diff options
123 files changed, 35750 insertions, 1 deletions
diff --git a/news/pygments-modifications.vendor.rst b/news/pygments-modifications.vendor.rst new file mode 100644 index 000000000..803f1a99f --- /dev/null +++ b/news/pygments-modifications.vendor.rst @@ -0,0 +1 @@ +Tree-trim unused portions of vendored pygments, to reduce the distribution size. diff --git a/news/pygments.vendor.rst b/news/pygments.vendor.rst new file mode 100644 index 000000000..ee559e9ea --- /dev/null +++ b/news/pygments.vendor.rst @@ -0,0 +1 @@ +Add pygments 2.10.0 as a vendored dependency. diff --git a/news/rich.vendor.rst b/news/rich.vendor.rst new file mode 100644 index 000000000..9ea8731da --- /dev/null +++ b/news/rich.vendor.rst @@ -0,0 +1 @@ +Add rich 10.13.0 as a vendored dependency. diff --git a/news/typing_extensions.vendor.rst b/news/typing_extensions.vendor.rst new file mode 100644 index 000000000..aec6b48de --- /dev/null +++ b/news/typing_extensions.vendor.rst @@ -0,0 +1 @@ +Add typing_extensions 3.10.0.2 as a vendored dependency. diff --git a/pyproject.toml b/pyproject.toml index 53343bfce..f14f34250 100644 --- a/pyproject.toml +++ b/pyproject.toml @@ -39,6 +39,7 @@ substitute = [ # pkg_resource's vendored packages are directly vendored in pip. { match='pkg_resources\.extern', replace="pip._vendor" }, { match='from \.extern', replace="from pip._vendor" }, + { match='''\('pygments\.lexers\.''', replace="('pip._vendor.pygments.lexer." }, ] drop = [ # contains unnecessary scripts @@ -50,6 +51,11 @@ drop = [ "setuptools", "pkg_resources/_vendor/", "pkg_resources/extern/", + # trim vendored pygments styles and lexers + "pygments/styles/[!_]*.py", + '^pygments/lexers/(?!python|__init__|_mapping).*\.py$', + # trim rich's markdown support + "rich/markdown.py", ] [tool.vendoring.typing-stubs] diff --git a/src/pip/_vendor/platformdirs/__init__.py b/src/pip/_vendor/platformdirs/__init__.py index 81c567d57..c4aeefc8b 100644 --- a/src/pip/_vendor/platformdirs/__init__.py +++ b/src/pip/_vendor/platformdirs/__init__.py @@ -9,7 +9,7 @@ from pathlib import Path from typing import TYPE_CHECKING, Optional, Type, Union if TYPE_CHECKING: - from typing_extensions import Literal # pragma: no cover + from pip._vendor.typing_extensions import Literal # pragma: no cover from .api import PlatformDirsABC from .version import __version__, __version_info__ diff --git a/src/pip/_vendor/pygments.pyi b/src/pip/_vendor/pygments.pyi new file mode 100644 index 000000000..566eaff36 --- /dev/null +++ b/src/pip/_vendor/pygments.pyi @@ -0,0 +1 @@ +from pygments import *
\ No newline at end of file diff --git a/src/pip/_vendor/pygments/LICENSE b/src/pip/_vendor/pygments/LICENSE new file mode 100644 index 000000000..e1b15663d --- /dev/null +++ b/src/pip/_vendor/pygments/LICENSE @@ -0,0 +1,25 @@ +Copyright (c) 2006-2021 by the respective authors (see AUTHORS file). +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + +* Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/src/pip/_vendor/pygments/__init__.py b/src/pip/_vendor/pygments/__init__.py new file mode 100644 index 000000000..4ffb19f67 --- /dev/null +++ b/src/pip/_vendor/pygments/__init__.py @@ -0,0 +1,84 @@ +""" + Pygments + ~~~~~~~~ + + Pygments is a syntax highlighting package written in Python. + + It is a generic syntax highlighter for general use in all kinds of software + such as forum systems, wikis or other applications that need to prettify + source code. Highlights are: + + * a wide range of common languages and markup formats is supported + * special attention is paid to details, increasing quality by a fair amount + * support for new languages and formats are added easily + * a number of output formats, presently HTML, LaTeX, RTF, SVG, all image + formats that PIL supports, and ANSI sequences + * it is usable as a command-line tool and as a library + * ... and it highlights even Brainfuck! + + The `Pygments master branch`_ is installable with ``easy_install Pygments==dev``. + + .. _Pygments master branch: + https://github.com/pygments/pygments/archive/master.zip#egg=Pygments-dev + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" +import sys +from io import StringIO, BytesIO + +__version__ = '2.10.0' +__docformat__ = 'restructuredtext' + +__all__ = ['lex', 'format', 'highlight'] + + +def lex(code, lexer): + """ + Lex ``code`` with ``lexer`` and return an iterable of tokens. + """ + try: + return lexer.get_tokens(code) + except TypeError as err: + if (isinstance(err.args[0], str) and + ('unbound method get_tokens' in err.args[0] or + 'missing 1 required positional argument' in err.args[0])): + raise TypeError('lex() argument must be a lexer instance, ' + 'not a class') + raise + + +def format(tokens, formatter, outfile=None): # pylint: disable=redefined-builtin + """ + Format a tokenlist ``tokens`` with the formatter ``formatter``. + + If ``outfile`` is given and a valid file object (an object + with a ``write`` method), the result will be written to it, otherwise + it is returned as a string. + """ + try: + if not outfile: + realoutfile = getattr(formatter, 'encoding', None) and BytesIO() or StringIO() + formatter.format(tokens, realoutfile) + return realoutfile.getvalue() + else: + formatter.format(tokens, outfile) + except TypeError as err: + if (isinstance(err.args[0], str) and + ('unbound method format' in err.args[0] or + 'missing 1 required positional argument' in err.args[0])): + raise TypeError('format() argument must be a formatter instance, ' + 'not a class') + raise + + +def highlight(code, lexer, formatter, outfile=None): + """ + Lex ``code`` with ``lexer`` and format it with the formatter ``formatter``. + + If ``outfile`` is given and a valid file object (an object + with a ``write`` method), the result will be written to it, otherwise + it is returned as a string. + """ + return format(lex(code, lexer), formatter, outfile) + diff --git a/src/pip/_vendor/pygments/__main__.py b/src/pip/_vendor/pygments/__main__.py new file mode 100644 index 000000000..010896b88 --- /dev/null +++ b/src/pip/_vendor/pygments/__main__.py @@ -0,0 +1,17 @@ +""" + pygments.__main__ + ~~~~~~~~~~~~~~~~~ + + Main entry point for ``python -m pygments``. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import sys +from pip._vendor.pygments.cmdline import main + +try: + sys.exit(main(sys.argv)) +except KeyboardInterrupt: + sys.exit(1) diff --git a/src/pip/_vendor/pygments/cmdline.py b/src/pip/_vendor/pygments/cmdline.py new file mode 100644 index 000000000..2519d8199 --- /dev/null +++ b/src/pip/_vendor/pygments/cmdline.py @@ -0,0 +1,602 @@ +""" + pygments.cmdline + ~~~~~~~~~~~~~~~~ + + Command line interface. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import os +import sys +import shutil +import argparse +from textwrap import dedent + +from pip._vendor.pygments import __version__, highlight +from pip._vendor.pygments.util import ClassNotFound, OptionError, docstring_headline, \ + guess_decode, guess_decode_from_terminal, terminal_encoding, \ + UnclosingTextIOWrapper +from pip._vendor.pygments.lexers import get_all_lexers, get_lexer_by_name, guess_lexer, \ + load_lexer_from_file, get_lexer_for_filename, find_lexer_class_for_filename +from pip._vendor.pygments.lexers.special import TextLexer +from pip._vendor.pygments.formatters.latex import LatexEmbeddedLexer, LatexFormatter +from pip._vendor.pygments.formatters import get_all_formatters, get_formatter_by_name, \ + load_formatter_from_file, get_formatter_for_filename, find_formatter_class +from pip._vendor.pygments.formatters.terminal import TerminalFormatter +from pip._vendor.pygments.formatters.terminal256 import Terminal256Formatter +from pip._vendor.pygments.filters import get_all_filters, find_filter_class +from pip._vendor.pygments.styles import get_all_styles, get_style_by_name + + +def _parse_options(o_strs): + opts = {} + if not o_strs: + return opts + for o_str in o_strs: + if not o_str.strip(): + continue + o_args = o_str.split(',') + for o_arg in o_args: + o_arg = o_arg.strip() + try: + o_key, o_val = o_arg.split('=', 1) + o_key = o_key.strip() + o_val = o_val.strip() + except ValueError: + opts[o_arg] = True + else: + opts[o_key] = o_val + return opts + + +def _parse_filters(f_strs): + filters = [] + if not f_strs: + return filters + for f_str in f_strs: + if ':' in f_str: + fname, fopts = f_str.split(':', 1) + filters.append((fname, _parse_options([fopts]))) + else: + filters.append((f_str, {})) + return filters + + +def _print_help(what, name): + try: + if what == 'lexer': + cls = get_lexer_by_name(name) + print("Help on the %s lexer:" % cls.name) + print(dedent(cls.__doc__)) + elif what == 'formatter': + cls = find_formatter_class(name) + print("Help on the %s formatter:" % cls.name) + print(dedent(cls.__doc__)) + elif what == 'filter': + cls = find_filter_class(name) + print("Help on the %s filter:" % name) + print(dedent(cls.__doc__)) + return 0 + except (AttributeError, ValueError): + print("%s not found!" % what, file=sys.stderr) + return 1 + + +def _print_list(what): + if what == 'lexer': + print() + print("Lexers:") + print("~~~~~~~") + + info = [] + for fullname, names, exts, _ in get_all_lexers(): + tup = (', '.join(names)+':', fullname, + exts and '(filenames ' + ', '.join(exts) + ')' or '') + info.append(tup) + info.sort() + for i in info: + print(('* %s\n %s %s') % i) + + elif what == 'formatter': + print() + print("Formatters:") + print("~~~~~~~~~~~") + + info = [] + for cls in get_all_formatters(): + doc = docstring_headline(cls) + tup = (', '.join(cls.aliases) + ':', doc, cls.filenames and + '(filenames ' + ', '.join(cls.filenames) + ')' or '') + info.append(tup) + info.sort() + for i in info: + print(('* %s\n %s %s') % i) + + elif what == 'filter': + print() + print("Filters:") + print("~~~~~~~~") + + for name in get_all_filters(): + cls = find_filter_class(name) + print("* " + name + ':') + print(" %s" % docstring_headline(cls)) + + elif what == 'style': + print() + print("Styles:") + print("~~~~~~~") + + for name in get_all_styles(): + cls = get_style_by_name(name) + print("* " + name + ':') + print(" %s" % docstring_headline(cls)) + + +def main_inner(parser, argns): + if argns.help: + parser.print_help() + return 0 + + if argns.V: + print('Pygments version %s, (c) 2006-2021 by Georg Brandl, Matthäus ' + 'Chajdas and contributors.' % __version__) + return 0 + + def is_only_option(opt): + return not any(v for (k, v) in vars(argns).items() if k != opt) + + # handle ``pygmentize -L`` + if argns.L is not None: + if not is_only_option('L'): + parser.print_help(sys.stderr) + return 2 + # print version + main(['', '-V']) + allowed_types = {'lexer', 'formatter', 'filter', 'style'} + largs = [arg.rstrip('s') for arg in argns.L] + if any(arg not in allowed_types for arg in largs): + parser.print_help(sys.stderr) + return 0 + if not largs: + largs = allowed_types + for arg in largs: + _print_list(arg) + return 