summaryrefslogtreecommitdiff
path: root/deps/v8/include/v8.h
diff options
context:
space:
mode:
authorAli Ijaz Sheikh <ofrobots@google.com>2015-08-23 06:09:40 -0700
committerRod Vagg <rod@vagg.org>2015-09-06 21:38:01 +1000
commit9fddd83cf9adf505bce2e2373881df0c4d41b261 (patch)
tree4272ce14c10fea496af2e78fc6debb187d613451 /deps/v8/include/v8.h
parent46b7d151674d138e7ea4342d5f3ada1208b87ff2 (diff)
downloadnode-new-9fddd83cf9adf505bce2e2373881df0c4d41b261.tar.gz
deps: upgrade V8 to 4.5.103.24
Upgrade to the latest branch-head for V8 4.5. For the full commit log see https://github.com/v8/v8-git-mirror/commits/4.5.103.24 PR-URL: https://github.com/nodejs/node/pull/2509 Reviewed-By: Ben Noordhuis <info@bnoordhuis.nl>
Diffstat (limited to 'deps/v8/include/v8.h')
-rw-r--r--deps/v8/include/v8.h1133
1 files changed, 725 insertions, 408 deletions
diff --git a/deps/v8/include/v8.h b/deps/v8/include/v8.h
index 910279b52e..6e1db3a581 100644
--- a/deps/v8/include/v8.h
+++ b/deps/v8/include/v8.h
@@ -94,6 +94,7 @@ class Primitive;
class Promise;
class RawOperationDescriptor;
class Script;
+class SharedArrayBuffer;
class Signature;
class StartupData;
class StackFrame;
@@ -102,7 +103,6 @@ class String;
class StringObject;
class Symbol;
class SymbolObject;
-class Private;
class Uint32;
class Utils;
class Value;
@@ -215,8 +215,8 @@ class Local {
: val_(reinterpret_cast<T*>(*that)) {
/**
* This check fails when trying to convert between incompatible
- * handles. For example, converting from a Handle<String> to a
- * Handle<Number>.
+ * handles. For example, converting from a Local<String> to a
+ * Local<Number>.
*/
TYPE_CHECK(T, S);
}
@@ -311,7 +311,6 @@ class Local {
friend class String;
friend class Object;
friend class Context;
- friend class Private;
template<class F> friend class internal::CustomArguments;
friend Local<Primitive> Undefined(Isolate* isolate);
friend Local<Primitive> Null(Isolate* isolate);
@@ -331,9 +330,11 @@ class Local {
};
-// Handle is an alias for Local for historical reasons.
+#if !defined(V8_IMMINENT_DEPRECATION_WARNINGS)
+// Local is an alias for Local for historical reasons.
template <class T>
using Handle = Local<T>;
+#endif
/**
@@ -418,11 +419,11 @@ class WeakCallbackInfo {
V8_INLINE void* GetInternalField(int index) const;
V8_INLINE V8_DEPRECATE_SOON("use indexed version",
- void* GetInternalField1()) const {
+ void* GetInternalField1() const) {
return internal_fields_[0];
}
V8_INLINE V8_DEPRECATE_SOON("use indexed version",
- void* GetInternalField2()) const {
+ void* GetInternalField2() const) {
return internal_fields_[1];
}
@@ -496,7 +497,7 @@ template <class T> class PersistentBase {
* and create a new one with the contents of other if other is non empty
*/
template <class S>
- V8_INLINE void Reset(Isolate* isolate, const Handle<S>& other);
+ V8_INLINE void Reset(Isolate* isolate, const Local<S>& other);
/**
* If non-empty, destroy the underlying storage cell
@@ -517,7 +518,8 @@ template <class T> class PersistentBase {
return *a == *b;
}
- template <class S> V8_INLINE bool operator==(const Handle<S>& that) const {
+ template <class S>
+ V8_INLINE bool operator==(const Local<S>& that) const {
internal::Object** a = reinterpret_cast<internal::Object**>(this->val_);
internal::Object** b = reinterpret_cast<internal::Object**>(that.val_);
if (a == NULL) return b == NULL;
@@ -530,7 +532,8 @@ template <class T> class PersistentBase {
return !operator==(that);
}
- template <class S> V8_INLINE bool operator!=(const Handle<S>& that) const {
+ template <class S>
+ V8_INLINE bool operator!=(const Local<S>& that) const {
return !operator==(that);
}
@@ -693,11 +696,12 @@ template <class T, class M> class Persistent : public PersistentBase<T> {
*/
V8_INLINE Persistent() : PersistentBase<T>(0) { }
/**
- * Construct a Persistent from a Handle.
- * When the Handle is non-empty, a new storage cell is created
+ * Construct a Persistent from a Local.
+ * When the Local is non-empty, a new storage cell is created
* pointing to the same object, and no flags are set.
*/
- template <class S> V8_INLINE Persistent(Isolate* isolate, Handle<S> that)
+ template <class S>
+ V8_INLINE Persistent(Isolate* isolate, Local<S> that)
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
TYPE_CHECK(T, S);
}
@@ -785,12 +789,12 @@ class Global : public PersistentBase<T> {
*/
V8_INLINE Global() : PersistentBase<T>(nullptr) {}
/**
- * Construct a Global from a Handle.
- * When the Handle is non-empty, a new storage cell is created
+ * Construct a Global from a Local.
+ * When the Local is non-empty, a new storage cell is created
* pointing to the same object, and no flags are set.
*/
template <class S>
- V8_INLINE Global(Isolate* isolate, Handle<S> that)
+ V8_INLINE Global(Isolate* isolate, Local<S> that)
: PersistentBase<T>(PersistentBase<T>::New(isolate, *that)) {
TYPE_CHECK(T, S);
}
@@ -835,8 +839,11 @@ class Global : public PersistentBase<T> {
typedef void MoveOnlyTypeForCPP03;
private:
+ template <class F>
+ friend class ReturnValue;
Global(Global&) = delete;
void operator=(Global&) = delete;
+ V8_INLINE T* operator*() const { return this->val_; }
};
@@ -973,44 +980,68 @@ class V8_EXPORT Data {
/**
+ * The optional attributes of ScriptOrigin.
+ */
+class ScriptOriginOptions {
+ public:
+ V8_INLINE ScriptOriginOptions(bool is_embedder_debug_script = false,
+ bool is_shared_cross_origin = false,
+ bool is_opaque = false)
+ : flags_((is_embedder_debug_script ? kIsEmbedderDebugScript : 0) |
+ (is_shared_cross_origin ? kIsSharedCrossOrigin : 0) |
+ (is_opaque ? kIsOpaque : 0)) {}
+ V8_INLINE ScriptOriginOptions(int flags)
+ : flags_(flags &
+ (kIsEmbedderDebugScript | kIsSharedCrossOrigin | kIsOpaque)) {}
+ bool IsEmbedderDebugScript() const {
+ return (flags_ & kIsEmbedderDebugScript) != 0;
+ }
+ bool IsSharedCrossOrigin() const {
+ return (flags_ & kIsSharedCrossOrigin) != 0;
+ }
+ bool IsOpaque() const { return (flags_ & kIsOpaque) != 0; }
+ int Flags() const { return flags_; }
+
+ private:
+ enum {
+ kIsEmbedderDebugScript = 1,
+ kIsSharedCrossOrigin = 1 << 1,
+ kIsOpaque = 1 << 2
+ };
+ const int flags_;
+};
+
+/**
* The origin, within a file, of a script.
*/
class ScriptOrigin {
public:
V8_INLINE ScriptOrigin(
- Handle<Value> resource_name,
- Handle<Integer> resource_line_offset = Handle<Integer>(),
- Handle<Integer> resource_column_offset = Handle<Integer>(),
- Handle<Boolean> resource_is_shared_cross_origin = Handle<Boolean>(),
- Handle<Integer> script_id = Handle<Integer>(),
- Handle<Boolean> resource_is_embedder_debug_script = Handle<Boolean>(),
- Handle<Value> source_map_url = Handle<Value>())
- : resource_name_(resource_name),
- resource_line_offset_(resource_line_offset),
- resource_column_offset_(resource_column_offset),
- resource_is_embedder_debug_script_(resource_is_embedder_debug_script),
- resource_is_shared_cross_origin_(resource_is_shared_cross_origin),
- script_id_(script_id),
- source_map_url_(source_map_url) {}
- V8_INLINE Handle<Value> ResourceName() const;
- V8_INLINE Handle<Integer> ResourceLineOffset() const;
- V8_INLINE Handle<Integer> ResourceColumnOffset() const;
+ Local<Value> resource_name,
+ Local<Integer> resource_line_offset = Local<Integer>(),
+ Local<Integer> resource_column_offset = Local<Integer>(),
+ Local<Boolean> resource_is_shared_cross_origin = Local<Boolean>(),
+ Local<Integer> script_id = Local<Integer>(),
+ Local<Boolean> resource_is_embedder_debug_script = Local<Boolean>(),
+ Local<Value> source_map_url = Local<Value>(),
+ Local<Boolean> resource_is_opaque = Local<Boolean>());
+ V8_INLINE Local<Value> ResourceName() const;
+ V8_INLINE Local<Integer> ResourceLineOffset() const;
+ V8_INLINE Local<Integer> ResourceColumnOffset() const;
/**
* Returns true for embedder's debugger scripts
*/
- V8_INLINE Handle<Boolean> ResourceIsEmbedderDebugScript() const;
- V8_INLINE Handle<Boolean> ResourceIsSharedCrossOrigin() const;
- V8_INLINE Handle<Integer> ScriptID() const;
- V8_INLINE Handle<Value> SourceMapUrl() const;
+ V8_INLINE Local<Integer> ScriptID() const;
+ V8_INLINE Local<Value> SourceMapUrl() const;
+ V8_INLINE ScriptOriginOptions Options() const { return options_; }
private:
- Handle<Value> resource_name_;
- Handle<Integer> resource_line_offset_;
- Handle<Integer> resource_column_offset_;
- Handle<Boolean> resource_is_embedder_debug_script_;
- Handle<Boolean> resource_is_shared_cross_origin_;
- Handle<Integer> script_id_;
- Handle<Value> source_map_url_;
+ Local<Value> resource_name_;
+ Local<Integer> resource_line_offset_;
+ Local<Integer> resource_column_offset_;
+ ScriptOriginOptions options_;
+ Local<Integer> script_id_;
+ Local<Value> source_map_url_;
};
@@ -1025,16 +1056,16 @@ class V8_EXPORT UnboundScript {
Local<Script> BindToCurrentContext();
int GetId();
- Handle<Value> GetScriptName();
+ Local<Value> GetScriptName();
/**
* Data read from magic sourceURL comments.
*/
- Handle<Value> GetSourceURL();
+ Local<Value> GetSourceURL();
/**
* Data read from magic sourceMappingURL comments.
*/
- Handle<Value> GetSourceMappingURL();
+ Local<Value> GetSourceMappingURL();
/**
* Returns zero based line number of the code_pos location in the script.
