diff options
author | Rebecca Turner <me@re-becca.org> | 2016-01-28 18:11:35 -0800 |
---|---|---|
committer | Jeremiah Senkpiel <fishrock123@rocketmail.com> | 2016-02-01 10:43:34 -0500 |
commit | 76cb81b354de8447898427619c66c86c59b22b3d (patch) | |
tree | 0c0826bed77086fb38cda8dc680d4fb10d2cff25 /deps/npm/node_modules/node-gyp | |
parent | d5d301f3032a0723f5a29cfbe0d95ac4ad205d42 (diff) | |
download | node-new-76cb81b354de8447898427619c66c86c59b22b3d.tar.gz |
deps: upgrade npm to 3.6.0
PR-URL: https://github.com/nodejs/node/pull/4958
Reviewed-By: Myles Borins <mborins@us.ibm.com>
Reviewed-By: Kat Marchán <kzm@sykosomatic.org>
Reviewed-By: James M Snell <jasnell@gmail.com>
Reviewed-By: Jeremiah Senkpiel <fishrock123@rocketmail.com>
Diffstat (limited to 'deps/npm/node_modules/node-gyp')
1001 files changed, 20991 insertions, 7104 deletions
diff --git a/deps/npm/node_modules/node-gyp/CHANGELOG.md b/deps/npm/node_modules/node-gyp/CHANGELOG.md index 4c8cc36781..a0193adf0c 100644 --- a/deps/npm/node_modules/node-gyp/CHANGELOG.md +++ b/deps/npm/node_modules/node-gyp/CHANGELOG.md @@ -1,3 +1,13 @@ +v3.1.0 2015-11-14 + +* [[`9049241f91`](https://github.com/nodejs/node-gyp/commit/9049241f91)] - **gyp**: don't use links at all, just copy the files instead (Nathan Zadoks) +* [[`8ef90348d1`](https://github.com/nodejs/node-gyp/commit/8ef90348d1)] - **gyp**: apply https://codereview.chromium.org/11361103/ (Nathan Rajlich) +* [[`a2ed0df84e`](https://github.com/nodejs/node-gyp/commit/a2ed0df84e)] - **gyp**: always install into $PRODUCT_DIR (Nathan Rajlich) +* [[`cc8b2fa83e`](https://github.com/nodejs/node-gyp/commit/cc8b2fa83e)] - Update gyp to b3cef02. (Imran Iqbal) [#781](https://github.com/nodejs/node-gyp/pull/781) +* [[`f5d86eb84e`](https://github.com/nodejs/node-gyp/commit/f5d86eb84e)] - Update to tar@2.0.0. (Edgar Muentes) [#797](https://github.com/nodejs/node-gyp/pull/797) +* [[`2ac7de02c4`](https://github.com/nodejs/node-gyp/commit/2ac7de02c4)] - Fix infinite loop with zero-length options. (Ben Noordhuis) [#745](https://github.com/nodejs/node-gyp/pull/745) +* [[`101bed639b`](https://github.com/nodejs/node-gyp/commit/101bed639b)] - This platform value came from debian package, and now the value (Jérémy Lal) [#738](https://github.com/nodejs/node-gyp/pull/738) + v3.0.3 2015-09-14 * [[`ad827cda30`](https://github.com/nodejs/node-gyp/commit/ad827cda30)] - tarballUrl global and && when checking for iojs (Lars-Magnus Skog) [#729](https://github.com/nodejs/node-gyp/pull/729) diff --git a/deps/npm/node_modules/node-gyp/README.md b/deps/npm/node_modules/node-gyp/README.md index 779dc6adc2..dec739f16f 100644 --- a/deps/npm/node_modules/node-gyp/README.md +++ b/deps/npm/node_modules/node-gyp/README.md @@ -38,11 +38,11 @@ You will also need to install: * A proper C/C++ compiler toolchain, like [GCC](https://gcc.gnu.org) * On Mac OS X: * `python` (`v2.7` recommended, `v3.x.x` is __*not*__ supported) (already installed on Mac OS X) - * [Xcode](https://developer.apple.com/xcode/downloads/) + * [Xcode](https://developer.apple.com/xcode/download/) * You also need to install the `Command Line Tools` via Xcode. You can find this under the menu `Xcode -> Preferences -> Downloads` * This step will install `gcc` and the related toolchain containing `make` * On Windows: - * [Python][windows-python] ([`v2.7.3`][windows-python-v2.7.3] recommended, `v3.x.x` is __*not*__ supported) + * Python ([`v2.7.10`][python-v2.7.10] recommended, `v3.x.x` is __*not*__ supported) * Make sure that you have a PYTHON environment variable, and it is set to drive:\path\to\python.exe not to a folder * Windows XP/Vista/7: * Microsoft Visual Studio C++ 2013 ([Express][msvc2013] version works well) @@ -50,6 +50,14 @@ You will also need to install: * If you get errors that the 64-bit compilers are not installed you may also need the [compiler update for the Windows SDK 7.1] * Windows 7/8: * Microsoft Visual Studio C++ 2013 for Windows Desktop ([Express][msvc2013] version works well) + * Windows 10: + * Install the latest version of npm (3.3.6 at the time of writing) + * Install Python 2.7 from https://www.python.org/download/releases/2.7/ and make sure its on the System Path + * Install Visual Studio Community 2015 Edition. (Custom Install, Select Visual C++ during the installation) + * Set the environment variable GYP_MSVS_VERSION=2015 + * Run the command prompt as Administrator + * $ npm install (--msvs_version=2015) <-- Shouldn't be needed if you have set GYP_MSVS_VERSION env + * If the above steps have not worked or you are unsure please visit http://www.serverpals.com/blog/building-using-node-gyp-with-visual-studio-express-2015-on-windows-10-pro-x64 for a full walkthrough * All Windows Versions * For 64-bit builds of node and native modules you will _**also**_ need the [Windows 7 64-bit SDK][win7sdk] * You may need to run one of the following commands if your build complains about WindowsSDKDir not being set, and you are sure you have already installed the SDK: @@ -136,9 +144,9 @@ A barebones `gyp` file appropriate for building a node addon looks like: Some additional resources for addons and writing `gyp` files: * ["Going Native" a nodeschool.io tutorial](http://nodeschool.io/#goingnative) - * ["Hello World" node addon example](https://github.com/joyent/node/tree/master/test/addons/hello-world) - * [gyp user documentation](https://chromium.googlesource.com/external/gyp/+/master/docs/UserDocumentation.md) - * [gyp input format reference](https://chromium.googlesource.com/external/gyp/+/master/docs/InputFormatReference.md) + * ["Hello World" node addon example](https://github.com/nodejs/node/tree/master/test/addons/hello-world) + * [gyp user documentation](https://gyp.gsrc.io/docs/UserDocumentation.md) + * [gyp input format reference](https://gyp.gsrc.io/docs/InputFormatReference.md) * [*"binding.gyp" files out in the wild* wiki page](https://github.com/nodejs/node-gyp/wiki/%22binding.gyp%22-files-out-in-the-wild) @@ -185,8 +193,7 @@ TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. -[windows-python]: http://www.python.org/getit/windows -[windows-python-v2.7.3]: http://www.python.org/download/releases/2.7.3#download -[msvc2013]: http://www.microsoft.com/en-gb/download/details.aspx?id=44914 -[win7sdk]: http://www.microsoft.com/en-us/download/details.aspx?id=8279 -[compiler update for the Windows SDK 7.1]: http://www.microsoft.com/en-us/download/details.aspx?id=4422 +[python-v2.7.10]: https://www.python.org/downloads/release/python-2710/ +[msvc2013]: https://www.microsoft.com/en-gb/download/details.aspx?id=44914 +[win7sdk]: https://www.microsoft.com/en-us/download/details.aspx?id=8279 +[compiler update for the Windows SDK 7.1]: https://www.microsoft.com/en-us/download/details.aspx?id=4422 diff --git a/deps/npm/node_modules/node-gyp/addon.gypi b/deps/npm/node_modules/node-gyp/addon.gypi index 510b00c713..3372bfa521 100644 --- a/deps/npm/node_modules/node-gyp/addon.gypi +++ b/deps/npm/node_modules/node-gyp/addon.gypi @@ -65,6 +65,11 @@ 'DYLIB_INSTALL_NAME_BASE': '@rpath' }, }], + [ 'OS=="aix"', { + 'ldflags': [ + '-Wl,-bimport:<(node_exp_file)' + ], + }], [ 'OS=="win"', { 'libraries': [ '-lkernel32.lib', diff --git a/deps/npm/node_modules/node-gyp/gyp/AUTHORS b/deps/npm/node_modules/node-gyp/gyp/AUTHORS index 9389ca0a23..fecf84a1c4 100644 --- a/deps/npm/node_modules/node-gyp/gyp/AUTHORS +++ b/deps/npm/node_modules/node-gyp/gyp/AUTHORS @@ -9,3 +9,4 @@ Steven Knight <knight@baldmt.com> Ryan Norton <rnorton10@gmail.com> David J. Sankel <david@sankelsoftware.com> Eric N. Vander Weele <ericvw@gmail.com> +Tom Freudenberg <th.freudenberg@gmail.com> diff --git a/deps/npm/node_modules/node-gyp/gyp/PRESUBMIT.py b/deps/npm/node_modules/node-gyp/gyp/PRESUBMIT.py index abec27b3e3..dde025383c 100644 --- a/deps/npm/node_modules/node-gyp/gyp/PRESUBMIT.py +++ b/deps/npm/node_modules/node-gyp/gyp/PRESUBMIT.py @@ -125,15 +125,13 @@ def CheckChangeOnCommit(input_api, output_api): TRYBOTS = [ - 'gyp-win32', - 'gyp-win64', - 'gyp-linux', - 'gyp-mac', - 'gyp-android' + 'linux_try', + 'mac_try', + 'win_try', ] def GetPreferredTryMasters(_, change): return { - 'tryserver.nacl': { t: set(['defaulttests']) for t in TRYBOTS }, + 'client.gyp': { t: set(['defaulttests']) for t in TRYBOTS }, } diff --git a/deps/npm/node_modules/node-gyp/gyp/buildbot/buildbot_run.py b/deps/npm/node_modules/node-gyp/gyp/buildbot/buildbot_run.py index f46ab1822f..9a2b71f1b3 100755 --- a/deps/npm/node_modules/node-gyp/gyp/buildbot/buildbot_run.py +++ b/deps/npm/node_modules/node-gyp/gyp/buildbot/buildbot_run.py @@ -3,27 +3,17 @@ # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. - """Argument-less script to select what to run on the buildbots.""" - -import filecmp import os import shutil import subprocess import sys -if sys.platform in ['win32', 'cygwin']: - EXE_SUFFIX = '.exe' -else: - EXE_SUFFIX = '' - - BUILDBOT_DIR = os.path.dirname(os.path.abspath(__file__)) TRUNK_DIR = os.path.dirname(BUILDBOT_DIR) ROOT_DIR = os.path.dirname(TRUNK_DIR) -ANDROID_DIR = os.path.join(ROOT_DIR, 'android') CMAKE_DIR = os.path.join(ROOT_DIR, 'cmake') CMAKE_BIN_DIR = os.path.join(CMAKE_DIR, 'bin') OUT_DIR = os.path.join(TRUNK_DIR, 'out') @@ -71,95 +61,6 @@ def PrepareCmake(): CallSubProcess( ['make', 'cmake'], cwd=CMAKE_DIR) -_ANDROID_SETUP = 'source build/envsetup.sh && lunch full-eng' - - -def PrepareAndroidTree(): - """Prepare an Android tree to run 'android' format tests.""" - if os.environ['BUILDBOT_CLOBBER'] == '1': - print '@@@BUILD_STEP Clobber Android checkout@@@' - shutil.rmtree(ANDROID_DIR) - - # (Re)create the directory so that the following steps will succeed. - if not os.path.isdir(ANDROID_DIR): - os.mkdir(ANDROID_DIR) - - # We use a manifest from the gyp project listing pinned revisions of AOSP to - # use, to ensure that we test against a stable target. This needs to be - # updated to pick up new build system changes sometimes, so we must test if - # it has changed. - manifest_filename = 'aosp_manifest.xml' - gyp_manifest = os.path.join(BUILDBOT_DIR, manifest_filename) - android_manifest = os.path.join(ANDROID_DIR, '.repo', 'manifests', - manifest_filename) - manifest_is_current = (os.path.isfile(android_manifest) and - filecmp.cmp(gyp_manifest, android_manifest)) - if not manifest_is_current: - # It's safe to repeat these steps, so just do them again to make sure we are - # in a good state. - print '@@@BUILD_STEP Initialize Android checkout@@@' - CallSubProcess( - ['repo', 'init', - '-u', 'https://android.googlesource.com/platform/manifest', - '-b', 'master', - '-g', 'all,-notdefault,-device,-darwin,-mips,-x86'], - cwd=ANDROID_DIR) - shutil.copy(gyp_manifest, android_manifest) - - print '@@@BUILD_STEP Sync Android@@@' - CallSubProcess(['repo', 'sync', '-j4', '-m', manifest_filename], - cwd=ANDROID_DIR) - - # If we already built the system image successfully and didn't sync to a new - # version of the source, skip running the build again as it's expensive even - # when there's nothing to do. - system_img = os.path.join(ANDROID_DIR, 'out', 'target', 'product', 'generic', - 'system.img') - if manifest_is_current and os.path.isfile(system_img): - return - - print '@@@BUILD_STEP Build Android@@@' - CallSubProcess( - ['/bin/bash', - '-c', '%s && make -j4' % _ANDROID_SETUP], - cwd=ANDROID_DIR) - - -def StartAndroidEmulator(): - """Start an android emulator from the built android tree.""" - print '@@@BUILD_STEP Start Android emulator@@@' - - CallSubProcess(['/bin/bash', '-c', - '%s && adb kill-server ' % _ANDROID_SETUP], - cwd=ANDROID_DIR) - - # If taskset is available, use it to force adbd to run only on one core, as, - # sadly, it improves its reliability (see crbug.com/268450). - adbd_wrapper = '' - with open(os.devnull, 'w') as devnull_fd: - if subprocess.call(['which', 'taskset'], stdout=devnull_fd) == 0: - adbd_wrapper = 'taskset -c 0' - CallSubProcess(['/bin/bash', '-c', - '%s && %s adb start-server ' % (_ANDROID_SETUP, adbd_wrapper)], - cwd=ANDROID_DIR) - - subprocess.Popen( - ['/bin/bash', '-c', - '%s && emulator -no-window' % _ANDROID_SETUP], - cwd=ANDROID_DIR) - CallSubProcess( - ['/bin/bash', '-c', - '%s && adb wait-for-device' % _ANDROID_SETUP], - cwd=ANDROID_DIR) - - -def StopAndroidEmulator(): - """Stop all android emulators.""" - print '@@@BUILD_STEP Stop Android emulator@@@' - # If this fails, it's because there is no emulator running. - subprocess.call(['pkill', 'emulator.*']) - - def GypTestFormat(title, format=None, msvs_version=None, tests=[]): """Run the gyp tests for a given format, emitting annotator tags. @@ -185,15 +86,7 @@ def GypTestFormat(title, format=None, msvs_version=None, tests=[]): '--format', format, '--path', CMAKE_BIN_DIR, '--chdir', 'gyp'] + tests) - if format == 'android': - # gyptest needs the environment setup from envsetup/lunch in order to build - # using the 'android' backend, so this is done in a single shell. - retcode = subprocess.call( - ['/bin/bash', - '-c', '%s && cd %s && %s' % (_ANDROID_SETUP, ROOT_DIR, command)], - cwd=ANDROID_DIR, env=env) - else: - retcode = subprocess.call(command, cwd=ROOT_DIR, env=env, shell=True) + retcode = subprocess.call(command, cwd=ROOT_DIR, env=env, shell=True) if retcode: # Emit failure tag, and keep going. print '@@@STEP_FAILURE@@@' @@ -209,15 +102,7 @@ def GypBuild(): print 'Done.' retcode = 0 - # The Android gyp bot runs on linux so this must be tested first. - if os.environ['BUILDBOT_BUILDERNAME'] == 'gyp-android': - PrepareAndroidTree() - StartAndroidEmulator() - try: - retcode += GypTestFormat('android') - finally: - StopAndroidEmulator() - elif sys.platform.startswith('linux'): + if sys.platform.startswith('linux'): retcode += GypTestFormat('ninja') retcode += GypTestFormat('make') PrepareCmake() diff --git a/deps/npm/node_modules/node-gyp/gyp/buildbot/commit_queue/cq_config.json b/deps/npm/node_modules/node-gyp/gyp/buildbot/commit_queue/cq_config.json index bbf20e394f..656c21e54f 100644 --- a/deps/npm/node_modules/node-gyp/gyp/buildbot/commit_queue/cq_config.json +++ b/deps/npm/node_modules/node-gyp/gyp/buildbot/commit_queue/cq_config.json @@ -3,7 +3,6 @@ "launched": { "tryserver.nacl": { "gyp-presubmit": ["defaulttests"], - "gyp-android": ["defaulttests"], "gyp-linux": ["defaulttests"], "gyp-mac": ["defaulttests"], "gyp-win32": ["defaulttests"], diff --git a/deps/npm/node_modules/node-gyp/gyp/gyp_main.py b/deps/npm/node_modules/node-gyp/gyp/gyp_main.py index 4ec872f0f9..25a6eba94a 100755 --- a/deps/npm/node_modules/node-gyp/gyp/gyp_main.py +++ b/deps/npm/node_modules/node-gyp/gyp/gyp_main.py @@ -4,15 +4,13 @@ # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. +import os import sys -# TODO(mark): sys.path manipulation is some temporary testing stuff. -try: - import gyp -except ImportError, e: - import os.path - sys.path.append(os.path.join(os.path.dirname(sys.argv[0]), 'pylib')) - import gyp +# Make sure we're using the version of pylib in this repo, not one installed +# elsewhere on the system. +sys.path.insert(0, os.path.join(os.path.dirname(sys.argv[0]), 'pylib')) +import gyp if __name__ == '__main__': sys.exit(gyp.script_main()) diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings.py index dde0e07092..4985756bdd 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings.py @@ -708,10 +708,7 @@ _MSVSOnly(_compile, 'UseUnicodeResponseFiles', _boolean) _MSBuildOnly(_compile, 'BuildingInIDE', _boolean) _MSBuildOnly(_compile, 'CompileAsManaged', _Enumeration([], new=['false', - 'true', # /clr - 'Pure', # /clr:pure - 'Safe', # /clr:safe - 'OldSyntax'])) # /clr:oldSyntax + 'true'])) # /clr _MSBuildOnly(_compile, 'CreateHotpatchableImage', _boolean) # /hotpatch _MSBuildOnly(_compile, 'MultiProcessorCompilation', _boolean) # /MP _MSBuildOnly(_compile, 'PreprocessOutputPath', _string) # /Fi diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings_test.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings_test.py index d24dcac4d5..bf6ea6b802 100755 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings_test.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSSettings_test.py @@ -296,7 +296,7 @@ class TestSequenceFunctions(unittest.TestCase): 'BuildingInIDE': 'true', 'CallingConvention': 'Cdecl', 'CompileAs': 'CompileAsC', - 'CompileAsManaged': 'Pure', + 'CompileAsManaged': 'true', 'CreateHotpatchableImage': 'true', 'DebugInformationFormat': 'ProgramDatabase', 'DisableLanguageExtensions': 'true', diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSVersion.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSVersion.py index 92e583fd6e..d9bfa684fa 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSVersion.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/MSVSVersion.py @@ -84,10 +84,11 @@ class VisualStudioVersion(object): # vcvars32, which it can only find if VS??COMNTOOLS is set, which it # isn't always. if target_arch == 'x86': - if self.short_name == '2013' and ( + if self.short_name >= '2013' and self.short_name[-1] != 'e' and ( os.environ.get('PROCESSOR_ARCHITECTURE') == 'AMD64' or os.environ.get('PROCESSOR_ARCHITEW6432') == 'AMD64'): - # VS2013 non-Express has a x64-x86 cross that we want to prefer. + # VS2013 and later, non-Express have a x64-x86 cross that we want + # to prefer. return [os.path.normpath( os.path.join(self.path, 'VC/vcvarsall.bat')), 'amd64_x86'] # Otherwise, the standard x86 compiler. diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/__init__.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/__init__.py index ac6d918b84..668f38b60d 100755 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/__init__.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/__init__.py @@ -49,7 +49,7 @@ def FindBuildFiles(): def Load(build_files, format, default_variables={}, includes=[], depth='.', params=None, check=False, - circular_check=True): + circular_check=True, duplicate_basename_check=True): """ Loads one or more specified build files. default_variables and includes will be copied before use. @@ -126,6 +126,7 @@ def Load(build_files, format, default_variables={}, # Process the input specific to this generator. result = gyp.input.Load(build_files, default_variables, includes[:], depth, generator_input_info, check, circular_check, + duplicate_basename_check, params['parallel'], params['root_targets']) return [generator] + result @@ -324,6 +325,16 @@ def gyp_main(args): parser.add_option('--no-circular-check', dest='circular_check', action='store_false', default=True, regenerate=False, help="don't check for circular relationships between files") + # --no-duplicate-basename-check disables the check for duplicate basenames + # in a static_library/shared_library project. Visual C++ 2008 generator + # doesn't support this configuration. Libtool on Mac also generates warnings + # when duplicate basenames are passed into Make generator on Mac. + # TODO(yukawa): Remove this option when these legacy generators are + # deprecated. + parser.add_option('--no-duplicate-basename-check', + dest='duplicate_basename_check', action='store_false', + default=True, regenerate=False, + help="don't check for duplicate basenames") parser.add_option('--no-parallel', action='store_true', default=False, help='Disable multiprocessing') parser.add_option('-S', '--suffix', dest='suffix', default='', @@ -499,7 +510,8 @@ def gyp_main(args): # Start with the default variables from the command line. [generator, flat_list, targets, data] = Load( build_files, format, cmdline_default_variables, includes, options.depth, - params, options.check, options.circular_check) + params, options.check, options.circular_check, + options.duplicate_basename_check) # TODO(mark): Pass |data| for now because the generator needs a list of # build files that came in. In the future, maybe it should just accept diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/common.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/common.py index b6875e43ef..256e3f3a6b 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/common.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/common.py @@ -131,13 +131,20 @@ def QualifiedTarget(build_file, target, toolset): @memoize -def RelativePath(path, relative_to): +def RelativePath(path, relative_to, follow_path_symlink=True): # Assuming both |path| and |relative_to| are relative to the current # directory, returns a relative path that identifies path relative to # relative_to. + # If |follow_symlink_path| is true (default) and |path| is a symlink, then + # this method returns a path to the real file represented by |path|. If it is + # false, this method returns a path to the symlink. If |path| is not a + # symlink, this option has no effect. # Convert to normalized (and therefore absolute paths). - path = os.path.realpath(path) + if follow_path_symlink: + path = os.path.realpath(path) + else: + path = os.path.abspath(path) relative_to = os.path.realpath(relative_to) # On Windows, we can't create a relative path to a different drive, so just @@ -418,6 +425,8 @@ def GetFlavor(params): return 'freebsd' if sys.platform.startswith('openbsd'): return 'openbsd' + if sys.platform.startswith('netbsd'): + return 'netbsd' if sys.platform.startswith('aix'): return 'aix' diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/analyzer.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/analyzer.py index 15b80ef973..921c1a6b71 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/analyzer.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/analyzer.py @@ -7,23 +7,59 @@ This script is intended for use as a GYP_GENERATOR. It takes as input (by way of the generator flag config_path) the path of a json file that dictates the files and targets to search for. The following keys are supported: files: list of paths (relative) of the files to search for. -targets: list of targets to search for. The target names are unqualified. +test_targets: unqualified target names to search for. Any target in this list +that depends upon a file in |files| is output regardless of the type of target +or chain of dependencies. +additional_compile_targets: Unqualified targets to search for in addition to +test_targets. Targets in the combined list that depend upon a file in |files| +are not necessarily output. For example, if the target is of type none then the +target is not output (but one of the descendants of the target will be). The following is output: error: only supplied if there is an error. -targets: the set of targets passed in via targets that either directly or - indirectly depend upon the set of paths supplied in files. -build_targets: minimal set of targets that directly depend on the changed - files and need to be built. The expectation is this set of targets is passed - into a build step. +compile_targets: minimal set of targets that directly or indirectly (for + targets of type none) depend on the files in |files| and is one of the + supplied targets or a target that one of the supplied targets depends on. + The expectation is this set of targets is passed into a build step. This list + always contains the output of test_targets as well. +test_targets: set of targets from the supplied |test_targets| that either + directly or indirectly depend upon a file in |files|. This list if useful + if additional processing needs to be done for certain targets after the + build, such as running tests. status: outputs one of three values: none of the supplied files were found, one of the include files changed so that it should be assumed everything - changed (in this case targets and build_targets are not output) or at + changed (in this case test_targets and compile_targets are not output) or at least one file was found. -invalid_targets: list of supplied targets thare were not found. +invalid_targets: list of supplied targets that were not found. + +Example: +Consider a graph like the following: + A D + / \ +B C +A depends upon both B and C, A is of type none and B and C are executables. +D is an executable, has no dependencies and nothing depends on it. +If |additional_compile_targets| = ["A"], |test_targets| = ["B", "C"] and +files = ["b.cc", "d.cc"] (B depends upon b.cc and D depends upon d.cc), then +the following is output: +|compile_targets| = ["B"] B must built as it depends upon the changed file b.cc +and the supplied target A depends upon it. A is not output as a build_target +as it is of type none with no rules and actions. +|test_targets| = ["B"] B directly depends upon the change file b.cc. + +Even though the file d.cc, which D depends upon, has changed D is not output +as it was not supplied by way of |additional_compile_targets| or |test_targets|. If the generator flag analyzer_output_path is specified, output is written there. Otherwise output is written to stdout. + +In Gyp the "all" target is shorthand for the root targets in the files passed +to gyp. For example, if file "a.gyp" contains targets "a1" and +"a2", and file "b.gyp" contains targets "b1" and "b2" and "a2" has a dependency +on "b2" and gyp is supplied "a.gyp" then "all" consists of "a1" and "a2". +Notice that "b1" and "b2" are not in the "all" target as "b.gyp" was not +directly supplied to gyp. OTOH if both "a.gyp" and "b.gyp" are supplied to gyp +then the "all" target includes "b1" and "b2". """ import gyp.common @@ -183,7 +219,10 @@ class Target(object): added_to_compile_targets: used when determining if the target was added to the set of targets that needs to be built. in_roots: true if this target is a descendant of one of the root nodes. - is_executable: true if the type of target is executable.""" + is_executable: true if the type of target is executable. + is_static_library: true if the type of target is static_library. + is_or_has_linked_ancestor: true if the target does a link (eg executable), or + if there is a target in back_deps that does a link.""" def __init__(self, name): self.deps = set() self.match_status = MATCH_STATUS_TBD @@ -196,6 +235,8 @@ class Target(object): self.added_to_compile_targets = False self.in_roots = False self.is_executable = False + self.is_static_library = False + self.is_or_has_linked_ancestor = False class Config(object): @@ -205,6 +246,8 @@ class Config(object): def __init__(self): self.files = [] self.targets = set() + self.additional_compile_target_names = set() + self.test_target_names = set() def Init(self, params): """Initializes Config. This is a separate method as it raises an exception @@ -224,7 +267,9 @@ class Config(object): if not isinstance(config, dict): raise Exception('config_path must be a JSON file containing a dictionary') self.files = config.get('files', []) - self.targets = set(config.get('targets', [])) + self.additional_compile_target_names = set( + config.get('additional_compile_targets', [])) + self.test_target_names = set(config.get('test_targets', [])) def _WasBuildFileModified(build_file, data, files, toplevel_dir): @@ -266,8 +311,8 @@ def _GetOrCreateTargetByName(targets, target_name): def _DoesTargetTypeRequireBuild(target_dict): """Returns true if the target type is such that it needs to be built.""" # If a 'none' target has rules or actions we assume it requires a build. - return target_dict['type'] != 'none' or \ - target_dict.get('actions') or target_dict.get('rules') + return bool(target_dict['type'] != 'none' or + target_dict.get('actions') or target_dict.get('rules')) def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, @@ -275,12 +320,13 @@ def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, """Returns a tuple of the following: . A dictionary mapping from fully qualified name to Target. . A list of the targets that have a source file in |files|. - . Set of root Targets reachable from the the files |build_files|. + . Targets that constitute the 'all' target. See description at top of file + for details on the 'all' target. This sets the |match_status| of the targets that contain any of the source files in |files| to MATCH_STATUS_MATCHES. |toplevel_dir| is the root of the source tree.""" # Maps from target name to Target. - targets = {} + name_to_target = {} # Targets that matched. matching_targets = [] @@ -300,7 +346,8 @@ def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, while len(targets_to_visit) > 0: target_name = targets_to_visit.pop() - created_target, target = _GetOrCreateTargetByName(targets, target_name) + created_target, target = _GetOrCreateTargetByName(name_to_target, + target_name) if created_target: roots.add(target) elif target.visited: @@ -309,7 +356,11 @@ def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, target.visited = True target.requires_build = _DoesTargetTypeRequireBuild( target_dicts[target_name]) - target.is_executable = target_dicts[target_name]['type'] == 'executable' + target_type = target_dicts[target_name]['type'] + target.is_executable = target_type == 'executable' + target.is_static_library = target_type == 'static_library' + target.is_or_has_linked_ancestor = (target_type == 'executable' or + target_type == 'shared_library') build_file = gyp.common.ParseQualifiedTarget(target_name)[0] if not build_file in build_file_in_files: @@ -329,7 +380,7 @@ def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, sources = _ExtractSources(target_name, target_dicts[target_name], toplevel_dir) for source in sources: - if source in files: + if _ToGypPath(os.path.normpath(source)) in files: print 'target', target_name, 'matches', source target.match_status = MATCH_STATUS_MATCHES matching_targets.append(target) @@ -339,22 +390,25 @@ def _GenerateTargets(data, target_list, target_dicts, toplevel_dir, files, for dep in target_dicts[target_name].get('dependencies', []): targets_to_visit.append(dep) - created_dep_target, dep_target = _GetOrCreateTargetByName(targets, dep) + created_dep_target, dep_target = _GetOrCreateTargetByName(name_to_target, + dep) if not created_dep_target: roots.discard(dep_target) target.deps.add(dep_target) dep_target.back_deps.add(target) - return targets, matching_targets, roots & build_file_targets + return name_to_target, matching_targets, roots & build_file_targets def _GetUnqualifiedToTargetMapping(all_targets, to_find): - """Returns a mapping (dictionary) from unqualified name to Target for all the - Targets in |to_find|.""" + """Returns a tuple of the following: + . mapping (dictionary) from unqualified name to Target for all the + Targets in |to_find|. + . any target names not found. If this is empty all targets were found.""" result = {} if not to_find: - return result + return {}, [] to_find = set(to_find) for target_name in all_targets.keys(): extracted = gyp.common.ParseQualifiedTarget(target_name) @@ -362,13 +416,14 @@ def _GetUnqualifiedToTargetMapping(all_targets, to_find): to_find.remove(extracted[1]) result[extracted[1]] = all_targets[target_name] if not to_find: - return result - return result + return result, [] + return result, [x for x in to_find] -def _DoesTargetDependOn(target): - """Returns true if |target| or any of its dependencies matches the supplied - set of paths. This updates |matches| of the Targets as it recurses. +def _DoesTargetDependOnMatchingTargets(target): + """Returns true if |target| or any of its dependencies is one of the + targets containing the files supplied as input to analyzer. This updates + |matches| of the Targets as it recurses. target: the Target to look for.""" if target.match_status == MATCH_STATUS_DOESNT_MATCH: return False @@ -376,25 +431,28 @@ def _DoesTargetDependOn(target): target.match_status == MATCH_STATUS_MATCHES_BY_DEPENDENCY: return True for dep in target.deps: - if _DoesTargetDependOn(dep): + if _DoesTargetDependOnMatchingTargets(dep): target.match_status = MATCH_STATUS_MATCHES_BY_DEPENDENCY + print '\t', target.name, 'matches by dep', dep.name return True target.match_status = MATCH_STATUS_DOESNT_MATCH return False -def _GetTargetsDependingOn(possible_targets): +def _GetTargetsDependingOnMatchingTargets(possible_targets): """Returns the list of Targets in |possible_targets| that depend (either - directly on indirectly) on the matched targets. + directly on indirectly) on at least one of the targets containing the files + supplied as input to analyzer. possible_targets: targets to search from.""" found = [] + print 'Targets that matched by dependency:' for target in possible_targets: - if _DoesTargetDependOn(target): + if _DoesTargetDependOnMatchingTargets(target): found.append(target) return found -def _AddBuildTargets(target, roots, add_if_no_ancestor, result): +def _AddCompileTargets(target, roots, add_if_no_ancestor, result): """Recurses through all targets that depend on |target|, adding all targets that need to be built (and are in |roots|) to |result|. roots: set of root targets. @@ -405,31 +463,45 @@ def _AddBuildTargets(target, roots, add_if_no_ancestor, result): return target.visited = True - target.in_roots = not target.back_deps and target in roots + target.in_roots = target in roots for back_dep_target in target.back_deps: - _AddBuildTargets(back_dep_target, roots, False, result) + _AddCompileTargets(back_dep_target, roots, False, result) target.added_to_compile_targets |= back_dep_target.added_to_compile_targets target.in_roots |= back_dep_target.in_roots + target.is_or_has_linked_ancestor |= ( + back_dep_target.is_or_has_linked_ancestor) # Always add 'executable' targets. Even though they may be built by other # targets that depend upon them it makes detection of what is going to be # built easier. + # And always add static_libraries that have no dependencies on them from + # linkables. This is necessary as the other dependencies on them may be + # static libraries themselves, which are not compile time dependencies. if target.in_roots and \ (target.is_executable or (not target.added_to_compile_targets and - (add_if_no_ancestor or target.requires_build))): + (add_if_no_ancestor or target.requires_build)) or + (target.is_static_library and add_if_no_ancestor and + not target.is_or_has_linked_ancestor)): + print '\t\tadding to compile targets', target.name, 'executable', \ + target.is_executable, 'added_to_compile_targets', \ + target.added_to_compile_targets, 'add_if_no_ancestor', \ + add_if_no_ancestor, 'requires_build', target.requires_build, \ + 'is_static_library', target.is_static_library, \ + 'is_or_has_linked_ancestor', target.is_or_has_linked_ancestor result.add(target) target.added_to_compile_targets = True -def _GetBuildTargets(matching_targets, roots): +def _GetCompileTargets(matching_targets, supplied_targets): """Returns the set of Targets that require a build. matching_targets: targets that changed and need to be built. - roots: set of root targets in the build files to search from.""" + supplied_targets: set of targets supplied to analyzer to search from.""" result = set() for target in matching_targets: - _AddBuildTargets(target, roots, True, result) + print 'finding compile targets for match', target.name + _AddCompileTargets(target, supplied_targets, True, result) return result @@ -454,6 +526,16 @@ def _WriteOutput(params, **values): print 'Targets that require a build:' for target in values['build_targets']: print '\t', target + if 'compile_targets' in values: + values['compile_targets'].sort() + print 'Targets that need to be built:' + for target in values['compile_targets']: + print '\t', target + if 'test_targets' in values: + values['test_targets'].sort() + print 'Test targets:' + for target in values['test_targets']: + print '\t', target output_path = params.get('generator_flags', {}).get( 'analyzer_output_path', None) @@ -473,7 +555,7 @@ def _WasGypIncludeFileModified(params, files): files.""" if params['options'].includes: for include in params['options'].includes: - if _ToGypPath(include) in files: + if _ToGypPath(os.path.normpath(include)) in files: print 'Include file modified, assuming all changed', include return True return False @@ -513,11 +595,104 @@ def CalculateVariables(default_variables, params): default_variables.setdefault('OS', operating_system) +class TargetCalculator(object): + """Calculates the matching test_targets and matching compile_targets.""" + def __init__(self, files, additional_compile_target_names, test_target_names, + data, target_list, target_dicts, toplevel_dir, build_files): + self._additional_compile_target_names = set(additional_compile_target_names) + self._test_target_names = set(test_target_names) + self._name_to_target, self._changed_targets, self._root_targets = ( + _GenerateTargets(data, target_list, target_dicts, toplevel_dir, + frozenset(files), build_files)) + self._unqualified_mapping, self.invalid_targets = ( + _GetUnqualifiedToTargetMapping(self._name_to_target, + self._supplied_target_names_no_all())) + + def _supplied_target_names(self): + return self._additional_compile_target_names | self._test_target_names + + def _supplied_target_names_no_all(self): + """Returns the supplied test targets without 'all'.""" + result = self._supplied_target_names(); + result.discard('all') + return result + + def is_build_impacted(self): + """Returns true if the supplied files impact the build at all.""" + return self._changed_targets + + def find_matching_test_target_names(self): + """Returns the set of output test targets.""" + assert self.is_build_impacted() + # Find the test targets first. 'all' is special cased to mean all the + # root targets. To deal with all the supplied |test_targets| are expanded + # to include the root targets during lookup. If any of the root targets + # match, we remove it and replace it with 'all'. + test_target_names_no_all = set(self._test_target_names) + test_target_names_no_all.discard('all') + test_targets_no_all = _LookupTargets(test_target_names_no_all, + self._unqualified_mapping) + test_target_names_contains_all = 'all' in self._test_target_names + if test_target_names_contains_all: + test_targets = [x for x in (set(test_targets_no_all) | + set(self._root_targets))] + else: + test_targets = [x for x in test_targets_no_all] + print 'supplied test_targets' + for target_name in self._test_target_names: + print '\t', target_name + print 'found test_targets' + for target in test_targets: + print '\t', target.name + print 'searching for matching test targets' + matching_test_targets = _GetTargetsDependingOnMatchingTargets(test_targets) + matching_test_targets_contains_all = (test_target_names_contains_all and + set(matching_test_targets) & + set(self._root_targets)) + if matching_test_targets_contains_all: + # Remove any of the targets for all that were not explicitly supplied, + # 'all' is subsequentely added to the matching names below. + matching_test_targets = [x for x in (set(matching_test_targets) & + set(test_targets_no_all))] + print 'matched test_targets' + for target in matching_test_targets: + print '\t', target.name + matching_target_names = [gyp.common.ParseQualifiedTarget(target.name)[1] + for target in matching_test_targets] + if matching_test_targets_contains_all: + matching_target_names.append('all') + print '\tall' + return matching_target_names + + def find_matching_compile_target_names(self): + """Returns the set of output compile targets.""" + assert self.is_build_impacted(); + # Compile targets are found by searching up from changed targets. + # Reset the visited status for _GetBuildTargets. + for target in self._name_to_target.itervalues(): + target.visited = False + + supplied_targets = _LookupTargets(self._supplied_target_names_no_all(), + self._unqualified_mapping) + if 'all' in self._supplied_target_names(): + supplied_targets = [x for x in (set(supplied_targets) | + set(self._root_targets))] + print 'Supplied test_targets & compile_targets' + for target in supplied_targets: + print '\t', target.name + print 'Finding compile targets' + compile_targets = _GetCompileTargets(self._changed_targets, + supplied_targets) + return [gyp.common.ParseQualifiedTarget(target.name)[1] + for target in compile_targets] + + def GenerateOutput(target_list, target_dicts, data, params): """Called by gyp as the final stage. Outputs results.""" config = Config() try: config.Init(params) + if not config.files: raise Exception('Must specify files to analyze via config_path generator ' 'flag') @@ -528,41 +703,38 @@ def GenerateOutput(target_list, target_dicts, data, params): if _WasGypIncludeFileModified(params, config.files): result_dict = { 'status': all_changed_string, - 'targets': list(config.targets) } + 'test_targets': list(config.test_target_names), + 'compile_targets': list( + config.additional_compile_target_names | + config.test_target_names) } _WriteOutput(params, **result_dict) return - all_targets, matching_targets, roots = _GenerateTargets( - data, target_list, target_dicts, toplevel_dir, frozenset(config.files), - params['build_files']) - - unqualified_mapping = _GetUnqualifiedToTargetMapping(all_targets, - config.targets) - invalid_targets = None - if len(unqualified_mapping) != len(config.targets): - invalid_targets = _NamesNotIn(config.targets, unqualified_mapping) - - if matching_targets: - search_targets = _LookupTargets(config.targets, unqualified_mapping) - matched_search_targets = _GetTargetsDependingOn(search_targets) - # Reset the visited status for _GetBuildTargets. - for target in all_targets.itervalues(): - target.visited = False - build_targets = _GetBuildTargets(matching_targets, roots) - matched_search_targets = [gyp.common.ParseQualifiedTarget(target.name)[1] - for target in matched_search_targets] - build_targets = [gyp.common.ParseQualifiedTarget(target.name)[1] - for target in build_targets] - else: - matched_search_targets = [] - build_targets = [] - - result_dict = { 'targets': matched_search_targets, - 'status': found_dependency_string if matching_targets else - no_dependency_string, - 'build_targets': build_targets} - if invalid_targets: - result_dict['invalid_targets'] = invalid_targets + calculator = TargetCalculator(config.files, + config.additional_compile_target_names, + config.test_target_names, data, + target_list, target_dicts, toplevel_dir, + params['build_files']) + if not calculator.is_build_impacted(): + result_dict = { 'status': no_dependency_string, + 'test_targets': [], + 'compile_targets': [] } + if calculator.invalid_targets: + result_dict['invalid_targets'] = calculator.invalid_targets + _WriteOutput(params, **result_dict) + return + + test_target_names = calculator.find_matching_test_target_names() + compile_target_names = calculator.find_matching_compile_target_names() + found_at_least_one_target = compile_target_names or test_target_names + result_dict = { 'test_targets': test_target_names, + 'status': found_dependency_string if + found_at_least_one_target else no_dependency_string, + 'compile_targets': list( + set(compile_target_names) | + set(test_target_names)) } + if calculator.invalid_targets: + result_dict['invalid_targets'] = calculator.invalid_targets _WriteOutput(params, **result_dict) except Exception as e: diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/cmake.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/cmake.py index 8f5feddee1..17f5e6396c 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/cmake.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/cmake.py @@ -55,7 +55,7 @@ generator_default_variables = { 'CONFIGURATION_NAME': '${configuration}', } -FULL_PATH_VARS = ('${CMAKE_SOURCE_DIR}', '${builddir}', '${obj}') +FULL_PATH_VARS = ('${CMAKE_CURRENT_LIST_DIR}', '${builddir}', '${obj}') generator_supports_multiple_toolsets = True generator_wants_static_library_dependencies_adjusted = True @@ -103,7 +103,7 @@ def NormjoinPathForceCMakeSource(base_path, rel_path): if any([rel_path.startswith(var) for var in FULL_PATH_VARS]): return rel_path # TODO: do we need to check base_path for absolute variables as well? - return os.path.join('${CMAKE_SOURCE_DIR}', + return os.path.join('${CMAKE_CURRENT_LIST_DIR}', os.path.normpath(os.path.join(base_path, rel_path))) @@ -150,20 +150,17 @@ def SetFileProperty(output, source_name, property_name, values, sep): output.write('")\n') -def SetFilesProperty(output, source_names, property_name, values, sep): +def SetFilesProperty(output, variable, property_name, values, sep): """Given a set of source files, sets the given property on them.""" - output.write('set_source_files_properties(\n') - for source_name in source_names: - output.write(' ') - output.write(source_name) - output.write('\n') - output.write(' PROPERTIES\n ') + output.write('set_source_files_properties(') + WriteVariable(output, variable) + output.write(' PROPERTIES ') output.write(property_name) output.write(' "') for value in values: output.write(CMakeStringEscape(value)) output.write(sep) - output.write('"\n)\n') + output.write('")\n') def SetTargetProperty(output, target_name, property_name, values, sep=''): @@ -236,11 +233,11 @@ def StringToCMakeTargetName(a): """Converts the given string 'a' to a valid CMake target name. All invalid characters are replaced by '_'. - Invalid for cmake: ' ', '/', '(', ')' + Invalid for cmake: ' ', '/', '(', ')', '"' Invalid for make: ':' Invalid for unknown reasons but cause failures: '.' """ - return a.translate(string.maketrans(' /():.', '______')) + return a.translate(string.maketrans(' /():."', '_______')) def WriteActions(target_name, actions, extra_sources, extra_deps, @@ -296,7 +293,7 @@ def WriteActions(target_name, actions, extra_sources, extra_deps, WriteVariable(output, inputs_name) output.write('\n') - output.write(' WORKING_DIRECTORY ${CMAKE_SOURCE_DIR}/') + output.write(' WORKING_DIRECTORY ${CMAKE_CURRENT_LIST_DIR}/') output.write(path_to_gyp) output.write('\n') @@ -401,9 +398,9 @@ def WriteRules(target_name, rules, extra_sources, extra_deps, output.write(NormjoinPath(path_to_gyp, rule_source)) output.write('\n') - # CMAKE_SOURCE_DIR is where the CMakeLists.txt lives. + # CMAKE_CURRENT_LIST_DIR is where the CMakeLists.txt lives. # The cwd is the current build directory. - output.write(' WORKING_DIRECTORY ${CMAKE_SOURCE_DIR}/') + output.write(' WORKING_DIRECTORY ${CMAKE_CURRENT_LIST_DIR}/') output.write(path_to_gyp) output.write('\n') @@ -488,7 +485,7 @@ def WriteCopies(target_name, copies, extra_deps, path_to_gyp, output): copy = file_copy if os.path.basename(src) else dir_copy - copy.cmake_inputs.append(NormjoinPath(path_to_gyp, src)) + copy.cmake_inputs.append(NormjoinPathForceCMakeSource(path_to_gyp, src)) copy.cmake_outputs.append(NormjoinPathForceCMakeSource(path_to_gyp, dst)) copy.gyp_inputs.append(src) copy.gyp_outputs.append(dst) @@ -525,7 +522,7 @@ def WriteCopies(target_name, copies, extra_deps, path_to_gyp, output): WriteVariable(output, copy.inputs_name, ' ') output.write('\n') - output.write('WORKING_DIRECTORY ${CMAKE_SOURCE_DIR}/') + output.write('WORKING_DIRECTORY ${CMAKE_CURRENT_LIST_DIR}/') output.write(path_to_gyp) output.write('\n') @@ -640,6 +637,12 @@ def WriteTarget(namer, qualified_target, target_dicts, build_dir, config_to_use, target_type = spec.get('type', '<missing target type>') target_toolset = spec.get('toolset') + cmake_target_type = cmake_target_type_from_gyp_target_type.get(target_type) + if cmake_target_type is None: + print ('Target %s has unknown target type %s, skipping.' % + ( target_name, target_type ) ) + return + SetVariable(output, 'TARGET', target_name) SetVariable(output, 'TOOLSET', target_toolset) @@ -667,27 +670,89 @@ def WriteTarget(namer, qualified_target, target_dicts, build_dir, config_to_use, srcs = spec.get('sources', []) # Gyp separates the sheep from the goats based on file extensions. - def partition(l, p): - return reduce(lambda x, e: x[not p(e)].append(e) or x, l, ([], [])) - compilable_srcs, other_srcs = partition(srcs, Compilable) + # A full separation is done here because of flag handing (see below). + s_sources = [] + c_sources = [] + cxx_sources = [] + linkable_sources = [] + other_sources = [] + for src in srcs: + _, ext = os.path.splitext(src) + src_type = COMPILABLE_EXTENSIONS.get(ext, None) + src_norm_path = NormjoinPath(path_from_cmakelists_to_gyp, src); - # CMake gets upset when executable targets provide no sources. - if target_type == 'executable' and not compilable_srcs and not extra_sources: - print ('Executable %s has no complilable sources, treating as "none".' % - target_name ) - target_type = 'none' + if src_type == 's': + s_sources.append(src_norm_path) + elif src_type == 'cc': + c_sources.append(src_norm_path) + elif src_type == 'cxx': + cxx_sources.append(src_norm_path) + elif Linkable(ext): + linkable_sources.append(src_norm_path) + else: + other_sources.append(src_norm_path) - cmake_target_type = cmake_target_type_from_gyp_target_type.get(target_type) - if cmake_target_type is None: - print ('Target %s has unknown target type %s, skipping.' % - ( target_name, target_type ) ) - return + for extra_source in extra_sources: + src, real_source = extra_source + _, ext = os.path.splitext(real_source) + src_type = COMPILABLE_EXTENSIONS.get(ext, None) + + if src_type == 's': + s_sources.append(src) + elif src_type == 'cc': + c_sources.append(src) + elif src_type == 'cxx': + cxx_sources.append(src) + elif Linkable(ext): + linkable_sources.append(src) + else: + other_sources.append(src) + + s_sources_name = None + if s_sources: + s_sources_name = cmake_target_name + '__asm_srcs' + SetVariableList(output, s_sources_name, s_sources) + + c_sources_name = None + if c_sources: + c_sources_name = cmake_target_name + '__c_srcs' + SetVariableList(output, c_sources_name, c_sources) + + cxx_sources_name = None + if cxx_sources: + cxx_sources_name = cmake_target_name + '__cxx_srcs' + SetVariableList(output, cxx_sources_name, cxx_sources) + + linkable_sources_name = None + if linkable_sources: + linkable_sources_name = cmake_target_name + '__linkable_srcs' + SetVariableList(output, linkable_sources_name, linkable_sources) + + other_sources_name = None + if other_sources: + other_sources_name = cmake_target_name + '__other_srcs' + SetVariableList(output, other_sources_name, other_sources) + + # CMake gets upset when executable targets provide no sources. + # http://www.cmake.org/pipermail/cmake/2010-July/038461.html + dummy_sources_name = None + has_sources = (s_sources_name or + c_sources_name or + cxx_sources_name or + linkable_sources_name or + other_sources_name) + if target_type == 'executable' and not has_sources: + dummy_sources_name = cmake_target_name + '__dummy_srcs' + SetVariable(output, dummy_sources_name, + "${obj}.${TOOLSET}/${TARGET}/genc/dummy.c") + output.write('if(NOT EXISTS "') + WriteVariable(output, dummy_sources_name) + output.write('")\n') + output.write(' file(WRITE "') + WriteVariable(output, dummy_sources_name) + output.write('" "")\n') + output.write("endif()\n") - other_srcs_name = None - if other_srcs: - other_srcs_name = cmake_target_name + '__other_srcs' - SetVariableList(output, other_srcs_name, - [NormjoinPath(path_from_cmakelists_to_gyp, src) for src in other_srcs]) # CMake is opposed to setting linker directories and considers the practice # of setting linker directories dangerous. Instead, it favors the use of @@ -713,31 +778,48 @@ def WriteTarget(namer, qualified_target, target_dicts, build_dir, config_to_use, output.write(' ') output.write(cmake_target_type.modifier) - if other_srcs_name: - WriteVariable(output, other_srcs_name, ' ') - - output.write('\n') - - for src in compilable_srcs: - output.write(' ') - output.write(NormjoinPath(path_from_cmakelists_to_gyp, src)) - output.write('\n') - for extra_source in extra_sources: - output.write(' ') - src, _ = extra_source - output.write(NormjoinPath(path_from_cmakelists_to_gyp, src)) - output.write('\n') + if s_sources_name: + WriteVariable(output, s_sources_name, ' ') + if c_sources_name: + WriteVariable(output, c_sources_name, ' ') + if cxx_sources_name: + WriteVariable(output, cxx_sources_name, ' ') + if linkable_sources_name: + WriteVariable(output, linkable_sources_name, ' ') + if other_sources_name: + WriteVariable(output, other_sources_name, ' ') + if dummy_sources_name: + WriteVariable(output, dummy_sources_name, ' ') output.write(')\n') + # Let CMake know if the 'all' target should depend on this target. + exclude_from_all = ('TRUE' if qualified_target not in all_qualified_targets + else 'FALSE') + SetTargetProperty(output, cmake_target_name, + 'EXCLUDE_FROM_ALL', exclude_from_all) + for extra_target_name in extra_deps: + SetTargetProperty(output, extra_target_name, + 'EXCLUDE_FROM_ALL', exclude_from_all) + # Output name and location. if target_type != 'none': + # Link as 'C' if there are no other files + if not c_sources and not cxx_sources: + SetTargetProperty(output, cmake_target_name, 'LINKER_LANGUAGE', ['C']) + # Mark uncompiled sources as uncompiled. - if other_srcs_name: + if other_sources_name: output.write('set_source_files_properties(') - WriteVariable(output, other_srcs_name, '') + WriteVariable(output, other_sources_name, '') output.write(' PROPERTIES HEADER_FILE_ONLY "TRUE")\n') + # Mark object sources as linkable. + if linkable_sources_name: + output.write('set_source_files_properties(') + WriteVariable(output, other_sources_name, '') + output.write(' PROPERTIES EXTERNAL_OBJECT "TRUE")\n') + # Output directory target_output_directory = spec.get('product_dir') if target_output_directory is None: @@ -804,122 +886,84 @@ def WriteTarget(namer, qualified_target, target_dicts, build_dir, config_to_use, cmake_target_output_basename) SetFileProperty(output, cmake_target_output, 'GENERATED', ['TRUE'], '') - # Let CMake know if the 'all' target should depend on this target. - exclude_from_all = ('TRUE' if qualified_target not in all_qualified_targets - else 'FALSE') - SetTargetProperty(output, cmake_target_name, - 'EXCLUDE_FROM_ALL', exclude_from_all) - for extra_target_name in extra_deps: - SetTargetProperty(output, extra_target_name, - 'EXCLUDE_FROM_ALL', exclude_from_all) - - # Includes - includes = config.get('include_dirs') - if includes: - # This (target include directories) is what requires CMake 2.8.8 - includes_name = cmake_target_name + '__include_dirs' - SetVariableList(output, includes_name, - [NormjoinPathForceCMakeSource(path_from_cmakelists_to_gyp, include) - for include in includes]) - output.write('set_property(TARGET ') - output.write(cmake_target_name) - output.write(' APPEND PROPERTY INCLUDE_DIRECTORIES ') - WriteVariable(output, includes_name, '') - output.write(')\n') - - # Defines - defines = config.get('defines') - if defines is not None: - SetTargetProperty(output, - cmake_target_name, - 'COMPILE_DEFINITIONS', - defines, - ';') - - # Compile Flags - http://www.cmake.org/Bug/view.php?id=6493 - # CMake currently does not have target C and CXX flags. - # So, instead of doing... - - # cflags_c = config.get('cflags_c') - # if cflags_c is not None: - # SetTargetProperty(output, cmake_target_name, - # 'C_COMPILE_FLAGS', cflags_c, ' ') - - # cflags_cc = config.get('cflags_cc') - # if cflags_cc is not None: - # SetTargetProperty(output, cmake_target_name, - # 'CXX_COMPILE_FLAGS', cflags_cc, ' ') - - # Instead we must... - s_sources = [] - c_sources = [] - cxx_sources = [] - for src in srcs: - _, ext = os.path.splitext(src) - src_type = COMPILABLE_EXTENSIONS.get(ext, None) - - if src_type == 's': - s_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - if src_type == 'cc': - c_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - if src_type == 'cxx': - cxx_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - for extra_source in extra_sources: - src, real_source = extra_source - _, ext = os.path.splitext(real_source) - src_type = COMPILABLE_EXTENSIONS.get(ext, None) - - if src_type == 's': - s_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - if src_type == 'cc': - c_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - if src_type == 'cxx': - cxx_sources.append(NormjoinPath(path_from_cmakelists_to_gyp, src)) - - cflags = config.get('cflags', []) - cflags_c = config.get('cflags_c', []) - cflags_cxx = config.get('cflags_cc', []) - if c_sources and not (s_sources or cxx_sources): - flags = [] - flags.extend(cflags) - flags.extend(cflags_c) - SetTargetProperty(output, cmake_target_name, 'COMPILE_FLAGS', flags, ' ') - - elif cxx_sources and not (s_sources or c_sources): - flags = [] - flags.extend(cflags) - flags.extend(cflags_cxx) - SetTargetProperty(output, cmake_target_name, 'COMPILE_FLAGS', flags, ' ') - - else: - if s_sources and cflags: - SetFilesProperty(output, s_sources, 'COMPILE_FLAGS', cflags, ' ') + # Includes + includes = config.get('include_dirs') + if includes: + # This (target include directories) is what requires CMake 2.8.8 + includes_name = cmake_target_name + '__include_dirs' + SetVariableList(output, includes_name, + [NormjoinPathForceCMakeSource(path_from_cmakelists_to_gyp, include) + for include in includes]) + output.write('set_property(TARGET ') + output.write(cmake_target_name) + output.write(' APPEND PROPERTY INCLUDE_DIRECTORIES ') + WriteVariable(output, includes_name, '') + output.write(')\n') - if c_sources and (cflags or cflags_c): + # Defines + defines = config.get('defines') + if defines is not None: + SetTargetProperty(output, + cmake_target_name, + 'COMPILE_DEFINITIONS', + defines, + ';') + + # Compile Flags - http://www.cmake.org/Bug/view.php?id=6493 + # CMake currently does not have target C and CXX flags. + # So, instead of doing... + + # cflags_c = config.get('cflags_c') + # if cflags_c is not None: + # SetTargetProperty(output, cmake_target_name, + # 'C_COMPILE_FLAGS', cflags_c, ' ') + + # cflags_cc = config.get('cflags_cc') + # if cflags_cc is not None: + # SetTargetProperty(output, cmake_target_name, + # 'CXX_COMPILE_FLAGS', cflags_cc, ' ') + + # Instead we must... + cflags = config.get('cflags', []) + cflags_c = config.get('cflags_c', []) + cflags_cxx = config.get('cflags_cc', []) + if (not cflags_c or not c_sources) and (not cflags_cxx or not cxx_sources): + SetTargetProperty(output, cmake_target_name, 'COMPILE_FLAGS', cflags, ' ') + + elif c_sources and not (s_sources or cxx_sources): flags = [] flags.extend(cflags) flags.extend(cflags_c) - SetFilesProperty(output, c_sources, 'COMPILE_FLAGS', flags, ' ') + SetTargetProperty(output, cmake_target_name, 'COMPILE_FLAGS', flags, ' ') - if cxx_sources and (cflags or cflags_cxx): + elif cxx_sources and not (s_sources or c_sources): flags = [] flags.extend(cflags) flags.extend(cflags_cxx) - SetFilesProperty(output, cxx_sources, 'COMPILE_FLAGS', flags, ' ') + SetTargetProperty(output, cmake_target_name, 'COMPILE_FLAGS', flags, ' ') - # Have assembly link as c if there are no other files - if not c_sources and not cxx_sources and s_sources: - SetTargetProperty(output, cmake_target_name, 'LINKER_LANGUAGE', ['C']) - - # Linker flags - ldflags = config.get('ldflags') - if ldflags is not None: - SetTargetProperty(output, cmake_target_name, 'LINK_FLAGS', ldflags, ' ') + else: + # TODO: This is broken, one cannot generally set properties on files, + # as other targets may require different properties on the same files. + if s_sources and cflags: + SetFilesProperty(output, s_sources_name, 'COMPILE_FLAGS', cflags, ' ') + + if c_sources and (cflags or cflags_c): + flags = [] + flags.extend(cflags) + flags.extend(cflags_c) + SetFilesProperty(output, c_sources_name, 'COMPILE_FLAGS', flags, ' ') + + if cxx_sources and (cflags or cflags_cxx): + flags = [] + flags.extend(cflags) + flags.extend(cflags_cxx) + SetFilesProperty(output, cxx_sources_name, 'COMPILE_FLAGS', flags, ' ') + + # Linker flags + ldflags = config.get('ldflags') + if ldflags is not None: + SetTargetProperty(output, cmake_target_name, 'LINK_FLAGS', ldflags, ' ') # Note on Dependencies and Libraries: # CMake wants to handle link order, resolving the link line up front. @@ -1040,20 +1084,49 @@ def GenerateOutputForConfig(target_list, target_dicts, data, output.write('cmake_minimum_required(VERSION 2.8.8 FATAL_ERROR)\n') output.write('cmake_policy(VERSION 2.8.8)\n') - _, project_target, _ = gyp.common.ParseQualifiedTarget(target_list[-1]) + gyp_file, project_target, _ = gyp.common.ParseQualifiedTarget(target_list[-1]) output.write('project(') output.write(project_target) output.write(')\n') SetVariable(output, 'configuration', config_to_use) + ar = None + cc = None + cxx = None + + make_global_settings = data[gyp_file].get('make_global_settings', []) + build_to_top = gyp.common.InvertRelativePath(build_dir, + options.toplevel_dir) + for key, value in make_global_settings: + if key == 'AR': + ar = os.path.join(build_to_top, value) + if key == 'CC': + cc = os.path.join(build_to_top, value) + if key == 'CXX': + cxx = os.path.join(build_to_top, value) + + ar = gyp.common.GetEnvironFallback(['AR_target', 'AR'], ar) + cc = gyp.common.GetEnvironFallback(['CC_target', 'CC'], cc) + cxx = gyp.common.GetEnvironFallback(['CXX_target', 'CXX'], cxx) + + if ar: + SetVariable(output, 'CMAKE_AR', ar) + if cc: + SetVariable(output, 'CMAKE_C_COMPILER', cc) + if cxx: + SetVariable(output, 'CMAKE_CXX_COMPILER', cxx) + # The following appears to be as-yet undocumented. # http://public.kitware.com/Bug/view.php?id=8392 output.write('enable_language(ASM)\n') # ASM-ATT does not support .S files. # output.write('enable_language(ASM-ATT)\n') - SetVariable(output, 'builddir', '${CMAKE_BINARY_DIR}') + if cc: + SetVariable(output, 'CMAKE_ASM_COMPILER', cc) + + SetVariable(output, 'builddir', '${CMAKE_CURRENT_BINARY_DIR}') SetVariable(output, 'obj', '${builddir}/obj') output.write('\n') @@ -1066,6 +1139,11 @@ def GenerateOutputForConfig(target_list, target_dicts, data, output.write('set(CMAKE_CXX_OUTPUT_EXTENSION_REPLACE 1)\n') output.write('\n') + # Force ninja to use rsp files. Otherwise link and ar lines can get too long, + # resulting in 'Argument list too long' errors. + output.write('set(CMAKE_NINJA_FORCE_RESPONSE_FILE 1)\n') + output.write('\n') + namer = CMakeNamer(target_list) # The list of targets upon which the 'all' target should depend. diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/dump_dependency_json.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/dump_dependency_json.py index 927ba6ebad..160eafe2ef 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/dump_dependency_json.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/dump_dependency_json.py @@ -14,6 +14,9 @@ generator_supports_multiple_toolsets = True generator_wants_static_library_dependencies_adjusted = False +generator_filelist_paths = { +} + generator_default_variables = { } for dirname in ['INTERMEDIATE_DIR', 'SHARED_INTERMEDIATE_DIR', 'PRODUCT_DIR', @@ -56,6 +59,17 @@ def CalculateGeneratorInputInfo(params): global generator_wants_static_library_dependencies_adjusted generator_wants_static_library_dependencies_adjusted = True + toplevel = params['options'].toplevel_dir + generator_dir = os.path.relpath(params['options'].generator_output or '.') + # output_dir: relative path from generator_dir to the build directory. + output_dir = generator_flags.get('output_dir', 'out') + qualified_out_dir = os.path.normpath(os.path.join( + toplevel, generator_dir, output_dir, 'gypfiles')) + global generator_filelist_paths + generator_filelist_paths = { + 'toplevel': toplevel, + 'qualified_out_dir': qualified_out_dir, + } def GenerateOutput(target_list, target_dicts, data, params): # Map of target -> list of targets it depends on. @@ -74,7 +88,11 @@ def GenerateOutput(target_list, target_dicts, data, params): edges[target].append(dep) targets_to_visit.append(dep) - filename = 'dump.json' + try: + filepath = params['generator_flags']['output_dir'] + except KeyError: + filepath = '.' + filename = os.path.join(filepath, 'dump.json') f = open(filename, 'w') json.dump(edges, f) f.close() diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/make.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/make.py index 06c7fdc2e8..aefdac787c 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/make.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/make.py @@ -211,10 +211,10 @@ cmd_solink_module_host = $(LINK.$(TOOLSET)) -shared $(GYP_LDFLAGS) $(LDFLAGS.$(T LINK_COMMANDS_AIX = """\ quiet_cmd_alink = AR($(TOOLSET)) $@ -cmd_alink = rm -f $@ && $(AR.$(TOOLSET)) crs $@ $(filter %.o,$^) +cmd_alink = rm -f $@ && $(AR.$(TOOLSET)) -X32_64 crs $@ $(filter %.o,$^) quiet_cmd_alink_thin = AR($(TOOLSET)) $@ -cmd_alink_thin = rm -f $@ && $(AR.$(TOOLSET)) crs $@ $(filter %.o,$^) +cmd_alink_thin = rm -f $@ && $(AR.$(TOOLSET)) -X32_64 crs $@ $(filter %.o,$^) quiet_cmd_link = LINK($(TOOLSET)) $@ cmd_link = $(LINK.$(TOOLSET)) $(GYP_LDFLAGS) $(LDFLAGS.$(TOOLSET)) -o $@ $(LD_INPUTS) $(LIBS) @@ -273,9 +273,9 @@ all_deps := %(make_global_settings)s CC.target ?= %(CC.target)s -CFLAGS.target ?= $(CFLAGS) +CFLAGS.target ?= $(CPPFLAGS) $(CFLAGS) CXX.target ?= %(CXX.target)s -CXXFLAGS.target ?= $(CXXFLAGS) +CXXFLAGS.target ?= $(CPPFLAGS) $(CXXFLAGS) LINK.target ?= %(LINK.target)s LDFLAGS.target ?= $(LDFLAGS) AR.target ?= $(AR) @@ -286,9 +286,9 @@ LINK ?= $(CXX.target) # TODO(evan): move all cross-compilation logic to gyp-time so we don't need # to replicate this environment fallback in make as well. CC.host ?= %(CC.host)s -CFLAGS.host ?= +CFLAGS.host ?= $(CPPFLAGS_host) $(CFLAGS_host) CXX.host ?= %(CXX.host)s -CXXFLAGS.host ?= +CXXFLAGS.host ?= $(CPPFLAGS_host) $(CXXFLAGS_host) LINK.host ?= %(LINK.host)s LDFLAGS.host ?= AR.host ?= %(AR.host)s @@ -365,7 +365,7 @@ cmd_touch = touch $@ quiet_cmd_copy = COPY $@ # send stderr to /dev/null to ignore messages when linking directories. -cmd_copy = rm -rf "$@" && cp -af "$<" "$@" +cmd_copy = rm -rf "$@" && cp %(copy_archive_args)s "$<" "$@" %(link_commands)s """ @@ -1019,7 +1019,8 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD # accidentally writing duplicate dummy rules for those outputs. self.WriteLn('%s: obj := $(abs_obj)' % outputs[0]) self.WriteLn('%s: builddir := $(abs_builddir)' % outputs[0]) - self.WriteMakeRule(outputs, inputs + ['FORCE_DO_CMD'], actions) + self.WriteMakeRule(outputs, inputs, actions, + command="%s_%d" % (name, count)) # Spaces in rule filenames are not supported, but rule variables have # spaces in them (e.g. RULE_INPUT_PATH expands to '$(abspath $<)'). # The spaces within the variables are valid, so remove the variables @@ -1578,7 +1579,7 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD for link_dep in link_deps: assert ' ' not in link_dep, ( "Spaces in alink input filenames not supported (%s)" % link_dep) - if (self.flavor not in ('mac', 'openbsd', 'win') and not + if (self.flavor not in ('mac', 'openbsd', 'netbsd', 'win') and not self.is_standalone_static_library): self.WriteDoCmd([self.output_binary], link_deps, 'alink_thin', part_of_all, postbuilds=postbuilds) @@ -1688,6 +1689,7 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD self.WriteMakeRule(outputs, inputs, actions = ['$(call do_cmd,%s%s)' % (command, suffix)], comment = comment, + command = command, force = True) # Add our outputs to the list of targets we read depfiles from. # all_deps is only used for deps file reading, and for deps files we replace @@ -1698,7 +1700,7 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD def WriteMakeRule(self, outputs, inputs, actions=None, comment=None, - order_only=False, force=False, phony=False): + order_only=False, force=False, phony=False, command=None): """Write a Makefile rule, with some extra tricks. outputs: a list of outputs for the rule (note: this is not directly @@ -1711,6 +1713,7 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD force: if true, include FORCE_DO_CMD as an order-only dep phony: if true, the rule does not actually generate the named output, the output is just a name to run the rule + command: (optional) command name to generate unambiguous labels """ outputs = map(QuoteSpaces, outputs) inputs = map(QuoteSpaces, inputs) @@ -1719,44 +1722,38 @@ $(obj).$(TOOLSET)/$(TARGET)/%%.o: $(obj)/%%%s FORCE_DO_CMD self.WriteLn('# ' + comment) if phony: self.WriteLn('.PHONY: ' + ' '.join(outputs)) - # TODO(evanm): just make order_only a list of deps instead of these hacks. - if order_only: - order_insert = '| ' - pick_output = ' '.join(outputs) - else: - order_insert = '' - pick_output = outputs[0] - if force: - force_append = ' FORCE_DO_CMD' - else: - force_append = '' if actions: self.WriteLn("%s: TOOLSET := $(TOOLSET)" % outputs[0]) - self.WriteLn('%s: %s%s%s' % (pick_output, order_insert, ' '.join(inputs), - force_append)) + force_append = ' FORCE_DO_CMD' if force else '' + + if order_only: + # Order only rule: Just write a simple rule. + # TODO(evanm): just make order_only a list of deps instead of this hack. + self.WriteLn('%s: | %s%s' % + (' '.join(outputs), ' '.join(inputs), force_append)) + elif len(outputs) == 1: + # Regular rule, one output: Just write a simple rule. + self.WriteLn('%s: %s%s' % (outputs[0], ' '.join(inputs), force_append)) + else: + # Regular rule, more than one output: Multiple outputs are tricky in + # make. We will write three rules: + # - All outputs depend on an intermediate file. + # - Make .INTERMEDIATE depend on the intermediate. + # - The intermediate file depends on the inputs and executes the + # actual command. + # - The intermediate recipe will 'touch' the intermediate file. + # - The multi-output rule will have an do-nothing recipe. + intermediate = "%s.intermediate" % (command if command else self.target) + self.WriteLn('%s: %s' % (' '.join(outputs), intermediate)) + self.WriteLn('\t%s' % '@:'); + self.WriteLn('%s: %s' % ('.INTERMEDIATE', intermediate)) + self.WriteLn('%s: %s%s' % + (intermediate, ' '.join(inputs), force_append)) + actions.insert(0, '$(call do_cmd,touch)') + if actions: for action in actions: self.WriteLn('\t%s' % action) - if not order_only and len(outputs) > 1: - # If we have more than one output, a rule like - # foo bar: baz - # that for *each* output we must run the action, potentially - # in parallel. That is not what we're trying to write -- what - # we want is that we run the action once and it generates all - # the files. - # http://www.gnu.org/software/hello/manual/automake/Multiple-Outputs.html - # discusses this problem and has this solution: - # 1) Write the naive rule that would produce parallel runs of - # the action. - # 2) Make the outputs seralized on each other, so we won't start - # a parallel run until the first run finishes, at which point - # we'll have generated all the outputs and we're done. - self.WriteLn('%s: %s' % (' '.join(outputs[1:]), outputs[0])) - # Add a dummy command to the "extra outputs" rule, otherwise make seems to - # think these outputs haven't (couldn't have?) changed, and thus doesn't - # flag them as changed (i.e. include in '$?') when evaluating dependent - # rules, which in turn causes do_cmd() to skip running dependent commands. - self.WriteLn('%s: ;' % (' '.join(outputs[1:]))) self.WriteLn() @@ -2015,6 +2012,7 @@ def GenerateOutput(target_list, target_dicts, data, params): srcdir_prefix = '$(srcdir)/' flock_command= 'flock' + copy_archive_arguments = '-af' header_params = { 'default_target': default_target, 'builddir': builddir_name, @@ -2024,6 +2022,7 @@ def GenerateOutput(target_list, target_dicts, data, params): 'link_commands': LINK_COMMANDS_LINUX, 'extra_commands': '', 'srcdir': srcdir, + 'copy_archive_args': copy_archive_arguments, } if flavor == 'mac': flock_command = './gyp-mac-tool flock' @@ -2047,8 +2046,15 @@ def GenerateOutput(target_list, target_dicts, data, params): header_params.update({ 'flock': 'lockf', }) + elif flavor == 'openbsd': + copy_archive_arguments = '-pPRf' + header_params.update({ + 'copy_archive_args': copy_archive_arguments, + }) elif flavor == 'aix': + copy_archive_arguments = '-pPRf' header_params.update({ + 'copy_archive_args': copy_archive_arguments, 'link_commands': LINK_COMMANDS_AIX, 'flock': './gyp-flock-tool flock', 'flock_index': 2, diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/msvs.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/msvs.py index 8e6bd7ba0a..2ecf964c68 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/msvs.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/msvs.py @@ -86,6 +86,9 @@ generator_additional_non_configuration_keys = [ 'msvs_enable_winrt', 'msvs_requires_importlibrary', 'msvs_enable_winphone', + 'msvs_application_type_revision', + 'msvs_target_platform_version', + 'msvs_target_platform_minversion', ] @@ -2344,6 +2347,9 @@ def _GenerateMSBuildRuleTargetsFile(targets_path, msbuild_rules): rule_name, {'Condition': "'@(%s)' != '' and '%%(%s.ExcludedFromBuild)' != " "'true'" % (rule_name, rule_name), + 'EchoOff': 'true', + 'StandardOutputImportance': 'High', + 'StandardErrorImportance': 'High', 'CommandLineTemplate': '%%(%s.CommandLineTemplate)' % rule_name, 'AdditionalOptions': '%%(%s.AdditionalOptions)' % rule_name, 'Inputs': rule_inputs @@ -2634,8 +2640,23 @@ def _GetMSBuildGlobalProperties(spec, guid, gyp_file_name): if spec.get('msvs_enable_winrt'): properties[0].append(['DefaultLanguage', 'en-US']) properties[0].append(['AppContainerApplication', 'true']) - properties[0].append(['ApplicationTypeRevision', '8.1']) - + if spec.get('msvs_application_type_revision'): + app_type_revision = spec.get('msvs_application_type_revision') + properties[0].append(['ApplicationTypeRevision', app_type_revision]) + else: + properties[0].append(['ApplicationTypeRevision', '8.1']) + + if spec.get('msvs_target_platform_version'): + target_platform_version = spec.get('msvs_target_platform_version') + properties[0].append(['WindowsTargetPlatformVersion', + target_platform_version]) + if spec.get('msvs_target_platform_minversion'): + target_platform_minversion = spec.get('msvs_target_platform_minversion') + properties[0].append(['WindowsTargetPlatformMinVersion', + target_platform_minversion]) + else: + properties[0].append(['WindowsTargetPlatformMinVersion', + target_platform_version]) if spec.get('msvs_enable_winphone'): properties[0].append(['ApplicationType', 'Windows Phone']) else: diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/ninja.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/ninja.py index 624c99ae89..841067ed34 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/ninja.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/ninja.py @@ -139,8 +139,11 @@ class Target(object): self.bundle = None # On Windows, incremental linking requires linking against all the .objs # that compose a .lib (rather than the .lib itself). That list is stored - # here. + # here. In this case, we also need to save the compile_deps for the target, + # so that the the target that directly depends on the .objs can also depend + # on those. self.component_objs = None + self.compile_deps = None # Windows only. The import .lib is the output of a build step, but # because dependents only link against the lib (not both the lib and the # dll) we keep track of the import library here. @@ -474,16 +477,17 @@ class NinjaWriter(object): elif self.flavor == 'mac' and len(self.archs) > 1: link_deps = collections.defaultdict(list) - + compile_deps = self.target.actions_stamp or actions_depends if self.flavor == 'win' and self.target.type == 'static_library': self.target.component_objs = link_deps + self.target.compile_deps = compile_deps # Write out a link step, if needed. output = None is_empty_bundle = not link_deps and not mac_bundle_depends if link_deps or self.target.actions_stamp or actions_depends: output = self.WriteTarget(spec, config_name, config, link_deps, - self.target.actions_stamp or actions_depends) + compile_deps) if self.is_mac_bundle: mac_bundle_depends.append(output) @@ -921,6 +925,11 @@ class NinjaWriter(object): os.environ.get('CFLAGS', '').split() + cflags_c) cflags_cc = (os.environ.get('CPPFLAGS', '').split() + os.environ.get('CXXFLAGS', '').split() + cflags_cc) + elif self.toolset == 'host': + cflags_c = (os.environ.get('CPPFLAGS_host', '').split() + + os.environ.get('CFLAGS_host', '').split() + cflags_c) + cflags_cc = (os.environ.get('CPPFLAGS_host', '').split() + + os.environ.get('CXXFLAGS_host', '').split() + cflags_cc) defines = config.get('defines', []) + extra_defines self.WriteVariableList(ninja_file, 'defines', @@ -1088,6 +1097,7 @@ class NinjaWriter(object): implicit_deps = set() solibs = set() + order_deps = set() if 'dependencies' in spec: # Two kinds of dependencies: @@ -1106,6 +1116,8 @@ class NinjaWriter(object): target.component_objs and self.msvs_settings.IsUseLibraryDependencyInputs(config_name)): new_deps = target.component_objs + if target.compile_deps: + order_deps.add(target.compile_deps) elif self.flavor == 'win' and target.import_lib: new_deps = [target.import_lib] elif target.UsesToc(self.flavor): @@ -1169,7 +1181,7 @@ class NinjaWriter(object): ldflags.append(r'-Wl,-rpath=\$$ORIGIN/%s' % rpath) ldflags.append('-Wl,-rpath-link=%s' % rpath) self.WriteVariableList(ninja_file, 'ldflags', - gyp.common.uniquer(map(self.ExpandSpecial, ldflags))) + map(self.ExpandSpecial, ldflags)) library_dirs = config.get('library_dirs', []) if self.flavor == 'win': @@ -1244,6 +1256,7 @@ class NinjaWriter(object): ninja_file.build(output, command + command_suffix, link_deps, implicit=list(implicit_deps), + order_only=list(order_deps), variables=extra_bindings) return linked_binary @@ -1258,7 +1271,7 @@ class NinjaWriter(object): self.target.type = 'none' elif spec['type'] == 'static_library': self.target.binary = self.ComputeOutput(spec) - if (self.flavor not in ('mac', 'openbsd', 'win') and not + if (self.flavor not in ('mac', 'openbsd', 'netbsd', 'win') and not self.is_standalone_static_library): self.ninja.build(self.target.binary, 'alink_thin', link_deps, order_only=compile_deps) @@ -1672,7 +1685,7 @@ def CommandWithWrapper(cmd, wrappers, prog): def GetDefaultConcurrentLinks(): """Returns a best-guess for a number of concurrent links.""" - pool_size = int(os.getenv('GYP_LINK_CONCURRENCY', 0)) + pool_size = int(os.environ.get('GYP_LINK_CONCURRENCY', 0)) if pool_size: return pool_size @@ -1696,8 +1709,10 @@ def GetDefaultConcurrentLinks(): stat.dwLength = ctypes.sizeof(stat) ctypes.windll.kernel32.GlobalMemoryStatusEx(ctypes.byref(stat)) - mem_limit = max(1, stat.ullTotalPhys / (4 * (2 ** 30))) # total / 4GB - hard_cap = max(1, int(os.getenv('GYP_LINK_CONCURRENCY_MAX', 2**32))) + # VS 2015 uses 20% more working set than VS 2013 and can consume all RAM + # on a 64 GB machine. + mem_limit = max(1, stat.ullTotalPhys / (5 * (2 ** 30))) # total / 5GB + hard_cap = max(1, int(os.environ.get('GYP_LINK_CONCURRENCY_MAX', 2**32))) return min(mem_limit, hard_cap) elif sys.platform.startswith('linux'): if os.path.exists("/proc/meminfo"): @@ -2275,7 +2290,11 @@ def GenerateOutputForConfig(target_list, target_dicts, data, params, if flavor == 'mac': gyp.xcode_emulation.MergeGlobalXcodeSettingsToSpec(data[build_file], spec) - build_file = gyp.common.RelativePath(build_file, options.toplevel_dir) + # If build_file is a symlink, we must not follow it because there's a chance + # it could point to a path above toplevel_dir, and we cannot correctly deal + # with that case at the moment. + build_file = gyp.common.RelativePath(build_file, options.toplevel_dir, + False) qualified_target_for_hash = gyp.common.QualifiedTarget(build_file, name, toolset) diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/xcode.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/xcode.py index 482b53ac8a..0e3fb9301e 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/xcode.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/generator/xcode.py @@ -87,6 +87,8 @@ generator_extra_sources_for_rules = [ 'mac_framework_private_headers', ] +generator_filelist_paths = None + # Xcode's standard set of library directories, which don't need to be duplicated # in LIBRARY_SEARCH_PATHS. This list is not exhaustive, but that's okay. xcode_standard_library_dirs = frozenset([ @@ -578,6 +580,26 @@ def PerformBuild(data, configurations, params): subprocess.check_call(arguments) +def CalculateGeneratorInputInfo(params): + toplevel = params['options'].toplevel_dir + if params.get('flavor') == 'ninja': + generator_dir = os.path.relpath(params['options'].generator_output or '.') + output_dir = params.get('generator_flags', {}).get('output_dir', 'out') + output_dir = os.path.normpath(os.path.join(generator_dir, output_dir)) + qualified_out_dir = os.path.normpath(os.path.join( + toplevel, output_dir, 'gypfiles-xcode-ninja')) + else: + output_dir = os.path.normpath(os.path.join(toplevel, 'xcodebuild')) + qualified_out_dir = os.path.normpath(os.path.join( + toplevel, output_dir, 'gypfiles')) + + global generator_filelist_paths + generator_filelist_paths = { + 'toplevel': toplevel, + 'qualified_out_dir': qualified_out_dir, + } + + def GenerateOutput(target_list, target_dicts, data, params): # Optionally configure each spec to use ninja as the external builder. ninja_wrapper = params.get('flavor') == 'ninja' @@ -590,6 +612,15 @@ def GenerateOutput(target_list, target_dicts, data, params): parallel_builds = generator_flags.get('xcode_parallel_builds', True) serialize_all_tests = \ generator_flags.get('xcode_serialize_all_test_runs', True) + upgrade_check_project_version = \ + generator_flags.get('xcode_upgrade_check_project_version', None) + + # Format upgrade_check_project_version with leading zeros as needed. + if upgrade_check_project_version: + upgrade_check_project_version = str(upgrade_check_project_version) + while len(upgrade_check_project_version) < 4: + upgrade_check_project_version = '0' + upgrade_check_project_version + skip_excluded_files = \ not generator_flags.get('xcode_list_excluded_files', True) xcode_projects = {} @@ -604,9 +635,17 @@ def GenerateOutput(target_list, target_dicts, data, params): xcode_projects[build_file] = xcp pbxp = xcp.project + # Set project-level attributes from multiple options + project_attributes = {}; if parallel_builds: - pbxp.SetProperty('attributes', - {'BuildIndependentTargetsInParallel': 'YES'}) + project_attributes['BuildIndependentTargetsInParallel'] = 'YES' + if upgrade_check_project_version: + project_attributes['LastUpgradeCheck'] = upgrade_check_project_version + project_attributes['LastTestingUpgradeCheck'] = \ + upgrade_check_project_version + project_attributes['LastSwiftUpdateCheck'] = \ + upgrade_check_project_version + pbxp.SetProperty('attributes', project_attributes) # Add gyp/gypi files to project if not generator_flags.get('standalone'): @@ -648,6 +687,7 @@ def GenerateOutput(target_list, target_dicts, data, params): 'loadable_module': 'com.googlecode.gyp.xcode.bundle', 'shared_library': 'com.apple.product-type.library.dynamic', 'static_library': 'com.apple.product-type.library.static', + 'mac_kernel_extension': 'com.apple.product-type.kernel-extension', 'executable+bundle': 'com.apple.product-type.application', 'loadable_module+bundle': 'com.apple.product-type.bundle', 'loadable_module+xctest': 'com.apple.product-type.bundle.unit-test', @@ -655,7 +695,9 @@ def GenerateOutput(target_list, target_dicts, data, params): 'executable+extension+bundle': 'com.apple.product-type.app-extension', 'executable+watch+extension+bundle': 'com.apple.product-type.watchkit-extension', - 'executable+watch+bundle': 'com.apple.product-type.application.watchapp', + 'executable+watch+bundle': + 'com.apple.product-type.application.watchapp', + 'mac_kernel_extension+bundle': 'com.apple.product-type.kernel-extension', } target_properties = { diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/input.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/input.py index 34fbc54711..20178672b2 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/input.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/input.py @@ -28,7 +28,12 @@ from gyp.common import OrderedSet # A list of types that are treated as linkable. -linkable_types = ['executable', 'shared_library', 'loadable_module'] +linkable_types = [ + 'executable', + 'shared_library', + 'loadable_module', + 'mac_kernel_extension', +] # A list of sections that contain links to other targets. dependency_sections = ['dependencies', 'export_dependent_settings'] @@ -57,7 +62,7 @@ def IsPathSection(section): # If section ends in one of the '=+?!' characters, it's applied to a section # without the trailing characters. '/' is notably absent from this list, # because there's no way for a regular expression to be treated as a path. - while section[-1:] in '=+?!': + while section and section[-1:] in '=+?!': section = section[:-1] if section in path_sections: @@ -893,11 +898,15 @@ def ExpandVariables(input, phase, variables, build_file): else: # Fix up command with platform specific workarounds. contents = FixupPlatformCommand(contents) - p = subprocess.Popen(contents, shell=use_shell, - stdout=subprocess.PIPE, - stderr=subprocess.PIPE, - stdin=subprocess.PIPE, - cwd=build_file_dir) + try: + p = subprocess.Popen(contents, shell=use_shell, + stdout=subprocess.PIPE, + stderr=subprocess.PIPE, + stdin=subprocess.PIPE, + cwd=build_file_dir) + except Exception, e: + raise GypError("%s while executing command '%s' in %s" % + (e, contents, build_file)) p_stdout, p_stderr = p.communicate('') @@ -905,8 +914,8 @@ def ExpandVariables(input, phase, variables, build_file): sys.stderr.write(p_stderr) # Simulate check_call behavior, since check_call only exists # in python 2.5 and later. - raise GypError("Call to '%s' returned exit status %d." % - (contents, p.returncode)) + raise GypError("Call to '%s' returned exit status %d while in %s." % + (contents, p.returncode, build_file)) replacement = p_stdout.rstrip() cached_command_results[cache_key] = replacement @@ -1662,8 +1671,8 @@ class DependencyGraphNode(object): if dependency.ref is None: continue if dependency.ref not in dependencies: - dependencies.add(dependency.ref) dependency.DeepDependencies(dependencies) + dependencies.add(dependency.ref) return dependencies @@ -1720,11 +1729,12 @@ class DependencyGraphNode(object): dependencies.add(self.ref) return dependencies - # Executables and loadable modules are already fully and finally linked. - # Nothing else can be a link dependency of them, there can only be - # dependencies in the sense that a dependent target might run an - # executable or load the loadable_module. - if not initial and target_type in ('executable', 'loadable_module'): + # Executables, mac kernel extensions and loadable modules are already fully + # and finally linked. Nothing else can be a link dependency of them, there + # can only be dependencies in the sense that a dependent target might run + # an executable or load the loadable_module. + if not initial and target_type in ('executable', 'loadable_module', + 'mac_kernel_extension'): return dependencies # Shared libraries are already fully linked. They should only be included @@ -2475,7 +2485,7 @@ def ValidateTargetType(target, target_dict): """ VALID_TARGET_TYPES = ('executable', 'loadable_module', 'static_library', 'shared_library', - 'none') + 'mac_kernel_extension', 'none') target_type = target_dict.get('type', None) if target_type not in VALID_TARGET_TYPES: raise GypError("Target %s has an invalid target type '%s'. " @@ -2488,6 +2498,35 @@ def ValidateTargetType(target, target_dict): target_type)) +def ValidateSourcesInTarget(target, target_dict, build_file, + duplicate_basename_check): + if not duplicate_basename_check: + return + if target_dict.get('type', None) != 'static_library': + return + sources = target_dict.get('sources', []) + basenames = {} + for source in sources: + name, ext = os.path.splitext(source) + is_compiled_file = ext in [ + '.c', '.cc', '.cpp', '.cxx', '.m', '.mm', '.s', '.S'] + if not is_compiled_file: + continue + basename = os.path.basename(name) # Don't include extension. + basenames.setdefault(basename, []).append(source) + + error = '' + for basename, files in basenames.iteritems(): + if len(files) > 1: + error += ' %s: %s\n' % (basename, ' '.join(files)) + + if error: + print('static library %s has several files with the same basename:\n' % + target + error + 'libtool on Mac cannot handle that. Use ' + '--no-duplicate-basename-check to disable this validation.') + raise GypError('Duplicate basenames in sources section, see list above') + + def ValidateRulesInTarget(target, target_dict, extra_sources_for_rules): """Ensures that the rules sections in target_dict are valid and consistent, and determines which sources they apply to. @@ -2708,7 +2747,7 @@ def SetGeneratorGlobals(generator_input_info): def Load(build_files, variables, includes, depth, generator_input_info, check, - circular_check, parallel, root_targets): + circular_check, duplicate_basename_check, parallel, root_targets): SetGeneratorGlobals(generator_input_info) # A generator can have other lists (in addition to sources) be processed # for rules. @@ -2840,6 +2879,8 @@ def Load(build_files, variables, includes, depth, generator_input_info, check, target_dict = targets[target] build_file = gyp.common.BuildFile(target) ValidateTargetType(target, target_dict) + ValidateSourcesInTarget(target, target_dict, build_file, + duplicate_basename_check) ValidateRulesInTarget(target, target_dict, extra_sources_for_rules) ValidateRunAsInTarget(target, target_dict, build_file) ValidateActionsInTarget(target, target_dict, build_file) diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/mac_tool.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/mac_tool.py index 366439a062..eeeaceb0c7 100755 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/mac_tool.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/mac_tool.py @@ -603,8 +603,7 @@ class MacTool(object): if isinstance(data, list): return [self._ExpandVariables(v, substitutions) for v in data] if isinstance(data, dict): - return dict((k, self._ExpandVariables(data[k], - substitutions)) for k in data) + return {k: self._ExpandVariables(data[k], substitutions) for k in data} return data if __name__ == '__main__': diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/msvs_emulation.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/msvs_emulation.py index ce5c46ea5b..ca67b122f0 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/msvs_emulation.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/msvs_emulation.py @@ -442,6 +442,7 @@ class MsvsSettings(object): cl('FloatingPointModel', map={'0': 'precise', '1': 'strict', '2': 'fast'}, prefix='/fp:', default='0') + cl('CompileAsManaged', map={'false': '', 'true': '/clr'}) cl('WholeProgramOptimization', map={'true': '/GL'}) cl('WarningLevel', prefix='/W') cl('WarnAsError', map={'true': '/WX'}) @@ -593,6 +594,15 @@ class MsvsSettings(object): '2': 'WINDOWS%s' % minimum_required_version}, prefix='/SUBSYSTEM:') + stack_reserve_size = self._Setting( + ('VCLinkerTool', 'StackReserveSize'), config, default='') + if stack_reserve_size: + stack_commit_size = self._Setting( + ('VCLinkerTool', 'StackCommitSize'), config, default='') + if stack_commit_size: + stack_commit_size = ',' + stack_commit_size + ldflags.append('/STACK:%s%s' % (stack_reserve_size, stack_commit_size)) + ld('TerminalServerAware', map={'1': ':NO', '2': ''}, prefix='/TSAWARE') ld('LinkIncremental', map={'1': ':NO', '2': ''}, prefix='/INCREMENTAL') ld('BaseAddress', prefix='/BASE:') diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/win_tool.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/win_tool.py index 417e465f78..bb6f1ea436 100755 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/win_tool.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/win_tool.py @@ -123,7 +123,9 @@ class WinTool(object): stderr=subprocess.STDOUT) out, _ = link.communicate() for line in out.splitlines(): - if not line.startswith(' Creating library '): + if (not line.startswith(' Creating library ') and + not line.startswith('Generating code') and + not line.startswith('Finished generating code')): print line return link.returncode diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcode_emulation.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcode_emulation.py index f1a839a2f5..b06bdc4e8b 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcode_emulation.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcode_emulation.py @@ -525,6 +525,13 @@ class XcodeSettings(object): if self._Test('GCC_WARN_ABOUT_MISSING_NEWLINE', 'YES', default='NO'): cflags.append('-Wnewline-eof') + # In Xcode, this is only activated when GCC_COMPILER_VERSION is clang or + # llvm-gcc. It also requires a fairly recent libtool, and + # if the system clang isn't used, DYLD_LIBRARY_PATH needs to contain the + # path to the libLTO.dylib that matches the used clang. + if self._Test('LLVM_LTO', 'YES', default='NO'): + cflags.append('-flto') + self._AppendPlatformVersionMinFlags(cflags) # TODO: @@ -831,8 +838,9 @@ class XcodeSettings(object): # These flags reflect the compilation options used by xcode to compile # extensions. ldflags.append('-lpkstart') - ldflags.append(sdk_root + - '/System/Library/PrivateFrameworks/PlugInKit.framework/PlugInKit') + if XcodeVersion() < '0900': + ldflags.append(sdk_root + + '/System/Library/PrivateFrameworks/PlugInKit.framework/PlugInKit') ldflags.append('-fapplication-extension') ldflags.append('-Xlinker -rpath ' '-Xlinker @executable_path/../../Frameworks') @@ -1024,7 +1032,23 @@ class XcodeSettings(object): sdk_root = self._SdkPath(config_name) if not sdk_root: sdk_root = '' - return l.replace('$(SDKROOT)', sdk_root) + # Xcode 7 started shipping with ".tbd" (text based stubs) files instead of + # ".dylib" without providing a real support for them. What it does, for + # "/usr/lib" libraries, is do "-L/usr/lib -lname" which is dependent on the + # library order and cause collision when building Chrome. + # + # Instead substitude ".tbd" to ".dylib" in the generated project when the + # following conditions are both true: + # - library is referenced in the gyp file as "$(SDKROOT)/**/*.dylib", + # - the ".dylib" file does not exists but a ".tbd" file do. + library = l.replace('$(SDKROOT)', sdk_root) + if l.startswith('$(SDKROOT)'): + basename, ext = os.path.splitext(library) + if ext == '.dylib' and not os.path.exists(library): + tbd_library = basename + '.tbd' + if os.path.exists(tbd_library): + library = tbd_library + return library def AdjustLibraries(self, libraries, config_name=None): """Transforms entries like 'Cocoa.framework' in libraries into entries like @@ -1428,6 +1452,7 @@ def _GetXcodeEnv(xcode_settings, built_products_dir, srcroot, configuration, # These are filled in on a as-needed basis. env = { + 'BUILT_FRAMEWORKS_DIR' : built_products_dir, 'BUILT_PRODUCTS_DIR' : built_products_dir, 'CONFIGURATION' : configuration, 'PRODUCT_NAME' : xcode_settings.GetProductName(), diff --git a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcodeproj_file.py b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcodeproj_file.py index 034a0d2d4f..d08b7f7770 100644 --- a/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcodeproj_file.py +++ b/deps/npm/node_modules/node-gyp/gyp/pylib/gyp/xcodeproj_file.py @@ -1492,6 +1492,7 @@ class PBXFileReference(XCFileLikeElement, XCContainerPortal, XCRemoteObject): 'icns': 'image.icns', 'java': 'sourcecode.java', 'js': 'sourcecode.javascript', + 'kext': 'wrapper.kext', 'm': 'sourcecode.c.objc', 'mm': 'sourcecode.cpp.objcpp', 'nib': 'wrapper.nib', @@ -1951,6 +1952,7 @@ class PBXCopyFilesBuildPhase(XCBuildPhase): # path_tree_to_subfolder maps names of Xcode variables to the associated # dstSubfolderSpec property value used in a PBXCopyFilesBuildPhase object. path_tree_to_subfolder = { + 'BUILT_FRAMEWORKS_DIR': 10, # Frameworks Directory 'BUILT_PRODUCTS_DIR': 16, # Products Directory # Other types that can be chosen via the Xcode UI. # TODO(mark): Map Xcode variable names to these. @@ -1958,7 +1960,6 @@ class PBXCopyFilesBuildPhase(XCBuildPhase): # : 6, # Executables: 6 # : 7, # Resources # : 15, # Java Resources - # : 10, # Frameworks # : 11, # Shared Frameworks # : 12, # Shared Support # : 13, # PlugIns @@ -2262,6 +2263,8 @@ class PBXNativeTarget(XCTarget): '', '.xctest'], 'com.googlecode.gyp.xcode.bundle': ['compiled.mach-o.dylib', '', '.so'], + 'com.apple.product-type.kernel-extension': ['wrapper.kext', + '', '.kext'], } def __init__(self, properties=None, id=None, parent=None, diff --git a/deps/npm/node_modules/node-gyp/lib/build.js b/deps/npm/node_modules/node-gyp/lib/build.js index 198017b262..3a3edccf87 100644 --- a/deps/npm/node_modules/node-gyp/lib/build.js +++ b/deps/npm/node_modules/node-gyp/lib/build.js @@ -19,9 +19,15 @@ var fs = require('graceful-fs') exports.usage = 'Invokes `' + (win ? 'msbuild' : 'make') + '` and builds the module' function build (gyp, argv, callback) { + var platformMake = 'make' + if (process.platform === 'aix') { + platformMake = 'gmake' + } else if (process.platform.indexOf('bsd') !== -1) { + platformMake = 'gmake' + } + var release = processRelease(argv, gyp, process.version, process.release) - , makeCommand = gyp.opts.make || process.env.MAKE - || (process.platform.indexOf('bsd') != -1 && process.platform.indexOf('kfreebsd') == -1 ? 'gmake' : 'make') + , makeCommand = gyp.opts.make || process.env.MAKE || platformMake , command = win ? 'msbuild' : makeCommand , buildDir = path.resolve('build') , configPath = path.resolve(buildDir, 'config.gypi') diff --git a/deps/npm/node_modules/node-gyp/lib/configure.js b/deps/npm/node_modules/node-gyp/lib/configure.js index 009935202a..4e0652961e 100644 --- a/deps/npm/node_modules/node-gyp/lib/configure.js +++ b/deps/npm/node_modules/node-gyp/lib/configure.js @@ -1,4 +1,5 @@ module.exports = exports = configure +module.exports.test = { findPython: findPython } /** * Module dependencies. @@ -19,6 +20,7 @@ var fs = require('graceful-fs') , spawn = cp.spawn , execFile = cp.execFile , win = process.platform == 'win32' + , findNodeDirectory = require('./find-node-directory') exports.usage = 'Generates ' + (win ? 'MSVC project files' : 'a Makefile') + ' for the current module' @@ -31,97 +33,14 @@ function configure (gyp, argv, callback) { , nodeDir , release = processRelease(argv, gyp, process.version, process.release) - checkPython() - - // Check if Python is in the $PATH - function checkPython () { - log.verbose('check python', 'checking for Python executable "%s" in the PATH', python) - which(python, function (err, execPath) { - if (err) { - log.verbose('`which` failed', python, err) - if (python === 'python2') { - python = 'python' - return checkPython() - } - if (win) { - guessPython() - } else { - failNoPython() - } - } else { - log.verbose('`which` succeeded', python, execPath) - checkPythonVersion() - } - }) - } - - // Called on Windows when "python" isn't available in the current $PATH. - // We're gonna check if "%SystemDrive%\python27\python.exe" exists. - function guessPython () { - log.verbose('could not find "' + python + '". guessing location') - var rootDir = process.env.SystemDrive || 'C:\\' - if (rootDir[rootDir.length - 1] !== '\\') { - rootDir += '\\' + findPython(python, function (err, found) { + if (err) { + callback(err) + } else { + python = found + getNodeDir() } - var pythonPath = path.resolve(rootDir, 'Python27', 'python.exe') - log.verbose('ensuring that file exists:', pythonPath) - fs.stat(pythonPath, function (err, stat) { - if (err) { - if (err.code == 'ENOENT') { - failNoPython() - } else { - callback(err) - } - return - } - python = pythonPath - checkPythonVersion() - }) - } - - function checkPythonVersion () { - var env = extend({}, process.env) - env.TERM = 'dumb' - - execFile(python, ['-c', 'import platform; print(platform.python_version());'], { env: env }, function (err, stdout) { - if (err) { - return callback(err) - } - log.verbose('check python version', '`%s -c "import platform; print(platform.python_version());"` returned: %j', python, stdout) - var version = stdout.trim() - if (~version.indexOf('+')) { - log.silly('stripping "+" sign(s) from version') - version = version.replace(/\+/g, '') - } - if (~version.indexOf('rc')) { - log.silly('stripping "rc" identifier from version') - version = version.replace(/rc(.*)$/ig, '') - } - var range = semver.Range('>=2.5.0 <3.0.0') - var valid = false - try { - valid = range.test(version) - } catch (e) { - log.silly('range.test() error', e) - } - if (valid) { - getNodeDir() - } else { - failPythonVersion(version) - } - }) - } - - function failNoPython () { - callback(new Error('Can\'t find Python executable "' + python + - '", you can set the PYTHON env variable.')) - } - - function failPythonVersion (badVersion) { - callback(new Error('Python executable "' + python + - '" is v' + badVersion + ', which is not supported by gyp.\n' + - 'You can pass the --python switch to point to Python >= v2.5.0 & < 3.0.0.')) - } + }) function getNodeDir () { @@ -299,6 +218,34 @@ function configure (gyp, argv, callback) { argv.push('-I', config) }) + // for AIX we need to set up the path to the exp file + // which contains the symbols needed for linking. + // The file will either be in one of the following + // depending on whether it is an installed or + // development environment: + // - the include/node directory + // - the out/Release directory + // - the out/Debug directory + // - the root directory + var node_exp_file = '' + if (process.platform === 'aix') { + var node_root_dir = findNodeDirectory() + var candidates = ['include/node/node.exp', + 'out/Release/node.exp', + 'out/Debug/node.exp', + 'node.exp'] + for (var next = 0; next < candidates.length; next++) { + node_exp_file = path.resolve(node_root_dir, candidates[next]) + try { + fs.accessSync(node_exp_file, fs.R_OK) + // exp file found, stop looking + break + } catch (exception) { + // this candidate was not found or not readable, do nothing + } + } + } + // this logic ported from the old `gyp_addon` python file var gyp_script = path.resolve(__dirname, '..', 'gyp', 'gyp_main.py') var addon_gypi = path.resolve(__dirname, '..', 'addon.gypi') @@ -319,6 +266,9 @@ function configure (gyp, argv, callback) { argv.push('-Dlibrary=shared_library') argv.push('-Dvisibility=default') argv.push('-Dnode_root_dir=' + nodeDir) + if (process.platform === 'aix') { + argv.push('-Dnode_exp_file=' + node_exp_file) + } argv.push('-Dnode_gyp_dir=' + nodeGypDir) argv.push('-Dnode_lib_file=' + release.name + '.lib') argv.push('-Dmodule_root_dir=' + process.cwd()) @@ -360,3 +310,101 @@ function configure (gyp, argv, callback) { } } + +function findPython (python, callback) { + checkPython() + + // Check if Python is in the $PATH + function checkPython () { + log.verbose('check python', 'checking for Python executable "%s" in the PATH', python) + which(python, function (err, execPath) { + if (err) { + log.verbose('`which` failed', python, err) + if (python === 'python2') { + python = 'python' + return checkPython() + } + if (win) { + guessPython() + } else { + failNoPython() + } + } else { + log.verbose('`which` succeeded', python, execPath) + // Found the `python` exceutable, and from now on we use it explicitly. + // This solves #667 and #750 (`execFile` won't run batch files + // (*.cmd, and *.bat)) + python = execPath + checkPythonVersion() + } + }) + } + + // Called on Windows when "python" isn't available in the current $PATH. + // We're gonna check if "%SystemDrive%\python27\python.exe" exists. + function guessPython () { + log.verbose('could not find "' + python + '". guessing location') + var rootDir = process.env.SystemDrive || 'C:\\' + if (rootDir[rootDir.length - 1] !== '\\') { + rootDir += '\\' + } + var pythonPath = path.resolve(rootDir, 'Python27', 'python.exe') + log.verbose('ensuring that file exists:', pythonPath) + fs.stat(pythonPath, function (err, stat) { + if (err) { + if (err.code == 'ENOENT') { + failNoPython() + } else { + callback(err) + } + return + } + python = pythonPath + checkPythonVersion() + }) + } + + function checkPythonVersion () { + var env = extend({}, process.env) + env.TERM = 'dumb' + + execFile(python, ['-c', 'import platform; print(platform.python_version());'], { env: env }, function (err, stdout) { + if (err) { + return callback(err) + } + log.verbose('check python version', '`%s -c "import platform; print(platform.python_version());"` returned: %j', python, stdout) + var version = stdout.trim() + if (~version.indexOf('+')) { + log.silly('stripping "+" sign(s) from version') + version = version.replace(/\+/g, '') + } + if (~version.indexOf('rc')) { + log.silly('stripping "rc" identifier from version') + version = version.replace(/rc(.*)$/ig, '') + } + var range = semver.Range('>=2.5.0 <3.0.0') + var valid = false + try { + valid = range.test(version) + } catch (e) { + log.silly('range.test() error', e) + } + if (valid) { + callback(null, python) + } else { + failPythonVersion(version) + } + }) + } + + function failNoPython () { + callback(new Error('Can\'t find Python executable "' + python + + '", you can set the PYTHON env variable.')) + } + + function failPythonVersion (badVersion) { + callback(new Error('Python executable "' + python + + '" is v' + badVersion + ', which is not supported by gyp.\n' + + 'You can pass the --python switch to point to Python >= v2.5.0 & < 3.0.0.')) + } +} diff --git a/deps/npm/node_modules/node-gyp/lib/find-node-directory.js b/deps/npm/node_modules/node-gyp/lib/find-node-directory.js new file mode 100644 index 0000000000..3aee8a109a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/lib/find-node-directory.js @@ -0,0 +1,61 @@ +var path = require('path') + , log = require('npmlog') + +function findNodeDirectory(scriptLocation, processObj) { + // set dirname and process if not passed in + // this facilitates regression tests + if (scriptLocation === undefined) { + scriptLocation = __dirname + } + if (processObj === undefined) { + processObj = process + } + + // Have a look to see what is above us, to try and work out where we are + npm_parent_directory = path.join(scriptLocation, '../../../..') + log.verbose('node-gyp root', 'npm_parent_directory is ' + + path.basename(npm_parent_directory)) + node_root_dir = "" + + log.verbose('node-gyp root', 'Finding node root directory') + if (path.basename(npm_parent_directory) === 'deps') { + // We are in a build directory where this script lives in + // deps/npm/node_modules/node-gyp/lib + node_root_dir = path.join(npm_parent_directory, '..') + log.verbose('node-gyp root', 'in build directory, root = ' + + node_root_dir) + } else if (path.basename(npm_parent_directory) === 'node_modules') { + // We are in a node install directory where this script lives in + // lib/node_modules/npm/node_modules/node-gyp/lib or + // node_modules/npm/node_modules/node-gyp/lib depending on the + // platform + if (processObj.platform === 'win32') { + node_root_dir = path.join(npm_parent_directory, '..') + } else { + node_root_dir = path.join(npm_parent_directory, '../..') + } + log.verbose('node-gyp root', 'in install directory, root = ' + + node_root_dir) + } else { + // We don't know where we are, try working it out from the location + // of the node binary + var node_dir = path.dirname(processObj.execPath) + var directory_up = path.basename(node_dir) + if (directory_up === 'bin') { + node_root_dir = path.join(node_dir, '..') + } else if (directory_up === 'Release' || directory_up === 'Debug') { + // If we are a recently built node, and the directory structure + // is that of a repository. If we are on Windows then we only need + // to go one level up, everything else, two + if (processObj.platform === 'win32') { + node_root_dir = path.join(node_dir, '..') + } else { + node_root_dir = path.join(node_dir, '../..') + } + } + // Else return the default blank, "". + } + return node_root_dir +} + +module.exports = findNodeDirectory diff --git a/deps/npm/node_modules/node-gyp/lib/node-gyp.js b/deps/npm/node_modules/node-gyp/lib/node-gyp.js index d6d6509a7a..b84f17d7e2 100644 --- a/deps/npm/node_modules/node-gyp/lib/node-gyp.js +++ b/deps/npm/node_modules/node-gyp/lib/node-gyp.js @@ -164,7 +164,9 @@ proto.parseArgv = function parseOpts (argv) { } else { // add the user-defined options to the config name = name.substring(npm_config_prefix.length) - this.opts[name] = val + // gyp@741b7f1 enters an infinite loop when it encounters + // zero-length options so ensure those don't get through. + if (name) this.opts[name] = val } }, this) diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml index cc4dba29d9..6e5919de39 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/.travis.yml @@ -1,4 +1,3 @@ language: node_js node_js: - - "0.8" - "0.10" diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md new file mode 100644 index 0000000000..2cdc8e4148 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/LICENSE.md @@ -0,0 +1,21 @@ +(MIT) + +Copyright (c) 2013 Julian Gruber <julian@juliangruber.com> + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies +of the Software, and to permit persons to whom the Software is furnished to do +so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md index 2aff0ebff4..421f3aa5f9 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/README.md @@ -47,6 +47,15 @@ If there's no match, `undefined` will be returned. If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']`. +### var r = balanced.range(a, b, str) + +For the first non-nested matching pair of `a` and `b` in `str`, return an +array with indexes: `[ <a index>, <b index> ]`. + +If there's no match, `undefined` will be returned. + +If the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `[ 1, 3 ]`. + ## Installation With [npm](https://npmjs.org) do: diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js index d165ae8174..75f3d71cba 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/index.js @@ -1,38 +1,50 @@ module.exports = balanced; function balanced(a, b, str) { - var bal = 0; - var m = {}; - var ended = false; - - for (var i = 0; i < str.length; i++) { - if (a == str.substr(i, a.length)) { - if (!('start' in m)) m.start = i; - bal++; - } - else if (b == str.substr(i, b.length) && 'start' in m) { - ended = true; - bal--; - if (!bal) { - m.end = i; - m.pre = str.substr(0, m.start); - m.body = (m.end - m.start > 1) - ? str.substring(m.start + a.length, m.end) - : ''; - m.post = str.slice(m.end + b.length); - return m; + var r = range(a, b, str); + + return r && { + start: r[0], + end: r[1], + pre: str.slice(0, r[0]), + body: str.slice(r[0] + a.length, r[1]), + post: str.slice(r[1] + b.length) + }; +} + +balanced.range = range; +function range(a, b, str) { + var begs, beg, left, right, result; + var ai = str.indexOf(a); + var bi = str.indexOf(b, ai + 1); + var i = ai; + + if (ai >= 0 && bi > 0) { + begs = []; + left = str.length; + + while (i < str.length && i >= 0 && ! result) { + if (i == ai) { + begs.push(i); + ai = str.indexOf(a, i + 1); + } else if (begs.length == 1) { + result = [ begs.pop(), bi ]; + } else { + beg = begs.pop(); + if (beg < left) { + left = beg; + right = bi; + } + + bi = str.indexOf(b, i + 1); } + + i = ai < bi && ai >= 0 ? ai : bi; } - } - // if we opened more than we closed, find the one we closed - if (bal && ended) { - var start = m.start + a.length; - m = balanced(a, b, str.substr(start)); - if (m) { - m.start += start; - m.end += start; - m.pre = str.slice(0, start) + m.pre; + if (begs.length) { + result = [ left, right ]; } - return m; } + + return result; } diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json index 35332a3c4e..ac0c6aaca5 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/package.json @@ -1,56 +1,98 @@ { - "name": "balanced-match", - "description": "Match balanced character pairs, like \"{\" and \"}\"", - "version": "0.2.0", - "repository": { - "type": "git", - "url": "git://github.com/juliangruber/balanced-match.git" + "_args": [ + [ + "balanced-match@^0.3.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion" + ] + ], + "_from": "balanced-match@>=0.3.0 <0.4.0", + "_id": "balanced-match@0.3.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion/balanced-match", + "_nodeVersion": "4.2.1", + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" }, - "homepage": "https://github.com/juliangruber/balanced-match", - "main": "index.js", - "scripts": { - "test": "make test" + "_npmVersion": "2.14.7", + "_phantomChildren": {}, + "_requested": { + "name": "balanced-match", + "raw": "balanced-match@^0.3.0", + "rawSpec": "^0.3.0", + "scope": null, + "spec": ">=0.3.0 <0.4.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/glob/minimatch/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-0.3.0.tgz", + "_shasum": "a91cdd1ebef1a86659e70ff4def01625fc2d6756", + "_shrinkwrap": null, + "_spec": "balanced-match@^0.3.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion", + "author": { + "email": "mail@juliangruber.com", + "name": "Julian Gruber", + "url": "http://juliangruber.com" + }, + "bugs": { + "url": "https://github.com/juliangruber/balanced-match/issues" }, "dependencies": {}, + "description": "Match balanced character pairs, like \"{\" and \"}\"", "devDependencies": { - "tape": "~1.1.1" + "tape": "~4.2.2" }, + "directories": {}, + "dist": { + "shasum": "a91cdd1ebef1a86659e70ff4def01625fc2d6756", + "tarball": "http://registry.npmjs.org/balanced-match/-/balanced-match-0.3.0.tgz" + }, + "gitHead": "a7114b0986554787e90b7ac595a043ca75ea77e5", + "homepage": "https://github.com/juliangruber/balanced-match", "keywords": [ + "balanced", "match", + "parse", "regexp", - "test", - "balanced", - "parse" + "test" ], - "author": { - "name": "Julian Gruber", - "email": "mail@juliangruber.com", - "url": "http://juliangruber.com" - }, "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "juliangruber", + "email": "julian@juliangruber.com" + } + ], + "name": "balanced-match", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/balanced-match.git" + }, + "scripts": { + "test": "make test" + }, "testling": { - "files": "test/*.js", "browsers": [ - "ie/8..latest", - "firefox/20..latest", - "firefox/nightly", + "android-browser/4.2..latest", "chrome/25..latest", "chrome/canary", - "opera/12..latest", - "opera/next", - "safari/5.1..latest", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", "ipad/6.0..latest", "iphone/6.0..latest", - "android-browser/4.2..latest" - ] - }, - "readme": "# balanced-match\n\nMatch balanced string pairs, like `{` and `}` or `<b>` and `</b>`.\n\n[![build status](https://secure.travis-ci.org/juliangruber/balanced-match.svg)](http://travis-ci.org/juliangruber/balanced-match)\n[![downloads](https://img.shields.io/npm/dm/balanced-match.svg)](https://www.npmjs.org/package/balanced-match)\n\n[![testling badge](https://ci.testling.com/juliangruber/balanced-match.png)](https://ci.testling.com/juliangruber/balanced-match)\n\n## Example\n\nGet the first matching pair of braces:\n\n```js\nvar balanced = require('balanced-match');\n\nconsole.log(balanced('{', '}', 'pre{in{nested}}post'));\nconsole.log(balanced('{', '}', 'pre{first}between{second}post'));\n```\n\nThe matches are:\n\n```bash\n$ node example.js\n{ start: 3, end: 14, pre: 'pre', body: 'in{nested}', post: 'post' }\n{ start: 3,\n end: 9,\n pre: 'pre',\n body: 'first',\n post: 'between{second}post' }\n```\n\n## API\n\n### var m = balanced(a, b, str)\n\nFor the first non-nested matching pair of `a` and `b` in `str`, return an\nobject with those keys:\n\n* **start** the index of the first match of `a`\n* **end** the index of the matching `b`\n* **pre** the preamble, `a` and `b` not included\n* **body** the match, `a` and `b` not included\n* **post** the postscript, `a` and `b` not included\n\nIf there's no match, `undefined` will be returned.\n\nIf the `str` contains more `a` than `b` / there are unmatched pairs, the first match that was closed will be used. For example, `{{a}` will match `['{', 'a', '']`.\n\n## Installation\n\nWith [npm](https://npmjs.org) do:\n\n```bash\nnpm install balanced-match\n```\n\n## License\n\n(MIT)\n\nCopyright (c) 2013 Julian Gruber <julian@juliangruber.com>\n\nPermission is hereby granted, free of charge, to any person obtaining a copy of\nthis software and associated documentation files (the \"Software\"), to deal in\nthe Software without restriction, including without limitation the rights to\nuse, copy, modify, merge, publish, distribute, sublicense, and/or sell copies\nof the Software, and to permit persons to whom the Software is furnished to do\nso, subject to the following conditions:\n\nThe above copyright notice and this permission notice shall be included in all\ncopies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR\nIMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\nFITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE\nAUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\nLIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\nOUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE\nSOFTWARE.\n", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/juliangruber/balanced-match/issues" + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" }, - "_id": "balanced-match@0.2.0", - "_shasum": "38f6730c03aab6d5edbb52bd934885e756d71674", - "_resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-0.2.0.tgz", - "_from": "balanced-match@>=0.2.0 <0.3.0" + "version": "0.3.0" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js index 36bfd39954..f5e98e3f2a 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/balanced-match/test/balanced.js @@ -52,5 +52,33 @@ test('balanced', function(t) { body: 'in<b>nest</b>', post: 'post' }); + t.deepEqual(balanced('{{', '}}', 'pre{{{in}}}post'), { + start: 3, + end: 9, + pre: 'pre', + body: '{in}', + post: 'post' + }); + t.deepEqual(balanced('{{{', '}}', 'pre{{{in}}}post'), { + start: 3, + end: 8, + pre: 'pre', + body: 'in', + post: '}post' + }); + t.deepEqual(balanced('{', '}', 'pre{{first}in{second}post'), { + start: 4, + end: 10, + pre: 'pre{', + body: 'first', + post: 'in{second}post' + }); + t.deepEqual(balanced('<?', '?>', 'pre<?>post'), { + start: 3, + end: 4, + pre: 'pre', + body: '', + post: 'post' + }); t.end(); }); diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json index b516138098..15acbe5c07 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/node_modules/concat-map/package.json @@ -1,83 +1,109 @@ { - "name": "concat-map", + "_args": [ + [ + "concat-map@0.0.1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion" + ] + ], + "_from": "concat-map@0.0.1", + "_id": "concat-map@0.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion/concat-map", + "_npmUser": { + "email": "mail@substack.net", + "name": "substack" + }, + "_npmVersion": "1.3.21", + "_phantomChildren": {}, + "_requested": { + "name": "concat-map", + "raw": "concat-map@0.0.1", + "rawSpec": "0.0.1", + "scope": null, + "spec": "0.0.1", + "type": "version" + }, + "_requiredBy": [ + "/node-gyp/glob/minimatch/brace-expansion" + ], + "_resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "_shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "_shrinkwrap": null, + "_spec": "concat-map@0.0.1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion", + "author": { + "email": "mail@substack.net", + "name": "James Halliday", + "url": "http://substack.net" + }, + "bugs": { + "url": "https://github.com/substack/node-concat-map/issues" + }, + "dependencies": {}, "description": "concatenative mapdashery", - "version": "0.0.1", - "repository": { - "type": "git", - "url": "git://github.com/substack/node-concat-map.git" + "devDependencies": { + "tape": "~2.4.0" }, - "main": "index.js", + "directories": { + "example": "example", + "test": "test" + }, + "dist": { + "shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", + "tarball": "http://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz" + }, + "homepage": "https://github.com/substack/node-concat-map", "keywords": [ "concat", "concatMap", - "map", "functional", - "higher-order" + "higher-order", + "map" ], - "directories": { - "example": "example", - "test": "test" + "license": "MIT", + "main": "index.js", + "maintainers": [ + { + "name": "substack", + "email": "mail@substack.net" + } + ], + "name": "concat-map", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/substack/node-concat-map.git" }, "scripts": { "test": "tape test/*.js" }, - "devDependencies": { - "tape": "~2.4.0" - }, - "license": "MIT", - "author": { - "name": "James Halliday", - "email": "mail@substack.net", - "url": "http://substack.net" - }, "testling": { - "files": "test/*.js", "browsers": { + "chrome": [ + 10, + 22 + ], + "ff": [ + 10, + 15, + 3.5 + ], "ie": [ 6, 7, 8, 9 ], - "ff": [ - 3.5, - 10, - 15 - ], - "chrome": [ - 10, - 22 + "opera": [ + 12 ], "safari": [ 5.1 - ], - "opera": [ - 12 ] - } - }, - "bugs": { - "url": "https://github.com/substack/node-concat-map/issues" - }, - "homepage": "https://github.com/substack/node-concat-map", - "_id": "concat-map@0.0.1", - "dist": { - "shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", - "tarball": "http://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz" + }, + "files": "test/*.js" }, - "_from": "concat-map@0.0.1", - "_npmVersion": "1.3.21", - "_npmUser": { - "name": "substack", - "email": "mail@substack.net" - }, - "maintainers": [ - { - "name": "substack", - "email": "mail@substack.net" - } - ], - "_shasum": "d8a96bd77fd68df7793a73036a3ba0d5405d477b", - "_resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", - "readme": "ERROR: No README data found!" + "version": "0.0.1" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json index 4cb3e05d7c..9b240267e8 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/node_modules/brace-expansion/package.json @@ -1,60 +1,64 @@ { - "name": "brace-expansion", - "description": "Brace expansion as known from sh/bash", - "version": "1.1.1", - "repository": { - "type": "git", - "url": "git://github.com/juliangruber/brace-expansion.git" - }, - "homepage": "https://github.com/juliangruber/brace-expansion", - "main": "index.js", - "scripts": { - "test": "tape test/*.js", - "gentest": "bash test/generate.sh" - }, - "dependencies": { - "balanced-match": "^0.2.0", - "concat-map": "0.0.1" + "_args": [ + [ + "brace-expansion@^1.0.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch" + ] + ], + "_from": "brace-expansion@>=1.0.0 <2.0.0", + "_id": "brace-expansion@1.1.2", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/glob/minimatch/brace-expansion", + "_nodeVersion": "4.2.1", + "_npmUser": { + "email": "julian@juliangruber.com", + "name": "juliangruber" }, - "devDependencies": { - "tape": "^3.0.3" + "_npmVersion": "2.14.7", + "_phantomChildren": {}, + "_requested": { + "name": "brace-expansion", + "raw": "brace-expansion@^1.0.0", + "rawSpec": "^1.0.0", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" }, - "keywords": [], + "_requiredBy": [ + "/node-gyp/glob/minimatch" + ], + "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.2.tgz", + "_shasum": "f21445d0488b658e2771efd870eff51df29f04ef", + "_shrinkwrap": null, + "_spec": "brace-expansion@^1.0.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/glob/node_modules/minimatch", "author": { - "name": "Julian Gruber", "email": "mail@juliangruber.com", + "name": "Julian Gruber", "url": "http://juliangruber.com" }, - "license": "MIT", - "testling": { - "files": "test/*.js", - "browsers": [ - "ie/8..latest", - "firefox/20..latest", - "firefox/nightly", - "chrome/25..latest", - "chrome/canary", - "opera/12..latest", - "opera/next", - "safari/5.1..latest", - "ipad/6.0..latest", - "iphone/6.0..latest", - "android-browser/4.2..latest" - ] - }, - "gitHead": "f50da498166d76ea570cf3b30179f01f0f119612", "bugs": { "url": "https://github.com/juliangruber/brace-expansion/issues" }, - "_id": "brace-expansion@1.1.1", - "_shasum": "da5fb78aef4c44c9e4acf525064fb3208ebab045", - "_from": "brace-expansion@>=1.0.0 <2.0.0", - "_npmVersion": "2.6.1", - "_nodeVersion": "0.10.36", - "_npmUser": { - "name": "juliangruber", - "email": "julian@juliangruber.com" + "dependencies": { + "balanced-match": "^0.3.0", + "concat-map": "0.0.1" }, + "description": "Brace expansion as known from sh/bash", + "devDependencies": { + "tape": "4.2.2" + }, + "directories": {}, + "dist": { + "shasum": "f21445d0488b658e2771efd870eff51df29f04ef", + "tarball": "http://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.2.tgz" + }, + "gitHead": "b03773a30fa516b1374945b68e9acb6253d595fa", + "homepage": "https://github.com/juliangruber/brace-expansion", + "keywords": [], + "license": "MIT", + "main": "index.js", "maintainers": [ { "name": "juliangruber", @@ -65,11 +69,32 @@ "email": "isaacs@npmjs.com" } ], - "dist": { - "shasum": "da5fb78aef4c44c9e4acf525064fb3208ebab045", - "tarball": "http://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.1.tgz" + "name": "brace-expansion", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/juliangruber/brace-expansion.git" }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.1.tgz", - "readme": "ERROR: No README data found!" + "scripts": { + "gentest": "bash test/generate.sh", + "test": "tape test/*.js" + }, + "testling": { + "browsers": [ + "android-browser/4.2..latest", + "chrome/25..latest", + "chrome/canary", + "firefox/20..latest", + "firefox/nightly", + "ie/8..latest", + "ipad/6.0..latest", + "iphone/6.0..latest", + "opera/12..latest", + "opera/next", + "safari/5.1..latest" + ], + "files": "test/*.js" + }, + "version": "1.1.2" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json index e9256630aa..3dc6beb49f 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/node_modules/minimatch/package.json @@ -33,14 +33,31 @@ "minimatch.js", "browser.js" ], - "readme": "# minimatch\n\nA minimal matching utility.\n\n[![Build Status](https://secure.travis-ci.org/isaacs/minimatch.png)](http://travis-ci.org/isaacs/minimatch)\n\n\nThis is the matching library used internally by npm.\n\nIt works by converting glob expressions into JavaScript `RegExp`\nobjects.\n\n## Usage\n\n```javascript\nvar minimatch = require(\"minimatch\")\n\nminimatch(\"bar.foo\", \"*.foo\") // true!\nminimatch(\"bar.foo\", \"*.bar\") // false!\nminimatch(\"bar.foo\", \"*.+(bar|foo)\", { debug: true }) // true, and noisy!\n```\n\n## Features\n\nSupports these glob features:\n\n* Brace Expansion\n* Extended glob matching\n* \"Globstar\" `**` matching\n\nSee:\n\n* `man sh`\n* `man bash`\n* `man 3 fnmatch`\n* `man 5 gitignore`\n\n## Minimatch Class\n\nCreate a minimatch object by instanting the `minimatch.Minimatch` class.\n\n```javascript\nvar Minimatch = require(\"minimatch\").Minimatch\nvar mm = new Minimatch(pattern, options)\n```\n\n### Properties\n\n* `pattern` The original pattern the minimatch object represents.\n* `options` The options supplied to the constructor.\n* `set` A 2-dimensional array of regexp or string expressions.\n Each row in the\n array corresponds to a brace-expanded pattern. Each item in the row\n corresponds to a single path-part. For example, the pattern\n `{a,b/c}/d` would expand to a set of patterns like:\n\n [ [ a, d ]\n , [ b, c, d ] ]\n\n If a portion of the pattern doesn't have any \"magic\" in it\n (that is, it's something like `\"foo\"` rather than `fo*o?`), then it\n will be left as a string rather than converted to a regular\n expression.\n\n* `regexp` Created by the `makeRe` method. A single regular expression\n expressing the entire pattern. This is useful in cases where you wish\n to use the pattern somewhat like `fnmatch(3)` with `FNM_PATH` enabled.\n* `negate` True if the pattern is negated.\n* `comment` True if the pattern is a comment.\n* `empty` True if the pattern is `\"\"`.\n\n### Methods\n\n* `makeRe` Generate the `regexp` member if necessary, and return it.\n Will return `false` if the pattern is invalid.\n* `match(fname)` Return true if the filename matches the pattern, or\n false otherwise.\n* `matchOne(fileArray, patternArray, partial)` Take a `/`-split\n filename, and match it against a single row in the `regExpSet`. This\n method is mainly for internal use, but is exposed so that it can be\n used by a glob-walker that needs to avoid excessive filesystem calls.\n\nAll other methods are internal, and will be called as necessary.\n\n## Functions\n\nThe top-level exported function has a `cache` property, which is an LRU\ncache set to store 100 items. So, calling these methods repeatedly\nwith the same pattern and options will use the same Minimatch object,\nsaving the cost of parsing it multiple times.\n\n### minimatch(path, pattern, options)\n\nMain export. Tests a path against the pattern using the options.\n\n```javascript\nvar isJS = minimatch(file, \"*.js\", { matchBase: true })\n```\n\n### minimatch.filter(pattern, options)\n\nReturns a function that tests its\nsupplied argument, suitable for use with `Array.filter`. Example:\n\n```javascript\nvar javascripts = fileList.filter(minimatch.filter(\"*.js\", {matchBase: true}))\n```\n\n### minimatch.match(list, pattern, options)\n\nMatch against the list of\nfiles, in the style of fnmatch or glob. If nothing is matched, and\noptions.nonull is set, then return a list containing the pattern itself.\n\n```javascript\nvar javascripts = minimatch.match(fileList, \"*.js\", {matchBase: true}))\n```\n\n### minimatch.makeRe(pattern, options)\n\nMake a regular expression object from the pattern.\n\n## Options\n\nAll options are `false` by default.\n\n### debug\n\nDump a ton of stuff to stderr.\n\n### nobrace\n\nDo not expand `{a,b}` and `{1..3}` brace sets.\n\n### noglobstar\n\nDisable `**` matching against multiple folder names.\n\n### dot\n\nAllow patterns to match filenames starting with a period, even if\nthe pattern does not explicitly have a period in that spot.\n\nNote that by default, `a/**/b` will **not** match `a/.d/b`, unless `dot`\nis set.\n\n### noext\n\nDisable \"extglob\" style patterns like `+(a|b)`.\n\n### nocase\n\nPerform a case-insensitive match.\n\n### nonull\n\nWhen a match is not found by `minimatch.match`, return a list containing\nthe pattern itself if this option is set. When not set, an empty list\nis returned if there are no matches.\n\n### matchBase\n\nIf set, then patterns without slashes will be matched\nagainst the basename of the path if it contains slashes. For example,\n`a?b` would match the path `/xyz/123/acb`, but not `/xyz/acb/123`.\n\n### nocomment\n\nSuppress the behavior of treating `#` at the start of a pattern as a\ncomment.\n\n### nonegate\n\nSuppress the behavior of treating a leading `!` character as negation.\n\n### flipNegate\n\nReturns from negate expressions the same as if they were not negated.\n(Ie, true on a hit, false on a miss.)\n\n\n## Comparisons to other fnmatch/glob implementations\n\nWhile strict compliance with the existing standards is a worthwhile\ngoal, some discrepancies exist between minimatch and other\nimplementations, and are intentional.\n\nIf the pattern starts with a `!` character, then it is negated. Set the\n`nonegate` flag to suppress this behavior, and treat leading `!`\ncharacters normally. This is perhaps relevant if you wish to start the\npattern with a negative extglob pattern like `!(a|B)`. Multiple `!`\ncharacters at the start of a pattern will negate the pattern multiple\ntimes.\n\nIf a pattern starts with `#`, then it is treated as a comment, and\nwill not match anything. Use `\\#` to match a literal `#` at the\nstart of a line, or set the `nocomment` flag to suppress this behavior.\n\nThe double-star character `**` is supported by default, unless the\n`noglobstar` flag is set. This is supported in the manner of bsdglob\nand bash 4.1, where `**` only has special significance if it is the only\nthing in a path part. That is, `a/**/b` will match `a/x/y/b`, but\n`a/**b` will not.\n\nIf an escaped pattern has no matches, and the `nonull` flag is set,\nthen minimatch.match returns the pattern as-provided, rather than\ninterpreting the character escapes. For example,\n`minimatch.match([], \"\\\\*a\\\\?\")` will return `\"\\\\*a\\\\?\"` rather than\n`\"*a?\"`. This is akin to setting the `nullglob` option in bash, except\nthat it does not resolve escaped pattern characters.\n\nIf brace expansion is not disabled, then it is performed before any\nother interpretation of the glob pattern. Thus, a pattern like\n`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded\n**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are\nchecked for validity. Since those two are valid, matching proceeds.\n", - "readmeFilename": "README.md", + "gitHead": "6afb85f0c324b321f76a38df81891e562693e257", "bugs": { "url": "https://github.com/isaacs/minimatch/issues" }, "homepage": "https://github.com/isaacs/minimatch#readme", "_id": "minimatch@2.0.10", "_shasum": "8d087c39c6b38c001b97fca7ce6d0e1e80afbac7", + "_from": "minimatch@>=2.0.1 <3.0.0", + "_npmVersion": "3.1.0", + "_nodeVersion": "2.2.1", + "_npmUser": { + "name": "isaacs", + "email": "isaacs@npmjs.com" + }, + "dist": { + "shasum": "8d087c39c6b38c001b97fca7ce6d0e1e80afbac7", + "tarball": "http://registry.npmjs.org/minimatch/-/minimatch-2.0.10.tgz" + }, + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "directories": {}, "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-2.0.10.tgz", - "_from": "minimatch@>=2.0.1 <3.0.0" + "readme": "ERROR: No README data found!" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/glob/package.json b/deps/npm/node_modules/node-gyp/node_modules/glob/package.json index 84b72480f8..434e4696f8 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/glob/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/glob/package.json @@ -42,14 +42,31 @@ "benchclean": "bash benchclean.sh" }, "license": "ISC", - "readme": "[![Build Status](https://travis-ci.org/isaacs/node-glob.svg?branch=master)](https://travis-ci.org/isaacs/node-glob/) [![Dependency Status](https://david-dm.org/isaacs/node-glob.svg)](https://david-dm.org/isaacs/node-glob) [![devDependency Status](https://david-dm.org/isaacs/node-glob/dev-status.svg)](https://david-dm.org/isaacs/node-glob#info=devDependencies) [![optionalDependency Status](https://david-dm.org/isaacs/node-glob/optional-status.svg)](https://david-dm.org/isaacs/node-glob#info=optionalDependencies)\n\n# Glob\n\nMatch files using the patterns the shell uses, like stars and stuff.