;
+ if (nentity++ < block) return;
+ lua_travstack(lua_markobject); /* mark stack objects */
+ lua_travsymbol(lua_markobject); /* mark symbol table objects */
+ luaI_travlock(lua_markobject); /* mark locked objects */
+ recovered += lua_strcollector();
+ recovered += lua_hashcollector();
+ nentity = 0; /* reset counter */
+ block=(16*block-7*recovered)/12; /* adapt block size */
+ if (block < MIN_GARBAGE_BLOCK) block = MIN_GARBAGE_BLOCK;
}
-/*
-** Garbage collection to atrings.
-** Delete all unmarked strings
-*/
-void lua_stringcollector (void)
-{
- int i, j;
- for (i=j=0; i<lua_nstring; i++)
- if (markstring(lua_string[i]) == 1)
- {
- lua_string[j++] = lua_string[i];
- markstring(lua_string[i]) = 0;
- }
- else
- {
- free (lua_string[i]-1);
- }
- lua_nstring = j;
-}
-
-/*
-** Allocate a new string at string table. The given string is already
-** allocated with mark space and the function puts it at the end of the
-** table, checking overflow, and returns its own pointer, or NULL on error.
-*/
-char *lua_createstring (char *s)
-{
- int i;
- if (s == NULL) return NULL;
-
- for (i=0; i<lua_nstring; i++)
- if (streq(s,lua_string[i]))
- {
- free(s-1);
- return lua_string[i];
- }
-
- if (lua_nentity == lua_block || lua_nstring >= MAXSTRING-1)
- {
- lua_pack ();
- if (lua_nstring >= MAXSTRING-1)
- {
- lua_error ("string table overflow");
- return NULL;
- }
- }
- lua_string[lua_nstring++] = s;
- lua_nentity++;
- return s;
-}
/*
** Add a file name at file table, checking overflow. This function also set
** the external variable "lua_filename" with the function filename set.
-** Return 0 on success or 1 on error.
+** Return 0 on success or error message on error.
*/
-int lua_addfile (char *fn)
+char *lua_addfile (char *fn)
{
- if (lua_nfile >= MAXFILE-1)
- {
- lua_error ("too many files");
- return 1;
- }
- if ((lua_file[lua_nfile++] = strdup (fn)) == NULL)
- {
- lua_error ("not enough memory");
- return 1;
- }
- return 0;
+ if (lua_nfile >= MAXFILE)
+ return "too many files";
+ if ((lua_file[lua_nfile++] = luaI_strdup (fn)) == NULL)
+ return "not enough memory";
+ return NULL;
}
/*
@@ -276,7 +207,7 @@ int lua_addfile (char *fn)
*/
int lua_delfile (void)
{
- lua_nfile--;
+ luaI_free(lua_file[--lua_nfile]);
return 1;
}
@@ -291,47 +222,56 @@ char *lua_filename (void)
/*
** Internal function: return next global variable
*/
-void lua_nextvar (void)
+static void lua_nextvar (void)
{
- int index;
- Object *o = lua_getparam (1);
- if (o == NULL)
- { lua_error ("too few arguments to function `nextvar'"); return; }
- if (lua_getparam (2) != NULL)
- { lua_error ("too many arguments to function `nextvar'"); return; }
- if (tag(o) == T_NIL)
+ char *varname;
+ TreeNode *next;
+ lua_Object o = lua_getparam(1);
+ if (o == LUA_NOOBJECT)
+ lua_reportbug("too few arguments to function `nextvar'");
+ if (lua_getparam(2) != LUA_NOOBJECT)
+ lua_reportbug("too many arguments to function `nextvar'");
+ if (lua_isnil(o))
+ varname = NULL;
+ else if (!lua_isstring(o))
{
- index = 0;
- }
- else if (tag(o) != T_STRING)
- {
- lua_error ("incorrect argument to function `nextvar'");
- return;
+ lua_reportbug("incorrect argument to function `nextvar'");
+ return; /* to avoid warnings */
}
else
+ varname = lua_getstring(o);
+ next = lua_varnext(varname);
+ if (next == NULL)
{
- for (index=0; index<lua_ntable; index++)
- if (streq(s_name(index),svalue(o))) break;
- if (index == lua_ntable)
- {
- lua_error ("name not found in function `nextvar'");
- return;
- }
- index++;
- while (index < lua_ntable && tag(&s_object(index)) == T_NIL) index++;
-
- if (index == lua_ntable)
- {
- lua_pushnil();
- lua_pushnil();
- return;
- }
+ lua_pushnil();
+ lua_pushnil();
}
+ else
{
Object name;
- tag(&name) = T_STRING;
- svalue(&name) = lua_createstring(lua_strdup(s_name(index)));
- if (lua_pushobject (&name)) return;
- if (lua_pushobject (&s_object(index))) return;
+ tag(&name) = LUA_T_STRING;
+ tsvalue(&name) = &(next->ts);
+ luaI_pushobject(&name);
+ luaI_pushobject(&s_object(next->varindex));
}
}
+
+
+static void setglobal (void)
+{
+ lua_Object name = lua_getparam(1);
+ lua_Object value = lua_getparam(2);
+ if (!lua_isstring(name))
+ lua_reportbug("incorrect argument to function `setglobal'");
+ lua_pushobject(value);
+ lua_storeglobal(lua_getstring(name));
+}
+
+
+static void getglobal (void)
+{
+ lua_Object name = lua_getparam(1);
+ if (!lua_isstring(name))
+ lua_reportbug("incorrect argument to function `getglobal'");
+ lua_pushobject(lua_getglobal(lua_getstring(name)));
+}
diff --git a/src/table.h b/src/table.h
index a1da6639..c25075c0 100644
--- a/src/table.h
+++ b/src/table.h
@@ -1,42 +1,31 @@
/*
** Module to control static tables
** TeCGraf - PUC-Rio
-** $Id: table.h,v 2.1 1994/04/20 22:07:57 celes Exp $
+** $Id: table.h,v 2.10 1994/12/20 21:20:36 roberto Exp $
*/
#ifndef table_h
#define table_h
-extern Symbol *lua_table;
-extern Word lua_ntable;
-
-extern char **lua_constant;
-extern Word lua_nconstant;
-
-extern char **lua_string;
-extern Word lua_nstring;
+#include "tree.h"
+#include "opcode.h"
-extern Hash **lua_array;
-extern Word lua_narray;
+extern Symbol *lua_table;
+extern TaggedString **lua_constant;
extern char *lua_file[];
extern int lua_nfile;
-extern Word lua_block;
-extern Word lua_nentity;
-
-
-int lua_findsymbol (char *s);
-int lua_findconstant (char *s);
+void lua_initconstant (void);
+Word luaI_findsymbolbyname (char *name);
+Word luaI_findsymbol (TreeNode *t);
+Word luaI_findconstant (TreeNode *t);
void lua_travsymbol (void (*fn)(Object *));
void lua_markobject (Object *o);
void lua_pack (void);
-void lua_stringcollector (void);
-char *lua_createstring (char *s);
-int lua_addfile (char *fn);
+char *lua_addfile (char *fn);
int lua_delfile (void);
char *lua_filename (void);
-void lua_nextvar (void);
#endif
diff --git a/src/tree.c b/src/tree.c
new file mode 100644
index 00000000..5dd9d78e
--- /dev/null
+++ b/src/tree.c
@@ -0,0 +1,141 @@
+/*
+** tree.c
+** TecCGraf - PUC-Rio
+*/
+
+char *rcs_tree="$Id: tree.c,v 1.13 1995/01/12 14:19:04 roberto Exp $";
+
+
+#include <string.h>
+
+#include "mem.h"
+#include "lua.h"
+#include "tree.h"
+#include "table.h"
+
+
+#define lua_strcmp(a,b) (a[0]<b[0]?(-1):(a[0]>b[0]?(1):strcmp(a,b)))
+
+
+typedef struct StringNode {
+ struct StringNode *next;
+ TaggedString ts;
+} StringNode;
+
+static StringNode *string_root = NULL;
+
+static TreeNode *constant_root = NULL;
+
+/*
+** Insert a new constant/variable at the tree.