@@ -1057,15 +1088,15 @@ class V8_EXPORT Script {
*/
static V8_DEPRECATE_SOON(
"Use maybe version",
- Local<Script> Compile(Handle<String> source,
+ Local<Script> Compile(Local<String> source,
ScriptOrigin* origin = nullptr));
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
- Local<Context> context, Handle<String> source,
+ Local<Context> context, Local<String> source,
ScriptOrigin* origin = nullptr);
static Local<Script> V8_DEPRECATE_SOON("Use maybe version",
- Compile(Handle<String> source,
- Handle<String> file_name));
+ Compile(Local<String> source,
+ Local<String> file_name));
/**
* Runs the script returning the resulting value. It will be run in the
@@ -1157,12 +1188,11 @@ class V8_EXPORT ScriptCompiler {
Local<String> source_string;
// Origin information
- Handle<Value> resource_name;
- Handle<Integer> resource_line_offset;
- Handle<Integer> resource_column_offset;
- Handle<Boolean> resource_is_embedder_debug_script;
- Handle<Boolean> resource_is_shared_cross_origin;
- Handle<Value> source_map_url;
+ Local<Value> resource_name;
+ Local<Integer> resource_line_offset;
+ Local<Integer> resource_column_offset;
+ ScriptOriginOptions resource_options;
+ Local<Value> source_map_url;
// Cached data from previous compilation (if a kConsume*Cache flag is
// set), or hold newly generated cache data (kProduce*Cache flags) are
@@ -1174,7 +1204,7 @@ class V8_EXPORT ScriptCompiler {
* For streaming incomplete script data to V8. The embedder should implement a
* subclass of this class.
*/
- class ExternalSourceStream {
+ class V8_EXPORT ExternalSourceStream {
public:
virtual ~ExternalSourceStream() {}
@@ -1196,6 +1226,23 @@ class V8_EXPORT ScriptCompiler {
* V8 has parsed the data it received so far.
*/
virtual size_t GetMoreData(const uint8_t** src) = 0;
+
+ /**
+ * V8 calls this method to set a 'bookmark' at the current position in
+ * the source stream, for the purpose of (maybe) later calling
+ * ResetToBookmark. If ResetToBookmark is called later, then subsequent
+ * calls to GetMoreData should return the same data as they did when
+ * SetBookmark was called earlier.
+ *
+ * The embedder may return 'false' to indicate it cannot provide this
+ * functionality.
+ */
+ virtual bool SetBookmark();
+
+ /**
+ * V8 calls this to return to a previously set bookmark.
+ */
+ virtual void ResetToBookmark();
};
@@ -1242,10 +1289,7 @@ class V8_EXPORT ScriptCompiler {
kProduceParserCache,
kConsumeParserCache,
kProduceCodeCache,
- kConsumeCodeCache,
-
- // Support the previous API for a transition period.
- kProduceDataToCache
+ kConsumeCodeCache
};
/**
@@ -1313,11 +1357,11 @@ class V8_EXPORT ScriptCompiler {
static V8_DEPRECATE_SOON(
"Use maybe version",
Local<Script> Compile(Isolate* isolate, StreamedSource* source,
- Handle<String> full_source_string,
+ Local<String> full_source_string,
const ScriptOrigin& origin));
static V8_WARN_UNUSED_RESULT MaybeLocal<Script> Compile(
Local<Context> context, StreamedSource* source,
- Handle<String> full_source_string, const ScriptOrigin& origin);
+ Local<String> full_source_string, const ScriptOrigin& origin);
/**
* Return a version tag for CachedData for the current V8 version & flags.
@@ -1390,7 +1434,7 @@ class V8_EXPORT Message {
public:
Local<String> Get() const;
- V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine()) const;
+ V8_DEPRECATE_SOON("Use maybe version", Local<String> GetSourceLine() const);
V8_WARN_UNUSED_RESULT MaybeLocal<String> GetSourceLine(
Local<Context> context) const;
@@ -1404,19 +1448,19 @@ class V8_EXPORT Message {
* Returns the resource name for the script from where the function causing
* the error originates.
*/
- Handle<Value> GetScriptResourceName() const;
+ Local<Value> GetScriptResourceName() const;
/**
* Exception stack trace. By default stack traces are not captured for
* uncaught exceptions. SetCaptureStackTraceForUncaughtExceptions allows
* to change this option.
*/
- Handle<StackTrace> GetStackTrace() const;
+ Local<StackTrace> GetStackTrace() const;
/**
* Returns the number, 1-based, of the line where the error occurred.
*/
- V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber()) const;
+ V8_DEPRECATE_SOON("Use maybe version", int GetLineNumber() const);
V8_WARN_UNUSED_RESULT Maybe<int> GetLineNumber(Local<Context> context) const;
/**
@@ -1435,14 +1479,14 @@ class V8_EXPORT Message {
* Returns the index within the line of the first character where
* the error occurred.
*/
- V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn()) const;
+ V8_DEPRECATE_SOON("Use maybe version", int GetStartColumn() const);
V8_WARN_UNUSED_RESULT Maybe<int> GetStartColumn(Local<Context> context) const;
/**
* Returns the index within the line of the last character where
* the error occurred.
*/
- V8_DEPRECATE_SOON("Use maybe version", int GetEndColumn()) const;
+ V8_DEPRECATE_SOON("Use maybe version", int GetEndColumn() const);
V8_WARN_UNUSED_RESULT Maybe<int> GetEndColumn(Local<Context> context) const;
/**
@@ -1450,6 +1494,7 @@ class V8_EXPORT Message {
* this Message was generated to V8.
*/
bool IsSharedCrossOrigin() const;
+ bool IsOpaque() const;
// TODO(1245381): Print to a string instead of on a FILE.
static void PrintCurrentStackTrace(Isolate* isolate, FILE* out);
@@ -1625,10 +1670,10 @@ class V8_EXPORT JSON {
class V8_EXPORT NativeWeakMap : public Data {
public:
static Local<NativeWeakMap> New(Isolate* isolate);
- void Set(Handle<Value> key, Handle<Value> value);
- Local<Value> Get(Handle<Value> key);
- bool Has(Handle<Value> key);
- bool Delete(Handle<Value> key);
+ void Set(Local<Value> key, Local<Value> value);
+ Local<Value> Get(Local<Value> key);
+ bool Has(Local<Value> key);
+ bool Delete(Local<Value> key);
};
@@ -1781,37 +1826,31 @@ class V8_EXPORT Value : public Data {
/**
* Returns true if this value is a Map.
- * This is an experimental feature.
*/
bool IsMap() const;
/**
* Returns true if this value is a Set.
- * This is an experimental feature.
*/
bool IsSet() const;
/**
* Returns true if this value is a Map Iterator.
- * This is an experimental feature.
*/
bool IsMapIterator() const;
/**
* Returns true if this value is a Set Iterator.
- * This is an experimental feature.
*/
bool IsSetIterator() const;
/**
* Returns true if this value is a WeakMap.
- * This is an experimental feature.
*/
bool IsWeakMap() const;
/**
* Returns true if this value is a WeakSet.
- * This is an experimental feature.
*/
bool IsWeakSet() const;
@@ -1888,11 +1927,24 @@ class V8_EXPORT Value : public Data {
bool IsFloat64Array() const;
/**
+ * Returns true if this value is a SIMD Float32x4.
+ * This is an experimental feature.
+ */
+ bool IsFloat32x4() const;
+
+ /**
* Returns true if this value is a DataView.
* This is an experimental feature.
*/
bool IsDataView() const;
+ /**
+ * Returns true if this value is a SharedArrayBuffer.
+ * This is an experimental feature.
+ */
+ bool IsSharedArrayBuffer() const;
+
+
V8_WARN_UNUSED_RESULT MaybeLocal<Boolean> ToBoolean(
Local<Context> context) const;
V8_WARN_UNUSED_RESULT MaybeLocal<Number> ToNumber(
@@ -1910,39 +1962,39 @@ class V8_EXPORT Value : public Data {
V8_WARN_UNUSED_RESULT MaybeLocal<Int32> ToInt32(Local<Context> context) const;
V8_DEPRECATE_SOON("Use maybe version",
- Local<Boolean> ToBoolean(Isolate* isolate)) const;
+ Local<Boolean> ToBoolean(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Number> ToNumber(Isolate* isolate)) const;
+ Local<Number> ToNumber(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<String> ToString(Isolate* isolate)) const;
+ Local<String> ToString(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<String> ToDetailString(Isolate* isolate)) const;
+ Local<String> ToDetailString(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Object> ToObject(Isolate* isolate)) const;
+ Local<Object> ToObject(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Integer> ToInteger(Isolate* isolate)) const;
+ Local<Integer> ToInteger(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Uint32> ToUint32(Isolate* isolate)) const;
+ Local<Uint32> ToUint32(Isolate* isolate) const);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Int32> ToInt32(Isolate* isolate)) const;
+ Local<Int32> ToInt32(Isolate* isolate) const);
inline V8_DEPRECATE_SOON("Use maybe version",
- Local<Boolean> ToBoolean()) const;
- inline V8_DEPRECATE_SOON("Use maybe version", Local<Number> ToNumber()) const;
- inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString()) const;
+ Local<Boolean> ToBoolean() const);
+ inline V8_DEPRECATE_SOON("Use maybe version", Local<Number> ToNumber() const);
+ inline V8_DEPRECATE_SOON("Use maybe version", Local<String> ToString() const);
inline V8_DEPRECATE_SOON("Use maybe version",
- Local<String> ToDetailString()) const;
- inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject()) const;
+ Local<String> ToDetailString() const);
+ inline V8_DEPRECATE_SOON("Use maybe version", Local<Object> ToObject() const);
inline V8_DEPRECATE_SOON("Use maybe version",
- Local<Integer> ToInteger()) const;
- inline V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToUint32()) const;
- inline V8_DEPRECATE_SOON("Use maybe version", Local<Int32> ToInt32()) const;
+ Local<Integer> ToInteger() const);
+ inline V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToUint32() const);
+ inline V8_DEPRECATE_SOON("Use maybe version", Local<Int32> ToInt32() const);
/**
* Attempts to convert a string to an array index.
* Returns an empty handle if the conversion fails.