\n\nThis is a glob implementation in JavaScript. It uses the `minimatch`\nlibrary to do its matching.\n\n![](oh-my-glob.gif)\n\n## Usage\n\n```javascript\nvar glob = require(\"glob\")\n\n// options is optional\nglob(\"**/*.js\", options, function (er, files) {\n // files is an array of filenames.\n // If the `nonull` option is set, and nothing\n // was found, then files is [\"**/*.js\"]\n // er is an error object or null.\n})\n```\n\n## Glob Primer\n\n\"Globs\" are the patterns you type when you do stuff like `ls *.js` on\nthe command line, or put `build/*` in a `.gitignore` file.\n\nBefore parsing the path part patterns, braced sections are expanded\ninto a set. Braced sections start with `{` and end with `}`, with any\nnumber of comma-delimited sections within. Braced sections may contain\nslash characters, so `a{/b/c,bcd}` would expand into `a/b/c` and `abcd`.\n\nThe following characters have special magic meaning when used in a\npath portion:\n\n* `*` Matches 0 or more characters in a single path portion\n* `?` Matches 1 character\n* `[...]` Matches a range of characters, similar to a RegExp range.\n If the first character of the range is `!` or `^` then it matches\n any character not in the range.\n* `!(pattern|pattern|pattern)` Matches anything that does not match\n any of the patterns provided.\n* `?(pattern|pattern|pattern)` Matches zero or one occurrence of the\n patterns provided.\n* `+(pattern|pattern|pattern)` Matches one or more occurrences of the\n patterns provided.\n* `*(a|b|c)` Matches zero or more occurrences of the patterns provided\n* `@(pattern|pat*|pat?erN)` Matches exactly one of the patterns\n provided\n* `**` If a \"globstar\" is alone in a path portion, then it matches\n zero or more directories and subdirectories searching for matches.\n It does not crawl symlinked directories.\n\n### Dots\n\nIf a file or directory path portion has a `.` as the first character,\nthen it will not match any glob pattern unless that pattern's\ncorresponding path part also has a `.` as its first character.\n\nFor example, the pattern `a/.*/c` would match the file at `a/.b/c`.\nHowever the pattern `a/*/c` would not, because `*` does not start with\na dot character.\n\nYou can make glob treat dots as normal characters by setting\n`dot:true` in the options.\n\n### Basename Matching\n\nIf you set `matchBase:true` in the options, and the pattern has no\nslashes in it, then it will seek for any file anywhere in the tree\nwith a matching basename. For example, `*.js` would match\n`test/simple/basic.js`.\n\n### Negation\n\nThe intent for negation would be for a pattern starting with `!` to\nmatch everything that *doesn't* match the supplied pattern. However,\nthe implementation is weird, and for the time being, this should be\navoided. The behavior will change or be deprecated in version 5.\n\n### Empty Sets\n\nIf no matching files are found, then an empty array is returned. This\ndiffers from the shell, where the pattern itself is returned. For\nexample:\n\n $ echo a*s*d*f\n a*s*d*f\n\nTo get the bash-style behavior, set the `nonull:true` in the options.\n\n### See Also:\n\n* `man sh`\n* `man bash` (Search for \"Pattern Matching\")\n* `man 3 fnmatch`\n* `man 5 gitignore`\n* [minimatch documentation](https://github.com/isaacs/minimatch)\n\n## glob.hasMagic(pattern, [options])\n\nReturns `true` if there are any special characters in the pattern, and\n`false` otherwise.\n\nNote that the options affect the results. If `noext:true` is set in\nthe options object, then `+(a|b)` will not be considered a magic\npattern. If the pattern has a brace expansion, like `a/{b/c,x/y}`\nthen that is considered magical, unless `nobrace:true` is set in the\noptions.\n\n## glob(pattern, [options], cb)\n\n* `pattern` {String} Pattern to be matched\n* `options` {Object}\n* `cb` {Function}\n * `err` {Error | null}\n * `matches` {Array<String>} filenames found matching the pattern\n\nPerform an asynchronous glob search.\n\n## glob.sync(pattern, [options])\n\n* `pattern` {String} Pattern to be matched\n* `options` {Object}\n* return: {Array<String>} filenames found matching the pattern\n\nPerform a synchronous glob search.\n\n## Class: glob.Glob\n\nCreate a Glob object by instantiating the `glob.Glob` class.\n\n```javascript\nvar Glob = require(\"glob\").Glob\nvar mg = new Glob(pattern, options, cb)\n```\n\nIt's an EventEmitter, and starts walking the filesystem to find matches\nimmediately.\n\n### new glob.Glob(pattern, [options], [cb])\n\n* `pattern` {String} pattern to search for\n* `options` {Object}\n* `cb` {Function} Called when an error occurs, or matches are found\n * `err` {Error | null}\n * `matches` {Array<String>} filenames found matching the pattern\n\nNote that if the `sync` flag is set in the options, then matches will\nbe immediately available on the `g.found` member.\n\n### Properties\n\n* `minimatch` The minimatch object that the glob uses.\n* `options` The options object passed in.\n* `aborted` Boolean which is set to true when calling `abort()`. There\n is no way at this time to continue a glob search after aborting, but\n you can re-use the statCache to avoid having to duplicate syscalls.\n* `statCache` Collection of all the stat results the glob search\n performed.\n* `cache` Convenience object. Each field has the following possible\n values:\n * `false` - Path does not exist\n * `true` - Path exists\n * `'DIR'` - Path exists, and is not a directory\n * `'FILE'` - Path exists, and is a directory\n * `[file, entries, ...]` - Path exists, is a directory, and the\n array value is the results of `fs.readdir`\n* `statCache` Cache of `fs.stat` results, to prevent statting the same\n path multiple times.\n* `symlinks` A record of which paths are symbolic links, which is\n relevant in resolving `**` patterns.\n* `realpathCache` An optional object which is passed to `fs.realpath`\n to minimize unnecessary syscalls. It is stored on the instantiated\n Glob object, and may be re-used.\n\n### Events\n\n* `end` When the matching is finished, this is emitted with all the\n matches found. If the `nonull` option is set, and no match was found,\n then the `matches` list contains the original pattern. The matches\n are sorted, unless the `nosort` flag is set.\n* `match` Every time a match is found, this is emitted with the matched.\n* `error` Emitted when an unexpected error is encountered, or whenever\n any fs error occurs if `options.strict` is set.\n* `abort` When `abort()` is called, this event is raised.\n\n### Methods\n\n* `pause` Temporarily stop the search\n* `resume` Resume the search\n* `abort` Stop the search forever\n\n### Options\n\nAll the options that can be passed to Minimatch can also be passed to\nGlob to change pattern matching behavior. Also, some have been added,\nor have glob-specific ramifications.\n\nAll options are false by default, unless otherwise noted.\n\nAll options are added to the Glob object, as well.\n\nIf you are running many `glob` operations, you can pass a Glob object\nas the `options` argument to a subsequent operation to shortcut some\n`stat` and `readdir` calls. At the very least, you may pass in shared\n`symlinks`, `statCache`, `realpathCache`, and `cache` options, so that\nparallel glob operations will be sped up by sharing information about\nthe filesystem.\n\n* `cwd` The current working directory in which to search. Defaults\n to `process.cwd()`.\n* `root` The place where patterns starting with `/` will be mounted\n onto. Defaults to `path.resolve(options.cwd, \"/\")` (`/` on Unix\n systems, and `C:\\` or some such on Windows.)\n* `dot` Include `.dot` files in normal matches and `globstar` matches.\n Note that an explicit dot in a portion of the pattern will always\n match dot files.\n* `nomount` By default, a pattern starting with a forward-slash will be\n \"mounted\" onto the root setting, so that a valid filesystem path is\n returned. Set this flag to disable that behavior.\n* `mark` Add a `/` character to directory matches. Note that this\n requires additional stat calls.\n* `nosort` Don't sort the results.\n* `stat` Set to true to stat *all* results. This reduces performance\n somewhat, and is completely unnecessary, unless `readdir` is presumed\n to be an untrustworthy indicator of file existence.\n* `silent` When an unusual error is encountered when attempting to\n read a directory, a warning will be printed to stderr. Set the\n `silent` option to true to suppress these warnings.\n* `strict` When an unusual error is encountered when attempting to\n read a directory, the process will just continue on in search of\n other matches. Set the `strict` option to raise an error in these\n cases.\n* `cache` See `cache` property above. Pass in a previously generated\n cache object to save some fs calls.\n* `statCache` A cache of results of filesystem information, to prevent\n unnecessary stat calls. While it should not normally be necessary\n to set this, you may pass the statCache from one glob() call to the\n options object of another, if you know that the filesystem will not\n change between calls. (See \"Race Conditions\" below.)\n* `symlinks` A cache of known symbolic links. You may pass in a\n previously generated `symlinks` object to save `lstat` calls when\n resolving `**` matches.\n* `sync` DEPRECATED: use `glob.sync(pattern, opts)` instead.\n* `nounique` In some cases, brace-expanded patterns can result in the\n same file showing up multiple times in the result set. By default,\n this implementation prevents duplicates in the result set. Set this\n flag to disable that behavior.\n* `nonull` Set to never return an empty set, instead returning a set\n containing the pattern itself. This is the default in glob(3).\n* `debug` Set to enable debug logging in minimatch and glob.\n* `nobrace` Do not expand `{a,b}` and `{1..3}` brace sets.\n* `noglobstar` Do not match `**` against multiple filenames. (Ie,\n treat it as a normal `*` instead.)\n* `noext` Do not match `+(a|b)` \"extglob\" patterns.\n* `nocase` Perform a case-insensitive match. Note: on\n case-insensitive filesystems, non-magic patterns will match by\n default, since `stat` and `readdir` will not raise errors.\n* `matchBase` Perform a basename-only match if the pattern does not\n contain any slash characters. That is, `*.js` would be treated as\n equivalent to `**/*.js`, matching all js files in all directories.\n* `nonegate` Suppress `negate` behavior. (See below.)\n* `nocomment` Suppress `comment` behavior. (See below.)\n* `nonull` Return the pattern when no matches are found.\n* `nodir` Do not match directories, only files. (Note: to match\n *only* directories, simply put a `/` at the end of the pattern.)\n* `ignore` Add a pattern or an array of patterns to exclude matches.\n* `follow` Follow symlinked directories when expanding `**` patterns.\n Note that this can result in a lot of duplicate references in the\n presence of cyclic links.\n* `realpath` Set to true to call `fs.realpath` on all of the results.\n In the case of a symlink that cannot be resolved, the full absolute\n path to the matched entry is returned (though it will usually be a\n broken symlink)\n\n## Comparisons to other fnmatch/glob implementations\n\nWhile strict compliance with the existing standards is a worthwhile\ngoal, some discrepancies exist between node-glob and other\nimplementations, and are intentional.\n\nIf the pattern starts with a `!` character, then it is negated. Set the\n`nonegate` flag to suppress this behavior, and treat leading `!`\ncharacters normally. This is perhaps relevant if you wish to start the\npattern with a negative extglob pattern like `!(a|B)`. Multiple `!`\ncharacters at the start of a pattern will negate the pattern multiple\ntimes.\n\nIf a pattern starts with `#`, then it is treated as a comment, and\nwill not match anything. Use `\\#` to match a literal `#` at the\nstart of a line, or set the `nocomment` flag to suppress this behavior.\n\nThe double-star character `**` is supported by default, unless the\n`noglobstar` flag is set. This is supported in the manner of bsdglob\nand bash 4.3, where `**` only has special significance if it is the only\nthing in a path part. That is, `a/**/b` will match `a/x/y/b`, but\n`a/**b` will not.\n\nNote that symlinked directories are not crawled as part of a `**`,\nthough their contents may match against subsequent portions of the\npattern. This prevents infinite loops and duplicates and the like.\n\nIf an escaped pattern has no matches, and the `nonull` flag is set,\nthen glob returns the pattern as-provided, rather than\ninterpreting the character escapes. For example,\n`glob.match([], \"\\\\*a\\\\?\")` will return `\"\\\\*a\\\\?\"` rather than\n`\"*a?\"`. This is akin to setting the `nullglob` option in bash, except\nthat it does not resolve escaped pattern characters.\n\nIf brace expansion is not disabled, then it is performed before any\nother interpretation of the glob pattern. Thus, a pattern like\n`+(a|{b),c)}`, which would not be valid in bash or zsh, is expanded\n**first** into the set of `+(a|b)` and `+(a|c)`, and those patterns are\nchecked for validity. Since those two are valid, matching proceeds.\n\n## Windows\n\n**Please only use forward-slashes in glob expressions.**\n\nThough windows uses either `/` or `\\` as its path separator, only `/`\ncharacters are used by this glob implementation. You must use\nforward-slashes **only** in glob expressions. Back-slashes will always\nbe interpreted as escape characters, not path separators.\n\nResults from absolute patterns such as `/foo/*` are mounted onto the\nroot setting using `path.join`. On windows, this will by default result\nin `/foo/*` matching `C:\\foo\\bar.txt`.\n\n## Race Conditions\n\nGlob searching, by its very nature, is susceptible to race conditions,\nsince it relies on directory walking and such.\n\nAs a result, it is possible that a file that exists when glob looks for\nit may have been deleted or modified by the time it returns the result.\n\nAs part of its internal implementation, this program caches all stat\nand readdir calls that it makes, in order to cut down on system\noverhead. However, this also makes it even more susceptible to races,\nespecially if the cache or statCache objects are reused between glob\ncalls.\n\nUsers are thus advised not to use a glob result as a guarantee of\nfilesystem state in the face of rapid changes. For the vast majority\nof operations, this is never a problem.\n\n## Contributing\n\nAny change to behavior (including bugfixes) must come with a test.\n\nPatches that fail tests or reduce performance will be rejected.\n\n```\n# to run tests\nnpm test\n\n# to re-generate test fixtures\nnpm run test-regen\n\n# to benchmark against bash/zsh\nnpm run bench\n\n# to profile javascript\nnpm run prof\n```\n", - "readmeFilename": "README.md", + "gitHead": "a4e461ab59a837eee80a4d8dbdbf5ae1054a646f", "bugs": { "url": "https://github.com/isaacs/node-glob/issues" }, - "homepage": "https://github.com/isaacs/node-glob#readme", + "homepage": "https://github.com/isaacs/node-glob", "_id": "glob@4.5.3", "_shasum": "c6cb73d3226c1efef04de3c56d012f03377ee15f", + "_from": "glob@>=3.0.0 <4.0.0||>=4.0.0 <5.0.0", + "_npmVersion": "2.7.1", + "_nodeVersion": "1.4.2", + "_npmUser": { + "name": "isaacs", + "email": "i@izs.me" + }, + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "dist": { + "shasum": "c6cb73d3226c1efef04de3c56d012f03377ee15f", + "tarball": "http://registry.npmjs.org/glob/-/glob-4.5.3.tgz" + }, + "directories": {}, "_resolved": "https://registry.npmjs.org/glob/-/glob-4.5.3.tgz", - "_from": "glob@>=3.0.0 <4.0.0||>=4.0.0 <5.0.0" + "readme": "ERROR: No README data found!" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md index 3fd6d0bcae..c06814e041 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/README.md @@ -24,6 +24,24 @@ If you put more stuff in it, then items will fall out. If you try to put an oversized thing in it, then it'll fall out right away. +## Keys should always be Strings or Numbers + +Note: this module will print warnings to `console.error` if you use a +key that is not a String or Number. Because items are stored in an +object, which coerces keys to a string, it won't go well for you if +you try to use a key that is not a unique string, it'll cause surprise +collisions. For example: + +```JavaScript +// Bad Example! Dont' do this! +var cache = LRU() +var a = {} +var b = {} +cache.set(a, 'this is a') +cache.set(b, 'this is b') +console.log(cache.get(a)) // prints: 'this is b' +``` + ## Options * `max` The maximum size of the cache, checked by applying the length diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js index 32c2d2d90b..2bbe653be8 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/lib/lru-cache.js @@ -13,6 +13,14 @@ function hOP (obj, key) { function naiveLength () { return 1 } +var didTypeWarning = false +function typeCheckKey(key) { + if (!didTypeWarning && typeof key !== 'string' && typeof key !== 'number') { + didTypeWarning = true + console.error(new TypeError("LRU: key must be a string or number. Almost certainly a bug! " + typeof key).stack) + } +} + function LRUCache (options) { if (!(this instanceof LRUCache)) return new LRUCache(options) @@ -163,6 +171,8 @@ LRUCache.prototype.dumpLru = function () { LRUCache.prototype.set = function (key, value, maxAge) { maxAge = maxAge || this._maxAge + typeCheckKey(key) + var now = maxAge ? Date.now() : 0 var len = this._lengthCalculator(value) @@ -207,6 +217,7 @@ LRUCache.prototype.set = function (key, value, maxAge) { } LRUCache.prototype.has = function (key) { + typeCheckKey(key) if (!hOP(this._cache, key)) return false var hit = this._cache[key] if (isStale(this, hit)) { @@ -216,10 +227,12 @@ LRUCache.prototype.has = function (key) { } LRUCache.prototype.get = function (key) { + typeCheckKey(key) return get(this, key, true) } LRUCache.prototype.peek = function (key) { + typeCheckKey(key) return get(this, key, false) } @@ -230,6 +243,7 @@ LRUCache.prototype.pop = function () { } LRUCache.prototype.del = function (key) { + typeCheckKey(key) del(this, this._cache[key]) } @@ -241,6 +255,7 @@ LRUCache.prototype.load = function (arr) { //A previous serialized cache has the most recent items first for (var l = arr.length - 1; l >= 0; l-- ) { var hit = arr[l] + typeCheckKey(hit.k) var expiresAt = hit.e || 0 if (expiresAt === 0) { //the item was created without expiration in a non aged cache @@ -254,6 +269,7 @@ LRUCache.prototype.load = function (arr) { } function get (self, key, doUse) { + typeCheckKey(key) var hit = self._cache[key] if (hit) { if (isStale(self, hit)) { diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json index 71a3544fd5..411b59ea1b 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/lru-cache/package.json @@ -1,37 +1,84 @@ { - "name": "lru-cache", - "description": "A cache object that deletes the least-recently-used items.", - "version": "2.7.0", + "_args": [ + [ + "lru-cache@2", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch" + ] + ], + "_from": "lru-cache@>=2.0.0 <3.0.0", + "_id": "lru-cache@2.7.3", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch/lru-cache", + "_nodeVersion": "4.0.0", + "_npmUser": { + "email": "i@izs.me", + "name": "isaacs" + }, + "_npmVersion": "3.3.2", + "_phantomChildren": {}, + "_requested": { + "name": "lru-cache", + "raw": "lru-cache@2", + "rawSpec": "2", + "scope": null, + "spec": ">=2.0.0 <3.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/minimatch" + ], + "_resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz", + "_shasum": "6d4524e8b955f95d4f5b58851ce21dd72fb4e952", + "_shrinkwrap": null, + "_spec": "lru-cache@2", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch", "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me" + "email": "i@izs.me", + "name": "Isaac Z. Schlueter" + }, + "bugs": { + "url": "https://github.com/isaacs/node-lru-cache/issues" + }, + "dependencies": {}, + "description": "A cache object that deletes the least-recently-used items.", + "devDependencies": { + "tap": "^1.2.0", + "weak": "" }, + "directories": {}, + "dist": { + "shasum": "6d4524e8b955f95d4f5b58851ce21dd72fb4e952", + "tarball": "http://registry.npmjs.org/lru-cache/-/lru-cache-2.7.3.tgz" + }, + "gitHead": "292048199f6d28b77fbe584279a1898e25e4c714", + "homepage": "https://github.com/isaacs/node-lru-cache#readme", "keywords": [ - "mru", + "cache", "lru", - "cache" + "mru" ], - "scripts": { - "test": "tap test --gc" - }, + "license": "ISC", "main": "lib/lru-cache.js", + "maintainers": [ + { + "name": "isaacs", + "email": "isaacs@npmjs.com" + }, + { + "name": "othiym23", + "email": "ogd@aoaioxxysz.net" + } + ], + "name": "lru-cache", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", "repository": { "type": "git", "url": "git://github.com/isaacs/node-lru-cache.git" }, - "devDependencies": { - "tap": "^1.2.0", - "weak": "" - }, - "license": "ISC", - "readme": "# lru cache\n\nA cache object that deletes the least-recently-used items.\n\n## Usage:\n\n```javascript\nvar LRU = require(\"lru-cache\")\n , options = { max: 500\n , length: function (n) { return n * 2 }\n , dispose: function (key, n) { n.close() }\n , maxAge: 1000 * 60 * 60 }\n , cache = LRU(options)\n , otherCache = LRU(50) // sets just the max size\n\ncache.set(\"key\", \"value\")\ncache.get(\"key\") // \"value\"\n\ncache.reset() // empty the cache\n```\n\nIf you put more stuff in it, then items will fall out.\n\nIf you try to put an oversized thing in it, then it'll fall out right\naway.\n\n## Options\n\n* `max` The maximum size of the cache, checked by applying the length\n function to all values in the cache. Not setting this is kind of\n silly, since that's the whole purpose of this lib, but it defaults\n to `Infinity`.\n* `maxAge` Maximum age in ms. Items are not pro-actively pruned out\n as they age, but if you try to get an item that is too old, it'll\n drop it and return undefined instead of giving it to you.\n* `length` Function that is used to calculate the length of stored\n items. If you're storing strings or buffers, then you probably want\n to do something like `function(n){return n.length}`. The default is\n `function(n){return 1}`, which is fine if you want to store `max`\n like-sized things.\n* `dispose` Function that is called on items when they are dropped\n from the cache. This can be handy if you want to close file\n descriptors or do other cleanup tasks when items are no longer\n accessible. Called with `key, value`. It's called *before*\n actually removing the item from the internal cache, so if you want\n to immediately put it back in, you'll have to do that in a\n `nextTick` or `setTimeout` callback or it won't do anything.\n* `stale` By default, if you set a `maxAge`, it'll only actually pull\n stale items out of the cache when you `get(key)`. (That is, it's\n not pre-emptively doing a `setTimeout` or anything.) If you set\n `stale:true`, it'll return the stale value before deleting it. If\n you don't set this, then it'll return `undefined` when you try to\n get a stale entry, as if it had already been deleted.\n\n## API\n\n* `set(key, value, maxAge)`\n* `get(key) => value`\n\n Both of these will update the \"recently used\"-ness of the key.\n They do what you think. `max` is optional and overrides the\n cache `max` option if provided.\n\n* `peek(key)`\n\n Returns the key value (or `undefined` if not found) without\n updating the \"recently used\"-ness of the key.\n\n (If you find yourself using this a lot, you *might* be using the\n wrong sort of data structure, but there are some use cases where\n it's handy.)\n\n* `del(key)`\n\n Deletes a key out of the cache.\n\n* `reset()`\n\n Clear the cache entirely, throwing away all values.\n\n* `has(key)`\n\n Check if a key is in the cache, without updating the recent-ness\n or deleting it for being stale.\n\n* `forEach(function(value,key,cache), [thisp])`\n\n Just like `Array.prototype.forEach`. Iterates over all the keys\n in the cache, in order of recent-ness. (Ie, more recently used\n items are iterated over first.)\n\n* `keys()`\n\n Return an array of the keys in the cache.\n\n* `values()`\n\n Return an array of the values in the cache.\n\n* `length()`\n\n Return total length of objects in cache taking into account\n `length` options function.\n\n* `itemCount`\n\n Return total quantity of objects currently in cache. Note, that\n `stale` (see options) items are returned as part of this item\n count.\n\n* `dump()`\n\n Return an array of the cache entries ready for serialization and usage\n with 'destinationCache.load(arr)`.\n\n* `load(cacheEntriesArray)`\n\n Loads another cache entries array, obtained with `sourceCache.dump()`,\n into the cache. The destination cache is reset before loading new entries\n", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/isaacs/node-lru-cache/issues" + "scripts": { + "test": "tap test --gc" }, - "homepage": "https://github.com/isaacs/node-lru-cache#readme", - "_id": "lru-cache@2.7.0", - "_shasum": "aaa376a4cd970f9cebf5ec1909566ec034f07ee6", - "_resolved": "https://registry.npmjs.org/lru-cache/-/lru-cache-2.7.0.tgz", - "_from": "lru-cache@>=2.0.0 <3.0.0" + "version": "2.7.3" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json index 0432d4e4c5..b1dbae0a80 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/node_modules/sigmund/package.json @@ -1,44 +1,85 @@ { - "name": "sigmund", - "version": "1.0.1", - "description": "Quick and dirty signatures for Objects.", - "main": "sigmund.js", - "directories": { - "test": "test" + "_args": [ + [ + "sigmund@~1.0.0", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch" + ] + ], + "_from": "sigmund@>=1.0.0 <1.1.0", + "_id": "sigmund@1.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch/sigmund", + "_nodeVersion": "2.0.1", + "_npmUser": { + "email": "isaacs@npmjs.com", + "name": "isaacs" + }, + "_npmVersion": "2.10.0", + "_phantomChildren": {}, + "_requested": { + "name": "sigmund", + "raw": "sigmund@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/minimatch" + ], + "_resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz", + "_shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590", + "_shrinkwrap": null, + "_spec": "sigmund@~1.0.0", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/minimatch", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me/" + }, + "bugs": { + "url": "https://github.com/isaacs/sigmund/issues" }, "dependencies": {}, + "description": "Quick and dirty signatures for Objects.", "devDependencies": { "tap": "~0.3.0" }, - "scripts": { - "test": "tap test/*.js", - "bench": "node bench.js" + "directories": { + "test": "test" }, - "repository": { - "type": "git", - "url": "git://github.com/isaacs/sigmund.git" + "dist": { + "shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590", + "tarball": "http://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz" }, + "gitHead": "527f97aa5bb253d927348698c0cd3bb267d098c6", + "homepage": "https://github.com/isaacs/sigmund#readme", "keywords": [ - "object", - "signature", - "key", "data", - "psychoanalysis" + "key", + "object", + "psychoanalysis", + "signature" ], - "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me", - "url": "http://blog.izs.me/" - }, "license": "ISC", - "readme": "# sigmund\n\nQuick and dirty signatures for Objects.\n\nThis is like a much faster `deepEquals` comparison, which returns a\nstring key suitable for caches and the like.\n\n## Usage\n\n```javascript\nfunction doSomething (someObj) {\n var key = sigmund(someObj, maxDepth) // max depth defaults to 10\n var cached = cache.get(key)\n if (cached) return cached\n\n var result = expensiveCalculation(someObj)\n cache.set(key, result)\n return result\n}\n```\n\nThe resulting key will be as unique and reproducible as calling\n`JSON.stringify` or `util.inspect` on the object, but is much faster.\nIn order to achieve this speed, some differences are glossed over.\nFor example, the object `{0:'foo'}` will be treated identically to the\narray `['foo']`.\n\nAlso, just as there is no way to summon the soul from the scribblings\nof a cocaine-addled psychoanalyst, there is no way to revive the object\nfrom the signature string that sigmund gives you. In fact, it's\nbarely even readable.\n\nAs with `util.inspect` and `JSON.stringify`, larger objects will\nproduce larger signature strings.\n\nBecause sigmund is a bit less strict than the more thorough\nalternatives, the strings will be shorter, and also there is a\nslightly higher chance for collisions. For example, these objects\nhave the same signature:\n\n var obj1 = {a:'b',c:/def/,g:['h','i',{j:'',k:'l'}]}\n var obj2 = {a:'b',c:'/def/',g:['h','i','{jkl']}\n\nLike a good Freudian, sigmund is most effective when you already have\nsome understanding of what you're looking for. It can help you help\nyourself, but you must be willing to do some work as well.\n\nCycles are handled, and cyclical objects are silently omitted (though\nthe key is included in the signature output.)\n\nThe second argument is the maximum depth, which defaults to 10,\nbecause that is the maximum object traversal depth covered by most\ninsurance carriers.\n", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/isaacs/sigmund/issues" + "main": "sigmund.js", + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + } + ], + "name": "sigmund", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/sigmund.git" }, - "homepage": "https://github.com/isaacs/sigmund#readme", - "_id": "sigmund@1.0.1", - "_shasum": "3ff21f198cad2175f9f3b781853fd94d0d19b590", - "_resolved": "https://registry.npmjs.org/sigmund/-/sigmund-1.0.1.tgz", - "_from": "sigmund@>=1.0.0 <1.1.0" + "scripts": { + "bench": "node bench.js", + "test": "tap test/*.js" + }, + "version": "1.0.1" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json b/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json index 8bf46ccae0..2f0d2de57e 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/package.json @@ -1,58 +1,83 @@ { - "author": { - "name": "Isaac Z. Schlueter", + "_args": [ + [ + "minimatch@1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp" + ] + ], + "_from": "minimatch@>=1.0.0 <2.0.0", + "_id": "minimatch@1.0.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/minimatch", + "_npmUser": { "email": "i@izs.me", - "url": "http://blog.izs.me" + "name": "isaacs" }, - "name": "minimatch", - "description": "a glob matcher in javascript", - "version": "1.0.0", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/minimatch.git" + "_npmVersion": "1.4.21", + "_phantomChildren": {}, + "_requested": { + "name": "minimatch", + "raw": "minimatch@1", + "rawSpec": "1", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" }, - "main": "minimatch.js", - "scripts": { - "test": "tap test/*.js" + "_requiredBy": [ + "/node-gyp" + ], + "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz", + "_shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", + "_shrinkwrap": null, + "_spec": "minimatch@1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp", + "author": { + "email": "i@izs.me", + "name": "Isaac Z. Schlueter", + "url": "http://blog.izs.me" }, - "engines": { - "node": "*" + "bugs": { + "url": "https://github.com/isaacs/minimatch/issues" }, "dependencies": { "lru-cache": "2", "sigmund": "~1.0.0" }, + "description": "a glob matcher in javascript", "devDependencies": { "tap": "" }, - "license": { - "type": "MIT", - "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE" + "directories": {}, + "dist": { + "shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", + "tarball": "http://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz" }, - "gitHead": "b374a643976eb55cdc19c60b6dd51ebe9bcc607a", - "bugs": { - "url": "https://github.com/isaacs/minimatch/issues" + "engines": { + "node": "*" }, + "gitHead": "b374a643976eb55cdc19c60b6dd51ebe9bcc607a", "homepage": "https://github.com/isaacs/minimatch", - "_id": "minimatch@1.0.0", - "_shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", - "_from": "minimatch@>=1.0.0 <2.0.0", - "_npmVersion": "1.4.21", - "_npmUser": { - "name": "isaacs", - "email": "i@izs.me" + "license": { + "type": "MIT", + "url": "http://github.com/isaacs/minimatch/raw/master/LICENSE" }, + "main": "minimatch.js", "maintainers": [ { "name": "isaacs", "email": "i@izs.me" } ], - "dist": { - "shasum": "e0dd2120b49e1b724ce8d714c520822a9438576d", - "tarball": "http://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz" + "name": "minimatch", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/minimatch.git" }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/minimatch/-/minimatch-1.0.0.tgz", - "readme": "ERROR: No README data found!" + "scripts": { + "test": "tap test/*.js" + }, + "version": "1.0.0" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js b/deps/npm/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js index e63d3f60c8..c3e19d9baf 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js +++ b/deps/npm/node_modules/node-gyp/node_modules/minimatch/test/brace-expand.js @@ -36,5 +36,3 @@ tap.test("brace expansion", function (t) { console.error("ending") t.end() }) - - diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/LICENSE index 19129e315f..19129e315f 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/LICENSE +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/LICENSE diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/README.md new file mode 100644 index 0000000000..a57cf429d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/README.md @@ -0,0 +1,195 @@ +# npmlog + +The logger util that npm uses. + +This logger is very basic. It does the logging for npm. It supports +custom levels and colored output. + +By default, logs are written to stderr. If you want to send log messages +to outputs other than streams, then you can change the `log.stream` +member, or you can just listen to the events that it emits, and do +whatever you want with them. + +# Basic Usage + +``` +var log = require('npmlog') + +// additional stuff ---------------------------+ +// message ----------+ | +// prefix ----+ | | +// level -+ | | | +// v v v v + log.info('fyi', 'I have a kitty cat: %j', myKittyCat) +``` + +## log.level + +* {String} + +The level to display logs at. Any logs at or above this level will be +displayed. The special level `silent` will prevent anything from being +displayed ever. + +## log.record + +* {Array} + +An array of all the log messages that have been entered. + +## log.maxRecordSize + +* {Number} + +The maximum number of records to keep. If log.record gets bigger than +10% over this value, then it is sliced down to 90% of this value. + +The reason for the 10% window is so that it doesn't have to resize a +large array on every log entry. + +## log.prefixStyle + +* {Object} + +A style object that specifies how prefixes are styled. (See below) + +## log.headingStyle + +* {Object} + +A style object that specifies how the heading is styled. (See below) + +## log.heading + +* {String} Default: "" + +If set, a heading that is printed at the start of every line. + +## log.stream + +* {Stream} Default: `process.stderr` + +The stream where output is written. + +## log.enableColor() + +Force colors to be used on all messages, regardless of the output +stream. + +## log.disableColor() + +Disable colors on all messages. + +## log.enableProgress() + +Enable the display of log activity spinner and progress bar + +## log.disableProgress() + +Disable the display of a progress bar + +## log.enableUnicode() + +Force the unicode theme to be used for the progress bar. + +## log.disableUnicode() + +Disable the use of unicode in the progress bar. + +## log.setGaugeTemplate(template) + +Overrides the default gauge template. + +## log.pause() + +Stop emitting messages to the stream, but do not drop them. + +## log.resume() + +Emit all buffered messages that were written while paused. + +## log.log(level, prefix, message, ...) + +* `level` {String} The level to emit the message at +* `prefix` {String} A string prefix. Set to "" to skip. +* `message...` Arguments to `util.format` + +Emit a log message at the specified level. + +## log\[level](prefix, message, ...) + +For example, + +* log.silly(prefix, message, ...) +* log.verbose(prefix, message, ...) +* log.info(prefix, message, ...) +* log.http(prefix, message, ...) +* log.warn(prefix, message, ...) +* log.error(prefix, message, ...) + +Like `log.log(level, prefix, message, ...)`. In this way, each level is +given a shorthand, so you can do `log.info(prefix, message)`. + +## log.addLevel(level, n, style, disp) + +* `level` {String} Level indicator +* `n` {Number} The numeric level +* `style` {Object} Object with fg, bg, inverse, etc. +* `disp` {String} Optional replacement for `level` in the output. + +Sets up a new level with a shorthand function and so forth. + +Note that if the number is `Infinity`, then setting the level to that +will cause all log messages to be suppressed. If the number is +`-Infinity`, then the only way to show it is to enable all log messages. + +## log.newItem(name, todo, weight) + +* `name` {String} Optional; progress item name. +* `todo` {Number} Optional; total amount of work to be done. Default 0. +* `weight` {Number} Optional; the weight of this item relative to others. Default 1. + +This adds a new `are-we-there-yet` item tracker to the progress tracker. The +object returned has the `log[level]` methods but is otherwise an +`are-we-there-yet` `Tracker` object. + +## log.newStream(name, todo, weight) + +This adds a new `are-we-there-yet` stream tracker to the progress tracker. The +object returned has the `log[level]` methods but is otherwise an +`are-we-there-yet` `TrackerStream` object. + +## log.newGroup(name, weight) + +This adds a new `are-we-there-yet` tracker group to the progress tracker. The +object returned has the `log[level]` methods but is otherwise an +`are-we-there-yet` `TrackerGroup` object. + +# Events + +Events are all emitted with the message object. + +* `log` Emitted for all messages +* `log.<level>` Emitted for all messages with the `<level>` level. +* `<prefix>` Messages with prefixes also emit their prefix as an event. + +# Style Objects + +Style objects can have the following fields: + +* `fg` {String} Color for the foreground text +* `bg` {String} Color for the background +* `bold`, `inverse`, `underline` {Boolean} Set the associated property +* `bell` {Boolean} Make a noise (This is pretty annoying, probably.) + +# Message Objects + +Every log event is emitted with a message object, and the `log.record` +list contains all of them that have been created. They have the +following fields: + +* `id` {Number} +* `level` {String} +* `prefix` {String} +* `message` {String} Result of `util.format()` +* `messageRaw` {Array} Arguments to `util.format()` diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/example.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/example.js new file mode 100644 index 0000000000..c009fb1577 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/example.js @@ -0,0 +1,39 @@ +var log = require('./log.js') + +log.heading = 'npm' + +console.error('log.level=silly') +log.level = 'silly' +log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) +log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) +log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) +log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) +log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) +log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) +log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) + +console.error('log.level=silent') +log.level = 'silent' +log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) +log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) +log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) +log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) +log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) +log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) +log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) + +console.error('log.level=info') +log.level = 'info' +log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) +log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) +log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) +log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) +log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) +log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) +log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) +log.error('404', 'This is a longer\n'+ + 'message, with some details\n'+ + 'and maybe a stack.\n'+ + new Error('a 404 error').stack) +log.addLevel('noise', 10000, {beep: true}) +log.noise(false, 'LOUD NOISES') diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/log.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/log.js new file mode 100644 index 0000000000..8bf6422b6c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/log.js @@ -0,0 +1,247 @@ +'use strict' +var Progress = require('are-we-there-yet') +var Gauge = require('gauge') +var EE = require('events').EventEmitter +var log = exports = module.exports = new EE +var util = require('util') + +var ansi = require('ansi') +log.cursor = ansi(process.stderr) +log.stream = process.stderr + +// by default, let ansi decide based on tty-ness. +var colorEnabled = undefined +log.enableColor = function () { + colorEnabled = true + this.cursor.enabled = true +} +log.disableColor = function () { + colorEnabled = false + this.cursor.enabled = false +} + +// default level +log.level = 'info' + +log.gauge = new Gauge(log.cursor) +log.tracker = new Progress.TrackerGroup() + +// no progress bars unless asked +log.progressEnabled = false + +var gaugeTheme = undefined + +log.enableUnicode = function () { + gaugeTheme = Gauge.unicode + log.gauge.setTheme(gaugeTheme) +} + +log.disableUnicode = function () { + gaugeTheme = Gauge.ascii + log.gauge.setTheme(gaugeTheme) +} + +var gaugeTemplate = undefined +log.setGaugeTemplate = function (template) { + gaugeTemplate = template + log.gauge.setTemplate(gaugeTemplate) +} + +log.enableProgress = function () { + if (this.progressEnabled) return + this.progressEnabled = true + if (this._pause) return + this.tracker.on('change', this.showProgress) + this.gauge.enable() + this.showProgress() +} + +log.disableProgress = function () { + if (!this.progressEnabled) return + this.clearProgress() + this.progressEnabled = false + this.tracker.removeListener('change', this.showProgress) + this.gauge.disable() +} + +var trackerConstructors = ['newGroup', 'newItem', 'newStream'] + +var mixinLog = function (tracker) { + // mixin the public methods from log into the tracker + // (except: conflicts and one's we handle specially) + Object.keys(log).forEach(function (P) { + if (P[0] === '_') return + if (trackerConstructors.filter(function (C) { return C === P }).length) return + if (tracker[P]) return + if (typeof log[P] !== 'function') return + var func = log[P] + tracker[P] = function () { + return func.apply(log, arguments) + } + }) + // if the new tracker is a group, make sure any subtrackers get + // mixed in too + if (tracker instanceof Progress.TrackerGroup) { + trackerConstructors.forEach(function (C) { + var func = tracker[C] + tracker[C] = function () { return mixinLog(func.apply(tracker, arguments)) } + }) + } + return tracker +} + +// Add tracker constructors to the top level log object +trackerConstructors.forEach(function (C) { + log[C] = function () { return mixinLog(this.tracker[C].apply(this.tracker, arguments)) } +}) + +log.clearProgress = function () { + if (!this.progressEnabled) return + this.gauge.hide() +} + +log.showProgress = function (name) { + if (!this.progressEnabled) return + this.gauge.show(name, this.tracker.completed()) +}.bind(log) // bind for use in tracker's on-change listener + +// temporarily stop emitting, but don't drop +log.pause = function () { + this._paused = true +} + +log.resume = function () { + if (!this._paused) return + this._paused = false + + var b = this._buffer + this._buffer = [] + b.forEach(function (m) { + this.emitLog(m) + }, this) + if (this.progressEnabled) this.enableProgress() +} + +log._buffer = [] + +var id = 0 +log.record = [] +log.maxRecordSize = 10000 +log.log = function (lvl, prefix, message) { + var l = this.levels[lvl] + if (l === undefined) { + return this.emit('error', new Error(util.format( + 'Undefined log level: %j', lvl))) + } + + var a = new Array(arguments.length - 2) + var stack = null + for (var i = 2; i < arguments.length; i ++) { + var arg = a[i-2] = arguments[i] + + // resolve stack traces to a plain string. + if (typeof arg === 'object' && arg && + (arg instanceof Error) && arg.stack) { + arg.stack = stack = arg.stack + '' + } + } + if (stack) a.unshift(stack + '\n') + message = util.format.apply(util, a) + + var m = { id: id++, + level: lvl, + prefix: String(prefix || ''), + message: message, + messageRaw: a } + + this.emit('log', m) + this.emit('log.' + lvl, m) + if (m.prefix) this.emit(m.prefix, m) + + this.record.push(m) + var mrs = this.maxRecordSize + var n = this.record.length - mrs + if (n > mrs / 10) { + var newSize = Math.floor(mrs * 0.9) + this.record = this.record.slice(-1 * newSize) + } + + this.emitLog(m) +}.bind(log) + +log.emitLog = function (m) { + if (this._paused) { + this._buffer.push(m) + return + } + if (this.progressEnabled) this.gauge.pulse(m.prefix) + var l = this.levels[m.level] + if (l === undefined) return + if (l < this.levels[this.level]) return + if (l > 0 && !isFinite(l)) return + + var style = log.style[m.level] + var disp = log.disp[m.level] || m.level + this.clearProgress() + m.message.split(/\r?\n/).forEach(function (line) { + if (this.heading) { + this.write(this.heading, this.headingStyle) + this.write(' ') + } + this.write(disp, log.style[m.level]) + var p = m.prefix || '' + if (p) this.write(' ') + this.write(p, this.prefixStyle) + this.write(' ' + line + '\n') + }, this) + this.showProgress() +} + +log.write = function (msg, style) { + if (!this.cursor) return + if (this.stream !== this.cursor.stream) { + this.cursor = ansi(this.stream, { enabled: colorEnabled }) + var options = {} + if (gaugeTheme != null) options.theme = gaugeTheme + if (gaugeTemplate != null) options.template = gaugeTemplate + this.gauge = new Gauge(options, this.cursor) + } + + style = style || {} + if (style.fg) this.cursor.fg[style.fg]() + if (style.bg) this.cursor.bg[style.bg]() + if (style.bold) this.cursor.bold() + if (style.underline) this.cursor.underline() + if (style.inverse) this.cursor.inverse() + if (style.beep) this.cursor.beep() + this.cursor.write(msg).reset() +} + +log.addLevel = function (lvl, n, style, disp) { + if (!disp) disp = lvl + this.levels[lvl] = n + this.style[lvl] = style + if (!this[lvl]) this[lvl] = function () { + var a = new Array(arguments.length + 1) + a[0] = lvl + for (var i = 0; i < arguments.length; i ++) { + a[i + 1] = arguments[i] + } + return this.log.apply(this, a) + }.bind(this) + this.disp[lvl] = disp +} + +log.prefixStyle = { fg: 'magenta' } +log.headingStyle = { fg: 'white', bg: 'black' } + +log.style = {} +log.levels = {} +log.disp = {} +log.addLevel('silly', -Infinity, { inverse: true }, 'sill') +log.addLevel('verbose', 1000, { fg: 'blue', bg: 'black' }, 'verb') +log.addLevel('info', 2000, { fg: 'green' }) +log.addLevel('http', 3000, { fg: 'green', bg: 'black' }) +log.addLevel('warn', 4000, { fg: 'black', bg: 'yellow' }, 'WARN') +log.addLevel('error', 5000, { fg: 'red', bg: 'black' }, 'ERR!') +log.addLevel('silent', Infinity) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.jshintrc b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.jshintrc new file mode 100644 index 0000000000..248c5426ea --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.jshintrc @@ -0,0 +1,4 @@ +{ + "laxcomma": true, + "asi": true +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.npmignore new file mode 100644 index 0000000000..3c3629e647 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/.npmignore @@ -0,0 +1 @@ +node_modules diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/History.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/History.md new file mode 100644 index 0000000000..aea8aaf099 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/History.md @@ -0,0 +1,23 @@ + +0.3.1 / 2016-01-14 +================== + + * add MIT LICENSE file (#23, @kasicka) + * preserve chaining after redundant style-method calls (#19, @drewblaisdell) + * package: add "license" field (#16, @BenjaminTsai) + +0.3.0 / 2014-05-09 +================== + + * package: remove "test" script and "devDependencies" + * package: remove "engines" section + * pacakge: remove "bin" section + * package: beautify + * examples: remove `starwars` example (#15) + * Documented goto, horizontalAbsolute, and eraseLine methods in README.md (#12, @Jammerwoch) + * add `.jshintrc` file + +< 0.3.0 +======= + + * Prehistoric diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/LICENSE new file mode 100644 index 0000000000..2ea4dc5efb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/README.md new file mode 100644 index 0000000000..6ce19403c4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/README.md @@ -0,0 +1,98 @@ +ansi.js +========= +### Advanced ANSI formatting tool for Node.js + +`ansi.js` is a module for Node.js that provides an easy-to-use API for +writing ANSI escape codes to `Stream` instances. ANSI escape codes are used to do +fancy things in a terminal window, like render text in colors, delete characters, +lines, the entire window, or hide and show the cursor, and lots more! + +#### Features: + + * 256 color support for the terminal! + * Make a beep sound from your terminal! + * Works with *any* writable `Stream` instance. + * Allows you to move the cursor anywhere on the terminal window. + * Allows you to delete existing contents from the terminal window. + * Allows you to hide and show the cursor. + * Converts CSS color codes and RGB values into ANSI escape codes. + * Low-level; you are in control of when escape codes are used, it's not abstracted. + + +Installation +------------ + +Install with `npm`: + +``` bash +$ npm install ansi +``` + + +Example +------- + +``` js +var ansi = require('ansi') + , cursor = ansi(process.stdout) + +// You can chain your calls forever: +cursor + .red() // Set font color to red + .bg.grey() // Set background color to grey + .write('Hello World!') // Write 'Hello World!' to stdout + .bg.reset() // Reset the bgcolor before writing the trailing \n, + // to avoid Terminal glitches + .write('\n') // And a final \n to wrap things up + +// Rendering modes are persistent: +cursor.hex('#660000').bold().underline() + +// You can use the regular logging functions, text will be green: +console.log('This is blood red, bold text') + +// To reset just the foreground color: +cursor.fg.reset() + +console.log('This will still be bold') + +// to go to a location (x,y) on the console +// note: 1-indexed, not 0-indexed: +cursor.goto(10, 5).write('Five down, ten over') + +// to clear the current line: +cursor.horizontalAbsolute(0).eraseLine().write('Starting again') + +// to go to a different column on the current line: +cursor.horizontalAbsolute(5).write('column five') + +// Clean up after yourself! +cursor.reset() +``` + + +License +------- + +(The MIT License) + +Copyright (c) 2012 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/beep/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/beep/index.js new file mode 100755 index 0000000000..c1ec929d0b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/beep/index.js @@ -0,0 +1,16 @@ +#!/usr/bin/env node + +/** + * Invokes the terminal "beep" sound once per second on every exact second. + */ + +process.title = 'beep' + +var cursor = require('../../')(process.stdout) + +function beep () { + cursor.beep() + setTimeout(beep, 1000 - (new Date()).getMilliseconds()) +} + +setTimeout(beep, 1000 - (new Date()).getMilliseconds()) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/clear/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/clear/index.js new file mode 100755 index 0000000000..6ac21ffa99 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/clear/index.js @@ -0,0 +1,15 @@ +#!/usr/bin/env node + +/** + * Like GNU ncurses "clear" command. + * https://github.com/mscdex/node-ncurses/blob/master/deps/ncurses/progs/clear.c + */ + +process.title = 'clear' + +function lf () { return '\n' } + +require('../../')(process.stdout) + .write(Array.apply(null, Array(process.stdout.getWindowSize()[1])).map(lf).join('')) + .eraseData(2) + .goto(1, 1) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/cursorPosition.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/cursorPosition.js new file mode 100755 index 0000000000..50f964490e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/cursorPosition.js @@ -0,0 +1,32 @@ +#!/usr/bin/env node + +var tty = require('tty') +var cursor = require('../')(process.stdout) + +// listen for the queryPosition report on stdin +process.stdin.resume() +raw(true) + +process.stdin.once('data', function (b) { + var match = /\[(\d+)\;(\d+)R$/.exec(b.toString()) + if (match) { + var xy = match.slice(1, 3).reverse().map(Number) + console.error(xy) + } + + // cleanup and close stdin + raw(false) + process.stdin.pause() +}) + + +// send the query position request code to stdout +cursor.queryPosition() + +function raw (mode) { + if (process.stdin.setRawMode) { + process.stdin.setRawMode(mode) + } else { + tty.setRawMode(mode) + } +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/progress/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/progress/index.js new file mode 100644 index 0000000000..d28dbda27f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/examples/progress/index.js @@ -0,0 +1,87 @@ +#!/usr/bin/env node + +var assert = require('assert') + , ansi = require('../../') + +function Progress (stream, width) { + this.cursor = ansi(stream) + this.delta = this.cursor.newlines + this.width = width | 0 || 10 + this.open = '[' + this.close = ']' + this.complete = '█' + this.incomplete = '_' + + // initial render + this.progress = 0 +} + +Object.defineProperty(Progress.prototype, 'progress', { + get: get + , set: set + , configurable: true + , enumerable: true +}) + +function get () { + return this._progress +} + +function set (v) { + this._progress = Math.max(0, Math.min(v, 100)) + + var w = this.width - this.complete.length - this.incomplete.length + , n = w * (this._progress / 100) | 0 + , i = w - n + , com = c(this.complete, n) + , inc = c(this.incomplete, i) + , delta = this.cursor.newlines - this.delta + + assert.equal(com.length + inc.length, w) + + if (delta > 0) { + this.cursor.up(delta) + this.delta = this.cursor.newlines + } + + this.cursor + .horizontalAbsolute(0) + .eraseLine(2) + .fg.white() + .write(this.open) + .fg.grey() + .bold() + .write(com) + .resetBold() + .write(inc) + .fg.white() + .write(this.close) + .fg.reset() + .write('\n') +} + +function c (char, length) { + return Array.apply(null, Array(length)).map(function () { + return char + }).join('') +} + + + + +// Usage +var width = parseInt(process.argv[2], 10) || process.stdout.getWindowSize()[0] / 2 + , p = new Progress(process.stdout, width) + +;(function tick () { + p.progress += Math.random() * 5 + p.cursor + .eraseLine(2) + .write('Progress: ') + .bold().write(p.progress.toFixed(2)) + .write('%') + .resetBold() + .write('\n') + if (p.progress < 100) + setTimeout(tick, 100) +})() diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/ansi.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/ansi.js new file mode 100644 index 0000000000..b1714e3289 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/ansi.js @@ -0,0 +1,405 @@ + +/** + * References: + * + * - http://en.wikipedia.org/wiki/ANSI_escape_code + * - http://www.termsys.demon.co.uk/vtansi.htm + * + */ + +/** + * Module dependencies. + */ + +var emitNewlineEvents = require('./newlines') + , prefix = '\x1b[' // For all escape codes + , suffix = 'm' // Only for color codes + +/** + * The ANSI escape sequences. + */ + +var codes = { + up: 'A' + , down: 'B' + , forward: 'C' + , back: 'D' + , nextLine: 'E' + , previousLine: 'F' + , horizontalAbsolute: 'G' + , eraseData: 'J' + , eraseLine: 'K' + , scrollUp: 'S' + , scrollDown: 'T' + , savePosition: 's' + , restorePosition: 'u' + , queryPosition: '6n' + , hide: '?25l' + , show: '?25h' +} + +/** + * Rendering ANSI codes. + */ + +var styles = { + bold: 1 + , italic: 3 + , underline: 4 + , inverse: 7 +} + +/** + * The negating ANSI code for the rendering modes. + */ + +var reset = { + bold: 22 + , italic: 23 + , underline: 24 + , inverse: 27 +} + +/** + * The standard, styleable ANSI colors. + */ + +var colors = { + white: 37 + , black: 30 + , blue: 34 + , cyan: 36 + , green: 32 + , magenta: 35 + , red: 31 + , yellow: 33 + , grey: 90 + , brightBlack: 90 + , brightRed: 91 + , brightGreen: 92 + , brightYellow: 93 + , brightBlue: 94 + , brightMagenta: 95 + , brightCyan: 96 + , brightWhite: 97 +} + + +/** + * Creates a Cursor instance based off the given `writable stream` instance. + */ + +function ansi (stream, options) { + if (stream._ansicursor) { + return stream._ansicursor + } else { + return stream._ansicursor = new Cursor(stream, options) + } +} +module.exports = exports = ansi + +/** + * The `Cursor` class. + */ + +function Cursor (stream, options) { + if (!(this instanceof Cursor)) { + return new Cursor(stream, options) + } + if (typeof stream != 'object' || typeof stream.write != 'function') { + throw new Error('a valid Stream instance must be passed in') + } + + // the stream to use + this.stream = stream + + // when 'enabled' is false then all the functions are no-ops except for write() + this.enabled = options && options.enabled + if (typeof this.enabled === 'undefined') { + this.enabled = stream.isTTY + } + this.enabled = !!this.enabled + + // then `buffering` is true, then `write()` calls are buffered in + // memory until `flush()` is invoked + this.buffering = !!(options && options.buffering) + this._buffer = [] + + // controls the foreground and background colors + this.fg = this.foreground = new Colorer(this, 0) + this.bg = this.background = new Colorer(this, 10) + + // defaults + this.Bold = false + this.Italic = false + this.Underline = false + this.Inverse = false + + // keep track of the number of "newlines" that get encountered + this.newlines = 0 + emitNewlineEvents(stream) + stream.on('newline', function () { + this.newlines++ + }.bind(this)) +} +exports.Cursor = Cursor + +/** + * Helper function that calls `write()` on the underlying Stream. + * Returns `this` instead of the write() return value to keep + * the chaining going. + */ + +Cursor.prototype.write = function (data) { + if (this.buffering) { + this._buffer.push(arguments) + } else { + this.stream.write.apply(this.stream, arguments) + } + return this +} + +/** + * Buffer `write()` calls into memory. + * + * @api public + */ + +Cursor.prototype.buffer = function () { + this.buffering = true + return this +} + +/** + * Write out the in-memory buffer. + * + * @api public + */ + +Cursor.prototype.flush = function () { + this.buffering = false + var str = this._buffer.map(function (args) { + if (args.length != 1) throw new Error('unexpected args length! ' + args.length); + return args[0]; + }).join(''); + this._buffer.splice(0); // empty + this.write(str); + return this +} + + +/** + * The `Colorer` class manages both the background and foreground colors. + */ + +function Colorer (cursor, base) { + this.current = null + this.cursor = cursor + this.base = base +} +exports.Colorer = Colorer + +/** + * Write an ANSI color code, ensuring that the same code doesn't get rewritten. + */ + +Colorer.prototype._setColorCode = function setColorCode (code) { + var c = String(code) + if (this.current === c) return + this.cursor.enabled && this.cursor.write(prefix + c + suffix) + this.current = c + return this +} + + +/** + * Set up the positional ANSI codes. + */ + +Object.keys(codes).forEach(function (name) { + var code = String(codes[name]) + Cursor.prototype[name] = function () { + var c = code + if (arguments.length > 0) { + c = toArray(arguments).map(Math.round).join(';') + code + } + this.enabled && this.write(prefix + c) + return this + } +}) + +/** + * Set up the functions for the rendering ANSI codes. + */ + +Object.keys(styles).forEach(function (style) { + var name = style[0].toUpperCase() + style.substring(1) + , c = styles[style] + , r = reset[style] + + Cursor.prototype[style] = function () { + if (this[name]) return this + this.enabled && this.write(prefix + c + suffix) + this[name] = true + return this + } + + Cursor.prototype['reset' + name] = function () { + if (!this[name]) return this + this.enabled && this.write(prefix + r + suffix) + this[name] = false + return this + } +}) + +/** + * Setup the functions for the standard colors. + */ + +Object.keys(colors).forEach(function (color) { + var code = colors[color] + + Colorer.prototype[color] = function () { + this._setColorCode(this.base + code) + return this.cursor + } + + Cursor.prototype[color] = function () { + return this.foreground[color]() + } +}) + +/** + * Makes a beep sound! + */ + +Cursor.prototype.beep = function () { + this.enabled && this.write('\x07') + return this +} + +/** + * Moves cursor to specific position + */ + +Cursor.prototype.goto = function (x, y) { + x = x | 0 + y = y | 0 + this.enabled && this.write(prefix + y + ';' + x + 'H') + return this +} + +/** + * Resets the color. + */ + +Colorer.prototype.reset = function () { + this._setColorCode(this.base + 39) + return this.cursor +} + +/** + * Resets all ANSI formatting on the stream. + */ + +Cursor.prototype.reset = function () { + this.enabled && this.write(prefix + '0' + suffix) + this.Bold = false + this.Italic = false + this.Underline = false + this.Inverse = false + this.foreground.current = null + this.background.current = null + return this +} + +/** + * Sets the foreground color with the given RGB values. + * The closest match out of the 216 colors is picked. + */ + +Colorer.prototype.rgb = function (r, g, b) { + var base = this.base + 38 + , code = rgb(r, g, b) + this._setColorCode(base + ';5;' + code) + return this.cursor +} + +/** + * Same as `cursor.fg.rgb(r, g, b)`. + */ + +Cursor.prototype.rgb = function (r, g, b) { + return this.foreground.rgb(r, g, b) +} + +/** + * Accepts CSS color codes for use with ANSI escape codes. + * For example: `#FF000` would be bright red. + */ + +Colorer.prototype.hex = function (color) { + return this.rgb.apply(this, hex(color)) +} + +/** + * Same as `cursor.fg.hex(color)`. + */ + +Cursor.prototype.hex = function (color) { + return this.foreground.hex(color) +} + + +// UTIL FUNCTIONS // + +/** + * Translates a 255 RGB value to a 0-5 ANSI RGV value, + * then returns the single ANSI color code to use. + */ + +function rgb (r, g, b) { + var red = r / 255 * 5 + , green = g / 255 * 5 + , blue = b / 255 * 5 + return rgb5(red, green, blue) +} + +/** + * Turns rgb 0-5 values into a single ANSI color code to use. + */ + +function rgb5 (r, g, b) { + var red = Math.round(r) + , green = Math.round(g) + , blue = Math.round(b) + return 16 + (red*36) + (green*6) + blue +} + +/** + * Accepts a hex CSS color code string (# is optional) and + * translates it into an Array of 3 RGB 0-255 values, which + * can then be used with rgb(). + */ + +function hex (color) { + var c = color[0] === '#' ? color.substring(1) : color + , r = c.substring(0, 2) + , g = c.substring(2, 4) + , b = c.substring(4, 6) + return [parseInt(r, 16), parseInt(g, 16), parseInt(b, 16)] +} + +/** + * Turns an array-like object into a real array. + */ + +function toArray (a) { + var i = 0 + , l = a.length + , rtn = [] + for (; i<l; i++) { + rtn.push(a[i]) + } + return rtn +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/newlines.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/newlines.js new file mode 100644 index 0000000000..4e37a0adbc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/lib/newlines.js @@ -0,0 +1,71 @@ + +/** + * Accepts any node Stream instance and hijacks its "write()" function, + * so that it can count any newlines that get written to the output. + * + * When a '\n' byte is encountered, then a "newline" event will be emitted + * on the stream, with no arguments. It is up to the listeners to determine + * any necessary deltas required for their use-case. + * + * Ex: + * + * var cursor = ansi(process.stdout) + * , ln = 0 + * process.stdout.on('newline', function () { + * ln++ + * }) + */ + +/** + * Module dependencies. + */ + +var assert = require('assert') +var NEWLINE = '\n'.charCodeAt(0) + +function emitNewlineEvents (stream) { + if (stream._emittingNewlines) { + // already emitting newline events + return + } + + var write = stream.write + + stream.write = function (data) { + // first write the data + var rtn = write.apply(stream, arguments) + + if (stream.listeners('newline').length > 0) { + var len = data.length + , i = 0 + // now try to calculate any deltas + if (typeof data == 'string') { + for (; i<len; i++) { + processByte(stream, data.charCodeAt(i)) + } + } else { + // buffer + for (; i<len; i++) { + processByte(stream, data[i]) + } + } + } + + return rtn + } + + stream._emittingNewlines = true +} +module.exports = emitNewlineEvents + + +/** + * Processes an individual byte being written to a stream + */ + +function processByte (stream, b) { + assert.equal(typeof b, 'number') + if (b === NEWLINE) { + stream.emit('newline') + } +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/package.json new file mode 100644 index 0000000000..1548dca5ac --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/ansi/package.json @@ -0,0 +1,86 @@ +{ + "_args": [ + [ + "ansi@~0.3.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog" + ] + ], + "_from": "ansi@>=0.3.0 <0.4.0", + "_id": "ansi@0.3.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/ansi", + "_nodeVersion": "5.3.0", + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" + }, + "_npmVersion": "3.3.12", + "_phantomChildren": {}, + "_requested": { + "name": "ansi", + "raw": "ansi@~0.3.0", + "rawSpec": "~0.3.0", + "scope": null, + "spec": ">=0.3.0 <0.4.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog", + "/node-gyp/npmlog/gauge" + ], + "_resolved": "https://registry.npmjs.org/ansi/-/ansi-0.3.1.tgz", + "_shasum": "0c42d4fb17160d5a9af1e484bace1c66922c1b21", + "_shrinkwrap": null, + "_spec": "ansi@~0.3.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog", + "author": { + "email": "nathan@tootallnate.net", + "name": "Nathan Rajlich", + "url": "http://tootallnate.net" + }, + "bugs": { + "url": "https://github.com/TooTallNate/ansi.js/issues" + }, + "dependencies": {}, + "description": "Advanced ANSI formatting tool for Node.js", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "0c42d4fb17160d5a9af1e484bace1c66922c1b21", + "tarball": "http://registry.npmjs.org/ansi/-/ansi-0.3.1.tgz" + }, + "gitHead": "4d0d4af94e0bdaa648bd7262acd3bde4b98d5246", + "homepage": "https://github.com/TooTallNate/ansi.js#readme", + "keywords": [ + "256", + "ansi", + "color", + "cursor", + "formatting", + "rgb", + "stream", + "terminal" + ], + "license": "MIT", + "main": "./lib/ansi.js", + "maintainers": [ + { + "name": "TooTallNate", + "email": "nathan@tootallnate.net" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" + } + ], + "name": "ansi", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/ansi.js.git" + }, + "scripts": {}, + "version": "0.3.1" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/.npmignore new file mode 100644 index 0000000000..926ddf616c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/.npmignore @@ -0,0 +1,3 @@ +*~ +.#* +node_modules diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/LICENSE new file mode 100644 index 0000000000..af4588069d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/LICENSE @@ -0,0 +1,5 @@ +Copyright (c) 2015, Rebecca Turner + +Permission to use, copy, modify, and/or distribute this software for any purpose with or without fee is hereby granted, provided that the above copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/README.md new file mode 100644 index 0000000000..cff489810b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/README.md @@ -0,0 +1,184 @@ +are-we-there-yet +---------------- + +Track complex hiearchies of asynchronous task completion statuses. This is +intended to give you a way of recording and reporting the progress of the big +recursive fan-out and gather type workflows that are so common in async. + +What you do with this completion data is up to you, but the most common use case is to +feed it to one of the many progress bar modules. + +Most progress bar modules include a rudamentary version of this, but my +needs were more complex. + +Usage +===== + +```javascript +var TrackerGroup = require("are-we-there-yet").TrackerGroup + +var top = new TrackerGroup("program") + +var single = top.newItem("one thing", 100) +single.completeWork(20) + +console.log(top.completed()) // 0.2 + +fs.stat("file", function(er, stat) { + if (er) throw er + var stream = top.newStream("file", stat.size) + console.log(top.completed()) // now 0.1 as single is 50% of the job and is 20% complete + // and 50% * 20% == 10% + fs.createReadStream("file").pipe(stream).on("data", function (chunk) { + // do stuff with chunk + }) + top.on("change", function (name) { + // called each time a chunk is read from "file" + // top.completed() will start at 0.1 and fill up to 0.6 as the file is read + }) +}) +``` + +Shared Methods +============== + +All tracker objects described below have the following methods, they, along +with the event comprise the interface for consumers of tracker objects. + +* var completed = tracker.completed() + +Returns the ratio of completed work to work to be done. Range of 0 to 1. + +* tracker.finish() + +Marks the tracker as completed. With a TrackerGroup this marks all of its +components as completed. + +Marks all of the components of this tracker as finished, which in turn means +that `tracker.completed()` for this will now be 1. + +This will result in one or more `change` events being emitted. + +Events +====== + +All tracker objects emit `change` events with an argument of the name of the +thing changing. + +TrackerGroup +============ + +* var tracker = new TrackerGroup(**name**) + + * **name** *(optional)* - The name of this tracker group, used in change + notifications if the component updating didn't have a name. Defaults to undefined. + +Creates a new empty tracker aggregation group. These are trackers whose +completion status is determined by the completion status of other trackers. + +* tracker.addUnit(**otherTracker**, **weight**) + + * **otherTracker** - Any of the other are-we-there-yet tracker objects + * **weight** *(optional)* - The weight to give the tracker, defaults to 1. + +Adds the **otherTracker** to this aggregation group. The weight determines +how long you expect this tracker to take to complete in proportion to other +units. So for instance, if you add one tracker with a weight of 1 and +another with a weight of 2, you're saying the second will take twice as long +to complete as the first. As such, the first will account for 33% of the +completion of this tracker and the second will account for the other 67%. + +Returns **otherTracker**. + +* var subGroup = tracker.newGroup(**name**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subGroup = tracker.addUnit(new TrackerGroup(name), weight) +``` + +* var subItem = tracker.newItem(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subItem = tracker.addUnit(new Tracker(name, todo), weight) +``` + +* var subStream = tracker.newStream(**name**, **todo**, **weight**) + +The above is exactly equivalent to: + +```javascript + var subStream = tracker.addUnit(new TrackerStream(name, todo), weight) +``` + +* console.log( tracker.debug() ) + +Returns a tree showing the completion of this tracker group and all of its +children, including recursively entering all of the children. + +Tracker +======= + +* var tracker = new Tracker(**name**, **todo**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **todo** *(optional)* The amount of work todo (a number). Defaults to 0. + +Ordinarily these are constructed as a part of a tracker group (via +`newItem`). + +* var completed = tracker.completed() + +Returns the ratio of completed work to work to be done. Range of 0 to 1. If +total work to be done is 0 then it will return 0. + +* tracker.addWork(**todo**) + + * **todo** A number to add to the amount of work to be done. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. + +* tracker.completeWork(**completed**) + + * **completed** A number to add to the work complete + +Increase the amount of work complete, thus increasing the completion percentage. +Will never increase the work completed past the amount of work todo. That is, +percentages > 100% are not allowed. Triggers a `change` event. + +* tracker.finish() + +Marks this tracker as finished, tracker.completed() will now be 1. Triggers +a `change` event. + +TrackerStream +============= + +* var tracker = new TrackerStream(**name**, **size**, **options**) + + * **name** *(optional)* The name of this counter to report in change + events. Defaults to undefined. + * **size** *(optional)* The number of bytes being sent through this stream. + * **options** *(optional)* A hash of stream options + +The tracker stream object is a pass through stream that updates an internal +tracker object each time a block passes through. It's intended to track +downloads, file extraction and other related activities. You use it by piping +your data source into it and then using it as your data source. + +If your data has a length attribute then that's used as the amount of work +completed when the chunk is passed through. If it does not (eg, object +streams) then each chunk counts as completing 1 unit of work, so your size +should be the total number of objects being streamed. + +* tracker.addWork(**todo**) + + * **todo** Increase the expected overall size by **todo** bytes. + +Increases the amount of work to be done, thus decreasing the completion +percentage. Triggers a `change` event. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/index.js new file mode 100644 index 0000000000..22f47ac885 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/index.js @@ -0,0 +1,130 @@ +"use strict" +var stream = require("readable-stream"); +var EventEmitter = require("events").EventEmitter +var util = require("util") +var delegate = require("delegates") + +var TrackerGroup = exports.TrackerGroup = function (name) { + EventEmitter.call(this) + this.name = name + this.trackGroup = [] + var self = this + this.totalWeight = 0 + var noteChange = this.noteChange = function (name) { + self.emit("change", name || this.name) + }.bind(this) + this.trackGroup.forEach(function(unit) { + unit.on("change", noteChange) + }) +} +util.inherits(TrackerGroup, EventEmitter) + +TrackerGroup.prototype.completed = function () { + if (this.trackGroup.length==0) return 0 + var valPerWeight = 1 / this.totalWeight + var completed = 0 + this.trackGroup.forEach(function(T) { + completed += valPerWeight * T.weight * T.completed() + }) + return completed +} + +TrackerGroup.prototype.addUnit = function (unit, weight, noChange) { + unit.weight = weight || 1 + this.totalWeight += unit.weight + this.trackGroup.push(unit) + unit.on("change", this.noteChange) + if (! noChange) this.emit("change", this.name) + return unit +} + +TrackerGroup.prototype.newGroup = function (name, weight) { + return this.addUnit(new TrackerGroup(name), weight) +} + +TrackerGroup.prototype.newItem = function (name, todo, weight) { + return this.addUnit(new Tracker(name, todo), weight) +} + +TrackerGroup.prototype.newStream = function (name, todo, weight) { + return this.addUnit(new TrackerStream(name, todo), weight) +} + +TrackerGroup.prototype.finish = function () { + if (! this.trackGroup.length) { this.addUnit(new Tracker(), 1, true) } + var self = this + this.trackGroup.forEach(function(T) { + T.removeListener("change", self.noteChange) + T.finish() + }) + this.emit("change", this.name) +} + +var buffer = " " +TrackerGroup.prototype.debug = function (depth) { + depth = depth || 0 + var indent = depth ? buffer.substr(0,depth) : "" + var output = indent + (this.name||"top") + ": " + this.completed() + "\n" + this.trackGroup.forEach(function(T) { + if (T instanceof TrackerGroup) { + output += T.debug(depth + 1) + } + else { + output += indent + " " + T.name + ": " + T.completed() + "\n" + } + }) + return output +} + +var Tracker = exports.Tracker = function (name,todo) { + EventEmitter.call(this) + this.name = name + this.workDone = 0 + this.workTodo = todo || 0 +} +util.inherits(Tracker, EventEmitter) + +Tracker.prototype.completed = function () { + return this.workTodo==0 ? 0 : this.workDone / this.workTodo +} + +Tracker.prototype.addWork = function (work) { + this.workTodo += work + this.emit("change", this.name) +} + +Tracker.prototype.completeWork = function (work) { + this.workDone += work + if (this.workDone > this.workTodo) this.workDone = this.workTodo + this.emit("change", this.name) +} + +Tracker.prototype.finish = function () { + this.workTodo = this.workDone = 1 + this.emit("change", this.name) +} + + +var TrackerStream = exports.TrackerStream = function (name, size, options) { + stream.Transform.call(this, options) + this.tracker = new Tracker(name, size) + this.name = name + var self = this + this.tracker.on("change", function (name) { self.emit("change", name) }) +} +util.inherits(TrackerStream, stream.Transform) + +TrackerStream.prototype._transform = function (data, encoding, cb) { + this.tracker.completeWork(data.length ? data.length : 1) + this.push(data) + cb() +} + +TrackerStream.prototype._flush = function (cb) { + this.tracker.finish() + cb() +} + +delegate(TrackerStream.prototype, "tracker") + .method("completed") + .method("addWork") diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/.npmignore new file mode 100644 index 0000000000..c2658d7d1b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/.npmignore @@ -0,0 +1 @@ +node_modules/ diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/History.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/History.md new file mode 100644 index 0000000000..aee31a4c35 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/History.md @@ -0,0 +1,16 @@ + +0.1.0 / 2014-10-17 +================== + + * adds `.fluent()` to api + +0.0.3 / 2014-01-13 +================== + + * fix receiver for .method() + +0.0.2 / 2014-01-13 +================== + + * Object.defineProperty() sucks + * Initial commit diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Makefile b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Makefile new file mode 100644 index 0000000000..a9dcfd50db --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Makefile @@ -0,0 +1,8 @@ + +test: + @./node_modules/.bin/mocha \ + --require should \ + --reporter spec \ + --bail + +.PHONY: test
\ No newline at end of file diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Readme.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Readme.md new file mode 100644 index 0000000000..ab8cf4ace1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/Readme.md @@ -0,0 +1,94 @@ + +# delegates + + Node method and accessor delegation utilty. + +## Installation + +``` +$ npm install delegates +``` + +## Example + +```js +var delegate = require('delegates'); + +... + +delegate(proto, 'request') + .method('acceptsLanguages') + .method('acceptsEncodings') + .method('acceptsCharsets') + .method('accepts') + .method('is') + .access('querystring') + .access('idempotent') + .access('socket') + .access('length') + .access('query') + .access('search') + .access('status') + .access('method') + .access('path') + .access('body') + .access('host') + .access('url') + .getter('subdomains') + .getter('protocol') + .getter('header') + .getter('stale') + .getter('fresh') + .getter('secure') + .getter('ips') + .getter('ip') +``` + +# API + +## Delegate(proto, prop) + +Creates a delegator instance used to configure using the `prop` on the given +`proto` object. (which is usually a prototype) + +## Delegate#method(name) + +Allows the given method `name` to be accessed on the host. + +## Delegate#getter(name) + +Creates a "getter" for the property with the given `name` on the delegated +object. + +## Delegate#setter(name) + +Creates a "setter" for the property with the given `name` on the delegated +object. + +## Delegate#access(name) + +Creates an "accessor" (ie: both getter *and* setter) for the property with the +given `name` on the delegated object. + +## Delegate#fluent(name) + +A unique type of "accessor" that works for a "fluent" API. When called as a +getter, the method returns the expected value. However, if the method is called +with a value, it will return itself so it can be chained. For example: + +```js +delegate(proto, 'request') + .fluent('query') + +// getter +var q = request.query(); + +// setter (chainable) +request + .query({ a: 1 }) + .query({ b: 2 }); +``` + +# License + + MIT diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/index.js new file mode 100644 index 0000000000..17c222d529 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/index.js @@ -0,0 +1,121 @@ + +/** + * Expose `Delegator`. + */ + +module.exports = Delegator; + +/** + * Initialize a delegator. + * + * @param {Object} proto + * @param {String} target + * @api public + */ + +function Delegator(proto, target) { + if (!(this instanceof Delegator)) return new Delegator(proto, target); + this.proto = proto; + this.target = target; + this.methods = []; + this.getters = []; + this.setters = []; + this.fluents = []; +} + +/** + * Delegate method `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.method = function(name){ + var proto = this.proto; + var target = this.target; + this.methods.push(name); + + proto[name] = function(){ + return this[target][name].apply(this[target], arguments); + }; + + return this; +}; + +/** + * Delegator accessor `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.access = function(name){ + return this.getter(name).setter(name); +}; + +/** + * Delegator getter `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.getter = function(name){ + var proto = this.proto; + var target = this.target; + this.getters.push(name); + + proto.__defineGetter__(name, function(){ + return this[target][name]; + }); + + return this; +}; + +/** + * Delegator setter `name`. + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.setter = function(name){ + var proto = this.proto; + var target = this.target; + this.setters.push(name); + + proto.__defineSetter__(name, function(val){ + return this[target][name] = val; + }); + + return this; +}; + +/** + * Delegator fluent accessor + * + * @param {String} name + * @return {Delegator} self + * @api public + */ + +Delegator.prototype.fluent = function (name) { + var proto = this.proto; + var target = this.target; + this.fluents.push(name); + + proto[name] = function(val){ + if ('undefined' != typeof val) { + this[target][name] = val; + return this; + } else { + return this[target][name]; + } + }; + + return this; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/package.json new file mode 100644 index 0000000000..ea3c1da0d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/package.json @@ -0,0 +1,48 @@ +{ + "name": "delegates", + "version": "0.1.0", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/node-delegates.git" + }, + "description": "delegate methods and accessors to another property", + "keywords": [ + "delegate", + "delegation" + ], + "dependencies": {}, + "devDependencies": { + "mocha": "*", + "should": "*" + }, + "license": "MIT", + "bugs": { + "url": "https://github.com/visionmedia/node-delegates/issues" + }, + "homepage": "https://github.com/visionmedia/node-delegates", + "_id": "delegates@0.1.0", + "_shasum": "b4b57be11a1653517a04b27f0949bdc327dfe390", + "_from": "delegates@>=0.1.0 <0.2.0", + "_npmVersion": "1.4.9", + "_npmUser": { + "name": "dominicbarnes", + "email": "dominic@dbarnes.info" + }, + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "dominicbarnes", + "email": "dominic@dbarnes.info" + } + ], + "dist": { + "shasum": "b4b57be11a1653517a04b27f0949bdc327dfe390", + "tarball": "http://registry.npmjs.org/delegates/-/delegates-0.1.0.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/delegates/-/delegates-0.1.0.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/test/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/test/index.js new file mode 100644 index 0000000000..7b6e3d4df1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/node_modules/delegates/test/index.js @@ -0,0 +1,94 @@ + +var assert = require('assert'); +var delegate = require('..'); + +describe('.method(name)', function(){ + it('should delegate methods', function(){ + var obj = {}; + + obj.request = { + foo: function(bar){ + assert(this == obj.request); + return bar; + } + }; + + delegate(obj, 'request').method('foo'); + + obj.foo('something').should.equal('something'); + }) +}) + +describe('.getter(name)', function(){ + it('should delegate getters', function(){ + var obj = {}; + + obj.request = { + get type() { + return 'text/html'; + } + } + + delegate(obj, 'request').getter('type'); + + obj.type.should.equal('text/html'); + }) +}) + +describe('.setter(name)', function(){ + it('should delegate setters', function(){ + var obj = {}; + + obj.request = { + get type() { + return this._type.toUpperCase(); + }, + + set type(val) { + this._type = val; + } + } + + delegate(obj, 'request').setter('type'); + + obj.type = 'hey'; + obj.request.type.should.equal('HEY'); + }) +}) + +describe('.access(name)', function(){ + it('should delegate getters and setters', function(){ + var obj = {}; + + obj.request = { + get type() { + return this._type.toUpperCase(); + }, + + set type(val) { + this._type = val; + } + } + + delegate(obj, 'request').access('type'); + + obj.type = 'hey'; + obj.type.should.equal('HEY'); + }) +}) + +describe('.fluent(name)', function () { + it('should delegate in a fluent fashion', function () { + var obj = { + settings: { + env: 'development' + } + }; + + delegate(obj, 'settings').fluent('env'); + + obj.env().should.equal('development'); + obj.env('production').should.equal(obj); + obj.settings.env.should.equal('production'); + }) +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/package.json new file mode 100644 index 0000000000..0df2df0abd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/package.json @@ -0,0 +1,77 @@ +{ + "_args": [ + [ + "are-we-there-yet@~1.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog" + ] + ], + "_from": "are-we-there-yet@>=1.0.0 <1.1.0", + "_id": "are-we-there-yet@1.0.5", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/are-we-there-yet", + "_nodeVersion": "4.2.2", + "_npmUser": { + "email": "me@re-becca.org", + "name": "iarna" + }, + "_npmVersion": "3.5.2", + "_phantomChildren": {}, + "_requested": { + "name": "are-we-there-yet", + "raw": "are-we-there-yet@~1.0.0", + "rawSpec": "~1.0.0", + "scope": null, + "spec": ">=1.0.0 <1.1.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog" + ], + "_resolved": "https://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.0.5.tgz", + "_shasum": "239f26706da902a2bffb72c33de66fdfd3798ac5", + "_shrinkwrap": null, + "_spec": "are-we-there-yet@~1.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog", + "author": { + "name": "Rebecca Turner", + "url": "http://re-becca.org" + }, + "bugs": { + "url": "https://github.com/iarna/are-we-there-yet/issues" + }, + "dependencies": { + "delegates": "^0.1.0", + "readable-stream": "^2.0.0 || ^1.1.13" + }, + "description": "Keep track of the overall completion of many dispirate processes", + "devDependencies": { + "tap": "^0.4.13" + }, + "directories": {}, + "dist": { + "shasum": "239f26706da902a2bffb72c33de66fdfd3798ac5", + "tarball": "http://registry.npmjs.org/are-we-there-yet/-/are-we-there-yet-1.0.5.tgz" + }, + "gitHead": "abaff79ae17e9397eae19d29d2d75778d18aab3a", + "homepage": "https://github.com/iarna/are-we-there-yet", + "license": "ISC", + "main": "index.js", + "maintainers": [ + { + "name": "iarna", + "email": "me@re-becca.org" + } + ], + "name": "are-we-there-yet", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/are-we-there-yet.git" + }, + "scripts": { + "test": "tap test/*.js" + }, + "version": "1.0.5" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/tracker.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/tracker.js new file mode 100644 index 0000000000..18c31c32cf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/tracker.js @@ -0,0 +1,56 @@ +"use strict" +var test = require("tap").test +var Tracker = require("../index.js").Tracker + +var timeoutError = new Error("timeout") +var testEvent = function (obj,event,next) { + var timeout = setTimeout(function(){ + obj.removeListener(event, eventHandler) + next(timeoutError) + }, 10) + var eventHandler = function () { + var args = Array.prototype.slice.call(arguments) + args.unshift(null) + clearTimeout(timeout) + next.apply(null, args) + } + obj.once(event, eventHandler) +} + +test("Tracker", function (t) { + t.plan(10) + + var name = "test" + var track = new Tracker(name) + + t.is(track.completed(), 0, "Nothing todo is 0 completion") + + var todo = 100 + track = new Tracker(name, todo) + t.is(track.completed(), 0, "Nothing done is 0 completion") + + testEvent(track, "change", afterCompleteWork) + track.completeWork(100) + function afterCompleteWork(er, onChangeName) { + t.is(er, null, "completeWork: on change event fired") + t.is(onChangeName, name, "completeWork: on change emits the correct name") + } + t.is(track.completed(), 1, "completeWork: 100% completed") + + testEvent(track, "change", afterAddWork) + track.addWork(100) + function afterAddWork(er, onChangeName) { + t.is(er, null, "addWork: on change event fired") + t.is(onChangeName, name, "addWork: on change emits the correct name") + } + t.is(track.completed(), 0.5, "addWork: 50% completed") + + + track.completeWork(200) + t.is(track.completed(), 1, "completeWork: Over completion is still only 100% complete") + + track = new Tracker(name, todo) + track.completeWork(50) + track.finish() + t.is(track.completed(), 1, "finish: Explicitly finishing moves to 100%") +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackergroup.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackergroup.js new file mode 100644 index 0000000000..f97e1034ff --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackergroup.js @@ -0,0 +1,87 @@ +"use strict" +var test = require("tap").test +var Tracker = require("../index.js").Tracker +var TrackerGroup = require("../index.js").TrackerGroup + +var timeoutError = new Error("timeout") +var testEvent = function (obj,event,next) { + var timeout = setTimeout(function(){ + obj.removeListener(event, eventHandler) + next(timeoutError) + }, 10) + var eventHandler = function () { + var args = Array.prototype.slice.call(arguments) + args.unshift(null) + clearTimeout(timeout) + next.apply(null, args) + } + obj.once(event, eventHandler) +} + +test("TrackerGroup", function (t) { + var name = "test" + + var track = new TrackerGroup(name) + t.is(track.completed(), 0, "Nothing todo is 0 completion") + testEvent(track, "change", afterFinishEmpty) + track.finish() + var a, b + function afterFinishEmpty(er, onChangeName) { + t.is(er, null, "finishEmpty: on change event fired") + t.is(onChangeName, name, "finishEmpty: on change emits the correct name") + t.is(track.completed(), 1, "finishEmpty: Finishing an empty group actually finishes it") + + track = new TrackerGroup(name) + a = track.newItem("a", 10, 1) + b = track.newItem("b", 10, 1) + t.is(track.completed(), 0, "Initially empty") + testEvent(track, "change", afterCompleteWork) + a.completeWork(5) + } + function afterCompleteWork(er, onChangeName) { + t.is(er, null, "on change event fired") + t.is(onChangeName, "a", "on change emits the correct name") + t.is(track.completed(), 0.25, "Complete half of one is a quarter overall") + testEvent(track, "change", afterFinishAll) + track.finish() + } + function afterFinishAll(er, onChangeName) { + t.is(er, null, "finishAll: on change event fired") + t.is(onChangeName, name, "finishAll: on change emits the correct name") + t.is(track.completed(), 1, "Finishing everything ") + + track = new TrackerGroup(name) + a = track.newItem("a", 10, 2) + b = track.newItem("b", 10, 1) + t.is(track.completed(), 0, "weighted: Initially empty") + testEvent(track, "change", afterWeightedCompleteWork) + a.completeWork(5) + } + function afterWeightedCompleteWork(er, onChangeName) { + t.is(er, null, "weighted: on change event fired") + t.is(onChangeName, "a", "weighted: on change emits the correct name") + t.is(Math.round(track.completed()*100), 33, "weighted: Complete half of double weighted") + testEvent(track, "change", afterWeightedFinishAll) + track.finish() + } + function afterWeightedFinishAll(er, onChangeName) { + t.is(er, null, "weightedFinishAll: on change event fired") + t.is(onChangeName, name, "weightedFinishAll: on change emits the correct name") + t.is(track.completed(), 1, "weightedFinishaAll: Finishing everything ") + + track = new TrackerGroup(name) + a = track.newGroup("a", 10) + b = track.newGroup("b", 10) + var a1 = a.newItem("a.1",10) + a1.completeWork(5) + t.is(track.completed(), 0.25, "nested: Initially quarter done") + testEvent(track, "change", afterNestedComplete) + b.finish() + } + function afterNestedComplete(er, onChangeName) { + t.is(er, null, "nestedComplete: on change event fired") + t.is(onChangeName, "b", "nestedComplete: on change emits the correct name") + t.is(track.completed(), 0.75, "nestedComplete: Finishing everything ") + t.end() + } +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackerstream.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackerstream.js new file mode 100644 index 0000000000..72b6043097 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/are-we-there-yet/test/trackerstream.js @@ -0,0 +1,65 @@ +"use strict" +var test = require("tap").test +var util = require("util") +var stream = require("readable-stream") +var TrackerStream = require("../index.js").TrackerStream + +var timeoutError = new Error("timeout") +var testEvent = function (obj,event,next) { + var timeout = setTimeout(function(){ + obj.removeListener(event, eventHandler) + next(timeoutError) + }, 10) + var eventHandler = function () { + var args = Array.prototype.slice.call(arguments) + args.unshift(null) + clearTimeout(timeout) + next.apply(null, args) + } + obj.once(event, eventHandler) +} + +var Sink = function () { + stream.Writable.apply(this,arguments) +} +util.inherits(Sink, stream.Writable) +Sink.prototype._write = function (data, encoding, cb) { + cb() +} + +test("TrackerStream", function (t) { + t.plan(9) + + var name = "test" + var track = new TrackerStream(name) + + t.is(track.completed(), 0, "Nothing todo is 0 completion") + + var todo = 10 + track = new TrackerStream(name, todo) + t.is(track.completed(), 0, "Nothing done is 0 completion") + + track.pipe(new Sink()) + + testEvent(track, "change", afterCompleteWork) + track.write("0123456789") + function afterCompleteWork(er, onChangeName) { + t.is(er, null, "write: on change event fired") + t.is(onChangeName, name, "write: on change emits the correct name") + t.is(track.completed(), 1, "write: 100% completed") + + testEvent(track, "change", afterAddWork) + track.addWork(10) + } + function afterAddWork(er, onChangeName) { + t.is(er, null, "addWork: on change event fired") + t.is(track.completed(), 0.5, "addWork: 50% completed") + + testEvent(track, "change", afterAllWork) + track.write("ABCDEFGHIJKLMNOPQRST") + } + function afterAllWork(er) { + t.is(er, null, "allWork: on change event fired") + t.is(track.completed(), 1, "allWork: 100% completed") + } +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/.npmignore new file mode 100644 index 0000000000..df22a16c63 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/.npmignore @@ -0,0 +1,32 @@ +# Logs +logs +*.log + +# Runtime data +pids +*.pid +*.seed + +# Directory for instrumented libs generated by jscoverage/JSCover +lib-cov + +# Coverage directory used by tools like istanbul +coverage + +# Grunt intermediate storage (http://gruntjs.com/creating-plugins#storing-task-files) +.grunt + +# Compiled binary addons (http://nodejs.org/api/addons.html) +build/Release + +# Dependency directory +# Commenting this out is preferred by some people, see +# https://www.npmjs.org/doc/misc/npm-faq.html#should-i-check-my-node_modules-folder-into-git- +node_modules + +# Users Environment Variables +.lock-wscript + +# Editor cruft +*~ +.#* diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/LICENSE new file mode 100644 index 0000000000..e756052969 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/LICENSE @@ -0,0 +1,13 @@ +Copyright (c) 2014, Rebecca Turner <me@re-becca.org> + +Permission to use, copy, modify, and/or distribute this software for any +purpose with or without fee is hereby granted, provided that the above +copyright notice and this permission notice appear in all copies. + +THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES +WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF +MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR +ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/README.md new file mode 100644 index 0000000000..ca0a8cd773 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/README.md @@ -0,0 +1,166 @@ +gauge +===== + +A nearly stateless terminal based horizontal guage / progress bar. + +```javascript +var Gauge = require("gauge") + +var gauge = new Gauge() + +gauge.show("test", 0.20) + +gauge.pulse("this") + +gauge.hide() +``` + +![](example.png) + + +### `var gauge = new Gauge([options], [ansiStream])` + +* **options** – *(optional)* An option object. (See [below] for details.) +* **ansiStream** – *(optional)* A stream that's been blessed by the [ansi] + module to include various commands for controlling the cursor in a terminal. + +[ansi]: https://www.npmjs.com/package/ansi +[below]: #theme-objects + +Constructs a new gauge. Gauges are drawn on a single line, and are not drawn +if the current terminal isn't a tty. + +If you resize your terminal in a way that can be detected then the gauge +will be drawn at the new size. As a general rule, growing your terminal will +be clean, but shrinking your terminal will result in cruft as we don't have +enough information to know where what we wrote previously is now located. + +The **options** object can have the following properties, all of which are +optional: + +* maxUpdateFrequency: defaults to 50 msec, the gauge will not be drawn more + than once in this period of time. This applies to `show` and `pulse` + calls, but if you `hide` and then `show` the gauge it will draw it + regardless of time since last draw. +* theme: defaults to Gauge.unicode` if the terminal supports + unicode according to [has-unicode], otherwise it defaults to `Gauge.ascii`. + Details on the [theme object](#theme-objects) are documented elsewhere. +* template: see [documentation elsewhere](#template-objects) for + defaults and details. + +[has-unicode]: https://www.npmjs.com/package/has-unicode + +If **ansiStream** isn't passed in, then one will be constructed from stderr +with `ansi(process.stderr)`. + +### `gauge.show([name, [completed]])` + +* **name** – *(optional)* The name of the current thing contributing to progress. Defaults to the last value used, or "". +* **completed** – *(optional)* The portion completed as a value between 0 and 1. Defaults to the last value used, or 0. + +If `process.stdout.isTTY` is false then this does nothing. If completed is 0 +and `gauge.pulse` has never been called, then similarly nothing will be printed. + +If `maxUpdateFrequency` msec haven't passed since the last call to `show` or +`pulse` then similarly, nothing will be printed. (Actually, the update is +deferred until `maxUpdateFrequency` msec have passed and if nothing else has +happened, the gauge update will happen.) + +### `gauge.hide()` + +Removes the gauge from the terminal. + +### `gauge.pulse([name])` + +* **name** – *(optional)* The specific thing that triggered this pulse + +Spins the spinner in the gauge to show output. If **name** is included then +it will be combined with the last name passed to `gauge.show` using the +subsection property of the theme (typically a right facing arrow). + +### `gauge.disable()` + +Hides the gauge and ignores further calls to `show` or `pulse`. + +### `gauge.enable()` + +Shows the gauge and resumes updating when `show` or `pulse` is called. + +### `gauge.setTheme(theme)` + +Change the active theme, will be displayed with the next show or pulse + +### `gauge.setTemplate(template)` + +Change the active template, will be displayed with the next show or pulse + +### Theme Objects + +There are two theme objects available as a part of the module, `Gauge.unicode` and `Gauge.ascii`. +Theme objects have the follow properties: + +| Property | Unicode | ASCII | +| ---------- | ------- | ----- | +| startgroup | ╢ | \| | +| endgroup | ╟ | \| | +| complete | █ | # | +| incomplete | ░ | - | +| spinner | ▀▐▄▌ | -\\\|/ | +| subsection | → | -> | + +*startgroup*, *endgroup* and *subsection* can be as many characters as you want. + +*complete* and *incomplete* should be a single character width each. + +*spinner* is a list of characters to use in turn when displaying an activity +spinner. The Gauge will spin as many characters as you give here. + +### Template Objects + +A template is an array of objects and strings that, after being evaluated, +will be turned into the gauge line. The default template is: + +```javascript +[ + {type: "name", separated: true, maxLength: 25, minLength: 25, align: "left"}, + {type: "spinner", separated: true}, + {type: "startgroup"}, + {type: "completionbar"}, + {type: "endgroup"} +] +``` + +The various template elements can either be **plain strings**, in which case they will +be be included verbatum in the output. + +If the template element is an object, it can have the following keys: + +* *type* can be: + * `name` – The most recent name passed to `show`; if this is in response to a + `pulse` then the name passed to `pulse` will be appended along with the + subsection property from the theme. + * `spinner` – If you've ever called `pulse` this will be one of the characters + from the spinner property of the theme. + * `startgroup` – The `startgroup` property from the theme. + * `completionbar` – This progress bar itself + * `endgroup` – The `endgroup` property from the theme. +* *separated* – If true, the element will be separated with spaces from things on + either side (and margins count as space, so it won't be indented), but only + if its included. +* *maxLength* – The maximum length for this element. If its value is longer it + will be truncated. +* *minLength* – The minimum length for this element. If its value is shorter it + will be padded according to the *align* value. +* *align* – (Default: left) Possible values "left", "right" and "center". Works + as you'd expect from word processors. +* *length* – Provides a single value for both *minLength* and *maxLength*. If both + *length* and *minLength or *maxLength* are specifed then the latter take precedence. + +### Tracking Completion + +If you have more than one thing going on that you want to track completion +of, you may find the related [are-we-there-yet] helpful. It's `change` +event can be wired up to the `show` method to get a more traditional +progress bar interface. + +[are-we-there-yet]: https://www.npmjs.com/package/are-we-there-yet diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/example.png b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/example.png Binary files differnew file mode 100644 index 0000000000..2667cac459 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/example.png diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/LICENSE new file mode 100644 index 0000000000..b054ca5a3a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2016 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/README.md new file mode 100644 index 0000000000..89c8deeafb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/README.md @@ -0,0 +1,18 @@ +# lodash.pad v3.2.0 + +The [lodash](https://lodash.com/) method `_.pad` exported as a [Node.js](https://nodejs.org/) module. + +## Installation + +Using npm: +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.pad +``` + +In Node.js: +```js +var pad = require('lodash.pad'); +``` + +See the [documentation](https://lodash.com/docs#pad) or [package source](https://github.com/lodash/lodash/blob/3.2.0-npm-packages/lodash.pad) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/index.js new file mode 100644 index 0000000000..4a32b912cb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/index.js @@ -0,0 +1,385 @@ +/** + * lodash 3.2.0 (Custom Build) <https://lodash.com/> + * Build: `lodash modularize exports="npm" -o ./` + * Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2016 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ +var repeat = require('lodash.repeat'); + +/** Used as references for various `Number` constants. */ +var INFINITY = 1 / 0, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + +/** `Object#toString` result references. */ +var funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Used to compose unicode character classes. */ +var rsAstralRange = '\\ud800-\\udfff', + rsComboRange = '\\u0300-\\u036f\\ufe20-\\ufe23', + rsVarRange = '\\ufe0e\\ufe0f'; + +/** Used to compose unicode capture groups. */ +var rsAstral = '[' + rsAstralRange + ']', + rsCombo = '[' + rsComboRange + ']', + rsModifier = '(?:\\ud83c[\\udffb-\\udfff])', + rsNonAstral = '[^' + rsAstralRange + ']', + rsRegional = '(?:\\ud83c[\\udde6-\\uddff]){2}', + rsSurrPair = '[\\ud800-\\udbff][\\udc00-\\udfff]', + rsZWJ = '\\u200d'; + +/** Used to compose unicode regexes. */ +var reOptMod = rsModifier + '?', + rsOptVar = '[' + rsVarRange + ']?', + rsOptJoin = '(?:' + rsZWJ + '(?:' + [rsNonAstral, rsRegional, rsSurrPair].join('|') + ')' + rsOptVar + reOptMod + ')*', + rsSeq = rsOptVar + reOptMod + rsOptJoin, + rsSymbol = '(?:' + [rsNonAstral + rsCombo + '?', rsCombo, rsRegional, rsSurrPair, rsAstral].join('|') + ')'; + +/** Used to match [string symbols](https://mathiasbynens.be/notes/javascript-unicode). */ +var reComplexSymbol = RegExp(rsSymbol + rsSeq, 'g'); + +/** Used to detect strings with [zero-width joiners or code points from the astral planes](http://eev.ee/blog/2015/09/12/dark-corners-of-unicode/). */ +var reHasComplexSymbol = RegExp('[' + rsZWJ + rsAstralRange + rsComboRange + rsVarRange + ']'); + +/** Built-in method references without a dependency on `global`. */ +var freeParseInt = parseInt; + +/** + * Gets the number of symbols in `string`. + * + * @param {string} string The string to inspect. + * @returns {number} Returns the string size. + */ +function stringSize(string) { + if (!(string && reHasComplexSymbol.test(string))) { + return string.length; + } + var result = reComplexSymbol.lastIndex = 0; + while (reComplexSymbol.test(string)) { + result++; + } + return result; +} + +/** + * Converts `string` to an array. + * + * @private + * @param {string} string The string to convert. + * @returns {Array} Returns the converted array. + */ +function stringToArray(string) { + return string.match(reComplexSymbol); +} + +/** Used for built-in method references. */ +var objectProto = global.Object.prototype; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Built-in value references. */ +var _Symbol = global.Symbol; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeCeil = Math.ceil, + nativeFloor = Math.floor; + +/** Used to convert symbols to primitives and strings. */ +var symbolProto = _Symbol ? _Symbol.prototype : undefined, + symbolToString = _Symbol ? symbolProto.toString : undefined; + +/** + * Creates the padding for `string` based on `length`. The `chars` string + * is truncated if the number of characters exceeds `length`. + * + * @private + * @param {string} string The string to create padding for. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padding for `string`. + */ +function createPadding(string, length, chars) { + length = toInteger(length); + + var strLength = stringSize(string); + if (!length || strLength >= length) { + return ''; + } + var padLength = length - strLength; + chars = chars === undefined ? ' ' : (chars + ''); + + var result = repeat(chars, nativeCeil(padLength / stringSize(chars))); + return reHasComplexSymbol.test(chars) + ? stringToArray(result).slice(0, padLength).join('') + : result.slice(0, padLength); +} + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array constructors, and + // PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to an integer. + * + * **Note:** This function is loosely based on [`ToInteger`](http://www.ecma-international.org/ecma-262/6.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3'); + * // => 3 + */ +function toInteger(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + var remainder = value % 1; + return value === value ? (remainder ? value - remainder : value) : 0; +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3); + * // => 3 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3'); + * // => 3 + */ +function toNumber(value) { + if (isObject(value)) { + var other = isFunction(value.valueOf) ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {string} Returns the string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ +function toString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (value == null) { + return ''; + } + if (isSymbol(value)) { + return _Symbol ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; +} + +/** + * Pads `string` on the left and right sides if it's shorter than `length`. + * Padding characters are truncated if they can't be evenly divided by `length`. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ +function pad(string, length, chars) { + string = toString(string); + length = toInteger(length); + + var strLength = stringSize(string); + if (!length || strLength >= length) { + return string; + } + var mid = (length - strLength) / 2, + leftLength = nativeFloor(mid), + rightLength = nativeCeil(mid); + + return createPadding('', leftLength, chars) + string + createPadding('', rightLength, chars); +} + +module.exports = pad; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/LICENSE new file mode 100644 index 0000000000..b054ca5a3a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2016 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/README.md new file mode 100644 index 0000000000..a911d99092 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/README.md @@ -0,0 +1,18 @@ +# lodash.repeat v3.1.0 + +The [lodash](https://lodash.com/) method `_.repeat` exported as a [Node.js](https://nodejs.org/) module. + +## Installation + +Using npm: +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.repeat +``` + +In Node.js: +```js +var repeat = require('lodash.repeat'); +``` + +See the [documentation](https://lodash.com/docs#repeat) or [package source](https://github.com/lodash/lodash/blob/3.1.0-npm-packages/lodash.repeat) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/index.js new file mode 100644 index 0000000000..85a5a90b3b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/index.js @@ -0,0 +1,307 @@ +/** + * lodash 3.1.0 (Custom Build) <https://lodash.com/> + * Build: `lodash modularize exports="npm" -o ./` + * Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2016 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ + +/** Used as references for various `Number` constants. */ +var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + +/** `Object#toString` result references. */ +var funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `global`. */ +var freeParseInt = parseInt; + +/** Used for built-in method references. */ +var objectProto = global.Object.prototype; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Built-in value references. */ +var _Symbol = global.Symbol; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeFloor = Math.floor; + +/** Used to convert symbols to primitives and strings. */ +var symbolProto = _Symbol ? _Symbol.prototype : undefined, + symbolToString = _Symbol ? symbolProto.toString : undefined; + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array constructors, and + // PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to an integer. + * + * **Note:** This function is loosely based on [`ToInteger`](http://www.ecma-international.org/ecma-262/6.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3'); + * // => 3 + */ +function toInteger(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + var remainder = value % 1; + return value === value ? (remainder ? value - remainder : value) : 0; +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3); + * // => 3 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3'); + * // => 3 + */ +function toNumber(value) { + if (isObject(value)) { + var other = isFunction(value.valueOf) ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {string} Returns the string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ +function toString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (value == null) { + return ''; + } + if (isSymbol(value)) { + return _Symbol ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; +} + +/** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=0] The number of times to repeat the string. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ +function repeat(string, n) { + string = toString(string); + n = toInteger(n); + + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + string += string; + } while (n); + + return result; +} + +module.exports = repeat; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/package.json new file mode 100644 index 0000000000..e47ce40925 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/node_modules/lodash.repeat/package.json @@ -0,0 +1,104 @@ +{ + "_args": [ + [ + "lodash.repeat@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad" + ] + ], + "_from": "lodash.repeat@>=3.0.0 <4.0.0", + "_id": "lodash.repeat@3.1.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/gauge/lodash.pad/lodash.repeat", + "_nodeVersion": "5.4.0", + "_npmUser": { + "email": "john.david.dalton@gmail.com", + "name": "jdalton" + }, + "_npmVersion": "2.14.15", + "_phantomChildren": {}, + "_requested": { + "name": "lodash.repeat", + "raw": "lodash.repeat@^3.0.0", + "rawSpec": "^3.0.0", + "scope": null, + "spec": ">=3.0.0 <4.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/gauge/lodash.pad" + ], + "_resolved": "https://registry.npmjs.org/lodash.repeat/-/lodash.repeat-3.1.0.tgz", + "_shasum": "a7bfe799b07c9a75dc010b65c61c1cfed3e18a96", + "_shrinkwrap": null, + "_spec": "lodash.repeat@^3.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad", + "author": { + "email": "john.david.dalton@gmail.com", + "name": "John-David Dalton", + "url": "http://allyoucanleet.com/" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "https://github.com/phated" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "dependencies": {}, + "description": "The lodash method `_.repeat` exported as a module.", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "a7bfe799b07c9a75dc010b65c61c1cfed3e18a96", + "tarball": "http://registry.npmjs.org/lodash.repeat/-/lodash.repeat-3.1.0.tgz" + }, + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "keywords": [ + "lodash", + "lodash-modularized", + "repeat", + "stdlib", + "util" + ], + "license": "MIT", + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "name": "lodash.repeat", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "version": "3.1.0" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/package.json new file mode 100644 index 0000000000..6c81f2aa4a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + "lodash.pad@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge" + ] + ], + "_from": "lodash.pad@>=3.0.0 <4.0.0", + "_id": "lodash.pad@3.2.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/gauge/lodash.pad", + "_nodeVersion": "5.4.0", + "_npmUser": { + "email": "john.david.dalton@gmail.com", + "name": "jdalton" + }, + "_npmVersion": "2.14.15", + "_phantomChildren": {}, + "_requested": { + "name": "lodash.pad", + "raw": "lodash.pad@^3.0.0", + "rawSpec": "^3.0.0", + "scope": null, + "spec": ">=3.0.0 <4.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/gauge" + ], + "_resolved": "https://registry.npmjs.org/lodash.pad/-/lodash.pad-3.2.0.tgz", + "_shasum": "d1d882526da12087ef8c6089173ec081717698a2", + "_shrinkwrap": null, + "_spec": "lodash.pad@^3.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge", + "author": { + "email": "john.david.dalton@gmail.com", + "name": "John-David Dalton", + "url": "http://allyoucanleet.com/" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "https://github.com/phated" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "dependencies": { + "lodash.repeat": "^3.0.0" + }, + "description": "The lodash method `_.pad` exported as a module.", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "d1d882526da12087ef8c6089173ec081717698a2", + "tarball": "http://registry.npmjs.org/lodash.pad/-/lodash.pad-3.2.0.tgz" + }, + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "keywords": [ + "lodash", + "lodash-modularized", + "pad", + "stdlib", + "util" + ], + "license": "MIT", + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "name": "lodash.pad", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "version": "3.2.0" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/LICENSE.txt b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/LICENSE.txt new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/LICENSE.txt @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/README.md new file mode 100644 index 0000000000..641b4d6f00 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/README.md @@ -0,0 +1,20 @@ +# lodash.padleft v3.1.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) `_.padLeft` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.padleft +``` + +In Node.js/io.js: + +```js +var padLeft = require('lodash.padleft'); +``` + +See the [documentation](https://lodash.com/docs#padLeft) or [package source](https://github.com/lodash/lodash/blob/3.1.1-npm-packages/lodash.padleft) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/index.js new file mode 100644 index 0000000000..2abb69a6c0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/index.js @@ -0,0 +1,50 @@ +/** + * lodash 3.1.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ +var baseToString = require('lodash._basetostring'), + createPadding = require('lodash._createpadding'); + +/** + * Creates a function for `_.padLeft` or `_.padRight`. + * + * @private + * @param {boolean} [fromRight] Specify padding from the right. + * @returns {Function} Returns the new pad function. + */ +function createPadDir(fromRight) { + return function(string, length, chars) { + string = baseToString(string); + return (fromRight ? string : '') + createPadding(string, length, chars) + (fromRight ? '' : string); + }; +} + +/** + * Pads `string` on the left side if it is shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padLeft('abc', 6); + * // => ' abc' + * + * _.padLeft('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padLeft('abc', 3); + * // => 'abc' + */ +var padLeft = createPadDir(); + +module.exports = padLeft; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/LICENSE new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/README.md new file mode 100644 index 0000000000..f81145e6eb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/README.md @@ -0,0 +1,20 @@ +# lodash._basetostring v3.0.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) internal `baseToString` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash._basetostring +``` + +In Node.js/io.js: + +```js +var baseToString = require('lodash._basetostring'); +``` + +See the [package source](https://github.com/lodash/lodash/blob/3.0.1-npm-packages/lodash._basetostring) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/index.js new file mode 100644 index 0000000000..db8ecc9fdd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/index.js @@ -0,0 +1,22 @@ +/** + * lodash 3.0.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` or `undefined` values. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ +function baseToString(value) { + return value == null ? '' : (value + ''); +} + +module.exports = baseToString; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/package.json new file mode 100644 index 0000000000..f592f32e19 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._basetostring/package.json @@ -0,0 +1,88 @@ +{ + "name": "lodash._basetostring", + "version": "3.0.1", + "description": "The modern build of lodash’s internal `baseToString` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash._basetostring@3.0.1", + "_shasum": "d1861d877f824a52f669832dcaf3ee15566a07d5", + "_from": "lodash._basetostring@>=3.0.0 <4.0.0", + "_npmVersion": "2.12.0", + "_nodeVersion": "0.12.5", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "d1861d877f824a52f669832dcaf3ee15566a07d5", + "tarball": "http://registry.npmjs.org/lodash._basetostring/-/lodash._basetostring-3.0.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash._basetostring/-/lodash._basetostring-3.0.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/LICENSE new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/README.md new file mode 100644 index 0000000000..f9c9411c70 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/README.md @@ -0,0 +1,20 @@ +# lodash._createpadding v3.6.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) internal `createPadding` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash._createpadding +``` + +In Node.js/io.js: + +```js +var createPadding = require('lodash._createpadding'); +``` + +See the [package source](https://github.com/lodash/lodash/blob/3.6.1-npm-packages/lodash._createpadding) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/index.js new file mode 100644 index 0000000000..3541a8aae3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/index.js @@ -0,0 +1,37 @@ +/** + * lodash 3.6.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ +var repeat = require('lodash.repeat'); + +/* Native method references for those with the same name as other `lodash` methods. */ +var nativeCeil = Math.ceil, + nativeIsFinite = global.isFinite; + +/** + * Creates the padding required for `string` based on the given `length`. + * The `chars` string is truncated if the number of characters exceeds `length`. + * + * @private + * @param {string} string The string to create padding for. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the pad for `string`. + */ +function createPadding(string, length, chars) { + var strLength = string.length; + length = +length; + + if (strLength >= length || !nativeIsFinite(length)) { + return ''; + } + var padLength = length - strLength; + chars = chars == null ? ' ' : (chars + ''); + return repeat(chars, nativeCeil(padLength / chars.length)).slice(0, padLength); +} + +module.exports = createPadding; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE new file mode 100644 index 0000000000..b054ca5a3a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2016 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md new file mode 100644 index 0000000000..a911d99092 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md @@ -0,0 +1,18 @@ +# lodash.repeat v3.1.0 + +The [lodash](https://lodash.com/) method `_.repeat` exported as a [Node.js](https://nodejs.org/) module. + +## Installation + +Using npm: +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.repeat +``` + +In Node.js: +```js +var repeat = require('lodash.repeat'); +``` + +See the [documentation](https://lodash.com/docs#repeat) or [package source](https://github.com/lodash/lodash/blob/3.1.0-npm-packages/lodash.repeat) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js new file mode 100644 index 0000000000..85a5a90b3b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js @@ -0,0 +1,307 @@ +/** + * lodash 3.1.0 (Custom Build) <https://lodash.com/> + * Build: `lodash modularize exports="npm" -o ./` + * Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2016 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ + +/** Used as references for various `Number` constants. */ +var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + +/** `Object#toString` result references. */ +var funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `global`. */ +var freeParseInt = parseInt; + +/** Used for built-in method references. */ +var objectProto = global.Object.prototype; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Built-in value references. */ +var _Symbol = global.Symbol; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeFloor = Math.floor; + +/** Used to convert symbols to primitives and strings. */ +var symbolProto = _Symbol ? _Symbol.prototype : undefined, + symbolToString = _Symbol ? symbolProto.toString : undefined; + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array constructors, and + // PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to an integer. + * + * **Note:** This function is loosely based on [`ToInteger`](http://www.ecma-international.org/ecma-262/6.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3'); + * // => 3 + */ +function toInteger(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + var remainder = value % 1; + return value === value ? (remainder ? value - remainder : value) : 0; +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3); + * // => 3 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3'); + * // => 3 + */ +function toNumber(value) { + if (isObject(value)) { + var other = isFunction(value.valueOf) ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {string} Returns the string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ +function toString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (value == null) { + return ''; + } + if (isSymbol(value)) { + return _Symbol ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; +} + +/** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=0] The number of times to repeat the string. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ +function repeat(string, n) { + string = toString(string); + n = toInteger(n); + + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + string += string; + } while (n); + + return result; +} + +module.exports = repeat; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json new file mode 100644 index 0000000000..fce6e4d3ac --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + "lodash.repeat@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad" + ], + [ + "lodash.repeat@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding" + ] + ], + "_from": "lodash.repeat@>=3.0.0 <4.0.0", + "_id": "lodash.repeat@3.1.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/gauge/lodash.padleft/lodash._createpadding/lodash.repeat", + "_nodeVersion": "5.4.0", + "_npmUser": { + "email": "john.david.dalton@gmail.com", + "name": "jdalton" + }, + "_npmVersion": "2.14.15", + "_phantomChildren": {}, + "_requested": { + "name": "lodash.repeat", + "raw": "lodash.repeat@^3.0.0", + "rawSpec": "^3.0.0", + "scope": null, + "spec": ">=3.0.0 <4.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/gauge/lodash.padleft/lodash._createpadding" + ], + "_shrinkwrap": null, + "_spec": "lodash.repeat@^3.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding", + "author": { + "email": "john.david.dalton@gmail.com", + "name": "John-David Dalton", + "url": "http://allyoucanleet.com/" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "https://github.com/phated" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "dependencies": {}, + "description": "The lodash method `_.repeat` exported as a module.", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "a7bfe799b07c9a75dc010b65c61c1cfed3e18a96", + "tarball": "http://registry.npmjs.org/lodash.repeat/-/lodash.repeat-3.1.0.tgz" + }, + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "keywords": [ + "lodash", + "lodash-modularized", + "repeat", + "stdlib", + "util" + ], + "license": "MIT", + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "name": "lodash.repeat", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "version": "3.1.0" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/package.json new file mode 100644 index 0000000000..376b174bee --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/node_modules/lodash._createpadding/package.json @@ -0,0 +1,91 @@ +{ + "name": "lodash._createpadding", + "version": "3.6.1", + "description": "The modern build of lodash’s internal `createPadding` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "dependencies": { + "lodash.repeat": "^3.0.0" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash._createpadding@3.6.1", + "_shasum": "4907b438595adc54ee8935527a6c424c02c81a87", + "_from": "lodash._createpadding@>=3.0.0 <4.0.0", + "_npmVersion": "2.12.0", + "_nodeVersion": "0.12.5", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "4907b438595adc54ee8935527a6c424c02c81a87", + "tarball": "http://registry.npmjs.org/lodash._createpadding/-/lodash._createpadding-3.6.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash._createpadding/-/lodash._createpadding-3.6.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/package.json new file mode 100644 index 0000000000..55b0c256f9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padleft/package.json @@ -0,0 +1,98 @@ +{ + "name": "lodash.padleft", + "version": "3.1.1", + "description": "The modern build of lodash’s `_.padLeft` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "keywords": [ + "lodash", + "lodash-modularized", + "stdlib", + "util" + ], + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "dependencies": { + "lodash._basetostring": "^3.0.0", + "lodash._createpadding": "^3.0.0" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash.padleft@3.1.1", + "_shasum": "150151f1e0245edba15d50af2d71f1d5cff46530", + "_from": "lodash.padleft@>=3.0.0 <4.0.0", + "_npmVersion": "2.9.0", + "_nodeVersion": "0.12.2", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "150151f1e0245edba15d50af2d71f1d5cff46530", + "tarball": "http://registry.npmjs.org/lodash.padleft/-/lodash.padleft-3.1.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash.padleft/-/lodash.padleft-3.1.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/LICENSE.txt b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/LICENSE.txt new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/LICENSE.txt @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/README.md new file mode 100644 index 0000000000..bcd6e5742f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/README.md @@ -0,0 +1,20 @@ +# lodash.padright v3.1.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) `_.padRight` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.padright +``` + +In Node.js/io.js: + +```js +var padRight = require('lodash.padright'); +``` + +See the [documentation](https://lodash.com/docs#padRight) or [package source](https://github.com/lodash/lodash/blob/3.1.1-npm-packages/lodash.padright) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/index.js new file mode 100644 index 0000000000..6de81c4bbe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/index.js @@ -0,0 +1,50 @@ +/** + * lodash 3.1.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ +var baseToString = require('lodash._basetostring'), + createPadding = require('lodash._createpadding'); + +/** + * Creates a function for `_.padLeft` or `_.padRight`. + * + * @private + * @param {boolean} [fromRight] Specify padding from the right. + * @returns {Function} Returns the new pad function. + */ +function createPadDir(fromRight) { + return function(string, length, chars) { + string = baseToString(string); + return (fromRight ? string : '') + createPadding(string, length, chars) + (fromRight ? '' : string); + }; +} + +/** + * Pads `string` on the right side if it is shorter than `length`. Padding + * characters are truncated if they exceed `length`. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padRight('abc', 6); + * // => 'abc ' + * + * _.padRight('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padRight('abc', 3); + * // => 'abc' + */ +var padRight = createPadDir(true); + +module.exports = padRight; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/LICENSE new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/README.md new file mode 100644 index 0000000000..f81145e6eb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/README.md @@ -0,0 +1,20 @@ +# lodash._basetostring v3.0.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) internal `baseToString` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash._basetostring +``` + +In Node.js/io.js: + +```js +var baseToString = require('lodash._basetostring'); +``` + +See the [package source](https://github.com/lodash/lodash/blob/3.0.1-npm-packages/lodash._basetostring) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/index.js new file mode 100644 index 0000000000..db8ecc9fdd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/index.js @@ -0,0 +1,22 @@ +/** + * lodash 3.0.