diff options
author | Lorry Tar Creator <lorry-tar-importer@baserock.org> | 2013-12-11 22:24:18 +0000 |
---|---|---|
committer | <> | 2014-07-24 09:30:59 +0000 |
commit | 59e2936f588aa945e8dcd6c737523c299067e9d0 (patch) | |
tree | 97e74980cc54baa19de5faa11f5a50a0121a48ea /js/public | |
download | mozjs24-59e2936f588aa945e8dcd6c737523c299067e9d0.tar.gz |
Imported from /home/lorry/working-area/delta_mozilla_mozjs24/mozjs-24.2.0.tar.bz2.HEADmozjs-24.2.0master
Diffstat (limited to 'js/public')
-rw-r--r-- | js/public/Anchor.h | 162 | ||||
-rw-r--r-- | js/public/CallArgs.h | 403 | ||||
-rw-r--r-- | js/public/CharacterEncoding.h | 155 | ||||
-rw-r--r-- | js/public/Date.h | 35 | ||||
-rw-r--r-- | js/public/GCAPI.h | 320 | ||||
-rw-r--r-- | js/public/HashTable.h | 1461 | ||||
-rw-r--r-- | js/public/HeapAPI.h | 145 | ||||
-rw-r--r-- | js/public/LegacyIntTypes.h | 60 | ||||
-rw-r--r-- | js/public/MemoryMetrics.h | 460 | ||||
-rw-r--r-- | js/public/PropertyKey.h | 98 | ||||
-rw-r--r-- | js/public/RequiredDefines.h | 23 | ||||
-rw-r--r-- | js/public/RootingAPI.h | 957 | ||||
-rw-r--r-- | js/public/TemplateLib.h | 117 | ||||
-rw-r--r-- | js/public/Utility.h | 871 | ||||
-rw-r--r-- | js/public/Value.h | 1844 | ||||
-rw-r--r-- | js/public/Vector.h | 1107 |
16 files changed, 8218 insertions, 0 deletions
diff --git a/js/public/Anchor.h b/js/public/Anchor.h new file mode 100644 index 0000000..0d458e6 --- /dev/null +++ b/js/public/Anchor.h @@ -0,0 +1,162 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* JS::Anchor implementation. */ + +#ifndef js_Anchor_h +#define js_Anchor_h + +#include "mozilla/Attributes.h" + +class JSFunction; +class JSObject; +class JSScript; +class JSString; + +namespace JS { class Value; } + +namespace JS { + +/* + * Protecting non-Value, non-JSObject *, non-JSString * values from collection + * + * Most of the time, the garbage collector's conservative stack scanner works + * behind the scenes, finding all live values and protecting them from being + * collected. However, when JSAPI client code obtains a pointer to data the + * scanner does not know about, owned by an object the scanner does know about, + * Care Must Be Taken. + * + * The scanner recognizes only a select set of types: pointers to JSObjects and + * similar things (JSFunctions, and so on), pointers to JSStrings, and Values. + * So while the scanner finds all live |JSString| pointers, it does not notice + * |jschar| pointers. + * + * So suppose we have: + * + * void f(JSString *str) { + * const jschar *ch = JS_GetStringCharsZ(str); + * ... do stuff with ch, but no uses of str ...; + * } + * + * After the call to |JS_GetStringCharsZ|, there are no further uses of + * |str|, which means that the compiler is within its rights to not store + * it anywhere. But because the stack scanner will not notice |ch|, there + * is no longer any live value in this frame that would keep the string + * alive. If |str| is the last reference to that |JSString|, and the + * collector runs while we are using |ch|, the string's array of |jschar|s + * may be freed out from under us. + * + * Note that there is only an issue when 1) we extract a thing X the scanner + * doesn't recognize from 2) a thing Y the scanner does recognize, and 3) if Y + * gets garbage-collected, then X gets freed. If we have code like this: + * + * void g(JSObject *obj) { + * JS::Value x; + * JS_GetProperty(obj, "x", &x); + * ... do stuff with x ... + * } + * + * there's no problem, because the value we've extracted, x, is a Value, a + * type that the conservative scanner recognizes. + * + * Conservative GC frees us from the obligation to explicitly root the types it + * knows about, but when we work with derived values like |ch|, we must root + * their owners, as the derived value alone won't keep them alive. + * + * A JS::Anchor is a kind of GC root that allows us to keep the owners of + * derived values like |ch| alive throughout the Anchor's lifetime. We could + * fix the above code as follows: + * + * void f(JSString *str) { + * JS::Anchor<JSString *> a_str(str); + * const jschar *ch = JS_GetStringCharsZ(str); + * ... do stuff with ch, but no uses of str ...; + * } + * + * This simply ensures that |str| will be live until |a_str| goes out of scope. + * As long as we don't retain a pointer to the string's characters for longer + * than that, we have avoided all garbage collection hazards. + */ +template<typename T> class AnchorPermitted; +template<> class AnchorPermitted<JSObject *> { }; +template<> class AnchorPermitted<const JSObject *> { }; +template<> class AnchorPermitted<JSFunction *> { }; +template<> class AnchorPermitted<const JSFunction *> { }; +template<> class AnchorPermitted<JSString *> { }; +template<> class AnchorPermitted<const JSString *> { }; +template<> class AnchorPermitted<Value> { }; +template<> class AnchorPermitted<const JSScript *> { }; +template<> class AnchorPermitted<JSScript *> { }; + +template<typename T> +class Anchor : AnchorPermitted<T> +{ + public: + Anchor() { } + explicit Anchor(T t) { hold = t; } + inline ~Anchor(); + T &get() { return hold; } + const T &get() const { return hold; } + void set(const T &t) { hold = t; } + void operator=(const T &t) { hold = t; } + void clear() { hold = 0; } + + private: + T hold; + Anchor(const Anchor &other) MOZ_DELETE; + void operator=(const Anchor &other) MOZ_DELETE; +}; + +template<typename T> +inline Anchor<T>::~Anchor() +{ +#ifdef __GNUC__ + /* + * No code is generated for this. But because this is marked 'volatile', G++ will + * assume it has important side-effects, and won't delete it. (G++ never looks at + * the actual text and notices it's empty.) And because we have passed |hold| to + * it, GCC will keep |hold| alive until this point. + * + * The "memory" clobber operand ensures that G++ will not move prior memory + * accesses after the asm --- it's a barrier. Unfortunately, it also means that + * G++ will assume that all memory has changed after the asm, as it would for a + * call to an unknown function. I don't know of a way to avoid that consequence. + */ + asm volatile("":: "g" (hold) : "memory"); +#else + /* + * An adequate portable substitute, for non-structure types. + * + * The compiler promises that, by the end of an expression statement, the + * last-stored value to a volatile object is the same as it would be in an + * unoptimized, direct implementation (the "abstract machine" whose behavior the + * language spec describes). However, the compiler is still free to reorder + * non-volatile accesses across this store --- which is what we must prevent. So + * assigning the held value to a volatile variable, as we do here, is not enough. + * + * In our case, however, garbage collection only occurs at function calls, so it + * is sufficient to ensure that the destructor's store isn't moved earlier across + * any function calls that could collect. It is hard to imagine the compiler + * analyzing the program so thoroughly that it could prove that such motion was + * safe. In practice, compilers treat calls to the collector as opaque operations + * --- in particular, as operations which could access volatile variables, across + * which this destructor must not be moved. + * + * ("Objection, your honor! *Alleged* killer whale!") + * + * The disadvantage of this approach is that it does generate code for the store. + * We do need to use Anchors in some cases where cycles are tight. + * + * Note that there is a Anchor<Value>::~Anchor() specialization in Value.h. + */ + volatile T sink; + sink = hold; +#endif /* defined(__GNUC__) */ +} + +} // namespace JS + +#endif /* js_Anchor_h */ diff --git a/js/public/CallArgs.h b/js/public/CallArgs.h new file mode 100644 index 0000000..986a3f0 --- /dev/null +++ b/js/public/CallArgs.h @@ -0,0 +1,403 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* + * Helper classes encapsulating access to the callee, |this| value, arguments, + * and argument count for a function call. + * + * The intent of JS::CallArgs and JS::CallReceiver is that they be used to + * encapsulate access to the un-abstracted |unsigned argc, Value *vp| arguments + * to a function. It's possible (albeit deprecated) to manually index into + * |vp| to access the callee, |this|, and arguments of a function, and to set + * its return value. It's also possible to use the supported API of JS_CALLEE, + * JS_THIS, JS_ARGV, JS_RVAL and JS_SET_RVAL to the same ends. But neither API + * has the error-handling or moving-GC correctness of CallArgs or CallReceiver. + * New code should use CallArgs and CallReceiver instead whenever possible. + * + * The eventual plan is to change JSNative to take |const CallArgs&| directly, + * for automatic assertion of correct use and to make calling functions more + * efficient. Embedders should start internally switching away from using + * |argc| and |vp| directly, except to create a |CallArgs|. Then, when an + * eventual release making that change occurs, porting efforts will require + * changing methods' signatures but won't require invasive changes to the + * methods' implementations, potentially under time pressure. + */ + +#ifndef js_CallArgs_h +#define js_CallArgs_h + +#include "mozilla/Assertions.h" +#include "mozilla/Attributes.h" +#include "mozilla/TypeTraits.h" + +#include "jstypes.h" + +#include "js/RootingAPI.h" +#include "js/Value.h" + +struct JSContext; +class JSObject; + +/* Typedef for native functions called by the JS VM. */ +typedef JSBool +(* JSNative)(JSContext *cx, unsigned argc, JS::Value *vp); + +/* + * Compute |this| for the |vp| inside a JSNative, either boxing primitives or + * replacing with the global object as necessary. + * + * This method will go away at some point: instead use |args.thisv()|. If the + * value is an object, no further work is required. If that value is |null| or + * |undefined|, use |JS_GetGlobalForObject| to compute the global object. If + * the value is some other primitive, use |JS_ValueToObject| to box it. + */ +extern JS_PUBLIC_API(JS::Value) +JS_ComputeThis(JSContext *cx, JS::Value *vp); + +namespace JS { + +extern JS_PUBLIC_DATA(const HandleValue) UndefinedHandleValue; + +/* + * JS::CallReceiver encapsulates access to the callee, |this|, and eventual + * return value for a function call. The principal way to create a + * CallReceiver is using JS::CallReceiverFromVp: + * + * static JSBool + * FunctionReturningThis(JSContext *cx, unsigned argc, JS::Value *vp) + * { + * JS::CallReceiver rec = JS::CallReceiverFromVp(vp); + * + * // Access to the callee must occur before accessing/setting + * // the return value. + * JSObject &callee = rec.callee(); + * rec.rval().set(JS::ObjectValue(callee)); + * + * // callee() and calleev() will now assert. + * + * // It's always fine to access thisv(). + * HandleValue thisv = rec.thisv(); + * rec.rval().set(thisv); + * + * // As the return value was last set to |this|, returns |this|. + * return true; + * } + * + * A note on JS_ComputeThis and JS_THIS_OBJECT: these methods currently aren't + * part of the CallReceiver interface. We will likely add them at some point. + * Until then, you should probably continue using |vp| directly for these two + * cases. + * + * CallReceiver is exposed publicly and used internally. Not all parts of its + * public interface are meant to be used by embedders! See inline comments to + * for details. + */ + +namespace detail { + +enum UsedRval { IncludeUsedRval, NoUsedRval }; + +template<UsedRval WantUsedRval> +class MOZ_STACK_CLASS UsedRvalBase; + +template<> +class MOZ_STACK_CLASS UsedRvalBase<IncludeUsedRval> +{ + protected: + mutable bool usedRval_; + void setUsedRval() const { usedRval_ = true; } + void clearUsedRval() const { usedRval_ = false; } +}; + +template<> +class MOZ_STACK_CLASS UsedRvalBase<NoUsedRval> +{ + protected: + void setUsedRval() const {} + void clearUsedRval() const {} +}; + +template<UsedRval WantUsedRval> +class MOZ_STACK_CLASS CallReceiverBase : public UsedRvalBase< +#ifdef JS_DEBUG + WantUsedRval +#else + NoUsedRval +#endif + > +{ + protected: + Value *argv_; + + public: + /* + * Returns the function being called, as an object. Must not be called + * after rval() has been used! + */ + JSObject &callee() const { + MOZ_ASSERT(!this->usedRval_); + return argv_[-2].toObject(); + } + + /* + * Returns the function being called, as a value. Must not be called after + * rval() has been used! + */ + HandleValue calleev() const { + MOZ_ASSERT(!this->usedRval_); + return HandleValue::fromMarkedLocation(&argv_[-2]); + } + + /* + * Returns the |this| value passed to the function. This method must not + * be called when the function is being called as a constructor via |new|. + * The value may or may not be an object: it is the individual function's + * responsibility to box the value if needed. + */ + HandleValue thisv() const { + // Some internal code uses thisv() in constructing cases, so don't do + // this yet. + // MOZ_ASSERT(!argv_[-1].isMagic(JS_IS_CONSTRUCTING)); + return HandleValue::fromMarkedLocation(&argv_[-1]); + } + + Value computeThis(JSContext *cx) const { + if (thisv().isObject()) + return thisv(); + + return JS_ComputeThis(cx, base()); + } + + /* + * Returns the currently-set return value. The initial contents of this + * value are unspecified. Once this method has been called, callee() and + * calleev() can no longer be used. (If you're compiling against a debug + * build of SpiderMonkey, these methods will assert to aid debugging.) + * + * If the method you're implementing succeeds by returning true, you *must* + * set this. (SpiderMonkey doesn't currently assert this, but it will do + * so eventually.) You don't need to use or change this if your method + * fails. + */ + MutableHandleValue rval() const { + this->setUsedRval(); + return MutableHandleValue::fromMarkedLocation(&argv_[-2]); + } + + public: + // These methods are only intended for internal use. Embedders shouldn't + // use them! + + Value *base() const { return argv_ - 2; } + + Value *spAfterCall() const { + this->setUsedRval(); + return argv_ - 1; + } + + public: + // These methods are publicly exposed, but they are *not* to be used when + // implementing a JSNative method and encapsulating access to |vp| within + // it. You probably don't want to use these! + + void setCallee(Value aCalleev) const { + this->clearUsedRval(); + argv_[-2] = aCalleev; + } + + void setThis(Value aThisv) const { + argv_[-1] = aThisv; + } + + MutableHandleValue mutableThisv() const { + return MutableHandleValue::fromMarkedLocation(&argv_[-1]); + } +}; + +} // namespace detail + +class MOZ_STACK_CLASS CallReceiver : public detail::CallReceiverBase<detail::IncludeUsedRval> +{ + private: + friend CallReceiver CallReceiverFromVp(Value *vp); + friend CallReceiver CallReceiverFromArgv(Value *argv); +}; + +MOZ_ALWAYS_INLINE CallReceiver +CallReceiverFromArgv(Value *argv) +{ + CallReceiver receiver; + receiver.clearUsedRval(); + receiver.argv_ = argv; + return receiver; +} + +MOZ_ALWAYS_INLINE CallReceiver +CallReceiverFromVp(Value *vp) +{ + return CallReceiverFromArgv(vp + 2); +} + +/* + * JS::CallArgs encapsulates everything JS::CallReceiver does, plus access to + * the function call's arguments. The principal way to create a CallArgs is + * like so, using JS::CallArgsFromVp: + * + * static JSBool + * FunctionReturningArgcTimesArg0(JSContext *cx, unsigned argc, JS::Value *vp) + * { + * JS::CallArgs args = JS::CallArgsFromVp(argc, vp); + * + * // Guard against no arguments or a non-numeric arg0. + * if (args.length() == 0 || !args[0].isNumber()) { + * args.rval().setInt32(0); + * return true; + * } + * + * args.rval().set(JS::NumberValue(args.length() * args[0].toNumber())); + * return true; + * } + * + * CallArgs is exposed publicly and used internally. Not all parts of its + * public interface are meant to be used by embedders! See inline comments to + * for details. + */ +namespace detail { + +template<UsedRval WantUsedRval> +class MOZ_STACK_CLASS CallArgsBase : + public mozilla::Conditional<WantUsedRval == detail::IncludeUsedRval, + CallReceiver, + CallReceiverBase<NoUsedRval> >::Type +{ + protected: + unsigned argc_; + + public: + /* Returns the number of arguments. */ + unsigned length() const { return argc_; } + + /* Returns the i-th zero-indexed argument. */ + Value &operator[](unsigned i) const { + MOZ_ASSERT(i < argc_); + return this->argv_[i]; + } + + /* Returns a mutable handle for the i-th zero-indexed argument. */ + MutableHandleValue handleAt(unsigned i) const { + MOZ_ASSERT(i < argc_); + return MutableHandleValue::fromMarkedLocation(&this->argv_[i]); + } + + /* + * Returns the i-th zero-indexed argument, or |undefined| if there's no + * such argument. + */ + Value get(unsigned i) const { + return i < length() ? this->argv_[i] : UndefinedValue(); + } + + /* + * Returns the i-th zero-indexed argument as a handle, or |undefined| if + * there's no such argument. + */ + HandleValue handleOrUndefinedAt(unsigned i) const { + return i < length() + ? HandleValue::fromMarkedLocation(&this->argv_[i]) + : UndefinedHandleValue; + } + + /* + * Returns true if the i-th zero-indexed argument is present and is not + * |undefined|. + */ + bool hasDefined(unsigned i) const { + return i < argc_ && !this->argv_[i].isUndefined(); + } + + public: + // These methods are publicly exposed, but we're less sure of the interface + // here than we'd like (because they're hackish and drop assertions). Try + // to avoid using these if you can. + + Value *array() const { return this->argv_; } + Value *end() const { return this->argv_ + argc_; } +}; + +} // namespace detail + +class MOZ_STACK_CLASS CallArgs : public detail::CallArgsBase<detail::IncludeUsedRval> +{ + private: + friend CallArgs CallArgsFromVp(unsigned argc, Value *vp); + friend CallArgs CallArgsFromSp(unsigned argc, Value *sp); + + static CallArgs create(unsigned argc, Value *argv) { + CallArgs args; + args.clearUsedRval(); + args.argv_ = argv; + args.argc_ = argc; + return args; + } + +}; + +MOZ_ALWAYS_INLINE CallArgs +CallArgsFromVp(unsigned argc, Value *vp) +{ + return CallArgs::create(argc, vp + 2); +} + +// This method is only intended for internal use in SpiderMonkey. We may +// eventually move it to an internal header. Embedders should use +// JS::CallArgsFromVp! +MOZ_ALWAYS_INLINE CallArgs +CallArgsFromSp(unsigned argc, Value *sp) +{ + return CallArgs::create(argc, sp - argc); +} + +} // namespace JS + +/* + * Macros to hide interpreter stack layout details from a JSNative using its + * JS::Value *vp parameter. DO NOT USE THESE! Instead use JS::CallArgs and + * friends, above. These macros will be removed when we change JSNative to + * take a const JS::CallArgs&. + */ + +#define JS_CALLEE(cx,vp) ((vp)[0]) +#define JS_THIS_OBJECT(cx,vp) (JSVAL_TO_OBJECT(JS_THIS(cx,vp))) +#define JS_ARGV(cx,vp) ((vp) + 2) +#define JS_RVAL(cx,vp) (*(vp)) +#define JS_SET_RVAL(cx,vp,v) (*(vp) = (v)) + +/* + * Note: if this method returns null, an error has occurred and must be + * propagated or caught. + */ +MOZ_ALWAYS_INLINE JS::Value +JS_THIS(JSContext *cx, JS::Value *vp) +{ + return JSVAL_IS_PRIMITIVE(vp[1]) ? JS_ComputeThis(cx, vp) : vp[1]; +} + +/* + * |this| is passed to functions in ES5 without change. Functions themselves + * do any post-processing they desire to box |this|, compute the global object, + * &c. This macro retrieves a function's unboxed |this| value. + * + * This macro must not be used in conjunction with JS_THIS or JS_THIS_OBJECT, + * or vice versa. Either use the provided this value with this macro, or + * compute the boxed |this| value using those. JS_THIS_VALUE must not be used + * if the function is being called as a constructor. + * + * But: DO NOT USE THIS! Instead use JS::CallArgs::thisv(), above. + * + */ +#define JS_THIS_VALUE(cx,vp) ((vp)[1]) + +#endif /* js_CallArgs_h */ diff --git a/js/public/CharacterEncoding.h b/js/public/CharacterEncoding.h new file mode 100644 index 0000000..7065a4b --- /dev/null +++ b/js/public/CharacterEncoding.h @@ -0,0 +1,155 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_CharacterEncoding_h +#define js_CharacterEncoding_h + +#include "mozilla/Range.h" + +#include "js/Utility.h" + +#include "jspubtd.h" + +namespace JS { + +/* + * By default, all C/C++ 1-byte-per-character strings passed into the JSAPI + * are treated as ISO/IEC 8859-1, also known as Latin-1. That is, each + * byte is treated as a 2-byte character, and there is no way to pass in a + * string containing characters beyond U+00FF. + */ +class Latin1Chars : public mozilla::Range<unsigned char> +{ + typedef mozilla::Range<unsigned char> Base; + + public: + Latin1Chars() : Base() {} + Latin1Chars(char *aBytes, size_t aLength) : Base(reinterpret_cast<unsigned char *>(aBytes), aLength) {} + Latin1Chars(const char *aBytes, size_t aLength) + : Base(reinterpret_cast<unsigned char *>(const_cast<char *>(aBytes)), aLength) + {} +}; + +/* + * A Latin1Chars, but with \0 termination for C compatibility. + */ +class Latin1CharsZ : public mozilla::RangedPtr<unsigned char> +{ + typedef mozilla::RangedPtr<unsigned char> Base; + + public: + Latin1CharsZ() : Base(NULL, 0) {} + + Latin1CharsZ(char *aBytes, size_t aLength) + : Base(reinterpret_cast<unsigned char *>(aBytes), aLength) + { + JS_ASSERT(aBytes[aLength] == '\0'); + } + + Latin1CharsZ(unsigned char *aBytes, size_t aLength) + : Base(aBytes, aLength) + { + JS_ASSERT(aBytes[aLength] == '\0'); + } + + char *c_str() { return reinterpret_cast<char *>(get()); } +}; + +/* + * SpiderMonkey also deals directly with UTF-8 encoded text in some places. + */ +class UTF8CharsZ : public mozilla::RangedPtr<unsigned char> +{ + typedef mozilla::RangedPtr<unsigned char> Base; + + public: + UTF8CharsZ() : Base(NULL, 0) {} + + UTF8CharsZ(char *aBytes, size_t aLength) + : Base(reinterpret_cast<unsigned char *>(aBytes), aLength) + { + JS_ASSERT(aBytes[aLength] == '\0'); + } + + UTF8CharsZ(unsigned char *aBytes, size_t aLength) + : Base(aBytes, aLength) + { + JS_ASSERT(aBytes[aLength] == '\0'); + } + + char *c_str() { return reinterpret_cast<char *>(get()); } +}; + +/* + * SpiderMonkey uses a 2-byte character representation: it is a + * 2-byte-at-a-time view of a UTF-16 byte stream. This is similar to UCS-2, + * but unlike UCS-2, we do not strip UTF-16 extension bytes. This allows a + * sufficiently dedicated JavaScript program to be fully unicode-aware by + * manually interpreting UTF-16 extension characters embedded in the JS + * string. + */ +class TwoByteChars : public mozilla::Range<jschar> +{ + typedef mozilla::Range<jschar> Base; + + public: + TwoByteChars() : Base() {} + TwoByteChars(jschar *aChars, size_t aLength) : Base(aChars, aLength) {} + TwoByteChars(const jschar *aChars, size_t aLength) : Base(const_cast<jschar *>(aChars), aLength) {} +}; + +/* + * A non-convertible variant of TwoByteChars that does not refer to characters + * inlined inside a JSShortString or a JSInlineString. StableTwoByteChars are + * thus safe to hold across a GC. + */ +class StableTwoByteChars : public mozilla::Range<jschar> +{ + typedef mozilla::Range<jschar> Base; + + public: + StableTwoByteChars() : Base() {} + StableTwoByteChars(jschar *aChars, size_t aLength) : Base(aChars, aLength) {} + StableTwoByteChars(const jschar *aChars, size_t aLength) : Base(const_cast<jschar *>(aChars), aLength) {} +}; + +/* + * A TwoByteChars, but \0 terminated for compatibility with JSFlatString. + */ +class TwoByteCharsZ : public mozilla::RangedPtr<jschar> +{ + typedef mozilla::RangedPtr<jschar> Base; + + public: + TwoByteCharsZ(jschar *chars, size_t length) + : Base(chars, length) + { + JS_ASSERT(chars[length] = '\0'); + } +}; + +/* + * Convert a 2-byte character sequence to "ISO-Latin-1". This works by + * truncating each 2-byte pair in the sequence to a 1-byte pair. If the source + * contains any UTF-16 extension characters, then this may give invalid Latin1 + * output. The returned string is zero terminated. The returned string or the + * returned string's |start()| must be freed with JS_free or js_free, + * respectively. If allocation fails, an OOM error will be set and the method + * will return a NULL chars (which can be tested for with the ! operator). + * This method cannot trigger GC. + */ +extern Latin1CharsZ +LossyTwoByteCharsToNewLatin1CharsZ(JSContext *cx, TwoByteChars tbchars); + +extern UTF8CharsZ +TwoByteCharsToNewUTF8CharsZ(JSContext *cx, TwoByteChars tbchars); + +} // namespace JS + +inline void JS_free(JS::Latin1CharsZ &ptr) { js_free((void*)ptr.get()); } +inline void JS_free(JS::UTF8CharsZ &ptr) { js_free((void*)ptr.get()); } + +#endif /* js_CharacterEncoding_h */ diff --git a/js/public/Date.h b/js/public/Date.h new file mode 100644 index 0000000..6199f9e --- /dev/null +++ b/js/public/Date.h @@ -0,0 +1,35 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- */ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_Date_h +#define js_Date_h + +#include "jstypes.h" + +namespace JS { + +// Year is a year, month is 0-11, day is 1-based. The return value is +// a number of milliseconds since the epoch. Can return NaN. +JS_PUBLIC_API(double) +MakeDate(double year, unsigned month, unsigned day); + +// Takes an integer number of milliseconds since the epoch and returns the +// year. Can return NaN, and will do so if NaN is passed in. +JS_PUBLIC_API(double) +YearFromTime(double time); + +// Takes an integer number of milliseconds since the epoch and returns the +// month (0-11). Can return NaN, and will do so if NaN is passed in. +JS_PUBLIC_API(double) +MonthFromTime(double time); + +// Takes an integer number of milliseconds since the epoch and returns the +// day (1-based). Can return NaN, and will do so if NaN is passed in. +JS_PUBLIC_API(double) +DayFromTime(double time); + +} // namespace JS + +#endif /* js_Date_h */ diff --git a/js/public/GCAPI.h b/js/public/GCAPI.h new file mode 100644 index 0000000..825efc8 --- /dev/null +++ b/js/public/GCAPI.h @@ -0,0 +1,320 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_GCAPI_h +#define js_GCAPI_h + +#include "HeapAPI.h" +#include "jsfriendapi.h" + +namespace JS { + +#define GCREASONS(D) \ + /* Reasons internal to the JS engine */ \ + D(API) \ + D(MAYBEGC) \ + D(LAST_CONTEXT) \ + D(DESTROY_CONTEXT) \ + D(LAST_DITCH) \ + D(TOO_MUCH_MALLOC) \ + D(ALLOC_TRIGGER) \ + D(DEBUG_GC) \ + D(DEBUG_MODE_GC) \ + D(TRANSPLANT) \ + D(RESET) \ + D(OUT_OF_NURSERY) \ + D(EVICT_NURSERY) \ + D(FULL_STORE_BUFFER) \ + \ + /* These are reserved for future use. */ \ + D(RESERVED0) \ + D(RESERVED1) \ + D(RESERVED2) \ + D(RESERVED3) \ + D(RESERVED4) \ + D(RESERVED5) \ + D(RESERVED6) \ + D(RESERVED7) \ + D(RESERVED8) \ + D(RESERVED9) \ + D(RESERVED10) \ + D(RESERVED11) \ + D(RESERVED12) \ + D(RESERVED13) \ + D(RESERVED14) \ + D(RESERVED15) \ + D(RESERVED16) \ + D(RESERVED17) \ + D(RESERVED18) \ + D(RESERVED19) \ + \ + /* Reasons from Firefox */ \ + D(DOM_WINDOW_UTILS) \ + D(COMPONENT_UTILS) \ + D(MEM_PRESSURE) \ + D(CC_WAITING) \ + D(CC_FORCED) \ + D(LOAD_END) \ + D(POST_COMPARTMENT) \ + D(PAGE_HIDE) \ + D(NSJSCONTEXT_DESTROY) \ + D(SET_NEW_DOCUMENT) \ + D(SET_DOC_SHELL) \ + D(DOM_UTILS) \ + D(DOM_IPC) \ + D(DOM_WORKER) \ + D(INTER_SLICE_GC) \ + D(REFRESH_FRAME) \ + D(FULL_GC_TIMER) \ + D(SHUTDOWN_CC) \ + D(FINISH_LARGE_EVALUTE) + +namespace gcreason { + +/* GCReasons will end up looking like JSGC_MAYBEGC */ +enum Reason { +#define MAKE_REASON(name) name, + GCREASONS(MAKE_REASON) +#undef MAKE_REASON + NO_REASON, + NUM_REASONS, + + /* + * For telemetry, we want to keep a fixed max bucket size over time so we + * don't have to switch histograms. 