0 + + # handle ``pygmentize -H`` + if argns.H: + if not is_only_option('H'): + parser.print_help(sys.stderr) + return 2 + what, name = argns.H + if what not in ('lexer', 'formatter', 'filter'): + parser.print_help(sys.stderr) + return 2 + return _print_help(what, name) + + # parse -O options + parsed_opts = _parse_options(argns.O or []) + + # parse -P options + for p_opt in argns.P or []: + try: + name, value = p_opt.split('=', 1) + except ValueError: + parsed_opts[p_opt] = True + else: + parsed_opts[name] = value + + # encodings + inencoding = parsed_opts.get('inencoding', parsed_opts.get('encoding')) + outencoding = parsed_opts.get('outencoding', parsed_opts.get('encoding')) + + # handle ``pygmentize -N`` + if argns.N: + lexer = find_lexer_class_for_filename(argns.N) + if lexer is None: + lexer = TextLexer + + print(lexer.aliases[0]) + return 0 + + # handle ``pygmentize -C`` + if argns.C: + inp = sys.stdin.buffer.read() + try: + lexer = guess_lexer(inp, inencoding=inencoding) + except ClassNotFound: + lexer = TextLexer + + print(lexer.aliases[0]) + return 0 + + # handle ``pygmentize -S`` + S_opt = argns.S + a_opt = argns.a + if S_opt is not None: + f_opt = argns.f + if not f_opt: + parser.print_help(sys.stderr) + return 2 + if argns.l or argns.INPUTFILE: + parser.print_help(sys.stderr) + return 2 + + try: + parsed_opts['style'] = S_opt + fmter = get_formatter_by_name(f_opt, **parsed_opts) + except ClassNotFound as err: + print(err, file=sys.stderr) + return 1 + + print(fmter.get_style_defs(a_opt or '')) + return 0 + + # if no -S is given, -a is not allowed + if argns.a is not None: + parser.print_help(sys.stderr) + return 2 + + # parse -F options + F_opts = _parse_filters(argns.F or []) + + # -x: allow custom (eXternal) lexers and formatters + allow_custom_lexer_formatter = bool(argns.x) + + # select lexer + lexer = None + + # given by name? + lexername = argns.l + if lexername: + # custom lexer, located relative to user's cwd + if allow_custom_lexer_formatter and '.py' in lexername: + try: + filename = None + name = None + if ':' in lexername: + filename, name = lexername.rsplit(':', 1) + + if '.py' in name: + # This can happen on Windows: If the lexername is + # C:\lexer.py -- return to normal load path in that case + name = None + + if filename and name: + lexer = load_lexer_from_file(filename, name, + **parsed_opts) + else: + lexer = load_lexer_from_file(lexername, **parsed_opts) + except ClassNotFound as err: + print('Error:', err, file=sys.stderr) + return 1 + else: + try: + lexer = get_lexer_by_name(lexername, **parsed_opts) + except (OptionError, ClassNotFound) as err: + print('Error:', err, file=sys.stderr) + return 1 + + # read input code + code = None + + if argns.INPUTFILE: + if argns.s: + print('Error: -s option not usable when input file specified', + file=sys.stderr) + return 2 + + infn = argns.INPUTFILE + try: + with open(infn, 'rb') as infp: + code = infp.read() + except Exception as err: + print('Error: cannot read infile:', err, file=sys.stderr) + return 1 + if not inencoding: + code, inencoding = guess_decode(code) + + # do we have to guess the lexer? + if not lexer: + try: + lexer = get_lexer_for_filename(infn, code, **parsed_opts) + except ClassNotFound as err: + if argns.g: + try: + lexer = guess_lexer(code, **parsed_opts) + except ClassNotFound: + lexer = TextLexer(**parsed_opts) + else: + print('Error:', err, file=sys.stderr) + return 1 + except OptionError as err: + print('Error:', err, file=sys.stderr) + return 1 + + elif not argns.s: # treat stdin as full file (-s support is later) + # read code from terminal, always in binary mode since we want to + # decode ourselves and be tolerant with it + code = sys.stdin.buffer.read() # use .buffer to get a binary stream + if not inencoding: + code, inencoding = guess_decode_from_terminal(code, sys.stdin) + # else the lexer will do the decoding + if not lexer: + try: + lexer = guess_lexer(code, **parsed_opts) + except ClassNotFound: + lexer = TextLexer(**parsed_opts) + + else: # -s option needs a lexer with -l + if not lexer: + print('Error: when using -s a lexer has to be selected with -l', + file=sys.stderr) + return 2 + + # process filters + for fname, fopts in F_opts: + try: + lexer.add_filter(fname, **fopts) + except ClassNotFound as err: + print('Error:', err, file=sys.stderr) + return 1 + + # select formatter + outfn = argns.o + fmter = argns.f + if fmter: + # custom formatter, located relative to user's cwd + if allow_custom_lexer_formatter and '.py' in fmter: + try: + filename = None + name = None + if ':' in fmter: + # Same logic as above for custom lexer + filename, name = fmter.rsplit(':', 1) + + if '.py' in name: + name = None + + if filename and name: + fmter = load_formatter_from_file(filename, name, + **parsed_opts) + else: + fmter = load_formatter_from_file(fmter, **parsed_opts) + except ClassNotFound as err: + print('Error:', err, file=sys.stderr) + return 1 + else: + try: + fmter = get_formatter_by_name(fmter, **parsed_opts) + except (OptionError, ClassNotFound) as err: + print('Error:', err, file=sys.stderr) + return 1 + + if outfn: + if not fmter: + try: + fmter = get_formatter_for_filename(outfn, **parsed_opts) + except (OptionError, ClassNotFound) as err: + print('Error:', err, file=sys.stderr) + return 1 + try: + outfile = open(outfn, 'wb') + except Exception as err: + print('Error: cannot open outfile:', err, file=sys.stderr) + return 1 + else: + if not fmter: + if '256' in os.environ.get('TERM', ''): + fmter = Terminal256Formatter(**parsed_opts) + else: + fmter = TerminalFormatter(**parsed_opts) + outfile = sys.stdout.buffer + + # determine output encoding if not explicitly selected + if not outencoding: + if outfn: + # output file? use lexer encoding for now (can still be None) + fmter.encoding = inencoding + else: + # else use terminal encoding + fmter.encoding = terminal_encoding(sys.stdout) + + # provide coloring under Windows, if possible + if not outfn and sys.platform in ('win32', 'cygwin') and \ + fmter.name in ('Terminal', 'Terminal256'): # pragma: no cover + # unfortunately colorama doesn't support binary streams on Py3 + outfile = UnclosingTextIOWrapper(outfile, encoding=fmter.encoding) + fmter.encoding = None + try: + import pip._vendor.colorama.initialise as colorama_initialise + except ImportError: + pass + else: + outfile = colorama_initialise.wrap_stream( + outfile, convert=None, strip=None, autoreset=False, wrap=True) + + # When using the LaTeX formatter and the option `escapeinside` is + # specified, we need a special lexer which collects escaped text + # before running the chosen language lexer. + escapeinside = parsed_opts.get('escapeinside', '') + if len(escapeinside) == 2 and isinstance(fmter, LatexFormatter): + left = escapeinside[0] + right = escapeinside[1] + lexer = LatexEmbeddedLexer(left, right, lexer) + + # ... and do it! + if not argns.s: + # process whole input as per normal... + try: + highlight(code, lexer, fmter, outfile) + finally: + if outfn: + outfile.close() + return 0 + else: + # line by line processing of stdin (eg: for 'tail -f')... + try: + while 1: + line = sys.stdin.buffer.readline() + if not line: + break + if not inencoding: + line = guess_decode_from_terminal(line, sys.stdin)[0] + highlight(line, lexer, fmter, outfile) + if hasattr(outfile, 'flush'): + outfile.flush() + return 0 + except KeyboardInterrupt: # pragma: no cover + return 0 + finally: + if outfn: + outfile.close() + + +class HelpFormatter(argparse.HelpFormatter): + def __init__(self, prog, indent_increment=2, max_help_position=16, width=None): + if width is None: + try: + width = shutil.get_terminal_size().columns - 2 + except Exception: + pass + argparse.HelpFormatter.__init__(self, prog, indent_increment, + max_help_position, width) + + +def main(args=sys.argv): + """ + Main command line entry point. + """ + desc = "Highlight an input file and write the result to an output file." + parser = argparse.ArgumentParser(description=desc, add_help=False, + formatter_class=HelpFormatter) + + operation = parser.add_argument_group('Main operation') + lexersel = operation.add_mutually_exclusive_group() + lexersel.add_argument( + '-l', metavar='LEXER', + help='Specify the lexer to use. (Query names with -L.) If not ' + 'given and -g is not present, the lexer is guessed from the filename.') + lexersel.add_argument( + '-g', action='store_true', + help='Guess the lexer from the file contents, or pass through ' + 'as plain text if nothing can be guessed.') + operation.add_argument( + '-F', metavar='FILTER[:options]', action='append', + help='Add a filter to the token stream. (Query names with -L.) ' + 'Filter options are given after a colon if necessary.') + operation.add_argument( + '-f', metavar='FORMATTER', + help='Specify the formatter to use. (Query names with -L.) ' + 'If not given, the formatter is guessed from the output filename, ' + 'and defaults to the terminal formatter if the output is to the ' + 'terminal or an unknown file extension.') + operation.add_argument( + '-O', metavar='OPTION=value[,OPTION=value,...]', action='append', + help='Give options to the lexer and formatter as a comma-separated ' + 'list of key-value pairs. ' + 'Example: `-O bg=light,python=cool`.') + operation.add_argument( + '-P', metavar='OPTION=value', action='append', + help='Give a single option to the lexer and formatter - with this ' + 'you can pass options whose value contains commas and equal signs. ' + 'Example: `-P "heading=Pygments, the Python highlighter"`.') + operation.add_argument( + '-o', metavar='OUTPUTFILE', + help='Where to write the output. Defaults to standard output.') + + operation.add_argument( + 'INPUTFILE', nargs='?', + help='Where to read the input. Defaults to standard input.') + + flags = parser.add_argument_group('Operation flags') + flags.add_argument( + '-v', action='store_true', + help='Print a detailed traceback on unhandled exceptions, which ' + 'is useful for debugging and bug reports.') + flags.add_argument( + '-s', action='store_true', + help='Process lines one at a time until EOF, rather than waiting to ' + 'process the entire file. This only works for stdin, only for lexers ' + 'with no line-spanning constructs, and is intended for streaming ' + 'input such as you get from `tail -f`. ' + 'Example usage: `tail -f sql.log | pygmentize -s -l sql`.') + flags.add_argument( + '-x', action='store_true', + help='Allow custom lexers and formatters to be loaded from a .py file ' + 'relative to the current working directory. For example, ' + '`-l ./customlexer.py -x`. By default, this option expects a file ' + 'with a class named CustomLexer or CustomFormatter; you can also ' + 'specify your own class name with a colon (`-l ./lexer.py:MyLexer`). ' + 'Users should be very careful not to use this option with untrusted ' + 'files, because it will import and run them.') + + special_modes_group = parser.add_argument_group( + 'Special modes - do not do any highlighting') + special_modes = special_modes_group.add_mutually_exclusive_group() + special_modes.add_argument( + '-S', metavar='STYLE -f formatter', + help='Print style definitions for STYLE for a formatter ' + 'given with -f. The argument given by -a is formatter ' + 'dependent.') + special_modes.add_argument( + '-L', nargs='*', metavar='WHAT', + help='List lexers, formatters, styles or filters -- ' + 'give additional arguments for the thing(s) you want to list ' + '(e.g. "styles"), or omit them to list everything.') + special_modes.add_argument( + '-N', metavar='FILENAME', + help='Guess and print out a lexer name based solely on the given ' + 'filename. Does not take input or highlight anything. If no specific ' + 'lexer can be determined, "text" is printed.') + special_modes.add_argument( + '-C', action='store_true', + help='Like -N, but print out a lexer name based solely on ' + 'a given content from standard input.') + special_modes.add_argument( + '-H', action='store', nargs=2, metavar=('NAME', 'TYPE'), + help='Print detailed help for the object <name> of type <type>, ' + 'where <type> is one of "lexer", "formatter" or "filter".') + special_modes.add_argument( + '-V', action='store_true', + help='Print the package version.') + special_modes.add_argument( + '-h', '--help', action='store_true', + help='Print this help.') + special_modes_group.add_argument( + '-a', metavar='ARG', + help='Formatter-specific additional argument for the -S (print ' + 'style sheet) mode.') + + argns = parser.parse_args(args[1:]) + + try: + return main_inner(parser, argns) + except Exception: + if argns.v: + print(file=sys.stderr) + print('*' * 65, file=sys.stderr) + print('An unhandled exception occurred while highlighting.', + file=sys.stderr) + print('Please report the whole traceback to the issue tracker at', + file=sys.stderr) + print('<https://github.com/pygments/pygments/issues>.', + file=sys.stderr) + print('*' * 65, file=sys.stderr) + print(file=sys.stderr) + raise + import traceback + info = traceback.format_exception(*sys.exc_info()) + msg = info[-1].strip() + if len(info) >= 3: + # extract relevant file and position info + msg += '\n (f%s)' % info[-2].split('\n')[0].strip()[1:] + print(file=sys.stderr) + print('*** Error while highlighting:', file=sys.stderr) + print(msg, file=sys.stderr) + print('*** If this is a bug you want to report, please rerun with -v.', + file=sys.stderr) + return 1 diff --git a/src/pip/_vendor/pygments/console.py b/src/pip/_vendor/pygments/console.py new file mode 100644 index 000000000..8dd08abeb --- /dev/null +++ b/src/pip/_vendor/pygments/console.py @@ -0,0 +1,70 @@ +""" + pygments.console + ~~~~~~~~~~~~~~~~ + + Format colored console output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +esc = "\x1b[" + +codes = {} +codes[""] = "" +codes["reset"] = esc + "39;49;00m" + +codes["bold"] = esc + "01m" +codes["faint"] = esc + "02m" +codes["standout"] = esc + "03m" +codes["underline"] = esc + "04m" +codes["blink"] = esc + "05m" +codes["overline"] = esc + "06m" + +dark_colors = ["black", "red", "green", "yellow", "blue", + "magenta", "cyan", "gray"] +light_colors = ["brightblack", "brightred", "brightgreen", "brightyellow", "brightblue", + "brightmagenta", "brightcyan", "white"] + +x = 30 +for d, l in zip(dark_colors, light_colors): + codes[d] = esc + "%im" % x + codes[l] = esc + "%im" % (60 + x) + x += 1 + +del d, l, x + +codes["white"] = codes["bold"] + + +def reset_color(): + return codes["reset"] + + +def colorize(color_key, text): + return codes[color_key] + text + codes["reset"] + + +def ansiformat(attr, text): + """ + Format ``text`` with a color and/or some attributes:: + + color normal color + *color* bold color + _color_ underlined color + +color+ blinking color + """ + result = [] + if attr[:1] == attr[-1:] == '+': + result.append(codes['blink']) + attr = attr[1:-1] + if attr[:1] == attr[-1:] == '*': + result.append(codes['bold']) + attr = attr[1:-1] + if attr[:1] == attr[-1:] == '_': + result.append(codes['underline']) + attr = attr[1:-1] + result.append(codes[attr]) + result.append(text) + result.append(codes['reset']) + return ''.join(result) diff --git a/src/pip/_vendor/pygments/filter.py b/src/pip/_vendor/pygments/filter.py new file mode 100644 index 000000000..85b482987 --- /dev/null +++ b/src/pip/_vendor/pygments/filter.py @@ -0,0 +1,71 @@ +""" + pygments.filter + ~~~~~~~~~~~~~~~ + + Module that implements the default filter. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + + +def apply_filters(stream, filters, lexer=None): + """ + Use this method to apply an iterable of filters to + a stream. If lexer is given it's forwarded to the + filter, otherwise the filter receives `None`. + """ + def _apply(filter_, stream): + yield from filter_.filter(lexer, stream) + for filter_ in filters: + stream = _apply(filter_, stream) + return stream + + +def simplefilter(f): + """ + Decorator that converts a function into a filter:: + + @simplefilter + def lowercase(self, lexer, stream, options): + for ttype, value in stream: + yield ttype, value.lower() + """ + return type(f.__name__, (FunctionFilter,), { + '__module__': getattr(f, '__module__'), + '__doc__': f.__doc__, + 'function': f, + }) + + +class Filter: + """ + Default filter. Subclass this class or use the `simplefilter` + decorator to create own filters. + """ + + def __init__(self, **options): + self.options = options + + def filter(self, lexer, stream): + raise NotImplementedError() + + +class FunctionFilter(Filter): + """ + Abstract class used by `simplefilter` to create simple + function filters on the fly. The `simplefilter` decorator + automatically creates subclasses of this class for + functions passed to it. + """ + function = None + + def __init__(self, **options): + if not hasattr(self, 'function'): + raise TypeError('%r used without bound function' % + self.__class__.__name__) + Filter.__init__(self, **options) + + def filter(self, lexer, stream): + # pylint: disable=not-callable + yield from self.function(lexer, stream, self.options) diff --git a/src/pip/_vendor/pygments/filters/__init__.py b/src/pip/_vendor/pygments/filters/__init__.py new file mode 100644 index 000000000..1d5a808f6 --- /dev/null +++ b/src/pip/_vendor/pygments/filters/__init__.py @@ -0,0 +1,937 @@ +""" + pygments.filters + ~~~~~~~~~~~~~~~~ + + Module containing filter lookup functions and default + filters. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re + +from pip._vendor.pygments.token import String, Comment, Keyword, Name, Error, Whitespace, \ + string_to_tokentype +from pip._vendor.pygments.filter import Filter +from pip._vendor.pygments.util import get_list_opt, get_int_opt, get_bool_opt, \ + get_choice_opt, ClassNotFound, OptionError +from pip._vendor.pygments.plugin import find_plugin_filters + + +def find_filter_class(filtername): + """Lookup a filter by name. Return None if not found.""" + if filtername in FILTERS: + return FILTERS[filtername] + for name, cls in find_plugin_filters(): + if name == filtername: + return cls + return None + + +def get_filter_by_name(filtername, **options): + """Return an instantiated filter. + + Options are passed to the filter initializer if wanted. + Raise a ClassNotFound if not found. + """ + cls = find_filter_class(filtername) + if cls: + return cls(**options) + else: + raise ClassNotFound('filter %r not found' % filtername) + + +def get_all_filters(): + """Return a generator of all filter names.""" + yield from FILTERS + for name, _ in find_plugin_filters(): + yield name + + +def _replace_special(ttype, value, regex, specialttype, + replacefunc=lambda x: x): + last = 0 + for match in regex.finditer(value): + start, end = match.start(), match.end() + if start != last: + yield ttype, value[last:start] + yield specialttype, replacefunc(value[start:end]) + last = end + if last != len(value): + yield ttype, value[last:] + + +class CodeTagFilter(Filter): + """Highlight special code tags in comments and docstrings. + + Options accepted: + + `codetags` : list of strings + A list of strings that are flagged as code tags. The default is to + highlight ``XXX``, ``TODO``, ``BUG`` and ``NOTE``. + """ + + def __init__(self, **options): + Filter.__init__(self, **options) + tags = get_list_opt(options, 'codetags', + ['XXX', 'TODO', 'BUG', 'NOTE']) + self.tag_re = re.compile(r'\b(%s)\b' % '|'.join([ + re.escape(tag) for tag in tags if tag + ])) + + def filter(self, lexer, stream): + regex = self.tag_re + for ttype, value in stream: + if ttype in String.Doc or \ + ttype in Comment and \ + ttype not in Comment.Preproc: + yield from _replace_special(ttype, value, regex, Comment.Special) + else: + yield ttype, value + + +class SymbolFilter(Filter): + """Convert mathematical symbols such as \\<longrightarrow> in Isabelle + or \\longrightarrow in LaTeX into Unicode characters. + + This is mostly useful for HTML or console output when you want to + approximate the source rendering you'd see in an IDE. + + Options accepted: + + `lang` : string + The symbol language. Must be one of ``'isabelle'`` or + ``'latex'``. The default is ``'isabelle'``. + """ + + latex_symbols = { + '\\alpha' : '\U000003b1', + '\\beta' : '\U000003b2', + '\\gamma' : '\U000003b3', + '\\delta' : '\U000003b4', + '\\varepsilon' : '\U000003b5', + '\\zeta' : '\U000003b6', + '\\eta' : '\U000003b7', + '\\vartheta' : '\U000003b8', + '\\iota' : '\U000003b9', + '\\kappa' : '\U000003ba', + '\\lambda' : '\U000003bb', + '\\mu' : '\U000003bc', + '\\nu' : '\U000003bd', + '\\xi' : '\U000003be', + '\\pi' : '\U000003c0', + '\\varrho' : '\U000003c1', + '\\sigma' : '\U000003c3', + '\\tau' : '\U000003c4', + '\\upsilon' : '\U000003c5', + '\\varphi' : '\U000003c6', + '\\chi' : '\U000003c7', + '\\psi' : '\U000003c8', + '\\omega' : '\U000003c9', + '\\Gamma' : '\U00000393', + '\\Delta' : '\U00000394', + '\\Theta' : '\U00000398', + '\\Lambda' : '\U0000039b', + '\\Xi' : '\U0000039e', + '\\Pi' : '\U000003a0', + '\\Sigma' : '\U000003a3', + '\\Upsilon' : '\U000003a5', + '\\Phi' : '\U000003a6', + '\\Psi' : '\U000003a8', + '\\Omega' : '\U000003a9', + '\\leftarrow' : '\U00002190', + '\\longleftarrow' : '\U000027f5', + '\\rightarrow' : '\U00002192', + '\\longrightarrow' : '\U000027f6', + '\\Leftarrow' : '\U000021d0', + '\\Longleftarrow' : '\U000027f8', + '\\Rightarrow' : '\U000021d2', + '\\Longrightarrow' : '\U000027f9', + '\\leftrightarrow' : '\U00002194', + '\\longleftrightarrow' : '\U000027f7', + '\\Leftrightarrow' : '\U000021d4', + '\\Longleftrightarrow' : '\U000027fa', + '\\mapsto' : '\U000021a6', + '\\longmapsto' : '\U000027fc', + '\\relbar' : '\U00002500', + '\\Relbar' : '\U00002550', + '\\hookleftarrow' : '\U000021a9', + '\\hookrightarrow' : '\U000021aa', + '\\leftharpoondown' : '\U000021bd', + '\\rightharpoondown' : '\U000021c1', + '\\leftharpoonup' : '\U000021bc', + '\\rightharpoonup' : '\U000021c0', + '\\rightleftharpoons' : '\U000021cc', + '\\leadsto' : '\U0000219d', + '\\downharpoonleft' : '\U000021c3', + '\\downharpoonright' : '\U000021c2', + '\\upharpoonleft' : '\U000021bf', + '\\upharpoonright' : '\U000021be', + '\\restriction' : '\U000021be', + '\\uparrow' : '\U00002191', + '\\Uparrow' : '\U000021d1', + '\\downarrow' : '\U00002193', + '\\Downarrow' : '\U000021d3', + '\\updownarrow' : '\U00002195', + '\\Updownarrow' : '\U000021d5', + '\\langle' : '\U000027e8', + '\\rangle' : '\U000027e9', + '\\lceil' : '\U00002308', + '\\rceil' : '\U00002309', + '\\lfloor' : '\U0000230a', + '\\rfloor' : '\U0000230b', + '\\flqq' : '\U000000ab', + '\\frqq' : '\U000000bb', + '\\bot' : '\U000022a5', + '\\top' : '\U000022a4', + '\\wedge' : '\U00002227', + '\\bigwedge' : '\U000022c0', + '\\vee' : '\U00002228', + '\\bigvee' : '\U000022c1', + '\\forall' : '\U00002200', + '\\exists' : '\U00002203', + '\\nexists' : '\U00002204', + '\\neg' : '\U000000ac', + '\\Box' : '\U000025a1', + '\\Diamond' : '\U000025c7', + '\\vdash' : '\U000022a2', + '\\models' : '\U000022a8', + '\\dashv' : '\U000022a3', + '\\surd' : '\U0000221a', + '\\le' : '\U00002264', + '\\ge' : '\U00002265', + '\\ll' : '\U0000226a', + '\\gg' : '\U0000226b', + '\\lesssim' : '\U00002272', + '\\gtrsim' : '\U00002273', + '\\lessapprox' : '\U00002a85', + '\\gtrapprox' : '\U00002a86', + '\\in' : '\U00002208', + '\\notin' : '\U00002209', + '\\subset' : '\U00002282', + '\\supset' : '\U00002283', + '\\subseteq' : '\U00002286', + '\\supseteq' : '\U00002287', + '\\sqsubset' : '\U0000228f', + '\\sqsupset' : '\U00002290', + '\\sqsubseteq' : '\U00002291', + '\\sqsupseteq' : '\U00002292', + '\\cap' : '\U00002229', + '\\bigcap' : '\U000022c2', + '\\cup' : '\U0000222a', + '\\bigcup' : '\U000022c3', + '\\sqcup' : '\U00002294', + '\\bigsqcup' : '\U00002a06', + '\\sqcap' : '\U00002293', + '\\Bigsqcap' : '\U00002a05', + '\\setminus' : '\U00002216', + '\\propto' : '\U0000221d', + '\\uplus' : '\U0000228e', + '\\bigplus' : '\U00002a04', + '\\sim' : '\U0000223c', + '\\doteq' : '\U00002250', + '\\simeq' : '\U00002243', + '\\approx' : '\U00002248', + '\\asymp' : '\U0000224d', + '\\cong' : '\U00002245', + '\\equiv' : '\U00002261', + '\\Join' : '\U000022c8', + '\\bowtie' : '\U00002a1d', + '\\prec' : '\U0000227a', + '\\succ' : '\U0000227b', + '\\preceq' : '\U0000227c', + '\\succeq' : '\U0000227d', + '\\parallel' : '\U00002225', + '\\mid' : '\U000000a6', + '\\pm' : '\U000000b1', + '\\mp' : '\U00002213', + '\\times' : '\U000000d7', + '\\div' : '\U000000f7', + '\\cdot' : '\U000022c5', + '\\star' : '\U000022c6', + '\\circ' : '\U00002218', + '\\dagger' : '\U00002020', + '\\ddagger' : '\U00002021', + '\\lhd' : '\U000022b2', + '\\rhd' : '\U000022b3', + '\\unlhd' : '\U000022b4', + '\\unrhd' : '\U000022b5', + '\\triangleleft' : '\U000025c3', + '\\triangleright' : '\U000025b9', + '\\triangle' : '\U000025b3', + '\\triangleq' : '\U0000225c', + '\\oplus' : '\U00002295', + '\\bigoplus' : '\U00002a01', + '\\otimes' : '\U00002297', + '\\bigotimes' : '\U00002a02', + '\\odot' : '\U00002299', + '\\bigodot' : '\U00002a00', + '\\ominus' : '\U00002296', + '\\oslash' : '\U00002298', + '\\dots' : '\U00002026', + '\\cdots' : '\U000022ef', + '\\sum' : '\U00002211', + '\\prod' : '\U0000220f', + '\\coprod' : '\U00002210', + '\\infty' : '\U0000221e', + '\\int' : '\U0000222b', + '\\oint' : '\U0000222e', + '\\clubsuit' : '\U00002663', + '\\diamondsuit' : '\U00002662', + '\\heartsuit' : '\U00002661', + '\\spadesuit' : '\U00002660', + '\\aleph' : '\U00002135', + '\\emptyset' : '\U00002205', + '\\nabla' : '\U00002207', + '\\partial' : '\U00002202', + '\\flat' : '\U0000266d', + '\\natural' : '\U0000266e', + '\\sharp' : '\U0000266f', + '\\angle' : '\U00002220', + '\\copyright' : '\U000000a9', + '\\textregistered' : '\U000000ae', + '\\textonequarter' : '\U000000bc', + '\\textonehalf' : '\U000000bd', + '\\textthreequarters' : '\U000000be', + '\\textordfeminine' : '\U000000aa', + '\\textordmasculine' : '\U000000ba', + '\\euro' : '\U000020ac', + '\\pounds' : '\U000000a3', + '\\yen' : '\U000000a5', + '\\textcent' : '\U000000a2', + '\\textcurrency' : '\U000000a4', + '\\textdegree' : '\U000000b0', + } + + isabelle_symbols = { + '\\<zero>' : '\U0001d7ec', + '\\<one>' : '\U0001d7ed', + '\\<two>' : '\U0001d7ee', + '\\<three>' : '\U0001d7ef', + '\\<four>' : '\U0001d7f0', + '\\<five>' : '\U0001d7f1', + '\\<six>' : '\U0001d7f2', + '\\<seven>' : '\U0001d7f3', + '\\<eight>' : '\U0001d7f4', + '\\<nine>' : '\U0001d7f5', + '\\<A>' : '\U0001d49c', + '\\<B>' : '\U0000212c', + '\\<C>' : '\U0001d49e', + '\\<D>' : '\U0001d49f', + '\\<E>' : '\U00002130', + '\\<F>' : '\U00002131', + '\\<G>' : '\U0001d4a2', + '\\<H>' : '\U0000210b', + '\\<I>' : '\U00002110', + '\\<J>' : '\U0001d4a5', + '\\<K>' : '\U0001d4a6', + '\\<L>' : '\U00002112', + '\\<M>' : '\U00002133', + '\\<N>' : '\U0001d4a9', + '\\<O>' : '\U0001d4aa', + '\\<P>' : '\U0001d4ab', + '\\<Q>' : '\U0001d4ac', + '\\<R>' : '\U0000211b', + '\\<S>' : '\U0001d4ae', + '\\<T>' : '\U0001d4af', + '\\<U>' : '\U0001d4b0', + '\\<V>' : '\U0001d4b1', + '\\<W>' : '\U0001d4b2', + '\\<X>' : '\U0001d4b3', + '\\<Y>' : '\U0001d4b4', + '\\<Z>' : '\U0001d4b5', + '\\<a>' : '\U0001d5ba', + '\\<b>' : '\U0001d5bb', + '\\<c>' : '\U0001d5bc', + '\\<d>' : '\U0001d5bd', + '\\<e>' : '\U0001d5be', + '\\<f>' : '\U0001d5bf', + '\\<g>' : '\U0001d5c0', + '\\<h>' : '\U0001d5c1', + '\\<i>' : '\U0001d5c2', + '\\<j>' : '\U0001d5c3', + '\\<k>' : '\U0001d5c4', + '\\<l>' : '\U0001d5c5', + '\\<m>' : '\U0001d5c6', + '\\<n>' : '\U0001d5c7', + '\\<o>' : '\U0001d5c8', + '\\<p>' : '\U0001d5c9', + '\\<q>' : '\U0001d5ca', + '\\<r>' : '\U0001d5cb', + '\\<s>' : '\U0001d5cc', + '\\<t>' : '\U0001d5cd', + '\\<u>' : '\U0001d5ce', + '\\<v>' : '\U0001d5cf', + '\\<w>' : '\U0001d5d0', + '\\<x>' : '\U0001d5d1', + '\\<y>' : '\U0001d5d2', + '\\<z>' : '\U0001d5d3', + '\\<AA>' : '\U0001d504', + '\\<BB>' : '\U0001d505', + '\\<CC>' : '\U0000212d', + '\\<DD>' : '\U0001d507', + '\\<EE>' : '\U0001d508', + '\\<FF>' : '\U0001d509', + '\\<GG>' : '\U0001d50a', + '\\<HH>' : '\U0000210c', + '\\<II>' : '\U00002111', + '\\<JJ>' : '\U0001d50d', + '\\<KK>' : '\U0001d50e', + '\\<LL>' : '\U0001d50f', + '\\<MM>' : '\U0001d510', + '\\<NN>' : '\U0001d511', + '\\<OO>' : '\U0001d512', + '\\<PP>' : '\U0001d513', + '\\<QQ>' : '\U0001d514', + '\\<RR>' : '\U0000211c', + '\\<SS>' : '\U0001d516', + '\\<TT>' : '\U0001d517', + '\\<UU>' : '\U0001d518', + '\\<VV>' : '\U0001d519', + '\\<WW>' : '\U0001d51a', + '\\<XX>' : '\U0001d51b', + '\\<YY>' : '\U0001d51c', + '\\<ZZ>' : '\U00002128', + '\\<aa>' : '\U0001d51e', + '\\<bb>' : '\U0001d51f', + '\\<cc>' : '\U0001d520', + '\\<dd>' : '\U0001d521', + '\\<ee>' : '\U0001d522', + '\\<ff>' : '\U0001d523', + '\\<gg>' : '\U0001d524', + '\\<hh>' : '\U0001d525', + '\\<ii>' : '\U0001d526', + '\\<jj>' : '\U0001d527', + '\\<kk>' : '\U0001d528', + '\\<ll>' : '\U0001d529', + '\\<mm>' : '\U0001d52a', + '\\<nn>' : '\U0001d52b', + '\\<oo>' : '\U0001d52c', + '\\<pp>' : '\U0001d52d', + '\\<qq>' : '\U0001d52e', + '\\<rr>' : '\U0001d52f', + '\\<ss>' : '\U0001d530', + '\\<tt>' : '\U0001d531', + '\\<uu>' : '\U0001d532', + '\\<vv>' : '\U0001d533', + '\\<ww>' : '\U0001d534', + '\\<xx>' : '\U0001d535', + '\\<yy>' : '\U0001d536', + '\\<zz>' : '\U0001d537', + '\\<alpha>' : '\U000003b1', + '\\<beta>' : '\U000003b2', + '\\<gamma>' : '\U000003b3', + '\\<delta>' : '\U000003b4', + '\\<epsilon>' : '\U000003b5', + '\\<zeta>' : '\U000003b6', + '\\<eta>' : '\U000003b7', + '\\<theta>' : '\U000003b8', + '\\<iota>' : '\U000003b9', + '\\<kappa>' : '\U000003ba', + '\\<lambda>' : '\U000003bb', + '\\<mu>' : '\U000003bc', + '\\<nu>' : '\U000003bd', + '\\<xi>' : '\U000003be', + '\\<pi>' : '\U000003c0', + '\\<rho>' : '\U000003c1', + '\\<sigma>' : '\U000003c3', + '\\<tau>' : '\U000003c4', + '\\<upsilon>' : '\U000003c5', + '\\<phi>' : '\U000003c6', + '\\<chi>' : '\U000003c7', + '\\<psi>' : '\U000003c8', + '\\<omega>' : '\U000003c9', + '\\<Gamma>' : '\U00000393', + '\\<Delta>' : '\U00000394', + '\\<Theta>' : '\U00000398', + '\\<Lambda>' : '\U0000039b', + '\\<Xi>' : '\U0000039e', + '\\<Pi>' : '\U000003a0', + '\\<Sigma>' : '\U000003a3', + '\\<Upsilon>' : '\U000003a5', + '\\<Phi>' : '\U000003a6', + '\\<Psi>' : '\U000003a8', + '\\<Omega>' : '\U000003a9', + '\\<bool>' : '\U0001d539', + '\\<complex>' : '\U00002102', + '\\<nat>' : '\U00002115', + '\\<rat>' : '\U0000211a', + '\\<real>' : '\U0000211d', + '\\<int>' : '\U00002124', + '\\<leftarrow>' : '\U00002190', + '\\<longleftarrow>' : '\U000027f5', + '\\<rightarrow>' : '\U00002192', + '\\<longrightarrow>' : '\U000027f6', + '\\<Leftarrow>' : '\U000021d0', + '\\<Longleftarrow>' : '\U000027f8', + '\\<Rightarrow>' : '\U000021d2', + '\\<Longrightarrow>' : '\U000027f9', + '\\<leftrightarrow>' : '\U00002194', + '\\<longleftrightarrow>' : '\U000027f7', + '\\<Leftrightarrow>' : '\U000021d4', + '\\<Longleftrightarrow>' : '\U000027fa', + '\\<mapsto>' : '\U000021a6', + '\\<longmapsto>' : '\U000027fc', + '\\<midarrow>' : '\U00002500', + '\\<Midarrow>' : '\U00002550', + '\\<hookleftarrow>' : '\U000021a9', + '\\<hookrightarrow>' : '\U000021aa', + '\\<leftharpoondown>' : '\U000021bd', + '\\<rightharpoondown>' : '\U000021c1', + '\\<leftharpoonup>' : '\U000021bc', + '\\<rightharpoonup>' : '\U000021c0', + '\\<rightleftharpoons>' : '\U000021cc', + '\\<leadsto>' : '\U0000219d', + '\\<downharpoonleft>' : '\U000021c3', + '\\<downharpoonright>' : '\U000021c2', + '\\<upharpoonleft>' : '\U000021bf', + '\\<upharpoonright>' : '\U000021be', + '\\<restriction>' : '\U000021be', + '\\<Colon>' : '\U00002237', + '\\<up>' : '\U00002191', + '\\<Up>' : '\U000021d1', + '\\<down>' : '\U00002193', + '\\<Down>' : '\U000021d3', + '\\<updown>' : '\U00002195', + '\\<Updown>' : '\U000021d5', + '\\<langle>' : '\U000027e8', + '\\<rangle>' : '\U000027e9', + '\\<lceil>' : '\U00002308', + '\\<rceil>' : '\U00002309', + '\\<lfloor>' : '\U0000230a', + '\\<rfloor>' : '\U0000230b', + '\\<lparr>' : '\U00002987', + '\\<rparr>' : '\U00002988', + '\\<lbrakk>' : '\U000027e6', + '\\<rbrakk>' : '\U000027e7', + '\\<lbrace>' : '\U00002983', + '\\<rbrace>' : '\U00002984', + '\\<guillemotleft>' : '\U000000ab', + '\\<guillemotright>' : '\U000000bb', + '\\<bottom>' : '\U000022a5', + '\\<top>' : '\U000022a4', + '\\<and>' : '\U00002227', + '\\<And>' : '\U000022c0', + '\\<or>' : '\U00002228', + '\\<Or>' : '\U000022c1', + '\\<forall>' : '\U00002200', + '\\<exists>' : '\U00002203', + '\\<nexists>' : '\U00002204', + '\\<not>' : '\U000000ac', + '\\<box>' : '\U000025a1', + '\\<diamond>' : '\U000025c7', + '\\<turnstile>' : '\U000022a2', + '\\<Turnstile>' : '\U000022a8', + '\\<tturnstile>' : '\U000022a9', + '\\<TTurnstile>' : '\U000022ab', + '\\<stileturn>' : '\U000022a3', + '\\<surd>' : '\U0000221a', + '\\<le>' : '\U00002264', + '\\<ge>' : '\U00002265', + '\\<lless>' : '\U0000226a', + '\\<ggreater>' : '\U0000226b', + '\\<lesssim>' : '\U00002272', + '\\<greatersim>' : '\U00002273', + '\\<lessapprox>' : '\U00002a85', + '\\<greaterapprox>' : '\U00002a86', + '\\<in>' : '\U00002208', + '\\<notin>' : '\U00002209', + '\\<subset>' : '\U00002282', + '\\<supset>' : '\U00002283', + '\\<subseteq>' : '\U00002286', + '\\<supseteq>' : '\U00002287', + '\\<sqsubset>' : '\U0000228f', + '\\<sqsupset>' : '\U00002290', + '\\<sqsubseteq>' : '\U00002291', + '\\<sqsupseteq>' : '\U00002292', + '\\<inter>' : '\U00002229', + '\\<Inter>' : '\U000022c2', + '\\<union>' : '\U0000222a', + '\\<Union>' : '\U000022c3', + '\\<squnion>' : '\U00002294', + '\\<Squnion>' : '\U00002a06', + '\\<sqinter>' : '\U00002293', + '\\<Sqinter>' : '\U00002a05', + '\\<setminus>' : '\U00002216', + '\\<propto>' : '\U0000221d', + '\\<uplus>' : '\U0000228e', + '\\<Uplus>' : '\U00002a04', + '\\<noteq>' : '\U00002260', + '\\<sim>' : '\U0000223c', + '\\<doteq>' : '\U00002250', + '\\<simeq>' : '\U00002243', + '\\<approx>' : '\U00002248', + '\\<asymp>' : '\U0000224d', + '\\<cong>' : '\U00002245', + '\\<smile>' : '\U00002323', + '\\<equiv>' : '\U00002261', + '\\<frown>' : '\U00002322', + '\\<Join>' : '\U000022c8', + '\\<bowtie>' : '\U00002a1d', + '\\<prec>' : '\U0000227a', + '\\<succ>' : '\U0000227b', + '\\<preceq>' : '\U0000227c', + '\\<succeq>' : '\U0000227d', + '\\<parallel>' : '\U00002225', + '\\<bar>' : '\U000000a6', + '\\<plusminus>' : '\U000000b1', + '\\<minusplus>' : '\U00002213', + '\\<times>' : '\U000000d7', + '\\<div>' : '\U000000f7', + '\\<cdot>' : '\U000022c5', + '\\<star>' : '\U000022c6', + '\\<bullet>' : '\U00002219', + '\\<circ>' : '\U00002218', + '\\<dagger>' : '\U00002020', + '\\<ddagger>' : '\U00002021', + '\\<lhd>' : '\U000022b2', + '\\<rhd>' : '\U000022b3', + '\\<unlhd>' : '\U000022b4', + '\\<unrhd>' : '\U000022b5', + '\\<triangleleft>' : '\U000025c3', + '\\<triangleright>' : '\U000025b9', + '\\<triangle>' : '\U000025b3', + '\\<triangleq>' : '\U0000225c', + '\\<oplus>' : '\U00002295', + '\\<Oplus>' : '\U00002a01', + '\\<otimes>' : '\U00002297', + '\\<Otimes>' : '\U00002a02', + '\\<odot>' : '\U00002299', + '\\<Odot>' : '\U00002a00', + '\\<ominus>' : '\U00002296', + '\\<oslash>' : '\U00002298', + '\\<dots>' : '\U00002026', + '\\<cdots>' : '\U000022ef', + '\\<Sum>' : '\U00002211', + '\\<Prod>' : '\U0000220f', + '\\<Coprod>' : '\U00002210', + '\\<infinity>' : '\U0000221e', + '\\<integral>' : '\U0000222b', + '\\<ointegral>' : '\U0000222e', + '\\<clubsuit>' : '\U00002663', + '\\<diamondsuit>' : '\U00002662', + '\\<heartsuit>' : '\U00002661', + '\\<spadesuit>' : '\U00002660', + '\\<aleph>' : '\U00002135', + '\\<emptyset>' : '\U00002205', + '\\<nabla>' : '\U00002207', + '\\<partial>' : '\U00002202', + '\\<flat>' : '\U0000266d', + '\\<natural>' : '\U0000266e', + '\\<sharp>' : '\U0000266f', + '\\<angle>' : '\U00002220', + '\\<copyright>' : '\U000000a9', + '\\<registered>' : '\U000000ae', + '\\<hyphen>' : '\U000000ad', + '\\<inverse>' : '\U000000af', + '\\<onequarter>' : '\U000000bc', + '\\<onehalf>' : '\U000000bd', + '\\<threequarters>' : '\U000000be', + '\\<ordfeminine>' : '\U000000aa', + '\\<ordmasculine>' : '\U000000ba', + '\\<section>' : '\U000000a7', + '\\<paragraph>' : '\U000000b6', + '\\<exclamdown>' : '\U000000a1', + '\\<questiondown>' : '\U000000bf', + '\\<euro>' : '\U000020ac', + '\\<pounds>' : '\U000000a3', + '\\<yen>' : '\U000000a5', + '\\<cent>' : '\U000000a2', + '\\<currency>' : '\U000000a4', + '\\<degree>' : '\U000000b0', + '\\<amalg>' : '\U00002a3f', + '\\<mho>' : '\U00002127', + '\\<lozenge>' : '\U000025ca', + '\\<wp>' : '\U00002118', + '\\<wrong>' : '\U00002240', + '\\<struct>' : '\U000022c4', + '\\<acute>' : '\U000000b4', + '\\<index>' : '\U00000131', + '\\<dieresis>' : '\U000000a8', + '\\<cedilla>' : '\U000000b8', + '\\<hungarumlaut>' : '\U000002dd', + '\\<some>' : '\U000003f5', + '\\<newline>' : '\U000023ce', + '\\<open>' : '\U00002039', + '\\<close>' : '\U0000203a', + '\\<here>' : '\U00002302', + '\\<^sub>' : '\U000021e9', + '\\<^sup>' : '\U000021e7', + '\\<^bold>' : '\U00002759', + '\\<^bsub>' : '\U000021d8', + '\\<^esub>' : '\U000021d9', + '\\<^bsup>' : '\U000021d7', + '\\<^esup>' : '\U000021d6', + } + + lang_map = {'isabelle' : isabelle_symbols, 'latex' : latex_symbols} + + def __init__(self, **options): + Filter.__init__(self, **options) + lang = get_choice_opt(options, 'lang', + ['isabelle', 'latex'], 'isabelle') + self.symbols = self.lang_map[lang] + + def filter(self, lexer, stream): + for ttype, value in stream: + if value in self.symbols: + yield ttype, self.symbols[value] + else: + yield ttype, value + + +class KeywordCaseFilter(Filter): + """Convert keywords to lowercase or uppercase or capitalize them, which + means first letter uppercase, rest lowercase. + + This can be useful e.g. if you highlight Pascal code and want to adapt the + code to your styleguide. + + Options accepted: + + `case` : string + The casing to convert keywords to. Must be one of ``'lower'``, + ``'upper'`` or ``'capitalize'``. The default is ``'lower'``. + """ + + def __init__(self, **options): + Filter.__init__(self, **options) + case = get_choice_opt(options, 'case', + ['lower', 'upper', 'capitalize'], 'lower') + self.convert = getattr(str, case) + + def filter(self, lexer, stream): + for ttype, value in stream: + if ttype in Keyword: + yield ttype, self.convert(value) + else: + yield ttype, value + + +class NameHighlightFilter(Filter): + """Highlight a normal Name (and Name.*) token with a different token type. + + Example:: + + filter = NameHighlightFilter( + names=['foo', 'bar', 'baz'], + tokentype=Name.Function, + ) + + This would highlight the names "foo", "bar" and "baz" + as functions. `Name.Function` is the default token type. + + Options accepted: + + `names` : list of strings + A list of names that should be given the different token type. + There is no default. + `tokentype` : TokenType or string + A token type or a string containing a token type name that is + used for highlighting the strings in `names`. The default is + `Name.Function`. + """ + + def __init__(self, **options): + Filter.__init__(self, **options) + self.names = set(get_list_opt(options, 'names', [])) + tokentype = options.get('tokentype') + if tokentype: + self.tokentype = string_to_tokentype(tokentype) + else: + self.tokentype = Name.Function + + def filter(self, lexer, stream): + for ttype, value in stream: + if ttype in Name and value in self.names: + yield self.tokentype, value + else: + yield ttype, value + + +class ErrorToken(Exception): + pass + + +class RaiseOnErrorTokenFilter(Filter): + """Raise an exception when the lexer generates an error token. + + Options accepted: + + `excclass` : Exception class + The exception class to raise. + The default is `pygments.filters.ErrorToken`. + + .. versionadded:: 0.8 + """ + + def __init__(self, **options): + Filter.__init__(self, **options) + self.exception = options.get('excclass', ErrorToken) + try: + # issubclass() will raise TypeError if first argument is not a class + if not issubclass(self.exception, Exception): + raise TypeError + except TypeError: + raise OptionError('excclass option is not an exception class') + + def filter(self, lexer, stream): + for ttype, value in stream: + if ttype is Error: + raise self.exception(value) + yield ttype, value + + +class VisibleWhitespaceFilter(Filter): + """Convert tabs, newlines and/or spaces to visible characters. + + Options accepted: + + `spaces` : string or bool + If this is a one-character string, spaces will be replaces by this string. + If it is another true value, spaces will be replaced by ``·`` (unicode + MIDDLE DOT). If it is a false value, spaces will not be replaced. The + default is ``False``. + `tabs` : string or bool + The same as for `spaces`, but the default replacement character is ``»`` + (unicode RIGHT-POINTING DOUBLE ANGLE QUOTATION MARK). The default value + is ``False``. Note: this will not work if the `tabsize` option for the + lexer is nonzero, as tabs will already have been expanded then. + `tabsize` : int + If tabs are to be replaced by this filter (see the `tabs` option), this + is the total number of characters that a tab should be expanded to. + The default is ``8``. + `newlines` : string or bool + The same as for `spaces`, but the default replacement character is ``¶`` + (unicode PILCROW SIGN). The default value is ``False``. + `wstokentype` : bool + If true, give whitespace the special `Whitespace` token type. This allows + styling the visible whitespace differently (e.g. greyed out), but it can + disrupt background colors. The default is ``True``. + + .. versionadded:: 0.8 + """ + + def __init__(self, **options): + Filter.__init__(self, **options) + for name, default in [('spaces', '·'), + ('tabs', '»'), + ('newlines', '¶')]: + opt = options.get(name, False) + if isinstance(opt, str) and len(opt) == 1: + setattr(self, name, opt) + else: + setattr(self, name, (opt and default or '')) + tabsize = get_int_opt(options, 'tabsize', 8) + if self.tabs: + self.tabs += ' ' * (tabsize - 1) + if self.newlines: + self.newlines += '\n' + self.wstt = get_bool_opt(options, 'wstokentype', True) + + def filter(self, lexer, stream): + if self.wstt: + spaces = self.spaces or ' ' + tabs = self.tabs or '\t' + newlines = self.newlines or '\n' + regex = re.compile(r'\s') + + def replacefunc(wschar): + if wschar == ' ': + return spaces + elif wschar == '\t': + return tabs + elif wschar == '\n': + return newlines + return wschar + + for ttype, value in stream: + yield from _replace_special(ttype, value, regex, Whitespace, + replacefunc) + else: + spaces, tabs, newlines = self.spaces, self.tabs, self.newlines + # simpler processing + for ttype, value in stream: + if spaces: + value = value.replace(' ', spaces) + if tabs: + value = value.replace('\t', tabs) + if newlines: + value = value.replace('\n', newlines) + yield ttype, value + + +class GobbleFilter(Filter): + """Gobbles source code lines (eats initial characters). + + This filter drops the first ``n`` characters off every line of code. This + may be useful when the source code fed to the lexer is indented by a fixed + amount of space that isn't desired in the output. + + Options accepted: + + `n` : int + The number of characters to gobble. + + .. versionadded:: 1.2 + """ + def __init__(self, **options): + Filter.__init__(self, **options) + self.n = get_int_opt(options, 'n', 0) + + def gobble(self, value, left): + if left < len(value): + return value[left:], 0 + else: + return '', left - len(value) + + def filter(self, lexer, stream): + n = self.n + left = n # How many characters left to gobble. + for ttype, value in stream: + # Remove ``left`` tokens from first line, ``n`` from all others. + parts = value.split('\n') + (parts[0], left) = self.gobble(parts[0], left) + for i in range(1, len(parts)): + (parts[i], left) = self.gobble(parts[i], n) + value = '\n'.join(parts) + + if value != '': + yield ttype, value + + +class TokenMergeFilter(Filter): + """Merges consecutive tokens with the same token type in the output + stream of a lexer. + + .. versionadded:: 1.2 + """ + def __init__(self, **options): + Filter.