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` or `undefined` values. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ +function baseToString(value) { + return value == null ? '' : (value + ''); +} + +module.exports = baseToString; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/package.json new file mode 100644 index 0000000000..f592f32e19 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._basetostring/package.json @@ -0,0 +1,88 @@ +{ + "name": "lodash._basetostring", + "version": "3.0.1", + "description": "The modern build of lodash’s internal `baseToString` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash._basetostring@3.0.1", + "_shasum": "d1861d877f824a52f669832dcaf3ee15566a07d5", + "_from": "lodash._basetostring@>=3.0.0 <4.0.0", + "_npmVersion": "2.12.0", + "_nodeVersion": "0.12.5", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "d1861d877f824a52f669832dcaf3ee15566a07d5", + "tarball": "http://registry.npmjs.org/lodash._basetostring/-/lodash._basetostring-3.0.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash._basetostring/-/lodash._basetostring-3.0.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/LICENSE new file mode 100644 index 0000000000..9cd87e5dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2015 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/README.md new file mode 100644 index 0000000000..f9c9411c70 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/README.md @@ -0,0 +1,20 @@ +# lodash._createpadding v3.6.1 + +The [modern build](https://github.com/lodash/lodash/wiki/Build-Differences) of [lodash’s](https://lodash.com/) internal `createPadding` exported as a [Node.js](http://nodejs.org/)/[io.js](https://iojs.org/) module. + +## Installation + +Using npm: + +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash._createpadding +``` + +In Node.js/io.js: + +```js +var createPadding = require('lodash._createpadding'); +``` + +See the [package source](https://github.com/lodash/lodash/blob/3.6.1-npm-packages/lodash._createpadding) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/index.js new file mode 100644 index 0000000000..3541a8aae3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/index.js @@ -0,0 +1,37 @@ +/** + * lodash 3.6.1 (Custom Build) <https://lodash.com/> + * Build: `lodash modern modularize exports="npm" -o ./` + * Copyright 2012-2015 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ +var repeat = require('lodash.repeat'); + +/* Native method references for those with the same name as other `lodash` methods. */ +var nativeCeil = Math.ceil, + nativeIsFinite = global.isFinite; + +/** + * Creates the padding required for `string` based on the given `length`. + * The `chars` string is truncated if the number of characters exceeds `length`. + * + * @private + * @param {string} string The string to create padding for. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the pad for `string`. + */ +function createPadding(string, length, chars) { + var strLength = string.length; + length = +length; + + if (strLength >= length || !nativeIsFinite(length)) { + return ''; + } + var padLength = length - strLength; + chars = chars == null ? ' ' : (chars + ''); + return repeat(chars, nativeCeil(padLength / chars.length)).slice(0, padLength); +} + +module.exports = createPadding; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE new file mode 100644 index 0000000000..b054ca5a3a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/LICENSE @@ -0,0 +1,22 @@ +Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> +Based on Underscore.js, copyright 2009-2016 Jeremy Ashkenas, +DocumentCloud and Investigative Reporters & Editors <http://underscorejs.org/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md new file mode 100644 index 0000000000..a911d99092 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/README.md @@ -0,0 +1,18 @@ +# lodash.repeat v3.1.0 + +The [lodash](https://lodash.com/) method `_.repeat` exported as a [Node.js](https://nodejs.org/) module. + +## Installation + +Using npm: +```bash +$ {sudo -H} npm i -g npm +$ npm i --save lodash.repeat +``` + +In Node.js: +```js +var repeat = require('lodash.repeat'); +``` + +See the [documentation](https://lodash.com/docs#repeat) or [package source](https://github.com/lodash/lodash/blob/3.1.0-npm-packages/lodash.repeat) for more details. diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js new file mode 100644 index 0000000000..85a5a90b3b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/index.js @@ -0,0 +1,307 @@ +/** + * lodash 3.1.0 (Custom Build) <https://lodash.com/> + * Build: `lodash modularize exports="npm" -o ./` + * Copyright 2012-2016 The Dojo Foundation <http://dojofoundation.org/> + * Based on Underscore.js 1.8.3 <http://underscorejs.org/LICENSE> + * Copyright 2009-2016 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license <https://lodash.com/license> + */ + +/** Used as references for various `Number` constants. */ +var INFINITY = 1 / 0, + MAX_SAFE_INTEGER = 9007199254740991, + MAX_INTEGER = 1.7976931348623157e+308, + NAN = 0 / 0; + +/** `Object#toString` result references. */ +var funcTag = '[object Function]', + genTag = '[object GeneratorFunction]', + symbolTag = '[object Symbol]'; + +/** Used to match leading and trailing whitespace. */ +var reTrim = /^\s+|\s+$/g; + +/** Used to detect bad signed hexadecimal string values. */ +var reIsBadHex = /^[-+]0x[0-9a-f]+$/i; + +/** Used to detect binary string values. */ +var reIsBinary = /^0b[01]+$/i; + +/** Used to detect octal string values. */ +var reIsOctal = /^0o[0-7]+$/i; + +/** Built-in method references without a dependency on `global`. */ +var freeParseInt = parseInt; + +/** Used for built-in method references. */ +var objectProto = global.Object.prototype; + +/** + * Used to resolve the [`toStringTag`](http://ecma-international.org/ecma-262/6.0/#sec-object.prototype.tostring) + * of values. + */ +var objectToString = objectProto.toString; + +/** Built-in value references. */ +var _Symbol = global.Symbol; + +/* Built-in method references for those with the same name as other `lodash` methods. */ +var nativeFloor = Math.floor; + +/** Used to convert symbols to primitives and strings. */ +var symbolProto = _Symbol ? _Symbol.prototype : undefined, + symbolToString = _Symbol ? symbolProto.toString : undefined; + +/** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ +function isFunction(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in Safari 8 which returns 'object' for typed array constructors, and + // PhantomJS 1.9 which returns 'function' for `NodeList` instances. + var tag = isObject(value) ? objectToString.call(value) : ''; + return tag == funcTag || tag == genTag; +} + +/** + * Checks if `value` is the [language type](https://es5.github.io/#x8) of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(_.noop); + * // => true + * + * _.isObject(null); + * // => false + */ +function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return !!value && (type == 'object' || type == 'function'); +} + +/** + * Checks if `value` is object-like. A value is object-like if it's not `null` + * and has a `typeof` result of "object". + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + * @example + * + * _.isObjectLike({}); + * // => true + * + * _.isObjectLike([1, 2, 3]); + * // => true + * + * _.isObjectLike(_.noop); + * // => false + * + * _.isObjectLike(null); + * // => false + */ +function isObjectLike(value) { + return !!value && typeof value == 'object'; +} + +/** + * Checks if `value` is classified as a `Symbol` primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isSymbol(Symbol.iterator); + * // => true + * + * _.isSymbol('abc'); + * // => false + */ +function isSymbol(value) { + return typeof value == 'symbol' || + (isObjectLike(value) && objectToString.call(value) == symbolTag); +} + +/** + * Converts `value` to an integer. + * + * **Note:** This function is loosely based on [`ToInteger`](http://www.ecma-international.org/ecma-262/6.0/#sec-tointeger). + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {number} Returns the converted integer. + * @example + * + * _.toInteger(3); + * // => 3 + * + * _.toInteger(Number.MIN_VALUE); + * // => 0 + * + * _.toInteger(Infinity); + * // => 1.7976931348623157e+308 + * + * _.toInteger('3'); + * // => 3 + */ +function toInteger(value) { + if (!value) { + return value === 0 ? value : 0; + } + value = toNumber(value); + if (value === INFINITY || value === -INFINITY) { + var sign = (value < 0 ? -1 : 1); + return sign * MAX_INTEGER; + } + var remainder = value % 1; + return value === value ? (remainder ? value - remainder : value) : 0; +} + +/** + * Converts `value` to a number. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {number} Returns the number. + * @example + * + * _.toNumber(3); + * // => 3 + * + * _.toNumber(Number.MIN_VALUE); + * // => 5e-324 + * + * _.toNumber(Infinity); + * // => Infinity + * + * _.toNumber('3'); + * // => 3 + */ +function toNumber(value) { + if (isObject(value)) { + var other = isFunction(value.valueOf) ? value.valueOf() : value; + value = isObject(other) ? (other + '') : other; + } + if (typeof value != 'string') { + return value === 0 ? value : +value; + } + value = value.replace(reTrim, ''); + var isBinary = reIsBinary.test(value); + return (isBinary || reIsOctal.test(value)) + ? freeParseInt(value.slice(2), isBinary ? 2 : 8) + : (reIsBadHex.test(value) ? NAN : +value); +} + +/** + * Converts `value` to a string if it's not one. An empty string is returned + * for `null` and `undefined` values. The sign of `-0` is preserved. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to process. + * @returns {string} Returns the string. + * @example + * + * _.toString(null); + * // => '' + * + * _.toString(-0); + * // => '-0' + * + * _.toString([1, 2, 3]); + * // => '1,2,3' + */ +function toString(value) { + // Exit early for strings to avoid a performance hit in some environments. + if (typeof value == 'string') { + return value; + } + if (value == null) { + return ''; + } + if (isSymbol(value)) { + return _Symbol ? symbolToString.call(value) : ''; + } + var result = (value + ''); + return (result == '0' && (1 / value) == -INFINITY) ? '-0' : result; +} + +/** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=0] The number of times to repeat the string. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ +function repeat(string, n) { + string = toString(string); + n = toInteger(n); + + var result = ''; + if (!string || n < 1 || n > MAX_SAFE_INTEGER) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = nativeFloor(n / 2); + string += string; + } while (n); + + return result; +} + +module.exports = repeat; diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json new file mode 100644 index 0000000000..b4df1e6939 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/node_modules/lodash.repeat/package.json @@ -0,0 +1,106 @@ +{ + "_args": [ + [ + "lodash.repeat@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.pad" + ], + [ + "lodash.repeat@^3.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding" + ] + ], + "_from": "lodash.repeat@>=3.0.0 <4.0.0", + "_id": "lodash.repeat@3.1.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/gauge/lodash.padright/lodash._createpadding/lodash.repeat", + "_nodeVersion": "5.4.0", + "_npmUser": { + "email": "john.david.dalton@gmail.com", + "name": "jdalton" + }, + "_npmVersion": "2.14.15", + "_phantomChildren": {}, + "_requested": { + "name": "lodash.repeat", + "raw": "lodash.repeat@^3.0.0", + "rawSpec": "^3.0.0", + "scope": null, + "spec": ">=3.0.0 <4.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog/gauge/lodash.padright/lodash._createpadding" + ], + "_shrinkwrap": null, + "_spec": "lodash.repeat@^3.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding", + "author": { + "email": "john.david.dalton@gmail.com", + "name": "John-David Dalton", + "url": "http://allyoucanleet.com/" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "https://github.com/phated" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "dependencies": {}, + "description": "The lodash method `_.repeat` exported as a module.", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "a7bfe799b07c9a75dc010b65c61c1cfed3e18a96", + "tarball": "http://registry.npmjs.org/lodash.repeat/-/lodash.repeat-3.1.0.tgz" + }, + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "keywords": [ + "lodash", + "lodash-modularized", + "repeat", + "stdlib", + "util" + ], + "license": "MIT", + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "name": "lodash.repeat", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "version": "3.1.0" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/package.json new file mode 100644 index 0000000000..376b174bee --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/node_modules/lodash._createpadding/package.json @@ -0,0 +1,91 @@ +{ + "name": "lodash._createpadding", + "version": "3.6.1", + "description": "The modern build of lodash’s internal `createPadding` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "dependencies": { + "lodash.repeat": "^3.0.0" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash._createpadding@3.6.1", + "_shasum": "4907b438595adc54ee8935527a6c424c02c81a87", + "_from": "lodash._createpadding@>=3.0.0 <4.0.0", + "_npmVersion": "2.12.0", + "_nodeVersion": "0.12.5", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "4907b438595adc54ee8935527a6c424c02c81a87", + "tarball": "http://registry.npmjs.org/lodash._createpadding/-/lodash._createpadding-3.6.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash._createpadding/-/lodash._createpadding-3.6.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/package.json new file mode 100644 index 0000000000..2a40f94bfc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/node_modules/lodash.padright/package.json @@ -0,0 +1,98 @@ +{ + "name": "lodash.padright", + "version": "3.1.1", + "description": "The modern build of lodash’s `_.padRight` as a module.", + "homepage": "https://lodash.com/", + "icon": "https://lodash.com/icon.svg", + "license": "MIT", + "keywords": [ + "lodash", + "lodash-modularized", + "stdlib", + "util" + ], + "author": { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + "contributors": [ + { + "name": "John-David Dalton", + "email": "john.david.dalton@gmail.com", + "url": "http://allyoucanleet.com/" + }, + { + "name": "Benjamin Tan", + "email": "demoneaux@gmail.com", + "url": "https://d10.github.io/" + }, + { + "name": "Blaine Bublitz", + "email": "blaine@iceddev.com", + "url": "http://www.iceddev.com/" + }, + { + "name": "Kit Cambridge", + "email": "github@kitcambridge.be", + "url": "http://kitcambridge.be/" + }, + { + "name": "Mathias Bynens", + "email": "mathias@qiwi.be", + "url": "https://mathiasbynens.be/" + } + ], + "repository": { + "type": "git", + "url": "git+https://github.com/lodash/lodash.git" + }, + "scripts": { + "test": "echo \"See https://travis-ci.org/lodash/lodash-cli for testing details.\"" + }, + "dependencies": { + "lodash._basetostring": "^3.0.0", + "lodash._createpadding": "^3.0.0" + }, + "bugs": { + "url": "https://github.com/lodash/lodash/issues" + }, + "_id": "lodash.padright@3.1.1", + "_shasum": "79f7770baaa39738c040aeb5465e8d88f2aacec0", + "_from": "lodash.padright@>=3.0.0 <4.0.0", + "_npmVersion": "2.9.0", + "_nodeVersion": "0.12.2", + "_npmUser": { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + "maintainers": [ + { + "name": "jdalton", + "email": "john.david.dalton@gmail.com" + }, + { + "name": "d10", + "email": "demoneaux@gmail.com" + }, + { + "name": "kitcambridge", + "email": "github@kitcambridge.be" + }, + { + "name": "mathias", + "email": "mathias@qiwi.be" + }, + { + "name": "phated", + "email": "blaine@iceddev.com" + } + ], + "dist": { + "shasum": "79f7770baaa39738c040aeb5465e8d88f2aacec0", + "tarball": "http://registry.npmjs.org/lodash.padright/-/lodash.padright-3.1.1.tgz" + }, + "directories": {}, + "_resolved": "https://registry.npmjs.org/lodash.padright/-/lodash.padright-3.1.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/package.json new file mode 100644 index 0000000000..fe0af0817f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/package.json @@ -0,0 +1,84 @@ +{ + "_args": [ + [ + "gauge@~1.2.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog" + ] + ], + "_from": "gauge@>=1.2.0 <1.3.0", + "_id": "gauge@1.2.4", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/npmlog/gauge", + "_nodeVersion": "4.2.2", + "_npmUser": { + "email": "me@re-becca.org", + "name": "iarna" + }, + "_npmVersion": "3.5.4", + "_phantomChildren": {}, + "_requested": { + "name": "gauge", + "raw": "gauge@~1.2.0", + "rawSpec": "~1.2.0", + "scope": null, + "spec": ">=1.2.0 <1.3.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/npmlog" + ], + "_shasum": "b1d519758b3c77c7b45021d0ca4841548818bc41", + "_shrinkwrap": null, + "_spec": "gauge@~1.2.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/npmlog", + "author": { + "email": "me@re-becca.org", + "name": "Rebecca Turner" + }, + "bugs": { + "url": "https://github.com/iarna/gauge/issues" + }, + "dependencies": { + "ansi": "^0.3.0", + "has-unicode": "^2.0.0", + "lodash.pad": "^3.0.0", + "lodash.padleft": "^3.0.0", + "lodash.padright": "^3.0.0" + }, + "description": "A terminal based horizontal guage", + "devDependencies": { + "tap": "^0.4.13" + }, + "directories": {}, + "dist": { + "shasum": "b1d519758b3c77c7b45021d0ca4841548818bc41", + "tarball": "http://registry.npmjs.org/gauge/-/gauge-1.2.4.tgz" + }, + "gitHead": "a6af415c7e143fd8dd058c97f5f3ed3dbad872f3", + "homepage": "https://github.com/iarna/gauge", + "keywords": [ + "gauge", + "progress", + "progressbar" + ], + "license": "ISC", + "main": "progress-bar.js", + "maintainers": [ + { + "name": "iarna", + "email": "me@re-becca.org" + } + ], + "name": "gauge", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git+https://github.com/iarna/gauge.git" + }, + "scripts": { + "test": "tap test/*.js" + }, + "version": "1.2.4" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/progress-bar.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/progress-bar.js new file mode 100644 index 0000000000..16bdadc510 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/progress-bar.js @@ -0,0 +1,226 @@ +"use strict" +var hasUnicode = require("has-unicode") +var ansi = require("ansi") +var align = { + center: require("lodash.pad"), + left: require("lodash.padright"), + right: require("lodash.padleft") +} +var defaultStream = process.stderr +function isTTY() { + return process.stderr.isTTY +} +function getWritableTTYColumns() { + // Writing to the final column wraps the line + // We have to use stdout here, because Node's magic SIGWINCH handler only + // updates process.stdout, not process.stderr + return process.stdout.columns - 1 +} + +var ProgressBar = module.exports = function (options, cursor) { + if (! options) options = {} + if (! cursor && options.write) { + cursor = options + options = {} + } + if (! cursor) { + cursor = ansi(defaultStream) + } + this.cursor = cursor + this.showing = false + this.theme = options.theme || (hasUnicode() ? ProgressBar.unicode : ProgressBar.ascii) + this.template = options.template || [ + {type: "name", separated: true, length: 25}, + {type: "spinner", separated: true}, + {type: "startgroup"}, + {type: "completionbar"}, + {type: "endgroup"} + ] + this.updatefreq = options.maxUpdateFrequency || 50 + this.lastName = "" + this.lastCompleted = 0 + this.spun = 0 + this.last = new Date(0) + + var self = this + this._handleSizeChange = function () { + if (!self.showing) return + self.hide() + self.show() + } +} +ProgressBar.prototype = {} + +ProgressBar.unicode = { + startgroup: "╢", + endgroup: "╟", + complete: "█", + incomplete: "░", + spinner: "▀▐▄▌", + subsection: "→" +} + +ProgressBar.ascii = { + startgroup: "|", + endgroup: "|", + complete: "#", + incomplete: "-", + spinner: "-\\|/", + subsection: "->" +} + +ProgressBar.prototype.setTheme = function(theme) { + this.theme = theme +} + +ProgressBar.prototype.setTemplate = function(template) { + this.template = template +} + +ProgressBar.prototype._enableResizeEvents = function() { + process.stdout.on('resize', this._handleSizeChange) +} + +ProgressBar.prototype._disableResizeEvents = function() { + process.stdout.removeListener('resize', this._handleSizeChange) +} + +ProgressBar.prototype.disable = function() { + this.hide() + this.disabled = true +} + +ProgressBar.prototype.enable = function() { + this.disabled = false + this.show() +} + +ProgressBar.prototype.hide = function() { + if (!isTTY()) return + if (this.disabled) return + this.cursor.show() + if (this.showing) this.cursor.up(1) + this.cursor.horizontalAbsolute(0).eraseLine() + this.showing = false +} + +var repeat = function (str, count) { + var out = "" + for (var ii=0; ii<count; ++ii) out += str + return out +} + +ProgressBar.prototype.pulse = function(name) { + ++ this.spun + if (! this.showing) return + if (this.disabled) return + + var baseName = this.lastName + name = name + ? ( baseName + ? baseName + " " + this.theme.subsection + " " + name + : null ) + : baseName + this.show(name) + this.lastName = baseName +} + +ProgressBar.prototype.show = function(name, completed) { + name = this.lastName = name || this.lastName + completed = this.lastCompleted = completed || this.lastCompleted + + if (!isTTY()) return + if (this.disabled) return + if (! this.spun && ! completed) return + if (this.tryAgain) { + clearTimeout(this.tryAgain) + this.tryAgain = null + } + var self = this + if (this.showing && new Date() - this.last < this.updatefreq) { + this.tryAgain = setTimeout(function () { + if (self.disabled) return + if (! self.spun && ! completed) return + drawBar() + }, this.updatefreq - (new Date() - this.last)) + return + } + + return drawBar() + + function drawBar() { + var values = { + name: name, + spinner: self.spun, + completed: completed + } + + self.last = new Date() + + var statusline = self.renderTemplate(self.theme, self.template, values) + + if (self.showing) self.cursor.up(1) + self.cursor + .hide() + .horizontalAbsolute(0) + .write(statusline.substr(0, getWritableTTYColumns()) + "\n") + .show() + + self.showing = true + } +} + +ProgressBar.prototype.renderTemplate = function (theme, template, values) { + values.startgroup = theme.startgroup + values.endgroup = theme.endgroup + values.spinner = values.spinner + ? theme.spinner.substr(values.spinner % theme.spinner.length,1) + : "" + + var output = {prebar: "", postbar: ""} + var status = "prebar" + var self = this + template.forEach(function(T) { + if (typeof T === "string") { + output[status] += T + return + } + if (T.type === "completionbar") { + status = "postbar" + return + } + if (!values.hasOwnProperty(T.type)) throw new Error("Unknown template value '"+T.type+"'") + var value = self.renderValue(T, values[T.type]) + if (value === "") return + var sofar = output[status].length + var lastChar = sofar ? output[status][sofar-1] : null + if (T.separated && sofar && lastChar !== " ") { + output[status] += " " + } + output[status] += value + if (T.separated) output[status] += " " + }) + + var bar = "" + if (status === "postbar") { + var nonBarLen = output.prebar.length + output.postbar.length + + var barLen = getWritableTTYColumns() - nonBarLen + var sofar = Math.round(barLen * Math.max(0,Math.min(1,values.completed||0))) + var rest = barLen - sofar + bar = repeat(theme.complete, sofar) + + repeat(theme.incomplete, rest) + } + + return output.prebar + bar + output.postbar +} +ProgressBar.prototype.renderValue = function (template, value) { + if (value == null || value === "") return "" + var maxLength = template.maxLength || template.length + var minLength = template.minLength || template.length + var alignWith = align[template.align] || align.left +// if (maxLength) value = value.substr(-1 * maxLength) + if (maxLength) value = value.substr(0, maxLength) + if (minLength) value = alignWith(value, minLength) + return value +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/test/progress-bar.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/test/progress-bar.js new file mode 100644 index 0000000000..39939269f5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/node_modules/gauge/test/progress-bar.js @@ -0,0 +1,176 @@ +"use strict" +var test = require("tap").test +var ProgressBar = require("../progress-bar.js") + +var cursor = [] +var C +var bar = new ProgressBar({theme: ProgressBar.ascii}, C = { + show: function () { + cursor.push(["show"]) + return C + }, + hide: function () { + cursor.push(["hide"]) + return C + }, + up: function (lines) { + cursor.push(["up",lines]) + return C + }, + horizontalAbsolute: function (col) { + cursor.push(["horizontalAbsolute", col]) + return C + }, + eraseLine: function () { + cursor.push(["eraseLine"]) + return C + }, + write: function (line) { + cursor.push(["write", line]) + return C + } +}) + + +function isOutput(t, msg, output) { + var tests = [] + for (var ii = 0; ii<output.length; ++ii) { + for (var jj = 0; jj<output[ii].length; ++jj) { + tests.push({cmd: ii, arg: jj}) + } + } + tests.forEach(function(test) { + t.is(cursor[test.cmd] ? cursor[test.cmd][test.arg] : null, + output[test.cmd][test.arg], + msg + ": " + output[test.cmd] + (test.arg ? " arg #"+test.arg : "")) + }) +} + +test("hide", function (t) { + t.plan(11) + process.stderr.isTTY = false + bar.hide() + t.is(cursor.length, 0, "We don't progress bar without a tty") + cursor = [] + process.stderr.isTTY = true + bar.hide() + isOutput(t, "hide while not showing",[ + ["show"], // cursor + ["horizontalAbsolute",0], + ["eraseLine"]]) + cursor = [] + bar.showing = true + bar.hide() + isOutput(t, "hide while showing",[ + ["show"], // cursor + ["up", 1], + ["horizontalAbsolute",0], + ["eraseLine"]]) +}) + +test("renderTemplate", function (t) { + t.plan(16) + process.stdout.columns = 11 + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "name"}],{name: "NAME"}) + t.is(result, "NAME", "name substitution") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "completionbar"}],{completed: 0}) + t.is(result, "----------", "0% bar") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "completionbar"}],{completed: 0.5}) + t.is(result, "#####-----", "50% bar") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "completionbar"}],{completed: 1}) + t.is(result, "##########", "100% bar") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "completionbar"}],{completed: -100}) + t.is(result, "----------", "0% underflow bar") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "completionbar"}],{completed: 100}) + t.is(result, "##########", "100% overflow bar") + var result = bar.renderTemplate(ProgressBar.ascii,[{type: "name"},{type: "completionbar"}],{name: "NAME", completed: 0.5}) + t.is(result, "NAME###---", "name + 50%") + var result = bar.renderTemplate(ProgressBar.ascii, ["static"], {}) + t.is(result, "static", "static text") + var result = bar.renderTemplate(ProgressBar.ascii, ["static",{type: "name"}], {name: "NAME"}) + t.is(result, "staticNAME", "static text + var") + var result = bar.renderTemplate(ProgressBar.ascii, ["static",{type: "name", separated: true}], {name: "NAME"}) + t.is(result, "static NAME ", "pre-separated") + var result = bar.renderTemplate(ProgressBar.ascii, [{type: "name", separated: true}, "static"], {name: "NAME"}) + t.is(result, "NAME static", "post-separated") + var result = bar.renderTemplate(ProgressBar.ascii, ["1",{type: "name", separated: true}, "2"], {name: ""}) + t.is(result, "12", "separated no value") + var result = bar.renderTemplate(ProgressBar.ascii, ["1",{type: "name", separated: true}, "2"], {name: "NAME"}) + t.is(result, "1 NAME 2", "separated value") + var result = bar.renderTemplate(ProgressBar.ascii, [{type: "spinner"}], {spinner: 0}) + t.is(result, "", "No spinner") + var result = bar.renderTemplate(ProgressBar.ascii, [{type: "spinner"}], {spinner: 1}) + t.is(result, "\\", "Spinner 1") + var result = bar.renderTemplate(ProgressBar.ascii, [{type: "spinner"}], {spinner: 10}) + t.is(result, "|", "Spinner 10") +}) + +test("show & pulse", function (t) { + t.plan(23) + + process.stdout.columns = 16 + cursor = [] + process.stderr.isTTY = false + bar.template[0].length = 6 + bar.last = new Date(0) + bar.show("NAME", 0) + t.is(cursor.length, 0, "no tty, no progressbar") + + cursor = [] + process.stderr.isTTY = true + bar.last = new Date(0) + bar.show("NAME", 0.1) + isOutput(t, "tty, name, completion", + [ [ 'hide' ], + [ 'horizontalAbsolute', 0 ], + [ 'write', 'NAME |#-----|\n' ], + [ 'show' ] ]) + + bar.show("S") + cursor = [] + bar.last = new Date(0) + bar.pulse() + isOutput(t, "pulsed spinner", + [ [ 'up', 1 ], + [ 'hide' ], + [ 'horizontalAbsolute', 0 ], + [ 'write', 'S \\ |----|\n' ], + [ 'show' ] ]) + cursor = [] + bar.last = new Date(0) + bar.pulse("P") + isOutput(t, "pulsed spinner with subsection", + [ [ 'up', 1 ], + [ 'hide' ], + [ 'horizontalAbsolute', 0 ], + [ 'write', 'S -> P | |----|\n' ], + [ 'show' ] ]) +}) + +test("window resizing", function (t) { + t.plan(16) + process.stderr.isTTY = true + process.stdout.columns = 32 + bar.show("NAME", 0.1) + cursor = [] + bar.last = new Date(0) + bar.pulse() + isOutput(t, "32 columns", + [ [ 'up', 1 ], + [ 'hide' ], + [ 'horizontalAbsolute', 0 ], + [ 'write', 'NAME / |##------------------|\n' ], + [ 'show' ] ]) + + process.stdout.columns = 16 + bar.show("NAME", 0.5) + cursor = [] + bar.last = new Date(0) + bar.pulse() + isOutput(t, "16 columns", + [ [ 'up', 1 ], + [ 'hide' ], + [ 'horizontalAbsolute', 0 ], + [ 'write', 'NAME - |##--|\n' ], + [ 'show' ] ]); +}); diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/package.json b/deps/npm/node_modules/node-gyp/node_modules/npmlog/package.json new file mode 100644 index 0000000000..5be8cf8e5b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/package.json @@ -0,0 +1,58 @@ +{ + "author": { + "name": "Isaac Z. Schlueter", + "email": "i@izs.me", + "url": "http://blog.izs.me/" + }, + "name": "npmlog", + "description": "logger for npm", + "version": "1.2.1", + "repository": { + "type": "git", + "url": "git://github.com/isaacs/npmlog.git" + }, + "main": "log.js", + "scripts": { + "test": "tap test/*.js" + }, + "dependencies": { + "ansi": "~0.3.0", + "are-we-there-yet": "~1.0.0", + "gauge": "~1.2.0" + }, + "devDependencies": { + "tap": "" + }, + "license": "ISC", + "gitHead": "4e1a73a567036064ded425a7d48c863d53550b4f", + "bugs": { + "url": "https://github.com/isaacs/npmlog/issues" + }, + "homepage": "https://github.com/isaacs/npmlog#readme", + "_id": "npmlog@1.2.1", + "_shasum": "28e7be619609b53f7ad1dd300a10d64d716268b6", + "_from": "npmlog@>=0.0.0 <1.0.0||>=1.0.0 <2.0.0", + "_npmVersion": "2.10.0", + "_nodeVersion": "2.0.1", + "_npmUser": { + "name": "isaacs", + "email": "isaacs@npmjs.com" + }, + "dist": { + "shasum": "28e7be619609b53f7ad1dd300a10d64d716268b6", + "tarball": "http://registry.npmjs.org/npmlog/-/npmlog-1.2.1.tgz" + }, + "maintainers": [ + { + "name": "isaacs", + "email": "i@izs.me" + }, + { + "name": "iarna", + "email": "me@re-becca.org" + } + ], + "directories": {}, + "_resolved": "https://registry.npmjs.org/npmlog/-/npmlog-1.2.1.tgz", + "readme": "ERROR: No README data found!" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/basic.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/basic.js new file mode 100644 index 0000000000..1afcabd1c6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/basic.js @@ -0,0 +1,228 @@ +var tap = require('tap') +var log = require('../') + +var result = [] +var logEvents = [] +var logInfoEvents = [] +var logPrefixEvents = [] + +var util = require('util') + +var resultExpect = +[ '\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[7msill\u001b[0m \u001b[0m\u001b[35msilly prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[34m\u001b[40mverb\u001b[0m \u001b[0m\u001b[35mverbose prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[32minfo\u001b[0m \u001b[0m\u001b[35minfo prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[32m\u001b[40mhttp\u001b[0m \u001b[0m\u001b[35mhttp prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[30m\u001b[43mWARN\u001b[0m \u001b[0m\u001b[35mwarn prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35merror prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[32minfo\u001b[0m \u001b[0m\u001b[35minfo prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[32m\u001b[40mhttp\u001b[0m \u001b[0m\u001b[35mhttp prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[30m\u001b[43mWARN\u001b[0m \u001b[0m\u001b[35mwarn prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35merror prefix\u001b[0m x = {"foo":{"bar":"baz"}}\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35m404\u001b[0m This is a longer\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35m404\u001b[0m message, with some details\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35m404\u001b[0m and maybe a stack.\n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u001b[31m\u001b[40mERR!\u001b[0m \u001b[0m\u001b[35m404\u001b[0m \n', + '\u001b[0m\u001b[37m\u001b[40mnpm\u001b[0m \u001b[0m\u0007noise\u001b[0m\u001b[35m\u001b[0m LOUD NOISES\n', + '\u001b[0m' ] + +var logPrefixEventsExpect = +[ { id: 2, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 9, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 16, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] } ] + +// should be the same. +var logInfoEventsExpect = logPrefixEventsExpect + +var logEventsExpect = +[ { id: 0, + level: 'silly', + prefix: 'silly prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 1, + level: 'verbose', + prefix: 'verbose prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 2, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 3, + level: 'http', + prefix: 'http prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 4, + level: 'warn', + prefix: 'warn prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 5, + level: 'error', + prefix: 'error prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 6, + level: 'silent', + prefix: 'silent prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 7, + level: 'silly', + prefix: 'silly prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 8, + level: 'verbose', + prefix: 'verbose prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 9, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 10, + level: 'http', + prefix: 'http prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 11, + level: 'warn', + prefix: 'warn prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 12, + level: 'error', + prefix: 'error prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 13, + level: 'silent', + prefix: 'silent prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 14, + level: 'silly', + prefix: 'silly prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 15, + level: 'verbose', + prefix: 'verbose prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 16, + level: 'info', + prefix: 'info prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 17, + level: 'http', + prefix: 'http prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 18, + level: 'warn', + prefix: 'warn prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 19, + level: 'error', + prefix: 'error prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 20, + level: 'silent', + prefix: 'silent prefix', + message: 'x = {"foo":{"bar":"baz"}}', + messageRaw: [ 'x = %j', { foo: { bar: 'baz' } } ] }, + { id: 21, + level: 'error', + prefix: '404', + message: 'This is a longer\nmessage, with some details\nand maybe a stack.\n', + messageRaw: [ 'This is a longer\nmessage, with some details\nand maybe a stack.\n' ] }, + { id: 22, + level: 'noise', + prefix: false, + message: 'LOUD NOISES', + messageRaw: [ 'LOUD NOISES' ] } ] + +var Stream = require('stream').Stream +var s = new Stream() +s.write = function (m) { + result.push(m) +} + +s.writable = true +s.isTTY = true +s.end = function () {} + +log.stream = s + +log.heading = 'npm' + + +tap.test('basic', function (t) { + log.on('log', logEvents.push.bind(logEvents)) + log.on('log.info', logInfoEvents.push.bind(logInfoEvents)) + log.on('info prefix', logPrefixEvents.push.bind(logPrefixEvents)) + + console.error('log.level=silly') + log.level = 'silly' + log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) + log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) + log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) + log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) + log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) + log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) + log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) + + console.error('log.level=silent') + log.level = 'silent' + log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) + log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) + log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) + log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) + log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) + log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) + log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) + + console.error('log.level=info') + log.level = 'info' + log.silly('silly prefix', 'x = %j', {foo:{bar:'baz'}}) + log.verbose('verbose prefix', 'x = %j', {foo:{bar:'baz'}}) + log.info('info prefix', 'x = %j', {foo:{bar:'baz'}}) + log.http('http prefix', 'x = %j', {foo:{bar:'baz'}}) + log.warn('warn prefix', 'x = %j', {foo:{bar:'baz'}}) + log.error('error prefix', 'x = %j', {foo:{bar:'baz'}}) + log.silent('silent prefix', 'x = %j', {foo:{bar:'baz'}}) + log.error('404', 'This is a longer\n'+ + 'message, with some details\n'+ + 'and maybe a stack.\n') + log.addLevel('noise', 10000, {beep: true}) + log.noise(false, 'LOUD NOISES') + + t.deepEqual(result.join('').trim(), resultExpect.join('').trim(), 'result') + t.deepEqual(log.record, logEventsExpect, 'record') + t.deepEqual(logEvents, logEventsExpect, 'logEvents') + t.deepEqual(logInfoEvents, logInfoEventsExpect, 'logInfoEvents') + t.deepEqual(logPrefixEvents, logPrefixEventsExpect, 'logPrefixEvents') + + t.end() +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/progress.js b/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/progress.js new file mode 100644 index 0000000000..14dfb32740 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/npmlog/test/progress.js @@ -0,0 +1,114 @@ +'use strict' + +var test = require('tap').test +var log = require('../log.js') + +var actions = [] +log.gauge = { + enable: function () { + actions.push(['enable']) + }, + disable: function () { + actions.push(['disable']) + }, + hide: function () { + actions.push(['hide']) + }, + show: function (name, completed) { + actions.push(['show', name, completed]) + }, + pulse: function (name) { + actions.push(['pulse', name]) + } +} + +function didActions(t, msg, output) { + var tests = [] + for (var ii = 0; ii < output.length; ++ ii) { + for (var jj = 0; jj < output[ii].length; ++ jj) { + tests.push({cmd: ii, arg: jj}) + } + } + t.is(actions.length, output.length, msg) + tests.forEach(function (test) { + t.is(actions[test.cmd] ? actions[test.cmd][test.arg] : null, + output[test.cmd][test.arg], + msg + ': ' + output[test.cmd] + (test.arg ? ' arg #'+test.arg : '')) + }) + actions = [] +} + + +test('enableProgress', function (t) { + t.plan(6) + log.enableProgress() + didActions(t, 'enableProgress', [ [ 'enable' ], [ 'show', undefined, 0 ] ]) + log.enableProgress() + didActions(t, 'enableProgress again', []) +}) + +test('disableProgress', function (t) { + t.plan(4) + log.disableProgress() + didActions(t, 'disableProgress', [ [ 'hide' ], [ 'disable' ] ]) + log.disableProgress() + didActions(t, 'disableProgress again', []) +}) + +test('showProgress', function (t) { + t.plan(5) + log.showProgress('foo') + didActions(t, 'showProgress disabled', []) + log.enableProgress() + actions = [] + log.showProgress('foo') + didActions(t, 'showProgress', [ [ 'show', 'foo', 0 ] ]) +}) + +test('clearProgress', function (t) { + t.plan(3) + log.clearProgress() + didActions(t, 'clearProgress', [ [ 'hide' ] ]) + log.disableProgress() + actions = [] + log.clearProgress() + didActions(t, 'clearProgress disabled', [ ]) +}) + +test("newItem", function (t) { + t.plan(12) + log.enableProgress() + actions = [] + var a = log.newItem("test", 10) + didActions(t, "newItem", [ [ 'show', undefined, 0 ] ]) + a.completeWork(5) + didActions(t, "newItem:completeWork", [ [ 'show', 'test', 0.5 ] ]) + a.finish() + didActions(t, "newItem:finish", [ [ 'show', 'test', 1 ] ]) +}) + +// test that log objects proxy through. And test that completion status filters up +test("newGroup", function (t) { + t.plan(23) + var a = log.newGroup("newGroup") + didActions(t, "newGroup", [ [ 'show', undefined, 0.5 ] ]) + a.warn("test", "this is a test") + didActions(t, "newGroup:warn", [ [ 'pulse', 'test' ], [ 'hide' ], [ 'show', undefined, 0.5 ] ]) + var b = a.newItem("newGroup2", 10) + didActions(t, "newGroup:newItem", [ [ 'show', 'newGroup', 0.5 ] ]) + b.completeWork(5) + didActions(t, "newGroup:completeWork", [ [ 'show', 'newGroup2', 0.75 ] ]) + a.finish() + didActions(t, "newGroup:finish", [ [ 'show', 'newGroup', 1 ] ]) +}) + +test("newStream", function (t) { + t.plan(13) + var a = log.newStream("newStream", 10) + didActions(t, "newStream", [ [ 'show', undefined, 0.6666666666666666 ] ]) + a.write("abcde") + didActions(t, "newStream", [ [ 'show', 'newStream', 0.8333333333333333 ] ]) + a.write("fghij") + didActions(t, "newStream", [ [ 'show', 'newStream', 1 ] ]) + t.is(log.tracker.completed(), 1, "Overall completion") +}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/.travis.yml index c7d8e3d83c..41840cb357 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/.travis.yml +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/.travis.yml @@ -1,6 +1,27 @@ +sudo: false + language: node_js + node_js: - - 0.8 - - 0.9 - - 0.10 - - 0.11 + - "0.8" + - "0.10" + - "0.12" + - "1" + - "2" + - "3" + - "4" + - "5" + +install: + - PATH="`npm bin`:`npm bin -g`:$PATH" + # Node 0.8 comes with a too obsolete npm + - if [[ "`node --version`" =~ ^v0\.8\. ]]; then npm install -g npm@1.4.28 ; fi + # Install dependencies and build + - npm install + +script: + # Output useful info for debugging + - node --version + - npm --version + # Run tests + - npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/History.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/History.md index ff93a2a28f..bbdacd30a0 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/History.md +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/History.md @@ -1,4 +1,12 @@ +1.0.1 / 2016-01-14 +================== + + * add MIT LICENSE file + * update "array-index" to v1.0.0 with new API + * travis: test more node versions and fix v0.8 + * travis: use quotes around node versions + 1.0.0 / 2014-11-11 ================== diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/path-array/LICENSE new file mode 100644 index 0000000000..2a54ccd2eb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/index.js index 40b982d2f1..1e8170136e 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/index.js +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/index.js @@ -94,7 +94,7 @@ PathArray.prototype._getLength = function () { * @api private */ -PathArray.prototype.__get__ = function get (index) { +PathArray.prototype[ArrayIndex.get] = function get (index) { return this._array()[index]; }; @@ -104,7 +104,7 @@ PathArray.prototype.__get__ = function get (index) { * @api private */ -PathArray.prototype.__set__ = function set (index, value) { +PathArray.prototype[ArrayIndex.set] = function set (index, value) { var arr = this._array(); arr[index] = value; this._setArray(arr); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.jshintrc b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.jshintrc new file mode 100644 index 0000000000..182e34d07d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.jshintrc @@ -0,0 +1,4 @@ +{ + "asi": true, + "laxcomma": true +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.travis.yml index 99cdc7439a..41840cb357 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.travis.yml +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/.travis.yml @@ -1,5 +1,27 @@ +sudo: false + language: node_js + node_js: - "0.8" - "0.10" - - "0.11" + - "0.12" + - "1" + - "2" + - "3" + - "4" + - "5" + +install: + - PATH="`npm bin`:`npm bin -g`:$PATH" + # Node 0.8 comes with a too obsolete npm + - if [[ "`node --version`" =~ ^v0\.8\. ]]; then npm install -g npm@1.4.28 ; fi + # Install dependencies and build + - npm install + +script: + # Output useful info for debugging + - node --version + - npm --version + # Run tests + - npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/History.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/History.md index 20b03e9a83..12990228a4 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/History.md +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/History.md @@ -1,11 +1,39 @@ +1.0.0 / 2016-01-02 +================== + + * remove `__get__` and `__set__` functionality + * README: s/->/→/ + +0.9.1 / 2015-12-29 +================== + + * fix backwards compat with tests + * README: update samples for new Symbols API + * travis: attempt to fix node v8 + +0.9.0 / 2015-12-27 +================== + + * add backwards compat logic with deprecate message + * add LICENSE field and entry in package.json + * convert to using es6 Symbols + * remove extraneous debug() calls + * travis: test moar Node.js versions + +0.2.0 / 2015-12-02 +================== + + * add support for invoking as a Mixin + * travis: test node v0.6 + 0.1.1 / 2014-11-03 ================== - * index: use `%o` debug formatters - * .travis: don't test node v0.9.x - * README: use svg for Travis badge - * add .jshintrc file + * index: use `%o` debug formatters + * .travis: don't test node v0.9.x + * README: use svg for Travis badge + * add .jshintrc file 0.1.0 / 2013-12-01 ================== diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/LICENSE new file mode 100644 index 0000000000..2ea4dc5efb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2012 Nathan Rajlich <nathan@tootallnate.net> + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/README.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/README.md index ecd3498dd1..b8d715d6eb 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/README.md +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/README.md @@ -6,8 +6,8 @@ array-index This little module provides an `ArrayIndex` constructor function that you can inherit from with your own objects. When a numbered property gets read, then the -`__get__` function on the object will be invoked. When a numbered property gets -set, then the `__set__` function on the object will be invoked. +`ArrayIndex.get` function on the object will be invoked. When a numbered property gets +set, then the `ArrayIndex.set` function on the object will be invoked. Installation @@ -26,22 +26,22 @@ Examples A quick silly example, using `Math.sqrt()` for the "getter": ``` js -var ArrayIndex = require('array-index') +var ArrayIndex = require('array-index'); // let's just create a singleton instance. -var a = new ArrayIndex() +var a = new ArrayIndex(); -// the "__get__" function is invoked for each "a[n]" access. +// the "ArrayIndex.get" function is invoked for each "a[n]" access. // it is given a single argument, the "index" currently being accessed. // so here, we're passing in the `Math.sqrt()` function, so accessing // "a[9]" will return `Math.sqrt(9)`. -a.__get__ = Math.sqrt +a[ArrayIndex.get] = Math.sqrt; -// the "__get__" and "__set__" functions are only invoked up +// the "ArrayIndex.get" and "ArrayIndex.set" functions are only invoked up // to "a.length", so we must set that manually. -a.length = 10 +a.length = 10; -console.log(a) +console.log(a); // [ 0, // 1, // 1.4142135623730951, @@ -51,19 +51,18 @@ console.log(a) // 2.449489742783178, // 2.6457513110645907, // 2.8284271247461903, -// 3, -// __get__: [Function: sqrt] ] +// 3 ] ``` Here's an example of creating a subclass of `ArrayIndex` using `util.inherits()`: ``` js -var ArrayIndex = require('array-index') -var inherits = require('util').inherits +var ArrayIndex = require('array-index'); +var inherits = require('util').inherits; function MyArray (length) { // be sure to call the ArrayIndex constructor in your own constructor - ArrayIndex.call(this, length) + ArrayIndex.call(this, length); // the "set" object will contain values at indexes previously set, // so that they can be returned in the "getter" function. This is just a @@ -71,28 +70,28 @@ function MyArray (length) { Object.defineProperty(this, 'set', { value: Object.create(null), enumerable: false - }) + }); } // inherit from the ArrayIndex's prototype -inherits(MyArray, ArrayIndex) +inherits(MyArray, ArrayIndex); -MyArray.prototype.__get__ = function (index) { - if (index in this.set) return this.set[index] - return index * 2 -} +MyArray.prototype[ArrayIndex.get] = function (index) { + if (index in this.set) return this.set[index]; + return index * 2; +}; -MyArray.prototype.__set__ = function (index, v) { - this.set[index] = v -} +MyArray.prototype[ArrayIndex.set] = function (index, v) { + this.set[index] = v; +}; // and now you can create some instances -var a = new MyArray(15) -a[9] = a[10] = a[14] = '_' -a[0] = 'nate' +var a = new MyArray(15); +a[9] = a[10] = a[14] = '_'; +a[0] = 'nate'; -console.log(a) +console.log(a); // [ 'nate', 2, 4, 6, 8, 10, 12, 14, 16, '_', '_', 22, 24, 26, '_' ] ``` @@ -102,28 +101,28 @@ API The `ArrayIndex` base class is meant to be subclassed, but it also has a few convenient functions built-in. -### "length" -> Number +### "length" → Number -The length of the ArrayIndex instance. The `__get__` and `__set__` functions will +The length of the ArrayIndex instance. The `ArrayIndex.get` and `ArrayIndex.set` functions will only be invoked on the object up to this "length". You may set this length at any time to adjust the amount range where the getters/setters will be invoked. -### "toArray()" -> Array +### "toArray()" → Array Returns a new regular Array instance with the same values that this ArrayIndex -class would have. This function calls the `__get__` function repeatedly from +class would have. This function calls the `ArrayIndex.get` function repeatedly from `0...length-1` and returns the "flattened" array instance. -### "toJSON()" -> Array +### "toJSON()" → Array All `ArrayIndex` instances get basic support for `JSON.stringify()`, which is the same as a "flattened" Array being stringified. -### "toString()" -> String +### "toString()" → String The `toString()` override is basically just `array.toArray().toString()`. -### "format()" -> String +### "format()" → String The `inspect()` implementation for the REPL attempts to mimic what a regular Array looks like in the REPL. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/component.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/component.json index 390d7a7fe8..f5f21fc7d6 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/component.json +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/component.json @@ -9,7 +9,7 @@ "setter", "proxy" ], - "version": "0.1.1", + "version": "1.0.0", "dependencies": { "visionmedia/debug": "*" }, diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/index.js index 18069c6bcd..a2e4110c18 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/index.js +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/index.js @@ -3,61 +3,62 @@ * Module dependencies. */ -var util = require('util') -var debug = require('debug')('array-index') +var Symbol = require('es6-symbol'); +var debug = require('debug')('array-index'); + +var get = Symbol('get'); +var set = Symbol('set'); +var length = Symbol('length'); /** * JavaScript Array "length" is bound to an unsigned 32-bit int. * See: http://stackoverflow.com/a/6155063/376773 */ -var MAX_LENGTH = Math.pow(2, 32) +var MAX_LENGTH = Math.pow(2, 32); /** * Module exports. */ -module.exports = ArrayIndex +module.exports = ArrayIndex; +ArrayIndex.get = get; +ArrayIndex.set = set; /** * Subclass this. */ -function ArrayIndex (length) { +function ArrayIndex (_length) { Object.defineProperty(this, 'length', { get: getLength, set: setLength, enumerable: false, configurable: true - }) + }); - Object.defineProperty(this, '__length', { - value: 0, - writable: true, - enumerable: false, - configurable: true - }) + this[length] = 0; if (arguments.length > 0) { - this.length = length + setLength.call(this, _length); } } /** - * You overwrite the "__get__" function in your subclass. + * You overwrite the "get" Symbol in your subclass. */ -ArrayIndex.prototype.__get__ = function () { - throw new Error('you must implement the __get__ function') -} +ArrayIndex.prototype[ArrayIndex.get] = function () { + throw new Error('you must implement the `ArrayIndex.get` Symbol'); +}; /** - * You overwrite the "__set__" function in your subclass. + * You overwrite the "set" Symbol in your subclass. */ -ArrayIndex.prototype.__set__ = function () { - throw new Error('you must implement the __set__ function') -} +ArrayIndex.prototype[ArrayIndex.set] = function () { + throw new Error('you must implement the `ArrayIndex.set` Symbol'); +}; /** * Converts this array class into a real JavaScript Array. Note that this @@ -70,91 +71,92 @@ ArrayIndex.prototype.__set__ = function () { */ ArrayIndex.prototype.toArray = function toArray () { - var i = 0, l = this.length, array = new Array(l) + var i = 0; + var l = this.length; + var array = new Array(l); for (; i < l; i++) { - array[i] = this[i] + array[i] = this[i]; } - return array -} + return array; +}; /** * Basic support for `JSON.stringify()`. */ ArrayIndex.prototype.toJSON = function toJSON () { - return this.toArray() -} + return this.toArray(); +}; /** * toString() override. Use Array.prototype.toString(). */ ArrayIndex.prototype.toString = function toString () { - var a = this.toArray() - return a.toString.apply(a, arguments) -} + var a = this.toArray(); + return a.toString.apply(a, arguments); +}; /** * inspect() override. For the REPL. */ ArrayIndex.prototype.inspect = function inspect () { - var a = this.toArray() + var a = this.toArray(); Object.keys(this).forEach(function (k) { - a[k] = this[k] - }, this) - return util.inspect(a) -} + a[k] = this[k]; + }, this); + return a; +}; /** * Getter for the "length" property. - * Returns the value of the "__length" property. + * Returns the value of the "length" Symbol. */ function getLength () { - debug('getting "length": %o', this.__length) - return this.__length -} + debug('getting "length": %o', this[length]); + return this[length]; +}; /** * Setter for the "length" property. - * Calls "ensureLength()", then sets the "__length" property. + * Calls "ensureLength()", then sets the "length" Symbol. */ function setLength (v) { - debug('setting "length": %o', v) - return this.__length = ensureLength(v) -} + debug('setting "length": %o', v); + return this[length] = ensureLength(this, v); +}; /** - * Ensures that getters/setters from 0 up to "_length" have been defined - * on `ArrayIndex.prototype`. + * Ensures that getters/setters from 0 up to "_newLength" have been defined + * on `Object.getPrototypeOf(this)`. * * @api private */ -function ensureLength (_length) { - var length - if (_length > MAX_LENGTH) { - length = MAX_LENGTH +function ensureLength (self, _newLength) { + var newLength; + if (_newLength > MAX_LENGTH) { + newLength = MAX_LENGTH; } else { - length = _length | 0 + newLength = _newLength | 0; } - var cur = ArrayIndex.prototype.__length__ | 0 - var num = length - cur + var proto = Object.getPrototypeOf(self); + var cur = proto[length] | 0; + var num = newLength - cur; if (num > 0) { - var desc = {} - debug('creating a descriptor object with %o entries', num) - for (var i = cur; i < length; i++) { - desc[i] = setup(i) + var desc = {}; + debug('creating a descriptor object with %o entries', num); + for (var i = cur; i < newLength; i++) { + desc[i] = setup(i); } - debug('done creating descriptor object') - debug('calling `Object.defineProperties()` with %o entries', num) - Object.defineProperties(ArrayIndex.prototype, desc) - debug('finished `Object.defineProperties()`') - ArrayIndex.prototype.__length__ = length + debug('calling `Object.defineProperties()` with %o entries', num); + Object.defineProperties(proto, desc); + proto[length] = newLength; } - return length + return newLength; } /** @@ -166,15 +168,15 @@ function ensureLength (_length) { function setup (index) { function get () { - return this.__get__(index) + return this[ArrayIndex.get](index); } function set (v) { - return this.__set__(index, v) + return this[ArrayIndex.set](index, v); } return { - enumerable: true - , configurable: true - , get: get - , set: set - } + enumerable: true, + configurable: true, + get: get, + set: set + }; } diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json index 7b5d86dbbd..a60580a9d1 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/node_modules/ms/package.json @@ -1,30 +1,74 @@ { - "name": "ms", - "version": "0.7.1", - "description": "Tiny ms conversion utility", - "repository": { - "type": "git", - "url": "git://github.com/guille/ms.js.git" + "_args": [ + [ + "ms@0.7.1", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug" + ] + ], + "_from": "ms@0.7.1", + "_id": "ms@0.7.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/debug/ms", + "_nodeVersion": "0.12.2", + "_npmUser": { + "email": "rauchg@gmail.com", + "name": "rauchg" }, - "main": "./index", - "devDependencies": { - "mocha": "*", - "expect.js": "*", - "serve": "*" + "_npmVersion": "2.7.5", + "_phantomChildren": {}, + "_requested": { + "name": "ms", + "raw": "ms@0.7.1", + "rawSpec": "0.7.1", + "scope": null, + "spec": "0.7.1", + "type": "version" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index/debug" + ], + "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz", + "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "_shrinkwrap": null, + "_spec": "ms@0.7.1", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug", + "bugs": { + "url": "https://github.com/guille/ms.js/issues" }, "component": { "scripts": { "ms/index.js": "index.js" } }, - "readme": "# ms.js: miliseconds conversion utility\n\n```js\nms('2 days') // 172800000\nms('1d') // 86400000\nms('10h') // 36000000\nms('2.5 hrs') // 9000000\nms('2h') // 7200000\nms('1m') // 60000\nms('5s') // 5000\nms('100') // 100\n```\n\n```js\nms(60000) // \"1m\"\nms(2 * 60000) // \"2m\"\nms(ms('10 hours')) // \"10h\"\n```\n\n```js\nms(60000, { long: true }) // \"1 minute\"\nms(2 * 60000, { long: true }) // \"2 minutes\"\nms(ms('10 hours'), { long: true }) // \"10 hours\"\n```\n\n- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](http://nodejs.org/download).\n- If a number is supplied to `ms`, a string with a unit is returned.\n- If a string that contains the number is supplied, it returns it as\na number (e.g: it returns `100` for `'100'`).\n- If you pass a string with a number and a valid unit, the number of\nequivalent ms is returned.\n\n## License\n\nMIT\n", - "readmeFilename": "README.md", - "bugs": { - "url": "https://github.com/guille/ms.js/issues" + "dependencies": {}, + "description": "Tiny ms conversion utility", + "devDependencies": { + "expect.js": "*", + "mocha": "*", + "serve": "*" }, - "homepage": "https://github.com/guille/ms.js#readme", - "_id": "ms@0.7.1", - "_shasum": "9cd13c03adbff25b65effde7ce864ee952017098", - "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.1.tgz", - "_from": "ms@0.7.1" + "directories": {}, + "dist": { + "shasum": "9cd13c03adbff25b65effde7ce864ee952017098", + "tarball": "http://registry.npmjs.org/ms/-/ms-0.7.1.tgz" + }, + "gitHead": "713dcf26d9e6fd9dbc95affe7eff9783b7f1b909", + "homepage": "https://github.com/guille/ms.js", + "main": "./index", + "maintainers": [ + { + "name": "rauchg", + "email": "rauchg@gmail.com" + } + ], + "name": "ms", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/guille/ms.js.git" + }, + "scripts": {}, + "version": "0.7.1" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json index ebe311fad9..758deaf8c3 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/debug/package.json @@ -1,19 +1,51 @@ { - "name": "debug", - "version": "2.2.0", - "repository": { - "type": "git", - "url": "git://github.com/visionmedia/debug.git" + "_args": [ + [ + "debug@*", + "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index" + ] + ], + "_from": "debug@*", + "_id": "debug@2.2.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/debug", + "_nodeVersion": "0.12.2", + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" }, - "description": "small debugging utility", - "keywords": [ - "debug", - "log", - "debugger" + "_npmVersion": "2.7.4", + "_phantomChildren": {}, + "_requested": { + "name": "debug", + "raw": "debug@*", + "rawSpec": "*", + "scope": null, + "spec": "*", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index" ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz", + "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "_shrinkwrap": null, + "_spec": "debug@*", + "_where": "/Users/rebecca/code/release/npm-3/node_modules/node-gyp/node_modules/path-array/node_modules/array-index", "author": { - "name": "TJ Holowaychuk", - "email": "tj@vision-media.ca" + "email": "tj@vision-media.ca", + "name": "TJ Holowaychuk" + }, + "browser": "./browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "component": { + "scripts": { + "debug/debug.js": "debug.js", + "debug/index.js": "browser.js" + } }, "contributors": [ { @@ -22,30 +54,45 @@ "url": "http://n8.io" } ], - "license": "MIT", "dependencies": { "ms": "0.7.1" }, + "description": "small debugging utility", "devDependencies": { "browserify": "9.0.3", "mocha": "*" }, + "directories": {}, + "dist": { + "shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", + "tarball": "http://registry.npmjs.org/debug/-/debug-2.2.0.tgz" + }, + "gitHead": "b38458422b5aa8aa6d286b10dfe427e8a67e2b35", + "homepage": "https://github.com/visionmedia/debug", + "keywords": [ + "debug", + "debugger", + "log" + ], + "license": "MIT", "main": "./node.js", - "browser": "./browser.js", - "component": { - "scripts": { - "debug/index.js": "browser.js", - "debug/debug.js": "debug.js" + "maintainers": [ + { + "name": "tjholowaychuk", + "email": "tj@vision-media.ca" + }, + { + "name": "tootallnate", + "email": "nathan@tootallnate.net" } + ], + "name": "debug", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" }, - "readme": "# debug\n\n tiny node.js debugging utility modelled after node core's debugging technique.\n\n## Installation\n\n```bash\n$ npm install debug\n```\n\n## Usage\n\n With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.\n\nExample _app.js_:\n\n```js\nvar debug = require('debug')('http')\n , http = require('http')\n , name = 'My App';\n\n// fake app\n\ndebug('booting %s', name);\n\nhttp.createServer(function(req, res){\n debug(req.method + ' ' + req.url);\n res.end('hello\\n');\n}).listen(3000, function(){\n debug('listening');\n});\n\n// fake worker of some kind\n\nrequire('./worker');\n```\n\nExample _worker.js_:\n\n```js\nvar debug = require('debug')('worker');\n\nsetInterval(function(){\n debug('doing some work');\n}, 1000);\n```\n\n The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:\n\n ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png)\n\n ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png)\n\n#### Windows note\n\n On Windows the environment variable is set using the `set` command.\n\n ```cmd\n set DEBUG=*,-not_this\n ```\n\nThen, run the program to be debugged as usual.\n\n## Millisecond diff\n\n When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the \"+NNNms\" will show you how much time was spent between calls.\n\n ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png)\n\n When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:\n\n ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png)\n\n## Conventions\n\n If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use \":\" to separate features. For example \"bodyParser\" from Connect would then be \"connect:bodyParser\".\n\n## Wildcards\n\n The `*` character may be used as a wildcard. Suppose for example your library has debuggers named \"connect:bodyParser\", \"connect:compress\", \"connect:session\", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.\n\n You can also exclude specific debuggers by prefixing them with a \"-\" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with \"connect:\".\n\n## Browser support\n\n Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:\n\n```js\nwindow.myDebug = require(\"debug\");\n```\n\n (\"debug\" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:\n\n```js\nmyDebug.enable(\"worker:*\")\n```\n\n Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.\n\n```js\na = debug('worker:a');\nb = debug('worker:b');\n\nsetInterval(function(){\n a('doing some work');\n}, 1000);\n\nsetInterval(function(){\n b('doing some work');\n}, 1200);\n```\n\n#### Web Inspector Colors\n\n Colors are also enabled on \"Web Inspectors\" that understand the `%c` formatting\n option. These are WebKit web inspectors, Firefox ([since version\n 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))\n and the Firebug plugin for Firefox (any version).\n\n Colored output looks something like:\n\n ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png)\n\n### stderr vs stdout\n\nYou can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:\n\nExample _stdout.js_:\n\n```js\nvar debug = require('debug');\nvar error = debug('app:error');\n\n// by default stderr is used\nerror('goes to stderr!');\n\nvar log = debug('app:log');\n// set this namespace to log via console.log\nlog.log = console.log.bind(console); // don't forget to bind to console!\nlog('goes to stdout');\nerror('still goes to stderr!');\n\n// set all output to go via console.info\n// overrides all per-namespace log settings\ndebug.log = console.info.bind(console);\nerror('now goes to stdout via console.info');\nlog('still goes to stdout, but via console.info now');\n```\n\n### Save debug output to a file\n\nYou can save all debug statements to a file by piping them.\n\nExample:\n\n```bash\n$ DEBUG_FD=3 node your-app.js 3> whatever.log\n```\n\n## Authors\n\n - TJ Holowaychuk\n - Nathan Rajlich\n\n## License\n\n(The MIT License)\n\nCopyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>\n\nPermission is hereby granted, free of charge, to any person obtaining\na copy of this software and associated documentation files (the\n'Software'), to deal in the Software without restriction, including\nwithout limitation the rights to use, copy, modify, merge, publish,\ndistribute, sublicense, and/or sell copies of the Software, and to\npermit persons to whom the Software is furnished to do so, subject to\nthe following conditions:\n\nThe above copyright notice and this permission notice shall be\nincluded in all copies or substantial portions of the Software.\n\nTHE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,\nEXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF\nMERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.\nIN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY\nCLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,\nTORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE\nSOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.\n", - "readmeFilename": "Readme.md", - "bugs": { - "url": "https://github.com/visionmedia/debug/issues" - }, - "homepage": "https://github.com/visionmedia/debug#readme", - "_id": "debug@2.2.0", - "_shasum": "f87057e995b1a1f6ae6a4960664137bc56f039da", - "_resolved": "https://registry.npmjs.org/debug/-/debug-2.2.0.tgz", - "_from": "debug@*" + "scripts": {}, + "version": "2.2.0" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.lint b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.lint new file mode 100644 index 0000000000..df1e53cd5f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.lint @@ -0,0 +1,15 @@ +@root + +module + +tabs +indent 2 +maxlen 100 + +ass +nomen +plusplus +newcap +vars + +predef+ Symbol diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.npmignore new file mode 100644 index 0000000000..155e41f691 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.npmignore @@ -0,0 +1,4 @@ +.DS_Store +/node_modules +/npm-debug.log +/.lintcache diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.travis.yml new file mode 100644 index 0000000000..6830765b56 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/.travis.yml @@ -0,0 +1,10 @@ +sudo: false # http://docs.travis-ci.com/user/workers/container-based-infrastructure/ +language: node_js +node_js: + - 0.12 + - v4 + - v5 + +notifications: + email: + - medikoo+es6-symbol@medikoo.com diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/CHANGES b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/CHANGES new file mode 100644 index 0000000000..cbedd4244b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/CHANGES @@ -0,0 +1,46 @@ +v3.0.2 -- 2015.12.12 +* Fix definition flow, so uneven state of Symbol implementation doesn't crash initialization of + polyfill. See #13 + +v3.0.1 -- 2015.10.22 +* Workaround for IE11 bug (reported in #12) + +v3.0.0 -- 2015.10.02 +* Reuse native symbols (e.g. iterator, toStringTag etc.) in a polyfill if they're available + Otherwise polyfill symbols may not be recognized by other functions +* Improve documentation + +v2.0.1 -- 2015.01.28 +* Fix Symbol.prototype[Symbol.isPrimitive] implementation +* Improve validation within Symbol.prototype.toString and + Symbol.prototype.valueOf + +v2.0.0 -- 2015.01.28 +* Update up to changes in specification: + * Implement `for` and `keyFor` + * Remove `Symbol.create` and `Symbol.isRegExp` + * Add `Symbol.match`, `Symbol.replace`, `Symbol.search`, `Symbol.species` and + `Symbol.split` +* Rename `validSymbol` to `validateSymbol` +* Improve documentation +* Remove dead test modules + +v1.0.0 -- 2015.01.26 +* Fix enumerability for symbol properties set normally (e.g. obj[symbol] = value) +* Introduce initialization via hidden constructor +* Fix isSymbol handling of polyfill values when native Symbol is present +* Fix spelling of LICENSE +* Configure lint scripts + +v0.1.1 -- 2014.10.07 +* Fix isImplemented, so it returns true in case of polyfill +* Improve documentations + +v0.1.0 -- 2014.04.28 +* Assure strictly npm dependencies +* Update to use latest versions of dependencies +* Fix implementation detection so it doesn't crash on `String(symbol)` +* throw on `new Symbol()` (as decided by TC39) + +v0.0.0 -- 2013.11.15 +* Initial (dev) version
\ No newline at end of file diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/LICENSE new file mode 100644 index 0000000000..04724a3ab1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2013-2015 Mariusz Nowak (www.medikoo.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/README.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/README.md new file mode 100644 index 0000000000..0fa8978450 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/README.md @@ -0,0 +1,71 @@ +# es6-symbol +## ECMAScript 6 Symbol polyfill + +For more information about symbols see following links +- [Symbols in ECMAScript 6 by Axel Rauschmayer](http://www.2ality.com/2014/12/es6-symbols.html) +- [MDN Documentation](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Symbol) +- [Specification](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-symbol-constructor) + +### Limitations + +Underneath it uses real string property names which can easily be retrieved, however accidental collision with other property names is unlikely. + +### Usage + +It’s safest to use *es6-symbol* as a [ponyfill](http://kikobeats.com/polyfill-ponyfill-and-prollyfill/) – a polyfill which doesn’t touch global objects: + +```javascript +var Symbol = require('es6-symbol'); +``` + +If you want to make sure your environment implements `Symbol` globally, do: + +```javascript +require('es6-symbol/implement'); +``` + +If you strictly want to use polyfill even if native `Symbol` exists (hard to find a good reason for that), do: + +```javascript +var Symbol = require('es6-symbol/polyfill'); +``` + +#### API + +Best is to refer to [specification](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-symbol-objects). Still if you want quick look, follow examples: + +```javascript +var Symbol = require('es6-symbol'); + +var symbol = Symbol('My custom symbol'); +var x = {}; + +x[symbol] = 'foo'; +console.log(x[symbol]); 'foo' + +// Detect iterable: +var iterator, result; +if (possiblyIterable[Symbol.iterator]) { + iterator = possiblyIterable[Symbol.iterator](); + result = iterator.next(); + while(!result.done) { + console.log(result.value); + result = iterator.next(); + } +} +``` + +### Installation +#### NPM + +In your project path: + + $ npm install es6-symbol + +##### Browser + +To port it to Browser or any other (non CJS) environment, use your favorite CJS bundler. No favorite yet? Try: [Browserify](http://browserify.org/), [Webmake](https://github.com/medikoo/modules-webmake) or [Webpack](http://webpack.github.io/) + +## Tests [![Build Status](https://travis-ci.org/medikoo/es6-symbol.png)](https://travis-ci.org/medikoo/es6-symbol) + + $ npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/implement.js new file mode 100644 index 0000000000..153edacdbe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(require('es5-ext/global'), 'Symbol', + { value: require('./polyfill'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/index.js new file mode 100644 index 0000000000..609f1faf55 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? Symbol : require('./polyfill'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-implemented.js new file mode 100644 index 0000000000..53759f3212 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-implemented.js @@ -0,0 +1,18 @@ +'use strict'; + +module.exports = function () { + var symbol; + if (typeof Symbol !== 'function') return false; + symbol = Symbol('test symbol'); + try { String(symbol); } catch (e) { return false; } + if (typeof Symbol.iterator === 'symbol') return true; + + // Return 'true' for polyfills + if (typeof Symbol.isConcatSpreadable !== 'object') return false; + if (typeof Symbol.iterator !== 'object') return false; + if (typeof Symbol.toPrimitive !== 'object') return false; + if (typeof Symbol.toStringTag !== 'object') return false; + if (typeof Symbol.unscopables !== 'object') return false; + + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-native-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-native-implemented.js new file mode 100644 index 0000000000..a8cb8b8681 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-native-implemented.js @@ -0,0 +1,8 @@ +// Exports true if environment provides native `Symbol` implementation + +'use strict'; + +module.exports = (function () { + if (typeof Symbol !== 'function') return false; + return (typeof Symbol.iterator === 'symbol'); +}()); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-symbol.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-symbol.js new file mode 100644 index 0000000000..beeba2cb4f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/is-symbol.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (x) { + return (x && ((typeof x === 'symbol') || (x['@@toStringTag'] === 'Symbol'))) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.lint b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.lint new file mode 100644 index 0000000000..858b75353b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.lint @@ -0,0 +1,12 @@ +@root + +es5 +module + +tabs +indent 2 +maxlen 80 + +ass +nomen +plusplus diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.npmignore new file mode 100644 index 0000000000..155e41f691 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.npmignore @@ -0,0 +1,4 @@ +.DS_Store +/node_modules +/npm-debug.log +/.lintcache diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.travis.yml new file mode 100644 index 0000000000..50008b23e6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/.travis.yml @@ -0,0 +1,9 @@ +language: node_js +node_js: + - 0.8 + - 0.10 + - 0.11 + +notifications: + email: + - medikoo+d@medikoo.com diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/CHANGES b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/CHANGES new file mode 100644 index 0000000000..45233f747e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/CHANGES @@ -0,0 +1,7 @@ +v0.1.1 -- 2014.04.24 +- Add `autoBind` and `lazy` utilities +- Allow to pass other options to be merged onto created descriptor. + Useful when used with other custom utilties + +v0.1.0 -- 2013.06.20 +Initial (derived from es5-ext project) diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/LICENCE b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/LICENCE new file mode 100644 index 0000000000..aaf35282f4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/LICENCE @@ -0,0 +1,19 @@ +Copyright (C) 2013 Mariusz Nowak (www.medikoo.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/README.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/README.md new file mode 100644 index 0000000000..872d493ed8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/README.md @@ -0,0 +1,108 @@ +# D - Property descriptor factory + +_Originally derived from [es5-ext](https://github.com/medikoo/es5-ext) package._ + +Defining properties with descriptors is very verbose: + +```javascript +var Account = function () {}; +Object.defineProperties(Account.prototype, { + deposit: { value: function () { + /* ... */ + }, configurable: true, enumerable: false, writable: true }, + whithdraw: { value: function () { + /* ... */ + }, configurable: true, enumerable: false, writable: true }, + balance: { get: function () { + /* ... */ + }, configurable: true, enumerable: false } +}); +``` + +D cuts that to: + +```javascript +var d = require('d'); + +var Account = function () {}; +Object.defineProperties(Account.prototype, { + deposit: d(function () { + /* ... */ + }), + whithdraw: d(function () { + /* ... */ + }), + balance: d.gs(function () { + /* ... */ + }) +}); +``` + +By default, created descriptor follow characteristics of native ES5 properties, and defines values as: + +```javascript +{ configurable: true, enumerable: false, writable: true } +``` + +You can overwrite it by preceding _value_ argument with instruction: +```javascript +d('c', value); // { configurable: true, enumerable: false, writable: false } +d('ce', value); // { configurable: true, enumerable: true, writable: false } +d('e', value); // { configurable: false, enumerable: true, writable: false } + +// Same way for get/set: +d.gs('e', value); // { configurable: false, enumerable: true } +``` + +### Other utilities + +#### autoBind(obj, props) _(d/auto-bind)_ + +Define methods which will be automatically bound to its instances + +```javascript +var d = require('d'); +var autoBind = require('d/auto-bind'); + +var Foo = function () { this._count = 0; }; +autoBind(Foo.prototype, { + increment: d(function () { ++this._count; }); +}); + +var foo = new Foo(); + +// Increment foo counter on each domEl click +domEl.addEventListener('click', foo.increment, false); +``` + +#### lazy(obj, props) _(d/lazy)_ + +Define lazy properties, which will be resolved on first access + +```javascript +var d = require('d'); +var lazy = require('d/lazy'); + +var Foo = function () {}; +lazy(Foo.prototype, { + items: d(function () { return []; }) +}); + +var foo = new Foo(); +foo.items.push(1, 2); // foo.items array created +``` + +## Installation +### NPM + +In your project path: + + $ npm install d + +### Browser + +You can easily bundle _D_ for browser with [modules-webmake](https://github.com/medikoo/modules-webmake) + +## Tests [![Build Status](https://travis-ci.org/medikoo/d.png)](https://travis-ci.org/medikoo/d) + + $ npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/auto-bind.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/auto-bind.js new file mode 100644 index 0000000000..1b00dba3cc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/auto-bind.js @@ -0,0 +1,31 @@ +'use strict'; + +var copy = require('es5-ext/object/copy') + , map = require('es5-ext/object/map') + , callable = require('es5-ext/object/valid-callable') + , validValue = require('es5-ext/object/valid-value') + + , bind = Function.prototype.bind, defineProperty = Object.defineProperty + , hasOwnProperty = Object.prototype.hasOwnProperty + , define; + +define = function (name, desc, bindTo) { + var value = validValue(desc) && callable(desc.value), dgs; + dgs = copy(desc); + delete dgs.writable; + delete dgs.value; + dgs.get = function () { + if (hasOwnProperty.call(this, name)) return value; + desc.value = bind.call(value, (bindTo == null) ? this : this[bindTo]); + defineProperty(this, name, desc); + return this[name]; + }; + return dgs; +}; + +module.exports = function (props/*, bindTo*/) { + var bindTo = arguments[1]; + return map(props, function (desc, name) { + return define(name, desc, bindTo); + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/index.js new file mode 100644 index 0000000000..076ae465f6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/index.js @@ -0,0 +1,63 @@ +'use strict'; + +var assign = require('es5-ext/object/assign') + , normalizeOpts = require('es5-ext/object/normalize-options') + , isCallable = require('es5-ext/object/is-callable') + , contains = require('es5-ext/string/#/contains') + + , d; + +d = module.exports = function (dscr, value/*, options*/) { + var c, e, w, options, desc; + if ((arguments.length < 2) || (typeof dscr !== 'string')) { + options = value; + value = dscr; + dscr = null; + } else { + options = arguments[2]; + } + if (dscr == null) { + c = w = true; + e = false; + } else { + c = contains.call(dscr, 'c'); + e = contains.call(dscr, 'e'); + w = contains.call(dscr, 'w'); + } + + desc = { value: value, configurable: c, enumerable: e, writable: w }; + return !options ? desc : assign(normalizeOpts(options), desc); +}; + +d.gs = function (dscr, get, set/*, options*/) { + var c, e, options, desc; + if (typeof dscr !== 'string') { + options = set; + set = get; + get = dscr; + dscr = null; + } else { + options = arguments[3]; + } + if (get == null) { + get = undefined; + } else if (!isCallable(get)) { + options = get; + get = set = undefined; + } else if (set == null) { + set = undefined; + } else if (!isCallable(set)) { + options = set; + set = undefined; + } + if (dscr == null) { + c = true; + e = false; + } else { + c = contains.call(dscr, 'c'); + e = contains.call(dscr, 'e'); + } + + desc = { get: get, set: set, configurable: c, enumerable: e }; + return !options ? desc : assign(normalizeOpts(options), desc); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/lazy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/lazy.js new file mode 100644 index 0000000000..61e466535f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/lazy.js @@ -0,0 +1,111 @@ +'use strict'; + +var map = require('es5-ext/object/map') + , isCallable = require('es5-ext/object/is-callable') + , validValue = require('es5-ext/object/valid-value') + , contains = require('es5-ext/string/#/contains') + + , call = Function.prototype.call + , defineProperty = Object.defineProperty + , getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor + , getPrototypeOf = Object.getPrototypeOf + , hasOwnProperty = Object.prototype.hasOwnProperty + , cacheDesc = { configurable: false, enumerable: false, writable: false, + value: null } + , define; + +define = function (name, options) { + var value, dgs, cacheName, desc, writable = false, resolvable + , flat; + options = Object(validValue(options)); + cacheName = options.cacheName; + flat = options.flat; + if (cacheName == null) cacheName = name; + delete options.cacheName; + value = options.value; + resolvable = isCallable(value); + delete options.value; + dgs = { configurable: Boolean(options.configurable), + enumerable: Boolean(options.enumerable) }; + if (name !== cacheName) { + dgs.get = function () { + if (hasOwnProperty.call(this, cacheName)) return this[cacheName]; + cacheDesc.value = resolvable ? call.call(value, this, options) : value; + cacheDesc.writable = writable; + defineProperty(this, cacheName, cacheDesc); + cacheDesc.value = null; + if (desc) defineProperty(this, name, desc); + return this[cacheName]; + }; + } else if (!flat) { + dgs.get = function self() { + var ownDesc; + if (hasOwnProperty.call(this, name)) { + ownDesc = getOwnPropertyDescriptor(this, name); + // It happens in Safari, that getter is still called after property + // was defined with a value, following workarounds that + if (ownDesc.hasOwnProperty('value')) return ownDesc.value; + if ((typeof ownDesc.get === 'function') && (ownDesc.get !== self)) { + return ownDesc.get.call(this); + } + return value; + } + desc.value = resolvable ? call.call(value, this, options) : value; + defineProperty(this, name, desc); + desc.value = null; + return this[name]; + }; + } else { + dgs.get = function self() { + var base = this, ownDesc; + if (hasOwnProperty.call(this, name)) { + // It happens in Safari, that getter is still called after property + // was defined with a value, following workarounds that + ownDesc = getOwnPropertyDescriptor(this, name); + if (ownDesc.hasOwnProperty('value')) return ownDesc.value; + if ((typeof ownDesc.get === 'function') && (ownDesc.get !== self)) { + return ownDesc.get.call(this); + } + } + while (!hasOwnProperty.call(base, name)) base = getPrototypeOf(base); + desc.value = resolvable ? call.call(value, base, options) : value; + defineProperty(base, name, desc); + desc.value = null; + return base[name]; + }; + } + dgs.set = function (value) { + dgs.get.call(this); + this[cacheName] = value; + }; + if (options.desc) { + desc = { + configurable: contains.call(options.desc, 'c'), + enumerable: contains.call(options.desc, 'e') + }; + if (cacheName === name) { + desc.writable = contains.call(options.desc, 'w'); + desc.value = null; + } else { + writable = contains.call(options.desc, 'w'); + desc.get = dgs.get; + desc.set = dgs.set; + } + delete options.desc; + } else if (cacheName === name) { + desc = { + configurable: Boolean(options.configurable), + enumerable: Boolean(options.enumerable), + writable: Boolean(options.writable), + value: null + }; + } + delete options.configurable; + delete options.enumerable; + delete options.writable; + return dgs; +}; + +module.exports = function (props) { + return map(props, function (desc, name) { return define(name, desc); }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/package.json new file mode 100644 index 0000000000..b7c327850c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/package.json @@ -0,0 +1,85 @@ +{ + "_args": [ + [ + "d@~0.1.1", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol" + ] + ], + "_from": "d@>=0.1.1 <0.2.0", + "_id": "d@0.1.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/es6-symbol/d", + "_npmUser": { + "email": "medikoo+npm@medikoo.com", + "name": "medikoo" + }, + "_npmVersion": "1.4.3", + "_phantomChildren": {}, + "_requested": { + "name": "d", + "raw": "d@~0.1.1", + "rawSpec": "~0.1.1", + "scope": null, + "spec": ">=0.1.1 <0.2.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index/es6-symbol", + "/node-gyp/path-array/array-index/es6-symbol/es5-ext/es6-iterator" + ], + "_resolved": "https://registry.npmjs.org/d/-/d-0.1.1.tgz", + "_shasum": "da184c535d18d8ee7ba2aa229b914009fae11309", + "_shrinkwrap": null, + "_spec": "d@~0.1.1", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol", + "author": { + "email": "medyk@medikoo.com", + "name": "Mariusz Nowak", + "url": "http://www.medikoo.com/" + }, + "bugs": { + "url": "https://github.com/medikoo/d/issues" + }, + "dependencies": { + "es5-ext": "~0.10.2" + }, + "description": "Property descriptor factory", + "devDependencies": { + "tad": "~0.1.21" + }, + "directories": {}, + "dist": { + "shasum": "da184c535d18d8ee7ba2aa229b914009fae11309", + "tarball": "http://registry.npmjs.org/d/-/d-0.1.1.tgz" + }, + "homepage": "https://github.com/medikoo/d", + "keywords": [ + "descriptor", + "descriptors", + "ecma", + "ecmascript", + "es", + "meta", + "properties", + "property" + ], + "license": "MIT", + "maintainers": [ + { + "name": "medikoo", + "email": "medikoo+npm@medikoo.com" + } + ], + "name": "d", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/medikoo/d.git" + }, + "scripts": { + "test": "node node_modules/tad/bin/tad" + }, + "version": "0.1.1" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/auto-bind.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/auto-bind.js new file mode 100644 index 0000000000..89edfb88bb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/auto-bind.js @@ -0,0 +1,12 @@ +'use strict'; + +var d = require('../'); + +module.exports = function (t, a) { + var o = Object.defineProperties({}, t({ + bar: d(function () { return this === o; }), + bar2: d(function () { return this; }) + })); + + a.deep([(o.bar)(), (o.bar2)()], [true, o]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/index.js new file mode 100644 index 0000000000..3db0af10ac --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/index.js @@ -0,0 +1,182 @@ +'use strict'; + +var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; + +module.exports = function (t, a) { + var o, c, cg, cs, ce, ceg, ces, cew, cw, e, eg, es, ew, v, vg, vs, w, df, dfg + , dfs; + + o = Object.create(Object.prototype, { + c: t('c', c = {}), + cgs: t.gs('c', cg = function () {}, cs = function () {}), + ce: t('ce', ce = {}), + cegs: t.gs('ce', ceg = function () {}, ces = function () {}), + cew: t('cew', cew = {}), + cw: t('cw', cw = {}), + e: t('e', e = {}), + egs: t.gs('e', eg = function () {}, es = function () {}), + ew: t('ew', ew = {}), + v: t('', v = {}), + vgs: t.gs('', vg = function () {}, vs = function () {}), + w: t('w', w = {}), + + df: t(df = {}), + dfgs: t.gs(dfg = function () {}, dfs = function () {}) + }); + + return { + c: function (a) { + var d = getOwnPropertyDescriptor(o, 'c'); + a(d.value, c, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, true, "Configurable"); + a(d.enumerable, false, "Enumerable"); + a(d.writable, false, "Writable"); + + d = getOwnPropertyDescriptor(o, 'cgs'); + a(d.value, undefined, "GS Value"); + a(d.get, cg, "GS Get"); + a(d.set, cs, "GS Set"); + a(d.configurable, true, "GS Configurable"); + a(d.enumerable, false, "GS Enumerable"); + a(d.writable, undefined, "GS Writable"); + }, + ce: function (a) { + var d = getOwnPropertyDescriptor(o, 'ce'); + a(d.value, ce, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, true, "Configurable"); + a(d.enumerable, true, "Enumerable"); + a(d.writable, false, "Writable"); + + d = getOwnPropertyDescriptor(o, 'cegs'); + a(d.value, undefined, "GS Value"); + a(d.get, ceg, "GS Get"); + a(d.set, ces, "GS Set"); + a(d.configurable, true, "GS Configurable"); + a(d.enumerable, true, "GS Enumerable"); + a(d.writable, undefined, "GS Writable"); + }, + cew: function (a) { + var d = getOwnPropertyDescriptor(o, 'cew'); + a(d.value, cew, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, true, "Configurable"); + a(d.enumerable, true, "Enumerable"); + a(d.writable, true, "Writable"); + }, + cw: function (a) { + var d = getOwnPropertyDescriptor(o, 'cw'); + a(d.value, cw, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, true, "Configurable"); + a(d.enumerable, false, "Enumerable"); + a(d.writable, true, "Writable"); + }, + e: function (a) { + var d = getOwnPropertyDescriptor(o, 'e'); + a(d.value, e, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, false, "Configurable"); + a(d.enumerable, true, "Enumerable"); + a(d.writable, false, "Writable"); + + d = getOwnPropertyDescriptor(o, 'egs'); + a(d.value, undefined, "GS Value"); + a(d.get, eg, "GS Get"); + a(d.set, es, "GS Set"); + a(d.configurable, false, "GS Configurable"); + a(d.enumerable, true, "GS Enumerable"); + a(d.writable, undefined, "GS Writable"); + }, + ew: function (a) { + var d = getOwnPropertyDescriptor(o, 'ew'); + a(d.value, ew, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, false, "Configurable"); + a(d.enumerable, true, "Enumerable"); + a(d.writable, true, "Writable"); + }, + v: function (a) { + var d = getOwnPropertyDescriptor(o, 'v'); + a(d.value, v, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, false, "Configurable"); + a(d.enumerable, false, "Enumerable"); + a(d.writable, false, "Writable"); + + d = getOwnPropertyDescriptor(o, 'vgs'); + a(d.value, undefined, "GS Value"); + a(d.get, vg, "GS Get"); + a(d.set, vs, "GS Set"); + a(d.configurable, false, "GS Configurable"); + a(d.enumerable, false, "GS Enumerable"); + a(d.writable, undefined, "GS Writable"); + }, + w: function (a) { + var d = getOwnPropertyDescriptor(o, 'w'); + a(d.value, w, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, false, "Configurable"); + a(d.enumerable, false, "Enumerable"); + a(d.writable, true, "Writable"); + }, + d: function (a) { + var d = getOwnPropertyDescriptor(o, 'df'); + a(d.value, df, "Value"); + a(d.get, undefined, "Get"); + a(d.set, undefined, "Set"); + a(d.configurable, true, "Configurable"); + a(d.enumerable, false, "Enumerable"); + a(d.writable, true, "Writable"); + + d = getOwnPropertyDescriptor(o, 'dfgs'); + a(d.value, undefined, "GS Value"); + a(d.get, dfg, "GS Get"); + a(d.set, dfs, "GS Set"); + a(d.configurable, true, "GS Configurable"); + a(d.enumerable, false, "GS Enumerable"); + a(d.writable, undefined, "GS Writable"); + }, + Options: { + v: function (a) { + var x = {}, d = t(x, { foo: true }); + a.deep(d, { configurable: true, enumerable: false, writable: true, + value: x, foo: true }, "No descriptor"); + d = t('c', 'foo', { marko: 'elo' }); + a.deep(d, { configurable: true, enumerable: false, writable: false, + value: 'foo', marko: 'elo' }, "Descriptor"); + }, + gs: function (a) { + var gFn = function () {}, sFn = function () {}, d; + d = t.gs(gFn, sFn, { foo: true }); + a.deep(d, { configurable: true, enumerable: false, get: gFn, set: sFn, + foo: true }, "No descriptor"); + d = t.gs(null, sFn, { foo: true }); + a.deep(d, { configurable: true, enumerable: false, get: undefined, + set: sFn, foo: true }, "No descriptor: Just set"); + d = t.gs(gFn, { foo: true }); + a.deep(d, { configurable: true, enumerable: false, get: gFn, + set: undefined, foo: true }, "No descriptor: Just get"); + + d = t.gs('e', gFn, sFn, { bar: true }); + a.deep(d, { configurable: false, enumerable: true, get: gFn, set: sFn, + bar: true }, "Descriptor"); + d = t.gs('e', null, sFn, { bar: true }); + a.deep(d, { configurable: false, enumerable: true, get: undefined, + set: sFn, bar: true }, "Descriptor: Just set"); + d = t.gs('e', gFn, { bar: true }); + a.deep(d, { configurable: false, enumerable: true, get: gFn, + set: undefined, bar: true }, "Descriptor: Just get"); + } + } + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/lazy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/lazy.js new file mode 100644 index 0000000000..8266deb240 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/d/test/lazy.js @@ -0,0 +1,77 @@ +'use strict'; + +var d = require('../') + + , getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor; + +module.exports = function (t, a) { + var Foo = function () {}, i = 1, o, o2, desc; + Object.defineProperties(Foo.prototype, t({ + bar: d(function () { return ++i; }), + bar2: d(function () { return this.bar + 23; }), + bar3: d(function () { return this.bar2 + 34; }, { desc: 'ew' }), + bar4: d(function () { return this.bar3 + 12; }, { cacheName: '_bar4_' }), + bar5: d(function () { return this.bar4 + 3; }, + { cacheName: '_bar5_', desc: 'e' }) + })); + + desc = getOwnPropertyDescriptor(Foo.prototype, 'bar'); + a(desc.configurable, true, "Configurable: default"); + a(desc.enumerable, false, "Enumerable: default"); + + o = new Foo(); + a.deep([o.bar, o.bar2, o.bar3, o.bar4, o.bar5], [2, 25, 59, 71, 74], + "Values"); + + a.deep(getOwnPropertyDescriptor(o, 'bar3'), { configurable: false, + enumerable: true, writable: true, value: 59 }, "Desc"); + a(o.hasOwnProperty('bar4'), false, "Cache not exposed"); + desc = getOwnPropertyDescriptor(o, 'bar5'); + a.deep(desc, { configurable: false, + enumerable: true, get: desc.get, set: desc.set }, "Cache & Desc: desc"); + + o2 = Object.create(o); + o2.bar = 30; + o2.bar3 = 100; + + a.deep([o2.bar, o2.bar2, o2.bar3, o2.bar4, o2.bar5], [30, 25, 100, 112, 115], + "Extension Values"); + + Foo = function () {}; + Object.defineProperties(Foo.prototype, t({ + test: d('w', function () { return 'raz'; }), + test2: d('', function () { return 'raz'; }, { desc: 'w' }), + test3: d('', function () { return 'raz'; }, + { cacheName: '__test3__', desc: 'w' }), + test4: d('w', 'bar') + })); + + o = new Foo(); + o.test = 'marko'; + a.deep(getOwnPropertyDescriptor(o, 'test'), + { configurable: false, enumerable: false, writable: true, value: 'marko' }, + "Set before get"); + o.test2 = 'marko2'; + a.deep(getOwnPropertyDescriptor(o, 'test2'), + { configurable: false, enumerable: false, writable: true, value: 'marko2' }, + "Set before get: Custom desc"); + o.test3 = 'marko3'; + a.deep(getOwnPropertyDescriptor(o, '__test3__'), + { configurable: false, enumerable: false, writable: true, value: 'marko3' }, + "Set before get: Custom cache name"); + a(o.test4, 'bar', "Resolve by value"); + + a.h1("Flat"); + Object.defineProperties(Foo.prototype, t({ + flat: d(function () { return 'foo'; }, { flat: true }), + flat2: d(function () { return 'bar'; }, { flat: true }) + })); + + a.h2("Instance"); + a(o.flat, 'foo', "Value"); + a(o.hasOwnProperty('flat'), false, "Instance"); + a(Foo.prototype.flat, 'foo', "Prototype"); + + a.h2("Direct"); + a(Foo.prototype.flat2, 'bar'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lint b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lint new file mode 100644 index 0000000000..d1da610376 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lint @@ -0,0 +1,38 @@ +@root + +module + +indent 2 +maxlen 100 +tabs + +ass +continue +forin +nomen +plusplus +vars + +./global.js +./function/_define-length.js +./function/#/copy.js +./object/unserialize.js +./test/function/valid-function.js +evil + +./math/_pack-ieee754.js +./math/_unpack-ieee754.js +./math/clz32/shim.js +./math/imul/shim.js +./number/to-uint32.js +./string/#/at.js +bitwise + +./math/fround/shim.js +predef+ Float32Array + +./object/first-key.js +forin + +./test/reg-exp/#/index.js +predef+ __dirname diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lintignore b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lintignore new file mode 100644 index 0000000000..eece4ff3c7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.lintignore @@ -0,0 +1,9 @@ +/string/#/normalize/_data.js +/test/boolean/is-boolean.js +/test/date/is-date.js +/test/number/is-number.js +/test/object/is-copy.js +/test/object/is-number-value.js +/test/object/is-object.js +/test/reg-exp/is-reg-exp.js +/test/string/is-string.js diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.npmignore new file mode 100644 index 0000000000..eb09b500d6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.npmignore @@ -0,0 +1,4 @@ +.DS_Store +/node_modules +/.lintcache +/npm-debug.log diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.travis.yml new file mode 100644 index 0000000000..e8e18ee77d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/.travis.yml @@ -0,0 +1,15 @@ +sudo: false # http://docs.travis-ci.com/user/workers/container-based-infrastructure/ +language: node_js +node_js: + - 0.12 + - 4 + - 5 + +before_install: + - mkdir node_modules; ln -s ../ node_modules/es5-ext + +notifications: + email: + - medikoo+es5-ext@medikoo.com + +script: "npm test && npm run lint" diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/CHANGES b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/CHANGES new file mode 100644 index 0000000000..92ee5f6ef6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/CHANGES @@ -0,0 +1,628 @@ +v0.10.11 -- 2015.12.18 +* Ensure that check for implementation of RegExp flags doesn't crash in V8 (thanks @mathiasbynens) + +v0.10.10 -- 2015.12.11 +* Add Object.isNumberValue util + +v0.10.9 -- 2015.12.01 +* Add Object.ensureNaturalNumber and Object.ensureNaturalNumberValue + +v0.10.8 -- 2015.10.02 +* Add Number.isNatural +* Add Object.find and Object.findKey +* Support arrays in Object.copyDeep +* Fix iteration issue in forEachRight and someRight +* Fix detection of native sinh +* Depend on es6-symbol v3 + +v0.10.7 -- 2015.04.22 +* New utlitities. They're convention differs from v0.10, as they were supposed to land in v1. + Still they're non breaking and start the conventions to be used in v1 + * Object.validateArrayLike + * Object.validateArrayLikeObject + * Object.validateStringifiable + * Object.validateStringifiableValue + * Universal utilities for array-like/iterable objects + * Iterable.is + * Iterable.validate + * Iterable.validateObject + * Iterable.forEach +* Fix camelToHyphen resolution, it must be absolutely reversable by hyphenToCamel +* Fix calculations of large numbers in Math.tanh +* Fix algorithm of Math.sinh +* Fix indexes to not use real symbols +* Fix length of String.fromCodePoint +* Fix tests of Array#copyWithin +* Update Travis CI configuration + +v0.10.6 -- 2015.02.02 +* Fix handling of infinite values in Math.trunc +* Fix handling of getters in Object.normalizeOptions + +v0.10.5 -- 2015.01.20 +* Add Function#toStringTokens +* Add Object.serialize and Object.unserialize +* Add String.randomUniq +* Fix Strin#camelToHyphen issue with tokens that end with digit +* Optimise Number.isInteger logic +* Improve documentation +* Configure lint scripts +* Fix spelling of LICENSE + +v0.10.4 -- 2014.04.30 +* Assure maximum spec compliance of Array.of and Array.from (thanks @mathiasbynens) +* Improve documentations + +v0.10.3 -- 2014.04.29 +Provide accurate iterators handling: +* Array.from improvements: + * Assure right unicode symbols resolution when processing strings in Array.from + * Rely on ES6 symbol shim and use native @@iterator Symbol if provided by environment +* Add methods: + * Array.prototype.entries + * Array.prototype.keys + * Array.prototype.values + * Array.prototype[@@iterator] + * String.prototype[@@iterator] + +Improve documentation + +v0.10.2 -- 2014.04.24 +- Simplify and deprecate `isCallable`. It seems in ES5 based engines there are + no callable objects which are `typeof obj !== 'function'` +- Update Array.from map callback signature (up to latest resolution of TC39) +- Improve documentation + +v0.10.1 -- 2014.04.14 +Bump version for npm +(Workaround for accidental premature publish & unpublish of v0.10.0 a while ago) + +v0.10.0 -- 2014.04.13 +Major update: +- All methods and function specified for ECMAScript 6 are now introduced as + shims accompanied with functions through which (optionally) they can be + implementend on native objects +- Filename convention was changed to shorter and strictly lower case names. e.g. + `lib/String/prototype/starts-with` became `string/#/starts-with` +- Generated functions are guaranteed to have expected length +- Objects with null prototype (created via `Object.create(null)`) are widely + supported (older version have crashed due to implied `obj.hasOwnProperty` and + related invocations) +- Support array subclasses +- When handling lists do not limit its length to Uint32 range +- Use newly introduced `Object.eq` for strict equality in place of `Object.is` +- Iteration of Object have been improved so properties that were hidden or + removed after iteration started are not iterated. + +Additions: +- `Array.isPlainArray` +- `Array.validArray` +- `Array.prototype.concat` (as updated with ES6) +- `Array.prototype.copyWithin` (as introduced with ES6) +- `Array.prototype.fill` (as introduced with ES6) +- `Array.prototype.filter` (as updated with ES6) +- `Array.prototype.findIndex` (as introduced with ES6) +- `Array.prototype.map` (as updated with ES6) +- `Array.prototype.separate` +- `Array.prototype.slice` (as updated with ES6) +- `Array.prototype.splice` (as updated with ES6) +- `Function.prototype.copy` +- `Math.acosh` (as introduced with ES6) +- `Math.atanh` (as introduced with ES6) +- `Math.cbrt` (as introduced with ES6) +- `Math.clz32` (as introduced with ES6) +- `Math.cosh` (as introduced with ES6) +- `Math.expm1` (as introduced with ES6) +- `Math.fround` (as introduced with ES6) +- `Math.hypot` (as introduced with ES6) +- `Math.imul` (as introduced with ES6) +- `Math.log2` (as introduced with ES6) +- `Math.log10` (as introduced with ES6) +- `Math.log1p` (as introduced with ES6) +- `Math.sinh` (as introduced with ES6) +- `Math.tanh` (as introduced with ES6) +- `Math.trunc` (as introduced with ES6) +- `Number.EPSILON` (as introduced with ES6) +- `Number.MIN_SAFE_INTEGER` (as introduced with ES6) +- `Number.MAX_SAFE_INTEGER` (as introduced with ES6) +- `Number.isFinite` (as introduced with ES6) +- `Number.isInteger` (as introduced with ES6) +- `Number.isSafeInteger` (as introduced with ES6) +- `Object.create` (with fix for V8 issue which disallows prototype turn of + objects derived from null +- `Object.eq` - Less restrictive version of `Object.is` based on SameValueZero + algorithm +- `Object.firstKey` +- `Object.keys` (as updated with ES6) +- `Object.mixinPrototypes` +- `Object.primitiveSet` +- `Object.setPrototypeOf` (as introduced with ES6) +- `Object.validObject` +- `RegExp.escape` +- `RegExp.prototype.match` (as introduced with ES6) +- `RegExp.prototype.replace` (as introduced with ES6) +- `RegExp.prototype.search` (as introduced with ES6) +- `RegExp.prototype.split` (as introduced with ES6) +- `RegExp.prototype.sticky` (as introduced with ES6) +- `RegExp.prototype.unicode` (as introduced with ES6) +- `String.fromCodePoint` (as introduced with ES6) +- `String.raw` (as introduced with ES6) +- `String.prototype.at` +- `String.prototype.codePointAt` (as introduced with ES6) +- `String.prototype.normalize` (as introduced with ES6) +- `String.prototype.plainReplaceAll` + +Removals: +- `reserved` set +- `Array.prototype.commonLeft` +- `Function.insert` +- `Function.remove` +- `Function.prototype.silent` +- `Function.prototype.wrap` +- `Object.descriptor` Move to external `d` project. + See: https://github.com/medikoo/d +- `Object.diff` +- `Object.extendDeep` +- `Object.reduce` +- `Object.values` +- `String.prototype.trimCommonLeft` + +Renames: +- `Function.i` into `Function.identity` +- `Function.k` into `Function.constant` +- `Number.toInt` into `Number.toInteger` +- `Number.toUint` into `Number.toPosInteger` +- `Object.extend` into `Object.assign` (as introduced in ES 6) +- `Object.extendProperties` into `Object.mixin`, with improved internal + handling, so it matches temporarily specified `Object.mixin` for ECMAScript 6 +- `Object.isList` into `Object.isArrayLike` +- `Object.mapToArray` into `Object.toArray` (with fixed function length) +- `Object.toPlainObject` into `Object.normalizeOptions` (as this is the real + use case where we use this function) +- `Function.prototype.chain` into `Function.prototype.compose` +- `Function.prototype.match` into `Function.prototype.spread` +- `String.prototype.format` into `String.formatMethod` + +Improvements & Fixes: +- Remove workaround for primitive values handling in object iterators +- `Array.from`: Update so it follows ES 6 spec +- `Array.prototype.compact`: filters just null and undefined values + (not all falsies) +- `Array.prototype.eIndexOf` and `Array.prototype.eLastIndexOf`: fix position + handling, improve internals +- `Array.prototype.find`: return undefined not null, in case of not found + (follow ES 6) +- `Array.prototype.remove` fix function length +- `Error.custom`: simplify, Custom class case is addressed by outer + `error-create` project -> https://github.com/medikoo/error-create +- `Error.isError` true only for Error instances (remove detection of host + Exception objects) +- `Number.prototype.pad`: Normalize negative pad +- `Object.clear`: Handle errors same way as in `Object.assign` +- `Object.compact`: filters just null and undefined values (not all falsies) +- `Object.compare`: Take into account NaN values +- `Object.copy`: Split into `Object.copy` and `Object.copyDeep` +- `Object.isCopy`: Separate into `Object.isCopy` and `Object.isCopyDeep`, where + `isCopyDeep` handles nested plain objects and plain arrays only +- `String.prototype.endsWith`: Adjust up to ES6 specification +- `String.prototype.repeat`: Adjust up to ES6 specification and improve algorithm +- `String.prototype.simpleReplace`: Rename into `String.prototype.plainReplace` +- `String.prototype.startsWith`: Adjust up to ES6 specification +- Update lint rules, and adjust code to that +- Update Travis CI configuration +- Remove Makefile (it's cross-env utility) + +v0.9.2 -- 2013.03.11 +Added: +* Array.prototype.isCopy +* Array.prototype.isUniq +* Error.CustomError +* Function.validFunction +* Object.extendDeep +* Object.descriptor.binder +* Object.safeTraverse +* RegExp.validRegExp +* String.prototype.capitalize +* String.prototype.simpleReplace + +Fixed: +* Fix Array.prototype.diff for sparse arrays +* Accept primitive objects as input values in Object iteration methods and + Object.clear, Object.count, Object.diff, Object.extend, + Object.getPropertyNames, Object.values +* Pass expected arguments to callbacks of Object.filter, Object.mapKeys, + Object.mapToArray, Object.map +* Improve callable callback support in Object.mapToArray + +v0.9.1 -- 2012.09.17 +* Object.reduce - reduce for hash-like collections +* Accapt any callable object as callback in Object.filter, mapKeys and map +* Convention cleanup + +v0.9.0 -- 2012.09.13 +We're getting to real solid API + +Removed: +* Function#memoize - it's grown up to be external package, to be soon published + as 'memoizee' +* String.guid - it doesn't fit es5-ext (extensions) concept, will be provided as + external package +# Function.arguments - obsolete +# Function.context - obsolete +# Function#flip - not readable when used, so it was never used +# Object.clone - obsolete and confusing + +Added: +* String#camelToHyphen - String format convertion + +Renamed: +* String#dashToCamelCase -> String#hyphenToCamel + +Fixes: +* Object.isObject - Quote names in literals that match reserved keywords + (older implementations crashed on that) +* String#repeat - Do not accept negative values (coerce them to 1) + +Improvements: +* Array#remove - Accepts many arguments, we can now remove many values at once +* Object iterators (forEach, map, some) - Compare function invoked with scope + object bound to this +* Function#curry - Algorithm cleanup +* Object.isCopy - Support for all types, not just plain objects +* Object.isPlainObject - Support for cross-frame objects +* Do not memoize any of the functions, it shouldn't be decided internally +* Remove Object.freeze calls in reserved, it's not up to convention +* Improved documentation +* Better linting (hard-core approach using both JSLint mod and JSHint) +* Optional arguments are now documented in funtions signature + +v0.8.2 -- 2012.06.22 +Fix errors in Array's intersection and exclusion methods, related to improper +usage of contains method + +v0.8.1 -- 2012.06.13 +Reorganized internal logic of Function.prototype.memoize. So it's more safe now +and clears cache properly. Additionally preventCache option was provided. + +v0.8.0 -- 2012.05.28 +Again, major overhaul. Probably last experimental stuff was trashed, all API +looks more like standard extensions now. + +Changes: +* Turn all Object.prototype extensions into functions and move them to Object +namespace. We learned that extending Object.prototype is bad idea in any case. +* Rename Function.prototype.curry into Function.prototype.partial. This function + is really doing partial application while currying is slightly different + concept. +* Convert Function.prototype.ncurry to new implementation of + Function.prototype.curry, it now serves real curry concept additionaly it + covers use cases for aritize and hold, which were removed. +* Rename Array's peek to last, and provide support for sparse arrays in it +* Rename Date's monthDaysCount into daysInMonth +* Simplify object iterators, now order of iteration can be configured with just + compareFn argument (no extra byKeys option) +* Rename Object.isDuplicate to Object.isCopy +* Rename Object.isEqual to Object.is which is compatible with future 'is' + keyword +* Function.memoize is now Function.prototype.memoize. Additionally clear cache + functionality is added, and access to original arguments object. +* Rename validation functions: assertNotNull to validValue, assertCallable to + validCallable. validValue was moved to Object namespace. On success they now + return validated value instead of true, it supports better composition. + Additionally created Date.validDate and Error.validError +* All documentation is now held in README.md not in code files. +* Move guid to String namespace. All guids now start with numbers. +* Array.generate: fill argument is now optional +* Object.toArray is now Array.from (as new ES6 specification draft suggests) +* All methods that rely on indexOf or lastIndexOf, now rely on egal (Object.is) + versions of them (eIndexOf, eLastIndexOf) +* Turn all get* functions that returned methods into actuall methods (get* + functionality can still be achieved with help of Function.prototype.partial). + So: Date.getFormat is now Date.prototype.format, + Number.getPad is now Number.prototype.pad, + String.getFormat is now String.prototype.format, + String.getIndent is now String.prototype.indent, + String.getPad is now String.prototype.pad +* Refactored Object.descriptor, it is now just two functions, main one and + main.gs, main is for describing values, and gs for describing getters and + setters. Configuration is passed with first argument as string e.g. 'ce' for + configurable and enumerable. If no configuration string is provided then by + default it returns configurable and writable but not enumerable for value or + configurable but not enumerable for getter/setter +* Function.prototype.silent now returns prepared function (it was + expected to be fixed for 0.7) +* Reserved keywords map (reserved) is now array not hash. +* Object.merge is now Object.extend (while former Object.extend was completely + removed) - 'extend' implies that we change object, not creating new one (as + 'merge' may imply). Similarily Object.mergeProperties was renamed to + Object.extendProperties +* Position argument support in Array.prototype.contains and + String.prototype.contains (so it follows ES6 specification draft) +* endPosition argument support in String.prototype.endsWith and fromPosition + argument support in String.prototype.startsWith (so it follows ES6 + specification draft) +* Better and cleaner String.prototype.indent implementation. No default value + for indent string argument, optional nest value (defaults to 1), remove + nostart argument +* Correct length values for most methods (so they reflect length of similar + methods in standard) +* Length argument is now optional in number and string pad methods. +* Improve arguments validation in general, so it adheres to standard conventions +* Fixed format of package.json + +Removed methods and functions: +* Object.prototype.slice - Object is not ordered collection, so slice doesn't + make sense. +* Function's rcurry, rncurry, s - too cumbersome for JS, not many use cases for + that +* Function.prototype.aritize and Function.prototype.hold - same functionality + can be achieved with new Function.prototype.curry +* Function.prototype.log - provided more generic Function.prototype.wrap for + same use case +* getNextIdGenerator - no use case for that (String.guid should be used if + needed) +* Object.toObject - Can be now acheived with Object(validValue(x)) +* Array.prototype.someValue - no real use case (personally used once and + case was already controversial) +* Date.prototype.duration - moved to external package +* Number.getAutoincrement - No real use case +* Object.prototype.extend, Object.prototype.override, + Object.prototype.plainCreate, Object.prototype.plainExtend - It was probably + too complex, same should be achieved just with Object.create, + Object.descriptor and by saving references to super methods in local scope. +* Object.getCompareBy - Functions should be created individually for each use + case +* Object.get, Object.getSet, Object.set, Object.unset - Not many use cases and + same can be easily achieved with simple inline function +* String.getPrefixWith - Not real use case for something that can be easily + achieved with '+' operator +* Object.isPrimitive - It's just negation of Object.isObject +* Number.prototype.isLess, Number.prototype.isLessOrEqual - they shouldn't be in + Number namespace and should rather be addressed with simple inline functions. +* Number.prototype.subtract - Should rather be addressed with simple inline + function + +New methods and functions: +* Array.prototype.lastIndex - Returns last declared index in array +* String.prototype.last - last for strings +* Function.prototype.wrap - Wrap function with other, it allows to specify + before and after behavior transform return value or prevent original function + from being called. +* Math.sign - Returns sign of a number (already in ES6 specification draft) +* Number.toInt - Converts value to integer (already in ES6 specification draft) +* Number.isNaN - Returns true if value is NaN (already in ES6 specification + draft) +* Number.toUint - Converts value to unsigned integer +* Number.toUint32 - Converts value to 32bit unsigned integer +* Array.prototype.eIndexOf, eLastIndexOf - Egal version (that uses Object.is) of + standard methods (all methods that were using native indexOf or lastIndexOf + now uses eIndexOf and elastIndexOf respectively) +* Array.of - as it's specified for ES6 + +Fixes: +* Fixed binarySearch so it always returns valid list index +* Object.isList - it failed on lists that are callable (e.g. NodeList in Nitro + engine) +* Object.map now supports third argument for callback + +v0.7.1 -- 2012.01.05 +New methods: +* Array.prototype.firstIndex - returns first valid index of array (for + sparse arrays it may not be '0' + +Improvements: +* Array.prototype.first - now returns value for index returned by firstIndex +* Object.prototype.mapToArray - can be called without callback, then array of + key-value pairs is returned + +Fixes +* Array.prototype.forEachRight, object's length read through UInt32 conversion + +v0.7.0 -- 2011.12.27 +Major update. +Stepped back from experimental ideas and introduced more standard approach +taking example from how ES5 methods and functions are designed. One exceptions +is that, we don’t refrain from declaring methods for Object.prototype - it’s up +to developer whether how he decides to use it in his context (as function or as +method). + +In general: +* Removed any method 'functionalization' and functionalize method itself. + es5-ext declares plain methods, which can be configured to work as functions + with call.bind(method) - see documentation. +* Removed separation of Object methods for ES5 (with descriptors) and + ES3 (plain) - we're following ES5 idea on that, some methods are intended just + for enumerable properties and some are for all properties, all are declared + for Object.prototype +* Removed separation of Array generic (collected in List folder) and not generic + methods (collected in Array folder). Now all methods are generic and are in + Array/prototype folder. This separation also meant, that methods in Array are + usually destructive. We don’t do that separation now, there’s generally no use + case for destructive iterators, we should be fine with one version of each + method, (same as ES5 is fine with e.g. one, non destructive 'filter' method) +* Folder structure resembles tree of native ES5 Objects +* All methods are written with ES5 conventions in mind, it means that most + methods are generic and can be run on any object. In more detail: + ** Array.prototype and Object.prototype methods can be run on any object (any + not null or undefined value), + ** Date.prototype methods should be called only on Date instances. + ** Function.prototype methods can be called on any callable objects (not + necessarily functions) + ** Number.prototype & String.prototype methods can be called on any value, in + case of Number it it’ll be degraded to number, in case of string it’ll be + degraded to string. +* Travis CI support (only for Node v0.6 branch, as v0.4 has buggy V8 version) + +Improvements for existing functions and methods: +* Function.memoize (was Function.cache) is now fully generic, can operate on any + type of arguments and it’s NaN safe (all NaN objects are considered equal) +* Method properties passed to Object.prototype.extend or + Object.prototype.override can aside of _super optionally take prototype object + via _proto argument +* Object iterators: forEach, mapToArray and every can now iterate in specified + order +* pluck, invoke and other functions that return reusable functions or methods + have now their results memoized. + +New methods: +* Global: assertNotNull, getNextIdGenerator, guid, isEqual, isPrimitive, + toObject +* Array: generate +* Array.prototype: binarySearch, clear, contains, diff, exclusion, find, first, + forEachRight, group, indexesOf, intersection, remove, someRight, someValue +* Boolean: isBoolean +* Date: isDate +* Function: arguments, context, insert, isArguments, remove +* Function.prototype: not, silent +* Number: getAutoincrement, isNumber +* Number.prototype: isLessOrEqual, isLess, subtract +* Object: assertCallable, descriptor (functions for clean descriptors), + getCompareBy, isCallable, isObject +* Object.prototype: clone (real clone), compact, count, diff, empty, + getPropertyNames, get, keyOf, mapKeys, override, plainCreate, plainExtend, + slice, some, unset +* RegExp: isRegExp +* String: getPrefixWith, isString +* String.prototype: caseInsensitiveCompare, contains, isNumeric + +Renamed methods: +* Date.clone -> Date.prototype.copy +* Date.format -> Date.getFormat +* Date/day/floor -> Date.prototype.floorDay +* Date/month/floor -> Date.prototype.floorMonth +* Date/month/year -> Date.prototype.floorYear +* Function.cache -> Function.memoize +* Function.getApplyArg -> Function.prototype.match +* Function.sequence -> Function.prototype.chain +* List.findSameStartLength -> Array.prototype.commonLeft +* Number.pad -> Number.getPad +* Object/plain/clone -> Object.prototype.copy +* Object/plain/elevate -> Object.prototype.flatten +* Object/plain/same -> Object.prototype.isDuplicate +* Object/plain/setValue -> Object.getSet +* String.format -> String.getFormat +* String.indent -> String.getIndent +* String.pad -> String.getPad +* String.trimLeftStr -> String.prototype.trimCommonLeft +* Object.merge -> Object.prototype.mergeProperties +* Object/plain/pluck -> Object.prototype.get +* Array.clone is now Array.prototype.copy and can be used also on any array-like + objects +* List.isList -> Object.isList +* List.toArray -> Object.prototype.toArray +* String/convert/dashToCamelCase -> String.prototype.dashToCamelCase + +Removed methods: +* Array.compact - removed destructive version (that operated on same array), we + have now non destructive version as Array.prototype.compact. +* Function.applyBind -> use apply.bind directly +* Function.bindBind -> use bind.bind directly +* Function.callBind -> use call.bind directly +* Fuction.clone -> no valid use case +* Function.dscope -> controversial approach, shouldn’t be considered seriously +* Function.functionalize -> It was experimental but standards are standards +* List/sort/length -> It can be easy obtained by Object.getCompareBy(‘length’) +* List.concat -> Concat’s for array-like’s makes no sense, just convert to array + first +* List.every -> Use Array.prototype.every directly +* List.filter -> Use Array.prototype.filter directly +* List.forEach -> User Array.prototype.forEach directly +* List.isListObject -> No valid use case, do: isList(list) && (typeof list === + 'object’) +* List.map -> Use Array.prototype.map directly +* List.reduce -> Use Array.prototype.reduce directly +* List.shiftSame -> Use Array.prototype.commonLeft and do slice +* List.slice -> Use Array.prototype.slice directly +* List.some -> Use Array.prototype.some directly +* Object.bindMethods -> it was version that considered descriptors, we have now + Object.prototype.bindMethods which operates only on enumerable properties +* Object.every -> version that considered all properties, we have now + Object.prototype.every which iterates only enumerables +* Object.invoke -> no use case +* Object.mergeDeep -> no use case +* Object.pluck -> no use case +* Object.same -> it considered descriptors, now there’s only Object.isDuplicate + which compares only enumerable properties +* Object.sameType -> no use case +* Object.toDescriptor and Object.toDescriptors -> replaced by much nicer + Object.descriptor functions +* Object/plain/link -> no use case (it was used internally only by + Object/plain/merge) +* Object/plain/setTrue -> now easily configurable by more universal + Object.getSet(true) +* String.trimRightStr -> Eventually String.prototype.trimCommonRight will be + added + +v0.6.3 -- 2011.12.12 +* Cleared npm warning for misnamed property in package.json + +v0.6.2 -- 2011.08.12 +* Calling String.indent without scope (global scope then) now treated as calling + it with null scope, it allows more direct invocations when using default nest + string: indent().call(str, nest) + +v0.6.1 -- 2011.08.08 +* Added TAD test suite to devDependencies, configured test commands. + Tests can be run with 'make test' or 'npm test' + +v0.6.0 -- 2011.08.07 +New methods: +* Array: clone, compact (in place) +* Date: format, duration, clone, monthDaysCount, day.floor, month.floor, + year.floor +* Function: getApplyArg, , ncurry, rncurry, hold, cache, log +* List: findSameStartLength, shiftSame, peek, isListObject +* Number: pad +* Object: sameType, toString, mapToArray, mergeDeep, toDescriptor, + toDescriptors, invoke +* String: startsWith, endsWith, indent, trimLeftStr, trimRightStr, pad, format + +Fixed: +* Object.extend does now prototypal extend as exptected +* Object.merge now tries to overwrite only configurable properties +* Function.flip + +Improved: +* Faster List.toArray +* Better global retrieval +* Functionalized all Function methods +* Renamed bindApply and bindCall to applyBind and callBind +* Removed Function.inherit (as it's unintuitive curry clone) +* Straightforward logic in Function.k +* Fixed naming of some tests files (letter case issue) +* Renamed Function.saturate into Function.lock +* String.dashToCamelCase digits support +* Strings now considered as List objects +* Improved List.compact +* Concise logic for List.concat +* Test wit TAD in clean ES5 context + +v0.5.1 -- 2011.07.11 +* Function's bindBind, bindCall and bindApply now more versatile + +v0.5.0 -- 2011.07.07 +* Removed Object.is and List.apply +* Renamed Object.plain.is to Object.plain.isPlainObject (keep naming convention + consistent) +* Improved documentation + +v0.4.0 -- 2011.07.05 +* Take most functions on Object to Object.plain to keep them away from object + descriptors +* Object functions with ES5 standard in mind (object descriptors) + +v0.3.0 -- 2011.06.24 +* New functions +* Consistent file naming (dash instead of camelCase) + +v0.2.1 -- 2011.05.28 +* Renamed Functions.K and Function.S to to lowercase versions (use consistent + naming) + +v0.2.0 -- 2011.05.28 +* Renamed Array folder to List (as its generic functions for array-like objects) +* Added Makefile +* Added various functions + +v0.1.0 -- 2011.05.24 +* Initial version diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/LICENSE new file mode 100644 index 0000000000..de39071f1b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2011-2015 Mariusz Nowak (www.medikoo.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/README.