+*/
+static TreeNode *tree_create (TreeNode **node, char *str)
+{
+ if (*node == NULL)
+ {
+ *node = (TreeNode *) luaI_malloc(sizeof(TreeNode)+strlen(str));
+ (*node)->left = (*node)->right = NULL;
+ strcpy((*node)->ts.str, str);
+ (*node)->ts.marked = 0;
+ (*node)->ts.hash = 0;
+ (*node)->varindex = (*node)->constindex = NOT_USED;
+ return *node;
+ }
+ else
+ {
+ int c = lua_strcmp(str, (*node)->ts.str);
+ if (c < 0)
+ return tree_create(&(*node)->left, str);
+ else if (c > 0)
+ return tree_create(&(*node)->right, str);
+ else
+ return *node;
+ }
+}
+
+TaggedString *lua_createstring (char *str)
+{
+ StringNode *newString;
+ if (str == NULL) return NULL;
+ lua_pack();
+ newString = (StringNode *)luaI_malloc(sizeof(StringNode)+strlen(str));
+ newString->ts.marked = 0;
+ newString->ts.hash = 0;
+ strcpy(newString->ts.str, str);
+ newString->next = string_root;
+ string_root = newString;
+ return &(newString->ts);
+}
+
+
+TreeNode *lua_constcreate (char *str)
+{
+ return tree_create(&constant_root, str);
+}
+
+
+/*
+** Garbage collection function.
+** This function traverse the string list freeing unindexed strings
+*/
+Long lua_strcollector (void)
+{
+ StringNode *curr = string_root, *prev = NULL;
+ Long counter = 0;
+ while (curr)
+ {
+ StringNode *next = curr->next;
+ if (!curr->ts.marked)
+ {
+ if (prev == NULL) string_root = next;
+ else prev->next = next;
+ luaI_free(curr);
+ ++counter;
+ }
+ else
+ {
+ curr->ts.marked = 0;
+ prev = curr;
+ }
+ curr = next;
+ }
+ return counter;
+}
+
+/*
+** Return next variable.
+*/
+static TreeNode *tree_next (TreeNode *node, char *str)
+{
+ if (node == NULL) return NULL;
+ else if (str == NULL) return node;
+ else
+ {
+ int c = lua_strcmp(str, node->ts.str);
+ if (c == 0)
+ return node->left != NULL ? node->left : node->right;
+ else if (c < 0)
+ {
+ TreeNode *result = tree_next(node->left, str);
+ return result != NULL ? result : node->right;
+ }
+ else
+ return tree_next(node->right, str);
+ }
+}
+
+TreeNode *lua_varnext (char *n)
+{
+ TreeNode *result;
+ char *name = n;
+ while (1)
+ { /* repeat until a valid (non nil) variable */
+ result = tree_next(constant_root, name);
+ if (result == NULL) return NULL;
+ if (result->varindex != NOT_USED &&
+ s_tag(result->varindex) != LUA_T_NIL)
+ return result;
+ name = result->ts.str;
+ }
+}
+
diff --git a/src/tree.h b/src/tree.h
new file mode 100644
index 00000000..849cd5a9
--- /dev/null
+++ b/src/tree.h
@@ -0,0 +1,37 @@
+/*
+** tree.h
+** TecCGraf - PUC-Rio
+** $Id: tree.h,v 1.9 1995/01/12 14:19:04 roberto Exp $
+*/
+
+#ifndef tree_h
+#define tree_h
+
+#include "types.h"
+
+#define NOT_USED 0xFFFE
+
+
+typedef struct TaggedString
+{
+ unsigned long hash; /* 0 if not initialized */
+ char marked; /* for garbage collection */
+ char str[1]; /* \0 byte already reserved */
+} TaggedString;
+
+typedef struct TreeNode
+{
+ struct TreeNode *right;
+ struct TreeNode *left;
+ unsigned short varindex; /* != NOT_USED if this is a symbol */
+ unsigned short constindex; /* != NOT_USED if this is a constant */
+ TaggedString ts;
+} TreeNode;
+
+
+TaggedString *lua_createstring (char *str);
+TreeNode *lua_constcreate (char *str);
+Long lua_strcollector (void);
+TreeNode *lua_varnext (char *n);
+
+#endif
diff --git a/src/types.h b/src/types.h
new file mode 100644
index 00000000..43684228
--- /dev/null
+++ b/src/types.h
@@ -0,0 +1,31 @@
+/*
+** TeCGraf - PUC-Rio
+** $Id: types.h,v 1.3 1995/02/06 19:32:43 roberto Exp $
+*/
+
+#ifndef types_h
+#define types_h
+
+#include <limits.h>
+
+#ifndef real
+#define real float
+#endif
+
+typedef int Bool; /* boolean values */
+
+#define Byte lua_Byte /* some systems have Byte as a predefined type */
+typedef unsigned char Byte; /* unsigned 8 bits */
+
+#define Word lua_Word /* some systems have Word as a predefined type */
+typedef unsigned short Word; /* unsigned 16 bits */
+
+#define MAX_WORD (USHRT_MAX-2) /* maximum value of a word (-2 for safety) */
+#define MAX_INT (INT_MAX-2) /* maximum value of a int (-2 for safety) */
+
+#define Long lua_Long /* some systems have Long as a predefined type */
+typedef signed long Long; /* 32 bits */
+
+typedef unsigned int IntPoint; /* unsigned with same size as a pointer (for hashing) */
+
+#endif
diff --git a/src/ugly.h b/src/ugly.h
new file mode 100644
index 00000000..c7512255
--- /dev/null
+++ b/src/ugly.h
@@ -0,0 +1,36 @@
+/*
+** ugly.h
+** TecCGraf - PUC-Rio
+** $Id: ugly.h,v 1.2 1994/11/13 14:39:04 roberto Stab $
+*/
+
+#ifndef ugly_h
+#define ugly_h
+
+/* This enum must have the same order of the array 'reserved' in lex.c */
+
+enum {
+ U_and=128,
+ U_do,
+ U_else,
+ U_elseif,
+ U_end,
+ U_function,
+ U_if,
+ U_local,
+ U_nil,
+ U_not,
+ U_or,
+ U_repeat,
+ U_return,
+ U_then,
+ U_until,
+ U_while,
+ U_eq = '='+128,
+ U_le = '<'+128,
+ U_ge = '>'+128,
+ U_ne = '~'+128,
+ U_sc = '.'+128
+};
+
+#endif
diff --git a/src/yacc/Makefile b/src/yacc/Makefile
index 1d887e10..284d4ab5 100644
--- a/src/yacc/Makefile
+++ b/src/yacc/Makefile
@@ -1,27 +1,3 @@
-# makefile for lua
-
-LIB= $(LUA)/lib
-INC= $(LUA)/inc
-
-CC= gcc
-CFLAGS= -g -Wall -O2 -I$(INC) $(DEFS)
-DEFS= -DMAXCODE=64000 -DMAXCONSTANT=1024 -DMAXSYMBOL=1024 -DMAXARRAY=1024
-
-OBJS= hash.o inout.o lex.o opcode.o table.o y.tab.o
-SLIB= $(LIB)/lua.a
-DLIB= $(LIB)/liblua.so.1.1
-
-libs: $(SLIB) $(DLIB)
-
-$(SLIB): y.tab.c $(OBJS)
- ar ruvl $@ $(OBJS)
- ranlib $(SLIB)
-
-$(DLIB): $(OBJS)
- ld -o $@ $(OBJS)
-
-y.tab.c: lua.stx exscript
- yacc -d lua.stx ; ex y.tab.c <exscript
-
-clean:
- rm -f $(OBJS) $(SLIB) $(DLIB)
+parser.c:
+ co -M lua.stx
+ yacc -d lua.stx ; mv -f y.tab.c ../parser.c ; mv -f y.tab.h ../parser.h
diff --git a/src/yacc/exscript b/src/yacc/exscript
deleted file mode 100644
index 0a0f2a9f..00000000
--- a/src/yacc/exscript
+++ /dev/null
@@ -1,3 +0,0 @@
-1d
-x
-
diff --git a/src/yacc/lua.lex b/src/yacc/lua.lex
deleted file mode 100644
index cbb0232a..00000000
--- a/src/yacc/lua.lex
+++ /dev/null
@@ -1,85 +0,0 @@