__init__(self, **options) + + def filter(self, lexer, stream): + current_type = None + current_value = None + for ttype, value in stream: + if ttype is current_type: + current_value += value + else: + if current_type is not None: + yield current_type, current_value + current_type = ttype + current_value = value + if current_type is not None: + yield current_type, current_value + + +FILTERS = { + 'codetagify': CodeTagFilter, + 'keywordcase': KeywordCaseFilter, + 'highlight': NameHighlightFilter, + 'raiseonerror': RaiseOnErrorTokenFilter, + 'whitespace': VisibleWhitespaceFilter, + 'gobble': GobbleFilter, + 'tokenmerge': TokenMergeFilter, + 'symbols': SymbolFilter, +} diff --git a/src/pip/_vendor/pygments/formatter.py b/src/pip/_vendor/pygments/formatter.py new file mode 100644 index 000000000..b585562b5 --- /dev/null +++ b/src/pip/_vendor/pygments/formatter.py @@ -0,0 +1,94 @@ +""" + pygments.formatter + ~~~~~~~~~~~~~~~~~~ + + Base formatter class. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import codecs + +from pip._vendor.pygments.util import get_bool_opt +from pip._vendor.pygments.styles import get_style_by_name + +__all__ = ['Formatter'] + + +def _lookup_style(style): + if isinstance(style, str): + return get_style_by_name(style) + return style + + +class Formatter: + """ + Converts a token stream to text. + + Options accepted: + + ``style`` + The style to use, can be a string or a Style subclass + (default: "default"). Not used by e.g. the + TerminalFormatter. + ``full`` + Tells the formatter to output a "full" document, i.e. + a complete self-contained document. This doesn't have + any effect for some formatters (default: false). + ``title`` + If ``full`` is true, the title that should be used to + caption the document (default: ''). + ``encoding`` + If given, must be an encoding name. This will be used to + convert the Unicode token strings to byte strings in the + output. If it is "" or None, Unicode strings will be written + to the output file, which most file-like objects do not + support (default: None). + ``outencoding`` + Overrides ``encoding`` if given. + """ + + #: Name of the formatter + name = None + + #: Shortcuts for the formatter + aliases = [] + + #: fn match rules + filenames = [] + + #: If True, this formatter outputs Unicode strings when no encoding + #: option is given. + unicodeoutput = True + + def __init__(self, **options): + self.style = _lookup_style(options.get('style', 'default')) + self.full = get_bool_opt(options, 'full', False) + self.title = options.get('title', '') + self.encoding = options.get('encoding', None) or None + if self.encoding in ('guess', 'chardet'): + # can happen for e.g. pygmentize -O encoding=guess + self.encoding = 'utf-8' + self.encoding = options.get('outencoding') or self.encoding + self.options = options + + def get_style_defs(self, arg=''): + """ + Return the style definitions for the current style as a string. + + ``arg`` is an additional argument whose meaning depends on the + formatter used. Note that ``arg`` can also be a list or tuple + for some formatters like the html formatter. + """ + return '' + + def format(self, tokensource, outfile): + """ + Format ``tokensource``, an iterable of ``(tokentype, tokenstring)`` + tuples and write it into ``outfile``. + """ + if self.encoding: + # wrap the outfile in a StreamWriter + outfile = codecs.lookup(self.encoding)[3](outfile) + return self.format_unencoded(tokensource, outfile) diff --git a/src/pip/_vendor/pygments/formatters/__init__.py b/src/pip/_vendor/pygments/formatters/__init__.py new file mode 100644 index 000000000..34f2bec59 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/__init__.py @@ -0,0 +1,153 @@ +""" + pygments.formatters + ~~~~~~~~~~~~~~~~~~~ + + Pygments formatters. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +import sys +import types +import fnmatch +from os.path import basename + +from pip._vendor.pygments.formatters._mapping import FORMATTERS +from pip._vendor.pygments.plugin import find_plugin_formatters +from pip._vendor.pygments.util import ClassNotFound + +__all__ = ['get_formatter_by_name', 'get_formatter_for_filename', + 'get_all_formatters', 'load_formatter_from_file'] + list(FORMATTERS) + +_formatter_cache = {} # classes by name +_pattern_cache = {} + + +def _fn_matches(fn, glob): + """Return whether the supplied file name fn matches pattern filename.""" + if glob not in _pattern_cache: + pattern = _pattern_cache[glob] = re.compile(fnmatch.translate(glob)) + return pattern.match(fn) + return _pattern_cache[glob].match(fn) + + +def _load_formatters(module_name): + """Load a formatter (and all others in the module too).""" + mod = __import__(module_name, None, None, ['__all__']) + for formatter_name in mod.__all__: + cls = getattr(mod, formatter_name) + _formatter_cache[cls.name] = cls + + +def get_all_formatters(): + """Return a generator for all formatter classes.""" + # NB: this returns formatter classes, not info like get_all_lexers(). + for info in FORMATTERS.values(): + if info[1] not in _formatter_cache: + _load_formatters(info[0]) + yield _formatter_cache[info[1]] + for _, formatter in find_plugin_formatters(): + yield formatter + + +def find_formatter_class(alias): + """Lookup a formatter by alias. + + Returns None if not found. + """ + for module_name, name, aliases, _, _ in FORMATTERS.values(): + if alias in aliases: + if name not in _formatter_cache: + _load_formatters(module_name) + return _formatter_cache[name] + for _, cls in find_plugin_formatters(): + if alias in cls.aliases: + return cls + + +def get_formatter_by_name(_alias, **options): + """Lookup and instantiate a formatter by alias. + + Raises ClassNotFound if not found. + """ + cls = find_formatter_class(_alias) + if cls is None: + raise ClassNotFound("no formatter found for name %r" % _alias) + return cls(**options) + + +def load_formatter_from_file(filename, formattername="CustomFormatter", + **options): + """Load a formatter from a file. + + This method expects a file located relative to the current working + directory, which contains a class named CustomFormatter. By default, + it expects the Formatter to be named CustomFormatter; you can specify + your own class name as the second argument to this function. + + Users should be very careful with the input, because this method + is equivalent to running eval on the input file. + + Raises ClassNotFound if there are any problems importing the Formatter. + + .. versionadded:: 2.2 + """ + try: + # This empty dict will contain the namespace for the exec'd file + custom_namespace = {} + with open(filename, 'rb') as f: + exec(f.read(), custom_namespace) + # Retrieve the class `formattername` from that namespace + if formattername not in custom_namespace: + raise ClassNotFound('no valid %s class found in %s' % + (formattername, filename)) + formatter_class = custom_namespace[formattername] + # And finally instantiate it with the options + return formatter_class(**options) + except OSError as err: + raise ClassNotFound('cannot read %s: %s' % (filename, err)) + except ClassNotFound: + raise + except Exception as err: + raise ClassNotFound('error when loading custom formatter: %s' % err) + + +def get_formatter_for_filename(fn, **options): + """Lookup and instantiate a formatter by filename pattern. + + Raises ClassNotFound if not found. + """ + fn = basename(fn) + for modname, name, _, filenames, _ in FORMATTERS.values(): + for filename in filenames: + if _fn_matches(fn, filename): + if name not in _formatter_cache: + _load_formatters(modname) + return _formatter_cache[name](**options) + for cls in find_plugin_formatters(): + for filename in cls.filenames: + if _fn_matches(fn, filename): + return cls(**options) + raise ClassNotFound("no formatter found for file name %r" % fn) + + +class _automodule(types.ModuleType): + """Automatically import formatters.""" + + def __getattr__(self, name): + info = FORMATTERS.get(name) + if info: + _load_formatters(info[0]) + cls = _formatter_cache[info[1]] + setattr(self, name, cls) + return cls + raise AttributeError(name) + + +oldmod = sys.modules[__name__] +newmod = _automodule(__name__) +newmod.__dict__.update(oldmod.__dict__) +sys.modules[__name__] = newmod +del newmod.newmod, newmod.oldmod, newmod.sys, newmod.types diff --git a/src/pip/_vendor/pygments/formatters/_mapping.py b/src/pip/_vendor/pygments/formatters/_mapping.py new file mode 100644 index 000000000..044ff4b2f --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/_mapping.py @@ -0,0 +1,83 @@ +""" + pygments.formatters._mapping + ~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter mapping definitions. This file is generated by itself. Everytime + you change something on a builtin formatter definition, run this script from + the formatters folder to update it. + + Do not alter the FORMATTERS dictionary by hand. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +FORMATTERS = { + 'BBCodeFormatter': ('pygments.formatters.bbcode', 'BBCode', ('bbcode', 'bb'), (), 'Format tokens with BBcodes. These formatting codes are used by many bulletin boards, so you can highlight your sourcecode with pygments before posting it there.'), + 'BmpImageFormatter': ('pygments.formatters.img', 'img_bmp', ('bmp', 'bitmap'), ('*.bmp',), 'Create a bitmap image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'GifImageFormatter': ('pygments.formatters.img', 'img_gif', ('gif',), ('*.gif',), 'Create a GIF image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'HtmlFormatter': ('pygments.formatters.html', 'HTML', ('html',), ('*.html', '*.htm'), "Format tokens as HTML 4 ``<span>`` tags within a ``<pre>`` tag, wrapped in a ``<div>`` tag. The ``<div>``'s CSS class can be set by the `cssclass` option."), + 'IRCFormatter': ('pygments.formatters.irc', 'IRC', ('irc', 'IRC'), (), 'Format tokens with IRC color sequences'), + 'ImageFormatter': ('pygments.formatters.img', 'img', ('img', 'IMG', 'png'), ('*.png',), 'Create a PNG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'JpgImageFormatter': ('pygments.formatters.img', 'img_jpg', ('jpg', 'jpeg'), ('*.jpg',), 'Create a JPEG image from source code. This uses the Python Imaging Library to generate a pixmap from the source code.'), + 'LatexFormatter': ('pygments.formatters.latex', 'LaTeX', ('latex', 'tex'), ('*.tex',), 'Format tokens as LaTeX code. This needs the `fancyvrb` and `color` standard packages.'), + 'NullFormatter': ('pygments.formatters.other', 'Text only', ('text', 'null'), ('*.txt',), 'Output the text unchanged without any formatting.'), + 'PangoMarkupFormatter': ('pygments.formatters.pangomarkup', 'Pango Markup', ('pango', 'pangomarkup'), (), 'Format tokens as Pango Markup code. It can then be rendered to an SVG.'), + 'RawTokenFormatter': ('pygments.formatters.other', 'Raw tokens', ('raw', 'tokens'), ('*.raw',), 'Format tokens as a raw representation for storing token streams.'), + 'RtfFormatter': ('pygments.formatters.rtf', 'RTF', ('rtf',), ('*.rtf',), 'Format tokens as RTF markup. This formatter automatically outputs full RTF documents with color information and other useful stuff. Perfect for Copy and Paste into Microsoft(R) Word(R) documents.'), + 'SvgFormatter': ('pygments.formatters.svg', 'SVG', ('svg',), ('*.svg',), 'Format tokens as an SVG graphics file. This formatter is still experimental. Each line of code is a ``<text>`` element with explicit ``x`` and ``y`` coordinates containing ``<tspan>`` elements with the individual token styles.'), + 'Terminal256Formatter': ('pygments.formatters.terminal256', 'Terminal256', ('terminal256', 'console256', '256'), (), 'Format tokens with ANSI color sequences, for output in a 256-color terminal or console. Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'), + 'TerminalFormatter': ('pygments.formatters.terminal', 'Terminal', ('terminal', 'console'), (), 'Format tokens with ANSI color sequences, for output in a text console. Color sequences are terminated at newlines, so that paging the output works correctly.'), + 'TerminalTrueColorFormatter': ('pygments.formatters.terminal256', 'TerminalTrueColor', ('terminal16m', 'console16m', '16m'), (), 'Format tokens with ANSI color sequences, for output in a true-color terminal or console. Like in `TerminalFormatter` color sequences are terminated at newlines, so that paging the output works correctly.'), + 'TestcaseFormatter': ('pygments.formatters.other', 'Testcase', ('testcase',), (), 'Format tokens as appropriate for a new testcase.') +} + +if __name__ == '__main__': # pragma: no cover + import sys + import os + + # lookup formatters + found_formatters = [] + imports = [] + sys.path.insert(0, os.path.join(os.path.dirname(__file__), '..', '..')) + from pip._vendor.pygments.util import docstring_headline + + for root, dirs, files in os.walk('.'): + for filename in files: + if filename.endswith('.py') and not filename.startswith('_'): + module_name = 'pygments.formatters%s.%s' % ( + root[1:].replace('/', '.'), filename[:-3]) + print(module_name) + module = __import__(module_name, None, None, ['']) + for formatter_name in module.__all__: + formatter = getattr(module, formatter_name) + found_formatters.append( + '%r: %r' % (formatter_name, + (module_name, + formatter.name, + tuple(formatter.aliases), + tuple(formatter.filenames), + docstring_headline(formatter)))) + # sort them to make the diff minimal + found_formatters.sort() + + # extract useful sourcecode from this file + with open(__file__) as fp: + content = fp.read() + # replace crnl to nl for Windows. + # + # Note that, originally, contributers should keep nl of master + # repository, for example by using some kind of automatic + # management EOL, like `EolExtension + # <https://www.mercurial-scm.org/wiki/EolExtension>`. + content = content.replace("\r\n", "\n") + header = content[:content.find('FORMATTERS = {')] + footer = content[content.find("if __name__ == '__main__':"):] + + # write new file + with open(__file__, 'w') as fp: + fp.write(header) + fp.write('FORMATTERS = {\n %s\n}\n\n' % ',\n '.join(found_formatters)) + fp.write(footer) + + print ('=== %d formatters processed.' % len(found_formatters)) diff --git a/src/pip/_vendor/pygments/formatters/bbcode.py b/src/pip/_vendor/pygments/formatters/bbcode.py new file mode 100644 index 000000000..35a37328e --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/bbcode.py @@ -0,0 +1,108 @@ +""" + pygments.formatters.bbcode + ~~~~~~~~~~~~~~~~~~~~~~~~~~ + + BBcode formatter. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.util import get_bool_opt + +__all__ = ['BBCodeFormatter'] + + +class BBCodeFormatter(Formatter): + """ + Format tokens with BBcodes. These formatting codes are used by many + bulletin boards, so you can highlight your sourcecode with pygments before + posting it there. + + This formatter has no support for background colors and borders, as there + are no common BBcode tags for that. + + Some board systems (e.g. phpBB) don't support colors in their [code] tag, + so you can't use the highlighting together with that tag. + Text in a [code] tag usually is shown with a monospace font (which this + formatter can do with the ``monofont`` option) and no spaces (which you + need for indentation) are removed. + + Additional options accepted: + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). + + `codetag` + If set to true, put the output into ``[code]`` tags (default: + ``false``) + + `monofont` + If set to true, add a tag to show the code with a monospace font + (default: ``false``). + """ + name = 'BBCode' + aliases = ['bbcode', 'bb'] + filenames = [] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self._code = get_bool_opt(options, 'codetag', False) + self._mono = get_bool_opt(options, 'monofont', False) + + self.styles = {} + self._make_styles() + + def _make_styles(self): + for ttype, ndef in self.style: + start = end = '' + if ndef['color']: + start += '[color=#%s]' % ndef['color'] + end = '[/color]' + end + if ndef['bold']: + start += '[b]' + end = '[/b]' + end + if ndef['italic']: + start += '[i]' + end = '[/i]' + end + if ndef['underline']: + start += '[u]' + end = '[/u]' + end + # there are no common BBcodes for background-color and border + + self.styles[ttype] = start, end + + def format_unencoded(self, tokensource, outfile): + if self._code: + outfile.write('[code]') + if self._mono: + outfile.write('[font=monospace]') + + lastval = '' + lasttype = None + + for ttype, value in tokensource: + while ttype not in self.styles: + ttype = ttype.parent + if ttype == lasttype: + lastval += value + else: + if lastval: + start, end = self.styles[lasttype] + outfile.write(''.join((start, lastval, end))) + lastval = value + lasttype = ttype + + if lastval: + start, end = self.styles[lasttype] + outfile.write(''.join((start, lastval, end))) + + if self._mono: + outfile.write('[/font]') + if self._code: + outfile.write('[/code]') + if self._code or self._mono: + outfile.write('\n') diff --git a/src/pip/_vendor/pygments/formatters/html.py b/src/pip/_vendor/pygments/formatters/html.py new file mode 100644 index 000000000..922c72f37 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/html.py @@ -0,0 +1,967 @@ +""" + pygments.formatters.html + ~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for HTML output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import functools +import os +import sys +import os.path +from io import StringIO + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.token import Token, Text, STANDARD_TYPES +from pip._vendor.pygments.util import get_bool_opt, get_int_opt, get_list_opt + +try: + import ctags +except ImportError: + ctags = None + +__all__ = ['HtmlFormatter'] + + +_escape_html_table = { + ord('&'): '&', + ord('<'): '<', + ord('>'): '>', + ord('"'): '"', + ord("'"): ''', +} + + +def escape_html(text, table=_escape_html_table): + """Escape &, <, > as well as single and double quotes for HTML.""" + return text.translate(table) + + +def webify(color): + if color.startswith('calc') or color.startswith('var'): + return color + else: + return '#' + color + + +def _get_ttype_class(ttype): + fname = STANDARD_TYPES.get(ttype) + if fname: + return fname + aname = '' + while fname is None: + aname = '-' + ttype[-1] + aname + ttype = ttype.parent + fname = STANDARD_TYPES.get(ttype) + return fname + aname + + +CSSFILE_TEMPLATE = '''\ +/* +generated by Pygments <https://pygments.org/> +Copyright 2006-2021 by the Pygments team. +Licensed under the BSD license, see LICENSE for details. +*/ +%(styledefs)s +''' + +DOC_HEADER = '''\ +<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.01//EN" + "http://www.w3.org/TR/html4/strict.dtd"> +<!-- +generated by Pygments <https://pygments.org/> +Copyright 2006-2021 by the Pygments team. +Licensed under the BSD license, see LICENSE for details. +--> +<html> +<head> + <title>%(title)s</title> + <meta http-equiv="content-type" content="text/html; charset=%(encoding)s"> + <style type="text/css"> +''' + CSSFILE_TEMPLATE + ''' + </style> +</head> +<body> +<h2>%(title)s</h2> + +''' + +DOC_HEADER_EXTERNALCSS = '''\ +<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.01//EN" + "http://www.w3.org/TR/html4/strict.dtd"> + +<html> +<head> + <title>%(title)s</title> + <meta http-equiv="content-type" content="text/html; charset=%(encoding)s"> + <link rel="stylesheet" href="%(cssfile)s" type="text/css"> +</head> +<body> +<h2>%(title)s</h2> + +''' + +DOC_FOOTER = '''\ +</body> +</html> +''' + + +class HtmlFormatter(Formatter): + r""" + Format tokens as HTML 4 ``<span>`` tags within a ``<pre>`` tag, wrapped + in a ``<div>`` tag. The ``<div>``'s CSS class can be set by the `cssclass` + option. + + If the `linenos` option is set to ``"table"``, the ``<pre>`` is + additionally wrapped inside a ``<table>`` which has one row and two + cells: one containing the line numbers and one containing the code. + Example: + + .. sourcecode:: html + + <div class="highlight" > + <table><tr> + <td class="linenos" title="click to toggle" + onclick="with (this.firstChild.style) + { display = (display == '') ? 