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/README.md new file mode 100644 index 0000000000..ad09fe2317 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/README.md @@ -0,0 +1,993 @@ +# es5-ext +## ECMAScript 5 extensions +### (with respect to ECMAScript 6 standard) + +Shims for upcoming ES6 standard and other goodies implemented strictly with ECMAScript conventions in mind. + +It's designed to be used in compliant ECMAScript 5 or ECMAScript 6 environments. Older environments are not supported, although most of the features should work with correct ECMAScript 5 shim on board. + +When used in ECMAScript 6 environment, native implementation (if valid) takes precedence over shims. + +### Installation + + $ npm install es5-ext + +To port it to Browser or any other (non CJS) environment, use your favorite CJS bundler. No favorite yet? Try: [Browserify](http://browserify.org/), [Webmake](https://github.com/medikoo/modules-webmake) or [Webpack](http://webpack.github.io/) + +### Usage + +#### ECMAScript 6 features + +You can force ES6 features to be implemented in your environment, e.g. following will assign `from` function to `Array` (only if it's not implemented already). + +```javascript +require('es5-ext/array/from/implement'); +Array.from('foo'); // ['f', 'o', 'o'] +``` + +You can also access shims directly, without fixing native objects. Following will return native `Array.from` if it's available and fallback to shim if it's not. + +```javascript +var aFrom = require('es5-ext/array/from'); +aFrom('foo'); // ['f', 'o', 'o'] +``` + +If you want to use shim unconditionally (even if native implementation exists) do: + +```javascript +var aFrom = require('es5-ext/array/from/shim'); +aFrom('foo'); // ['f', 'o', 'o'] +``` + +##### List of ES6 shims + +It's about properties introduced with ES6 and those that have been updated in new spec. + +- `Array.from` -> `require('es5-ext/array/from')` +- `Array.of` -> `require('es5-ext/array/of')` +- `Array.prototype.concat` -> `require('es5-ext/array/#/concat')` +- `Array.prototype.copyWithin` -> `require('es5-ext/array/#/copy-within')` +- `Array.prototype.entries` -> `require('es5-ext/array/#/entries')` +- `Array.prototype.fill` -> `require('es5-ext/array/#/fill')` +- `Array.prototype.filter` -> `require('es5-ext/array/#/filter')` +- `Array.prototype.find` -> `require('es5-ext/array/#/find')` +- `Array.prototype.findIndex` -> `require('es5-ext/array/#/find-index')` +- `Array.prototype.keys` -> `require('es5-ext/array/#/keys')` +- `Array.prototype.map` -> `require('es5-ext/array/#/map')` +- `Array.prototype.slice` -> `require('es5-ext/array/#/slice')` +- `Array.prototype.splice` -> `require('es5-ext/array/#/splice')` +- `Array.prototype.values` -> `require('es5-ext/array/#/values')` +- `Array.prototype[@@iterator]` -> `require('es5-ext/array/#/@@iterator')` +- `Math.acosh` -> `require('es5-ext/math/acosh')` +- `Math.asinh` -> `require('es5-ext/math/asinh')` +- `Math.atanh` -> `require('es5-ext/math/atanh')` +- `Math.cbrt` -> `require('es5-ext/math/cbrt')` +- `Math.clz32` -> `require('es5-ext/math/clz32')` +- `Math.cosh` -> `require('es5-ext/math/cosh')` +- `Math.exmp1` -> `require('es5-ext/math/expm1')` +- `Math.fround` -> `require('es5-ext/math/fround')` +- `Math.hypot` -> `require('es5-ext/math/hypot')` +- `Math.imul` -> `require('es5-ext/math/imul')` +- `Math.log1p` -> `require('es5-ext/math/log1p')` +- `Math.log2` -> `require('es5-ext/math/log2')` +- `Math.log10` -> `require('es5-ext/math/log10')` +- `Math.sign` -> `require('es5-ext/math/sign')` +- `Math.signh` -> `require('es5-ext/math/signh')` +- `Math.tanh` -> `require('es5-ext/math/tanh')` +- `Math.trunc` -> `require('es5-ext/math/trunc')` +- `Number.EPSILON` -> `require('es5-ext/number/epsilon')` +- `Number.MAX_SAFE_INTEGER` -> `require('es5-ext/number/max-safe-integer')` +- `Number.MIN_SAFE_INTEGER` -> `require('es5-ext/number/min-safe-integer')` +- `Number.isFinite` -> `require('es5-ext/number/is-finite')` +- `Number.isInteger` -> `require('es5-ext/number/is-integer')` +- `Number.isNaN` -> `require('es5-ext/number/is-nan')` +- `Number.isSafeInteger` -> `require('es5-ext/number/is-safe-integer')` +- `Object.assign` -> `require('es5-ext/object/assign')` +- `Object.keys` -> `require('es5-ext/object/keys')` +- `Object.setPrototypeOf` -> `require('es5-ext/object/set-prototype-of')` +- `RegExp.prototype.match` -> `require('es5-ext/reg-exp/#/match')` +- `RegExp.prototype.replace` -> `require('es5-ext/reg-exp/#/replace')` +- `RegExp.prototype.search` -> `require('es5-ext/reg-exp/#/search')` +- `RegExp.prototype.split` -> `require('es5-ext/reg-exp/#/split')` +- `RegExp.prototype.sticky` -> Implement with `require('es5-ext/reg-exp/#/sticky/implement')`, use as function with `require('es5-ext/reg-exp/#/is-sticky')` +- `RegExp.prototype.unicode` -> Implement with `require('es5-ext/reg-exp/#/unicode/implement')`, use as function with `require('es5-ext/reg-exp/#/is-unicode')` +- `String.fromCodePoint` -> `require('es5-ext/string/from-code-point')` +- `String.raw` -> `require('es5-ext/string/raw')` +- `String.prototype.codePointAt` -> `require('es5-ext/string/#/code-point-at')` +- `String.prototype.contains` -> `require('es5-ext/string/#/contains')` +- `String.prototype.endsWith` -> `require('es5-ext/string/#/ends-with')` +- `String.prototype.normalize` -> `require('es5-ext/string/#/normalize')` +- `String.prototype.repeat` -> `require('es5-ext/string/#/repeat')` +- `String.prototype.startsWith` -> `require('es5-ext/string/#/starts-with')` +- `String.prototype[@@iterator]` -> `require('es5-ext/string/#/@@iterator')` + +#### Non ECMAScript standard features + +__es5-ext__ provides also other utils, and implements them as if they were proposed for a standard. It mostly offers methods (not functions) which can directly be assigned to native prototypes: + +```javascript +Object.defineProperty(Function.prototype, 'partial', { value: require('es5-ext/function/#/partial'), + configurable: true, enumerable: false, writable: true }); +Object.defineProperty(Array.prototype, 'flatten', { value: require('es5-ext/array/#/flatten'), + configurable: true, enumerable: false, writable: true }); +Object.defineProperty(String.prototype, 'capitalize', { value: require('es5-ext/string/#/capitalize'), + configurable: true, enumerable: false, writable: true }); +``` + +See [es5-extend](https://github.com/wookieb/es5-extend#es5-extend), a great utility that automatically will extend natives for you. + +__Important:__ Remember to __not__ extend natives in scope of generic reusable packages (e.g. ones you intend to publish to npm). Extending natives is fine __only__ if you're the _owner_ of the global scope, so e.g. in final project you lead development of. + +When you're in situation when native extensions are not good idea, then you should use methods indirectly: + + +```javascript +var flatten = require('es5-ext/array/#/flatten'); + +flatten.call([1, [2, [3, 4]]]); // [1, 2, 3, 4] +``` + +for better convenience you can turn methods into functions: + + +```javascript +var call = Function.prototype.call +var flatten = call.bind(require('es5-ext/array/#/flatten')); + +flatten([1, [2, [3, 4]]]); // [1, 2, 3, 4] +``` + +You can configure custom toolkit (like [underscorejs](http://underscorejs.org/)), and use it throughout your application + +```javascript +var util = {}; +util.partial = call.bind(require('es5-ext/function/#/partial')); +util.flatten = call.bind(require('es5-ext/array/#/flatten')); +util.startsWith = call.bind(require('es5-ext/string/#/starts-with')); + +util.flatten([1, [2, [3, 4]]]); // [1, 2, 3, 4] +``` + +As with native ones most methods are generic and can be run on any type of object. + +## API + +### Global extensions + +#### global _(es5-ext/global)_ + +Object that represents global scope + +### Array Constructor extensions + +#### from(arrayLike[, mapFn[, thisArg]]) _(es5-ext/array/from)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.from). +Returns array representation of _iterable_ or _arrayLike_. If _arrayLike_ is an instance of array, its copy is returned. + +#### generate([length[, …fill]]) _(es5-ext/array/generate)_ + +Generate an array of pre-given _length_ built of repeated arguments. + +#### isPlainArray(x) _(es5-ext/array/is-plain-array)_ + +Returns true if object is plain array (not instance of one of the Array's extensions). + +#### of([…items]) _(es5-ext/array/of)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.of). +Create an array from given arguments. + +#### toArray(obj) _(es5-ext/array/to-array)_ + +Returns array representation of `obj`. If `obj` is already an array, `obj` is returned back. + +#### validArray(obj) _(es5-ext/array/valid-array)_ + +Returns `obj` if it's an array, otherwise throws `TypeError` + +### Array Prototype extensions + +#### arr.binarySearch(compareFn) _(es5-ext/array/#/binary-search)_ + +In __sorted__ list search for index of item for which _compareFn_ returns value closest to _0_. +It's variant of binary search algorithm + +#### arr.clear() _(es5-ext/array/#/clear)_ + +Clears the array + +#### arr.compact() _(es5-ext/array/#/compact)_ + +Returns a copy of the context with all non-values (`null` or `undefined`) removed. + +#### arr.concat() _(es5-ext/array/#/concat)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.prototype.concat). +ES6's version of `concat`. Supports `isConcatSpreadable` symbol, and returns array of same type as the context. + +#### arr.contains(searchElement[, position]) _(es5-ext/array/#/contains)_ + +Whether list contains the given value. + +#### arr.copyWithin(target, start[, end]) _(es5-ext/array/#/copy-within)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.copywithin). + +#### arr.diff(other) _(es5-ext/array/#/diff)_ + +Returns the array of elements that are present in context list but not present in other list. + +#### arr.eIndexOf(searchElement[, fromIndex]) _(es5-ext/array/#/e-index-of)_ + +_egal_ version of `indexOf` method. [_SameValueZero_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) logic is used for comparision + +#### arr.eLastIndexOf(searchElement[, fromIndex]) _(es5-ext/array/#/e-last-index-of)_ + +_egal_ version of `lastIndexOf` method. [_SameValueZero_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) logic is used for comparision + +#### arr.entries() _(es5-ext/array/#/entries)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.prototype.entries). +Returns iterator object, which traverses the array. Each value is represented with an array, where first value is an index and second is corresponding to index value. + +#### arr.exclusion([…lists]]) _(es5-ext/array/#/exclusion)_ + +Returns the array of elements that are found only in one of the lists (either context list or list provided in arguments). + +#### arr.fill(value[, start, end]) _(es5-ext/array/#/fill)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.fill). + +#### arr.filter(callback[, thisArg]) _(es5-ext/array/#/filter)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.filter). +ES6's version of `filter`, returns array of same type as the context. + +#### arr.find(predicate[, thisArg]) _(es5-ext/array/#/find)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.find). +Return first element for which given function returns true + +#### arr.findIndex(predicate[, thisArg]) _(es5-ext/array/#/find-index)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.findindex). +Return first index for which given function returns true + +#### arr.first() _(es5-ext/array/#/first)_ + +Returns value for first defined index + +#### arr.firstIndex() _(es5-ext/array/#/first-index)_ + +Returns first declared index of the array + +#### arr.flatten() _(es5-ext/array/#/flatten)_ + +Returns flattened version of the array + +#### arr.forEachRight(cb[, thisArg]) _(es5-ext/array/#/for-each-right)_ + +`forEach` starting from last element + +#### arr.group(cb[, thisArg]) _(es5-ext/array/#/group)_ + +Group list elements by value returned by _cb_ function + +#### arr.indexesOf(searchElement[, fromIndex]) _(es5-ext/array/#/indexes-of)_ + +Returns array of all indexes of given value + +#### arr.intersection([…lists]) _(es5-ext/array/#/intersection)_ + +Computes the array of values that are the intersection of all lists (context list and lists given in arguments) + +#### arr.isCopy(other) _(es5-ext/array/#/is-copy)_ + +Returns true if both context and _other_ lists have same content + +#### arr.isUniq() _(es5-ext/array/#/is-uniq)_ + +Returns true if all values in array are unique + +#### arr.keys() _(es5-ext/array/#/keys)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.prototype.keys). +Returns iterator object, which traverses all array indexes. + +#### arr.last() _(es5-ext/array/#/last)_ + +Returns value of last defined index + +#### arr.lastIndex() _(es5-ext/array/#/last)_ + +Returns last defined index of the array + +#### arr.map(callback[, thisArg]) _(es5-ext/array/#/map)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.map). +ES6's version of `map`, returns array of same type as the context. + +#### arr.remove(value[, …valuen]) _(es5-ext/array/#/remove)_ + +Remove values from the array + +#### arr.separate(sep) _(es5-ext/array/#/separate)_ + +Returns array with items separated with `sep` value + +#### arr.slice(callback[, thisArg]) _(es5-ext/array/#/slice)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.slice). +ES6's version of `slice`, returns array of same type as the context. + +#### arr.someRight(cb[, thisArg]) _(es5-ext/array/#/someRight)_ + +`some` starting from last element + +#### arr.splice(callback[, thisArg]) _(es5-ext/array/#/splice)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.splice). +ES6's version of `splice`, returns array of same type as the context. + +#### arr.uniq() _(es5-ext/array/#/uniq)_ + +Returns duplicate-free version of the array + +#### arr.values() _(es5-ext/array/#/values)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.prototype.values). +Returns iterator object which traverses all array values. + +#### arr[@@iterator] _(es5-ext/array/#/@@iterator)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-array.prototype-@@iterator). +Returns iterator object which traverses all array values. + +### Boolean Constructor extensions + +#### isBoolean(x) _(es5-ext/boolean/is-boolean)_ + +Whether value is boolean + +### Date Constructor extensions + +#### isDate(x) _(es5-ext/date/is-date)_ + +Whether value is date instance + +#### validDate(x) _(es5-ext/date/valid-date)_ + +If given object is not date throw TypeError in other case return it. + +### Date Prototype extensions + +#### date.copy(date) _(es5-ext/date/#/copy)_ + +Returns a copy of the date object + +#### date.daysInMonth() _(es5-ext/date/#/days-in-month)_ + +Returns number of days of date's month + +#### date.floorDay() _(es5-ext/date/#/floor-day)_ + +Sets the date time to 00:00:00.000 + +#### date.floorMonth() _(es5-ext/date/#/floor-month)_ + +Sets date day to 1 and date time to 00:00:00.000 + +#### date.floorYear() _(es5-ext/date/#/floor-year)_ + +Sets date month to 0, day to 1 and date time to 00:00:00.000 + +#### date.format(pattern) _(es5-ext/date/#/format)_ + +Formats date up to given string. Supported patterns: + +* `%Y` - Year with century, 1999, 2003 +* `%y` - Year without century, 99, 03 +* `%m` - Month, 01..12 +* `%d` - Day of the month 01..31 +* `%H` - Hour (24-hour clock), 00..23 +* `%M` - Minute, 00..59 +* `%S` - Second, 00..59 +* `%L` - Milliseconds, 000..999 + +### Error Constructor extensions + +#### custom(message/*, code, ext*/) _(es5-ext/error/custom)_ + +Creates custom error object, optinally extended with `code` and other extension properties (provided with `ext` object) + +#### isError(x) _(es5-ext/error/is-error)_ + +Whether value is an error (instance of `Error`). + +#### validError(x) _(es5-ext/error/valid-error)_ + +If given object is not error throw TypeError in other case return it. + +### Error Prototype extensions + +#### err.throw() _(es5-ext/error/#/throw)_ + +Throws error + +### Function Constructor extensions + +Some of the functions were inspired by [Functional JavaScript](http://osteele.com/sources/javascript/functional/) project by Olivier Steele + +#### constant(x) _(es5-ext/function/constant)_ + +Returns a constant function that returns pregiven argument + +_k(x)(y) =def x_ + +#### identity(x) _(es5-ext/function/identity)_ + +Identity function. Returns first argument + +_i(x) =def x_ + +#### invoke(name[, …args]) _(es5-ext/function/invoke)_ + +Returns a function that takes an object as an argument, and applies object's +_name_ method to arguments. +_name_ can be name of the method or method itself. + +_invoke(name, …args)(object, …args2) =def object\[name\]\(…args, …args2\)_ + +#### isArguments(x) _(es5-ext/function/is-arguments)_ + +Whether value is arguments object + +#### isFunction(arg) _(es5-ext/function/is-function)_ + +Wether value is instance of function + +#### noop() _(es5-ext/function/noop)_ + +No operation function + +#### pluck(name) _(es5-ext/function/pluck)_ + +Returns a function that takes an object, and returns the value of its _name_ +property + +_pluck(name)(obj) =def obj[name]_ + +#### validFunction(arg) _(es5-ext/function/valid-function)_ + +If given object is not function throw TypeError in other case return it. + +### Function Prototype extensions + +Some of the methods were inspired by [Functional JavaScript](http://osteele.com/sources/javascript/functional/) project by Olivier Steele + +#### fn.compose([…fns]) _(es5-ext/function/#/compose)_ + +Applies the functions in reverse argument-list order. + +_f1.compose(f2, f3, f4)(…args) =def f1(f2(f3(f4(…arg))))_ + +#### fn.copy() _(es5-ext/function/#/copy)_ + +Produces copy of given function + +#### fn.curry([n]) _(es5-ext/function/#/curry)_ + +Invoking the function returned by this function only _n_ arguments are passed to the underlying function. If the underlying function is not saturated, the result is a function that passes all its arguments to the underlying function. +If _n_ is not provided then it defaults to context function length + +_f.curry(4)(arg1, arg2)(arg3)(arg4) =def f(arg1, args2, arg3, arg4)_ + +#### fn.lock([…args]) _(es5-ext/function/#/lock)_ + +Returns a function that applies the underlying function to _args_, and ignores its own arguments. + +_f.lock(…args)(…args2) =def f(…args)_ + +_Named after it's counterpart in Google Closure_ + +#### fn.not() _(es5-ext/function/#/not)_ + +Returns a function that returns boolean negation of value returned by underlying function. + +_f.not()(…args) =def !f(…args)_ + +#### fn.partial([…args]) _(es5-ext/function/#/partial)_ + +Returns a function that when called will behave like context function called with initially passed arguments. If more arguments are suplilied, they are appended to initial args. + +_f.partial(…args1)(…args2) =def f(…args1, …args2)_ + +#### fn.spread() _(es5-ext/function/#/spread)_ + +Returns a function that applies underlying function with first list argument + +_f.match()(args) =def f.apply(null, args)_ + +#### fn.toStringTokens() _(es5-ext/function/#/to-string-tokens)_ + +Serializes function into two (arguments and body) string tokens. Result is plain object with `args` and `body` properties. + +### Math extensions + +#### acosh(x) _(es5-ext/math/acosh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.acosh). + +#### asinh(x) _(es5-ext/math/asinh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.asinh). + +#### atanh(x) _(es5-ext/math/atanh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.atanh). + +#### cbrt(x) _(es5-ext/math/cbrt)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.cbrt). + +#### clz32(x) _(es5-ext/math/clz32)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.clz32). + +#### cosh(x) _(es5-ext/math/cosh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.cosh). + +#### expm1(x) _(es5-ext/math/expm1)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.expm1). + +#### fround(x) _(es5-ext/math/fround)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.fround). + +#### hypot([…values]) _(es5-ext/math/hypot)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.hypot). + +#### imul(x, y) _(es5-ext/math/imul)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.imul). + +#### log1p(x) _(es5-ext/math/log1p)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.log1p). + +#### log2(x) _(es5-ext/math/log2)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.log2). + +#### log10(x) _(es5-ext/math/log10)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.log10). + +#### sign(x) _(es5-ext/math/sign)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.sign). + +#### sinh(x) _(es5-ext/math/sinh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.sinh). + +#### tanh(x) _(es5-ext/math/tanh)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.tanh). + +#### trunc(x) _(es5-ext/math/trunc)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-math.trunc). + +### Number Constructor extensions + +#### EPSILON _(es5-ext/number/epsilon)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.epsilon). + +The difference between 1 and the smallest value greater than 1 that is representable as a Number value, which is approximately 2.2204460492503130808472633361816 x 10-16. + +#### isFinite(x) _(es5-ext/number/is-finite)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.isfinite). +Whether value is finite. Differs from global isNaN that it doesn't do type coercion. + +#### isInteger(x) _(es5-ext/number/is-integer)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.isinteger). +Whether value is integer. + +#### isNaN(x) _(es5-ext/number/is-nan)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.isnan). +Whether value is NaN. Differs from global isNaN that it doesn't do type coercion. + +#### isNumber(x) _(es5-ext/number/is-number)_ + +Whether given value is number + +#### isSafeInteger(x) _(es5-ext/number/is-safe-integer)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.issafeinteger). + +#### MAX_SAFE_INTEGER _(es5-ext/number/max-safe-integer)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.maxsafeinteger). +The value of Number.MAX_SAFE_INTEGER is 9007199254740991. + +#### MIN_SAFE_INTEGER _(es5-ext/number/min-safe-integer)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.minsafeinteger). +The value of Number.MIN_SAFE_INTEGER is -9007199254740991 (253-1). + +#### toInteger(x) _(es5-ext/number/to-integer)_ + +Converts value to integer + +#### toPosInteger(x) _(es5-ext/number/to-pos-integer)_ + +Converts value to positive integer. If provided value is less than 0, then 0 is returned + +#### toUint32(x) _(es5-ext/number/to-uint32)_ + +Converts value to unsigned 32 bit integer. This type is used for array lengths. +See: http://www.2ality.com/2012/02/js-integers.html + +### Number Prototype extensions + +#### num.pad(length[, precision]) _(es5-ext/number/#/pad)_ + +Pad given number with zeros. Returns string + +### Object Constructor extensions + +#### assign(target, source[, …sourcen]) _(es5-ext/object/assign)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.assign). +Extend _target_ by enumerable own properties of other objects. If properties are already set on target object, they will be overwritten. + +#### clear(obj) _(es5-ext/object/clear)_ + +Remove all enumerable own properties of the object + +#### compact(obj) _(es5-ext/object/compact)_ + +Returns copy of the object with all enumerable properties that have no falsy values + +#### compare(obj1, obj2) _(es5-ext/object/compare)_ + +Universal cross-type compare function. To be used for e.g. array sort. + +#### copy(obj) _(es5-ext/object/copy)_ + +Returns copy of the object with all enumerable properties. + +#### copyDeep(obj) _(es5-ext/object/copy-deep)_ + +Returns deep copy of the object with all enumerable properties. + +#### count(obj) _(es5-ext/object/count)_ + +Counts number of enumerable own properties on object + +#### create(obj[, properties]) _(es5-ext/object/create)_ + +`Object.create` alternative that provides workaround for [V8 issue](http://code.google.com/p/v8/issues/detail?id=2804). + +When `null` is provided as a prototype, it's substituted with specially prepared object that derives from Object.prototype but has all Object.prototype properties shadowed with undefined. + +It's quirky solution that allows us to have plain objects with no truthy properties but with turnable prototype. + +Use only for objects that you plan to switch prototypes of and be aware of limitations of this workaround. + +#### eq(x, y) _(es5-ext/object/eq)_ + +Whether two values are equal, using [_SameValueZero_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) algorithm. + +#### every(obj, cb[, thisArg[, compareFn]]) _(es5-ext/object/every)_ + +Analogous to Array.prototype.every. Returns true if every key-value pair in this object satisfies the provided testing function. +Optionally _compareFn_ can be provided which assures that keys are tested in given order. If provided _compareFn_ is equal to `true`, then order is alphabetical (by key). + +#### filter(obj, cb[, thisArg]) _(es5-ext/object/filter)_ + +Analogous to Array.prototype.filter. Returns new object with properites for which _cb_ function returned truthy value. + +#### firstKey(obj) _(es5-ext/object/first-key)_ + +Returns first enumerable key of the object, as keys are unordered by specification, it can be any key of an object. + +#### flatten(obj) _(es5-ext/object/flatten)_ + +Returns new object, with flatten properties of input object + +_flatten({ a: { b: 1 }, c: { d: 1 } }) =def { b: 1, d: 1 }_ + +#### forEach(obj, cb[, thisArg[, compareFn]]) _(es5-ext/object/for-each)_ + +Analogous to Array.prototype.forEach. Calls a function for each key-value pair found in object +Optionally _compareFn_ can be provided which assures that properties are iterated in given order. If provided _compareFn_ is equal to `true`, then order is alphabetical (by key). + +#### getPropertyNames() _(es5-ext/object/get-property-names)_ + +Get all (not just own) property names of the object + +#### is(x, y) _(es5-ext/object/is)_ + +Whether two values are equal, using [_SameValue_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) algorithm. + +#### isArrayLike(x) _(es5-ext/object/is-array-like)_ + +Whether object is array-like object + +#### isCopy(x, y) _(es5-ext/object/is-copy)_ + +Two values are considered a copy of same value when all of their own enumerable properties have same values. + +#### isCopyDeep(x, y) _(es5-ext/object/is-copy-deep)_ + +Deep comparision of objects + +#### isEmpty(obj) _(es5-ext/object/is-empty)_ + +True if object doesn't have any own enumerable property + +#### isObject(arg) _(es5-ext/object/is-object)_ + +Whether value is not primitive + +#### isPlainObject(arg) _(es5-ext/object/is-plain-object)_ + +Whether object is plain object, its protototype should be Object.prototype and it cannot be host object. + +#### keyOf(obj, searchValue) _(es5-ext/object/key-of)_ + +Search object for value + +#### keys(obj) _(es5-ext/object/keys)_ + +[_Updated with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.keys). +ES6's version of `keys`, doesn't throw on primitive input + +#### map(obj, cb[, thisArg]) _(es5-ext/object/map)_ + +Analogous to Array.prototype.map. Creates a new object with properties which values are results of calling a provided function on every key-value pair in this object. + +#### mapKeys(obj, cb[, thisArg]) _(es5-ext/object/map-keys)_ + +Create new object with same values, but remapped keys + +#### mixin(target, source) _(es5-ext/object/mixin)_ + +Extend _target_ by all own properties of other objects. Properties found in both objects will be overwritten (unless they're not configurable and cannot be overwritten). +_It was for a moment part of ECMAScript 6 draft._ + +#### mixinPrototypes(target, …source]) _(es5-ext/object/mixin-prototypes)_ + +Extends _target_, with all source and source's prototype properties. +Useful as an alternative for `setPrototypeOf` in environments in which it cannot be shimmed (no `__proto__` support). + +#### normalizeOptions(options) _(es5-ext/object/normalize-options)_ + +Normalizes options object into flat plain object. + +Useful for functions in which we either need to keep options object for future reference or need to modify it for internal use. + +- It never returns input `options` object back (always a copy is created) +- `options` can be undefined in such case empty plain object is returned. +- Copies all enumerable properties found down prototype chain. + +#### primitiveSet([…names]) _(es5-ext/object/primitive-set)_ + +Creates `null` prototype based plain object, and sets on it all property names provided in arguments to true. + +#### safeTraverse(obj[, …names]) _(es5-ext/object/safe-traverse)_ + +Safe navigation of object properties. See http://wiki.ecmascript.org/doku.php?id=strawman:existential_operator + +#### serialize(value) _(es5-ext/object/serialize)_ + +Serialize value into string. Differs from [JSON.stringify](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/JSON/stringify) that it serializes also dates, functions and regular expresssions. + +#### setPrototypeOf(object, proto) _(es5-ext/object/set-prototype-of)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.setprototypeof). +If native version is not provided, it depends on existence of `__proto__` functionality, if it's missing, `null` instead of function is exposed. + +#### some(obj, cb[, thisArg[, compareFn]]) _(es5-ext/object/some)_ + +Analogous to Array.prototype.some Returns true if any key-value pair satisfies the provided +testing function. +Optionally _compareFn_ can be provided which assures that keys are tested in given order. If provided _compareFn_ is equal to `true`, then order is alphabetical (by key). + +#### toArray(obj[, cb[, thisArg[, compareFn]]]) _(es5-ext/object/to-array)_ + +Creates an array of results of calling a provided function on every key-value pair in this object. +Optionally _compareFn_ can be provided which assures that results are added in given order. If provided _compareFn_ is equal to `true`, then order is alphabetical (by key). + +#### unserialize(str) _(es5-ext/object/unserialize)_ + +Userializes value previously serialized with [serialize](#serializevalue-es5-extobjectserialize) + +#### validCallable(x) _(es5-ext/object/valid-callable)_ + +If given object is not callable throw TypeError in other case return it. + +#### validObject(x) _(es5-ext/object/valid-object)_ + +Throws error if given value is not an object, otherwise it is returned. + +#### validValue(x) _(es5-ext/object/valid-value)_ + +Throws error if given value is `null` or `undefined`, otherwise returns value. + +### RegExp Constructor extensions + +#### escape(str) _(es5-ext/reg-exp/escape)_ + +Escapes string to be used in regular expression + +#### isRegExp(x) _(es5-ext/reg-exp/is-reg-exp)_ + +Whether object is regular expression + +#### validRegExp(x) _(es5-ext/reg-exp/valid-reg-exp)_ + +If object is regular expression it is returned, otherwise TypeError is thrown. + +### RegExp Prototype extensions + +#### re.isSticky(x) _(es5-ext/reg-exp/#/is-sticky)_ + +Whether regular expression has `sticky` flag. + +It's to be used as counterpart to [regExp.sticky](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-get-regexp.prototype.sticky) if it's not implemented. + +#### re.isUnicode(x) _(es5-ext/reg-exp/#/is-unicode)_ + +Whether regular expression has `unicode` flag. + +It's to be used as counterpart to [regExp.unicode](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-get-regexp.prototype.unicode) if it's not implemented. + +#### re.match(string) _(es5-ext/reg-exp/#/match)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.match). + +#### re.replace(string, replaceValue) _(es5-ext/reg-exp/#/replace)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.replace). + +#### re.search(string) _(es5-ext/reg-exp/#/search)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.search). + +#### re.split(string) _(es5-ext/reg-exp/#/search)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.split). + +#### re.sticky _(es5-ext/reg-exp/#/sticky/implement)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.sticky). +It's a getter, so only `implement` and `is-implemented` modules are provided. + +#### re.unicode _(es5-ext/reg-exp/#/unicode/implement)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-regexp.prototype.unicode). +It's a getter, so only `implement` and `is-implemented` modules are provided. + +### String Constructor extensions + +#### formatMethod(fMap) _(es5-ext/string/format-method)_ + +Creates format method. It's used e.g. to create `Date.prototype.format` method + +#### fromCodePoint([…codePoints]) _(es5-ext/string/from-code-point)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.fromcodepoint) + +#### isString(x) _(es5-ext/string/is-string)_ + +Whether object is string + +#### randomUniq() _(es5-ext/string/random-uniq)_ + +Returns randomly generated id, with guarantee of local uniqueness (no same id will be returned twice) + +#### raw(callSite[, …substitutions]) _(es5-ext/string/raw)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.raw) + +### String Prototype extensions + +#### str.at(pos) _(es5-ext/string/#/at)_ + +_Proposed for ECMAScript 6/7 standard, but not (yet) in a draft_ + +Returns a string at given position in Unicode-safe manner. +Based on [implementation by Mathias Bynens](https://github.com/mathiasbynens/String.prototype.at). + +#### str.camelToHyphen() _(es5-ext/string/#/camel-to-hyphen)_ + +Convert camelCase string to hyphen separated, e.g. one-two-three -> oneTwoThree. +Useful when converting names from js property convention into filename convention. + +#### str.capitalize() _(es5-ext/string/#/capitalize)_ + +Capitalize first character of a string + +#### str.caseInsensitiveCompare(str) _(es5-ext/string/#/case-insensitive-compare)_ + +Case insensitive compare + +#### str.codePointAt(pos) _(es5-ext/string/#/code-point-at)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype.codepointat) + +Based on [implementation by Mathias Bynens](https://github.com/mathiasbynens/String.prototype.codePointAt). + +#### str.contains(searchString[, position]) _(es5-ext/string/#/contains)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype.contains) + +Whether string contains given string. + +#### str.endsWith(searchString[, endPosition]) _(es5-ext/string/#/ends-with)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype.endswith). +Whether strings ends with given string + +#### str.hyphenToCamel() _(es5-ext/string/#/hyphen-to-camel)_ + +Convert hyphen separated string to camelCase, e.g. one-two-three -> oneTwoThree. +Useful when converting names from filename convention to js property name convention. + +#### str.indent(str[, count]) _(es5-ext/string/#/indent)_ + +Indents each line with provided _str_ (if _count_ given then _str_ is repeated _count_ times). + +#### str.last() _(es5-ext/string/#/last)_ + +Return last character + +#### str.normalize([form]) _(es5-ext/string/#/normalize)_ + +[_Introduced with ECMAScript 6_](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/String/normalize). +Returns the Unicode Normalization Form of a given string. +Based on Matsuza's version. Code used for integrated shim can be found at [github.com/walling/unorm](https://github.com/walling/unorm/blob/master/lib/unorm.js) + +#### str.pad(fill[, length]) _(es5-ext/string/#/pad)_ + +Pad string with _fill_. +If _length_ si given than _fill_ is reapated _length_ times. +If _length_ is negative then pad is applied from right. + +#### str.repeat(n) _(es5-ext/string/#/repeat)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype.repeat). +Repeat given string _n_ times + +#### str.plainReplace(search, replace) _(es5-ext/string/#/plain-replace)_ + +Simple `replace` version. Doesn't support regular expressions. Replaces just first occurrence of search string. Doesn't support insert patterns, therefore it is safe to replace text with text obtained programmatically (there's no need for additional _$_ characters escape in such case). + +#### str.plainReplaceAll(search, replace) _(es5-ext/string/#/plain-replace-all)_ + +Simple `replace` version. Doesn't support regular expressions. Replaces all occurrences of search string. Doesn't support insert patterns, therefore it is safe to replace text with text obtained programmatically (there's no need for additional _$_ characters escape in such case). + +#### str.startsWith(searchString[, position]) _(es5-ext/string/#/starts-with)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype.startswith). +Whether strings starts with given string + +#### str[@@iterator] _(es5-ext/string/#/@@iterator)_ + +[_Introduced with ECMAScript 6_](http://people.mozilla.org/~jorendorff/es6-draft.html#sec-string.prototype-@@iterator). +Returns iterator object which traverses all string characters (with respect to unicode symbols) + +### Tests [![Build Status](https://travis-ci.org/medikoo/es5-ext.png)](https://travis-ci.org/medikoo/es5-ext) + + $ npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/implement.js new file mode 100644 index 0000000000..0f714a1d27 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, require('es6-symbol').iterator, { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/index.js new file mode 100644 index 0000000000..a69462650e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Array.prototype[require('es6-symbol').iterator] : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/is-implemented.js new file mode 100644 index 0000000000..72eb1f8a27 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/is-implemented.js @@ -0,0 +1,16 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function () { + var arr = ['foo', 1], iterator, result; + if (typeof arr[iteratorSymbol] !== 'function') return false; + iterator = arr[iteratorSymbol](); + if (!iterator) return false; + if (typeof iterator.next !== 'function') return false; + result = iterator.next(); + if (!result) return false; + if (result.value !== 'foo') return false; + if (result.done !== false) return false; + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/shim.js new file mode 100644 index 0000000000..ff295df996 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/@@iterator/shim.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('../values/shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/_compare-by-length.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/_compare-by-length.js new file mode 100644 index 0000000000..d8343ce306 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/_compare-by-length.js @@ -0,0 +1,9 @@ +// Used internally to sort array of lists by length + +'use strict'; + +var toPosInt = require('../../number/to-pos-integer'); + +module.exports = function (a, b) { + return toPosInt(a.length) - toPosInt(b.length); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/binary-search.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/binary-search.js new file mode 100644 index 0000000000..8eb4567514 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/binary-search.js @@ -0,0 +1,28 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , callable = require('../../object/valid-callable') + , value = require('../../object/valid-value') + + , floor = Math.floor; + +module.exports = function (compareFn) { + var length, low, high, middle; + + value(this); + callable(compareFn); + + length = toPosInt(this.length); + low = 0; + high = length - 1; + + while (low <= high) { + middle = floor((low + high) / 2); + if (compareFn(this[middle]) < 0) high = middle - 1; + else low = middle + 1; + } + + if (high < 0) return 0; + if (high >= length) return length - 1; + return high; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/clear.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/clear.js new file mode 100644 index 0000000000..3587bdf972 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/clear.js @@ -0,0 +1,12 @@ +// Inspired by Google Closure: +// http://closure-library.googlecode.com/svn/docs/ +// closure_goog_array_array.js.html#goog.array.clear + +'use strict'; + +var value = require('../../object/valid-value'); + +module.exports = function () { + value(this).length = 0; + return this; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/compact.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/compact.js new file mode 100644 index 0000000000..d529d5a2be --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/compact.js @@ -0,0 +1,9 @@ +// Inspired by: http://documentcloud.github.com/underscore/#compact + +'use strict'; + +var filter = Array.prototype.filter; + +module.exports = function () { + return filter.call(this, function (val) { return val != null; }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/implement.js new file mode 100644 index 0000000000..80c67cb4fa --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'concat', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/index.js new file mode 100644 index 0000000000..db205ea54a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.concat : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/is-implemented.js new file mode 100644 index 0000000000..cab8bc9e32 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +var SubArray = require('../../_sub-array-dummy-safe'); + +module.exports = function () { + return (new SubArray()).concat('foo') instanceof SubArray; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/shim.js new file mode 100644 index 0000000000..8b28e4ae03 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/concat/shim.js @@ -0,0 +1,39 @@ +'use strict'; + +var isPlainArray = require('../../is-plain-array') + , toPosInt = require('../../../number/to-pos-integer') + , isObject = require('../../../object/is-object') + + , isArray = Array.isArray, concat = Array.prototype.concat + , forEach = Array.prototype.forEach + + , isSpreadable; + +isSpreadable = function (value) { + if (!value) return false; + if (!isObject(value)) return false; + if (value['@@isConcatSpreadable'] !== undefined) { + return Boolean(value['@@isConcatSpreadable']); + } + return isArray(value); +}; + +module.exports = function (item/*, …items*/) { + var result; + if (!this || !isArray(this) || isPlainArray(this)) { + return concat.apply(this, arguments); + } + result = new this.constructor(this.length); + forEach.call(this, function (val, i) { result[i] = val; }); + forEach.call(arguments, function (arg) { + var base; + if (isSpreadable(arg)) { + base = result.length; + result.length += toPosInt(arg.length); + forEach.call(arg, function (val, i) { result[base + i] = val; }); + return; + } + result.push(arg); + }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/contains.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/contains.js new file mode 100644 index 0000000000..4a2f9f6731 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/contains.js @@ -0,0 +1,7 @@ +'use strict'; + +var indexOf = require('./e-index-of'); + +module.exports = function (searchElement/*, position*/) { + return indexOf.call(this, searchElement, arguments[1]) > -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/implement.js new file mode 100644 index 0000000000..eedbad77ee --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'copyWithin', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/index.js new file mode 100644 index 0000000000..bb89d0b879 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.copyWithin : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/is-implemented.js new file mode 100644 index 0000000000..8f17e06d81 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var arr = [1, 2, 3, 4, 5]; + if (typeof arr.copyWithin !== 'function') return false; + return String(arr.copyWithin(1, 3)) === '1,4,5,4,5'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/shim.js new file mode 100644 index 0000000000..c0bfb8b060 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/copy-within/shim.js @@ -0,0 +1,39 @@ +// Taken from: https://github.com/paulmillr/es6-shim/ + +'use strict'; + +var toInteger = require('../../../number/to-integer') + , toPosInt = require('../../../number/to-pos-integer') + , validValue = require('../../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty + , max = Math.max, min = Math.min; + +module.exports = function (target, start/*, end*/) { + var o = validValue(this), end = arguments[2], l = toPosInt(o.length) + , to, from, fin, count, direction; + + target = toInteger(target); + start = toInteger(start); + end = (end === undefined) ? l : toInteger(end); + + to = target < 0 ? max(l + target, 0) : min(target, l); + from = start < 0 ? max(l + start, 0) : min(start, l); + fin = end < 0 ? max(l + end, 0) : min(end, l); + count = min(fin - from, l - to); + direction = 1; + + if ((from < to) && (to < (from + count))) { + direction = -1; + from += count - 1; + to += count - 1; + } + while (count > 0) { + if (hasOwnProperty.call(o, from)) o[to] = o[from]; + else delete o[from]; + from += direction; + to += direction; + count -= 1; + } + return o; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/diff.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/diff.js new file mode 100644 index 0000000000..a1f95419d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/diff.js @@ -0,0 +1,13 @@ +'use strict'; + +var value = require('../../object/valid-value') + , contains = require('./contains') + + , filter = Array.prototype.filter; + +module.exports = function (other) { + (value(this) && value(other)); + return filter.call(this, function (item) { + return !contains.call(other, item); + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-index-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-index-of.js new file mode 100644 index 0000000000..80864d0666 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-index-of.js @@ -0,0 +1,29 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , value = require('../../object/valid-value') + + , indexOf = Array.prototype.indexOf + , hasOwnProperty = Object.prototype.hasOwnProperty + , abs = Math.abs, floor = Math.floor; + +module.exports = function (searchElement/*, fromIndex*/) { + var i, l, fromIndex, val; + if (searchElement === searchElement) { //jslint: ignore + return indexOf.apply(this, arguments); + } + + l = toPosInt(value(this).length); + fromIndex = arguments[1]; + if (isNaN(fromIndex)) fromIndex = 0; + else if (fromIndex >= 0) fromIndex = floor(fromIndex); + else fromIndex = toPosInt(this.length) - floor(abs(fromIndex)); + + for (i = fromIndex; i < l; ++i) { + if (hasOwnProperty.call(this, i)) { + val = this[i]; + if (val !== val) return i; //jslint: ignore + } + } + return -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-last-index-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-last-index-of.js new file mode 100644 index 0000000000..4fc536bd68 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/e-last-index-of.js @@ -0,0 +1,29 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , value = require('../../object/valid-value') + + , lastIndexOf = Array.prototype.lastIndexOf + , hasOwnProperty = Object.prototype.hasOwnProperty + , abs = Math.abs, floor = Math.floor; + +module.exports = function (searchElement/*, fromIndex*/) { + var i, fromIndex, val; + if (searchElement === searchElement) { //jslint: ignore + return lastIndexOf.apply(this, arguments); + } + + value(this); + fromIndex = arguments[1]; + if (isNaN(fromIndex)) fromIndex = (toPosInt(this.length) - 1); + else if (fromIndex >= 0) fromIndex = floor(fromIndex); + else fromIndex = toPosInt(this.length) - floor(abs(fromIndex)); + + for (i = fromIndex; i >= 0; --i) { + if (hasOwnProperty.call(this, i)) { + val = this[i]; + if (val !== val) return i; //jslint: ignore + } + } + return -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/implement.js new file mode 100644 index 0000000000..490de60e20 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'entries', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/index.js new file mode 100644 index 0000000000..292792cf15 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.entries : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/is-implemented.js new file mode 100644 index 0000000000..e186c17237 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/is-implemented.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function () { + var arr = [1, 'foo'], iterator, result; + if (typeof arr.entries !== 'function') return false; + iterator = arr.entries(); + if (!iterator) return false; + if (typeof iterator.next !== 'function') return false; + result = iterator.next(); + if (!result || !result.value) return false; + if (result.value[0] !== 0) return false; + if (result.value[1] !== 1) return false; + if (result.done !== false) return false; + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/shim.js new file mode 100644 index 0000000000..c052b53f01 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/entries/shim.js @@ -0,0 +1,4 @@ +'use strict'; + +var ArrayIterator = require('es6-iterator/array'); +module.exports = function () { return new ArrayIterator(this, 'key+value'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/exclusion.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/exclusion.js new file mode 100644 index 0000000000..f08adc81c9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/exclusion.js @@ -0,0 +1,27 @@ +'use strict'; + +var value = require('../../object/valid-value') + , aFrom = require('../from') + , toArray = require('../to-array') + , contains = require('./contains') + , byLength = require('./_compare-by-length') + + , filter = Array.prototype.filter, push = Array.prototype.push; + +module.exports = function (/*…lists*/) { + var lists, seen, result; + if (!arguments.length) return aFrom(this); + push.apply(lists = [this], arguments); + lists.forEach(value); + seen = []; + result = []; + lists.sort(byLength).forEach(function (list) { + result = result.filter(function (item) { + return !contains.call(list, item); + }).concat(filter.call(list, function (x) { + return !contains.call(seen, x); + })); + push.apply(seen, toArray(list)); + }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/implement.js new file mode 100644 index 0000000000..22511919c5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'fill', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/index.js new file mode 100644 index 0000000000..36c1f66668 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.fill : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/is-implemented.js new file mode 100644 index 0000000000..b8e546888a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var arr = [1, 2, 3, 4, 5, 6]; + if (typeof arr.fill !== 'function') return false; + return String(arr.fill(-1, -3)) === '1,2,3,-1,-1,-1'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/shim.js new file mode 100644 index 0000000000..45823be51f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/fill/shim.js @@ -0,0 +1,21 @@ +// Taken from: https://github.com/paulmillr/es6-shim/ + +'use strict'; + +var toInteger = require('../../../number/to-integer') + , toPosInt = require('../../../number/to-pos-integer') + , validValue = require('../../../object/valid-value') + + , max = Math.max, min = Math.min; + +module.exports = function (value/*, start, end*/) { + var o = validValue(this), start = arguments[1], end = arguments[2] + , l = toPosInt(o.length), relativeStart, i; + + start = (start === undefined) ? 0 : toInteger(start); + end = (end === undefined) ? l : toInteger(end); + + relativeStart = start < 0 ? max(l + start, 0) : min(start, l); + for (i = relativeStart; i < l && i < end; ++i) o[i] = value; + return o; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/implement.js new file mode 100644 index 0000000000..090c5f109a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'filter', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/index.js new file mode 100644 index 0000000000..bcf0268dc2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.filter : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/is-implemented.js new file mode 100644 index 0000000000..5577273501 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +var SubArray = require('../../_sub-array-dummy-safe') + + , pass = function () { return true; }; + +module.exports = function () { + return (new SubArray()).filter(pass) instanceof SubArray; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/shim.js new file mode 100644 index 0000000000..b0116defce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/filter/shim.js @@ -0,0 +1,22 @@ +'use strict'; + +var isPlainArray = require('../../is-plain-array') + , callable = require('../../../object/valid-callable') + + , isArray = Array.isArray, filter = Array.prototype.filter + , forEach = Array.prototype.forEach, call = Function.prototype.call; + +module.exports = function (callbackFn/*, thisArg*/) { + var result, thisArg, i; + if (!this || !isArray(this) || isPlainArray(this)) { + return filter.apply(this, arguments); + } + callable(callbackFn); + thisArg = arguments[1]; + result = new this.constructor(); + i = 0; + forEach.call(this, function (val, j, self) { + if (call.call(callbackFn, thisArg, val, j, self)) result[i++] = val; + }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/implement.js new file mode 100644 index 0000000000..556cb84600 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'findIndex', + { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/index.js new file mode 100644 index 0000000000..03a987e223 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.findIndex : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/is-implemented.js new file mode 100644 index 0000000000..dbd3c814b4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +var fn = function (x) { return x > 3; }; + +module.exports = function () { + var arr = [1, 2, 3, 4, 5, 6]; + if (typeof arr.findIndex !== 'function') return false; + return arr.findIndex(fn) === 3; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/shim.js new file mode 100644 index 0000000000..957939f2ba --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find-index/shim.js @@ -0,0 +1,20 @@ +'use strict'; + +var callable = require('../../../object/valid-callable') + , value = require('../../../object/valid-value') + + , some = Array.prototype.some, apply = Function.prototype.apply; + +module.exports = function (predicate/*, thisArg*/) { + var k, self; + self = Object(value(this)); + callable(predicate); + + return some.call(self, function (value, index) { + if (apply.call(predicate, this, arguments)) { + k = index; + return true; + } + return false; + }, arguments[1]) ? k : -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/implement.js new file mode 100644 index 0000000000..0f37104ac8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'find', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/index.js new file mode 100644 index 0000000000..96819d09f0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.find : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/is-implemented.js new file mode 100644 index 0000000000..cc7ec774df --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +var fn = function (x) { return x > 3; }; + +module.exports = function () { + var arr = [1, 2, 3, 4, 5, 6]; + if (typeof arr.find !== 'function') return false; + return arr.find(fn) === 4; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/shim.js new file mode 100644 index 0000000000..c7ee9069a9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/find/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +var findIndex = require('../find-index/shim'); + +module.exports = function (predicate/*, thisArg*/) { + var index = findIndex.apply(this, arguments); + return (index === -1) ? undefined : this[index]; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first-index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first-index.js new file mode 100644 index 0000000000..7a9e4c3473 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first-index.js @@ -0,0 +1,16 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , value = require('../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty; + +module.exports = function () { + var i, l; + if (!(l = toPosInt(value(this).length))) return null; + i = 0; + while (!hasOwnProperty.call(this, i)) { + if (++i === l) return null; + } + return i; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first.js new file mode 100644 index 0000000000..11df571754 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/first.js @@ -0,0 +1,9 @@ +'use strict'; + +var firstIndex = require('./first-index'); + +module.exports = function () { + var i; + if ((i = firstIndex.call(this)) !== null) return this[i]; + return undefined; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/flatten.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/flatten.js new file mode 100644 index 0000000000..c95407d317 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/flatten.js @@ -0,0 +1,12 @@ +'use strict'; + +var isArray = Array.isArray, forEach = Array.prototype.forEach + , push = Array.prototype.push; + +module.exports = function flatten() { + var r = []; + forEach.call(this, function (x) { + push.apply(r, isArray(x) ? flatten.call(x) : [x]); + }); + return r; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/for-each-right.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/for-each-right.js new file mode 100644 index 0000000000..1702bb1644 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/for-each-right.js @@ -0,0 +1,20 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , callable = require('../../object/valid-callable') + , value = require('../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty + , call = Function.prototype.call; + +module.exports = function (cb/*, thisArg*/) { + var i, self, thisArg; + + self = Object(value(this)); + callable(cb); + thisArg = arguments[1]; + + for (i = (toPosInt(self.length) - 1); i >= 0; --i) { + if (hasOwnProperty.call(self, i)) call.call(cb, thisArg, self[i], i, self); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/group.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/group.js new file mode 100644 index 0000000000..fbb178c35c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/group.js @@ -0,0 +1,23 @@ +// Inspired by Underscore's groupBy: +// http://documentcloud.github.com/underscore/#groupBy + +'use strict'; + +var callable = require('../../object/valid-callable') + , value = require('../../object/valid-value') + + , forEach = Array.prototype.forEach, apply = Function.prototype.apply; + +module.exports = function (cb/*, thisArg*/) { + var r; + + (value(this) && callable(cb)); + + r = {}; + forEach.call(this, function (v) { + var key = apply.call(cb, this, arguments); + if (!r.hasOwnProperty(key)) r[key] = []; + r[key].push(v); + }, arguments[1]); + return r; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/index.js new file mode 100644 index 0000000000..97ef65cfd4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/index.js @@ -0,0 +1,40 @@ +'use strict'; + +module.exports = { + '@@iterator': require('./@@iterator'), + binarySearch: require('./binary-search'), + clear: require('./clear'), + compact: require('./compact'), + concat: require('./concat'), + contains: require('./contains'), + copyWithin: require('./copy-within'), + diff: require('./diff'), + eIndexOf: require('./e-index-of'), + eLastIndexOf: require('./e-last-index-of'), + entries: require('./entries'), + exclusion: require('./exclusion'), + fill: require('./fill'), + filter: require('./filter'), + find: require('./find'), + findIndex: require('./find-index'), + first: require('./first'), + firstIndex: require('./first-index'), + flatten: require('./flatten'), + forEachRight: require('./for-each-right'), + keys: require('./keys'), + group: require('./group'), + indexesOf: require('./indexes-of'), + intersection: require('./intersection'), + isCopy: require('./is-copy'), + isUniq: require('./is-uniq'), + last: require('./last'), + lastIndex: require('./last-index'), + map: require('./map'), + remove: require('./remove'), + separate: require('./separate'), + slice: require('./slice'), + someRight: require('./some-right'), + splice: require('./splice'), + uniq: require('./uniq'), + values: require('./values') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/indexes-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/indexes-of.js new file mode 100644 index 0000000000..6b89157a35 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/indexes-of.js @@ -0,0 +1,12 @@ +'use strict'; + +var indexOf = require('./e-index-of'); + +module.exports = function (value/*, fromIndex*/) { + var r = [], i, fromIndex = arguments[1]; + while ((i = indexOf.call(this, value, fromIndex)) !== -1) { + r.push(i); + fromIndex = i + 1; + } + return r; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/intersection.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/intersection.js new file mode 100644 index 0000000000..fadcb52530 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/intersection.js @@ -0,0 +1,19 @@ +'use strict'; + +var value = require('../../object/valid-value') + , contains = require('./contains') + , byLength = require('./_compare-by-length') + + , filter = Array.prototype.filter, push = Array.prototype.push + , slice = Array.prototype.slice; + +module.exports = function (/*…list*/) { + var lists; + if (!arguments.length) slice.call(this); + push.apply(lists = [this], arguments); + lists.forEach(value); + lists.sort(byLength); + return lists.reduce(function (a, b) { + return filter.call(a, function (x) { return contains.call(b, x); }); + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-copy.js new file mode 100644 index 0000000000..ac7c79bc45 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-copy.js @@ -0,0 +1,21 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , eq = require('../../object/eq') + , value = require('../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty; + +module.exports = function (other) { + var i, l; + (value(this) && value(other)); + l = toPosInt(this.length); + if (l !== toPosInt(other.length)) return false; + for (i = 0; i < l; ++i) { + if (hasOwnProperty.call(this, i) !== hasOwnProperty.call(other, i)) { + return false; + } + if (!eq(this[i], other[i])) return false; + } + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-uniq.js new file mode 100644 index 0000000000..b14f461d94 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/is-uniq.js @@ -0,0 +1,12 @@ +'use strict'; + +var indexOf = require('./e-index-of') + + , every = Array.prototype.every + , isFirst; + +isFirst = function (value, index) { + return indexOf.call(this, value) === index; +}; + +module.exports = function () { return every.call(this, isFirst, this); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/implement.js new file mode 100644 index 0000000000..e18e61701f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'keys', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/index.js new file mode 100644 index 0000000000..2f89cffe10 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.keys : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/is-implemented.js new file mode 100644 index 0000000000..06bd87bf29 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/is-implemented.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function () { + var arr = [1, 'foo'], iterator, result; + if (typeof arr.keys !== 'function') return false; + iterator = arr.keys(); + if (!iterator) return false; + if (typeof iterator.next !== 'function') return false; + result = iterator.next(); + if (!result) return false; + if (result.value !== 0) return false; + if (result.done !== false) return false; + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/shim.js new file mode 100644 index 0000000000..83773f6ec9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/keys/shim.js @@ -0,0 +1,4 @@ +'use strict'; + +var ArrayIterator = require('es6-iterator/array'); +module.exports = function () { return new ArrayIterator(this, 'key'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last-index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last-index.js new file mode 100644 index 0000000000..a191d6e153 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last-index.js @@ -0,0 +1,16 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , value = require('../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty; + +module.exports = function () { + var i, l; + if (!(l = toPosInt(value(this).length))) return null; + i = l - 1; + while (!hasOwnProperty.call(this, i)) { + if (--i === -1) return null; + } + return i; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last.js new file mode 100644 index 0000000000..bf9d2f2924 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/last.js @@ -0,0 +1,9 @@ +'use strict'; + +var lastIndex = require('./last-index'); + +module.exports = function () { + var i; + if ((i = lastIndex.call(this)) !== null) return this[i]; + return undefined; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/implement.js new file mode 100644 index 0000000000..3aabb87440 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'map', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/index.js new file mode 100644 index 0000000000..66f66607df --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? + Array.prototype.map : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/is-implemented.js new file mode 100644 index 0000000000..c328b47330 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var identity = require('../../../function/identity') + , SubArray = require('../../_sub-array-dummy-safe'); + +module.exports = function () { + return (new SubArray()).map(identity) instanceof SubArray; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/shim.js new file mode 100644 index 0000000000..2ee731347b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/map/shim.js @@ -0,0 +1,21 @@ +'use strict'; + +var isPlainArray = require('../../is-plain-array') + , callable = require('../../../object/valid-callable') + + , isArray = Array.isArray, map = Array.prototype.map + , forEach = Array.prototype.forEach, call = Function.prototype.call; + +module.exports = function (callbackFn/*, thisArg*/) { + var result, thisArg; + if (!this || !isArray(this) || isPlainArray(this)) { + return map.apply(this, arguments); + } + callable(callbackFn); + thisArg = arguments[1]; + result = new this.constructor(this.length); + forEach.call(this, function (val, i, self) { + result[i] = call.call(callbackFn, thisArg, val, i, self); + }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/remove.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/remove.js new file mode 100644 index 0000000000..dcf843313d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/remove.js @@ -0,0 +1,12 @@ +'use strict'; + +var indexOf = require('./e-index-of') + + , forEach = Array.prototype.forEach, splice = Array.prototype.splice; + +module.exports = function (item/*, …item*/) { + forEach.call(arguments, function (item) { + var index = indexOf.call(this, item); + if (index !== -1) splice.call(this, index, 1); + }, this); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/separate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/separate.js new file mode 100644 index 0000000000..dc974b832e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/separate.js @@ -0,0 +1,10 @@ +'use strict'; + +var forEach = Array.prototype.forEach; + +module.exports = function (sep) { + var result = []; + forEach.call(this, function (val, i) { result.push(val, sep); }); + result.pop(); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/implement.js new file mode 100644 index 0000000000..cd488a0639 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'slice', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/index.js new file mode 100644 index 0000000000..72200ca9e3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Array.prototype.slice : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/is-implemented.js new file mode 100644 index 0000000000..ec1985e70e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +var SubArray = require('../../_sub-array-dummy-safe'); + +module.exports = function () { + return (new SubArray()).slice() instanceof SubArray; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/shim.js new file mode 100644 index 0000000000..2761a1aad8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/slice/shim.js @@ -0,0 +1,35 @@ +'use strict'; + +var toInteger = require('../../../number/to-integer') + , toPosInt = require('../../../number/to-pos-integer') + , isPlainArray = require('../../is-plain-array') + + , isArray = Array.isArray, slice = Array.prototype.slice + , hasOwnProperty = Object.prototype.hasOwnProperty, max = Math.max; + +module.exports = function (start, end) { + var length, result, i; + if (!this || !isArray(this) || isPlainArray(this)) { + return slice.apply(this, arguments); + } + length = toPosInt(this.length); + start = toInteger(start); + if (start < 0) start = max(length + start, 0); + else if (start > length) start = length; + if (end === undefined) { + end = length; + } else { + end = toInteger(end); + if (end < 0) end = max(length + end, 0); + else if (end > length) end = length; + } + if (start > end) start = end; + result = new this.constructor(end - start); + i = 0; + while (start !== end) { + if (hasOwnProperty.call(this, start)) result[i] = this[start]; + ++i; + ++start; + } + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/some-right.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/some-right.js new file mode 100644 index 0000000000..f54cf945c3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/some-right.js @@ -0,0 +1,23 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , callable = require('../../object/valid-callable') + , value = require('../../object/valid-value') + + , hasOwnProperty = Object.prototype.hasOwnProperty + , call = Function.prototype.call; + +module.exports = function (cb/*, thisArg*/) { + var i, self, thisArg; + self = Object(value(this)); + callable(cb); + thisArg = arguments[1]; + + for (i = (toPosInt(self.length) - 1); i >= 0; --i) { + if (hasOwnProperty.call(self, i) && + call.call(cb, thisArg, self[i], i, self)) { + return true; + } + } + return false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/implement.js new file mode 100644 index 0000000000..aab1f8eff6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'splice', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/index.js new file mode 100644 index 0000000000..e8ecf3cf85 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Array.prototype.splice : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/is-implemented.js new file mode 100644 index 0000000000..ffddaa81ef --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +var SubArray = require('../../_sub-array-dummy-safe'); + +module.exports = function () { + return (new SubArray()).splice(0) instanceof SubArray; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/shim.js new file mode 100644 index 0000000000..a8505a2ce2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/splice/shim.js @@ -0,0 +1,14 @@ +'use strict'; + +var isPlainArray = require('../../is-plain-array') + + , isArray = Array.isArray, splice = Array.prototype.splice + , forEach = Array.prototype.forEach; + +module.exports = function (start, deleteCount/*, …items*/) { + var arr = splice.apply(this, arguments), result; + if (!this || !isArray(this) || isPlainArray(this)) return arr; + result = new this.constructor(arr.length); + forEach.call(arr, function (val, i) { result[i] = val; }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/uniq.js new file mode 100644 index 0000000000..db01465557 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/uniq.js @@ -0,0 +1,13 @@ +'use strict'; + +var indexOf = require('./e-index-of') + + , filter = Array.prototype.filter + + , isFirst; + +isFirst = function (value, index) { + return indexOf.call(this, value) === index; +}; + +module.exports = function () { return filter.call(this, isFirst, this); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/implement.js new file mode 100644 index 0000000000..237281fd3b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array.prototype, 'values', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/index.js new file mode 100644 index 0000000000..c0832c30ea --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./is-implemented')() ? Array.prototype.values : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/is-implemented.js new file mode 100644 index 0000000000..cc0c6294e2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/is-implemented.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function () { + var arr = ['foo', 1], iterator, result; + if (typeof arr.values !== 'function') return false; + iterator = arr.values(); + if (!iterator) return false; + if (typeof iterator.next !== 'function') return false; + result = iterator.next(); + if (!result) return false; + if (result.value !== 'foo') return false; + if (result.done !== false) return false; + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/shim.js new file mode 100644 index 0000000000..f6555fd858 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/#/values/shim.js @@ -0,0 +1,4 @@ +'use strict'; + +var ArrayIterator = require('es6-iterator/array'); +module.exports = function () { return new ArrayIterator(this, 'value'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_is-extensible.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_is-extensible.js new file mode 100644 index 0000000000..612320647b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_is-extensible.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = (function () { + var SubArray = require('./_sub-array-dummy'), arr; + + if (!SubArray) return false; + arr = new SubArray(); + if (!Array.isArray(arr)) return false; + if (!(arr instanceof SubArray)) return false; + + arr[34] = 'foo'; + return (arr.length === 35); +}()); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy-safe.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy-safe.js new file mode 100644 index 0000000000..5baf8a8d11 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy-safe.js @@ -0,0 +1,23 @@ +'use strict'; + +var setPrototypeOf = require('../object/set-prototype-of') + , isExtensible = require('./_is-extensible'); + +module.exports = (function () { + var SubArray; + + if (isExtensible) return require('./_sub-array-dummy'); + + if (!setPrototypeOf) return null; + SubArray = function () { + var arr = Array.apply(this, arguments); + setPrototypeOf(arr, SubArray.prototype); + return arr; + }; + setPrototypeOf(SubArray, Array); + SubArray.prototype = Object.create(Array.prototype, { + constructor: { value: SubArray, enumerable: false, writable: true, + configurable: true } + }); + return SubArray; +}()); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy.js new file mode 100644 index 0000000000..a926d1a32d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/_sub-array-dummy.js @@ -0,0 +1,16 @@ +'use strict'; + +var setPrototypeOf = require('../object/set-prototype-of'); + +module.exports = (function () { + var SubArray; + + if (!setPrototypeOf) return null; + SubArray = function () { Array.apply(this, arguments); }; + setPrototypeOf(SubArray, Array); + SubArray.prototype = Object.create(Array.prototype, { + constructor: { value: SubArray, enumerable: false, writable: true, + configurable: true } + }); + return SubArray; +}()); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/implement.js new file mode 100644 index 0000000000..f3411b1377 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array, 'from', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/index.js new file mode 100644 index 0000000000..3b99cda8ec --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Array.from + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/is-implemented.js new file mode 100644 index 0000000000..63ff2a572a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function () { + var from = Array.from, arr, result; + if (typeof from !== 'function') return false; + arr = ['raz', 'dwa']; + result = from(arr); + return Boolean(result && (result !== arr) && (result[1] === 'dwa')); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/shim.js new file mode 100644 index 0000000000..a90ba2f973 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/from/shim.js @@ -0,0 +1,106 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator + , isArguments = require('../../function/is-arguments') + , isFunction = require('../../function/is-function') + , toPosInt = require('../../number/to-pos-integer') + , callable = require('../../object/valid-callable') + , validValue = require('../../object/valid-value') + , isString = require('../../string/is-string') + + , isArray = Array.isArray, call = Function.prototype.call + , desc = { configurable: true, enumerable: true, writable: true, value: null } + , defineProperty = Object.defineProperty; + +module.exports = function (arrayLike/*, mapFn, thisArg*/) { + var mapFn = arguments[1], thisArg = arguments[2], Constructor, i, j, arr, l, code, iterator + , result, getIterator, value; + + arrayLike = Object(validValue(arrayLike)); + + if (mapFn != null) callable(mapFn); + if (!this || (this === Array) || !isFunction(this)) { + // Result: Plain array + if (!mapFn) { + if (isArguments(arrayLike)) { + // Source: Arguments + l = arrayLike.length; + if (l !== 1) return Array.apply(null, arrayLike); + arr = new Array(1); + arr[0] = arrayLike[0]; + return arr; + } + if (isArray(arrayLike)) { + // Source: Array + arr = new Array(l = arrayLike.length); + for (i = 0; i < l; ++i) arr[i] = arrayLike[i]; + return arr; + } + } + arr = []; + } else { + // Result: Non plain array + Constructor = this; + } + + if (!isArray(arrayLike)) { + if ((getIterator = arrayLike[iteratorSymbol]) !== undefined) { + // Source: Iterator + iterator = callable(getIterator).call(arrayLike); + if (Constructor) arr = new Constructor(); + result = iterator.next(); + i = 0; + while (!result.done) { + value = mapFn ? call.call(mapFn, thisArg, result.value, i) : result.value; + if (!Constructor) { + arr[i] = value; + } else { + desc.value = value; + defineProperty(arr, i, desc); + } + result = iterator.next(); + ++i; + } + l = i; + } else if (isString(arrayLike)) { + // Source: String + l = arrayLike.length; + if (Constructor) arr = new Constructor(); + for (i = 0, j = 0; i < l; ++i) { + value = arrayLike[i]; + if ((i + 1) < l) { + code = value.charCodeAt(0); + if ((code >= 0xD800) && (code <= 0xDBFF)) value += arrayLike[++i]; + } + value = mapFn ? call.call(mapFn, thisArg, value, j) : value; + if (!Constructor) { + arr[j] = value; + } else { + desc.value = value; + defineProperty(arr, j, desc); + } + ++j; + } + l = j; + } + } + if (l === undefined) { + // Source: array or array-like + l = toPosInt(arrayLike.length); + if (Constructor) arr = new Constructor(l); + for (i = 0; i < l; ++i) { + value = mapFn ? call.call(mapFn, thisArg, arrayLike[i], i) : arrayLike[i]; + if (!Constructor) { + arr[i] = value; + } else { + desc.value = value; + defineProperty(arr, i, desc); + } + } + } + if (Constructor) { + desc.value = null; + arr.length = l; + } + return arr; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/generate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/generate.js new file mode 100644 index 0000000000..5e066750b1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/generate.js @@ -0,0 +1,20 @@ +'use strict'; + +var toPosInt = require('../number/to-pos-integer') + , value = require('../object/valid-value') + + , slice = Array.prototype.slice; + +module.exports = function (length/*, …fill*/) { + var arr, l; + length = toPosInt(value(length)); + if (length === 0) return []; + + arr = (arguments.length < 2) ? [undefined] : + slice.call(arguments, 1, 1 + length); + + while ((l = arr.length) < length) { + arr = arr.concat(arr.slice(0, length - l)); + } + return arr; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/index.js new file mode 100644 index 0000000000..7a6867894b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/index.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + from: require('./from'), + generate: require('./generate'), + isPlainArray: require('./is-plain-array'), + of: require('./of'), + toArray: require('./to-array'), + validArray: require('./valid-array') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/is-plain-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/is-plain-array.js new file mode 100644 index 0000000000..6b37e40697 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/is-plain-array.js @@ -0,0 +1,11 @@ +'use strict'; + +var isArray = Array.isArray, getPrototypeOf = Object.getPrototypeOf; + +module.exports = function (obj) { + var proto; + if (!obj || !isArray(obj)) return false; + proto = getPrototypeOf(obj); + if (!isArray(proto)) return false; + return !isArray(getPrototypeOf(proto)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/implement.js new file mode 100644 index 0000000000..bf2a5a54a7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Array, 'of', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/index.js new file mode 100644 index 0000000000..07ee54dbcd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Array.of + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/is-implemented.js new file mode 100644 index 0000000000..4390a10863 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function () { + var of = Array.of, result; + if (typeof of !== 'function') return false; + result = of('foo', 'bar'); + return Boolean(result && (result[1] === 'bar')); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/shim.js new file mode 100644 index 0000000000..de72bc9229 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/of/shim.js @@ -0,0 +1,19 @@ +'use strict'; + +var isFunction = require('../../function/is-function') + + , slice = Array.prototype.slice, defineProperty = Object.defineProperty + , desc = { configurable: true, enumerable: true, writable: true, value: null }; + +module.exports = function (/*…items*/) { + var result, i, l; + if (!this || (this === Array) || !isFunction(this)) return slice.call(arguments); + result = new this(l = arguments.length); + for (i = 0; i < l; ++i) { + desc.value = arguments[i]; + defineProperty(result, i, desc); + } + desc.value = null; + result.length = l; + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/to-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/to-array.js new file mode 100644 index 0000000000..ce908dd912 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/to-array.js @@ -0,0 +1,9 @@ +'use strict'; + +var from = require('./from') + + , isArray = Array.isArray; + +module.exports = function (arrayLike) { + return isArray(arrayLike) ? arrayLike : from(arrayLike); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/valid-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/valid-array.js new file mode 100644 index 0000000000..d86a8f5f24 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/array/valid-array.js @@ -0,0 +1,8 @@ +'use strict'; + +var isArray = Array.isArray; + +module.exports = function (value) { + if (isArray(value)) return value; + throw new TypeError(value + " is not an array"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/index.js new file mode 100644 index 0000000000..c193b948eb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = { + isBoolean: require('./is-boolean') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/is-boolean.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/is-boolean.js new file mode 100644 index 0000000000..5d1a802e11 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/boolean/is-boolean.js @@ -0,0 +1,10 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(true); + +module.exports = function (x) { + return (typeof x === 'boolean') || ((typeof x === 'object') && + ((x instanceof Boolean) || (toString.call(x) === id))); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/copy.js new file mode 100644 index 0000000000..69e2eb09fc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/copy.js @@ -0,0 +1,5 @@ +'use strict'; + +var getTime = Date.prototype.getTime; + +module.exports = function () { return new Date(getTime.call(this)); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/days-in-month.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/days-in-month.js new file mode 100644 index 0000000000..e780efe3c7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/days-in-month.js @@ -0,0 +1,17 @@ +'use strict'; + +var getMonth = Date.prototype.getMonth; + +module.exports = function () { + switch (getMonth.call(this)) { + case 1: + return this.getFullYear() % 4 ? 28 : 29; + case 3: + case 5: + case 8: + case 10: + return 30; + default: + return 31; + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-day.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-day.js new file mode 100644 index 0000000000..0c9eb8b627 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-day.js @@ -0,0 +1,8 @@ +'use strict'; + +var setHours = Date.prototype.setHours; + +module.exports = function () { + setHours.call(this, 0, 0, 0, 0); + return this; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-month.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-month.js new file mode 100644 index 0000000000..7328c250b3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-month.js @@ -0,0 +1,8 @@ +'use strict'; + +var floorDay = require('./floor-day'); + +module.exports = function () { + floorDay.call(this).setDate(1); + return this; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-year.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-year.js new file mode 100644 index 0000000000..9c5085389f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/floor-year.js @@ -0,0 +1,8 @@ +'use strict'; + +var floorMonth = require('./floor-month'); + +module.exports = function () { + floorMonth.call(this).setMonth(0); + return this; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/format.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/format.js new file mode 100644 index 0000000000..15bd95f7ed --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/format.js @@ -0,0 +1,21 @@ +'use strict'; + +var pad = require('../../number/#/pad') + , date = require('../valid-date') + + , format; + +format = require('../../string/format-method')({ + Y: function () { return String(this.getFullYear()); }, + y: function () { return String(this.getFullYear()).slice(-2); }, + m: function () { return pad.call(this.getMonth() + 1, 2); }, + d: function () { return pad.call(this.getDate(), 2); }, + H: function () { return pad.call(this.getHours(), 2); }, + M: function () { return pad.call(this.getMinutes(), 2); }, + S: function () { return pad.call(this.getSeconds(), 2); }, + L: function () { return pad.call(this.getMilliseconds(), 3); } +}); + +module.exports = function (pattern) { + return format.call(date(this), pattern); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/index.js new file mode 100644 index 0000000000..f71b295002 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/#/index.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = { + copy: require('./copy'), + daysInMonth: require('./days-in-month'), + floorDay: require('./floor-day'), + floorMonth: require('./floor-month'), + floorYear: require('./floor-year'), + format: require('./format') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/index.js new file mode 100644 index 0000000000..eac33fbe6d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/index.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + isDate: require('./is-date'), + validDate: require('./valid-date') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/is-date.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/is-date.js new file mode 100644 index 0000000000..6ba236ecbc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/is-date.js @@ -0,0 +1,9 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(new Date()); + +module.exports = function (x) { + return (x && ((x instanceof Date) || (toString.call(x) === id))) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/valid-date.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/valid-date.js new file mode 100644 index 0000000000..7d1a9b60d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/date/valid-date.js @@ -0,0 +1,8 @@ +'use strict'; + +var isDate = require('./is-date'); + +module.exports = function (x) { + if (!isDate(x)) throw new TypeError(x + " is not a Date object"); + return x; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/index.js new file mode 100644 index 0000000000..b984aa91fe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = { + throw: require('./throw') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/throw.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/throw.js new file mode 100644 index 0000000000..7e15ebd1cf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/#/throw.js @@ -0,0 +1,5 @@ +'use strict'; + +var error = require('../valid-error'); + +module.exports = function () { throw error(this); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/custom.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/custom.js new file mode 100644 index 0000000000..bbc2dc20b4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/custom.js @@ -0,0 +1,20 @@ +'use strict'; + +var assign = require('../object/assign') + + , captureStackTrace = Error.captureStackTrace; + +exports = module.exports = function (message/*, code, ext*/) { + var err = new Error(), code = arguments[1], ext = arguments[2]; + if (ext == null) { + if (code && (typeof code === 'object')) { + ext = code; + code = null; + } + } + if (ext != null) assign(err, ext); + err.message = String(message); + if (code != null) err.code = String(code); + if (captureStackTrace) captureStackTrace(err, exports); + return err; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/index.js new file mode 100644 index 0000000000..62984b52de --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/index.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + custom: require('./custom'), + isError: require('./is-error'), + validError: require('./valid-error') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/is-error.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/is-error.js new file mode 100644 index 0000000000..422705faf7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/is-error.js @@ -0,0 +1,9 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(new Error()); + +module.exports = function (x) { + return (x && ((x instanceof Error) || (toString.call(x)) === id)) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/valid-error.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/valid-error.js new file mode 100644 index 0000000000..0bef768a77 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/error/valid-error.js @@ -0,0 +1,8 @@ +'use strict'; + +var isError = require('./is-error'); + +module.exports = function (x) { + if (!isError(x)) throw new TypeError(x + " is not an Error object"); + return x; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/compose.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/compose.js new file mode 100644 index 0000000000..1da5e01162 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/compose.js @@ -0,0 +1,20 @@ +'use strict'; + +var callable = require('../../object/valid-callable') + , aFrom = require('../../array/from') + + , apply = Function.prototype.apply, call = Function.prototype.call + , callFn = function (arg, fn) { return call.call(fn, this, arg); }; + +module.exports = function (fn/*, …fnn*/) { + var fns, first; + if (!fn) callable(fn); + fns = [this].concat(aFrom(arguments)); + fns.forEach(callable); + fns = fns.reverse(); + first = fns[0]; + fns = fns.slice(1); + return function (arg) { + return fns.reduce(callFn, apply.call(first, this, arguments)); + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/copy.js new file mode 100644 index 0000000000..e1467f7671 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/copy.js @@ -0,0 +1,15 @@ +'use strict'; + +var mixin = require('../../object/mixin') + , validFunction = require('../valid-function') + + , re = /^\s*function\s*([\0-'\)-\uffff]+)*\s*\(([\0-\(\*-\uffff]*)\)\s*\{/; + +module.exports = function () { + var match = String(validFunction(this)).match(re), fn; + + fn = new Function('fn', 'return function ' + match[1].trim() + '(' + + match[2] + ') { return fn.apply(this, arguments); };')(this); + try { mixin(fn, this); } catch (ignore) {} + return fn; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/curry.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/curry.js new file mode 100644 index 0000000000..943d6faf86 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/curry.js @@ -0,0 +1,24 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , callable = require('../../object/valid-callable') + , defineLength = require('../_define-length') + + , slice = Array.prototype.slice, apply = Function.prototype.apply + , curry; + +curry = function self(fn, length, preArgs) { + return defineLength(function () { + var args = preArgs ? + preArgs.concat(slice.call(arguments, 0, length - preArgs.length)) : + slice.call(arguments, 0, length); + return (args.length === length) ? apply.call(fn, this, args) : + self(fn, length, args); + }, preArgs ? (length - preArgs.length) : length); +}; + +module.exports = function (/*length*/) { + var length = arguments[0]; + return curry(callable(this), + isNaN(length) ? toPosInt(this.length) : toPosInt(length)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/index.js new file mode 100644 index 0000000000..8d0da007fa --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/index.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = { + compose: require('./compose'), + copy: require('./copy'), + curry: require('./curry'), + lock: require('./lock'), + not: require('./not'), + partial: require('./partial'), + spread: require('./spread'), + toStringTokens: require('./to-string-tokens') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/lock.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/lock.js new file mode 100644 index 0000000000..91e1a65cd9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/lock.js @@ -0,0 +1,12 @@ +'use strict'; + +var callable = require('../../object/valid-callable') + + , apply = Function.prototype.apply; + +module.exports = function (/*…args*/) { + var fn = callable(this) + , args = arguments; + + return function () { return apply.call(fn, this, args); }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/not.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/not.js new file mode 100644 index 0000000000..c6dbe97fb6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/not.js @@ -0,0 +1,14 @@ +'use strict'; + +var callable = require('../../object/valid-callable') + , defineLength = require('../_define-length') + + , apply = Function.prototype.apply; + +module.exports = function () { + var fn = callable(this); + + return defineLength(function () { + return !apply.call(fn, this, arguments); + }, fn.length); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/partial.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/partial.js new file mode 100644 index 0000000000..bf31a3575a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/partial.js @@ -0,0 +1,16 @@ +'use strict'; + +var callable = require('../../object/valid-callable') + , aFrom = require('../../array/from') + , defineLength = require('../_define-length') + + , apply = Function.prototype.apply; + +module.exports = function (/*…args*/) { + var fn = callable(this) + , args = aFrom(arguments); + + return defineLength(function () { + return apply.call(fn, this, args.concat(aFrom(arguments))); + }, fn.length - args.length); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/spread.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/spread.js new file mode 100644 index 0000000000..d7c93b7e07 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/spread.js @@ -0,0 +1,10 @@ +'use strict'; + +var callable = require('../../object/valid-callable') + + , apply = Function.prototype.apply; + +module.exports = function () { + var fn = callable(this); + return function (args) { return apply.call(fn, this, args); }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/to-string-tokens.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/to-string-tokens.js new file mode 100644 index 0000000000..67afeae82d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/#/to-string-tokens.js @@ -0,0 +1,11 @@ +'use strict'; + +var validFunction = require('../valid-function') + + , re = new RegExp('^\\s*function[\\0-\'\\)-\\uffff]*' + + '\\(([\\0-\\(\\*-\\uffff]*)\\)\\s*\\{([\\0-\\uffff]*)\\}\\s*$'); + +module.exports = function () { + var data = String(validFunction(this)).match(re); + return { args: data[1], body: data[2] }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/_define-length.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/_define-length.js new file mode 100644 index 0000000000..496ea62c52 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/_define-length.js @@ -0,0 +1,44 @@ +'use strict'; + +var toPosInt = require('../number/to-pos-integer') + + , test = function (a, b) {}, desc, defineProperty + , generate, mixin; + +try { + Object.defineProperty(test, 'length', { configurable: true, writable: false, + enumerable: false, value: 1 }); +} catch (ignore) {} + +if (test.length === 1) { + // ES6 + desc = { configurable: true, writable: false, enumerable: false }; + defineProperty = Object.defineProperty; + module.exports = function (fn, length) { + length = toPosInt(length); + if (fn.length === length) return fn; + desc.value = length; + return defineProperty(fn, 'length', desc); + }; +} else { + mixin = require('../object/mixin'); + generate = (function () { + var cache = []; + return function (l) { + var args, i = 0; + if (cache[l]) return cache[l]; + args = []; + while (l--) args.push('a' + (++i).toString(36)); + return new Function('fn', 'return function (' + args.join(', ') + + ') { return fn.apply(this, arguments); };'); + }; + }()); + module.exports = function (src, length) { + var target; + length = toPosInt(length); + if (src.length === length) return src; + target = generate(length)(src); + try { mixin(target, src); } catch (ignore) {} + return target; + }; +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/constant.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/constant.js new file mode 100644 index 0000000000..10f1e203e2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/constant.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (x) { + return function () { return x; }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/identity.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/identity.js new file mode 100644 index 0000000000..a9289f0b21 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/identity.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (x) { return x; }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/index.js new file mode 100644 index 0000000000..cfad3f3ec2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/index.js @@ -0,0 +1,15 @@ +// Export all modules. + +'use strict'; + +module.exports = { + '#': require('./#'), + constant: require('./constant'), + identity: require('./identity'), + invoke: require('./invoke'), + isArguments: require('./is-arguments'), + isFunction: require('./is-function'), + noop: require('./noop'), + pluck: require('./pluck'), + validFunction: require('./valid-function') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/invoke.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/invoke.js new file mode 100644 index 0000000000..9195afddd8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/invoke.js @@ -0,0 +1,15 @@ +'use strict'; + +var isCallable = require('../object/is-callable') + , value = require('../object/valid-value') + + , slice = Array.prototype.slice, apply = Function.prototype.apply; + +module.exports = function (name/*, …args*/) { + var args = slice.call(arguments, 1), isFn = isCallable(name); + return function (obj) { + value(obj); + return apply.call(isFn ? name : obj[name], obj, + args.concat(slice.call(arguments, 1))); + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-arguments.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-arguments.js new file mode 100644 index 0000000000..9a29855f87 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-arguments.js @@ -0,0 +1,7 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call((function () { return arguments; }())); + +module.exports = function (x) { return (toString.call(x) === id); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-function.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-function.js new file mode 100644 index 0000000000..ab4399ce25 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/is-function.js @@ -0,0 +1,9 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(require('./noop')); + +module.exports = function (f) { + return (typeof f === "function") && (toString.call(f) === id); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/noop.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/noop.js new file mode 100644 index 0000000000..aa43baedf1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/noop.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function () {}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/pluck.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/pluck.js new file mode 100644 index 0000000000..7f70a30cbd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/pluck.js @@ -0,0 +1,7 @@ +'use strict'; + +var value = require('../object/valid-value'); + +module.exports = function (name) { + return function (o) { return value(o)[name]; }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/valid-function.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/valid-function.js new file mode 100644 index 0000000000..05fdee2c3d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/function/valid-function.js @@ -0,0 +1,8 @@ +'use strict'; + +var isFunction = require('./is-function'); + +module.exports = function (x) { + if (!isFunction(x)) throw new TypeError(x + " is not a function"); + return x; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/global.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/global.js new file mode 100644 index 0000000000..872a40e814 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/global.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = new Function("return this")(); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/index.js new file mode 100644 index 0000000000..db9a7600b4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/index.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = { + global: require('./global'), + + array: require('./array'), + boolean: require('./boolean'), + date: require('./date'), + error: require('./error'), + function: require('./function'), + iterable: require('./iterable'), + math: require('./math'), + number: require('./number'), + object: require('./object'), + regExp: require('./reg-exp'), + string: require('./string') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/for-each.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/for-each.js new file mode 100644 index 0000000000..f1e20425b3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/for-each.js @@ -0,0 +1,12 @@ +'use strict'; + +var forOf = require('es6-iterator/for-of') + , isIterable = require('es6-iterator/is-iterable') + , iterable = require('./validate') + + , forEach = Array.prototype.forEach; + +module.exports = function (target, cb/*, thisArg*/) { + if (isIterable(iterable(target))) forOf(target, cb, arguments[2]); + else forEach.call(target, cb, arguments[2]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/index.js new file mode 100644 index 0000000000..a3e16a5e89 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/index.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = { + forEach: require('./for-each'), + is: require('./is'), + validate: require('./validate'), + validateObject: require('./validate-object') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/is.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/is.js new file mode 100644 index 0000000000..bb8bf28727 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/is.js @@ -0,0 +1,10 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator + , isArrayLike = require('../object/is-array-like'); + +module.exports = function (x) { + if (x == null) return false; + if (typeof x[iteratorSymbol] === 'function') return true; + return isArrayLike(x); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate-object.js new file mode 100644 index 0000000000..988a6adb62 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate-object.js @@ -0,0 +1,9 @@ +'use strict'; + +var isObject = require('../object/is-object') + , is = require('./is'); + +module.exports = function (x) { + if (is(x) && isObject(x)) return x; + throw new TypeError(x + " is not an iterable or array-like object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate.js new file mode 100644 index 0000000000..1be6d7fcd9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/iterable/validate.js @@ -0,0 +1,8 @@ +'use strict'; + +var is = require('./is'); + +module.exports = function (x) { + if (is(x)) return x; + throw new TypeError(x + " is not an iterable or array-like"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_pack-ieee754.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_pack-ieee754.js new file mode 100644 index 0000000000..eecda5654d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_pack-ieee754.js @@ -0,0 +1,82 @@ +// Credit: https://github.com/paulmillr/es6-shim/ + +'use strict'; + +var abs = Math.abs, floor = Math.floor, log = Math.log, min = Math.min + , pow = Math.pow, LN2 = Math.LN2 + , roundToEven; + +roundToEven = function (n) { + var w = floor(n), f = n - w; + if (f < 0.5) return w; + if (f > 0.5) return w + 1; + return w % 2 ? w + 1 : w; +}; + +module.exports = function (v, ebits, fbits) { + var bias = (1 << (ebits - 1)) - 1, s, e, f, i, bits, str, bytes; + + // Compute sign, exponent, fraction + if (isNaN(v)) { + // NaN + // http://dev.w3.org/2006/webapi/WebIDL/#es-type-mapping + e = (1 << ebits) - 1; + f = pow(2, fbits - 1); + s = 0; + } else if (v === Infinity || v === -Infinity) { + e = (1 << ebits) - 1; + f = 0; + s = (v < 0) ? 1 : 0; + } else if (v === 0) { + e = 0; + f = 0; + s = (1 / v === -Infinity) ? 1 : 0; + } else { + s = v < 0; + v = abs(v); + + if (v >= pow(2, 1 - bias)) { + e = min(floor(log(v) / LN2), 1023); + f = roundToEven(v / pow(2, e) * pow(2, fbits)); + if (f / pow(2, fbits) >= 2) { + e = e + 1; + f = 1; + } + if (e > bias) { + // Overflow + e = (1 << ebits) - 1; + f = 0; + } else { + // Normal + e = e + bias; + f = f - pow(2, fbits); + } + } else { + // Subnormal + e = 0; + f = roundToEven(v / pow(2, 1 - bias - fbits)); + } + } + + // Pack sign, exponent, fraction + bits = []; + for (i = fbits; i; i -= 1) { + bits.push(f % 2 ? 1 : 0); + f = floor(f / 2); + } + for (i = ebits; i; i -= 1) { + bits.push(e % 2 ? 1 : 0); + e = floor(e / 2); + } + bits.push(s ? 1 : 0); + bits.reverse(); + str = bits.join(''); + + // Bits to bytes + bytes = []; + while (str.length) { + bytes.push(parseInt(str.substring(0, 8), 2)); + str = str.substring(8); + } + return bytes; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_unpack-ieee754.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_unpack-ieee754.js new file mode 100644 index 0000000000..c9f26f2bb6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/_unpack-ieee754.js @@ -0,0 +1,33 @@ +// Credit: https://github.com/paulmillr/es6-shim/ + +'use strict'; + +var pow = Math.pow; + +module.exports = function (bytes, ebits, fbits) { + // Bytes to bits + var bits = [], i, j, b, str, + bias, s, e, f; + + for (i = bytes.length; i; i -= 1) { + b = bytes[i - 1]; + for (j = 8; j; j -= 1) { + bits.push(b % 2 ? 1 : 0); + b = b >> 1; + } + } + bits.reverse(); + str = bits.join(''); + + // Unpack sign, exponent, fraction + bias = (1 << (ebits - 1)) - 1; + s = parseInt(str.substring(0, 1), 2) ? -1 : 1; + e = parseInt(str.substring(1, 1 + ebits), 2); + f = parseInt(str.substring(1 + ebits), 2); + + // Produce number + if (e === (1 << ebits) - 1) return f !== 0 ? NaN : s * Infinity; + if (e > 0) return s * pow(2, e - bias) * (1 + f / pow(2, fbits)); + if (f !== 0) return s * pow(2, -(bias - 1)) * (f / pow(2, fbits)); + return s < 0 ? -0 : 0; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/implement.js new file mode 100644 index 0000000000..f48ad11de7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'acosh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/index.js new file mode 100644 index 0000000000..00ddea69dd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.acosh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/is-implemented.js new file mode 100644 index 0000000000..363f0d8bcd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var acosh = Math.acosh; + if (typeof acosh !== 'function') return false; + return acosh(2) === 1.3169578969248166; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/shim.js new file mode 100644 index 0000000000..89a24b5d76 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/acosh/shim.js @@ -0,0 +1,12 @@ +'use strict'; + +var log = Math.log, sqrt = Math.sqrt; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x < 1) return NaN; + if (x === 1) return 0; + if (x === Infinity) return x; + return log(x + sqrt(x * x - 1)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/implement.js new file mode 100644 index 0000000000..21f64d5049 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'asinh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/index.js new file mode 100644 index 0000000000..d415144eea --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.asinh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/is-implemented.js new file mode 100644 index 0000000000..6c205f418c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var asinh = Math.asinh; + if (typeof asinh !== 'function') return false; + return asinh(2) === 1.4436354751788103; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/shim.js new file mode 100644 index 0000000000..42fbf1457f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/asinh/shim.js @@ -0,0 +1,15 @@ +'use strict'; + +var log = Math.log, sqrt = Math.sqrt; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (!isFinite(x)) return x; + if (x < 0) { + x = -x; + return -log(x + sqrt(x * x + 1)); + } + return log(x + sqrt(x * x + 1)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/implement.js new file mode 100644 index 0000000000..1a4851343b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'atanh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/index.js new file mode 100644 index 0000000000..785b3deba5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.atanh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/is-implemented.js new file mode 100644 index 0000000000..dbaf18ece2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var atanh = Math.atanh; + if (typeof atanh !== 'function') return false; + return atanh(0.5) === 0.5493061443340549; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/shim.js new file mode 100644 index 0000000000..531e2891fe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/atanh/shim.js @@ -0,0 +1,14 @@ +'use strict'; + +var log = Math.log; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x < -1) return NaN; + if (x > 1) return NaN; + if (x === -1) return -Infinity; + if (x === 1) return Infinity; + if (x === 0) return x; + return 0.5 * log((1 + x) / (1 - x)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/implement.js new file mode 100644 index 0000000000..3a12dde487 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'cbrt', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/index.js new file mode 100644 index 0000000000..89f966dfe4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.cbrt + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/is-implemented.js new file mode 100644 index 0000000000..69809f3cf4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var cbrt = Math.cbrt; + if (typeof cbrt !== 'function') return false; + return cbrt(2) === 1.2599210498948732; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/shim.js new file mode 100644 index 0000000000..bca196026c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cbrt/shim.js @@ -0,0 +1,12 @@ +'use strict'; + +var pow = Math.pow; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (!isFinite(x)) return x; + if (x < 0) return -pow(-x, 1 / 3); + return pow(x, 1 / 3); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/implement.js new file mode 100644 index 0000000000..339df33ea7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'clz32', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/index.js new file mode 100644 index 0000000000..1687b337e3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.clz32 + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/is-implemented.js new file mode 100644 index 0000000000..ccc8f71337 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var clz32 = Math.clz32; + if (typeof clz32 !== 'function') return false; + return clz32(1000) === 22; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/shim.js new file mode 100644 index 0000000000..2a582da3bf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/clz32/shim.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (value) { + value = value >>> 0; + return value ? 32 - value.toString(2).length : 32; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/implement.js new file mode 100644 index 0000000000..f90d83056c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'cosh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/index.js new file mode 100644 index 0000000000..000636ab77 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.cosh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/is-implemented.js new file mode 100644 index 0000000000..c796bcbf31 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var cosh = Math.cosh; + if (typeof cosh !== 'function') return false; + return cosh(1) === 1.5430806348152437; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/shim.js new file mode 100644 index 0000000000..f9062bd976 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/cosh/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +var exp = Math.exp; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return 1; + if (!isFinite(x)) return Infinity; + return (exp(x) + exp(-x)) / 2; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/implement.js new file mode 100644 index 0000000000..fc20c8cfa0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'expm1', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/index.js new file mode 100644 index 0000000000..4c1bc77a22 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.expm1 + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/is-implemented.js new file mode 100644 index 0000000000..3b106d5d53 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var expm1 = Math.expm1; + if (typeof expm1 !== 'function') return false; + return expm1(1).toFixed(15) === '1.718281828459045'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/shim.js new file mode 100644 index 0000000000..9c8c236085 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/expm1/shim.js @@ -0,0 +1,16 @@ +// Thanks: https://github.com/monolithed/ECMAScript-6 + +'use strict'; + +var exp = Math.exp; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (x === Infinity) return Infinity; + if (x === -Infinity) return -1; + + if ((x > -1.0e-6) && (x < 1.0e-6)) return x + x * x / 2; + return exp(x) - 1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/implement.js new file mode 100644 index 0000000000..c55b26c464 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'fround', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/index.js new file mode 100644 index 0000000000..a077ed0ba3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.fround + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/is-implemented.js new file mode 100644 index 0000000000..ffbf094e6b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var fround = Math.fround; + if (typeof fround !== 'function') return false; + return fround(1.337) === 1.3370000123977661; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/shim.js new file mode 100644 index 0000000000..f2c86e46a4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/fround/shim.js @@ -0,0 +1,33 @@ +// Credit: https://github.com/paulmillr/es6-shim/blob/master/es6-shim.js + +'use strict'; + +var toFloat32; + +if (typeof Float32Array !== 'undefined') { + toFloat32 = (function () { + var float32Array = new Float32Array(1); + return function (x) { + float32Array[0] = x; + return float32Array[0]; + }; + }()); +} else { + toFloat32 = (function () { + var pack = require('../_pack-ieee754') + , unpack = require('../_unpack-ieee754'); + + return function (x) { + return unpack(pack(x, 8, 23), 8, 23); + }; + }()); +} + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (!isFinite(x)) return x; + + return toFloat32(x); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/implement.js new file mode 100644 index 0000000000..b27fda7a09 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'hypot', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/index.js new file mode 100644 index 0000000000..334bc584cf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.hypot + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/is-implemented.js new file mode 100644 index 0000000000..e75c5d36be --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var hypot = Math.hypot; + if (typeof hypot !== 'function') return false; + return hypot(3, 4) === 5; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/shim.js new file mode 100644 index 0000000000..3d0988bc13 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/hypot/shim.js @@ -0,0 +1,34 @@ +// Thanks for hints: https://github.com/paulmillr/es6-shim + +'use strict'; + +var some = Array.prototype.some, abs = Math.abs, sqrt = Math.sqrt + + , compare = function (a, b) { return b - a; } + , divide = function (x) { return x / this; } + , add = function (sum, number) { return sum + number * number; }; + +module.exports = function (val1, val2/*, …valn*/) { + var result, numbers; + if (!arguments.length) return 0; + some.call(arguments, function (val) { + if (isNaN(val)) { + result = NaN; + return; + } + if (!isFinite(val)) { + result = Infinity; + return true; + } + if (result !== undefined) return; + val = Number(val); + if (val === 0) return; + if (!numbers) numbers = [abs(val)]; + else numbers.push(abs(val)); + }); + if (result !== undefined) return result; + if (!numbers) return 0; + + numbers.sort(compare); + return numbers[0] * sqrt(numbers.map(divide, numbers[0]).reduce(add, 0)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/implement.js new file mode 100644 index 0000000000..ed207bd271 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'imul', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/index.js new file mode 100644 index 0000000000..41e5d5f010 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.imul + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/is-implemented.js new file mode 100644 index 0000000000..d8495dea2a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var imul = Math.imul; + if (typeof imul !== 'function') return false; + return imul(-1, 8) === -8; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/shim.js new file mode 100644 index 0000000000..8fd8a8d7a7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/imul/shim.js @@ -0,0 +1,13 @@ +// Thanks: https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference +// /Global_Objects/Math/imul + +'use strict'; + +module.exports = function (x, y) { + var xh = (x >>> 16) & 0xffff, xl = x & 0xffff + , yh = (y >>> 16) & 0xffff, yl = y & 0xffff; + + // the shift by 0 fixes the sign on the high part + // the final |0 converts the unsigned value into a signed value + return ((xl * yl) + (((xh * yl + xl * yh) << 16) >>> 0) | 0); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/index.js new file mode 100644 index 0000000000..d112d0bfe0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/index.js @@ -0,0 +1,21 @@ +'use strict'; + +module.exports = { + acosh: require('./acosh'), + asinh: require('./asinh'), + atanh: require('./atanh'), + cbrt: require('./cbrt'), + clz32: require('./clz32'), + cosh: require('./cosh'), + expm1: require('./expm1'), + fround: require('./fround'), + hypot: require('./hypot'), + imul: require('./imul'), + log10: require('./log10'), + log2: require('./log2'), + log1p: require('./log1p'), + sign: require('./sign'), + sinh: require('./sinh'), + tanh: require('./tanh'), + trunc: require('./trunc') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/implement.js new file mode 100644 index 0000000000..dd96edd80e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'log10', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/index.js new file mode 100644 index 0000000000..a9eee51313 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.log10 + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/is-implemented.js new file mode 100644 index 0000000000..c7f40ee775 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var log10 = Math.log10; + if (typeof log10 !== 'function') return false; + return log10(2) === 0.3010299956639812; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/shim.js new file mode 100644 index 0000000000..fc77287f61 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log10/shim.js @@ -0,0 +1,14 @@ +'use strict'; + +var log = Math.log, LOG10E = Math.LOG10E; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x < 0) return NaN; + if (x === 0) return -Infinity; + if (x === 1) return 0; + if (x === Infinity) return Infinity; + + return log(x) * LOG10E; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/implement.js new file mode 100644 index 0000000000..f62f91f687 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'log1p', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/index.js new file mode 100644 index 0000000000..107b114713 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.log1p + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/is-implemented.js new file mode 100644 index 0000000000..61e90974c5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var log1p = Math.log1p; + if (typeof log1p !== 'function') return false; + return log1p(1) === 0.6931471805599453; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/shim.js new file mode 100644 index 0000000000..10acebca4a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log1p/shim.js @@ -0,0 +1,17 @@ +// Thanks: https://github.com/monolithed/ECMAScript-6/blob/master/ES6.js + +'use strict'; + +var log = Math.log; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x < -1) return NaN; + if (x === -1) return -Infinity; + if (x === 0) return x; + if (x === Infinity) return Infinity; + + if (x > -1.0e-8 && x < 1.0e-8) return (x - x * x / 2); + return log(1 + x); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/implement.js new file mode 100644 index 0000000000..8483f0950a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'log2', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/index.js new file mode 100644 index 0000000000..87e9050abe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.log2 + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/is-implemented.js new file mode 100644 index 0000000000..802322faf3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var log2 = Math.log2; + if (typeof log2 !== 'function') return false; + return log2(3).toFixed(15) === '1.584962500721156'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/shim.js new file mode 100644 index 0000000000..cd80994a72 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/log2/shim.js @@ -0,0 +1,14 @@ +'use strict'; + +var log = Math.log, LOG2E = Math.LOG2E; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x < 0) return NaN; + if (x === 0) return -Infinity; + if (x === 1) return 0; + if (x === Infinity) return Infinity; + + return log(x) * LOG2E; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/implement.js new file mode 100644 index 0000000000..b0db2f413f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'sign', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/index.js new file mode 100644 index 0000000000..b232633343 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.sign + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/is-implemented.js new file mode 100644 index 0000000000..6d0de475ab --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var sign = Math.sign; + if (typeof sign !== 'function') return false; + return ((sign(10) === 1) && (sign(-20) === -1)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/shim.js new file mode 100644 index 0000000000..4df9c95aa5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sign/shim.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (value) { + value = Number(value); + if (isNaN(value) || (value === 0)) return value; + return (value > 0) ? 1 : -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/implement.js new file mode 100644 index 0000000000..f259a631b5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'sinh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/index.js new file mode 100644 index 0000000000..e5bea572f8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.sinh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/is-implemented.js new file mode 100644 index 0000000000..888ec67a9c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var sinh = Math.sinh; + if (typeof sinh !== 'function') return false; + return ((sinh(1) === 1.1752011936438014) && (sinh(Number.MIN_VALUE) === 5e-324)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/shim.js new file mode 100644 index 0000000000..5b725bed65 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/sinh/shim.js @@ -0,0 +1,17 @@ +// Parts of implementation taken from es6-shim project +// See: https://github.com/paulmillr/es6-shim/blob/master/es6-shim.js + +'use strict'; + +var expm1 = require('../expm1') + + , abs = Math.abs, exp = Math.exp, e = Math.E; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (!isFinite(x)) return x; + if (abs(x) < 1) return (expm1(x) - expm1(-x)) / 2; + return (exp(x - 1) - exp(-x - 1)) * e / 2; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/implement.js new file mode 100644 index 0000000000..5199a029c8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'tanh', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/index.js new file mode 100644 index 0000000000..6099c408a8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.tanh + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/is-implemented.js new file mode 100644 index 0000000000..a7d2223713 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var tanh = Math.tanh; + if (typeof tanh !== 'function') return false; + return ((tanh(1) === 0.7615941559557649) && (tanh(Number.MAX_VALUE) === 1)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/shim.js new file mode 100644 index 0000000000..f6e948f2c5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/tanh/shim.js @@ -0,0 +1,17 @@ +'use strict'; + +var exp = Math.exp; + +module.exports = function (x) { + var a, b; + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (x === Infinity) return 1; + if (x === -Infinity) return -1; + a = exp(x); + if (a === Infinity) return 1; + b = exp(-x); + if (b === Infinity) return -1; + return (a - b) / (a + b); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/implement.js new file mode 100644 index 0000000000..3ee80ab2a0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Math, 'trunc', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/index.js new file mode 100644 index 0000000000..0b0f9b2ac9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Math.trunc + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/is-implemented.js new file mode 100644 index 0000000000..3e8cde1f00 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var trunc = Math.trunc; + if (typeof trunc !== 'function') return false; + return (trunc(13.67) === 13) && (trunc(-13.67) === -13); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/shim.js new file mode 100644 index 0000000000..02e2c2ad3b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/math/trunc/shim.js @@ -0,0 +1,13 @@ +'use strict'; + +var floor = Math.floor; + +module.exports = function (x) { + if (isNaN(x)) return NaN; + x = Number(x); + if (x === 0) return x; + if (x === Infinity) return Infinity; + if (x === -Infinity) return -Infinity; + if (x > 0) return floor(x); + return -floor(-x); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/#/chain.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/#/chain.js new file mode 100644 index 0000000000..6dc1543b35 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/#/chain.js @@ -0,0 +1,40 @@ +'use strict'; + +var setPrototypeOf = require('es5-ext/object/set-prototype-of') + , d = require('d') + , Iterator = require('../') + , validIterable = require('../valid-iterable') + + , push = Array.prototype.push + , defineProperties = Object.defineProperties + , IteratorChain; + +IteratorChain = function (iterators) { + defineProperties(this, { + __iterators__: d('', iterators), + __current__: d('w', iterators.shift()) + }); +}; +if (setPrototypeOf) setPrototypeOf(IteratorChain, Iterator); + +IteratorChain.prototype = Object.create(Iterator.prototype, { + constructor: d(IteratorChain), + next: d(function () { + var result; + if (!this.__current__) return { done: true, value: undefined }; + result = this.__current__.next(); + while (result.done) { + this.__current__ = this.__iterators__.shift(); + if (!this.__current__) return { done: true, value: undefined }; + result = this.__current__.next(); + } + return result; + }) +}); + +module.exports = function () { + var iterators = [this]; + push.apply(iterators, arguments); + iterators.forEach(validIterable); + return new IteratorChain(iterators); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.lint b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.lint new file mode 100644 index 0000000000..cf54d81568 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.lint @@ -0,0 +1,11 @@ +@root + +module + +tabs +indent 2 +maxlen 100 + +ass +nomen +plusplus diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.npmignore new file mode 100644 index 0000000000..155e41f691 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.npmignore @@ -0,0 +1,4 @@ +.DS_Store +/node_modules +/npm-debug.log +/.lintcache diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.travis.yml new file mode 100644 index 0000000000..fc25411060 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/.travis.yml @@ -0,0 +1,11 @@ +sudo: false # http://docs.travis-ci.com/user/workers/container-based-infrastructure/ +language: node_js +node_js: + - 0.12 + - 4 + +notifications: + email: + - medikoo+es6-iterator@medikoo.com + +script: "npm test && npm run lint" diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/CHANGES b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/CHANGES new file mode 100644 index 0000000000..ce33180939 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/CHANGES @@ -0,0 +1,35 @@ +v2.0.0 -- 2015.10.02 +* Use es6-symbol at v3 + +v1.0.0 -- 2015.06.23 +* Implement support for arguments object +* Drop support for v0.8 node ('^' in package.json dependencies) + +v0.1.3 -- 2015.02.02 +* Update dependencies +* Fix spelling of LICENSE + +v0.1.2 -- 2014.11.19 +* Optimise internal `_next` to not verify internal's list length at all times + (#2 thanks @RReverser) +* Fix documentation examples +* Configure lint scripts + +v0.1.1 -- 2014.04.29 +* Fix es6-symbol dependency version + +v0.1.0 -- 2014.04.29 +* Assure strictly npm hosted dependencies +* Remove sparse arrays dedicated handling (as per spec) +* Add: isIterable, validIterable and chain (method) +* Remove toArray, it's addressed by Array.from (polyfil can be found in es5-ext/array/from) +* Add break possiblity to 'forOf' via 'doBreak' function argument +* Provide dedicated iterator for array-likes (ArrayIterator) and for strings (StringIterator) +* Provide @@toStringTag symbol +* When available rely on @@iterator symbol +* Remove 32bit integer maximum list length restriction +* Improve Iterator internals +* Update to use latest version of dependencies + +v0.0.0 -- 2013.10.12 +Initial (dev version)