-%{
-
-char *rcs_lualex = "$Id: lua.lex,v 1.1 1993/12/17 18:53:41 celes Exp $";
-
-#include <stdlib.h>
-#include <string.h>
-
-#include "opcode.h"
-#include "hash.h"
-#include "inout.h"
-#include "table.h"
-#include "y.tab.h"
-
-#undef input
-#undef unput
-
-static Input input;
-static Unput unput;
-
-void lua_setinput (Input fn)
-{
- input = fn;
-}
-
-void lua_setunput (Unput fn)
-{
- unput = fn;
-}
-
-char *lua_lasttext (void)
-{
- return yytext;
-}
-
-%}
-
-
-%%
-[ \t]* ;
-^"$debug" {yylval.vInt = 1; return DEBUG;}
-^"$nodebug" {yylval.vInt = 0; return DEBUG;}
-\n lua_linenumber++;
-"--".* ;
-"local" return LOCAL;
-"if" return IF;
-"then" return THEN;
-"else" return ELSE;
-"elseif" return ELSEIF;
-"while" return WHILE;
-"do" return DO;
-"repeat" return REPEAT;
-"until" return UNTIL;
-"function" {
- yylval.vWord = lua_nfile-1;
- return FUNCTION;
- }
-"end" return END;
-"return" return RETURN;
-"local" return LOCAL;
-"nil" return NIL;
-"and" return AND;
-"or" return OR;
-"not" return NOT;
-"~=" return NE;
-"<=" return LE;
-">=" return GE;
-".." return CONC;
-\"[^\"]*\" |
-\'[^\']*\' {
- yylval.vWord = lua_findenclosedconstant (yytext);
- return STRING;
- }
-[0-9]+("."[0-9]*)? |
-([0-9]+)?"."[0-9]+ |
-[0-9]+("."[0-9]*)?[dDeEgG][+-]?[0-9]+ |
-([0-9]+)?"."[0-9]+[dDeEgG][+-]?[0-9]+ {
- yylval.vFloat = atof(yytext);
- return NUMBER;
- }
-[a-zA-Z_][a-zA-Z0-9_]* {
- yylval.vWord = lua_findsymbol (yytext);
- return NAME;
- }
-. return *yytext;
-
diff --git a/src/yacc/lua.stx b/src/yacc/lua.stx
index 118a240c..9c818708 100644
--- a/src/yacc/lua.stx
+++ b/src/yacc/lua.stx
@@ -1,35 +1,43 @@
%{
-char *rcs_luastx = "$Id: lua.stx,v 2.4 1994/04/20 16:22:21 celes Exp $";
+char *rcs_luastx = "$Id: lua.stx,v 3.17 1995/01/13 22:11:12 roberto Exp $";
#include <stdio.h>
#include <stdlib.h>
#include <string.h>
-#include "mm.h"
-
+#include "mem.h"
#include "opcode.h"
#include "hash.h"
#include "inout.h"
+#include "tree.h"
#include "table.h"
#include "lua.h"
+/* to avoid warnings generated by yacc */
+int yyparse (void);
+#define malloc luaI_malloc
+#define realloc luaI_realloc
+#define free luaI_free
+
+#ifndef LISTING
#define LISTING 0
+#endif
-#ifndef GAPCODE
-#define GAPCODE 50
+#ifndef CODE_BLOCK
+#define CODE_BLOCK 256
#endif
-static Word maxcode;
-static Word maxmain;
-static Word maxcurr ;
-static Byte *code = NULL;
-static Byte *initcode;
+static int maxcode;
+static int maxmain;
+static Long maxcurr; /* to allow maxcurr *= 2 without overflow */
+static Byte *funcCode = NULL;
+static Byte **initcode;
static Byte *basepc;
-static Word maincode;
-static Word pc;
+static int maincode;
+static int pc;
#define MAXVAR 32
-static long varbuffer[MAXVAR]; /* variables in an assignment list;
+static Long varbuffer[MAXVAR]; /* variables in an assignment list;
it's long to store negative Word values */
static int nvarbuffer=0; /* number of variables at a list */
@@ -39,8 +47,7 @@ static int nlocalvar=0; /* number of local variables */
#define MAXFIELDS FIELDS_PER_FLUSH*2
static Word fields[MAXFIELDS]; /* fieldnames to be flushed */
static int nfields=0;
-static int ntemp; /* number of temporary var into stack */
-static int err; /* flag to indicate error */
+
/* Internal functions */
@@ -48,13 +55,12 @@ static void code_byte (Byte c)
{
if (pc>maxcurr-2) /* 1 byte free to code HALT of main code */
{
- maxcurr += GAPCODE;
- basepc = (Byte *)realloc(basepc, maxcurr*sizeof(Byte));
- if (basepc == NULL)
- {
- lua_error ("not enough memory");
- err = 1;
- }
+ if (maxcurr >= MAX_INT)
+ lua_error("code size overflow");
+ maxcurr *= 2;
+ if (maxcurr >= MAX_INT)
+ maxcurr = MAX_INT;
+ basepc = growvector(basepc, maxcurr, Byte);
}
basepc[pc++] = c;
}
@@ -77,6 +83,16 @@ static void code_float (float n)
code_byte(code.m.c4);
}
+static void code_code (Byte *b)
+{
+ CodeCode code;
+ code.b = b;
+ code_byte(code.m.c1);
+ code_byte(code.m.c2);
+ code_byte(code.m.c3);
+ code_byte(code.m.c4);
+}
+
static void code_word_at (Byte *p, Word n)
{
CodeWord code;
@@ -90,10 +106,7 @@ static void push_field (Word name)
if (nfields < STACKGAP-1)
fields[nfields++] = name;
else
- {
lua_error ("too many fields in a constructor");
- err = 1;
- }
}
static void flush_record (int n)
@@ -104,7 +117,6 @@ static void flush_record (int n)
code_byte(n);
for (i=0; i<n; i++)
code_word(fields[--nfields]);
- ntemp -= n;
}
static void flush_list (int m, int n)
@@ -113,34 +125,22 @@ static void flush_list (int m, int n)
if (m == 0)
code_byte(STORELIST0);
else
+ if (m < 255)
{
code_byte(STORELIST);
code_byte(m);
}
+ else
+ lua_error ("list constructor too long");
code_byte(n);
- ntemp-=n;
-}
-
-static void incr_ntemp (void)
-{
- if (ntemp+nlocalvar+MAXVAR+1 < STACKGAP)
- ntemp++;
- else
- {
- lua_error ("stack overflow");
- err = 1;
- }
}
static void add_nlocalvar (int n)
{
- if (ntemp+nlocalvar+MAXVAR+n < STACKGAP)
+ if (MAX_TEMPS+nlocalvar+MAXVAR+n < STACKGAP)
nlocalvar += n;
else
- {
- lua_error ("too many local variables or expression too complicate");
- err = 1;
- }
+ lua_error ("too many local variables");
}
static void incr_nvarbuffer (void)
@@ -148,14 +148,12 @@ static void incr_nvarbuffer (void)
if (nvarbuffer < MAXVAR-1)
nvarbuffer++;
else
- {
lua_error ("variable buffer overflow");
- err = 1;
- }
}
static void code_number (float f)
-{ Word i = (Word)f;
+{
+ Word i = (Word)f;
if (f == (float)i) /* f has an (short) integer value */
{
if (i <= 2) code_byte(PUSH0 + i);
@@ -175,20 +173,204 @@ static void code_number (float f)
code_byte(PUSHFLOAT);
code_float(f);
}
- incr_ntemp();
}
+/*
+** Search a local name and if find return its index. If do not find return -1
+*/
+static int lua_localname (Word n)
+{
+ int i;
+ for (i=nlocalvar-1; i >= 0; i--)
+ if (n == localvar[i]) return i; /* local var */
+ return -1; /* global var */
+}
+
+/*
+** Push a variable given a number. If number is positive, push global variable
+** indexed by (number -1). If negative, push local indexed by ABS(number)-1.