*/
- V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToArrayIndex()) const;
+ V8_DEPRECATE_SOON("Use maybe version", Local<Uint32> ToArrayIndex() const);
V8_WARN_UNUSED_RESULT MaybeLocal<Uint32> ToArrayIndex(
Local<Context> context) const;
@@ -1954,18 +2006,18 @@ class V8_EXPORT Value : public Data {
Local<Context> context) const;
V8_WARN_UNUSED_RESULT Maybe<int32_t> Int32Value(Local<Context> context) const;
- V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue()) const;
- V8_DEPRECATE_SOON("Use maybe version", double NumberValue()) const;
- V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue()) const;
- V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value()) const;
- V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value()) const;
+ V8_DEPRECATE_SOON("Use maybe version", bool BooleanValue() const);
+ V8_DEPRECATE_SOON("Use maybe version", double NumberValue() const);
+ V8_DEPRECATE_SOON("Use maybe version", int64_t IntegerValue() const);
+ V8_DEPRECATE_SOON("Use maybe version", uint32_t Uint32Value() const);
+ V8_DEPRECATE_SOON("Use maybe version", int32_t Int32Value() const);
/** JS == */
- V8_DEPRECATE_SOON("Use maybe version", bool Equals(Handle<Value> that)) const;
+ V8_DEPRECATE_SOON("Use maybe version", bool Equals(Local<Value> that) const);
V8_WARN_UNUSED_RESULT Maybe<bool> Equals(Local<Context> context,
- Handle<Value> that) const;
- bool StrictEquals(Handle<Value> that) const;
- bool SameValue(Handle<Value> that) const;
+ Local<Value> that) const;
+ bool StrictEquals(Local<Value> that) const;
+ bool SameValue(Local<Value> that) const;
template <class T> V8_INLINE static Value* Cast(T* value);
@@ -1993,7 +2045,8 @@ class V8_EXPORT Boolean : public Primitive {
public:
bool Value() const;
V8_INLINE static Boolean* Cast(v8::Value* obj);
- V8_INLINE static Handle<Boolean> New(Isolate* isolate, bool value);
+ V8_INLINE static Local<Boolean> New(Isolate* isolate, bool value);
+
private:
static void CheckCast(v8::Value* obj);
};
@@ -2274,7 +2327,7 @@ class V8_EXPORT String : public Name {
* Creates a new string by concatenating the left and the right strings
* passed in as parameters.
*/
- static Local<String> Concat(Handle<String> left, Handle<String> right);
+ static Local<String> Concat(Local<String> left, Local<String> right);
/**
* Creates a new external string using the data defined in the given
@@ -2342,7 +2395,7 @@ class V8_EXPORT String : public Name {
*/
class V8_EXPORT Utf8Value {
public:
- explicit Utf8Value(Handle<v8::Value> obj);
+ explicit Utf8Value(Local<v8::Value> obj);
~Utf8Value();
char* operator*() { return str_; }
const char* operator*() const { return str_; }
@@ -2364,7 +2417,7 @@ class V8_EXPORT String : public Name {
*/
class V8_EXPORT Value {
public:
- explicit Value(Handle<v8::Value> obj);
+ explicit Value(Local<v8::Value> obj);
~Value();
uint16_t* operator*() { return str_; }
const uint16_t* operator*() const { return str_; }
@@ -2425,34 +2478,6 @@ class V8_EXPORT Symbol : public Name {
/**
- * A private symbol
- *
- * This is an experimental feature. Use at your own risk.
- */
-class V8_EXPORT Private : public Data {
- public:
- // Returns the print name string of the private symbol, or undefined if none.
- Local<Value> Name() const;
-
- // Create a private symbol. If name is not empty, it will be the description.
- static Local<Private> New(
- Isolate *isolate, Local<String> name = Local<String>());
-
- // Retrieve a global private symbol. If a symbol with this name has not
- // been retrieved in the same isolate before, it is created.
- // Note that private symbols created this way are never collected, so
- // they should only be used for statically fixed properties.
- // Also, there is only one global name space for the names used as keys.
- // To minimize the potential for clashes, use qualified names as keys,
- // e.g., "Class#property".
- static Local<Private> ForApi(Isolate *isolate, Local<String> name);
-
- private:
- Private();
-};
-
-
-/**
* A JavaScript number value (ECMA-262, 4.3.20)
*/
class V8_EXPORT Number : public Primitive {
@@ -2562,15 +2587,39 @@ enum AccessControl {
class V8_EXPORT Object : public Value {
public:
V8_DEPRECATE_SOON("Use maybe version",
- bool Set(Handle<Value> key, Handle<Value> value));
+ bool Set(Local<Value> key, Local<Value> value));
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context,
Local<Value> key, Local<Value> value);
V8_DEPRECATE_SOON("Use maybe version",
- bool Set(uint32_t index, Handle<Value> value));
+ bool Set(uint32_t index, Local<Value> value));
V8_WARN_UNUSED_RESULT Maybe<bool> Set(Local<Context> context, uint32_t index,
Local<Value> value);
+ // Implements CreateDataProperty (ECMA-262, 7.3.4).
+ //
+ // Defines a configurable, writable, enumerable property with the given value
+ // on the object unless the property already exists and is not configurable
+ // or the object is not extensible.
+ //
+ // Returns true on success.
+ V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
+ Local<Name> key,
+ Local<Value> value);
+ V8_WARN_UNUSED_RESULT Maybe<bool> CreateDataProperty(Local<Context> context,
+ uint32_t index,
+ Local<Value> value);
+
+ // Implements DefineOwnProperty.
+ //
+ // In general, CreateDataProperty will be faster, however, does not allow
+ // for specifying attributes.
+ //
+ // Returns true on success.
+ V8_WARN_UNUSED_RESULT Maybe<bool> DefineOwnProperty(
+ Local<Context> context, Local<Name> key, Local<Value> value,
+ PropertyAttribute attributes = None);
+
// Sets an own property on this object bypassing interceptors and
// overriding accessors or read-only properties.
//
@@ -2579,14 +2628,15 @@ class V8_EXPORT Object : public Value {
// will only be returned if the interceptor doesn't return a value.
//
// Note also that this only works for named properties.
- V8_DEPRECATE_SOON("Use maybe version",
- bool ForceSet(Handle<Value> key, Handle<Value> value,
+ V8_DEPRECATE_SOON("Use CreateDataProperty",
+ bool ForceSet(Local<Value> key, Local<Value> value,
PropertyAttribute attribs = None));
- // TODO(dcarney): mark V8_WARN_UNUSED_RESULT
- Maybe<bool> ForceSet(Local<Context> context, Local<Value> key,
- Local<Value> value, PropertyAttribute attribs = None);
+ V8_DEPRECATE_SOON("Use CreateDataProperty",
+ Maybe<bool> ForceSet(Local<Context> context,
+ Local<Value> key, Local<Value> value,
+ PropertyAttribute attribs = None));
- V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Handle<Value> key));
+ V8_DEPRECATE_SOON("Use maybe version", Local<Value> Get(Local<Value> key));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
Local<Value> key);
@@ -2600,7 +2650,7 @@ class V8_EXPORT Object : public Value {
* None when the property doesn't exist.
*/
V8_DEPRECATE_SOON("Use maybe version",
- PropertyAttribute GetPropertyAttributes(Handle<Value> key));
+ PropertyAttribute GetPropertyAttributes(Local<Value> key));
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetPropertyAttributes(
Local<Context> context, Local<Value> key);
@@ -2612,11 +2662,11 @@ class V8_EXPORT Object : public Value {
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetOwnPropertyDescriptor(
Local<Context> context, Local<String> key);
- V8_DEPRECATE_SOON("Use maybe version", bool Has(Handle<Value> key));
+ V8_DEPRECATE_SOON("Use maybe version", bool Has(Local<Value> key));
V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
Local<Value> key);
- V8_DEPRECATE_SOON("Use maybe version", bool Delete(Handle<Value> key));
+ V8_DEPRECATE_SOON("Use maybe version", bool Delete(Local<Value> key));
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
Maybe<bool> Delete(Local<Context> context, Local<Value> key);
@@ -2628,17 +2678,17 @@ class V8_EXPORT Object : public Value {
Maybe<bool> Delete(Local<Context> context, uint32_t index);
V8_DEPRECATE_SOON("Use maybe version",
- bool SetAccessor(Handle<String> name,
+ bool SetAccessor(Local<String> name,
AccessorGetterCallback getter,
AccessorSetterCallback setter = 0,
- Handle<Value> data = Handle<Value>(),
+ Local<Value> data = Local<Value>(),
AccessControl settings = DEFAULT,
PropertyAttribute attribute = None));
V8_DEPRECATE_SOON("Use maybe version",
- bool SetAccessor(Handle<Name> name,
+ bool SetAccessor(Local<Name> name,
AccessorNameGetterCallback getter,
AccessorNameSetterCallback setter = 0,
- Handle<Value> data = Handle<Value>(),
+ Local<Value> data = Local<Value>(),
AccessControl settings = DEFAULT,
PropertyAttribute attribute = None));
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
@@ -2649,25 +2699,12 @@ class V8_EXPORT Object : public Value {
AccessControl settings = DEFAULT,
PropertyAttribute attribute = None);
- void SetAccessorProperty(Local<Name> name,
- Local<Function> getter,
- Handle<Function> setter = Handle<Function>(),
+ void SetAccessorProperty(Local<Name> name, Local<Function> getter,
+ Local<Function> setter = Local<Function>(),
PropertyAttribute attribute = None,
AccessControl settings = DEFAULT);
/**
- * Functionality for private properties.
- * This is an experimental feature, use at your own risk.
- * Note: Private properties are inherited. Do not rely on this, since it may
- * change.
- */
- // TODO(dcarney): convert these or remove?
- bool HasPrivate(Handle<Private> key);
- bool SetPrivate(Handle<Private> key, Handle<Value> value);
- bool DeletePrivate(Handle<Private> key);
- Local<Value> GetPrivate(Handle<Private> key);
-
- /**
* Returns an array containing the names of the enumerable properties
* of this object, including properties from prototype objects. The
* array returned by this method contains the same values as would
@@ -2699,7 +2736,7 @@ class V8_EXPORT Object : public Value {
* handler.
*/
V8_DEPRECATE_SOON("Use maybe version",
- bool SetPrototype(Handle<Value> prototype));
+ bool SetPrototype(Local<Value> prototype));
V8_WARN_UNUSED_RESULT Maybe<bool> SetPrototype(Local<Context> context,
Local<Value> prototype);
@@ -2707,7 +2744,7 @@ class V8_EXPORT Object : public Value {
* Finds an instance of the given function template in the prototype
* chain.
*/
- Local<Object> FindInstanceInPrototypeChain(Handle<FunctionTemplate> tmpl);
+ Local<Object> FindInstanceInPrototypeChain(Local<FunctionTemplate> tmpl);
/**
* Call builtin Object.prototype.toString on this object.
@@ -2736,7 +2773,7 @@ class V8_EXPORT Object : public Value {
V8_INLINE Local<Value> GetInternalField(int index);
/** Sets the value in an internal field. */
- void SetInternalField(int index, Handle<Value> value);
+ void SetInternalField(int index, Local<Value> value);
/**
* Gets a 2-byte-aligned native pointer from an internal field. This field
@@ -2760,11 +2797,11 @@ class V8_EXPORT Object : public Value {
// Testers for local properties.