\ No newline at end of file diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/LICENSE b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/LICENSE new file mode 100644 index 0000000000..04724a3ab1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/LICENSE @@ -0,0 +1,19 @@ +Copyright (C) 2013-2015 Mariusz Nowak (www.medikoo.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/README.md b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/README.md new file mode 100644 index 0000000000..30faa82bba --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/README.md @@ -0,0 +1,148 @@ +# es6-iterator +## ECMAScript 6 Iterator interface + +### Installation + + $ npm install es6-iterator + +To port it to Browser or any other (non CJS) environment, use your favorite CJS bundler. No favorite yet? Try: [Browserify](http://browserify.org/), [Webmake](https://github.com/medikoo/modules-webmake) or [Webpack](http://webpack.github.io/) + +## API + +### Constructors + +#### Iterator(list) _(es6-iterator)_ + +Abstract Iterator interface. Meant for extensions and not to be used on its own. + +Accepts any _list_ object (technically object with numeric _length_ property). + +_Mind it doesn't iterate strings properly, for that use dedicated [StringIterator](#string-iterator)_ + +```javascript +var Iterator = require('es6-iterator') +var iterator = new Iterator([1, 2, 3]); + +iterator.next(); // { value: 1, done: false } +iterator.next(); // { value: 2, done: false } +iterator.next(); // { value: 3, done: false } +iterator.next(); // { value: undefined, done: true } +``` + + +#### ArrayIterator(arrayLike[, kind]) _(es6-iterator/array)_ + +Dedicated for arrays and array-likes. Supports three iteration kinds: +* __value__ _(default)_ - Iterates values +* __key__ - Iterates indexes +* __key+value__ - Iterates keys and indexes, each iteration value is in _[key, value]_ form. + + +```javascript +var ArrayIterator = require('es6-iterator/array') +var iterator = new ArrayIterator([1, 2, 3], 'key+value'); + +iterator.next(); // { value: [0, 1], done: false } +iterator.next(); // { value: [1, 2], done: false } +iterator.next(); // { value: [2, 3], done: false } +iterator.next(); // { value: undefined, done: true } +``` + +May also be used for _arguments_ objects: + +```javascript +(function () { + var iterator = new ArrayIterator(arguments); + + iterator.next(); // { value: 1, done: false } + iterator.next(); // { value: 2, done: false } + iterator.next(); // { value: 3, done: false } + iterator.next(); // { value: undefined, done: true } +}(1, 2, 3)); +``` + +#### StringIterator(str) _(es6-iterator/string)_ + +Assures proper iteration over unicode symbols. +See: http://mathiasbynens.be/notes/javascript-unicode + +```javascript +var StringIterator = require('es6-iterator/string'); +var iterator = new StringIterator('f🙈o🙉o🙊'); + +iterator.next(); // { value: 'f', done: false } +iterator.next(); // { value: '🙈', done: false } +iterator.next(); // { value: 'o', done: false } +iterator.next(); // { value: '🙉', done: false } +iterator.next(); // { value: 'o', done: false } +iterator.next(); // { value: '🙊', done: false } +iterator.next(); // { value: undefined, done: true } +``` + +### Function utilities + +#### forOf(iterable, callback[, thisArg]) _(es6-iterator/for-of)_ + +Polyfill for ECMAScript 6 [`for...of`](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Statements/for...of) statement. + +``` +var forOf = require('es6-iterator/for-of'); +var result = []; + +forOf('🙈🙉🙊', function (monkey) { result.push(monkey); }); +console.log(result); // ['🙈', '🙉', '🙊']; +``` + +Optionally you can break iteration at any point: + +```javascript +var result = []; + +forOf([1,2,3,4]', function (val, doBreak) { + result.push(monkey); + if (val >= 3) doBreak(); +}); +console.log(result); // [1, 2, 3]; +``` + +#### get(obj) _(es6-iterator/get)_ + +Return iterator for any iterable object. + +```javascript +var getIterator = require('es6-iterator/get'); +var iterator = get([1,2,3]); + +iterator.next(); // { value: 1, done: false } +iterator.next(); // { value: 2, done: false } +iterator.next(); // { value: 3, done: false } +iterator.next(); // { value: undefined, done: true } +``` + +#### isIterable(obj) _(es6-iterator/is-iterable)_ + +Whether _obj_ is iterable + +```javascript +var isIterable = require('es6-iterator/is-iterable'); + +isIterable(null); // false +isIterable(true); // false +isIterable('str'); // true +isIterable(['a', 'r', 'r']); // true +isIterable(new ArrayIterator([])); // true +``` + +#### validIterable(obj) _(es6-iterator/valid-iterable)_ + +If _obj_ is an iterable it is returned. Otherwise _TypeError_ is thrown. + +### Method extensions + +#### iterator.chain(iterator1[, …iteratorn]) _(es6-iterator/#/chain)_ + +Chain multiple iterators into one. + +### Tests [![Build Status](https://travis-ci.org/medikoo/es6-iterator.png)](https://travis-ci.org/medikoo/es6-iterator) + + $ npm test diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/array.js new file mode 100644 index 0000000000..885ad0a4fd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/array.js @@ -0,0 +1,30 @@ +'use strict'; + +var setPrototypeOf = require('es5-ext/object/set-prototype-of') + , contains = require('es5-ext/string/#/contains') + , d = require('d') + , Iterator = require('./') + + , defineProperty = Object.defineProperty + , ArrayIterator; + +ArrayIterator = module.exports = function (arr, kind) { + if (!(this instanceof ArrayIterator)) return new ArrayIterator(arr, kind); + Iterator.call(this, arr); + if (!kind) kind = 'value'; + else if (contains.call(kind, 'key+value')) kind = 'key+value'; + else if (contains.call(kind, 'key')) kind = 'key'; + else kind = 'value'; + defineProperty(this, '__kind__', d('', kind)); +}; +if (setPrototypeOf) setPrototypeOf(ArrayIterator, Iterator); + +ArrayIterator.prototype = Object.create(Iterator.prototype, { + constructor: d(ArrayIterator), + _resolve: d(function (i) { + if (this.__kind__ === 'value') return this.__list__[i]; + if (this.__kind__ === 'key+value') return [i, this.__list__[i]]; + return i; + }), + toString: d(function () { return '[object Array Iterator]'; }) +}); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/for-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/for-of.js new file mode 100644 index 0000000000..c7a28411d5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/for-of.js @@ -0,0 +1,46 @@ +'use strict'; + +var isArguments = require('es5-ext/function/is-arguments') + , callable = require('es5-ext/object/valid-callable') + , isString = require('es5-ext/string/is-string') + , get = require('./get') + + , isArray = Array.isArray, call = Function.prototype.call + , some = Array.prototype.some; + +module.exports = function (iterable, cb/*, thisArg*/) { + var mode, thisArg = arguments[2], result, doBreak, broken, i, l, char, code; + if (isArray(iterable) || isArguments(iterable)) mode = 'array'; + else if (isString(iterable)) mode = 'string'; + else iterable = get(iterable); + + callable(cb); + doBreak = function () { broken = true; }; + if (mode === 'array') { + some.call(iterable, function (value) { + call.call(cb, thisArg, value, doBreak); + if (broken) return true; + }); + return; + } + if (mode === 'string') { + l = iterable.length; + for (i = 0; i < l; ++i) { + char = iterable[i]; + if ((i + 1) < l) { + code = char.charCodeAt(0); + if ((code >= 0xD800) && (code <= 0xDBFF)) char += iterable[++i]; + } + call.call(cb, thisArg, char, doBreak); + if (broken) break; + } + return; + } + result = iterable.next(); + + while (!result.done) { + call.call(cb, thisArg, result.value, doBreak); + if (broken) return; + result = iterable.next(); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/get.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/get.js new file mode 100644 index 0000000000..7c7e052b19 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/get.js @@ -0,0 +1,15 @@ +'use strict'; + +var isArguments = require('es5-ext/function/is-arguments') + , isString = require('es5-ext/string/is-string') + , ArrayIterator = require('./array') + , StringIterator = require('./string') + , iterable = require('./valid-iterable') + , iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (obj) { + if (typeof iterable(obj)[iteratorSymbol] === 'function') return obj[iteratorSymbol](); + if (isArguments(obj)) return new ArrayIterator(obj); + if (isString(obj)) return new StringIterator(obj); + return new ArrayIterator(obj); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/index.js new file mode 100644 index 0000000000..10fd08958f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/index.js @@ -0,0 +1,90 @@ +'use strict'; + +var clear = require('es5-ext/array/#/clear') + , assign = require('es5-ext/object/assign') + , callable = require('es5-ext/object/valid-callable') + , value = require('es5-ext/object/valid-value') + , d = require('d') + , autoBind = require('d/auto-bind') + , Symbol = require('es6-symbol') + + , defineProperty = Object.defineProperty + , defineProperties = Object.defineProperties + , Iterator; + +module.exports = Iterator = function (list, context) { + if (!(this instanceof Iterator)) return new Iterator(list, context); + defineProperties(this, { + __list__: d('w', value(list)), + __context__: d('w', context), + __nextIndex__: d('w', 0) + }); + if (!context) return; + callable(context.on); + context.on('_add', this._onAdd); + context.on('_delete', this._onDelete); + context.on('_clear', this._onClear); +}; + +defineProperties(Iterator.prototype, assign({ + constructor: d(Iterator), + _next: d(function () { + var i; + if (!this.__list__) return; + if (this.__redo__) { + i = this.__redo__.shift(); + if (i !== undefined) return i; + } + if (this.__nextIndex__ < this.__list__.length) return this.__nextIndex__++; + this._unBind(); + }), + next: d(function () { return this._createResult(this._next()); }), + _createResult: d(function (i) { + if (i === undefined) return { done: true, value: undefined }; + return { done: false, value: this._resolve(i) }; + }), + _resolve: d(function (i) { return this.__list__[i]; }), + _unBind: d(function () { + this.__list__ = null; + delete this.__redo__; + if (!this.__context__) return; + this.__context__.off('_add', this._onAdd); + this.__context__.off('_delete', this._onDelete); + this.__context__.off('_clear', this._onClear); + this.__context__ = null; + }), + toString: d(function () { return '[object Iterator]'; }) +}, autoBind({ + _onAdd: d(function (index) { + if (index >= this.__nextIndex__) return; + ++this.__nextIndex__; + if (!this.__redo__) { + defineProperty(this, '__redo__', d('c', [index])); + return; + } + this.__redo__.forEach(function (redo, i) { + if (redo >= index) this.__redo__[i] = ++redo; + }, this); + this.__redo__.push(index); + }), + _onDelete: d(function (index) { + var i; + if (index >= this.__nextIndex__) return; + --this.__nextIndex__; + if (!this.__redo__) return; + i = this.__redo__.indexOf(index); + if (i !== -1) this.__redo__.splice(i, 1); + this.__redo__.forEach(function (redo, i) { + if (redo > index) this.__redo__[i] = --redo; + }, this); + }), + _onClear: d(function () { + if (this.__redo__) clear.call(this.__redo__); + this.__nextIndex__ = 0; + }) +}))); + +defineProperty(Iterator.prototype, Symbol.iterator, d(function () { + return this; +})); +defineProperty(Iterator.prototype, Symbol.toStringTag, d('', 'Iterator')); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/is-iterable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/is-iterable.js new file mode 100644 index 0000000000..2c6f496c38 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/is-iterable.js @@ -0,0 +1,15 @@ +'use strict'; + +var isArguments = require('es5-ext/function/is-arguments') + , isString = require('es5-ext/string/is-string') + , iteratorSymbol = require('es6-symbol').iterator + + , isArray = Array.isArray; + +module.exports = function (value) { + if (value == null) return false; + if (isArray(value)) return true; + if (isString(value)) return true; + if (isArguments(value)) return true; + return (typeof value[iteratorSymbol] === 'function'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/package.json new file mode 100644 index 0000000000..e4e603f6b2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/package.json @@ -0,0 +1,91 @@ +{ + "_args": [ + [ + "es6-iterator@2", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext" + ] + ], + "_from": "es6-iterator@>=2.0.0 <3.0.0", + "_id": "es6-iterator@2.0.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/es6-symbol/es5-ext/es6-iterator", + "_nodeVersion": "0.12.7", + "_npmUser": { + "email": "medikoo+npm@medikoo.com", + "name": "medikoo" + }, + "_npmVersion": "2.11.3", + "_phantomChildren": {}, + "_requested": { + "name": "es6-iterator", + "raw": "es6-iterator@2", + "rawSpec": "2", + "scope": null, + "spec": ">=2.0.0 <3.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index/es6-symbol/es5-ext" + ], + "_resolved": "https://registry.npmjs.org/es6-iterator/-/es6-iterator-2.0.0.tgz", + "_shasum": "bd968567d61635e33c0b80727613c9cb4b096bac", + "_shrinkwrap": null, + "_spec": "es6-iterator@2", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext", + "author": { + "email": "medyk@medikoo.com", + "name": "Mariusz Nowak", + "url": "http://www.medikoo.com/" + }, + "bugs": { + "url": "https://github.com/medikoo/es6-iterator/issues" + }, + "dependencies": { + "d": "^0.1.1", + "es5-ext": "^0.10.7", + "es6-symbol": "3" + }, + "description": "Iterator abstraction based on ES6 specification", + "devDependencies": { + "event-emitter": "^0.3.4", + "tad": "^0.2.3", + "xlint": "^0.2.2", + "xlint-jslint-medikoo": "^0.1.3" + }, + "directories": {}, + "dist": { + "shasum": "bd968567d61635e33c0b80727613c9cb4b096bac", + "tarball": "http://registry.npmjs.org/es6-iterator/-/es6-iterator-2.0.0.tgz" + }, + "gitHead": "4d9445834e87780ab373b14d6791e860899e2d31", + "homepage": "https://github.com/medikoo/es6-iterator#readme", + "keywords": [ + "array", + "generator", + "iterator", + "list", + "map", + "set" + ], + "license": "MIT", + "maintainers": [ + { + "name": "medikoo", + "email": "medikoo+npm@medikoo.com" + } + ], + "name": "es6-iterator", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/medikoo/es6-iterator.git" + }, + "scripts": { + "lint": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --no-cache --no-stream", + "lint-console": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --watch", + "test": "node ./node_modules/tad/bin/tad" + }, + "version": "2.0.0" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/string.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/string.js new file mode 100644 index 0000000000..cdb39ea4e4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/string.js @@ -0,0 +1,37 @@ +// Thanks @mathiasbynens +// http://mathiasbynens.be/notes/javascript-unicode#iterating-over-symbols + +'use strict'; + +var setPrototypeOf = require('es5-ext/object/set-prototype-of') + , d = require('d') + , Iterator = require('./') + + , defineProperty = Object.defineProperty + , StringIterator; + +StringIterator = module.exports = function (str) { + if (!(this instanceof StringIterator)) return new StringIterator(str); + str = String(str); + Iterator.call(this, str); + defineProperty(this, '__length__', d('', str.length)); + +}; +if (setPrototypeOf) setPrototypeOf(StringIterator, Iterator); + +StringIterator.prototype = Object.create(Iterator.prototype, { + constructor: d(StringIterator), + _next: d(function () { + if (!this.__list__) return; + if (this.__nextIndex__ < this.__length__) return this.__nextIndex__++; + this._unBind(); + }), + _resolve: d(function (i) { + var char = this.__list__[i], code; + if (this.__nextIndex__ === this.__length__) return char; + code = char.charCodeAt(0); + if ((code >= 0xD800) && (code <= 0xDBFF)) return char + this.__list__[this.__nextIndex__++]; + return char; + }), + toString: d(function () { return '[object String Iterator]'; }) +}); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/#/chain.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/#/chain.js new file mode 100644 index 0000000000..a414c66d78 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/#/chain.js @@ -0,0 +1,23 @@ +'use strict'; + +var Iterator = require('../../'); + +module.exports = function (t, a) { + var i1 = new Iterator(['raz', 'dwa', 'trzy']) + , i2 = new Iterator(['cztery', 'pięć', 'sześć']) + , i3 = new Iterator(['siedem', 'osiem', 'dziewięć']) + + , iterator = t.call(i1, i2, i3); + + a.deep(iterator.next(), { done: false, value: 'raz' }, "#1"); + a.deep(iterator.next(), { done: false, value: 'dwa' }, "#2"); + a.deep(iterator.next(), { done: false, value: 'trzy' }, "#3"); + a.deep(iterator.next(), { done: false, value: 'cztery' }, "#4"); + a.deep(iterator.next(), { done: false, value: 'pięć' }, "#5"); + a.deep(iterator.next(), { done: false, value: 'sześć' }, "#6"); + a.deep(iterator.next(), { done: false, value: 'siedem' }, "#7"); + a.deep(iterator.next(), { done: false, value: 'osiem' }, "#8"); + a.deep(iterator.next(), { done: false, value: 'dziewięć' }, "#9"); + a.deep(iterator.next(), { done: true, value: undefined }, "Done #1"); + a.deep(iterator.next(), { done: true, value: undefined }, "Done #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/array.js new file mode 100644 index 0000000000..ae7c2199e8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/array.js @@ -0,0 +1,67 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (T) { + return { + Values: function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], it; + + it = new T(x); + a(it[iteratorSymbol](), it, "@@iterator"); + a.deep(it.next(), { done: false, value: 'raz' }, "#1"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#2"); + x.splice(1, 0, 'elo'); + a.deep(it.next(), { done: false, value: 'dwa' }, "Insert"); + a.deep(it.next(), { done: false, value: 'trzy' }, "#3"); + a.deep(it.next(), { done: false, value: 'cztery' }, "#4"); + x.pop(); + a.deep(it.next(), { done: false, value: 'pięć' }, "#5"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + "Keys & Values": function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], it; + + it = new T(x, 'key+value'); + a(it[iteratorSymbol](), it, "@@iterator"); + a.deep(it.next(), { done: false, value: [0, 'raz'] }, "#1"); + a.deep(it.next(), { done: false, value: [1, 'dwa'] }, "#2"); + x.splice(1, 0, 'elo'); + a.deep(it.next(), { done: false, value: [2, 'dwa'] }, "Insert"); + a.deep(it.next(), { done: false, value: [3, 'trzy'] }, "#3"); + a.deep(it.next(), { done: false, value: [4, 'cztery'] }, "#4"); + x.pop(); + a.deep(it.next(), { done: false, value: [5, 'pięć'] }, "#5"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + Keys: function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], it; + + it = new T(x, 'key'); + a(it[iteratorSymbol](), it, "@@iterator"); + a.deep(it.next(), { done: false, value: 0 }, "#1"); + a.deep(it.next(), { done: false, value: 1 }, "#2"); + x.splice(1, 0, 'elo'); + a.deep(it.next(), { done: false, value: 2 }, "Insert"); + a.deep(it.next(), { done: false, value: 3 }, "#3"); + a.deep(it.next(), { done: false, value: 4 }, "#4"); + x.pop(); + a.deep(it.next(), { done: false, value: 5 }, "#5"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + Sparse: function (a) { + var x = new Array(6), it; + + x[2] = 'raz'; + x[4] = 'dwa'; + it = new T(x); + a.deep(it.next(), { done: false, value: undefined }, "#1"); + a.deep(it.next(), { done: false, value: undefined }, "#2"); + a.deep(it.next(), { done: false, value: 'raz' }, "#3"); + a.deep(it.next(), { done: false, value: undefined }, "#4"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#5"); + a.deep(it.next(), { done: false, value: undefined }, "#6"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + } + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/for-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/for-of.js new file mode 100644 index 0000000000..108df7d97a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/for-of.js @@ -0,0 +1,40 @@ +'use strict'; + +var ArrayIterator = require('../array') + + , slice = Array.prototype.slice; + +module.exports = function (t, a) { + var i = 0, x = ['raz', 'dwa', 'trzy'], y = {}, called = 0; + t(x, function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Array " + i + "#"); + a(this, y, "Array: context: " + (i++) + "#"); + }, y); + i = 0; + t((function () { return arguments; }('raz', 'dwa', 'trzy')), function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Arguments" + i + "#"); + a(this, y, "Arguments: context: " + (i++) + "#"); + }, y); + i = 0; + t(x = 'foo', function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "String " + i + "#"); + a(this, y, "Regular String: context: " + (i++) + "#"); + }, y); + i = 0; + x = ['r', '💩', 'z']; + t('r💩z', function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "String " + i + "#"); + a(this, y, "Unicode String: context: " + (i++) + "#"); + }, y); + i = 0; + t(new ArrayIterator(x), function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Iterator " + i + "#"); + a(this, y, "Iterator: context: " + (i++) + "#"); + }, y); + + t(x = ['raz', 'dwa', 'trzy'], function (value, doBreak) { + ++called; + return doBreak(); + }); + a(called, 1, "Break"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/get.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/get.js new file mode 100644 index 0000000000..81ce6e6ae4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/get.js @@ -0,0 +1,17 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator + , Iterator = require('../'); + +module.exports = function (t, a) { + var iterator; + a.throws(function () { t(); }, TypeError, "Null"); + a.throws(function () { t({}); }, TypeError, "Plain object"); + a.throws(function () { t({ length: 0 }); }, TypeError, "Array-like"); + iterator = {}; + iterator[iteratorSymbol] = function () { return new Iterator([]); }; + a(t(iterator) instanceof Iterator, true, "Iterator"); + a(String(t([])), '[object Array Iterator]', " Array"); + a(String(t((function () { return arguments; }()))), '[object Array Iterator]', " Arguments"); + a(String(t('foo')), '[object String Iterator]', "String"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/index.js new file mode 100644 index 0000000000..ea3621adfe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/index.js @@ -0,0 +1,99 @@ +'use strict'; + +var ee = require('event-emitter') + , iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (T) { + return { + "": function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć'], it, y, z; + + it = new T(x); + a(it[iteratorSymbol](), it, "@@iterator"); + y = it.next(); + a.deep(y, { done: false, value: 'raz' }, "#1"); + z = it.next(); + a.not(y, z, "Recreate result"); + a.deep(z, { done: false, value: 'dwa' }, "#2"); + a.deep(it.next(), { done: false, value: 'trzy' }, "#3"); + a.deep(it.next(), { done: false, value: 'cztery' }, "#4"); + a.deep(it.next(), { done: false, value: 'pięć' }, "#5"); + a.deep(y = it.next(), { done: true, value: undefined }, "End"); + a.not(y, it.next(), "Recreate result on dead"); + }, + Emited: function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć'], y, it; + + y = ee(); + it = new T(x, y); + a.deep(it.next(), { done: false, value: 'raz' }, "#1"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#2"); + y.emit('_add', x.push('sześć') - 1); + a.deep(it.next(), { done: false, value: 'trzy' }, "#3"); + x.splice(1, 0, 'półtora'); + y.emit('_add', 1); + a.deep(it.next(), { done: false, value: 'półtora' }, "Insert"); + x.splice(5, 1); + y.emit('_delete', 5); + a.deep(it.next(), { done: false, value: 'cztery' }, "#4"); + a.deep(it.next(), { done: false, value: 'sześć' }, "#5"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + "Emited #2": function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], y, it; + + y = ee(); + it = new T(x, y); + a.deep(it.next(), { done: false, value: 'raz' }, "#1"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#2"); + x.splice(1, 0, 'półtora'); + y.emit('_add', 1); + x.splice(1, 0, '1.25'); + y.emit('_add', 1); + x.splice(0, 1); + y.emit('_delete', 0); + a.deep(it.next(), { done: false, value: 'półtora' }, "Insert"); + a.deep(it.next(), { done: false, value: '1.25' }, "Insert #2"); + a.deep(it.next(), { done: false, value: 'trzy' }, "#3"); + a.deep(it.next(), { done: false, value: 'cztery' }, "#4"); + x.splice(5, 1); + y.emit('_delete', 5); + a.deep(it.next(), { done: false, value: 'sześć' }, "#5"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + "Emited: Clear #1": function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], y, it; + + y = ee(); + it = new T(x, y); + a.deep(it.next(), { done: false, value: 'raz' }, "#1"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#2"); + x.length = 0; + y.emit('_clear'); + a.deep(it.next(), { done: true, value: undefined }, "End"); + }, + "Emited: Clear #2": function (a) { + var x = ['raz', 'dwa', 'trzy', 'cztery', 'pięć', 'sześć'], y, it; + + y = ee(); + it = new T(x, y); + a.deep(it.next(), { done: false, value: 'raz' }, "#1"); + a.deep(it.next(), { done: false, value: 'dwa' }, "#2"); + x.length = 0; + y.emit('_clear'); + x.push('foo'); + x.push('bar'); + a.deep(it.next(), { done: false, value: 'foo' }, "#3"); + a.deep(it.next(), { done: false, value: 'bar' }, "#4"); + x.splice(1, 0, 'półtora'); + y.emit('_add', 1); + x.splice(1, 0, '1.25'); + y.emit('_add', 1); + x.splice(0, 1); + y.emit('_delete', 0); + a.deep(it.next(), { done: false, value: 'półtora' }, "Insert"); + a.deep(it.next(), { done: false, value: '1.25' }, "Insert #2"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + } + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/is-iterable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/is-iterable.js new file mode 100644 index 0000000000..438ad349ca --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/is-iterable.js @@ -0,0 +1,19 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator + , Iterator = require('../'); + +module.exports = function (t, a) { + var iterator; + a(t(), false, "Undefined"); + a(t(123), false, "Number"); + a(t({}), false, "Plain object"); + a(t({ length: 0 }), false, "Array-like"); + iterator = {}; + iterator[iteratorSymbol] = function () { return new Iterator([]); }; + a(t(iterator), true, "Iterator"); + a(t([]), true, "Array"); + a(t('foo'), true, "String"); + a(t(''), true, "Empty string"); + a(t((function () { return arguments; }())), true, "Arguments"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/string.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/string.js new file mode 100644 index 0000000000..d11855f251 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/string.js @@ -0,0 +1,23 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (T, a) { + var it = new T('foobar'); + + a(it[iteratorSymbol](), it, "@@iterator"); + a.deep(it.next(), { done: false, value: 'f' }, "#1"); + a.deep(it.next(), { done: false, value: 'o' }, "#2"); + a.deep(it.next(), { done: false, value: 'o' }, "#3"); + a.deep(it.next(), { done: false, value: 'b' }, "#4"); + a.deep(it.next(), { done: false, value: 'a' }, "#5"); + a.deep(it.next(), { done: false, value: 'r' }, "#6"); + a.deep(it.next(), { done: true, value: undefined }, "End"); + + a.h1("Outside of BMP"); + it = new T('r💩z'); + a.deep(it.next(), { done: false, value: 'r' }, "#1"); + a.deep(it.next(), { done: false, value: '💩' }, "#2"); + a.deep(it.next(), { done: false, value: 'z' }, "#3"); + a.deep(it.next(), { done: true, value: undefined }, "End"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/valid-iterable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/valid-iterable.js new file mode 100644 index 0000000000..a407f1a0c4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/test/valid-iterable.js @@ -0,0 +1,18 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator + , Iterator = require('../'); + +module.exports = function (t, a) { + var obj; + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t({}); }, TypeError, "Plain object"); + a.throws(function () { t({ length: 0 }); }, TypeError, "Array-like"); + obj = {}; + obj[iteratorSymbol] = function () { return new Iterator([]); }; + a(t(obj), obj, "Iterator"); + obj = []; + a(t(obj), obj, 'Array'); + obj = (function () { return arguments; }()); + a(t(obj), obj, "Arguments"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/valid-iterable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/valid-iterable.js new file mode 100644 index 0000000000..d330997cb1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/node_modules/es6-iterator/valid-iterable.js @@ -0,0 +1,8 @@ +'use strict'; + +var isIterable = require('./is-iterable'); + +module.exports = function (value) { + if (!isIterable(value)) throw new TypeError(value + " is not iterable"); + return value; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/index.js new file mode 100644 index 0000000000..324811704b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = { + pad: require('./pad') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/pad.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/pad.js new file mode 100644 index 0000000000..4478f6a11e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/#/pad.js @@ -0,0 +1,15 @@ +'use strict'; + +var pad = require('../../string/#/pad') + , toPosInt = require('../to-pos-integer') + + , toFixed = Number.prototype.toFixed; + +module.exports = function (length/*, precision*/) { + var precision; + length = toPosInt(length); + precision = toPosInt(arguments[1]); + + return pad.call(precision ? toFixed.call(this, precision) : this, + '0', length + (precision ? (1 + precision) : 0)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/implement.js new file mode 100644 index 0000000000..f0a670ae33 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'EPSILON', { value: require('./'), + configurable: false, enumerable: false, writable: false }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/index.js new file mode 100644 index 0000000000..4e4b621b7b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = 2.220446049250313e-16; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/is-implemented.js new file mode 100644 index 0000000000..141f5d2f24 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/epsilon/is-implemented.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function () { + return (typeof Number.EPSILON === 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/index.js new file mode 100644 index 0000000000..841b3612c0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/index.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + EPSILON: require('./epsilon'), + isFinite: require('./is-finite'), + isInteger: require('./is-integer'), + isNaN: require('./is-nan'), + isNatural: require('./is-natural'), + isNumber: require('./is-number'), + isSafeInteger: require('./is-safe-integer'), + MAX_SAFE_INTEGER: require('./max-safe-integer'), + MIN_SAFE_INTEGER: require('./min-safe-integer'), + toInteger: require('./to-integer'), + toPosInteger: require('./to-pos-integer'), + toUint32: require('./to-uint32') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/implement.js new file mode 100644 index 0000000000..51d7cac07a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'isFinite', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/index.js new file mode 100644 index 0000000000..15d5f40588 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Number.isFinite + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/is-implemented.js new file mode 100644 index 0000000000..556e396bb0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var isFinite = Number.isFinite; + if (typeof isFinite !== 'function') return false; + return !isFinite('23') && isFinite(34) && !isFinite(Infinity); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/shim.js new file mode 100644 index 0000000000..e3aee551a7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-finite/shim.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (value) { + return (typeof value === 'number') && isFinite(value); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/implement.js new file mode 100644 index 0000000000..fe53f28143 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'isInteger', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/index.js new file mode 100644 index 0000000000..55e039a99d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Number.isInteger + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/is-implemented.js new file mode 100644 index 0000000000..a0e573be7c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var isInteger = Number.isInteger; + if (typeof isInteger !== 'function') return false; + return !isInteger('23') && isInteger(34) && !isInteger(32.34); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/shim.js new file mode 100644 index 0000000000..5402939806 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-integer/shim.js @@ -0,0 +1,8 @@ +// Credit: http://www.2ality.com/2014/05/is-integer.html + +'use strict'; + +module.exports = function (value) { + if (typeof value !== 'number') return false; + return (value % 1 === 0); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/implement.js new file mode 100644 index 0000000000..e1c5deea36 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'isNaN', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/index.js new file mode 100644 index 0000000000..3b2c4ca6bd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Number.isNaN + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/is-implemented.js new file mode 100644 index 0000000000..4cf2766563 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var isNaN = Number.isNaN; + if (typeof isNaN !== 'function') return false; + return !isNaN({}) && isNaN(NaN) && !isNaN(34); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/shim.js new file mode 100644 index 0000000000..070d96cd46 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-nan/shim.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (value) { return (value !== value); } //jslint: ignore diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-natural.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-natural.js new file mode 100644 index 0000000000..831090d23c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-natural.js @@ -0,0 +1,5 @@ +'use strict'; + +var isInteger = require('./is-integer'); + +module.exports = function (num) { return isInteger(num) && (num >= 0); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-number.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-number.js new file mode 100644 index 0000000000..19a99e4f19 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-number.js @@ -0,0 +1,11 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(1); + +module.exports = function (x) { + return ((typeof x === 'number') || + ((x instanceof Number) || + ((typeof x === 'object') && (toString.call(x) === id)))); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/implement.js new file mode 100644 index 0000000000..51cef96021 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'isSafeInteger', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/index.js new file mode 100644 index 0000000000..49adeaaf78 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Number.isSafeInteger + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/is-implemented.js new file mode 100644 index 0000000000..510b60e4e4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function () { + var isSafeInteger = Number.isSafeInteger; + if (typeof isSafeInteger !== 'function') return false; + return !isSafeInteger('23') && isSafeInteger(34232322323) && + !isSafeInteger(9007199254740992); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/shim.js new file mode 100644 index 0000000000..692acdd6ca --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/is-safe-integer/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +var isInteger = require('../is-integer/shim') + , maxValue = require('../max-safe-integer') + + , abs = Math.abs; + +module.exports = function (value) { + if (!isInteger(value)) return false; + return abs(value) <= maxValue; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/implement.js new file mode 100644 index 0000000000..4e0bb5741d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'MAX_SAFE_INTEGER', { value: require('./'), + configurable: false, enumerable: false, writable: false }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/index.js new file mode 100644 index 0000000000..ed5d6a5379 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = Math.pow(2, 53) - 1; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/is-implemented.js new file mode 100644 index 0000000000..7bd08a9da4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/max-safe-integer/is-implemented.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function () { + return (typeof Number.MAX_SAFE_INTEGER === 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/implement.js new file mode 100644 index 0000000000..e3f110e419 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Number, 'MIN_SAFE_INTEGER', { value: require('./'), + configurable: false, enumerable: false, writable: false }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/index.js new file mode 100644 index 0000000000..1c6cc2744e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = -(Math.pow(2, 53) - 1); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/is-implemented.js new file mode 100644 index 0000000000..efc9875f48 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/min-safe-integer/is-implemented.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function () { + return (typeof Number.MIN_SAFE_INTEGER === 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-integer.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-integer.js new file mode 100644 index 0000000000..60e798c5fd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-integer.js @@ -0,0 +1,12 @@ +'use strict'; + +var sign = require('../math/sign') + + , abs = Math.abs, floor = Math.floor; + +module.exports = function (value) { + if (isNaN(value)) return 0; + value = Number(value); + if ((value === 0) || !isFinite(value)) return value; + return sign(value) * floor(abs(value)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-pos-integer.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-pos-integer.js new file mode 100644 index 0000000000..605a302c71 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-pos-integer.js @@ -0,0 +1,7 @@ +'use strict'; + +var toInteger = require('./to-integer') + + , max = Math.max; + +module.exports = function (value) { return max(0, toInteger(value)); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-uint32.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-uint32.js new file mode 100644 index 0000000000..6263e85ed6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/number/to-uint32.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (value) { return value >>> 0; }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/_iterate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/_iterate.js new file mode 100644 index 0000000000..1ccbaf2742 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/_iterate.js @@ -0,0 +1,29 @@ +// Internal method, used by iteration functions. +// Calls a function for each key-value pair found in object +// Optionally takes compareFn to iterate object in specific order + +'use strict'; + +var callable = require('./valid-callable') + , value = require('./valid-value') + + , bind = Function.prototype.bind, call = Function.prototype.call, keys = Object.keys + , propertyIsEnumerable = Object.prototype.propertyIsEnumerable; + +module.exports = function (method, defVal) { + return function (obj, cb/*, thisArg, compareFn*/) { + var list, thisArg = arguments[2], compareFn = arguments[3]; + obj = Object(value(obj)); + callable(cb); + + list = keys(obj); + if (compareFn) { + list.sort((typeof compareFn === 'function') ? bind.call(compareFn, obj) : undefined); + } + if (typeof method !== 'function') method = list[method]; + return call.call(method, list, function (key, index) { + if (!propertyIsEnumerable.call(obj, key)) return defVal; + return call.call(cb, thisArg, obj[key], key, obj, index); + }); + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/implement.js new file mode 100644 index 0000000000..3bcc68e31e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Object, 'assign', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/index.js new file mode 100644 index 0000000000..ab0f9f249e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Object.assign + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/is-implemented.js new file mode 100644 index 0000000000..579ad2ddc4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function () { + var assign = Object.assign, obj; + if (typeof assign !== 'function') return false; + obj = { foo: 'raz' }; + assign(obj, { bar: 'dwa' }, { trzy: 'trzy' }); + return (obj.foo + obj.bar + obj.trzy) === 'razdwatrzy'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/shim.js new file mode 100644 index 0000000000..74da11a86a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/assign/shim.js @@ -0,0 +1,22 @@ +'use strict'; + +var keys = require('../keys') + , value = require('../valid-value') + + , max = Math.max; + +module.exports = function (dest, src/*, …srcn*/) { + var error, i, l = max(arguments.length, 2), assign; + dest = Object(value(dest)); + assign = function (key) { + try { dest[key] = src[key]; } catch (e) { + if (!error) error = e; + } + }; + for (i = 1; i < l; ++i) { + src = arguments[i]; + keys(src).forEach(assign); + } + if (error !== undefined) throw error; + return dest; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/clear.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/clear.js new file mode 100644 index 0000000000..85e4637285 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/clear.js @@ -0,0 +1,16 @@ +'use strict'; + +var keys = require('./keys'); + +module.exports = function (obj) { + var error; + keys(obj).forEach(function (key) { + try { + delete this[key]; + } catch (e) { + if (!error) error = e; + } + }, obj); + if (error !== undefined) throw error; + return obj; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compact.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compact.js new file mode 100644 index 0000000000..d021da457e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compact.js @@ -0,0 +1,7 @@ +'use strict'; + +var filter = require('./filter'); + +module.exports = function (obj) { + return filter(obj, function (val) { return val != null; }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compare.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compare.js new file mode 100644 index 0000000000..2ab11f1a39 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/compare.js @@ -0,0 +1,42 @@ +'use strict'; + +var strCompare = require('../string/#/case-insensitive-compare') + , isObject = require('./is-object') + + , resolve, typeMap; + +typeMap = { + undefined: 0, + object: 1, + boolean: 2, + string: 3, + number: 4 +}; + +resolve = function (a) { + if (isObject(a)) { + if (typeof a.valueOf !== 'function') return NaN; + a = a.valueOf(); + if (isObject(a)) { + if (typeof a.toString !== 'function') return NaN; + a = a.toString(); + if (typeof a !== 'string') return NaN; + } + } + return a; +}; + +module.exports = function (a, b) { + if (a === b) return 0; // Same + + a = resolve(a); + b = resolve(b); + if (a == b) return typeMap[typeof a] - typeMap[typeof b]; //jslint: ignore + if (a == null) return -1; + if (b == null) return 1; + if ((typeof a === 'string') || (typeof b === 'string')) { + return strCompare.call(a, b); + } + if ((a !== a) && (b !== b)) return 0; //jslint: ignore + return Number(a) - Number(b); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy-deep.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy-deep.js new file mode 100644 index 0000000000..b203a7c693 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy-deep.js @@ -0,0 +1,38 @@ +'use strict'; + +var forEach = require('./for-each') + , isPlainObject = require('./is-plain-object') + , value = require('./valid-value') + + , isArray = Array.isArray + , copy, copyItem; + +copyItem = function (value, key) { + var index; + if (!isPlainObject(value) && !isArray(value)) return value; + index = this[0].indexOf(value); + if (index === -1) return copy.call(this, value); + return this[1][index]; +}; + +copy = function (source) { + var target = isArray(source) ? [] : {}; + this[0].push(source); + this[1].push(target); + if (isArray(source)) { + source.forEach(function (value, key) { + target[key] = copyItem.call(this, value, key); + }, this); + } else { + forEach(source, function (value, key) { + target[key] = copyItem.call(this, value, key); + }, this); + } + return target; +}; + +module.exports = function (source) { + var obj = Object(value(source)); + if (obj !== source) return obj; + return copy.call([[], []], obj); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy.js new file mode 100644 index 0000000000..4d7177285f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/copy.js @@ -0,0 +1,10 @@ +'use strict'; + +var assign = require('./assign') + , value = require('./valid-value'); + +module.exports = function (obj) { + var copy = Object(value(obj)); + if (copy !== obj) return copy; + return assign({}, obj); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/count.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/count.js new file mode 100644 index 0000000000..29cfbb53fb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/count.js @@ -0,0 +1,5 @@ +'use strict'; + +var keys = require('./keys'); + +module.exports = function (obj) { return keys(obj).length; }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/create.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/create.js new file mode 100644 index 0000000000..f813b4661c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/create.js @@ -0,0 +1,36 @@ +// Workaround for http://code.google.com/p/v8/issues/detail?id=2804 + +'use strict'; + +var create = Object.create, shim; + +if (!require('./set-prototype-of/is-implemented')()) { + shim = require('./set-prototype-of/shim'); +} + +module.exports = (function () { + var nullObject, props, desc; + if (!shim) return create; + if (shim.level !== 1) return create; + + nullObject = {}; + props = {}; + desc = { configurable: false, enumerable: false, writable: true, + value: undefined }; + Object.getOwnPropertyNames(Object.prototype).forEach(function (name) { + if (name === '__proto__') { + props[name] = { configurable: true, enumerable: false, writable: true, + value: undefined }; + return; + } + props[name] = desc; + }); + Object.defineProperties(nullObject, props); + + Object.defineProperty(shim, 'nullPolyfill', { configurable: false, + enumerable: false, writable: false, value: nullObject }); + + return function (prototype, props) { + return create((prototype === null) ? nullObject : prototype, props); + }; +}()); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number-value.js new file mode 100644 index 0000000000..f58fb4e4a7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number-value.js @@ -0,0 +1,8 @@ +'use strict'; + +var ensure = require('./ensure-natural-number'); + +module.exports = function (arg) { + if (arg == null) throw new TypeError(arg + " is not a natural number"); + return ensure(arg); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number.js new file mode 100644 index 0000000000..af9b4d77c2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/ensure-natural-number.js @@ -0,0 +1,9 @@ +'use strict'; + +var isNatural = require('../number/is-natural'); + +module.exports = function (arg) { + var num = Number(arg); + if (!isNatural(num)) throw new TypeError(arg + " is not a natural number"); + return num; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/eq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/eq.js new file mode 100644 index 0000000000..037937ea6e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/eq.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (x, y) { + return ((x === y) || ((x !== x) && (y !== y))); //jslint: ignore +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/every.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/every.js new file mode 100644 index 0000000000..1303db2095 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/every.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./_iterate')('every', true); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/filter.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/filter.js new file mode 100644 index 0000000000..e5edb49b1b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/filter.js @@ -0,0 +1,15 @@ +'use strict'; + +var callable = require('./valid-callable') + , forEach = require('./for-each') + + , call = Function.prototype.call; + +module.exports = function (obj, cb/*, thisArg*/) { + var o = {}, thisArg = arguments[2]; + callable(cb); + forEach(obj, function (value, key, obj, index) { + if (call.call(cb, thisArg, value, key, obj, index)) o[key] = obj[key]; + }); + return o; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find-key.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find-key.js new file mode 100644 index 0000000000..5841fd709a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find-key.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./_iterate')(require('../array/#/find'), false); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find.js new file mode 100644 index 0000000000..c94f643f3f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/find.js @@ -0,0 +1,8 @@ +'use strict'; + +var findKey = require('./find-key'); + +module.exports = function (obj, cb/*, thisArg, compareFn*/) { + var key = findKey.apply(this, arguments); + return (key == null) ? key : obj[key]; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/first-key.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/first-key.js new file mode 100644 index 0000000000..7df10b2f7f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/first-key.js @@ -0,0 +1,14 @@ +'use strict'; + +var value = require('./valid-value') + + , propertyIsEnumerable = Object.prototype.propertyIsEnumerable; + +module.exports = function (obj) { + var i; + value(obj); + for (i in obj) { + if (propertyIsEnumerable.call(obj, i)) return i; + } + return null; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/flatten.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/flatten.js new file mode 100644 index 0000000000..e8b40444a9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/flatten.js @@ -0,0 +1,17 @@ +'use strict'; + +var isPlainObject = require('./is-plain-object') + , forEach = require('./for-each') + + , process; + +process = function self(value, key) { + if (isPlainObject(value)) forEach(value, self, this); + else this[key] = value; +}; + +module.exports = function (obj) { + var flattened = {}; + forEach(obj, process, flattened); + return flattened; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/for-each.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/for-each.js new file mode 100644 index 0000000000..6674f8a614 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/for-each.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./_iterate')('forEach'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/get-property-names.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/get-property-names.js new file mode 100644 index 0000000000..54a01e5047 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/get-property-names.js @@ -0,0 +1,18 @@ +'use strict'; + +var uniq = require('../array/#/uniq') + , value = require('./valid-value') + + , push = Array.prototype.push + , getOwnPropertyNames = Object.getOwnPropertyNames + , getPrototypeOf = Object.getPrototypeOf; + +module.exports = function (obj) { + var keys; + obj = Object(value(obj)); + keys = getOwnPropertyNames(obj); + while ((obj = getPrototypeOf(obj))) { + push.apply(keys, getOwnPropertyNames(obj)); + } + return uniq.call(keys); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/index.js new file mode 100644 index 0000000000..77f5b6aeba --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/index.js @@ -0,0 +1,53 @@ +'use strict'; + +module.exports = { + assign: require('./assign'), + clear: require('./clear'), + compact: require('./compact'), + compare: require('./compare'), + copy: require('./copy'), + copyDeep: require('./copy-deep'), + count: require('./count'), + create: require('./create'), + ensureNaturalNumber: require('./ensure-natural-number'), + ensureNaturalNumberValue: require('./ensure-natural-number-value'), + eq: require('./eq'), + every: require('./every'), + filter: require('./filter'), + find: require('./find'), + findKey: require('./find-key'), + firstKey: require('./first-key'), + flatten: require('./flatten'), + forEach: require('./for-each'), + getPropertyNames: require('./get-property-names'), + is: require('./is'), + isArrayLike: require('./is-array-like'), + isCallable: require('./is-callable'), + isCopy: require('./is-copy'), + isCopyDeep: require('./is-copy-deep'), + isEmpty: require('./is-empty'), + isNumberValue: require('./is-number-value'), + isObject: require('./is-object'), + isPlainObject: require('./is-plain-object'), + keyOf: require('./key-of'), + keys: require('./keys'), + map: require('./map'), + mapKeys: require('./map-keys'), + normalizeOptions: require('./normalize-options'), + mixin: require('./mixin'), + mixinPrototypes: require('./mixin-prototypes'), + primitiveSet: require('./primitive-set'), + safeTraverse: require('./safe-traverse'), + serialize: require('./serialize'), + setPrototypeOf: require('./set-prototype-of'), + some: require('./some'), + toArray: require('./to-array'), + unserialize: require('./unserialize'), + validateArrayLike: require('./validate-array-like'), + validateArrayLikeObject: require('./validate-array-like-object'), + validCallable: require('./valid-callable'), + validObject: require('./valid-object'), + validateStringifiable: require('./validate-stringifiable'), + validateStringifiableValue: require('./validate-stringifiable-value'), + validValue: require('./valid-value') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-array-like.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-array-like.js new file mode 100644 index 0000000000..b8beed225b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-array-like.js @@ -0,0 +1,14 @@ +'use strict'; + +var isFunction = require('../function/is-function') + , isObject = require('./is-object'); + +module.exports = function (x) { + return ((x != null) && (typeof x.length === 'number') && + + // Just checking ((typeof x === 'object') && (typeof x !== 'function')) + // won't work right for some cases, e.g.: + // type of instance of NodeList in Safari is a 'function' + + ((isObject(x) && !isFunction(x)) || (typeof x === "string"))) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-callable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-callable.js new file mode 100644 index 0000000000..5d5d4b316b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-callable.js @@ -0,0 +1,5 @@ +// Deprecated + +'use strict'; + +module.exports = function (obj) { return typeof obj === 'function'; }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy-deep.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy-deep.js new file mode 100644 index 0000000000..c4b2b42b10 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy-deep.js @@ -0,0 +1,58 @@ +'use strict'; + +var eq = require('./eq') + , isPlainObject = require('./is-plain-object') + , value = require('./valid-value') + + , isArray = Array.isArray, keys = Object.keys + , propertyIsEnumerable = Object.prototype.propertyIsEnumerable + + , eqArr, eqVal, eqObj; + +eqArr = function (a, b, recMap) { + var i, l = a.length; + if (l !== b.length) return false; + for (i = 0; i < l; ++i) { + if (a.hasOwnProperty(i) !== b.hasOwnProperty(i)) return false; + if (!eqVal(a[i], b[i], recMap)) return false; + } + return true; +}; + +eqObj = function (a, b, recMap) { + var k1 = keys(a), k2 = keys(b); + if (k1.length !== k2.length) return false; + return k1.every(function (key) { + if (!propertyIsEnumerable.call(b, key)) return false; + return eqVal(a[key], b[key], recMap); + }); +}; + +eqVal = function (a, b, recMap) { + var i, eqX, c1, c2; + if (eq(a, b)) return true; + if (isPlainObject(a)) { + if (!isPlainObject(b)) return false; + eqX = eqObj; + } else if (isArray(a) && isArray(b)) { + eqX = eqArr; + } else { + return false; + } + c1 = recMap[0]; + c2 = recMap[1]; + i = c1.indexOf(a); + if (i !== -1) { + if (c2[i].indexOf(b) !== -1) return true; + } else { + i = c1.push(a) - 1; + c2[i] = []; + } + c2[i].push(b); + return eqX(a, b, recMap); +}; + +module.exports = function (a, b) { + if (eq(value(a), value(b))) return true; + return eqVal(Object(a), Object(b), [[], []]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy.js new file mode 100644 index 0000000000..4fe639d4ef --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-copy.js @@ -0,0 +1,24 @@ +'use strict'; + +var eq = require('./eq') + , value = require('./valid-value') + + , keys = Object.keys + , propertyIsEnumerable = Object.prototype.propertyIsEnumerable; + +module.exports = function (a, b) { + var k1, k2; + + if (eq(value(a), value(b))) return true; + + a = Object(a); + b = Object(b); + + k1 = keys(a); + k2 = keys(b); + if (k1.length !== k2.length) return false; + return k1.every(function (key) { + if (!propertyIsEnumerable.call(b, key)) return false; + return eq(a[key], b[key]); + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-empty.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-empty.js new file mode 100644 index 0000000000..7b51a87cf5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-empty.js @@ -0,0 +1,14 @@ +'use strict'; + +var value = require('./valid-value') + + , propertyIsEnumerable = Object.prototype.propertyIsEnumerable; + +module.exports = function (obj) { + var i; + value(obj); + for (i in obj) { //jslint: ignore + if (propertyIsEnumerable.call(obj, i)) return false; + } + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-number-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-number-value.js new file mode 100644 index 0000000000..f6396f580f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-number-value.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (value) { return (value != null) && !isNaN(value); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-object.js new file mode 100644 index 0000000000..a86facf187 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-object.js @@ -0,0 +1,7 @@ +'use strict'; + +var map = { function: true, object: true }; + +module.exports = function (x) { + return ((x != null) && map[typeof x]) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-plain-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-plain-object.js new file mode 100644 index 0000000000..9a2823198e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is-plain-object.js @@ -0,0 +1,20 @@ +'use strict'; + +var getPrototypeOf = Object.getPrototypeOf, prototype = Object.prototype + , toString = prototype.toString + + , id = Object().toString(); + +module.exports = function (value) { + var proto, constructor; + if (!value || (typeof value !== 'object') || (toString.call(value) !== id)) { + return false; + } + proto = getPrototypeOf(value); + if (proto === null) { + constructor = value.constructor; + if (typeof constructor !== 'function') return true; + return (constructor.prototype !== value); + } + return (proto === prototype) || (getPrototypeOf(proto) === null); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is.js new file mode 100644 index 0000000000..5778b502d9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/is.js @@ -0,0 +1,10 @@ +// Implementation credits go to: +// http://wiki.ecmascript.org/doku.php?id=harmony:egal + +'use strict'; + +module.exports = function (x, y) { + return (x === y) ? + ((x !== 0) || ((1 / x) === (1 / y))) : + ((x !== x) && (y !== y)); //jslint: ignore +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/key-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/key-of.js new file mode 100644 index 0000000000..8c44c8d802 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/key-of.js @@ -0,0 +1,15 @@ +'use strict'; + +var eq = require('./eq') + , some = require('./some'); + +module.exports = function (obj, searchValue) { + var r; + return some(obj, function (value, name) { + if (eq(value, searchValue)) { + r = name; + return true; + } + return false; + }) ? r : null; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/implement.js new file mode 100644 index 0000000000..c6872bd02a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(Object, 'keys', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/index.js new file mode 100644 index 0000000000..5ef052233a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Object.keys + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/is-implemented.js new file mode 100644 index 0000000000..40c32c3394 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function () { + try { + Object.keys('primitive'); + return true; + } catch (e) { return false; } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/shim.js new file mode 100644 index 0000000000..034b6b2981 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/keys/shim.js @@ -0,0 +1,7 @@ +'use strict'; + +var keys = Object.keys; + +module.exports = function (object) { + return keys(object == null ? object : Object(object)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map-keys.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map-keys.js new file mode 100644 index 0000000000..26f0ecacb8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map-keys.js @@ -0,0 +1,15 @@ +'use strict'; + +var callable = require('./valid-callable') + , forEach = require('./for-each') + + , call = Function.prototype.call; + +module.exports = function (obj, cb/*, thisArg*/) { + var o = {}, thisArg = arguments[2]; + callable(cb); + forEach(obj, function (value, key, obj, index) { + o[call.call(cb, thisArg, key, value, this, index)] = value; + }, obj); + return o; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map.js new file mode 100644 index 0000000000..6b39d3c94b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/map.js @@ -0,0 +1,15 @@ +'use strict'; + +var callable = require('./valid-callable') + , forEach = require('./for-each') + + , call = Function.prototype.call; + +module.exports = function (obj, cb/*, thisArg*/) { + var o = {}, thisArg = arguments[2]; + callable(cb); + forEach(obj, function (value, key, obj, index) { + o[key] = call.call(cb, thisArg, value, key, obj, index); + }); + return o; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin-prototypes.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin-prototypes.js new file mode 100644 index 0000000000..1ef5756423 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin-prototypes.js @@ -0,0 +1,34 @@ +'use strict'; + +var value = require('./valid-value') + , mixin = require('./mixin') + + , defineProperty = Object.defineProperty + , getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor + , getOwnPropertyNames = Object.getOwnPropertyNames + , getPrototypeOf = Object.getPrototypeOf + , hasOwnProperty = Object.prototype.hasOwnProperty; + +module.exports = function (target, source) { + var error, end, define; + target = Object(value(target)); + source = Object(value(source)); + end = getPrototypeOf(target); + if (source === end) return target; + try { + mixin(target, source); + } catch (e) { error = e; } + source = getPrototypeOf(source); + define = function (name) { + if (hasOwnProperty.call(target, name)) return; + try { + defineProperty(target, name, getOwnPropertyDescriptor(source, name)); + } catch (e) { error = e; } + }; + while (source && (source !== end)) { + getOwnPropertyNames(source).forEach(define); + source = getPrototypeOf(source); + } + if (error) throw error; + return target; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin.js new file mode 100644 index 0000000000..80b5df5e04 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/mixin.js @@ -0,0 +1,19 @@ +'use strict'; + +var value = require('./valid-value') + + , defineProperty = Object.defineProperty + , getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor + , getOwnPropertyNames = Object.getOwnPropertyNames; + +module.exports = function (target, source) { + var error; + target = Object(value(target)); + getOwnPropertyNames(Object(value(source))).forEach(function (name) { + try { + defineProperty(target, name, getOwnPropertyDescriptor(source, name)); + } catch (e) { error = e; } + }); + if (error !== undefined) throw error; + return target; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/normalize-options.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/normalize-options.js new file mode 100644 index 0000000000..cf8ed8d38c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/normalize-options.js @@ -0,0 +1,17 @@ +'use strict'; + +var forEach = Array.prototype.forEach, create = Object.create; + +var process = function (src, obj) { + var key; + for (key in src) obj[key] = src[key]; +}; + +module.exports = function (options/*, …options*/) { + var result = create(null); + forEach.call(arguments, function (options) { + if (options == null) return; + process(Object(options), result); + }); + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/primitive-set.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/primitive-set.js new file mode 100644 index 0000000000..ada109510d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/primitive-set.js @@ -0,0 +1,9 @@ +'use strict'; + +var forEach = Array.prototype.forEach, create = Object.create; + +module.exports = function (arg/*, …args*/) { + var set = create(null); + forEach.call(arguments, function (name) { set[name] = true; }); + return set; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/safe-traverse.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/safe-traverse.js new file mode 100644 index 0000000000..7e1b5f41ed --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/safe-traverse.js @@ -0,0 +1,15 @@ +'use strict'; + +var value = require('./valid-value'); + +module.exports = function (obj/*, …names*/) { + var length, current = 1; + value(obj); + length = arguments.length - 1; + if (!length) return obj; + while (current < length) { + obj = obj[arguments[current++]]; + if (obj == null) return undefined; + } + return obj[arguments[current]]; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/serialize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/serialize.js new file mode 100644 index 0000000000..8113b6801d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/serialize.js @@ -0,0 +1,36 @@ +'use strict'; + +var toArray = require('./to-array') + , isDate = require('../date/is-date') + , isRegExp = require('../reg-exp/is-reg-exp') + + , isArray = Array.isArray, stringify = JSON.stringify + , keyValueToString = function (value, key) { return stringify(key) + ':' + exports(value); }; + +var sparseMap = function (arr) { + var i, l = arr.length, result = new Array(l); + for (i = 0; i < l; ++i) { + if (!arr.hasOwnProperty(i)) continue; + result[i] = exports(arr[i]); + } + return result; +}; + +module.exports = exports = function (obj) { + if (obj == null) return String(obj); + switch (typeof obj) { + case 'string': + return stringify(obj); + case 'number': + case 'boolean': + case 'function': + return String(obj); + case 'object': + if (isArray(obj)) return '[' + sparseMap(obj) + ']'; + if (isRegExp(obj)) return String(obj); + if (isDate(obj)) return 'new Date(' + obj.valueOf() + ')'; + return '{' + toArray(obj, keyValueToString) + '}'; + default: + throw new TypeError("Serialization of " + String(obj) + "is unsupported"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/implement.js new file mode 100644 index 0000000000..000e6bdbbe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/implement.js @@ -0,0 +1,8 @@ +'use strict'; + +var shim; + +if (!require('./is-implemented')() && (shim = require('./shim'))) { + Object.defineProperty(Object, 'setPrototypeOf', + { value: shim, configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/index.js new file mode 100644 index 0000000000..ccc40995b1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? Object.setPrototypeOf + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/is-implemented.js new file mode 100644 index 0000000000..98d0c8436a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/is-implemented.js @@ -0,0 +1,11 @@ +'use strict'; + +var create = Object.create, getPrototypeOf = Object.getPrototypeOf + , x = {}; + +module.exports = function (/*customCreate*/) { + var setPrototypeOf = Object.setPrototypeOf + , customCreate = arguments[0] || create; + if (typeof setPrototypeOf !== 'function') return false; + return getPrototypeOf(setPrototypeOf(customCreate(null), x)) === x; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/shim.js new file mode 100644 index 0000000000..4ec944675e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/set-prototype-of/shim.js @@ -0,0 +1,73 @@ +// Big thanks to @WebReflection for sorting this out +// https://gist.github.com/WebReflection/5593554 + +'use strict'; + +var isObject = require('../is-object') + , value = require('../valid-value') + + , isPrototypeOf = Object.prototype.isPrototypeOf + , defineProperty = Object.defineProperty + , nullDesc = { configurable: true, enumerable: false, writable: true, + value: undefined } + , validate; + +validate = function (obj, prototype) { + value(obj); + if ((prototype === null) || isObject(prototype)) return obj; + throw new TypeError('Prototype must be null or an object'); +}; + +module.exports = (function (status) { + var fn, set; + if (!status) return null; + if (status.level === 2) { + if (status.set) { + set = status.set; + fn = function (obj, prototype) { + set.call(validate(obj, prototype), prototype); + return obj; + }; + } else { + fn = function (obj, prototype) { + validate(obj, prototype).__proto__ = prototype; + return obj; + }; + } + } else { + fn = function self(obj, prototype) { + var isNullBase; + validate(obj, prototype); + isNullBase = isPrototypeOf.call(self.nullPolyfill, obj); + if (isNullBase) delete self.nullPolyfill.__proto__; + if (prototype === null) prototype = self.nullPolyfill; + obj.__proto__ = prototype; + if (isNullBase) defineProperty(self.nullPolyfill, '__proto__', nullDesc); + return obj; + }; + } + return Object.defineProperty(fn, 'level', { configurable: false, + enumerable: false, writable: false, value: status.level }); +}((function () { + var x = Object.create(null), y = {}, set + , desc = Object.getOwnPropertyDescriptor(Object.prototype, '__proto__'); + + if (desc) { + try { + set = desc.set; // Opera crashes at this point + set.call(x, y); + } catch (ignore) { } + if (Object.getPrototypeOf(x) === y) return { set: set, level: 2 }; + } + + x.__proto__ = y; + if (Object.getPrototypeOf(x) === y) return { level: 2 }; + + x = {}; + x.__proto__ = y; + if (Object.getPrototypeOf(x) === y) return { level: 1 }; + + return false; +}()))); + +require('../create'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/some.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/some.js new file mode 100644 index 0000000000..cde5ddeecd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/some.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./_iterate')('some', false); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/to-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/to-array.js new file mode 100644 index 0000000000..a954abb26f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/to-array.js @@ -0,0 +1,18 @@ +'use strict'; + +var callable = require('./valid-callable') + , forEach = require('./for-each') + + , call = Function.prototype.call + + , defaultCb = function (value, key) { return [key, value]; }; + +module.exports = function (obj/*, cb, thisArg, compareFn*/) { + var a = [], cb = arguments[1], thisArg = arguments[2]; + cb = (cb == null) ? defaultCb : callable(cb); + + forEach(obj, function (value, key, obj, index) { + a.push(call.call(cb, thisArg, value, key, this, index)); + }, obj, arguments[3]); + return a; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/unserialize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/unserialize.js new file mode 100644 index 0000000000..ce68e403ae --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/unserialize.js @@ -0,0 +1,7 @@ +'use strict'; + +var value = require('./valid-value'); + +module.exports = exports = function (code) { + return (new Function('return ' + value(code)))(); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-callable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-callable.js new file mode 100644 index 0000000000..c977527a4f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-callable.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (fn) { + if (typeof fn !== 'function') throw new TypeError(fn + " is not a function"); + return fn; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-object.js new file mode 100644 index 0000000000..f82bd51ed1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-object.js @@ -0,0 +1,8 @@ +'use strict'; + +var isObject = require('./is-object'); + +module.exports = function (value) { + if (!isObject(value)) throw new TypeError(value + " is not an Object"); + return value; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-value.js new file mode 100644 index 0000000000..36c8ec31e8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/valid-value.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (value) { + if (value == null) throw new TypeError("Cannot use null or undefined"); + return value; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like-object.js new file mode 100644 index 0000000000..89e12c51c5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like-object.js @@ -0,0 +1,9 @@ +'use strict'; + +var isArrayLike = require('./is-array-like') + , isObject = require('./is-object'); + +module.exports = function (obj) { + if (isObject(obj) && isArrayLike(obj)) return obj; + throw new TypeError(obj + " is not array-like object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like.js new file mode 100644 index 0000000000..6a35b54a14 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-array-like.js @@ -0,0 +1,8 @@ +'use strict'; + +var isArrayLike = require('./is-array-like'); + +module.exports = function (obj) { + if (isArrayLike(obj)) return obj; + throw new TypeError(obj + " is not array-like value"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable-value.js new file mode 100644 index 0000000000..9df3b668fb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable-value.js @@ -0,0 +1,6 @@ +'use strict'; + +var value = require('./valid-value') + , stringifiable = require('./validate-stringifiable'); + +module.exports = function (x) { return stringifiable(value(x)); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable.js new file mode 100644 index 0000000000..eba7ce787c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/object/validate-stringifiable.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (stringifiable) { + try { + return String(stringifiable); + } catch (e) { + throw new TypeError("Passed argument cannot be stringifed"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/package.json new file mode 100644 index 0000000000..597a347e96 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/package.json @@ -0,0 +1,105 @@ +{ + "_args": [ + [ + "es5-ext@~0.10.10", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol" + ] + ], + "_from": "es5-ext@>=0.10.10 <0.11.0", + "_id": "es5-ext@0.10.11", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/es6-symbol/es5-ext", + "_nodeVersion": "4.2.3", + "_npmUser": { + "email": "medikoo+npm@medikoo.com", + "name": "medikoo" + }, + "_npmVersion": "2.14.7", + "_phantomChildren": { + "d": "0.1.1", + "es5-ext": "0.10.11", + "es6-symbol": "3.0.2" + }, + "_requested": { + "name": "es5-ext", + "raw": "es5-ext@~0.10.10", + "rawSpec": "~0.10.10", + "scope": null, + "spec": ">=0.10.10 <0.11.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index/es6-symbol", + "/node-gyp/path-array/array-index/es6-symbol/d", + "/node-gyp/path-array/array-index/es6-symbol/es5-ext/es6-iterator" + ], + "_resolved": "https://registry.npmjs.org/es5-ext/-/es5-ext-0.10.11.tgz", + "_shasum": "8184c3e705a820948c2dbe043849379b1dbd0c45", + "_shrinkwrap": null, + "_spec": "es5-ext@~0.10.10", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol", + "author": { + "email": "medyk@medikoo.com", + "name": "Mariusz Nowak", + "url": "http://www.medikoo.com/" + }, + "bugs": { + "url": "https://github.com/medikoo/es5-ext/issues" + }, + "dependencies": { + "es6-iterator": "2", + "es6-symbol": "~3.0.2" + }, + "description": "ECMAScript extensions and shims", + "devDependencies": { + "tad": "~0.2.4", + "xlint": "~0.2.2", + "xlint-jslint-medikoo": "~0.1.4" + }, + "directories": {}, + "dist": { + "shasum": "8184c3e705a820948c2dbe043849379b1dbd0c45", + "tarball": "http://registry.npmjs.org/es5-ext/-/es5-ext-0.10.11.tgz" + }, + "gitHead": "aba94140a6bf79ce1a448a2db8834e8c1842b527", + "homepage": "https://github.com/medikoo/es5-ext#readme", + "keywords": [ + "addons", + "ecmascript", + "ecmascript5", + "ecmascript6", + "es5", + "es6", + "ext", + "extensions", + "extras", + "harmony", + "javascript", + "polyfill", + "shim", + "util", + "utilities", + "utils" + ], + "license": "MIT", + "maintainers": [ + { + "name": "medikoo", + "email": "medikoo+npm@medikoo.com" + } + ], + "name": "es5-ext", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/medikoo/es5-ext.git" + }, + "scripts": { + "lint": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --no-cache --no-stream", + "lint-console": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --watch", + "test": "node ./node_modules/tad/bin/tad" + }, + "version": "0.10.11" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/index.js new file mode 100644 index 0000000000..f7e7a58ebd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/index.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = { + isSticky: require('./is-sticky'), + isUnicode: require('./is-unicode'), + match: require('./match'), + replace: require('./replace'), + search: require('./search'), + split: require('./split') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-sticky.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-sticky.js new file mode 100644 index 0000000000..830a481f7e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-sticky.js @@ -0,0 +1,9 @@ +'use strict'; + +var validRegExp = require('../valid-reg-exp') + + , re = /\/[a-xz]*y[a-xz]*$/; + +module.exports = function () { + return Boolean(String(validRegExp(this)).match(re)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-unicode.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-unicode.js new file mode 100644 index 0000000000..b005f6d919 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/is-unicode.js @@ -0,0 +1,9 @@ +'use strict'; + +var validRegExp = require('../valid-reg-exp') + + , re = /\/[a-xz]*u[a-xz]*$/; + +module.exports = function () { + return Boolean(String(validRegExp(this)).match(re)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/implement.js new file mode 100644 index 0000000000..921c9368e7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'match', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/index.js new file mode 100644 index 0000000000..0534ac3bc3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? RegExp.prototype.match + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/is-implemented.js new file mode 100644 index 0000000000..b7e9964314 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var re = /foo/; + +module.exports = function () { + if (typeof re.match !== 'function') return false; + return re.match('barfoobar') && !re.match('elo'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/shim.js new file mode 100644 index 0000000000..4f99cf4d1c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/match/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +var validRegExp = require('../../valid-reg-exp'); + +module.exports = function (string) { + validRegExp(this); + return String(string).match(this); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/implement.js new file mode 100644 index 0000000000..ad580de890 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'replace', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/index.js new file mode 100644 index 0000000000..5658177d80 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? RegExp.prototype.replace + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/is-implemented.js new file mode 100644 index 0000000000..1b42d25243 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var re = /foo/; + +module.exports = function () { + if (typeof re.replace !== 'function') return false; + return re.replace('foobar', 'mar') === 'marbar'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/shim.js new file mode 100644 index 0000000000..c3e6aebab0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/replace/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +var validRegExp = require('../../valid-reg-exp'); + +module.exports = function (string, replaceValue) { + validRegExp(this); + return String(string).replace(this, replaceValue); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/implement.js new file mode 100644 index 0000000000..3804f4eb1c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'search', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/index.js new file mode 100644 index 0000000000..67995d4ac7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? RegExp.prototype.search + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/is-implemented.js new file mode 100644 index 0000000000..efba889f81 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var re = /foo/; + +module.exports = function () { + if (typeof re.search !== 'function') return false; + return re.search('barfoo') === 3; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/shim.js new file mode 100644 index 0000000000..6d9dcaed8a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/search/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +var validRegExp = require('../../valid-reg-exp'); + +module.exports = function (string) { + validRegExp(this); + return String(string).search(this); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/implement.js new file mode 100644 index 0000000000..50facb6834 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'split', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/index.js new file mode 100644 index 0000000000..f101f5af75 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? RegExp.prototype.split + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/is-implemented.js new file mode 100644 index 0000000000..7244c998bf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var re = /\|/; + +module.exports = function () { + if (typeof re.split !== 'function') return false; + return re.split('bar|foo')[1] === 'foo'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/shim.js new file mode 100644 index 0000000000..76154e7e3c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/split/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +var validRegExp = require('../../valid-reg-exp'); + +module.exports = function (string) { + validRegExp(this); + return String(string).split(this); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/implement.js new file mode 100644 index 0000000000..7e8af1db31 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/implement.js @@ -0,0 +1,8 @@ +'use strict'; + +var isSticky = require('../is-sticky'); + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'sticky', { configurable: true, + enumerable: false, get: isSticky }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/is-implemented.js new file mode 100644 index 0000000000..e4184ee4ec --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/sticky/is-implemented.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function () { + var dummyRegExp = /a/; + // We need to do check on instance and not on prototype due to how ES2015 spec evolved: + // https://github.com/tc39/ecma262/issues/262 + // https://github.com/tc39/ecma262/pull/263 + // https://bugs.chromium.org/p/v8/issues/detail?id=4617 + return 'sticky' in dummyRegExp; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/implement.js new file mode 100644 index 0000000000..5a82a4d1d2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/implement.js @@ -0,0 +1,8 @@ +'use strict'; + +var isUnicode = require('../is-unicode'); + +if (!require('./is-implemented')()) { + Object.defineProperty(RegExp.prototype, 'unicode', { configurable: true, + enumerable: false, get: isUnicode }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/is-implemented.js new file mode 100644 index 0000000000..3e3a54b669 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/#/unicode/is-implemented.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function () { + var dummyRegExp = /a/; + // We need to do check on instance and not on prototype due to how ES2015 spec evolved: + // https://github.com/tc39/ecma262/issues/262 + // https://github.com/tc39/ecma262/pull/263 + // https://bugs.chromium.org/p/v8/issues/detail?id=4617 + return 'unicode' in dummyRegExp; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/escape.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/escape.js new file mode 100644 index 0000000000..a2363fcfc6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/escape.js @@ -0,0 +1,9 @@ +// Thanks to Andrew Clover: +// http://stackoverflow.com/questions/3561493 +// /is-there-a-regexp-escape-function-in-javascript + +'use strict'; + +var re = /[\-\/\\\^$*+?.()|\[\]{}]/g; + +module.exports = function (str) { return String(str).replace(re, '\\$&'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/index.js new file mode 100644 index 0000000000..75ea3135a8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/index.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + escape: require('./escape'), + isRegExp: require('./is-reg-exp'), + validRegExp: require('./valid-reg-exp') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/is-reg-exp.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/is-reg-exp.js new file mode 100644 index 0000000000..6eb12977c0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/is-reg-exp.js @@ -0,0 +1,9 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(/a/); + +module.exports = function (x) { + return (x && (x instanceof RegExp || (toString.call(x) === id))) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/valid-reg-exp.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/valid-reg-exp.js new file mode 100644 index 0000000000..d3a77641da --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/reg-exp/valid-reg-exp.js @@ -0,0 +1,8 @@ +'use strict'; + +var isRegExp = require('./is-reg-exp'); + +module.exports = function (x) { + if (!isRegExp(x)) throw new TypeError(x + " is not a RegExp object"); + return x; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/implement.js new file mode 100644 index 0000000000..4494d7b6af --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, require('es6-symbol').iterator, + { value: require('./shim'), configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/index.js new file mode 100644 index 0000000000..22f15e6960 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/index.js @@ -0,0 +1,4 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype[require('es6-symbol').iterator] : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/is-implemented.js new file mode 100644 index 0000000000..f5c462deb9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/is-implemented.js @@ -0,0 +1,16 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function () { + var str = '🙈f', iterator, result; + if (typeof str[iteratorSymbol] !== 'function') return false; + iterator = str[iteratorSymbol](); + if (!iterator) return false; + if (typeof iterator.next !== 'function') return false; + result = iterator.next(); + if (!result) return false; + if (result.value !== '🙈') return false; + if (result.done !== false) return false; + return true; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/shim.js new file mode 100644 index 0000000000..0be30292f6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/@@iterator/shim.js @@ -0,0 +1,6 @@ +'use strict'; + +var StringIterator = require('es6-iterator/string') + , value = require('../../../object/valid-value'); + +module.exports = function () { return new StringIterator(value(this)); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/at.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/at.js new file mode 100644 index 0000000000..77bd251ac4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/at.js @@ -0,0 +1,33 @@ +// Based on: https://github.com/mathiasbynens/String.prototype.at +// Thanks @mathiasbynens ! + +'use strict'; + +var toInteger = require('../../number/to-integer') + , validValue = require('../../object/valid-value'); + +module.exports = function (pos) { + var str = String(validValue(this)), size = str.length + , cuFirst, cuSecond, nextPos, len; + pos = toInteger(pos); + + // Account for out-of-bounds indices + // The odd lower bound is because the ToInteger operation is + // going to round `n` to `0` for `-1 < n <= 0`. + if (pos <= -1 || pos >= size) return ''; + + // Second half of `ToInteger` + pos = pos | 0; + // Get the first code unit and code unit value + cuFirst = str.charCodeAt(pos); + nextPos = pos + 1; + len = 1; + if ( // check if it’s the start of a surrogate pair + (cuFirst >= 0xD800) && (cuFirst <= 0xDBFF) && // high surrogate + (size > nextPos) // there is a next code unit + ) { + cuSecond = str.charCodeAt(nextPos); + if (cuSecond >= 0xDC00 && cuSecond <= 0xDFFF) len = 2; // low surrogate + } + return str.slice(pos, pos + len); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/camel-to-hyphen.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/camel-to-hyphen.js new file mode 100644 index 0000000000..1cb8d12779 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/camel-to-hyphen.js @@ -0,0 +1,10 @@ +'use strict'; + +var replace = String.prototype.replace + , re = /([A-Z])/g; + +module.exports = function () { + var str = replace.call(this, re, "-$1").toLowerCase(); + if (str[0] === '-') str = str.slice(1); + return str; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/capitalize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/capitalize.js new file mode 100644 index 0000000000..ed76827365 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/capitalize.js @@ -0,0 +1,8 @@ +'use strict'; + +var value = require('../../object/valid-value'); + +module.exports = function () { + var str = String(value(this)); + return str.charAt(0).toUpperCase() + str.slice(1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/case-insensitive-compare.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/case-insensitive-compare.js new file mode 100644 index 0000000000..599cb83469 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/case-insensitive-compare.js @@ -0,0 +1,7 @@ +'use strict'; + +var toLowerCase = String.prototype.toLowerCase; + +module.exports = function (other) { + return toLowerCase.call(this).localeCompare(toLowerCase.call(String(other))); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/implement.js new file mode 100644 index 0000000000..1e7a37bd4d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'codePointAt', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/index.js new file mode 100644 index 0000000000..7e91d833a8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.codePointAt + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/is-implemented.js new file mode 100644 index 0000000000..b27158913a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var str = 'abc\uD834\uDF06def'; + +module.exports = function () { + if (typeof str.codePointAt !== 'function') return false; + return str.codePointAt(3) === 0x1D306; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/shim.js new file mode 100644 index 0000000000..1c9038b3cb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/code-point-at/shim.js @@ -0,0 +1,26 @@ +// Based on: https://github.com/mathiasbynens/String.prototype.codePointAt +// Thanks @mathiasbynens ! + +'use strict'; + +var toInteger = require('../../../number/to-integer') + , validValue = require('../../../object/valid-value'); + +module.exports = function (pos) { + var str = String(validValue(this)), l = str.length, first, second; + pos = toInteger(pos); + + // Account for out-of-bounds indices: + if (pos < 0 || pos >= l) return undefined; + + // Get the first code unit + first = str.charCodeAt(pos); + if ((first >= 0xD800) && (first <= 0xDBFF) && (l > pos + 1)) { + second = str.charCodeAt(pos + 1); + if (second >= 0xDC00 && second <= 0xDFFF) { + // http://mathiasbynens.be/notes/javascript-encoding#surrogate-formulae + return (first - 0xD800) * 0x400 + second - 0xDC00 + 0x10000; + } + } + return first; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/implement.js new file mode 100644 index 0000000000..6b7a3c0816 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'contains', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/index.js new file mode 100644 index 0000000000..abb3e3730b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.contains + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/is-implemented.js new file mode 100644 index 0000000000..6f7d4b719e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var str = 'razdwatrzy'; + +module.exports = function () { + if (typeof str.contains !== 'function') return false; + return ((str.contains('dwa') === true) && (str.contains('foo') === false)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/shim.js new file mode 100644 index 0000000000..89e39e7933 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/contains/shim.js @@ -0,0 +1,7 @@ +'use strict'; + +var indexOf = String.prototype.indexOf; + +module.exports = function (searchString/*, position*/) { + return indexOf.call(this, searchString, arguments[1]) > -1; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/implement.js new file mode 100644 index 0000000000..0b09025b0c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'endsWith', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/index.js new file mode 100644 index 0000000000..d2d9484827 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.endsWith + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/is-implemented.js new file mode 100644 index 0000000000..f3bb00883b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var str = 'razdwatrzy'; + +module.exports = function () { + if (typeof str.endsWith !== 'function') return false; + return ((str.endsWith('trzy') === true) && (str.endsWith('raz') === false)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/shim.js new file mode 100644 index 0000000000..26cbdb1366 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/ends-with/shim.js @@ -0,0 +1,16 @@ +'use strict'; + +var toInteger = require('../../../number/to-integer') + , value = require('../../../object/valid-value') + + , min = Math.min, max = Math.max; + +module.exports = function (searchString/*, endPosition*/) { + var self, start, endPos; + self = String(value(this)); + searchString = String(searchString); + endPos = arguments[1]; + start = ((endPos == null) ? self.length : + min(max(toInteger(endPos), 0), self.length)) - searchString.length; + return (start < 0) ? false : (self.indexOf(searchString, start) === start); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/hyphen-to-camel.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/hyphen-to-camel.js new file mode 100644 index 0000000000..8928b02497 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/hyphen-to-camel.js @@ -0,0 +1,8 @@ +'use strict'; + +var replace = String.prototype.replace + + , re = /-([a-z0-9])/g + , toUpperCase = function (m, a) { return a.toUpperCase(); }; + +module.exports = function () { return replace.call(this, re, toUpperCase); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/indent.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/indent.js new file mode 100644 index 0000000000..223bd82b0f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/indent.js @@ -0,0 +1,12 @@ +'use strict'; + +var repeat = require('./repeat') + + , replace = String.prototype.replace + , re = /(\r\n|[\n\r\u2028\u2029])([\u0000-\u0009\u000b-\uffff]+)/g; + +module.exports = function (indent/*, count*/) { + var count = arguments[1]; + indent = repeat.call(String(indent), (count == null) ? 1 : count); + return indent + replace.call(this, re, '$1' + indent + '$2'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/index.js new file mode 100644 index 0000000000..3efa01c040 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/index.js @@ -0,0 +1,22 @@ +'use strict'; + +module.exports = { + '@@iterator': require('./@@iterator'), + at: require('./at'), + camelToHyphen: require('./camel-to-hyphen'), + capitalize: require('./capitalize'), + caseInsensitiveCompare: require('./case-insensitive-compare'), + codePointAt: require('./code-point-at'), + contains: require('./contains'), + hyphenToCamel: require('./hyphen-to-camel'), + endsWith: require('./ends-with'), + indent: require('./indent'), + last: require('./last'), + normalize: require('./normalize'), + pad: require('./pad'), + plainReplace: require('./plain-replace'), + plainReplaceAll: require('./plain-replace-all'), + repeat: require('./repeat'), + startsWith: require('./starts-with'), + uncapitalize: require('./uncapitalize') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/last.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/last.js new file mode 100644 index 0000000000..d5cf46ee5f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/last.js @@ -0,0 +1,8 @@ +'use strict'; + +var value = require('../../object/valid-value'); + +module.exports = function () { + var self = String(value(this)), l = self.length; + return l ? self[l - 1] : null; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/_data.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/_data.js new file mode 100644 index 0000000000..e4e00a3298 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/_data.js @@ -0,0 +1,69 @@ +'use strict'; + +module.exports = { 0:{60:[,,{824:8814}],61:[,,{824:8800}],62:[,,{824:8815}],65:[,,{768:192,769:193,770:194,771:195,772:256,774:258,775:550,776:196,777:7842,778:197,780:461,783:512,785:514,803:7840,805:7680,808:260}],66:[,,{775:7682,803:7684,817:7686}],67:[,,{769:262,770:264,775:266,780:268,807:199}],68:[,,{775:7690,780:270,803:7692,807:7696,813:7698,817:7694}],69:[,,{768:200,769:201,770:202,771:7868,772:274,774:276,775:278,776:203,777:7866,780:282,783:516,785:518,803:7864,807:552,808:280,813:7704,816:7706}],70:[,,{775:7710}],71:[,,{769:500,770:284,772:7712,774:286,775:288,780:486,807:290}],72:[,,{770:292,775:7714,776:7718,780:542,803:7716,807:7720,814:7722}],73:[,,{768:204,769:205,770:206,771:296,772:298,774:300,775:304,776:207,777:7880,780:463,783:520,785:522,803:7882,808:302,816:7724}],74:[,,{770:308}],75:[,,{769:7728,780:488,803:7730,807:310,817:7732}],76:[,,{769:313,780:317,803:7734,807:315,813:7740,817:7738}],77:[,,{769:7742,775:7744,803:7746}],78:[,,{768:504,769:323,771:209,775:7748,780:327,803:7750,807:325,813:7754,817:7752}],79:[,,{768:210,769:211,770:212,771:213,772:332,774:334,775:558,776:214,777:7886,779:336,780:465,783:524,785:526,795:416,803:7884,808:490}],80:[,,{769:7764,775:7766}],82:[,,{769:340,775:7768,780:344,783:528,785:530,803:7770,807:342,817:7774}],83:[,,{769:346,770:348,775:7776,780:352,803:7778,806:536,807:350}],84:[,,{775:7786,780:356,803:7788,806:538,807:354,813:7792,817:7790}],85:[,,{768:217,769:218,770:219,771:360,772:362,774:364,776:220,777:7910,778:366,779:368,780:467,783:532,785:534,795:431,803:7908,804:7794,808:370,813:7798,816:7796}],86:[,,{771:7804,803:7806}],87:[,,{768:7808,769:7810,770:372,775:7814,776:7812,803:7816}],88:[,,{775:7818,776:7820}],89:[,,{768:7922,769:221,770:374,771:7928,772:562,775:7822,776:376,777:7926,803:7924}],90:[,,{769:377,770:7824,775:379,780:381,803:7826,817:7828}],97:[,,{768:224,769:225,770:226,771:227,772:257,774:259,775:551,776:228,777:7843,778:229,780:462,783:513,785:515,803:7841,805:7681,808:261}],98:[,,{775:7683,803:7685,817:7687}],99:[,,{769:263,770:265,775:267,780:269,807:231}],100:[,,{775:7691,780:271,803:7693,807:7697,813:7699,817:7695}],101:[,,{768:232,769:233,770:234,771:7869,772:275,774:277,775:279,776:235,777:7867,780:283,783:517,785:519,803:7865,807:553,808:281,813:7705,816:7707}],102:[,,{775:7711}],103:[,,{769:501,770:285,772:7713,774:287,775:289,780:487,807:291}],104:[,,{770:293,775:7715,776:7719,780:543,803:7717,807:7721,814:7723,817:7830}],105:[,,{768:236,769:237,770:238,771:297,772:299,774:301,776:239,777:7881,780:464,783:521,785:523,803:7883,808:303,816:7725}],106:[,,{770:309,780:496}],107:[,,{769:7729,780:489,803:7731,807:311,817:7733}],108:[,,{769:314,780:318,803:7735,807:316,813:7741,817:7739}],109:[,,{769:7743,775:7745,803:7747}],110:[,,{768:505,769:324,771:241,775:7749,780:328,803:7751,807:326,813:7755,817:7753}],111:[,,{768:242,769:243,770:244,771:245,772:333,774:335,775:559,776:246,777:7887,779:337,780:466,783:525,785:527,795:417,803:7885,808:491}],112:[,,{769:7765,775:7767}],114:[,,{769:341,775:7769,780:345,783:529,785:531,803:7771,807:343,817:7775}],115:[,,{769:347,770:349,775:7777,780:353,803:7779,806:537,807:351}],116:[,,{775:7787,776:7831,780:357,803:7789,806:539,807:355,813:7793,817:7791}],117:[,,{768:249,769:250,770:251,771:361,772:363,774:365,776:252,777:7911,778:367,779:369,780:468,783:533,785:535,795:432,803:7909,804:7795,808:371,813:7799,816:7797}],118:[,,{771:7805,803:7807}],119:[,,{768:7809,769:7811,770:373,775:7815,776:7813,778:7832,803:7817}],120:[,,{775:7819,776:7821}],121:[,,{768:7923,769:253,770:375,771:7929,772:563,775:7823,776:255,777:7927,778:7833,803:7925}],122:[,,{769:378,770:7825,775:380,780:382,803:7827,817:7829}],160:[[32],256],168:[[32,776],256,{768:8173,769:901,834:8129}],170:[[97],256],175:[[32,772],256],178:[[50],256],179:[[51],256],180:[[32,769],256],181:[[956],256],184:[[32,807],256],185:[[49],256],186:[[111],256],188:[[49,8260,52],256],189:[[49,8260,50],256],190:[[51,8260,52],256],192:[[65,768]],193:[[65,769]],194:[[65,770],,{768:7846,769:7844,771:7850,777:7848}],195:[[65,771]],196:[[65,776],,{772:478}],197:[[65,778],,{769:506}],198:[,,{769:508,772:482}],199:[[67,807],,{769:7688}],200:[[69,768]],201:[[69,769]],202:[[69,770],,{768:7872,769:7870,771:7876,777:7874}],203:[[69,776]],204:[[73,768]],205:[[73,769]],206:[[73,770]],207:[[73,776],,{769:7726}],209:[[78,771]],210:[[79,768]],211:[[79,769]],212:[[79,770],,{768:7890,769:7888,771:7894,777:7892}],213:[[79,771],,{769:7756,772:556,776:7758}],214:[[79,776],,{772:554}],216:[,,{769:510}],217:[[85,768]],218:[[85,769]],219:[[85,770]],220:[[85,776],,{768:475,769:471,772:469,780:473}],221:[[89,769]],224:[[97,768]],225:[[97,769]],226:[[97,770],,{768:7847,769:7845,771:7851,777:7849}],227:[[97,771]],228:[[97,776],,{772:479}],229:[[97,778],,{769:507}],230:[,,{769:509,772:483}],231:[[99,807],,{769:7689}],232:[[101,768]],233:[[101,769]],234:[[101,770],,{768:7873,769:7871,771:7877,777:7875}],235:[[101,776]],236:[[105,768]],237:[[105,769]],238:[[105,770]],239:[[105,776],,{769:7727}],241:[[110,771]],242:[[111,768]],243:[[111,769]],244:[[111,770],,{768:7891,769:7889,771:7895,777:7893}],245:[[111,771],,{769:7757,772:557,776:7759}],246:[[111,776],,{772:555}],248:[,,{769:511}],249:[[117,768]],250:[[117,769]],251:[[117,770]],252:[[117,776],,{768:476,769:472,772:470,780:474}],253:[[121,769]],255:[[121,776]]}, + 256:{256:[[65,772]],257:[[97,772]],258:[[65,774],,{768:7856,769:7854,771:7860,777:7858}],259:[[97,774],,{768:7857,769:7855,771:7861,777:7859}],260:[[65,808]],261:[[97,808]],262:[[67,769]],263:[[99,769]],264:[[67,770]],265:[[99,770]],266:[[67,775]],267:[[99,775]],268:[[67,780]],269:[[99,780]],270:[[68,780]],271:[[100,780]],274:[[69,772],,{768:7700,769:7702}],275:[[101,772],,{768:7701,769:7703}],276:[[69,774]],277:[[101,774]],278:[[69,775]],279:[[101,775]],280:[[69,808]],281:[[101,808]],282:[[69,780]],283:[[101,780]],284:[[71,770]],285:[[103,770]],286:[[71,774]],287:[[103,774]],288:[[71,775]],289:[[103,775]],290:[[71,807]],291:[[103,807]],292:[[72,770]],293:[[104,770]],296:[[73,771]],297:[[105,771]],298:[[73,772]],299:[[105,772]],300:[[73,774]],301:[[105,774]],302:[[73,808]],303:[[105,808]],304:[[73,775]],306:[[73,74],256],307:[[105,106],256],308:[[74,770]],309:[[106,770]],310:[[75,807]],311:[[107,807]],313:[[76,769]],314:[[108,769]],315:[[76,807]],316:[[108,807]],317:[[76,780]],318:[[108,780]],319:[[76,183],256],320:[[108,183],256],323:[[78,769]],324:[[110,769]],325:[[78,807]],326:[[110,807]],327:[[78,780]],328:[[110,780]],329:[[700,110],256],332:[[79,772],,{768:7760,769:7762}],333:[[111,772],,{768:7761,769:7763}],334:[[79,774]],335:[[111,774]],336:[[79,779]],337:[[111,779]],340:[[82,769]],341:[[114,769]],342:[[82,807]],343:[[114,807]],344:[[82,780]],345:[[114,780]],346:[[83,769],,{775:7780}],347:[[115,769],,{775:7781}],348:[[83,770]],349:[[115,770]],350:[[83,807]],351:[[115,807]],352:[[83,780],,{775:7782}],353:[[115,780],,{775:7783}],354:[[84,807]],355:[[116,807]],356:[[84,780]],357:[[116,780]],360:[[85,771],,{769:7800}],361:[[117,771],,{769:7801}],362:[[85,772],,{776:7802}],363:[[117,772],,{776:7803}],364:[[85,774]],365:[[117,774]],366:[[85,778]],367:[[117,778]],368:[[85,779]],369:[[117,779]],370:[[85,808]],371:[[117,808]],372:[[87,770]],373:[[119,770]],374:[[89,770]],375:[[121,770]],376:[[89,776]],377:[[90,769]],378:[[122,769]],379:[[90,775]],380:[[122,775]],381:[[90,780]],382:[[122,780]],383:[[115],256,{775:7835}],416:[[79,795],,{768:7900,769:7898,771:7904,777:7902,803:7906}],417:[[111,795],,{768:7901,769:7899,771:7905,777:7903,803:7907}],431:[[85,795],,{768:7914,769:7912,771:7918,777:7916,803:7920}],432:[[117,795],,{768:7915,769:7913,771:7919,777:7917,803:7921}],439:[,,{780:494}],452:[[68,381],256],453:[[68,382],256],454:[[100,382],256],455:[[76,74],256],456:[[76,106],256],457:[[108,106],256],458:[[78,74],256],459:[[78,106],256],460:[[110,106],256],461:[[65,780]],462:[[97,780]],463:[[73,780]],464:[[105,780]],465:[[79,780]],466:[[111,780]],467:[[85,780]],468:[[117,780]],469:[[220,772]],470:[[252,772]],471:[[220,769]],472:[[252,769]],473:[[220,780]],474:[[252,780]],475:[[220,768]],476:[[252,768]],478:[[196,772]],479:[[228,772]],480:[[550,772]],481:[[551,772]],482:[[198,772]],483:[[230,772]],486:[[71,780]],487:[[103,780]],488:[[75,780]],489:[[107,780]],490:[[79,808],,{772:492}],491:[[111,808],,{772:493}],492:[[490,772]],493:[[491,772]],494:[[439,780]],495:[[658,780]],496:[[106,780]],497:[[68,90],256],498:[[68,122],256],499:[[100,122],256],500:[[71,769]],501:[[103,769]],504:[[78,768]],505:[[110,768]],506:[[197,769]],507:[[229,769]],508:[[198,769]],509:[[230,769]],510:[[216,769]],511:[[248,769]],66045:[,220]}, + 512:{512:[[65,783]],513:[[97,783]],514:[[65,785]],515:[[97,785]],516:[[69,783]],517:[[101,783]],518:[[69,785]],519:[[101,785]],520:[[73,783]],521:[[105,783]],522:[[73,785]],523:[[105,785]],524:[[79,783]],525:[[111,783]],526:[[79,785]],527:[[111,785]],528:[[82,783]],529:[[114,783]],530:[[82,785]],531:[[114,785]],532:[[85,783]],533:[[117,783]],534:[[85,785]],535:[[117,785]],536:[[83,806]],537:[[115,806]],538:[[84,806]],539:[[116,806]],542:[[72,780]],543:[[104,780]],550:[[65,775],,{772:480}],551:[[97,775],,{772:481}],552:[[69,807],,{774:7708}],553:[[101,807],,{774:7709}],554:[[214,772]],555:[[246,772]],556:[[213,772]],557:[[245,772]],558:[[79,775],,{772:560}],559:[[111,775],,{772:561}],560:[[558,772]],561:[[559,772]],562:[[89,772]],563:[[121,772]],658:[,,{780:495}],688:[[104],256],689:[[614],256],690:[[106],256],691:[[114],256],692:[[633],256],693:[[635],256],694:[[641],256],695:[[119],256],696:[[121],256],728:[[32,774],256],729:[[32,775],256],730:[[32,778],256],731:[[32,808],256],732:[[32,771],256],733:[[32,779],256],736:[[611],256],737:[[108],256],738:[[115],256],739:[[120],256],740:[[661],256]}, + 768:{768:[,230],769:[,230],770:[,230],771:[,230],772:[,230],773:[,230],774:[,230],775:[,230],776:[,230,{769:836}],777:[,230],778:[,230],779:[,230],780:[,230],781:[,230],782:[,230],783:[,230],784:[,230],785:[,230],786:[,230],787:[,230],788:[,230],789:[,232],790:[,220],791:[,220],792:[,220],793:[,220],794:[,232],795:[,216],796:[,220],797:[,220],798:[,220],799:[,220],800:[,220],801:[,202],802:[,202],803:[,220],804:[,220],805:[,220],806:[,220],807:[,202],808:[,202],809:[,220],810:[,220],811:[,220],812:[,220],813:[,220],814:[,220],815:[,220],816:[,220],817:[,220],818:[,220],819:[,220],820:[,1],821:[,1],822:[,1],823:[,1],824:[,1],825:[,220],826:[,220],827:[,220],828:[,220],829:[,230],830:[,230],831:[,230],832:[[768],230],833:[[769],230],834:[,230],835:[[787],230],836:[[776,769],230],837:[,240],838:[,230],839:[,220],840:[,220],841:[,220],842:[,230],843:[,230],844:[,230],845:[,220],846:[,220],848:[,230],849:[,230],850:[,230],851:[,220],852:[,220],853:[,220],854:[,220],855:[,230],856:[,232],857:[,220],858:[,220],859:[,230],860:[,233],861:[,234],862:[,234],863:[,233],864:[,234],865:[,234],866:[,233],867:[,230],868:[,230],869:[,230],870:[,230],871:[,230],872:[,230],873:[,230],874:[,230],875:[,230],876:[,230],877:[,230],878:[,230],879:[,230],884:[[697]],890:[[32,837],256],894:[[59]],900:[[32,769],256],901:[[168,769]],902:[[913,769]],903:[[183]],904:[[917,769]],905:[[919,769]],906:[[921,769]],908:[[927,769]],910:[[933,769]],911:[[937,769]],912:[[970,769]],913:[,,{768:8122,769:902,772:8121,774:8120,787:7944,788:7945,837:8124}],917:[,,{768:8136,769:904,787:7960,788:7961}],919:[,,{768:8138,769:905,787:7976,788:7977,837:8140}],921:[,,{768:8154,769:906,772:8153,774:8152,776:938,787:7992,788:7993}],927:[,,{768:8184,769:908,787:8008,788:8009}],929:[,,{788:8172}],933:[,,{768:8170,769:910,772:8169,774:8168,776:939,788:8025}],937:[,,{768:8186,769:911,787:8040,788:8041,837:8188}],938:[[921,776]],939:[[933,776]],940:[[945,769],,{837:8116}],941:[[949,769]],942:[[951,769],,{837:8132}],943:[[953,769]],944:[[971,769]],945:[,,{768:8048,769:940,772:8113,774:8112,787:7936,788:7937,834:8118,837:8115}],949:[,,{768:8050,769:941,787:7952,788:7953}],951:[,,{768:8052,769:942,787:7968,788:7969,834:8134,837:8131}],953:[,,{768:8054,769:943,772:8145,774:8144,776:970,787:7984,788:7985,834:8150}],959:[,,{768:8056,769:972,787:8000,788:8001}],961:[,,{787:8164,788:8165}],965:[,,{768:8058,769:973,772:8161,774:8160,776:971,787:8016,788:8017,834:8166}],969:[,,{768:8060,769:974,787:8032,788:8033,834:8182,837:8179}],970:[[953,776],,{768:8146,769:912,834:8151}],971:[[965,776],,{768:8162,769:944,834:8167}],972:[[959,769]],973:[[965,769]],974:[[969,769],,{837:8180}],976:[[946],256],977:[[952],256],978:[[933],256,{769:979,776:980}],979:[[978,769]],980:[[978,776]],981:[[966],256],982:[[960],256],1008:[[954],256],1009:[[961],256],1010:[[962],256],1012:[[920],256],1013:[[949],256],1017:[[931],256]}, + 1024:{1024:[[1045,768]],1025:[[1045,776]],1027:[[1043,769]],1030:[,,{776:1031}],1031:[[1030,776]],1036:[[1050,769]],1037:[[1048,768]],1038:[[1059,774]],1040:[,,{774:1232,776:1234}],1043:[,,{769:1027}],1045:[,,{768:1024,774:1238,776:1025}],1046:[,,{774:1217,776:1244}],1047:[,,{776:1246}],1048:[,,{768:1037,772:1250,774:1049,776:1252}],1049:[[1048,774]],1050:[,,{769:1036}],1054:[,,{776:1254}],1059:[,,{772:1262,774:1038,776:1264,779:1266}],1063:[,,{776:1268}],1067:[,,{776:1272}],1069:[,,{776:1260}],1072:[,,{774:1233,776:1235}],1075:[,,{769:1107}],1077:[,,{768:1104,774:1239,776:1105}],1078:[,,{774:1218,776:1245}],1079:[,,{776:1247}],1080:[,,{768:1117,772:1251,774:1081,776:1253}],1081:[[1080,774]],1082:[,,{769:1116}],1086:[,,{776:1255}],1091:[,,{772:1263,774:1118,776:1265,779:1267}],1095:[,,{776:1269}],1099:[,,{776:1273}],1101:[,,{776:1261}],1104:[[1077,768]],1105:[[1077,776]],1107:[[1075,769]],1110:[,,{776:1111}],1111:[[1110,776]],1116:[[1082,769]],1117:[[1080,768]],1118:[[1091,774]],1140:[,,{783:1142}],1141:[,,{783:1143}],1142:[[1140,783]],1143:[[1141,783]],1155:[,230],1156:[,230],1157:[,230],1158:[,230],1159:[,230],1217:[[1046,774]],1218:[[1078,774]],1232:[[1040,774]],1233:[[1072,774]],1234:[[1040,776]],1235:[[1072,776]],1238:[[1045,774]],1239:[[1077,774]],1240:[,,{776:1242}],1241:[,,{776:1243}],1242:[[1240,776]],1243:[[1241,776]],1244:[[1046,776]],1245:[[1078,776]],1246:[[1047,776]],1247:[[1079,776]],1250:[[1048,772]],1251:[[1080,772]],1252:[[1048,776]],1253:[[1080,776]],1254:[[1054,776]],1255:[[1086,776]],1256:[,,{776:1258}],1257:[,,{776:1259}],1258:[[1256,776]],1259:[[1257,776]],1260:[[1069,776]],1261:[[1101,776]],1262:[[1059,772]],1263:[[1091,772]],1264:[[1059,776]],1265:[[1091,776]],1266:[[1059,779]],1267:[[1091,779]],1268:[[1063,776]],1269:[[1095,776]],1272:[[1067,776]],1273:[[1099,776]]}, + 1280:{1415:[[1381,1410],256],1425:[,220],1426:[,230],1427:[,230],1428:[,230],1429:[,230],1430:[,220],1431:[,230],1432:[,230],1433:[,230],1434:[,222],1435:[,220],1436:[,230],1437:[,230],1438:[,230],1439:[,230],1440:[,230],1441:[,230],1442:[,220],1443:[,220],1444:[,220],1445:[,220],1446:[,220],1447:[,220],1448:[,230],1449:[,230],1450:[,220],1451:[,230],1452:[,230],1453:[,222],1454:[,228],1455:[,230],1456:[,10],1457:[,11],1458:[,12],1459:[,13],1460:[,14],1461:[,15],1462:[,16],1463:[,17],1464:[,18],1465:[,19],1466:[,19],1467:[,20],1468:[,21],1469:[,22],1471:[,23],1473:[,24],1474:[,25],1476:[,230],1477:[,220],1479:[,18]}, + 1536:{1552:[,230],1553:[,230],1554:[,230],1555:[,230],1556:[,230],1557:[,230],1558:[,230],1559:[,230],1560:[,30],1561:[,31],1562:[,32],1570:[[1575,1619]],1571:[[1575,1620]],1572:[[1608,1620]],1573:[[1575,1621]],1574:[[1610,1620]],1575:[,,{1619:1570,1620:1571,1621:1573}],1608:[,,{1620:1572}],1610:[,,{1620:1574}],1611:[,27],1612:[,28],1613:[,29],1614:[,30],1615:[,31],1616:[,32],1617:[,33],1618:[,34],1619:[,230],1620:[,230],1621:[,220],1622:[,220],1623:[,230],1624:[,230],1625:[,230],1626:[,230],1627:[,230],1628:[,220],1629:[,230],1630:[,230],1631:[,220],1648:[,35],1653:[[1575,1652],256],1654:[[1608,1652],256],1655:[[1735,1652],256],1656:[[1610,1652],256],1728:[[1749,1620]],1729:[,,{1620:1730}],1730:[[1729,1620]],1746:[,,{1620:1747}],1747:[[1746,1620]],1749:[,,{1620:1728}],1750:[,230],1751:[,230],1752:[,230],1753:[,230],1754:[,230],1755:[,230],1756:[,230],1759:[,230],1760:[,230],1761:[,230],1762:[,230],1763:[,220],1764:[,230],1767:[,230],1768:[,230],1770:[,220],1771:[,230],1772:[,230],1773:[,220]}, + 1792:{1809:[,36],1840:[,230],1841:[,220],1842:[,230],1843:[,230],1844:[,220],1845:[,230],1846:[,230],1847:[,220],1848:[,220],1849:[,220],1850:[,230],1851:[,220],1852:[,220],1853:[,230],1854:[,220],1855:[,230],1856:[,230],1857:[,230],1858:[,220],1859:[,230],1860:[,220],1861:[,230],1862:[,220],1863:[,230],1864:[,220],1865:[,230],1866:[,230],2027:[,230],2028:[,230],2029:[,230],2030:[,230],2031:[,230],2032:[,230],2033:[,230],2034:[,220],2035:[,230]}, + 2048:{2070:[,230],2071:[,230],2072:[,230],2073:[,230],2075:[,230],2076:[,230],2077:[,230],2078:[,230],2079:[,230],2080:[,230],2081:[,230],2082:[,230],2083:[,230],2085:[,230],2086:[,230],2087:[,230],2089:[,230],2090:[,230],2091:[,230],2092:[,230],2093:[,230],2137:[,220],2138:[,220],2139:[,220],2276:[,230],2277:[,230],2278:[,220],2279:[,230],2280:[,230],2281:[,220],2282:[,230],2283:[,230],2284:[,230],2285:[,220],2286:[,220],2287:[,220],2288:[,27],2289:[,28],2290:[,29],2291:[,230],2292:[,230],2293:[,230],2294:[,220],2295:[,230],2296:[,230],2297:[,220],2298:[,220],2299:[,230],2300:[,230],2301:[,230],2302:[,230]}, + 2304:{2344:[,,{2364:2345}],2345:[[2344,2364]],2352:[,,{2364:2353}],2353:[[2352,2364]],2355:[,,{2364:2356}],2356:[[2355,2364]],2364:[,7],2381:[,9],2385:[,230],2386:[,220],2387:[,230],2388:[,230],2392:[[2325,2364],512],2393:[[2326,2364],512],2394:[[2327,2364],512],2395:[[2332,2364],512],2396:[[2337,2364],512],2397:[[2338,2364],512],2398:[[2347,2364],512],2399:[[2351,2364],512],2492:[,7],2503:[,,{2494:2507,2519:2508}],2507:[[2503,2494]],2508:[[2503,2519]],2509:[,9],2524:[[2465,2492],512],2525:[[2466,2492],512],2527:[[2479,2492],512]}, + 2560:{2611:[[2610,2620],512],2614:[[2616,2620],512],2620:[,7],2637:[,9],2649:[[2582,2620],512],2650:[[2583,2620],512],2651:[[2588,2620],512],2654:[[2603,2620],512],2748:[,7],2765:[,9],68109:[,220],68111:[,230],68152:[,230],68153:[,1],68154:[,220],68159:[,9]}, + 2816:{2876:[,7],2887:[,,{2878:2891,2902:2888,2903:2892}],2888:[[2887,2902]],2891:[[2887,2878]],2892:[[2887,2903]],2893:[,9],2908:[[2849,2876],512],2909:[[2850,2876],512],2962:[,,{3031:2964}],2964:[[2962,3031]],3014:[,,{3006:3018,3031:3020}],3015:[,,{3006:3019}],3018:[[3014,3006]],3019:[[3015,3006]],3020:[[3014,3031]],3021:[,9]}, + 3072:{3142:[,,{3158:3144}],3144:[[3142,3158]],3149:[,9],3157:[,84],3158:[,91],3260:[,7],3263:[,,{3285:3264}],3264:[[3263,3285]],3270:[,,{3266:3274,3285:3271,3286:3272}],3271:[[3270,3285]],3272:[[3270,3286]],3274:[[3270,3266],,{3285:3275}],3275:[[3274,3285]],3277:[,9]}, + 3328:{3398:[,,{3390:3402,3415:3404}],3399:[,,{3390:3403}],3402:[[3398,3390]],3403:[[3399,3390]],3404:[[3398,3415]],3405:[,9],3530:[,9],3545:[,,{3530:3546,3535:3548,3551:3550}],3546:[[3545,3530]],3548:[[3545,3535],,{3530:3549}],3549:[[3548,3530]],3550:[[3545,3551]]}, + 3584:{3635:[[3661,3634],256],3640:[,103],3641:[,103],3642:[,9],3656:[,107],3657:[,107],3658:[,107],3659:[,107],3763:[[3789,3762],256],3768:[,118],3769:[,118],3784:[,122],3785:[,122],3786:[,122],3787:[,122],3804:[[3755,3737],256],3805:[[3755,3745],256]}, + 3840:{3852:[[3851],256],3864:[,220],3865:[,220],3893:[,220],3895:[,220],3897:[,216],3907:[[3906,4023],512],3917:[[3916,4023],512],3922:[[3921,4023],512],3927:[[3926,4023],512],3932:[[3931,4023],512],3945:[[3904,4021],512],3953:[,129],3954:[,130],3955:[[3953,3954],512],3956:[,132],3957:[[3953,3956],512],3958:[[4018,3968],512],3959:[[4018,3969],256],3960:[[4019,3968],512],3961:[[4019,3969],256],3962:[,130],3963:[,130],3964:[,130],3965:[,130],3968:[,130],3969:[[3953,3968],512],3970:[,230],3971:[,230],3972:[,9],3974:[,230],3975:[,230],3987:[[3986,4023],512],3997:[[3996,4023],512],4002:[[4001,4023],512],4007:[[4006,4023],512],4012:[[4011,4023],512],4025:[[3984,4021],512],4038:[,220]}, + 4096:{4133:[,,{4142:4134}],4134:[[4133,4142]],4151:[,7],4153:[,9],4154:[,9],4237:[,220],4348:[[4316],256],69702:[,9],69785:[,,{69818:69786}],69786:[[69785,69818]],69787:[,,{69818:69788}],69788:[[69787,69818]],69797:[,,{69818:69803}],69803:[[69797,69818]],69817:[,9],69818:[,7]}, + 4352:{69888:[,230],69889:[,230],69890:[,230],69934:[[69937,69927]],69935:[[69938,69927]],69937:[,,{69927:69934}],69938:[,,{69927:69935}],69939:[,9],69940:[,9],70080:[,9]}, + 4864:{4957:[,230],4958:[,230],4959:[,230]}, + 5632:{71350:[,9],71351:[,7]}, + 5888:{5908:[,9],5940:[,9],6098:[,9],6109:[,230]}, + 6144:{6313:[,228]}, + 6400:{6457:[,222],6458:[,230],6459:[,220]}, + 6656:{6679:[,230],6680:[,220],6752:[,9],6773:[,230],6774:[,230],6775:[,230],6776:[,230],6777:[,230],6778:[,230],6779:[,230],6780:[,230],6783:[,220]}, + 6912:{6917:[,,{6965:6918}],6918:[[6917,6965]],6919:[,,{6965:6920}],6920:[[6919,6965]],6921:[,,{6965:6922}],6922:[[6921,6965]],6923:[,,{6965:6924}],6924:[[6923,6965]],6925:[,,{6965:6926}],6926:[[6925,6965]],6929:[,,{6965:6930}],6930:[[6929,6965]],6964:[,7],6970:[,,{6965:6971}],6971:[[6970,6965]],6972:[,,{6965:6973}],6973:[[6972,6965]],6974:[,,{6965:6976}],6975:[,,{6965:6977}],6976:[[6974,6965]],6977:[[6975,6965]],6978:[,,{6965:6979}],6979:[[6978,6965]],6980:[,9],7019:[,230],7020:[,220],7021:[,230],7022:[,230],7023:[,230],7024:[,230],7025:[,230],7026:[,230],7027:[,230],7082:[,9],7083:[,9],7142:[,7],7154:[,9],7155:[,9]}, + 7168:{7223:[,7],7376:[,230],7377:[,230],7378:[,230],7380:[,1],7381:[,220],7382:[,220],7383:[,220],7384:[,220],7385:[,220],7386:[,230],7387:[,230],7388:[,220],7389:[,220],7390:[,220],7391:[,220],7392:[,230],7394:[,1],7395:[,1],7396:[,1],7397:[,1],7398:[,1],7399:[,1],7400:[,1],7405:[,220],7412:[,230]}, + 7424:{7468:[[65],256],7469:[[198],256],7470:[[66],256],7472:[[68],256],7473:[[69],256],7474:[[398],256],7475:[[71],256],7476:[[72],256],7477:[[73],256],7478:[[74],256],7479:[[75],256],7480:[[76],256],7481:[[77],256],7482:[[78],256],7484:[[79],256],7485:[[546],256],7486:[[80],256],7487:[[82],256],7488:[[84],256],7489:[[85],256],7490:[[87],256],7491:[[97],256],7492:[[592],256],7493:[[593],256],7494:[[7426],256],7495:[[98],256],7496:[[100],256],7497:[[101],256],7498:[[601],256],7499:[[603],256],7500:[[604],256],7501:[[103],256],7503:[[107],256],7504:[[109],256],7505:[[331],256],7506:[[111],256],7507:[[596],256],7508:[[7446],256],7509:[[7447],256],7510:[[112],256],7511:[[116],256],7512:[[117],256],7513:[[7453],256],7514:[[623],256],7515:[[118],256],7516:[[7461],256],7517:[[946],256],7518:[[947],256],7519:[[948],256],7520:[[966],256],7521:[[967],256],7522:[[105],256],7523:[[114],256],7524:[[117],256],7525:[[118],256],7526:[[946],256],7527:[[947],256],7528:[[961],256],7529:[[966],256],7530:[[967],256],7544:[[1085],256],7579:[[594],256],7580:[[99],256],7581:[[597],256],7582:[[240],256],7583:[[604],256],7584:[[102],256],7585:[[607],256],7586:[[609],256],7587:[[613],256],7588:[[616],256],7589:[[617],256],7590:[[618],256],7591:[[7547],256],7592:[[669],256],7593:[[621],256],7594:[[7557],256],7595:[[671],256],7596:[[625],256],7597:[[624],256],7598:[[626],256],7599:[[627],256],7600:[[628],256],7601:[[629],256],7602:[[632],256],7603:[[642],256],7604:[[643],256],7605:[[427],256],7606:[[649],256],7607:[[650],256],7608:[[7452],256],7609:[[651],256],7610:[[652],256],7611:[[122],256],7612:[[656],256],7613:[[657],256],7614:[[658],256],7615:[[952],256],7616:[,230],7617:[,230],7618:[,220],7619:[,230],7620:[,230],7621:[,230],7622:[,230],7623:[,230],7624:[,230],7625:[,230],7626:[,220],7627:[,230],7628:[,230],7629:[,234],7630:[,214],7631:[,220],7632:[,202],7633:[,230],7634:[,230],7635:[,230],7636:[,230],7637:[,230],7638:[,230],7639:[,230],7640:[,230],7641:[,230],7642:[,230],7643:[,230],7644:[,230],7645:[,230],7646:[,230],7647:[,230],7648:[,230],7649:[,230],7650:[,230],7651:[,230],7652:[,230],7653:[,230],7654:[,230],7676:[,233],7677:[,220],7678:[,230],7679:[,220]}, + 7680:{7680:[[65,805]],7681:[[97,805]],7682:[[66,775]],7683:[[98,775]],7684:[[66,803]],7685:[[98,803]],7686:[[66,817]],7687:[[98,817]],7688:[[199,769]],7689:[[231,769]],7690:[[68,775]],7691:[[100,775]],7692:[[68,803]],7693:[[100,803]],7694:[[68,817]],7695:[[100,817]],7696:[[68,807]],7697:[[100,807]],7698:[[68,813]],7699:[[100,813]],7700:[[274,768]],7701:[[275,768]],7702:[[274,769]],7703:[[275,769]],7704:[[69,813]],7705:[[101,813]],7706:[[69,816]],7707:[[101,816]],7708:[[552,774]],7709:[[553,774]],7710:[[70,775]],7711:[[102,775]],7712:[[71,772]],7713:[[103,772]],7714:[[72,775]],7715:[[104,775]],7716:[[72,803]],7717:[[104,803]],7718:[[72,776]],7719:[[104,776]],7720:[[72,807]],7721:[[104,807]],7722:[[72,814]],7723:[[104,814]],7724:[[73,816]],7725:[[105,816]],7726:[[207,769]],7727:[[239,769]],7728:[[75,769]],7729:[[107,769]],7730:[[75,803]],7731:[[107,803]],7732:[[75,817]],7733:[[107,817]],7734:[[76,803],,{772:7736}],7735:[[108,803],,{772:7737}],7736:[[7734,772]],7737:[[7735,772]],7738:[[76,817]],7739:[[108,817]],7740:[[76,813]],7741:[[108,813]],7742:[[77,769]],7743:[[109,769]],7744:[[77,775]],7745:[[109,775]],7746:[[77,803]],7747:[[109,803]],7748:[[78,775]],7749:[[110,775]],7750:[[78,803]],7751:[[110,803]],7752:[[78,817]],7753:[[110,817]],7754:[[78,813]],7755:[[110,813]],7756:[[213,769]],7757:[[245,769]],7758:[[213,776]],7759:[[245,776]],7760:[[332,768]],7761:[[333,768]],7762:[[332,769]],7763:[[333,769]],7764:[[80,769]],7765:[[112,769]],7766:[[80,775]],7767:[[112,775]],7768:[[82,775]],7769:[[114,775]],7770:[[82,803],,{772:7772}],7771:[[114,803],,{772:7773}],7772:[[7770,772]],7773:[[7771,772]],7774:[[82,817]],7775:[[114,817]],7776:[[83,775]],7777:[[115,775]],7778:[[83,803],,{775:7784}],7779:[[115,803],,{775:7785}],7780:[[346,775]],7781:[[347,775]],7782:[[352,775]],7783:[[353,775]],7784:[[7778,775]],7785:[[7779,775]],7786:[[84,775]],7787:[[116,775]],7788:[[84,803]],7789:[[116,803]],7790:[[84,817]],7791:[[116,817]],7792:[[84,813]],7793:[[116,813]],7794:[[85,804]],7795:[[117,804]],7796:[[85,816]],7797:[[117,816]],7798:[[85,813]],7799:[[117,813]],7800:[[360,769]],7801:[[361,769]],7802:[[362,776]],7803:[[363,776]],7804:[[86,771]],7805:[[118,771]],7806:[[86,803]],7807:[[118,803]],7808:[[87,768]],7809:[[119,768]],7810:[[87,769]],7811:[[119,769]],7812:[[87,776]],7813:[[119,776]],7814:[[87,775]],7815:[[119,775]],7816:[[87,803]],7817:[[119,803]],7818:[[88,775]],7819:[[120,775]],7820:[[88,776]],7821:[[120,776]],7822:[[89,775]],7823:[[121,775]],7824:[[90,770]],7825:[[122,770]],7826:[[90,803]],7827:[[122,803]],7828:[[90,817]],7829:[[122,817]],7830:[[104,817]],7831:[[116,776]],7832:[[119,778]],7833:[[121,778]],7834:[[97,702],256],7835:[[383,775]],7840:[[65,803],,{770:7852,774:7862}],7841:[[97,803],,{770:7853,774:7863}],7842:[[65,777]],7843:[[97,777]],7844:[[194,769]],7845:[[226,769]],7846:[[194,768]],7847:[[226,768]],7848:[[194,777]],7849:[[226,777]],7850:[[194,771]],7851:[[226,771]],7852:[[7840,770]],7853:[[7841,770]],7854:[[258,769]],7855:[[259,769]],7856:[[258,768]],7857:[[259,768]],7858:[[258,777]],7859:[[259,777]],7860:[[258,771]],7861:[[259,771]],7862:[[7840,774]],7863:[[7841,774]],7864:[[69,803],,{770:7878}],7865:[[101,803],,{770:7879}],7866:[[69,777]],7867:[[101,777]],7868:[[69,771]],7869:[[101,771]],7870:[[202,769]],7871:[[234,769]],7872:[[202,768]],7873:[[234,768]],7874:[[202,777]],7875:[[234,777]],7876:[[202,771]],7877:[[234,771]],7878:[[7864,770]],7879:[[7865,770]],7880:[[73,777]],7881:[[105,777]],7882:[[73,803]],7883:[[105,803]],7884:[[79,803],,{770:7896}],7885:[[111,803],,{770:7897}],7886:[[79,777]],7887:[[111,777]],7888:[[212,769]],7889:[[244,769]],7890:[[212,768]],7891:[[244,768]],7892:[[212,777]],7893:[[244,777]],7894:[[212,771]],7895:[[244,771]],7896:[[7884,770]],7897:[[7885,770]],7898:[[416,769]],7899:[[417,769]],7900:[[416,768]],7901:[[417,768]],7902:[[416,777]],7903:[[417,777]],7904:[[416,771]],7905:[[417,771]],7906:[[416,803]],7907:[[417,803]],7908:[[85,803]],7909:[[117,803]],7910:[[85,777]],7911:[[117,777]],7912:[[431,769]],7913:[[432,769]],7914:[[431,768]],7915:[[432,768]],7916:[[431,777]],7917:[[432,777]],7918:[[431,771]],7919:[[432,771]],7920:[[431,803]],7921:[[432,803]],7922:[[89,768]],7923:[[121,768]],7924:[[89,803]],7925:[[121,803]],7926:[[89,777]],7927:[[121,777]],7928:[[89,771]],7929:[[121,771]]}, + 7936:{7936:[[945,787],,{768:7938,769:7940,834:7942,837:8064}],7937:[[945,788],,{768:7939,769:7941,834:7943,837:8065}],7938:[[7936,768],,{837:8066}],7939:[[7937,768],,{837:8067}],7940:[[7936,769],,{837:8068}],7941:[[7937,769],,{837:8069}],7942:[[7936,834],,{837:8070}],7943:[[7937,834],,{837:8071}],7944:[[913,787],,{768:7946,769:7948,834:7950,837:8072}],7945:[[913,788],,{768:7947,769:7949,834:7951,837:8073}],7946:[[7944,768],,{837:8074}],7947:[[7945,768],,{837:8075}],7948:[[7944,769],,{837:8076}],7949:[[7945,769],,{837:8077}],7950:[[7944,834],,{837:8078}],7951:[[7945,834],,{837:8079}],7952:[[949,787],,{768:7954,769:7956}],7953:[[949,788],,{768:7955,769:7957}],7954:[[7952,768]],7955:[[7953,768]],7956:[[7952,769]],7957:[[7953,769]],7960:[[917,787],,{768:7962,769:7964}],7961:[[917,788],,{768:7963,769:7965}],7962:[[7960,768]],7963:[[7961,768]],7964:[[7960,769]],7965:[[7961,769]],7968:[[951,787],,{768:7970,769:7972,834:7974,837:8080}],7969:[[951,788],,{768:7971,769:7973,834:7975,837:8081}],7970:[[7968,768],,{837:8082}],7971:[[7969,768],,{837:8083}],7972:[[7968,769],,{837:8084}],7973:[[7969,769],,{837:8085}],7974:[[7968,834],,{837:8086}],7975:[[7969,834],,{837:8087}],7976:[[919,787],,{768:7978,769:7980,834:7982,837:8088}],7977:[[919,788],,{768:7979,769:7981,834:7983,837:8089}],7978:[[7976,768],,{837:8090}],7979:[[7977,768],,{837:8091}],7980:[[7976,769],,{837:8092}],7981:[[7977,769],,{837:8093}],7982:[[7976,834],,{837:8094}],7983:[[7977,834],,{837:8095}],7984:[[953,787],,{768:7986,769:7988,834:7990}],7985:[[953,788],,{768:7987,769:7989,834:7991}],7986:[[7984,768]],7987:[[7985,768]],7988:[[7984,769]],7989:[[7985,769]],7990:[[7984,834]],7991:[[7985,834]],7992:[[921,787],,{768:7994,769:7996,834:7998}],7993:[[921,788],,{768:7995,769:7997,834:7999}],7994:[[7992,768]],7995:[[7993,768]],7996:[[7992,769]],7997:[[7993,769]],7998:[[7992,834]],7999:[[7993,834]],8000:[[959,787],,{768:8002,769:8004}],8001:[[959,788],,{768:8003,769:8005}],8002:[[8000,768]],8003:[[8001,768]],8004:[[8000,769]],8005:[[8001,769]],8008:[[927,787],,{768:8010,769:8012}],8009:[[927,788],,{768:8011,769:8013}],8010:[[8008,768]],8011:[[8009,768]],8012:[[8008,769]],8013:[[8009,769]],8016:[[965,787],,{768:8018,769:8020,834:8022}],8017:[[965,788],,{768:8019,769:8021,834:8023}],8018:[[8016,768]],8019:[[8017,768]],8020:[[8016,769]],8021:[[8017,769]],8022:[[8016,834]],8023:[[8017,834]],8025:[[933,788],,{768:8027,769:8029,834:8031}],8027:[[8025,768]],8029:[[8025,769]],8031:[[8025,834]],8032:[[969,787],,{768:8034,769:8036,834:8038,837:8096}],8033:[[969,788],,{768:8035,769:8037,834:8039,837:8097}],8034:[[8032,768],,{837:8098}],8035:[[8033,768],,{837:8099}],8036:[[8032,769],,{837:8100}],8037:[[8033,769],,{837:8101}],8038:[[8032,834],,{837:8102}],8039:[[8033,834],,{837:8103}],8040:[[937,787],,{768:8042,769:8044,834:8046,837:8104}],8041:[[937,788],,{768:8043,769:8045,834:8047,837:8105}],8042:[[8040,768],,{837:8106}],8043:[[8041,768],,{837:8107}],8044:[[8040,769],,{837:8108}],8045:[[8041,769],,{837:8109}],8046:[[8040,834],,{837:8110}],8047:[[8041,834],,{837:8111}],8048:[[945,768],,{837:8114}],8049:[[940]],8050:[[949,768]],8051:[[941]],8052:[[951,768],,{837:8130}],8053:[[942]],8054:[[953,768]],8055:[[943]],8056:[[959,768]],8057:[[972]],8058:[[965,768]],8059:[[973]],8060:[[969,768],,{837:8178}],8061:[[974]],8064:[[7936,837]],8065:[[7937,837]],8066:[[7938,837]],8067:[[7939,837]],8068:[[7940,837]],8069:[[7941,837]],8070:[[7942,837]],8071:[[7943,837]],8072:[[7944,837]],8073:[[7945,837]],8074:[[7946,837]],8075:[[7947,837]],8076:[[7948,837]],8077:[[7949,837]],8078:[[7950,837]],8079:[[7951,837]],8080:[[7968,837]],8081:[[7969,837]],8082:[[7970,837]],8083:[[7971,837]],8084:[[7972,837]],8085:[[7973,837]],8086:[[7974,837]],8087:[[7975,837]],8088:[[7976,837]],8089:[[7977,837]],8090:[[7978,837]],8091:[[7979,837]],8092:[[7980,837]],8093:[[7981,837]],8094:[[7982,837]],8095:[[7983,837]],8096:[[8032,837]],8097:[[8033,837]],8098:[[8034,837]],8099:[[8035,837]],8100:[[8036,837]],8101:[[8037,837]],8102:[[8038,837]],8103:[[8039,837]],8104:[[8040,837]],8105:[[8041,837]],8106:[[8042,837]],8107:[[8043,837]],8108:[[8044,837]],8109:[[8045,837]],8110:[[8046,837]],8111:[[8047,837]],8112:[[945,774]],8113:[[945,772]],8114:[[8048,837]],8115:[[945,837]],8116:[[940,837]],8118:[[945,834],,{837:8119}],8119:[[8118,837]],8120:[[913,774]],8121:[[913,772]],8122:[[913,768]],8123:[[902]],8124:[[913,837]],8125:[[32,787],256],8126:[[953]],8127:[[32,787],256,{768:8141,769:8142,834:8143}],8128:[[32,834],256],8129:[[168,834]],8130:[[8052,837]],8131:[[951,837]],8132:[[942,837]],8134:[[951,834],,{837:8135}],8135:[[8134,837]],8136:[[917,768]],8137:[[904]],8138:[[919,768]],8139:[[905]],8140:[[919,837]],8141:[[8127,768]],8142:[[8127,769]],8143:[[8127,834]],8144:[[953,774]],8145:[[953,772]],8146:[[970,768]],8147:[[912]],8150:[[953,834]],8151:[[970,834]],8152:[[921,774]],8153:[[921,772]],8154:[[921,768]],8155:[[906]],8157:[[8190,768]],8158:[[8190,769]],8159:[[8190,834]],8160:[[965,774]],8161:[[965,772]],8162:[[971,768]],8163:[[944]],8164:[[961,787]],8165:[[961,788]],8166:[[965,834]],8167:[[971,834]],8168:[[933,774]],8169:[[933,772]],8170:[[933,768]],8171:[[910]],8172:[[929,788]],8173:[[168,768]],8174:[[901]],8175:[[96]],8178:[[8060,837]],8179:[[969,837]],8180:[[974,837]],8182:[[969,834],,{837:8183}],8183:[[8182,837]],8184:[[927,768]],8185:[[908]],8186:[[937,768]],8187:[[911]],8188:[[937,837]],8189:[[180]],8190:[[32,788],256,{768:8157,769:8158,834:8159}]}, + 8192:{8192:[[8194]],8193:[[8195]],8194:[[32],256],8195:[[32],256],8196:[[32],256],8197:[[32],256],8198:[[32],256],8199:[[32],256],8200:[[32],256],8201:[[32],256],8202:[[32],256],8209:[[8208],256],8215:[[32,819],256],8228:[[46],256],8229:[[46,46],256],8230:[[46,46,46],256],8239:[[32],256],8243:[[8242,8242],256],8244:[[8242,8242,8242],256],8246:[[8245,8245],256],8247:[[8245,8245,8245],256],8252:[[33,33],256],8254:[[32,773],256],8263:[[63,63],256],8264:[[63,33],256],8265:[[33,63],256],8279:[[8242,8242,8242,8242],256],8287:[[32],256],8304:[[48],256],8305:[[105],256],8308:[[52],256],8309:[[53],256],8310:[[54],256],8311:[[55],256],8312:[[56],256],8313:[[57],256],8314:[[43],256],8315:[[8722],256],8316:[[61],256],8317:[[40],256],8318:[[41],256],8319:[[110],256],8320:[[48],256],8321:[[49],256],8322:[[50],256],8323:[[51],256],8324:[[52],256],8325:[[53],256],8326:[[54],256],8327:[[55],256],8328:[[56],256],8329:[[57],256],8330:[[43],256],8331:[[8722],256],8332:[[61],256],8333:[[40],256],8334:[[41],256],8336:[[97],256],8337:[[101],256],8338:[[111],256],8339:[[120],256],8340:[[601],256],8341:[[104],256],8342:[[107],256],8343:[[108],256],8344:[[109],256],8345:[[110],256],8346:[[112],256],8347:[[115],256],8348:[[116],256],8360:[[82,115],256],8400:[,230],8401:[,230],8402:[,1],8403:[,1],8404:[,230],8405:[,230],8406:[,230],8407:[,230],8408:[,1],8409:[,1],8410:[,1],8411:[,230],8412:[,230],8417:[,230],8421:[,1],8422:[,1],8423:[,230],8424:[,220],8425:[,230],8426:[,1],8427:[,1],8428:[,220],8429:[,220],8430:[,220],8431:[,220],8432:[,230]}, + 8448:{8448:[[97,47,99],256],8449:[[97,47,115],256],8450:[[67],256],8451:[[176,67],256],8453:[[99,47,111],256],8454:[[99,47,117],256],8455:[[400],256],8457:[[176,70],256],8458:[[103],256],8459:[[72],256],8460:[[72],256],8461:[[72],256],8462:[[104],256],8463:[[295],256],8464:[[73],256],8465:[[73],256],8466:[[76],256],8467:[[108],256],8469:[[78],256],8470:[[78,111],256],8473:[[80],256],8474:[[81],256],8475:[[82],256],8476:[[82],256],8477:[[82],256],8480:[[83,77],256],8481:[[84,69,76],256],8482:[[84,77],256],8484:[[90],256],8486:[[937]],8488:[[90],256],8490:[[75]],8491:[[197]],8492:[[66],256],8493:[[67],256],8495:[[101],256],8496:[[69],256],8497:[[70],256],8499:[[77],256],8500:[[111],256],8501:[[1488],256],8502:[[1489],256],8503:[[1490],256],8504:[[1491],256],8505:[[105],256],8507:[[70,65,88],256],8508:[[960],256],8509:[[947],256],8510:[[915],256],8511:[[928],256],8512:[[8721],256],8517:[[68],256],8518:[[100],256],8519:[[101],256],8520:[[105],256],8521:[[106],256],8528:[[49,8260,55],256],8529:[[49,8260,57],256],8530:[[49,8260,49,48],256],8531:[[49,8260,51],256],8532:[[50,8260,51],256],8533:[[49,8260,53],256],8534:[[50,8260,53],256],8535:[[51,8260,53],256],8536:[[52,8260,53],256],8537:[[49,8260,54],256],8538:[[53,8260,54],256],8539:[[49,8260,56],256],8540:[[51,8260,56],256],8541:[[53,8260,56],256],8542:[[55,8260,56],256],8543:[[49,8260],256],8544:[[73],256],8545:[[73,73],256],8546:[[73,73,73],256],8547:[[73,86],256],8548:[[86],256],8549:[[86,73],256],8550:[[86,73,73],256],8551:[[86,73,73,73],256],8552:[[73,88],256],8553:[[88],256],8554:[[88,73],256],8555:[[88,73,73],256],8556:[[76],256],8557:[[67],256],8558:[[68],256],8559:[[77],256],8560:[[105],256],8561:[[105,105],256],8562:[[105,105,105],256],8563:[[105,118],256],8564:[[118],256],8565:[[118,105],256],8566:[[118,105,105],256],8567:[[118,105,105,105],256],8568:[[105,120],256],8569:[[120],256],8570:[[120,105],256],8571:[[120,105,105],256],8572:[[108],256],8573:[[99],256],8574:[[100],256],8575:[[109],256],8585:[[48,8260,51],256],8592:[,,{824:8602}],8594:[,,{824:8603}],8596:[,,{824:8622}],8602:[[8592,824]],8603:[[8594,824]],8622:[[8596,824]],8653:[[8656,824]],8654:[[8660,824]],8655:[[8658,824]],8656:[,,{824:8653}],8658:[,,{824:8655}],8660:[,,{824:8654}]}, + 8704:{8707:[,,{824:8708}],8708:[[8707,824]],8712:[,,{824:8713}],8713:[[8712,824]],8715:[,,{824:8716}],8716:[[8715,824]],8739:[,,{824:8740}],8740:[[8739,824]],8741:[,,{824:8742}],8742:[[8741,824]],8748:[[8747,8747],256],8749:[[8747,8747,8747],256],8751:[[8750,8750],256],8752:[[8750,8750,8750],256],8764:[,,{824:8769}],8769:[[8764,824]],8771:[,,{824:8772}],8772:[[8771,824]],8773:[,,{824:8775}],8775:[[8773,824]],8776:[,,{824:8777}],8777:[[8776,824]],8781:[,,{824:8813}],8800:[[61,824]],8801:[,,{824:8802}],8802:[[8801,824]],8804:[,,{824:8816}],8805:[,,{824:8817}],8813:[[8781,824]],8814:[[60,824]],8815:[[62,824]],8816:[[8804,824]],8817:[[8805,824]],8818:[,,{824:8820}],8819:[,,{824:8821}],8820:[[8818,824]],8821:[[8819,824]],8822:[,,{824:8824}],8823:[,,{824:8825}],8824:[[8822,824]],8825:[[8823,824]],8826:[,,{824:8832}],8827:[,,{824:8833}],8828:[,,{824:8928}],8829:[,,{824:8929}],8832:[[8826,824]],8833:[[8827,824]],8834:[,,{824:8836}],8835:[,,{824:8837}],8836:[[8834,824]],8837:[[8835,824]],8838:[,,{824:8840}],8839:[,,{824:8841}],8840:[[8838,824]],8841:[[8839,824]],8849:[,,{824:8930}],8850:[,,{824:8931}],8866:[,,{824:8876}],8872:[,,{824:8877}],8873:[,,{824:8878}],8875:[,,{824:8879}],8876:[[8866,824]],8877:[[8872,824]],8878:[[8873,824]],8879:[[8875,824]],8882:[,,{824:8938}],8883:[,,{824:8939}],8884:[,,{824:8940}],8885:[,,{824:8941}],8928:[[8828,824]],8929:[[8829,824]],8930:[[8849,824]],8931:[[8850,824]],8938:[[8882,824]],8939:[[8883,824]],8940:[[8884,824]],8941:[[8885,824]]}, + 8960:{9001:[[12296]],9002:[[12297]]}, + 9216:{9312:[[49],256],9313:[[50],256],9314:[[51],256],9315:[[52],256],9316:[[53],256],9317:[[54],256],9318:[[55],256],9319:[[56],256],9320:[[57],256],9321:[[49,48],256],9322:[[49,49],256],9323:[[49,50],256],9324:[[49,51],256],9325:[[49,52],256],9326:[[49,53],256],9327:[[49,54],256],9328:[[49,55],256],9329:[[49,56],256],9330:[[49,57],256],9331:[[50,48],256],9332:[[40,49,41],256],9333:[[40,50,41],256],9334:[[40,51,41],256],9335:[[40,52,41],256],9336:[[40,53,41],256],9337:[[40,54,41],256],9338:[[40,55,41],256],9339:[[40,56,41],256],9340:[[40,57,41],256],9341:[[40,49,48,41],256],9342:[[40,49,49,41],256],9343:[[40,49,50,41],256],9344:[[40,49,51,41],256],9345:[[40,49,52,41],256],9346:[[40,49,53,41],256],9347:[[40,49,54,41],256],9348:[[40,49,55,41],256],9349:[[40,49,56,41],256],9350:[[40,49,57,41],256],9351:[[40,50,48,41],256],9352:[[49,46],256],9353:[[50,46],256],9354:[[51,46],256],9355:[[52,46],256],9356:[[53,46],256],9357:[[54,46],256],9358:[[55,46],256],9359:[[56,46],256],9360:[[57,46],256],9361:[[49,48,46],256],9362:[[49,49,46],256],9363:[[49,50,46],256],9364:[[49,51,46],256],9365:[[49,52,46],256],9366:[[49,53,46],256],9367:[[49,54,46],256],9368:[[49,55,46],256],9369:[[49,56,46],256],9370:[[49,57,46],256],9371:[[50,48,46],256],9372:[[40,97,41],256],9373:[[40,98,41],256],9374:[[40,99,41],256],9375:[[40,100,41],256],9376:[[40,101,41],256],9377:[[40,102,41],256],9378:[[40,103,41],256],9379:[[40,104,41],256],9380:[[40,105,41],256],9381:[[40,106,41],256],9382:[[40,107,41],256],9383:[[40,108,41],256],9384:[[40,109,41],256],9385:[[40,110,41],256],9386:[[40,111,41],256],9387:[[40,112,41],256],9388:[[40,113,41],256],9389:[[40,114,41],256],9390:[[40,115,41],256],9391:[[40,116,41],256],9392:[[40,117,41],256],9393:[[40,118,41],256],9394:[[40,119,41],256],9395:[[40,120,41],256],9396:[[40,121,41],256],9397:[[40,122,41],256],9398:[[65],256],9399:[[66],256],9400:[[67],256],9401:[[68],256],9402:[[69],256],9403:[[70],256],9404:[[71],256],9405:[[72],256],9406:[[73],256],9407:[[74],256],9408:[[75],256],9409:[[76],256],9410:[[77],256],9411:[[78],256],9412:[[79],256],9413:[[80],256],9414:[[81],256],9415:[[82],256],9416:[[83],256],9417:[[84],256],9418:[[85],256],9419:[[86],256],9420:[[87],256],9421:[[88],256],9422:[[89],256],9423:[[90],256],9424:[[97],256],9425:[[98],256],9426:[[99],256],9427:[[100],256],9428:[[101],256],9429:[[102],256],9430:[[103],256],9431:[[104],256],9432:[[105],256],9433:[[106],256],9434:[[107],256],9435:[[108],256],9436:[[109],256],9437:[[110],256],9438:[[111],256],9439:[[112],256],9440:[[113],256],9441:[[114],256],9442:[[115],256],9443:[[116],256],9444:[[117],256],9445:[[118],256],9446:[[119],256],9447:[[120],256],9448:[[121],256],9449:[[122],256],9450:[[48],256]}, + 