summaryrefslogtreecommitdiff
path: root/dbtests/jsobjtests.cpp
Commit message (Expand)AuthorAgeFilesLines
* Add SIZE labelAaron2009-03-271-1/+10
* Build a subobject without recopying the contentsAaron2009-03-251-0/+28
* Initialize BSONElement() with correct totalSizeAaron2009-03-241-0/+8
* Replace emptyObj with BSONObj()Aaron2009-03-191-2/+2
* Rename CurrentTime to Timestamp, don't change type on insertAaron2009-02-271-8/+11
* Add BSONElementManipulator and CurrentTime typeAaron2009-02-271-0/+30
* woCompare consider object lengthAaron2009-02-261-1/+10
* Fix woSortOrderAaron2009-02-241-0/+9
* virtual dtors == goodAaron2009-02-181-0/+2
* Remove loggingAaron2009-02-101-2/+0
* Make labeled subobj specs easier in c++. Now you can do BSON( "a" << GT << 4...Aaron2009-02-101-2/+82
* bsonobjbuilder cleanupDwight2009-02-091-2/+2
* doneAndDecouple() -> obj()Dwight2009-02-091-4/+4
* Make sure object w/ undefined elt is validAaron2009-02-031-2/+14
* Undefined element can appear anywhere in objectAaron2009-02-031-12/+0
* Add negative element size testAaron2009-01-211-0/+12
* Try a short object tooAaron2009-01-181-4/+11
* Patch some more holes in BSON validationAaron2009-01-181-0/+85
* Merge branch 'master' of ssh://aaron@git.10gen.com/data/gitroot/pAaron2009-01-171-1/+18
|\
| * oid parsing, slight better randomEliot Horowitz2009-01-171-1/+18
* | Add more interesting fuzz tests, move json tests into separate fileAaron2009-01-171-851/+11
|/
* Just use a charAaron2009-01-161-1/+1
* Add tests for BSON validating randomized bitstreamsAaron2009-01-161-0/+40
* Merge branch 'master' of ssh://aaron@git.10gen.com/data/gitroot/pAaron2009-01-161-0/+17
|\
| * incorrect implementation of OIDEliot Horowitz2009-01-161-0/+17
* | Enhance BSONObj::validate()Aaron2009-01-161-0/+198
|/
* Replaced our #defined cout with mongo::out()Aaron2009-01-151-1/+1
* Indent all lines within namespaces one levelAaron2009-01-151-924/+924
* Replace tab indentation with spacesAaron2009-01-141-751/+753
* NEW pdfile # : 4.4; Support compound directions with compound indexesAaron2009-01-141-0/+13
* Limit regex options, only use Dbref() in TenGen modeAaron2009-01-131-14/+41
* Check syntactically reserved field names specificallyAaron2009-01-121-1/+13
* Don't allow field names starting with $, added some testsAaron2009-01-081-22/+70
* Fix my dumb testAaron2009-01-071-1/+1
* Added token parse failure testAaron2009-01-071-0/+9
* Add regex escaping testAaron2009-01-061-0/+14
* Fix up regexp parsingAaron2009-01-061-0/+24
* Enhance json parserAaron2009-01-061-1/+432
* Actually handle utf8 correctlyAaron2009-01-021-10/+0
* Add non-Strict mode for Dbref, use base64 encoding for bindataAaron2008-12-311-7/+21
* Start on TenGen and JS modesAaron2008-12-301-25/+31
* Only escape if utf8 character in basic ascii rangeAaron2008-12-301-2/+14
* Add date and regexp strict modeAaron2008-12-301-43/+64
* Added Symbol support to formattedString, modified BinData formatAaron2008-12-301-1/+11
* Better OID printingAaron2008-12-301-7/+5
* Started BSONObj::formattedStringAaron2008-12-301-0/+214
* Add newline at end of file to remove compiler warningsAaron2008-12-291-1/+1
* Replace tab indentation with spacesAaron2008-12-281-88/+88
* Add embedded object inequality testAaron2008-12-111-0/+7
* Make object comparison recursive, with testsAaron2008-12-111-0/+109
View Lorry Controller Status