V8_DEPRECATE_SOON("Use maybe version",
- bool HasOwnProperty(Handle<String> key));
+ bool HasOwnProperty(Local<String> key));
V8_WARN_UNUSED_RESULT Maybe<bool> HasOwnProperty(Local<Context> context,
Local<Name> key);
V8_DEPRECATE_SOON("Use maybe version",
- bool HasRealNamedProperty(Handle<String> key));
+ bool HasRealNamedProperty(Local<String> key));
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedProperty(Local<Context> context,
Local<Name> key);
V8_DEPRECATE_SOON("Use maybe version",
@@ -2772,7 +2809,7 @@ class V8_EXPORT Object : public Value {
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealIndexedProperty(
Local<Context> context, uint32_t index);
V8_DEPRECATE_SOON("Use maybe version",
- bool HasRealNamedCallbackProperty(Handle<String> key));
+ bool HasRealNamedCallbackProperty(Local<String> key));
V8_WARN_UNUSED_RESULT Maybe<bool> HasRealNamedCallbackProperty(
Local<Context> context, Local<Name> key);
@@ -2782,7 +2819,7 @@ class V8_EXPORT Object : public Value {
*/
V8_DEPRECATE_SOON(
"Use maybe version",
- Local<Value> GetRealNamedPropertyInPrototypeChain(Handle<String> key));
+ Local<Value> GetRealNamedPropertyInPrototypeChain(Local<String> key));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedPropertyInPrototypeChain(
Local<Context> context, Local<Name> key);
@@ -2794,7 +2831,7 @@ class V8_EXPORT Object : public Value {
V8_DEPRECATE_SOON(
"Use maybe version",
Maybe<PropertyAttribute> GetRealNamedPropertyAttributesInPrototypeChain(
- Handle<String> key));
+ Local<String> key));
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute>
GetRealNamedPropertyAttributesInPrototypeChain(Local<Context> context,
Local<Name> key);
@@ -2805,7 +2842,7 @@ class V8_EXPORT Object : public Value {
* This means interceptors in the prototype chain are not called.
*/
V8_DEPRECATE_SOON("Use maybe version",
- Local<Value> GetRealNamedProperty(Handle<String> key));
+ Local<Value> GetRealNamedProperty(Local<String> key));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> GetRealNamedProperty(
Local<Context> context, Local<Name> key);
@@ -2816,7 +2853,7 @@ class V8_EXPORT Object : public Value {
*/
V8_DEPRECATE_SOON("Use maybe version",
Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
- Handle<String> key));
+ Local<String> key));
V8_WARN_UNUSED_RESULT Maybe<PropertyAttribute> GetRealNamedPropertyAttributes(
Local<Context> context, Local<Name> key);
@@ -2827,13 +2864,6 @@ class V8_EXPORT Object : public Value {
bool HasIndexedLookupInterceptor();
/**
- * Turns on access check on the object if the object is an instance of
- * a template that has access check callbacks. If an object has no
- * access check info, the object cannot be accessed by anyone.
- */
- V8_DEPRECATE_SOON("No alternative", void TurnOnAccessCheck());
-
- /**
* Returns the identity hash for this object. The current implementation
* uses a hidden property on the object to store the identity hash.
*
@@ -2849,9 +2879,9 @@ class V8_EXPORT Object : public Value {
* identity hash) are prefixed with "v8::".
*/
// TODO(dcarney): convert these to take a isolate and optionally bailout?
- bool SetHiddenValue(Handle<String> key, Handle<Value> value);
- Local<Value> GetHiddenValue(Handle<String> key);
- bool DeleteHiddenValue(Handle<String> key);
+ bool SetHiddenValue(Local<String> key, Local<Value> value);
+ Local<Value> GetHiddenValue(Local<String> key);
+ bool DeleteHiddenValue(Local<String> key);
/**
* Clone this object with a fast but shallow copy. Values will point
@@ -2877,12 +2907,12 @@ class V8_EXPORT Object : public Value {
* ObjectTemplate::SetCallAsFunctionHandler method.
*/
V8_DEPRECATE_SOON("Use maybe version",
- Local<Value> CallAsFunction(Handle<Value> recv, int argc,
- Handle<Value> argv[]));
+ Local<Value> CallAsFunction(Local<Value> recv, int argc,
+ Local<Value> argv[]));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsFunction(Local<Context> context,
- Handle<Value> recv,
+ Local<Value> recv,
int argc,
- Handle<Value> argv[]);
+ Local<Value> argv[]);
/**
* Call an Object as a constructor if a callback is set by the
@@ -2891,7 +2921,7 @@ class V8_EXPORT Object : public Value {
*/
V8_DEPRECATE_SOON("Use maybe version",
Local<Value> CallAsConstructor(int argc,
- Handle<Value> argv[]));
+ Local<Value> argv[]));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> CallAsConstructor(
Local<Context> context, int argc, Local<Value> argv[]);
@@ -2941,6 +2971,89 @@ class V8_EXPORT Array : public Object {
};
+/**
+ * An instance of the built-in Map constructor (ECMA-262, 6th Edition, 23.1.1).
+ */
+class V8_EXPORT Map : public Object {
+ public:
+ size_t Size() const;
+ void Clear();
+ V8_WARN_UNUSED_RESULT MaybeLocal<Value> Get(Local<Context> context,
+ Local<Value> key);
+ V8_WARN_UNUSED_RESULT MaybeLocal<Map> Set(Local<Context> context,
+ Local<Value> key,
+ Local<Value> value);
+ V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
+ Local<Value> key);
+ V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
+ Local<Value> key);
+
+ /**
+ * Returns an array of length Size() * 2, where index N is the Nth key and
+ * index N + 1 is the Nth value.
+ */
+ Local<Array> AsArray() const;
+
+ /**
+ * Creates a new empty Map.
+ */
+ static Local<Map> New(Isolate* isolate);
+
+ /**
+ * Creates a new Map containing the elements of array, which must be formatted
+ * in the same manner as the array returned from AsArray().
+ * Guaranteed to be side-effect free if the array contains no holes.
+ */
+ static V8_WARN_UNUSED_RESULT MaybeLocal<Map> FromArray(Local<Context> context,
+ Local<Array> array);
+
+ V8_INLINE static Map* Cast(Value* obj);
+
+ private:
+ Map();
+ static void CheckCast(Value* obj);
+};
+
+
+/**
+ * An instance of the built-in Set constructor (ECMA-262, 6th Edition, 23.2.1).
+ */
+class V8_EXPORT Set : public Object {
+ public:
+ size_t Size() const;
+ void Clear();
+ V8_WARN_UNUSED_RESULT MaybeLocal<Set> Add(Local<Context> context,
+ Local<Value> key);
+ V8_WARN_UNUSED_RESULT Maybe<bool> Has(Local<Context> context,
+ Local<Value> key);
+ V8_WARN_UNUSED_RESULT Maybe<bool> Delete(Local<Context> context,
+ Local<Value> key);
+
+ /**
+ * Returns an array of the keys in this Set.
+ */
+ Local<Array> AsArray() const;
+
+ /**
+ * Creates a new empty Set.
+ */
+ static Local<Set> New(Isolate* isolate);
+
+ /**
+ * Creates a new Set containing the items in array.
+ * Guaranteed to be side-effect free if the array contains no holes.
+ */
+ static V8_WARN_UNUSED_RESULT MaybeLocal<Set> FromArray(Local<Context> context,
+ Local<Array> array);
+
+ V8_INLINE static Set* Cast(Value* obj);
+
+ private:
+ Set();
+ static void CheckCast(Value* obj);
+};
+
+
template<typename T>
class ReturnValue {
public:
@@ -2948,9 +3061,14 @@ class ReturnValue {
: value_(that.value_) {
TYPE_CHECK(T, S);
}
- // Handle setters
- template <typename S> V8_INLINE void Set(const Persistent<S>& handle);
- template <typename S> V8_INLINE void Set(const Handle<S> handle);
+ // Local setters
+ template <typename S>
+ V8_INLINE V8_DEPRECATE_SOON("Use Global<> instead",
+ void Set(const Persistent<S>& handle));
+ template <typename S>
+ V8_INLINE void Set(const Global<S>& handle);
+ template <typename S>
+ V8_INLINE void Set(const Local<S> handle);
// Fast primitive setters
V8_INLINE void Set(bool value);
V8_INLINE void Set(double i);
@@ -3066,32 +3184,36 @@ class V8_EXPORT Function : public Object {
* Create a function in the current execution context
* for a given FunctionCallback.
*/
- static Local<Function> New(Isolate* isolate,
- FunctionCallback callback,
- Local<Value> data = Local<Value>(),
- int length = 0);
+ static MaybeLocal<Function> New(Local<Context> context,
+ FunctionCallback callback,
+ Local<Value> data = Local<Value>(),
+ int length = 0);
+ static V8_DEPRECATE_SOON(
+ "Use maybe version",
+ Local<Function> New(Isolate* isolate, FunctionCallback callback,
+ Local<Value> data = Local<Value>(), int length = 0));
V8_DEPRECATE_SOON("Use maybe version",
- Local<Object> NewInstance(int argc,
- Handle<Value> argv[])) const;
+ Local<Object> NewInstance(int argc, Local<Value> argv[])
+ const);
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
- Local<Context> context, int argc, Handle<Value> argv[]) const;
+ Local<Context> context, int argc, Local<Value> argv[]) const;
- V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance()) const;
+ V8_DEPRECATE_SOON("Use maybe version", Local<Object> NewInstance() const);
V8_WARN_UNUSED_RESULT MaybeLocal<Object> NewInstance(
Local<Context> context) const {
return NewInstance(context, 0, nullptr);
}
V8_DEPRECATE_SOON("Use maybe version",
- Local<Value> Call(Handle<Value> recv, int argc,
- Handle<Value> argv[]));
+ Local<Value> Call(Local<Value> recv, int argc,
+ Local<Value> argv[]));
V8_WARN_UNUSED_RESULT MaybeLocal<Value> Call(Local<Context> context,
- Handle<Value> recv, int argc,
- Handle<Value> argv[]);
+ Local<Value> recv, int argc,
+ Local<Value> argv[]);
- void SetName(Handle<String> name);
- Handle<Value> GetName() const;
+ void SetName(Local<String> name);
+ Local<Value> GetName() const;
/**
* Name inferred from variable or property assignment of this function.
@@ -3099,13 +3221,13 @@ class V8_EXPORT Function : public Object {
* in an OO style, where many functions are anonymous but are assigned
* to object properties.
*/
- Handle<Value> GetInferredName() const;
+ Local<Value> GetInferredName() const;
/**
* User-defined name assigned to the "displayName" property of this function.
* Used to facilitate debugging and profiling of JavaScript code.
*/
- Handle<Value> GetDisplayName() const;
+ Local<Value> GetDisplayName() const;
/**
* Returns zero based line number of function body and
@@ -3169,13 +3291,13 @@ class V8_EXPORT Promise : public Object {
* Resolve/reject the associated promise with a given value.
* Ignored if the promise is no longer pending.
*/
- V8_DEPRECATE_SOON("Use maybe version", void Resolve(Handle<Value> value));
+ V8_DEPRECATE_SOON("Use maybe version", void Resolve(Local<Value> value));
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
- Maybe<bool> Resolve(Local<Context> context, Handle<Value> value);
+ Maybe<bool> Resolve(Local<Context> context, Local<Value> value);
- V8_DEPRECATE_SOON("Use maybe version", void Reject(Handle<Value> value));
+ V8_DEPRECATE_SOON("Use maybe version", void Reject(Local<Value> value));
// TODO(dcarney): mark V8_WARN_UNUSED_RESULT
- Maybe<bool> Reject(Local<Context> context, Handle<Value> value);
+ Maybe<bool> Reject(Local<Context> context, Local<Value> value);
V8_INLINE static Resolver* Cast(Value* obj);
@@ -3191,19 +3313,19 @@ class V8_EXPORT Promise : public Object {
* invoked at the end of turn.