10752:{10764:[[8747,8747,8747,8747],256],10868:[[58,58,61],256],10869:[[61,61],256],10870:[[61,61,61],256],10972:[[10973,824],512]}, + 11264:{11388:[[106],256],11389:[[86],256],11503:[,230],11504:[,230],11505:[,230]}, + 11520:{11631:[[11617],256],11647:[,9],11744:[,230],11745:[,230],11746:[,230],11747:[,230],11748:[,230],11749:[,230],11750:[,230],11751:[,230],11752:[,230],11753:[,230],11754:[,230],11755:[,230],11756:[,230],11757:[,230],11758:[,230],11759:[,230],11760:[,230],11761:[,230],11762:[,230],11763:[,230],11764:[,230],11765:[,230],11766:[,230],11767:[,230],11768:[,230],11769:[,230],11770:[,230],11771:[,230],11772:[,230],11773:[,230],11774:[,230],11775:[,230]}, + 11776:{11935:[[27597],256],12019:[[40863],256]}, + 12032:{12032:[[19968],256],12033:[[20008],256],12034:[[20022],256],12035:[[20031],256],12036:[[20057],256],12037:[[20101],256],12038:[[20108],256],12039:[[20128],256],12040:[[20154],256],12041:[[20799],256],12042:[[20837],256],12043:[[20843],256],12044:[[20866],256],12045:[[20886],256],12046:[[20907],256],12047:[[20960],256],12048:[[20981],256],12049:[[20992],256],12050:[[21147],256],12051:[[21241],256],12052:[[21269],256],12053:[[21274],256],12054:[[21304],256],12055:[[21313],256],12056:[[21340],256],12057:[[21353],256],12058:[[21378],256],12059:[[21430],256],12060:[[21448],256],12061:[[21475],256],12062:[[22231],256],12063:[[22303],256],12064:[[22763],256],12065:[[22786],256],12066:[[22794],256],12067:[[22805],256],12068:[[22823],256],12069:[[22899],256],12070:[[23376],256],12071:[[23424],256],12072:[[23544],256],12073:[[23567],256],12074:[[23586],256],12075:[[23608],256],12076:[[23662],256],12077:[[23665],256],12078:[[24027],256],12079:[[24037],256],12080:[[24049],256],12081:[[24062],256],12082:[[24178],256],12083:[[24186],256],12084:[[24191],256],12085:[[24308],256],12086:[[24318],256],12087:[[24331],256],12088:[[24339],256],12089:[[24400],256],12090:[[24417],256],12091:[[24435],256],12092:[[24515],256],12093:[[25096],256],12094:[[25142],256],12095:[[25163],256],12096:[[25903],256],12097:[[25908],256],12098:[[25991],256],12099:[[26007],256],12100:[[26020],256],12101:[[26041],256],12102:[[26080],256],12103:[[26085],256],12104:[[26352],256],12105:[[26376],256],12106:[[26408],256],12107:[[27424],256],12108:[[27490],256],12109:[[27513],256],12110:[[27571],256],12111:[[27595],256],12112:[[27604],256],12113:[[27611],256],12114:[[27663],256],12115:[[27668],256],12116:[[27700],256],12117:[[28779],256],12118:[[29226],256],12119:[[29238],256],12120:[[29243],256],12121:[[29247],256],12122:[[29255],256],12123:[[29273],256],12124:[[29275],256],12125:[[29356],256],12126:[[29572],256],12127:[[29577],256],12128:[[29916],256],12129:[[29926],256],12130:[[29976],256],12131:[[29983],256],12132:[[29992],256],12133:[[30000],256],12134:[[30091],256],12135:[[30098],256],12136:[[30326],256],12137:[[30333],256],12138:[[30382],256],12139:[[30399],256],12140:[[30446],256],12141:[[30683],256],12142:[[30690],256],12143:[[30707],256],12144:[[31034],256],12145:[[31160],256],12146:[[31166],256],12147:[[31348],256],12148:[[31435],256],12149:[[31481],256],12150:[[31859],256],12151:[[31992],256],12152:[[32566],256],12153:[[32593],256],12154:[[32650],256],12155:[[32701],256],12156:[[32769],256],12157:[[32780],256],12158:[[32786],256],12159:[[32819],256],12160:[[32895],256],12161:[[32905],256],12162:[[33251],256],12163:[[33258],256],12164:[[33267],256],12165:[[33276],256],12166:[[33292],256],12167:[[33307],256],12168:[[33311],256],12169:[[33390],256],12170:[[33394],256],12171:[[33400],256],12172:[[34381],256],12173:[[34411],256],12174:[[34880],256],12175:[[34892],256],12176:[[34915],256],12177:[[35198],256],12178:[[35211],256],12179:[[35282],256],12180:[[35328],256],12181:[[35895],256],12182:[[35910],256],12183:[[35925],256],12184:[[35960],256],12185:[[35997],256],12186:[[36196],256],12187:[[36208],256],12188:[[36275],256],12189:[[36523],256],12190:[[36554],256],12191:[[36763],256],12192:[[36784],256],12193:[[36789],256],12194:[[37009],256],12195:[[37193],256],12196:[[37318],256],12197:[[37324],256],12198:[[37329],256],12199:[[38263],256],12200:[[38272],256],12201:[[38428],256],12202:[[38582],256],12203:[[38585],256],12204:[[38632],256],12205:[[38737],256],12206:[[38750],256],12207:[[38754],256],12208:[[38761],256],12209:[[38859],256],12210:[[38893],256],12211:[[38899],256],12212:[[38913],256],12213:[[39080],256],12214:[[39131],256],12215:[[39135],256],12216:[[39318],256],12217:[[39321],256],12218:[[39340],256],12219:[[39592],256],12220:[[39640],256],12221:[[39647],256],12222:[[39717],256],12223:[[39727],256],12224:[[39730],256],12225:[[39740],256],12226:[[39770],256],12227:[[40165],256],12228:[[40565],256],12229:[[40575],256],12230:[[40613],256],12231:[[40635],256],12232:[[40643],256],12233:[[40653],256],12234:[[40657],256],12235:[[40697],256],12236:[[40701],256],12237:[[40718],256],12238:[[40723],256],12239:[[40736],256],12240:[[40763],256],12241:[[40778],256],12242:[[40786],256],12243:[[40845],256],12244:[[40860],256],12245:[[40864],256]}, + 12288:{12288:[[32],256],12330:[,218],12331:[,228],12332:[,232],12333:[,222],12334:[,224],12335:[,224],12342:[[12306],256],12344:[[21313],256],12345:[[21316],256],12346:[[21317],256],12358:[,,{12441:12436}],12363:[,,{12441:12364}],12364:[[12363,12441]],12365:[,,{12441:12366}],12366:[[12365,12441]],12367:[,,{12441:12368}],12368:[[12367,12441]],12369:[,,{12441:12370}],12370:[[12369,12441]],12371:[,,{12441:12372}],12372:[[12371,12441]],12373:[,,{12441:12374}],12374:[[12373,12441]],12375:[,,{12441:12376}],12376:[[12375,12441]],12377:[,,{12441:12378}],12378:[[12377,12441]],12379:[,,{12441:12380}],12380:[[12379,12441]],12381:[,,{12441:12382}],12382:[[12381,12441]],12383:[,,{12441:12384}],12384:[[12383,12441]],12385:[,,{12441:12386}],12386:[[12385,12441]],12388:[,,{12441:12389}],12389:[[12388,12441]],12390:[,,{12441:12391}],12391:[[12390,12441]],12392:[,,{12441:12393}],12393:[[12392,12441]],12399:[,,{12441:12400,12442:12401}],12400:[[12399,12441]],12401:[[12399,12442]],12402:[,,{12441:12403,12442:12404}],12403:[[12402,12441]],12404:[[12402,12442]],12405:[,,{12441:12406,12442:12407}],12406:[[12405,12441]],12407:[[12405,12442]],12408:[,,{12441:12409,12442:12410}],12409:[[12408,12441]],12410:[[12408,12442]],12411:[,,{12441:12412,12442:12413}],12412:[[12411,12441]],12413:[[12411,12442]],12436:[[12358,12441]],12441:[,8],12442:[,8],12443:[[32,12441],256],12444:[[32,12442],256],12445:[,,{12441:12446}],12446:[[12445,12441]],12447:[[12424,12426],256],12454:[,,{12441:12532}],12459:[,,{12441:12460}],12460:[[12459,12441]],12461:[,,{12441:12462}],12462:[[12461,12441]],12463:[,,{12441:12464}],12464:[[12463,12441]],12465:[,,{12441:12466}],12466:[[12465,12441]],12467:[,,{12441:12468}],12468:[[12467,12441]],12469:[,,{12441:12470}],12470:[[12469,12441]],12471:[,,{12441:12472}],12472:[[12471,12441]],12473:[,,{12441:12474}],12474:[[12473,12441]],12475:[,,{12441:12476}],12476:[[12475,12441]],12477:[,,{12441:12478}],12478:[[12477,12441]],12479:[,,{12441:12480}],12480:[[12479,12441]],12481:[,,{12441:12482}],12482:[[12481,12441]],12484:[,,{12441:12485}],12485:[[12484,12441]],12486:[,,{12441:12487}],12487:[[12486,12441]],12488:[,,{12441:12489}],12489:[[12488,12441]],12495:[,,{12441:12496,12442:12497}],12496:[[12495,12441]],12497:[[12495,12442]],12498:[,,{12441:12499,12442:12500}],12499:[[12498,12441]],12500:[[12498,12442]],12501:[,,{12441:12502,12442:12503}],12502:[[12501,12441]],12503:[[12501,12442]],12504:[,,{12441:12505,12442:12506}],12505:[[12504,12441]],12506:[[12504,12442]],12507:[,,{12441:12508,12442:12509}],12508:[[12507,12441]],12509:[[12507,12442]],12527:[,,{12441:12535}],12528:[,,{12441:12536}],12529:[,,{12441:12537}],12530:[,,{12441:12538}],12532:[[12454,12441]],12535:[[12527,12441]],12536:[[12528,12441]],12537:[[12529,12441]],12538:[[12530,12441]],12541:[,,{12441:12542}],12542:[[12541,12441]],12543:[[12467,12488],256]}, + 12544:{12593:[[4352],256],12594:[[4353],256],12595:[[4522],256],12596:[[4354],256],12597:[[4524],256],12598:[[4525],256],12599:[[4355],256],12600:[[4356],256],12601:[[4357],256],12602:[[4528],256],12603:[[4529],256],12604:[[4530],256],12605:[[4531],256],12606:[[4532],256],12607:[[4533],256],12608:[[4378],256],12609:[[4358],256],12610:[[4359],256],12611:[[4360],256],12612:[[4385],256],12613:[[4361],256],12614:[[4362],256],12615:[[4363],256],12616:[[4364],256],12617:[[4365],256],12618:[[4366],256],12619:[[4367],256],12620:[[4368],256],12621:[[4369],256],12622:[[4370],256],12623:[[4449],256],12624:[[4450],256],12625:[[4451],256],12626:[[4452],256],12627:[[4453],256],12628:[[4454],256],12629:[[4455],256],12630:[[4456],256],12631:[[4457],256],12632:[[4458],256],12633:[[4459],256],12634:[[4460],256],12635:[[4461],256],12636:[[4462],256],12637:[[4463],256],12638:[[4464],256],12639:[[4465],256],12640:[[4466],256],12641:[[4467],256],12642:[[4468],256],12643:[[4469],256],12644:[[4448],256],12645:[[4372],256],12646:[[4373],256],12647:[[4551],256],12648:[[4552],256],12649:[[4556],256],12650:[[4558],256],12651:[[4563],256],12652:[[4567],256],12653:[[4569],256],12654:[[4380],256],12655:[[4573],256],12656:[[4575],256],12657:[[4381],256],12658:[[4382],256],12659:[[4384],256],12660:[[4386],256],12661:[[4387],256],12662:[[4391],256],12663:[[4393],256],12664:[[4395],256],12665:[[4396],256],12666:[[4397],256],12667:[[4398],256],12668:[[4399],256],12669:[[4402],256],12670:[[4406],256],12671:[[4416],256],12672:[[4423],256],12673:[[4428],256],12674:[[4593],256],12675:[[4594],256],12676:[[4439],256],12677:[[4440],256],12678:[[4441],256],12679:[[4484],256],12680:[[4485],256],12681:[[4488],256],12682:[[4497],256],12683:[[4498],256],12684:[[4500],256],12685:[[4510],256],12686:[[4513],256],12690:[[19968],256],12691:[[20108],256],12692:[[19977],256],12693:[[22235],256],12694:[[19978],256],12695:[[20013],256],12696:[[19979],256],12697:[[30002],256],12698:[[20057],256],12699:[[19993],256],12700:[[19969],256],12701:[[22825],256],12702:[[22320],256],12703:[[20154],256]}, + 12800:{12800:[[40,4352,41],256],12801:[[40,4354,41],256],12802:[[40,4355,41],256],12803:[[40,4357,41],256],12804:[[40,4358,41],256],12805:[[40,4359,41],256],12806:[[40,4361,41],256],12807:[[40,4363,41],256],12808:[[40,4364,41],256],12809:[[40,4366,41],256],12810:[[40,4367,41],256],12811:[[40,4368,41],256],12812:[[40,4369,41],256],12813:[[40,4370,41],256],12814:[[40,4352,4449,41],256],12815:[[40,4354,4449,41],256],12816:[[40,4355,4449,41],256],12817:[[40,4357,4449,41],256],12818:[[40,4358,4449,41],256],12819:[[40,4359,4449,41],256],12820:[[40,4361,4449,41],256],12821:[[40,4363,4449,41],256],12822:[[40,4364,4449,41],256],12823:[[40,4366,4449,41],256],12824:[[40,4367,4449,41],256],12825:[[40,4368,4449,41],256],12826:[[40,4369,4449,41],256],12827:[[40,4370,4449,41],256],12828:[[40,4364,4462,41],256],12829:[[40,4363,4457,4364,4453,4523,41],256],12830:[[40,4363,4457,4370,4462,41],256],12832:[[40,19968,41],256],12833:[[40,20108,41],256],12834:[[40,19977,41],256],12835:[[40,22235,41],256],12836:[[40,20116,41],256],12837:[[40,20845,41],256],12838:[[40,19971,41],256],12839:[[40,20843,41],256],12840:[[40,20061,41],256],12841:[[40,21313,41],256],12842:[[40,26376,41],256],12843:[[40,28779,41],256],12844:[[40,27700,41],256],12845:[[40,26408,41],256],12846:[[40,37329,41],256],12847:[[40,22303,41],256],12848:[[40,26085,41],256],12849:[[40,26666,41],256],12850:[[40,26377,41],256],12851:[[40,31038,41],256],12852:[[40,21517,41],256],12853:[[40,29305,41],256],12854:[[40,36001,41],256],12855:[[40,31069,41],256],12856:[[40,21172,41],256],12857:[[40,20195,41],256],12858:[[40,21628,41],256],12859:[[40,23398,41],256],12860:[[40,30435,41],256],12861:[[40,20225,41],256],12862:[[40,36039,41],256],12863:[[40,21332,41],256],12864:[[40,31085,41],256],12865:[[40,20241,41],256],12866:[[40,33258,41],256],12867:[[40,33267,41],256],12868:[[21839],256],12869:[[24188],256],12870:[[25991],256],12871:[[31631],256],12880:[[80,84,69],256],12881:[[50,49],256],12882:[[50,50],256],12883:[[50,51],256],12884:[[50,52],256],12885:[[50,53],256],12886:[[50,54],256],12887:[[50,55],256],12888:[[50,56],256],12889:[[50,57],256],12890:[[51,48],256],12891:[[51,49],256],12892:[[51,50],256],12893:[[51,51],256],12894:[[51,52],256],12895:[[51,53],256],12896:[[4352],256],12897:[[4354],256],12898:[[4355],256],12899:[[4357],256],12900:[[4358],256],12901:[[4359],256],12902:[[4361],256],12903:[[4363],256],12904:[[4364],256],12905:[[4366],256],12906:[[4367],256],12907:[[4368],256],12908:[[4369],256],12909:[[4370],256],12910:[[4352,4449],256],12911:[[4354,4449],256],12912:[[4355,4449],256],12913:[[4357,4449],256],12914:[[4358,4449],256],12915:[[4359,4449],256],12916:[[4361,4449],256],12917:[[4363,4449],256],12918:[[4364,4449],256],12919:[[4366,4449],256],12920:[[4367,4449],256],12921:[[4368,4449],256],12922:[[4369,4449],256],12923:[[4370,4449],256],12924:[[4366,4449,4535,4352,4457],256],12925:[[4364,4462,4363,4468],256],12926:[[4363,4462],256],12928:[[19968],256],12929:[[20108],256],12930:[[19977],256],12931:[[22235],256],12932:[[20116],256],12933:[[20845],256],12934:[[19971],256],12935:[[20843],256],12936:[[20061],256],12937:[[21313],256],12938:[[26376],256],12939:[[28779],256],12940:[[27700],256],12941:[[26408],256],12942:[[37329],256],12943:[[22303],256],12944:[[26085],256],12945:[[26666],256],12946:[[26377],256],12947:[[31038],256],12948:[[21517],256],12949:[[29305],256],12950:[[36001],256],12951:[[31069],256],12952:[[21172],256],12953:[[31192],256],12954:[[30007],256],12955:[[22899],256],12956:[[36969],256],12957:[[20778],256],12958:[[21360],256],12959:[[27880],256],12960:[[38917],256],12961:[[20241],256],12962:[[20889],256],12963:[[27491],256],12964:[[19978],256],12965:[[20013],256],12966:[[19979],256],12967:[[24038],256],12968:[[21491],256],12969:[[21307],256],12970:[[23447],256],12971:[[23398],256],12972:[[30435],256],12973:[[20225],256],12974:[[36039],256],12975:[[21332],256],12976:[[22812],256],12977:[[51,54],256],12978:[[51,55],256],12979:[[51,56],256],12980:[[51,57],256],12981:[[52,48],256],12982:[[52,49],256],12983:[[52,50],256],12984:[[52,51],256],12985:[[52,52],256],12986:[[52,53],256],12987:[[52,54],256],12988:[[52,55],256],12989:[[52,56],256],12990:[[52,57],256],12991:[[53,48],256],12992:[[49,26376],256],12993:[[50,26376],256],12994:[[51,26376],256],12995:[[52,26376],256],12996:[[53,26376],256],12997:[[54,26376],256],12998:[[55,26376],256],12999:[[56,26376],256],13000:[[57,26376],256],13001:[[49,48,26376],256],13002:[[49,49,26376],256],13003:[[49,50,26376],256],13004:[[72,103],256],13005:[[101,114,103],256],13006:[[101,86],256],13007:[[76,84,68],256],13008:[[12450],256],13009:[[12452],256],13010:[[12454],256],13011:[[12456],256],13012:[[12458],256],13013:[[12459],256],13014:[[12461],256],13015:[[12463],256],13016:[[12465],256],13017:[[12467],256],13018:[[12469],256],13019:[[12471],256],13020:[[12473],256],13021:[[12475],256],13022:[[12477],256],13023:[[12479],256],13024:[[12481],256],13025:[[12484],256],13026:[[12486],256],13027:[[12488],256],13028:[[12490],256],13029:[[12491],256],13030:[[12492],256],13031:[[12493],256],13032:[[12494],256],13033:[[12495],256],13034:[[12498],256],13035:[[12501],256],13036:[[12504],256],13037:[[12507],256],13038:[[12510],256],13039:[[12511],256],13040:[[12512],256],13041:[[12513],256],13042:[[12514],256],13043:[[12516],256],13044:[[12518],256],13045:[[12520],256],13046:[[12521],256],13047:[[12522],256],13048:[[12523],256],13049:[[12524],256],13050:[[12525],256],13051:[[12527],256],13052:[[12528],256],13053:[[12529],256],13054:[[12530],256]}, + 13056:{13056:[[12450,12497,12540,12488],256],13057:[[12450,12523,12501,12449],256],13058:[[12450,12531,12506,12450],256],13059:[[12450,12540,12523],256],13060:[[12452,12491,12531,12464],256],13061:[[12452,12531,12481],256],13062:[[12454,12457,12531],256],13063:[[12456,12473,12463,12540,12489],256],13064:[[12456,12540,12459,12540],256],13065:[[12458,12531,12473],256],13066:[[12458,12540,12512],256],13067:[[12459,12452,12522],256],13068:[[12459,12521,12483,12488],256],13069:[[12459,12525,12522,12540],256],13070:[[12460,12525,12531],256],13071:[[12460,12531,12510],256],13072:[[12462,12460],256],13073:[[12462,12491,12540],256],13074:[[12461,12517,12522,12540],256],13075:[[12462,12523,12480,12540],256],13076:[[12461,12525],256],13077:[[12461,12525,12464,12521,12512],256],13078:[[12461,12525,12513,12540,12488,12523],256],13079:[[12461,12525,12527,12483,12488],256],13080:[[12464,12521,12512],256],13081:[[12464,12521,12512,12488,12531],256],13082:[[12463,12523,12476,12452,12525],256],13083:[[12463,12525,12540,12493],256],13084:[[12465,12540,12473],256],13085:[[12467,12523,12490],256],13086:[[12467,12540,12509],256],13087:[[12469,12452,12463,12523],256],13088:[[12469,12531,12481,12540,12512],256],13089:[[12471,12522,12531,12464],256],13090:[[12475,12531,12481],256],13091:[[12475,12531,12488],256],13092:[[12480,12540,12473],256],13093:[[12487,12471],256],13094:[[12489,12523],256],13095:[[12488,12531],256],13096:[[12490,12494],256],13097:[[12494,12483,12488],256],13098:[[12495,12452,12484],256],13099:[[12497,12540,12475,12531,12488],256],13100:[[12497,12540,12484],256],13101:[[12496,12540,12524,12523],256],13102:[[12500,12450,12473,12488,12523],256],13103:[[12500,12463,12523],256],13104:[[12500,12467],256],13105:[[12499,12523],256],13106:[[12501,12449,12521,12483,12489],256],13107:[[12501,12451,12540,12488],256],13108:[[12502,12483,12471,12455,12523],256],13109:[[12501,12521,12531],256],13110:[[12504,12463,12479,12540,12523],256],13111:[[12506,12477],256],13112:[[12506,12491,12498],256],13113:[[12504,12523,12484],256],13114:[[12506,12531,12473],256],13115:[[12506,12540,12472],256],13116:[[12505,12540,12479],256],13117:[[12509,12452,12531,12488],256],13118:[[12508,12523,12488],256],13119:[[12507,12531],256],13120:[[12509,12531,12489],256],13121:[[12507,12540,12523],256],13122:[[12507,12540,12531],256],13123:[[12510,12452,12463,12525],256],13124:[[12510,12452,12523],256],13125:[[12510,12483,12495],256],13126:[[12510,12523,12463],256],13127:[[12510,12531,12471,12519,12531],256],13128:[[12511,12463,12525,12531],256],13129:[[12511,12522],256],13130:[[12511,12522,12496,12540,12523],256],13131:[[12513,12460],256],13132:[[12513,12460,12488,12531],256],13133:[[12513,12540,12488,12523],256],13134:[[12516,12540,12489],256],13135:[[12516,12540,12523],256],13136:[[12518,12450,12531],256],13137:[[12522,12483,12488,12523],256],13138:[[12522,12521],256],13139:[[12523,12500,12540],256],13140:[[12523,12540,12502,12523],256],13141:[[12524,12512],256],13142:[[12524,12531,12488,12466,12531],256],13143:[[12527,12483,12488],256],13144:[[48,28857],256],13145:[[49,28857],256],13146:[[50,28857],256],13147:[[51,28857],256],13148:[[52,28857],256],13149:[[53,28857],256],13150:[[54,28857],256],13151:[[55,28857],256],13152:[[56,28857],256],13153:[[57,28857],256],13154:[[49,48,28857],256],13155:[[49,49,28857],256],13156:[[49,50,28857],256],13157:[[49,51,28857],256],13158:[[49,52,28857],256],13159:[[49,53,28857],256],13160:[[49,54,28857],256],13161:[[49,55,28857],256],13162:[[49,56,28857],256],13163:[[49,57,28857],256],13164:[[50,48,28857],256],13165:[[50,49,28857],256],13166:[[50,50,28857],256],13167:[[50,51,28857],256],13168:[[50,52,28857],256],13169:[[104,80,97],256],13170:[[100,97],256],13171:[[65,85],256],13172:[[98,97,114],256],13173:[[111,86],256],13174:[[112,99],256],13175:[[100,109],256],13176:[[100,109,178],256],13177:[[100,109,179],256],13178:[[73,85],256],13179:[[24179,25104],256],13180:[[26157,21644],256],13181:[[22823,27491],256],13182:[[26126,27835],256],13183:[[26666,24335,20250,31038],256],13184:[[112,65],256],13185:[[110,65],256],13186:[[956,65],256],13187:[[109,65],256],13188:[[107,65],256],13189:[[75,66],256],13190:[[77,66],256],13191:[[71,66],256],13192:[[99,97,108],256],13193:[[107,99,97,108],256],13194:[[112,70],256],13195:[[110,70],256],13196:[[956,70],256],13197:[[956,103],256],13198:[[109,103],256],13199:[[107,103],256],13200:[[72,122],256],13201:[[107,72,122],256],13202:[[77,72,122],256],13203:[[71,72,122],256],13204:[[84,72,122],256],13205:[[956,8467],256],13206:[[109,8467],256],13207:[[100,8467],256],13208:[[107,8467],256],13209:[[102,109],256],13210:[[110,109],256],13211:[[956,109],256],13212:[[109,109],256],13213:[[99,109],256],13214:[[107,109],256],13215:[[109,109,178],256],13216:[[99,109,178],256],13217:[[109,178],256],13218:[[107,109,178],256],13219:[[109,109,179],256],13220:[[99,109,179],256],13221:[[109,179],256],13222:[[107,109,179],256],13223:[[109,8725,115],256],13224:[[109,8725,115,178],256],13225:[[80,97],256],13226:[[107,80,97],256],13227:[[77,80,97],256],13228:[[71,80,97],256],13229:[[114,97,100],256],13230:[[114,97,100,8725,115],256],13231:[[114,97,100,8725,115,178],256],13232:[[112,115],256],13233:[[110,115],256],13234:[[956,115],256],13235:[[109,115],256],13236:[[112,86],256],13237:[[110,86],256],13238:[[956,86],256],13239:[[109,86],256],13240:[[107,86],256],13241:[[77,86],256],13242:[[112,87],256],13243:[[110,87],256],13244:[[956,87],256],13245:[[109,87],256],13246:[[107,87],256],13247:[[77,87],256],13248:[[107,937],256],13249:[[77,937],256],13250:[[97,46,109,46],256],13251:[[66,113],256],13252:[[99,99],256],13253:[[99,100],256],13254:[[67,8725,107,103],256],13255:[[67,111,46],256],13256:[[100,66],256],13257:[[71,121],256],13258:[[104,97],256],13259:[[72,80],256],13260:[[105,110],256],13261:[[75,75],256],13262:[[75,77],256],13263:[[107,116],256],13264:[[108,109],256],13265:[[108,110],256],13266:[[108,111,103],256],13267:[[108,120],256],13268:[[109,98],256],13269:[[109,105,108],256],13270:[[109,111,108],256],13271:[[80,72],256],13272:[[112,46,109,46],256],13273:[[80,80,77],256],13274:[[80,82],256],13275:[[115,114],256],13276:[[83,118],256],13277:[[87,98],256],13278:[[86,8725,109],256],13279:[[65,8725,109],256],13280:[[49,26085],256],13281:[[50,26085],256],13282:[[51,26085],256],13283:[[52,26085],256],13284:[[53,26085],256],13285:[[54,26085],256],13286:[[55,26085],256],13287:[[56,26085],256],13288:[[57,26085],256],13289:[[49,48,26085],256],13290:[[49,49,26085],256],13291:[[49,50,26085],256],13292:[[49,51,26085],256],13293:[[49,52,26085],256],13294:[[49,53,26085],256],13295:[[49,54,26085],256],13296:[[49,55,26085],256],13297:[[49,56,26085],256],13298:[[49,57,26085],256],13299:[[50,48,26085],256],13300:[[50,49,26085],256],13301:[[50,50,26085],256],13302:[[50,51,26085],256],13303:[[50,52,26085],256],13304:[[50,53,26085],256],13305:[[50,54,26085],256],13306:[[50,55,26085],256],13307:[[50,56,26085],256],13308:[[50,57,26085],256],13309:[[51,48,26085],256],13310:[[51,49,26085],256],13311:[[103,97,108],256]}, + 42496:{42607:[,230],42612:[,230],42613:[,230],42614:[,230],42615:[,230],42616:[,230],42617:[,230],42618:[,230],42619:[,230],42620:[,230],42621:[,230],42655:[,230],42736:[,230],42737:[,230]}, + 42752:{42864:[[42863],256],43000:[[294],256],43001:[[339],256]}, + 43008:{43014:[,9],43204:[,9],43232:[,230],43233:[,230],43234:[,230],43235:[,230],43236:[,230],43237:[,230],43238:[,230],43239:[,230],43240:[,230],43241:[,230],43242:[,230],43243:[,230],43244:[,230],43245:[,230],43246:[,230],43247:[,230],43248:[,230],43249:[,230]}, + 43264:{43307:[,220],43308:[,220],43309:[,220],43347:[,9],43443:[,7],43456:[,9]}, + 43520:{43696:[,230],43698:[,230],43699:[,230],43700:[,220],43703:[,230],43704:[,230],43710:[,230],43711:[,230],43713:[,230],43766:[,9]}, + 43776:{44013:[,9]}, + 53504:{119134:[[119127,119141],512],119135:[[119128,119141],512],119136:[[119135,119150],512],119137:[[119135,119151],512],119138:[[119135,119152],512],119139:[[119135,119153],512],119140:[[119135,119154],512],119141:[,216],119142:[,216],119143:[,1],119144:[,1],119145:[,1],119149:[,226],119150:[,216],119151:[,216],119152:[,216],119153:[,216],119154:[,216],119163:[,220],119164:[,220],119165:[,220],119166:[,220],119167:[,220],119168:[,220],119169:[,220],119170:[,220],119173:[,230],119174:[,230],119175:[,230],119176:[,230],119177:[,230],119178:[,220],119179:[,220],119210:[,230],119211:[,230],119212:[,230],119213:[,230],119227:[[119225,119141],512],119228:[[119226,119141],512],119229:[[119227,119150],512],119230:[[119228,119150],512],119231:[[119227,119151],512],119232:[[119228,119151],512]}, + 53760:{119362:[,230],119363:[,230],119364:[,230]}, + 54272:{119808:[[65],256],119809:[[66],256],119810:[[67],256],119811:[[68],256],119812:[[69],256],119813:[[70],256],119814:[[71],256],119815:[[72],256],119816:[[73],256],119817:[[74],256],119818:[[75],256],119819:[[76],256],119820:[[77],256],119821:[[78],256],119822:[[79],256],119823:[[80],256],119824:[[81],256],119825:[[82],256],119826:[[83],256],119827:[[84],256],119828:[[85],256],119829:[[86],256],119830:[[87],256],119831:[[88],256],119832:[[89],256],119833:[[90],256],119834:[[97],256],119835:[[98],256],119836:[[99],256],119837:[[100],256],119838:[[101],256],119839:[[102],256],119840:[[103],256],119841:[[104],256],119842:[[105],256],119843:[[106],256],119844:[[107],256],119845:[[108],256],119846:[[109],256],119847:[[110],256],119848:[[111],256],119849:[[112],256],119850:[[113],256],119851:[[114],256],119852:[[115],256],119853:[[116],256],119854:[[117],256],119855:[[118],256],119856:[[119],256],119857:[[120],256],119858:[[121],256],119859:[[122],256],119860:[[65],256],119861:[[66],256],119862:[[67],256],119863:[[68],256],119864:[[69],256],119865:[[70],256],119866:[[71],256],119867:[[72],256],119868:[[73],256],119869:[[74],256],119870:[[75],256],119871:[[76],256],119872:[[77],256],119873:[[78],256],119874:[[79],256],119875:[[80],256],119876:[[81],256],119877:[[82],256],119878:[[83],256],119879:[[84],256],119880:[[85],256],119881:[[86],256],119882:[[87],256],119883:[[88],256],119884:[[89],256],119885:[[90],256],119886:[[97],256],119887:[[98],256],119888:[[99],256],119889:[[100],256],119890:[[101],256],119891:[[102],256],119892:[[103],256],119894:[[105],256],119895:[[106],256],119896:[[107],256],119897:[[108],256],119898:[[109],256],119899:[[110],256],119900:[[111],256],119901:[[112],256],119902:[[113],256],119903:[[114],256],119904:[[115],256],119905:[[116],256],119906:[[117],256],119907:[[118],256],119908:[[119],256],119909:[[120],256],119910:[[121],256],119911:[[122],256],119912:[[65],256],119913:[[66],256],119914:[[67],256],119915:[[68],256],119916:[[69],256],119917:[[70],256],119918:[[71],256],119919:[[72],256],119920:[[73],256],119921:[[74],256],119922:[[75],256],119923:[[76],256],119924:[[77],256],119925:[[78],256],119926:[[79],256],119927:[[80],256],119928:[[81],256],119929:[[82],256],119930:[[83],256],119931:[[84],256],119932:[[85],256],119933:[[86],256],119934:[[87],256],119935:[[88],256],119936:[[89],256],119937:[[90],256],119938:[[97],256],119939:[[98],256],119940:[[99],256],119941:[[100],256],119942:[[101],256],119943:[[102],256],119944:[[103],256],119945:[[104],256],119946:[[105],256],119947:[[106],256],119948:[[107],256],119949:[[108],256],119950:[[109],256],119951:[[110],256],119952:[[111],256],119953:[[112],256],119954:[[113],256],119955:[[114],256],119956:[[115],256],119957:[[116],256],119958:[[117],256],119959:[[118],256],119960:[[119],256],119961:[[120],256],119962:[[121],256],119963:[[122],256],119964:[[65],256],119966:[[67],256],119967:[[68],256],119970:[[71],256],119973:[[74],256],119974:[[75],256],119977:[[78],256],119978:[[79],256],119979:[[80],256],119980:[[81],256],119982:[[83],256],119983:[[84],256],119984:[[85],256],119985:[[86],256],119986:[[87],256],119987:[[88],256],119988:[[89],256],119989:[[90],256],119990:[[97],256],119991:[[98],256],119992:[[99],256],119993:[[100],256],119995:[[102],256],119997:[[104],256],119998:[[105],256],119999:[[106],256],120000:[[107],256],120001:[[108],256],120002:[[109],256],120003:[[110],256],120005:[[112],256],120006:[[113],256],120007:[[114],256],120008:[[115],256],120009:[[116],256],120010:[[117],256],120011:[[118],256],120012:[[119],256],120013:[[120],256],120014:[[121],256],120015:[[122],256],120016:[[65],256],120017:[[66],256],120018:[[67],256],120019:[[68],256],120020:[[69],256],120021:[[70],256],120022:[[71],256],120023:[[72],256],120024:[[73],256],120025:[[74],256],120026:[[75],256],120027:[[76],256],120028:[[77],256],120029:[[78],256],120030:[[79],256],120031:[[80],256],120032:[[81],256],120033:[[82],256],120034:[[83],256],120035:[[84],256],120036:[[85],256],120037:[[86],256],120038:[[87],256],120039:[[88],256],120040:[[89],256],120041:[[90],256],120042:[[97],256],120043:[[98],256],120044:[[99],256],120045:[[100],256],120046:[[101],256],120047:[[102],256],120048:[[103],256],120049:[[104],256],120050:[[105],256],120051:[[106],256],120052:[[107],256],120053:[[108],256],120054:[[109],256],120055:[[110],256],120056:[[111],256],120057:[[112],256],120058:[[113],256],120059:[[114],256],120060:[[115],256],120061:[[116],256],120062:[[117],256],120063:[[118],256]}, + 54528:{120064:[[119],256],120065:[[120],256],120066:[[121],256],120067:[[122],256],120068:[[65],256],120069:[[66],256],120071:[[68],256],120072:[[69],256],120073:[[70],256],120074:[[71],256],120077:[[74],256],120078:[[75],256],120079:[[76],256],120080:[[77],256],120081:[[78],256],120082:[[79],256],120083:[[80],256],120084:[[81],256],120086:[[83],256],120087:[[84],256],120088:[[85],256],120089:[[86],256],120090:[[87],256],120091:[[88],256],120092:[[89],256],120094:[[97],256],120095:[[98],256],120096:[[99],256],120097:[[100],256],120098:[[101],256],120099:[[102],256],120100:[[103],256],120101:[[104],256],120102:[[105],256],120103:[[106],256],120104:[[107],256],120105:[[108],256],120106:[[109],256],120107:[[110],256],120108:[[111],256],120109:[[112],256],120110:[[113],256],120111:[[114],256],120112:[[115],256],120113:[[116],256],120114:[[117],256],120115:[[118],256],120116:[[119],256],120117:[[120],256],120118:[[121],256],120119:[[122],256],120120:[[65],256],120121:[[66],256],120123:[[68],256],120124:[[69],256],120125:[[70],256],120126:[[71],256],120128:[[73],256],120129:[[74],256],120130:[[75],256],120131:[[76],256],120132:[[77],256],120134:[[79],256],120138:[[83],256],120139:[[84],256],120140:[[85],256],120141:[[86],256],120142:[[87],256],120143:[[88],256],120144:[[89],256],120146:[[97],256],120147:[[98],256],120148:[[99],256],120149:[[100],256],120150:[[101],256],120151:[[102],256],120152:[[103],256],120153:[[104],256],120154:[[105],256],120155:[[106],256],120156:[[107],256],120157:[[108],256],120158:[[109],256],120159:[[110],256],120160:[[111],256],120161:[[112],256],120162:[[113],256],120163:[[114],256],120164:[[115],256],120165:[[116],256],120166:[[117],256],120167:[[118],256],120168:[[119],256],120169:[[120],256],120170:[[121],256],120171:[[122],256],120172:[[65],256],120173:[[66],256],120174:[[67],256],120175:[[68],256],120176:[[69],256],120177:[[70],256],120178:[[71],256],120179:[[72],256],120180:[[73],256],120181:[[74],256],120182:[[75],256],120183:[[76],256],120184:[[77],256],120185:[[78],256],120186:[[79],256],120187:[[80],256],120188:[[81],256],120189:[[82],256],120190:[[83],256],120191:[[84],256],120192:[[85],256],120193:[[86],256],120194:[[87],256],120195:[[88],256],120196:[[89],256],120197:[[90],256],120198:[[97],256],120199:[[98],256],120200:[[99],256],120201:[[100],256],120202:[[101],256],120203:[[102],256],120204:[[103],256],120205:[[104],256],120206:[[105],256],120207:[[106],256],120208:[[107],256],120209:[[108],256],120210:[[109],256],120211:[[110],256],120212:[[111],256],120213:[[112],256],120214:[[113],256],120215:[[114],256],120216:[[115],256],120217:[[116],256],120218:[[117],256],120219:[[118],256],120220:[[119],256],120221:[[120],256],120222:[[121],256],120223:[[122],256],120224:[[65],256],120225:[[66],256],120226:[[67],256],120227:[[68],256],120228:[[69],256],120229:[[70],256],120230:[[71],256],120231:[[72],256],120232:[[73],256],120233:[[74],256],120234:[[75],256],120235:[[76],256],120236:[[77],256],120237:[[78],256],120238:[[79],256],120239:[[80],256],120240:[[81],256],120241:[[82],256],120242:[[83],256],120243:[[84],256],120244:[[85],256],120245:[[86],256],120246:[[87],256],120247:[[88],256],120248:[[89],256],120249:[[90],256],120250:[[97],256],120251:[[98],256],120252:[[99],256],120253:[[100],256],120254:[[101],256],120255:[[102],256],120256:[[103],256],120257:[[104],256],120258:[[105],256],120259:[[106],256],120260:[[107],256],120261:[[108],256],120262:[[109],256],120263:[[110],256],120264:[[111],256],120265:[[112],256],120266:[[113],256],120267:[[114],256],120268:[[115],256],120269:[[116],256],120270:[[117],256],120271:[[118],256],120272:[[119],256],120273:[[120],256],120274:[[121],256],120275:[[122],256],120276:[[65],256],120277:[[66],256],120278:[[67],256],120279:[[68],256],120280:[[69],256],120281:[[70],256],120282:[[71],256],120283:[[72],256],120284:[[73],256],120285:[[74],256],120286:[[75],256],120287:[[76],256],120288:[[77],256],120289:[[78],256],120290:[[79],256],120291:[[80],256],120292:[[81],256],120293:[[82],256],120294:[[83],256],120295:[[84],256],120296:[[85],256],120297:[[86],256],120298:[[87],256],120299:[[88],256],120300:[[89],256],120301:[[90],256],120302:[[97],256],120303:[[98],256],120304:[[99],256],120305:[[100],256],120306:[[101],256],120307:[[102],256],120308:[[103],256],120309:[[104],256],120310:[[105],256],120311:[[106],256],120312:[[107],256],120313:[[108],256],120314:[[109],256],120315:[[110],256],120316:[[111],256],120317:[[112],256],120318:[[113],256],120319:[[114],256]}, + 54784:{120320:[[115],256],120321:[[116],256],120322:[[117],256],120323:[[118],256],120324:[[119],256],120325:[[120],256],120326:[[121],256],120327:[[122],256],120328:[[65],256],120329:[[66],256],120330:[[67],256],120331:[[68],256],120332:[[69],256],120333:[[70],256],120334:[[71],256],120335:[[72],256],120336:[[73],256],120337:[[74],256],120338:[[75],256],120339:[[76],256],120340:[[77],256],120341:[[78],256],120342:[[79],256],120343:[[80],256],120344:[[81],256],120345:[[82],256],120346:[[83],256],120347:[[84],256],120348:[[85],256],120349:[[86],256],120350:[[87],256],120351:[[88],256],120352:[[89],256],120353:[[90],256],120354:[[97],256],120355:[[98],256],120356:[[99],256],120357:[[100],256],120358:[[101],256],120359:[[102],256],120360:[[103],256],120361:[[104],256],120362:[[105],256],120363:[[106],256],120364:[[107],256],120365:[[108],256],120366:[[109],256],120367:[[110],256],120368:[[111],256],120369:[[112],256],120370:[[113],256],120371:[[114],256],120372:[[115],256],120373:[[116],256],120374:[[117],256],120375:[[118],256],120376:[[119],256],120377:[[120],256],120378:[[121],256],120379:[[122],256],120380:[[65],256],120381:[[66],256],120382:[[67],256],120383:[[68],256],120384:[[69],256],120385:[[70],256],120386:[[71],256],120387:[[72],256],120388:[[73],256],120389:[[74],256],120390:[[75],256],120391:[[76],256],120392:[[77],256],120393:[[78],256],120394:[[79],256],120395:[[80],256],120396:[[81],256],120397:[[82],256],120398:[[83],256],120399:[[84],256],120400:[[85],256],120401:[[86],256],120402:[[87],256],120403:[[88],256],120404:[[89],256],120405:[[90],256],120406:[[97],256],120407:[[98],256],120408:[[99],256],120409:[[100],256],120410:[[101],256],120411:[[102],256],120412:[[103],256],120413:[[104],256],120414:[[105],256],120415:[[106],256],120416:[[107],256],120417:[[108],256],120418:[[109],256],120419:[[110],256],120420:[[111],256],120421:[[112],256],120422:[[113],256],120423:[[114],256],120424:[[115],256],120425:[[116],256],120426:[[117],256],120427:[[118],256],120428:[[119],256],120429:[[120],256],120430:[[121],256],120431:[[122],256],120432:[[65],256],120433:[[66],256],120434:[[67],256],120435:[[68],256],120436:[[69],256],120437:[[70],256],120438:[[71],256],120439:[[72],256],120440:[[73],256],120441:[[74],256],120442:[[75],256],120443:[[76],256],120444:[[77],256],120445:[[78],256],120446:[[79],256],120447:[[80],256],120448:[[81],256],120449:[[82],256],120450:[[83],256],120451:[[84],256],120452:[[85],256],120453:[[86],256],120454:[[87],256],120455:[[88],256],120456:[[89],256],120457:[[90],256],120458:[[97],256],120459:[[98],256],120460:[[99],256],120461:[[100],256],120462:[[101],256],120463:[[102],256],120464:[[103],256],120465:[[104],256],120466:[[105],256],120467:[[106],256],120468:[[107],256],120469:[[108],256],120470:[[109],256],120471:[[110],256],120472:[[111],256],120473:[[112],256],120474:[[113],256],120475:[[114],256],120476:[[115],256],120477:[[116],256],120478:[[117],256],120479:[[118],256],120480:[[119],256],120481:[[120],256],120482:[[121],256],120483:[[122],256],120484:[[305],256],120485:[[567],256],120488:[[913],256],120489:[[914],256],120490:[[915],256],120491:[[916],256],120492:[[917],256],120493:[[918],256],120494:[[919],256],120495:[[920],256],120496:[[921],256],120497:[[922],256],120498:[[923],256],120499:[[924],256],120500:[[925],256],120501:[[926],256],120502:[[927],256],120503:[[928],256],120504:[[929],256],120505:[[1012],256],120506:[[931],256],120507:[[932],256],120508:[[933],256],120509:[[934],256],120510:[[935],256],120511:[[936],256],120512:[[937],256],120513:[[8711],256],120514:[[945],256],120515:[[946],256],120516:[[947],256],120517:[[948],256],120518:[[949],256],120519:[[950],256],120520:[[951],256],120521:[[952],256],120522:[[953],256],120523:[[954],256],120524:[[955],256],120525:[[956],256],120526:[[957],256],120527:[[958],256],120528:[[959],256],120529:[[960],256],120530:[[961],256],120531:[[962],256],120532:[[963],256],120533:[[964],256],120534:[[965],256],120535:[[966],256],120536:[[967],256],120537:[[968],256],120538:[[969],256],120539:[[8706],256],120540:[[1013],256],120541:[[977],256],120542:[[1008],256],120543:[[981],256],120544:[[1009],256],120545:[[982],256],120546:[[913],256],120547:[[914],256],120548:[[915],256],120549:[[916],256],120550:[[917],256],120551:[[918],256],120552:[[919],256],120553:[[920],256],120554:[[921],256],120555:[[922],256],120556:[[923],256],120557:[[924],256],120558:[[925],256],120559:[[926],256],120560:[[927],256],120561:[[928],256],120562:[[929],256],120563:[[1012],256],120564:[[931],256],120565:[[932],256],120566:[[933],256],120567:[[934],256],120568:[[935],256],120569:[[936],256],120570:[[937],256],120571:[[8711],256],120572:[[945],256],120573:[[946],256],120574:[[947],256],120575:[[948],256]}, + 55040:{120576:[[949],256],120577:[[950],256],120578:[[951],256],120579:[[952],256],120580:[[953],256],120581:[[954],256],120582:[[955],256],120583:[[956],256],120584:[[957],256],120585:[[958],256],120586:[[959],256],120587:[[960],256],120588:[[961],256],120589:[[962],256],120590:[[963],256],120591:[[964],256],120592:[[965],256],120593:[[966],256],120594:[[967],256],120595:[[968],256],120596:[[969],256],120597:[[8706],256],120598:[[1013],256],120599:[[977],256],120600:[[1008],256],120601:[[981],256],120602:[[1009],256],120603:[[982],256],120604:[[913],256],120605:[[914],256],120606:[[915],256],120607:[[916],256],120608:[[917],256],120609:[[918],256],120610:[[919],256],120611:[[920],256],120612:[[921],256],120613:[[922],256],120614:[[923],256],120615:[[924],256],120616:[[925],256],120617:[[926],256],120618:[[927],256],120619:[[928],256],120620:[[929],256],120621:[[1012],256],120622:[[931],256],120623:[[932],256],120624:[[933],256],120625:[[934],256],120626:[[935],256],120627:[[936],256],120628:[[937],256],120629:[[8711],256],120630:[[945],256],120631:[[946],256],120632:[[947],256],120633:[[948],256],120634:[[949],256],120635:[[950],256],120636:[[951],256],120637:[[952],256],120638:[[953],256],120639:[[954],256],120640:[[955],256],120641:[[956],256],120642:[[957],256],120643:[[958],256],120644:[[959],256],120645:[[960],256],120646:[[961],256],120647:[[962],256],120648:[[963],256],120649:[[964],256],120650:[[965],256],120651:[[966],256],120652:[[967],256],120653:[[968],256],120654:[[969],256],120655:[[8706],256],120656:[[1013],256],120657:[[977],256],120658:[[1008],256],120659:[[981],256],120660:[[1009],256],120661:[[982],256],120662:[[913],256],120663:[[914],256],120664:[[915],256],120665:[[916],256],120666:[[917],256],120667:[[918],256],120668:[[919],256],120669:[[920],256],120670:[[921],256],120671:[[922],256],120672:[[923],256],120673:[[924],256],120674:[[925],256],120675:[[926],256],120676:[[927],256],120677:[[928],256],120678:[[929],256],120679:[[1012],256],120680:[[931],256],120681:[[932],256],120682:[[933],256],120683:[[934],256],120684:[[935],256],120685:[[936],256],120686:[[937],256],120687:[[8711],256],120688:[[945],256],120689:[[946],256],120690:[[947],256],120691:[[948],256],120692:[[949],256],120693:[[950],256],120694:[[951],256],120695:[[952],256],120696:[[953],256],120697:[[954],256],120698:[[955],256],120699:[[956],256],120700:[[957],256],120701:[[958],256],120702:[[959],256],120703:[[960],256],120704:[[961],256],120705:[[962],256],120706:[[963],256],120707:[[964],256],120708:[[965],256],120709:[[966],256],120710:[[967],256],120711:[[968],256],120712:[[969],256],120713:[[8706],256],120714:[[1013],256],120715:[[977],256],120716:[[1008],256],120717:[[981],256],120718:[[1009],256],120719:[[982],256],120720:[[913],256],120721:[[914],256],120722:[[915],256],120723:[[916],256],120724:[[917],256],120725:[[918],256],120726:[[919],256],120727:[[920],256],120728:[[921],256],120729:[[922],256],120730:[[923],256],120731:[[924],256],120732:[[925],256],120733:[[926],256],120734:[[927],256],120735:[[928],256],120736:[[929],256],120737:[[1012],256],120738:[[931],256],120739:[[932],256],120740:[[933],256],120741:[[934],256],120742:[[935],256],120743:[[936],256],120744:[[937],256],120745:[[8711],256],120746:[[945],256],120747:[[946],256],120748:[[947],256],120749:[[948],256],120750:[[949],256],120751:[[950],256],120752:[[951],256],120753:[[952],256],120754:[[953],256],120755:[[954],256],120756:[[955],256],120757:[[956],256],120758:[[957],256],120759:[[958],256],120760:[[959],256],120761:[[960],256],120762:[[961],256],120763:[[962],256],120764:[[963],256],120765:[[964],256],120766:[[965],256],120767:[[966],256],120768:[[967],256],120769:[[968],256],120770:[[969],256],120771:[[8706],256],120772:[[1013],256],120773:[[977],256],120774:[[1008],256],120775:[[981],256],120776:[[1009],256],120777:[[982],256],120778:[[988],256],120779:[[989],256],120782:[[48],256],120783:[[49],256],120784:[[50],256],120785:[[51],256],120786:[[52],256],120787:[[53],256],120788:[[54],256],120789:[[55],256],120790:[[56],256],120791:[[57],256],120792:[[48],256],120793:[[49],256],120794:[[50],256],120795:[[51],256],120796:[[52],256],120797:[[53],256],120798:[[54],256],120799:[[55],256],120800:[[56],256],120801:[[57],256],120802:[[48],256],120803:[[49],256],120804:[[50],256],120805:[[51],256],120806:[[52],256],120807:[[53],256],120808:[[54],256],120809:[[55],256],120810:[[56],256],120811:[[57],256],120812:[[48],256],120813:[[49],256],120814:[[50],256],120815:[[51],256],120816:[[52],256],120817:[[53],256],120818:[[54],256],120819:[[55],256],120820:[[56],256],120821:[[57],256],120822:[[48],256],120823:[[49],256],120824:[[50],256],120825:[[51],256],120826:[[52],256],120827:[[53],256],120828:[[54],256],120829:[[55],256],120830:[[56],256],120831:[[57],256]}, + 60928:{126464:[[1575],256],126465:[[1576],256],126466:[[1580],256],126467:[[1583],256],126469:[[1608],256],126470:[[1586],256],126471:[[1581],256],126472:[[1591],256],126473:[[1610],256],126474:[[1603],256],126475:[[1604],256],126476:[[1605],256],126477:[[1606],256],126478:[[1587],256],126479:[[1593],256],126480:[[1601],256],126481:[[1589],256],126482:[[1602],256],126483:[[1585],256],126484:[[1588],256],126485:[[1578],256],126486:[[1579],256],126487:[[1582],256],126488:[[1584],256],126489:[[1590],256],126490:[[1592],256],126491:[[1594],256],126492:[[1646],256],126493:[[1722],256],126494:[[1697],256],126495:[[1647],256],126497:[[1576],256],126498:[[1580],256],126500:[[1607],256],126503:[[1581],256],126505:[[1610],256],126506:[[1603],256],126507:[[1604],256],126508:[[1605],256],126509:[[1606],256],126510:[[1587],256],126511:[[1593],256],126512:[[1601],256],126513:[[1589],256],126514:[[1602],256],126516:[[1588],256],126517:[[1578],256],126518:[[1579],256],126519:[[1582],256],126521:[[1590],256],126523:[[1594],256],126530:[[1580],256],126535:[[1581],256],126537:[[1610],256],126539:[[1604],256],126541:[[1606],256],126542:[[1587],256],126543:[[1593],256],126545:[[1589],256],126546:[[1602],256],126548:[[1588],256],126551:[[1582],256],126553:[[1590],256],126555:[[1594],256],126557:[[1722],256],126559:[[1647],256],126561:[[1576],256],126562:[[1580],256],126564:[[1607],256],126567:[[1581],256],126568:[[1591],256],126569:[[1610],256],126570:[[1603],256],126572:[[1605],256],126573:[[1606],256],126574:[[1587],256],126575:[[1593],256],126576:[[1601],256],126577:[[1589],256],126578:[[1602],256],126580:[[1588],256],126581:[[1578],256],126582:[[1579],256],126583:[[1582],256],126585:[[1590],256],126586:[[1592],256],126587:[[1594],256],126588:[[1646],256],126590:[[1697],256],126592:[[1575],256],126593:[[1576],256],126594:[[1580],256],126595:[[1583],256],126596:[[1607],256],126597:[[1608],256],126598:[[1586],256],126599:[[1581],256],126600:[[1591],256],126601:[[1610],256],126603:[[1604],256],126604:[[1605],256],126605:[[1606],256],126606:[[1587],256],126607:[[1593],256],126608:[[1601],256],126609:[[1589],256],126610:[[1602],256],126611:[[1585],256],126612:[[1588],256],126613:[[1578],256],126614:[[1579],256],126615:[[1582],256],126616:[[1584],256],126617:[[1590],256],126618:[[1592],256],126619:[[1594],256],126625:[[1576],256],126626:[[1580],256],126627:[[1583],256],126629:[[1608],256],126630:[[1586],256],126631:[[1581],256],126632:[[1591],256],126633:[[1610],256],126635:[[1604],256],126636:[[1605],256],126637:[[1606],256],126638:[[1587],256],126639:[[1593],256],126640:[[1601],256],126641:[[1589],256],126642:[[1602],256],126643:[[1585],256],126644:[[1588],256],126645:[[1578],256],126646:[[1579],256],126647:[[1582],256],126648:[[1584],256],126649:[[1590],256],126650:[[1592],256],126651:[[1594],256]}, + 61696:{127232:[[48,46],256],127233:[[48,44],256],127234:[[49,44],256],127235:[[50,44],256],127236:[[51,44],256],127237:[[52,44],256],127238:[[53,44],256],127239:[[54,44],256],127240:[[55,44],256],127241:[[56,44],256],127242:[[57,44],256],127248:[[40,65,41],256],127249:[[40,66,41],256],127250:[[40,67,41],256],127251:[[40,68,41],256],127252:[[40,69,41],256],127253:[[40,70,41],256],127254:[[40,71,41],256],127255:[[40,72,41],256],127256:[[40,73,41],256],127257:[[40,74,41],256],127258:[[40,75,41],256],127259:[[40,76,41],256],127260:[[40,77,41],256],127261:[[40,78,41],256],127262:[[40,79,41],256],127263:[[40,80,41],256],127264:[[40,81,41],256],127265:[[40,82,41],256],127266:[[40,83,41],256],127267:[[40,84,41],256],127268:[[40,85,41],256],127269:[[40,86,41],256],127270:[[40,87,41],256],127271:[[40,88,41],256],127272:[[40,89,41],256],127273:[[40,90,41],256],127274:[[12308,83,12309],256],127275:[[67],256],127276:[[82],256],127277:[[67,68],256],127278:[[87,90],256],127280:[[65],256],127281:[[66],256],127282:[[67],256],127283:[[68],256],127284:[[69],256],127285:[[70],256],127286:[[71],256],127287:[[72],256],127288:[[73],256],127289:[[74],256],127290:[[75],256],127291:[[76],256],127292:[[77],256],127293:[[78],256],127294:[[79],256],127295:[[80],256],127296:[[81],256],127297:[[82],256],127298:[[83],256],127299:[[84],256],127300:[[85],256],127301:[[86],256],127302:[[87],256],127303:[[88],256],127304:[[89],256],127305:[[90],256],127306:[[72,86],256],127307:[[77,86],256],127308:[[83,68],256],127309:[[83,83],256],127310:[[80,80,86],256],127311:[[87,67],256],127338:[[77,67],256],127339:[[77,68],256],127376:[[68,74],256]}, + 61952:{127488:[[12411,12363],256],127489:[[12467,12467],256],127490:[[12469],256],127504:[[25163],256],127505:[[23383],256],127506:[[21452],256],127507:[[12487],256],127508:[[20108],256],127509:[[22810],256],127510:[[35299],256],127511:[[22825],256],127512:[[20132],256],127513:[[26144],256],127514:[[28961],256],127515:[[26009],256],127516:[[21069],256],127517:[[24460],256],127518:[[20877],256],127519:[[26032],256],127520:[[21021],256],127521:[[32066],256],127522:[[29983],256],127523:[[36009],256],127524:[[22768],256],127525:[[21561],256],127526:[[28436],256],127527:[[25237],256],127528:[[25429],256],127529:[[19968],256],127530:[[19977],256],127531:[[36938],256],127532:[[24038],256],127533:[[20013],256],127534:[[21491],256],127535:[[25351],256],127536:[[36208],256],127537:[[25171],256],127538:[[31105],256],127539:[[31354],256],127540:[[21512],256],127541:[[28288],256],127542:[[26377],256],127543:[[26376],256],127544:[[30003],256],127545:[[21106],256],127546:[[21942],256],127552:[[12308,26412,12309],256],127553:[[12308,19977,12309],256],127554:[[12308,20108,12309],256],127555:[[12308,23433,12309],256],127556:[[12308,28857,12309],256],127557:[[12308,25171,12309],256],127558:[[12308,30423,12309],256],127559:[[12308,21213,12309],256],127560:[[12308,25943,12309],256],127568:[[24471],256],127569:[[21487],256]}, + 63488:{194560:[[20029]],194561:[[20024]],194562:[[20033]],194563:[[131362]],194564:[[20320]],194565:[[20398]],194566:[[20411]],194567:[[20482]],194568:[[20602]],194569:[[20633]],194570:[[20711]],194571:[[20687]],194572:[[13470]],194573:[[132666]],194574:[[20813]],194575:[[20820]],194576:[[20836]],194577:[[20855]],194578:[[132380]],194579:[[13497]],194580:[[20839]],194581:[[20877]],194582:[[132427]],194583:[[20887]],194584:[[20900]],194585:[[20172]],194586:[[20908]],194587:[[20917]],194588:[[168415]],194589:[[20981]],194590:[[20995]],194591:[[13535]],194592:[[21051]],194593:[[21062]],194594:[[21106]],194595:[[21111]],194596:[[13589]],194597:[[21191]],194598:[[21193]],194599:[[21220]],194600:[[21242]],194601:[[21253]],194602:[[21254]],194603:[[21271]],194604:[[21321]],194605:[[21329]],194606:[[21338]],194607:[[21363]],194608:[[21373]],194609:[[21375]],194610:[[21375]],194611:[[21375]],194612:[[133676]],194613:[[28784]],194614:[[21450]],194615:[[21471]],194616:[[133987]],194617:[[21483]],194618:[[21489]],194619:[[21510]],194620:[[21662]],194621:[[21560]],194622:[[21576]],194623:[[21608]],194624:[[21666]],194625:[[21750]],194626:[[21776]],194627:[[21843]],194628:[[21859]],194629:[[21892]],194630:[[21892]],194631:[[21913]],194632:[[21931]],194633:[[21939]],194634:[[21954]],194635:[[22294]],194636:[[22022]],194637:[[22295]],194638:[[22097]],194639:[[22132]],194640:[[20999]],194641:[[22766]],194642:[[22478]],194643:[[22516]],194644:[[22541]],194645:[[22411]],194646:[[22578]],194647:[[22577]],194648:[[22700]],194649:[[136420]],194650:[[22770]],194651:[[22775]],194652:[[22790]],194653:[[22810]],194654:[[22818]],194655:[[22882]],194656:[[136872]],194657:[[136938]],194658:[[23020]],194659:[[23067]],194660:[[23079]],194661:[[23000]],194662:[[23142]],194663:[[14062]],194664:[[14076]],194665:[[23304]],194666:[[23358]],194667:[[23358]],194668:[[137672]],194669:[[23491]],194670:[[23512]],194671:[[23527]],194672:[[23539]],194673:[[138008]],194674:[[23551]],194675:[[23558]],194676:[[24403]],194677:[[23586]],194678:[[14209]],194679:[[23648]],194680:[[23662]],194681:[[23744]],194682:[[23693]],194683:[[138724]],194684:[[23875]],194685:[[138726]],194686:[[23918]],194687:[[23915]],194688:[[23932]],194689:[[24033]],194690:[[24034]],194691:[[14383]],194692:[[24061]],194693:[[24104]],194694:[[24125]],194695:[[24169]],194696:[[14434]],194697:[[139651]],194698:[[14460]],194699:[[24240]],194700:[[24243]],194701:[[24246]],194702:[[24266]],194703:[[172946]],194704:[[24318]],194705:[[140081]],194706:[[140081]],194707:[[33281]],194708:[[24354]],194709:[[24354]],194710:[[14535]],194711:[[144056]],194712:[[156122]],194713:[[24418]],194714:[[24427]],194715:[[14563]],194716:[[24474]],194717:[[24525]],194718:[[24535]],194719:[[24569]],194720:[[24705]],194721:[[14650]],194722:[[14620]],194723:[[24724]],194724:[[141012]],194725:[[24775]],194726:[[24904]],194727:[[24908]],194728:[[24910]],194729:[[24908]],194730:[[24954]],194731:[[24974]],194732:[[25010]],194733:[[24996]],194734:[[25007]],194735:[[25054]],194736:[[25074]],194737:[[25078]],194738:[[25104]],194739:[[25115]],194740:[[25181]],194741:[[25265]],194742:[[25300]],194743:[[25424]],194744:[[142092]],194745:[[25405]],194746:[[25340]],194747:[[25448]],194748:[[25475]],194749:[[25572]],194750:[[142321]],194751:[[25634]],194752:[[25541]],194753:[[25513]],194754:[[14894]],194755:[[25705]],194756:[[25726]],194757:[[25757]],194758:[[25719]],194759:[[14956]],194760:[[25935]],194761:[[25964]],194762:[[143370]],194763:[[26083]],194764:[[26360]],194765:[[26185]],194766:[[15129]],194767:[[26257]],194768:[[15112]],194769:[[15076]],194770:[[20882]],194771:[[20885]],194772:[[26368]],194773:[[26268]],194774:[[32941]],194775:[[17369]],194776:[[26391]],194777:[[26395]],194778:[[26401]],194779:[[26462]],194780:[[26451]],194781:[[144323]],194782:[[15177]],194783:[[26618]],194784:[[26501]],194785:[[26706]],194786:[[26757]],194787:[[144493]],194788:[[26766]],194789:[[26655]],194790:[[26900]],194791:[[15261]],194792:[[26946]],194793:[[27043]],194794:[[27114]],194795:[[27304]],194796:[[145059]],194797:[[27355]],194798:[[15384]],194799:[[27425]],194800:[[145575]],194801:[[27476]],194802:[[15438]],194803:[[27506]],194804:[[27551]],194805:[[27578]],194806:[[27579]],194807:[[146061]],194808:[[138507]],194809:[[146170]],194810:[[27726]],194811:[[146620]],194812:[[27839]],194813:[[27853]],194814:[[27751]],194815:[[27926]]}, + 63744:{63744:[[35912]],63745:[[26356]],63746:[[36554]],63747:[[36040]],63748:[[28369]],63749:[[20018]],63750:[[21477]],63751:[[40860]],63752:[[40860]],63753:[[22865]],63754:[[37329]],63755:[[21895]],63756:[[22856]],63757:[[25078]],63758:[[30313]],63759:[[32645]],63760:[[34367]],63761:[[34746]],63762:[[35064]],63763:[[37007]],63764:[[27138]],63765:[[27931]],63766:[[28889]],63767:[[29662]],63768:[[33853]],63769:[[37226]],63770:[[39409]],63771:[[20098]],63772:[[21365]],63773:[[27396]],63774:[[29211]],63775:[[34349]],63776:[[40478]],63777:[[23888]],63778:[[28651]],63779:[[34253]],63780:[[35172]],63781:[[25289]],63782:[[33240]],63783:[[34847]],63784:[[24266]],63785:[[26391]],63786:[[28010]],63787:[[29436]],63788:[[37070]],63789:[[20358]],63790:[[20919]],63791:[[21214]],63792:[[25796]],63793:[[27347]],63794:[[29200]],63795:[[30439]],63796:[[32769]],63797:[[34310]],63798:[[34396]],63799:[[36335]],63800:[[38706]],63801:[[39791]],63802:[[40442]],63803:[[30860]],63804:[[31103]],63805:[[32160]],63806:[[33737]],63807:[[37636]],63808:[[40575]],63809:[[35542]],63810:[[22751]],63811:[[24324]],63812:[[31840]],63813:[[32894]],63814:[[29282]],63815:[[30922]],63816:[[36034]],63817:[[38647]],63818:[[22744]],63819:[[23650]],63820:[[27155]],63821:[[28122]],63822:[[28431]],63823:[[32047]],63824:[[32311]],63825:[[38475]],63826:[[21202]],63827:[[32907]],63828:[[20956]],63829:[[20940]],63830:[[31260]],63831:[[32190]],63832:[[33777]],63833:[[38517]],63834:[[35712]],63835:[[25295]],63836:[[27138]],63837:[[35582]],63838:[[20025]],63839:[[23527]],63840:[[24594]],63841:[[29575]],63842:[[30064]],63843:[[21271]],63844:[[30971]],63845:[[20415]],63846:[[24489]],63847:[[19981]],63848:[[27852]],63849:[[25976]],63850:[[32034]],63851:[[21443]],63852:[[22622]],63853:[[30465]],63854:[[33865]],63855:[[35498]],63856:[[27578]],63857:[[36784]],63858:[[27784]],63859:[[25342]],63860:[[33509]],63861:[[25504]],63862:[[30053]],63863:[[20142]],63864:[[20841]],63865:[[20937]],63866:[[26753]],63867:[[31975]],63868:[[33391]],63869:[[35538]],63870:[[37327]],63871:[[21237]],63872:[[21570]],63873:[[22899]],63874:[[24300]],63875:[[26053]],63876:[[28670]],63877:[[31018]],63878:[[38317]],63879:[[39530]],63880:[[40599]],63881:[[40654]],63882:[[21147]],63883:[[26310]],63884:[[27511]],63885:[[36706]],63886:[[24180]],63887:[[24976]],63888:[[25088]],63889:[[25754]],63890:[[28451]],63891:[[29001]],63892:[[29833]],63893:[[31178]],63894:[[32244]],63895:[[32879]],63896:[[36646]],63897:[[34030]],63898:[[36899]],63899:[[37706]],63900:[[21015]],63901:[[21155]],63902:[[21693]],63903:[[28872]],63904:[[35010]],63905:[[35498]],63906:[[24265]],63907:[[24565]],63908:[[25467]],63909:[[27566]],63910:[[31806]],63911:[[29557]],63912:[[20196]],63913:[[22265]],63914:[[23527]],63915:[[23994]],63916:[[24604]],63917:[[29618]],63918:[[29801]],63919:[[32666]],63920:[[32838]],63921:[[37428]],63922:[[38646]],63923:[[38728]],63924:[[38936]],63925:[[20363]],63926:[[31150]],63927:[[37300]],63928:[[38584]],63929:[[24801]],63930:[[20102]],63931:[[20698]],63932:[[23534]],63933:[[23615]],63934:[[26009]],63935:[[27138]],63936:[[29134]],63937:[[30274]],63938:[[34044]],63939:[[36988]],63940:[[40845]],63941:[[26248]],63942:[[38446]],63943:[[21129]],63944:[[26491]],63945:[[26611]],63946:[[27969]],63947:[[28316]],63948:[[29705]],63949:[[30041]],63950:[[30827]],63951:[[32016]],63952:[[39006]],63953:[[20845]],63954:[[25134]],63955:[[38520]],63956:[[20523]],63957:[[23833]],63958:[[28138]],63959:[[36650]],63960:[[24459]],63961:[[24900]],63962:[[26647]],63963:[[29575]],63964:[[38534]],63965:[[21033]],63966:[[21519]],63967:[[23653]],63968:[[26131]],63969:[[26446]],63970:[[26792]],63971:[[27877]],63972:[[29702]],63973:[[30178]],63974:[[32633]],63975:[[35023]],63976:[[35041]],63977:[[37324]],63978:[[38626]],63979:[[21311]],63980:[[28346]],63981:[[21533]],63982:[[29136]],63983:[[29848]],63984:[[34298]],63985:[[38563]],63986:[[40023]],63987:[[40607]],63988:[[26519]],63989:[[28107]],63990:[[33256]],63991:[[31435]],63992:[[31520]],63993:[[31890]],63994:[[29376]],63995:[[28825]],63996:[[35672]],63997:[[20160]],63998:[[33590]],63999:[[21050]],194816:[[27966]],194817:[[28023]],194818:[[27969]],194819:[[28009]],194820:[[28024]],194821:[[28037]],194822:[[146718]],194823:[[27956]],194824:[[28207]],194825:[[28270]],194826:[[15667]],194827:[[28363]],194828:[[28359]],194829:[[147153]],194830:[[28153]],194831:[[28526]],194832:[[147294]],194833:[[147342]],194834:[[28614]],194835:[[28729]],194836:[[28702]],194837:[[28699]],194838:[[15766]],194839:[[28746]],194840:[[28797]],194841:[[28791]],194842:[[28845]],194843:[[132389]],194844:[[28997]],194845:[[148067]],194846:[[29084]],194847:[[148395]],194848:[[29224]],194849:[[29237]],194850:[[29264]],194851:[[149000]],194852:[[29312]],194853:[[29333]],194854:[[149301]],194855:[[149524]],194856:[[29562]],194857:[[29579]],194858:[[16044]],194859:[[29605]],194860:[[16056]],194861:[[16056]],194862:[[29767]],194863:[[29788]],194864:[[29809]],194865:[[29829]],194866:[[29898]],194867:[[16155]],194868:[[29988]],194869:[[150582]],194870:[[30014]],194871:[[150674]],194872:[[30064]],194873:[[139679]],194874:[[30224]],194875:[[151457]],194876:[[151480]],194877:[[151620]],194878:[[16380]],194879:[[16392]],194880:[[30452]],194881:[[151795]],194882:[[151794]],194883:[[151833]],194884:[[151859]],194885:[[30494]],194886:[[30495]],194887:[[30495]],194888:[[30538]],194889:[[16441]],194890:[[30603]],194891:[[16454]],194892:[[16534]],194893:[[152605]],194894:[[30798]],194895:[[30860]],194896:[[30924]],194897:[[16611]],194898:[[153126]],194899:[[31062]],194900:[[153242]],194901:[[153285]],194902:[[31119]],194903:[[31211]],194904:[[16687]],194905:[[31296]],194906:[[31306]],194907:[[31311]],194908:[[153980]],194909:[[154279]],194910:[[154279]],194911:[[31470]],194912:[[16898]],194913:[[154539]],194914:[[31686]],194915:[[31689]],194916:[[16935]],194917:[[154752]],194918:[[31954]],194919:[[17056]],194920:[[31976]],194921:[[31971]],194922:[[32000]],194923:[[155526]],194924:[[32099]],194925:[[17153]],194926:[[32199]],194927:[[32258]],194928:[[32325]],194929:[[17204]],194930:[[156200]],194931:[[156231]],194932:[[17241]],194933:[[156377]],194934:[[32634]],194935:[[156478]],194936:[[32661]],194937:[[32762]],194938:[[32773]],194939:[[156890]],194940:[[156963]],194941:[[32864]],194942:[[157096]],194943:[[32880]],194944:[[144223]],194945:[[17365]],194946:[[32946]],194947:[[33027]],194948:[[17419]],194949:[[33086]],194950:[[23221]],194951:[[157607]],194952:[[157621]],194953:[[144275]],194954:[[144284]],194955:[[33281]],194956:[[33284]],194957:[[36766]],194958:[[17515]],194959:[[33425]],194960:[[33419]],194961:[[33437]],194962:[[21171]],194963:[[33457]],194964:[[33459]],194965:[[33469]],194966:[[33510]],194967:[[158524]],194968:[[33509]],194969:[[33565]],194970:[[33635]],194971:[[33709]],194972:[[33571]],194973:[[33725]],194974:[[33767]],194975:[[33879]],194976:[[33619]],194977:[[33738]],194978:[[33740]],194979:[[33756]],194980:[[158774]],194981:[[159083]],194982:[[158933]],194983:[[17707]],194984:[[34033]],194985:[[34035]],194986:[[34070]],194987:[[160714]],194988:[[34148]],194989:[[159532]],194990:[[17757]],194991:[[17761]],194992:[[159665]],194993:[[159954]],194994:[[17771]],194995:[[34384]],194996:[[34396]],194997:[[34407]],194998:[[34409]],194999:[[34473]],195000:[[34440]],195001:[[34574]],195002:[[34530]],195003:[[34681]],195004:[[34600]],195005:[[34667]],195006:[[34694]],195007:[[17879]],195008:[[34785]],195009:[[34817]],195010:[[17913]],195011:[[34912]],195012:[[34915]],195013:[[161383]],195014:[[35031]],195015:[[35038]],195016:[[17973]],195017:[[35066]],195018:[[13499]],195019:[[161966]],195020:[[162150]],195021:[[18110]],195022:[[18119]],195023:[[35488]],195024:[[35565]],195025:[[35722]],195026:[[35925]],195027:[[162984]],195028:[[36011]],195029:[[36033]],195030:[[36123]],195031:[[36215]],195032:[[163631]],195033:[[133124]],195034:[[36299]],195035:[[36284]],195036:[[36336]],195037:[[133342]],195038:[[36564]],195039:[[36664]],195040:[[165330]],195041:[[165357]],195042:[[37012]],195043:[[37105]],195044:[[37137]],195045:[[165678]],195046:[[37147]],195047:[[37432]],195048:[[37591]],195049:[[37592]],195050:[[37500]],195051:[[37881]],195052:[[37909]],195053:[[166906]],195054:[[38283]],195055:[[18837]],195056:[[38327]],195057:[[167287]],195058:[[18918]],195059:[[38595]],195060:[[23986]],195061:[[38691]],195062:[[168261]],195063:[[168474]],195064:[[19054]],195065:[[19062]],195066:[[38880]],195067:[[168970]],195068:[[19122]],195069:[[169110]],195070:[[38923]],195071:[[38923]]}, + 64000:{64000:[[20999]],64001:[[24230]],64002:[[25299]],64003:[[31958]],64004:[[23429]],64005:[[27934]],64006:[[26292]],64007:[[36667]],64008:[[34892]],64009:[[38477]],64010:[[35211]],64011:[[24275]],64012:[[20800]],64013:[[21952]],64016:[[22618]],64018:[[26228]],64021:[[20958]],64022:[[29482]],64023:[[30410]],64024:[[31036]],64025:[[31070]],64026:[[31077]],64027:[[31119]],64028:[[38742]],64029:[[31934]],64030:[[32701]],64032:[[34322]],64034:[[35576]],64037:[[36920]],64038:[[37117]],64042:[[39151]],64043:[[39164]],64044:[[39208]],64045:[[40372]],64046:[[37086]],64047:[[38583]],64048:[[20398]],64049:[[20711]],64050:[[20813]],64051:[[21193]],64052:[[21220]],64053:[[21329]],64054:[[21917]],64055:[[22022]],64056:[[22120]],64057:[[22592]],64058:[[22696]],64059:[[23652]],64060:[[23662]],64061:[[24724]],64062:[[24936]],64063:[[24974]],64064:[[25074]],64065:[[25935]],64066:[[26082]],64067:[[26257]],64068:[[26757]],64069:[[28023]],64070:[[28186]],64071:[[28450]],64072:[[29038]],64073:[[29227]],64074:[[29730]],64075:[[30865]],64076:[[31038]],64077:[[31049]],64078:[[31048]],64079:[[31056]],64080:[[31062]],64081:[[31069]],64082:[[31117]],64083:[[31118]],64084:[[31296]],64085:[[31361]],64086:[[31680]],64087:[[32244]],64088:[[32265]],64089:[[32321]],64090:[[32626]],64091:[[32773]],64092:[[33261]],64093:[[33401]],64094:[[33401]],64095:[[33879]],64096:[[35088]],64097:[[35222]],64098:[[35585]],64099:[[35641]],64100:[[36051]],64101:[[36104]],64102:[[36790]],64103:[[36920]],64104:[[38627]],64105:[[38911]],64106:[[38971]],64107:[[24693]],64108:[[148206]],64109:[[33304]],64112:[[20006]],64113:[[20917]],64114:[[20840]],64115:[[20352]],64116:[[20805]],64117:[[20864]],64118:[[21191]],64119:[[21242]],64120:[[21917]],64121:[[21845]],64122:[[21913]],64123:[[21986]],64124:[[22618]],64125:[[22707]],64126:[[22852]],64127:[[22868]],64128:[[23138]],64129:[[23336]],64130:[[24274]],64131:[[24281]],64132:[[24425]],64133:[[24493]],64134:[[24792]],64135:[[24910]],64136:[[24840]],64137:[[24974]],64138:[[24928]],64139:[[25074]],64140:[[25140]],64141:[[25540]],64142:[[25628]],64143:[[25682]],64144:[[25942]],64145:[[26228]],64146:[[26391]],64147:[[26395]],64148:[[26454]],64149:[[27513]],64150:[[27578]],64151:[[27969]],64152:[[28379]],64153:[[28363]],64154:[[28450]],64155:[[28702]],64156:[[29038]],64157:[[30631]],64158:[[29237]],64159:[[29359]],64160:[[29482]],64161:[[29809]],64162:[[29958]],64163:[[30011]],64164:[[30237]],64165:[[30239]],64166:[[30410]],64167:[[30427]],64168:[[30452]],64169:[[30538]],64170:[[30528]],64171:[[30924]],64172:[[31409]],64173:[[31680]],64174:[[31867]],64175:[[32091]],64176:[[32244]],64177:[[32574]],64178:[[32773]],64179:[[33618]],64180:[[33775]],64181:[[34681]],64182:[[35137]],64183:[[35206]],64184:[[35222]],64185:[[35519]],64186:[[35576]],64187:[[35531]],64188:[[35585]],64189:[[35582]],64190:[[35565]],64191:[[35641]],64192:[[35722]],64193:[[36104]],64194:[[36664]],64195:[[36978]],64196:[[37273]],64197:[[37494]],64198:[[38524]],64199:[[38627]],64200:[[38742]],64201:[[38875]],64202:[[38911]],64203:[[38923]],64204:[[38971]],64205:[[39698]],64206:[[40860]],64207:[[141386]],64208:[[141380]],64209:[[144341]],64210:[[15261]],64211:[[16408]],64212:[[16441]],64213:[[152137]],64214:[[154832]],64215:[[163539]],64216:[[40771]],64217:[[40846]],195072:[[38953]],195073:[[169398]],195074:[[39138]],195075:[[19251]],195076:[[39209]],195077:[[39335]],195078:[[39362]],195079:[[39422]],195080:[[19406]],195081:[[170800]],195082:[[39698]],195083:[[40000]],195084:[[40189]],195085:[[19662]],195086:[[19693]],195087:[[40295]],195088:[[172238]],195089:[[19704]],195090:[[172293]],195091:[[172558]],195092:[[172689]],195093:[[40635]],195094:[[19798]],195095:[[40697]],195096:[[40702]],195097:[[40709]],195098:[[40719]],195099:[[40726]],195100:[[40763]],195101:[[173568]]}, + 64256:{64256:[[102,102],256],64257:[[102,105],256],64258:[[102,108],256],64259:[[102,102,105],256],64260:[[102,102,108],256],64261:[[383,116],256],64262:[[115,116],256],64275:[[1396,1398],256],64276:[[1396,1381],256],64277:[[1396,1387],256],64278:[[1406,1398],256],64279:[[1396,1389],256],64285:[[1497,1460],512],64286:[,26],64287:[[1522,1463],512],64288:[[1506],256],64289:[[1488],256],64290:[[1491],256],64291:[[1492],256],64292:[[1499],256],64293:[[1500],256],64294:[[1501],256],64295:[[1512],256],64296:[[1514],256],64297:[[43],256],64298:[[1513,1473],512],64299:[[1513,1474],512],64300:[[64329,1473],512],64301:[[64329,1474],512],64302:[[1488,1463],512],64303:[[1488,1464],512],64304:[[1488,1468],512],64305:[[1489,1468],512],64306:[[1490,1468],512],64307:[[1491,1468],512],64308:[[1492,1468],512],64309:[[1493,1468],512],64310:[[1494,1468],512],64312:[[1496,1468],512],64313:[[1497,1468],512],64314:[[1498,1468],512],64315:[[1499,1468],512],64316:[[1500,1468],512],64318:[[1502,1468],512],64320:[[1504,1468],512],64321:[[1505,1468],512],64323:[[1507,1468],512],64324:[[1508,1468],512],64326:[[1510,1468],512],64327:[[1511,1468],512],64328:[[1512,1468],512],64329:[[1513,1468],512],64330:[[1514,1468],512],64331:[[1493,1465],512],64332:[[1489,1471],512],64333:[[1499,1471],512],64334:[[1508,1471],512],64335:[[1488,1500],256],64336:[[1649],256],64337:[[1649],256],64338:[[1659],256],64339:[[1659],256],64340:[[1659],256],64341:[[1659],256],64342:[[1662],256],64343:[[1662],256],64344:[[1662],256],64345:[[1662],256],64346:[[1664],256],64347:[[1664],256],64348:[[1664],256],64349:[[1664],256],64350:[[1658],256],64351:[[1658],256],64352:[[1658],256],64353:[[1658],256],64354:[[1663],256],64355:[[1663],256],64356:[[1663],256],64357:[[1663],256],64358:[[1657],256],64359:[[1657],256],64360:[[1657],256],64361:[[1657],256],64362:[[1700],256],64363:[[1700],256],64364:[[1700],256],64365:[[1700],256],64366:[[1702],256],64367:[[1702],256],64368:[[1702],256],64369:[[1702],256],64370:[[1668],256],64371:[[1668],256],64372:[[1668],256],64373:[[1668],256],64374:[[1667],256],64375:[[1667],256],64376:[[1667],256],64377:[[1667],256],64378:[[1670],256],64379:[[1670],256],64380:[[1670],256],64381:[[1670],256],64382:[[1671],256],64383:[[1671],256],64384:[[1671],256],64385:[[1671],256],64386:[[1677],256],64387:[[1677],256],64388:[[1676],256],64389:[[1676],256],64390:[[1678],256],64391:[[1678],256],64392:[[1672],256],64393:[[1672],256],64394:[[1688],256],64395:[[1688],256],64396:[[1681],256],64397:[[1681],256],64398:[[1705],256],64399:[[1705],256],64400:[[1705],256],64401:[[1705],256],64402:[[1711],256],64403:[[1711],256],64404:[[1711],256],64405:[[1711],256],64406:[[1715],256],64407:[[1715],256],64408:[[1715],256],64409:[[1715],256],64410:[[1713],256],64411:[[1713],256],64412:[[1713],256],64413:[[1713],256],64414:[[1722],256],64415:[[1722],256],64416:[[1723],256],64417:[[1723],256],64418:[[1723],256],64419:[[1723],256],64420:[[1728],256],64421:[[1728],256],64422:[[1729],256],64423:[[1729],256],64424:[[1729],256],64425:[[1729],256],64426:[[1726],256],64427:[[1726],256],64428:[[1726],256],64429:[[1726],256],64430:[[1746],256],64431:[[1746],256],64432:[[1747],256],64433:[[1747],256],64467:[[1709],256],64468:[[1709],256],64469:[[1709],256],64470:[[1709],256],64471:[[1735],256],64472:[[1735],256],64473:[[1734],256],64474:[[1734],256],64475:[[1736],256],64476:[[1736],256],64477:[[1655],256],64478:[[1739],256],64479:[[1739],256],64480:[[1733],256],64481:[[1733],256],64482:[[1737],256],64483:[[1737],256],64484:[[1744],256],64485:[[1744],256],64486:[[1744],256],64487:[[1744],256],64488:[[1609],256],64489:[[1609],256],64490:[[1574,1575],256],64491:[[1574,1575],256],64492:[[1574,1749],256],64493:[[1574,1749],256],64494:[[1574,1608],256],64495:[[1574,1608],256],64496:[[1574,1735],256],64497:[[1574,1735],256],64498:[[1574,1734],256],64499:[[1574,1734],256],64500:[[1574,1736],256],64501:[[1574,1736],256],64502:[[1574,1744],256],64503:[[1574,1744],256],64504:[[1574,1744],256],64505:[[1574,1609],256],64506:[[1574,1609],256],64507:[[1574,1609],256],64508:[[1740],256],64509:[[1740],256],64510:[[1740],256],64511:[[1740],256]}, + 64512:{64512:[[1574,1580],256],64513:[[1574,1581],256],64514:[[1574,1605],256],64515:[[1574,1609],256],64516:[[1574,1610],256],64517:[[1576,1580],256],64518:[[1576,1581],256],64519:[[1576,1582],256],64520:[[1576,1605],256],64521:[[1576,1609],256],64522:[[1576,1610],256],64523:[[1578,1580],256],64524:[[1578,1581],256],64525:[[1578,1582],256],64526:[[1578,1605],256],64527:[[1578,1609],256],64528:[[1578,1610],256],64529:[[1579,1580],256],64530:[[1579,1605],256],64531:[[1579,1609],256],64532:[[1579,1610],256],64533:[[1580,1581],256],64534:[[1580,1605],256],64535:[[1581,1580],256],64536:[[1581,1605],256],64537:[[1582,1580],256],64538:[[1582,1581],256],64539:[[1582,1605],256],64540:[[1587,1580],256],64541:[[1587,1581],256],64542:[[1587,1582],256],64543:[[1587,1605],256],64544:[[1589,1581],256],64545:[[1589,1605],256],64546:[[1590,1580],256],64547:[[1590,1581],256],64548:[[1590,1582],256],64549:[[1590,1605],256],64550:[[1591,1581],256],64551:[[1591,1605],256],64552:[[1592,1605],256],64553:[[1593,1580],256],64554:[[1593,1605],256],64555:[[1594,1580],256],64556:[[1594,1605],256],64557:[[1601,1580],256],64558:[[1601,1581],256],64559:[[1601,1582],256],64560:[[1601,1605],256],64561:[[1601,1609],256],64562:[[1601,1610],256],64563:[[1602,1581],256],64564:[[1602,1605],256],64565:[[1602,1609],256],64566:[[1602,1610],256],64567:[[1603,1575],256],64568:[[1603,1580],256],64569:[[1603,1581],256],64570:[[1603,1582],256],64571:[[1603,1604],256],64572:[[1603,1605],256],64573:[[1603,1609],256],64574:[[1603,1610],256],64575:[[1604,1580],256],64576:[[1604,1581],256],64577:[[1604,1582],256],64578:[[1604,1605],256],64579:[[1604,1609],256],64580:[[1604,1610],256],64581:[[1605,1580],256],64582:[[1605,1581],256],64583:[[1605,1582],256],64584:[[1605,1605],256],64585:[[1605,1609],256],64586:[[1605,1610],256],64587:[[1606,1580],256],64588:[[1606,1581],256],64589:[[1606,1582],256],64590:[[1606,1605],256],64591:[[1606,1609],256],64592:[[1606,1610],256],64593:[[1607,1580],256],64594:[[1607,1605],256],64595:[[1607,1609],256],64596:[[1607,1610],256],64597:[[1610,1580],256],64598:[[1610,1581],256],64599:[[1610,1582],256],64600:[[1610,1605],256],64601:[[1610,1609],256],64602:[[1610,1610],256],64603:[[1584,1648],256],64604:[[1585,1648],256],64605:[[1609,1648],256],64606:[[32,1612,1617],256],64607:[[32,1613,1617],256],64608:[[32,1614,1617],256],64609:[[32,1615,1617],256],64610:[[32,1616,1617],256],64611:[[32,1617,1648],256],64612:[[1574,1585],256],64613:[[1574,1586],256],64614:[[1574,1605],256],64615:[[1574,1606],256],64616:[[1574,1609],256],64617:[[1574,1610],256],64618:[[1576,1585],256],64619:[[1576,1586],256],64620:[[1576,1605],256],64621:[[1576,1606],256],64622:[[1576,1609],256],64623:[[1576,1610],256],64624:[[1578,1585],256],64625:[[1578,1586],256],64626:[[1578,1605],256],64627:[[1578,1606],256],64628:[[1578,1609],256],64629:[[1578,1610],256],64630:[[1579,1585],256],64631:[[1579,1586],256],64632:[[1579,1605],256],64633:[[1579,1606],256],64634:[[1579,1609],256],64635:[[1579,1610],256],64636:[[1601,1609],256],64637:[[1601,1610],256],64638:[[1602,1609],256],64639:[[1602,1610],256],64640:[[1603,1575],256],64641:[[1603,1604],256],64642:[[1603,1605],256],64643:[[1603,1609],256],64644:[[1603,1610],256],64645:[[1604,1605],256],64646:[[1604,1609],256],64647:[[1604,1610],256],64648:[[1605,1575],256],64649:[[1605,1605],256],64650:[[1606,1585],256],64651:[[1606,1586],256],64652:[[1606,1605],256],64653:[[1606,1606],256],64654:[[1606,1609],256],64655:[[1606,1610],256],64656:[[1609,1648],256],64657:[[1610,1585],256],64658:[[1610,1586],256],64659:[[1610,1605],256],64660:[[1610,1606],256],64661:[[1610,1609],256],64662:[[1610,1610],256],64663:[[1574,1580],256],64664:[[1574,1581],256],64665:[[1574,1582],256],64666:[[1574,1605],256],64667:[[1574,1607],256],64668:[[1576,1580],256],64669:[[1576,1581],256],64670:[[1576,1582],256],64671:[[1576,1605],256],64672:[[1576,1607],256],64673:[[1578,1580],256],64674:[[1578,1581],256],64675:[[1578,1582],256],64676:[[1578,1605],256],64677:[[1578,1607],256],64678:[[1579,1605],256],64679:[[1580,1581],256],64680:[[1580,1605],256],64681:[[1581,1580],256],64682:[[1581,1605],256],64683:[[1582,1580],256],64684:[[1582,1605],256],64685:[[1587,1580],256],64686:[[1587,1581],256],64687:[[1587,1582],256],64688:[[1587,1605],256],64689:[[1589,1581],256],64690:[[1589,1582],256],64691:[[1589,1605],256],64692:[[1590,1580],256],64693:[[1590,1581],256],64694:[[1590,1582],256],64695:[[1590,1605],256],64696:[[1591,1581],256],64697:[[1592,1605],256],64698:[[1593,1580],256],64699:[[1593,1605],256],64700:[[1594,1580],256],64701:[[1594,1605],256],64702:[[1601,1580],256],64703:[[1601,1581],256],64704:[[1601,1582],256],64705:[[1601,1605],256],64706:[[1602,1581],256],64707:[[1602,1605],256],64708:[[1603,1580],256],64709:[[1603,1581],256],64710:[[1603,1582],256],64711:[[1603,1604],256],64712:[[1603,1605],256],64713:[[1604,1580],256],64714:[[1604,1581],256],64715:[[1604,1582],256],64716:[[1604,1605],256],64717:[[1604,1607],256],64718:[[1605,1580],256],64719:[[1605,1581],256],64720:[[1605,1582],256],64721:[[1605,1605],256],64722:[[1606,1580],256],64723:[[1606,1581],256],64724:[[1606,1582],256],64725:[[1606,1605],256],64726:[[1606,1607],256],64727:[[1607,1580],256],64728:[[1607,1605],256],64729:[[1607,1648],256],64730:[[1610,1580],256],64731:[[1610,1581],256],64732:[[1610,1582],256],64733:[[1610,1605],256],64734:[[1610,1607],256],64735:[[1574,1605],256],64736:[[1574,1607],256],64737:[[1576,1605],256],64738:[[1576,1607],256],64739:[[1578,1605],256],64740:[[1578,1607],256],64741:[[1579,1605],256],64742:[[1579,1607],256],64743:[[1587,1605],256],64744:[[1587,1607],256],64745:[[1588,1605],256],64746:[[1588,1607],256],64747:[[1603,1604],256],64748:[[1603,1605],256],64749:[[1604,1605],256],64750:[[1606,1605],256],64751:[[1606,1607],256],64752:[[1610,1605],256],64753:[[1610,1607],256],64754:[[1600,1614,1617],256],64755:[[1600,1615,1617],256],64756:[[1600,1616,1617],256],64757:[[1591,1609],256],64758:[[1591,1610],256],64759:[[1593,1609],256],64760:[[1593,1610],256],64761:[[1594,1609],256],64762:[[1594,1610],256],64763:[[1587,1609],256],64764:[[1587,1610],256],64765:[[1588,1609],256],64766:[[1588,1610],256],64767:[[1581,1609],256]}, + 64768:{64768:[[1581,1610],256],64769:[[1580,1609],256],64770:[[1580,1610],256],64771:[[1582,1609],256],64772:[[1582,1610],256],64773:[[1589,1609],256],64774:[[1589,1610],256],64775:[[1590,1609],256],64776:[[1590,1610],256],64777:[[1588,1580],256],64778:[[1588,1581],256],64779:[[1588,1582],256],64780:[[1588,1605],256],64781:[[1588,1585],256],64782:[[1587,1585],256],64783:[[1589,1585],256],64784:[[1590,1585],256],64785:[[1591,1609],256],64786:[[1591,1610],256],64787:[[1593,1609],256],64788:[[1593,1610],256],64789:[[1594,1609],256],64790:[[1594,1610],256],64791:[[1587,1609],256],64792:[[1587,1610],256],64793:[[1588,1609],256],64794:[[1588,1610],256],64795:[[1581,1609],256],64796:[[1581,1610],256],64797:[[1580,1609],256],64798:[[1580,1610],256],64799:[[1582,1609],256],64800:[[1582,1610],256],64801:[[1589,1609],256],64802:[[1589,1610],256],64803:[[1590,1609],256],64804:[[1590,1610],256],64805:[[1588,1580],256],64806:[[1588,1581],256],64807:[[1588,1582],256],64808:[[1588,1605],256],64809:[[1588,1585],256],64810:[[1587,1585],256],64811:[[1589,1585],256],64812:[[1590,1585],256],64813:[[1588,1580],256],64814:[[1588,1581],256],64815:[[1588,1582],256],64816:[[1588,1605],256],64817:[[1587,1607],256],64818:[[1588,1607],256],64819:[[1591,1605],256],64820:[[1587,1580],256],64821:[[1587,1581],256],64822:[[1587,1582],256],64823:[[1588,1580],256],64824:[[1588,1581],256],64825:[[1588,1582],256],64826:[[1591,1605],256],64827:[[1592,1605],256],64828:[[1575,1611],256],64829:[[1575,1611],256],64848:[[1578,1580,1605],256],64849:[[1578,1581,1580],256],64850:[[1578,1581,1580],256],64851:[[1578,1581,1605],256],64852:[[1578,1582,1605],256],64853:[[1578,1605,1580],256],64854:[[1578,1605,1581],256],64855:[[1578,1605,1582],256],64856:[[1580,1605,1581],256],64857:[[1580,1605,1581],256],64858:[[1581,1605,1610],256],64859:[[1581,1605,1609],256],64860:[[1587,1581,1580],256],64861:[[1587,1580,1581],256],64862:[[1587,1580,1609],256],64863:[[1587,1605,1581],256],64864:[[1587,1605,1581],256],64865:[[1587,1605,1580],256],64866:[[1587,1605,1605],256],64867:[[1587,1605,1605],256],64868:[[1589,1581,1581],256],64869:[[1589,1581,1581],256],64870:[[1589,1605,1605],256],64871:[[1588,1581,1605],256],64872:[[1588,1581,1605],256],64873:[[1588,1580,1610],256],64874:[[1588,1605,1582],256],64875:[[1588,1605,1582],256],64876:[[1588,1605,1605],256],64877:[[1588,1605,1605],256],64878:[[1590,1581,1609],256],64879:[[1590,1582,1605],256],64880:[[1590,1582,1605],256],64881:[[1591,1605,1581],256],64882:[[1591,1605,1581],256],64883:[[1591,1605,1605],256],64884:[[1591,1605,1610],256],64885:[[1593,1580,1605],256],64886:[[1593,1605,1605],256],64887:[[1593,1605,1605],256],64888:[[1593,1605,1609],256],64889:[[1594,1605,1605],256],64890:[[1594,1605,1610],256],64891:[[1594,1605,1609],256],64892:[[1601,1582,1605],256],64893:[[1601,1582,1605],256],64894:[[1602,1605,1581],256],64895:[[1602,1605,1605],256],64896:[[1604,1581,1605],256],64897:[[1604,1581,1610],256],64898:[[1604,1581,1609],256],64899:[[1604,1580,1580],256],64900:[[1604,1580,1580],256],64901:[[1604,1582,1605],256],64902:[[1604,1582,1605],256],64903:[[1604,1605,1581],256],64904:[[1604,1605,1581],256],64905:[[1605,1581,1580],256],64906:[[1605,1581,1605],256],64907:[[1605,1581,1610],256],64908:[[1605,1580,1581],256],64909:[[1605,1580,1605],256],64910:[[1605,1582,1580],256],64911:[[1605,1582,1605],256],64914:[[1605,1580,1582],256],64915:[[1607,1605,1580],256],64916:[[1607,1605,1605],256],64917:[[1606,1581,1605],256],64918:[[1606,1581,1609],256],64919:[[1606,1580,1605],256],64920:[[1606,1580,1605],256],64921:[[1606,1580,1609],256],64922:[[1606,1605,1610],256],64923:[[1606,1605,1609],256],64924:[[1610,1605,1605],256],64925:[[1610,1605,1605],256],64926:[[1576,1582,1610],256],64927:[[1578,1580,1610],256],64928:[[1578,1580,1609],256],64929:[[1578,1582,1610],256],64930:[[1578,1582,1609],256],64931:[[1578,1605,1610],256],64932:[[1578,1605,1609],256],64933:[[1580,1605,1610],256],64934:[[1580,1581,1609],256],64935:[[1580,1605,1609],256],64936:[[1587,1582,1609],256],64937:[[1589,1581,1610],256],64938:[[1588,1581,1610],256],64939:[[1590,1581,1610],256],64940:[[1604,1580,1610],256],64941:[[1604,1605,1610],256],64942:[[1610,1581,1610],256],64943:[[1610,1580,1610],256],64944:[[1610,1605,1610],256],64945:[[1605,1605,1610],256],64946:[[1602,1605,1610],256],64947:[[1606,1581,1610],256],64948:[[1602,1605,1581],256],64949:[[1604,1581,1605],256],64950:[[1593,1605,1610],256],64951:[[1603,1605,1610],256],64952:[[1606,1580,1581],256],64953:[[1605,1582,1610],256],64954:[[1604,1580,1605],256],64955:[[1603,1605,1605],256],64956:[[1604,1580,1605],256],64957:[[1606,1580,1581],256],64958:[[1580,1581,1610],256],64959:[[1581,1580,1610],256],64960:[[1605,1580,1610],256],64961:[[1601,1605,1610],256],64962:[[1576,1581,1610],256],64963:[[1603,1605,1605],256],64964:[[1593,1580,1605],256],64965:[[1589,1605,1605],256],64966:[[1587,1582,1610],256],64967:[[1606,1580,1610],256],65008:[[1589,1604,1746],256],65009:[[1602,1604,1746],256],65010:[[1575,1604,1604,1607],256],65011:[[1575,1603,1576,1585],256],65012:[[1605,1581,1605,1583],256],65013:[[1589,1604,1593,1605],256],65014:[[1585,1587,1608,1604],256],65015:[[1593,1604,1610,1607],256],65016:[[1608,1587,1604,1605],256],65017:[[1589,1604,1609],256],65018:[[1589,1604,1609,32,1575,1604,1604,1607,32,1593,1604,1610,1607,32,1608,1587,1604,1605],256],65019:[[1580,1604,32,1580,1604,1575,1604,1607],256],65020:[[1585,1740,1575,1604],256]}, + 65024:{65040:[[44],256],65041:[[12289],256],65042:[[12290],256],65043:[[58],256],65044:[[59],256],65045:[[33],256],65046:[[63],256],65047:[[12310],256],65048:[[12311],256],65049:[[8230],256],65056:[,230],65057:[,230],65058:[,230],65059:[,230],65060:[,230],65061:[,230],65062:[,230],65072:[[8229],256],65073:[[8212],256],65074:[[8211],256],65075:[[95],256],65076:[[95],256],65077:[[40],256],65078:[[41],256],65079:[[123],256],65080:[[125],256],65081:[[12308],256],65082:[[12309],256],65083:[[12304],256],65084:[[12305],256],65085:[[12298],256],65086:[[12299],256],65087:[[12296],256],65088:[[12297],256],65089:[[12300],256],65090:[[12301],256],65091:[[12302],256],65092:[[12303],256],65095:[[91],256],65096:[[93],256],65097:[[8254],256],65098:[[8254],256],65099:[[8254],256],65100:[[8254],256],65101:[[95],256],65102:[[95],256],65103:[[95],256],65104:[[44],256],65105:[[12289],256],65106:[[46],256],65108:[[59],256],65109:[[58],256],65110:[[63],256],65111:[[33],256],65112:[[8212],256],65113:[[40],256],65114:[[41],256],65115:[[123],256],65116:[[125],256],65117:[[12308],256],65118:[[12309],256],65119:[[35],256],65120:[[38],256],65121:[[42],256],65122:[[43],256],65123:[[45],256],65124:[[60],256],65125:[[62],256],65126:[[61],256],65128:[[92],256],65129:[[36],256],65130:[[37],256],65131:[[64],256],65136:[[32,1611],256],65137:[[1600,1611],256],65138:[[32,1612],256],65140:[[32,1613],256],65142:[[32,1614],256],65143:[[1600,1614],256],65144:[[32,1615],256],65145:[[1600,1615],256],65146:[[32,1616],256],65147:[[1600,1616],256],65148:[[32,1617],256],65149:[[1600,1617],256],65150:[[32,1618],256],65151:[[1600,1618],256],65152:[[1569],256],65153:[[1570],256],65154:[[1570],256],65155:[[1571],256],65156:[[1571],256],65157:[[1572],256],65158:[[1572],256],65159:[[1573],256],65160:[[1573],256],65161:[[1574],256],65162:[[1574],256],65163:[[1574],256],65164:[[1574],256],65165:[[1575],256],65166:[[1575],256],65167:[[1576],256],65168:[[1576],256],65169:[[1576],256],65170:[[1576],256],65171:[[1577],256],65172:[[1577],256],65173:[[1578],256],65174:[[1578],256],65175:[[1578],256],65176:[[1578],256],65177:[[1579],256],65178:[[1579],256],65179:[[1579],256],65180:[[1579],256],65181:[[1580],256],65182:[[1580],256],65183:[[1580],256],65184:[[1580],256],65185:[[1581],256],65186:[[1581],256],65187:[[1581],256],65188:[[1581],256],65189:[[1582],256],65190:[[1582],256],65191:[[1582],256],65192:[[1582],256],65193:[[1583],256],65194:[[1583],256],65195:[[1584],256],65196:[[1584],256],65197:[[1585],256],65198:[[1585],256],65199:[[1586],256],65200:[[1586],256],65201:[[1587],256],65202:[[1587],256],65203:[[1587],256],65204:[[1587],256],65205:[[1588],256],65206:[[1588],256],65207:[[1588],256],65208:[[1588],256],65209:[[1589],256],65210:[[1589],256],65211:[[1589],256],65212:[[1589],256],65213:[[1590],256],65214:[[1590],256],65215:[[1590],256],65216:[[1590],256],65217:[[1591],256],65218:[[1591],256],65219:[[1591],256],65220:[[1591],256],65221:[[1592],256],65222:[[1592],256],65223:[[1592],256],65224:[[1592],256],65225:[[1593],256],65226:[[1593],256],65227:[[1593],256],65228:[[1593],256],65229:[[1594],256],65230:[[1594],256],65231:[[1594],256],65232:[[1594],256],65233:[[1601],256],65234:[[1601],256],65235:[[1601],256],65236:[[1601],256],65237:[[1602],256],65238:[[1602],256],65239:[[1602],256],65240:[[1602],256],65241:[[1603],256],65242:[[1603],256],65243:[[1603],256],65244:[[1603],256],65245:[[1604],256],65246:[[1604],256],65247:[[1604],256],65248:[[1604],256],65249:[[1605],256],65250:[[1605],256],65251:[[1605],256],65252:[[1605],256],65253:[[1606],256],65254:[[1606],256],65255:[[1606],256],65256:[[1606],256],65257:[[1607],256],65258:[[1607],256],65259:[[1607],256],65260:[[1607],256],65261:[[1608],256],65262:[[1608],256],65263:[[1609],256],65264:[[1609],256],65265:[[1610],256],65266:[[1610],256],65267:[[1610],256],65268:[[1610],256],65269:[[1604,1570],256],65270:[[1604,1570],256],65271:[[1604,1571],256],65272:[[1604,1571],256],65273:[[1604,1573],256],65274:[[1604,1573],256],65275:[[1604,1575],256],65276:[[1604,1575],256]}, + 65280:{65281:[[33],256],65282:[[34],256],65283:[[35],256],65284:[[36],256],65285:[[37],256],65286:[[38],256],65287:[[39],256],65288:[[40],256],65289:[[41],256],65290:[[42],256],65291:[[43],256],65292:[[44],256],65293:[[45],256],65294:[[46],256],65295:[[47],256],65296:[[48],256],65297:[[49],256],65298:[[50],256],65299:[[51],256],65300:[[52],256],65301:[[53],256],65302:[[54],256],65303:[[55],256],65304:[[56],256],65305:[[57],256],65306:[[58],256],65307:[[59],256],65308:[[60],256],65309:[[61],256],65310:[[62],256],65311:[[63],256],65312:[[64],256],65313:[[65],256],65314:[[66],256],65315:[[67],256],65316:[[68],256],65317:[[69],256],65318:[[70],256],65319:[[71],256],65320:[[72],256],65321:[[73],256],65322:[[74],256],65323:[[75],256],65324:[[76],256],65325:[[77],256],65326:[[78],256],65327:[[79],256],65328:[[80],256],65329:[[81],256],65330:[[82],256],65331:[[83],256],65332:[[84],256],65333:[[85],256],65334:[[86],256],65335:[[87],256],65336:[[88],256],65337:[[89],256],65338:[[90],256],65339:[[91],256],65340:[[92],256],65341:[[93],256],65342:[[94],256],65343:[[95],256],65344:[[96],256],65345:[[97],256],65346:[[98],256],65347:[[99],256],65348:[[100],256],65349:[[101],256],65350:[[102],256],65351:[[103],256],65352:[[104],256],65353:[[105],256],65354:[[106],256],65355:[[107],256],65356:[[108],256],65357:[[109],256],65358:[[110],256],65359:[[111],256],65360:[[112],256],65361:[[113],256],65362:[[114],256],65363:[[115],256],65364:[[116],256],65365:[[117],256],65366:[[118],256],65367:[[119],256],65368:[[120],256],65369:[[121],256],65370:[[122],256],65371:[[123],256],65372:[[124],256],65373:[[125],256],65374:[[126],256],65375:[[10629],256],65376:[[10630],256],65377:[[12290],256],65378:[[12300],256],65379:[[12301],256],65380:[[12289],256],65381:[[12539],256],65382:[[12530],256],65383:[[12449],256],65384:[[12451],256],65385:[[12453],256],65386:[[12455],256],65387:[[12457],256],65388:[[12515],256],65389:[[12517],256],65390:[[12519],256],65391:[[12483],256],65392:[[12540],256],65393:[[12450],256],65394:[[12452],256],65395:[[12454],256],65396:[[12456],256],65397:[[12458],256],65398:[[12459],256],65399:[[12461],256],65400:[[12463],256],65401:[[12465],256],65402:[[12467],256],65403:[[12469],256],65404:[[12471],256],65405:[[12473],256],65406:[[12475],256],65407:[[12477],256],65408:[[12479],256],65409:[[12481],256],65410:[[12484],256],65411:[[12486],256],65412:[[12488],256],65413:[[12490],256],65414:[[12491],256],65415:[[12492],256],65416:[[12493],256],65417:[[12494],256],65418:[[12495],256],65419:[[12498],256],65420:[[12501],256],65421:[[12504],256],65422:[[12507],256],65423:[[12510],256],65424:[[12511],256],65425:[[12512],256],65426:[[12513],256],65427:[[12514],256],65428:[[12516],256],65429:[[12518],256],65430:[[12520],256],65431:[[12521],256],65432:[[12522],256],65433:[[12523],256],65434:[[12524],256],65435:[[12525],256],65436:[[12527],256],65437:[[12531],256],65438:[[12441],256],65439:[[12442],256],65440:[[12644],256],65441:[[12593],256],65442:[[12594],256],65443:[[12595],256],65444:[[12596],256],65445:[[12597],256],65446:[[12598],256],65447:[[12599],256],65448:[[12600],256],65449:[[12601],256],65450:[[12602],256],65451:[[12603],256],65452:[[12604],256],65453:[[12605],256],65454:[[12606],256],65455:[[12607],256],65456:[[12608],256],65457:[[12609],256],65458:[[12610],256],65459:[[12611],256],65460:[[12612],256],65461:[[12613],256],65462:[[12614],256],65463:[[12615],256],65464:[[12616],256],65465:[[12617],256],65466:[[12618],256],65467:[[12619],256],65468:[[12620],256],65469:[[12621],256],65470:[[12622],256],65474:[[12623],256],65475:[[12624],256],65476:[[12625],256],65477:[[12626],256],65478:[[12627],256],65479:[[12628],256],65482:[[12629],256],65483:[[12630],256],65484:[[12631],256],65485:[[12632],256],65486:[[12633],256],65487:[[12634],256],65490:[[12635],256],65491:[[12636],256],65492:[[12637],256],65493:[[12638],256],65494:[[12639],256],65495:[[12640],256],65498:[[12641],256],65499:[[12642],256],65500:[[12643],256],65504:[[162],256],65505:[[163],256],65506:[[172],256],65507:[[175],256],65508:[[166],256],65509:[[165],256],65510:[[8361],256],65512:[[9474],256],65513:[[8592],256],65514:[[8593],256],65515:[[8594],256],65516:[[8595],256],65517:[[9632],256],65518:[[9675],256]} +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/implement.js new file mode 100644 index 0000000000..cfc710ea43 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'normalize', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/index.js new file mode 100644 index 0000000000..619b0965d6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.normalize + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/is-implemented.js new file mode 100644 index 0000000000..67c8d8da5c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var str = 'æøåäüö'; + +module.exports = function () { + if (typeof str.normalize !== 'function') return false; + return str.normalize('NFKD') === 'æøåäüö'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/shim.js new file mode 100644 index 0000000000..a379989775 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/normalize/shim.js @@ -0,0 +1,289 @@ +// Taken from: https://github.com/walling/unorm/blob/master/lib/unorm.js + +/* + * UnicodeNormalizer 1.0.0 + * Copyright (c) 2008 Matsuza + * Dual licensed under the MIT (MIT-LICENSE.txt) and + * GPL (GPL-LICENSE.txt) licenses. + * $Date: 2008-06-05 16:44:17 +0200 (Thu, 05 Jun 2008) $ + * $Rev: 13309 $ +*/ + +'use strict'; + +var primitiveSet = require('../../../object/primitive-set') + , validValue = require('../../../object/valid-value') + , data = require('./_data') + + , floor = Math.floor + , forms = primitiveSet('NFC', 'NFD', 'NFKC', 'NFKD') + + , DEFAULT_FEATURE = [null, 0, {}], CACHE_THRESHOLD = 10, SBase = 0xAC00 + , LBase = 0x1100, VBase = 0x1161, TBase = 0x11A7, LCount = 19, VCount = 21 + , TCount = 28, NCount = VCount * TCount, SCount = LCount * NCount + , UChar, cache = {}, cacheCounter = [], i, fromCache, fromData, fromCpOnly + , fromRuleBasedJamo, fromCpFilter, strategies, UCharIterator + , RecursDecompIterator, DecompIterator, CompIterator, createIterator + , normalize; + +UChar = function (cp, feature) { + this.codepoint = cp; + this.feature = feature; +}; + +// Strategies +for (i = 0; i <= 0xFF; ++i) cacheCounter[i] = 0; + +fromCache = function (next, cp, needFeature) { + var ret = cache[cp]; + if (!ret) { + ret = next(cp, needFeature); + if (!!ret.feature && ++cacheCounter[(cp >> 8) & 0xFF] > CACHE_THRESHOLD) { + cache[cp] = ret; + } + } + return ret; +}; + +fromData = function (next, cp, needFeature) { + var hash = cp & 0xFF00, dunit = UChar.udata[hash] || {}, f = dunit[cp]; + return f ? new UChar(cp, f) : new UChar(cp, DEFAULT_FEATURE); +}; +fromCpOnly = function (next, cp, needFeature) { + return !!needFeature ? next(cp, needFeature) : new UChar(cp, null); +}; + +fromRuleBasedJamo = function (next, cp, needFeature) { + var c, base, i, arr, SIndex, TIndex, feature, j; + if (cp < LBase || (LBase + LCount <= cp && cp < SBase) || + (SBase + SCount < cp)) { + return next(cp, needFeature); + } + if (LBase <= cp && cp < LBase + LCount) { + c = {}; + base = (cp - LBase) * VCount; + for (i = 0; i < VCount; ++i) { + c[VBase + i] = SBase + TCount * (i + base); + } + arr = new Array(3); + arr[2] = c; + return new UChar(cp, arr); + } + + SIndex = cp - SBase; + TIndex = SIndex % TCount; + feature = []; + if (TIndex !== 0) { + feature[0] = [SBase + SIndex - TIndex, TBase + TIndex]; + } else { + feature[0] = [LBase + floor(SIndex / NCount), VBase + + floor((SIndex % NCount) / TCount)]; + feature[2] = {}; + for (j = 1; j < TCount; ++j) { + feature[2][TBase + j] = cp + j; + } + } + return new UChar(cp, feature); +}; + +fromCpFilter = function (next, cp, needFeature) { + return (cp < 60) || ((13311 < cp) && (cp < 42607)) + ? new UChar(cp, DEFAULT_FEATURE) : next(cp, needFeature); +}; + +strategies = [fromCpFilter, fromCache, fromCpOnly, fromRuleBasedJamo, fromData]; + +UChar.fromCharCode = strategies.reduceRight(function (next, strategy) { + return function (cp, needFeature) { return strategy(next, cp, needFeature); }; +}, null); + +UChar.isHighSurrogate = function (cp) { return cp >= 0xD800 && cp <= 0xDBFF; }; +UChar.isLowSurrogate = function (cp) { return cp >= 0xDC00 && cp <= 0xDFFF; }; + +UChar.prototype.prepFeature = function () { + if (!this.feature) { + this.feature = UChar.fromCharCode(this.codepoint, true).feature; + } +}; + +UChar.prototype.toString = function () { + var x; + if (this.codepoint < 0x10000) return String.fromCharCode(this.codepoint); + x = this.codepoint - 0x10000; + return String.fromCharCode(floor(x / 0x400) + 0xD800, x % 0x400 + 0xDC00); +}; + +UChar.prototype.getDecomp = function () { + this.prepFeature(); + return this.feature[0] || null; +}; + +UChar.prototype.isCompatibility = function () { + this.prepFeature(); + return !!this.feature[1] && (this.feature[1] & (1 << 8)); +}; +UChar.prototype.isExclude = function () { + this.prepFeature(); + return !!this.feature[1] && (this.feature[1] & (1 << 9)); +}; +UChar.prototype.getCanonicalClass = function () { + this.prepFeature(); + return !!this.feature[1] ? (this.feature[1] & 0xff) : 0; +}; +UChar.prototype.getComposite = function (following) { + var cp; + this.prepFeature(); + if (!this.feature[2]) return null; + cp = this.feature[2][following.codepoint]; + return cp ? UChar.fromCharCode(cp) : null; +}; + +UCharIterator = function (str) { + this.str = str; + this.cursor = 0; +}; +UCharIterator.prototype.next = function () { + if (!!this.str && this.cursor < this.str.length) { + var cp = this.str.charCodeAt(this.cursor++), d; + if (UChar.isHighSurrogate(cp) && this.cursor < this.str.length && + UChar.isLowSurrogate((d = this.str.charCodeAt(this.cursor)))) { + cp = (cp - 0xD800) * 0x400 + (d - 0xDC00) + 0x10000; + ++this.cursor; + } + return UChar.fromCharCode(cp); + } + this.str = null; + return null; +}; + +RecursDecompIterator = function (it, cano) { + this.it = it; + this.canonical = cano; + this.resBuf = []; +}; + +RecursDecompIterator.prototype.next = function () { + var recursiveDecomp, uchar; + recursiveDecomp = function (cano, uchar) { + var decomp = uchar.getDecomp(), ret, i, a, j; + if (!!decomp && !(cano && uchar.isCompatibility())) { + ret = []; + for (i = 0; i < decomp.length; ++i) { + a = recursiveDecomp(cano, UChar.fromCharCode(decomp[i])); + //ret.concat(a); //<-why does not this work? + //following block is a workaround. + for (j = 0; j < a.length; ++j) ret.push(a[j]); + } + return ret; + } + return [uchar]; + }; + if (this.resBuf.length === 0) { + uchar = this.it.next(); + if (!uchar) return null; + this.resBuf = recursiveDecomp(this.canonical, uchar); + } + return this.resBuf.shift(); +}; + +DecompIterator = function (it) { + this.it = it; + this.resBuf = []; +}; + +DecompIterator.prototype.next = function () { + var cc, uchar, inspt, uchar2, cc2; + if (this.resBuf.length === 0) { + do { + uchar = this.it.next(); + if (!uchar) break; + cc = uchar.getCanonicalClass(); + inspt = this.resBuf.length; + if (cc !== 0) { + for (inspt; inspt > 0; --inspt) { + uchar2 = this.resBuf[inspt - 1]; + cc2 = uchar2.getCanonicalClass(); + if (cc2 <= cc) break; + } + } + this.resBuf.splice(inspt, 0, uchar); + } while (cc !== 0); + } + return this.resBuf.shift(); +}; + +CompIterator = function (it) { + this.it = it; + this.procBuf = []; + this.resBuf = []; + this.lastClass = null; +}; + +CompIterator.prototype.next = function () { + var uchar, starter, composite, cc; + while (this.resBuf.length === 0) { + uchar = this.it.next(); + if (!uchar) { + this.resBuf = this.procBuf; + this.procBuf = []; + break; + } + if (this.procBuf.length === 0) { + this.lastClass = uchar.getCanonicalClass(); + this.procBuf.push(uchar); + } else { + starter = this.procBuf[0]; + composite = starter.getComposite(uchar); + cc = uchar.getCanonicalClass(); + if (!!composite && (this.lastClass < cc || this.lastClass === 0)) { + this.procBuf[0] = composite; + } else { + if (cc === 0) { + this.resBuf = this.procBuf; + this.procBuf = []; + } + this.lastClass = cc; + this.procBuf.push(uchar); + } + } + } + return this.resBuf.shift(); +}; + +createIterator = function (mode, str) { + switch (mode) { + case "NFD": + return new DecompIterator( + new RecursDecompIterator(new UCharIterator(str), true) + ); + case "NFKD": + return new DecompIterator( + new RecursDecompIterator(new UCharIterator(str), false) + ); + case "NFC": + return new CompIterator(new DecompIterator( + new RecursDecompIterator(new UCharIterator(str), true) + )); + case "NFKC": + return new CompIterator(new DecompIterator( + new RecursDecompIterator(new UCharIterator(str), false) + )); + } + throw mode + " is invalid"; +}; +normalize = function (mode, str) { + var it = createIterator(mode, str), ret = "", uchar; + while (!!(uchar = it.next())) ret += uchar.toString(); + return ret; +}; + +/* Unicode data */ +UChar.udata = data; + +module.exports = function (/*form*/) { + var str = String(validValue(this)), form = arguments[0]; + if (form === undefined) form = 'NFC'; + else form = String(form); + if (!forms[form]) throw new RangeError('Invalid normalization form: ' + form); + return normalize(form, str); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/pad.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/pad.js new file mode 100644 index 0000000000..f227f239de --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/pad.js @@ -0,0 +1,18 @@ +'use strict'; + +var toInteger = require('../../number/to-integer') + , value = require('../../object/valid-value') + , repeat = require('./repeat') + + , abs = Math.abs, max = Math.max; + +module.exports = function (fill/*, length*/) { + var self = String(value(this)) + , sLength = self.length + , length = arguments[1]; + + length = isNaN(length) ? 1 : toInteger(length); + fill = repeat.call(String(fill), abs(length)); + if (length >= 0) return fill.slice(0, max(0, length - sLength)) + self; + return self + (((sLength + length) >= 0) ? '' : fill.slice(length + sLength)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace-all.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace-all.js new file mode 100644 index 0000000000..678b1cbcff --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace-all.js @@ -0,0 +1,16 @@ +'use strict'; + +var value = require('../../object/valid-value'); + +module.exports = function (search, replace) { + var index, pos = 0, str = String(value(this)), sl, rl; + search = String(search); + replace = String(replace); + sl = search.length; + rl = replace.length; + while ((index = str.indexOf(search, pos)) !== -1) { + str = str.slice(0, index) + replace + str.slice(index + sl); + pos = index + rl; + } + return str; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace.js new file mode 100644 index 0000000000..24ce16d3bc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/plain-replace.js @@ -0,0 +1,10 @@ +'use strict'; + +var indexOf = String.prototype.indexOf, slice = String.prototype.slice; + +module.exports = function (search, replace) { + var index = indexOf.call(this, search); + if (index === -1) return String(this); + return slice.call(this, 0, index) + replace + + slice.call(this, index + String(search).length); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/implement.js new file mode 100644 index 0000000000..4c39b9fbe6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'repeat', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/index.js new file mode 100644 index 0000000000..15a800e8de --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.repeat + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/is-implemented.js new file mode 100644 index 0000000000..f7b8750f0f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/is-implemented.js @@ -0,0 +1,8 @@ +'use strict'; + +var str = 'foo'; + +module.exports = function () { + if (typeof str.repeat !== 'function') return false; + return (str.repeat(2) === 'foofoo'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/shim.js new file mode 100644 index 0000000000..0a3928b2c0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/repeat/shim.js @@ -0,0 +1,22 @@ +// Thanks: http://www.2ality.com/2014/01/efficient-string-repeat.html + +'use strict'; + +var value = require('../../../object/valid-value') + , toInteger = require('../../../number/to-integer'); + +module.exports = function (count) { + var str = String(value(this)), result; + count = toInteger(count); + if (count < 0) throw new RangeError("Count must be >= 0"); + if (!isFinite(count)) throw new RangeError("Count must be < ∞"); + result = ''; + if (!count) return result; + while (true) { + if (count & 1) result += str; + count >>>= 1; + if (count <= 0) break; + str += str; + } + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/implement.js new file mode 100644 index 0000000000..d4f1eaf547 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/implement.js @@ -0,0 +1,7 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String.prototype, 'startsWith', + { value: require('./shim'), configurable: true, enumerable: false, + writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/index.js new file mode 100644 index 0000000000..ec66a7c005 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.prototype.startsWith + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/is-implemented.js new file mode 100644 index 0000000000..a0556f196e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +var str = 'razdwatrzy'; + +module.exports = function () { + if (typeof str.startsWith !== 'function') return false; + return ((str.startsWith('trzy') === false) && + (str.startsWith('raz') === true)); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/shim.js new file mode 100644 index 0000000000..aa5aaf4145 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/starts-with/shim.js @@ -0,0 +1,12 @@ +'use strict'; + +var value = require('../../../object/valid-value') + , toInteger = require('../../../number/to-integer') + + , max = Math.max, min = Math.min; + +module.exports = function (searchString/*, position*/) { + var start, self = String(value(this)); + start = min(max(toInteger(arguments[1]), 0), self.length); + return (self.indexOf(searchString, start) === start); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/uncapitalize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/uncapitalize.js new file mode 100644 index 0000000000..bedd7e7b00 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/#/uncapitalize.js @@ -0,0 +1,8 @@ +'use strict'; + +var ensureStringifiable = require('../../object/validate-stringifiable-value'); + +module.exports = function () { + var str = ensureStringifiable(this); + return str.charAt(0).toLowerCase() + str.slice(1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/format-method.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/format-method.js new file mode 100644 index 0000000000..f1de1e301d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/format-method.js @@ -0,0 +1,24 @@ +'use strict'; + +var isCallable = require('../object/is-callable') + , value = require('../object/valid-value') + + , call = Function.prototype.call; + +module.exports = function (fmap) { + fmap = Object(value(fmap)); + return function (pattern) { + var context = value(this); + pattern = String(pattern); + return pattern.replace(/%([a-zA-Z]+)|\\([\u0000-\uffff])/g, + function (match, token, escape) { + var t, r; + if (escape) return escape; + t = token; + while (t && !(r = fmap[t])) t = t.slice(0, -1); + if (!r) return match; + if (isCallable(r)) r = call.call(r, context); + return r + token.slice(t.length); + }); + }; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/implement.js new file mode 100644 index 0000000000..b062331cc5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String, 'fromCodePoint', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/index.js new file mode 100644 index 0000000000..3f3110b6eb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.fromCodePoint + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/is-implemented.js new file mode 100644 index 0000000000..840a20e3f3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/is-implemented.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function () { + var fromCodePoint = String.fromCodePoint; + if (typeof fromCodePoint !== 'function') return false; + return fromCodePoint(0x1D306, 0x61, 0x1D307) === '\ud834\udf06a\ud834\udf07'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/shim.js new file mode 100644 index 0000000000..41fd7378f8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/from-code-point/shim.js @@ -0,0 +1,30 @@ +// Based on: +// http://norbertlindenberg.com/2012/05/ecmascript-supplementary-characters/ +// and: +// https://github.com/mathiasbynens/String.fromCodePoint/blob/master +// /fromcodepoint.js + +'use strict'; + +var floor = Math.floor, fromCharCode = String.fromCharCode; + +module.exports = function (codePoint/*, …codePoints*/) { + var chars = [], l = arguments.length, i, c, result = ''; + for (i = 0; i < l; ++i) { + c = Number(arguments[i]); + if (!isFinite(c) || c < 0 || c > 0x10FFFF || floor(c) !== c) { + throw new RangeError("Invalid code point " + c); + } + + if (c < 0x10000) { + chars.push(c); + } else { + c -= 0x10000; + chars.push((c >> 10) + 0xD800, (c % 0x400) + 0xDC00); + } + if (i + 1 !== l && chars.length <= 0x4000) continue; + result += fromCharCode.apply(null, chars); + chars.length = 0; + } + return result; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/index.js new file mode 100644 index 0000000000..dbbcdf61f0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/index.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = { + '#': require('./#'), + formatMethod: require('./format-method'), + fromCodePoint: require('./from-code-point'), + isString: require('./is-string'), + randomUniq: require('./random-uniq'), + raw: require('./raw') +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/is-string.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/is-string.js new file mode 100644 index 0000000000..719aeec16c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/is-string.js @@ -0,0 +1,10 @@ +'use strict'; + +var toString = Object.prototype.toString + + , id = toString.call(''); + +module.exports = function (x) { + return (typeof x === 'string') || (x && (typeof x === 'object') && + ((x instanceof String) || (toString.call(x) === id))) || false; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/random-uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/random-uniq.js new file mode 100644 index 0000000000..54ae6f8c9f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/random-uniq.js @@ -0,0 +1,11 @@ +'use strict'; + +var generated = Object.create(null) + + , random = Math.random; + +module.exports = function () { + var str; + do { str = random().toString(36).slice(2); } while (generated[str]); + return str; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/implement.js new file mode 100644 index 0000000000..c417e659b2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +if (!require('./is-implemented')()) { + Object.defineProperty(String, 'raw', { value: require('./shim'), + configurable: true, enumerable: false, writable: true }); +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/index.js new file mode 100644 index 0000000000..504a5de24b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = require('./is-implemented')() + ? String.raw + : require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/is-implemented.js new file mode 100644 index 0000000000..d7204c0c49 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/is-implemented.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function () { + var raw = String.raw, test; + if (typeof raw !== 'function') return false; + test = ['foo\nbar', 'marko\n']; + test.raw = ['foo\\nbar', 'marko\\n']; + return raw(test, 'INSE\nRT') === 'foo\\nbarINSE\nRTmarko\\n'; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/shim.js new file mode 100644 index 0000000000..7096efbc56 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/string/raw/shim.js @@ -0,0 +1,15 @@ +'use strict'; + +var toPosInt = require('../../number/to-pos-integer') + , validValue = require('../../object/valid-value') + + , reduce = Array.prototype.reduce; + +module.exports = function (callSite/*, …substitutions*/) { + var args, rawValue = Object(validValue(Object(validValue(callSite)).raw)); + if (!toPosInt(rawValue.length)) return ''; + args = arguments; + return reduce.call(rawValue, function (a, b, i) { + return a + String(args[i]) + b; + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/__tad.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/__tad.js new file mode 100644 index 0000000000..884577887f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/__tad.js @@ -0,0 +1,3 @@ +'use strict'; + +exports.context = null; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/implement.js new file mode 100644 index 0000000000..f0605399e0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/@@iterator/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/shim.js new file mode 100644 index 0000000000..e590d8f28e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/@@iterator/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +exports.__generic = function (t, a) { + var iterator = t.call(this); + a.deep(iterator.next(), { value: '1', done: false }); + a.deep(iterator.next(), { value: '2', done: false }); + a.deep(iterator.next(), { value: '3', done: false }); + a.deep(iterator.next(), { value: undefined, done: true }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/_compare-by-length.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/_compare-by-length.js new file mode 100644 index 0000000000..e40c305b98 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/_compare-by-length.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + var x = [4, 5, 6], y = { length: 8 }, w = {}, z = { length: 1 }; + + a.deep([x, y, w, z].sort(t), [w, z, x, y]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/binary-search.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/binary-search.js new file mode 100644 index 0000000000..cf3317371b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/binary-search.js @@ -0,0 +1,15 @@ +'use strict'; + +var compare = function (value) { return this - value; }; + +module.exports = function (t, a) { + var arr; + arr = [2, 5, 5, 8, 34, 67, 98, 345, 678]; + + // highest, equal match + a(t.call(arr, compare.bind(1)), 0, "All higher"); + a(t.call(arr, compare.bind(679)), arr.length - 1, "All lower"); + a(t.call(arr, compare.bind(4)), 0, "Mid"); + a(t.call(arr, compare.bind(5)), 2, "Match"); + a(t.call(arr, compare.bind(6)), 2, "Above"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/clear.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/clear.js new file mode 100644 index 0000000000..a5b1c977ad --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/clear.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + var x = [1, 2, {}, 4]; + a(t.call(x), x, "Returns same array"); + a.deep(x, [], "Empties array"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/compact.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/compact.js new file mode 100644 index 0000000000..6390eb26dd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/compact.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + a(t.call(this).length, 3); + }, + "": function (t, a) { + var o, x, y, z; + o = {}; + x = [0, 1, "", null, o, false, undefined, true]; + y = x.slice(0); + + a.not(z = t.call(x), x, "Returns different object"); + a.deep(x, y, "Origin not changed"); + a.deep(z, [0, 1, "", o, false, true], "Result"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/implement.js new file mode 100644 index 0000000000..3bdbe86812 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/concat/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/shim.js new file mode 100644 index 0000000000..c30eb7eab0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/concat/shim.js @@ -0,0 +1,26 @@ +'use strict'; + +var SubArray = require('../../../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr = [1, 3, 45], x = {}, subArr, subArr2, result; + + a.deep(t.call(arr, '2d', x, ['ere', 'fe', x], false, null), + [1, 3, 45, '2d', x, 'ere', 'fe', x, false, null], "Plain array"); + + subArr = new SubArray('lol', 'miszko'); + subArr2 = new SubArray('elo', 'fol'); + + result = t.call(subArr, 'df', arr, 'fef', subArr2, null); + a(result instanceof SubArray, true, "Instance of subclass"); + a.deep(result, ['lol', 'miszko', 'df', 1, 3, 45, 'fef', 'elo', 'fol', null], + "Spreable by default"); + + SubArray.prototype['@@isConcatSpreadable'] = false; + + result = t.call(subArr, 'df', arr, 'fef', subArr2, null); + a.deep(result, ['lol', 'miszko', 'df', 1, 3, 45, 'fef', subArr2, null], + "Non spreadable"); + + delete SubArray.prototype['@@isConcatSpreadable']; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/contains.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/contains.js new file mode 100644 index 0000000000..21404a17a6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/contains.js @@ -0,0 +1,21 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + a(t.call(this, this[1]), true, "Contains"); + a(t.call(this, {}), false, "Does Not contain"); + }, + "": function (t, a) { + var o, x = {}, y = {}; + + o = [1, 'raz', x]; + + a(t.call(o, 1), true, "First"); + a(t.call(o, '1'), false, "Type coercion"); + a(t.call(o, 'raz'), true, "Primitive"); + a(t.call(o, 'foo'), false, "Primitive not found"); + a(t.call(o, x), true, "Object found"); + a(t.call(o, y), false, "Object not found"); + a(t.call(o, 1, 1), false, "Position"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/implement.js new file mode 100644 index 0000000000..36070477d6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/copy-within/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/shim.js new file mode 100644 index 0000000000..93c85ea311 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/copy-within/shim.js @@ -0,0 +1,29 @@ +'use strict'; + +module.exports = function (t, a) { + var args, x; + + a.h1("2 args"); + x = [1, 2, 3, 4, 5]; + t.call(x, 0, 3); + a.deep(x, [4, 5, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 1, 3), [1, 4, 5, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 1, 2), [1, 3, 4, 5, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 2, 2), [1, 2, 3, 4, 5]); + + a.h1("3 args"); + a.deep(t.call([1, 2, 3, 4, 5], 0, 3, 4), [4, 2, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 1, 3, 4), [1, 4, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 1, 2, 4), [1, 3, 4, 4, 5]); + + a.h1("Negative args"); + a.deep(t.call([1, 2, 3, 4, 5], 0, -2), [4, 5, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], 0, -2, -1), [4, 2, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], -4, -3, -2), [1, 3, 3, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], -4, -3, -1), [1, 3, 4, 4, 5]); + a.deep(t.call([1, 2, 3, 4, 5], -4, -3), [1, 3, 4, 5, 5]); + + a.h1("Array-likes"); + args = { 0: 1, 1: 2, 2: 3, length: 3 }; + a.deep(t.call(args, -2, 0), { '0': 1, '1': 1, '2': 2, length: 3 }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/diff.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/diff.js new file mode 100644 index 0000000000..bcfa3a0bd1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/diff.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + a.deep(t.call(this, this), []); + }, + "": function (t, a) { + var x = {}, y = {}; + + a.deep(t.call([1, 'raz', x, 2, 'trzy', y], [x, 2, 'trzy']), [1, 'raz', y], + "Scope longer"); + a.deep(t.call([1, 'raz', x], [x, 2, 'trzy', 1, y]), ['raz'], + "Arg longer"); + a.deep(t.call([1, 'raz', x], []), [1, 'raz', x], "Empty arg"); + a.deep(t.call([], [1, y, 'sdfs']), [], "Empty scope"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-index-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-index-of.js new file mode 100644 index 0000000000..4cf6c6359d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-index-of.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}; + a(t.call([3, 'raz', {}, x, {}], x), 3, "Regular"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN), 2, "NaN"); + a(t.call([3, 'raz', 0, {}, -0], -0), 2, "-0"); + a(t.call([3, 'raz', -0, {}, 0], +0), 2, "+0"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN, 3), 4, "fromIndex"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN, -1), 4, "fromIndex negative #1"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN, -2), 4, "fromIndex negative #2"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN, -3), 2, "fromIndex negative #3"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-last-index-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-last-index-of.js new file mode 100644 index 0000000000..ed4f700421 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/e-last-index-of.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}; + a(t.call([3, 'raz', {}, x, {}, x], x), 5, "Regular"); + a(t.call([3, 'raz', NaN, {}, x], NaN), 2, "NaN"); + a(t.call([3, 'raz', 0, {}, -0], -0), 4, "-0"); + a(t.call([3, 'raz', -0, {}, 0], +0), 4, "+0"); + a(t.call([3, 'raz', NaN, {}, NaN], NaN, 3), 2, "fromIndex"); + a(t.call([3, 'raz', NaN, 2, NaN], NaN, -1), 4, "Negative fromIndex #1"); + a(t.call([3, 'raz', NaN, 2, NaN], NaN, -2), 2, "Negative fromIndex #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/implement.js new file mode 100644 index 0000000000..733209a1c8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/entries/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/shim.js new file mode 100644 index 0000000000..bf40d31005 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/entries/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +exports.__generic = function (t, a) { + var iterator = t.call(this); + a.deep(iterator.next(), { value: [0, '1'], done: false }); + a.deep(iterator.next(), { value: [1, '2'], done: false }); + a.deep(iterator.next(), { value: [2, '3'], done: false }); + a.deep(iterator.next(), { value: undefined, done: true }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/exclusion.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/exclusion.js new file mode 100644 index 0000000000..07b32d8e8c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/exclusion.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + var x = {}; + a.deep(t.call(this, this, [this[0], this[2], x]), [x]); + }, + "": function (t, a) { + var x = {}, y = {}; + + a.deep(t.call([x, y]), [x, y], "No arguments"); + a.deep(t.call([x, 1], [], []), [x, 1], "Empty arguments"); + a.deep(t.call([1, 'raz', x], [2, 'raz', y], [2, 'raz', x]), [1, y]); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/implement.js new file mode 100644 index 0000000000..2a01d2850a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/fill/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/shim.js new file mode 100644 index 0000000000..d67300fcc2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/fill/shim.js @@ -0,0 +1,18 @@ +// Taken from https://github.com/paulmillr/es6-shim/blob/master/test/array.js + +'use strict'; + +module.exports = function (t, a) { + var x; + + x = [1, 2, 3, 4, 5, 6]; + a(t.call(x, -1), x, "Returns self object"); + a.deep(x, [-1, -1, -1, -1, -1, -1], "Value"); + + a.deep(t.call([1, 2, 3, 4, 5, 6], -1, 3), [1, 2, 3, -1, -1, -1], + "Positive start"); + a.deep(t.call([1, 2, 3, 4, 5, 6], -1, -3), [1, 2, 3, -1, -1, -1], + "Negative start"); + a.deep(t.call([1, 2, 3, 4, 5, 6], -1, 9), [1, 2, 3, 4, 5, 6], + "Large start"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/implement.js new file mode 100644 index 0000000000..6d6b87cc30 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/filter/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/shim.js new file mode 100644 index 0000000000..e8b5c39849 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/filter/shim.js @@ -0,0 +1,17 @@ +'use strict'; + +var SubArray = require('../../../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr, x = {}, subArr, result; + + arr = ['foo', undefined, 0, '2d', false, x, null]; + + a.deep(t.call(arr, Boolean), ['foo', '2d', x], "Plain array"); + + subArr = new SubArray('foo', undefined, 0, '2d', false, x, null); + + result = t.call(subArr, Boolean); + a(result instanceof SubArray, true, "Instance of subclass"); + a.deep(result, ['foo', '2d', x], "Result of subclass"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/implement.js new file mode 100644 index 0000000000..8d85e618cc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/find-index/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/shim.js new file mode 100644 index 0000000000..b5fee46381 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find-index/shim.js @@ -0,0 +1,17 @@ +'use strict'; + +exports.__generic = function (t, a) { + var count = 0, o = {}, self = Object(this); + a(t.call(self, function (value, i, scope) { + a(value, this[i], "Value"); + a(i, count++, "Index"); + a(scope, this, "Scope"); + }, self), -1, "Falsy result"); + a(count, 3); + + count = -1; + a(t.call(this, function () { + return ++count ? o : null; + }, this), 1, "Truthy result"); + a(count, 1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/implement.js new file mode 100644 index 0000000000..29fac41e01 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/find/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/shim.js new file mode 100644 index 0000000000..ad2e645067 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/find/shim.js @@ -0,0 +1,17 @@ +'use strict'; + +exports.__generic = function (t, a) { + var count = 0, o = {}, self = Object(this); + a(t.call(self, function (value, i, scope) { + a(value, this[i], "Value"); + a(i, count++, "Index"); + a(scope, this, "Scope"); + }, self), undefined, "Falsy result"); + a(count, 3); + + count = -1; + a(t.call(this, function () { + return ++count ? o : null; + }, this), this[1], "Truthy result"); + a(count, 1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first-index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first-index.js new file mode 100644 index 0000000000..4aebad64b4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first-index.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a(t.call([]), null, "Empty"); + a(t.call([null]), 0, "One value"); + a(t.call([1, 2, 3]), 0, "Many values"); + a(t.call(new Array(1000)), null, "Sparse empty"); + x = []; + x[883] = undefined; + x[890] = null; + a(t.call(x), 883, "Manual sparse, distant value"); + x = new Array(1000); + x[657] = undefined; + x[700] = null; + a(t.call(x), 657, "Sparse, distant value"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first.js new file mode 100644 index 0000000000..87fde0357e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/first.js @@ -0,0 +1,13 @@ +'use strict'; + +exports.__generic = function (t, a) { + a(t.call(this), this[0]); +}; +exports[''] = function (t, a) { + var x; + a(t.call([]), undefined, "Empty"); + a(t.call(new Array(234), undefined, "Sparse empty")); + x = new Array(2342); + x[434] = {}; + a(t.call(x), x[434], "Sparse"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/flatten.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/flatten.js new file mode 100644 index 0000000000..65f1214b04 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/flatten.js @@ -0,0 +1,12 @@ +'use strict'; + +var o = [1, 2, [3, 4, [5, 6], 7, 8], 9, 10]; + +module.exports = { + __generic: function (t, a) { + a(t.call(this).length, 3); + }, + "Nested Arrays": function (t, a) { + a(t.call(o).length, 10); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/for-each-right.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/for-each-right.js new file mode 100644 index 0000000000..2d24569d94 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/for-each-right.js @@ -0,0 +1,36 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + var count = 0, first, last, x, icount = this.length; + t.call(this, function (item, index, col) { + ++count; + if (!first) { + first = item; + } + last = item; + x = col; + a(index, --icount, "Index"); + }); + a(count, this.length, "Iterated"); + a(first, this[this.length - 1], "First is last"); + a(last, this[0], "Last is first"); + a.deep(x, Object(this), "Collection as third argument"); //jslint: skip + }, + "": function (t, a) { + var x = {}, y, count; + t.call([1], function () { y = this; }, x); + a(y, x, "Scope"); + y = 0; + t.call([3, 4, 4], function (a, i) { y += i; }); + a(y, 3, "Indexes"); + + x = [1, 3]; + x[5] = 'x'; + y = 0; + count = 0; + t.call(x, function (a, i) { ++count; y += i; }); + a(y, 6, "Misssing Indexes"); + a(count, 3, "Misssing Indexes, count"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/group.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/group.js new file mode 100644 index 0000000000..32dc8c2dbb --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/group.js @@ -0,0 +1,24 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + var count = 0, self; + + self = Object(this); + a.deep(t.call(self, function (v, i, scope) { + a(v, this[i], "Value"); + a(i, count++, "Index"); + a(scope, this, "Scope"); + return i; + }, self), { 0: [this[0]], 1: [this[1]], 2: [this[2]] }); + }, + "": function (t, a) { + var r; + r = t.call([2, 3, 3, 4, 5, 6, 7, 7, 23, 45, 34, 56], + function (v) { + return v % 2 ? 'odd' : 'even'; + }); + a.deep(r.odd, [3, 3, 5, 7, 7, 23, 45]); + a.deep(r.even, [2, 4, 6, 34, 56]); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/indexes-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/indexes-of.js new file mode 100644 index 0000000000..3364170f1e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/indexes-of.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + a.deep(t.call(this, this[1]), [1]); + }, + "": function (t, a) { + var x = {}; + a.deep(t.call([1, 3, 5, 3, 5], 6), [], "No result"); + a.deep(t.call([1, 3, 5, 1, 3, 5, 1], 1), [0, 3, 6], "Some results"); + a.deep(t.call([], x), [], "Empty array"); + a.deep(t.call([x, 3, {}, x, 3, 5, x], x), [0, 3, 6], "Search for object"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/intersection.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/intersection.js new file mode 100644 index 0000000000..b72b2fb074 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/intersection.js @@ -0,0 +1,24 @@ +'use strict'; + +var toArray = require('../../../array/to-array'); + +module.exports = { + __generic: function (t, a) { + a.deep(t.call(this, this, this), toArray(this)); + }, + "": function (t, a) { + var x = {}, y = {}, p, r; + a.deep(t.call([], [2, 3, 4]), [], "Empty #1"); + a.deep(t.call([2, 3, 4], []), [], "Empty #2"); + a.deep(t.call([2, 3, x], [y, 5, 7]), [], "Different"); + p = t.call([3, 5, 'raz', {}, 'dwa', x], [1, 3, 'raz', 'dwa', 'trzy', x, {}], + [3, 'raz', x, 65]); + r = [3, 'raz', x]; + p.sort(); + r.sort(); + a.deep(p, r, "Same parts"); + a.deep(t.call(r, r), r, "Same"); + a.deep(t.call([1, 2, x, 4, 5, y, 7], [7, y, 5, 4, x, 2, 1]), + [1, 2, x, 4, 5, y, 7], "Long reverse same"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-copy.js new file mode 100644 index 0000000000..e7f80e7a8d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-copy.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}; + a(t.call([], []), true, "Empty"); + a(t.call([], {}), true, "Empty lists"); + a(t.call([1, x, 'raz'], [1, x, 'raz']), true, "Same"); + a(t.call([1, x, 'raz'], { 0: 1, 1: x, 2: 'raz', length: 3 }), true, + "Same lists"); + a(t.call([1, x, 'raz'], [x, 1, 'raz']), false, "Diff order"); + a(t.call([1, x], [1, x, 'raz']), false, "Diff length #1"); + a(t.call([1, x, 'raz'], [1, x]), false, "Diff length #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-uniq.js new file mode 100644 index 0000000000..7349ba3371 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/is-uniq.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}; + a(t.call([]), true, "Empty"); + a(t.call({}), true, "Empty lists"); + a(t.call([1, x, 'raz']), true, "Uniq"); + a(t.call([1, x, 1, 'raz']), false, "Not Uniq: primitive"); + a(t.call([1, x, '1', 'raz']), true, "Uniq: primitive"); + a(t.call([1, x, 1, {}, 'raz']), false, "Not Uniq: Obj"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/implement.js new file mode 100644 index 0000000000..b0c1aa078f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/keys/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/shim.js new file mode 100644 index 0000000000..a43c04cac1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/keys/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +exports.__generic = function (t, a) { + var iterator = t.call(this); + a.deep(iterator.next(), { value: 0, done: false }); + a.deep(iterator.next(), { value: 1, done: false }); + a.deep(iterator.next(), { value: 2, done: false }); + a.deep(iterator.next(), { value: undefined, done: true }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last-index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last-index.js new file mode 100644 index 0000000000..a1cac1073f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last-index.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a(t.call([]), null, "Empty"); + a(t.call([null]), 0, "One value"); + a(t.call([1, 2, 3]), 2, "Many values"); + a(t.call(new Array(1000)), null, "Sparse empty"); + x = []; + x[883] = null; + x[890] = undefined; + a(t.call(x), 890, "Manual sparse, distant value"); + x = new Array(1000); + x[657] = null; + x[700] = undefined; + a(t.call(x), 700, "Sparse, distant value"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last.js new file mode 100644 index 0000000000..8d051bc8d2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/last.js @@ -0,0 +1,15 @@ +'use strict'; + +exports.__generic = function (t, a) { + a(t.call(this), this[this.length - 1]); +}; + +exports[''] = function (t, a) { + var x; + a(t.call([]), undefined, "Empty"); + a(t.call(new Array(234), undefined, "Sparse empty")); + x = new Array(2342); + x[434] = {}; + x[450] = {}; + a(t.call(x), x[450], "Sparse"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/implement.js new file mode 100644 index 0000000000..cdcbc8df62 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/map/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/shim.js new file mode 100644 index 0000000000..bbfefe8e33 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/map/shim.js @@ -0,0 +1,19 @@ +'use strict'; + +var SubArray = require('../../../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr, x = {}, subArr, result; + + arr = ['foo', undefined, 0, '2d', false, x, null]; + + a.deep(t.call(arr, Boolean), [true, false, false, true, false, true, false], + "Plain array"); + + subArr = new SubArray('foo', undefined, 0, '2d', false, x, null); + + result = t.call(subArr, Boolean); + a(result instanceof SubArray, true, "Instance of subclass"); + a.deep(result, [true, false, false, true, false, true, false], + "Result of subclass"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/remove.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/remove.js new file mode 100644 index 0000000000..3ebdca2d01 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/remove.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function (t, a) { + var y = {}, z = {}, x = [9, z, 5, y, 'foo']; + t.call(x, y); + a.deep(x, [9, z, 5, 'foo']); + t.call(x, {}); + a.deep(x, [9, z, 5, 'foo'], "Not existing"); + t.call(x, 5); + a.deep(x, [9, z, 'foo'], "Primitive"); + x = [9, z, 5, y, 'foo']; + t.call(x, z, 5, 'foo'); + a.deep(x, [9, y], "More than one argument"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/separate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/separate.js new file mode 100644 index 0000000000..42918b5971 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/separate.