+** Otherwise, if zero, push indexed variable (record).
+*/
+static void lua_pushvar (Long number)
+{
+ if (number > 0) /* global var */
+ {
+ code_byte(PUSHGLOBAL);
+ code_word(number-1);
+ }
+ else if (number < 0) /* local var */
+ {
+ number = (-number) - 1;
+ if (number < 10) code_byte(PUSHLOCAL0 + number);
+ else
+ {
+ code_byte(PUSHLOCAL);
+ code_byte(number);
+ }
+ }
+ else
+ {
+ code_byte(PUSHINDEXED);
+ }
+}
+
+static void lua_codeadjust (int n)
+{
+ if (n+nlocalvar == 0)
+ code_byte(ADJUST0);
+ else
+ {
+ code_byte(ADJUST);
+ code_byte(n+nlocalvar);
+ }
+}
+
+static void init_function (TreeNode *func)
+{
+ if (funcCode == NULL) /* first function */
+ {
+ funcCode = newvector(CODE_BLOCK, Byte);
+ maxcode = CODE_BLOCK;
+ }
+ pc=0; basepc=funcCode; maxcurr=maxcode;
+ nlocalvar=0;
+ if (lua_debug)
+ {
+ code_byte(SETFUNCTION);
+ code_code((Byte *)luaI_strdup(lua_file[lua_nfile-1]));
+ code_word(luaI_findconstant(func));
+ }
+}
+
+static void codereturn (void)
+{
+ if (lua_debug) code_byte(RESET);
+ if (nlocalvar == 0)
+ code_byte(RETCODE0);
+ else
+ {
+ code_byte(RETCODE);
+ code_byte(nlocalvar);
+ }
+}
+
+static void codedebugline (void)
+{
+ if (lua_debug)
+ {
+ code_byte(SETLINE);
+ code_word(lua_linenumber);
+ }
+}
+
+static void adjust_mult_assign (int vars, int exps, int temps)
+{
+ if (exps < 0)
+ {
+ int r = vars - (-exps-1);
+ if (r >= 0)
+ code_byte(r);
+ else
+ {
+ code_byte(0);
+ lua_codeadjust(temps);
+ }
+ }
+ else if (vars != exps)
+ lua_codeadjust(temps);
+}
+
+static void lua_codestore (int i)
+{
+ if (varbuffer[i] > 0) /* global var */
+ {
+ code_byte(STOREGLOBAL);
+ code_word(varbuffer[i]-1);
+ }
+ else if (varbuffer[i] < 0) /* local var */
+ {
+ int number = (-varbuffer[i]) - 1;
+ if (number < 10) code_byte(STORELOCAL0 + number);
+ else
+ {
+ code_byte(STORELOCAL);
+ code_byte(number);
+ }
+ }
+ else /* indexed var */
+ {
+ int j;
+ int upper=0; /* number of indexed variables upper */
+ int param; /* number of itens until indexed expression */
+ for (j=i+1; j <nvarbuffer; j++)
+ if (varbuffer[j] == 0) upper++;
+ param = upper*2 + i;
+ if (param == 0)
+ code_byte(STOREINDEXED0);
+ else
+ {
+ code_byte(STOREINDEXED);
+ code_byte(param);
+ }
+ }
+}
+
+static void codeIf (Long thenAdd, Long elseAdd)
+{
+ Long elseinit = elseAdd+sizeof(Word)+1;
+ if (pc == elseinit) /* no else */
+ {
+ pc -= sizeof(Word)+1;
+ elseinit = pc;
+ }
+ else
+ {
+ basepc[elseAdd] = JMP;
+ code_word_at(basepc+elseAdd+1, pc-elseinit);
+ }
+ basepc[thenAdd] = IFFJMP;
+ code_word_at(basepc+thenAdd+1,elseinit-(thenAdd+sizeof(Word)+1));
+}
+
+static void yyerror (char *s)
+{
+ static char msg[256];
+ sprintf (msg,"%s near \"%s\" at line %d in file \"%s\"",
+ s, lua_lasttext (), lua_linenumber, lua_filename());
+ lua_error (msg);
+}
+
+
+/*
+** Parse LUA code.
+*/
+void lua_parse (Byte **code)
+{
+ initcode = code;
+ *initcode = newvector(CODE_BLOCK, Byte);
+ maincode = 0;
+ maxmain = CODE_BLOCK;
+ if (yyparse ()) lua_error("parse error");
+ (*initcode)[maincode++] = RETCODE0;
+#if LISTING
+{ static void PrintCode (Byte *c, Byte *end);
+ PrintCode(*initcode,*initcode+maincode); }
+#endif
+}
+
+
%}
%union
{
int vInt;
- long vLong;
float vFloat;
char *pChar;
Word vWord;
+ Long vLong;
Byte *pByte;
+ TreeNode *pNode;
}
%start functionlist
@@ -198,25 +380,27 @@ static void code_number (float f)
%token IF THEN ELSE ELSEIF WHILE DO REPEAT UNTIL END
%token RETURN
%token LOCAL
+%token FUNCTION
%token <vFloat> NUMBER
-%token <vWord> FUNCTION STRING
-%token <pChar> NAME
+%token <vWord> STRING
+%token <pNode> NAME
%token <vInt> DEBUG
-%type <vWord> PrepJump
-%type <vInt> expr, exprlist, exprlist1, varlist1, typeconstructor
-%type <vInt> fieldlist, localdeclist
-%type <vInt> ffieldlist, ffieldlist1
-%type <vInt> lfieldlist, lfieldlist1
-%type <vLong> var, objectname
-
+%type <vLong> PrepJump
+%type <vInt> expr, exprlist, exprlist1, varlist1, funcParams, funcvalue
+%type <vInt> fieldlist, localdeclist, decinit
+%type <vInt> ffieldlist1
+%type <vInt> lfieldlist1
+%type <vLong> var, singlevar
+%type <pByte> body
%left AND OR
-%left '=' NE '>' '<' LE GE
+%left EQ NE '>' '<' LE GE
%left CONC
%left '+' '-'
%left '*' '/'
%left UNARY NOT
+%right '^'
%% /* beginning of rules section */
@@ -225,156 +409,115 @@ static void code_number (float f)
functionlist : /* empty */
| functionlist
{
- pc=maincode; basepc=initcode; maxcurr=maxmain;
+ pc=maincode; basepc=*initcode; maxcurr=maxmain;
nlocalvar=0;
}
stat sc
{
- maincode=pc; initcode=basepc; maxmain=maxcurr;
+ maincode=pc; *initcode=basepc; maxmain=maxcurr;
}
| functionlist function
+ | functionlist method
| functionlist setdebug
;
-
+
function : FUNCTION NAME
+ {
+ init_function($2);
+ }
+ body
+ {
+ Word func = luaI_findsymbol($2);
+ s_tag(func) = LUA_T_FUNCTION;
+ s_bvalue(func) = $4;
+ }
+ ;
+
+method : FUNCTION NAME ':' NAME
{
- if (code == NULL) /* first function */
- {
- code = (Byte *) calloc(GAPCODE, sizeof(Byte));
- if (code == NULL)
- {
- lua_error("not enough memory");
- err = 1;
- }
- maxcode = GAPCODE;
- }
- pc=0; basepc=code; maxcurr=maxcode;
- nlocalvar=0;
- $<vWord>$ = lua_findsymbol($2);
+ init_function($4);
+ localvar[nlocalvar]=luaI_findsymbolbyname("self");
+ add_nlocalvar(1);
}
- '(' parlist ')'
+ body
{
- if (lua_debug)
- {
- code_byte(SETFUNCTION);
- code_word(lua_nfile-1);
- code_word($<vWord>3);
- }
- lua_codeadjust (0);
+ /* assign function to table field */
+ pc=maincode; basepc=*initcode; maxcurr=maxmain;
+ nlocalvar=0;
+ lua_pushvar(luaI_findsymbol($2)+1);