*/
V8_DEPRECATE_SOON("Use maybe version",
- Local<Promise> Chain(Handle<Function> handler));
+ Local<Promise> Chain(Local<Function> handler));
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Chain(Local<Context> context,
- Handle<Function> handler);
+ Local<Function> handler);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Promise> Catch(Handle<Function> handler));
+ Local<Promise> Catch(Local<Function> handler));
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Catch(Local<Context> context,
- Handle<Function> handler);
+ Local<Function> handler);
V8_DEPRECATE_SOON("Use maybe version",
- Local<Promise> Then(Handle<Function> handler));
+ Local<Promise> Then(Local<Function> handler));
V8_WARN_UNUSED_RESULT MaybeLocal<Promise> Then(Local<Context> context,
- Handle<Function> handler);
+ Local<Function> handler);
/**
* Returns true if the promise has at least one derived promise, and
@@ -3312,7 +3434,7 @@ class V8_EXPORT ArrayBuffer : public Object {
ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
/**
- * Returns true if ArrayBuffer is extrenalized, that is, does not
+ * Returns true if ArrayBuffer is externalized, that is, does not
* own its memory block.
*/
bool IsExternal() const;
@@ -3445,7 +3567,9 @@ class V8_EXPORT TypedArray : public ArrayBufferView {
*/
class V8_EXPORT Uint8Array : public TypedArray {
public:
- static Local<Uint8Array> New(Handle<ArrayBuffer> array_buffer,
+ static Local<Uint8Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Uint8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
size_t byte_offset, size_t length);
V8_INLINE static Uint8Array* Cast(Value* obj);
@@ -3461,8 +3585,11 @@ class V8_EXPORT Uint8Array : public TypedArray {
*/
class V8_EXPORT Uint8ClampedArray : public TypedArray {
public:
- static Local<Uint8ClampedArray> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Uint8ClampedArray> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Uint8ClampedArray> New(
+ Local<SharedArrayBuffer> shared_array_buffer, size_t byte_offset,
+ size_t length);
V8_INLINE static Uint8ClampedArray* Cast(Value* obj);
private:
@@ -3476,8 +3603,10 @@ class V8_EXPORT Uint8ClampedArray : public TypedArray {
*/
class V8_EXPORT Int8Array : public TypedArray {
public:
- static Local<Int8Array> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Int8Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Int8Array> New(Local<SharedArrayBuffer> shared_array_buffer,
+ size_t byte_offset, size_t length);
V8_INLINE static Int8Array* Cast(Value* obj);
private:
@@ -3492,8 +3621,10 @@ class V8_EXPORT Int8Array : public TypedArray {
*/
class V8_EXPORT Uint16Array : public TypedArray {
public:
- static Local<Uint16Array> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Uint16Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Uint16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
+ size_t byte_offset, size_t length);
V8_INLINE static Uint16Array* Cast(Value* obj);
private:
@@ -3508,7 +3639,9 @@ class V8_EXPORT Uint16Array : public TypedArray {
*/
class V8_EXPORT Int16Array : public TypedArray {
public:
- static Local<Int16Array> New(Handle<ArrayBuffer> array_buffer,
+ static Local<Int16Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Int16Array> New(Local<SharedArrayBuffer> shared_array_buffer,
size_t byte_offset, size_t length);
V8_INLINE static Int16Array* Cast(Value* obj);
@@ -3524,8 +3657,10 @@ class V8_EXPORT Int16Array : public TypedArray {
*/
class V8_EXPORT Uint32Array : public TypedArray {
public:
- static Local<Uint32Array> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Uint32Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Uint32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
+ size_t byte_offset, size_t length);
V8_INLINE static Uint32Array* Cast(Value* obj);
private:
@@ -3540,7 +3675,9 @@ class V8_EXPORT Uint32Array : public TypedArray {
*/
class V8_EXPORT Int32Array : public TypedArray {
public:
- static Local<Int32Array> New(Handle<ArrayBuffer> array_buffer,
+ static Local<Int32Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Int32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
size_t byte_offset, size_t length);
V8_INLINE static Int32Array* Cast(Value* obj);
@@ -3556,8 +3693,10 @@ class V8_EXPORT Int32Array : public TypedArray {
*/
class V8_EXPORT Float32Array : public TypedArray {
public:
- static Local<Float32Array> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Float32Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Float32Array> New(Local<SharedArrayBuffer> shared_array_buffer,
+ size_t byte_offset, size_t length);
V8_INLINE static Float32Array* Cast(Value* obj);
private:
@@ -3572,8 +3711,10 @@ class V8_EXPORT Float32Array : public TypedArray {
*/
class V8_EXPORT Float64Array : public TypedArray {
public:
- static Local<Float64Array> New(Handle<ArrayBuffer> array_buffer,
- size_t byte_offset, size_t length);
+ static Local<Float64Array> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<Float64Array> New(Local<SharedArrayBuffer> shared_array_buffer,
+ size_t byte_offset, size_t length);
V8_INLINE static Float64Array* Cast(Value* obj);
private:
@@ -3588,7 +3729,9 @@ class V8_EXPORT Float64Array : public TypedArray {
*/
class V8_EXPORT DataView : public ArrayBufferView {
public:
- static Local<DataView> New(Handle<ArrayBuffer> array_buffer,
+ static Local<DataView> New(Local<ArrayBuffer> array_buffer,
+ size_t byte_offset, size_t length);
+ static Local<DataView> New(Local<SharedArrayBuffer> shared_array_buffer,
size_t byte_offset, size_t length);
V8_INLINE static DataView* Cast(Value* obj);
@@ -3599,6 +3742,105 @@ class V8_EXPORT DataView : public ArrayBufferView {
/**
+ * An instance of the built-in SharedArrayBuffer constructor.
+ * This API is experimental and may change significantly.
+ */
+class V8_EXPORT SharedArrayBuffer : public Object {
+ public:
+ /**
+ * The contents of an |SharedArrayBuffer|. Externalization of
+ * |SharedArrayBuffer| returns an instance of this class, populated, with a
+ * pointer to data and byte length.
+ *
+ * The Data pointer of SharedArrayBuffer::Contents is always allocated with
+ * |ArrayBuffer::Allocator::Allocate| by the allocator specified in
+ * v8::Isolate::CreateParams::array_buffer_allocator.
+ *
+ * This API is experimental and may change significantly.
+ */
+ class V8_EXPORT Contents { // NOLINT
+ public:
+ Contents() : data_(NULL), byte_length_(0) {}
+
+ void* Data() const { return data_; }
+ size_t ByteLength() const { return byte_length_; }
+
+ private:
+ void* data_;
+ size_t byte_length_;
+
+ friend class SharedArrayBuffer;
+ };
+
+
+ /**
+ * Data length in bytes.
+ */
+ size_t ByteLength() const;
+
+ /**
+ * Create a new SharedArrayBuffer. Allocate |byte_length| bytes.
+ * Allocated memory will be owned by a created SharedArrayBuffer and
+ * will be deallocated when it is garbage-collected,
+ * unless the object is externalized.
+ */
+ static Local<SharedArrayBuffer> New(Isolate* isolate, size_t byte_length);
+
+ /**
+ * Create a new SharedArrayBuffer over an existing memory block. The created
+ * array buffer is immediately in externalized state unless otherwise
+ * specified. The memory block will not be reclaimed when a created
+ * SharedArrayBuffer is garbage-collected.
+ */
+ static Local<SharedArrayBuffer> New(
+ Isolate* isolate, void* data, size_t byte_length,
+ ArrayBufferCreationMode mode = ArrayBufferCreationMode::kExternalized);
+
+ /**
+ * Returns true if SharedArrayBuffer is externalized, that is, does not
+ * own its memory block.
+ */
+ bool IsExternal() const;
+
+ /**
+ * Make this SharedArrayBuffer external. The pointer to underlying memory
+ * block and byte length are returned as |Contents| structure. After
+ * SharedArrayBuffer had been etxrenalized, it does no longer owns the memory
+ * block. The caller should take steps to free memory when it is no longer
+ * needed.
+ *
+ * The memory block is guaranteed to be allocated with |Allocator::Allocate|
+ * by the allocator specified in
+ * v8::Isolate::CreateParams::array_buffer_allocator.
+ *
+ */
+ Contents Externalize();
+
+ /**
+ * Get a pointer to the ArrayBuffer's underlying memory block without
+ * externalizing it. If the ArrayBuffer is not externalized, this pointer
+ * will become invalid as soon as the ArrayBuffer became garbage collected.
+ *
+ * The embedder should make sure to hold a strong reference to the
+ * ArrayBuffer while accessing this pointer.
+ *
+ * The memory block is guaranteed to be allocated with |Allocator::Allocate|
+ * by the allocator specified in
+ * v8::Isolate::CreateParams::array_buffer_allocator.
+ */
+ Contents GetContents();
+
+ V8_INLINE static SharedArrayBuffer* Cast(Value* obj);
+
+ static const int kInternalFieldCount = V8_ARRAY_BUFFER_INTERNAL_FIELD_COUNT;
+
+ private:
+ SharedArrayBuffer();
+ static void CheckCast(Value* obj);
+};
+
+
+/**
* An instance of the built-in Date constructor (ECMA-262, 15.9).
*/
class V8_EXPORT Date : public Object {
@@ -3672,7 +3914,7 @@ class V8_EXPORT BooleanObject : public Object {
*/
class V8_EXPORT StringObject : public Object {
public:
- static Local<Value> New(Handle<String> value);
+ static Local<Value> New(Local<String> value);
Local<String> ValueOf() const;
@@ -3690,7 +3932,7 @@ class V8_EXPORT StringObject : public Object {
*/
class V8_EXPORT SymbolObject : public Object {
public:
- static Local<Value> New(Isolate* isolate, Handle<Symbol> value);
+ static Local<Value> New(Isolate* isolate, Local<Symbol> value);
Local<Symbol> ValueOf() const;
@@ -3728,10 +3970,10 @@ class V8_EXPORT RegExp : public Object {
* is equivalent to evaluating "/foo/gm".
*/
static V8_DEPRECATE_SOON("Use maybe version",
- Local<RegExp> New(Handle<String> pattern,
+ Local<RegExp> New(Local<String> pattern,
Flags flags));
static V8_WARN_UNUSED_RESULT MaybeLocal<RegExp> New(Local<Context> context,
- Handle<String> pattern,
+ Local<String> pattern,
Flags flags);
/**
@@ -3775,9 +4017,9 @@ class V8_EXPORT External : public Value {
class V8_EXPORT Template : public Data {
public:
/** Adds a property to each instance created by this template.*/
- void Set(Handle<Name> name, Handle<Data> value,
+ void Set(Local<Name> name, Local<Data> value,
PropertyAttribute attributes = None);
- V8_INLINE void Set(Isolate* isolate, const char* name, Handle<Data> value);
+ V8_INLINE void Set(Isolate* isolate, const char* name, Local<Data> value);
void SetAccessorProperty(
Local<Name> name,
@@ -3813,24 +4055,20 @@ class V8_EXPORT Template : public Data {
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
* thrown and no callback is invoked.