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var x = [], y = {}, z = {}; + a.deep(t.call(x, y), [], "Empty"); + a.not(t.call(x), x, "Returns copy"); + a.deep(t.call([1], y), [1], "One"); + a.deep(t.call([1, 'raz'], y), [1, y, 'raz'], "One"); + a.deep(t.call([1, 'raz', x], y), [1, y, 'raz', y, x], "More"); + x = new Array(1000); + x[23] = 2; + x[3453] = 'raz'; + x[500] = z; + a.deep(t.call(x, y), [2, y, z, y, 'raz'], "Sparse"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/implement.js new file mode 100644 index 0000000000..855ae2fa4d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/slice/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/shim.js new file mode 100644 index 0000000000..f674f34700 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/slice/shim.js @@ -0,0 +1,17 @@ +'use strict'; + +var SubArray = require('../../../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr, x = {}, subArr, result; + + arr = ['foo', undefined, 0, '2d', false, x, null]; + + a.deep(t.call(arr, 2, 4), [0, '2d'], "Plain array: result"); + + subArr = new SubArray('foo', undefined, 0, '2d', false, x, null); + + result = t.call(subArr, 2, 4); + a(result instanceof SubArray, true, "Instance of subclass"); + a.deep(result, [0, '2d'], "Subclass: result"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/some-right.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/some-right.js new file mode 100644 index 0000000000..900771a6f8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/some-right.js @@ -0,0 +1,43 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + var count = 0, first, last, x, icount = this.length; + t.call(this, function (item, index, col) { + ++count; + if (!first) { + first = item; + } + last = item; + x = col; + a(index, --icount, "Index"); + }); + a(count, this.length, "Iterated"); + a(first, this[this.length - 1], "First is last"); + a(last, this[0], "Last is first"); + a.deep(x, Object(this), "Collection as third argument"); //jslint: skip + }, + "": function (t, a) { + var x = {}, y, count; + t.call([1], function () { y = this; }, x); + a(y, x, "Scope"); + y = 0; + t.call([3, 4, 4], function (a, i) { y += i; }); + a(y, 3, "Indexes"); + + x = [1, 3]; + x[5] = 'x'; + y = 0; + count = 0; + a(t.call(x, function (a, i) { ++count; y += i; }), false, "Return"); + a(y, 6, "Misssing Indexes"); + a(count, 3, "Misssing Indexes, count"); + + count = 0; + a(t.call([-2, -3, -4, 2, -5], function (item) { + ++count; + return item > 0; + }), true, "Return"); + a(count, 2, "Break after true is returned"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/implement.js new file mode 100644 index 0000000000..0d9f46188b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/splice/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/shim.js new file mode 100644 index 0000000000..2c751e6724 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/splice/shim.js @@ -0,0 +1,19 @@ +'use strict'; + +var SubArray = require('../../../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr, x = {}, subArr, result; + + arr = ['foo', undefined, 0, '2d', false, x, null]; + + a.deep(t.call(arr, 2, 2, 'bar'), [0, '2d'], "Plain array: result"); + a.deep(arr, ["foo", undefined, "bar", false, x, null], "Plain array: change"); + + subArr = new SubArray('foo', undefined, 0, '2d', false, x, null); + + result = t.call(subArr, 2, 2, 'bar'); + a(result instanceof SubArray, true, "Instance of subclass"); + a.deep(result, [0, '2d'], "Subclass: result"); + a.deep(subArr, ["foo", undefined, "bar", false, x, null], "Subclass: change"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/uniq.js new file mode 100644 index 0000000000..2f7e6c4ed1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/uniq.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = { + __generic: function (t, a) { + a(t.call(this).length, 3); + }, + "": function (t, a) { + var o, x = {}, y = {}, z = {}, w; + o = [1, 2, x, 3, 1, 'raz', '1', y, x, 'trzy', z, 'raz']; + + a.not(w = t.call(o), o, "Returns different object"); + a.deep(w, [1, 2, x, 3, 'raz', '1', y, 'trzy', z], "Result"); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/implement.js new file mode 100644 index 0000000000..9f40138c25 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../array/#/values/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/shim.js new file mode 100644 index 0000000000..e590d8f28e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/#/values/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +exports.__generic = function (t, a) { + var iterator = t.call(this); + a.deep(iterator.next(), { value: '1', done: false }); + a.deep(iterator.next(), { value: '2', done: false }); + a.deep(iterator.next(), { value: '3', done: false }); + a.deep(iterator.next(), { value: undefined, done: true }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/__scopes.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/__scopes.js new file mode 100644 index 0000000000..6bfdcbc949 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/__scopes.js @@ -0,0 +1,11 @@ +'use strict'; + +exports.Array = ['1', '2', '3']; + +exports.Arguments = (function () { + return arguments; +}('1', '2', '3')); + +exports.String = "123"; + +exports.Object = { 0: '1', 1: '2', 2: '3', 3: '4', length: 3 }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_is-extensible.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_is-extensible.js new file mode 100644 index 0000000000..d387126fe1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_is-extensible.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(typeof t, 'boolean'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy-safe.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy-safe.js new file mode 100644 index 0000000000..29d8699d46 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy-safe.js @@ -0,0 +1,7 @@ +'use strict'; + +var isArray = Array.isArray; + +module.exports = function (t, a) { + t((t === null) || isArray(t.prototype), true); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy.js new file mode 100644 index 0000000000..29d8699d46 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/_sub-array-dummy.js @@ -0,0 +1,7 @@ +'use strict'; + +var isArray = Array.isArray; + +module.exports = function (t, a) { + t((t === null) || isArray(t.prototype), true); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/implement.js new file mode 100644 index 0000000000..e0db846f99 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../array/from/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/shim.js new file mode 100644 index 0000000000..310302ac48 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/from/shim.js @@ -0,0 +1,60 @@ +// Some tests taken from: https://github.com/mathiasbynens/Array.from/blob/master/tests/tests.js + +'use strict'; + +module.exports = function (t, a) { + var o = [1, 2, 3], MyType; + a.not(t(o), o, "Array"); + a.deep(t(o), o, "Array: same content"); + a.deep(t('12r3v'), ['1', '2', 'r', '3', 'v'], "String"); + a.deep(t((function () { return arguments; }(3, o, 'raz'))), + [3, o, 'raz'], "Arguments"); + a.deep(t((function () { return arguments; }(3))), [3], + "Arguments with one numeric value"); + + a.deep(t({ 0: 'raz', 1: 'dwa', length: 2 }), ['raz', 'dwa'], "Other"); + + a.deep(t(o, function (val) { return (val + 2) * 10; }, 10), [30, 40, 50], + "Mapping"); + + a.throws(function () { t(); }, TypeError, "Undefined"); + a.deep(t(3), [], "Primitive"); + + a(t.length, 1, "Length"); + a.deep(t({ length: 0 }), [], "No values Array-like"); + a.deep(t({ length: -1 }), [], "Invalid length Array-like"); + a.deep(t({ length: -Infinity }), [], "Invalid length Array-like #2"); + a.throws(function () { t(undefined); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Null"); + a.deep(t(false), [], "Boolean"); + a.deep(t(-Infinity), [], "Inifity"); + a.deep(t(-0), [], "-0"); + a.deep(t(+0), [], "+0"); + a.deep(t(1), [], "1"); + a.deep(t(+Infinity), [], "+Infinity"); + a.deep(t({}), [], "Plain object"); + a.deep(t({ length: 1 }), [undefined], "Sparse array-like"); + a.deep(t({ '0': 'a', '1': 'b', length: 2 }, function (x) { return x + x; }), ['aa', 'bb'], + "Map"); + a.deep(t({ '0': 'a', '1': 'b', length: 2 }, function (x) { return String(this); }, undefined), + ['undefined', 'undefined'], "Map context"); + a.deep(t({ '0': 'a', '1': 'b', length: 2 }, function (x) { return String(this); }, 'x'), + ['x', 'x'], "Map primitive context"); + a.throws(function () { t({}, 'foo', 'x'); }, TypeError, "Non callable for map"); + + a.deep(t.call(null, { length: 1, '0': 'a' }), ['a'], "Null context"); + + a(t({ __proto__: { '0': 'abc', length: 1 } })[0], 'abc', "Values on prototype"); + + a.throws(function () { t.call(function () { return Object.freeze({}); }, {}); }, + TypeError, "Contructor producing freezed objects"); + + // Ensure no setters are called for the indexes + // Ensure no setters are called for the indexes + MyType = function () {}; + Object.defineProperty(MyType.prototype, '0', { + set: function (x) { throw new Error('Setter called: ' + x); } + }); + a.deep(t.call(MyType, { '0': 'abc', length: 1 }), { '0': 'abc', length: 1 }, + "Defined not set"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/generate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/generate.js new file mode 100644 index 0000000000..d72e056887 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/generate.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}, y = {}; + a.deep(t(3), [undefined, undefined, undefined], "Just length"); + a.deep(t(0, 'x'), [], "No repeat"); + a.deep(t(1, x, y), [x], "Arguments length larger than repeat number"); + a.deep(t(3, x), [x, x, x], "Single argument"); + a.deep(t(5, x, y), [x, y, x, y, x], "Many arguments"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/is-plain-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/is-plain-array.js new file mode 100644 index 0000000000..871a08aec2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/is-plain-array.js @@ -0,0 +1,18 @@ +'use strict'; + +var SubArray = require('../../array/_sub-array-dummy-safe'); + +module.exports = function (t, a) { + var arr = [1, 2, 3]; + a(t(arr), true, "Array"); + a(t(null), false, "Null"); + a(t(), false, "Undefined"); + a(t('234'), false, "String"); + a(t(23), false, "Number"); + a(t({}), false, "Plain object"); + a(t({ length: 1, 0: 'raz' }), false, "Array-like"); + a(t(Object.create(arr)), false, "Array extension"); + if (!SubArray) return; + a(t(new SubArray(23)), false, "Subclass instance"); + a(t(Array.prototype), false, "Array.prototype"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/implement.js new file mode 100644 index 0000000000..30d53be2d7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../array/of/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/shim.js new file mode 100644 index 0000000000..e6974420c1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/of/shim.js @@ -0,0 +1,68 @@ +// Most tests taken from https://github.com/mathiasbynens/Array.of/blob/master/tests/tests.js +// Thanks @mathiasbynens + +'use strict'; + +var defineProperty = Object.defineProperty; + +module.exports = function (t, a) { + var x = {}, testObject, MyType; + + a.deep(t(), [], "No arguments"); + a.deep(t(3), [3], "One numeric argument"); + a.deep(t(3, 'raz', null, x, undefined), [3, 'raz', null, x, undefined], + "Many arguments"); + + a(t.length, 0, "Length"); + + a.deep(t('abc'), ['abc'], "String"); + a.deep(t(undefined), [undefined], "Undefined"); + a.deep(t(null), [null], "Null"); + a.deep(t(false), [false], "Boolean"); + a.deep(t(-Infinity), [-Infinity], "Infinity"); + a.deep(t(-0), [-0], "-0"); + a.deep(t(+0), [+0], "+0"); + a.deep(t(1), [1], "1"); + a.deep(t(1, 2, 3), [1, 2, 3], "Numeric args"); + a.deep(t(+Infinity), [+Infinity], "+Infinity"); + a.deep(t({ '0': 'a', '1': 'b', '2': 'c', length: 3 }), + [{ '0': 'a', '1': 'b', '2': 'c', length: 3 }], "Array like"); + a.deep(t(undefined, null, false, -Infinity, -0, +0, 1, 2, +Infinity), + [undefined, null, false, -Infinity, -0, +0, 1, 2, +Infinity], "Falsy arguments"); + + a.h1("Null context"); + a.deep(t.call(null, 'abc'), ['abc'], "String"); + a.deep(t.call(null, undefined), [undefined], "Undefined"); + a.deep(t.call(null, null), [null], "Null"); + a.deep(t.call(null, false), [false], "Boolean"); + a.deep(t.call(null, -Infinity), [-Infinity], "-Infinity"); + a.deep(t.call(null, -0), [-0], "-0"); + a.deep(t.call(null, +0), [+0], "+0"); + a.deep(t.call(null, 1), [1], "1"); + a.deep(t.call(null, 1, 2, 3), [1, 2, 3], "Numeric"); + a.deep(t.call(null, +Infinity), [+Infinity], "+Infinity"); + a.deep(t.call(null, { '0': 'a', '1': 'b', '2': 'c', length: 3 }), + [{ '0': 'a', '1': 'b', '2': 'c', length: 3 }], "Array-like"); + a.deep(t.call(null, undefined, null, false, -Infinity, -0, +0, 1, 2, +Infinity), + [undefined, null, false, -Infinity, -0, +0, 1, 2, +Infinity], "Falsy"); + + a.h1("Other constructor context"); + a.deep(t.call(Object, 1, 2, 3), { '0': 1, '1': 2, '2': 3, length: 3 }, "Many arguments"); + + testObject = Object(3); + testObject[0] = 1; + testObject[1] = 2; + testObject[2] = 3; + testObject.length = 3; + a.deep(t.call(Object, 1, 2, 3), testObject, "Test object"); + a(t.call(Object).length, 0, "No arguments"); + a.throws(function () { t.call(function () { return Object.freeze({}); }); }, TypeError, + "Frozen instance"); + + // Ensure no setters are called for the indexes + MyType = function () {}; + defineProperty(MyType.prototype, '0', { + set: function (x) { throw new Error('Setter called: ' + x); } + }); + a.deep(t.call(MyType, 'abc'), { '0': 'abc', length: 1 }, "Define, not set"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/to-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/to-array.js new file mode 100644 index 0000000000..4985b5eaee --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/to-array.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + var o = [1, 2, 3]; + a(t(o), o, "Array"); + a.deep(t('12r3v'), ['1', '2', 'r', '3', 'v'], "String"); + a.deep(t((function () { return arguments; }(3, o, 'raz'))), + [3, o, 'raz'], "Arguments"); + a.deep(t((function () { return arguments; }(3))), [3], + "Arguments with one numeric value"); + + a.deep(t({ 0: 'raz', 1: 'dwa', length: 2 }), ['raz', 'dwa'], "Other"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/valid-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/valid-array.js new file mode 100644 index 0000000000..3732192d1b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/array/valid-array.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Null"); + a.throws(function () { t(0); }, TypeError, "Number"); + a.throws(function () { t(true); }, TypeError, "Boolean"); + a.throws(function () { t('raz'); }, TypeError, "String"); + a.throws(function () { t(function () {}); }, TypeError, "Function"); + a.throws(function () { t({}); }, TypeError, "Object"); + a.throws(function () { t({ length: 0 }); }, TypeError, "Array-like"); + a(t(x = []), x, "Array"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/boolean/is-boolean.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/boolean/is-boolean.js new file mode 100644 index 0000000000..4e6b3cb73e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/boolean/is-boolean.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a(t('arar'), false, "String"); + a(t(12), false, "Number"); + a(t(false), true, "Boolean"); + a(t(new Boolean(false)), true, "Boolean object"); + a(t(new Date()), false, "Date"); + a(t(new String('raz')), false, "String object"); + a(t({}), false, "Plain object"); + a(t(/a/), false, "Regular expression"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/copy.js new file mode 100644 index 0000000000..767c5e16a4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/copy.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var o = new Date(), o2; + + o2 = t.call(o); + a.not(o, o2, "Different objects"); + a.ok(o2 instanceof Date, "Instance of Date"); + a(o.getTime(), o2.getTime(), "Same time"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/days-in-month.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/days-in-month.js new file mode 100644 index 0000000000..9ddba55f74 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/days-in-month.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(new Date(2001, 0, 1)), 31, "January"); + a(t.call(new Date(2001, 1, 1)), 28, "February"); + a(t.call(new Date(2000, 1, 1)), 29, "February (leap)"); + a(t.call(new Date(2001, 2, 1)), 31, "March"); + a(t.call(new Date(2001, 3, 1)), 30, "April"); + a(t.call(new Date(2001, 4, 1)), 31, "May"); + a(t.call(new Date(2001, 5, 1)), 30, "June"); + a(t.call(new Date(2001, 6, 1)), 31, "July"); + a(t.call(new Date(2001, 7, 1)), 31, "August"); + a(t.call(new Date(2001, 8, 1)), 30, "September"); + a(t.call(new Date(2001, 9, 1)), 31, "October"); + a(t.call(new Date(2001, 10, 1)), 30, "November"); + a(t.call(new Date(2001, 11, 1)), 31, "December"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-day.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-day.js new file mode 100644 index 0000000000..d4f4a9087c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-day.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(new Date(2000, 0, 1, 13, 32, 34, 234)).valueOf(), + new Date(2000, 0, 1).valueOf()); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-month.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-month.js new file mode 100644 index 0000000000..b4a81bef6d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-month.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(new Date(2000, 0, 15, 13, 32, 34, 234)).valueOf(), + new Date(2000, 0, 1).valueOf()); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-year.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-year.js new file mode 100644 index 0000000000..aae117e769 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/floor-year.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(new Date(2000, 5, 13, 13, 32, 34, 234)).valueOf(), + new Date(2000, 0, 1).valueOf()); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/format.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/format.js new file mode 100644 index 0000000000..e68e4bf782 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/#/format.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + var dt = new Date(2011, 2, 3, 3, 5, 5, 32); + a(t.call(dt, ' %Y.%y.%m.%d.%H.%M.%S.%L '), ' 2011.11.03.03.03.05.05.032 '); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/is-date.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/is-date.js new file mode 100644 index 0000000000..109093dfbe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/is-date.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t('arar'), false, "String"); + a(t(12), false, "Number"); + a(t(true), false, "Boolean"); + a(t(new Date()), true, "Date"); + a(t(new String('raz')), false, "String object"); + a(t({}), false, "Plain object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/valid-date.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/valid-date.js new file mode 100644 index 0000000000..98787e4078 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/date/valid-date.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var d = new Date(); + a(t(d), d, "Date"); + a.throws(function () { + t({}); + }, "Object"); + a.throws(function () { + t({ valueOf: function () { return 20; } }); + }, "Number object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/#/throw.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/#/throw.js new file mode 100644 index 0000000000..1213cfc3b1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/#/throw.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var e = new Error(); + try { + t.call(e); + } catch (e2) { + a(e2, e); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/custom.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/custom.js new file mode 100644 index 0000000000..d4ff500c9b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/custom.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var T = t, err = new T('My Error', 'MY_ERROR', { errno: 123 }); + a(err instanceof Error, true, "Instance of error"); + a(err.constructor, Error, "Constructor"); + a(err.name, 'Error', "Name"); + a(String(err), 'Error: My Error', "String representation"); + a(err.code, 'MY_ERROR', "Code"); + a(err.errno, 123, "Errno"); + a(typeof err.stack, 'string', "Stack trace"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/is-error.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/is-error.js new file mode 100644 index 0000000000..f8b5e2000e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/is-error.js @@ -0,0 +1,16 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(), false, "Undefined"); + a(t(1), false, "Primitive"); + a(t({}), false, "Objectt"); + a(t({ toString: function () { return '[object Error]'; } }), false, + "Fake error"); + a(t(new Error()), true, "Error"); + a(t(new EvalError()), true, "EvalError"); + a(t(new RangeError()), true, "RangeError"); + a(t(new ReferenceError()), true, "ReferenceError"); + a(t(new SyntaxError()), true, "SyntaxError"); + a(t(new TypeError()), true, "TypeError"); + a(t(new URIError()), true, "URIError"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/valid-error.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/valid-error.js new file mode 100644 index 0000000000..e04cdb33b7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/error/valid-error.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + var e = new Error(); + a(t(e), e, "Error"); + a.throws(function () { + t({}); + }, "Other"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/compose.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/compose.js new file mode 100644 index 0000000000..83de5e844a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/compose.js @@ -0,0 +1,9 @@ +'use strict'; + +var f = function (a, b) { return ['a', arguments.length, a, b]; } + , g = function (a) { return ['b', arguments.length].concat(a); } + , h = function (a) { return ['c', arguments.length].concat(a); }; + +module.exports = function (t, a) { + a.deep(t.call(h, g, f)(1, 2), ['c', 1, 'b', 1, 'a', 2, 1, 2]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/copy.js new file mode 100644 index 0000000000..7a22e2f249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/copy.js @@ -0,0 +1,19 @@ +'use strict'; + +module.exports = function (t, a) { + var foo = 'raz', bar = 'dwa' + , fn = function marko(a, b) { return this + a + b + foo + bar; } + , result, o = {}; + + fn.prototype = o; + + fn.foo = 'raz'; + + result = t.call(fn); + + a(result.length, fn.length, "Length"); + a(result.name, fn.name, "Length"); + a(result.call('marko', 'el', 'fe'), 'markoelferazdwa', "Body"); + a(result.prototype, fn.prototype, "Prototype"); + a(result.foo, fn.foo, "Custom property"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/curry.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/curry.js new file mode 100644 index 0000000000..18fb0389e7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/curry.js @@ -0,0 +1,18 @@ +'use strict'; + +var toArray = require('../../../array/to-array') + + , f = function () { return toArray(arguments); }; + +module.exports = function (t, a) { + var x, y = {}, z; + a.deep(t.call(f, 0, 1, 2)(3), [], "0 arguments"); + x = t.call(f, 5, {}); + a(x.length, 5, "Length #1"); + z = x(1, 2); + a(z.length, 3, "Length #2"); + z = z(3, 4); + a(z.length, 1, "Length #1"); + a.deep(z(5, 6), [1, 2, 3, 4, 5], "Many arguments"); + a.deep(x(8, 3)(y, 45)('raz', 6), [8, 3, y, 45, 'raz'], "Many arguments #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/lock.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/lock.js new file mode 100644 index 0000000000..44a12d7b56 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/lock.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(function () { + return arguments.length; + })(1, 2, 3), 0); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/not.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/not.js new file mode 100644 index 0000000000..c0f5e9d4b9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/not.js @@ -0,0 +1,11 @@ +'use strict'; + +var identity = require('../../../function/identity') + , noop = require('../../../function/noop'); + +module.exports = function (t, a) { + a(t.call(identity)(''), true, "Falsy"); + a(t.call(noop)(), true, "Undefined"); + a(t.call(identity)({}), false, "Any object"); + a(t.call(identity)(true), false, "True"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/partial.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/partial.js new file mode 100644 index 0000000000..bd00ce752f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/partial.js @@ -0,0 +1,9 @@ +'use strict'; + +var toArray = require('../../../array/to-array') + + , f = function () { return toArray(arguments); }; + +module.exports = function (t, a) { + a.deep(t.call(f, 1)(2, 3), [1, 2, 3]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/spread.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/spread.js new file mode 100644 index 0000000000..b82dfecfe9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/spread.js @@ -0,0 +1,8 @@ +'use strict'; + +var f = function (a, b) { return this[a] + this[b]; } + , o = { a: 3, b: 4 }; + +module.exports = function (t, a) { + a(t.call(f).call(o, ['a', 'b']), 7); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/to-string-tokens.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/to-string-tokens.js new file mode 100644 index 0000000000..4c54d30354 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/#/to-string-tokens.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t.call(function (a, b) { return this[a] + this[b]; }), + { args: 'a, b', body: ' return this[a] + this[b]; ' }); + a.deep(t.call(function () {}), + { args: '', body: '' }); + a.deep(t.call(function (raz) {}), + { args: 'raz', body: '' }); + a.deep(t.call(function () { Object(); }), + { args: '', body: ' Object(); ' }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/_define-length.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/_define-length.js new file mode 100644 index 0000000000..8f037e857e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/_define-length.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var foo = 'raz', bar = 'dwa' + , fn = function (a, b) { return this + a + b + foo + bar; } + , result; + + result = t(fn, 3); + a(result.call('marko', 'el', 'fe'), 'markoelferazdwa', "Content"); + a(result.length, 3, "Length"); + a(result.prototype, fn.prototype, "Prototype"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/constant.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/constant.js new file mode 100644 index 0000000000..fda52aa437 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/constant.js @@ -0,0 +1,7 @@ +'use strict'; + +var o = {}; + +module.exports = function (t, a) { + a(t(o)(), o); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/identity.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/identity.js new file mode 100644 index 0000000000..8013e2e5af --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/identity.js @@ -0,0 +1,7 @@ +'use strict'; + +var o = {}; + +module.exports = function (t, a) { + a(t(o), o); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/invoke.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/invoke.js new file mode 100644 index 0000000000..fcce4aaaaa --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/invoke.js @@ -0,0 +1,9 @@ +'use strict'; + +var constant = require('../../function/constant') + + , o = { b: constant('c') }; + +module.exports = function (t, a) { + a(t('b')(o), 'c'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-arguments.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-arguments.js new file mode 100644 index 0000000000..f8de8812a5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-arguments.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + var args, dummy; + args = (function () { return arguments; }()); + dummy = { '0': 1, '1': 2 }; + Object.defineProperty(dummy, 'length', { value: 2 }); + a(t(args), true, "Arguments"); + a(t(dummy), false, "Dummy"); + a(t([]), false, "Array"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-function.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-function.js new file mode 100644 index 0000000000..83acc42f9a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/is-function.js @@ -0,0 +1,8 @@ +'use strict'; + +var o = { call: Function.prototype.call, apply: Function.prototype.apply }; + +module.exports = function (t, a) { + a(t(function () {}), true, "Function is function"); + a(t(o), false, "Plain object is not function"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/noop.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/noop.js new file mode 100644 index 0000000000..4305c6fcfd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/noop.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(typeof t(1, 2, 3), 'undefined'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/pluck.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/pluck.js new file mode 100644 index 0000000000..5bf9583ad5 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/pluck.js @@ -0,0 +1,7 @@ +'use strict'; + +var o = { foo: 'bar' }; + +module.exports = function (t, a) { + a(t('foo')(o), o.foo); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/valid-function.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/valid-function.js new file mode 100644 index 0000000000..59b16233b3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/function/valid-function.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = function (t, a) { + var f = function () {}; + a(t(f), f, "Function"); + f = new Function(); + a(t(f), f, "Function"); + a.throws(function () { + t({}); + }, "Object"); + a.throws(function () { + t(/re/); + }, "RegExp"); + a.throws(function () { + t({ call: function () { return 20; } }); + }, "Plain object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/global.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/global.js new file mode 100644 index 0000000000..1f452aefb0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/global.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a.ok(t && typeof t === 'object'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/for-each.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/for-each.js new file mode 100644 index 0000000000..0fed8ad898 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/for-each.js @@ -0,0 +1,40 @@ +'use strict'; + +var ArrayIterator = require('es6-iterator/array') + + , slice = Array.prototype.slice; + +module.exports = function (t, a) { + var i = 0, x = ['raz', 'dwa', 'trzy'], y = {}; + t(x, function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Array " + i + "#"); + a(this, y, "Array: context: " + (i++) + "#"); + }, y); + i = 0; + t((function () { return arguments; }('raz', 'dwa', 'trzy')), function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Arguments" + i + "#"); + a(this, y, "Arguments: context: " + (i++) + "#"); + }, y); + i = 0; + t({ 0: 'raz', 1: 'dwa', 2: 'trzy', length: 3 }, function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Array-like" + i + "#"); + a(this, y, "Array-like: context: " + (i++) + "#"); + }, y); + i = 0; + t(x = 'foo', function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "String " + i + "#"); + a(this, y, "Regular String: context: " + (i++) + "#"); + }, y); + i = 0; + x = ['r', '💩', 'z']; + t('r💩z', function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "String " + i + "#"); + a(this, y, "Unicode String: context: " + (i++) + "#"); + }, y); + i = 0; + t(new ArrayIterator(x), function () { + a.deep(slice.call(arguments, 0, 1), [x[i]], "Iterator " + i + "#"); + a(this, y, "Iterator: context: " + (i++) + "#"); + }, y); + +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/is.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/is.js new file mode 100644 index 0000000000..c0d2a43ebf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/is.js @@ -0,0 +1,20 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (t, a) { + var x; + a(t([]), true, "Array"); + a(t(""), true, "String"); + a(t((function () { return arguments; }())), true, "Arguments"); + a(t({ length: 0 }), true, "List object"); + a(t(function () {}), false, "Function"); + a(t({}), false, "Plain object"); + a(t(/raz/), false, "Regexp"); + a(t(), false, "No argument"); + a(t(null), false, "Null"); + a(t(undefined), false, "Undefined"); + x = {}; + x[iteratorSymbol] = function () {}; + a(t(x), true, "Iterable"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate-object.js new file mode 100644 index 0000000000..da12529bc0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate-object.js @@ -0,0 +1,20 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(0); }, TypeError, "0"); + a.throws(function () { t(false); }, TypeError, "false"); + a.throws(function () { t(''); }, TypeError, "String"); + a.throws(function () { t({}); }, TypeError, "Plain Object"); + a.throws(function () { t(function () {}); }, TypeError, "Function"); + a(t(x = new String('raz')), x, "String object"); //jslint: ignore + + a(t(x = { length: 1 }), x, "Array like"); + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "null"); + x = {}; + x[iteratorSymbol] = function () {}; + a(t(x), x, "Iterable"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate.js new file mode 100644 index 0000000000..bcc2ad3d0a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/iterable/validate.js @@ -0,0 +1,20 @@ +'use strict'; + +var iteratorSymbol = require('es6-symbol').iterator; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(0); }, TypeError, "0"); + a.throws(function () { t(false); }, TypeError, "false"); + a(t(''), '', "''"); + a.throws(function () { t({}); }, TypeError, "Plain Object"); + a.throws(function () { t(function () {}); }, TypeError, "Function"); + a(t(x = new String('raz')), x, "String object"); //jslint: ignore + + a(t(x = { length: 1 }), x, "Array like"); + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "null"); + x = {}; + x[iteratorSymbol] = function () {}; + a(t(x), x, "Iterable"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_pack-ieee754.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_pack-ieee754.js new file mode 100644 index 0000000000..9041431d77 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_pack-ieee754.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t(1.337, 8, 23), [63, 171, 34, 209]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_unpack-ieee754.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_unpack-ieee754.js new file mode 100644 index 0000000000..ca30b8208d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/_unpack-ieee754.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t([63, 171, 34, 209], 8, 23), 1.3370000123977661); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/implement.js new file mode 100644 index 0000000000..01fb6d0822 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/acosh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/shim.js new file mode 100644 index 0000000000..3d710c7930 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/acosh/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(-1), NaN, "Negative"); + a(t(0), NaN, "Zero"); + a(t(0.5), NaN, "Below 1"); + a(t(1), 0, "1"); + a(t(2), 1.3169578969248166, "Other"); + a(t(Infinity), Infinity, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/implement.js new file mode 100644 index 0000000000..d1fceceee1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/asinh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/shim.js new file mode 100644 index 0000000000..d9fbe49edc --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/asinh/shim.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -Infinity, "-Infinity"); + a(t(-2), -1.4436354751788103, "Negative"); + a(t(2), 1.4436354751788103, "Positive"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/implement.js new file mode 100644 index 0000000000..cba8fad83e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/atanh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/shim.js new file mode 100644 index 0000000000..a857b49668 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/atanh/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(-2), NaN, "Less than -1"); + a(t(2), NaN, "Greater than 1"); + a(t(-1), -Infinity, "-1"); + a(t(1), Infinity, "1"); + a(t(0), 0, "Zero"); + a(t(0.5), 0.5493061443340549, "Ohter"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/implement.js new file mode 100644 index 0000000000..374d4b383f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/cbrt/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/shim.js new file mode 100644 index 0000000000..43ab68b848 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cbrt/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -Infinity, "-Infinity"); + a(t(-1), -1, "-1"); + a(t(1), 1, "1"); + a(t(2), 1.2599210498948732, "Ohter"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/implement.js new file mode 100644 index 0000000000..44f8815526 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/clz32/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/shim.js new file mode 100644 index 0000000000..a769b39b85 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/clz32/shim.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(1), 31, "1"); + a(t(1000), 22, "1000"); + a(t(), 32, "No arguments"); + a(t(Infinity), 32, "Infinity"); + a(t(-Infinity), 32, "-Infinity"); + a(t("foo"), 32, "String"); + a(t(true), 31, "Boolean"); + a(t(3.5), 30, "Float"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/implement.js new file mode 100644 index 0000000000..f3c712b1df --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/cosh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/shim.js new file mode 100644 index 0000000000..419c12367d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/cosh/shim.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 1, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), Infinity, "-Infinity"); + a(t(1), 1.5430806348152437, "1"); + a(t(Number.MAX_VALUE), Infinity); + a(t(-Number.MAX_VALUE), Infinity); + a(t(Number.MIN_VALUE), 1); + a(t(-Number.MIN_VALUE), 1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/implement.js new file mode 100644 index 0000000000..c21296725d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/expm1/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/shim.js new file mode 100644 index 0000000000..15f0e796ce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/expm1/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -1, "-Infinity"); + a(t(1).toFixed(15), '1.718281828459045', "1"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/implement.js new file mode 100644 index 0000000000..c909af7c30 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/fround/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/shim.js new file mode 100644 index 0000000000..4ef6d4ea9b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/fround/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -Infinity, "-Infinity"); + a(t(1.337), 1.3370000123977661, "1"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/implement.js new file mode 100644 index 0000000000..99466464c1 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/hypot/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/shim.js new file mode 100644 index 0000000000..91d950a5d3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/hypot/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(), 0, "No arguments"); + a(t(0, -0, 0), 0, "Zeros"); + a(t(4, NaN, Infinity), Infinity, "Infinity"); + a(t(4, NaN, -Infinity), Infinity, "Infinity"); + a(t(4, NaN, 34), NaN, "NaN"); + a(t(3, 4), 5, "#1"); + a(t(3, 4, 5), 7.0710678118654755, "#2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/implement.js new file mode 100644 index 0000000000..7b2a2a6165 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/imul/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/shim.js new file mode 100644 index 0000000000..a2ca7fe783 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/imul/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(), 0, "No arguments"); + a(t(0, 0), 0, "Zeros"); + a(t(2, 4), 8, "#1"); + a(t(-1, 8), -8, "#2"); + a(t(0xfffffffe, 5), -10, "#3"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/implement.js new file mode 100644 index 0000000000..4b3b4a4569 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/log10/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/shim.js new file mode 100644 index 0000000000..5fa0d5be3a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log10/shim.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(-0.5), NaN, "Less than 0"); + a(t(0), -Infinity, "0"); + a(t(1), 0, "1"); + a(t(Infinity), Infinity, "Infinity"); + a(t(2), 0.3010299956639812, "Other"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/implement.js new file mode 100644 index 0000000000..5d269bd3ea --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/log1p/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/shim.js new file mode 100644 index 0000000000..d495ce0496 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log1p/shim.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(-1.5), NaN, "Less than -1"); + a(t(-1), -Infinity, "-1"); + a(t(0), 0, "0"); + a(t(Infinity), Infinity, "Infinity"); + a(t(1), 0.6931471805599453, "Other"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/implement.js new file mode 100644 index 0000000000..92b501ac72 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/log2/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/shim.js new file mode 100644 index 0000000000..faa9c32a85 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/log2/shim.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(-0.5), NaN, "Less than 0"); + a(t(0), -Infinity, "0"); + a(t(1), 0, "1"); + a(t(Infinity), Infinity, "Infinity"); + a(t(3).toFixed(15), '1.584962500721156', "Other"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/implement.js new file mode 100644 index 0000000000..5875c42d60 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/sign/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/shim.js new file mode 100644 index 0000000000..b6b89c1588 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sign/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +var is = require('../../../object/is'); + +module.exports = function (t, a) { + a(is(t(0), +0), true, "+0"); + a(is(t(-0), -0), true, "-0"); + a(t({}), NaN, true, "NaN"); + a(t(-234234234), -1, "Negative"); + a(t(234234234), 1, "Positive"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/implement.js new file mode 100644 index 0000000000..e52089e450 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/sinh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/shim.js new file mode 100644 index 0000000000..4f63b59e73 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/sinh/shim.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -Infinity, "-Infinity"); + a(t(1), 1.1752011936438014, "1"); + a(t(Number.MAX_VALUE), Infinity); + a(t(-Number.MAX_VALUE), -Infinity); + a(t(Number.MIN_VALUE), 5e-324); + a(t(-Number.MIN_VALUE), -5e-324); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/implement.js new file mode 100644 index 0000000000..a96bf19336 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/tanh/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/shim.js new file mode 100644 index 0000000000..2c67aaf470 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/tanh/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), 1, "Infinity"); + a(t(-Infinity), -1, "-Infinity"); + a(t(1), 0.7615941559557649, "1"); + a(t(Number.MAX_VALUE), 1); + a(t(-Number.MAX_VALUE), -1); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/implement.js new file mode 100644 index 0000000000..1830e61f69 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../math/trunc/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/shim.js new file mode 100644 index 0000000000..9e5eed7910 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/math/trunc/shim.js @@ -0,0 +1,16 @@ +'use strict'; + +var is = require('../../../object/is'); + +module.exports = function (t, a) { + a(t({}), NaN, "NaN"); + a(t(0), 0, "Zero"); + a(t(Infinity), Infinity, "Infinity"); + a(t(-Infinity), -Infinity, "-Infinity"); + a(is(t(0.234), 0), true, "0"); + a(is(t(-0.234), -0), true, "-0"); + a(t(13.7), 13, "Positive #1"); + a(t(12.3), 12, "Positive #2"); + a(t(-12.3), -12, "Negative #1"); + a(t(-14.7), -14, "Negative #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/#/pad.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/#/pad.js new file mode 100644 index 0000000000..e020823533 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/#/pad.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(78, 4), '0078'); + a(t.call(65.12323, 4, 3), '0065.123', "Precision"); + a(t.call(65, 4, 3), '0065.000', "Precision integer"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/implement.js new file mode 100644 index 0000000000..574da75dce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/epsilon/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/index.js new file mode 100644 index 0000000000..c892fd47d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(typeof t, 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/epsilon/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/implement.js new file mode 100644 index 0000000000..b35345fa6e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/is-finite/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/shim.js new file mode 100644 index 0000000000..5205d1c260 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-finite/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(2), true, "Number"); + a(t('23'), false, "Not numeric"); + a(t(NaN), false, "NaN"); + a(t(Infinity), false, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/implement.js new file mode 100644 index 0000000000..127149ceed --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/is-integer/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/shim.js new file mode 100644 index 0000000000..3f3985c3a0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-integer/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(2), true, "Number"); + a(t(2.34), false, "Float"); + a(t('23'), false, "Not numeric"); + a(t(NaN), false, "NaN"); + a(t(Infinity), false, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/implement.js new file mode 100644 index 0000000000..2f01d6d30a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/is-nan/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/shim.js new file mode 100644 index 0000000000..425723e74b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-nan/shim.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(2), false, "Number"); + a(t({}), false, "Not numeric"); + a(t(NaN), true, "NaN"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-natural.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-natural.js new file mode 100644 index 0000000000..d56f12042b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-natural.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(2), true, "Number"); + a(t(-2), false, "Negative"); + a(t(2.34), false, "Float"); + a(t('23'), false, "Not numeric"); + a(t(NaN), false, "NaN"); + a(t(Infinity), false, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-number.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-number.js new file mode 100644 index 0000000000..275133476a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-number.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(0), true, "Zero"); + a(t(NaN), true, "NaN"); + a(t(Infinity), true, "Infinity"); + a(t(12), true, "Number"); + a(t(false), false, "Boolean"); + a(t(new Date()), false, "Date"); + a(t(new Number(2)), true, "Number object"); + a(t('asdfaf'), false, "String"); + a(t(''), false, "Empty String"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/implement.js new file mode 100644 index 0000000000..33667e2e9a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/is-safe-integer/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/shim.js new file mode 100644 index 0000000000..77e0667471 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/is-safe-integer/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(2), true, "Number"); + a(t(2.34), false, "Float"); + a(t(Math.pow(2, 53)), false, "Too large"); + a(t(Math.pow(2, 53) - 1), true, "Maximum"); + a(t('23'), false, "Not numeric"); + a(t(NaN), false, "NaN"); + a(t(Infinity), false, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/implement.js new file mode 100644 index 0000000000..bef00ca413 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/max-safe-integer/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/index.js new file mode 100644 index 0000000000..c892fd47d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(typeof t, 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/max-safe-integer/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/implement.js new file mode 100644 index 0000000000..fa440248bf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../number/min-safe-integer/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/index.js new file mode 100644 index 0000000000..c892fd47d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/index.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(typeof t, 'number'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/min-safe-integer/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-integer.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-integer.js new file mode 100644 index 0000000000..ff326ba7a9 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-integer.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), 0, "NaN"); + a(t(20), 20, "Positive integer"); + a(t('-20'), -20, "String negative integer"); + a(t(Infinity), Infinity, "Infinity"); + a(t(15.343), 15, "Float"); + a(t(-15.343), -15, "Negative float"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-pos-integer.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-pos-integer.js new file mode 100644 index 0000000000..2f3b4e674e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-pos-integer.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), 0, "NaN"); + a(t(20), 20, "Positive integer"); + a(t(-20), 0, "Negative integer"); + a(t(Infinity), Infinity, "Infinity"); + a(t(15.343), 15, "Float"); + a(t(-15.343), 0, "Negative float"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-uint32.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-uint32.js new file mode 100644 index 0000000000..00d05bdfe3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/number/to-uint32.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), 0, "Not numeric"); + a(t(-4), 4294967292, "Negative"); + a(t(133432), 133432, "Positive"); + a(t(8589934592), 0, "Greater than maximum"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/_iterate.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/_iterate.js new file mode 100644 index 0000000000..179afed88e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/_iterate.js @@ -0,0 +1,30 @@ +'use strict'; + +module.exports = function (t, a) { + var o = { raz: 1, dwa: 2, trzy: 3 } + , o2 = {}, o3 = {}, arr, i = -1; + + t = t('forEach'); + t(o, function (value, name, self, index) { + o2[name] = value; + a(index, ++i, "Index"); + a(self, o, "Self"); + a(this, o3, "Scope"); + }, o3); + a.deep(o2, o); + + arr = []; + o2 = {}; + i = -1; + t(o, function (value, name, self, index) { + arr.push(value); + o2[name] = value; + a(index, ++i, "Index"); + a(self, o, "Self"); + a(this, o3, "Scope"); + }, o3, function (a, b) { + return o[b] - o[a]; + }); + a.deep(o2, o, "Sort by Values: Content"); + a.deep(arr, [3, 2, 1], "Sort by Values: Order"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/implement.js new file mode 100644 index 0000000000..4006559418 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../object/assign/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/shim.js new file mode 100644 index 0000000000..9afe5f658c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/assign/shim.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + var o1 = { a: 1, b: 2 } + , o2 = { b: 3, c: 4 }; + + a(t(o1, o2), o1, "Returns self"); + a.deep(o1, { a: 1, b: 3, c: 4 }, "Single: content"); + + a.deep(t({}, o1, o2), { a: 1, b: 3, c: 4 }, "Multi argument"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/clear.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/clear.js new file mode 100644 index 0000000000..bfc08cc208 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/clear.js @@ -0,0 +1,13 @@ +'use strict'; + +var isEmpty = require('../../object/is-empty'); + +module.exports = function (t, a) { + var x = {}; + a(t(x), x, "Empty: Returns same object"); + a(isEmpty(x), true, "Empty: Not changed"); + x.foo = 'raz'; + x.bar = 'dwa'; + a(t(x), x, "Same object"); + a(isEmpty(x), true, "Emptied"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compact.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compact.js new file mode 100644 index 0000000000..9c9064c788 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compact.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}, y = {}, z; + z = t(x); + a.not(z, x, "Returns different object"); + a.deep(z, {}, "Empty on empty"); + + x = { foo: 'bar', a: 0, b: false, c: '', d: '0', e: null, bar: y, + elo: undefined }; + z = t(x); + a.deep(z, { foo: 'bar', a: 0, b: false, c: '', d: '0', bar: y }, + "Cleared null values"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compare.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compare.js new file mode 100644 index 0000000000..cb9424109c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/compare.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + var d = new Date(); + + a.ok(t(12, 3) > 0, "Numbers"); + a.ok(t(2, 13) < 0, "Numbers #2"); + a.ok(t("aaa", "aa") > 0, "Strings"); + a.ok(t("aa", "ab") < 0, "Strings #2"); + a(t("aa", "aa"), 0, "Strings same"); + a(t(d, new Date(d.getTime())), 0, "Same date"); + a.ok(t(d, new Date(d.getTime() + 1)) < 0, "Different date"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy-deep.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy-deep.js new file mode 100644 index 0000000000..79e02be49e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy-deep.js @@ -0,0 +1,28 @@ +'use strict'; + +var stringify = JSON.stringify; + +module.exports = function (t, a) { + var o = { 1: 'raz', 2: 'dwa', 3: 'trzy' } + , no = t(o); + + a.not(no, o, "Return different object"); + a(stringify(no), stringify(o), "Match properties and values"); + + o = { foo: 'bar', raz: { dwa: 'dwa', + trzy: { cztery: 'pięć', 'sześć': 'siedem' }, osiem: {}, + 'dziewięć': function () { } }, + 'dziesięć': 10, "jedenaście": ['raz', ['dwa', 'trzy', { elo: "true" }]] }; + o.raz.rec = o; + + no = t(o); + a.not(o.raz, no.raz, "Deep"); + a.not(o.raz.trzy, no.raz.trzy, "Deep #2"); + a(stringify(o.raz.trzy), stringify(no.raz.trzy), "Deep content"); + a(no.raz.rec, no, "Recursive"); + a.not(o.raz.osiem, no.raz.osiem, "Empty object"); + a(o.raz['dziewięć'], no.raz['dziewięć'], "Function"); + a.not(o['jedenaście'], no['jedenaście']); + a.not(o['jedenaście'][1], no['jedenaście'][1]); + a.not(o['jedenaście'][1][2], no['jedenaście'][1][2]); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy.js new file mode 100644 index 0000000000..2f222ef809 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/copy.js @@ -0,0 +1,19 @@ +'use strict'; + +var stringify = JSON.stringify; + +module.exports = function (t, a) { + var o = { 1: 'raz', 2: 'dwa', 3: 'trzy' } + , no = t(o); + + a.not(no, o, "Return different object"); + a(stringify(no), stringify(o), "Match properties and values"); + + o = { foo: 'bar', raz: { dwa: 'dwa', + trzy: { cztery: 'pięć', 'sześć': 'siedem' }, osiem: {}, + 'dziewięć': function () { } }, 'dziesięć': 10 }; + o.raz.rec = o; + + no = t(o); + a(o.raz, no.raz, "Shallow"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/count.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/count.js new file mode 100644 index 0000000000..494f4f1635 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/count.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), 0, "Empty"); + a(t({ raz: 1, dwa: null, trzy: undefined, cztery: 0 }), 4, + "Some properties"); + a(t(Object.defineProperties({}, { + raz: { value: 'raz' }, + dwa: { value: 'dwa', enumerable: true } + })), 1, "Some properties hidden"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/create.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/create.js new file mode 100644 index 0000000000..8b7be21413 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/create.js @@ -0,0 +1,22 @@ +'use strict'; + +var setPrototypeOf = require('../../object/set-prototype-of') + + , getPrototypeOf = Object.getPrototypeOf; + +module.exports = function (t, a) { + var x = {}, obj; + + a(getPrototypeOf(t(x)), x, "Normal object"); + a(getPrototypeOf(t(null)), + (setPrototypeOf && setPrototypeOf.nullPolyfill) || null, "Null"); + + a.h1("Properties"); + a.h2("Normal object"); + a(getPrototypeOf(obj = t(x, { foo: { value: 'bar' } })), x, "Prototype"); + a(obj.foo, 'bar', "Property"); + a.h2("Null"); + a(getPrototypeOf(obj = t(null, { foo: { value: 'bar2' } })), + (setPrototypeOf && setPrototypeOf.nullPolyfill) || null, "Prototype"); + a(obj.foo, 'bar2', "Property"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number-value.js new file mode 100644 index 0000000000..dde23986ba --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number-value.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a.throws(function () { t(undefined); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Null"); + a(t(2), 2, "Number"); + a.throws(function () { t(-2); }, TypeError, "Negative"); + a.throws(function () { t(2.34); }, TypeError, "Float"); + a(t('23'), 23, "Numeric string"); + a.throws(function () { t(NaN); }, TypeError, "NaN"); + a.throws(function () { t(Infinity); }, TypeError, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number.js new file mode 100644 index 0000000000..5ebed1e524 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/ensure-natural-number.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a.throws(function () { t(undefined); }, TypeError, "Undefined"); + a(t(null), 0, "Null"); + a(t(2), 2, "Number"); + a.throws(function () { t(-2); }, TypeError, "Negative"); + a.throws(function () { t(2.34); }, TypeError, "Float"); + a(t('23'), 23, "Numeric string"); + a.throws(function () { t(NaN); }, TypeError, "NaN"); + a.throws(function () { t(Infinity); }, TypeError, "Infinity"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/eq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/eq.js new file mode 100644 index 0000000000..02b3f0027c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/eq.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var o = {}; + a(t(o, {}), false, "Different objects"); + a(t(o, o), true, "Same objects"); + a(t('1', '1'), true, "Same primitive"); + a(t('1', 1), false, "Different primitive types"); + a(t(NaN, NaN), true, "NaN"); + a(t(0, 0), true, "0,0"); + a(t(0, -0), true, "0,-0"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/every.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/every.js new file mode 100644 index 0000000000..07d5bbbd61 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/every.js @@ -0,0 +1,21 @@ +'use strict'; + +var o = { 1: 1, 2: 2, 3: 3 }; + +module.exports = function (t, a) { + var o2 = {}; + t(o, function (value, name) { + o2[name] = value; + return true; + }); + a(JSON.stringify(o2), JSON.stringify(o), "Iterates"); + + a(t(o, function () { + return true; + }), true, "Succeeds"); + + a(t(o, function () { + return false; + }), false, "Fails"); + +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/filter.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/filter.js new file mode 100644 index 0000000000..7307da8640 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/filter.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t({ 1: 1, 2: 2, 3: 3, 4: 4 }, + function (value) { return Boolean(value % 2); }), { 1: 1, 3: 3 }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find-key.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find-key.js new file mode 100644 index 0000000000..cca834d936 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find-key.js @@ -0,0 +1,23 @@ +'use strict'; + +var o = { 1: 1, 2: 2, 3: 3 }; + +module.exports = function (t, a) { + var o2 = {}, i = 0; + t(o, function (value, name) { + o2[name] = value; + return false; + }); + a(JSON.stringify(o2), JSON.stringify(o), "Iterates"); + + a(t(o, function () { + ++i; + return true; + }), '1', "Finds"); + a(i, 1, "Stops iteration after condition is met"); + + a(t(o, function () { + return false; + }), undefined, "Fails"); + +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find.js new file mode 100644 index 0000000000..b6ad60a542 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/find.js @@ -0,0 +1,23 @@ +'use strict'; + +var o = { 1: 1, 2: 2, 3: 3 }; + +module.exports = function (t, a) { + var o2 = {}, i = 0; + t(o, function (value, name) { + o2[name] = value; + return false; + }); + a(JSON.stringify(o2), JSON.stringify(o), "Iterates"); + + a(t(o, function () { + ++i; + return true; + }), 1, "Finds"); + a(i, 1, "Stops iteration after condition is met"); + + a(t(o, function () { + return false; + }), undefined, "Fails"); + +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/first-key.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/first-key.js new file mode 100644 index 0000000000..8169cd2353 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/first-key.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}, y = Object.create(null); + a(t(x), null, "Normal: Empty"); + a(t(y), null, "Null extension: Empty"); + x.foo = 'raz'; + x.bar = 343; + a(['foo', 'bar'].indexOf(t(x)) !== -1, true, "Normal"); + y.elo = 'foo'; + y.mar = 'wew'; + a(['elo', 'mar'].indexOf(t(y)) !== -1, true, "Null extension"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/flatten.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/flatten.js new file mode 100644 index 0000000000..ca342eab9c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/flatten.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t({ a: { aa: 1, ab: 2 }, b: { ba: 3, bb: 4 } }), + { aa: 1, ab: 2, ba: 3, bb: 4 }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/for-each.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/for-each.js new file mode 100644 index 0000000000..8690d1e821 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/for-each.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var o = { raz: 1, dwa: 2, trzy: 3 } + , o2 = {}; + a(t(o, function (value, name) { + o2[name] = value; + }), undefined, "Return"); + a.deep(o2, o); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/get-property-names.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/get-property-names.js new file mode 100644 index 0000000000..b91c3dd50e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/get-property-names.js @@ -0,0 +1,18 @@ +'use strict'; + +module.exports = function (t, a) { + var o = { first: 1, second: 4 }, r1, r2; + o = Object.create(o, { + third: { value: null } + }); + o.first = 2; + o = Object.create(o); + o.fourth = 3; + + r1 = t(o); + r1.sort(); + r2 = ['first', 'second', 'third', 'fourth'] + .concat(Object.getOwnPropertyNames(Object.prototype)); + r2.sort(); + a.deep(r1, r2); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-array-like.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-array-like.js new file mode 100644 index 0000000000..6295973ca8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-array-like.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function (t, a) { + a(t([]), true, "Array"); + a(t(""), true, "String"); + a(t((function () { return arguments; }())), true, "Arguments"); + a(t({ length: 0 }), true, "List object"); + a(t(function () {}), false, "Function"); + a(t({}), false, "Plain object"); + a(t(/raz/), false, "Regexp"); + a(t(), false, "No argument"); + a(t(null), false, "Null"); + a(t(undefined), false, "Undefined"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-callable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-callable.js new file mode 100644 index 0000000000..625e221d2c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-callable.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(function () {}), true, "Function"); + a(t({}), false, "Object"); + a(t(), false, "Undefined"); + a(t(null), false, "Null"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy-deep.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy-deep.js new file mode 100644 index 0000000000..4f14cbbe81 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy-deep.js @@ -0,0 +1,46 @@ +'use strict'; + +module.exports = function (t, a) { + var x, y; + + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2, 3: 3 }), true, "Same"); + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2, 3: 4 }), false, + "Different property value"); + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2 }), false, + "Property only in source"); + a(t({ 1: 1, 2: 2 }, { 1: 1, 2: 2, 3: 4 }), false, + "Property only in target"); + + a(t("raz", "dwa"), false, "String: diff"); + a(t("raz", "raz"), true, "String: same"); + a(t("32", 32), false, "String & Number"); + + a(t([1, 'raz', true], [1, 'raz', true]), true, "Array: same"); + a(t([1, 'raz', undefined], [1, 'raz']), false, "Array: diff"); + a(t(['foo'], ['one']), false, "Array: One value comparision"); + + x = { foo: { bar: { mar: {} } } }; + y = { foo: { bar: { mar: {} } } }; + a(t(x, y), true, "Deep"); + + a(t({ foo: { bar: { mar: 'foo' } } }, { foo: { bar: { mar: {} } } }), + false, "Deep: false"); + + x = { foo: { bar: { mar: {} } } }; + x.rec = { foo: x }; + + y = { foo: { bar: { mar: {} } } }; + y.rec = { foo: x }; + + a(t(x, y), true, "Object: Infinite Recursion: Same #1"); + + x.rec.foo = y; + a(t(x, y), true, "Object: Infinite Recursion: Same #2"); + + x.rec.foo = x; + y.rec.foo = y; + a(t(x, y), true, "Object: Infinite Recursion: Same #3"); + + y.foo.bar.mar = 'raz'; + a(t(x, y), false, "Object: Infinite Recursion: Diff"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy.js new file mode 100644 index 0000000000..394e2ed94c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-copy.js @@ -0,0 +1,18 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2, 3: 3 }), true, "Same"); + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2, 3: 4 }), false, + "Different property value"); + a(t({ 1: 1, 2: 2, 3: 3 }, { 1: 1, 2: 2 }), false, + "Property only in source"); + a(t({ 1: 1, 2: 2 }, { 1: 1, 2: 2, 3: 4 }), false, + "Property only in target"); + + a(t("raz", "dwa"), false, "String: diff"); + a(t("raz", "raz"), true, "String: same"); + a(t("32", 32), false, "String & Number"); + + a(t([1, 'raz', true], [1, 'raz', true]), true, "Array: same"); + a(t([1, 'raz', undefined], [1, 'raz']), false, "Array: diff"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-empty.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-empty.js new file mode 100644 index 0000000000..b560c2c36b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-empty.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), true, "Empty"); + a(t({ 1: 1 }), false, "Not empty"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-number-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-number-value.js new file mode 100644 index 0000000000..21b6b62032 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-number-value.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(undefined), false, "Undefined"); + a(t(null), false, "Null"); + a(t(0), true, "Zero"); + a(t(NaN), false, "NaN"); + a(t(Infinity), true, "Infinity"); + a(t(12), true, "Number"); + a(t(false), true, "Boolean"); + a(t(new Date()), true, "Date"); + a(t(new Number(2)), true, "Number object"); + a(t('asdfaf'), false, "String"); + a(t(''), true, "Empty String"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-object.js new file mode 100644 index 0000000000..72c8aa6daf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-object.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function (t, a) { + a(t('arar'), false, "String"); + a(t(12), false, "Number"); + a(t(true), false, "Boolean"); + a(t(null), false, "Null"); + a(t(new Date()), true, "Date"); + a(t(new String('raz')), true, "String object"); + a(t({}), true, "Plain object"); + a(t(/a/), true, "Regular expression"); + a(t(function () {}), true, "Function"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-plain-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-plain-object.js new file mode 100644 index 0000000000..e988829d55 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is-plain-object.js @@ -0,0 +1,18 @@ +'use strict'; + +module.exports = function (t, a) { + a(t({}), true, "Empty {} is plain object"); + a(t({ a: true }), true, "{} with property is plain object"); + a(t({ prototype: 1, constructor: 2, __proto__: 3 }), true, + "{} with any property keys is plain object"); + a(t(null), false, "Null is not plain object"); + a(t('string'), false, "Primitive is not plain object"); + a(t(function () {}), false, "Function is not plain object"); + a(t(Object.create({})), false, + "Object whose prototype is not Object.prototype is not plain object"); + a(t(Object.create(Object.prototype)), true, + "Object whose prototype is Object.prototype is plain object"); + a(t(Object.create(null)), true, + "Object whose prototype is null is plain object"); + a(t(Object.prototype), false, "Object.prototype"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is.js new file mode 100644 index 0000000000..4f8948cbf3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/is.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var o = {}; + a(t(o, {}), false, "Different objects"); + a(t(o, o), true, "Same objects"); + a(t('1', '1'), true, "Same primitive"); + a(t('1', 1), false, "Different primitive types"); + a(t(NaN, NaN), true, "NaN"); + a(t(0, 0), true, "0,0"); + a(t(0, -0), false, "0,-0"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/key-of.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/key-of.js new file mode 100644 index 0000000000..a9225a048c --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/key-of.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + var x = {}, y = {} + , o = { foo: 'bar', raz: x, trzy: 'cztery', five: '6' }; + + a(t(o, 'bar'), 'foo', "First property"); + a(t(o, 6), null, "Primitive that's not there"); + a(t(o, x), 'raz', "Object"); + a(t(o, y), null, "Object that's not there"); + a(t(o, '6'), 'five', "Last property"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/implement.js new file mode 100644 index 0000000000..179e1e5612 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../object/keys/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/shim.js new file mode 100644 index 0000000000..ed29eebcd7 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/keys/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t({ foo: 'bar' }), ['foo'], "Object"); + a.deep(t('raz'), ['0', '1', '2'], "Primitive"); + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Undefined"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map-keys.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map-keys.js new file mode 100644 index 0000000000..be84825b1b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map-keys.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t({ 1: 1, 2: 2, 3: 3 }, function (key, value) { + return 'x' + (key + value); + }), { x11: 1, x22: 2, x33: 3 }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map.js new file mode 100644 index 0000000000..f9cc09c01b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/map.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + var obj = { 1: 1, 2: 2, 3: 3 }; + a.deep(t(obj, function (value, key, context) { + a(context, obj, "Context argument"); + return (value + 1) + key; + }), { 1: '21', 2: '32', 3: '43' }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin-prototypes.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin-prototypes.js new file mode 100644 index 0000000000..d1c727a95a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin-prototypes.js @@ -0,0 +1,67 @@ +'use strict'; + +module.exports = function (t, a) { + var o, o1, o2, x, y = {}, z = {}; + o = { inherited: true, visible: 23 }; + o1 = Object.create(o); + o1.visible = z; + o1.nonremovable = 'raz'; + Object.defineProperty(o1, 'hidden', { value: 'hidden' }); + + o2 = Object.defineProperties({}, { nonremovable: { value: y } }); + o2.other = 'other'; + + try { t(o2, o1); } catch (ignore) {} + + a(o2.visible, z, "Enumerable"); + a(o1.hidden, 'hidden', "Not Enumerable"); + a(o2.propertyIsEnumerable('visible'), true, "Enumerable is enumerable"); + a(o2.propertyIsEnumerable('hidden'), false, + "Not enumerable is not enumerable"); + + a(o2.inherited, true, "Extend deep"); + + a(o2.nonremovable, y, "Do not overwrite non configurable"); + a(o2.other, 'other', "Own kept"); + + x = {}; + t(x, o2); + try { t(x, o1); } catch (ignore) {} + + a(x.visible, z, "Enumerable"); + a(x.hidden, 'hidden', "Not Enumerable"); + a(x.propertyIsEnumerable('visible'), true, "Enumerable is enumerable"); + a(x.propertyIsEnumerable('hidden'), false, + "Not enumerable is not enumerable"); + + a(x.inherited, true, "Extend deep"); + + a(x.nonremovable, y, "Ignored non configurable"); + a(x.other, 'other', "Other"); + + x.visible = 3; + a(x.visible, 3, "Writable is writable"); + + x = {}; + t(x, o1); + a.throws(function () { + x.hidden = 3; + }, "Not writable is not writable"); + + x = {}; + t(x, o1); + delete x.visible; + a.ok(!x.hasOwnProperty('visible'), "Configurable is configurable"); + + x = {}; + t(x, o1); + a.throws(function () { + delete x.hidden; + }, "Not configurable is not configurable"); + + x = Object.defineProperty({}, 'foo', + { configurable: false, writable: true, enumerable: false, value: 'bar' }); + + try { t(x, { foo: 'lorem' }); } catch (ignore) {} + a(x.foo, 'bar', "Writable, not enumerable"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin.js new file mode 100644 index 0000000000..866005b03d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/mixin.js @@ -0,0 +1,69 @@ +'use strict'; + +module.exports = function (t, a) { + var o, o1, o2, x, y = {}, z = {}; + o = { inherited: true }; + o1 = Object.create(o); + o1.visible = z; + o1.nonremovable = 'raz'; + Object.defineProperty(o1, 'hidden', { value: 'hidden' }); + + o2 = Object.defineProperties({}, { nonremovable: { value: y } }); + o2.other = 'other'; + + try { t(o2, o1); } catch (ignore) {} + + a(o2.visible, z, "Enumerable"); + a(o1.hidden, 'hidden', "Not Enumerable"); + a(o2.propertyIsEnumerable('visible'), true, "Enumerable is enumerable"); + a(o2.propertyIsEnumerable('hidden'), false, + "Not enumerable is not enumerable"); + + a(o2.hasOwnProperty('inherited'), false, "Extend only own"); + a(o2.inherited, undefined, "Extend ony own: value"); + + a(o2.nonremovable, y, "Do not overwrite non configurable"); + a(o2.other, 'other', "Own kept"); + + x = {}; + t(x, o2); + try { t(x, o1); } catch (ignore) {} + + a(x.visible, z, "Enumerable"); + a(x.hidden, 'hidden', "Not Enumerable"); + a(x.propertyIsEnumerable('visible'), true, "Enumerable is enumerable"); + a(x.propertyIsEnumerable('hidden'), false, + "Not enumerable is not enumerable"); + + a(x.hasOwnProperty('inherited'), false, "Extend only own"); + a(x.inherited, undefined, "Extend ony own: value"); + + a(x.nonremovable, y, "Ignored non configurable"); + a(x.other, 'other', "Other"); + + x.visible = 3; + a(x.visible, 3, "Writable is writable"); + + x = {}; + t(x, o1); + a.throws(function () { + x.hidden = 3; + }, "Not writable is not writable"); + + x = {}; + t(x, o1); + delete x.visible; + a.ok(!x.hasOwnProperty('visible'), "Configurable is configurable"); + + x = {}; + t(x, o1); + a.throws(function () { + delete x.hidden; + }, "Not configurable is not configurable"); + + x = Object.defineProperty({}, 'foo', + { configurable: false, writable: true, enumerable: false, value: 'bar' }); + + try { t(x, { foo: 'lorem' }); } catch (ignore) {} + a(x.foo, 'bar', "Writable, not enumerable"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/normalize-options.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/normalize-options.js new file mode 100644 index 0000000000..0d2d4da04a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/normalize-options.js @@ -0,0 +1,32 @@ +'use strict'; + +var create = Object.create, defineProperty = Object.defineProperty; + +module.exports = function (t, a) { + var x = { foo: 'raz', bar: 'dwa' }, y; + y = t(x); + a.not(y, x, "Returns copy"); + a.deep(y, x, "Plain"); + + x = { raz: 'one', dwa: 'two' }; + defineProperty(x, 'get', { + configurable: true, + enumerable: true, + get: function () { return this.dwa; } + }); + x = create(x); + x.trzy = 'three'; + x.cztery = 'four'; + x = create(x); + x.dwa = 'two!'; + x.trzy = 'three!'; + x.piec = 'five'; + x.szesc = 'six'; + + a.deep(t(x), { raz: 'one', dwa: 'two!', trzy: 'three!', cztery: 'four', + piec: 'five', szesc: 'six', get: 'two!' }, "Deep object"); + + a.deep(t({ marko: 'raz', raz: 'foo' }, x, { szesc: 'elo', siedem: 'bibg' }), + { marko: 'raz', raz: 'one', dwa: 'two!', trzy: 'three!', cztery: 'four', + piec: 'five', szesc: 'elo', siedem: 'bibg', get: 'two!' }, "Multiple options"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/primitive-set.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/primitive-set.js new file mode 100644 index 0000000000..839857eab3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/primitive-set.js @@ -0,0 +1,15 @@ +'use strict'; + +var getPropertyNames = require('../../object/get-property-names') + , isPlainObject = require('../../object/is-plain-object'); + +module.exports = function (t, a) { + var x = t(); + a(isPlainObject(x), true, "Plain object"); + a.deep(getPropertyNames(x), [], "No properties"); + x.foo = 'bar'; + a.deep(getPropertyNames(x), ['foo'], "Extensible"); + + a.deep(t('raz', 'dwa', 3), { raz: true, dwa: true, 3: true }, + "Arguments handling"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/safe-traverse.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/safe-traverse.js new file mode 100644 index 0000000000..d30cdefe68 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/safe-traverse.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var obj = { foo: { bar: { lorem: 12 } } }; + a(t(obj), obj, "No props"); + a(t(obj, 'foo'), obj.foo, "One"); + a(t(obj, 'raz'), undefined, "One: Fail"); + a(t(obj, 'foo', 'bar'), obj.foo.bar, "Two"); + a(t(obj, 'dsd', 'raz'), undefined, "Two: Fail #1"); + a(t(obj, 'foo', 'raz'), undefined, "Two: Fail #2"); + a(t(obj, 'foo', 'bar', 'lorem'), obj.foo.bar.lorem, "Three"); + a(t(obj, 'dsd', 'raz', 'fef'), undefined, "Three: Fail #1"); + a(t(obj, 'foo', 'raz', 'asdf'), undefined, "Three: Fail #2"); + a(t(obj, 'foo', 'bar', 'asd'), undefined, "Three: Fail #3"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/serialize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/serialize.js new file mode 100644 index 0000000000..43eed6a861 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/serialize.js @@ -0,0 +1,25 @@ +'use strict'; + +module.exports = function (t, a) { + var fn = function (raz, dwa) { return raz + dwa; }; + a(t(), 'undefined', "Undefined"); + a(t(null), 'null', "Null"); + a(t(null), 'null', "Null"); + a(t('raz'), '"raz"', "String"); + a(t('raz"ddwa\ntrzy'), '"raz\\"ddwa\\ntrzy"', "String with escape"); + a(t(false), 'false', "Booelean"); + a(t(fn), String(fn), "Function"); + + a(t(/raz-dwa/g), '/raz-dwa/g', "RegExp"); + a(t(new Date(1234567)), 'new Date(1234567)', "Date"); + a(t([]), '[]', "Empty array"); + a(t([undefined, false, null, 'raz"ddwa\ntrzy', fn, /raz/g, new Date(1234567), ['foo']]), + '[undefined,false,null,"raz\\"ddwa\\ntrzy",' + String(fn) + + ',/raz/g,new Date(1234567),["foo"]]', "Rich Array"); + a(t({}), '{}', "Empty object"); + a(t({ raz: undefined, dwa: false, trzy: null, cztery: 'raz"ddwa\ntrzy', piec: fn, szesc: /raz/g, + siedem: new Date(1234567), osiem: ['foo', 32], dziewiec: { foo: 'bar', dwa: 343 } }), + '{"raz":undefined,"dwa":false,"trzy":null,"cztery":"raz\\"ddwa\\ntrzy","piec":' + String(fn) + + ',"szesc":/raz/g,"siedem":new Date(1234567),"osiem":["foo",32],' + + '"dziewiec":{"foo":"bar","dwa":343}}', "Rich object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/implement.js new file mode 100644 index 0000000000..30b2ac4b96 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +var create = require('../../../object/create') + , isImplemented = require('../../../object/set-prototype-of/is-implemented'); + +module.exports = function (a) { a(isImplemented(create), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/index.js new file mode 100644 index 0000000000..aec2605cc2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/index.js @@ -0,0 +1,23 @@ +'use strict'; + +var create = require('../../../object/create') + + , getPrototypeOf = Object.getPrototypeOf; + +module.exports = function (t, a) { + var x = {}, y = {}; + + if (t === null) return; + a(t(x, y), x, "Return self object"); + a(getPrototypeOf(x), y, "Object"); + a.throws(function () { t(x); }, TypeError, "Undefined"); + a.throws(function () { t('foo'); }, TypeError, "Primitive"); + a(getPrototypeOf(t(x, null)), t.nullPolyfill || null, "Null"); + x = create(null); + a.h1("Change null prototype"); + a(t(x, y), x, "Result"); + a(getPrototypeOf(x), y, "Prototype"); + a.h1("Set null prototype"); + a(t(y, null), y, "Result"); + a(getPrototypeOf(y), t.nullPolyfill || null, "Prototype"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/shim.js new file mode 100644 index 0000000000..aec2605cc2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/set-prototype-of/shim.js @@ -0,0 +1,23 @@ +'use strict'; + +var create = require('../../../object/create') + + , getPrototypeOf = Object.getPrototypeOf; + +module.exports = function (t, a) { + var x = {}, y = {}; + + if (t === null) return; + a(t(x, y), x, "Return self object"); + a(getPrototypeOf(x), y, "Object"); + a.throws(function () { t(x); }, TypeError, "Undefined"); + a.throws(function () { t('foo'); }, TypeError, "Primitive"); + a(getPrototypeOf(t(x, null)), t.nullPolyfill || null, "Null"); + x = create(null); + a.h1("Change null prototype"); + a(t(x, y), x, "Result"); + a(getPrototypeOf(x), y, "Prototype"); + a.h1("Set null prototype"); + a(t(y, null), y, "Result"); + a(getPrototypeOf(y), t.nullPolyfill || null, "Prototype"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/some.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/some.js new file mode 100644 index 0000000000..490431e7ac --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/some.js @@ -0,0 +1,23 @@ +'use strict'; + +var o = { 1: 1, 2: 2, 3: 3 }; + +module.exports = function (t, a) { + var o2 = {}, i = 0; + t(o, function (value, name) { + o2[name] = value; + return false; + }); + a(JSON.stringify(o2), JSON.stringify(o), "Iterates"); + + a(t(o, function () { + ++i; + return true; + }), true, "Succeeds"); + a(i, 1, "Stops iteration after condition is met"); + + a(t(o, function () { + return false; + }), false, "Fails"); + +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/to-array.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/to-array.js new file mode 100644 index 0000000000..1f4beef7ea --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/to-array.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var o = { 1: 1, 2: 2, 3: 3 }, o1 = {} + , o2 = t(o, function (value, name, self) { + a(self, o, "Self"); + a(this, o1, "Scope"); + return value + Number(name); + }, o1); + a.deep(o2, [2, 4, 6]); + + t(o).sort().forEach(function (item) { + a.deep(item, [item[0], o[item[0]]], "Default"); + }); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/unserialize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/unserialize.js new file mode 100644 index 0000000000..405eef112f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/unserialize.js @@ -0,0 +1,24 @@ +'use strict'; + +module.exports = function (t, a) { + var fn = function (raz, dwa) { return raz + dwa; }; + a(t('undefined'), undefined, "Undefined"); + a(t('null'), null, "Null"); + a(t('"raz"'), 'raz', "String"); + a(t('"raz\\"ddwa\\ntrzy"'), 'raz"ddwa\ntrzy', "String with escape"); + a(t('false'), false, "Booelean"); + a(String(t(String(fn))), String(fn), "Function"); + + a.deep(t('/raz-dwa/g'), /raz-dwa/g, "RegExp"); + a.deep(t('new Date(1234567)'), new Date(1234567), "Date"); + a.deep(t('[]'), [], "Empty array"); + a.deep(t('[undefined,false,null,"raz\\"ddwa\\ntrzy",/raz/g,new Date(1234567),["foo"]]'), + [undefined, false, null, 'raz"ddwa\ntrzy', /raz/g, new Date(1234567), ['foo']], "Rich Array"); + a.deep(t('{}'), {}, "Empty object"); + a.deep(t('{"raz":undefined,"dwa":false,"trzy":null,"cztery":"raz\\"ddwa\\ntrzy",' + + '"szesc":/raz/g,"siedem":new Date(1234567),"osiem":["foo",32],' + + '"dziewiec":{"foo":"bar","dwa":343}}'), + { raz: undefined, dwa: false, trzy: null, cztery: 'raz"ddwa\ntrzy', szesc: /raz/g, + siedem: new Date(1234567), osiem: ['foo', 32], dziewiec: { foo: 'bar', dwa: 343 } }, + "Rich object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-callable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-callable.js new file mode 100644 index 0000000000..b40540b6ba --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-callable.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + var f = function () {}; + a(t(f), f, "Function"); + a.throws(function () { + t({}); + }, "Not Function"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-object.js new file mode 100644 index 0000000000..eaa8e7bcb3 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-object.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(0); }, TypeError, "0"); + a.throws(function () { t(false); }, TypeError, "false"); + a.throws(function () { t(''); }, TypeError, "''"); + a(t(x = {}), x, "Object"); + a(t(x = function () {}), x, "Function"); + a(t(x = new String('raz')), x, "String object"); //jslint: ignore + a(t(x = new Date()), x, "Date"); + + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "null"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-value.js new file mode 100644 index 0000000000..f1eeafa977 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/valid-value.js @@ -0,0 +1,19 @@ +'use strict'; + +var numIsNaN = require('../../number/is-nan'); + +module.exports = function (t, a) { + var x; + a(t(0), 0, "0"); + a(t(false), false, "false"); + a(t(''), '', "''"); + a(numIsNaN(t(NaN)), true, "NaN"); + a(t(x = {}), x, "{}"); + + a.throws(function () { + t(); + }, "Undefined"); + a.throws(function () { + t(null); + }, "null"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like-object.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like-object.js new file mode 100644 index 0000000000..2f3e31b442 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like-object.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(0); }, TypeError, "0"); + a.throws(function () { t(false); }, TypeError, "false"); + a.throws(function () { t(''); }, TypeError, "String"); + a.throws(function () { t({}); }, TypeError, "Plain Object"); + a.throws(function () { t(function () {}); }, TypeError, "Function"); + a(t(x = new String('raz')), x, "String object"); //jslint: ignore + + a(t(x = { length: 1 }), x, "Array like"); + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "null"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like.js new file mode 100644 index 0000000000..53bd11249e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-array-like.js @@ -0,0 +1,15 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(0); }, TypeError, "0"); + a.throws(function () { t(false); }, TypeError, "false"); + a(t(''), '', "''"); + a.throws(function () { t({}); }, TypeError, "Plain Object"); + a.throws(function () { t(function () {}); }, TypeError, "Function"); + a(t(x = new String('raz')), x, "String object"); //jslint: ignore + + a(t(x = { length: 1 }), x, "Array like"); + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "null"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable-value.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable-value.js new file mode 100644 index 0000000000..ae9bd17a59 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable-value.js @@ -0,0 +1,16 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a.throws(function () { t(); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Null"); + a(t(0), "0"); + a(t(false), "false"); + a(t(''), ""); + a(t({}), String({}), "Object"); + a(t(x = function () {}), String(x), "Function"); + a(t(x = new String('raz')), String(x), "String object"); //jslint: ignore + a(t(x = new Date()), String(x), "Date"); + + a.throws(function () { t(Object.create(null)); }, TypeError, "Null prototype object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable.js new file mode 100644 index 0000000000..4a46bb5219 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/object/validate-stringifiable.js @@ -0,0 +1,16 @@ +'use strict'; + +module.exports = function (t, a) { + var x; + a(t(), 'undefined', "Undefined"); + a(t(null), 'null', "Null"); + a(t(0), "0"); + a(t(false), "false"); + a(t(''), ""); + a(t({}), String({}), "Object"); + a(t(x = function () {}), String(x), "Function"); + a(t(x = new String('raz')), String(x), "String object"); //jslint: ignore + a(t(x = new Date()), String(x), "Date"); + + a.throws(function () { t(Object.create(null)); }, TypeError, "Null prototype object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/index.js new file mode 100644 index 0000000000..ca2bd65061 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/index.js @@ -0,0 +1,12 @@ +'use strict'; + +var indexTest = require('tad/lib/utils/index-test') + + , path = require('path').resolve(__dirname, '../../../reg-exp/#'); + +module.exports = function (t, a, d) { + indexTest(indexTest.readDir(path).aside(function (data) { + delete data.sticky; + delete data.unicode; + }))(t, a, d); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-sticky.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-sticky.js new file mode 100644 index 0000000000..e154ac2916 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-sticky.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var re; + a(t.call(/raz/), false, "Normal"); + a(t.call(/raz/g), false, "Global"); + try { re = new RegExp('raz', 'y'); } catch (ignore) {} + if (!re) return; + a(t.call(re), true, "Sticky"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-unicode.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-unicode.js new file mode 100644 index 0000000000..2ffb9e869b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/is-unicode.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + var re; + a(t.call(/raz/), false, "Normal"); + a(t.call(/raz/g), false, "Global"); + try { re = new RegExp('raz', 'u'); } catch (ignore) {} + if (!re) return; + a(t.call(re), true, "Unicode"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/implement.js new file mode 100644 index 0000000000..89825a45f6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/match/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/shim.js new file mode 100644 index 0000000000..5249139fff --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/match/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + var result = ['foo']; + result.index = 0; + result.input = 'foobar'; + a.deep(t.call(/foo/, 'foobar'), result); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/implement.js new file mode 100644 index 0000000000..c32b23a6d0 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/replace/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/shim.js new file mode 100644 index 0000000000..2b378fd594 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/replace/shim.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(/foo/, 'foobar', 'mar'), 'marbar'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/implement.js new file mode 100644 index 0000000000..ff1b8087f2 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/search/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/shim.js new file mode 100644 index 0000000000..596bcdb92e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/search/shim.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(/foo/, 'barfoo'), 3); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/implement.js new file mode 100644 index 0000000000..1cee441806 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/split/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/shim.js new file mode 100644 index 0000000000..6a95cd03d6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/split/shim.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a.deep(t.call(/\|/, 'bar|foo'), ['bar', 'foo']); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/implement.js new file mode 100644 index 0000000000..d94e7b98d8 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/sticky/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/sticky/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/implement.js new file mode 100644 index 0000000000..9b1aa0f2ab --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../reg-exp/#/unicode/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/#/unicode/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/escape.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/escape.js new file mode 100644 index 0000000000..5b00f67f28 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/escape.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + var str = "(?:^te|er)s{2}t\\[raz]+$"; + a(RegExp('^' + t(str) + '$').test(str), true); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/is-reg-exp.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/is-reg-exp.js new file mode 100644 index 0000000000..785ca28c2e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/is-reg-exp.js @@ -0,0 +1,12 @@ +'use strict'; + +module.exports = function (t, a) { + a(t('arar'), false, "String"); + a(t(12), false, "Number"); + a(t(true), false, "Boolean"); + a(t(new Date()), false, "Date"); + a(t(new String('raz')), false, "String object"); + a(t({}), false, "Plain object"); + a(t(/a/), true, "Regular expression"); + a(t(new RegExp('a')), true, "Regular expression via constructor"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/valid-reg-exp.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/valid-reg-exp.js new file mode 100644 index 0000000000..cd12cf126a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/reg-exp/valid-reg-exp.js @@ -0,0 +1,17 @@ +'use strict'; + +module.exports = function (t, a) { + var r = /raz/; + a(t(r), r, "Direct"); + r = new RegExp('foo'); + a(t(r), r, "Constructor"); + a.throws(function () { + t({}); + }, "Object"); + a.throws(function () { + t(function () {}); + }, "Function"); + a.throws(function () { + t({ exec: function () { return 20; } }); + }, "Plain object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/implement.js new file mode 100644 index 0000000000..09bf3361ac --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/@@iterator/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/shim.js new file mode 100644 index 0000000000..3b0e0b7547 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/@@iterator/shim.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + var it = t.call('r💩z'); + a.deep(it.next(), { done: false, value: 'r' }, "#1"); + a.deep(it.next(), { done: false, value: '💩' }, "#2"); + a.deep(it.next(), { done: false, value: 'z' }, "#3"); + a.deep(it.next(), { done: true, value: undefined }, "End"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/at.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/at.js new file mode 100644 index 0000000000..2447a9f64d --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/at.js @@ -0,0 +1,97 @@ +// See tests at https://github.com/mathiasbynens/String.prototype.at + +'use strict'; + +module.exports = function (t, a) { + a(t.length, 1, "Length"); + + a.h1("BMP"); + a(t.call('abc\uD834\uDF06def', -Infinity), '', "-Infinity"); + a(t.call('abc\uD834\uDF06def', -1), '', "-1"); + a(t.call('abc\uD834\uDF06def', -0), 'a', "-0"); + a(t.call('abc\uD834\uDF06def', +0), 'a', "+0"); + a(t.call('abc\uD834\uDF06def', 1), 'b', "1"); + a(t.call('abc\uD834\uDF06def', 3), '\uD834\uDF06', "3"); + a(t.call('abc\uD834\uDF06def', 4), '\uDF06', "4"); + a(t.call('abc\uD834\uDF06def', 5), 'd', "5"); + a(t.call('abc\uD834\uDF06def', 42), '', "42"); + a(t.call('abc\uD834\uDF06def', +Infinity), '', "+Infinity"); + a(t.call('abc\uD834\uDF06def', null), 'a', "null"); + a(t.call('abc\uD834\uDF06def', undefined), 'a', "undefined"); + a(t.call('abc\uD834\uDF06def'), 'a', "No argument"); + a(t.call('abc\uD834\uDF06def', false), 'a', "false"); + a(t.call('abc\uD834\uDF06def', NaN), 'a', "NaN"); + a(t.call('abc\uD834\uDF06def', ''), 'a', "Empty string"); + a(t.call('abc\uD834\uDF06def', '_'), 'a', "_"); + a(t.call('abc\uD834\uDF06def', '1'), 'b', "'1'"); + a(t.call('abc\uD834\uDF06def', []), 'a', "[]"); + a(t.call('abc\uD834\uDF06def', {}), 'a', "{}"); + a(t.call('abc\uD834\uDF06def', -0.9), 'a', "-0.9"); + a(t.call('abc\uD834\uDF06def', 1.9), 'b', "1.9"); + a(t.call('abc\uD834\uDF06def', 7.9), 'f', "7.9"); + a(t.call('abc\uD834\uDF06def', Math.pow(2, 32)), '', "Big number"); + + a.h1("Astral symbol"); + a(t.call('\uD834\uDF06def', -Infinity), '', "-Infinity"); + a(t.call('\uD834\uDF06def', -1), '', "-1"); + a(t.call('\uD834\uDF06def', -0), '\uD834\uDF06', "-0"); + a(t.call('\uD834\uDF06def', +0), '\uD834\uDF06', "+0"); + a(t.call('\uD834\uDF06def', 1), '\uDF06', "1"); + a(t.call('\uD834\uDF06def', 2), 'd', "2"); + a(t.call('\uD834\uDF06def', 3), 'e', "3"); + a(t.call('\uD834\uDF06def', 4), 'f', "4"); + a(t.call('\uD834\uDF06def', 42), '', "42"); + a(t.call('\uD834\uDF06def', +Infinity), '', "+Infinity"); + a(t.call('\uD834\uDF06def', null), '\uD834\uDF06', "null"); + a(t.call('\uD834\uDF06def', undefined), '\uD834\uDF06', "undefined"); + a(t.call('\uD834\uDF06def'), '\uD834\uDF06', "No arguments"); + a(t.call('\uD834\uDF06def', false), '\uD834\uDF06', "false"); + a(t.call('\uD834\uDF06def', NaN), '\uD834\uDF06', "NaN"); + a(t.call('\uD834\uDF06def', ''), '\uD834\uDF06', "Empty string"); + a(t.call('\uD834\uDF06def', '_'), '\uD834\uDF06', "_"); + a(t.call('\uD834\uDF06def', '1'), '\uDF06', "'1'"); + + a.h1("Lone high surrogates"); + a(t.call('\uD834abc', -Infinity), '', "-Infinity"); + a(t.call('\uD834abc', -1), '', "-1"); + a(t.call('\uD834abc', -0), '\uD834', "-0"); + a(t.call('\uD834abc', +0), '\uD834', "+0"); + a(t.call('\uD834abc', 1), 'a', "1"); + a(t.call('\uD834abc', 42), '', "42"); + a(t.call('\uD834abc', +Infinity), '', "Infinity"); + a(t.call('\uD834abc', null), '\uD834', "null"); + a(t.call('\uD834abc', undefined), '\uD834', "undefined"); + a(t.call('\uD834abc'), '\uD834', "No arguments"); + a(t.call('\uD834abc', false), '\uD834', "false"); + a(t.call('\uD834abc', NaN), '\uD834', "NaN"); + a(t.call('\uD834abc', ''), '\uD834', "Empty string"); + a(t.call('\uD834abc', '_'), '\uD834', "_"); + a(t.call('\uD834abc', '1'), 'a', "'a'"); + + a.h1("Lone low surrogates"); + a(t.call('\uDF06abc', -Infinity), '', "-Infinity"); + a(t.call('\uDF06abc', -1), '', "-1"); + a(t.call('\uDF06abc', -0), '\uDF06', "-0"); + a(t.call('\uDF06abc', +0), '\uDF06', "+0"); + a(t.call('\uDF06abc', 1), 'a', "1"); + a(t.call('\uDF06abc', 42), '', "42"); + a(t.call('\uDF06abc', +Infinity), '', "+Infinity"); + a(t.call('\uDF06abc', null), '\uDF06', "null"); + a(t.call('\uDF06abc', undefined), '\uDF06', "undefined"); + a(t.call('\uDF06abc'), '\uDF06', "No arguments"); + a(t.call('\uDF06abc', false), '\uDF06', "false"); + a(t.call('\uDF06abc', NaN), '\uDF06', "NaN"); + a(t.call('\uDF06abc', ''), '\uDF06', "Empty string"); + a(t.call('\uDF06abc', '_'), '\uDF06', "_"); + a(t.call('\uDF06abc', '1'), 'a', "'1'"); + + a.h1("Context"); + a.throws(function () { t.call(undefined); }, TypeError, "Undefined"); + a.throws(function () { t.call(undefined, 4); }, TypeError, + "Undefined + argument"); + a.throws(function () { t.call(null); }, TypeError, "Null"); + a.throws(function () { t.call(null, 4); }, TypeError, "Null + argument"); + a(t.call(42, 0), '4', "Number #1"); + a(t.call(42, 1), '2', "Number #2"); + a(t.call({ toString: function () { return 'abc'; } }, 2), 'c', "Object"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/camel-to-hyphen.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/camel-to-hyphen.js new file mode 100644 index 0000000000..8b47a8158a --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/camel-to-hyphen.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('razDwaTRzy4yFoo45My'), 'raz-dwa-t-rzy4y-foo45-my'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/capitalize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/capitalize.js new file mode 100644 index 0000000000..fa11ff8eef --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/capitalize.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('raz'), 'Raz', "Word"); + a(t.call('BLA'), 'BLA', "Uppercase"); + a(t.call(''), '', "Empty"); + a(t.call('a'), 'A', "One letter"); + a(t.call('this is a test'), 'This is a test', "Sentence"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/case-insensitive-compare.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/case-insensitive-compare.js new file mode 100644 index 0000000000..01a90c39ce --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/case-insensitive-compare.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call("AA", "aa"), 0, "Same"); + a.ok(t.call("Amber", "zebra") < 0, "Less"); + a.ok(t.call("Zebra", "amber") > 0, "Greater"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/implement.js new file mode 100644 index 0000000000..5e33cd715f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/implement.js @@ -0,0 +1,6 @@ +'use strict'; + +var isImplemented = + require('../../../../string/#/code-point-at/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/shim.js new file mode 100644 index 0000000000..0df4751c56 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/code-point-at/shim.js @@ -0,0 +1,81 @@ +// Taken from: https://github.com/mathiasbynens/String.prototype.codePointAt +// /blob/master/tests/tests.js + +'use strict'; + +module.exports = function (t, a) { + a(t.length, 1, "Length"); + + // String that starts with a BMP symbol + a(t.call('abc\uD834\uDF06def', ''), 0x61); + a(t.call('abc\uD834\uDF06def', '_'), 0x61); + a(t.call('abc\uD834\uDF06def'), 0x61); + a(t.call('abc\uD834\uDF06def', -Infinity), undefined); + a(t.call('abc\uD834\uDF06def', -1), undefined); + a(t.call('abc\uD834\uDF06def', -0), 0x61); + a(t.call('abc\uD834\uDF06def', 0), 0x61); + a(t.call('abc\uD834\uDF06def', 3), 0x1D306); + a(t.call('abc\uD834\uDF06def', 4), 0xDF06); + a(t.call('abc\uD834\uDF06def', 5), 0x64); + a(t.call('abc\uD834\uDF06def', 42), undefined); + a(t.call('abc\uD834\uDF06def', Infinity), undefined); + a(t.call('abc\uD834\uDF06def', Infinity), undefined); + a(t.call('abc\uD834\uDF06def', NaN), 0x61); + a(t.call('abc\uD834\uDF06def', false), 0x61); + a(t.call('abc\uD834\uDF06def', null), 0x61); + a(t.call('abc\uD834\uDF06def', undefined), 0x61); + + // String that starts with an astral symbol + a(t.call('\uD834\uDF06def', ''), 0x1D306); + a(t.call('\uD834\uDF06def', '1'), 0xDF06); + a(t.call('\uD834\uDF06def', '_'), 0x1D306); + a(t.call('\uD834\uDF06def'), 0x1D306); + a(t.call('\uD834\uDF06def', -1), undefined); + a(t.call('\uD834\uDF06def', -0), 0x1D306); + a(t.call('\uD834\uDF06def', 0), 0x1D306); + a(t.call('\uD834\uDF06def', 1), 0xDF06); + a(t.call('\uD834\uDF06def', 42), undefined); + a(t.call('\uD834\uDF06def', false), 0x1D306); + a(t.call('\uD834\uDF06def', null), 0x1D306); + a(t.call('\uD834\uDF06def', undefined), 0x1D306); + + // Lone high surrogates + a(t.call('\uD834abc', ''), 0xD834); + a(t.call('\uD834abc', '_'), 0xD834); + a(t.call('\uD834abc'), 0xD834); + a(t.call('\uD834abc', -1), undefined); + a(t.call('\uD834abc', -0), 0xD834); + a(t.call('\uD834abc', 0), 0xD834); + a(t.call('\uD834abc', false), 0xD834); + a(t.call('\uD834abc', NaN), 0xD834); + a(t.call('\uD834abc', null), 0xD834); + a(t.call('\uD834abc', undefined), 0xD834); + + // Lone low surrogates + a(t.call('\uDF06abc', ''), 0xDF06); + a(t.call('\uDF06abc', '_'), 0xDF06); + a(t.call('\uDF06abc'), 0xDF06); + a(t.call('\uDF06abc', -1), undefined); + a(t.call('\uDF06abc', -0), 0xDF06); + a(t.call('\uDF06abc', 0), 0xDF06); + a(t.call('\uDF06abc', false), 0xDF06); + a(t.call('\uDF06abc', NaN), 0xDF06); + a(t.call('\uDF06abc', null), 0xDF06); + a(t.call('\uDF06abc', undefined), 0xDF06); + + a.throws(function () { t.call(undefined); }, TypeError); + a.throws(function () { t.call(undefined, 4); }, TypeError); + a.throws(function () { t.call(null); }, TypeError); + a.throws(function () { t.call(null, 4); }, TypeError); + a(t.call(42, 0), 0x34); + a(t.call(42, 1), 0x32); + a(t.call({ toString: function () { return 'abc'; } }, 2), 0x63); + + a.throws(function () { t.apply(undefined); }, TypeError); + a.throws(function () { t.apply(undefined, [4]); }, TypeError); + a.throws(function () { t.apply(null); }, TypeError); + a.throws(function () { t.apply(null, [4]); }, TypeError); + a(t.apply(42, [0]), 0x34); + a(t.apply(42, [1]), 0x32); + a(t.apply({ toString: function () { return 'abc'; } }, [2]), 0x63); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/implement.js new file mode 100644 index 0000000000..220f50d467 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/contains/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/shim.js new file mode 100644 index 0000000000..a0ea4db208 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/contains/shim.js @@ -0,0 +1,14 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('raz', ''), true, "Empty"); + a(t.call('', ''), true, "Both Empty"); + a(t.call('raz', 'raz'), true, "Same"); + a(t.call('razdwa', 'raz'), true, "Starts with"); + a(t.call('razdwa', 'dwa'), true, "Ends with"); + a(t.call('razdwa', 'zdw'), true, "In middle"); + a(t.call('', 'raz'), false, "Something in empty"); + a(t.call('az', 'raz'), false, "Longer"); + a(t.call('azasdfasdf', 'azff'), false, "Not found"); + a(t.call('razdwa', 'raz', 1), false, "Position"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/implement.js new file mode 100644 index 0000000000..93bd2ddcd6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/ends-with/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/shim.js new file mode 100644 index 0000000000..e4b93c407b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/ends-with/shim.js @@ -0,0 +1,16 @@ +// In some parts copied from: +// http://closure-library.googlecode.com/svn/trunk/closure/goog/ +// string/string_test.html + +'use strict'; + +module.exports = function (t, a) { + a(t.call('abc', ''), true, "Empty needle"); + a(t.call('abcd', 'cd'), true, "Ends with needle"); + a(t.call('abcd', 'abcd'), true, "Needle equals haystack"); + a(t.call('abcd', 'ab'), false, "Doesn't end with needle"); + a(t.call('abc', 'defg'), false, "Length trick"); + a(t.call('razdwa', 'zd', 3), false, "Position: false"); + a(t.call('razdwa', 'zd', 4), true, "Position: true"); + a(t.call('razdwa', 'zd', 5), false, "Position: false #2"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/hyphen-to-camel.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/hyphen-to-camel.js new file mode 100644 index 0000000000..bd7ded4bef --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/hyphen-to-camel.js @@ -0,0 +1,5 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('raz-dwa-t-rzy-4y-rtr4-tiu-45-pa'), 'razDwaTRzy4yRtr4Tiu45Pa'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/indent.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/indent.js new file mode 100644 index 0000000000..eb92b36f54 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/indent.js @@ -0,0 +1,9 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('ra\nzz', ''), 'ra\nzz', "Empty"); + a(t.call('ra\nzz', '\t', 3), '\t\t\tra\n\t\t\tzz', "String repeat"); + a(t.call('ra\nzz\nsss\nfff\n', '\t'), '\tra\n\tzz\n\tsss\n\tfff\n', + "Multi-line"); + a(t.call('ra\n\nzz\n', '\t'), '\tra\n\n\tzz\n', "Don't touch empty lines"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/last.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/last.js new file mode 100644 index 0000000000..ad36a213c6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/last.js @@ -0,0 +1,6 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call(''), null, "Null"); + a(t.call('abcdef'), 'f', "String"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/_data.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/_data.js new file mode 100644 index 0000000000..c741addb00 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/_data.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t[0], 'object'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/implement.js new file mode 100644 index 0000000000..4886c9b834 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/normalize/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/shim.js new file mode 100644 index 0000000000..28e27f5952 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/normalize/shim.js @@ -0,0 +1,13 @@ +// Taken from: https://github.com/walling/unorm/blob/master/test/es6-shim.js + +'use strict'; + +var str = 'äiti'; + +module.exports = function (t, a) { + a(t.call(str), "\u00e4iti"); + a(t.call(str, "NFC"), "\u00e4iti"); + a(t.call(str, "NFD"), "a\u0308iti"); + a(t.call(str, "NFKC"), "\u00e4iti"); + a(t.call(str, "NFKD"), "a\u0308iti"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/pad.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/pad.js new file mode 100644 index 0000000000..28c3fcaa10 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/pad.js @@ -0,0 +1,24 @@ +'use strict'; + +var partial = require('../../../function/#/partial'); + +module.exports = { + Left: function (t, a) { + t = partial.call(t, 'x', 5); + + a(t.call('yy'), 'xxxyy'); + a(t.call(''), 'xxxxx', "Empty string"); + + a(t.call('yyyyy'), 'yyyyy', 'Equal length'); + a(t.call('yyyyyyy'), 'yyyyyyy', 'Longer'); + }, + Right: function (t, a) { + t = partial.call(t, 'x', -5); + + a(t.call('yy'), 'yyxxx'); + a(t.call(''), 'xxxxx', "Empty string"); + + a(t.call('yyyyy'), 'yyyyy', 'Equal length'); + a(t.call('yyyyyyy'), 'yyyyyyy', 'Longer'); + } +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace-all.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace-all.js new file mode 100644 index 0000000000..a425c87a40 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace-all.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('razdwatrzy', 'dwa', 'olera'), 'razoleratrzy', "Basic"); + a(t.call('razdwatrzy', 'dwa', 'ole$&a'), 'razole$&atrzy', "Inserts"); + a(t.call('razdwa', 'ola', 'sdfs'), 'razdwa', "No replace"); + + a(t.call('$raz$$dwa$trzy$', '$', '&&'), '&&raz&&&&dwa&&trzy&&', "Multi"); + a(t.call('$raz$$dwa$$$$trzy$', '$$', '&'), '$raz&dwa&&trzy$', + "Multi many chars"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace.js new file mode 100644 index 0000000000..54522ed749 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/plain-replace.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('razdwatrzy', 'dwa', 'olera'), 'razoleratrzy', "Basic"); + a(t.call('razdwatrzy', 'dwa', 'ole$&a'), 'razole$&atrzy', "Inserts"); + a(t.call('razdwa', 'ola', 'sdfs'), 'razdwa', "No replace"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/implement.js new file mode 100644 index 0000000000..7ff65a8110 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/repeat/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/shim.js new file mode 100644 index 0000000000..7e0d077ec4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/repeat/shim.js @@ -0,0 +1,8 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('a', 0), '', "Empty"); + a(t.call('a', 1), 'a', "1"); + a(t.call('\t', 5), '\t\t\t\t\t', "Whitespace"); + a(t.call('raz', 3), 'razrazraz', "Many chars"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/implement.js new file mode 100644 index 0000000000..fc8490fc91 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../../string/#/starts-with/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/shim.js new file mode 100644 index 0000000000..e0e123b324 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/starts-with/shim.js @@ -0,0 +1,14 @@ +// Inspired and in some parts copied from: +// http://closure-library.googlecode.com/svn/trunk/closure/goog +// /string/string_test.html + +'use strict'; + +module.exports = function (t, a) { + a(t.call('abc', ''), true, "Empty needle"); + a(t.call('abcd', 'ab'), true, "Starts with needle"); + a(t.call('abcd', 'abcd'), true, "Needle equals haystack"); + a(t.call('abcd', 'bcde', 1), false, "Needle larger than haystack"); + a(!t.call('abcd', 'cd'), true, "Doesn't start with needle"); + a(t.call('abcd', 'bc', 1), true, "Position"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/uncapitalize.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/uncapitalize.js new file mode 100644 index 0000000000..50f35f1fe4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/#/uncapitalize.js @@ -0,0 +1,10 @@ +'use strict'; + +module.exports = function (t, a) { + a(t.call('raz'), 'raz', "Word"); + a(t.call('BLA'), 'bLA', "Uppercase"); + a(t.call(''), '', "Empty"); + a(t.call('a'), 'a', "One letter"); + a(t.call('this is a test'), 'this is a test', "Sentence"); + a(t.call('This is a test'), 'this is a test', "Capitalized sentence"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/format-method.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/format-method.js new file mode 100644 index 0000000000..bb5561ee45 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/format-method.js @@ -0,0 +1,7 @@ +'use strict'; + +module.exports = function (t, a) { + t = t({ a: 'A', aa: 'B', ab: 'C', b: 'D', + c: function () { return ++this.a; } }); + a(t.call({ a: 0 }, ' %a%aab%abb%b\\%aa%ab%c%c '), ' ABbCbD%aaC12 '); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/implement.js new file mode 100644 index 0000000000..0aceb97efd --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../string/from-code-point/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/shim.js new file mode 100644 index 0000000000..88cda3d636 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/from-code-point/shim.js @@ -0,0 +1,47 @@ +// Taken from: https://github.com/mathiasbynens/String.fromCodePoint/blob/master +// /tests/tests.js + +'use strict'; + +var pow = Math.pow; + +module.exports = function (t, a) { + var counter, result; + + a(t.length, 1, "Length"); + a(String.propertyIsEnumerable('fromCodePoint'), false, "Not enumerable"); + + a(t(''), '\0', "Empty string"); + a(t(), '', "No arguments"); + a(t(-0), '\0', "-0"); + a(t(0), '\0', "0"); + a(t(0x1D306), '\uD834\uDF06', "Unicode"); + a(t(0x1D306, 0x61, 0x1D307), '\uD834\uDF06a\uD834\uDF07', "Complex unicode"); + a(t(0x61, 0x62, 0x1D307), 'ab\uD834\uDF07', "Complex"); + a(t(false), '\0', "false"); + a(t(null), '\0', "null"); + + a.throws(function () { t('_'); }, RangeError, "_"); + a.throws(function () { t(Infinity); }, RangeError, "Infinity"); + a.throws(function () { t(-Infinity); }, RangeError, "-Infinity"); + a.throws(function () { t(-1); }, RangeError, "-1"); + a.throws(function () { t(0x10FFFF + 1); }, RangeError, "Range error #1"); + a.throws(function () { t(3.14); }, RangeError, "Range error #2"); + a.throws(function () { t(3e-2); }, RangeError, "Range error #3"); + a.throws(function () { t(-Infinity); }, RangeError, "Range error #4"); + a.throws(function () { t(+Infinity); }, RangeError, "Range error #5"); + a.throws(function () { t(NaN); }, RangeError, "Range error #6"); + a.throws(function () { t(undefined); }, RangeError, "Range error #7"); + a.throws(function () { t({}); }, RangeError, "Range error #8"); + a.throws(function () { t(/re/); }, RangeError, "Range error #9"); + + counter = pow(2, 15) * 3 / 2; + result = []; + while (--counter >= 0) result.push(0); // one code unit per symbol + t.apply(null, result); // must not throw + + counter = pow(2, 15) * 3 / 2; + result = []; + while (--counter >= 0) result.push(0xFFFF + 1); // two code units per symbol + t.apply(null, result); // must not throw +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/is-string.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/is-string.js new file mode 100644 index 0000000000..32f5958291 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/is-string.js @@ -0,0 +1,11 @@ +'use strict'; + +module.exports = function (t, a) { + a(t(null), false, "Null"); + a(t(''), true, "Empty string"); + a(t(12), false, "Number"); + a(t(false), false, "Boolean"); + a(t(new Date()), false, "Date"); + a(t(new String('raz')), true, "String object"); + a(t('asdfaf'), true, "String"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/random-uniq.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/random-uniq.js new file mode 100644 index 0000000000..6791ac266e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/random-uniq.js @@ -0,0 +1,14 @@ +'use strict'; + +var isValidFormat = RegExp.prototype.test.bind(/^[a-z0-9]+$/); + +module.exports = function (t, a) { + a(typeof t(), 'string'); + a.ok(t().length > 7); + a.not(t(), t()); + a.ok(isValidFormat(t())); + a.ok(isValidFormat(t())); + a.ok(isValidFormat(t())); + a.ok(isValidFormat(t())); + a.ok(isValidFormat(t())); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/implement.js new file mode 100644 index 0000000000..59416de3af --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/implement.js @@ -0,0 +1,5 @@ +'use strict'; + +var isImplemented = require('../../../string/raw/is-implemented'); + +module.exports = function (a) { a(isImplemented(), true); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/index.js new file mode 100644 index 0000000000..2e0bfa3249 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/index.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = require('./shim'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/is-implemented.js new file mode 100644 index 0000000000..1a8832889b --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/is-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t(), 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/shim.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/shim.js new file mode 100644 index 0000000000..025ed78045 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/node_modules/es5-ext/test/string/raw/shim.js @@ -0,0 +1,15 @@ +// Partially taken from: +// https://github.com/paulmillr/es6-shim/blob/master/test/string.js + +'use strict'; + +module.exports = function (t, a) { + var callSite = []; + + callSite.raw = ["The total is ", " ($", " with tax)"]; + a(t(callSite, '{total}', '{total * 1.01}'), + 'The total is {total} (${total * 1.01} with tax)'); + + callSite.raw = []; + a(t(callSite, '{total}', '{total * 1.01}'), ''); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/package.json new file mode 100644 index 0000000000..f98280ca28 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/package.json @@ -0,0 +1,95 @@ +{ + "_args": [ + [ + "es6-symbol@^3.0.2", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index" + ] + ], + "_from": "es6-symbol@>=3.0.2 <4.0.0", + "_id": "es6-symbol@3.0.2", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index/es6-symbol", + "_nodeVersion": "5.2.0", + "_npmUser": { + "email": "medikoo+npm@medikoo.com", + "name": "medikoo" + }, + "_npmVersion": "3.3.12", + "_phantomChildren": { + "es6-symbol": "3.0.2" + }, + "_requested": { + "name": "es6-symbol", + "raw": "es6-symbol@^3.0.2", + "rawSpec": "^3.0.2", + "scope": null, + "spec": ">=3.0.2 <4.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array/array-index", + "/node-gyp/path-array/array-index/es6-symbol/es5-ext", + "/node-gyp/path-array/array-index/es6-symbol/es5-ext/es6-iterator" + ], + "_resolved": "https://registry.npmjs.org/es6-symbol/-/es6-symbol-3.0.2.tgz", + "_shasum": "1e928878c6f5e63541625b4bb4df4af07d154219", + "_shrinkwrap": null, + "_spec": "es6-symbol@^3.0.2", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index", + "author": { + "email": "medyk@medikoo.com", + "name": "Mariusz Nowak", + "url": "http://www.medikoo.com/" + }, + "bugs": { + "url": "https://github.com/medikoo/es6-symbol/issues" + }, + "dependencies": { + "d": "~0.1.1", + "es5-ext": "~0.10.10" + }, + "description": "ECMAScript 6 Symbol polyfill", + "devDependencies": { + "tad": "~0.2.4", + "xlint": "~0.2.2", + "xlint-jslint-medikoo": "~0.1.4" + }, + "directories": {}, + "dist": { + "shasum": "1e928878c6f5e63541625b4bb4df4af07d154219", + "tarball": "http://registry.npmjs.org/es6-symbol/-/es6-symbol-3.0.2.tgz" + }, + "gitHead": "b7da6b926c44e3745de69b17c98c00a5c84b4ebe", + "homepage": "https://github.com/medikoo/es6-symbol#readme", + "keywords": [ + "ecmascript", + "es6", + "harmony", + "polyfill", + "ponyfill", + "private", + "property", + "symbol" + ], + "license": "MIT", + "maintainers": [ + { + "name": "medikoo", + "email": "medikoo+npm@medikoo.com" + } + ], + "name": "es6-symbol", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/medikoo/es6-symbol.git" + }, + "scripts": { + "lint": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --no-cache --no-stream", + "lint-console": "node node_modules/xlint/bin/xlint --linter=node_modules/xlint-jslint-medikoo/index.js --watch", + "test": "node ./node_modules/tad/bin/tad" + }, + "version": "3.0.2" +} diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/polyfill.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/polyfill.js new file mode 100644 index 0000000000..7c3c8fe900 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/polyfill.js @@ -0,0 +1,107 @@ +// ES2015 Symbol polyfill for environments that do not support it (or partially support it_ + +'use strict'; + +var d = require('d') + , validateSymbol = require('./validate-symbol') + + , create = Object.create, defineProperties = Object.defineProperties + , defineProperty = Object.defineProperty, objPrototype = Object.prototype + , NativeSymbol, SymbolPolyfill, HiddenSymbol, globalSymbols = create(null); + +if (typeof Symbol === 'function') NativeSymbol = Symbol; + +var generateName = (function () { + var created = create(null); + return function (desc) { + var postfix = 0, name, ie11BugWorkaround; + while (created[desc + (postfix || '')]) ++postfix; + desc += (postfix || ''); + created[desc] = true; + name = '@@' + desc; + defineProperty(objPrototype, name, d.gs(null, function (value) { + // For IE11 issue see: + // https://connect.microsoft.com/IE/feedbackdetail/view/1928508/ + // ie11-broken-getters-on-dom-objects + // https://github.com/medikoo/es6-symbol/issues/12 + if (ie11BugWorkaround) return; + ie11BugWorkaround = true; + defineProperty(this, name, d(value)); + ie11BugWorkaround = false; + })); + return name; + }; +}()); + +// Internal constructor (not one exposed) for creating Symbol instances. +// This one is used to ensure that `someSymbol instanceof Symbol` always return false +HiddenSymbol = function Symbol(description) { + if (this instanceof HiddenSymbol) throw new TypeError('TypeError: Symbol is not a constructor'); + return SymbolPolyfill(description); +}; + +// Exposed `Symbol` constructor +// (returns instances of HiddenSymbol) +module.exports = SymbolPolyfill = function Symbol(description) { + var symbol; + if (this instanceof Symbol) throw new TypeError('TypeError: Symbol is not a constructor'); + symbol = create(HiddenSymbol.prototype); + description = (description === undefined ? '' : String(description)); + return defineProperties(symbol, { + __description__: d('', description), + __name__: d('', generateName(description)) + }); +}; +defineProperties(SymbolPolyfill, { + for: d(function (key) { + if (globalSymbols[key]) return globalSymbols[key]; + return (globalSymbols[key] = SymbolPolyfill(String(key))); + }), + keyFor: d(function (s) { + var key; + validateSymbol(s); + for (key in globalSymbols) if (globalSymbols[key] === s) return key; + }), + + // If there's native implementation of given symbol, let's fallback to it + // to ensure proper interoperability with other native functions e.g. Array.from + hasInstance: d('', (NativeSymbol && NativeSymbol.hasInstance) || SymbolPolyfill('hasInstance')), + isConcatSpreadable: d('', (NativeSymbol && NativeSymbol.isConcatSpreadable) || + SymbolPolyfill('isConcatSpreadable')), + iterator: d('', (NativeSymbol && NativeSymbol.iterator) || SymbolPolyfill('iterator')), + match: d('', (NativeSymbol && NativeSymbol.match) || SymbolPolyfill('match')), + replace: d('', (NativeSymbol && NativeSymbol.replace) || SymbolPolyfill('replace')), + search: d('', (NativeSymbol && NativeSymbol.search) || SymbolPolyfill('search')), + species: d('', (NativeSymbol && NativeSymbol.species) || SymbolPolyfill('species')), + split: d('', (NativeSymbol && NativeSymbol.split) || SymbolPolyfill('split')), + toPrimitive: d('', (NativeSymbol && NativeSymbol.toPrimitive) || SymbolPolyfill('toPrimitive')), + toStringTag: d('', (NativeSymbol && NativeSymbol.toStringTag) || SymbolPolyfill('toStringTag')), + unscopables: d('', (NativeSymbol && NativeSymbol.unscopables) || SymbolPolyfill('unscopables')) +}); + +// Internal tweaks for real symbol producer +defineProperties(HiddenSymbol.prototype, { + constructor: d(SymbolPolyfill), + toString: d('', function () { return this.__name__; }) +}); + +// Proper implementation of methods exposed on Symbol.prototype +// They won't be accessible on produced symbol instances as they derive from HiddenSymbol.prototype +defineProperties(SymbolPolyfill.prototype, { + toString: d(function () { return 'Symbol (' + validateSymbol(this).__description__ + ')'; }), + valueOf: d(function () { return validateSymbol(this); }) +}); +defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toPrimitive, d('', + function () { return validateSymbol(this); })); +defineProperty(SymbolPolyfill.prototype, SymbolPolyfill.toStringTag, d('c', 'Symbol')); + +// Proper implementaton of toPrimitive and toStringTag for returned symbol instances +defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toStringTag, + d('c', SymbolPolyfill.prototype[SymbolPolyfill.toStringTag])); + +// Note: It's important to define `toPrimitive` as last one, as some implementations +// implement `toPrimitive` natively without implementing `toStringTag` (or other specified symbols) +// And that may invoke error in definition flow: +// See: https://github.com/medikoo/es6-symbol/issues/13#issuecomment-164146149 +defineProperty(HiddenSymbol.prototype, SymbolPolyfill.toPrimitive, + d('c', SymbolPolyfill.prototype[SymbolPolyfill.toPrimitive])); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/implement.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/implement.js new file mode 100644 index 0000000000..eb35c30188 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/implement.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof Symbol, 'function'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/index.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/index.js new file mode 100644 index 0000000000..62b3296df6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/index.js @@ -0,0 +1,12 @@ +'use strict'; + +var d = require('d') + + , defineProperty = Object.defineProperty; + +module.exports = function (T, a) { + var symbol = T('test'), x = {}; + defineProperty(x, symbol, d('foo')); + a(x.test, undefined, "Name"); + a(x[symbol], 'foo', "Get"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-implemented.js new file mode 100644 index 0000000000..bb0d64536e --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-implemented.js @@ -0,0 +1,14 @@ +'use strict'; + +var global = require('es5-ext/global') + , polyfill = require('../polyfill'); + +module.exports = function (t, a) { + var cache; + a(typeof t(), 'boolean'); + cache = global.Symbol; + global.Symbol = polyfill; + a(t(), true); + if (cache === undefined) delete global.Symbol; + else global.Symbol = cache; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-native-implemented.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-native-implemented.js new file mode 100644 index 0000000000..df8ba0323f --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-native-implemented.js @@ -0,0 +1,3 @@ +'use strict'; + +module.exports = function (t, a) { a(typeof t, 'boolean'); }; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-symbol.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-symbol.js new file mode 100644 index 0000000000..ac24b9abbf --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/is-symbol.js @@ -0,0 +1,16 @@ +'use strict'; + +var SymbolPoly = require('../polyfill'); + +module.exports = function (t, a) { + a(t(undefined), false, "Undefined"); + a(t(null), false, "Null"); + a(t(true), false, "Primitive"); + a(t('raz'), false, "String"); + a(t({}), false, "Object"); + a(t([]), false, "Array"); + if (typeof Symbol !== 'undefined') { + a(t(Symbol()), true, "Native"); + } + a(t(SymbolPoly()), true, "Polyfill"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/polyfill.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/polyfill.js new file mode 100644 index 0000000000..83fb5e9253 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/polyfill.js @@ -0,0 +1,27 @@ +'use strict'; + +var d = require('d') + , isSymbol = require('../is-symbol') + + , defineProperty = Object.defineProperty; + +module.exports = function (T, a) { + var symbol = T('test'), x = {}; + defineProperty(x, symbol, d('foo')); + a(x.test, undefined, "Name"); + a(x[symbol], 'foo', "Get"); + a(x instanceof T, false); + + a(isSymbol(symbol), true, "Symbol"); + a(isSymbol(T.iterator), true, "iterator"); + a(isSymbol(T.toStringTag), true, "toStringTag"); + + x = {}; + x[symbol] = 'foo'; + a.deep(Object.getOwnPropertyDescriptor(x, symbol), { configurable: true, enumerable: false, + value: 'foo', writable: true }); + symbol = T.for('marko'); + a(isSymbol(symbol), true); + a(T.for('marko'), symbol); + a(T.keyFor(symbol), 'marko'); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/validate-symbol.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/validate-symbol.js new file mode 100644 index 0000000000..2c8f84c823 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/test/validate-symbol.js @@ -0,0 +1,19 @@ +'use strict'; + +var SymbolPoly = require('../polyfill'); + +module.exports = function (t, a) { + var symbol; + a.throws(function () { t(undefined); }, TypeError, "Undefined"); + a.throws(function () { t(null); }, TypeError, "Null"); + a.throws(function () { t(true); }, TypeError, "Primitive"); + a.throws(function () { t('raz'); }, TypeError, "String"); + a.throws(function () { t({}); }, TypeError, "Object"); + a.throws(function () { t([]); }, TypeError, "Array"); + if (typeof Symbol !== 'undefined') { + symbol = Symbol(); + a(t(symbol), symbol, "Native"); + } + symbol = SymbolPoly(); + a(t(symbol), symbol, "Polyfill"); +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/validate-symbol.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/validate-symbol.js new file mode 100644 index 0000000000..42750043d4 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/node_modules/es6-symbol/validate-symbol.js @@ -0,0 +1,8 @@ +'use strict'; + +var isSymbol = require('./is-symbol'); + +module.exports = function (value) { + if (!isSymbol(value)) throw new TypeError(value + " is not a symbol"); + return value; +}; diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/package.json index 6ba9df72c2..dd33e38560 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/package.json @@ -1,58 +1,86 @@ { - "name": "array-index", - "description": "Invoke getter/setter functions on array-like objects", - "keywords": [ - "index", - "array", - "getter", - "setter", - "proxy" + "_args": [ + [ + "array-index@^1.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array" + ] ], - "version": "0.1.1", + "_from": "array-index@>=1.0.0 <2.0.0", + "_id": "array-index@1.0.0", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array/array-index", + "_nodeVersion": "5.3.0", + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" + }, + "_npmVersion": "3.3.12", + "_phantomChildren": {}, + "_requested": { + "name": "array-index", + "raw": "array-index@^1.0.0", + "rawSpec": "^1.0.0", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" + }, + "_requiredBy": [ + "/node-gyp/path-array" + ], + "_resolved": "https://registry.npmjs.org/array-index/-/array-index-1.0.0.tgz", + "_shasum": "ec56a749ee103e4e08c790b9c353df16055b97f9", + "_shrinkwrap": null, + "_spec": "array-index@^1.