+ code_byte(PUSHSTRING);
+ code_word(luaI_findconstant($4));
+ code_byte(PUSHFUNCTION);
+ code_code($6);
+ code_byte(STOREINDEXED0);
+ maincode=pc; *initcode=basepc; maxmain=maxcurr;
}
- block
- END
- {
- if (lua_debug) code_byte(RESET);
- code_byte(RETCODE); code_byte(nlocalvar);
- s_tag($<vWord>3) = T_FUNCTION;
- s_bvalue($<vWord>3) = calloc (pc, sizeof(Byte));
- if (s_bvalue($<vWord>3) == NULL)
- {
- lua_error("not enough memory");
- err = 1;
- }
- memcpy (s_bvalue($<vWord>3), basepc, pc*sizeof(Byte));
- code = basepc; maxcode=maxcurr;
+ ;
+
+body : '(' parlist ')' block END
+ {
+ codereturn();
+ $$ = newvector(pc, Byte);
+ memcpy($$, basepc, pc*sizeof(Byte));
+ funcCode = basepc; maxcode=maxcurr;
#if LISTING
-PrintCode(code,code+pc);
+ PrintCode(funcCode,funcCode+pc);
#endif
- }
- ;
+ }
+ ;
statlist : /* empty */
| statlist stat sc
;
-stat : {
- ntemp = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
- }
- stat1
-
sc : /* empty */ | ';' ;
+stat : { codedebugline(); } stat1 ;
+
+cond : { codedebugline(); } expr1 ;
stat1 : IF expr1 THEN PrepJump block PrepJump elsepart END
- {
- {
- Word elseinit = $6+sizeof(Word)+1;
- if (pc - elseinit == 0) /* no else */
- {
- pc -= sizeof(Word)+1;
- elseinit = pc;
- }
- else
- {
- basepc[$6] = JMP;
- code_word_at(basepc+$6+1, pc - elseinit);
- }
- basepc[$4] = IFFJMP;
- code_word_at(basepc+$4+1,elseinit-($4+sizeof(Word)+1));
- }
- }
-
- | WHILE {$<vWord>$=pc;} expr1 DO PrepJump block PrepJump END
-
+ { codeIf($4, $6); }
+
+ | WHILE {$<vLong>$=pc;} expr1 DO PrepJump block PrepJump END
{
basepc[$5] = IFFJMP;
code_word_at(basepc+$5+1, pc - ($5 + sizeof(Word)+1));
-
basepc[$7] = UPJMP;
- code_word_at(basepc+$7+1, pc - ($<vWord>2));
+ code_word_at(basepc+$7+1, pc - ($<vLong>2));
}
- | REPEAT {$<vWord>$=pc;} block UNTIL expr1 PrepJump
-
+ | REPEAT {$<vLong>$=pc;} block UNTIL cond PrepJump
{
basepc[$6] = IFFUPJMP;
- code_word_at(basepc+$6+1, pc - ($<vWord>2));
+ code_word_at(basepc+$6+1, pc - ($<vLong>2));
}
-
| varlist1 '=' exprlist1
{
{
int i;
- if ($3 == 0 || nvarbuffer != ntemp - $1 * 2)
- lua_codeadjust ($1 * 2 + nvarbuffer);
+ adjust_mult_assign(nvarbuffer, $3, $1 * 2 + nvarbuffer);
for (i=nvarbuffer-1; i>=0; i--)
lua_codestore (i);
if ($1 > 1 || ($1 == 1 && varbuffer[0] != 0))
lua_codeadjust (0);
}
}
- | functioncall { lua_codeadjust (0); }
- | typeconstructor { lua_codeadjust (0); }
- | LOCAL localdeclist decinit { add_nlocalvar($2); lua_codeadjust (0); }
+ | functioncall { code_byte(0); }
+ | LOCAL localdeclist decinit
+ { add_nlocalvar($2);
+ adjust_mult_assign($2, $3, 0);
+ }
;
elsepart : /* empty */
| ELSE block
- | ELSEIF expr1 THEN PrepJump block PrepJump elsepart
- {
- {
- Word elseinit = $6+sizeof(Word)+1;
- if (pc - elseinit == 0) /* no else */
- {
- pc -= sizeof(Word)+1;
- elseinit = pc;
- }
- else
- {
- basepc[$6] = JMP;
- code_word_at(basepc+$6+1, pc - elseinit);
- }
- basepc[$4] = IFFJMP;
- code_word_at(basepc+$4+1, elseinit - ($4 + sizeof(Word)+1));
- }
- }
+ | ELSEIF cond THEN PrepJump block PrepJump elsepart
+ { codeIf($4, $6); }
;
-block : {$<vInt>$ = nlocalvar;} statlist {ntemp = 0;} ret
+block : {$<vInt>$ = nlocalvar;} statlist ret
{
if (nlocalvar != $<vInt>1)
{
@@ -385,11 +528,10 @@ block : {$<vInt>$ = nlocalvar;} statlist {ntemp = 0;} ret
;
ret : /* empty */
- | { if (lua_debug){code_byte(SETLINE);code_word(lua_linenumber);}}
- RETURN exprlist sc
- {
- if (lua_debug) code_byte(RESET);
- code_byte(RETCODE); code_byte(nlocalvar);
+ | RETURN { codedebugline(); } exprlist sc
+ {
+ if ($3 < 0) code_byte(MULT_RET);
+ codereturn();
}
;
@@ -400,55 +542,42 @@ PrepJump : /* empty */
code_word (0);
}
-expr1 : expr { if ($1 == 0) {lua_codeadjust (ntemp+1); incr_ntemp();}}
+expr1 : expr { if ($1 == 0) code_byte(1); }
;
-expr : '(' expr ')' { $$ = $2; }
- | expr1 '=' expr1 { code_byte(EQOP); $$ = 1; ntemp--;}
- | expr1 '<' expr1 { code_byte(LTOP); $$ = 1; ntemp--;}
- | expr1 '>' expr1 { code_byte(LEOP); code_byte(NOTOP); $$ = 1; ntemp--;}
- | expr1 NE expr1 { code_byte(EQOP); code_byte(NOTOP); $$ = 1; ntemp--;}
- | expr1 LE expr1 { code_byte(LEOP); $$ = 1; ntemp--;}
- | expr1 GE expr1 { code_byte(LTOP); code_byte(NOTOP); $$ = 1; ntemp--;}
- | expr1 '+' expr1 { code_byte(ADDOP); $$ = 1; ntemp--;}
- | expr1 '-' expr1 { code_byte(SUBOP); $$ = 1; ntemp--;}
- | expr1 '*' expr1 { code_byte(MULTOP); $$ = 1; ntemp--;}
- | expr1 '/' expr1 { code_byte(DIVOP); $$ = 1; ntemp--;}
- | expr1 CONC expr1 { code_byte(CONCOP); $$ = 1; ntemp--;}
- | '+' expr1 %prec UNARY { $$ = 1; }
+expr : '(' expr ')' { $$ = $2; }
+ | expr1 EQ expr1 { code_byte(EQOP); $$ = 1; }
+ | expr1 '<' expr1 { code_byte(LTOP); $$ = 1; }
+ | expr1 '>' expr1 { code_byte(GTOP); $$ = 1; }
+ | expr1 NE expr1 { code_byte(EQOP); code_byte(NOTOP); $$ = 1; }
+ | expr1 LE expr1 { code_byte(LEOP); $$ = 1; }
+ | expr1 GE expr1 { code_byte(GEOP); $$ = 1; }
+ | expr1 '+' expr1 { code_byte(ADDOP); $$ = 1; }
+ | expr1 '-' expr1 { code_byte(SUBOP); $$ = 1; }
+ | expr1 '*' expr1 { code_byte(MULTOP); $$ = 1; }
+ | expr1 '/' expr1 { code_byte(DIVOP); $$ = 1; }
+ | expr1 '^' expr1 { code_byte(POWOP); $$ = 1; }
+ | expr1 CONC expr1 { code_byte(CONCOP); $$ = 1; }
| '-' expr1 %prec UNARY { code_byte(MINUSOP); $$ = 1;}
- | typeconstructor { $$ = $1; }
- | '@' '(' dimension ')'
- {
- code_byte(CREATEARRAY);
- $$ = 1;
- }
- | var { lua_pushvar ($1); $$ = 1;}
- | NUMBER { code_number($1); $$ = 1; }
- | STRING
+ | table { $$ = 1; }
+ | varexp { $$ = 1;}
+ | NUMBER { code_number($1); $$ = 1; }
+ | STRING
{
code_byte(PUSHSTRING);