*/
- void SetNativeDataProperty(Local<String> name,
- AccessorGetterCallback getter,
- AccessorSetterCallback setter = 0,
- // TODO(dcarney): gcc can't handle Local below
- Handle<Value> data = Handle<Value>(),
- PropertyAttribute attribute = None,
- Local<AccessorSignature> signature =
- Local<AccessorSignature>(),
- AccessControl settings = DEFAULT);
- void SetNativeDataProperty(Local<Name> name,
- AccessorNameGetterCallback getter,
- AccessorNameSetterCallback setter = 0,
- // TODO(dcarney): gcc can't handle Local below
- Handle<Value> data = Handle<Value>(),
- PropertyAttribute attribute = None,
- Local<AccessorSignature> signature =
- Local<AccessorSignature>(),
- AccessControl settings = DEFAULT);
+ void SetNativeDataProperty(
+ Local<String> name, AccessorGetterCallback getter,
+ AccessorSetterCallback setter = 0,
+ // TODO(dcarney): gcc can't handle Local below
+ Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
+ Local<AccessorSignature> signature = Local<AccessorSignature>(),
+ AccessControl settings = DEFAULT);
+ void SetNativeDataProperty(
+ Local<Name> name, AccessorNameGetterCallback getter,
+ AccessorNameSetterCallback setter = 0,
+ // TODO(dcarney): gcc can't handle Local below
+ Local<Value> data = Local<Value>(), PropertyAttribute attribute = None,
+ Local<AccessorSignature> signature = Local<AccessorSignature>(),
+ AccessControl settings = DEFAULT);
private:
Template();
@@ -4109,11 +4347,9 @@ class V8_EXPORT FunctionTemplate : public Template {
public:
/** Creates a function template.*/
static Local<FunctionTemplate> New(
- Isolate* isolate,
- FunctionCallback callback = 0,
- Handle<Value> data = Handle<Value>(),
- Handle<Signature> signature = Handle<Signature>(),
- int length = 0);
+ Isolate* isolate, FunctionCallback callback = 0,
+ Local<Value> data = Local<Value>(),
+ Local<Signature> signature = Local<Signature>(), int length = 0);
/** Returns the unique function instance in the current execution context.*/
V8_DEPRECATE_SOON("Use maybe version", Local<Function> GetFunction());
@@ -4126,7 +4362,7 @@ class V8_EXPORT FunctionTemplate : public Template {
* FunctionTemplate is called.
*/
void SetCallHandler(FunctionCallback callback,
- Handle<Value> data = Handle<Value>());
+ Local<Value> data = Local<Value>());
/** Set the predefined length property for the FunctionTemplate. */
void SetLength(int length);
@@ -4135,7 +4371,7 @@ class V8_EXPORT FunctionTemplate : public Template {
Local<ObjectTemplate> InstanceTemplate();
/** Causes the function template to inherit from a parent function template.*/
- void Inherit(Handle<FunctionTemplate> parent);
+ void Inherit(Local<FunctionTemplate> parent);
/**
* A PrototypeTemplate is the template used to create the prototype object
@@ -4148,7 +4384,7 @@ class V8_EXPORT FunctionTemplate : public Template {
* printing objects created with the function created from the
* FunctionTemplate as its constructor.
*/
- void SetClassName(Handle<String> name);
+ void SetClassName(Local<String> name);
/**
@@ -4187,7 +4423,7 @@ class V8_EXPORT FunctionTemplate : public Template {
* Returns true if the given object is an instance of this function
* template.
*/
- bool HasInstance(Handle<Value> object);
+ bool HasInstance(Local<Value> object);
private:
FunctionTemplate();
@@ -4217,7 +4453,7 @@ struct NamedPropertyHandlerConfiguration {
GenericNamedPropertyQueryCallback query = 0,
GenericNamedPropertyDeleterCallback deleter = 0,
GenericNamedPropertyEnumeratorCallback enumerator = 0,
- Handle<Value> data = Handle<Value>(),
+ Local<Value> data = Local<Value>(),
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
: getter(getter),
setter(setter),
@@ -4232,7 +4468,7 @@ struct NamedPropertyHandlerConfiguration {
GenericNamedPropertyQueryCallback query;
GenericNamedPropertyDeleterCallback deleter;
GenericNamedPropertyEnumeratorCallback enumerator;
- Handle<Value> data;
+ Local<Value> data;
PropertyHandlerFlags flags;
};
@@ -4245,7 +4481,7 @@ struct IndexedPropertyHandlerConfiguration {
IndexedPropertyQueryCallback query = 0,
IndexedPropertyDeleterCallback deleter = 0,
IndexedPropertyEnumeratorCallback enumerator = 0,
- Handle<Value> data = Handle<Value>(),
+ Local<Value> data = Local<Value>(),
PropertyHandlerFlags flags = PropertyHandlerFlags::kNone)
: getter(getter),
setter(setter),
@@ -4260,7 +4496,7 @@ struct IndexedPropertyHandlerConfiguration {
IndexedPropertyQueryCallback query;
IndexedPropertyDeleterCallback deleter;
IndexedPropertyEnumeratorCallback enumerator;
- Handle<Value> data;
+ Local<Value> data;
PropertyHandlerFlags flags;
};
@@ -4276,7 +4512,7 @@ class V8_EXPORT ObjectTemplate : public Template {
/** Creates an ObjectTemplate. */
static Local<ObjectTemplate> New(
Isolate* isolate,
- Handle<FunctionTemplate> constructor = Handle<FunctionTemplate>());
+ Local<FunctionTemplate> constructor = Local<FunctionTemplate>());
static V8_DEPRECATE_SOON("Use isolate version", Local<ObjectTemplate> New());
/** Creates a new instance of this template.*/
@@ -4312,22 +4548,16 @@ class V8_EXPORT ObjectTemplate : public Template {
* defined by FunctionTemplate::HasInstance()), an implicit TypeError is
* thrown and no callback is invoked.
*/
- void SetAccessor(Handle<String> name,
- AccessorGetterCallback getter,
- AccessorSetterCallback setter = 0,
- Handle<Value> data = Handle<Value>(),
- AccessControl settings = DEFAULT,
- PropertyAttribute attribute = None,
- Handle<AccessorSignature> signature =
- Handle<AccessorSignature>());
- void SetAccessor(Handle<Name> name,
- AccessorNameGetterCallback getter,
- AccessorNameSetterCallback setter = 0,
- Handle<Value> data = Handle<Value>(),
- AccessControl settings = DEFAULT,
- PropertyAttribute attribute = None,
- Handle<AccessorSignature> signature =
- Handle<AccessorSignature>());
+ void SetAccessor(
+ Local<String> name, AccessorGetterCallback getter,
+ AccessorSetterCallback setter = 0, Local<Value> data = Local<Value>(),
+ AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
+ Local<AccessorSignature> signature = Local<AccessorSignature>());
+ void SetAccessor(
+ Local<Name> name, AccessorNameGetterCallback getter,
+ AccessorNameSetterCallback setter = 0, Local<Value> data = Local<Value>(),
+ AccessControl settings = DEFAULT, PropertyAttribute attribute = None,
+ Local<AccessorSignature> signature = Local<AccessorSignature>());
/**
* Sets a named property handler on the object template.
@@ -4350,13 +4580,12 @@ class V8_EXPORT ObjectTemplate : public Template {
* whenever they are invoked.
*/
// TODO(dcarney): deprecate
- void SetNamedPropertyHandler(
- NamedPropertyGetterCallback getter,
- NamedPropertySetterCallback setter = 0,
- NamedPropertyQueryCallback query = 0,
- NamedPropertyDeleterCallback deleter = 0,
- NamedPropertyEnumeratorCallback enumerator = 0,
- Handle<Value> data = Handle<Value>());
+ void SetNamedPropertyHandler(NamedPropertyGetterCallback getter,
+ NamedPropertySetterCallback setter = 0,
+ NamedPropertyQueryCallback query = 0,
+ NamedPropertyDeleterCallback deleter = 0,
+ NamedPropertyEnumeratorCallback enumerator = 0,
+ Local<Value> data = Local<Value>());
void SetHandler(const NamedPropertyHandlerConfiguration& configuration);
/**
@@ -4383,7 +4612,7 @@ class V8_EXPORT ObjectTemplate : public Template {
IndexedPropertyQueryCallback query = 0,
IndexedPropertyDeleterCallback deleter = 0,
IndexedPropertyEnumeratorCallback enumerator = 0,
- Handle<Value> data = Handle<Value>()) {
+ Local<Value> data = Local<Value>()) {
SetHandler(IndexedPropertyHandlerConfiguration(getter, setter, query,
deleter, enumerator, data));
}
@@ -4394,7 +4623,7 @@ class V8_EXPORT ObjectTemplate : public Template {
* function.
*/
void SetCallAsFunctionHandler(FunctionCallback callback,
- Handle<Value> data = Handle<Value>());
+ Local<Value> data = Local<Value>());
/**
* Mark object instances of the template as undetectable.
@@ -4407,20 +4636,16 @@ class V8_EXPORT ObjectTemplate : public Template {
void MarkAsUndetectable();
/**
- * Sets access check callbacks on the object template.
+ * Sets access check callbacks on the object template and enables
+ * access checks.
*
* When accessing properties on instances of this object template,
* the access check callback will be called to determine whether or
* not to allow cross-context access to the properties.
- * The last parameter specifies whether access checks are turned
- * on by default on instances. If access checks are off by default,
- * they can be turned on on individual instances by calling
- * Object::TurnOnAccessCheck().