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp/node_modules/path-array", "author": { - "name": "Nathan Rajlich", "email": "nathan@tootallnate.net", + "name": "Nathan Rajlich", "url": "http://tootallnate.net" }, - "repository": { - "type": "git", - "url": "git://github.com/TooTallNate/array-index.git" - }, - "main": "index.js", - "scripts": { - "test": "node test" + "bugs": { + "url": "https://github.com/TooTallNate/array-index/issues" }, "dependencies": { - "debug": "*" + "debug": "^2.2.0", + "es6-symbol": "^3.0.2" + }, + "description": "Invoke getter/setter functions on array-like objects", + "devDependencies": {}, + "directories": {}, + "dist": { + "shasum": "ec56a749ee103e4e08c790b9c353df16055b97f9", + "tarball": "http://registry.npmjs.org/array-index/-/array-index-1.0.0.tgz" }, "engines": { "node": "*" }, - "gitHead": "65a5d884f25b4b7a1608e367d715d713dbd3b3d6", - "bugs": { - "url": "https://github.com/TooTallNate/array-index/issues" - }, - "homepage": "https://github.com/TooTallNate/array-index", - "_id": "array-index@0.1.1", - "_shasum": "4d5eaf06cc3d925847cd73d1535c217ba306d3e1", - "_from": "array-index@>=0.1.0 <0.2.0", - "_npmVersion": "2.1.3", - "_nodeVersion": "0.10.32", - "_npmUser": { - "name": "tootallnate", - "email": "nathan@tootallnate.net" - }, + "gitHead": "4b3cc059c70eefd8ef2a0d4213d681b671eb3d11", + "homepage": "https://github.com/TooTallNate/array-index#readme", + "keywords": [ + "array", + "getter", + "index", + "proxy", + "setter" + ], + "license": "MIT", + "main": "index.js", "maintainers": [ { "name": "tootallnate", "email": "nathan@tootallnate.net" } ], - "dist": { - "shasum": "4d5eaf06cc3d925847cd73d1535c217ba306d3e1", - "tarball": "http://registry.npmjs.org/array-index/-/array-index-0.1.1.tgz" + "name": "array-index", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/array-index.git" }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/array-index/-/array-index-0.1.1.tgz", - "readme": "ERROR: No README data found!" + "scripts": { + "test": "node test" + }, + "version": "1.0.0" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/test.js b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/test.js index d9e9c18281..65ff607f1c 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/test.js +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/node_modules/array-index/test.js @@ -1,4 +1,3 @@ - var ArrayIndex = require('./') var inherits = require('util').inherits var assert = require('assert') @@ -19,14 +18,15 @@ inherits(Arrayish, ArrayIndex) // create an instance and run some tests var a = new Arrayish(11) +assert.equal(a.length, 11); assert.throws(function () { a[0] -}, /__get__/) +}, /you must implement the `ArrayIndex.get` Symbol/) assert.throws(function () { a[0] = 0 -}, /__set__/) +}, /you must implement the `ArrayIndex.set` Symbol/) /** @@ -35,7 +35,7 @@ assert.throws(function () { * return the index as-is. */ -Arrayish.prototype.__get__ = function get (index) { +Arrayish.prototype[ArrayIndex.get] = function get (index) { if (index in this.sets) { return +this.sets[index] * index } else { @@ -47,7 +47,7 @@ Arrayish.prototype.__get__ = function get (index) { * Store the last value set for this index. */ -Arrayish.prototype.__set__ = function set (index, value) { +Arrayish.prototype[ArrayIndex.set] = function set (index, value) { this.sets[index] = value } @@ -74,3 +74,37 @@ a[4] = 20 a[6] = 5.55432 var b = [0, 1, 2, 3, 80, 5, 33.325919999999996, 7, 8, 9, 30] assert.equal(JSON.stringify(b), JSON.stringify(a)) + + +/** + * It should work when invoking as a Mixin. + */ + +function Foo () { + ArrayIndex.call(this, 5); +} +var f = new Foo(); + +// these throw because there's no __get__ and __set__ function defined +assert.throws(function () { + f[0]; +}); +assert.throws(function () { + f[0] = 0 +}); + +f[ArrayIndex.get] = function (index) { + return index * 2; +}; + +assert.equal(f[0], 0); +assert.equal(f[1], 2); +assert.equal(f[2], 4); +assert.equal(f[3], 6); + +f[ArrayIndex.set] = function (index, value) { + this['foo' + index] = value; +}; + +f[1] = 'bar'; +assert.equal(f.foo1, 'bar'); diff --git a/deps/npm/node_modules/node-gyp/node_modules/path-array/package.json b/deps/npm/node_modules/node-gyp/node_modules/path-array/package.json index 41d25482b8..e69958df33 100644 --- a/deps/npm/node_modules/node-gyp/node_modules/path-array/package.json +++ b/deps/npm/node_modules/node-gyp/node_modules/path-array/package.json @@ -1,56 +1,82 @@ { - "name": "path-array", - "version": "1.0.0", - "description": "Treat your $PATH like a JavaScript Array", - "main": "index.js", - "scripts": { - "test": "mocha --reporter spec" + "_args": [ + [ + "path-array@^1.0.0", + "/Users/rebecca/code/npm/node_modules/node-gyp" + ] + ], + "_from": "path-array@>=1.0.0 <2.0.0", + "_id": "path-array@1.0.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp/path-array", + "_nodeVersion": "5.3.0", + "_npmUser": { + "email": "nathan@tootallnate.net", + "name": "tootallnate" }, - "repository": { - "type": "git", - "url": "git://github.com/TooTallNate/node-path-array.git" + "_npmVersion": "3.3.12", + "_phantomChildren": {}, + "_requested": { + "name": "path-array", + "raw": "path-array@^1.0.0", + "rawSpec": "^1.0.0", + "scope": null, + "spec": ">=1.0.0 <2.0.0", + "type": "range" }, - "keywords": [ - "PATH", - "env", - "array" + "_requiredBy": [ + "/node-gyp" ], + "_resolved": "https://registry.npmjs.org/path-array/-/path-array-1.0.1.tgz", + "_shasum": "7e2f0f35f07a2015122b868b7eac0eb2c4fec271", + "_shrinkwrap": null, + "_spec": "path-array@^1.0.0", + "_where": "/Users/rebecca/code/npm/node_modules/node-gyp", "author": { - "name": "Nathan Rajlich", "email": "nathan@tootallnate.net", + "name": "Nathan Rajlich", "url": "http://n8.io/" }, - "license": "MIT", "bugs": { "url": "https://github.com/TooTallNate/node-path-array/issues" }, - "homepage": "https://github.com/TooTallNate/node-path-array", "dependencies": { - "array-index": "~0.1.0" + "array-index": "^1.0.0" }, + "description": "Treat your $PATH like a JavaScript Array", "devDependencies": { "mocha": "~1.16.1" }, - "gitHead": "5d1fedd54e4413459f67e4a4babb024144cd00d0", - "_id": "path-array@1.0.0", - "_shasum": "6c14130c33084f0150553c657b38397ab67aaa4e", - "_from": "path-array@>=1.0.0 <2.0.0", - "_npmVersion": "1.4.28", - "_npmUser": { - "name": "tootallnate", - "email": "nathan@tootallnate.net" + "directories": {}, + "dist": { + "shasum": "7e2f0f35f07a2015122b868b7eac0eb2c4fec271", + "tarball": "http://registry.npmjs.org/path-array/-/path-array-1.0.1.tgz" }, + "gitHead": "d249bd897661ca60720218edabbfeaa73c67778a", + "homepage": "https://github.com/TooTallNate/node-path-array", + "keywords": [ + "PATH", + "array", + "env" + ], + "license": "MIT", + "main": "index.js", "maintainers": [ { "name": "tootallnate", "email": "nathan@tootallnate.net" } ], - "dist": { - "shasum": "6c14130c33084f0150553c657b38397ab67aaa4e", - "tarball": "http://registry.npmjs.org/path-array/-/path-array-1.0.0.tgz" + "name": "path-array", + "optionalDependencies": {}, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/TooTallNate/node-path-array.git" }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/path-array/-/path-array-1.0.0.tgz", - "readme": "ERROR: No README data found!" + "scripts": { + "test": "mocha --reporter spec" + }, + "version": "1.0.1" } diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore b/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore deleted file mode 100644 index c167ad5b1c..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/.npmignore +++ /dev/null @@ -1,5 +0,0 @@ -.*.swp -node_modules -examples/extract/ -test/tmp/ -test/fixtures/ diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml b/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml deleted file mode 100644 index fca8ef0194..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/.travis.yml +++ /dev/null @@ -1,4 +0,0 @@ -language: node_js -node_js: - - 0.10 - - 0.11 diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE b/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE deleted file mode 100644 index 74489e2e26..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/LICENCE +++ /dev/null @@ -1,25 +0,0 @@ -Copyright (c) Isaac Z. Schlueter -All rights reserved. - -The BSD License - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions -are met: -1. Redistributions of source code must retain the above copyright - notice, this list of conditions and the following disclaimer. -2. Redistributions in binary form must reproduce the above copyright - notice, this list of conditions and the following disclaimer in the - documentation and/or other materials provided with the distribution. - -THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS -``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED -TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR -PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS -BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR -CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF -SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS -INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN -CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) -ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE -POSSIBILITY OF SUCH DAMAGE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/README.md b/deps/npm/node_modules/node-gyp/node_modules/tar/README.md deleted file mode 100644 index 424a2782bf..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/README.md +++ /dev/null @@ -1,48 +0,0 @@ -# node-tar - -Tar for Node.js. - -[![NPM](https://nodei.co/npm/tar.png)](https://nodei.co/npm/tar/) - -## API - -See `examples/` for usage examples. - -### var tar = require('tar') - -Returns an object with `.Pack`, `.Extract` and `.Parse` methods. - -### tar.Pack([properties]) - -Returns a through stream. Use -[fstream](https://npmjs.org/package/fstream) to write files into the -pack stream and you will receive tar archive data from the pack -stream. - -This only works with directories, it does not work with individual files. - -The optional `properties` object are used to set properties in the tar -'Global Extended Header'. - -### tar.Extract([options]) - -Returns a through stream. Write tar data to the stream and the files -in the tarball will be extracted onto the filesystem. - -`options` can be: - -```js -{ - path: '/path/to/extract/tar/into', - strip: 0, // how many path segments to strip from the root when extracting -} -``` - -`options` also get passed to the `fstream.Writer` instance that `tar` -uses internally. - -### tar.Parse() - -Returns a writable stream. Write tar data to it and it will emit -`entry` events for each entry parsed from the tarball. This is used by -`tar.Extract`. diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js deleted file mode 100644 index f6253a72c5..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/extracter.js +++ /dev/null @@ -1,19 +0,0 @@ -var tar = require("../tar.js") - , fs = require("fs") - - -function onError(err) { - console.error('An error occurred:', err) -} - -function onEnd() { - console.log('Extracted!') -} - -var extractor = tar.Extract({path: __dirname + "/extract"}) - .on('error', onError) - .on('end', onEnd); - -fs.createReadStream(__dirname + "/../test/fixtures/c.tar") - .on('error', onError) - .pipe(extractor); diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js deleted file mode 100644 index 039969ce30..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/packer.js +++ /dev/null @@ -1,24 +0,0 @@ -var tar = require("../tar.js") - , fstream = require("fstream") - , fs = require("fs") - -var dirDest = fs.createWriteStream('dir.tar') - - -function onError(err) { - console.error('An error occurred:', err) -} - -function onEnd() { - console.log('Packed!') -} - -var packer = tar.Pack({ noProprietary: true }) - .on('error', onError) - .on('end', onEnd); - -// This must be a "directory" -fstream.Reader({ path: __dirname, type: "Directory" }) - .on('error', onError) - .pipe(packer) - .pipe(dirDest) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js b/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js deleted file mode 100644 index 39f3f0888a..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/examples/reader.js +++ /dev/null @@ -1,36 +0,0 @@ -var tar = require("../tar.js") - , fs = require("fs") - -fs.createReadStream(__dirname + "/../test/fixtures/c.tar") - .pipe(tar.Parse()) - .on("extendedHeader", function (e) { - console.error("extended pax header", e.props) - e.on("end", function () { - console.error("extended pax fields:", e.fields) - }) - }) - .on("ignoredEntry", function (e) { - console.error("ignoredEntry?!?", e.props) - }) - .on("longLinkpath", function (e) { - console.error("longLinkpath entry", e.props) - e.on("end", function () { - console.error("value=%j", e.body.toString()) - }) - }) - .on("longPath", function (e) { - console.error("longPath entry", e.props) - e.on("end", function () { - console.error("value=%j", e.body.toString()) - }) - }) - .on("entry", function (e) { - console.error("entry", e.props) - e.on("data", function (c) { - console.error(" >>>" + c.toString().replace(/\n/g, "\\n")) - }) - e.on("end", function () { - console.error(" <<<EOF") - }) - }) - diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js deleted file mode 100644 index 6c1da2373a..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/buffer-entry.js +++ /dev/null @@ -1,30 +0,0 @@ -// just like the Entry class, but it buffers the contents -// -// XXX It would be good to set a maximum BufferEntry filesize, -// since it eats up memory. In normal operation, -// these are only for long filenames or link names, which are -// rarely very big. - -module.exports = BufferEntry - -var inherits = require("inherits") - , Entry = require("./entry.js") - -function BufferEntry () { - Entry.apply(this, arguments) - this._buffer = new Buffer(this.props.size) - this._offset = 0 - this.body = "" - this.on("end", function () { - this.body = this._buffer.toString().slice(0, -1) - }) -} - -inherits(BufferEntry, Entry) - -// collect the bytes as they come in. -BufferEntry.prototype.write = function (c) { - c.copy(this._buffer, this._offset) - this._offset += c.length - Entry.prototype.write.call(this, c) -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js deleted file mode 100644 index 8e09042d01..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry-writer.js +++ /dev/null @@ -1,169 +0,0 @@ -module.exports = EntryWriter - -var tar = require("../tar.js") - , TarHeader = require("./header.js") - , Entry = require("./entry.js") - , inherits = require("inherits") - , BlockStream = require("block-stream") - , ExtendedHeaderWriter - , Stream = require("stream").Stream - , EOF = {} - -inherits(EntryWriter, Stream) - -function EntryWriter (props) { - var me = this - - if (!(me instanceof EntryWriter)) { - return new EntryWriter(props) - } - - Stream.apply(this) - - me.writable = true - me.readable = true - - me._stream = new BlockStream(512) - - me._stream.on("data", function (c) { - me.emit("data", c) - }) - - me._stream.on("drain", function () { - me.emit("drain") - }) - - me._stream.on("end", function () { - me.emit("end") - me.emit("close") - }) - - me.props = props - if (props.type === "Directory") { - props.size = 0 - } - props.ustar = "ustar\0" - props.ustarver = "00" - me.path = props.path - - me._buffer = [] - me._didHeader = false - me._meta = false - - me.on("pipe", function () { - me._process() - }) -} - -EntryWriter.prototype.write = function (c) { - // console.error(".. ew write") - if (this._ended) return this.emit("error", new Error("write after end")) - this._buffer.push(c) - this._process() - this._needDrain = this._buffer.length > 0 - return !this._needDrain -} - -EntryWriter.prototype.end = function (c) { - // console.error(".. ew end") - if (c) this._buffer.push(c) - this._buffer.push(EOF) - this._ended = true - this._process() - this._needDrain = this._buffer.length > 0 -} - -EntryWriter.prototype.pause = function () { - // console.error(".. ew pause") - this._paused = true - this.emit("pause") -} - -EntryWriter.prototype.resume = function () { - // console.error(".. ew resume") - this._paused = false - this.emit("resume") - this._process() -} - -EntryWriter.prototype.add = function (entry) { - // console.error(".. ew add") - if (!this.parent) return this.emit("error", new Error("no parent")) - - // make sure that the _header and such is emitted, and clear out - // the _currentEntry link on the parent. - if (!this._ended) this.end() - - return this.parent.add(entry) -} - -EntryWriter.prototype._header = function () { - // console.error(".. ew header") - if (this._didHeader) return - this._didHeader = true - - var headerBlock = TarHeader.encode(this.props) - - if (this.props.needExtended && !this._meta) { - var me = this - - ExtendedHeaderWriter = ExtendedHeaderWriter || - require("./extended-header-writer.js") - - ExtendedHeaderWriter(this.props) - .on("data", function (c) { - me.emit("data", c) - }) - .on("error", function (er) { - me.emit("error", er) - }) - .end() - } - - // console.error(".. .. ew headerBlock emitting") - this.emit("data", headerBlock) - this.emit("header") -} - -EntryWriter.prototype._process = function () { - // console.error(".. .. ew process") - if (!this._didHeader && !this._meta) { - this._header() - } - - if (this._paused || this._processing) { - // console.error(".. .. .. paused=%j, processing=%j", this._paused, this._processing) - return - } - - this._processing = true - - var buf = this._buffer - for (var i = 0; i < buf.length; i ++) { - // console.error(".. .. .. i=%d", i) - - var c = buf[i] - - if (c === EOF) this._stream.end() - else this._stream.write(c) - - if (this._paused) { - // console.error(".. .. .. paused mid-emission") - this._processing = false - if (i < buf.length) { - this._needDrain = true - this._buffer = buf.slice(i + 1) - } - return - } - } - - // console.error(".. .. .. emitted") - this._buffer.length = 0 - this._processing = false - - // console.error(".. .. .. emitting drain") - this.emit("drain") -} - -EntryWriter.prototype.destroy = function () {} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js deleted file mode 100644 index 4af5c41083..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/entry.js +++ /dev/null @@ -1,213 +0,0 @@ -// A passthrough read/write stream that sets its properties -// based on a header, extendedHeader, and globalHeader -// -// Can be either a file system object of some sort, or -// a pax/ustar metadata entry. - -module.exports = Entry - -var TarHeader = require("./header.js") - , tar = require("../tar") - , assert = require("assert").ok - , Stream = require("stream").Stream - , inherits = require("inherits") - , fstream = require("fstream").Abstract - -function Entry (header, extended, global) { - Stream.call(this) - this.readable = true - this.writable = true - - this._needDrain = false - this._paused = false - this._reading = false - this._ending = false - this._ended = false - this._remaining = 0 - this._queue = [] - this._index = 0 - this._queueLen = 0 - - this._read = this._read.bind(this) - - this.props = {} - this._header = header - this._extended = extended || {} - - // globals can change throughout the course of - // a file parse operation. Freeze it at its current state. - this._global = {} - var me = this - Object.keys(global || {}).forEach(function (g) { - me._global[g] = global[g] - }) - - this._setProps() -} - -inherits(Entry, Stream) - -Entry.prototype.write = function (c) { - if (this._ending) this.error("write() after end()", null, true) - if (this._remaining === 0) { - this.error("invalid bytes past eof") - } - - // often we'll get a bunch of \0 at the end of the last write, - // since chunks will always be 512 bytes when reading a tarball. - if (c.length > this._remaining) { - c = c.slice(0, this._remaining) - } - this._remaining -= c.length - - // put it on the stack. - var ql = this._queueLen - this._queue.push(c) - this._queueLen ++ - - this._read() - - // either paused, or buffered - if (this._paused || ql > 0) { - this._needDrain = true - return false - } - - return true -} - -Entry.prototype.end = function (c) { - if (c) this.write(c) - this._ending = true - this._read() -} - -Entry.prototype.pause = function () { - this._paused = true - this.emit("pause") -} - -Entry.prototype.resume = function () { - // console.error(" Tar Entry resume", this.path) - this.emit("resume") - this._paused = false - this._read() - return this._queueLen - this._index > 1 -} - - // This is bound to the instance -Entry.prototype._read = function () { - // console.error(" Tar Entry _read", this.path) - - if (this._paused || this._reading || this._ended) return - - // set this flag so that event handlers don't inadvertently - // get multiple _read() calls running. - this._reading = true - - // have any data to emit? - while (this._index < this._queueLen && !this._paused) { - var chunk = this._queue[this._index ++] - this.emit("data", chunk) - } - - // check if we're drained - if (this._index >= this._queueLen) { - this._queue.length = this._queueLen = this._index = 0 - if (this._needDrain) { - this._needDrain = false - this.emit("drain") - } - if (this._ending) { - this._ended = true - this.emit("end") - } - } - - // if the queue gets too big, then pluck off whatever we can. - // this should be fairly rare. - var mql = this._maxQueueLen - if (this._queueLen > mql && this._index > 0) { - mql = Math.min(this._index, mql) - this._index -= mql - this._queueLen -= mql - this._queue = this._queue.slice(mql) - } - - this._reading = false -} - -Entry.prototype._setProps = function () { - // props = extended->global->header->{} - var header = this._header - , extended = this._extended - , global = this._global - , props = this.props - - // first get the values from the normal header. - var fields = tar.fields - for (var f = 0; fields[f] !== null; f ++) { - var field = fields[f] - , val = header[field] - if (typeof val !== "undefined") props[field] = val - } - - // next, the global header for this file. - // numeric values, etc, will have already been parsed. - ;[global, extended].forEach(function (p) { - Object.keys(p).forEach(function (f) { - if (typeof p[f] !== "undefined") props[f] = p[f] - }) - }) - - // no nulls allowed in path or linkpath - ;["path", "linkpath"].forEach(function (p) { - if (props.hasOwnProperty(p)) { - props[p] = props[p].split("\0")[0] - } - }) - - - // set date fields to be a proper date - ;["mtime", "ctime", "atime"].forEach(function (p) { - if (props.hasOwnProperty(p)) { - props[p] = new Date(props[p] * 1000) - } - }) - - // set the type so that we know what kind of file to create - var type - switch (tar.types[props.type]) { - case "OldFile": - case "ContiguousFile": - type = "File" - break - - case "GNUDumpDir": - type = "Directory" - break - - case undefined: - type = "Unknown" - break - - case "Link": - case "SymbolicLink": - case "CharacterDevice": - case "BlockDevice": - case "Directory": - case "FIFO": - default: - type = tar.types[props.type] - } - - this.type = type - this.path = props.path - this.size = props.size - - // size is special, since it signals when the file needs to end. - this._remaining = props.size -} - -Entry.prototype.warn = fstream.warn -Entry.prototype.error = fstream.error diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js deleted file mode 100644 index 1728c4583a..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header-writer.js +++ /dev/null @@ -1,191 +0,0 @@ - -module.exports = ExtendedHeaderWriter - -var inherits = require("inherits") - , EntryWriter = require("./entry-writer.js") - -inherits(ExtendedHeaderWriter, EntryWriter) - -var tar = require("../tar.js") - , path = require("path") - , TarHeader = require("./header.js") - -// props is the props of the thing we need to write an -// extended header for. -// Don't be shy with it. Just encode everything. -function ExtendedHeaderWriter (props) { - // console.error(">> ehw ctor") - var me = this - - if (!(me instanceof ExtendedHeaderWriter)) { - return new ExtendedHeaderWriter(props) - } - - me.fields = props - - var p = - { path : ("PaxHeader" + path.join("/", props.path || "")) - .replace(/\\/g, "/").substr(0, 100) - , mode : props.mode || 0666 - , uid : props.uid || 0 - , gid : props.gid || 0 - , size : 0 // will be set later - , mtime : props.mtime || Date.now() / 1000 - , type : "x" - , linkpath : "" - , ustar : "ustar\0" - , ustarver : "00" - , uname : props.uname || "" - , gname : props.gname || "" - , devmaj : props.devmaj || 0 - , devmin : props.devmin || 0 - } - - - EntryWriter.call(me, p) - // console.error(">> ehw props", me.props) - me.props = p - - me._meta = true -} - -ExtendedHeaderWriter.prototype.end = function () { - // console.error(">> ehw end") - var me = this - - if (me._ended) return - me._ended = true - - me._encodeFields() - - if (me.props.size === 0) { - // nothing to write! - me._ready = true - me._stream.end() - return - } - - me._stream.write(TarHeader.encode(me.props)) - me.body.forEach(function (l) { - me._stream.write(l) - }) - me._ready = true - - // console.error(">> ehw _process calling end()", me.props) - this._stream.end() -} - -ExtendedHeaderWriter.prototype._encodeFields = function () { - // console.error(">> ehw _encodeFields") - this.body = [] - if (this.fields.prefix) { - this.fields.path = this.fields.prefix + "/" + this.fields.path - this.fields.prefix = "" - } - encodeFields(this.fields, "", this.body, this.fields.noProprietary) - var me = this - this.body.forEach(function (l) { - me.props.size += l.length - }) -} - -function encodeFields (fields, prefix, body, nop) { - // console.error(">> >> ehw encodeFields") - // "%d %s=%s\n", <length>, <keyword>, <value> - // The length is a decimal number, and includes itself and the \n - // Numeric values are decimal strings. - - Object.keys(fields).forEach(function (k) { - var val = fields[k] - , numeric = tar.numeric[k] - - if (prefix) k = prefix + "." + k - - // already including NODETAR.type, don't need File=true also - if (k === fields.type && val === true) return - - switch (k) { - // don't include anything that's always handled just fine - // in the normal header, or only meaningful in the context - // of nodetar - case "mode": - case "cksum": - case "ustar": - case "ustarver": - case "prefix": - case "basename": - case "dirname": - case "needExtended": - case "block": - case "filter": - return - - case "rdev": - if (val === 0) return - break - - case "nlink": - case "dev": // Truly a hero among men, Creator of Star! - case "ino": // Speak his name with reverent awe! It is: - k = "SCHILY." + k - break - - default: break - } - - if (val && typeof val === "object" && - !Buffer.isBuffer(val)) encodeFields(val, k, body, nop) - else if (val === null || val === undefined) return - else body.push.apply(body, encodeField(k, val, nop)) - }) - - return body -} - -function encodeField (k, v, nop) { - // lowercase keys must be valid, otherwise prefix with - // "NODETAR." - if (k.charAt(0) === k.charAt(0).toLowerCase()) { - var m = k.split(".")[0] - if (!tar.knownExtended[m]) k = "NODETAR." + k - } - - // no proprietary - if (nop && k.charAt(0) !== k.charAt(0).toLowerCase()) { - return [] - } - - if (typeof val === "number") val = val.toString(10) - - var s = new Buffer(" " + k + "=" + v + "\n") - , digits = Math.floor(Math.log(s.length) / Math.log(10)) + 1 - - // console.error("1 s=%j digits=%j s.length=%d", s.toString(), digits, s.length) - - // if adding that many digits will make it go over that length, - // then add one to it. For example, if the string is: - // " foo=bar\n" - // then that's 9 characters. With the "9", that bumps the length - // up to 10. However, this is invalid: - // "10 foo=bar\n" - // but, since that's actually 11 characters, since 10 adds another - // character to the length, and the length includes the number - // itself. In that case, just bump it up again. - if (s.length + digits >= Math.pow(10, digits)) digits += 1 - // console.error("2 s=%j digits=%j s.length=%d", s.toString(), digits, s.length) - - var len = digits + s.length - // console.error("3 s=%j digits=%j s.length=%d len=%d", s.toString(), digits, s.length, len) - var lenBuf = new Buffer("" + len) - if (lenBuf.length + s.length !== len) { - throw new Error("Bad length calculation\n"+ - "len="+len+"\n"+ - "lenBuf="+JSON.stringify(lenBuf.toString())+"\n"+ - "lenBuf.length="+lenBuf.length+"\n"+ - "digits="+digits+"\n"+ - "s="+JSON.stringify(s.toString())+"\n"+ - "s.length="+s.length) - } - - return [lenBuf, s] -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js deleted file mode 100644 index 74f432ceee..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extended-header.js +++ /dev/null @@ -1,140 +0,0 @@ -// An Entry consisting of: -// -// "%d %s=%s\n", <length>, <keyword>, <value> -// -// The length is a decimal number, and includes itself and the \n -// \0 does not terminate anything. Only the length terminates the string. -// Numeric values are decimal strings. - -module.exports = ExtendedHeader - -var Entry = require("./entry.js") - , inherits = require("inherits") - , tar = require("../tar.js") - , numeric = tar.numeric - , keyTrans = { "SCHILY.dev": "dev" - , "SCHILY.ino": "ino" - , "SCHILY.nlink": "nlink" } - -function ExtendedHeader () { - Entry.apply(this, arguments) - this.on("data", this._parse) - this.fields = {} - this._position = 0 - this._fieldPos = 0 - this._state = SIZE - this._sizeBuf = [] - this._keyBuf = [] - this._valBuf = [] - this._size = -1 - this._key = "" -} - -inherits(ExtendedHeader, Entry) -ExtendedHeader.prototype._parse = parse - -var s = 0 - , states = ExtendedHeader.states = {} - , SIZE = states.SIZE = s++ - , KEY = states.KEY = s++ - , VAL = states.VAL = s++ - , ERR = states.ERR = s++ - -Object.keys(states).forEach(function (s) { - states[states[s]] = states[s] -}) - -states[s] = null - -// char code values for comparison -var _0 = "0".charCodeAt(0) - , _9 = "9".charCodeAt(0) - , point = ".".charCodeAt(0) - , a = "a".charCodeAt(0) - , Z = "Z".charCodeAt(0) - , a = "a".charCodeAt(0) - , z = "z".charCodeAt(0) - , space = " ".charCodeAt(0) - , eq = "=".charCodeAt(0) - , cr = "\n".charCodeAt(0) - -function parse (c) { - if (this._state === ERR) return - - for ( var i = 0, l = c.length - ; i < l - ; this._position++, this._fieldPos++, i++) { - // console.error("top of loop, size="+this._size) - - var b = c[i] - - if (this._size >= 0 && this._fieldPos > this._size) { - error(this, "field exceeds length="+this._size) - return - } - - switch (this._state) { - case ERR: return - - case SIZE: - // console.error("parsing size, b=%d, rest=%j", b, c.slice(i).toString()) - if (b === space) { - this._state = KEY - // this._fieldPos = this._sizeBuf.length - this._size = parseInt(new Buffer(this._sizeBuf).toString(), 10) - this._sizeBuf.length = 0 - continue - } - if (b < _0 || b > _9) { - error(this, "expected [" + _0 + ".." + _9 + "], got " + b) - return - } - this._sizeBuf.push(b) - continue - - case KEY: - // can be any char except =, not > size. - if (b === eq) { - this._state = VAL - this._key = new Buffer(this._keyBuf).toString() - if (keyTrans[this._key]) this._key = keyTrans[this._key] - this._keyBuf.length = 0 - continue - } - this._keyBuf.push(b) - continue - - case VAL: - // field must end with cr - if (this._fieldPos === this._size - 1) { - // console.error("finished with "+this._key) - if (b !== cr) { - error(this, "expected \\n at end of field") - return - } - var val = new Buffer(this._valBuf).toString() - if (numeric[this._key]) { - val = parseFloat(val) - } - this.fields[this._key] = val - - this._valBuf.length = 0 - this._state = SIZE - this._size = -1 - this._fieldPos = -1 - continue - } - this._valBuf.push(b) - continue - } - } -} - -function error (me, msg) { - msg = "invalid header: " + msg - + "\nposition=" + me._position - + "\nfield position=" + me._fieldPos - - me.error(msg) - me.state = ERR -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js deleted file mode 100644 index 9fb1e6fb1b..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/extract.js +++ /dev/null @@ -1,86 +0,0 @@ -// give it a tarball and a path, and it'll dump the contents - -module.exports = Extract - -var tar = require("../tar.js") - , fstream = require("fstream") - , inherits = require("inherits") - , path = require("path") - -function Extract (opts) { - if (!(this instanceof Extract)) return new Extract(opts) - tar.Parse.apply(this) - - // have to dump into a directory - opts.type = "Directory" - opts.Directory = true - - if (typeof opts !== "object") { - opts = { path: opts } - } - - // better to drop in cwd? seems more standard. - opts.path = opts.path || path.resolve("node-tar-extract") - opts.type = "Directory" - opts.Directory = true - - // similar to --strip or --strip-components - opts.strip = +opts.strip - if (!opts.strip || opts.strip <= 0) opts.strip = 0 - - this._fst = fstream.Writer(opts) - - this.pause() - var me = this - - // Hardlinks in tarballs are relative to the root - // of the tarball. So, they need to be resolved against - // the target directory in order to be created properly. - me.on("entry", function (entry) { - // if there's a "strip" argument, then strip off that many - // path components. - if (opts.strip) { - var p = entry.path.split("/").slice(opts.strip).join("/") - entry.path = entry.props.path = p - if (entry.linkpath) { - var lp = entry.linkpath.split("/").slice(opts.strip).join("/") - entry.linkpath = entry.props.linkpath = lp - } - } - if (entry.type !== "Link") return - entry.linkpath = entry.props.linkpath = - path.join(opts.path, path.join("/", entry.props.linkpath)) - }) - - this._fst.on("ready", function () { - me.pipe(me._fst, { end: false }) - me.resume() - }) - - this._fst.on('error', function(err) { - me.emit('error', err) - }) - - this._fst.on('drain', function() { - me.emit('drain') - }) - - // this._fst.on("end", function () { - // console.error("\nEEEE Extract End", me._fst.path) - // }) - - this._fst.on("close", function () { - // console.error("\nEEEE Extract End", me._fst.path) - me.emit("end") - me.emit("close") - }) -} - -inherits(Extract, tar.Parse) - -Extract.prototype._streamEnd = function () { - var me = this - if (!me._ended) me.error("unexpected eof") - me._fst.end() - // my .end() is coming later. -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js deleted file mode 100644 index 0bfc7b80aa..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/global-header-writer.js +++ /dev/null @@ -1,14 +0,0 @@ -module.exports = GlobalHeaderWriter - -var ExtendedHeaderWriter = require("./extended-header-writer.js") - , inherits = require("inherits") - -inherits(GlobalHeaderWriter, ExtendedHeaderWriter) - -function GlobalHeaderWriter (props) { - if (!(this instanceof GlobalHeaderWriter)) { - return new GlobalHeaderWriter(props) - } - ExtendedHeaderWriter.call(this, props) - this.props.type = "g" -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js deleted file mode 100644 index 05b237c0c7..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/header.js +++ /dev/null @@ -1,385 +0,0 @@ -// parse a 512-byte header block to a data object, or vice-versa -// If the data won't fit nicely in a simple header, then generate -// the appropriate extended header file, and return that. - -module.exports = TarHeader - -var tar = require("../tar.js") - , fields = tar.fields - , fieldOffs = tar.fieldOffs - , fieldEnds = tar.fieldEnds - , fieldSize = tar.fieldSize - , numeric = tar.numeric - , assert = require("assert").ok - , space = " ".charCodeAt(0) - , slash = "/".charCodeAt(0) - , bslash = process.platform === "win32" ? "\\".charCodeAt(0) : null - -function TarHeader (block) { - if (!(this instanceof TarHeader)) return new TarHeader(block) - if (block) this.decode(block) -} - -TarHeader.prototype = - { decode : decode - , encode: encode - , calcSum: calcSum - , checkSum: checkSum - } - -TarHeader.parseNumeric = parseNumeric -TarHeader.encode = encode -TarHeader.decode = decode - -// note that this will only do the normal ustar header, not any kind -// of extended posix header file. If something doesn't fit comfortably, -// then it will set obj.needExtended = true, and set the block to -// the closest approximation. -function encode (obj) { - if (!obj && !(this instanceof TarHeader)) throw new Error( - "encode must be called on a TarHeader, or supplied an object") - - obj = obj || this - var block = obj.block = new Buffer(512) - - // if the object has a "prefix", then that's actually an extension of - // the path field. - if (obj.prefix) { - // console.error("%% header encoding, got a prefix", obj.prefix) - obj.path = obj.prefix + "/" + obj.path - // console.error("%% header encoding, prefixed path", obj.path) - obj.prefix = "" - } - - obj.needExtended = false - - if (obj.mode) { - if (typeof obj.mode === "string") obj.mode = parseInt(obj.mode, 8) - obj.mode = obj.mode & 0777 - } - - for (var f = 0; fields[f] !== null; f ++) { - var field = fields[f] - , off = fieldOffs[f] - , end = fieldEnds[f] - , ret - - switch (field) { - case "cksum": - // special, done below, after all the others - break - - case "prefix": - // special, this is an extension of the "path" field. - // console.error("%% header encoding, skip prefix later") - break - - case "type": - // convert from long name to a single char. - var type = obj.type || "0" - if (type.length > 1) { - type = tar.types[obj.type] - if (!type) type = "0" - } - writeText(block, off, end, type) - break - - case "path": - // uses the "prefix" field if > 100 bytes, but <= 255 - var pathLen = Buffer.byteLength(obj.path) - , pathFSize = fieldSize[fields.path] - , prefFSize = fieldSize[fields.prefix] - - // paths between 100 and 255 should use the prefix field. - // longer than 255 - if (pathLen > pathFSize && - pathLen <= pathFSize + prefFSize) { - // need to find a slash somewhere in the middle so that - // path and prefix both fit in their respective fields - var searchStart = pathLen - 1 - pathFSize - , searchEnd = prefFSize - , found = false - , pathBuf = new Buffer(obj.path) - - for ( var s = searchStart - ; (s <= searchEnd) - ; s ++ ) { - if (pathBuf[s] === slash || pathBuf[s] === bslash) { - found = s - break - } - } - - if (found !== false) { - prefix = pathBuf.slice(0, found).toString("utf8") - path = pathBuf.slice(found + 1).toString("utf8") - - ret = writeText(block, off, end, path) - off = fieldOffs[fields.prefix] - end = fieldEnds[fields.prefix] - // console.error("%% header writing prefix", off, end, prefix) - ret = writeText(block, off, end, prefix) || ret - break - } - } - - // paths less than 100 chars don't need a prefix - // and paths longer than 255 need an extended header and will fail - // on old implementations no matter what we do here. - // Null out the prefix, and fallthrough to default. - // console.error("%% header writing no prefix") - var poff = fieldOffs[fields.prefix] - , pend = fieldEnds[fields.prefix] - writeText(block, poff, pend, "") - // fallthrough - - // all other fields are numeric or text - default: - ret = numeric[field] - ? writeNumeric(block, off, end, obj[field]) - : writeText(block, off, end, obj[field] || "") - break - } - obj.needExtended = obj.needExtended || ret - } - - var off = fieldOffs[fields.cksum] - , end = fieldEnds[fields.cksum] - - writeNumeric(block, off, end, calcSum.call(this, block)) - - return block -} - -// if it's a negative number, or greater than will fit, -// then use write256. -var MAXNUM = { 12: 077777777777 - , 11: 07777777777 - , 8 : 07777777 - , 7 : 0777777 } -function writeNumeric (block, off, end, num) { - var writeLen = end - off - , maxNum = MAXNUM[writeLen] || 0 - - num = num || 0 - // console.error(" numeric", num) - - if (num instanceof Date || - Object.prototype.toString.call(num) === "[object Date]") { - num = num.getTime() / 1000 - } - - if (num > maxNum || num < 0) { - write256(block, off, end, num) - // need an extended header if negative or too big. - return true - } - - // god, tar is so annoying - // if the string is small enough, you should put a space - // between the octal string and the \0, but if it doesn't - // fit, then don't. - var numStr = Math.floor(num).toString(8) - if (num < MAXNUM[writeLen - 1]) numStr += " " - - // pad with "0" chars - if (numStr.length < writeLen) { - numStr = (new Array(writeLen - numStr.length).join("0")) + numStr - } - - if (numStr.length !== writeLen - 1) { - throw new Error("invalid length: " + JSON.stringify(numStr) + "\n" + - "expected: "+writeLen) - } - block.write(numStr, off, writeLen, "utf8") - block[end - 1] = 0 -} - -function write256 (block, off, end, num) { - var buf = block.slice(off, end) - var positive = num >= 0 - buf[0] = positive ? 0x80 : 0xFF - - // get the number as a base-256 tuple - if (!positive) num *= -1 - var tuple = [] - do { - var n = num % 256 - tuple.push(n) - num = (num - n) / 256 - } while (num) - - var bytes = tuple.length - - var fill = buf.length - bytes - for (var i = 1; i < fill; i ++) { - buf[i] = positive ? 0 : 0xFF - } - - // tuple is a base256 number, with [0] as the *least* significant byte - // if it's negative, then we need to flip all the bits once we hit the - // first non-zero bit. The 2's-complement is (0x100 - n), and the 1's- - // complement is (0xFF - n). - var zero = true - for (i = bytes; i > 0; i --) { - var byte = tuple[bytes - i] - if (positive) buf[fill + i] = byte - else if (zero && byte === 0) buf[fill + i] = 0 - else if (zero) { - zero = false - buf[fill + i] = 0x100 - byte - } else buf[fill + i] = 0xFF - byte - } -} - -function writeText (block, off, end, str) { - // strings are written as utf8, then padded with \0 - var strLen = Buffer.byteLength(str) - , writeLen = Math.min(strLen, end - off) - // non-ascii fields need extended headers - // long fields get truncated - , needExtended = strLen !== str.length || strLen > writeLen - - // write the string, and null-pad - if (writeLen > 0) block.write(str, off, writeLen, "utf8") - for (var i = off + writeLen; i < end; i ++) block[i] = 0 - - return needExtended -} - -function calcSum (block) { - block = block || this.block - assert(Buffer.isBuffer(block) && block.length === 512) - - if (!block) throw new Error("Need block to checksum") - - // now figure out what it would be if the cksum was " " - var sum = 0 - , start = fieldOffs[fields.cksum] - , end = fieldEnds[fields.cksum] - - for (var i = 0; i < fieldOffs[fields.cksum]; i ++) { - sum += block[i] - } - - for (var i = start; i < end; i ++) { - sum += space - } - - for (var i = end; i < 512; i ++) { - sum += block[i] - } - - return sum -} - - -function checkSum (block) { - var sum = calcSum.call(this, block) - block = block || this.block - - var cksum = block.slice(fieldOffs[fields.cksum], fieldEnds[fields.cksum]) - cksum = parseNumeric(cksum) - - return cksum === sum -} - -function decode (block) { - block = block || this.block - assert(Buffer.isBuffer(block) && block.length === 512) - - this.block = block - this.cksumValid = this.checkSum() - - var prefix = null - - // slice off each field. - for (var f = 0; fields[f] !== null; f ++) { - var field = fields[f] - , val = block.slice(fieldOffs[f], fieldEnds[f]) - - switch (field) { - case "ustar": - // if not ustar, then everything after that is just padding. - if (val.toString() !== "ustar\0") { - this.ustar = false - return - } else { - // console.error("ustar:", val, val.toString()) - this.ustar = val.toString() - } - break - - // prefix is special, since it might signal the xstar header - case "prefix": - var atime = parseNumeric(val.slice(131, 131 + 12)) - , ctime = parseNumeric(val.slice(131 + 12, 131 + 12 + 12)) - if ((val[130] === 0 || val[130] === space) && - typeof atime === "number" && - typeof ctime === "number" && - val[131 + 12] === space && - val[131 + 12 + 12] === space) { - this.atime = atime - this.ctime = ctime - val = val.slice(0, 130) - } - prefix = val.toString("utf8").replace(/\0+$/, "") - // console.error("%% header reading prefix", prefix) - break - - // all other fields are null-padding text - // or a number. - default: - if (numeric[field]) { - this[field] = parseNumeric(val) - } else { - this[field] = val.toString("utf8").replace(/\0+$/, "") - } - break - } - } - - // if we got a prefix, then prepend it to the path. - if (prefix) { - this.path = prefix + "/" + this.path - // console.error("%% header got a prefix", this.path) - } -} - -function parse256 (buf) { - // first byte MUST be either 80 or FF - // 80 for positive, FF for 2's comp - var positive - if (buf[0] === 0x80) positive = true - else if (buf[0] === 0xFF) positive = false - else return null - - // build up a base-256 tuple from the least sig to the highest - var zero = false - , tuple = [] - for (var i = buf.length - 1; i > 0; i --) { - var byte = buf[i] - if (positive) tuple.push(byte) - else if (zero && byte === 0) tuple.push(0) - else if (zero) { - zero = false - tuple.push(0x100 - byte) - } else tuple.push(0xFF - byte) - } - - for (var sum = 0, i = 0, l = tuple.length; i < l; i ++) { - sum += tuple[i] * Math.pow(256, i) - } - - return positive ? sum : -1 * sum -} - -function parseNumeric (f) { - if (f[0] & 0x80) return parse256(f) - - var str = f.toString("utf8").split("\0")[0].trim() - , res = parseInt(str, 8) - - return isNaN(res) ? null : res -} - diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js deleted file mode 100644 index 3ff14dd695..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/pack.js +++ /dev/null @@ -1,231 +0,0 @@ -// pipe in an fstream, and it'll make a tarball. -// key-value pair argument is global extended header props. - -module.exports = Pack - -var EntryWriter = require("./entry-writer.js") - , Stream = require("stream").Stream - , path = require("path") - , inherits = require("inherits") - , GlobalHeaderWriter = require("./global-header-writer.js") - , collect = require("fstream").collect - , eof = new Buffer(512) - -for (var i = 0; i < 512; i ++) eof[i] = 0 - -inherits(Pack, Stream) - -function Pack (props) { - // console.error("-- p ctor") - var me = this - if (!(me instanceof Pack)) return new Pack(props) - - if (props) me._noProprietary = props.noProprietary - else me._noProprietary = false - - me._global = props - - me.readable = true - me.writable = true - me._buffer = [] - // console.error("-- -- set current to null in ctor") - me._currentEntry = null - me._processing = false - - me._pipeRoot = null - me.on("pipe", function (src) { - if (src.root === me._pipeRoot) return - me._pipeRoot = src - src.on("end", function () { - me._pipeRoot = null - }) - me.add(src) - }) -} - -Pack.prototype.addGlobal = function (props) { - // console.error("-- p addGlobal") - if (this._didGlobal) return - this._didGlobal = true - - var me = this - GlobalHeaderWriter(props) - .on("data", function (c) { - me.emit("data", c) - }) - .end() -} - -Pack.prototype.add = function (stream) { - if (this._global && !this._didGlobal) this.addGlobal(this._global) - - if (this._ended) return this.emit("error", new Error("add after end")) - - collect(stream) - this._buffer.push(stream) - this._process() - this._needDrain = this._buffer.length > 0 - return !this._needDrain -} - -Pack.prototype.pause = function () { - this._paused = true - if (this._currentEntry) this._currentEntry.pause() - this.emit("pause") -} - -Pack.prototype.resume = function () { - this._paused = false - if (this._currentEntry) this._currentEntry.resume() - this.emit("resume") - this._process() -} - -Pack.prototype.end = function () { - this._ended = true - this._buffer.push(eof) - this._process() -} - -Pack.prototype._process = function () { - var me = this - if (me._paused || me._processing) { - return - } - - var entry = me._buffer.shift() - - if (!entry) { - if (me._needDrain) { - me.emit("drain") - } - return - } - - if (entry.ready === false) { - // console.error("-- entry is not ready", entry) - me._buffer.unshift(entry) - entry.on("ready", function () { - // console.error("-- -- ready!", entry) - me._process() - }) - return - } - - me._processing = true - - if (entry === eof) { - // need 2 ending null blocks. - me.emit("data", eof) - me.emit("data", eof) - me.emit("end") - me.emit("close") - return - } - - // Change the path to be relative to the root dir that was - // added to the tarball. - // - // XXX This should be more like how -C works, so you can - // explicitly set a root dir, and also explicitly set a pathname - // in the tarball to use. That way we can skip a lot of extra - // work when resolving symlinks for bundled dependencies in npm. - - var root = path.dirname((entry.root || entry).path) - var wprops = {} - - Object.keys(entry.props || {}).forEach(function (k) { - wprops[k] = entry.props[k] - }) - - if (me._noProprietary) wprops.noProprietary = true - - wprops.path = path.relative(root, entry.path || '') - - // actually not a matter of opinion or taste. - if (process.platform === "win32") { - wprops.path = wprops.path.replace(/\\/g, "/") - } - - if (!wprops.type) - wprops.type = 'Directory' - - switch (wprops.type) { - // sockets not supported - case "Socket": - return - - case "Directory": - wprops.path += "/" - wprops.size = 0 - break - - case "Link": - var lp = path.resolve(path.dirname(entry.path), entry.linkpath) - wprops.linkpath = path.relative(root, lp) || "." - wprops.size = 0 - break - - case "SymbolicLink": - var lp = path.resolve(path.dirname(entry.path), entry.linkpath) - wprops.linkpath = path.relative(path.dirname(entry.path), lp) || "." - wprops.size = 0 - break - } - - // console.error("-- new writer", wprops) - // if (!wprops.type) { - // // console.error("-- no type?", entry.constructor.name, entry) - // } - - // console.error("-- -- set current to new writer", wprops.path) - var writer = me._currentEntry = EntryWriter(wprops) - - writer.parent = me - - // writer.on("end", function () { - // // console.error("-- -- writer end", writer.path) - // }) - - writer.on("data", function (c) { - me.emit("data", c) - }) - - writer.on("header", function () { - Buffer.prototype.toJSON = function () { - return this.toString().split(/\0/).join(".") - } - // console.error("-- -- writer header %j", writer.props) - if (writer.props.size === 0) nextEntry() - }) - writer.on("close", nextEntry) - - var ended = false - function nextEntry () { - if (ended) return - ended = true - - // console.error("-- -- writer close", writer.path) - // console.error("-- -- set current to null", wprops.path) - me._currentEntry = null - me._processing = false - me._process() - } - - writer.on("error", function (er) { - // console.error("-- -- writer error", writer.path) - me.emit("error", er) - }) - - // if it's the root, then there's no need to add its entries, - // or data, since they'll be added directly. - if (entry === me._pipeRoot) { - // console.error("-- is the root, don't auto-add") - writer.add = null - } - - entry.pipe(writer) -} - -Pack.prototype.destroy = function () {} -Pack.prototype.write = function () {} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js b/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js deleted file mode 100644 index 8517c481bc..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/lib/parse.js +++ /dev/null @@ -1,271 +0,0 @@ - -// A writable stream. -// It emits "entry" events, which provide a readable stream that has -// header info attached. - -module.exports = Parse.create = Parse - -var stream = require("stream") - , Stream = stream.Stream - , BlockStream = require("block-stream") - , tar = require("../tar.js") - , TarHeader = require("./header.js") - , Entry = require("./entry.js") - , BufferEntry = require("./buffer-entry.js") - , ExtendedHeader = require("./extended-header.js") - , assert = require("assert").ok - , inherits = require("inherits") - , fstream = require("fstream") - -// reading a tar is a lot like reading a directory -// However, we're actually not going to run the ctor, -// since it does a stat and various other stuff. -// This inheritance gives us the pause/resume/pipe -// behavior that is desired. -inherits(Parse, fstream.Reader) - -function Parse () { - var me = this - if (!(me instanceof Parse)) return new Parse() - - // doesn't apply fstream.Reader ctor? - // no, becasue we don't want to stat/etc, we just - // want to get the entry/add logic from .pipe() - Stream.apply(me) - - me.writable = true - me.readable = true - me._stream = new BlockStream(512) - me.position = 0 - me._ended = false - - me._stream.on("error", function (e) { - me.emit("error", e) - }) - - me._stream.on("data", function (c) { - me._process(c) - }) - - me._stream.on("end", function () { - me._streamEnd() - }) - - me._stream.on("drain", function () { - me.emit("drain") - }) -} - -// overridden in Extract class, since it needs to -// wait for its DirWriter part to finish before -// emitting "end" -Parse.prototype._streamEnd = function () { - var me = this - if (!me._ended) me.error("unexpected eof") - me.emit("end") -} - -// a tar reader is actually a filter, not just a readable stream. -// So, you should pipe a tarball stream into it, and it needs these -// write/end methods to do that. -Parse.prototype.write = function (c) { - if (this._ended) { - // gnutar puts a LOT of nulls at the end. - // you can keep writing these things forever. - // Just ignore them. - for (var i = 0, l = c.length; i > l; i ++) { - if (c[i] !== 0) return this.error("write() after end()") - } - return - } - return this._stream.write(c) -} - -Parse.prototype.end = function (c) { - this._ended = true - return this._stream.end(c) -} - -// don't need to do anything, since we're just -// proxying the data up from the _stream. -// Just need to override the parent's "Not Implemented" -// error-thrower. -Parse.prototype._read = function () {} - -Parse.prototype._process = function (c) { - assert(c && c.length === 512, "block size should be 512") - - // one of three cases. - // 1. A new header - // 2. A part of a file/extended header - // 3. One of two or more EOF null blocks - - if (this._entry) { - var entry = this._entry - entry.write(c) - if (entry._remaining === 0) { - entry.end() - this._entry = null - } - } else { - // either zeroes or a header - var zero = true - for (var i = 0; i < 512 && zero; i ++) { - zero = c[i] === 0 - } - - // eof is *at least* 2 blocks of nulls, and then the end of the - // file. you can put blocks of nulls between entries anywhere, - // so appending one tarball to another is technically valid. - // ending without the eof null blocks is not allowed, however. - if (zero) { - if (this._eofStarted) - this._ended = true - this._eofStarted = true - } else { - this._eofStarted = false - this._startEntry(c) - } - } - - this.position += 512 -} - -// take a header chunk, start the right kind of entry. -Parse.prototype._startEntry = function (c) { - var header = new TarHeader(c) - , self = this - , entry - , ev - , EntryType - , onend - , meta = false - - if (null === header.size || !header.cksumValid) { - var e = new Error("invalid tar file") - e.header = header - e.tar_file_offset = this.position - e.tar_block = this.position / 512 - return this.emit("error", e) - } - - switch (tar.types[header.type]) { - case "File": - case "OldFile": - case "Link": - case "SymbolicLink": - case "CharacterDevice": - case "BlockDevice": - case "Directory": - case "FIFO": - case "ContiguousFile": - case "GNUDumpDir": - // start a file. - // pass in any extended headers - // These ones consumers are typically most interested in. - EntryType = Entry - ev = "entry" - break - - case "GlobalExtendedHeader": - // extended headers that apply to the rest of the tarball - EntryType = ExtendedHeader - onend = function () { - self._global = self._global || {} - Object.keys(entry.fields).forEach(function (k) { - self._global[k] = entry.fields[k] - }) - } - ev = "globalExtendedHeader" - meta = true - break - - case "ExtendedHeader": - case "OldExtendedHeader": - // extended headers that apply to the next entry - EntryType = ExtendedHeader - onend = function () { - self._extended = entry.fields - } - ev = "extendedHeader" - meta = true - break - - case "NextFileHasLongLinkpath": - // set linkpath=<contents> in extended header - EntryType = BufferEntry - onend = function () { - self._extended = self._extended || {} - self._extended.linkpath = entry.body - } - ev = "longLinkpath" - meta = true - break - - case "NextFileHasLongPath": - case "OldGnuLongPath": - // set path=<contents> in file-extended header - EntryType = BufferEntry - onend = function () { - self._extended = self._extended || {} - self._extended.path = entry.body - } - ev = "longPath" - meta = true - break - - default: - // all the rest we skip, but still set the _entry - // member, so that we can skip over their data appropriately. - // emit an event to say that this is an ignored entry type? - EntryType = Entry - ev = "ignoredEntry" - break - } - - var global, extended - if (meta) { - global = extended = null - } else { - var global = this._global - var extended = this._extended - - // extendedHeader only applies to one entry, so once we start - // an entry, it's over. - this._extended = null - } - entry = new EntryType(header, extended, global) - entry.meta = meta - - // only proxy data events of normal files. - if (!meta) { - entry.on("data", function (c) { - me.emit("data", c) - }) - } - - if (onend) entry.on("end", onend) - - this._entry = entry - var me = this - - entry.on("pause", function () { - me.pause() - }) - - entry.on("resume", function () { - me.resume() - }) - - if (this.listeners("*").length) { - this.emit("*", ev, entry) - } - - this.emit(ev, entry) - - // Zero-byte entry. End immediately. - if (entry.props.size === 0) { - entry.end() - this._entry = null - } -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/LICENCE b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/LICENCE deleted file mode 100644 index 74489e2e26..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/LICENCE +++ /dev/null @@ -1,25 +0,0 @@ -Copyright (c) Isaac Z. Schlueter -All rights reserved. - -The BSD License - -Redistribution and use in source and binary forms, with or without -modification, are permitted provided that the following conditions -are met: -1. Redistributions of source code must retain the above copyright - notice, this list of conditions and the following disclaimer. -2. Redistributions in binary form must reproduce the above copyright - notice, this list of conditions and the following disclaimer in the - documentation and/or other materials provided with the distribution. - -THIS SOFTWARE IS PROVIDED BY THE NETBSD FOUNDATION, INC. AND CONTRIBUTORS -``AS IS'' AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED -TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR -PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE FOUNDATION OR CONTRIBUTORS -BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR -CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF -SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS -INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN -CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) -ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE -POSSIBILITY OF SUCH DAMAGE. diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/README.md b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/README.md deleted file mode 100644 index c16e9c4688..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/README.md +++ /dev/null @@ -1,14 +0,0 @@ -# block-stream - -A stream of blocks. - -Write data into it, and it'll output data in buffer blocks the size you -specify, padding with zeroes if necessary. - -```javascript -var block = new BlockStream(512) -fs.createReadStream("some-file").pipe(block) -block.pipe(fs.createWriteStream("block-file")) -``` - -When `.end()` or `.flush()` is called, it'll pad the block with zeroes. diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream-pause.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream-pause.js deleted file mode 100644 index 9328844aa6..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream-pause.js +++ /dev/null @@ -1,70 +0,0 @@ -var BlockStream = require("../block-stream.js") - -var blockSizes = [16, 25, 1024] - , writeSizes = [4, 8, 15, 16, 17, 64, 100] - , writeCounts = [1, 10, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize, {nopad: true }) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - f.pause() - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - f.resume() - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = writeSize * writeCount * 2 - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream.js deleted file mode 100644 index 1141f3a84c..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/block-stream.js +++ /dev/null @@ -1,68 +0,0 @@ -var BlockStream = require("../block-stream.js") - -var blockSizes = [16, 25, 1024] - , writeSizes = [4, 8, 15, 16, 17, 64, 100] - , writeCounts = [1, 10, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize, {nopad: true }) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = writeSize * writeCount * 2 - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper-pause.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper-pause.js deleted file mode 100644 index 93e4068eea..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper-pause.js +++ /dev/null @@ -1,70 +0,0 @@ -var BlockStream = require("dropper") - -var blockSizes = [16, 25, 1024] - , writeSizes = [4, 8, 15, 16, 17, 64, 100] - , writeCounts = [1, 10, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize, {nopad: true }) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - f.pause() - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - f.resume() - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = writeSize * writeCount * 2 - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper.js deleted file mode 100644 index 55fa133054..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/bench/dropper.js +++ /dev/null @@ -1,68 +0,0 @@ -var BlockStream = require("dropper") - -var blockSizes = [16, 25, 1024] - , writeSizes = [4, 8, 15, 16, 17, 64, 100] - , writeCounts = [1, 10, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize, {nopad: true }) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = writeSize * writeCount * 2 - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/block-stream.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/block-stream.js deleted file mode 100644 index 008de035c2..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/block-stream.js +++ /dev/null @@ -1,209 +0,0 @@ -// write data to it, and it'll emit data in 512 byte blocks. -// if you .end() or .flush(), it'll emit whatever it's got, -// padded with nulls to 512 bytes. - -module.exports = BlockStream - -var Stream = require("stream").Stream - , inherits = require("inherits") - , assert = require("assert").ok - , debug = process.env.DEBUG ? console.error : function () {} - -function BlockStream (size, opt) { - this.writable = this.readable = true - this._opt = opt || {} - this._chunkSize = size || 512 - this._offset = 0 - this._buffer = [] - this._bufferLength = 0 - if (this._opt.nopad) this._zeroes = false - else { - this._zeroes = new Buffer(this._chunkSize) - for (var i = 0; i < this._chunkSize; i ++) { - this._zeroes[i] = 0 - } - } -} - -inherits(BlockStream, Stream) - -BlockStream.prototype.write = function (c) { - // debug(" BS write", c) - if (this._ended) throw new Error("BlockStream: write after end") - if (c && !Buffer.isBuffer(c)) c = new Buffer(c + "") - if (c.length) { - this._buffer.push(c) - this._bufferLength += c.length - } - // debug("pushed onto buffer", this._bufferLength) - if (this._bufferLength >= this._chunkSize) { - if (this._paused) { - // debug(" BS paused, return false, need drain") - this._needDrain = true - return false - } - this._emitChunk() - } - return true -} - -BlockStream.prototype.pause = function () { - // debug(" BS pausing") - this._paused = true -} - -BlockStream.prototype.resume = function () { - // debug(" BS resume") - this._paused = false - return this._emitChunk() -} - -BlockStream.prototype.end = function (chunk) { - // debug("end", chunk) - if (typeof chunk === "function") cb = chunk, chunk = null - if (chunk) this.write(chunk) - this._ended = true - this.flush() -} - -BlockStream.prototype.flush = function () { - this._emitChunk(true) -} - -BlockStream.prototype._emitChunk = function (flush) { - // debug("emitChunk flush=%j emitting=%j paused=%j", flush, this._emitting, this._paused) - - // emit a <chunkSize> chunk - if (flush && this._zeroes) { - // debug(" BS push zeroes", this._bufferLength) - // push a chunk of zeroes - var padBytes = (this._bufferLength % this._chunkSize) - if (padBytes !== 0) padBytes = this._chunkSize - padBytes - if (padBytes > 0) { - // debug("padBytes", padBytes, this._zeroes.slice(0, padBytes)) - this._buffer.push(this._zeroes.slice(0, padBytes)) - this._bufferLength += padBytes - // debug(this._buffer[this._buffer.length - 1].length, this._bufferLength) - } - } - - if (this._emitting || this._paused) return - this._emitting = true - - // debug(" BS entering loops") - var bufferIndex = 0 - while (this._bufferLength >= this._chunkSize && - (flush || !this._paused)) { - // debug(" BS data emission loop", this._bufferLength) - - var out - , outOffset = 0 - , outHas = this._chunkSize - - while (outHas > 0 && (flush || !this._paused) ) { - // debug(" BS data inner emit loop", this._bufferLength) - var cur = this._buffer[bufferIndex] - , curHas = cur.length - this._offset - // debug("cur=", cur) - // debug("curHas=%j", curHas) - // If it's not big enough to fill the whole thing, then we'll need - // to copy multiple buffers into one. However, if it is big enough, - // then just slice out the part we want, to save unnecessary copying. - // Also, need to copy if we've already done some copying, since buffers - // can't be joined like cons strings. - if (out || curHas < outHas) { - out = out || new Buffer(this._chunkSize) - cur.copy(out, outOffset, - this._offset, this._offset + Math.min(curHas, outHas)) - } else if (cur.length === outHas && this._offset === 0) { - // shortcut -- cur is exactly long enough, and no offset. - out = cur - } else { - // slice out the piece of cur that we need. - out = cur.slice(this._offset, this._offset + outHas) - } - - if (curHas > outHas) { - // means that the current buffer couldn't be completely output - // update this._offset to reflect how much WAS written - this._offset += outHas - outHas = 0 - } else { - // output the entire current chunk. - // toss it away - outHas -= curHas - outOffset += curHas - bufferIndex ++ - this._offset = 0 - } - } - - this._bufferLength -= this._chunkSize - assert(out.length === this._chunkSize) - // debug("emitting data", out) - // debug(" BS emitting, paused=%j", this._paused, this._bufferLength) - this.emit("data", out) - out = null - } - // debug(" BS out of loops", this._bufferLength) - - // whatever is left, it's not enough to fill up a block, or we're paused - this._buffer = this._buffer.slice(bufferIndex) - if (this._paused) { - // debug(" BS paused, leaving", this._bufferLength) - this._needsDrain = true - this._emitting = false - return - } - - // if flushing, and not using null-padding, then need to emit the last - // chunk(s) sitting in the queue. We know that it's not enough to - // fill up a whole block, because otherwise it would have been emitted - // above, but there may be some offset. - var l = this._buffer.length - if (flush && !this._zeroes && l) { - if (l === 1) { - if (this._offset) { - this.emit("data", this._buffer[0].slice(this._offset)) - } else { - this.emit("data", this._buffer[0]) - } - } else { - var outHas = this._bufferLength - , out = new Buffer(outHas) - , outOffset = 0 - for (var i = 0; i < l; i ++) { - var cur = this._buffer[i] - , curHas = cur.length - this._offset - cur.copy(out, outOffset, this._offset) - this._offset = 0 - outOffset += curHas - this._bufferLength -= curHas - } - this.emit("data", out) - } - // truncate - this._buffer.length = 0 - this._bufferLength = 0 - this._offset = 0 - } - - // now either drained or ended - // debug("either draining, or ended", this._bufferLength, this._ended) - // means that we've flushed out all that we can so far. - if (this._needDrain) { - // debug("emitting drain", this._bufferLength) - this._needDrain = false - this.emit("drain") - } - - if ((this._bufferLength === 0) && this._ended && !this._endEmitted) { - // debug("emitting end", this._bufferLength) - this._endEmitted = true - this.emit("end") - } - - this._emitting = false - - // debug(" BS no longer emitting", flush, this._paused, this._emitting, this._bufferLength, this._chunkSize) -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/package.json b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/package.json deleted file mode 100644 index 97d9d42aba..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/package.json +++ /dev/null @@ -1,55 +0,0 @@ -{ - "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me", - "url": "http://blog.izs.me/" - }, - "name": "block-stream", - "description": "a stream of blocks", - "version": "0.0.8", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/block-stream.git" - }, - "engines": { - "node": "0.4 || >=0.5.8" - }, - "main": "block-stream.js", - "dependencies": { - "inherits": "~2.0.0" - }, - "devDependencies": { - "tap": "0.x" - }, - "scripts": { - "test": "tap test/" - }, - "license": "ISC", - "gitHead": "b35520314f4763af0788d65a846bb43d9c0a8f02", - "bugs": { - "url": "https://github.com/isaacs/block-stream/issues" - }, - "homepage": "https://github.com/isaacs/block-stream#readme", - "_id": "block-stream@0.0.8", - "_shasum": "0688f46da2bbf9cff0c4f68225a0cb95cbe8a46b", - "_from": "block-stream@*", - "_npmVersion": "2.10.0", - "_nodeVersion": "2.0.1", - "_npmUser": { - "name": "isaacs", - "email": "isaacs@npmjs.com" - }, - "dist": { - "shasum": "0688f46da2bbf9cff0c4f68225a0cb95cbe8a46b", - "tarball": "http://registry.npmjs.org/block-stream/-/block-stream-0.0.8.tgz" - }, - "maintainers": [ - { - "name": "isaacs", - "email": "i@izs.me" - } - ], - "directories": {}, - "_resolved": "https://registry.npmjs.org/block-stream/-/block-stream-0.0.8.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/basic.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/basic.js deleted file mode 100644 index b4b930511e..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/basic.js +++ /dev/null @@ -1,27 +0,0 @@ -var tap = require("tap") - , BlockStream = require("../block-stream.js") - -tap.test("basic test", function (t) { - var b = new BlockStream(16) - var fs = require("fs") - var fstr = fs.createReadStream(__filename, {encoding: "utf8"}) - fstr.pipe(b) - - var stat - t.doesNotThrow(function () { - stat = fs.statSync(__filename) - }, "stat should not throw") - - var totalBytes = 0 - b.on("data", function (c) { - t.equal(c.length, 16, "chunks should be 16 bytes long") - t.type(c, Buffer, "chunks should be buffer objects") - totalBytes += c.length - }) - b.on("end", function () { - var expectedBytes = stat.size + (16 - stat.size % 16) - t.equal(totalBytes, expectedBytes, "Should be multiple of 16") - t.end() - }) - -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad-thorough.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad-thorough.js deleted file mode 100644 index 7a8de88b5b..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad-thorough.js +++ /dev/null @@ -1,68 +0,0 @@ -var BlockStream = require("../block-stream.js") - -var blockSizes = [16]//, 25]//, 1024] - , writeSizes = [4, 15, 16, 17, 64 ]//, 64, 100] - , writeCounts = [1, 10]//, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize, {nopad: true }) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = writeSize * writeCount * 2 - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad.js deleted file mode 100644 index 6d38429fbc..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/nopad.js +++ /dev/null @@ -1,57 +0,0 @@ -var BlockStream = require("../") -var tap = require("tap") - - -tap.test("don't pad, small writes", function (t) { - var f = new BlockStream(16, { nopad: true }) - t.plan(1) - - f.on("data", function (c) { - t.equal(c.toString(), "abc", "should get 'abc'") - }) - - f.on("end", function () { t.end() }) - - f.write(new Buffer("a")) - f.write(new Buffer("b")) - f.write(new Buffer("c")) - f.end() -}) - -tap.test("don't pad, exact write", function (t) { - var f = new BlockStream(16, { nopad: true }) - t.plan(1) - - var first = true - f.on("data", function (c) { - if (first) { - first = false - t.equal(c.toString(), "abcdefghijklmnop", "first chunk") - } else { - t.fail("should only get one") - } - }) - - f.on("end", function () { t.end() }) - - f.end(new Buffer("abcdefghijklmnop")) -}) - -tap.test("don't pad, big write", function (t) { - var f = new BlockStream(16, { nopad: true }) - t.plan(2) - - var first = true - f.on("data", function (c) { - if (first) { - first = false - t.equal(c.toString(), "abcdefghijklmnop", "first chunk") - } else { - t.equal(c.toString(), "q") - } - }) - - f.on("end", function () { t.end() }) - - f.end(new Buffer("abcdefghijklmnopq")) -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/pause-resume.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/pause-resume.js deleted file mode 100644 index 64d0d091da..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/pause-resume.js +++ /dev/null @@ -1,73 +0,0 @@ -var BlockStream = require("../block-stream.js") - -var blockSizes = [16] - , writeSizes = [15, 16, 17] - , writeCounts = [1, 10]//, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - var paused = false - - f.on("data", function (c) { - timeouts ++ - t.notOk(paused, "should not be paused when emitting data") - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - paused = true - f.pause() - process.nextTick(function () { - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - paused = false - f.resume() - timeouts -- - }) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = expectChunks * blockSize - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 200) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/thorough.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/thorough.js deleted file mode 100644 index 1cc9ea08a3..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/thorough.js +++ /dev/null @@ -1,68 +0,0 @@ -var BlockStream = require("../block-stream.js") - -var blockSizes = [16]//, 25]//, 1024] - , writeSizes = [4, 15, 16, 17, 64 ]//, 64, 100] - , writeCounts = [1, 10]//, 100] - , tap = require("tap") - -writeCounts.forEach(function (writeCount) { -blockSizes.forEach(function (blockSize) { -writeSizes.forEach(function (writeSize) { - tap.test("writeSize=" + writeSize + - " blockSize="+blockSize + - " writeCount="+writeCount, function (t) { - var f = new BlockStream(blockSize) - - var actualChunks = 0 - var actualBytes = 0 - var timeouts = 0 - - f.on("data", function (c) { - timeouts ++ - - actualChunks ++ - actualBytes += c.length - - // make sure that no data gets corrupted, and basic sanity - var before = c.toString() - // simulate a slow write operation - setTimeout(function () { - timeouts -- - - var after = c.toString() - t.equal(after, before, "should not change data") - - // now corrupt it, to find leaks. - for (var i = 0; i < c.length; i ++) { - c[i] = "x".charCodeAt(0) - } - }, 100) - }) - - f.on("end", function () { - // round up to the nearest block size - var expectChunks = Math.ceil(writeSize * writeCount * 2 / blockSize) - var expectBytes = expectChunks * blockSize - t.equal(actualBytes, expectBytes, - "bytes=" + expectBytes + " writeSize=" + writeSize) - t.equal(actualChunks, expectChunks, - "chunks=" + expectChunks + " writeSize=" + writeSize) - - // wait for all the timeout checks to finish, then end the test - setTimeout(function WAIT () { - if (timeouts > 0) return setTimeout(WAIT) - t.end() - }, 100) - }) - - for (var i = 0; i < writeCount; i ++) { - var a = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) a[j] = "a".charCodeAt(0) - var b = new Buffer(writeSize); - for (var j = 0; j < writeSize; j ++) b[j] = "b".charCodeAt(0) - f.write(a) - f.write(b) - } - f.end() - }) -}) }) }) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/two-stream.js b/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/two-stream.js deleted file mode 100644 index b0f5d82546..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/node_modules/block-stream/test/two-stream.js +++ /dev/null @@ -1,59 +0,0 @@ -var log = console.log, - assert = require( 'assert' ), - BlockStream = require("../block-stream.js"), - isize = 0, tsize = 0, fsize = 0, psize = 0, i = 0, - filter = null, paper = null, stack = null, - -// a source data buffer -tsize = 1 * 1024; // <- 1K -stack = new Buffer( tsize ); -for ( ; i < tsize; i++) stack[i] = "x".charCodeAt(0); - -isize = 1 * 1024; // <- initial packet size with 4K no bug! -fsize = 2 * 1024 ; // <- first block-stream size -psize = Math.ceil( isize / 6 ); // <- second block-stream size - -fexpected = Math.ceil( tsize / fsize ); // <- packets expected for first -pexpected = Math.ceil( tsize / psize ); // <- packets expected for second - - -filter = new BlockStream( fsize, { nopad : true } ); -paper = new BlockStream( psize, { nopad : true } ); - - -var fcounter = 0; -filter.on( 'data', function (c) { - // verify that they're not null-padded - for (var i = 0; i < c.length; i ++) { - assert.strictEqual(c[i], "x".charCodeAt(0)) - } - ++fcounter; -} ); - -var pcounter = 0; -paper.on( 'data', function (c) { - // verify that they're not null-padded - for (var i = 0; i < c.length; i ++) { - assert.strictEqual(c[i], "x".charCodeAt(0)) - } - ++pcounter; -} ); - -filter.pipe( paper ); - -filter.on( 'end', function () { - log("fcounter: %s === %s", fcounter, fexpected) - assert.strictEqual( fcounter, fexpected ); -} ); - -paper.on( 'end', function () { - log("pcounter: %s === %s", pcounter, pexpected); - assert.strictEqual( pcounter, pexpected ); -} ); - - -for ( i = 0, j = isize; j <= tsize; j += isize ) { - filter.write( stack.slice( j - isize, j ) ); -} - -filter.end(); diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/package.json b/deps/npm/node_modules/node-gyp/node_modules/tar/package.json deleted file mode 100644 index 7fab5394cd..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/package.json +++ /dev/null @@ -1,61 +0,0 @@ -{ - "author": { - "name": "Isaac Z. Schlueter", - "email": "i@izs.me", - "url": "http://blog.izs.me/" - }, - "name": "tar", - "description": "tar for node", - "version": "1.0.3", - "repository": { - "type": "git", - "url": "git://github.com/isaacs/node-tar.git" - }, - "main": "tar.js", - "scripts": { - "test": "tap test/*.js" - }, - "dependencies": { - "block-stream": "*", - "fstream": "^1.0.2", - "inherits": "2" - }, - "devDependencies": { - "graceful-fs": "^3.0.2", - "rimraf": "1.x", - "tap": "0.x", - "mkdirp": "^0.5.0" - }, - "license": "BSD", - "gitHead": "f4151128c585da236c6b1e278b762ecaedc20c15", - "bugs": { - "url": "https://github.com/isaacs/node-tar/issues" - }, - "homepage": "https://github.com/isaacs/node-tar", - "_id": "tar@1.0.3", - "_shasum": "15bcdab244fa4add44e4244a0176edb8aa9a2b44", - "_from": "tar@>=1.0.0 <2.0.0", - "_npmVersion": "2.1.10", - "_nodeVersion": "0.10.33", - "_npmUser": { - "name": "othiym23", - "email": "ogd@aoaioxxysz.net" - }, - "maintainers": [ - { - "name": "isaacs", - "email": "i@izs.me" - }, - { - "name": "othiym23", - "email": "ogd@aoaioxxysz.net" - } - ], - "dist": { - "shasum": "15bcdab244fa4add44e4244a0176edb8aa9a2b44", - "tarball": "http://registry.npmjs.org/tar/-/tar-1.0.3.tgz" - }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/tar/-/tar-1.0.3.tgz", - "readme": "ERROR: No README data found!" -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js b/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js deleted file mode 100644 index a81298b9a0..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/tar.js +++ /dev/null @@ -1,173 +0,0 @@ -// field paths that every tar file must have. -// header is padded to 512 bytes. -var f = 0 - , fields = {} - , path = fields.path = f++ - , mode = fields.mode = f++ - , uid = fields.uid = f++ - , gid = fields.gid = f++ - , size = fields.size = f++ - , mtime = fields.mtime = f++ - , cksum = fields.cksum = f++ - , type = fields.type = f++ - , linkpath = fields.linkpath = f++ - , headerSize = 512 - , blockSize = 512 - , fieldSize = [] - -fieldSize[path] = 100 -fieldSize[mode] = 8 -fieldSize[uid] = 8 -fieldSize[gid] = 8 -fieldSize[size] = 12 -fieldSize[mtime] = 12 -fieldSize[cksum] = 8 -fieldSize[type] = 1 -fieldSize[linkpath] = 100 - -// "ustar\0" may introduce another bunch of headers. -// these are optional, and will be nulled out if not present. - -var ustar = fields.ustar = f++ - , ustarver = fields.ustarver = f++ - , uname = fields.uname = f++ - , gname = fields.gname = f++ - , devmaj = fields.devmaj = f++ - , devmin = fields.devmin = f++ - , prefix = fields.prefix = f++ - , fill = fields.fill = f++ - -// terminate fields. -fields[f] = null - -fieldSize[ustar] = 6 -fieldSize[ustarver] = 2 -fieldSize[uname] = 32 -fieldSize[gname] = 32 -fieldSize[devmaj] = 8 -fieldSize[devmin] = 8 -fieldSize[prefix] = 155 -fieldSize[fill] = 12 - -// nb: prefix field may in fact be 130 bytes of prefix, -// a null char, 12 bytes for atime, 12 bytes for ctime. -// -// To recognize this format: -// 1. prefix[130] === ' ' or '\0' -// 2. atime and ctime are octal numeric values -// 3. atime and ctime have ' ' in their last byte - -var fieldEnds = {} - , fieldOffs = {} - , fe = 0 -for (var i = 0; i < f; i ++) { - fieldOffs[i] = fe - fieldEnds[i] = (fe += fieldSize[i]) -} - -// build a translation table of field paths. -Object.keys(fields).forEach(function (f) { - if (fields[f] !== null) fields[fields[f]] = f -}) - -// different values of the 'type' field -// paths match the values of Stats.isX() functions, where appropriate -var types = - { 0: "File" - , "\0": "OldFile" // like 0 - , "": "OldFile" - , 1: "Link" - , 2: "SymbolicLink" - , 3: "CharacterDevice" - , 4: "BlockDevice" - , 5: "Directory" - , 6: "FIFO" - , 7: "ContiguousFile" // like 0 - // posix headers - , g: "GlobalExtendedHeader" // k=v for the rest of the archive - , x: "ExtendedHeader" // k=v for the next file - // vendor-specific stuff - , A: "SolarisACL" // skip - , D: "GNUDumpDir" // like 5, but with data, which should be skipped - , I: "Inode" // metadata only, skip - , K: "NextFileHasLongLinkpath" // data = link path of next file - , L: "NextFileHasLongPath" // data = path of next file - , M: "ContinuationFile" // skip - , N: "OldGnuLongPath" // like L - , S: "SparseFile" // skip - , V: "TapeVolumeHeader" // skip - , X: "OldExtendedHeader" // like x - } - -Object.keys(types).forEach(function (t) { - types[types[t]] = types[types[t]] || t -}) - -// values for the mode field -var modes = - { suid: 04000 // set uid on extraction - , sgid: 02000 // set gid on extraction - , svtx: 01000 // set restricted deletion flag on dirs on extraction - , uread: 0400 - , uwrite: 0200 - , uexec: 0100 - , gread: 040 - , gwrite: 020 - , gexec: 010 - , oread: 4 - , owrite: 2 - , oexec: 1 - , all: 07777 - } - -var numeric = - { mode: true - , uid: true - , gid: true - , size: true - , mtime: true - , devmaj: true - , devmin: true - , cksum: true - , atime: true - , ctime: true - , dev: true - , ino: true - , nlink: true - } - -Object.keys(modes).forEach(function (t) { - modes[modes[t]] = modes[modes[t]] || t -}) - -var knownExtended = - { atime: true - , charset: true - , comment: true - , ctime: true - , gid: true - , gname: true - , linkpath: true - , mtime: true - , path: true - , realtime: true - , security: true - , size: true - , uid: true - , uname: true } - - -exports.fields = fields -exports.fieldSize = fieldSize -exports.fieldOffs = fieldOffs -exports.fieldEnds = fieldEnds -exports.types = types -exports.modes = modes -exports.numeric = numeric -exports.headerSize = headerSize -exports.blockSize = blockSize -exports.knownExtended = knownExtended - -exports.Pack = require("./lib/pack.js") -exports.Parse = require("./lib/parse.js") -exports.Extract = require("./lib/extract.js") diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js deleted file mode 100644 index 1524ff7af0..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/00-setup-fixtures.js +++ /dev/null @@ -1,53 +0,0 @@ -// the fixtures have some weird stuff that is painful -// to include directly in the repo for various reasons. -// -// So, unpack the fixtures with the system tar first. -// -// This means, of course, that it'll only work if you -// already have a tar implementation, and some of them -// will not properly unpack the fixtures anyway. -// -// But, since usually those tests will fail on Windows -// and other systems with less capable filesystems anyway, -// at least this way we don't cause inconveniences by -// merely cloning the repo or installing the package. - -var tap = require("tap") -, child_process = require("child_process") -, rimraf = require("rimraf") -, test = tap.test -, path = require("path") - -test("clean fixtures", function (t) { - rimraf(path.resolve(__dirname, "fixtures"), function (er) { - t.ifError(er, "rimraf ./fixtures/") - t.end() - }) -}) - -test("clean tmp", function (t) { - rimraf(path.resolve(__dirname, "tmp"), function (er) { - t.ifError(er, "rimraf ./tmp/") - t.end() - }) -}) - -test("extract fixtures", function (t) { - var c = child_process.spawn("tar" - ,["xzvf", "fixtures.tgz"] - ,{ cwd: __dirname }) - - c.stdout.on("data", errwrite) - c.stderr.on("data", errwrite) - function errwrite (chunk) { - process.stderr.write(chunk) - } - - c.on("exit", function (code) { - t.equal(code, 0, "extract fixtures should exit with 0") - if (code) { - t.comment("Note, all tests from here on out will fail because of this.") - } - t.end() - }) -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js deleted file mode 100644 index 45400cd9bb..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract-move.js +++ /dev/null @@ -1,132 +0,0 @@ -// Set the umask, so that it works the same everywhere. -process.umask(parseInt('22', 8)) - -var tap = require("tap") - , tar = require("../tar.js") - , fs = require("fs") - , gfs = require("graceful-fs") - , path = require("path") - , file = path.resolve(__dirname, "fixtures/dir.tar") - , target = path.resolve(__dirname, "tmp/extract-test") - , index = 0 - , fstream = require("fstream") - , rimraf = require("rimraf") - , mkdirp = require("mkdirp") - - , ee = 0 - , expectEntries = [ - { - "path" : "dir/", - "mode" : "750", - "type" : "5", - "depth" : undefined, - "size" : 0, - "linkpath" : "", - "nlink" : undefined, - "dev" : undefined, - "ino" : undefined - }, - { - "path" : "dir/sub/", - "mode" : "750", - "type" : "5", - "depth" : undefined, - "size" : 0, - "linkpath" : "", - "nlink" : undefined, - "dev" : undefined, - "ino" : undefined - } ] - -function slow (fs, method, t1, t2) { - var orig = fs[method] - if (!orig) return null - fs[method] = function () { - var args = [].slice.call(arguments) - console.error("slow", method, args[0]) - var cb = args.pop() - - setTimeout(function () { - orig.apply(fs, args.concat(function(er, data) { - setTimeout(function() { - cb(er, data) - }, t2) - })) - }, t1) - } -} - -// Make sure we get the graceful-fs that fstream is using. -var gfs2 -try { - gfs2 = require("fstream/node_modules/graceful-fs") -} catch (er) {} - -var slowMethods = ["chown", "chmod", "utimes", "lutimes"] -slowMethods.forEach(function (method) { - var t1 = 500 - var t2 = 0 - slow(fs, method, t1, t2) - slow(gfs, method, t1, t2) - if (gfs2) { - slow(gfs2, method, t1, t2) - } -}) - - - -// The extract class basically just pipes the input -// to a Reader, and then to a fstream.DirWriter - -// So, this is as much a test of fstream.Reader and fstream.Writer -// as it is of tar.Extract, but it sort of makes sense. - -tap.test("preclean", function (t) { - rimraf.sync(target) - /mkdirp.sync(target) - t.pass("cleaned!") - t.end() -}) - -tap.test("extract test", function (t) { - var extract = tar.Extract(target) - var inp = fs.createReadStream(file) - - // give it a weird buffer size to try to break in odd places - inp.bufferSize = 1234 - - inp.pipe(extract) - - extract.on("end", function () { - rimraf.sync(target) - - t.equal(ee, expectEntries.length, "should see "+ee+" entries") - - // should get no more entries after end - extract.removeAllListeners("entry") - extract.on("entry", function (e) { - t.fail("Should not get entries after end!") - }) - - t.end() - }) - - - extract.on("entry", function (entry) { - var found = - { path: entry.path - , mode: entry.props.mode.toString(8) - , type: entry.props.type - , depth: entry.props.depth - , size: entry.props.size - , linkpath: entry.props.linkpath - , nlink: entry.props.nlink - , dev: entry.props.dev - , ino: entry.props.ino - } - - var wanted = expectEntries[ee ++] - - t.equivalent(found, wanted, "tar entry " + ee + " " + wanted.path) - }) -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js deleted file mode 100644 index eca4e7cc96..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/extract.js +++ /dev/null @@ -1,367 +0,0 @@ -// Set the umask, so that it works the same everywhere. -process.umask(parseInt('22', 8)) - -var tap = require("tap") - , tar = require("../tar.js") - , fs = require("fs") - , path = require("path") - , file = path.resolve(__dirname, "fixtures/c.tar") - , target = path.resolve(__dirname, "tmp/extract-test") - , index = 0 - , fstream = require("fstream") - - , ee = 0 - , expectEntries = -[ { path: 'c.txt', - mode: '644', - type: '0', - depth: undefined, - size: 513, - linkpath: '', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: 'cc.txt', - mode: '644', - type: '0', - depth: undefined, - size: 513, - linkpath: '', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '644', - type: '0', - depth: undefined, - size: 100, - linkpath: '', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: 'Ω.txt', - mode: '644', - type: '0', - depth: undefined, - size: 2, - linkpath: '', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: 'Ω.txt', - mode: '644', - type: '0', - depth: undefined, - size: 2, - linkpath: '', - nlink: 1, - dev: 234881026, - ino: 51693379 }, - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '644', - type: '0', - depth: undefined, - size: 200, - linkpath: '', - nlink: 1, - dev: 234881026, - ino: 51681874 }, - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '644', - type: '0', - depth: undefined, - size: 201, - linkpath: '', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL', - mode: '777', - type: '2', - depth: undefined, - size: 0, - linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - nlink: undefined, - dev: undefined, - ino: undefined }, - { path: '200-hard', - mode: '644', - type: '0', - depth: undefined, - size: 200, - linkpath: '', - nlink: 2, - dev: 234881026, - ino: 51681874 }, - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '644', - type: '1', - depth: undefined, - size: 0, - linkpath: path.resolve(target, '200-hard'), - nlink: 2, - dev: 234881026, - ino: 51681874 } ] - - , ef = 0 - , expectFiles = -[ { path: '', - mode: '40755', - type: 'Directory', - depth: 0, - linkpath: undefined }, - { path: '/200-hard', - mode: '100644', - type: 'File', - depth: 1, - size: 200, - linkpath: undefined, - nlink: 2 }, - { path: '/200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL', - mode: '120777', - type: 'SymbolicLink', - depth: 1, - size: 200, - linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - nlink: 1 }, - { path: '/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '100644', - type: 'Link', - depth: 1, - size: 200, - linkpath: path.join(target, '200-hard'), - nlink: 2 }, - { path: '/c.txt', - mode: '100644', - type: 'File', - depth: 1, - size: 513, - linkpath: undefined, - nlink: 1 }, - { path: '/cc.txt', - mode: '100644', - type: 'File', - depth: 1, - size: 513, - linkpath: undefined, - nlink: 1 }, - { path: '/r', - mode: '40755', - type: 'Directory', - depth: 1, - linkpath: undefined }, - { path: '/r/e', - mode: '40755', - type: 'Directory', - depth: 2, - linkpath: undefined }, - { path: '/r/e/a', - mode: '40755', - type: 'Directory', - depth: 3, - linkpath: undefined }, - { path: '/r/e/a/l', - mode: '40755', - type: 'Directory', - depth: 4, - linkpath: undefined }, - { path: '/r/e/a/l/l', - mode: '40755', - type: 'Directory', - depth: 5, - linkpath: undefined }, - { path: '/r/e/a/l/l/y', - mode: '40755', - type: 'Directory', - depth: 6, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-', - mode: '40755', - type: 'Directory', - depth: 7, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d', - mode: '40755', - type: 'Directory', - depth: 8, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e', - mode: '40755', - type: 'Directory', - depth: 9, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e', - mode: '40755', - type: 'Directory', - depth: 10, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p', - mode: '40755', - type: 'Directory', - depth: 11, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-', - mode: '40755', - type: 'Directory', - depth: 12, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f', - mode: '40755', - type: 'Directory', - depth: 13, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o', - mode: '40755', - type: 'Directory', - depth: 14, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l', - mode: '40755', - type: 'Directory', - depth: 15, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d', - mode: '40755', - type: 'Directory', - depth: 16, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e', - mode: '40755', - type: 'Directory', - depth: 17, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r', - mode: '40755', - type: 'Directory', - depth: 18, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-', - mode: '40755', - type: 'Directory', - depth: 19, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p', - mode: '40755', - type: 'Directory', - depth: 20, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a', - mode: '40755', - type: 'Directory', - depth: 21, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t', - mode: '40755', - type: 'Directory', - depth: 22, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h', - mode: '40755', - type: 'Directory', - depth: 23, - linkpath: undefined }, - { path: '/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: '100644', - type: 'File', - depth: 24, - size: 100, - linkpath: undefined, - nlink: 1 }, - { path: '/Ω.txt', - mode: '100644', - type: 'File', - depth: 1, - size: 2, - linkpath: undefined, - nlink: 1 } ] - - - -// The extract class basically just pipes the input -// to a Reader, and then to a fstream.DirWriter - -// So, this is as much a test of fstream.Reader and fstream.Writer -// as it is of tar.Extract, but it sort of makes sense. - -tap.test("preclean", function (t) { - require("rimraf").sync(__dirname + "/tmp/extract-test") - t.pass("cleaned!") - t.end() -}) - -tap.test("extract test", function (t) { - var extract = tar.Extract(target) - var inp = fs.createReadStream(file) - - // give it a weird buffer size to try to break in odd places - inp.bufferSize = 1234 - - inp.pipe(extract) - - extract.on("end", function () { - t.equal(ee, expectEntries.length, "should see "+ee+" entries") - - // should get no more entries after end - extract.removeAllListeners("entry") - extract.on("entry", function (e) { - t.fail("Should not get entries after end!") - }) - - next() - }) - - extract.on("entry", function (entry) { - var found = - { path: entry.path - , mode: entry.props.mode.toString(8) - , type: entry.props.type - , depth: entry.props.depth - , size: entry.props.size - , linkpath: entry.props.linkpath - , nlink: entry.props.nlink - , dev: entry.props.dev - , ino: entry.props.ino - } - - var wanted = expectEntries[ee ++] - - t.equivalent(found, wanted, "tar entry " + ee + " " + wanted.path) - }) - - function next () { - var r = fstream.Reader({ path: target - , type: "Directory" - // this is just to encourage consistency - , sort: "alpha" }) - - r.on("ready", function () { - foundEntry(r) - }) - - r.on("end", finish) - - function foundEntry (entry) { - var p = entry.path.substr(target.length) - var found = - { path: p - , mode: entry.props.mode.toString(8) - , type: entry.props.type - , depth: entry.props.depth - , size: entry.props.size - , linkpath: entry.props.linkpath - , nlink: entry.props.nlink - } - - var wanted = expectFiles[ef ++] - - t.has(found, wanted, "unpacked file " + ef + " " + wanted.path) - - entry.on("entry", foundEntry) - } - - function finish () { - t.equal(ef, expectFiles.length, "should have "+ef+" items") - t.end() - } - } -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz b/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz Binary files differdeleted file mode 100644 index f1676023af..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/fixtures.tgz +++ /dev/null diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js deleted file mode 100644 index 8ea6f79500..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/header.js +++ /dev/null @@ -1,183 +0,0 @@ -var tap = require("tap") -var TarHeader = require("../lib/header.js") -var tar = require("../tar.js") -var fs = require("fs") - - -var headers = - { "a.txt file header": - [ "612e747874000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303430312031313635313336303333332030313234353100203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true - , path: 'a.txt' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 257 - , mtime: 1319493851 - , cksum: 5417 - , type: '0' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } - ] - - , "omega pax": // the extended header from omega tar. - [ "5061784865616465722fcea92e74787400000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303137302031313534333731303631312030313530353100207800000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true - , path: 'PaxHeader/Ω.txt' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 120 - , mtime: 1301254537 - , cksum: 6697 - , type: 'x' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } ] - - , "omega file header": - [ "cea92e7478740000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303030322031313534333731303631312030313330373200203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true - , path: 'Ω.txt' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 2 - , mtime: 1301254537 - , cksum: 5690 - , type: '0' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } ] - - , "foo.js file header": - [ "666f6f2e6a730000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030303030342031313534333637303734312030313236313700203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true - , path: 'foo.js' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 4 - , mtime: 1301246433 - , cksum: 5519 - , type: '0' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } - ] - - , "b.txt file header": - [ "622e747874000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000030303036343420003035373736312000303030303234200030303030303030313030302031313635313336303637372030313234363100203000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000757374617200303069736161637300000000000000000000000000000000000000000000000000007374616666000000000000000000000000000000000000000000000000000000303030303030200030303030303020000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true - , path: 'b.txt' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 512 - , mtime: 1319494079 - , cksum: 5425 - , type: '0' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } - ] - - , "deep nested file": - [ "636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363636363633030303634342000303537373631200030303030323420003030303030303030313434203131363532313531353333203034333331340020300000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000075737461720030306973616163730000000000000000000000000000000000000000000000000000737461666600000000000000000000000000000000000000000000000000000030303030303020003030303030302000722f652f612f6c2f6c2f792f2d2f642f652f652f702f2d2f662f6f2f6c2f642f652f722f2d2f702f612f742f680000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000000" - , { cksumValid: true, - path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc' - , mode: 420 - , uid: 24561 - , gid: 20 - , size: 100 - , mtime: 1319687003 - , cksum: 18124 - , type: '0' - , linkpath: '' - , ustar: 'ustar\0' - , ustarver: '00' - , uname: 'isaacs' - , gname: 'staff' - , devmaj: 0 - , devmin: 0 - , fill: '' } - ] - } - -tap.test("parsing", function (t) { - Object.keys(headers).forEach(function (name) { - var h = headers[name] - , header = new Buffer(h[0], "hex") - , expect = h[1] - , parsed = new TarHeader(header) - - // console.error(parsed) - t.has(parsed, expect, "parse " + name) - }) - t.end() -}) - -tap.test("encoding", function (t) { - Object.keys(headers).forEach(function (name) { - var h = headers[name] - , expect = new Buffer(h[0], "hex") - , encoded = TarHeader.encode(h[1]) - - // might have slightly different bytes, since the standard - // isn't very strict, but should have the same semantics - // checkSum will be different, but cksumValid will be true - - var th = new TarHeader(encoded) - delete h[1].block - delete h[1].needExtended - delete h[1].cksum - t.has(th, h[1], "fields "+name) - }) - t.end() -}) - -// test these manually. they're a bit rare to find in the wild -tap.test("parseNumeric tests", function (t) { - var parseNumeric = TarHeader.parseNumeric - , numbers = - { "303737373737373700": 2097151 - , "30373737373737373737373700": 8589934591 - , "303030303036343400": 420 - , "800000ffffffffffff": 281474976710655 - , "ffffff000000000001": -281474976710654 - , "ffffff000000000000": -281474976710655 - , "800000000000200000": 2097152 - , "8000000000001544c5": 1393861 - , "ffffffffffff1544c5": -15383354 } - Object.keys(numbers).forEach(function (n) { - var b = new Buffer(n, "hex") - t.equal(parseNumeric(b), numbers[n], n + " === " + numbers[n]) - }) - t.end() -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js deleted file mode 100644 index d4b03a1fe9..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack-no-proprietary.js +++ /dev/null @@ -1,886 +0,0 @@ -// This is exactly like test/pack.js, except that it's excluding -// any proprietary headers. -// -// This loses some information about the filesystem, but creates -// tarballs that are supported by more versions of tar, especially -// old non-spec-compliant copies of gnutar. - -// the symlink file is excluded from git, because it makes -// windows freak the hell out. -var fs = require("fs") - , path = require("path") - , symlink = path.resolve(__dirname, "fixtures/symlink") -try { fs.unlinkSync(symlink) } catch (e) {} -fs.symlinkSync("./hardlink-1", symlink) -process.on("exit", function () { - fs.unlinkSync(symlink) -}) - -var tap = require("tap") - , tar = require("../tar.js") - , pkg = require("../package.json") - , Pack = tar.Pack - , fstream = require("fstream") - , Reader = fstream.Reader - , Writer = fstream.Writer - , input = path.resolve(__dirname, "fixtures/") - , target = path.resolve(__dirname, "tmp/pack.tar") - , uid = process.getuid ? process.getuid() : 0 - , gid = process.getgid ? process.getgid() : 0 - - , entries = - - // the global header and root fixtures/ dir are going to get - // a different date each time, so omit that bit. - // Also, dev/ino values differ across machines, so that's not - // included. - [ [ 'entry', - { path: 'fixtures/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/200cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - uid: uid, - gid: gid, - size: 200 } ] - - , [ 'entry', - { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - size: 200, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/a.txt', - mode: 420, - uid: uid, - gid: gid, - size: 257, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/b.txt', - mode: 420, - uid: uid, - gid: gid, - size: 512, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/c.txt', - mode: 420, - uid: uid, - gid: gid, - size: 513, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/cc.txt', - mode: 420, - uid: uid, - gid: gid, - size: 513, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/dir/', - mode: 488, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/dir/sub/', - mode: 488, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/foo.js', - mode: 420, - uid: uid, - gid: gid, - size: 4, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/hardlink-1', - mode: 420, - uid: uid, - gid: gid, - size: 200, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/hardlink-2', - mode: 420, - uid: uid, - gid: gid, - size: 0, - type: '1', - linkpath: 'fixtures/hardlink-1', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/omega.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/omega.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/star.4.html', - mode: 420, - uid: uid, - gid: gid, - size: 54081, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/packtest/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: 'fixtures/packtest/Ω.txt', - uid: uid, - gid: gid, - size: 2 } ] - - , [ 'entry', - { path: 'fixtures/packtest/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - size: 100, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/symlink', - uid: uid, - gid: gid, - size: 0, - type: '2', - linkpath: 'hardlink-1', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: "fixtures/Ω.txt" - , uid: uid - , gid: gid - , size: 2 } ] - - , [ 'entry', - { path: 'fixtures/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - ] - - -// first, make sure that the hardlinks are actually hardlinks, or this -// won't work. Git has a way of replacing them with a copy. -var hard1 = path.resolve(__dirname, "fixtures/hardlink-1") - , hard2 = path.resolve(__dirname, "fixtures/hardlink-2") - , fs = require("fs") - -try { fs.unlinkSync(hard2) } catch (e) {} -fs.linkSync(hard1, hard2) - -tap.test("with global header", { timeout: 10000 }, function (t) { - runTest(t, true) -}) - -tap.test("without global header", { timeout: 10000 }, function (t) { - runTest(t, false) -}) - -function alphasort (a, b) { - return a === b ? 0 - : a.toLowerCase() > b.toLowerCase() ? 1 - : a.toLowerCase() < b.toLowerCase() ? -1 - : a > b ? 1 - : -1 -} - - -function runTest (t, doGH) { - var reader = Reader({ path: input - , filter: function () { - return !this.path.match(/\.(tar|hex)$/) - } - , sort: alphasort - }) - - var props = doGH ? pkg : {} - props.noProprietary = true - var pack = Pack(props) - var writer = Writer(target) - - // global header should be skipped regardless, since it has no content. - var entry = 0 - - t.ok(reader, "reader ok") - t.ok(pack, "pack ok") - t.ok(writer, "writer ok") - - pack.pipe(writer) - - var parse = tar.Parse() - t.ok(parse, "parser should be ok") - - pack.on("data", function (c) { - // console.error("PACK DATA") - if (c.length !== 512) { - // this one is too noisy, only assert if it'll be relevant - t.equal(c.length, 512, "parser should emit data in 512byte blocks") - } - parse.write(c) - }) - - pack.on("end", function () { - // console.error("PACK END") - t.pass("parser ends") - parse.end() - }) - - pack.on("error", function (er) { - t.fail("pack error", er) - }) - - parse.on("error", function (er) { - t.fail("parse error", er) - }) - - writer.on("error", function (er) { - t.fail("writer error", er) - }) - - reader.on("error", function (er) { - t.fail("reader error", er) - }) - - parse.on("*", function (ev, e) { - var wanted = entries[entry++] - if (!wanted) { - t.fail("unexpected event: "+ev) - return - } - t.equal(ev, wanted[0], "event type should be "+wanted[0]) - - if (ev !== wanted[0] || e.path !== wanted[1].path) { - console.error("wanted", wanted) - console.error([ev, e.props]) - e.on("end", function () { - console.error(e.fields) - throw "break" - }) - } - - t.has(e.props, wanted[1], "properties "+wanted[1].path) - if (wanted[2]) { - e.on("end", function () { - if (!e.fields) { - t.ok(e.fields, "should get fields") - } else { - t.has(e.fields, wanted[2], "should get expected fields") - } - }) - } - }) - - reader.pipe(pack) - - writer.on("close", function () { - t.equal(entry, entries.length, "should get all expected entries") - t.pass("it finished") - t.end() - }) - -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js deleted file mode 100644 index bf033c1298..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/pack.js +++ /dev/null @@ -1,934 +0,0 @@ - -// the symlink file is excluded from git, because it makes -// windows freak the hell out. -var fs = require("fs") - , path = require("path") - , symlink = path.resolve(__dirname, "fixtures/symlink") -try { fs.unlinkSync(symlink) } catch (e) {} -fs.symlinkSync("./hardlink-1", symlink) -process.on("exit", function () { - fs.unlinkSync(symlink) -}) - - -var tap = require("tap") - , tar = require("../tar.js") - , pkg = require("../package.json") - , Pack = tar.Pack - , fstream = require("fstream") - , Reader = fstream.Reader - , Writer = fstream.Writer - , input = path.resolve(__dirname, "fixtures/") - , target = path.resolve(__dirname, "tmp/pack.tar") - , uid = process.getuid ? process.getuid() : 0 - , gid = process.getgid ? process.getgid() : 0 - - , entries = - - // the global header and root fixtures/ dir are going to get - // a different date each time, so omit that bit. - // Also, dev/ino values differ across machines, so that's not - // included. - [ [ 'globalExtendedHeader', - { path: 'PaxHeader/', - mode: 438, - uid: 0, - gid: 0, - type: 'g', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { "NODETAR.author": pkg.author, - "NODETAR.name": pkg.name, - "NODETAR.description": pkg.description, - "NODETAR.version": pkg.version, - "NODETAR.repository.type": pkg.repository.type, - "NODETAR.repository.url": pkg.repository.url, - "NODETAR.main": pkg.main, - "NODETAR.scripts.test": pkg.scripts.test } ] - - , [ 'entry', - { path: 'fixtures/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/200cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - 'NODETAR.depth': '1', - 'NODETAR.type': 'File', - nlink: 1, - uid: uid, - gid: gid, - size: 200, - 'NODETAR.blksize': '4096', - 'NODETAR.blocks': '8' } ] - - , [ 'entry', - { path: 'fixtures/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - size: 200, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '', - 'NODETAR.depth': '1', - 'NODETAR.type': 'File', - nlink: 1, - 'NODETAR.blksize': '4096', - 'NODETAR.blocks': '8' } ] - - , [ 'entry', - { path: 'fixtures/a.txt', - mode: 420, - uid: uid, - gid: gid, - size: 257, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/b.txt', - mode: 420, - uid: uid, - gid: gid, - size: 512, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/c.txt', - mode: 420, - uid: uid, - gid: gid, - size: 513, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/cc.txt', - mode: 420, - uid: uid, - gid: gid, - size: 513, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/dir/', - mode: 488, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/dir/sub/', - mode: 488, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - - , [ 'entry', - { path: 'fixtures/foo.js', - mode: 420, - uid: uid, - gid: gid, - size: 4, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/hardlink-1', - mode: 420, - uid: uid, - gid: gid, - size: 200, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/hardlink-2', - mode: 420, - uid: uid, - gid: gid, - size: 0, - type: '1', - linkpath: 'fixtures/hardlink-1', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/omega.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/omega.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/packtest/star.4.html', - mode: 420, - uid: uid, - gid: gid, - size: 54081, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/packtest/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: 'fixtures/packtest/Ω.txt', - 'NODETAR.depth': '2', - 'NODETAR.type': 'File', - nlink: 1, - uid: uid, - gid: gid, - size: 2, - 'NODETAR.blksize': '4096', - 'NODETAR.blocks': '8' } ] - - , [ 'entry', - { path: 'fixtures/packtest/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '', - 'NODETAR.depth': '2', - 'NODETAR.type': 'File', - nlink: 1, - 'NODETAR.blksize': '4096', - 'NODETAR.blocks': '8' } ] - - , [ 'entry', - { path: 'fixtures/r/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/', - mode: 493, - uid: uid, - gid: gid, - size: 0, - type: '5', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: uid, - gid: gid, - size: 100, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'entry', - { path: 'fixtures/symlink', - uid: uid, - gid: gid, - size: 0, - type: '2', - linkpath: 'hardlink-1', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' } ] - - , [ 'extendedHeader', - { path: 'PaxHeader/fixtures/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - type: 'x', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: "fixtures/Ω.txt" - , "NODETAR.depth": "1" - , "NODETAR.type": "File" - , nlink: 1 - , uid: uid - , gid: gid - , size: 2 - , "NODETAR.blksize": "4096" - , "NODETAR.blocks": "8" } ] - - , [ 'entry', - { path: 'fixtures/Ω.txt', - mode: 420, - uid: uid, - gid: gid, - size: 2, - type: '0', - linkpath: '', - ustar: 'ustar\u0000', - ustarver: '00', - uname: '', - gname: '', - devmaj: 0, - devmin: 0, - fill: '', - 'NODETAR.depth': '1', - 'NODETAR.type': 'File', - nlink: 1, - 'NODETAR.blksize': '4096', - 'NODETAR.blocks': '8' } ] - ] - - -// first, make sure that the hardlinks are actually hardlinks, or this -// won't work. Git has a way of replacing them with a copy. -var hard1 = path.resolve(__dirname, "fixtures/hardlink-1") - , hard2 = path.resolve(__dirname, "fixtures/hardlink-2") - , fs = require("fs") - -try { fs.unlinkSync(hard2) } catch (e) {} -fs.linkSync(hard1, hard2) - -tap.test("with global header", { timeout: 10000 }, function (t) { - runTest(t, true) -}) - -tap.test("without global header", { timeout: 10000 }, function (t) { - runTest(t, false) -}) - -function alphasort (a, b) { - return a === b ? 0 - : a.toLowerCase() > b.toLowerCase() ? 1 - : a.toLowerCase() < b.toLowerCase() ? -1 - : a > b ? 1 - : -1 -} - - -function runTest (t, doGH) { - var reader = Reader({ path: input - , filter: function () { - return !this.path.match(/\.(tar|hex)$/) - } - , sort: alphasort - }) - - var pack = Pack(doGH ? pkg : null) - var writer = Writer(target) - - // skip the global header if we're not doing that. - var entry = doGH ? 0 : 1 - - t.ok(reader, "reader ok") - t.ok(pack, "pack ok") - t.ok(writer, "writer ok") - - pack.pipe(writer) - - var parse = tar.Parse() - t.ok(parse, "parser should be ok") - - pack.on("data", function (c) { - // console.error("PACK DATA") - if (c.length !== 512) { - // this one is too noisy, only assert if it'll be relevant - t.equal(c.length, 512, "parser should emit data in 512byte blocks") - } - parse.write(c) - }) - - pack.on("end", function () { - // console.error("PACK END") - t.pass("parser ends") - parse.end() - }) - - pack.on("error", function (er) { - t.fail("pack error", er) - }) - - parse.on("error", function (er) { - t.fail("parse error", er) - }) - - writer.on("error", function (er) { - t.fail("writer error", er) - }) - - reader.on("error", function (er) { - t.fail("reader error", er) - }) - - parse.on("*", function (ev, e) { - var wanted = entries[entry++] - if (!wanted) { - t.fail("unexpected event: "+ev) - return - } - t.equal(ev, wanted[0], "event type should be "+wanted[0]) - - if (ev !== wanted[0] || e.path !== wanted[1].path) { - console.error("wanted", wanted) - console.error([ev, e.props]) - e.on("end", function () { - console.error(e.fields) - throw "break" - }) - } - - - t.has(e.props, wanted[1], "properties "+wanted[1].path) - if (wanted[2]) { - e.on("end", function () { - if (!e.fields) { - t.ok(e.fields, "should get fields") - } else { - t.has(e.fields, wanted[2], "should get expected fields") - } - }) - } - }) - - reader.pipe(pack) - - writer.on("close", function () { - t.equal(entry, entries.length, "should get all expected entries") - t.pass("it finished") - t.end() - }) - -} diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js deleted file mode 100644 index f765a50129..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/parse.js +++ /dev/null @@ -1,359 +0,0 @@ -var tap = require("tap") - , tar = require("../tar.js") - , fs = require("fs") - , path = require("path") - , file = path.resolve(__dirname, "fixtures/c.tar") - , index = 0 - - , expect = -[ [ 'entry', - { path: 'c.txt', - mode: 420, - uid: 24561, - gid: 20, - size: 513, - mtime: new Date('Wed, 26 Oct 2011 01:10:58 GMT'), - cksum: 5422, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - undefined ], - [ 'entry', - { path: 'cc.txt', - mode: 420, - uid: 24561, - gid: 20, - size: 513, - mtime: new Date('Wed, 26 Oct 2011 01:11:02 GMT'), - cksum: 5525, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - undefined ], - [ 'entry', - { path: 'r/e/a/l/l/y/-/d/e/e/p/-/f/o/l/d/e/r/-/p/a/t/h/cccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 24561, - gid: 20, - size: 100, - mtime: new Date('Thu, 27 Oct 2011 03:43:23 GMT'), - cksum: 18124, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - undefined ], - [ 'entry', - { path: 'Ω.txt', - mode: 420, - uid: 24561, - gid: 20, - size: 2, - mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'), - cksum: 5695, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - undefined ], - [ 'extendedHeader', - { path: 'PaxHeader/Ω.txt', - mode: 420, - uid: 24561, - gid: 20, - size: 120, - mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'), - cksum: 6702, - type: 'x', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: 'Ω.txt', - ctime: 1319737909, - atime: 1319739061, - dev: 234881026, - ino: 51693379, - nlink: 1 } ], - [ 'entry', - { path: 'Ω.txt', - mode: 420, - uid: 24561, - gid: 20, - size: 2, - mtime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'), - cksum: 5695, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '', - ctime: new Date('Thu, 27 Oct 2011 17:51:49 GMT'), - atime: new Date('Thu, 27 Oct 2011 18:11:01 GMT'), - dev: 234881026, - ino: 51693379, - nlink: 1 }, - undefined ], - [ 'extendedHeader', - { path: 'PaxHeader/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 24561, - gid: 20, - size: 353, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 14488, - type: 'x', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - ctime: 1319686868, - atime: 1319741254, - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 1 } ], - [ 'entry', - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 24561, - gid: 20, - size: 200, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 14570, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '', - ctime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - atime: new Date('Thu, 27 Oct 2011 18:47:34 GMT'), - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 1 }, - undefined ], - [ 'longPath', - { path: '././@LongLink', - mode: 0, - uid: 0, - gid: 0, - size: 201, - mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'), - cksum: 4976, - type: 'L', - linkpath: '', - ustar: false }, - '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc' ], - [ 'entry', - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 1000, - gid: 1000, - size: 201, - mtime: new Date('Thu, 27 Oct 2011 22:21:50 GMT'), - cksum: 14086, - type: '0', - linkpath: '', - ustar: false }, - undefined ], - [ 'longLinkpath', - { path: '././@LongLink', - mode: 0, - uid: 0, - gid: 0, - size: 201, - mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'), - cksum: 4975, - type: 'K', - linkpath: '', - ustar: false }, - '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc' ], - [ 'longPath', - { path: '././@LongLink', - mode: 0, - uid: 0, - gid: 0, - size: 201, - mtime: new Date('Thu, 01 Jan 1970 00:00:00 GMT'), - cksum: 4976, - type: 'L', - linkpath: '', - ustar: false }, - '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL' ], - [ 'entry', - { path: '200LLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLLL', - mode: 511, - uid: 1000, - gid: 1000, - size: 0, - mtime: new Date('Fri, 28 Oct 2011 23:05:17 GMT'), - cksum: 21603, - type: '2', - linkpath: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - ustar: false }, - undefined ], - [ 'extendedHeader', - { path: 'PaxHeader/200-hard', - mode: 420, - uid: 24561, - gid: 20, - size: 143, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 6533, - type: 'x', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - { ctime: 1320617144, - atime: 1320617232, - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 2 } ], - [ 'entry', - { path: '200-hard', - mode: 420, - uid: 24561, - gid: 20, - size: 200, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 5526, - type: '0', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '', - ctime: new Date('Sun, 06 Nov 2011 22:05:44 GMT'), - atime: new Date('Sun, 06 Nov 2011 22:07:12 GMT'), - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 2 }, - undefined ], - [ 'extendedHeader', - { path: 'PaxHeader/200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 24561, - gid: 20, - size: 353, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 14488, - type: 'x', - linkpath: '', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '' }, - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - ctime: 1320617144, - atime: 1320617406, - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 2 } ], - [ 'entry', - { path: '200ccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccccc', - mode: 420, - uid: 24561, - gid: 20, - size: 0, - mtime: new Date('Thu, 27 Oct 2011 03:41:08 GMT'), - cksum: 15173, - type: '1', - linkpath: '200-hard', - ustar: 'ustar\0', - ustarver: '00', - uname: 'isaacs', - gname: 'staff', - devmaj: 0, - devmin: 0, - fill: '', - ctime: new Date('Sun, 06 Nov 2011 22:05:44 GMT'), - atime: new Date('Sun, 06 Nov 2011 22:10:06 GMT'), - 'LIBARCHIVE.creationtime': '1319686852', - dev: 234881026, - ino: 51681874, - nlink: 2 }, - undefined ] ] - - -tap.test("parser test", function (t) { - var parser = tar.Parse() - - parser.on("end", function () { - t.equal(index, expect.length, "saw all expected events") - t.end() - }) - - fs.createReadStream(file) - .pipe(parser) - .on("*", function (ev, entry) { - var wanted = expect[index] - if (!wanted) { - return t.fail("Unexpected event: " + ev) - } - var result = [ev, entry.props] - entry.on("end", function () { - result.push(entry.fields || entry.body) - - t.equal(ev, wanted[0], index + " event type") - t.equivalent(entry.props, wanted[1], wanted[1].path + " entry properties") - if (wanted[2]) { - t.equivalent(result[2], wanted[2], "metadata values") - } - index ++ - }) - }) -}) diff --git a/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js b/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js deleted file mode 100644 index a00ff7faa0..0000000000 --- a/deps/npm/node_modules/node-gyp/node_modules/tar/test/zz-cleanup.js +++ /dev/null @@ -1,20 +0,0 @@ -// clean up the fixtures - -var tap = require("tap") -, rimraf = require("rimraf") -, test = tap.test -, path = require("path") - -test("clean fixtures", function (t) { - rimraf(path.resolve(__dirname, "fixtures"), function (er) { - t.ifError(er, "rimraf ./fixtures/") - t.end() - }) -}) - -test("clean tmp", function (t) { - rimraf(path.resolve(__dirname, "tmp"), function (er) { - t.ifError(er, "rimraf ./tmp/") - t.end() - }) -}) diff --git a/deps/npm/node_modules/node-gyp/package.json b/deps/npm/node_modules/node-gyp/package.json index 6ec7ec5024..f92c3d56d7 100644 --- a/deps/npm/node_modules/node-gyp/package.json +++ b/deps/npm/node_modules/node-gyp/package.json @@ -1,32 +1,59 @@ { - "name": "node-gyp", - "description": "Node.js native addon build tool", - "license": "MIT", - "keywords": [ - "native", - "addon", - "module", - "c", - "c++", - "bindings", - "gyp" + "_args": [ + [ + "node-gyp@~3.2.1", + "/Users/ogd/Documents/projects/npm/npm" + ] ], - "version": "3.0.3", - "installVersion": 9, + "_from": "node-gyp@>=3.2.1 <3.3.0", + "_id": "node-gyp@3.2.1", + "_inCache": true, + "_installable": true, + "_location": "/node-gyp", + "_nodeVersion": "6.0.0-pre", + "_npmUser": { + "email": "info@bnoordhuis.nl", + "name": "bnoordhuis" + }, + "_npmVersion": "3.3.12", + "_phantomChildren": { + "brace-expansion": "1.1.2", + "core-util-is": "1.0.2", + "debug": "2.2.0", + "has-unicode": "1.0.1", + "inflight": "1.0.4", + "inherits": "2.0.1", + "isarray": "0.0.1", + "once": "1.3.2", + "string_decoder": "0.10.31" + }, + "_requested": { + "name": "node-gyp", + "raw": "node-gyp@~3.2.1", + "rawSpec": "~3.2.1", + "scope": null, + "spec": ">=3.2.1 <3.3.0", + "type": "range" + }, + "_requiredBy": [ + "/" + ], + "_resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.2.1.tgz", + "_shasum": "f5dd569970a508464cc3c15d7e9e8d2de8638dd5", + "_shrinkwrap": null, + "_spec": "node-gyp@~3.2.1", + "_where": "/Users/ogd/Documents/projects/npm/npm", "author": { - "name": "Nathan Rajlich", "email": "nathan@tootallnate.net", + "name": "Nathan Rajlich", "url": "http://tootallnate.net" }, - "repository": { - "type": "git", - "url": "git://github.com/nodejs/node-gyp.git" - }, - "preferGlobal": true, "bin": { "node-gyp": "./bin/node-gyp.js" }, - "main": "./lib/node-gyp.js", + "bugs": { + "url": "https://github.com/nodejs/node-gyp/issues" + }, "dependencies": { "fstream": "^1.0.0", "glob": "3 || 4", @@ -40,44 +67,51 @@ "request": "2", "rimraf": "2", "semver": "2.x || 3.x || 4 || 5", - "tar": "^1.0.0", + "tar": "^2.0.0", "which": "1" }, - "engines": { - "node": ">= 0.8.0" - }, + "description": "Node.js native addon build tool", "devDependencies": { "tape": "~4.2.0" }, - "scripts": { - "test": "tape test/test-*" - }, - "gitHead": "d6b03851d366c7fa78e7d2f57c61bb074ea45ea3", - "bugs": { - "url": "https://github.com/nodejs/node-gyp/issues" + "directories": {}, + "dist": { + "shasum": "f5dd569970a508464cc3c15d7e9e8d2de8638dd5", + "tarball": "http://registry.npmjs.org/node-gyp/-/node-gyp-3.2.1.tgz" }, - "homepage": "https://github.com/nodejs/node-gyp", - "_id": "node-gyp@3.0.3", - "_shasum": "9b004219f4fa9efbfd78c5fc674aa12e58fb8694", - "_from": "node-gyp@>=3.0.3 <3.1.0", - "_npmVersion": "2.14.2", - "_nodeVersion": "4.0.0", - "_npmUser": { - "name": "rvagg", - "email": "rod@vagg.org" + "engines": { + "node": ">= 0.8.0" }, + "gitHead": "89692c9187e10df944b0bf587ed44381b004a08c", + "homepage": "https://github.com/nodejs/node-gyp#readme", + "installVersion": 9, + "keywords": [ + "addon", + "bindings", + "c", + "c++", + "gyp", + "module", + "native" + ], + "license": "MIT", + "main": "./lib/node-gyp.js", "maintainers": [ { "name": "TooTallNate", "email": "nathan@tootallnate.net" }, { + "name": "bnoordhuis", + "email": "info@bnoordhuis.nl" + }, + { "name": "fishrock123", "email": "fishrock123@rocketmail.com" }, { "name": "isaacs", - "email": "isaacs@npmjs.com" + "email": "i@izs.me" }, { "name": "rvagg", @@ -88,11 +122,16 @@ "email": "nathan@tootallnate.net" } ], - "dist": { - "shasum": "9b004219f4fa9efbfd78c5fc674aa12e58fb8694", - "tarball": "http://registry.npmjs.org/node-gyp/-/node-gyp-3.0.3.tgz" + "name": "node-gyp", + "optionalDependencies": {}, + "preferGlobal": true, + "readme": "ERROR: No README data found!", + "repository": { + "type": "git", + "url": "git://github.com/nodejs/node-gyp.git" }, - "directories": {}, - "_resolved": "https://registry.npmjs.org/node-gyp/-/node-gyp-3.0.3.tgz", - "readme": "ERROR: No README data found!" + "scripts": { + "test": "tape test/test-*" + }, + "version": "3.2.1" } diff --git a/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c b/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c index f397cfa195..b1e170aa13 100644 --- a/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c +++ b/deps/npm/node_modules/node-gyp/src/win_delay_load_hook.c @@ -9,7 +9,10 @@ #ifdef _MSC_VER +#ifndef WIN32_LEAN_AND_MEAN #define WIN32_LEAN_AND_MEAN +#endif + #include <windows.h> #include <delayimp.h> diff --git a/deps/npm/node_modules/node-gyp/test/test-find-node-directory.js b/deps/npm/node_modules/node-gyp/test/test-find-node-directory.js new file mode 100644 index 0000000000..46659d0cfe --- /dev/null +++ b/deps/npm/node_modules/node-gyp/test/test-find-node-directory.js @@ -0,0 +1,115 @@ +var test = require('tape') +var path = require('path') +var findNodeDirectory = require('../lib/find-node-directory') + +var platforms = ['darwin', 'freebsd', 'linux', 'sunos', 'win32', 'aix'] + +// we should find the directory based on the directory +// the script is running in and it should match the layout +// in a build tree where npm is installed in +// .... /deps/npm +test('test find-node-directory - node install', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj = {execPath: '/x/y/bin/node', platform: platforms[next]} + t.equal( + findNodeDirectory('/x/deps/npm/node_modules/node-gyp/lib', processObj), + path.join('/x')) + } +}) + +// we should find the directory based on the directory +// the script is running in and it should match the layout +// in an installed tree where npm is installed in +// .... /lib/node_modules/npm or .../node_modules/npm +// depending on the patform +test('test find-node-directory - node build', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj = {execPath: '/x/y/bin/node', platform: platforms[next]} + if (platforms[next] === 'win32') { + t.equal( + findNodeDirectory('/y/node_modules/npm/node_modules/node-gyp/lib', + processObj), path.join('/y')) + } else { + t.equal( + findNodeDirectory('/y/lib/node_modules/npm/node_modules/node-gyp/lib', + processObj), path.join('/y')) + } + } +}) + +// we should find the directory based on the execPath +// for node and match because it was in the bin directory +test('test find-node-directory - node in bin directory', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj = {execPath: '/x/y/bin/node', platform: platforms[next]} + t.equal( + findNodeDirectory('/nothere/npm/node_modules/node-gyp/lib', processObj), + path.join('/x/y')) + } +}) + +// we should find the directory based on the execPath +// for node and match because it was in the Release directory +test('test find-node-directory - node in build release dir', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj + if (platforms[next] === 'win32') { + processObj = {execPath: '/x/y/Release/node', platform: platforms[next]} + } else { + processObj = {execPath: '/x/y/out/Release/node', + platform: platforms[next]} + } + + t.equal( + findNodeDirectory('/nothere/npm/node_modules/node-gyp/lib', processObj), + path.join('/x/y')) + } +}) + +// we should find the directory based on the execPath +// for node and match because it was in the Debug directory +test('test find-node-directory - node in Debug release dir', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj + if (platforms[next] === 'win32') { + processObj = {execPath: '/a/b/Debug/node', platform: platforms[next]} + } else { + processObj = {execPath: '/a/b/out/Debug/node', platform: platforms[next]} + } + + t.equal( + findNodeDirectory('/nothere/npm/node_modules/node-gyp/lib', processObj), + path.join('/a/b')) + } +}) + +// we should not find it as it will not match based on the execPath nor +// the directory from which the script is running +test('test find-node-directory - not found', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj = {execPath: '/x/y/z/y', platform:next} + t.equal(findNodeDirectory('/a/b/c/d', processObj), '') + } +}) + +// we should find the directory based on the directory +// the script is running in and it should match the layout +// in a build tree where npm is installed in +// .... /deps/npm +// same test as above but make sure additional directory entries +// don't cause an issue +test('test find-node-directory - node install', function (t) { + t.plan(platforms.length) + for (var next = 0; next < platforms.length; next++) { + var processObj = {execPath: '/x/y/bin/node', platform: platforms[next]} + t.equal( + findNodeDirectory('/x/y/z/a/b/c/deps/npm/node_modules/node-gyp/lib', + processObj), path.join('/x/y/z/a/b/c')) + } +}) diff --git a/deps/npm/node_modules/node-gyp/test/test-find-python.js b/deps/npm/node_modules/node-gyp/test/test-find-python.js new file mode 100644 index 0000000000..7f5c394679 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/test/test-find-python.js @@ -0,0 +1,20 @@ +'use strict' + +var test = require('tape') +var configure = require('../lib/configure') +var execFile = require('child_process').execFile + +test('find python executable', function (t) { + t.plan(4) + + configure.test.findPython('python', function (err, found) { + t.strictEqual(err, null) + var proc = execFile(found, ['-V'], function (err, stdout, stderr) { + t.strictEqual(err, null) + t.strictEqual(stdout, '') + t.ok(/Python 2/.test(stderr)) + }) + proc.stdout.setEncoding('utf-8') + proc.stderr.setEncoding('utf-8') + }) +}) diff --git a/deps/npm/node_modules/node-gyp/test/test-options.js b/deps/npm/node_modules/node-gyp/test/test-options.js new file mode 100644 index 0000000000..d097f81be6 --- /dev/null +++ b/deps/npm/node_modules/node-gyp/test/test-options.js @@ -0,0 +1,25 @@ +'use strict'; + +var test = require('tape') +var gyp = require('../lib/node-gyp') + +test('options in environment', function (t) { + t.plan(1) + + // `npm test` dumps a ton of npm_config_* variables in the environment. + Object.keys(process.env) + .filter(function(key) { return /^npm_config_/.test(key) }) + .forEach(function(key) { delete process.env[key] }) + + // Zero-length keys should get filtered out. + process.env.npm_config_ = '42' + // Other keys should get added. + process.env.npm_config_x = '42' + // Except loglevel. + process.env.npm_config_loglevel = 'debug' + + var g = gyp(); + g.parseArgv(['rebuild']) // Also sets opts.argv. + + t.deepEqual(Object.keys(g.opts).sort(), ['argv', 'x']) +}) |