100 is conservative; as of this writing + * there are 26. But the cost of extra buckets seems to be low while the + * cost of switching histograms is high. + */ + NUM_TELEMETRY_REASONS = 100 +}; + +} /* namespace gcreason */ + +extern JS_FRIEND_API(void) +PrepareZoneForGC(Zone *zone); + +extern JS_FRIEND_API(void) +PrepareForFullGC(JSRuntime *rt); + +extern JS_FRIEND_API(void) +PrepareForIncrementalGC(JSRuntime *rt); + +extern JS_FRIEND_API(bool) +IsGCScheduled(JSRuntime *rt); + +extern JS_FRIEND_API(void) +SkipZoneForGC(Zone *zone); + +/* + * When triggering a GC using one of the functions below, it is first necessary + * to select the compartments to be collected. To do this, you can call + * PrepareZoneForGC on each compartment, or you can call PrepareForFullGC + * to select all compartments. Failing to select any compartment is an error. + */ + +extern JS_FRIEND_API(void) +GCForReason(JSRuntime *rt, gcreason::Reason reason); + +extern JS_FRIEND_API(void) +ShrinkingGC(JSRuntime *rt, gcreason::Reason reason); + +extern JS_FRIEND_API(void) +ShrinkGCBuffers(JSRuntime *rt); + +extern JS_FRIEND_API(void) +IncrementalGC(JSRuntime *rt, gcreason::Reason reason, int64_t millis = 0); + +extern JS_FRIEND_API(void) +FinishIncrementalGC(JSRuntime *rt, gcreason::Reason reason); + +enum GCProgress { + /* + * During non-incremental GC, the GC is bracketed by JSGC_CYCLE_BEGIN/END + * callbacks. During an incremental GC, the sequence of callbacks is as + * follows: + * JSGC_CYCLE_BEGIN, JSGC_SLICE_END (first slice) + * JSGC_SLICE_BEGIN, JSGC_SLICE_END (second slice) + * ... + * JSGC_SLICE_BEGIN, JSGC_CYCLE_END (last slice) + */ + + GC_CYCLE_BEGIN, + GC_SLICE_BEGIN, + GC_SLICE_END, + GC_CYCLE_END +}; + +struct JS_FRIEND_API(GCDescription) { + bool isCompartment_; + + GCDescription(bool isCompartment) + : isCompartment_(isCompartment) {} + + jschar *formatMessage(JSRuntime *rt) const; + jschar *formatJSON(JSRuntime *rt, uint64_t timestamp) const; +}; + +typedef void +(* GCSliceCallback)(JSRuntime *rt, GCProgress progress, const GCDescription &desc); + +extern JS_FRIEND_API(GCSliceCallback) +SetGCSliceCallback(JSRuntime *rt, GCSliceCallback callback); + +/* + * Signals a good place to do an incremental slice, because the browser is + * drawing a frame. + */ +extern JS_FRIEND_API(void) +NotifyDidPaint(JSRuntime *rt); + +extern JS_FRIEND_API(bool) +IsIncrementalGCEnabled(JSRuntime *rt); + +JS_FRIEND_API(bool) +IsIncrementalGCInProgress(JSRuntime *rt); + +extern JS_FRIEND_API(void) +DisableIncrementalGC(JSRuntime *rt); + +extern JS_FRIEND_API(void) +DisableGenerationalGC(JSRuntime *rt); + +extern JS_FRIEND_API(bool) +IsIncrementalBarrierNeeded(JSRuntime *rt); + +extern JS_FRIEND_API(bool) +IsIncrementalBarrierNeeded(JSContext *cx); + +extern JS_FRIEND_API(void) +IncrementalReferenceBarrier(void *ptr, JSGCTraceKind kind); + +extern JS_FRIEND_API(void) +IncrementalValueBarrier(const Value &v); + +extern JS_FRIEND_API(void) +IncrementalObjectBarrier(JSObject *obj); + +extern JS_FRIEND_API(void) +PokeGC(JSRuntime *rt); + +/* Was the most recent GC run incrementally? */ +extern JS_FRIEND_API(bool) +WasIncrementalGC(JSRuntime *rt); + +class ObjectPtr +{ + JSObject *value; + + public: + ObjectPtr() : value(NULL) {} + + ObjectPtr(JSObject *obj) : value(obj) {} + + /* Always call finalize before the destructor. */ + ~ObjectPtr() { JS_ASSERT(!value); } + + void finalize(JSRuntime *rt) { + if (IsIncrementalBarrierNeeded(rt)) + IncrementalObjectBarrier(value); + value = NULL; + } + + void init(JSObject *obj) { value = obj; } + + JSObject *get() const { return value; } + + void writeBarrierPre(JSRuntime *rt) { + IncrementalObjectBarrier(value); + } + + bool isAboutToBeFinalized() { + return JS_IsAboutToBeFinalized(&value); + } + + ObjectPtr &operator=(JSObject *obj) { + IncrementalObjectBarrier(value); + value = obj; + return *this; + } + + void trace(JSTracer *trc, const char *name) { + JS_CallObjectTracer(trc, &value, name); + } + + JSObject &operator*() const { return *value; } + JSObject *operator->() const { return value; } + operator JSObject *() const { return value; } +}; + +/* + * Unsets the gray bit for anything reachable from |thing|. |kind| should not be + * JSTRACE_SHAPE. |thing| should be non-null. + */ +extern JS_FRIEND_API(void) +UnmarkGrayGCThingRecursively(void *thing, JSGCTraceKind kind); + +/* + * This should be called when an object that is marked gray is exposed to the JS + * engine (by handing it to running JS code or writing it into live JS + * data). During incremental GC, since the gray bits haven't been computed yet, + * we conservatively mark the object black. + */ +static JS_ALWAYS_INLINE void +ExposeGCThingToActiveJS(void *thing, JSGCTraceKind kind) +{ + JS_ASSERT(kind != JSTRACE_SHAPE); + + shadow::Runtime *rt = js::gc::GetGCThingRuntime(thing); +#ifdef JSGC_GENERATIONAL + /* + * GC things residing in the nursery cannot be gray: they have no mark bits. + * All live objects in the nursery are moved to tenured at the beginning of + * each GC slice, so the gray marker never sees nursery things. + */ + if (uintptr_t(thing) >= rt->gcNurseryStart_ && uintptr_t(thing) < rt->gcNurseryEnd_) + return; +#endif + if (IsIncrementalBarrierNeededOnGCThing(rt, thing, kind)) + IncrementalReferenceBarrier(thing, kind); + else if (GCThingIsMarkedGray(thing)) + UnmarkGrayGCThingRecursively(thing, kind); +} + +static JS_ALWAYS_INLINE void +ExposeValueToActiveJS(const Value &v) +{ + if (v.isMarkable()) + ExposeGCThingToActiveJS(v.toGCThing(), v.gcKind()); +} + +/* + * If a GC is currently marking, mark the object black. + */ +static JS_ALWAYS_INLINE void +MarkGCThingAsLive(JSRuntime *rt_, void *thing, JSGCTraceKind kind) +{ + shadow::Runtime *rt = reinterpret_cast<JS::shadow::Runtime*>(rt_); + +#ifdef JSGC_GENERATIONAL + /* + * Any object in the nursery will not be freed during any GC running at that time. + */ + if (js::gc::IsInsideNursery(rt, thing)) + return; +#endif + if (IsIncrementalBarrierNeededOnGCThing(rt, thing, kind)) + IncrementalReferenceBarrier(thing, kind); +} + +static JS_ALWAYS_INLINE void +MarkStringAsLive(JSContext *cx, JSString *string) +{ + MarkGCThingAsLive(js::GetRuntime(cx), string, JSTRACE_STRING); +} + +} /* namespace JS */ + +#endif /* js_GCAPI_h */ diff --git a/js/public/HashTable.h b/js/public/HashTable.h new file mode 100644 index 0000000..4d1de4a --- /dev/null +++ b/js/public/HashTable.h @@ -0,0 +1,1461 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_HashTable_h +#define js_HashTable_h + +#include "mozilla/Assertions.h" +#include "mozilla/Attributes.h" +#include "mozilla/Casting.h" +#include "mozilla/DebugOnly.h" +#include "mozilla/PodOperations.h" +#include "mozilla/TypeTraits.h" +#include "mozilla/Util.h" + +#include "js/TemplateLib.h" +#include "js/Utility.h" + +namespace js { + +class TempAllocPolicy; +template <class> struct DefaultHasher; +template <class, class> class HashMapEntry; +namespace detail { + template <class T> class HashTableEntry; + template <class T, class HashPolicy, class AllocPolicy> class HashTable; +} + +/*****************************************************************************/ + +// A JS-friendly, STL-like container providing a hash-based map from keys to +// values. In particular, HashMap calls constructors and destructors of all +// objects added so non-PODs may be used safely. +// +// Key/Value requirements: +// - movable, destructible, assignable +// HashPolicy requirements: +// - see Hash Policy section below +// AllocPolicy: +// - see jsalloc.h +// +// Note: +// - HashMap is not reentrant: Key/Value/HashPolicy/AllocPolicy members +// called by HashMap must not call back into the same HashMap object. +// - Due to the lack of exception handling, the user must call |init()|. +template <class Key, + class Value, + class HashPolicy = DefaultHasher<Key>, + class AllocPolicy = TempAllocPolicy> +class HashMap +{ + typedef HashMapEntry<Key, Value> TableEntry; + + struct MapHashPolicy : HashPolicy + { + typedef Key KeyType; + static const Key &getKey(TableEntry &e) { return e.key; } + static void setKey(TableEntry &e, Key &k) { const_cast<Key &>(e.key) = k; } + }; + + typedef detail::HashTable<TableEntry, MapHashPolicy, AllocPolicy> Impl; + Impl impl; + + public: + typedef typename HashPolicy::Lookup Lookup; + typedef TableEntry Entry; + + // HashMap construction is fallible (due to OOM); thus the user must call + // init after constructing a HashMap and check the return value. + HashMap(AllocPolicy a = AllocPolicy()) + : impl(a) + { + MOZ_STATIC_ASSERT(tl::IsRelocatableHeapType<Key>::result, + "Key type must be relocatable"); + MOZ_STATIC_ASSERT(tl::IsRelocatableHeapType<Value>::result, + "Value type must be relocatable"); + } + + bool init(uint32_t len = 16) { return impl.init(len); } + bool initialized() const { return impl.initialized(); } + + // Return whether the given lookup value is present in the map. E.g.: + // + // typedef HashMap<int,char> HM; + // HM h; + // if (HM::Ptr p = h.lookup(3)) { + // const HM::Entry &e = *p; // p acts like a pointer to Entry + // assert(p->key == 3); // Entry contains the key + // char val = p->value; // and value + // } + // + // Also see the definition of Ptr in HashTable above (with T = Entry). + typedef typename Impl::Ptr Ptr; + Ptr lookup(const Lookup &l) const { return impl.lookup(l); } + + // Like lookup, but does not assert if two threads call lookup at the same + // time. Only use this method when none of the threads will modify the map. + Ptr readonlyThreadsafeLookup(const Lookup &l) const { return impl.readonlyThreadsafeLookup(l); } + + // Assuming |p.found()|, remove |*p|. + void remove(Ptr p) { impl.remove(p); } + + // Like |lookup(l)|, but on miss, |p = lookupForAdd(l)| allows efficient + // insertion of Key |k| (where |HashPolicy::match(k,l) == true|) using + // |add(p,k,v)|. After |add(p,k,v)|, |p| points to the new Entry. E.g.: + // + // typedef HashMap<int,char> HM; + // HM h; + // HM::AddPtr p = h.lookupForAdd(3); + // if (!p) { + // if (!h.add(p, 3, 'a')) + // return false; + // } + // const HM::Entry &e = *p; // p acts like a pointer to Entry + // assert(p->key == 3); // Entry contains the key + // char val = p->value; // and value + // + // Also see the definition of AddPtr in HashTable above (with T = Entry). + // + // N.B. The caller must ensure that no mutating hash table operations + // occur between a pair of |lookupForAdd| and |add| calls. To avoid + // looking up the key a second time, the caller may use the more efficient + // relookupOrAdd method. This method reuses part of the hashing computation + // to more efficiently insert the key if it has not been added. For + // example, a mutation-handling version of the previous example: + // + // HM::AddPtr p = h.lookupForAdd(3); + // if (!p) { + // call_that_may_mutate_h(); + // if (!h.relookupOrAdd(p, 3, 'a')) + // return false; + // } + // const HM::Entry &e = *p; + // assert(p->key == 3); + // char val = p->value; + typedef typename Impl::AddPtr AddPtr; + AddPtr lookupForAdd(const Lookup &l) const { + return impl.lookupForAdd(l); + } + + template<typename KeyInput, typename ValueInput> + bool add(AddPtr &p, const KeyInput &k, const ValueInput &v) { + Entry e(k, v); + return impl.add(p, Move(e)); + } + + bool add(AddPtr &p, const Key &k) { + Entry e(k, Value()); + return impl.add(p, Move(e)); + } + + template<typename KeyInput, typename ValueInput> + bool relookupOrAdd(AddPtr &p, const KeyInput &k, const ValueInput &v) { + Entry e(k, v); + return impl.relookupOrAdd(p, k, Move(e)); + } + + // |all()| returns a Range containing |count()| elements. E.g.: + // + // typedef HashMap<int,char> HM; + // HM h; + // for (HM::Range r = h.all(); !r.empty(); r.popFront()) + // char c = r.front().value; + // + // Also see the definition of Range in HashTable above (with T = Entry). + typedef typename Impl::Range Range; + Range all() const { return impl.all(); } + + // Typedef for the enumeration class. An Enum may be used to examine and + // remove table entries: + // + // typedef HashMap<int,char> HM; + // HM s; + // for (HM::Enum e(s); !e.empty(); e.popFront()) + // if (e.front().value == 'l') + // e.removeFront(); + // + // Table resize may occur in Enum's destructor. Also see the definition of + // Enum in HashTable above (with T = Entry). + typedef typename Impl::Enum Enum; + + // Remove all entries. This does not shrink the table. For that consider + // using the finish() method. + void clear() { impl.clear(); } + + // Remove all entries without triggering destructors. This method is unsafe. + void clearWithoutCallingDestructors() { impl.clearWithoutCallingDestructors(); } + + // Remove all the entries and release all internal buffers. The map must + // be initialized again before any use. + void finish() { impl.finish(); } + + // Does the table contain any entries? + bool empty() const { return impl.empty(); } + + // Number of live elements in the map. + uint32_t count() const { return impl.count(); } + + // Total number of allocation in the dynamic table. Note: resize will + // happen well before count() == capacity(). + size_t capacity() const { return impl.capacity(); } + + // Don't just call |impl.sizeOfExcludingThis()| because there's no + // guarantee that |impl| is the first field in HashMap. + size_t sizeOfExcludingThis(JSMallocSizeOfFun mallocSizeOf) const { + return impl.sizeOfExcludingThis(mallocSizeOf); + } + size_t sizeOfIncludingThis(JSMallocSizeOfFun mallocSizeOf) const { + return mallocSizeOf(this) + impl.sizeOfExcludingThis(mallocSizeOf); + } + + // If |generation()| is the same before and after a HashMap operation, + // pointers into the table remain valid. + unsigned generation() const { return impl.generation(); } + + /************************************************** Shorthand operations */ + + bool has(const Lookup &l) const { + return impl.lookup(l) != NULL; + } + + // Overwrite existing value with v. Return false on oom. + template<typename KeyInput, typename ValueInput> + bool put(const KeyInput &k, const ValueInput &v) { + AddPtr p = lookupForAdd(k); + if (p) { + p->value = v; + return true; + } + return add(p, k, v); + } + + // Like put, but assert that the given key is not already present. + template<typename KeyInput, typename ValueInput> + bool putNew(const KeyInput &k, const ValueInput &v) { + Entry e(k, v); + return impl.putNew(k, Move(e)); + } + + // Add (k,defaultValue) if |k| is not found. Return a false-y Ptr on oom. + Ptr lookupWithDefault(const Key &k, const Value &defaultValue) { + AddPtr p = lookupForAdd(k); + if (p) + return p; + (void)add(p, k, defaultValue); // p is left false-y on oom. + return p; + } + + // Remove if present. + void remove(const Lookup &l) { + if (Ptr p = lookup(l)) + remove(p); + } + + // HashMap is movable + HashMap(MoveRef<HashMap> rhs) : impl(Move(rhs->impl)) {} + void operator=(MoveRef<HashMap> rhs) { impl = Move(rhs->impl); } + + private: + // HashMap is not copyable or assignable + HashMap(const HashMap &hm) MOZ_DELETE; + HashMap &operator=(const HashMap &hm) MOZ_DELETE; + + friend class Impl::Enum; +}; + +/*****************************************************************************/ + +// A JS-friendly, STL-like container providing a hash-based set of values. In +// particular, HashSet calls constructors and destructors of all objects added +// so non-PODs may be used safely. +// +// T requirements: +// - movable, destructible, assignable +// HashPolicy requirements: +// - see Hash Policy section below +// AllocPolicy: +// - see jsalloc.h +// +// Note: +// - HashSet is not reentrant: T/HashPolicy/AllocPolicy members called by +// HashSet must not call back into the same HashSet object. +// - Due to the lack of exception handling, the user must call |init()|. +template <class T, + class HashPolicy = DefaultHasher<T>, + class AllocPolicy = TempAllocPolicy> +class HashSet +{ + struct SetOps : HashPolicy + { + typedef T KeyType; + static const KeyType &getKey(const T &t) { return t; } + static void setKey(T &t, KeyType &k) { t = k; } + }; + + typedef detail::HashTable<const T, SetOps, AllocPolicy> Impl; + Impl impl; + + public: + typedef typename HashPolicy::Lookup Lookup; + typedef T Entry; + + // HashSet construction is fallible (due to OOM); thus the user must call + // init after constructing a HashSet and check the return value. + HashSet(AllocPolicy a = AllocPolicy()) : impl(a) + { + MOZ_STATIC_ASSERT(tl::IsRelocatableHeapType<T>::result, + "Set element type must be relocatable"); + } + bool init(uint32_t len = 16) { return impl.init(len); } + bool initialized() const { return impl.initialized(); } + + // Return whether the given lookup value is present in the map. E.g.: + // + // typedef HashSet<int> HS; + // HS h; + // if (HS::Ptr p = h.lookup(3)) { + // assert(*p == 3); // p acts like a pointer to int + // } + // + // Also see the definition of Ptr in HashTable above. + typedef typename Impl::Ptr Ptr; + Ptr lookup(const Lookup &l) const { return impl.lookup(l); } + + // Assuming |p.found()|, remove |*p|. + void remove(Ptr p) { impl.remove(p); } + + // Like |lookup(l)|, but on miss, |p = lookupForAdd(l)| allows efficient + // insertion of T value |t| (where |HashPolicy::match(t,l) == true|) using + // |add(p,t)|. After |add(p,t)|, |p| points to the new element. E.g.: + // + // typedef HashSet<int> HS; + // HS h; + // HS::AddPtr p = h.lookupForAdd(3); + // if (!p) { + // if (!h.add(p, 3)) + // return false; + // } + // assert(*p == 3); // p acts like a pointer to int + // + // Also see the definition of AddPtr in HashTable above. + // + // N.B. The caller must ensure that no mutating hash table operations + // occur between a pair of |lookupForAdd| and |add| calls. To avoid + // looking up the key a second time, the caller may use the more efficient + // relookupOrAdd method. This method reuses part of the hashing computation + // to more efficiently insert the key if it has not been added. For + // example, a mutation-handling version of the previous example: + // + // HS::AddPtr p = h.lookupForAdd(3); + // if (!p) { + // call_that_may_mutate_h(); + // if (!h.relookupOrAdd(p, 3, 3)) + // return false; + // } + // assert(*p == 3); + // + // Note that relookupOrAdd(p,l,t) performs Lookup using |l| and adds the + // entry |t|, where the caller ensures match(l,t). + typedef typename Impl::AddPtr AddPtr; + AddPtr lookupForAdd(const Lookup &l) const { return impl.lookupForAdd(l); } + + bool add(AddPtr &p, const T &t) { return impl.add(p, t); } + + bool relookupOrAdd(AddPtr &p, const Lookup &l, const T &t) { + return impl.relookupOrAdd(p, l, t); + } + + // |all()| returns a Range containing |count()| elements: + // + // typedef HashSet<int> HS; + // HS h; + // for (HS::Range r = h.all(); !r.empty(); r.popFront()) + // int i = r.front(); + // + // Also see the definition of Range in HashTable above. + typedef typename Impl::Range Range; + Range all() const { return impl.all(); } + + // Typedef for the enumeration class. An Enum may be used to examine and + // remove table entries: + // + // typedef HashSet<int> HS; + // HS s; + // for (HS::Enum e(s); !e.empty(); e.popFront()) + // if (e.front() == 42) + // e.removeFront(); + // + // Table resize may occur in Enum's destructor. Also see the definition of + // Enum in HashTable above. + typedef typename Impl::Enum Enum; + + // Remove all entries. This does not shrink the table. For that consider + // using the finish() method. + void clear() { impl.clear(); } + + // Remove all the entries and release all internal buffers. The set must + // be initialized again before any use. + void finish() { impl.finish(); } + + // Does the table contain any entries? + bool empty() const { return impl.empty(); } + + // Number of live elements in the map. + uint32_t count() const { return impl.count(); } + + // Total number of allocation in the dynamic table. Note: resize will + // happen well before count() == capacity(). + size_t capacity() const { return impl.capacity(); } + + // Don't just call |impl.sizeOfExcludingThis()| because there's no + // guarantee that |impl| is the first field in HashSet. + size_t sizeOfExcludingThis(JSMallocSizeOfFun mallocSizeOf) const { + return impl.sizeOfExcludingThis(mallocSizeOf); + } + size_t sizeOfIncludingThis(JSMallocSizeOfFun mallocSizeOf) const { + return mallocSizeOf(this) + impl.sizeOfExcludingThis(mallocSizeOf); + } + + // If |generation()| is the same before and after a HashSet operation, + // pointers into the table remain valid. + unsigned generation() const { return impl.generation(); } + + /************************************************** Shorthand operations */ + + bool has(const Lookup &l) const { + return impl.lookup(l) != NULL; + } + + // Overwrite existing value with v. Return false on oom. + bool put(const T &t) { + AddPtr p = lookupForAdd(t); + return p ? true : add(p, t); + } + + // Like put, but assert that the given key is not already present. + bool putNew(const T &t) { + return impl.putNew(t, t); + } + + bool putNew(const Lookup &l, const T &t) { + return impl.putNew(l, t); + } + + void remove(const Lookup &l) { + if (Ptr p = lookup(l)) + remove(p); + } + + // HashSet is movable + HashSet(MoveRef<HashSet> rhs) : impl(Move(rhs->impl)) {} + void operator=(MoveRef<HashSet> rhs) { impl = Move(rhs->impl); } + + private: + // HashSet is not copyable or assignable + HashSet(const HashSet &hs) MOZ_DELETE; + HashSet &operator=(const HashSet &hs) MOZ_DELETE; + + friend class Impl::Enum; +}; + +/*****************************************************************************/ + +// Hash Policy +// +// A hash policy P for a hash table with key-type Key must provide: +// - a type |P::Lookup| to use to lookup table entries; +// - a static member function |P::hash| with signature +// +// static js::HashNumber hash(Lookup) +// +// to use to hash the lookup type; and +// - a static member function |P::match| with signature +// +// static bool match(Key, Lookup) +// +// to use to test equality of key and lookup values. +// +// Normally, Lookup = Key. In general, though, different values and types of +// values can be used to lookup and store. If a Lookup value |l| is != to the +// added Key value |k|, the user must ensure that |P::match(k,l)|. E.g.: +// +// js::HashSet<Key, P>::AddPtr p = h.lookup(l); +// if (!p) { +// assert(P::match(k, l)); // must hold +// h.add(p, k); +// } + +// Pointer hashing policy that strips the lowest zeroBits when calculating the +// hash to improve key distribution. +template <typename Key, size_t zeroBits> +struct PointerHasher +{ + typedef Key Lookup; + static HashNumber hash(const Lookup &l) { + JS_ASSERT(!JS::IsPoisonedPtr(l)); + size_t word = reinterpret_cast<size_t>(l) >> zeroBits; + JS_STATIC_ASSERT(sizeof(HashNumber) == 4); +#if JS_BYTES_PER_WORD == 4 + return HashNumber(word); +#else + JS_STATIC_ASSERT(sizeof word == 8); + return HashNumber((word >> 32) ^ word); +#endif + } + static bool match(const Key &k, const Lookup &l) { + JS_ASSERT(!JS::IsPoisonedPtr(k)); + JS_ASSERT(!JS::IsPoisonedPtr(l)); + return k == l; + } +}; + +// Default hash policy: just use the 'lookup' value. This of course only +// works if the lookup value is integral. HashTable applies ScrambleHashCode to +// the result of the 'hash' which means that it is 'ok' if the lookup value is +// not well distributed over the HashNumber domain. +template <class Key> +struct DefaultHasher +{ + typedef Key Lookup; + static HashNumber hash(const Lookup &l) { + // Hash if can implicitly cast to hash number type. + return l; + } + static bool match(const Key &k, const Lookup &l) { + // Use builtin or overloaded operator==. + return k == l; + } +}; + +// Specialize hashing policy for pointer types. It assumes that the type is +// at least word-aligned. For types with smaller size use PointerHasher. +template <class T> +struct DefaultHasher<T *> : PointerHasher<T *, tl::FloorLog2<sizeof(void *)>::result> +{}; + +// For doubles, we can xor the two uint32s. +template <> +struct DefaultHasher<double> +{ + typedef double Lookup; + static HashNumber hash(double d) { + JS_STATIC_ASSERT(sizeof(HashNumber) == 4); + uint64_t u = mozilla::BitwiseCast<uint64_t>(d); + return HashNumber(u ^ (u >> 32)); + } + static bool match(double lhs, double rhs) { + return mozilla::BitwiseCast<uint64_t>(lhs) == mozilla::BitwiseCast<uint64_t>(rhs); + } +}; + +/*****************************************************************************/ + +// Both HashMap and HashSet are implemented by a single HashTable that is even +// more heavily parameterized than the other two. This leaves HashTable gnarly +// and extremely coupled to HashMap and HashSet; thus code should not use +// HashTable directly. + +template <class Key, class Value> +class HashMapEntry +{ + template <class, class, class> friend class detail::HashTable; + template <class> friend class detail::HashTableEntry; + + HashMapEntry(const HashMapEntry &) MOZ_DELETE; + void operator=(const HashMapEntry &) MOZ_DELETE; + + public: + template<typename KeyInput, typename ValueInput> + HashMapEntry(const KeyInput &k, const ValueInput &v) : key(k), value(v) {} + + HashMapEntry(MoveRef<HashMapEntry> rhs) + : key(Move(rhs->key)), value(Move(rhs->value)) { } + + typedef Key KeyType; + typedef Value ValueType; + + const Key key; + Value value; +}; + +} // namespace js + +namespace mozilla { + +template <typename T> +struct IsPod<js::detail::HashTableEntry<T> > : IsPod<T> {}; + +template <typename K, typename V> +struct IsPod<js::HashMapEntry<K, V> > + : IntegralConstant<bool, IsPod<K>::value && IsPod<V>::value> +{}; + +} // namespace mozilla + +namespace js { + +namespace detail { + +template <class T, class HashPolicy, class AllocPolicy> +class HashTable; + +template <class T> +class HashTableEntry +{ + template <class, class, class> friend class HashTable; + typedef typename mozilla::RemoveConst<T>::Type NonConstT; + + HashNumber keyHash; + mozilla::AlignedStorage2<NonConstT> mem; + + static const HashNumber sFreeKey = 0; + static const HashNumber sRemovedKey = 1; + static const HashNumber sCollisionBit = 1; + + // Assumed by calloc in createTable. + JS_STATIC_ASSERT(sFreeKey == 0); + + static bool isLiveHash(HashNumber hash) + { + return hash > sRemovedKey; + } + + HashTableEntry(const HashTableEntry &) MOZ_DELETE; + void operator=(const HashTableEntry &) MOZ_DELETE; + ~HashTableEntry() MOZ_DELETE; + + public: + // NB: HashTableEntry is treated as a POD: no constructor or destructor calls. + + void destroyIfLive() { + if (isLive()) + mem.addr()->~T(); + } + + void destroy() { + JS_ASSERT(isLive()); + mem.addr()->~T(); + } + + void swap(HashTableEntry *other) { + Swap(keyHash, other->keyHash); + Swap(mem, other->mem); + } + + T &get() { JS_ASSERT(isLive()); return *mem.addr(); } + + bool isFree() const { return keyHash == sFreeKey; } + void clearLive() { JS_ASSERT(isLive()); keyHash = sFreeKey; mem.addr()->~T(); } + void clear() { if (isLive()) mem.addr()->~T(); keyHash = sFreeKey; } + bool isRemoved() const { return keyHash == sRemovedKey; } + void removeLive() { JS_ASSERT(isLive()); keyHash = sRemovedKey; mem.addr()->~T(); } + bool isLive() const { return isLiveHash(keyHash); } + void setCollision() { JS_ASSERT(isLive()); keyHash |= sCollisionBit; } + void setCollision(HashNumber bit) { JS_ASSERT(isLive()); keyHash |= bit; } + void unsetCollision() { keyHash &= ~sCollisionBit; } + bool hasCollision() const { return keyHash & sCollisionBit; } + bool matchHash(HashNumber hn) { return (keyHash & ~sCollisionBit) == hn; } + HashNumber getKeyHash() const { return keyHash & ~sCollisionBit; } + + template <class U> + void setLive(HashNumber hn, const U &u) + { + JS_ASSERT(!isLive()); + keyHash = hn; + new(mem.addr()) T(u); + JS_ASSERT(isLive()); + } +}; + +template <class T, class HashPolicy, class AllocPolicy> +class HashTable : private AllocPolicy +{ + typedef typename mozilla::RemoveConst<T>::Type NonConstT; + typedef typename HashPolicy::KeyType Key; + typedef typename HashPolicy::Lookup Lookup; + + public: + typedef HashTableEntry<T> Entry; + + // A nullable pointer to a hash table element. A Ptr |p| can be tested + // either explicitly |if (p.found()) p->...| or using boolean conversion + // |if (p) p->...|. Ptr objects must not be used after any mutating hash + // table operations unless |generation()| is tested. + class Ptr + { + friend class HashTable; + typedef void (Ptr::* ConvertibleToBool)(); + void nonNull() {} + + Entry *entry_; + + protected: + Ptr(Entry &entry) : entry_(&entry) {} + + public: + // Leaves Ptr uninitialized. + Ptr() { +#ifdef JS_DEBUG + entry_ = (Entry *)0xbad; +#endif + } + + bool found() const { return entry_->isLive(); } + operator ConvertibleToBool() const { return found() ? &Ptr::nonNull : 0; } + bool operator==(const Ptr &rhs) const { JS_ASSERT(found() && rhs.found()); return entry_ == rhs.entry_; } + bool operator!=(const Ptr &rhs) const { return !