summaryrefslogtreecommitdiff
Commit message (Expand)AuthorAgeFilesLines
* - Significantly improve hash table performance by using djb's hash functionexperimental/pre_new_hash_funcAndi Gutmans2001-07-092-53/+42
* This commit was manufactured by cvs2svn to create branchSVN Migration2001-07-031644-399937/+0
* Trivial fix - but the period looks odd in error messagesRasmus Lerdorf2001-07-031-1/+1
* Fix a major thread safety bug in the output mechanismZeev Suraski2001-07-026-17/+27
* Missing constant.foobar2001-07-021-0/+1
* Fix FastCGI shutdown for MacOSX, it didn't want to die.Ben Mansell2001-07-021-0/+3
* Fix possible corruption problem with curl_errno() and curl_error()Sterling Hughes2001-07-021-1/+3
* Fix mispell.Sterling Hughes2001-07-021-1/+1
* - Fixed proto's (Patch by Zak)Derick Rethans2001-07-021-13/+13
* Moved Config-Package from Experimental to main-directory, since noone complai...Christian Stocker2001-07-026-0/+1476
* fixed a link problem of shared extension module in ext/xslt.Rui Hirokawa2001-07-022-2/+2
* PHPAPI-ize php_var_* functionsDaniel Beulshausen2001-07-012-4/+4
* fix some popen troubleDaniel Beulshausen2001-07-012-2/+9
* Fix for #11821.Sebastian Bergmann2001-07-011-0/+1
* Remove unused variable.Sean Bright2001-07-011-2/+1
* mhash_keygen_s2k() overwrote the limits of a statically allocated bufferSascha Schumann2001-07-011-3/+4
* Fix for bug #11796. Also, fixed a problem in get_meta_tags that requiredSean Bright2001-06-302-79/+124
* Make the FastCGI module behave nicer when trying to shut it down. If youBen Mansell2001-06-301-26/+104
* Test commitSascha Schumann2001-06-301-1/+1
* - Fix the memory limit fix.Andi Gutmans2001-06-301-1/+1
* If no backend is specified, bail out.foobar2001-06-301-0/+4
* Now all these options should behave the same.foobar2001-06-301-24/+22
* - Remove bogus comment.Andi Gutmans2001-06-291-1/+0
* suppress sending of cookies if session id already cameHartmut Holzgraefe2001-06-291-0/+2
* Fixed bug: #11728. Error message was cleared before outputted in pg_pconnect()foobar2001-06-291-1/+1
* This file needed an update..foobar2001-06-291-36/+15
* Fix memory_limit, kill warningZeev Suraski2001-06-291-0/+5
* Fix warningsZeev Suraski2001-06-281-3/+3
* standard .h protectionZeev Suraski2001-06-281-1/+4
* - Fix for bug #11775: Typo in cpdf.cDerick Rethans2001-06-281-1/+1
* changed CLSIDfromProgId to CLSIDfromStringHarald Radi2001-06-282-2/+2
* Adding new function to convert from binary to GUID formatFrank M. Kromann2001-06-282-3/+74
* let this be more userfriendly.foobar2001-06-281-1/+1
* added in note to fix for odbc_fetch_intoDan Kalowsky2001-06-281-0/+3
* Update NEWS, test cvs commitZeev Suraski2001-06-271-0/+5
* Update NEWS, test new CVS serverZeev Suraski2001-06-271-0/+2
* Fix leak in the patch, and revert a couple of lines I didn't mean to commitZeev Suraski2001-06-271-6/+4
* - Warn about illegal offsetsZeev Suraski2001-06-271-7/+28
* Fix UNC path handlingZeev Suraski2001-06-271-2/+2
* # leftoversSterling Hughes2001-06-261-0/+1
* Making logging optional.Sterling Hughes2001-06-261-1/+11
* Fixed autoconversion of negative values to double (Fix bug #11685)Zeev Suraski2001-06-261-3/+3
* Make info look more like mysql's output.Joey Smith2001-06-261-1/+1
* Added charset support.Joey Smith2001-06-261-15/+55
* Fix bug #11678Zeev Suraski2001-06-262-2/+20
* special offer... 0 out a structure, and remove a crash bug...Sterling Hughes2001-06-261-3/+3
* - Fix crash bug (fix by Jani).Andi Gutmans2001-06-261-1/+5
* fix bug: #11693. Some systems have crypt() in libc.foobar2001-06-261-4/+4
* Fix Win32 buildZeev Suraski2001-06-261-0/+2
* Simplify this and fix bug: #11654foobar2001-06-261-19/+8