*/
void SetAccessCheckCallbacks(NamedSecurityCallback named_handler,
IndexedSecurityCallback indexed_handler,
- Handle<Value> data = Handle<Value>(),
- bool turned_on_by_default = true);
+ Local<Value> data = Local<Value>());
/**
* Gets the number of internal fields for objects generated from
@@ -4437,7 +4662,7 @@ class V8_EXPORT ObjectTemplate : public Template {
private:
ObjectTemplate();
static Local<ObjectTemplate> New(internal::Isolate* isolate,
- Handle<FunctionTemplate> constructor);
+ Local<FunctionTemplate> constructor);
friend class FunctionTemplate;
};
@@ -4449,7 +4674,7 @@ class V8_EXPORT Signature : public Data {
public:
static Local<Signature> New(
Isolate* isolate,
- Handle<FunctionTemplate> receiver = Handle<FunctionTemplate>());
+ Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
private:
Signature();
@@ -4462,9 +4687,9 @@ class V8_EXPORT Signature : public Data {
*/
class V8_EXPORT AccessorSignature : public Data {
public:
- static Local<AccessorSignature> New(Isolate* isolate,
- Handle<FunctionTemplate> receiver =
- Handle<FunctionTemplate>());
+ static Local<AccessorSignature> New(
+ Isolate* isolate,
+ Local<FunctionTemplate> receiver = Local<FunctionTemplate>());
private:
AccessorSignature();
@@ -4477,9 +4702,10 @@ class V8_EXPORT AccessorSignature : public Data {
*/
class V8_EXPORT TypeSwitch : public Data {
public:
- static Local<TypeSwitch> New(Handle<FunctionTemplate> type);
- static Local<TypeSwitch> New(int argc, Handle<FunctionTemplate> types[]);
- int match(Handle<Value> value);
+ static Local<TypeSwitch> New(Local<FunctionTemplate> type);
+ static Local<TypeSwitch> New(int argc, Local<FunctionTemplate> types[]);
+ int match(Local<Value> value);
+
private:
TypeSwitch();
};
@@ -4514,9 +4740,9 @@ class V8_EXPORT Extension { // NOLINT
const char** deps = 0,
int source_length = -1);
virtual ~Extension() { }
- virtual v8::Handle<v8::FunctionTemplate> GetNativeFunctionTemplate(
- v8::Isolate* isolate, v8::Handle<v8::String> name) {
- return v8::Handle<v8::FunctionTemplate>();
+ virtual v8::Local<v8::FunctionTemplate> GetNativeFunctionTemplate(
+ v8::Isolate* isolate, v8::Local<v8::String> name) {
+ return v8::Local<v8::FunctionTemplate>();
}
const char* name() const { return name_; }
@@ -4547,10 +4773,10 @@ void V8_EXPORT RegisterExtension(Extension* extension);
// --- Statics ---
-V8_INLINE Handle<Primitive> Undefined(Isolate* isolate);
-V8_INLINE Handle<Primitive> Null(Isolate* isolate);
-V8_INLINE Handle<Boolean> True(Isolate* isolate);
-V8_INLINE Handle<Boolean> False(Isolate* isolate);
+V8_INLINE Local<Primitive> Undefined(Isolate* isolate);
+V8_INLINE Local<Primitive> Null(Isolate* isolate);
+V8_INLINE Local<Boolean> True(Isolate* isolate);
+V8_INLINE Local<Boolean> False(Isolate* isolate);
/**
@@ -4622,7 +4848,7 @@ class V8_EXPORT ResourceConstraints {
typedef void (*FatalErrorCallback)(const char* location, const char* message);
-typedef void (*MessageCallback)(Handle<Message> message, Handle<Value> error);
+typedef void (*MessageCallback)(Local<Message> message, Local<Value> error);
// --- Tracing ---
@@ -4634,24 +4860,24 @@ typedef void (*LogEventCallback)(const char* name, int event);
*/
class V8_EXPORT Exception {
public:
- static Local<Value> RangeError(Handle<String> message);
- static Local<Value> ReferenceError(Handle<String> message);
- static Local<Value> SyntaxError(Handle<String> message);
- static Local<Value> TypeError(Handle<String> message);
- static Local<Value> Error(Handle<String> message);
+ static Local<Value> RangeError(Local<String> message);
+ static Local<Value> ReferenceError(Local<String> message);
+ static Local<Value> SyntaxError(Local<String> message);
+ static Local<Value> TypeError(Local<String> message);
+ static Local<Value> Error(Local<String> message);
/**
* Creates an error message for the given exception.
* Will try to reconstruct the original stack trace from the exception value,
* or capture the current stack trace if not available.
*/
- static Local<Message> CreateMessage(Handle<Value> exception);
+ static Local<Message> CreateMessage(Local<Value> exception);
/**
* Returns the original stack trace that was captured at the creation time
* of a given exception, or an empty handle if not available.
*/
- static Local<StackTrace> GetStackTrace(Handle<Value> exception);
+ static Local<StackTrace> GetStackTrace(Local<Value> exception);
};
@@ -4699,25 +4925,25 @@ enum PromiseRejectEvent {
class PromiseRejectMessage {
public:
- PromiseRejectMessage(Handle<Promise> promise, PromiseRejectEvent event,
- Handle<Value> value, Handle<StackTrace> stack_trace)
+ PromiseRejectMessage(Local<Promise> promise, PromiseRejectEvent event,
+ Local<Value> value, Local<StackTrace> stack_trace)
: promise_(promise),
event_(event),
value_(value),
stack_trace_(stack_trace) {}
- V8_INLINE Handle<Promise> GetPromise() const { return promise_; }
+ V8_INLINE Local<Promise> GetPromise() const { return promise_; }
V8_INLINE PromiseRejectEvent GetEvent() const { return event_; }
- V8_INLINE Handle<Value> GetValue() const { return value_; }
+ V8_INLINE Local<Value> GetValue() const { return value_; }
// DEPRECATED. Use v8::Exception::CreateMessage(GetValue())->GetStackTrace()
- V8_INLINE Handle<StackTrace> GetStackTrace() const { return stack_trace_; }
+ V8_INLINE Local<StackTrace> GetStackTrace() const { return stack_trace_; }
private:
- Handle<Promise> promise_;
+ Local<Promise> promise_;
PromiseRejectEvent event_;
- Handle<Value> value_;
- Handle<StackTrace> stack_trace_;
+ Local<Value> value_;
+ Local<StackTrace> stack_trace_;
};
typedef void (*PromiseRejectCallback)(PromiseRejectMessage message);
@@ -4815,6 +5041,24 @@ class V8_EXPORT HeapSpaceStatistics {
};
+class V8_EXPORT HeapObjectStatistics {
+ public:
+ HeapObjectStatistics();
+ const char* object_type() { return object_type_; }
+ const char* object_sub_type() { return object_sub_type_; }
+ size_t object_count() { return object_count_; }
+ size_t object_size() { return object_size_; }
+
+ private:
+ const char* object_type_;
+ const char* object_sub_type_;
+ size_t object_count_;
+ size_t object_size_;
+
+ friend class Isolate;
+};
+
+
class RetainedObjectInfo;
@@ -4860,7 +5104,7 @@ struct JitCodeEvent {
// Size of the instructions.
size_t code_len;
// Script info for CODE_ADDED event.
- Handle<UnboundScript> script;
+ Local<UnboundScript> script;
// User-defined data for *_LINE_INFO_* event. It's used to hold the source
// code line information which is returned from the
// CODE_START_LINE_INFO_RECORDING event. And it's passed to subsequent
@@ -4920,7 +5164,7 @@ typedef void (*JitCodeEventHandler)(const JitCodeEvent* event);
class V8_EXPORT ExternalResourceVisitor { // NOLINT
public:
virtual ~ExternalResourceVisitor() {}
- virtual void VisitExternalString(Handle<String> string) {}
+ virtual void VisitExternalString(Local<String> string) {}
};
@@ -5107,6 +5351,7 @@ class V8_EXPORT Isolate {
kStoreBufferOverflow = 4,
kSlotsBufferOverflow = 5,
kObjectObserve = 6,
+ kForcedGC = 7,
kUseCounterFeatureCount // This enum value must be last.
};
@@ -5125,7 +5370,7 @@ class V8_EXPORT Isolate {
*/
static Isolate* New(const CreateParams& params);
- static V8_DEPRECATE_SOON("Always pass CreateParams", Isolate* New());
+ static V8_DEPRECATED("Always pass CreateParams", Isolate* New());
/**
* Returns the entered isolate for the current thread or NULL in
@@ -5203,6 +5448,23 @@ class V8_EXPORT Isolate {
size_t index);
/**
+ * Returns the number of types of objects tracked in the heap at GC.
+ */
+ size_t NumberOfTrackedHeapObjectTypes();
+
+ /**
+ * Get statistics about objects in the heap.
+ *
+ * \param object_statistics The HeapObjectStatistics object to fill in
+ * statistics of objects of given type, which were live in the previous GC.
+ * \param type_index The index of the type of object to fill details about,
+ * which ranges from 0 to NumberOfTrackedHeapObjectTypes() - 1.
+ * \returns true on success.
+ */
+ bool GetHeapObjectStatisticsAtLastGC(HeapObjectStatistics* object_statistics,
+ size_t type_index);
+
+ /**
* Get a call stack sample from the isolate.
* \param state Execution state.
* \param frames Caller allocated buffer to store stack frames.
@@ -5439,7 +5701,7 @@ class V8_EXPORT Isolate {
/**
* Experimental: Enqueues the callback to the Microtask Work Queue
*/
- void EnqueueMicrotask(Handle<Function> microtask);
+ void EnqueueMicrotask(Local<Function> microtask);
/**
* Experimental: Enqueues the callback to the Microtask Work Queue
@@ -5591,7 +5853,7 @@ class V8_EXPORT Isolate {
* Otherwise, the exception object will be passed to the callback instead.
*/
bool AddMessageListener(MessageCallback that,
- Handle<Value> data = Handle<Value>());
+ Local<Value> data = Local<Value>());
/**
* Remove all message listeners from the specified callback function.
@@ -5762,7 +6024,7 @@ class V8_EXPORT V8 {
V8_INLINE static V8_DEPRECATE_SOON(
"Use isolate version",
bool AddMessageListener(MessageCallback that,
- Handle<Value> data = Handle<Value>()));
+ Local<Value> data = Local<Value>()));
/**
* Remove all message listeners from the specified callback function.
@@ -6160,7 +6422,7 @@ class V8_EXPORT TryCatch {
* ReThrow; the caller must return immediately to where the exception
* is caught.
*/
- Handle<Value> ReThrow();
+ Local<Value> ReThrow();
/**
* Returns the exception caught by this try/catch block. If no exception has
@@ -6174,7 +6436,7 @@ class V8_EXPORT TryCatch {
* Returns the .stack property of the thrown object. If no .stack
* property is present an empty handle is returned.
*/
- V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace()) const;
+ V8_DEPRECATE_SOON("Use maybe version.", Local<Value> StackTrace() const);
V8_WARN_UNUSED_RESULT MaybeLocal<Value> StackTrace(
Local<Context> context) const;
@@ -6322,22 +6584,21 @@ class V8_EXPORT Context {
* and only object identify will remain.
*/
static Local<Context> New(
- Isolate* isolate,
- ExtensionConfiguration* extensions = NULL,
- Handle<ObjectTemplate> global_template = Handle<ObjectTemplate>(),
- Handle<Value> global_object = Handle<Value>());
+ Isolate* isolate, ExtensionConfiguration* extensions = NULL,
+ Local<ObjectTemplate> global_template = Local<ObjectTemplate>(),
+ Local<Value> global_object = Local<Value>());
/**
* Sets the security token for the context. To access an object in
* another context, the security tokens must match.
*/
- void SetSecurityToken(Handle<Value> token);
+ void SetSecurityToken(Local<Value> token);
/** Restores the security token to the default value. */
void UseDefaultSecurityToken();
/** Returns the security token of this context.*/
- Handle<Value> GetSecurityToken();
+ Local<Value> GetSecurityToken();
/**
* Enter this context. After entering a context, all code compiled
@@ -6371,11 +6632,17 @@ class V8_EXPORT Context {
V8_INLINE Local<Value> GetEmbedderData(int index);
/**
+ * Gets the exports object used by V8 extras. Extra natives get a reference
+ * to this object and can use it to export functionality.
+ */
+ Local<Object> GetExtrasExportsObject();
+
+ /**
* Sets the embedder data with the given index, growing the data as
* needed. Note that index 0 currently has a special meaning for Chrome's
* debugger.
*/
- void SetEmbedderData(int index, Handle<Value> value);
+ void SetEmbedderData(int index, Local<Value> value);
/**
* Gets a 2-byte-aligned native pointer from the embedder data with the given
@@ -6418,7 +6685,7 @@ class V8_EXPORT Context {
* code generation from strings is not allowed and 'eval' or the 'Function'
* constructor are called.