code_word($1);
$$ = 1;
- incr_ntemp();
- }
- | NIL {code_byte(PUSHNIL); $$ = 1; incr_ntemp();}
- | functioncall
- {
- $$ = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
}
+ | NIL {code_byte(PUSHNIL); $$ = 1; }
+ | functioncall { $$ = 0; }
| NOT expr1 { code_byte(NOTOP); $$ = 1;}
- | expr1 AND PrepJump {code_byte(POP); ntemp--;} expr1
+ | expr1 AND PrepJump {code_byte(POP); } expr1
{
basepc[$3] = ONFJMP;
code_word_at(basepc+$3+1, pc - ($3 + sizeof(Word)+1));
$$ = 1;
}
- | expr1 OR PrepJump {code_byte(POP); ntemp--;} expr1
+ | expr1 OR PrepJump {code_byte(POP); } expr1
{
basepc[$3] = ONTJMP;
code_word_at(basepc+$3+1, pc - ($3 + sizeof(Word)+1));
@@ -456,92 +585,77 @@ expr : '(' expr ')' { $$ = $2; }
}
;
-typeconstructor: '@'
+table :
{
- code_byte(PUSHBYTE);
- $<vWord>$ = pc; code_byte(0);
- incr_ntemp();
code_byte(CREATEARRAY);
+ $<vLong>$ = pc; code_word(0);
}
- objectname fieldlist
+ '{' fieldlist '}'
{
- basepc[$<vWord>2] = $4;
- if ($3 < 0) /* there is no function to be called */
- {
- $$ = 1;
- }
- else
- {
- lua_pushvar ($3+1);
- code_byte(PUSHMARK);
- incr_ntemp();
- code_byte(PUSHOBJECT);
- incr_ntemp();
- code_byte(CALLFUNC);
- ntemp -= 4;
- $$ = 0;
- if (lua_debug)
- {
- code_byte(SETLINE); code_word(lua_linenumber);
- }
- }
+ code_word_at(basepc+$<vLong>1, $3);
}
;
-dimension : /* empty */ { code_byte(PUSHNIL); incr_ntemp();}
- | expr1
+functioncall : funcvalue funcParams
+ { code_byte(CALLFUNC); code_byte($1+$2); }
;
-
-functioncall : functionvalue {code_byte(PUSHMARK); $<vInt>$ = ntemp; incr_ntemp();}
- '(' exprlist ')' { code_byte(CALLFUNC); ntemp = $<vInt>2-1;}
-functionvalue : var {lua_pushvar ($1); }
- ;
-
-exprlist : /* empty */ { $$ = 1; }
+funcvalue : varexp { $$ = 0; }
+ | varexp ':' NAME
+ {
+ code_byte(PUSHSELF);
+ code_word(luaI_findconstant($3));
+ $$ = 1;
+ }
+ ;
+
+funcParams : '(' exprlist ')'
+ { if ($2<0) { code_byte(1); $$ = -$2; } else $$ = $2; }
+ | table { $$ = 1; }
+ ;
+
+exprlist : /* empty */ { $$ = 0; }
| exprlist1 { $$ = $1; }
;
-exprlist1 : expr { $$ = $1; }
- | exprlist1 ',' {if (!$1){lua_codeadjust (ntemp+1); incr_ntemp();}}
- expr {$$ = $4;}
+exprlist1 : expr { if ($1 == 0) $$ = -1; else $$ = 1; }
+ | exprlist1 ',' { if ($1 < 0) code_byte(1); } expr
+ {
+ int r = $1 < 0 ? -$1 : $1;
+ $$ = ($4 == 0) ? -(r+1) : r+1;
+ }
;
-parlist : /* empty */
- | parlist1
+parlist : /* empty */ { lua_codeadjust(0); }
+ | parlist1 { lua_codeadjust(0); }
;
parlist1 : NAME
{
- localvar[nlocalvar]=lua_findsymbol($1);
+ localvar[nlocalvar]=luaI_findsymbol($1);
add_nlocalvar(1);
}
| parlist1 ',' NAME
{
- localvar[nlocalvar]=lua_findsymbol($3);
+ localvar[nlocalvar]=luaI_findsymbol($3);
add_nlocalvar(1);
}
;
-objectname : /* empty */ {$$=-1;}
- | NAME {$$=lua_findsymbol($1);}
- ;
-
-fieldlist : '{' ffieldlist '}'
- {
- flush_record($2%FIELDS_PER_FLUSH);
- $$ = $2;
- }
- | '[' lfieldlist ']'
- {
- flush_list($2/FIELDS_PER_FLUSH, $2%FIELDS_PER_FLUSH);
- $$ = $2;
- }
+fieldlist : /* empty */ { $$ = 0; }
+ | lfieldlist1 lastcomma
+ { $$ = $1; flush_list($1/FIELDS_PER_FLUSH, $1%FIELDS_PER_FLUSH); }
+ | ffieldlist1 lastcomma
+ { $$ = $1; flush_record($1%FIELDS_PER_FLUSH); }
+ | lfieldlist1 ';'
+ { flush_list($1/FIELDS_PER_FLUSH, $1%FIELDS_PER_FLUSH); }
+ ffieldlist1 lastcomma
+ { $$ = $1+$4; flush_record($4%FIELDS_PER_FLUSH); }
;
-ffieldlist : /* empty */ { $$ = 0; }
- | ffieldlist1 { $$ = $1; }
- ;
+lastcomma : /* empty */
+ | ','
+ ;
ffieldlist1 : ffield {$$=1;}
| ffieldlist1 ',' ffield
@@ -551,16 +665,12 @@ ffieldlist1 : ffield {$$=1;}
}
;
-ffield : NAME {$<vWord>$ = lua_findconstant($1);} '=' expr1
+ffield : NAME '=' expr1
{
- push_field($<vWord>2);
+ push_field(luaI_findconstant($1));
}
;
-lfieldlist : /* empty */ { $$ = 0; }
- | lfieldlist1 { $$ = $1; }
- ;
-
lfieldlist1 : expr1 {$$=1;}
| lfieldlist1 ',' expr1
{
@@ -583,169 +693,49 @@ varlist1 : var
}
;
-var : NAME
- {
- Word s = lua_findsymbol($1);
- int local = lua_localname (s);
- if (local == -1) /* global var */
- $$ = s + 1; /* return positive value */
- else
- $$ = -(local+1); /* return negative value */
- }
-
- | var {lua_pushvar ($1);} '[' expr1 ']'
+var : singlevar { $$ = $1; }
+ | varexp '[' expr1 ']'
{
$$ = 0; /* indexed variable */
}
- | var {lua_pushvar ($1);} '.' NAME
+ | varexp '.' NAME
{
code_byte(PUSHSTRING);
- code_word(lua_findconstant($4)); incr_ntemp();
+ code_word(luaI_findconstant($3));
$$ = 0; /* indexed variable */
}
;
-localdeclist : NAME {localvar[nlocalvar]=lua_findsymbol($1); $$ = 1;}
+singlevar : NAME
+ {
+ Word s = luaI_findsymbol($1);
+ int local = lua_localname (s);
+ if (local == -1) /* global var */
+ $$ = s + 1; /* return positive value */
+ else
+ $$ = -(local+1); /* return negative value */
+ }
+ ;
+
+varexp : var { lua_pushvar($1); }
+ ;
+
+localdeclist : NAME {localvar[nlocalvar]=luaI_findsymbol($1); $$ = 1;}
| localdeclist ',' NAME
{
- localvar[nlocalvar+$1]=lua_findsymbol($3);
+ localvar[nlocalvar+$1]=luaI_findsymbol($3);
$$ = $1+1;
}
;
-decinit : /* empty */
- | '=' exprlist1
+decinit : /* empty */ { $$ = 0; }
+ | '=' exprlist1 { $$ = $2; }
;
setdebug : DEBUG {lua_debug = $1;}
%%
-/*
-** Search a local name and if find return its index. If do not find return -1
-*/
-static int lua_localname (Word n)
-{
- int i;
- for (i=nlocalvar-1; i >= 0; i--)
- if (n == localvar[i]) return i; /* local var */
- return -1; /* global var */
-}
-
-/*
-** Push a variable given a number. If number is positive, push global variable
-** indexed by (number -1). If negative, push local indexed by ABS(number)-1.