(*this == rhs); } + + T &operator*() const { return entry_->get(); } + T *operator->() const { return &entry_->get(); } + }; + + // A Ptr that can be used to add a key after a failed lookup. + class AddPtr : public Ptr + { + friend class HashTable; + HashNumber keyHash; + mozilla::DebugOnly<uint64_t> mutationCount; + + AddPtr(Entry &entry, HashNumber hn) : Ptr(entry), keyHash(hn) {} + public: + // Leaves AddPtr uninitialized. + AddPtr() {} + }; + + // A collection of hash table entries. The collection is enumerated by + // calling |front()| followed by |popFront()| as long as |!empty()|. As + // with Ptr/AddPtr, Range objects must not be used after any mutating hash + // table operation unless the |generation()| is tested. + class Range + { + protected: + friend class HashTable; + + Range(Entry *c, Entry *e) : cur(c), end(e), validEntry(true) { + while (cur < end && !cur->isLive()) + ++cur; + } + + Entry *cur, *end; + mozilla::DebugOnly<bool> validEntry; + + public: + Range() : cur(NULL), end(NULL), validEntry(false) {} + + bool empty() const { + return cur == end; + } + + T &front() const { + JS_ASSERT(validEntry); + JS_ASSERT(!empty()); + return cur->get(); + } + + void popFront() { + JS_ASSERT(!empty()); + while (++cur < end && !cur->isLive()) + continue; + validEntry = true; + } + }; + + // A Range whose lifetime delimits a mutating enumeration of a hash table. + // Since rehashing when elements were removed during enumeration would be + // bad, it is postponed until the Enum is destructed. Since the Enum's + // destructor touches the hash table, the user must ensure that the hash + // table is still alive when the destructor runs. + class Enum : public Range + { + friend class HashTable; + + HashTable &table; + bool rekeyed; + bool removed; + + /* Not copyable. */ + Enum(const Enum &); + void operator=(const Enum &); + + public: + template<class Map> explicit + Enum(Map &map) : Range(map.all()), table(map.impl), rekeyed(false), removed(false) {} + + // Removes the |front()| element from the table, leaving |front()| + // invalid until the next call to |popFront()|. For example: + // + // HashSet<int> s; + // for (HashSet<int>::Enum e(s); !e.empty(); e.popFront()) + // if (e.front() == 42) + // e.removeFront(); + void removeFront() { + table.remove(*this->cur); + removed = true; + this->validEntry = false; + } + + // Removes the |front()| element and re-inserts it into the table with + // a new key at the new Lookup position. |front()| is invalid after + // this operation until the next call to |popFront()|. + void rekeyFront(const Lookup &l, const Key &k) { + typename HashTableEntry<T>::NonConstT t(Move(this->cur->get())); + HashPolicy::setKey(t, const_cast<Key &>(k)); + table.remove(*this->cur); + table.putNewInfallible(l, Move(t)); + rekeyed = true; + this->validEntry = false; + } + + void rekeyFront(const Key &k) { + rekeyFront(k, k); + } + + // Potentially rehashes the table. + ~Enum() { + if (rekeyed) { + table.gen++; + table.checkOverRemoved(); + } + + if (removed) + table.compactIfUnderloaded(); + } + }; + + // HashTable is movable + HashTable(MoveRef<HashTable> rhs) + : AllocPolicy(*rhs) + { + mozilla::PodAssign(this, &*rhs); + rhs->table = NULL; + } + void operator=(MoveRef<HashTable> rhs) { + if (table) + destroyTable(*this, table, capacity()); + mozilla::PodAssign(this, &*rhs); + rhs->table = NULL; + } + + private: + // HashTable is not copyable or assignable + HashTable(const HashTable &) MOZ_DELETE; + void operator=(const HashTable &) MOZ_DELETE; + + private: + uint32_t hashShift; // multiplicative hash shift + uint32_t entryCount; // number of entries in table + uint32_t gen; // entry storage generation number + uint32_t removedCount; // removed entry sentinels in table + Entry *table; // entry storage + + void setTableSizeLog2(unsigned sizeLog2) + { + hashShift = sHashBits - sizeLog2; + } + +#ifdef JS_DEBUG + mutable struct Stats + { + uint32_t searches; // total number of table searches + uint32_t steps; // hash chain links traversed + uint32_t hits; // searches that found key + uint32_t misses; // searches that didn't find key + uint32_t addOverRemoved; // adds that recycled a removed entry + uint32_t removes; // calls to remove + uint32_t removeFrees; // calls to remove that freed the entry + uint32_t grows; // table expansions + uint32_t shrinks; // table contractions + uint32_t compresses; // table compressions + uint32_t rehashes; // tombstone decontaminations + } stats; +# define METER(x) x +#else +# define METER(x) +#endif + + friend class js::ReentrancyGuard; + mutable mozilla::DebugOnly<bool> entered; + mozilla::DebugOnly<uint64_t> mutationCount; + + // The default initial capacity is 32 (enough to hold 16 elements), but it + // can be as low as 4. + static const unsigned sMinCapacityLog2 = 2; + static const unsigned sMinCapacity = 1 << sMinCapacityLog2; + static const unsigned sMaxInit = JS_BIT(23); + static const unsigned sMaxCapacity = JS_BIT(24); + static const unsigned sHashBits = tl::BitSize<HashNumber>::result; + static const uint8_t sMinAlphaFrac = 64; // (0x100 * .25) + static const uint8_t sMaxAlphaFrac = 192; // (0x100 * .75) + static const uint8_t sInvMaxAlpha = 171; // (ceil(0x100 / .75) >> 1) + static const HashNumber sFreeKey = Entry::sFreeKey; + static const HashNumber sRemovedKey = Entry::sRemovedKey; + static const HashNumber sCollisionBit = Entry::sCollisionBit; + + static void staticAsserts() + { + // Rely on compiler "constant overflow warnings". + JS_STATIC_ASSERT(((sMaxInit * sInvMaxAlpha) >> 7) < sMaxCapacity); + JS_STATIC_ASSERT((sMaxCapacity * sInvMaxAlpha) <= UINT32_MAX); + JS_STATIC_ASSERT((sMaxCapacity * sizeof(Entry)) <= UINT32_MAX); + } + + static bool isLiveHash(HashNumber hash) + { + return Entry::isLiveHash(hash); + } + + static HashNumber prepareHash(const Lookup& l) + { + HashNumber keyHash = ScrambleHashCode(HashPolicy::hash(l)); + + // Avoid reserved hash codes. + if (!isLiveHash(keyHash)) + keyHash -= (sRemovedKey + 1); + return keyHash & ~sCollisionBit; + } + + static Entry *createTable(AllocPolicy &alloc, uint32_t capacity) + { + // See JS_STATIC_ASSERT(sFreeKey == 0) in HashTableEntry. + return (Entry *)alloc.calloc_(capacity * sizeof(Entry)); + } + + static void destroyTable(AllocPolicy &alloc, Entry *oldTable, uint32_t capacity) + { + for (Entry *e = oldTable, *end = e + capacity; e < end; ++e) + e->destroyIfLive(); + alloc.free_(oldTable); + } + + public: + HashTable(AllocPolicy ap) + : AllocPolicy(ap), + hashShift(sHashBits), + entryCount(0), + gen(0), + removedCount(0), + table(NULL), + entered(false), + mutationCount(0) + {} + + MOZ_WARN_UNUSED_RESULT bool init(uint32_t length) + { + JS_ASSERT(!initialized()); + + // Correct for sMaxAlphaFrac such that the table will not resize + // when adding 'length' entries. + if (length > sMaxInit) { + this->reportAllocOverflow(); + return false; + } + uint32_t newCapacity = (length * sInvMaxAlpha) >> 7; + + if (newCapacity < sMinCapacity) + newCapacity = sMinCapacity; + + // FIXME: use JS_CEILING_LOG2 when PGO stops crashing (bug 543034). + uint32_t roundUp = sMinCapacity, roundUpLog2 = sMinCapacityLog2; + while (roundUp < newCapacity) { + roundUp <<= 1; + ++roundUpLog2; + } + + newCapacity = roundUp; + JS_ASSERT(newCapacity <= sMaxCapacity); + + table = createTable(*this, newCapacity); + if (!table) + return false; + + setTableSizeLog2(roundUpLog2); + METER(memset(&stats, 0, sizeof(stats))); + return true; + } + + bool initialized() const + { + return !!table; + } + + ~HashTable() + { + if (table) + destroyTable(*this, table, capacity()); + } + + private: + HashNumber hash1(HashNumber hash0) const + { + return hash0 >> hashShift; + } + + struct DoubleHash + { + HashNumber h2; + HashNumber sizeMask; + }; + + DoubleHash hash2(HashNumber curKeyHash) const + { + unsigned sizeLog2 = sHashBits - hashShift; + DoubleHash dh = { + ((curKeyHash << sizeLog2) >> hashShift) | 1, + (HashNumber(1) << sizeLog2) - 1 + }; + return dh; + } + + static HashNumber applyDoubleHash(HashNumber h1, const DoubleHash &dh) + { + return (h1 - dh.h2) & dh.sizeMask; + } + + bool overloaded() + { + return entryCount + removedCount >= ((sMaxAlphaFrac * capacity()) >> 8); + } + + // Would the table be underloaded if it had the given capacity and entryCount? + static bool wouldBeUnderloaded(uint32_t capacity, uint32_t entryCount) + { + return capacity > sMinCapacity && entryCount <= ((sMinAlphaFrac * capacity) >> 8); + } + + bool underloaded() + { + return wouldBeUnderloaded(capacity(), entryCount); + } + + static bool match(Entry &e, const Lookup &l) + { + return HashPolicy::match(HashPolicy::getKey(e.get()), l); + } + + Entry &lookup(const Lookup &l, HashNumber keyHash, unsigned collisionBit) const + { + JS_ASSERT(isLiveHash(keyHash)); + JS_ASSERT(!(keyHash & sCollisionBit)); + JS_ASSERT(collisionBit == 0 || collisionBit == sCollisionBit); + JS_ASSERT(table); + METER(stats.searches++); + + // Compute the primary hash address. + HashNumber h1 = hash1(keyHash); + Entry *entry = &table[h1]; + + // Miss: return space for a new entry. + if (entry->isFree()) { + METER(stats.misses++); + return *entry; + } + + // Hit: return entry. + if (entry->matchHash(keyHash) && match(*entry, l)) { + METER(stats.hits++); + return *entry; + } + + // Collision: double hash. + DoubleHash dh = hash2(keyHash); + + // Save the first removed entry pointer so we can recycle later. + Entry *firstRemoved = NULL; + + while(true) { + if (JS_UNLIKELY(entry->isRemoved())) { + if (!firstRemoved) + firstRemoved = entry; + } else { + entry->setCollision(collisionBit); + } + + METER(stats.steps++); + h1 = applyDoubleHash(h1, dh); + + entry = &table[h1]; + if (entry->isFree()) { + METER(stats.misses++); + return firstRemoved ? *firstRemoved : *entry; + } + + if (entry->matchHash(keyHash) && match(*entry, l)) { + METER(stats.hits++); + return *entry; + } + } + } + + // This is a copy of lookup hardcoded to the assumptions: + // 1. the lookup is a lookupForAdd + // 2. the key, whose |keyHash| has been passed is not in the table, + // 3. no entries have been removed from the table. + // This specialized search avoids the need for recovering lookup values + // from entries, which allows more flexible Lookup/Key types. + Entry &findFreeEntry(HashNumber keyHash) + { + JS_ASSERT(!(keyHash & sCollisionBit)); + JS_ASSERT(table); + METER(stats.searches++); + + // We assume 'keyHash' has already been distributed. + + // Compute the primary hash address. + HashNumber h1 = hash1(keyHash); + Entry *entry = &table[h1]; + + // Miss: return space for a new entry. + if (!entry->isLive()) { + METER(stats.misses++); + return *entry; + } + + // Collision: double hash. + DoubleHash dh = hash2(keyHash); + + while(true) { + JS_ASSERT(!entry->isRemoved()); + entry->setCollision(); + + METER(stats.steps++); + h1 = applyDoubleHash(h1, dh); + + entry = &table[h1]; + if (!entry->isLive()) { + METER(stats.misses++); + return *entry; + } + } + } + + enum RebuildStatus { NotOverloaded, Rehashed, RehashFailed }; + + RebuildStatus changeTableSize(int deltaLog2) + { + // Look, but don't touch, until we succeed in getting new entry store. + Entry *oldTable = table; + uint32_t oldCap = capacity(); + uint32_t newLog2 = sHashBits - hashShift + deltaLog2; + uint32_t newCapacity = JS_BIT(newLog2); + if (newCapacity > sMaxCapacity) { + this->reportAllocOverflow(); + return RehashFailed; + } + + Entry *newTable = createTable(*this, newCapacity); + if (!newTable) + return RehashFailed; + + // We can't fail from here on, so update table parameters. + setTableSizeLog2(newLog2); + removedCount = 0; + gen++; + table = newTable; + + // Copy only live entries, leaving removed ones behind. + for (Entry *src = oldTable, *end = src + oldCap; src < end; ++src) { + if (src->isLive()) { + HashNumber hn = src->getKeyHash(); + findFreeEntry(hn).setLive(hn, Move(src->get())); + src->destroy(); + } + } + + // All entries have been destroyed, no need to destroyTable. + this->free_(oldTable); + return Rehashed; + } + + RebuildStatus checkOverloaded() + { + if (!overloaded()) + return NotOverloaded; + + // Compress if a quarter or more of all entries are removed. + int deltaLog2; + if (removedCount >= (capacity() >> 2)) { + METER(stats.compresses++); + deltaLog2 = 0; + } else { + METER(stats.grows++); + deltaLog2 = 1; + } + + return changeTableSize(deltaLog2); + } + + // Infallibly rehash the table if we are overloaded with removals. + void checkOverRemoved() + { + if (overloaded()) { + if (checkOverloaded() == RehashFailed) + rehashTableInPlace(); + } + } + + void remove(Entry &e) + { + JS_ASSERT(table); + METER(stats.removes++); + + if (e.hasCollision()) { + e.removeLive(); + removedCount++; + } else { + METER(stats.removeFrees++); + e.clearLive(); + } + entryCount--; + mutationCount++; + } + + void checkUnderloaded() + { + if (underloaded()) { + METER(stats.shrinks++); + (void) changeTableSize(-1); + } + } + + // Resize the table down to the largest capacity which doesn't underload the + // table. Since we call checkUnderloaded() on every remove, you only need + // to call this after a bulk removal of items done without calling remove(). + void compactIfUnderloaded() + { + int32_t resizeLog2 = 0; + uint32_t newCapacity = capacity(); + while (wouldBeUnderloaded(newCapacity, entryCount)) { + newCapacity = newCapacity >> 1; + resizeLog2--; + } + + if (resizeLog2 != 0) { + changeTableSize(resizeLog2); + } + } + + // This is identical to changeTableSize(currentSize), but without requiring + // a second table. We do this by recycling the collision bits to tell us if + // the element is already inserted or still waiting to be inserted. Since + // already-inserted elements win any conflicts, we get the same table as we + // would have gotten through random insertion order. + void rehashTableInPlace() + { + METER(stats.rehashes++); + removedCount = 0; + for (size_t i = 0; i < capacity(); ++i) + table[i].unsetCollision(); + + for (size_t i = 0; i < capacity();) { + Entry *src = &table[i]; + + if (!src->isLive() || src->hasCollision()) { + ++i; + continue; + } + + HashNumber keyHash = src->getKeyHash(); + HashNumber h1 = hash1(keyHash); + DoubleHash dh = hash2(keyHash); + Entry *tgt = &table[h1]; + while (true) { + if (!tgt->hasCollision()) { + src->swap(tgt); + tgt->setCollision(); + break; + } + + h1 = applyDoubleHash(h1, dh); + tgt = &table[h1]; + } + } + + // TODO: this algorithm leaves collision bits on *all* elements, even if + // they are on no collision path. We have the option of setting the + // collision bits correctly on a subsequent pass or skipping the rehash + // unless we are totally filled with tombstones: benchmark to find out + // which approach is best. + } + + public: + void clear() + { + if (mozilla::IsPod<Entry>::value) { + memset(table, 0, sizeof(*table) * capacity()); + } else { + uint32_t tableCapacity = capacity(); + for (Entry *e = table, *end = table + tableCapacity; e < end; ++e) + e->clear(); + } + removedCount = 0; + entryCount = 0; + mutationCount++; + } + + void finish() + { + JS_ASSERT(!entered); + + if (!table) + return; + + destroyTable(*this, table, capacity()); + table = NULL; + gen++; + entryCount = 0; + removedCount = 0; + mutationCount++; + } + + Range all() const + { + JS_ASSERT(table); + return Range(table, table + capacity()); + } + + bool empty() const + { + JS_ASSERT(table); + return !entryCount; + } + + uint32_t count() const + { + JS_ASSERT(table); + return entryCount; + } + + uint32_t capacity() const + { + JS_ASSERT(table); + return JS_BIT(sHashBits - hashShift); + } + + uint32_t generation() const + { + JS_ASSERT(table); + return gen; + } + + size_t sizeOfExcludingThis(JSMallocSizeOfFun mallocSizeOf) const + { + return mallocSizeOf(table); + } + + size_t sizeOfIncludingThis(JSMallocSizeOfFun mallocSizeOf) const + { + return mallocSizeOf(this) + sizeOfExcludingThis(mallocSizeOf); + } + + Ptr lookup(const Lookup &l) const + { + ReentrancyGuard g(*this); + HashNumber keyHash = prepareHash(l); + return Ptr(lookup(l, keyHash, 0)); + } + + Ptr readonlyThreadsafeLookup(const Lookup &l) const + { + HashNumber keyHash = prepareHash(l); + return Ptr(lookup(l, keyHash, 0)); + } + + AddPtr lookupForAdd(const Lookup &l) const + { + ReentrancyGuard g(*this); + HashNumber keyHash = prepareHash(l); + Entry &entry = lookup(l, keyHash, sCollisionBit); + AddPtr p(entry, keyHash); + p.mutationCount = mutationCount; + return p; + } + + template <class U> + bool add(AddPtr &p, const U &rhs) + { + ReentrancyGuard g(*this); + JS_ASSERT(mutationCount == p.mutationCount); + JS_ASSERT(table); + JS_ASSERT(!p.found()); + JS_ASSERT(!(p.keyHash & sCollisionBit)); + + // Changing an entry from removed to live does not affect whether we + // are overloaded and can be handled separately. + if (p.entry_->isRemoved()) { + METER(stats.addOverRemoved++); + removedCount--; + p.keyHash |= sCollisionBit; + } else { + // Preserve the validity of |p.entry_|. + RebuildStatus status = checkOverloaded(); + if (status == RehashFailed) + return false; + if (status == Rehashed) + p.entry_ = &findFreeEntry(p.keyHash); + } + + p.entry_->setLive(p.keyHash, rhs); + entryCount++; + mutationCount++; + return true; + } + + template <class U> + void putNewInfallible(const Lookup &l, const U &u) + { + JS_ASSERT(table); + + HashNumber keyHash = prepareHash(l); + Entry *entry = &findFreeEntry(keyHash); + + if (entry->isRemoved()) { + METER(stats.addOverRemoved++); + removedCount--; + keyHash |= sCollisionBit; + } + + entry->setLive(keyHash, u); + entryCount++; + mutationCount++; + } + + template <class U> + bool putNew(const Lookup &l, const U &u) + { + if (checkOverloaded() == RehashFailed) + return false; + + putNewInfallible(l, u); + return true; + } + + template <class U> + bool relookupOrAdd(AddPtr& p, const Lookup &l, const U &u) + { + p.mutationCount = mutationCount; + { + ReentrancyGuard g(*this); + p.entry_ = &lookup(l, p.keyHash, sCollisionBit); + } + return p.found() || add(p, u); + } + + void remove(Ptr p) + { + JS_ASSERT(table); + ReentrancyGuard g(*this); + JS_ASSERT(p.found()); + remove(*p.entry_); + checkUnderloaded(); + } + +#undef METER +}; + +} // namespace detail +} // namespace js + +#endif /* js_HashTable_h */ diff --git a/js/public/HeapAPI.h b/js/public/HeapAPI.h new file mode 100644 index 0000000..37cadfa --- /dev/null +++ b/js/public/HeapAPI.h @@ -0,0 +1,145 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_HeapAPI_h +#define js_HeapAPI_h + +#include "jspubtd.h" + +/* These values are private to the JS engine. */ +namespace js { +namespace gc { + +const size_t ArenaShift = 12; +const size_t ArenaSize = size_t(1) << ArenaShift; +const size_t ArenaMask = ArenaSize - 1; + +const size_t ChunkShift = 20; +const size_t ChunkSize = size_t(1) << ChunkShift; +const size_t ChunkMask = ChunkSize - 1; + +const size_t CellShift = 3; +const size_t CellSize = size_t(1) << CellShift; +const size_t CellMask = CellSize - 1; + +/* These are magic constants derived from actual offsets in gc/Heap.h. */ +const size_t ChunkMarkBitmapOffset = 1032368; +const size_t ChunkMarkBitmapBits = 129024; +const size_t ChunkRuntimeOffset = ChunkSize - sizeof(void*); + +/* + * Live objects are marked black. How many other additional colors are available + * depends on the size of the GCThing. Objects marked gray are eligible for + * cycle collection. + */ +static const uint32_t BLACK = 0; +static const uint32_t GRAY = 1; + +} /* namespace gc */ +} /* namespace js */ + +namespace JS { +struct Zone; +} /* namespace JS */ + +namespace JS { +namespace shadow { + +struct ArenaHeader +{ + js::Zone *zone; +}; + +struct Zone +{ + bool needsBarrier_; + + Zone() : needsBarrier_(false) {} +}; + +} /* namespace shadow */ +} /* namespace JS */ + +namespace js { +namespace gc { + +static JS_ALWAYS_INLINE uintptr_t * +GetGCThingMarkBitmap(const void *thing) +{ + uintptr_t addr = uintptr_t(thing); + addr &= ~js::gc::ChunkMask; + addr |= js::gc::ChunkMarkBitmapOffset; + return reinterpret_cast<uintptr_t *>(addr); +} + +static JS_ALWAYS_INLINE JS::shadow::Runtime * +GetGCThingRuntime(const void *thing) +{ + uintptr_t addr = uintptr_t(thing); + addr &= ~js::gc::ChunkMask; + addr |= js::gc::ChunkRuntimeOffset; + return *reinterpret_cast<JS::shadow::Runtime **>(addr); +} + +static JS_ALWAYS_INLINE void +GetGCThingMarkWordAndMask(const void *thing, uint32_t color, + uintptr_t **wordp, uintptr_t *maskp) +{ + uintptr_t addr = uintptr_t(thing); + size_t bit = (addr & js::gc::ChunkMask) / js::gc::CellSize + color; + JS_ASSERT(bit < js::gc::ChunkMarkBitmapBits); + uintptr_t *bitmap = GetGCThingMarkBitmap(thing); + *maskp = uintptr_t(1) << (bit % JS_BITS_PER_WORD); + *wordp = &bitmap[bit / JS_BITS_PER_WORD]; +} + +static JS_ALWAYS_INLINE JS::shadow::ArenaHeader * +GetGCThingArena(void *thing) +{ + uintptr_t addr = uintptr_t(thing); + addr &= ~js::gc::ArenaMask; + return reinterpret_cast<JS::shadow::ArenaHeader *>(addr); +} + +} /* namespace gc */ + +} /* namespace js */ + +namespace JS { + +static JS_ALWAYS_INLINE Zone * +GetGCThingZone(void *thing) +{ + JS_ASSERT(thing); + return js::gc::GetGCThingArena(thing)->zone; +} + +static JS_ALWAYS_INLINE Zone * +GetObjectZone(JSObject *obj) +{ + return GetGCThingZone(obj); +} + +static JS_ALWAYS_INLINE bool +GCThingIsMarkedGray(void *thing) +{ + uintptr_t *word, mask; + js::gc::GetGCThingMarkWordAndMask(thing, js::gc::GRAY, &word, &mask); + return *word & mask; +} + +static JS_ALWAYS_INLINE bool +IsIncrementalBarrierNeededOnGCThing(shadow::Runtime *rt, void *thing, JSGCTraceKind kind) +{ + if (!rt->needsBarrier_) + return false; + js::Zone *zone = GetGCThingZone(thing); + return reinterpret_cast<shadow::Zone *>(zone)->needsBarrier_; +} + +} /* namespace JS */ + +#endif /* js_HeapAPI_h */ diff --git a/js/public/LegacyIntTypes.h b/js/public/LegacyIntTypes.h new file mode 100644 index 0000000..903f2e6 --- /dev/null +++ b/js/public/LegacyIntTypes.h @@ -0,0 +1,60 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* + * This section typedefs the old 'native' types to the new <stdint.h> types. + * These redefinitions are provided solely to allow JSAPI users to more easily + * transition to <stdint.h> types. They are not to be used in the JSAPI, and + * new JSAPI user code should not use them. This mapping file may eventually + * be removed from SpiderMonkey, so don't depend on it in the long run. + */ + +/* + * BEWARE: Comity with other implementers of these types is not guaranteed. + * Indeed, if you use this header and third-party code defining these + * types, *expect* to encounter either compile errors or link errors, + * depending how these types are used and on the order of inclusion. + * It is safest to use only the JSAPI <stdint.h>-style types, + * customizing those types using MOZ_CUSTOM_STDINT_H if necessary. + */ +#ifndef js_LegacyIntTypes_h +#define js_LegacyIntTypes_h + +#include "mozilla/StandardInteger.h" + +#include "js-config.h" + +typedef uint8_t uint8; +typedef uint16_t uint16; +typedef uint32_t uint32; +typedef uint64_t uint64; + +/* + * On AIX 4.3, sys/inttypes.h (which is included by sys/types.h, a very + * common header file) defines the types int8, int16, int32, and int64. + * So we don't define these four types here to avoid conflicts in case + * the code also includes sys/types.h. + */ +#if defined(AIX) && defined(HAVE_SYS_INTTYPES_H) +#include <sys/inttypes.h> +#else +typedef int8_t int8; +typedef int16_t int16; +typedef int32_t int32; +typedef int64_t int64; +#endif /* AIX && HAVE_SYS_INTTYPES_H */ + +typedef uint8_t JSUint8; +typedef uint16_t JSUint16; +typedef uint32_t JSUint32; +typedef uint64_t JSUint64; + +typedef int8_t JSInt8; +typedef int16_t JSInt16; +typedef int32_t JSInt32; +typedef int64_t JSInt64; + +#endif /* js_LegacyIntTypes_h */ diff --git a/js/public/MemoryMetrics.h b/js/public/MemoryMetrics.h new file mode 100644 index 0000000..7fdf0d3 --- /dev/null +++ b/js/public/MemoryMetrics.h @@ -0,0 +1,460 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_MemoryMetrics_h +#define js_MemoryMetrics_h + +// These declarations are not within jsapi.h because they are highly likely to +// change in the future. Depend on them at your own risk. + +#include <string.h> + +#include "jsalloc.h" +#include "jspubtd.h" + +#include "js/Utility.h" +#include "js/Vector.h" + +class nsISupports; // This is needed for ObjectPrivateVisitor. + +namespace js { + +// In memory reporting, we have concept of "sundries", line items which are too +// small to be worth reporting individually. Under some circumstances, a memory +// reporter gets tossed into the sundries bucket if it's smaller than +// MemoryReportingSundriesThreshold() bytes. +// +// We need to define this value here, rather than in the code which actually +// generates the memory reports, because HugeStringInfo uses this value. +JS_FRIEND_API(size_t) MemoryReportingSundriesThreshold(); + +} // namespace js + +namespace JS { + +// Data for tracking memory usage of things hanging off objects. +struct ObjectsExtraSizes +{ + size_t slots; + size_t elementsNonAsmJS; + size_t elementsAsmJSHeap; + size_t elementsAsmJSNonHeap; + size_t argumentsData; + size_t regExpStatics; + size_t propertyIteratorData; + size_t ctypesData; + size_t private_; // The '_' suffix is required because |private| is a keyword. + // Note that this field is measured separately from the others. + + ObjectsExtraSizes() { memset(this, 0, sizeof(ObjectsExtraSizes)); } + + void add(ObjectsExtraSizes &sizes) { + this->slots += sizes.slots; + this->elementsNonAsmJS += sizes.elementsNonAsmJS; + this->elementsAsmJSHeap += sizes.elementsAsmJSHeap; + this->elementsAsmJSNonHeap += sizes.elementsAsmJSNonHeap; + this->argumentsData += sizes.argumentsData; + this->regExpStatics += sizes.regExpStatics; + this->propertyIteratorData += sizes.propertyIteratorData; + this->ctypesData += sizes.ctypesData; + this->private_ += sizes.private_; + } +}; + +// Data for tracking analysis/inference memory usage. +struct TypeInferenceSizes +{ + size_t typeScripts; + size_t typeResults; + size_t analysisPool; + size_t pendingArrays; + size_t allocationSiteTables; + size_t arrayTypeTables; + size_t objectTypeTables; + + TypeInferenceSizes() { memset(this, 0, sizeof(TypeInferenceSizes)); } + + void add(TypeInferenceSizes &sizes) { + this->typeScripts += sizes.typeScripts; + this->typeResults += sizes.typeResults; + this->analysisPool += sizes.analysisPool; + this->pendingArrays += sizes.pendingArrays; + this->allocationSiteTables += sizes.allocationSiteTables; + this->arrayTypeTables += sizes.arrayTypeTables; + this->objectTypeTables += sizes.objectTypeTables; + } +}; + +// Data for tracking JIT-code memory usage. +struct CodeSizes +{ + size_t ion; + size_t asmJS; + size_t baseline; + size_t regexp; + size_t other; + size_t unused; + + CodeSizes() { memset(this, 0, sizeof(CodeSizes)); } +}; + +// Holds data about a huge string (one which uses more HugeStringInfo::MinSize +// bytes of memory), so we can report it individually. +struct HugeStringInfo +{ + HugeStringInfo() : length(0), size(0) { memset(&buffer, 0, sizeof(buffer)); } + + // A string needs to take up this many bytes of storage before we consider + // it to be "huge". + static size_t MinSize() { + return js::MemoryReportingSundriesThreshold(); + } + + // A string's size in memory is not necessarily equal to twice its length + // because the allocator and the JS engine both may round up. + size_t length; + size_t size; + + // We record the first 32 chars of the escaped string here. (We escape the + // string so we can use a char[] instead of a jschar[] here. + char buffer[32]; +}; + +// These measurements relate directly to the JSRuntime, and not to +// compartments within it. +struct RuntimeSizes +{ + RuntimeSizes() { memset(this, 0, sizeof(RuntimeSizes)); } + + size_t object; + size_t atomsTable; + size_t contexts; + size_t dtoa; + size_t temporary; + size_t regexpData; + size_t interpreterStack; + size_t gcMarker; + size_t mathCache; + size_t scriptData; + size_t scriptSources; + + CodeSizes code; +}; + +struct ZoneStats +{ + ZoneStats() + : extra(NULL), + gcHeapArenaAdmin(0), + gcHeapUnusedGcThings(0), + gcHeapStringsNormal(0), + gcHeapStringsShort(0), + gcHeapLazyScripts(0), + gcHeapTypeObjects(0), + gcHeapIonCodes(0), + stringCharsNonHuge(0), + lazyScripts(0), + typeObjects(0), + typePool(0), + hugeStrings() + {} + + ZoneStats(const ZoneStats &other) + : extra(other.extra), + gcHeapArenaAdmin(other.gcHeapArenaAdmin), + gcHeapUnusedGcThings(other.gcHeapUnusedGcThings), + gcHeapStringsNormal(other.gcHeapStringsNormal), + gcHeapStringsShort(other.gcHeapStringsShort), + gcHeapLazyScripts(other.gcHeapLazyScripts), + gcHeapTypeObjects(other.gcHeapTypeObjects), + gcHeapIonCodes(other.gcHeapIonCodes), + stringCharsNonHuge(other.stringCharsNonHuge), + lazyScripts(other.lazyScripts), + typeObjects(other.typeObjects), + typePool(other.typePool), + hugeStrings() + { + hugeStrings.append(other.hugeStrings); + } + + // Add other's numbers to this object's numbers. + void add(ZoneStats &other) { + #define ADD(x) this->x += other.x + + ADD(gcHeapArenaAdmin); + ADD(gcHeapUnusedGcThings); + + ADD(gcHeapStringsNormal); + ADD(gcHeapStringsShort); + ADD(gcHeapLazyScripts); + ADD(gcHeapTypeObjects); + ADD(gcHeapIonCodes); + + ADD(stringCharsNonHuge); + ADD(lazyScripts); + ADD(typeObjects); + ADD(typePool); + + #undef ADD + + hugeStrings.append(other.hugeStrings); + } + + // This field can be used by embedders. + void *extra; + + size_t gcHeapArenaAdmin; + size_t gcHeapUnusedGcThings; + + size_t gcHeapStringsNormal; + size_t gcHeapStringsShort; + + size_t gcHeapLazyScripts; + size_t gcHeapTypeObjects; + size_t gcHeapIonCodes; + + size_t stringCharsNonHuge; + size_t lazyScripts; + size_t typeObjects; + size_t typePool; + + js::Vector<HugeStringInfo, 0, js::SystemAllocPolicy> hugeStrings; + + // The size of all the live things in the GC heap that don't belong to any + // compartment. + size_t GCHeapThingsSize(); +}; + +struct CompartmentStats +{ + CompartmentStats() + : extra(NULL), + gcHeapObjectsOrdinary(0), + gcHeapObjectsFunction(0), + gcHeapObjectsDenseArray(0), + gcHeapObjectsSlowArray(0), + gcHeapObjectsCrossCompartmentWrapper(0), + gcHeapShapesTreeGlobalParented(0), + gcHeapShapesTreeNonGlobalParented(0), + gcHeapShapesDict(0), + gcHeapShapesBase(0), + gcHeapScripts(0), + objectsExtra(), + shapesExtraTreeTables(0), + shapesExtraDictTables(0), + shapesExtraTreeShapeKids(0), + shapesCompartmentTables(0), + scriptData(0), + baselineData(0), + baselineStubsFallback(0), + baselineStubsOptimized(0), + ionData(0), + compartmentObject(0), + crossCompartmentWrappersTable(0), + regexpCompartment(0), + debuggeesSet(0), + typeInference() + {} + + CompartmentStats(const CompartmentStats &other) + : extra(other.extra), + gcHeapObjectsOrdinary(other.gcHeapObjectsOrdinary), + gcHeapObjectsFunction(other.gcHeapObjectsFunction), + gcHeapObjectsDenseArray(other.gcHeapObjectsDenseArray), + gcHeapObjectsSlowArray(other.gcHeapObjectsSlowArray), + gcHeapObjectsCrossCompartmentWrapper(other.gcHeapObjectsCrossCompartmentWrapper), + gcHeapShapesTreeGlobalParented(other.gcHeapShapesTreeGlobalParented), + gcHeapShapesTreeNonGlobalParented(other.gcHeapShapesTreeNonGlobalParented), + gcHeapShapesDict(other.gcHeapShapesDict), + gcHeapShapesBase(other.gcHeapShapesBase), + gcHeapScripts(other.gcHeapScripts), + objectsExtra(other.objectsExtra), + shapesExtraTreeTables(other.shapesExtraTreeTables), + shapesExtraDictTables(other.shapesExtraDictTables), + shapesExtraTreeShapeKids(other.shapesExtraTreeShapeKids), + shapesCompartmentTables(other.shapesCompartmentTables), + scriptData(other.scriptData), + baselineData(other.baselineData), + baselineStubsFallback(other.baselineStubsFallback), + baselineStubsOptimized(other.baselineStubsOptimized), + ionData(other.ionData), + compartmentObject(other.compartmentObject), + crossCompartmentWrappersTable(other.crossCompartmentWrappersTable), + regexpCompartment(other.regexpCompartment), + debuggeesSet(other.debuggeesSet), + typeInference(other.typeInference) + { + } + + // This field can be used by embedders. + void *extra; + + // If you add a new number, remember to update the constructors, add(), and + // maybe gcHeapThingsSize()! + size_t gcHeapObjectsOrdinary; + size_t gcHeapObjectsFunction; + size_t gcHeapObjectsDenseArray; + size_t gcHeapObjectsSlowArray; + size_t gcHeapObjectsCrossCompartmentWrapper; + size_t gcHeapShapesTreeGlobalParented; + size_t gcHeapShapesTreeNonGlobalParented; + size_t gcHeapShapesDict; + size_t gcHeapShapesBase; + size_t gcHeapScripts; + ObjectsExtraSizes objectsExtra; + + size_t shapesExtraTreeTables; + size_t shapesExtraDictTables; + size_t shapesExtraTreeShapeKids; + size_t shapesCompartmentTables; + size_t scriptData; + size_t baselineData; + size_t baselineStubsFallback; + size_t baselineStubsOptimized; + size_t ionData; + size_t compartmentObject; + size_t crossCompartmentWrappersTable; + size_t regexpCompartment; + size_t debuggeesSet; + + TypeInferenceSizes typeInference; + + // Add cStats's numbers to this object's numbers. + void add(CompartmentStats &cStats) { + #define ADD(x) this->x += cStats.x + + ADD(gcHeapObjectsOrdinary); + ADD(gcHeapObjectsFunction); + ADD(gcHeapObjectsDenseArray); + ADD(gcHeapObjectsSlowArray); + ADD(gcHeapObjectsCrossCompartmentWrapper); + ADD(gcHeapShapesTreeGlobalParented); + ADD(gcHeapShapesTreeNonGlobalParented); + ADD(gcHeapShapesDict); + ADD(gcHeapShapesBase); + ADD(gcHeapScripts); + objectsExtra.add(cStats.objectsExtra); + + ADD(shapesExtraTreeTables); + ADD(shapesExtraDictTables); + ADD(shapesExtraTreeShapeKids); + ADD(shapesCompartmentTables); + ADD(scriptData); + ADD(baselineData); + ADD(baselineStubsFallback); + ADD(baselineStubsOptimized); + ADD(ionData); + ADD(compartmentObject); + ADD(crossCompartmentWrappersTable); + ADD(regexpCompartment); + ADD(debuggeesSet); + + #undef ADD + + typeInference.add(cStats.typeInference); + } + + // The size of all the live things in the GC heap. + size_t GCHeapThingsSize(); +}; + +struct RuntimeStats +{ + RuntimeStats(JSMallocSizeOfFun mallocSizeOf) + : runtime(), + gcHeapChunkTotal(0), + gcHeapDecommittedArenas(0), + gcHeapUnusedChunks(0), + gcHeapUnusedArenas(0), + gcHeapUnusedGcThings(0), + gcHeapChunkAdmin(0), + gcHeapGcThings(0), + cTotals(), + zTotals(), + compartmentStatsVector(), + zoneStatsVector(), + currZoneStats(NULL), + mallocSizeOf_(mallocSizeOf) + {} + + RuntimeSizes runtime; + + // If you add a new number, remember to update the constructor! + + // Here's a useful breakdown of the GC heap. + // + // - rtStats.gcHeapChunkTotal + // - decommitted bytes + // - rtStats.gcHeapDecommittedArenas (decommitted arenas in non-empty chunks) + // - unused bytes + // - rtStats.gcHeapUnusedChunks (empty chunks) + // - rtStats.gcHeapUnusedArenas (empty arenas within non-empty chunks) + // - rtStats.total.gcHeapUnusedGcThings (empty GC thing slots within non-empty arenas) + // - used bytes + // - rtStats.gcHeapChunkAdmin + // - rtStats.total.gcHeapArenaAdmin + // - rtStats.gcHeapGcThings (in-use GC things) + // + // It's possible that some arenas in empty chunks may be decommitted, but + // we don't count those under rtStats.gcHeapDecommittedArenas because (a) + // it's rare, and (b) this means that rtStats.gcHeapUnusedChunks is a + // multiple of the chunk size, which is good. + + size_t gcHeapChunkTotal; + size_t gcHeapDecommittedArenas; + size_t gcHeapUnusedChunks; + size_t gcHeapUnusedArenas; + size_t gcHeapUnusedGcThings; + size_t gcHeapChunkAdmin; + size_t gcHeapGcThings; + + // The sum of all compartment's measurements. + CompartmentStats cTotals; + ZoneStats zTotals; + + js::Vector<CompartmentStats, 0, js::SystemAllocPolicy> compartmentStatsVector; + js::Vector<ZoneStats, 0, js::SystemAllocPolicy> zoneStatsVector; + + ZoneStats *currZoneStats; + + JSMallocSizeOfFun mallocSizeOf_; + + virtual void initExtraCompartmentStats(JSCompartment *c, CompartmentStats *cstats) = 0; + virtual void initExtraZoneStats(JS::Zone *zone, ZoneStats *zstats) = 0; +}; + +class ObjectPrivateVisitor +{ + public: + // Within CollectRuntimeStats, this method is called for each JS object + // that has an nsISupports pointer. + virtual size_t sizeOfIncludingThis(nsISupports *aSupports) = 0; + + // A callback that gets a JSObject's nsISupports pointer, if it has one. + // Note: this function does *not* addref |iface|. + typedef JSBool(*GetISupportsFun)(JSObject *obj, nsISupports **iface); + GetISupportsFun getISupports_; + + ObjectPrivateVisitor(GetISupportsFun getISupports) + : getISupports_(getISupports) + {} +}; + +extern JS_PUBLIC_API(bool) +CollectRuntimeStats(JSRuntime *rt, RuntimeStats *rtStats, ObjectPrivateVisitor *opv); + +extern JS_PUBLIC_API(size_t) +SystemCompartmentCount(JSRuntime *rt); + +extern JS_PUBLIC_API(size_t) +UserCompartmentCount(JSRuntime *rt); + +extern JS_PUBLIC_API(size_t) +PeakSizeOfTemporary(const JSRuntime *rt); + +} // namespace JS + +#endif /* js_MemoryMetrics_h */ diff --git a/js/public/PropertyKey.h b/js/public/PropertyKey.h new file mode 100644 index 0000000..c949db1 --- /dev/null +++ b/js/public/PropertyKey.h @@ -0,0 +1,98 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* JS::PropertyKey implementation. */ + +#ifndef js_PropertyKey_h +#define js_PropertyKey_h + +#include "mozilla/Attributes.h" + +#include "js/Value.h" + +struct JSContext; + +namespace JS { + +class PropertyKey; + +namespace detail { + +extern JS_PUBLIC_API(bool) +ToPropertyKeySlow(JSContext *cx, HandleValue v, PropertyKey *key); + +} // namespace detail + +/* + * A PropertyKey is a key used to access some property on an object. It is a + * natural way to represent a property accessed using a JavaScript value. + * + * PropertyKey can represent indexes, named properties, and ES6 symbols. The + * latter aren't implemented in SpiderMonkey yet, but PropertyKey carves out + * space for them. + */ +class PropertyKey +{ + Value v; + friend JS_PUBLIC_API(bool) detail::ToPropertyKeySlow(JSContext *cx, HandleValue v, PropertyKey *key); + + public: + explicit PropertyKey(uint32_t index) : v(PrivateUint32Value(index)) {} + + /* + * An index is a string property name whose characters exactly spell out an + * unsigned 32-bit integer in decimal: "0", "1", "2", ...., "4294967294", + * "4294967295". + */ + bool isIndex(uint32_t *index) { + // The implementation here assumes that private uint32_t are stored + // using the int32_t representation. This is purely an implementation + // detail: embedders must not rely upon this! + if (!v.isInt32()) + return false; + *index = v.toPrivateUint32(); + return true; + } + + /* + * A name is a string property name which is *not* an index. Note that by + * the ECMAScript language grammar, any dotted property access |obj.prop| + * will access a named property. + */ + bool isName(JSString **str) { + uint32_t dummy; + if (isIndex(&dummy)) + return false; + *str = v.toString(); + return true; + } + + /* + * A symbol is a property name that's a Symbol, a particular kind of object + * in ES6. It is the only kind of property name that's not a string. + * + * SpiderMonkey doesn't yet implement symbols, but we're carving out API + * space for them in advance. + */ + bool isSymbol() { + return false; + } +}; + +inline bool +ToPropertyKey(JSContext *cx, HandleValue v, PropertyKey *key) +{ + if (v.isInt32() && v.toInt32() >= 0) { + *key = PropertyKey(uint32_t(v.toInt32())); + return true; + } + + return detail::ToPropertyKeySlow(cx, v, key); +} + +} // namespace JS + +#endif /* js_PropertyKey_h */ diff --git a/js/public/RequiredDefines.h b/js/public/RequiredDefines.h new file mode 100644 index 0000000..6af9ca8 --- /dev/null +++ b/js/public/RequiredDefines.h @@ -0,0 +1,23 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* + * Various #defines required to build SpiderMonkey. Embedders should add this + * file to the start of the command line via -include or a similar mechanism, + * or SpiderMonkey public headers may not work correctly. + */ + +#ifndef js_RequiredDefines_h +#define js_RequiredDefines_h + +/* + * The c99 defining the limit macros (UINT32_MAX for example), says: + * C++ implementations should define these macros only when __STDC_LIMIT_MACROS + * is defined before <stdint.h> is included. + */ +#define __STDC_LIMIT_MACROS + +#endif /* js_RequiredDefines_h */ diff --git a/js/public/RootingAPI.h b/js/public/RootingAPI.h new file mode 100644 index 0000000..89223d1 --- /dev/null +++ b/js/public/RootingAPI.h @@ -0,0 +1,957 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_RootingAPI_h +#define js_RootingAPI_h + +#include "mozilla/GuardObjects.h" +#include "mozilla/TypeTraits.h" + +#include "js/Utility.h" +#include "js/TemplateLib.h" + +#include "jspubtd.h" + +/* + * Moving GC Stack Rooting + * + * A moving GC may change the physical location of GC allocated things, even + * when they are rooted, updating all pointers to the thing to refer to its new + * location. The GC must therefore know about all live pointers to a thing, + * not just one of them, in order to behave correctly. + * + * The |Rooted| and |Handle| classes below are used to root stack locations + * whose value may be held live across a call that can trigger GC. For a + * code fragment such as: + * + * JSObject *obj = NewObject(cx); + * DoSomething(cx); + * ... = obj->lastProperty(); + * + * If |DoSomething()| can trigger a GC, the stack location of |obj| must be + * rooted to ensure that the GC does not move the JSObject referred to by + * |obj| without updating |obj|'s location itself. This rooting must happen + * regardless of whether there are other roots which ensure that the object + * itself will not be collected. + * + * If |DoSomething()| cannot trigger a GC, and the same holds for all other + * calls made between |obj|'s definitions and its last uses, then no rooting + * is required. + * + * SpiderMonkey can trigger a GC at almost any time and in ways that are not + * always clear. For example, the following innocuous-looking actions can + * cause a GC: allocation of any new GC thing; JSObject::hasProperty; + * JS_ReportError and friends; and ToNumber, among many others. The following + * dangerous-looking actions cannot trigger a GC: js_malloc, cx->malloc_, + * rt->malloc_, and friends and JS_ReportOutOfMemory. + * + * The following family of three classes will exactly root a stack location. + * Incorrect usage of these classes will result in a compile error in almost + * all cases. Therefore, it is very hard to be incorrectly rooted if you use + * these classes exclusively. These classes are all templated on the type T of + * the value being rooted. + * + * - Rooted<T> declares a variable of type T, whose value is always rooted. + * Rooted<T> may be automatically coerced to a Handle<T>, below. Rooted<T> + * should be used whenever a local variable's value may be held live across a + * call which can trigger a GC. + * + * - Handle<T> is a const reference to a Rooted<T>. Functions which take GC + * things or values as arguments and need to root those arguments should + * generally use handles for those arguments and avoid any explicit rooting. + * This has two benefits. First, when several such functions call each other + * then redundant rooting of multiple copies of the GC thing can be avoided. + * Second, if the caller does not pass a rooted value a compile error will be + * generated, which is quicker and easier to fix than when relying on a + * separate rooting analysis. + * + * - MutableHandle<T> is a non-const reference to Rooted<T>. It is used in the + * same way as Handle<T> and includes a |set(const T &v)| method to allow + * updating the value of the referenced Rooted<T>. A MutableHandle<T> can be + * created from a Rooted<T> by using |Rooted<T>::operator&()|. + * + * In some cases the small performance overhead of exact rooting (measured to + * be a few nanoseconds on desktop) is too much. In these cases, try the + * following: + * + * - Move all Rooted<T> above inner loops: this allows you to re-use the root + * on each iteration of the loop. + * + * - Pass Handle<T> through your hot call stack to avoid re-rooting costs at + * every invocation. + * + * The following diagram explains the list of supported, implicit type + * conversions between classes of this family: + * + * Rooted<T> ----> Handle<T> + * | ^ + * | | + * | | + * +---> MutableHandle<T> + * (via &) + * + * All of these types have an implicit conversion to raw pointers. + */ + +namespace js { + +class Module; +class ScriptSourceObject; + +template <typename T> +struct GCMethods {}; + +template <typename T> +class RootedBase {}; + +template <typename T> +class HandleBase {}; + +template <typename T> +class MutableHandleBase {}; + +template <typename T> +class HeapBase {}; + +/* + * js::NullPtr acts like a NULL pointer in contexts that require a Handle. + * + * Handle provides an implicit constructor for js::NullPtr so that, given: + * foo(Handle<JSObject*> h); + * callers can simply write: + * foo(js::NullPtr()); + * which avoids creating a Rooted<JSObject*> just to pass NULL. + * + * This is the SpiderMonkey internal variant. js::NullPtr should be used in + * preference to JS::NullPtr to avoid the GOT access required for JS_PUBLIC_API + * symbols. + */ +struct NullPtr +{ + static void * const constNullValue; +}; + +namespace gc { +struct Cell; +} /* namespace gc */ + +} /* namespace js */ + +namespace JS { + +template <typename T> class Rooted; + +template <typename T> class Handle; +template <typename T> class MutableHandle; + +/* This is exposing internal state of the GC for inlining purposes. */ +JS_FRIEND_API(bool) isGCEnabled(); + +#if defined(JS_DEBUG) && defined(JS_GC_ZEAL) && defined(JSGC_ROOT_ANALYSIS) && !defined(JS_THREADSAFE) +extern void +CheckStackRoots(JSContext *cx); +#endif + +/* + * JS::NullPtr acts like a NULL pointer in contexts that require a Handle. + * + * Handle provides an implicit constructor for JS::NullPtr so that, given: + * foo(Handle<JSObject*> h); + * callers can simply write: + * foo(JS::NullPtr()); + * which avoids creating a Rooted<JSObject*> just to pass NULL. + */ +struct JS_PUBLIC_API(NullPtr) +{ + static void * const constNullValue; +}; + +/* + * An encapsulated pointer class for heap based GC thing pointers. + * + * This implements post-barriers for GC thing pointers stored on the heap. It is + * designed to be used for all heap-based GC thing pointers outside the JS + * engine. + * + * The template parameter T must be a JS GC thing pointer, masked pointer or + * possible pointer, such as a JS::Value or jsid. + * + * The class must be used to declare data members of heap classes only. + * Stack-based GC thing pointers should used Rooted<T>. + * + * Write barriers are implemented by overloading the assingment operator. + * Assiging to a Heap<T> triggers the appropriate calls into the GC to notify it + * of the change. + */ +template <typename T> +class Heap : public js::HeapBase<T> +{ + public: + Heap() { + MOZ_STATIC_ASSERT(sizeof(T) == sizeof(Heap<T>), + "Heap<T> must be binary compatible with T."); + init(js::GCMethods<T>::initial()); + } + explicit Heap(T p) { init(p); } + explicit Heap(const Heap<T> &p) { init(p.ptr); } + + ~Heap() { + if (js::GCMethods<T>::needsPostBarrier(ptr)) + relocate(); + } + + bool operator!=(const T &other) const { return ptr != other; } + bool operator==(const T &other) const { return ptr == other; } + + operator T() const { return ptr; } + T operator->() const { return ptr; } + const T *address() const { return &ptr; } + const T &get() const { return ptr; } + + T *unsafeGet() { return &ptr; } + + Heap<T> &operator=(T p) { + set(p); + return *this; + } + + void set(T newPtr) { + JS_ASSERT(!js::GCMethods<T>::poisoned(newPtr)); + if (js::GCMethods<T>::needsPostBarrier(newPtr)) { + ptr = newPtr; + post(); + } else if (js::GCMethods<T>::needsPostBarrier(ptr)) { + relocate(); /* Called before overwriting ptr. */ + ptr = newPtr; + } else { + ptr = newPtr; + } + } + + private: + void init(T newPtr) { + JS_ASSERT(!js::GCMethods<T>::poisoned(newPtr)); + ptr = newPtr; + if (js::GCMethods<T>::needsPostBarrier(ptr)) + post(); + } + + void post() { +#ifdef JSGC_GENERATIONAL + JS_ASSERT(js::GCMethods<T>::needsPostBarrier(ptr)); + js::GCMethods<T>::postBarrier(&ptr); +#endif + } + + void relocate() { +#ifdef JSGC_GENERATIONAL + js::GCMethods<T>::relocate(&ptr); +#endif + } + + T ptr; +}; + +/* + * Reference to a T that has been rooted elsewhere. This is most useful + * as a parameter type, which guarantees that the T lvalue is properly + * rooted. See "Move GC Stack Rooting" above. + * + * If you want to add additional methods to Handle for a specific + * specialization, define a HandleBase<T> specialization containing them. + */ +template <typename T> +class MOZ_NONHEAP_CLASS Handle : public js::HandleBase<T> +{ + friend class MutableHandle<T>; + + public: + /* Creates a handle from a handle of a type convertible to T. */ + template <typename S> + Handle(Handle<S> handle, + typename mozilla::EnableIf<mozilla::IsConvertible<S, T>::value, int>::Type dummy = 0) + { + MOZ_STATIC_ASSERT(sizeof(Handle<T>) == sizeof(T *), + "Handle must be binary compatible with T*."); + ptr = reinterpret_cast<const T *>(handle.address()); + } + + /* Create a handle for a NULL pointer. */ + Handle(js::NullPtr) { + MOZ_STATIC_ASSERT(mozilla::IsPointer<T>::value, + "js::NullPtr overload not valid for non-pointer types"); + ptr = reinterpret_cast<const T *>(&js::NullPtr::constNullValue); + } + + /* Create a handle for a NULL pointer. */ + Handle(JS::NullPtr) { + MOZ_STATIC_ASSERT(mozilla::IsPointer<T>::value, + "JS::NullPtr overload not valid for non-pointer types"); + ptr = reinterpret_cast<const T *>(&JS::NullPtr::constNullValue); + } + + Handle(MutableHandle<T> handle) { + ptr = handle.address(); + } + + Handle(const Heap<T> &heapPtr) { + ptr = heapPtr.address(); + } + + /* + * This may be called only if the location of the T is guaranteed + * to be marked (for some reason other than being a Rooted), + * e.g., if it is guaranteed to be reachable from an implicit root. + * + * Create a Handle from a raw location of a T. + */ + static Handle fromMarkedLocation(const T *p) { + Handle h; + h.ptr = p; + return h; + } + + /* + * Construct a handle from an explicitly rooted location. This is the + * normal way to create a handle, and normally happens implicitly. + */ + template <typename S> + inline + Handle(const Rooted<S> &root, + typename mozilla::EnableIf<mozilla::IsConvertible<S, T>::value, int>::Type dummy = 0); + + /* Construct a read only handle from a mutable handle. */ + template <typename S> + inline + Handle(MutableHandle<S> &root, + typename mozilla::EnableIf<mozilla::IsConvertible<S, T>::value, int>::Type dummy = 0); + + const T *address() const { return ptr; } + const T& get() const { return *ptr; } + + /* + * Return a reference so passing a Handle<T> to something that + * takes a |const T&| is not a GC hazard. + */ + operator const T&() const { return get(); } + T operator->() const { return get(); } + + bool operator!=(const T &other) const { return *ptr != other; } + bool operator==(const T &other) const { return *ptr == other; } + + private: + Handle() {} + + const T *ptr; + + template <typename S> + void operator=(S v) MOZ_DELETE; +}; + +typedef Handle<JSObject*> HandleObject; +typedef Handle<js::Module*> HandleModule; +typedef Handle<js::ScriptSourceObject *> HandleScriptSource; +typedef Handle<JSFunction*> HandleFunction; +typedef Handle<JSScript*> HandleScript; +typedef Handle<JSString*> HandleString; +typedef Handle<jsid> HandleId; +typedef Handle<Value> HandleValue; + +/* + * Similar to a handle, but the underlying storage can be changed. This is + * useful for outparams. + * + * If you want to add additional methods to MutableHandle for a specific + * specialization, define a MutableHandleBase<T> specialization containing + * them. + */ +template <typename T> +class MOZ_STACK_CLASS MutableHandle : public js::MutableHandleBase<T> +{ + public: + inline MutableHandle(Rooted<T> *root); + + void set(T v) { + JS_ASSERT(!js::GCMethods<T>::poisoned(v)); + *ptr = v; + } + + /* + * This may be called only if the location of the T is guaranteed + * to be marked (for some reason other than being a Rooted), + * e.g., if it is guaranteed to be reachable from an implicit root. + * + * Create a MutableHandle from a raw location of a T. + */ + static MutableHandle fromMarkedLocation(T *p) { + MutableHandle h; + h.ptr = p; + return h; + } + + T *address() const { return ptr; } + T get() const { return *ptr; } + + operator T() const { return get(); } + T operator->() const { return get(); } + + private: + MutableHandle() {} + + T *ptr; + + template <typename S> + void operator=(S v) MOZ_DELETE; +}; + +typedef MutableHandle<JSObject*> MutableHandleObject; +typedef MutableHandle<JSFunction*> MutableHandleFunction; +typedef MutableHandle<JSScript*> MutableHandleScript; +typedef MutableHandle<JSString*> MutableHandleString; +typedef MutableHandle<jsid> MutableHandleId; +typedef MutableHandle<Value> MutableHandleValue; + +#ifdef JSGC_GENERATIONAL +JS_PUBLIC_API(void) HeapCellPostBarrier(js::gc::Cell **cellp); +JS_PUBLIC_API(void) HeapCellRelocate(js::gc::Cell **cellp); +#endif + +} /* namespace JS */ + +namespace js { + +/* + * InternalHandle is a handle to an internal pointer into a gcthing. Use + * InternalHandle when you have a pointer to a direct field of a gcthing, or + * when you need a parameter type for something that *may* be a pointer to a + * direct field of a gcthing. + */ +template <typename T> +class InternalHandle {}; + +template <typename T> +class InternalHandle<T*> +{ + void * const *holder; + size_t offset; + + public: + /* + * Create an InternalHandle using a Handle to the gcthing containing the + * field in question, and a pointer to the field. + */ + template<typename H> + InternalHandle(const JS::Handle<H> &handle, T *field) + : holder((void**)handle.address()), offset(uintptr_t(field) - uintptr_t(handle.get())) + {} + + /* + * Create an InternalHandle to a field within a Rooted<>. + */ + template<typename R> + InternalHandle(const JS::Rooted<R> &root, T *field) + : holder((void**)root.address()), offset(uintptr_t(field) - uintptr_t(root.get())) + {} + + T *get() const { return reinterpret_cast<T*>(uintptr_t(*holder) + offset); } + + const T &operator*() const { return *get(); } + T *operator->() const { return get(); } + + static InternalHandle<T*> fromMarkedLocation(T *fieldPtr) { + return InternalHandle(fieldPtr); + } + + private: + /* + * Create an InternalHandle to something that is not a pointer to a + * gcthing, and so does not need to be rooted in the first place. Use these + * InternalHandles to pass pointers into functions that also need to accept + * regular InternalHandles to gcthing fields. + * + * Make this private to prevent accidental misuse; this is only for + * fromMarkedLocation(). + */ + InternalHandle(T *field) + : holder(reinterpret_cast<void * const *>(&js::NullPtr::constNullValue)), + offset(uintptr_t(field)) + {} +}; + +/* + * By default, pointers should use the inheritance hierarchy to find their + * ThingRootKind. Some pointer types are explicitly set in jspubtd.h so that + * Rooted<T> may be used without the class definition being available. + */ +template <typename T> +struct RootKind<T *> +{ + static ThingRootKind rootKind() { return T::rootKind(); } +}; + +template <typename T> +struct GCMethods<T *> +{ + static T *initial() { return NULL; } + static ThingRootKind kind() { return RootKind<T *>::rootKind(); } + static bool poisoned(T *v) { return JS::IsPoisonedPtr(v); } + static bool needsPostBarrier(T *v) { return v; } +#ifdef JSGC_GENERATIONAL + static void postBarrier(T **vp) { + JS::HeapCellPostBarrier(reinterpret_cast<js::gc::Cell **>(vp)); + } + static void relocate(T **vp) { + JS::HeapCellRelocate(reinterpret_cast<js::gc::Cell **>(vp)); + } +#endif +}; + +#if defined(JS_DEBUG) && defined(JS_THREADSAFE) +/* This helper allows us to assert that Rooted<T> is scoped within a request. */ +extern JS_PUBLIC_API(bool) +IsInRequest(JSContext *cx); +#endif + +} /* namespace js */ + +namespace JS { + +/* + * Local variable of type T whose value is always rooted. This is typically + * used for local variables, or for non-rooted values being passed to a + * function that requires a handle, e.g. Foo(Root<T>(cx, x)). + * + * If you want to add additional methods to Rooted for a specific + * specialization, define a RootedBase<T> specialization containing them. + */ +template <typename T> +class MOZ_STACK_CLASS Rooted : public js::RootedBase<T> +{ + void init(JSContext *cxArg) { + MOZ_ASSERT(cxArg); +#if defined(JS_DEBUG) && defined(JS_THREADSAFE) + MOZ_ASSERT(js::IsInRequest(cxArg)); +#endif +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + js::ContextFriendFields *cx = js::ContextFriendFields::get(cxArg); + commonInit(cx->thingGCRooters); +#endif + } + + void init(js::PerThreadDataFriendFields *pt) { + MOZ_ASSERT(pt); +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + commonInit(pt->thingGCRooters); +#endif + } + + public: + Rooted(JSContext *cx + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(js::GCMethods<T>::initial()) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(cx); + } + + Rooted(JSContext *cx, T initial + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(initial) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(cx); + } + + Rooted(js::PerThreadData *pt + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(js::GCMethods<T>::initial()) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(js::PerThreadDataFriendFields::get(pt)); + } + + Rooted(js::PerThreadData *pt, T initial + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(initial) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(js::PerThreadDataFriendFields::get(pt)); + } + + Rooted(JSRuntime *rt + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(js::GCMethods<T>::initial()) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(js::PerThreadDataFriendFields::getMainThread(rt)); + } + + Rooted(JSRuntime *rt, T initial + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(initial) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + init(js::PerThreadDataFriendFields::getMainThread(rt)); + } + + ~Rooted() { +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + JS_ASSERT(*stack == reinterpret_cast<Rooted<void*>*>(this)); + *stack = prev; +#endif + } + +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + Rooted<T> *previous() { return prev; } +#endif + + /* + * Important: Return a reference here so passing a Rooted<T> to + * something that takes a |const T&| is not a GC hazard. + */ + operator const T&() const { return ptr; } + T operator->() const { return ptr; } + T *address() { return &ptr; } + const T *address() const { return &ptr; } + T &get() { return ptr; } + const T &get() const { return ptr; } + + T &operator=(T value) { + JS_ASSERT(!js::GCMethods<T>::poisoned(value)); + ptr = value; + return ptr; + } + + T &operator=(const Rooted &value) { + ptr = value; + return ptr; + } + + void set(T value) { + JS_ASSERT(!js::GCMethods<T>::poisoned(value)); + ptr = value; + } + + bool operator!