*/
- void SetErrorMessageForCodeGenerationFromStrings(Handle<String> message);
+ void SetErrorMessageForCodeGenerationFromStrings(Local<String> message);
/**
* Stack-allocated class which sets the execution context for all
@@ -6426,13 +6693,13 @@ class V8_EXPORT Context {
*/
class Scope {
public:
- explicit V8_INLINE Scope(Handle<Context> context) : context_(context) {
+ explicit V8_INLINE Scope(Local<Context> context) : context_(context) {
context_->Enter();
}
V8_INLINE ~Scope() { context_->Exit(); }
private:
- Handle<Context> context_;
+ Local<Context> context_;
};
private:
@@ -6672,7 +6939,7 @@ class Internals {
static const int kJSObjectHeaderSize = 3 * kApiPointerSize;
static const int kFixedArrayHeaderSize = 2 * kApiPointerSize;
static const int kContextHeaderSize = 2 * kApiPointerSize;
- static const int kContextEmbedderDataIndex = 77;
+ static const int kContextEmbedderDataIndex = 81;
static const int kFullStringRepresentationMask = 0x07;
static const int kStringEncodingMask = 0x4;
static const int kExternalTwoByteRepresentationTag = 0x02;
@@ -6708,7 +6975,7 @@ class Internals {
static const int kJSObjectType = 0xbe;
static const int kFirstNonstringType = 0x80;
static const int kOddballType = 0x83;
- static const int kForeignType = 0x86;
+ static const int kForeignType = 0x87;
static const int kUndefinedOddballKind = 5;
static const int kNullOddballKind = 3;
@@ -6939,7 +7206,7 @@ void PersistentBase<T>::Reset() {
template <class T>
template <class S>
-void PersistentBase<T>::Reset(Isolate* isolate, const Handle<S>& other) {
+void PersistentBase<T>::Reset(Isolate* isolate, const Local<S>& other) {
TYPE_CHECK(T, S);
Reset();
if (other.IsEmpty()) return;
@@ -7064,9 +7331,20 @@ void ReturnValue<T>::Set(const Persistent<S>& handle) {
}
}
-template<typename T>
-template<typename S>
-void ReturnValue<T>::Set(const Handle<S> handle) {
+template <typename T>
+template <typename S>
+void ReturnValue<T>::Set(const Global<S>& handle) {
+ TYPE_CHECK(T, S);
+ if (V8_UNLIKELY(handle.IsEmpty())) {
+ *value_ = GetDefaultValue();
+ } else {
+ *value_ = *reinterpret_cast<internal::Object**>(*handle);
+ }
+}
+
+template <typename T>
+template <typename S>
+void ReturnValue<T>::Set(const Local<S> handle) {
TYPE_CHECK(T, S);
if (V8_UNLIKELY(handle.IsEmpty())) {
*value_ = GetDefaultValue();
@@ -7225,38 +7503,42 @@ int FunctionCallbackInfo<T>::Length() const {
return length_;
}
-
-Handle<Value> ScriptOrigin::ResourceName() const {
- return resource_name_;
-}
-
-
-Handle<Integer> ScriptOrigin::ResourceLineOffset() const {
+ScriptOrigin::ScriptOrigin(Local<Value> resource_name,
+ Local<Integer> resource_line_offset,
+ Local<Integer> resource_column_offset,
+ Local<Boolean> resource_is_shared_cross_origin,
+ Local<Integer> script_id,
+ Local<Boolean> resource_is_embedder_debug_script,
+ Local<Value> source_map_url,
+ Local<Boolean> resource_is_opaque)
+ : resource_name_(resource_name),
+ resource_line_offset_(resource_line_offset),
+ resource_column_offset_(resource_column_offset),
+ options_(!resource_is_embedder_debug_script.IsEmpty() &&
+ resource_is_embedder_debug_script->IsTrue(),
+ !resource_is_shared_cross_origin.IsEmpty() &&
+ resource_is_shared_cross_origin->IsTrue(),
+ !resource_is_opaque.IsEmpty() && resource_is_opaque->IsTrue()),
+ script_id_(script_id),
+ source_map_url_(source_map_url) {}
+
+Local<Value> ScriptOrigin::ResourceName() const { return resource_name_; }
+
+
+Local<Integer> ScriptOrigin::ResourceLineOffset() const {
return resource_line_offset_;
}
-Handle<Integer> ScriptOrigin::ResourceColumnOffset() const {
+Local<Integer> ScriptOrigin::ResourceColumnOffset() const {
return resource_column_offset_;
}
-Handle<Boolean> ScriptOrigin::ResourceIsEmbedderDebugScript() const {
- return resource_is_embedder_debug_script_;
-}
+Local<Integer> ScriptOrigin::ScriptID() const { return script_id_; }
-Handle<Boolean> ScriptOrigin::ResourceIsSharedCrossOrigin() const {
- return resource_is_shared_cross_origin_;
-}
-
-
-Handle<Integer> ScriptOrigin::ScriptID() const {
- return script_id_;
-}
-
-
-Handle<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; }
+Local<Value> ScriptOrigin::SourceMapUrl() const { return source_map_url_; }
ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
@@ -7265,8 +7547,7 @@ ScriptCompiler::Source::Source(Local<String> string, const ScriptOrigin& origin,
resource_name(origin.ResourceName()),
resource_line_offset(origin.ResourceLineOffset()),
resource_column_offset(origin.ResourceColumnOffset()),
- resource_is_embedder_debug_script(origin.ResourceIsEmbedderDebugScript()),
- resource_is_shared_cross_origin(origin.ResourceIsSharedCrossOrigin()),
+ resource_options(origin.Options()),
source_map_url(origin.SourceMapUrl()),
cached_data(data) {}
@@ -7287,13 +7568,15 @@ const ScriptCompiler::CachedData* ScriptCompiler::Source::GetCachedData()
}
-Handle<Boolean> Boolean::New(Isolate* isolate, bool value) {
+Local<Boolean> Boolean::New(Isolate* isolate, bool value) {
return value ? True(isolate) : False(isolate);
}
-void Template::Set(Isolate* isolate, const char* name, v8::Handle<Data> value) {
- Set(v8::String::NewFromUtf8(isolate, name), value);
+void Template::Set(Isolate* isolate, const char* name, v8::Local<Data> value) {
+ Set(v8::String::NewFromUtf8(isolate, name, NewStringType::kNormal)
+ .ToLocalChecked(),
+ value);
}
@@ -7446,41 +7729,51 @@ template <class T> Value* Value::Cast(T* value) {
Local<Boolean> Value::ToBoolean() const {
- return ToBoolean(Isolate::GetCurrent());
+ return ToBoolean(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Boolean>());
}
Local<Number> Value::ToNumber() const {
- return ToNumber(Isolate::GetCurrent());
+ return ToNumber(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Number>());
}
Local<String> Value::ToString() const {
- return ToString(Isolate::GetCurrent());
+ return ToString(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<String>());
}
Local<String> Value::ToDetailString() const {
- return ToDetailString(Isolate::GetCurrent());
+ return ToDetailString(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<String>());
}
Local<Object> Value::ToObject() const {
- return ToObject(Isolate::GetCurrent());
+ return ToObject(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Object>());
}
Local<Integer> Value::ToInteger() const {
- return ToInteger(Isolate::GetCurrent());
+ return ToInteger(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Integer>());
}
Local<Uint32> Value::ToUint32() const {
- return ToUint32(Isolate::GetCurrent());
+ return ToUint32(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Uint32>());
}
-Local<Int32> Value::ToInt32() const { return ToInt32(Isolate::GetCurrent()); }
+Local<Int32> Value::ToInt32() const {
+ return ToInt32(Isolate::GetCurrent()->GetCurrentContext())
+ .FromMaybe(Local<Int32>());
+}
Boolean* Boolean::Cast(v8::Value* value) {
@@ -7603,6 +7896,22 @@ Array* Array::Cast(v8::Value* value) {
}
+Map* Map::Cast(v8::Value* value) {
+#ifdef V8_ENABLE_CHECKS
+ CheckCast(value);
+#endif
+ return static_cast<Map*>(value);
+}
+
+
+Set* Set::Cast(v8::Value* value) {
+#ifdef V8_ENABLE_CHECKS
+ CheckCast(value);
+#endif
+ return static_cast<Set*>(value);
+}
+
+
Promise* Promise::Cast(v8::Value* value) {
#ifdef V8_ENABLE_CHECKS
CheckCast(value);
@@ -7723,6 +8032,14 @@ DataView* DataView::Cast(v8::Value* value) {
}
+SharedArrayBuffer* SharedArrayBuffer::Cast(v8::Value* value) {
+#ifdef V8_ENABLE_CHECKS
+ CheckCast(value);
+#endif
+ return static_cast<SharedArrayBuffer*>(value);
+}
+
+
Function* Function::Cast(v8::Value* value) {
#ifdef V8_ENABLE_CHECKS
CheckCast(value);
@@ -7769,39 +8086,39 @@ ReturnValue<T> PropertyCallbackInfo<T>::GetReturnValue() const {
}
-Handle<Primitive> Undefined(Isolate* isolate) {
+Local<Primitive> Undefined(Isolate* isolate) {
typedef internal::Object* S;
typedef internal::Internals I;
I::CheckInitialized(isolate);
S* slot = I::GetRoot(isolate, I::kUndefinedValueRootIndex);
- return Handle<Primitive>(reinterpret_cast<Primitive*>(slot));
+ return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
}
-Handle<Primitive> Null(Isolate* isolate) {
+Local<Primitive> Null(Isolate* isolate) {
typedef internal::Object* S;
typedef internal::Internals I;
I::CheckInitialized(isolate);
S* slot = I::GetRoot(isolate, I::kNullValueRootIndex);
- return Handle<Primitive>(reinterpret_cast<Primitive*>(slot));
+ return Local<Primitive>(reinterpret_cast<Primitive*>(slot));
}
-Handle<Boolean> True(Isolate* isolate) {
+Local<Boolean> True(Isolate* isolate) {
typedef internal::Object* S;
typedef internal::Internals I;
I::CheckInitialized(isolate);
S* slot = I::GetRoot(isolate, I::kTrueValueRootIndex);
- return Handle<Boolean>(reinterpret_cast<Boolean*>(slot));
+ return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
}
-Handle<Boolean> False(Isolate* isolate) {
+Local<Boolean> False(Isolate* isolate) {
typedef internal::Object* S;
typedef internal::Internals I;
I::CheckInitialized(isolate);
S* slot = I::GetRoot(isolate, I::kFalseValueRootIndex);
- return Handle<Boolean>(reinterpret_cast<Boolean*>(slot));
+ return Local<Boolean>(reinterpret_cast<Boolean*>(slot));
}
@@ -7909,7 +8226,7 @@ bool V8::IsDead() {
}
-bool V8::AddMessageListener(MessageCallback that, Handle<Value> data) {
+bool V8::AddMessageListener(MessageCallback that, Local<Value> data) {
Isolate* isolate = Isolate::GetCurrent();
return isolate->AddMessageListener(that, data);
}