-** Otherwise, if zero, push indexed variable (record).
-*/
-static void lua_pushvar (long number)
-{
- if (number > 0) /* global var */
- {
- code_byte(PUSHGLOBAL);
- code_word(number-1);
- incr_ntemp();
- }
- else if (number < 0) /* local var */
- {
- number = (-number) - 1;
- if (number < 10) code_byte(PUSHLOCAL0 + number);
- else
- {
- code_byte(PUSHLOCAL);
- code_byte(number);
- }
- incr_ntemp();
- }
- else
- {
- code_byte(PUSHINDEXED);
- ntemp--;
- }
-}
-
-static void lua_codeadjust (int n)
-{
- code_byte(ADJUST);
- code_byte(n + nlocalvar);
-}
-
-static void lua_codestore (int i)
-{
- if (varbuffer[i] > 0) /* global var */
- {
- code_byte(STOREGLOBAL);
- code_word(varbuffer[i]-1);
- }
- else if (varbuffer[i] < 0) /* local var */
- {
- int number = (-varbuffer[i]) - 1;
- if (number < 10) code_byte(STORELOCAL0 + number);
- else
- {
- code_byte(STORELOCAL);
- code_byte(number);
- }
- }
- else /* indexed var */
- {
- int j;
- int upper=0; /* number of indexed variables upper */
- int param; /* number of itens until indexed expression */
- for (j=i+1; j <nvarbuffer; j++)
- if (varbuffer[j] == 0) upper++;
- param = upper*2 + i;
- if (param == 0)
- code_byte(STOREINDEXED0);
- else
- {
- code_byte(STOREINDEXED);
- code_byte(param);
- }
- }
-}
-
-void yyerror (char *s)
-{
- static char msg[256];
- sprintf (msg,"%s near \"%s\" at line %d in file \"%s\"",
- s, lua_lasttext (), lua_linenumber, lua_filename());
- lua_error (msg);
- err = 1;
-}
-
-int yywrap (void)
-{
- return 1;
-}
-
-
-/*
-** Parse LUA code and execute global statement.
-** Return 0 on success or 1 on error.
-*/
-int lua_parse (void)
-{
- Byte *init = initcode = (Byte *) calloc(GAPCODE, sizeof(Byte));
- maincode = 0;
- maxmain = GAPCODE;
- if (init == NULL)
- {
- lua_error("not enough memory");
- return 1;
- }
- err = 0;
- if (yyparse () || (err==1)) return 1;
- initcode[maincode++] = HALT;
- init = initcode;
-#if LISTING
- PrintCode(init,init+maincode);
-#endif
- if (lua_execute (init)) return 1;
- free(init);
- return 0;
-}
-
-
#if LISTING
static void PrintCode (Byte *code, Byte *end)
@@ -792,6 +782,16 @@ static void PrintCode (Byte *code, Byte *end)
printf ("%d PUSHSTRING %d\n", n, c.w);
}
break;
+ case PUSHFUNCTION:
+ {
+ CodeCode c;
+ int n = p-code;
+ p++;
+ get_code(c,p);
+ printf ("%d PUSHFUNCTION %p\n", n, c.b);
+ }
+ break;
+
case PUSHLOCAL0: case PUSHLOCAL1: case PUSHLOCAL2: case PUSHLOCAL3:
case PUSHLOCAL4: case PUSHLOCAL5: case PUSHLOCAL6: case PUSHLOCAL7:
case PUSHLOCAL8: case PUSHLOCAL9:
@@ -811,8 +811,6 @@ static void PrintCode (Byte *code, Byte *end)
}
break;
case PUSHINDEXED: printf ("%d PUSHINDEXED\n", (p++)-code); break;
- case PUSHMARK: printf ("%d PUSHMARK\n", (p++)-code); break;
- case PUSHOBJECT: printf ("%d PUSHOBJECT\n", (p++)-code); break;
case STORELOCAL0: case STORELOCAL1: case STORELOCAL2: case STORELOCAL3:
case STORELOCAL4: case STORELOCAL5: case STORELOCAL6: case STORELOCAL7:
case STORELOCAL8: case STORELOCAL9:
@@ -832,6 +830,15 @@ static void PrintCode (Byte *code, Byte *end)
printf ("%d STOREGLOBAL %d\n", n, c.w);
}
break;
+ case PUSHSELF:
+ {
+ CodeWord c;
+ int n = p-code;
+ p++;
+ get_word(c,p);
+ printf ("%d PUSHSELF %d\n", n, c.w);
+ }
+ break;
case STOREINDEXED0: printf ("%d STOREINDEXED0\n", (p++)-code); break;
case STOREINDEXED: printf ("%d STOREINDEXED %d\n", p-code, *(++p));
p++;
@@ -848,11 +855,20 @@ static void PrintCode (Byte *code, Byte *end)
printf("%d STORERECORD %d\n", p-code, *(++p));
p += *p*sizeof(Word) + 1;
break;
+ case ADJUST0: printf ("%d ADJUST0\n", (p++)-code); break;
case ADJUST:
printf ("%d ADJUST %d\n", p-code, *(++p));
p++;
break;
- case CREATEARRAY: printf ("%d CREATEARRAY\n", (p++)-code); break;
+ case CREATEARRAY:
+ {
+ CodeWord c;
+ int n = p-code;
+ p++;
+ get_word(c,p);
+ printf ("%d CREATEARRAY %d\n", n, c.w);
+ break;
+ }
case EQOP: printf ("%d EQOP\n", (p++)-code); break;
case LTOP: printf ("%d LTOP\n", (p++)-code); break;
case LEOP: printf ("%d LEOP\n", (p++)-code); break;
@@ -860,6 +876,7 @@ static void PrintCode (Byte *code, Byte *end)
case SUBOP: printf ("%d SUBOP\n", (p++)-code); break;
case MULTOP: printf ("%d MULTOP\n", (p++)-code); break;
case DIVOP: printf ("%d DIVOP\n", (p++)-code); break;
+ case POWOP: printf ("%d POWOP\n", (p++)-code); break;
case CONCOP: printf ("%d CONCOP\n", (p++)-code); break;
case MINUSOP: printf ("%d MINUSOP\n", (p++)-code); break;
case NOTOP: printf ("%d NOTOP\n", (p++)-code); break;
@@ -918,20 +935,24 @@ static void PrintCode (Byte *code, Byte *end)
}
break;
case POP: printf ("%d POP\n", (p++)-code); break;
- case CALLFUNC: printf ("%d CALLFUNC\n", (p++)-code); break;
+ case CALLFUNC:
+ printf ("%d CALLFUNC %d %d\n", p-code, *(p+1), *(p+2));
+ p+=3;
+ break;
+ case RETCODE0: printf ("%d RETCODE0\n", (p++)-code); break;
case RETCODE:
printf ("%d RETCODE %d\n", p-code, *(++p));
p++;
break;
- case HALT: printf ("%d HALT\n", (p++)-code); break;
case SETFUNCTION:
{
- CodeWord c1, c2;
+ CodeCode c1;
+ CodeWord c2;
int n = p-code;
p++;
- get_word(c1,p);
+ get_code(c1,p);
get_word(c2,p);
- printf ("%d SETFUNCTION %d %d\n", n, c1.w, c2.w);
+ printf ("%d SETFUNCTION %s %d\n", n, (char *)c1.b, c2.w);
}
break;
case SETLINE:
diff --git a/test/array.lua b/test/array.lua
index 349fb818..7caca888 100644
--- a/test/array.lua
+++ b/test/array.lua
@@ -1,6 +1,6 @@
$debug
-a = @()
+a = {}
i=0
while i<10 do
diff --git a/test/dump b/test/dump.lua
index d5feb2b4..fa0aa4fb 100644
--- a/test/dump
+++ b/test/dump.lua
@@ -1,20 +1,20 @@