=(const T &other) const { return ptr != other; } + bool operator==(const T &other) const { return ptr == other; } + + private: + void commonInit(Rooted<void*> **thingGCRooters) { +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + js::ThingRootKind kind = js::GCMethods<T>::kind(); + this->stack = &thingGCRooters[kind]; + this->prev = *stack; + *stack = reinterpret_cast<Rooted<void*>*>(this); + + JS_ASSERT(!js::GCMethods<T>::poisoned(ptr)); +#endif + } + +#if defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING) + Rooted<void*> **stack, *prev; +#endif + +#if defined(JS_DEBUG) && defined(JS_GC_ZEAL) && defined(JSGC_ROOT_ANALYSIS) && !defined(JS_THREADSAFE) + /* Has the rooting analysis ever scanned this Rooted's stack location? */ + friend void JS::CheckStackRoots(JSContext*); + bool scanned; +#endif + + /* + * |ptr| must be the last field in Rooted because the analysis treats all + * Rooted as Rooted<void*> during the analysis. See bug 829372. + */ + T ptr; + + MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER + + Rooted(const Rooted &) MOZ_DELETE; +}; + +#if !(defined(JSGC_ROOT_ANALYSIS) || defined(JSGC_USE_EXACT_ROOTING)) +// Defined in vm/String.h. +template <> +class Rooted<JSStableString *>; +#endif + +typedef Rooted<JSObject*> RootedObject; +typedef Rooted<js::Module*> RootedModule; +typedef Rooted<js::ScriptSourceObject *> RootedScriptSource; +typedef Rooted<JSFunction*> RootedFunction; +typedef Rooted<JSScript*> RootedScript; +typedef Rooted<JSString*> RootedString; +typedef Rooted<jsid> RootedId; +typedef Rooted<JS::Value> RootedValue; + +} /* namespace JS */ + +namespace js { + +/* + * Mark a stack location as a root for the rooting analysis, without actually + * rooting it in release builds. This should only be used for stack locations + * of GC things that cannot be relocated by a garbage collection, and that + * are definitely reachable via another path. + */ +class SkipRoot +{ +#if defined(JS_DEBUG) && defined(JS_GC_ZEAL) && defined(JSGC_ROOT_ANALYSIS) && !defined(JS_THREADSAFE) + + SkipRoot **stack, *prev; + const uint8_t *start; + const uint8_t *end; + + template <typename T> + void init(SkipRoot **head, const T *ptr, size_t count) { + this->stack = head; + this->prev = *stack; + *stack = this; + this->start = (const uint8_t *) ptr; + this->end = this->start + (sizeof(T) * count); + } + + public: + template <typename T> + SkipRoot(JSContext *cx, const T *ptr, size_t count = 1 + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + { + init(&ContextFriendFields::get(cx)->skipGCRooters, ptr, count); + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + + template <typename T> + SkipRoot(js::PerThreadData *ptd, const T *ptr, size_t count = 1 + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + { + PerThreadDataFriendFields *ptff = PerThreadDataFriendFields::get(ptd); + init(&ptff->skipGCRooters, ptr, count); + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + + ~SkipRoot() { + JS_ASSERT(*stack == this); + *stack = prev; + } + + SkipRoot *previous() { return prev; } + + bool contains(const uint8_t *v, size_t len) { + return v >= start && v + len <= end; + } + +#else /* JS_DEBUG && JSGC_ROOT_ANALYSIS */ + + public: + template <typename T> + SkipRoot(JSContext *cx, const T *ptr, size_t count = 1 + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + + template <typename T> + SkipRoot(PerThreadData *ptd, const T *ptr, size_t count = 1 + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + +#endif /* JS_DEBUG && JSGC_ROOT_ANALYSIS */ + + MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER +}; + +/* Interface substitute for Rooted<T> which does not root the variable's memory. */ +template <typename T> +class FakeRooted : public RootedBase<T> +{ + public: + FakeRooted(JSContext *cx + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(GCMethods<T>::initial()) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + + FakeRooted(JSContext *cx, T initial + MOZ_GUARD_OBJECT_NOTIFIER_PARAM) + : ptr(initial) + { + MOZ_GUARD_OBJECT_NOTIFIER_INIT; + } + + operator T() const { return ptr; } + T operator->() const { return ptr; } + T *address() { return &ptr; } + const T *address() const { return &ptr; } + T &get() { return ptr; } + const T &get() const { return ptr; } + + T &operator=(T value) { + JS_ASSERT(!GCMethods<T>::poisoned(value)); + ptr = value; + return ptr; + } + + bool operator!=(const T &other) const { return ptr != other; } + bool operator==(const T &other) const { return ptr == other; } + + private: + T ptr; + + MOZ_DECL_USE_GUARD_OBJECT_NOTIFIER + + FakeRooted(const FakeRooted &) MOZ_DELETE; +}; + +/* Interface substitute for MutableHandle<T> which is not required to point to rooted memory. */ +template <typename T> +class FakeMutableHandle : public js::MutableHandleBase<T> +{ + public: + FakeMutableHandle(T *t) { + ptr = t; + } + + FakeMutableHandle(FakeRooted<T> *root) { + ptr = root->address(); + } + + void set(T v) { + JS_ASSERT(!js::GCMethods<T>::poisoned(v)); + *ptr = v; + } + + T *address() const { return ptr; } + T get() const { return *ptr; } + + operator T() const { return get(); } + T operator->() const { return get(); } + + private: + FakeMutableHandle() {} + + T *ptr; + + template <typename S> + void operator=(S v) MOZ_DELETE; +}; + +/* + * Types for a variable that either should or shouldn't be rooted, depending on + * the template parameter Rooted. Used for implementing functions that can + * operate on either rooted or unrooted data. + * + * The toHandle() and toMutableHandle() functions are for calling functions + * which require handle types and are only called in the CanGC case. These + * allow the calling code to type check. + */ +enum AllowGC { + NoGC = 0, + CanGC = 1 +}; +template <typename T, AllowGC allowGC> +class MaybeRooted +{ +}; + +template <typename T> class MaybeRooted<T, CanGC> +{ + public: + typedef JS::Handle<T> HandleType; + typedef JS::Rooted<T> RootType; + typedef JS::MutableHandle<T> MutableHandleType; + + static inline JS::Handle<T> toHandle(HandleType v) { + return v; + } + + static inline JS::MutableHandle<T> toMutableHandle(MutableHandleType v) { + return v; + } +}; + +template <typename T> class MaybeRooted<T, NoGC> +{ + public: + typedef T HandleType; + typedef FakeRooted<T> RootType; + typedef FakeMutableHandle<T> MutableHandleType; + + static inline JS::Handle<T> toHandle(HandleType v) { + JS_NOT_REACHED("Bad conversion"); + return JS::Handle<T>::fromMarkedLocation(NULL); + } + + static inline JS::MutableHandle<T> toMutableHandle(MutableHandleType v) { + JS_NOT_REACHED("Bad conversion"); + return JS::MutableHandle<T>::fromMarkedLocation(NULL); + } +}; + +} /* namespace js */ + +namespace JS { + +template <typename T> template <typename S> +inline +Handle<T>::Handle(const Rooted<S> &root, + typename mozilla::EnableIf<mozilla::IsConvertible<S, T>::value, int>::Type dummy) +{ + ptr = reinterpret_cast<const T *>(root.address()); +} + +template <typename T> template <typename S> +inline +Handle<T>::Handle(MutableHandle<S> &root, + typename mozilla::EnableIf<mozilla::IsConvertible<S, T>::value, int>::Type dummy) +{ + ptr = reinterpret_cast<const T *>(root.address()); +} + +template <typename T> +inline +MutableHandle<T>::MutableHandle(Rooted<T> *root) +{ + MOZ_STATIC_ASSERT(sizeof(MutableHandle<T>) == sizeof(T *), + "MutableHandle must be binary compatible with T*."); + ptr = root->address(); +} + +} /* namespace JS */ + +namespace js { + +/* + * Hook for dynamic root analysis. Checks the native stack and poisons + * references to GC things which have not been rooted. + */ +inline void MaybeCheckStackRoots(JSContext *cx) +{ +#if defined(JS_DEBUG) && defined(JS_GC_ZEAL) && defined(JSGC_ROOT_ANALYSIS) && !defined(JS_THREADSAFE) + JS::CheckStackRoots(cx); +#endif +} + +/* Base class for automatic read-only object rooting during compilation. */ +class CompilerRootNode +{ + protected: + CompilerRootNode(js::gc::Cell *ptr) : next(NULL), ptr_(ptr) {} + + public: + void **address() { return (void **)&ptr_; } + + public: + CompilerRootNode *next; + + protected: + js::gc::Cell *ptr_; +}; + +} /* namespace js */ + +#endif /* js_RootingAPI_h */ diff --git a/js/public/TemplateLib.h b/js/public/TemplateLib.h new file mode 100644 index 0000000..711158f --- /dev/null +++ b/js/public/TemplateLib.h @@ -0,0 +1,117 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_TemplateLib_h +#define js_TemplateLib_h + +#include "jstypes.h" + +/* + * Library of reusable template meta-functions (that is, functions on types and + * compile-time values). Meta-functions are placed inside the 'tl' namespace to + * avoid conflict with non-meta functions that logically have the same name + * (e.g., js::tl::Min vs. js::Min). + */ + +namespace js { +namespace tl { + +/* Compute min/max/clamp. */ +template <size_t i, size_t j> struct Min { + static const size_t result = i < j ? i : j; +}; +template <size_t i, size_t j> struct Max { + static const size_t result = i > j ? i : j; +}; +template <size_t i, size_t min, size_t max> struct Clamp { + static const size_t result = i < min ? min : (i > max ? max : i); +}; + +/* Compute x^y. */ +template <size_t x, size_t y> struct Pow { + static const size_t result = x * Pow<x, y - 1>::result; +}; +template <size_t x> struct Pow<x,0> { + static const size_t result = 1; +}; + +/* Compute floor(log2(i)). */ +template <size_t i> struct FloorLog2 { + static const size_t result = 1 + FloorLog2<i / 2>::result; +}; +template <> struct FloorLog2<0> { /* Error */ }; +template <> struct FloorLog2<1> { static const size_t result = 0; }; + +/* Compute ceiling(log2(i)). */ +template <size_t i> struct CeilingLog2 { + static const size_t result = FloorLog2<2 * i - 1>::result; +}; + +/* Round up to the nearest power of 2. */ +template <size_t i> struct RoundUpPow2 { + static const size_t result = size_t(1) << CeilingLog2<i>::result; +}; +template <> struct RoundUpPow2<0> { + static const size_t result = 1; +}; + +/* Compute the number of bits in the given unsigned type. */ +template <class T> struct BitSize { + static const size_t result = sizeof(T) * JS_BITS_PER_BYTE; +}; + +/* + * Produce an N-bit mask, where N <= BitSize<size_t>::result. Handle the + * language-undefined edge case when N = BitSize<size_t>::result. + */ +template <size_t N> struct NBitMask { + // Assert the precondition. On success this evaluates to 0. Otherwise it + // triggers divide-by-zero at compile time: a guaranteed compile error in + // C++11, and usually one in C++98. Add this value to |result| to assure + // its computation. + static const size_t checkPrecondition = 0 / size_t(N < BitSize<size_t>::result); + static const size_t result = (size_t(1) << N) - 1 + checkPrecondition; +}; +template <> struct NBitMask<BitSize<size_t>::result> { + static const size_t result = size_t(-1); +}; + +/* + * For the unsigned integral type size_t, compute a mask M for N such that + * for all X, !(X & M) implies X * N will not overflow (w.r.t size_t) + */ +template <size_t N> struct MulOverflowMask { + static const size_t result = + ~NBitMask<BitSize<size_t>::result - CeilingLog2<N>::result>::result; +}; +template <> struct MulOverflowMask<0> { /* Error */ }; +template <> struct MulOverflowMask<1> { static const size_t result = 0; }; + +/* + * Generate a mask for T such that if (X & sUnsafeRangeSizeMask), an X-sized + * array of T's is big enough to cause a ptrdiff_t overflow when subtracting + * a pointer to the end of the array from the beginning. + */ +template <class T> struct UnsafeRangeSizeMask { + /* + * The '2' factor means the top bit is clear, sizeof(T) converts from + * units of elements to bytes. + */ + static const size_t result = MulOverflowMask<2 * sizeof(T)>::result; +}; + +template <bool cond, typename T, T v1, T v2> struct If { static const T result = v1; }; +template <typename T, T v1, T v2> struct If<false, T, v1, v2> { static const T result = v2; }; + +/* + * Traits class for identifying types that are implicitly barriered. + */ +template <class T> struct IsRelocatableHeapType { static const bool result = true; }; + +} /* namespace tl */ +} /* namespace js */ + +#endif /* js_TemplateLib_h */ diff --git a/js/public/Utility.h b/js/public/Utility.h new file mode 100644 index 0000000..ae50a2a --- /dev/null +++ b/js/public/Utility.h @@ -0,0 +1,871 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_Utility_h +#define js_Utility_h + +#include "mozilla/Assertions.h" +#include "mozilla/Attributes.h" +#include "mozilla/Compiler.h" +#include "mozilla/Scoped.h" + +#include <stdlib.h> +#include <string.h> + +#ifdef JS_OOM_DO_BACKTRACES +#include <stdio.h> +#include <execinfo.h> +#endif + +#include "jstypes.h" + +#include "js/TemplateLib.h" + +/* The public JS engine namespace. */ +namespace JS {} + +/* The mozilla-shared reusable template/utility namespace. */ +namespace mozilla {} + +/* The private JS engine namespace. */ +namespace js {} + +/* + * Pattern used to overwrite freed memory. If you are accessing an object with + * this pattern, you probably have a dangling pointer. + */ +#define JS_FREE_PATTERN 0xDA + +#define JS_ASSERT(expr) MOZ_ASSERT(expr) +#define JS_ASSERT_IF(cond, expr) MOZ_ASSERT_IF(cond, expr) +#define JS_NOT_REACHED(reason) MOZ_NOT_REACHED(reason) +#define JS_ALWAYS_TRUE(expr) MOZ_ALWAYS_TRUE(expr) +#define JS_ALWAYS_FALSE(expr) MOZ_ALWAYS_FALSE(expr) + +#ifdef JS_DEBUG +# ifdef JS_THREADSAFE +# define JS_THREADSAFE_ASSERT(expr) JS_ASSERT(expr) +# else +# define JS_THREADSAFE_ASSERT(expr) ((void) 0) +# endif +#else +# define JS_THREADSAFE_ASSERT(expr) ((void) 0) +#endif + +#if defined(JS_DEBUG) +# define JS_DIAGNOSTICS_ASSERT(expr) MOZ_ASSERT(expr) +#elif defined(JS_CRASH_DIAGNOSTICS) +# define JS_DIAGNOSTICS_ASSERT(expr) do { if (!(expr)) MOZ_CRASH(); } while(0) +#else +# define JS_DIAGNOSTICS_ASSERT(expr) ((void) 0) +#endif + +#define JS_STATIC_ASSERT(cond) MOZ_STATIC_ASSERT(cond, "JS_STATIC_ASSERT") +#define JS_STATIC_ASSERT_IF(cond, expr) MOZ_STATIC_ASSERT_IF(cond, expr, "JS_STATIC_ASSERT_IF") + +extern MOZ_NORETURN JS_PUBLIC_API(void) +JS_Assert(const char *s, const char *file, int ln); + +/* + * Abort the process in a non-graceful manner. This will cause a core file, + * call to the debugger or other moral equivalent as well as causing the + * entire process to stop. + */ +extern JS_PUBLIC_API(void) JS_Abort(void); + +/* + * Custom allocator support for SpiderMonkey + */ +#if defined JS_USE_CUSTOM_ALLOCATOR +# include "jscustomallocator.h" +#else +# ifdef JS_DEBUG +/* + * In order to test OOM conditions, when the testing function + * oomAfterAllocations COUNT is passed, we fail continuously after the NUM'th + * allocation from now. + */ +extern JS_PUBLIC_DATA(uint32_t) OOM_maxAllocations; /* set in builtins/TestingFunctions.cpp */ +extern JS_PUBLIC_DATA(uint32_t) OOM_counter; /* data race, who cares. */ + +#ifdef JS_OOM_DO_BACKTRACES +#define JS_OOM_BACKTRACE_SIZE 32 +static JS_ALWAYS_INLINE void +PrintBacktrace() +{ + void* OOM_trace[JS_OOM_BACKTRACE_SIZE]; + char** OOM_traceSymbols = NULL; + int32_t OOM_traceSize = 0; + int32_t OOM_traceIdx = 0; + OOM_traceSize = backtrace(OOM_trace, JS_OOM_BACKTRACE_SIZE); + OOM_traceSymbols = backtrace_symbols(OOM_trace, OOM_traceSize); + + if (!OOM_traceSymbols) + return; + + for (OOM_traceIdx = 0; OOM_traceIdx < OOM_traceSize; ++OOM_traceIdx) { + fprintf(stderr, "#%d %s\n", OOM_traceIdx, OOM_traceSymbols[OOM_traceIdx]); + } + + // This must be free(), not js_free(), because backtrace_symbols() + // allocates with malloc(). + free(OOM_traceSymbols); +} + +#define JS_OOM_EMIT_BACKTRACE() \ + do {\ + fprintf(stderr, "Forcing artificial memory allocation function failure:\n");\ + PrintBacktrace();\ + } while (0) +# else +# define JS_OOM_EMIT_BACKTRACE() do {} while(0) +#endif /* JS_OOM_DO_BACKTRACES */ + +# define JS_OOM_POSSIBLY_FAIL() \ + do \ + { \ + if (++OOM_counter > OOM_maxAllocations) { \ + JS_OOM_EMIT_BACKTRACE();\ + return NULL; \ + } \ + } while (0) + +# define JS_OOM_POSSIBLY_FAIL_REPORT(cx) \ + do \ + { \ + if (++OOM_counter > OOM_maxAllocations) { \ + JS_OOM_EMIT_BACKTRACE();\ + js_ReportOutOfMemory(cx);\ + return NULL; \ + } \ + } while (0) + +# else +# define JS_OOM_POSSIBLY_FAIL() do {} while(0) +# define JS_OOM_POSSIBLY_FAIL_REPORT(cx) do {} while(0) +# endif /* JS_DEBUG */ + +static JS_INLINE void* js_malloc(size_t bytes) +{ + JS_OOM_POSSIBLY_FAIL(); + return malloc(bytes); +} + +static JS_INLINE void* js_calloc(size_t bytes) +{ + JS_OOM_POSSIBLY_FAIL(); + return calloc(bytes, 1); +} + +static JS_INLINE void* js_calloc(size_t nmemb, size_t size) +{ + JS_OOM_POSSIBLY_FAIL(); + return calloc(nmemb, size); +} + +static JS_INLINE void* js_realloc(void* p, size_t bytes) +{ + JS_OOM_POSSIBLY_FAIL(); + return realloc(p, bytes); +} + +static JS_INLINE void js_free(void* p) +{ + free(p); +} +#endif/* JS_USE_CUSTOM_ALLOCATOR */ + +JS_BEGIN_EXTERN_C + +/* + * Replace bit-scanning code sequences with CPU-specific instructions to + * speedup calculations of ceiling/floor log2. + * + * With GCC 3.4 or later we can use __builtin_clz for that, see bug 327129. + * + * SWS: Added MSVC intrinsic bitscan support. See bugs 349364 and 356856. + */ +#if defined(_WIN32) && (_MSC_VER >= 1300) && (defined(_M_IX86) || defined(_M_AMD64) || defined(_M_X64)) + +unsigned char _BitScanForward(unsigned long * Index, unsigned long Mask); +unsigned char _BitScanReverse(unsigned long * Index, unsigned long Mask); +# pragma intrinsic(_BitScanForward,_BitScanReverse) + +__forceinline static int +__BitScanForward32(unsigned int val) +{ + unsigned long idx; + + _BitScanForward(&idx, (unsigned long)val); + return (int)idx; +} +__forceinline static int +__BitScanReverse32(unsigned int val) +{ + unsigned long idx; + + _BitScanReverse(&idx, (unsigned long)val); + return (int)(31-idx); +} +# define js_bitscan_ctz32(val) __BitScanForward32(val) +# define js_bitscan_clz32(val) __BitScanReverse32(val) + +#if defined(_M_AMD64) || defined(_M_X64) +unsigned char _BitScanForward64(unsigned long * Index, unsigned __int64 Mask); +unsigned char _BitScanReverse64(unsigned long * Index, unsigned __int64 Mask); +# pragma intrinsic(_BitScanForward64,_BitScanReverse64) +#endif + +__forceinline static int +__BitScanForward64(unsigned __int64 val) +{ +#if defined(_M_AMD64) || defined(_M_X64) + unsigned long idx; + + _BitScanForward64(&idx, val); + return (int)idx; +#else + uint32_t lo = (uint32_t)val; + uint32_t hi = (uint32_t)(val >> 32); + return lo != 0 ? + js_bitscan_ctz32(lo) : + 32 + js_bitscan_ctz32(hi); +#endif +} +__forceinline static int +__BitScanReverse64(unsigned __int64 val) +{ +#if defined(_M_AMD64) || defined(_M_X64) + unsigned long idx; + + _BitScanReverse64(&idx, val); + return (int)(63-idx); +#else + uint32_t lo = (uint32_t)val; + uint32_t hi = (uint32_t)(val >> 32); + return hi != 0 ? + js_bitscan_clz32(hi) : + 32 + js_bitscan_clz32(lo); +#endif +} +# define js_bitscan_ctz64(val) __BitScanForward64(val) +# define js_bitscan_clz64(val) __BitScanReverse64(val) +#elif MOZ_IS_GCC + +#if MOZ_GCC_VERSION_AT_LEAST(3, 4, 0) +# define USE_BUILTIN_CTZ +#endif + +#elif defined(__clang__) + +#if __has_builtin(__builtin_ctz) +# define USE_BUILTIN_CTZ +#endif + +#endif + +#if defined(USE_BUILTIN_CTZ) + +JS_STATIC_ASSERT(sizeof(unsigned int) == sizeof(uint32_t)); +# define js_bitscan_ctz32(val) __builtin_ctz(val) +# define js_bitscan_clz32(val) __builtin_clz(val) + +JS_STATIC_ASSERT(sizeof(unsigned long long) == sizeof(uint64_t)); +# define js_bitscan_ctz64(val) __builtin_ctzll(val) +# define js_bitscan_clz64(val) __builtin_clzll(val) + +# undef USE_BUILTIN_CTZ + +#endif + +/* +** Macro version of JS_CeilingLog2: Compute the log of the least power of +** 2 greater than or equal to _n. The result is returned in _log2. +*/ +/* + * Use intrinsic function or count-leading-zeros to calculate ceil(log2(_n)). + * The macro checks for "n <= 1" and not "n != 0" as js_bitscan_clz32(0) is + * undefined. + */ +# define JS_CEILING_LOG2(_log2,_n) \ + JS_BEGIN_MACRO \ + unsigned int j_ = (unsigned int)(_n); \ + (_log2) = (j_ <= 1 ? 0 : 32 - js_bitscan_clz32(j_ - 1)); \ + JS_END_MACRO + +/* +** Macro version of JS_FloorLog2: Compute the log of the greatest power of +** 2 less than or equal to _n. The result is returned in _log2. +** +** This is equivalent to finding the highest set bit in the word. +*/ +/* + * Use js_bitscan_clz32 or count-leading-zeros to calculate floor(log2(_n)). + * Since js_bitscan_clz32(0) is undefined, the macro set the loweset bit to 1 + * to ensure 0 result when _n == 0. + */ +# define JS_FLOOR_LOG2(_log2,_n) \ + JS_BEGIN_MACRO \ + (_log2) = 31 - js_bitscan_clz32(((unsigned int)(_n)) | 1); \ + JS_END_MACRO + +#if JS_BYTES_PER_WORD == 4 +# define js_FloorLog2wImpl(n) \ + ((size_t)(JS_BITS_PER_WORD - 1 - js_bitscan_clz32(n))) +#elif JS_BYTES_PER_WORD == 8 +# define js_FloorLog2wImpl(n) \ + ((size_t)(JS_BITS_PER_WORD - 1 - js_bitscan_clz64(n))) +#else +# error "NOT SUPPORTED" +#endif + +JS_END_EXTERN_C + +/* + * Internal function. + * Compute the log of the least power of 2 greater than or equal to n. This is + * a version of JS_CeilingLog2 that operates on unsigned integers with + * CPU-dependant size. + */ +#define JS_CEILING_LOG2W(n) ((n) <= 1 ? 0 : 1 + JS_FLOOR_LOG2W((n) - 1)) + +/* + * Internal function. + * Compute the log of the greatest power of 2 less than or equal to n. + * This is a version of JS_FloorLog2 that operates on unsigned integers with + * CPU-dependant size and requires that n != 0. + */ +static MOZ_ALWAYS_INLINE size_t +JS_FLOOR_LOG2W(size_t n) +{ + JS_ASSERT(n != 0); + return js_FloorLog2wImpl(n); +} + +/* + * JS_ROTATE_LEFT32 + * + * There is no rotate operation in the C Language so the construct (a << 4) | + * (a >> 28) is used instead. Most compilers convert this to a rotate + * instruction but some versions of MSVC don't without a little help. To get + * MSVC to generate a rotate instruction, we have to use the _rotl intrinsic + * and use a pragma to make _rotl inline. + * + * MSVC in VS2005 will do an inline rotate instruction on the above construct. + */ +#if defined(_MSC_VER) && (defined(_M_IX86) || defined(_M_AMD64) || \ + defined(_M_X64)) +#include <stdlib.h> +#pragma intrinsic(_rotl) +#define JS_ROTATE_LEFT32(a, bits) _rotl(a, bits) +#else +#define JS_ROTATE_LEFT32(a, bits) (((a) << (bits)) | ((a) >> (32 - (bits)))) +#endif + +#include <new> + +/* + * Low-level memory management in SpiderMonkey: + * + * ** Do not use the standard malloc/free/realloc: SpiderMonkey allows these + * to be redefined (via JS_USE_CUSTOM_ALLOCATOR) and Gecko even #define's + * these symbols. + * + * ** Do not use the builtin C++ operator new and delete: these throw on + * error and we cannot override them not to. + * + * Allocation: + * + * - If the lifetime of the allocation is tied to the lifetime of a GC-thing + * (that is, finalizing the GC-thing will free the allocation), call one of + * the following functions: + * + * JSContext::{malloc_,realloc_,calloc_,new_} + * JSRuntime::{malloc_,realloc_,calloc_,new_} + * + * These functions accumulate the number of bytes allocated which is used as + * part of the GC-triggering heuristic. + * + * The difference between the JSContext and JSRuntime versions is that the + * cx version reports an out-of-memory error on OOM. (This follows from the + * general SpiderMonkey idiom that a JSContext-taking function reports its + * own errors.) + * + * - Otherwise, use js_malloc/js_realloc/js_calloc/js_free/js_new + * + * Deallocation: + * + * - Ordinarily, use js_free/js_delete. + * + * - For deallocations during GC finalization, use one of the following + * operations on the FreeOp provided to the finalizer: + * + * FreeOp::{free_,delete_} + * + * The advantage of these operations is that the memory is batched and freed + * on another thread. + */ + +#define JS_NEW_BODY(allocator, t, parms) \ + void *memory = allocator(sizeof(t)); \ + return memory ? new(memory) t parms : NULL; + +/* + * Given a class which should provide 'new' methods, add + * JS_DECLARE_NEW_METHODS (see JSContext for a usage example). This + * adds news with up to 12 parameters. Add more versions of new below if + * you need more than 12 parameters. + * + * Note: Do not add a ; at the end of a use of JS_DECLARE_NEW_METHODS, + * or the build will break. + */ +#define JS_DECLARE_NEW_METHODS(NEWNAME, ALLOCATOR, QUALIFIERS)\ + template <class T>\ + QUALIFIERS T *NEWNAME() {\ + JS_NEW_BODY(ALLOCATOR, T, ())\ + }\ +\ + template <class T, class P1>\ + QUALIFIERS T *NEWNAME(P1 p1) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1))\ + }\ +\ + template <class T, class P1, class P2>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2))\ + }\ +\ + template <class T, class P1, class P2, class P3>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7, class P8>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7, P8 p8) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7, p8))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7, class P8, class P9>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7, P8 p8, P9 p9) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7, p8, p9))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7, class P8, class P9, class P10>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7, P8 p8, P9 p9, P10 p10) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7, p8, p9, p10))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7, class P8, class P9, class P10, class P11>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7, P8 p8, P9 p9, P10 p10, P11 p11) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7, p8, p9, p10, p11))\ + }\ +\ + template <class T, class P1, class P2, class P3, class P4, class P5, class P6, class P7, class P8, class P9, class P10, class P11, class P12>\ + QUALIFIERS T *NEWNAME(P1 p1, P2 p2, P3 p3, P4 p4, P5 p5, P6 p6, P7 p7, P8 p8, P9 p9, P10 p10, P11 p11, P12 p12) {\ + JS_NEW_BODY(ALLOCATOR, T, (p1, p2, p3, p4, p5, p6, p7, p8, p9, p10, p11, p12))\ + }\ + +JS_DECLARE_NEW_METHODS(js_new, js_malloc, static JS_ALWAYS_INLINE) + +template <class T> +static JS_ALWAYS_INLINE void +js_delete(T *p) +{ + if (p) { + p->~T(); + js_free(p); + } +} + +template<class T> +static JS_ALWAYS_INLINE void +js_delete_poison(T *p) +{ + if (p) { + p->~T(); + memset(p, 0x3B, sizeof(T)); + js_free(p); + } +} + +template <class T> +static JS_ALWAYS_INLINE T * +js_pod_malloc() +{ + return (T *)js_malloc(sizeof(T)); +} + +template <class T> +static JS_ALWAYS_INLINE T * +js_pod_calloc() +{ + return (T *)js_calloc(sizeof(T)); +} + +template <class T> +static JS_ALWAYS_INLINE T * +js_pod_malloc(size_t numElems) +{ + if (numElems & js::tl::MulOverflowMask<sizeof(T)>::result) + return NULL; + return (T *)js_malloc(numElems * sizeof(T)); +} + +template <class T> +static JS_ALWAYS_INLINE T * +js_pod_calloc(size_t numElems) +{ + if (numElems & js::tl::MulOverflowMask<sizeof(T)>::result) + return NULL; + return (T *)js_calloc(numElems * sizeof(T)); +} + +namespace js { + +template<typename T> +struct ScopedFreePtrTraits +{ + typedef T* type; + static T* empty() { return NULL; } + static void release(T* ptr) { js_free(ptr); } +}; +SCOPED_TEMPLATE(ScopedJSFreePtr, ScopedFreePtrTraits) + +template <typename T> +struct ScopedDeletePtrTraits : public ScopedFreePtrTraits<T> +{ + static void release(T *ptr) { js_delete(ptr); } +}; +SCOPED_TEMPLATE(ScopedJSDeletePtr, ScopedDeletePtrTraits) + +template <typename T> +struct ScopedReleasePtrTraits : public ScopedFreePtrTraits<T> +{ + static void release(T *ptr) { if (ptr) ptr->release(); } +}; +SCOPED_TEMPLATE(ScopedReleasePtr, ScopedReleasePtrTraits) + +} /* namespace js */ + +namespace js { + +/* + * "Move" References + * + * Some types can be copied much more efficiently if we know the original's + * value need not be preserved --- that is, if we are doing a "move", not a + * "copy". For example, if we have: + * + * Vector<T> u; + * Vector<T> v(u); + * + * the constructor for v must apply a copy constructor to each element of u --- + * taking time linear in the length of u. However, if we know we will not need u + * any more once v has been initialized, then we could initialize v very + * efficiently simply by stealing u's dynamically allocated buffer and giving it + * to v --- a constant-time operation, regardless of the size of u. + * + * Moves often appear in container implementations. For example, when we append + * to a vector, we may need to resize its buffer. This entails moving each of + * its extant elements from the old, smaller buffer to the new, larger buffer. + * But once the elements have been migrated, we're just going to throw away the + * old buffer; we don't care if they still have their values. So if the vector's + * element type can implement "move" more efficiently than "copy", the vector + * resizing should by all means use a "move" operation. Hash tables also need to + * be resized. + * + * The details of the optimization, and whether it's worth applying, vary from + * one type to the next. And while some constructor calls are moves, many really + * are copies, and can't be optimized this way. So we need: + * + * 1) a way for a particular invocation of a copy constructor to say that it's + * really a move, and that the value of the original isn't important + * afterwards (althought it must still be safe to destroy); and + * + * 2) a way for a type (like Vector) to announce that it can be moved more + * efficiently than it can be copied, and provide an implementation of that + * move operation. + * + * The Move(T &) function takes a reference to a T, and returns an MoveRef<T> + * referring to the same value; that's 1). An MoveRef<T> is simply a reference + * to a T, annotated to say that a copy constructor applied to it may move that + * T, instead of copying it. Finally, a constructor that accepts an MoveRef<T> + * should perform a more efficient move, instead of a copy, providing 2). + * + * So, where we might define a copy constructor for a class C like this: + * + * C(const C &rhs) { ... copy rhs to this ... } + * + * we would declare a move constructor like this: + * + * C(MoveRef<C> rhs) { ... move rhs to this ... } + * + * And where we might perform a copy like this: + * + * C c2(c1); + * + * we would perform a move like this: + * + * C c2(Move(c1)) + * + * Note that MoveRef<T> implicitly converts to T &, so you can pass an + * MoveRef<T> to an ordinary copy constructor for a type that doesn't support a + * special move constructor, and you'll just get a copy. This means that + * templates can use Move whenever they know they won't use the original value + * any more, even if they're not sure whether the type at hand has a specialized + * move constructor. If it doesn't, the MoveRef<T> will just convert to a T &, + * and the ordinary copy constructor will apply. + * + * A class with a move constructor can also provide a move assignment operator, + * which runs this's destructor, and then applies the move constructor to + * *this's memory. A typical definition: + * + * C &operator=(MoveRef<C> rhs) { + * this->~C(); + * new(this) C(rhs); + * return *this; + * } + * + * With that in place, one can write move assignments like this: + * + * c2 = Move(c1); + * + * This destroys c1, moves c1's value to c2, and leaves c1 in an undefined but + * destructible state. + * + * This header file defines MoveRef and Move in the js namespace. It's up to + * individual containers to annotate moves as such, by calling Move; and it's up + * to individual types to define move constructors. + * + * One hint: if you're writing a move constructor where the type has members + * that should be moved themselves, it's much nicer to write this: + * + * C(MoveRef<C> c) : x(c->x), y(c->y) { } + * + * than the equivalent: + * + * C(MoveRef<C> c) { new(&x) X(c->x); new(&y) Y(c->y); } + * + * especially since GNU C++ fails to notice that this does indeed initialize x + * and y, which may matter if they're const. + */ +template<typename T> +class MoveRef { + public: + typedef T Referent; + explicit MoveRef(T &t) : pointer(&t) { } + T &operator*() const { return *pointer; } + T *operator->() const { return pointer; } + operator T& () const { return *pointer; } + private: + T *pointer; +}; + +template<typename T> +MoveRef<T> Move(T &t) { return MoveRef<T>(t); } + +template<typename T> +MoveRef<T> Move(const T &t) { return MoveRef<T>(const_cast<T &>(t)); } + +/* Useful for implementing containers that assert non-reentrancy */ +class ReentrancyGuard +{ + /* ReentrancyGuard is not copyable. */ + ReentrancyGuard(const ReentrancyGuard &); + void operator=(const ReentrancyGuard &); + +#ifdef JS_DEBUG + bool &entered; +#endif + public: + template <class T> +#ifdef JS_DEBUG + ReentrancyGuard(T &obj) + : entered(obj.entered) +#else + ReentrancyGuard(T &/*obj*/) +#endif + { +#ifdef JS_DEBUG + JS_ASSERT(!entered); + entered = true; +#endif + } + ~ReentrancyGuard() + { +#ifdef JS_DEBUG + entered = false; +#endif + } +}; + +template <class T> +JS_ALWAYS_INLINE static void +Swap(T &t, T &u) +{ + T tmp(Move(t)); + t = Move(u); + u = Move(tmp); +} + +/* + * Round x up to the nearest power of 2. This function assumes that the most + * significant bit of x is not set, which would lead to overflow. + */ +JS_ALWAYS_INLINE size_t +RoundUpPow2(size_t x) +{ + return size_t(1) << JS_CEILING_LOG2W(x); +} + +/* Integral types for all hash functions. */ +typedef uint32_t HashNumber; +const unsigned HashNumberSizeBits = 32; + +namespace detail { + +/* + * Given a raw hash code, h, return a number that can be used to select a hash + * bucket. + * + * This function aims to produce as uniform an output distribution as possible, + * especially in the most significant (leftmost) bits, even though the input + * distribution may be highly nonrandom, given the constraints that this must + * be deterministic and quick to compute. + * + * Since the leftmost bits of the result are best, the hash bucket index is + * computed by doing ScrambleHashCode(h) / (2^32/N) or the equivalent + * right-shift, not ScrambleHashCode(h) % N or the equivalent bit-mask. + * + * FIXME: OrderedHashTable uses a bit-mask; see bug 775896. + */ +inline HashNumber +ScrambleHashCode(HashNumber h) +{ + /* + * Simply returning h would not cause any hash tables to produce wrong + * answers. But it can produce pathologically bad performance: The caller + * right-shifts the result, keeping only the highest bits. The high bits of + * hash codes are very often completely entropy-free. (So are the lowest + * bits.) + * + * So we use Fibonacci hashing, as described in Knuth, The Art of Computer + * Programming, 6.4. This mixes all the bits of the input hash code h. + * + * The value of goldenRatio is taken from the hex + * expansion of the golden ratio, which starts 1.9E3779B9.... + * This value is especially good if values with consecutive hash codes + * are stored in a hash table; see Knuth for details. + */ + static const HashNumber goldenRatio = 0x9E3779B9U; + return h * goldenRatio; +} + +} /* namespace detail */ + +} /* namespace js */ + +namespace JS { + +/* + * Methods for poisoning GC heap pointer words and checking for poisoned words. + * These are in this file for use in Value methods and so forth. + * + * If the moving GC hazard analysis is in use and detects a non-rooted stack + * pointer to a GC thing, one byte of that pointer is poisoned to refer to an + * invalid location. For both 32 bit and 64 bit systems, the fourth byte of the + * pointer is overwritten, to reduce the likelihood of accidentally changing + * a live integer value. + */ + +inline void PoisonPtr(void *v) +{ +#if defined(JSGC_ROOT_ANALYSIS) && defined(JS_DEBUG) + uint8_t *ptr = (uint8_t *) v + 3; + *ptr = JS_FREE_PATTERN; +#endif +} + +template <typename T> +inline bool IsPoisonedPtr(T *v) +{ +#if defined(JSGC_ROOT_ANALYSIS) && defined(JS_DEBUG) + uint32_t mask = uintptr_t(v) & 0xff000000; + return mask == uint32_t(JS_FREE_PATTERN << 24); +#else + return false; +#endif +} + +} + +/* + * This is SpiderMonkey's equivalent to |nsMallocSizeOfFun|. + */ +typedef size_t(*JSMallocSizeOfFun)(const void *p); + +/* sixgill annotation defines */ +#ifndef HAVE_STATIC_ANNOTATIONS +# define HAVE_STATIC_ANNOTATIONS +# ifdef XGILL_PLUGIN +# define STATIC_PRECONDITION(COND) __attribute__((precondition(#COND))) +# define STATIC_PRECONDITION_ASSUME(COND) __attribute__((precondition_assume(#COND))) +# define STATIC_POSTCONDITION(COND) __attribute__((postcondition(#COND))) +# define STATIC_POSTCONDITION_ASSUME(COND) __attribute__((postcondition_assume(#COND))) +# define STATIC_INVARIANT(COND) __attribute__((invariant(#COND))) +# define STATIC_INVARIANT_ASSUME(COND) __attribute__((invariant_assume(#COND))) +# define STATIC_PASTE2(X,Y) X ## Y +# define STATIC_PASTE1(X,Y) STATIC_PASTE2(X,Y) +# define STATIC_ASSERT(COND) \ + JS_BEGIN_MACRO \ + __attribute__((assert_static(#COND), unused)) \ + int STATIC_PASTE1(assert_static_, __COUNTER__); \ + JS_END_MACRO +# define STATIC_ASSUME(COND) \ + JS_BEGIN_MACRO \ + __attribute__((assume_static(#COND), unused)) \ + int STATIC_PASTE1(assume_static_, __COUNTER__); \ + JS_END_MACRO +# define STATIC_ASSERT_RUNTIME(COND) \ + JS_BEGIN_MACRO \ + __attribute__((assert_static_runtime(#COND), unused)) \ + int STATIC_PASTE1(assert_static_runtime_, __COUNTER__); \ + JS_END_MACRO +# else /* XGILL_PLUGIN */ +# define STATIC_PRECONDITION(COND) /* nothing */ +# define STATIC_PRECONDITION_ASSUME(COND) /* nothing */ +# define STATIC_POSTCONDITION(COND) /* nothing */ +# define STATIC_POSTCONDITION_ASSUME(COND) /* nothing */ +# define STATIC_INVARIANT(COND) /* nothing */ +# define STATIC_INVARIANT_ASSUME(COND) /* nothing */ +# define STATIC_ASSERT(COND) JS_BEGIN_MACRO /* nothing */ JS_END_MACRO +# define STATIC_ASSUME(COND) JS_BEGIN_MACRO /* nothing */ JS_END_MACRO +# define STATIC_ASSERT_RUNTIME(COND) JS_BEGIN_MACRO /* nothing */ JS_END_MACRO +# endif /* XGILL_PLUGIN */ +# define STATIC_SKIP_INFERENCE STATIC_INVARIANT(skip_inference()) +#endif /* HAVE_STATIC_ANNOTATIONS */ + +#endif /* js_Utility_h */ diff --git a/js/public/Value.h b/js/public/Value.h new file mode 100644 index 0000000..72b3f38 --- /dev/null +++ b/js/public/Value.h @@ -0,0 +1,1844 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +/* JS::Value implementation. */ + +#ifndef js_Value_h +#define js_Value_h + +#include "mozilla/Attributes.h" +#include "mozilla/FloatingPoint.h" +#include "mozilla/Likely.h" + +#include <limits> /* for std::numeric_limits */ + +#include "js/Anchor.h" +#include "js/RootingAPI.h" +#include "js/Utility.h" + +namespace JS { class Value; } + +/* JS::Value can store a full int32_t. */ +#define JSVAL_INT_BITS 32 +#define JSVAL_INT_MIN ((int32_t)0x80000000) +#define JSVAL_INT_MAX ((int32_t)0x7fffffff) + +/* + * Try to get jsvals 64-bit aligned. We could almost assert that all values are + * aligned, but MSVC and GCC occasionally break alignment. + */ +#if defined(__GNUC__) || defined(__xlc__) || defined(__xlC__) +# define JSVAL_ALIGNMENT __attribute__((aligned (8))) +#elif defined(_MSC_VER) + /* + * Structs can be aligned with MSVC, but not if they are used as parameters, + * so we just don't try to align. + */ +# define JSVAL_ALIGNMENT +#elif defined(__SUNPRO_C) || defined(__SUNPRO_CC) +# define JSVAL_ALIGNMENT +#elif defined(__HP_cc) || defined(__HP_aCC) +# define JSVAL_ALIGNMENT +#endif + +#if JS_BITS_PER_WORD == 64 +# define JSVAL_TAG_SHIFT 47 +#endif + +/* + * We try to use enums so that printing a jsval_layout in the debugger shows + * nice symbolic type tags, however we can only do this when we can force the + * underlying type of the enum to be the desired size. + */ +#if defined(__cplusplus) && !defined(__SUNPRO_CC) && !defined(__xlC__) + +#if defined(_MSC_VER) +# define JS_ENUM_HEADER(id, type) enum id : type +# define JS_ENUM_FOOTER(id) +#else +# define JS_ENUM_HEADER(id, type) enum id +# define JS_ENUM_FOOTER(id) __attribute__((packed)) +#endif + +/* Remember to propagate changes to the C defines below. */ +JS_ENUM_HEADER(JSValueType, uint8_t) +{ + JSVAL_TYPE_DOUBLE = 0x00, + JSVAL_TYPE_INT32 = 0x01, + JSVAL_TYPE_UNDEFINED = 0x02, + JSVAL_TYPE_BOOLEAN = 0x03, + JSVAL_TYPE_MAGIC = 0x04, + JSVAL_TYPE_STRING = 0x05, + JSVAL_TYPE_NULL = 0x06, + JSVAL_TYPE_OBJECT = 0x07, + + /* These never appear in a jsval; they are only provided as an out-of-band value. */ + JSVAL_TYPE_UNKNOWN = 0x20, + JSVAL_TYPE_MISSING = 0x21 +} JS_ENUM_FOOTER(JSValueType); + +JS_STATIC_ASSERT(sizeof(JSValueType) == 1); + +#if JS_BITS_PER_WORD == 32 + +/* Remember to propagate changes to the C defines below. */ +JS_ENUM_HEADER(JSValueTag, uint32_t) +{ + JSVAL_TAG_CLEAR = 0xFFFFFF80, + JSVAL_TAG_INT32 = JSVAL_TAG_CLEAR | JSVAL_TYPE_INT32, + JSVAL_TAG_UNDEFINED = JSVAL_TAG_CLEAR | JSVAL_TYPE_UNDEFINED, + JSVAL_TAG_STRING = JSVAL_TAG_CLEAR | JSVAL_TYPE_STRING, + JSVAL_TAG_BOOLEAN = JSVAL_TAG_CLEAR | JSVAL_TYPE_BOOLEAN, + JSVAL_TAG_MAGIC = JSVAL_TAG_CLEAR | JSVAL_TYPE_MAGIC, + JSVAL_TAG_NULL = JSVAL_TAG_CLEAR | JSVAL_TYPE_NULL, + JSVAL_TAG_OBJECT = JSVAL_TAG_CLEAR | JSVAL_TYPE_OBJECT +} JS_ENUM_FOOTER(JSValueTag); + +JS_STATIC_ASSERT(sizeof(JSValueTag) == 4); + +#elif JS_BITS_PER_WORD == 64 + +/* Remember to propagate changes to the C defines below. */ +JS_ENUM_HEADER(JSValueTag, uint32_t) +{ + JSVAL_TAG_MAX_DOUBLE = 0x1FFF0, + JSVAL_TAG_INT32 = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_INT32, + JSVAL_TAG_UNDEFINED = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_UNDEFINED, + JSVAL_TAG_STRING = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_STRING, + JSVAL_TAG_BOOLEAN = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_BOOLEAN, + JSVAL_TAG_MAGIC = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_MAGIC, + JSVAL_TAG_NULL = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_NULL, + JSVAL_TAG_OBJECT = JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_OBJECT +} JS_ENUM_FOOTER(JSValueTag); + +JS_STATIC_ASSERT(sizeof(JSValueTag) == sizeof(uint32_t)); + +JS_ENUM_HEADER(JSValueShiftedTag, uint64_t) +{ + JSVAL_SHIFTED_TAG_MAX_DOUBLE = ((((uint64_t)JSVAL_TAG_MAX_DOUBLE) << JSVAL_TAG_SHIFT) | 0xFFFFFFFF), + JSVAL_SHIFTED_TAG_INT32 = (((uint64_t)JSVAL_TAG_INT32) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_UNDEFINED = (((uint64_t)JSVAL_TAG_UNDEFINED) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_STRING = (((uint64_t)JSVAL_TAG_STRING) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_BOOLEAN = (((uint64_t)JSVAL_TAG_BOOLEAN) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_MAGIC = (((uint64_t)JSVAL_TAG_MAGIC) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_NULL = (((uint64_t)JSVAL_TAG_NULL) << JSVAL_TAG_SHIFT), + JSVAL_SHIFTED_TAG_OBJECT = (((uint64_t)JSVAL_TAG_OBJECT) << JSVAL_TAG_SHIFT) +} JS_ENUM_FOOTER(JSValueShiftedTag); + +JS_STATIC_ASSERT(sizeof(JSValueShiftedTag) == sizeof(uint64_t)); + +#endif + +#else /* defined(__cplusplus) */ + +typedef uint8_t JSValueType; +#define JSVAL_TYPE_DOUBLE ((uint8_t)0x00) +#define JSVAL_TYPE_INT32 ((uint8_t)0x01) +#define JSVAL_TYPE_UNDEFINED ((uint8_t)0x02) +#define JSVAL_TYPE_BOOLEAN ((uint8_t)0x03) +#define JSVAL_TYPE_MAGIC ((uint8_t)0x04) +#define JSVAL_TYPE_STRING ((uint8_t)0x05) +#define JSVAL_TYPE_NULL ((uint8_t)0x06) +#define JSVAL_TYPE_OBJECT ((uint8_t)0x07) +#define JSVAL_TYPE_UNKNOWN ((uint8_t)0x20) + +#if JS_BITS_PER_WORD == 32 + +typedef uint32_t JSValueTag; +#define JSVAL_TAG_CLEAR ((uint32_t)(0xFFFFFF80)) +#define JSVAL_TAG_INT32 ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_INT32)) +#define JSVAL_TAG_UNDEFINED ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_UNDEFINED)) +#define JSVAL_TAG_STRING ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_STRING)) +#define JSVAL_TAG_BOOLEAN ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_BOOLEAN)) +#define JSVAL_TAG_MAGIC ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_MAGIC)) +#define JSVAL_TAG_NULL ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_NULL)) +#define JSVAL_TAG_OBJECT ((uint32_t)(JSVAL_TAG_CLEAR | JSVAL_TYPE_OBJECT)) + +#elif JS_BITS_PER_WORD == 64 + +typedef uint32_t JSValueTag; +#define JSVAL_TAG_MAX_DOUBLE ((uint32_t)(0x1FFF0)) +#define JSVAL_TAG_INT32 (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_INT32) +#define JSVAL_TAG_UNDEFINED (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_UNDEFINED) +#define JSVAL_TAG_STRING (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_STRING) +#define JSVAL_TAG_BOOLEAN (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_BOOLEAN) +#define JSVAL_TAG_MAGIC (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_MAGIC) +#define JSVAL_TAG_NULL (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_NULL) +#define JSVAL_TAG_OBJECT (uint32_t)(JSVAL_TAG_MAX_DOUBLE | JSVAL_TYPE_OBJECT) + +typedef uint64_t JSValueShiftedTag; +#define JSVAL_SHIFTED_TAG_MAX_DOUBLE ((((uint64_t)JSVAL_TAG_MAX_DOUBLE) << JSVAL_TAG_SHIFT) | 0xFFFFFFFF) +#define JSVAL_SHIFTED_TAG_INT32 (((uint64_t)JSVAL_TAG_INT32) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_UNDEFINED (((uint64_t)JSVAL_TAG_UNDEFINED) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_STRING (((uint64_t)JSVAL_TAG_STRING) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_BOOLEAN (((uint64_t)JSVAL_TAG_BOOLEAN) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_MAGIC (((uint64_t)JSVAL_TAG_MAGIC) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_NULL (((uint64_t)JSVAL_TAG_NULL) << JSVAL_TAG_SHIFT) +#define JSVAL_SHIFTED_TAG_OBJECT (((uint64_t)JSVAL_TAG_OBJECT) << JSVAL_TAG_SHIFT) + +#endif /* JS_BITS_PER_WORD */ +#endif /* defined(__cplusplus) && !defined(__SUNPRO_CC) */ + +#define JSVAL_LOWER_INCL_TYPE_OF_OBJ_OR_NULL_SET JSVAL_TYPE_NULL +#define JSVAL_UPPER_EXCL_TYPE_OF_PRIMITIVE_SET JSVAL_TYPE_OBJECT +#define JSVAL_UPPER_INCL_TYPE_OF_NUMBER_SET JSVAL_TYPE_INT32 +#define JSVAL_LOWER_INCL_TYPE_OF_PTR_PAYLOAD_SET JSVAL_TYPE_MAGIC + +#if JS_BITS_PER_WORD == 32 + +#define JSVAL_TYPE_TO_TAG(type) ((JSValueTag)(JSVAL_TAG_CLEAR | (type))) + +#define JSVAL_LOWER_INCL_TAG_OF_OBJ_OR_NULL_SET JSVAL_TAG_NULL +#define JSVAL_UPPER_EXCL_TAG_OF_PRIMITIVE_SET JSVAL_TAG_OBJECT +#define JSVAL_UPPER_INCL_TAG_OF_NUMBER_SET JSVAL_TAG_INT32 +#define JSVAL_LOWER_INCL_TAG_OF_GCTHING_SET JSVAL_TAG_STRING + +#elif JS_BITS_PER_WORD == 64 + +#define JSVAL_PAYLOAD_MASK 0x00007FFFFFFFFFFFLL +#define JSVAL_TAG_MASK 0xFFFF800000000000LL +#define JSVAL_TYPE_TO_TAG(type) ((JSValueTag)(JSVAL_TAG_MAX_DOUBLE | (type))) +#define JSVAL_TYPE_TO_SHIFTED_TAG(type) (((uint64_t)JSVAL_TYPE_TO_TAG(type)) << JSVAL_TAG_SHIFT) + +#define JSVAL_LOWER_INCL_TAG_OF_OBJ_OR_NULL_SET JSVAL_TAG_NULL +#define JSVAL_UPPER_EXCL_TAG_OF_PRIMITIVE_SET JSVAL_TAG_OBJECT +#define JSVAL_UPPER_INCL_TAG_OF_NUMBER_SET JSVAL_TAG_INT32 +#define JSVAL_LOWER_INCL_TAG_OF_GCTHING_SET JSVAL_TAG_STRING + +#define JSVAL_LOWER_INCL_SHIFTED_TAG_OF_OBJ_OR_NULL_SET JSVAL_SHIFTED_TAG_NULL +#define JSVAL_UPPER_EXCL_SHIFTED_TAG_OF_PRIMITIVE_SET JSVAL_SHIFTED_TAG_OBJECT +#define JSVAL_UPPER_EXCL_SHIFTED_TAG_OF_NUMBER_SET JSVAL_SHIFTED_TAG_UNDEFINED +#define JSVAL_LOWER_INCL_SHIFTED_TAG_OF_GCTHING_SET JSVAL_SHIFTED_TAG_STRING + +#endif /* JS_BITS_PER_WORD */ + +typedef enum JSWhyMagic +{ + JS_ELEMENTS_HOLE, /* a hole in a native object's elements */ + JS_NATIVE_ENUMERATE, /* indicates that a custom enumerate hook forwarded + * to JS_EnumerateState, which really means the object can be + * enumerated like a native object. */ + JS_NO_ITER_VALUE, /* there is not a pending iterator value */ + JS_GENERATOR_CLOSING, /* exception value thrown when closing a generator */ + JS_NO_CONSTANT, /* compiler sentinel value */ + JS_THIS_POISON, /* used in debug builds to catch tracing errors */ + JS_ARG_POISON, /* used in debug builds to catch tracing errors */ + JS_SERIALIZE_NO_NODE, /* an empty subnode in the AST serializer */ + JS_LAZY_ARGUMENTS, /* lazy arguments value on the stack */ + JS_OPTIMIZED_ARGUMENTS, /* optimized-away 'arguments' value */ + JS_IS_CONSTRUCTING, /* magic value passed to natives to indicate construction */ + JS_OVERWRITTEN_CALLEE, /* arguments.callee has been overwritten */ + JS_FORWARD_TO_CALL_OBJECT, /* args object element stored in call object */ + JS_BLOCK_NEEDS_CLONE, /* value of static block object slot */ + JS_HASH_KEY_EMPTY, /* see class js::HashableValue */ + JS_ION_ERROR, /* error while running Ion code */ + JS_ION_BAILOUT, /* status code to signal EnterIon will OSR into Interpret */ + JS_GENERIC_MAGIC /* for local use */ +} JSWhyMagic; + +#if defined(IS_LITTLE_ENDIAN) +# if JS_BITS_PER_WORD == 32 +typedef union jsval_layout +{ + uint64_t asBits; + struct { + union { + int32_t i32; + uint32_t u32; + JSBool boo; + JSString *str; + JSObject *obj; + void *ptr; + JSWhyMagic why; + size_t word; + uintptr_t uintptr; + } payload; + JSValueTag tag; + } s; + double asDouble; + void *asPtr; +} JSVAL_ALIGNMENT jsval_layout; +# elif JS_BITS_PER_WORD == 64 +typedef union jsval_layout +{ + uint64_t asBits; +#if (!defined(_WIN64) && defined(__cplusplus)) + /* MSVC does not pack these correctly :-( */ + struct { + uint64_t payload47 : 47; + JSValueTag tag : 17; + } debugView; +#endif + struct { + union { + int32_t i32; + uint32_t u32; + JSWhyMagic why; + } payload; + } s; + double asDouble; + void *asPtr; + size_t asWord; + uintptr_t asUIntPtr; +} JSVAL_ALIGNMENT jsval_layout; +# endif /* JS_BITS_PER_WORD */ +#else /* defined(IS_LITTLE_ENDIAN) */ +# if JS_BITS_PER_WORD == 32 +typedef union jsval_layout +{ + uint64_t asBits; + struct { + JSValueTag tag; + union { + int32_t i32; + uint32_t u32; + JSBool boo; + JSString *str; + JSObject *obj; + void *ptr; + JSWhyMagic why; + size_t word; + uintptr_t uintptr; + } payload; + } s; + double asDouble; + void *asPtr; +} JSVAL_ALIGNMENT jsval_layout; +# elif JS_BITS_PER_WORD == 64 +typedef union jsval_layout +{ + uint64_t asBits; + struct { + JSValueTag tag : 17; + uint64_t payload47 : 47; + } debugView; + struct { + uint32_t padding; + union { + int32_t i32; + uint32_t u32; + JSWhyMagic why; + } payload; + } s; + double asDouble; + void *asPtr; + size_t asWord; + uintptr_t asUIntPtr; +} JSVAL_ALIGNMENT jsval_layout; +# endif /* JS_BITS_PER_WORD */ +#endif /* defined(IS_LITTLE_ENDIAN) */ + +JS_STATIC_ASSERT(sizeof(jsval_layout) == 8); + +#if JS_BITS_PER_WORD == 32 + +/* + * N.B. GCC, in some but not all cases, chooses to emit signed comparison of + * JSValueTag even though its underlying type has been forced to be uint32_t. + * Thus, all comparisons should explicitly cast operands to uint32_t. + */ + +static inline jsval_layout +BUILD_JSVAL(JSValueTag tag, uint32_t payload) +{ + jsval_layout l; + l.asBits = (((uint64_t)(uint32_t)tag) << 32) | payload; + return l; +} + +static inline JSBool +JSVAL_IS_DOUBLE_IMPL(jsval_layout l) +{ + return (uint32_t)l.s.tag <= (uint32_t)JSVAL_TAG_CLEAR; +} + +static inline jsval_layout +DOUBLE_TO_JSVAL_IMPL(double d) +{ + jsval_layout l; + l.asDouble = d; + MOZ_ASSERT(JSVAL_IS_DOUBLE_IMPL(l)); + return l; +} + +static inline JSBool +JSVAL_IS_INT32_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_INT32; +} + +static inline int32_t +JSVAL_TO_INT32_IMPL(jsval_layout l) +{ + return l.s.payload.i32; +} + +static inline jsval_layout +INT32_TO_JSVAL_IMPL(int32_t i) +{ + jsval_layout l; + l.s.tag = JSVAL_TAG_INT32; + l.s.payload.i32 = i; + return l; +} + +static inline JSBool +JSVAL_IS_NUMBER_IMPL(jsval_layout l) +{ + JSValueTag tag = l.s.tag; + MOZ_ASSERT(tag != JSVAL_TAG_CLEAR); + return (uint32_t)tag <= (uint32_t)JSVAL_UPPER_INCL_TAG_OF_NUMBER_SET; +} + +static inline JSBool +JSVAL_IS_UNDEFINED_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_UNDEFINED; +} + +static inline JSBool +JSVAL_IS_STRING_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_STRING; +} + +static inline jsval_layout +STRING_TO_JSVAL_IMPL(JSString *str) +{ + jsval_layout l; + MOZ_ASSERT(str); + l.s.tag = JSVAL_TAG_STRING; + l.s.payload.str = str; + return l; +} + +static inline JSString * +JSVAL_TO_STRING_IMPL(jsval_layout l) +{ + return l.s.payload.str; +} + +static inline JSBool +JSVAL_IS_BOOLEAN_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_BOOLEAN; +} + +static inline JSBool +JSVAL_TO_BOOLEAN_IMPL(jsval_layout l) +{ + return l.s.payload.boo; +} + +static inline jsval_layout +BOOLEAN_TO_JSVAL_IMPL(JSBool b) +{ + jsval_layout l; + MOZ_ASSERT(b == JS_TRUE || b == JS_FALSE); + l.s.tag = JSVAL_TAG_BOOLEAN; + l.s.payload.boo = b; + return l; +} + +static inline JSBool +JSVAL_IS_MAGIC_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_MAGIC; +} + +static inline JSBool +JSVAL_IS_OBJECT_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_OBJECT; +} + +static inline JSBool +JSVAL_IS_PRIMITIVE_IMPL(jsval_layout l) +{ + return (uint32_t)l.s.tag < (uint32_t)JSVAL_UPPER_EXCL_TAG_OF_PRIMITIVE_SET; +} + +static inline JSBool +JSVAL_IS_OBJECT_OR_NULL_IMPL(jsval_layout l) +{ + MOZ_ASSERT((uint32_t)l.s.tag <= (uint32_t)JSVAL_TAG_OBJECT); + return (uint32_t)l.s.tag >= (uint32_t)JSVAL_LOWER_INCL_TAG_OF_OBJ_OR_NULL_SET; +} + +static inline JSObject * +JSVAL_TO_OBJECT_IMPL(jsval_layout l) +{ + return l.s.payload.obj; +} + +static inline jsval_layout +OBJECT_TO_JSVAL_IMPL(JSObject *obj) +{ + jsval_layout l; + MOZ_ASSERT(obj); + l.s.tag = JSVAL_TAG_OBJECT; + l.s.payload.obj = obj; + return l; +} + +static inline JSBool +JSVAL_IS_NULL_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_NULL; +} + +static inline jsval_layout +PRIVATE_PTR_TO_JSVAL_IMPL(void *ptr) +{ + jsval_layout l; + MOZ_ASSERT(((uint32_t)ptr & 1) == 0); + l.s.tag = (JSValueTag)0; + l.s.payload.ptr = ptr; + MOZ_ASSERT(JSVAL_IS_DOUBLE_IMPL(l)); + return l; +} + +static inline void * +JSVAL_TO_PRIVATE_PTR_IMPL(jsval_layout l) +{ + return l.s.payload.ptr; +} + +static inline JSBool +JSVAL_IS_GCTHING_IMPL(jsval_layout l) +{ + /* gcc sometimes generates signed < without explicit casts. */ + return (uint32_t)l.s.tag >= (uint32_t)JSVAL_LOWER_INCL_TAG_OF_GCTHING_SET; +} + +static inline void * +JSVAL_TO_GCTHING_IMPL(jsval_layout l) +{ + return l.s.payload.ptr; +} + +static inline JSBool +JSVAL_IS_TRACEABLE_IMPL(jsval_layout l) +{ + return l.s.tag == JSVAL_TAG_STRING || l.s.tag == JSVAL_TAG_OBJECT; +} + +static inline uint32_t +JSVAL_TRACE_KIND_IMPL(jsval_layout l) +{ + return (uint32_t)(JSBool)JSVAL_IS_STRING_IMPL(l); +} + +static inline JSBool +JSVAL_IS_SPECIFIC_INT32_IMPL(jsval_layout l, int32_t i32) +{ + return l.s.tag == JSVAL_TAG_INT32 && l.s.payload.i32 == i32; +} + +static inline JSBool +JSVAL_IS_SPECIFIC_BOOLEAN(jsval_layout l, JSBool b) +{ + return (l.s.tag == JSVAL_TAG_BOOLEAN) && (l.s.payload.boo == b); +} + +static inline jsval_layout +MAGIC_TO_JSVAL_IMPL(JSWhyMagic why) +{ + jsval_layout l; + l.s.tag = JSVAL_TAG_MAGIC; + l.s.payload.why = why; + return l; +} + +static inline JSBool +JSVAL_SAME_TYPE_IMPL(jsval_layout lhs, jsval_layout rhs) +{ + JSValueTag ltag = lhs.s.tag, rtag = rhs.s.tag; + return ltag == rtag || (ltag < JSVAL_TAG_CLEAR && rtag < JSVAL_TAG_CLEAR); +} + +static inline JSValueType +JSVAL_EXTRACT_NON_DOUBLE_TYPE_IMPL(jsval_layout l) +{ + uint32_t type = l.s.tag & 0xF; + MOZ_ASSERT(type > JSVAL_TYPE_DOUBLE); + return (JSValueType)type; +} + +#elif JS_BITS_PER_WORD == 64 + +static inline jsval_layout +BUILD_JSVAL(JSValueTag tag, uint64_t payload) +{ + jsval_layout l; + l.asBits = (((uint64_t)(uint32_t)tag) << JSVAL_TAG_SHIFT) | payload; + return l; +} + +static inline JSBool +JSVAL_IS_DOUBLE_IMPL(jsval_layout l) +{ + return l.asBits <= JSVAL_SHIFTED_TAG_MAX_DOUBLE; +} + +static inline jsval_layout +DOUBLE_TO_JSVAL_IMPL(double d) +{ + jsval_layout l; + l.asDouble = d; + MOZ_ASSERT(l.asBits <= JSVAL_SHIFTED_TAG_MAX_DOUBLE); + return l; +} + +static inline JSBool +JSVAL_IS_INT32_IMPL(jsval_layout l) +{ + return (uint32_t)(l.asBits >> JSVAL_TAG_SHIFT) == JSVAL_TAG_INT32; +} + +static inline int32_t +JSVAL_TO_INT32_IMPL(jsval_layout l) +{ + return (int32_t)l.asBits; +} + +static inline jsval_layout +INT32_TO_JSVAL_IMPL(int32_t i32) +{ + jsval_layout l; + l.asBits = ((uint64_t)(uint32_t)i32) | JSVAL_SHIFTED_TAG_INT32; + return l; +} + +static inline JSBool +JSVAL_IS_NUMBER_IMPL(jsval_layout l) +{ + return l.asBits < JSVAL_UPPER_EXCL_SHIFTED_TAG_OF_NUMBER_SET; +} + +static inline JSBool +JSVAL_IS_UNDEFINED_IMPL(jsval_layout l) +{ + return l.asBits == JSVAL_SHIFTED_TAG_UNDEFINED; +} + +static inline JSBool +JSVAL_IS_STRING_IMPL(jsval_layout l) +{ + return (uint32_t)(l.asBits >> JSVAL_TAG_SHIFT) == JSVAL_TAG_STRING; +} + +static inline jsval_layout +STRING_TO_JSVAL_IMPL(JSString *str) +{ + jsval_layout l; + uint64_t strBits = (uint64_t)str; + MOZ_ASSERT(str); + MOZ_ASSERT((strBits >> JSVAL_TAG_SHIFT) == 0); + l.asBits = strBits | JSVAL_SHIFTED_TAG_STRING; + return l; +} + +static inline JSString * +JSVAL_TO_STRING_IMPL(jsval_layout l) +{ + return (JSString *)(l.asBits & JSVAL_PAYLOAD_MASK); +} + +static inline JSBool +JSVAL_IS_BOOLEAN_IMPL(jsval_layout l) +{ + return (uint32_t)(l.asBits >> JSVAL_TAG_SHIFT) == JSVAL_TAG_BOOLEAN; +} + +static inline JSBool +JSVAL_TO_BOOLEAN_IMPL(jsval_layout l) +{ + return (JSBool)l.asBits; +} + +static inline jsval_layout +BOOLEAN_TO_JSVAL_IMPL(JSBool b) +{ + jsval_layout l; + MOZ_ASSERT(b == JS_TRUE || b == JS_FALSE); + l.asBits = ((uint64_t)(uint32_t)b) | JSVAL_SHIFTED_TAG_BOOLEAN; + return l; +} + +static inline JSBool +JSVAL_IS_MAGIC_IMPL(jsval_layout l) +{ + return (l.asBits >> JSVAL_TAG_SHIFT) == JSVAL_TAG_MAGIC; +} + +static inline JSBool +JSVAL_IS_PRIMITIVE_IMPL(jsval_layout l) +{ + return l.asBits < JSVAL_UPPER_EXCL_SHIFTED_TAG_OF_PRIMITIVE_SET; +} + +static inline JSBool +JSVAL_IS_OBJECT_IMPL(jsval_layout l) +{ + MOZ_ASSERT((l.asBits >> JSVAL_TAG_SHIFT) <= JSVAL_SHIFTED_TAG_OBJECT); + return l.asBits >= JSVAL_SHIFTED_TAG_OBJECT; +} + +static inline JSBool +JSVAL_IS_OBJECT_OR_NULL_IMPL(jsval_layout l) +{ + MOZ_ASSERT((l.asBits >> JSVAL_TAG_SHIFT) <= JSVAL_TAG_OBJECT); + return l.asBits >= JSVAL_LOWER_INCL_SHIFTED_TAG_OF_OBJ_OR_NULL_SET; +} + +static inline JSObject * +JSVAL_TO_OBJECT_IMPL(jsval_layout l) +{ + uint64_t ptrBits = l.asBits & JSVAL_PAYLOAD_MASK; + MOZ_ASSERT((ptrBits & 0x7) == 0); + return (JSObject *)ptrBits; +} + +static inline jsval_layout +OBJECT_TO_JSVAL_IMPL(JSObject *obj) +{ + jsval_layout l; + uint64_t objBits = (uint64_t)obj; + MOZ_ASSERT(obj); + MOZ_ASSERT((objBits >> JSVAL_TAG_SHIFT) == 0); + l.asBits = objBits | JSVAL_SHIFTED_TAG_OBJECT; + return l; +} + +static inline JSBool +JSVAL_IS_NULL_IMPL(jsval_layout l) +{ + return l.asBits == JSVAL_SHIFTED_TAG_NULL; +} + +static inline JSBool +JSVAL_IS_GCTHING_IMPL(jsval_layout l) +{ + return l.asBits >= JSVAL_LOWER_INCL_SHIFTED_TAG_OF_GCTHING_SET; +} + +static inline void * +JSVAL_TO_GCTHING_IMPL(jsval_layout l) +{ + uint64_t ptrBits = l.asBits & JSVAL_PAYLOAD_MASK; + MOZ_ASSERT((ptrBits & 0x7) == 0); + return (void *)ptrBits; +} + +static inline JSBool +JSVAL_IS_TRACEABLE_IMPL(jsval_layout l) +{ + return JSVAL_IS_GCTHING_IMPL(l) && !JSVAL_IS_NULL_IMPL(l); +} + +static inline uint32_t +JSVAL_TRACE_KIND_IMPL(jsval_layout l) +{ + return (uint32_t)(JSBool)!