function savevar (n,v)
- if v = nil then return end;
- if type(v) = "number" then print(n.."="..v) return end
- if type(v) = "string" then print(n.."='"..v.."'") return end
- if type(v) = "table" then
+ if v == nil then return end;
+ if type(v) == "number" then print(n.."="..v) return end
+ if type(v) == "string" then print(n.."='"..v.."'") return end
+ if type(v) == "table" then
if v.__visited__ ~= nil then
print(n .. "=" .. v.__visited__);
else
- print(n.."=@()")
+ print(n.."={}")
v.__visited__ = n;
local r,f;
r,f = next(v,nil);
while r ~= nil do
if r ~= "__visited__" then
- if type(r) = 'string' then
+ if type(r) == 'string' then
savevar(n.."."..r,f)
else
savevar(n.."["..r.."]",f)
diff --git a/test/teste.lua b/test/long.lua
index 467ce122..5492fd50 100644
--- a/test/teste.lua
+++ b/test/long.lua
@@ -12,7 +12,7 @@ function sort(a,n) -- selection sort
end
-v = @(5000)
+v = { }
i=1
while i <= 5000 do v[i] = 5000-i i=i+1 end
diff --git a/test/save.lua b/test/save.lua
index 3eb91086..8c64c568 100644
--- a/test/save.lua
+++ b/test/save.lua
@@ -1,10 +1,10 @@
function savevar (n,v)
- if v = nil then return end;
- if type(v) = "number" then print(n.."="..v) return end
- if type(v) = "string" then print(n.."='"..v.."'") return end
- if type(v) = "table" then
+ if v == nil then return end;
+ if type(v) == "number" then print(n.."="..v) return end
+ if type(v) == "string" then print(n.."='"..v.."'") return end
+ if type(v) == "table" then
if v.__visited__ ~= nil then
print(n .. "=" .. v.__visited__);
else
@@ -14,7 +14,7 @@ function savevar (n,v)
r,f = next(v,nil);
while r ~= nil do
if r ~= "__visited__" then
- if type(r) = 'string' then
+ if type(r) == 'string' then
savevar(n.."['"..r.."']",f)
else
savevar(n.."["..r.."]",f)
@@ -36,9 +36,9 @@ local n,v
end
a = 3
-x = @{a = 4, b = "name", l=@[4,5,67]}
+x = {a = 4, b = "name", l={4,5,67}}
-b = @{t=5}
+b = {t=5}
x.next = b
diff --git a/test/sort.lua b/test/sort.lua
index 6d0d9a0d..14d4cf22 100644
--- a/test/sort.lua
+++ b/test/sort.lua
@@ -31,7 +31,7 @@ function sort(a,n) -- selection sort
end
function main()
- x=@()
+ x={}
n=-1
n=n+1; x[n]="a"
n=n+1; x[n]="waldemar"
diff --git a/test/sort/q.lua b/test/sort/q.lua
deleted file mode 100644
index 8d9a20d4..00000000
--- a/test/sort/q.lua
+++ /dev/null
@@ -1,51 +0,0 @@
-function quicksort(r,s)
- if s<=r then return end -- caso basico da recursao
- local v=x[r]
- local i=r
- local j=s+1
- repeat
- repeat i=i+1 until x[i]>=v
- repeat j=j-1 until x[j]<=v
- x[i],x[j]=x[j],x[i]
- until j<=i -- separacao
- x[i],x[j]=x[j],x[i] -- undo last swap
- x[j],x[r]=x[r],x[j]
- quicksort(r,j-1) -- recursao
- quicksort(j+1,s)
-end
-
-function main()
- x=@()
- n=-1
- n=n+1; x[n]="a"
- n=n+1; x[n]="waldemar"
- n=n+1; x[n]="luiz"
- n=n+1; x[n]="lula"
- n=n+1; x[n]="peter"
- n=n+1; x[n]="raquel"
- n=n+1; x[n]="camilo"
- n=n+1; x[n]="andre"
- n=n+1; x[n]="marcelo"
- n=n+1; x[n]="sedrez"
- n=n+1; x[n]="z"
--- sort(x,n)
- quicksort(1,n-1)
-print(x[0]..","..x[1]..","..x[2]..","..x[3]..","..x[4]..","..x[5]..","..x[6]..","..x[7]..","..x[8]..","..x[9]..","..x[10])
-end
-
-function sort(a,n) -- selection sort
- local i=1
- while i<=n do
- local m=i
- local j=i+1
- while j<=n do
- if a[j]<a[m] then m=j end
- j=j+1
- end
- a[i],a[m]=a[m],a[i] -- swap a[i] and a[m]
- print (i, a[i])
- i=i+1
- end
-end
-
-main()
diff --git a/test/sort/sort.lua b/test/sort/sort.lua
deleted file mode 100644
index ba2e273c..00000000
--- a/test/sort/sort.lua
+++ /dev/null
@@ -1,51 +0,0 @@
-$debug
-function quicksort(r,s)
- if s<=r then return end -- caso basico da recursao
- local v=x[r]
- local i=r
- local j=s+1
- i=i+1; while x[i]<v do i=i+1 end
- j=j-1; while x[j]>v do j=j-1 end
- x[i],x[j]=x[j],x[i]
- while j>i do -- separacao
- i=i+1; while x[i]<v do i=i+1 end
- j=j+1; while x[j]>v do j=j-1 end
- x[i],x[j]=x[j],x[i]
- end
- x[i],x[j]=x[j],x[i] -- undo last swap
- x[j],x[r]=x[r],x[j]
- quicksort(r,j-1) -- recursao
- quicksort(j+1,s)
-end
-
-function sort(a,n) -- selection sort
- local i=1
- while i<=n do
- local m=i
- local j=i+1
- while j<=n do
- if a[j]<a[m] then m=j end
- j=j+1
- end
- a[i],a[m]=a[m],a[i] -- swap a[i] and a[m]
- print (i, a[i])
- i=i+1
- end
-end
-
-x=@(20)
-n=-1
-n=n+1; x[n]="a"
-n=n+1; x[n]="waldemar"
-n=n+1; x[n]="luiz"
-n=n+1; x[n]="lula"
-n=n+1; x[n]="peter"
-n=n+1; x[n]="raquel"
-n=n+1; x[n]="camilo"
-n=n+1; x[n]="andre"
-n=n+1; x[n]="marcelo"
-n=n+1; x[n]="sedrez"
-n=n+1; x[n]="z"
--- sort(x,n)
-quicksort(1,n-1)
-print(x[0]..","..x[1]..","..x[2]..","..x[3]..","..x[4]..","..x[5]..","..x[6]..","..x[7]..","..x[8]..","..x[9]..","..x[10])
diff --git a/test/type.lua b/test/type.lua
index 5078920b..3079391d 100644
--- a/test/type.lua
+++ b/test/type.lua
@@ -3,7 +3,7 @@ $debug
function check (object, class)
local v = next(object,nil);
while v ~= nil do
- if class[v] = nil then
+ if class[v] == nil then
print("unknown field: " .. v)
elseif type(object[v]) ~= class[v].type then
print("wrong type for field " .. v)
@@ -12,7 +12,7 @@ function check (object, class)
end
v = next(class,nil);
while v ~= nil do
- if object[v] = nil then
+ if object[v] == nil then
if class[v].default ~= nil then
object[v] = class[v].default
else
@@ -23,9 +23,9 @@ function check (object, class)
end
end
-typeblock = @{x = @{default = 0, type = "number"},
- y = @{default = 0, type = "number"},
- name = @{type = "string"}
+typeblock = {x = {default = 0, type = "number"},
+ y = {default = 0, type = "number"},
+ name = {type = "string"}
}
function block(t) check(t,typeblock) end