(JSVAL_IS_OBJECT_IMPL(l)); +} + +static inline jsval_layout +PRIVATE_PTR_TO_JSVAL_IMPL(void *ptr) +{ + jsval_layout l; + uint64_t ptrBits = (uint64_t)ptr; + MOZ_ASSERT((ptrBits & 1) == 0); + l.asBits = ptrBits >> 1; + MOZ_ASSERT(JSVAL_IS_DOUBLE_IMPL(l)); + return l; +} + +static inline void * +JSVAL_TO_PRIVATE_PTR_IMPL(jsval_layout l) +{ + MOZ_ASSERT((l.asBits & 0x8000000000000000LL) == 0); + return (void *)(l.asBits << 1); +} + +static inline JSBool +JSVAL_IS_SPECIFIC_INT32_IMPL(jsval_layout l, int32_t i32) +{ + return l.asBits == (((uint64_t)(uint32_t)i32) | JSVAL_SHIFTED_TAG_INT32); +} + +static inline JSBool +JSVAL_IS_SPECIFIC_BOOLEAN(jsval_layout l, JSBool b) +{ + return l.asBits == (((uint64_t)(uint32_t)b) | JSVAL_SHIFTED_TAG_BOOLEAN); +} + +static inline jsval_layout +MAGIC_TO_JSVAL_IMPL(JSWhyMagic why) +{ + jsval_layout l; + l.asBits = ((uint64_t)(uint32_t)why) | JSVAL_SHIFTED_TAG_MAGIC; + return l; +} + +static inline JSBool +JSVAL_SAME_TYPE_IMPL(jsval_layout lhs, jsval_layout rhs) +{ + uint64_t lbits = lhs.asBits, rbits = rhs.asBits; + return (lbits <= JSVAL_SHIFTED_TAG_MAX_DOUBLE && rbits <= JSVAL_SHIFTED_TAG_MAX_DOUBLE) || + (((lbits ^ rbits) & 0xFFFF800000000000LL) == 0); +} + +static inline JSValueType +JSVAL_EXTRACT_NON_DOUBLE_TYPE_IMPL(jsval_layout l) +{ + uint64_t type = (l.asBits >> JSVAL_TAG_SHIFT) & 0xF; + MOZ_ASSERT(type > JSVAL_TYPE_DOUBLE); + return (JSValueType)type; +} + +#endif /* JS_BITS_PER_WORD */ + +static inline jsval_layout JSVAL_TO_IMPL(JS::Value v); +static inline JS::Value IMPL_TO_JSVAL(jsval_layout l); + +namespace JS { + +/** + * Returns a generic quiet NaN value, with all payload bits set to zero. + * + * Among other properties, this NaN's bit pattern conforms to JS::Value's + * bit pattern restrictions. + */ +static MOZ_ALWAYS_INLINE double +GenericNaN() +{ + return mozilla::SpecificNaN(0, 0x8000000000000ULL); +} + +static inline double +CanonicalizeNaN(double d) +{ + if (MOZ_UNLIKELY(mozilla::IsNaN(d))) + return GenericNaN(); + return d; +} + +/* + * JS::Value is the interface for a single JavaScript Engine value. A few + * general notes on JS::Value: + * + * - JS::Value has setX() and isX() members for X in + * + * { Int32, Double, String, Boolean, Undefined, Null, Object, Magic } + * + * JS::Value also contains toX() for each of the non-singleton types. + * + * - Magic is a singleton type whose payload contains a JSWhyMagic "reason" for + * the magic value. By providing JSWhyMagic values when creating and checking + * for magic values, it is possible to assert, at runtime, that only magic + * values with the expected reason flow through a particular value. For + * example, if cx->exception has a magic value, the reason must be + * JS_GENERATOR_CLOSING. + * + * - The JS::Value operations are preferred. The JSVAL_* operations remain for + * compatibility; they may be removed at some point. These operations mostly + * provide similar functionality. But there are a few key differences. One + * is that JS::Value gives null a separate type. Thus + * + * JSVAL_IS_OBJECT(v) === v.isObjectOrNull() + * !JSVAL_IS_PRIMITIVE(v) === v.isObject() + * + * Also, to help prevent mistakenly boxing a nullable JSObject* as an object, + * Value::setObject takes a JSObject&. (Conversely, Value::asObject returns a + * JSObject&.) A convenience member Value::setObjectOrNull is provided. + * + * - JSVAL_VOID is the same as the singleton value of the Undefined type. + * + * - Note that JS::Value is 8 bytes on 32 and 64-bit architectures. Thus, on + * 32-bit user code should avoid copying jsval/JS::Value as much as possible, + * preferring to pass by const Value &. + */ +class Value +{ + public: + /* + * N.B. the default constructor leaves Value unitialized. Adding a default + * constructor prevents Value from being stored in a union. + */ + + /*** Mutators ***/ + + void setNull() { + data.asBits = BUILD_JSVAL(JSVAL_TAG_NULL, 0).asBits; + } + + void setUndefined() { + data.asBits = BUILD_JSVAL(JSVAL_TAG_UNDEFINED, 0).asBits; + } + + void setInt32(int32_t i) { + data = INT32_TO_JSVAL_IMPL(i); + } + + int32_t &getInt32Ref() { + MOZ_ASSERT(isInt32()); + return data.s.payload.i32; + } + + void setDouble(double d) { + data = DOUBLE_TO_JSVAL_IMPL(d); + } + + double &getDoubleRef() { + MOZ_ASSERT(isDouble()); + return data.asDouble; + } + + void setString(JSString *str) { + MOZ_ASSERT(!IsPoisonedPtr(str)); + data = STRING_TO_JSVAL_IMPL(str); + } + + void setString(const JS::Anchor<JSString *> &str) { + setString(str.get()); + } + + void setObject(JSObject &obj) { + MOZ_ASSERT(!IsPoisonedPtr(&obj)); + data = OBJECT_TO_JSVAL_IMPL(&obj); + } + + void setBoolean(bool b) { + data = BOOLEAN_TO_JSVAL_IMPL(b); + } + + void setMagic(JSWhyMagic why) { + data = MAGIC_TO_JSVAL_IMPL(why); + } + + bool setNumber(uint32_t ui) { + if (ui > JSVAL_INT_MAX) { + setDouble((double)ui); + return false; + } else { + setInt32((int32_t)ui); + return true; + } + } + + bool setNumber(double d) { + int32_t i; + if (mozilla::DoubleIsInt32(d, &i)) { + setInt32(i); + return true; + } + + setDouble(d); + return false; + } + + void setObjectOrNull(JSObject *arg) { + if (arg) + setObject(*arg); + else + setNull(); + } + + void swap(Value &rhs) { + uint64_t tmp = rhs.data.asBits; + rhs.data.asBits = data.asBits; + data.asBits = tmp; + } + + /*** Value type queries ***/ + + bool isUndefined() const { + return JSVAL_IS_UNDEFINED_IMPL(data); + } + + bool isNull() const { + return JSVAL_IS_NULL_IMPL(data); + } + + bool isNullOrUndefined() const { + return isNull() || isUndefined(); + } + + bool isInt32() const { + return JSVAL_IS_INT32_IMPL(data); + } + + bool isInt32(int32_t i32) const { + return JSVAL_IS_SPECIFIC_INT32_IMPL(data, i32); + } + + bool isDouble() const { + return JSVAL_IS_DOUBLE_IMPL(data); + } + + bool isNumber() const { + return JSVAL_IS_NUMBER_IMPL(data); + } + + bool isString() const { + return JSVAL_IS_STRING_IMPL(data); + } + + bool isObject() const { + return JSVAL_IS_OBJECT_IMPL(data); + } + + bool isPrimitive() const { + return JSVAL_IS_PRIMITIVE_IMPL(data); + } + + bool isObjectOrNull() const { + return JSVAL_IS_OBJECT_OR_NULL_IMPL(data); + } + + bool isGCThing() const { + return JSVAL_IS_GCTHING_IMPL(data); + } + + bool isBoolean() const { + return JSVAL_IS_BOOLEAN_IMPL(data); + } + + bool isTrue() const { + return JSVAL_IS_SPECIFIC_BOOLEAN(data, true); + } + + bool isFalse() const { + return JSVAL_IS_SPECIFIC_BOOLEAN(data, false); + } + + bool isMagic() const { + return JSVAL_IS_MAGIC_IMPL(data); + } + + bool isMagic(JSWhyMagic why) const { + MOZ_ASSERT_IF(isMagic(), data.s.payload.why == why); + return JSVAL_IS_MAGIC_IMPL(data); + } + + bool isMarkable() const { + return JSVAL_IS_TRACEABLE_IMPL(data); + } + + JSGCTraceKind gcKind() const { + MOZ_ASSERT(isMarkable()); + return JSGCTraceKind(JSVAL_TRACE_KIND_IMPL(data)); + } + + JSWhyMagic whyMagic() const { + MOZ_ASSERT(isMagic()); + return data.s.payload.why; + } + + /*** Comparison ***/ + + bool operator==(const Value &rhs) const { + return data.asBits == rhs.data.asBits; + } + + bool operator!=(const Value &rhs) const { + return data.asBits != rhs.data.asBits; + } + + friend inline bool SameType(const Value &lhs, const Value &rhs); + + /*** Extract the value's typed payload ***/ + + int32_t toInt32() const { + MOZ_ASSERT(isInt32()); + return JSVAL_TO_INT32_IMPL(data); + } + + double toDouble() const { + MOZ_ASSERT(isDouble()); + return data.asDouble; + } + + double toNumber() const { + MOZ_ASSERT(isNumber()); + return isDouble() ? toDouble() : double(toInt32()); + } + + JSString *toString() const { + MOZ_ASSERT(isString()); + return JSVAL_TO_STRING_IMPL(data); + } + + JSObject &toObject() const { + MOZ_ASSERT(isObject()); + return *JSVAL_TO_OBJECT_IMPL(data); + } + + JSObject *toObjectOrNull() const { + MOZ_ASSERT(isObjectOrNull()); + return JSVAL_TO_OBJECT_IMPL(data); + } + + void *toGCThing() const { + MOZ_ASSERT(isGCThing()); + return JSVAL_TO_GCTHING_IMPL(data); + } + + bool toBoolean() const { + MOZ_ASSERT(isBoolean()); + return JSVAL_TO_BOOLEAN_IMPL(data); + } + + uint32_t payloadAsRawUint32() const { + MOZ_ASSERT(!isDouble()); + return data.s.payload.u32; + } + + uint64_t asRawBits() const { + return data.asBits; + } + + JSValueType extractNonDoubleType() const { + return JSVAL_EXTRACT_NON_DOUBLE_TYPE_IMPL(data); + } + + /* + * Private API + * + * Private setters/getters allow the caller to read/write arbitrary types + * that fit in the 64-bit payload. It is the caller's responsibility, after + * storing to a value with setPrivateX to read only using getPrivateX. + * Privates values are given a type which ensures they are not marked. + */ + + void setPrivate(void *ptr) { + data = PRIVATE_PTR_TO_JSVAL_IMPL(ptr); + } + + void *toPrivate() const { + MOZ_ASSERT(JSVAL_IS_DOUBLE_IMPL(data)); + return JSVAL_TO_PRIVATE_PTR_IMPL(data); + } + + void setPrivateUint32(uint32_t ui) { + MOZ_ASSERT(uint32_t(int32_t(ui)) == ui); + setInt32(int32_t(ui)); + } + + uint32_t toPrivateUint32() const { + return uint32_t(toInt32()); + } + + /* + * An unmarked value is just a void* cast as a Value. Thus, the Value is + * not safe for GC and must not be marked. This API avoids raw casts + * and the ensuing strict-aliasing warnings. + */ + + void setUnmarkedPtr(void *ptr) { + data.asPtr = ptr; + } + + void *toUnmarkedPtr() const { + return data.asPtr; + } + + const size_t *payloadWord() const { +#if JS_BITS_PER_WORD == 32 + return &data.s.payload.word; +#elif JS_BITS_PER_WORD == 64 + return &data.asWord; +#endif + } + + const uintptr_t *payloadUIntPtr() const { +#if JS_BITS_PER_WORD == 32 + return &data.s.payload.uintptr; +#elif JS_BITS_PER_WORD == 64 + return &data.asUIntPtr; +#endif + } + +#if !defined(_MSC_VER) && !defined(__sparc) + // Value must be POD so that MSVC will pass it by value and not in memory + // (bug 689101); the same is true for SPARC as well (bug 737344). More + // precisely, we don't want Value return values compiled as out params. + private: +#endif + + jsval_layout data; + + private: + void staticAssertions() { + JS_STATIC_ASSERT(sizeof(JSValueType) == 1); + JS_STATIC_ASSERT(sizeof(JSValueTag) == 4); + JS_STATIC_ASSERT(sizeof(JSBool) == 4); + JS_STATIC_ASSERT(sizeof(JSWhyMagic) <= 4); + JS_STATIC_ASSERT(sizeof(Value) == 8); + } + + friend jsval_layout (::JSVAL_TO_IMPL)(Value); + friend Value (::IMPL_TO_JSVAL)(jsval_layout l); +}; + +inline bool +IsPoisonedValue(const Value &v) +{ + if (v.isString()) + return IsPoisonedPtr(v.toString()); + if (v.isObject()) + return IsPoisonedPtr(&v.toObject()); + return false; +} + +/************************************************************************/ + +static inline Value +NullValue() +{ + Value v; + v.setNull(); + return v; +} + +static inline Value +UndefinedValue() +{ + Value v; + v.setUndefined(); + return v; +} + +static inline Value +Int32Value(int32_t i32) +{ + Value v; + v.setInt32(i32); + return v; +} + +static inline Value +DoubleValue(double dbl) +{ + Value v; + v.setDouble(dbl); + return v; +} + +static inline Value +StringValue(JSString *str) +{ + Value v; + v.setString(str); + return v; +} + +static inline Value +BooleanValue(bool boo) +{ + Value v; + v.setBoolean(boo); + return v; +} + +static inline Value +ObjectValue(JSObject &obj) +{ + Value v; + v.setObject(obj); + return v; +} + +static inline Value +ObjectValueCrashOnTouch() +{ + Value v; + v.setObject(*reinterpret_cast<JSObject *>(0x42)); + return v; +} + +static inline Value +MagicValue(JSWhyMagic why) +{ + Value v; + v.setMagic(why); + return v; +} + +static inline Value +NumberValue(float f) +{ + Value v; + v.setNumber(f); + return v; +} + +static inline Value +NumberValue(double dbl) +{ + Value v; + v.setNumber(dbl); + return v; +} + +static inline Value +NumberValue(int8_t i) +{ + return Int32Value(i); +} + +static inline Value +NumberValue(uint8_t i) +{ + return Int32Value(i); +} + +static inline Value +NumberValue(int16_t i) +{ + return Int32Value(i); +} + +static inline Value +NumberValue(uint16_t i) +{ + return Int32Value(i); +} + +static inline Value +NumberValue(int32_t i) +{ + return Int32Value(i); +} + +static inline Value +NumberValue(uint32_t i) +{ + Value v; + v.setNumber(i); + return v; +} + +namespace detail { + +template <bool Signed> +class MakeNumberValue +{ + public: + template<typename T> + static inline Value create(const T t) + { + Value v; + if (JSVAL_INT_MIN <= t && t <= JSVAL_INT_MAX) + v.setInt32(int32_t(t)); + else + v.setDouble(double(t)); + return v; + } +}; + +template <> +class MakeNumberValue<false> +{ + public: + template<typename T> + static inline Value create(const T t) + { + Value v; + if (t <= JSVAL_INT_MAX) + v.setInt32(int32_t(t)); + else + v.setDouble(double(t)); + return v; + } +}; + +} // namespace detail + +template <typename T> +static inline Value +NumberValue(const T t) +{ + MOZ_ASSERT(T(double(t)) == t, "value creation would be lossy"); + return detail::MakeNumberValue<std::numeric_limits<T>::is_signed>::create(t); +} + +static inline Value +ObjectOrNullValue(JSObject *obj) +{ + Value v; + v.setObjectOrNull(obj); + return v; +} + +static inline Value +PrivateValue(void *ptr) +{ + Value v; + v.setPrivate(ptr); + return v; +} + +static inline Value +PrivateUint32Value(uint32_t ui) +{ + Value v; + v.setPrivateUint32(ui); + return v; +} + +inline bool +SameType(const Value &lhs, const Value &rhs) +{ + return JSVAL_SAME_TYPE_IMPL(lhs.data, rhs.data); +} + +} // namespace JS + +/************************************************************************/ + +#ifdef JSGC_GENERATIONAL +namespace JS { +JS_PUBLIC_API(void) HeapValuePostBarrier(Value *valuep); +JS_PUBLIC_API(void) HeapValueRelocate(Value *valuep); +} +#endif + +namespace js { + +template <> struct GCMethods<const JS::Value> +{ + static JS::Value initial() { return JS::UndefinedValue(); } + static ThingRootKind kind() { return THING_ROOT_VALUE; } + static bool poisoned(const JS::Value &v) { return JS::IsPoisonedValue(v); } +}; + +template <> struct GCMethods<JS::Value> +{ + static JS::Value initial() { return JS::UndefinedValue(); } + static ThingRootKind kind() { return THING_ROOT_VALUE; } + static bool poisoned(const JS::Value &v) { return JS::IsPoisonedValue(v); } + static bool needsPostBarrier(const JS::Value &v) { return v.isMarkable(); } +#ifdef JSGC_GENERATIONAL + static void postBarrier(JS::Value *v) { JS::HeapValuePostBarrier(v); } + static void relocate(JS::Value *v) { JS::HeapValueRelocate(v); } +#endif +}; + +template <class Outer> class UnbarrieredMutableValueOperations; +template <class Outer> class MutableValueOperations; + +/* + * A class designed for CRTP use in implementing the non-mutating parts of the + * Value interface in Value-like classes. Outer must be a class inheriting + * ValueOperations<Outer> with a visible extract() method returning the + * const Value* abstracted by Outer. + */ +template <class Outer> +class ValueOperations +{ + friend class UnbarrieredMutableValueOperations<Outer>; + friend class MutableValueOperations<Outer>; + + const JS::Value * value() const { return static_cast<const Outer*>(this)->extract(); } + + public: + bool isUndefined() const { return value()->isUndefined(); } + bool isNull() const { return value()->isNull(); } + bool isBoolean() const { return value()->isBoolean(); } + bool isTrue() const { return value()->isTrue(); } + bool isFalse() const { return value()->isFalse(); } + bool isNumber() const { return value()->isNumber(); } + bool isInt32() const { return value()->isInt32(); } + bool isDouble() const { return value()->isDouble(); } + bool isString() const { return value()->isString(); } + bool isObject() const { return value()->isObject(); } + bool isMagic() const { return value()->isMagic(); } + bool isMagic(JSWhyMagic why) const { return value()->isMagic(why); } + bool isMarkable() const { return value()->isMarkable(); } + bool isPrimitive() const { return value()->isPrimitive(); } + bool isGCThing() const { return value()->isGCThing(); } + + bool isNullOrUndefined() const { return value()->isNullOrUndefined(); } + bool isObjectOrNull() const { return value()->isObjectOrNull(); } + + bool toBoolean() const { return value()->toBoolean(); } + double toNumber() const { return value()->toNumber(); } + int32_t toInt32() const { return value()->toInt32(); } + double toDouble() const { return value()->toDouble(); } + JSString *toString() const { return value()->toString(); } + JSObject &toObject() const { return value()->toObject(); } + JSObject *toObjectOrNull() const { return value()->toObjectOrNull(); } + void *toGCThing() const { return value()->toGCThing(); } + + JSValueType extractNonDoubleType() const { return value()->extractNonDoubleType(); } + + JSWhyMagic whyMagic() const { return value()->whyMagic(); } +}; + +/* + * A class designed for CRTP use in implementing the mutating parts of the Value + * interface in Value-like classes that don't need post barriers. Outer must be + * a class inheriting UnbarrieredMutableValueOperations<Outer> with visible + * extractMutable() and extract() methods returning the const Value* and Value* + * abstracted by Outer. + */ +template <class Outer> +class UnbarrieredMutableValueOperations : public ValueOperations<Outer> +{ + friend class MutableValueOperations<Outer>; + JS::Value * value() { return static_cast<Outer*>(this)->extractMutable(); } + + public: + void setNull() { value()->setNull(); } + void setUndefined() { value()->setUndefined(); } + void setInt32(int32_t i) { value()->setInt32(i); } + void setDouble(double d) { value()->setDouble(d); } + void setBoolean(bool b) { value()->setBoolean(b); } + void setMagic(JSWhyMagic why) { value()->setMagic(why); } + bool setNumber(uint32_t ui) { return value()->setNumber(ui); } + bool setNumber(double d) { return value()->setNumber(d); } +}; + +/* + * A class designed for CRTP use in implementing all the mutating parts of the + * Value interface in Value-like classes. Outer must be a class inheriting + * MutableValueOperations<Outer> with visible extractMutable() and extract() + * methods returning the const Value* and Value* abstracted by Outer. + */ +template <class Outer> +class MutableValueOperations : public UnbarrieredMutableValueOperations<Outer> +{ + public: + void setString(JSString *str) { this->value()->setString(str); } + void setString(const JS::Anchor<JSString *> &str) { this->value()->setString(str); } + void setObject(JSObject &obj) { this->value()->setObject(obj); } + void setObjectOrNull(JSObject *arg) { this->value()->setObjectOrNull(arg); } +}; + +/* + * Augment the generic Heap<T> interface when T = Value with + * type-querying, value-extracting, and mutating operations. + */ +template <> +class HeapBase<JS::Value> : public UnbarrieredMutableValueOperations<JS::Heap<JS::Value> > +{ + typedef JS::Heap<JS::Value> Outer; + + friend class ValueOperations<Outer>; + friend class UnbarrieredMutableValueOperations<Outer>; + + const JS::Value * extract() const { return static_cast<const Outer*>(this)->address(); } + JS::Value * extractMutable() { return static_cast<Outer*>(this)->unsafeGet(); } + + /* + * Setters that potentially change the value to a GC thing from a non-GC + * thing must call JS::Heap::set() to trigger the post barrier. + * + * Changing from a GC thing to a non-GC thing value will leave the heap + * value in the store buffer, but it will be ingored so this is not a + * problem. + */ + void setBarriered(const JS::Value &v) { + static_cast<JS::Heap<JS::Value> *>(this)->set(v); + } + + public: + void setString(JSString *str) { setBarriered(JS::StringValue(str)); } + void setString(const JS::Anchor<JSString *> &str) { setBarriered(JS::StringValue(str.get())); } + void setObject(JSObject &obj) { setBarriered(JS::ObjectValue(obj)); } + + void setObjectOrNull(JSObject *arg) { + if (arg) + setObject(*arg); + else + setNull(); + } +}; + +/* + * Augment the generic Handle<T> interface when T = Value with type-querying + * and value-extracting operations. + */ +template <> +class HandleBase<JS::Value> : public ValueOperations<JS::Handle<JS::Value> > +{ + friend class ValueOperations<JS::Handle<JS::Value> >; + const JS::Value * extract() const { + return static_cast<const JS::Handle<JS::Value>*>(this)->address(); + } +}; + +/* + * Augment the generic MutableHandle<T> interface when T = Value with + * type-querying, value-extracting, and mutating operations. + */ +template <> +class MutableHandleBase<JS::Value> : public MutableValueOperations<JS::MutableHandle<JS::Value> > +{ + friend class ValueOperations<JS::MutableHandle<JS::Value> >; + const JS::Value * extract() const { + return static_cast<const JS::MutableHandle<JS::Value>*>(this)->address(); + } + + friend class UnbarrieredMutableValueOperations<JS::MutableHandle<JS::Value> >; + friend class MutableValueOperations<JS::MutableHandle<JS::Value> >; + JS::Value * extractMutable() { + return static_cast<JS::MutableHandle<JS::Value>*>(this)->address(); + } +}; + +/* + * Augment the generic Rooted<T> interface when T = Value with type-querying, + * value-extracting, and mutating operations. + */ +template <> +class RootedBase<JS::Value> : public MutableValueOperations<JS::Rooted<JS::Value> > +{ + friend class ValueOperations<JS::Rooted<JS::Value> >; + const JS::Value * extract() const { + return static_cast<const JS::Rooted<JS::Value>*>(this)->address(); + } + + friend class UnbarrieredMutableValueOperations<JS::Rooted<JS::Value> >; + friend class MutableValueOperations<JS::Rooted<JS::Value> >; + JS::Value * extractMutable() { + return static_cast<JS::Rooted<JS::Value>*>(this)->address(); + } +}; + +} // namespace js + +inline jsval_layout +JSVAL_TO_IMPL(JS::Value v) +{ + return v.data; +} + +inline JS::Value +IMPL_TO_JSVAL(jsval_layout l) +{ + JS::Value v; + v.data = l; + return v; +} + +namespace JS { + +#ifndef __GNUC__ +/* + * The default assignment operator for |struct C| has the signature: + * + * C& C::operator=(const C&) + * + * And in particular requires implicit conversion of |this| to type |C| for the + * return value. But |volatile C| cannot thus be converted to |C|, so just + * doing |sink = hold| as in the non-specialized version would fail to compile. + * Do the assignment on asBits instead, since I don't think we want to give + * jsval_layout an assignment operator returning |volatile jsval_layout|. + */ +template<> +inline Anchor<Value>::~Anchor() +{ + volatile uint64_t bits; + bits = JSVAL_TO_IMPL(hold).asBits; +} +#endif + +#ifdef JS_DEBUG +namespace detail { + +struct ValueAlignmentTester { char c; JS::Value v; }; +MOZ_STATIC_ASSERT(sizeof(ValueAlignmentTester) == 16, + "JS::Value must be 16-byte-aligned"); + +struct LayoutAlignmentTester { char c; jsval_layout l; }; +MOZ_STATIC_ASSERT(sizeof(LayoutAlignmentTester) == 16, + "jsval_layout must be 16-byte-aligned"); + +} // namespace detail +#endif /* JS_DEBUG */ + +} // namespace JS + +/* + * JS::Value and jsval are the same type; jsval is the old name, kept around + * for backwards compatibility along with all the JSVAL_* operations below. + * jsval_layout is an implementation detail and should not be used externally. + */ +typedef JS::Value jsval; + +MOZ_STATIC_ASSERT(sizeof(jsval_layout) == sizeof(JS::Value), + "jsval_layout and JS::Value must have identical layouts"); + +/************************************************************************/ + +static inline JSBool +JSVAL_IS_NULL(jsval v) +{ + return JSVAL_IS_NULL_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSBool +JSVAL_IS_VOID(jsval v) +{ + return JSVAL_IS_UNDEFINED_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSBool +JSVAL_IS_INT(jsval v) +{ + return JSVAL_IS_INT32_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline int32_t +JSVAL_TO_INT(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_INT(v)); + return JSVAL_TO_INT32_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline jsval +INT_TO_JSVAL(int32_t i) +{ + return IMPL_TO_JSVAL(INT32_TO_JSVAL_IMPL(i)); +} + +static inline JSBool +JSVAL_IS_DOUBLE(jsval v) +{ + return JSVAL_IS_DOUBLE_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline double +JSVAL_TO_DOUBLE(jsval v) +{ + jsval_layout l; + MOZ_ASSERT(JSVAL_IS_DOUBLE(v)); + l = JSVAL_TO_IMPL(v); + return l.asDouble; +} + +static inline jsval +DOUBLE_TO_JSVAL(double d) +{ + /* + * This is a manually inlined version of: + * d = JS_CANONICALIZE_NAN(d); + * return IMPL_TO_JSVAL(DOUBLE_TO_JSVAL_IMPL(d)); + * because GCC from XCode 3.1.4 miscompiles the above code. + */ + jsval_layout l; + if (MOZ_UNLIKELY(d != d)) + l.asBits = 0x7FF8000000000000LL; + else + l.asDouble = d; + return IMPL_TO_JSVAL(l); +} + +static inline jsval +UINT_TO_JSVAL(uint32_t i) +{ + if (i <= JSVAL_INT_MAX) + return INT_TO_JSVAL((int32_t)i); + return DOUBLE_TO_JSVAL((double)i); +} + +static inline JSBool +JSVAL_IS_NUMBER(jsval v) +{ + return JSVAL_IS_NUMBER_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSBool +JSVAL_IS_STRING(jsval v) +{ + return JSVAL_IS_STRING_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSString * +JSVAL_TO_STRING(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_STRING(v)); + return JSVAL_TO_STRING_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline jsval +STRING_TO_JSVAL(JSString *str) +{ + return IMPL_TO_JSVAL(STRING_TO_JSVAL_IMPL(str)); +} + +static inline JSObject * +JSVAL_TO_OBJECT(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_OBJECT_OR_NULL_IMPL(JSVAL_TO_IMPL(v))); + return JSVAL_TO_OBJECT_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline jsval +OBJECT_TO_JSVAL(JSObject *obj) +{ + if (obj) + return IMPL_TO_JSVAL(OBJECT_TO_JSVAL_IMPL(obj)); + return IMPL_TO_JSVAL(BUILD_JSVAL(JSVAL_TAG_NULL, 0)); +} + +static inline JSBool +JSVAL_IS_BOOLEAN(jsval v) +{ + return JSVAL_IS_BOOLEAN_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSBool +JSVAL_TO_BOOLEAN(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_BOOLEAN(v)); + return JSVAL_TO_BOOLEAN_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline jsval +BOOLEAN_TO_JSVAL(JSBool b) +{ + return IMPL_TO_JSVAL(BOOLEAN_TO_JSVAL_IMPL(b)); +} + +static inline JSBool +JSVAL_IS_PRIMITIVE(jsval v) +{ + return JSVAL_IS_PRIMITIVE_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline JSBool +JSVAL_IS_GCTHING(jsval v) +{ + return JSVAL_IS_GCTHING_IMPL(JSVAL_TO_IMPL(v)); +} + +static inline void * +JSVAL_TO_GCTHING(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_GCTHING(v)); + return JSVAL_TO_GCTHING_IMPL(JSVAL_TO_IMPL(v)); +} + +/* To be GC-safe, privates are tagged as doubles. */ + +static inline jsval +PRIVATE_TO_JSVAL(void *ptr) +{ + return IMPL_TO_JSVAL(PRIVATE_PTR_TO_JSVAL_IMPL(ptr)); +} + +static inline void * +JSVAL_TO_PRIVATE(jsval v) +{ + MOZ_ASSERT(JSVAL_IS_DOUBLE(v)); + return JSVAL_TO_PRIVATE_PTR_IMPL(JSVAL_TO_IMPL(v)); +} + +#endif /* js_Value_h */ diff --git a/js/public/Vector.h b/js/public/Vector.h new file mode 100644 index 0000000..7e0bd76 --- /dev/null +++ b/js/public/Vector.h @@ -0,0 +1,1107 @@ +/* -*- Mode: C++; tab-width: 8; indent-tabs-mode: nil; c-basic-offset: 4 -*- + * vim: set ts=8 sts=4 et sw=4 tw=99: + * This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. */ + +#ifndef js_Vector_h +#define js_Vector_h + +#include "mozilla/Attributes.h" +#include "mozilla/TypeTraits.h" + +#include "TemplateLib.h" +#include "Utility.h" + +/* Silence dire "bugs in previous versions of MSVC have been fixed" warnings */ +#ifdef _MSC_VER +#pragma warning(push) +#pragma warning(disable:4345) +#endif + +namespace js { + +class TempAllocPolicy; + +template <class T, + size_t MinInlineCapacity = 0, + class AllocPolicy = TempAllocPolicy> +class Vector; + +/* + * Check that the given capacity wastes the minimal amount of space if + * allocated on the heap. This means that cap*sizeof(T) is as close to a + * power-of-two as possible. growStorageBy() is responsible for ensuring + * this. + */ +template <typename T> +static bool CapacityHasExcessSpace(size_t cap) +{ + size_t size = cap * sizeof(T); + return RoundUpPow2(size) - size >= sizeof(T); +} + +/* + * This template class provides a default implementation for vector operations + * when the element type is not known to be a POD, as judged by IsPod. + */ +template <class T, size_t N, class AP, bool IsPod> +struct VectorImpl +{ + /* Destroys constructed objects in the range [begin, end). */ + static inline void destroy(T *begin, T *end) { + for (T *p = begin; p != end; ++p) + p->~T(); + } + + /* Constructs objects in the uninitialized range [begin, end). */ + static inline void initialize(T *begin, T *end) { + for (T *p = begin; p != end; ++p) + new(p) T(); + } + + /* + * Copy-constructs objects in the uninitialized range + * [dst, dst+(srcend-srcbeg)) from the range [srcbeg, srcend). + */ + template <class U> + static inline void copyConstruct(T *dst, const U *srcbeg, const U *srcend) { + for (const U *p = srcbeg; p != srcend; ++p, ++dst) + new(dst) T(*p); + } + + /* + * Move-constructs objects in the uninitialized range + * [dst, dst+(srcend-srcbeg)) from the range [srcbeg, srcend). + */ + template <class U> + static inline void moveConstruct(T *dst, const U *srcbeg, const U *srcend) { + for (const U *p = srcbeg; p != srcend; ++p, ++dst) + new(dst) T(Move(*p)); + } + + /* + * Copy-constructs objects in the uninitialized range [dst, dst+n) from the + * same object u. + */ + template <class U> + static inline void copyConstructN(T *dst, size_t n, const U &u) { + for (T *end = dst + n; dst != end; ++dst) + new(dst) T(u); + } + + /* + * Grows the given buffer to have capacity newCap, preserving the objects + * constructed in the range [begin, end) and updating v. Assumes that (1) + * newCap has not overflowed, and (2) multiplying newCap by sizeof(T) will + * not overflow. + */ + static inline bool growTo(Vector<T,N,AP> &v, size_t newCap) { + JS_ASSERT(!v.usingInlineStorage()); + JS_ASSERT(!CapacityHasExcessSpace<T>(newCap)); + T *newbuf = reinterpret_cast<T *>(v.malloc_(newCap * sizeof(T))); + if (!newbuf) + return false; + for (T *dst = newbuf, *src = v.beginNoCheck(); src != v.endNoCheck(); ++dst, ++src) + new(dst) T(Move(*src)); + VectorImpl::destroy(v.beginNoCheck(), v.endNoCheck()); + v.free_(v.mBegin); + v.mBegin = newbuf; + /* v.mLength is unchanged. */ + v.mCapacity = newCap; + return true; + } +}; + +/* + * This partial template specialization provides a default implementation for + * vector operations when the element type is known to be a POD, as judged by + * IsPod. + */ +template <class T, size_t N, class AP> +struct VectorImpl<T, N, AP, true> +{ + static inline void destroy(T *, T *) {} + + static inline void initialize(T *begin, T *end) { + /* + * You would think that memset would be a big win (or even break even) + * when we know T is a POD. But currently it's not. This is probably + * because |append| tends to be given small ranges and memset requires + * a function call that doesn't get inlined. + * + * memset(begin, 0, sizeof(T) * (end-begin)); + */ + for (T *p = begin; p != end; ++p) + new(p) T(); + } + + template <class U> + static inline void copyConstruct(T *dst, const U *srcbeg, const U *srcend) { + /* + * See above memset comment. Also, notice that copyConstruct is + * currently templated (T != U), so memcpy won't work without + * requiring T == U. + * + * memcpy(dst, srcbeg, sizeof(T) * (srcend - srcbeg)); + */ + for (const U *p = srcbeg; p != srcend; ++p, ++dst) + *dst = *p; + } + + template <class U> + static inline void moveConstruct(T *dst, const U *srcbeg, const U *srcend) { + copyConstruct(dst, srcbeg, srcend); + } + + static inline void copyConstructN(T *dst, size_t n, const T &t) { + for (T *p = dst, *end = dst + n; p != end; ++p) + *p = t; + } + + static inline bool growTo(Vector<T,N,AP> &v, size_t newCap) { + JS_ASSERT(!v.usingInlineStorage()); + JS_ASSERT(!CapacityHasExcessSpace<T>(newCap)); + size_t oldSize = sizeof(T) * v.mCapacity; + size_t newSize = sizeof(T) * newCap; + T *newbuf = reinterpret_cast<T *>(v.realloc_(v.mBegin, oldSize, newSize)); + if (!newbuf) + return false; + v.mBegin = newbuf; + /* v.mLength is unchanged. */ + v.mCapacity = newCap; + return true; + } +}; + +/* + * JS-friendly, STL-like container providing a short-lived, dynamic buffer. + * Vector calls the constructors/destructors of all elements stored in + * its internal buffer, so non-PODs may be safely used. Additionally, + * Vector will store the first N elements in-place before resorting to + * dynamic allocation. + * + * T requirements: + * - default and copy constructible, assignable, destructible + * - operations do not throw + * N requirements: + * - any value, however, N is clamped to min/max values + * AllocPolicy: + * - see "Allocation policies" in jsalloc.h (default js::TempAllocPolicy) + * + * N.B: Vector is not reentrant: T member functions called during Vector member + * functions must not call back into the same object. + */ +template <class T, size_t N, class AllocPolicy> +class Vector : private AllocPolicy +{ + // typedef typename tl::StaticAssert<!tl::IsPostBarrieredType<T>::result>::result _; + + /* utilities */ + + static const bool sElemIsPod = mozilla::IsPod<T>::value; + typedef VectorImpl<T, N, AllocPolicy, sElemIsPod> Impl; + friend struct VectorImpl<T, N, AllocPolicy, sElemIsPod>; + + bool growStorageBy(size_t incr); + bool convertToHeapStorage(size_t newCap); + + template <bool InitNewElems> inline bool growByImpl(size_t inc); + + /* magic constants */ + + static const int sMaxInlineBytes = 1024; + + /* compute constants */ + + /* + * Consider element size to be 1 for buffer sizing if there are + * 0 inline elements. This allows us to compile when the definition + * of the element type is not visible here. + * + * Explicit specialization is only allowed at namespace scope, so + * in order to keep everything here, we use a dummy template + * parameter with partial specialization. + */ + template <int M, int Dummy> + struct ElemSize { + static const size_t result = sizeof(T); + }; + template <int Dummy> + struct ElemSize<0, Dummy> { + static const size_t result = 1; + }; + + static const size_t sInlineCapacity = + tl::Min<N, sMaxInlineBytes / ElemSize<N, 0>::result>::result; + + /* Calculate inline buffer size; avoid 0-sized array. */ + static const size_t sInlineBytes = + tl::Max<1, sInlineCapacity * ElemSize<N, 0>::result>::result; + + /* member data */ + + /* + * Pointer to the buffer, be it inline or heap-allocated. Only [mBegin, + * mBegin + mLength) hold valid constructed T objects. The range [mBegin + + * mLength, mBegin + mCapacity) holds uninitialized memory. The range + * [mBegin + mLength, mBegin + mReserved) also holds uninitialized memory + * previously allocated by a call to reserve(). + */ + T *mBegin; + size_t mLength; /* Number of elements in the Vector. */ + size_t mCapacity; /* Max number of elements storable in the Vector without resizing. */ +#ifdef JS_DEBUG + size_t mReserved; /* Max elements of reserved or used space in this vector. */ +#endif + + mozilla::AlignedStorage<sInlineBytes> storage; + +#ifdef JS_DEBUG + friend class ReentrancyGuard; + bool entered; +#endif + + Vector(const Vector &) MOZ_DELETE; + Vector &operator=(const Vector &) MOZ_DELETE; + + /* private accessors */ + + bool usingInlineStorage() const { + return mBegin == inlineStorage(); + } + + T *inlineStorage() const { + return (T *)storage.addr(); + } + + T *beginNoCheck() const { + return mBegin; + } + + T *endNoCheck() { + return mBegin + mLength; + } + + const T *endNoCheck() const { + return mBegin + mLength; + } + +#ifdef JS_DEBUG + size_t reserved() const { + JS_ASSERT(mReserved <= mCapacity); + JS_ASSERT(mLength <= mReserved); + return mReserved; + } +#endif + + /* Append operations guaranteed to succeed due to pre-reserved space. */ + template <class U> void internalAppend(U u); + void internalAppendN(const T &t, size_t n); + template <class U> void internalAppend(const U *begin, size_t length); + template <class U, size_t O, class BP> void internalAppend(const Vector<U,O,BP> &other); + + public: + static const size_t sMaxInlineStorage = N; + + typedef T ElementType; + + Vector(AllocPolicy = AllocPolicy()); + Vector(MoveRef<Vector>); /* Move constructor. */ + Vector &operator=(MoveRef<Vector>); /* Move assignment. */ + ~Vector(); + + /* accessors */ + + const AllocPolicy &allocPolicy() const { + return *this; + } + + AllocPolicy &allocPolicy() { + return *this; + } + + enum { InlineLength = N }; + + size_t length() const { + return mLength; + } + + bool empty() const { + return mLength == 0; + } + + size_t capacity() const { + return mCapacity; + } + + T *begin() { + JS_ASSERT(!entered); + return mBegin; + } + + const T *begin() const { + JS_ASSERT(!entered); + return mBegin; + } + + T *end() { + JS_ASSERT(!entered); + return mBegin + mLength; + } + + const T *end() const { + JS_ASSERT(!entered); + return mBegin + mLength; + } + + T &operator[](size_t i) { + JS_ASSERT(!entered && i < mLength); + return begin()[i]; + } + + const T &operator[](size_t i) const { + JS_ASSERT(!entered && i < mLength); + return begin()[i]; + } + + T &back() { + JS_ASSERT(!entered && !empty()); + return *(end() - 1); + } + + const T &back() const { + JS_ASSERT(!entered && !empty()); + return *(end() - 1); + } + + class Range { + friend class Vector; + T *cur_, *end_; + Range(T *cur, T *end) : cur_(cur), end_(end) {} + public: + Range() {} + bool empty() const { return cur_ == end_; } + size_t remain() const { return end_ - cur_; } + T &front() const { return *cur_; } + void popFront() { JS_ASSERT(!empty()); ++cur_; } + T popCopyFront() { JS_ASSERT(!empty()); return *cur_++; } + }; + + Range all() { + return Range(begin(), end()); + } + + /* mutators */ + + /* Given that the Vector is empty and has no inline storage, grow to |capacity|. */ + bool initCapacity(size_t request); + + /* If reserve(length() + N) succeeds, the N next appends are guaranteed to succeed. */ + bool reserve(size_t request); + + /* + * Destroy elements in the range [end() - incr, end()). Does not deallocate + * or unreserve storage for those elements. + */ + void shrinkBy(size_t incr); + + /* Grow the vector by incr elements. */ + bool growBy(size_t incr); + + /* Call shrinkBy or growBy based on whether newSize > length(). */ + bool resize(size_t newLength); + + /* Leave new elements as uninitialized memory. */ + bool growByUninitialized(size_t incr); + bool resizeUninitialized(size_t newLength); + + /* Shorthand for shrinkBy(length()). */ + void clear(); + + /* Clears and releases any heap-allocated storage. */ + void clearAndFree(); + + /* If true, appending |needed| elements will not call realloc(). */ + bool canAppendWithoutRealloc(size_t needed) const; + + /* + * Potentially fallible append operations. + * + * The function templates that take an unspecified type U require a + * const T & or a MoveRef<T>. The MoveRef<T> variants move their + * operands into the vector, instead of copying them. If they fail, the + * operand is left unmoved. + */ + template <class U> bool append(U t); + bool appendN(const T &t, size_t n); + template <class U> bool append(const U *begin, const U *end); + template <class U> bool append(const U *begin, size_t length); + template <class U, size_t O, class BP> bool append(const Vector<U,O,BP> &other); + + /* + * Guaranteed-infallible append operations for use upon vectors whose + * memory has been pre-reserved. + */ + template <class U> void infallibleAppend(const U &u) { + internalAppend(u); + } + void infallibleAppendN(const T &t, size_t n) { + internalAppendN(t, n); + } + template <class U> void infallibleAppend(const U *aBegin, const U *aEnd) { + internalAppend(aBegin, mozilla::PointerRangeSize(aBegin, aEnd)); + } + template <class U> void infallibleAppend(const U *aBegin, size_t aLength) { + internalAppend(aBegin, aLength); + } + template <class U, size_t O, class BP> void infallibleAppend(const Vector<U,O,BP> &other) { + internalAppend(other); + } + + void popBack(); + + T popCopy(); + + /* + * Transfers ownership of the internal buffer used by Vector to the caller. + * After this call, the Vector is empty. Since the returned buffer may need + * to be allocated (if the elements are currently stored in-place), the + * call can fail, returning NULL. + * + * N.B. Although a T*, only the range [0, length()) is constructed. + */ + T *extractRawBuffer(); + + /* + * Transfer ownership of an array of objects into the Vector. + * N.B. This call assumes that there are no uninitialized elements in the + * passed array. + */ + void replaceRawBuffer(T *p, size_t length); + + /* + * Places |val| at position |p|, shifting existing elements from |p| + * onward one position higher. On success, |p| should not be reused + * because it will be a dangling pointer if reallocation of the vector + * storage occurred; the return value should be used instead. On failure, + * NULL is returned. + * + * Example usage: + * + * if (!(p = vec.insert(p, val))) + * <handle failure> + * <keep working with p> + */ + T *insert(T *p, const T &val); + + /* + * Removes the element |t|, which must fall in the bounds [begin, end), + * shifting existing elements from |t + 1| onward one position lower. + */ + void erase(T *t); + + /* + * Measure the size of the Vector's heap-allocated storage. + */ + size_t sizeOfExcludingThis(JSMallocSizeOfFun mallocSizeOf) const; + + /* + * Like sizeOfExcludingThis, but also measures the size of the Vector + * object (which must be heap-allocated) itself. + */ + size_t sizeOfIncludingThis(JSMallocSizeOfFun mallocSizeOf) const; + + void swap(Vector &other); +}; + +/* This does the re-entrancy check plus several other sanity checks. */ +#define REENTRANCY_GUARD_ET_AL \ + ReentrancyGuard g(*this); \ + JS_ASSERT_IF(usingInlineStorage(), mCapacity == sInlineCapacity); \ + JS_ASSERT(reserved() <= mCapacity); \ + JS_ASSERT(mLength <= reserved()); \ + JS_ASSERT(mLength <= mCapacity) + +/* Vector Implementation */ + +template <class T, size_t N, class AllocPolicy> +JS_ALWAYS_INLINE +Vector<T,N,AllocPolicy>::Vector(AllocPolicy ap) + : AllocPolicy(ap), mBegin((T *)storage.addr()), mLength(0), + mCapacity(sInlineCapacity) +#ifdef JS_DEBUG + , mReserved(sInlineCapacity), entered(false) +#endif +{} + +/* Move constructor. */ +template <class T, size_t N, class AllocPolicy> +JS_ALWAYS_INLINE +Vector<T, N, AllocPolicy>::Vector(MoveRef<Vector> rhs) + : AllocPolicy(rhs) +#ifdef JS_DEBUG + , entered(false) +#endif +{ + mLength = rhs->mLength; + mCapacity = rhs->mCapacity; +#ifdef JS_DEBUG + mReserved = rhs->mReserved; +#endif + + if (rhs->usingInlineStorage()) { + /* We can't move the buffer over in this case, so copy elements. */ + mBegin = (T *)storage.addr(); + Impl::moveConstruct(mBegin, rhs->beginNoCheck(), rhs->endNoCheck()); + /* + * Leave rhs's mLength, mBegin, mCapacity, and mReserved as they are. + * The elements in its in-line storage still need to be destroyed. + */ + } else { + /* + * Take src's buffer, and turn src into an empty vector using + * in-line storage. + */ + mBegin = rhs->mBegin; + rhs->mBegin = (T *) rhs->storage.addr(); + rhs->mCapacity = sInlineCapacity; + rhs->mLength = 0; +#ifdef JS_DEBUG + rhs->mReserved = sInlineCapacity; +#endif + } +} + +/* Move assignment. */ +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE +Vector<T, N, AP> & +Vector<T, N, AP>::operator=(MoveRef<Vector> rhs) +{ + this->~Vector(); + new(this) Vector(rhs); + return *this; +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE +Vector<T,N,AP>::~Vector() +{ + REENTRANCY_GUARD_ET_AL; + Impl::destroy(beginNoCheck(), endNoCheck()); + if (!usingInlineStorage()) + this->free_(beginNoCheck()); +} + +/* + * This function will create a new heap buffer with capacity newCap, + * move all elements in the inline buffer to this new buffer, + * and fail on OOM. + */ +template <class T, size_t N, class AP> +inline bool +Vector<T,N,AP>::convertToHeapStorage(size_t newCap) +{ + JS_ASSERT(usingInlineStorage()); + + /* Allocate buffer. */ + JS_ASSERT(!CapacityHasExcessSpace<T>(newCap)); + T *newBuf = reinterpret_cast<T *>(this->malloc_(newCap * sizeof(T))); + if (!newBuf) + return false; + + /* Copy inline elements into heap buffer. */ + Impl::moveConstruct(newBuf, beginNoCheck(), endNoCheck()); + Impl::destroy(beginNoCheck(), endNoCheck()); + + /* Switch in heap buffer. */ + mBegin = newBuf; + /* mLength is unchanged. */ + mCapacity = newCap; + return true; +} + +template <class T, size_t N, class AP> +JS_NEVER_INLINE bool +Vector<T,N,AP>::growStorageBy(size_t incr) +{ + JS_ASSERT(mLength + incr > mCapacity); + JS_ASSERT_IF(!usingInlineStorage(), !CapacityHasExcessSpace<T>(mCapacity)); + + /* + * When choosing a new capacity, its size should is as close to 2^N bytes + * as possible. 2^N-sized requests are best because they are unlikely to + * be rounded up by the allocator. Asking for a 2^N number of elements + * isn't as good, because if sizeof(T) is not a power-of-two that would + * result in a non-2^N request size. + */ + + size_t newCap; + + if (incr == 1) { + if (usingInlineStorage()) { + /* This case occurs in ~70--80% of the calls to this function. */ + size_t newSize = tl::RoundUpPow2<(sInlineCapacity + 1) * sizeof(T)>::result; + newCap = newSize / sizeof(T); + goto convert; + } + + if (mLength == 0) { + /* This case occurs in ~0--10% of the calls to this function. */ + newCap = 1; + goto grow; + } + + /* This case occurs in ~15--20% of the calls to this function. */ + + /* + * Will mLength*4*sizeof(T) overflow? This condition limits a Vector + * to 1GB of memory on a 32-bit system, which is a reasonable limit. + * It also ensures that the ((char *)end() - (char *)begin()) does not + * overflow ptrdiff_t (see Bug 510319). + */ + if (mLength & tl::MulOverflowMask<4 * sizeof(T)>::result) { + this->reportAllocOverflow(); + return false; + } + + /* + * If we reach here, the existing capacity will have a size that is + * already as close to 2^N as sizeof(T) will allow. Just double the + * capacity, and then there might be space for one more element. + */ + newCap = mLength * 2; + if (CapacityHasExcessSpace<T>(newCap)) + newCap += 1; + + } else { + /* This case occurs in ~2% of the calls to this function. */ + size_t newMinCap = mLength + incr; + + /* Did mLength+incr overflow? Will newCap*sizeof(T) overflow? */ + if (newMinCap < mLength || + newMinCap & tl::MulOverflowMask<2 * sizeof(T)>::result) + { + this->reportAllocOverflow(); + return false; + } + + size_t newMinSize = newMinCap * sizeof(T); + size_t newSize = RoundUpPow2(newMinSize); + newCap = newSize / sizeof(T); + } + + if (usingInlineStorage()) { + convert: + return convertToHeapStorage(newCap); + } + + grow: + return Impl::growTo(*this, newCap); +} + +template <class T, size_t N, class AP> +inline bool +Vector<T,N,AP>::initCapacity(size_t request) +{ + JS_ASSERT(empty()); + JS_ASSERT(usingInlineStorage()); + if (request == 0) + return true; + T *newbuf = reinterpret_cast<T *>(this->malloc_(request * sizeof(T))); + if (!newbuf) + return false; + mBegin = newbuf; + mCapacity = request; +#ifdef JS_DEBUG + mReserved = request; +#endif + return true; +} + +template <class T, size_t N, class AP> +inline bool +Vector<T,N,AP>::reserve(size_t request) +{ + REENTRANCY_GUARD_ET_AL; + if (request > mCapacity && !growStorageBy(request - mLength)) + return false; + +#ifdef JS_DEBUG + if (request > mReserved) + mReserved = request; + JS_ASSERT(mLength <= mReserved); + JS_ASSERT(mReserved <= mCapacity); +#endif + return true; +} + +template <class T, size_t N, class AP> +inline void +Vector<T,N,AP>::shrinkBy(size_t incr) +{ + REENTRANCY_GUARD_ET_AL; + JS_ASSERT(incr <= mLength); + Impl::destroy(endNoCheck() - incr, endNoCheck()); + mLength -= incr; +} + +template <class T, size_t N, class AP> +template <bool InitNewElems> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::growByImpl(size_t incr) +{ + REENTRANCY_GUARD_ET_AL; + if (incr > mCapacity - mLength && !growStorageBy(incr)) + return false; + + JS_ASSERT(mLength + incr <= mCapacity); + T *newend = endNoCheck() + incr; + if (InitNewElems) + Impl::initialize(endNoCheck(), newend); + mLength += incr; +#ifdef JS_DEBUG + if (mLength > mReserved) + mReserved = mLength; +#endif + return true; +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::growBy(size_t incr) +{ + return growByImpl<true>(incr); +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::growByUninitialized(size_t incr) +{ + return growByImpl<false>(incr); +} + +template <class T, size_t N, class AP> +STATIC_POSTCONDITION(!return || ubound(this->begin()) >= newLength) +inline bool +Vector<T,N,AP>::resize(size_t newLength) +{ + size_t curLength = mLength; + if (newLength > curLength) + return growBy(newLength - curLength); + shrinkBy(curLength - newLength); + return true; +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::resizeUninitialized(size_t newLength) +{ + size_t curLength = mLength; + if (newLength > curLength) + return growByUninitialized(newLength - curLength); + shrinkBy(curLength - newLength); + return true; +} + +template <class T, size_t N, class AP> +inline void +Vector<T,N,AP>::clear() +{ + REENTRANCY_GUARD_ET_AL; + Impl::destroy(beginNoCheck(), endNoCheck()); + mLength = 0; +} + +template <class T, size_t N, class AP> +inline void +Vector<T,N,AP>::clearAndFree() +{ + clear(); + + if (usingInlineStorage()) + return; + + this->free_(beginNoCheck()); + mBegin = (T *)storage.addr(); + mCapacity = sInlineCapacity; +#ifdef JS_DEBUG + mReserved = sInlineCapacity; +#endif +} + +template <class T, size_t N, class AP> +inline bool +Vector<T,N,AP>::canAppendWithoutRealloc(size_t needed) const +{ + return mLength + needed <= mCapacity; +} + +template <class T, size_t N, class AP> +template <class U> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::append(U t) +{ + REENTRANCY_GUARD_ET_AL; + if (mLength == mCapacity && !growStorageBy(1)) + return false; + +#ifdef JS_DEBUG + if (mLength + 1 > mReserved) + mReserved = mLength + 1; +#endif + internalAppend(t); + return true; +} + +template <class T, size_t N, class AP> +template <class U> +JS_ALWAYS_INLINE void +Vector<T,N,AP>::internalAppend(U u) +{ + JS_ASSERT(mLength + 1 <= mReserved); + JS_ASSERT(mReserved <= mCapacity); + new(endNoCheck()) T(u); + ++mLength; +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::appendN(const T &t, size_t needed) +{ + REENTRANCY_GUARD_ET_AL; + if (mLength + needed > mCapacity && !growStorageBy(needed)) + return false; + +#ifdef JS_DEBUG + if (mLength + needed > mReserved) + mReserved = mLength + needed; +#endif + internalAppendN(t, needed); + return true; +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE void +Vector<T,N,AP>::internalAppendN(const T &t, size_t needed) +{ + JS_ASSERT(mLength + needed <= mReserved); + JS_ASSERT(mReserved <= mCapacity); + Impl::copyConstructN(endNoCheck(), needed, t); + mLength += needed; +} + +template <class T, size_t N, class AP> +inline T * +Vector<T,N,AP>::insert(T *p, const T &val) +{ + JS_ASSERT(begin() <= p && p <= end()); + size_t pos = p - begin(); + JS_ASSERT(pos <= mLength); + size_t oldLength = mLength; + if (pos == oldLength) { + if (!append(val)) + return NULL; + } else { + T oldBack = back(); + if (!append(oldBack)) /* Dup the last element. */ + return NULL; + for (size_t i = oldLength; i > pos; --i) + (*this)[i] = (*this)[i - 1]; + (*this)[pos] = val; + } + return begin() + pos; +} + +template<typename T, size_t N, class AP> +inline void +Vector<T,N,AP>::erase(T *it) +{ + JS_ASSERT(begin() <= it && it < end()); + while (it + 1 != end()) { + *it = *(it + 1); + ++it; + } + popBack(); +} + +template <class T, size_t N, class AP> +template <class U> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::append(const U *insBegin, const U *insEnd) +{ + REENTRANCY_GUARD_ET_AL; + size_t needed = mozilla::PointerRangeSize(insBegin, insEnd); + if (mLength + needed > mCapacity && !growStorageBy(needed)) + return false; + +#ifdef JS_DEBUG + if (mLength + needed > mReserved) + mReserved = mLength + needed; +#endif + internalAppend(insBegin, needed); + return true; +} + +template <class T, size_t N, class AP> +template <class U> +JS_ALWAYS_INLINE void +Vector<T,N,AP>::internalAppend(const U *insBegin, size_t insLength) +{ + JS_ASSERT(mLength + insLength <= mReserved); + JS_ASSERT(mReserved <= mCapacity); + Impl::copyConstruct(endNoCheck(), insBegin, insBegin + insLength); + mLength += insLength; +} + +template <class T, size_t N, class AP> +template <class U, size_t O, class BP> +inline bool +Vector<T,N,AP>::append(const Vector<U,O,BP> &other) +{ + return append(other.begin(), other.end()); +} + +template <class T, size_t N, class AP> +template <class U, size_t O, class BP> +inline void +Vector<T,N,AP>::internalAppend(const Vector<U,O,BP> &other) +{ + internalAppend(other.begin(), other.length()); +} + +template <class T, size_t N, class AP> +template <class U> +JS_ALWAYS_INLINE bool +Vector<T,N,AP>::append(const U *insBegin, size_t insLength) +{ + return this->append(insBegin, insBegin + insLength); +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE void +Vector<T,N,AP>::popBack() +{ + REENTRANCY_GUARD_ET_AL; + JS_ASSERT(!empty()); + --mLength; + endNoCheck()->~T(); +} + +template <class T, size_t N, class AP> +JS_ALWAYS_INLINE T +Vector<T,N,AP>::popCopy() +{ + T ret = back(); + popBack(); + return ret; +} + +template <class T, size_t N, class AP> +inline T * +Vector<T,N,AP>::extractRawBuffer() +{ + T *ret; + if (usingInlineStorage()) { + ret = reinterpret_cast<T *>(this->malloc_(mLength * sizeof(T))); + if (!ret) + return NULL; + Impl::copyConstruct(ret, beginNoCheck(), endNoCheck()); + Impl::destroy(beginNoCheck(), endNoCheck()); + /* mBegin, mCapacity are unchanged. */ + mLength = 0; + } else { + ret = mBegin; + mBegin = (T *)storage.addr(); + mLength = 0; + mCapacity = sInlineCapacity; +#ifdef JS_DEBUG + mReserved = sInlineCapacity; +#endif + } + return ret; +} + +template <class T, size_t N, class AP> +inline void +Vector<T,N,AP>::replaceRawBuffer(T *p, size_t aLength) +{ + REENTRANCY_GUARD_ET_AL; + + /* Destroy what we have. */ + Impl::destroy(beginNoCheck(), endNoCheck()); + if (!usingInlineStorage()) + this->free_(beginNoCheck()); + + /* Take in the new buffer. */ + if (aLength <= sInlineCapacity) { + /* + * We convert to inline storage if possible, even though p might + * otherwise be acceptable. Maybe this behaviour should be + * specifiable with an argument to this function. + */ + mBegin = (T *)storage.addr(); + mLength = aLength; + mCapacity = sInlineCapacity; + Impl::moveConstruct(mBegin, p, p + aLength); + Impl::destroy(p, p + aLength); + this->free_(p); + } else { + mBegin = p; + mLength = aLength; + mCapacity = aLength; + } +#ifdef JS_DEBUG + mReserved = aLength; +#endif +} + +template <class T, size_t N, class AP> +inline size_t +Vector<T,N,AP>::sizeOfExcludingThis(JSMallocSizeOfFun mallocSizeOf) const +{ + return usingInlineStorage() ? 0 : mallocSizeOf(beginNoCheck()); +} + +template <class T, size_t N, class AP> +inline size_t +Vector<T,N,AP>::sizeOfIncludingThis(JSMallocSizeOfFun mallocSizeOf) const +{ + return mallocSizeOf(this) + sizeOfExcludingThis(mallocSizeOf); +} + +template <class T, size_t N, class AP> +inline void +Vector<T,N,AP>::swap(Vector &other) +{ + // TODO Implement N != 0 + JS_STATIC_ASSERT(N == 0); + + // This only works when inline storage is always empty. + if (!usingInlineStorage() && other.usingInlineStorage()) { + other.mBegin = mBegin; + mBegin = inlineStorage(); + } else if (usingInlineStorage() && !other.usingInlineStorage()) { + mBegin = other.mBegin; + other.mBegin = other.inlineStorage(); + } else if (!usingInlineStorage() && !other.usingInlineStorage()) { + Swap(mBegin, other.mBegin); + } else { + // This case is a no-op, since we'd set both to use their inline storage. + } + + Swap(mLength, other.mLength); + Swap(mCapacity, other.mCapacity); +#ifdef JS_DEBUG + Swap(mReserved, other.mReserved); +#endif +} + +} /* namespace js */ + +#ifdef _MSC_VER +#pragma warning(pop) +#endif + +#endif /* js_Vector_h */ |