'none' : '' }"> + <pre>1 + 2</pre> + </td> + <td class="code"> + <pre><span class="Ke">def </span><span class="NaFu">foo</span>(bar): + <span class="Ke">pass</span> + </pre> + </td> + </tr></table></div> + + (whitespace added to improve clarity). + + Wrapping can be disabled using the `nowrap` option. + + A list of lines can be specified using the `hl_lines` option to make these + lines highlighted (as of Pygments 0.11). + + With the `full` option, a complete HTML 4 document is output, including + the style definitions inside a ``<style>`` tag, or in a separate file if + the `cssfile` option is given. + + When `tagsfile` is set to the path of a ctags index file, it is used to + generate hyperlinks from names to their definition. You must enable + `lineanchors` and run ctags with the `-n` option for this to work. The + `python-ctags` module from PyPI must be installed to use this feature; + otherwise a `RuntimeError` will be raised. + + The `get_style_defs(arg='')` method of a `HtmlFormatter` returns a string + containing CSS rules for the CSS classes used by the formatter. The + argument `arg` can be used to specify additional CSS selectors that + are prepended to the classes. A call `fmter.get_style_defs('td .code')` + would result in the following CSS classes: + + .. sourcecode:: css + + td .code .kw { font-weight: bold; color: #00FF00 } + td .code .cm { color: #999999 } + ... + + If you have Pygments 0.6 or higher, you can also pass a list or tuple to the + `get_style_defs()` method to request multiple prefixes for the tokens: + + .. sourcecode:: python + + formatter.get_style_defs(['div.syntax pre', 'pre.syntax']) + + The output would then look like this: + + .. sourcecode:: css + + div.syntax pre .kw, + pre.syntax .kw { font-weight: bold; color: #00FF00 } + div.syntax pre .cm, + pre.syntax .cm { color: #999999 } + ... + + Additional options accepted: + + `nowrap` + If set to ``True``, don't wrap the tokens at all, not even inside a ``<pre>`` + tag. This disables most other options (default: ``False``). + + `full` + Tells the formatter to output a "full" document, i.e. a complete + self-contained document (default: ``False``). + + `title` + If `full` is true, the title that should be used to caption the + document (default: ``''``). + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). This option has no effect if the `cssfile` + and `noclobber_cssfile` option are given and the file specified in + `cssfile` exists. + + `noclasses` + If set to true, token ``<span>`` tags (as well as line number elements) + will not use CSS classes, but inline styles. This is not recommended + for larger pieces of code since it increases output size by quite a bit + (default: ``False``). + + `classprefix` + Since the token types use relatively short class names, they may clash + with some of your own class names. In this case you can use the + `classprefix` option to give a string to prepend to all Pygments-generated + CSS class names for token types. + Note that this option also affects the output of `get_style_defs()`. + + `cssclass` + CSS class for the wrapping ``<div>`` tag (default: ``'highlight'``). + If you set this option, the default selector for `get_style_defs()` + will be this class. + + .. versionadded:: 0.9 + If you select the ``'table'`` line numbers, the wrapping table will + have a CSS class of this string plus ``'table'``, the default is + accordingly ``'highlighttable'``. + + `cssstyles` + Inline CSS styles for the wrapping ``<div>`` tag (default: ``''``). + + `prestyles` + Inline CSS styles for the ``<pre>`` tag (default: ``''``). + + .. versionadded:: 0.11 + + `cssfile` + If the `full` option is true and this option is given, it must be the + name of an external file. If the filename does not include an absolute + path, the file's path will be assumed to be relative to the main output + file's path, if the latter can be found. The stylesheet is then written + to this file instead of the HTML file. + + .. versionadded:: 0.6 + + `noclobber_cssfile` + If `cssfile` is given and the specified file exists, the css file will + not be overwritten. This allows the use of the `full` option in + combination with a user specified css file. Default is ``False``. + + .. versionadded:: 1.1 + + `linenos` + If set to ``'table'``, output line numbers as a table with two cells, + one containing the line numbers, the other the whole code. This is + copy-and-paste-friendly, but may cause alignment problems with some + browsers or fonts. If set to ``'inline'``, the line numbers will be + integrated in the ``<pre>`` tag that contains the code (that setting + is *new in Pygments 0.8*). + + For compatibility with Pygments 0.7 and earlier, every true value + except ``'inline'`` means the same as ``'table'`` (in particular, that + means also ``True``). + + The default value is ``False``, which means no line numbers at all. + + **Note:** with the default ("table") line number mechanism, the line + numbers and code can have different line heights in Internet Explorer + unless you give the enclosing ``<pre>`` tags an explicit ``line-height`` + CSS property (you get the default line spacing with ``line-height: + 125%``). + + `hl_lines` + Specify a list of lines to be highlighted. The line numbers are always + relative to the input (i.e. the first line is line 1) and are + independent of `linenostart`. + + .. versionadded:: 0.11 + + `linenostart` + The line number for the first line (default: ``1``). + + `linenostep` + If set to a number n > 1, only every nth line number is printed. + + `linenospecial` + If set to a number n > 0, every nth line number is given the CSS + class ``"special"`` (default: ``0``). + + `nobackground` + If set to ``True``, the formatter won't output the background color + for the wrapping element (this automatically defaults to ``False`` + when there is no wrapping element [eg: no argument for the + `get_syntax_defs` method given]) (default: ``False``). + + .. versionadded:: 0.6 + + `lineseparator` + This string is output between lines of code. It defaults to ``"\n"``, + which is enough to break a line inside ``<pre>`` tags, but you can + e.g. set it to ``"<br>"`` to get HTML line breaks. + + .. versionadded:: 0.7 + + `lineanchors` + If set to a nonempty string, e.g. ``foo``, the formatter will wrap each + output line in an anchor tag with an ``id`` (and `name`) of ``foo-linenumber``. + This allows easy linking to certain lines. + + .. versionadded:: 0.9 + + `linespans` + If set to a nonempty string, e.g. ``foo``, the formatter will wrap each + output line in a span tag with an ``id`` of ``foo-linenumber``. + This allows easy access to lines via javascript. + + .. versionadded:: 1.6 + + `anchorlinenos` + If set to `True`, will wrap line numbers in <a> tags. Used in + combination with `linenos` and `lineanchors`. + + `tagsfile` + If set to the path of a ctags file, wrap names in anchor tags that + link to their definitions. `lineanchors` should be used, and the + tags file should specify line numbers (see the `-n` option to ctags). + + .. versionadded:: 1.6 + + `tagurlformat` + A string formatting pattern used to generate links to ctags definitions. + Available variables are `%(path)s`, `%(fname)s` and `%(fext)s`. + Defaults to an empty string, resulting in just `#prefix-number` links. + + .. versionadded:: 1.6 + + `filename` + A string used to generate a filename when rendering ``<pre>`` blocks, + for example if displaying source code. If `linenos` is set to + ``'table'`` then the filename will be rendered in an initial row + containing a single `<th>` which spans both columns. + + .. versionadded:: 2.1 + + `wrapcode` + Wrap the code inside ``<pre>`` blocks using ``<code>``, as recommended + by the HTML5 specification. + + .. versionadded:: 2.4 + + + **Subclassing the HTML formatter** + + .. versionadded:: 0.7 + + The HTML formatter is now built in a way that allows easy subclassing, thus + customizing the output HTML code. The `format()` method calls + `self._format_lines()` which returns a generator that yields tuples of ``(1, + line)``, where the ``1`` indicates that the ``line`` is a line of the + formatted source code. + + If the `nowrap` option is set, the generator is the iterated over and the + resulting HTML is output. + + Otherwise, `format()` calls `self.wrap()`, which wraps the generator with + other generators. These may add some HTML code to the one generated by + `_format_lines()`, either by modifying the lines generated by the latter, + then yielding them again with ``(1, line)``, and/or by yielding other HTML + code before or after the lines, with ``(0, html)``. The distinction between + source lines and other code makes it possible to wrap the generator multiple + times. + + The default `wrap()` implementation adds a ``<div>`` and a ``<pre>`` tag. + + A custom `HtmlFormatter` subclass could look like this: + + .. sourcecode:: python + + class CodeHtmlFormatter(HtmlFormatter): + + def wrap(self, source, outfile): + return self._wrap_code(source) + + def _wrap_code(self, source): + yield 0, '<code>' + for i, t in source: + if i == 1: + # it's a line of formatted code + t += '<br>' + yield i, t + yield 0, '</code>' + + This results in wrapping the formatted lines with a ``<code>`` tag, where the + source lines are broken using ``<br>`` tags. + + After calling `wrap()`, the `format()` method also adds the "line numbers" + and/or "full document" wrappers if the respective options are set. Then, all + HTML yielded by the wrapped generator is output. + """ + + name = 'HTML' + aliases = ['html'] + filenames = ['*.html', '*.htm'] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self.title = self._decodeifneeded(self.title) + self.nowrap = get_bool_opt(options, 'nowrap', False) + self.noclasses = get_bool_opt(options, 'noclasses', False) + self.classprefix = options.get('classprefix', '') + self.cssclass = self._decodeifneeded(options.get('cssclass', 'highlight')) + self.cssstyles = self._decodeifneeded(options.get('cssstyles', '')) + self.prestyles = self._decodeifneeded(options.get('prestyles', '')) + self.cssfile = self._decodeifneeded(options.get('cssfile', '')) + self.noclobber_cssfile = get_bool_opt(options, 'noclobber_cssfile', False) + self.tagsfile = self._decodeifneeded(options.get('tagsfile', '')) + self.tagurlformat = self._decodeifneeded(options.get('tagurlformat', '')) + self.filename = self._decodeifneeded(options.get('filename', '')) + self.wrapcode = get_bool_opt(options, 'wrapcode', False) + self.span_element_openers = {} + + if self.tagsfile: + if not ctags: + raise RuntimeError('The "ctags" package must to be installed ' + 'to be able to use the "tagsfile" feature.') + self._ctags = ctags.CTags(self.tagsfile) + + linenos = options.get('linenos', False) + if linenos == 'inline': + self.linenos = 2 + elif linenos: + # compatibility with <= 0.7 + self.linenos = 1 + else: + self.linenos = 0 + self.linenostart = abs(get_int_opt(options, 'linenostart', 1)) + self.linenostep = abs(get_int_opt(options, 'linenostep', 1)) + self.linenospecial = abs(get_int_opt(options, 'linenospecial', 0)) + self.nobackground = get_bool_opt(options, 'nobackground', False) + self.lineseparator = options.get('lineseparator', '\n') + self.lineanchors = options.get('lineanchors', '') + self.linespans = options.get('linespans', '') + self.anchorlinenos = get_bool_opt(options, 'anchorlinenos', False) + self.hl_lines = set() + for lineno in get_list_opt(options, 'hl_lines', []): + try: + self.hl_lines.add(int(lineno)) + except ValueError: + pass + + self._create_stylesheet() + + def _get_css_class(self, ttype): + """Return the css class of this token type prefixed with + the classprefix option.""" + ttypeclass = _get_ttype_class(ttype) + if ttypeclass: + return self.classprefix + ttypeclass + return '' + + def _get_css_classes(self, ttype): + """Return the CSS classes of this token type prefixed with the classprefix option.""" + cls = self._get_css_class(ttype) + while ttype not in STANDARD_TYPES: + ttype = ttype.parent + cls = self._get_css_class(ttype) + ' ' + cls + return cls or '' + + def _get_css_inline_styles(self, ttype): + """Return the inline CSS styles for this token type.""" + cclass = self.ttype2class.get(ttype) + while cclass is None: + ttype = ttype.parent + cclass = self.ttype2class.get(ttype) + return cclass or '' + + def _create_stylesheet(self): + t2c = self.ttype2class = {Token: ''} + c2s = self.class2style = {} + for ttype, ndef in self.style: + name = self._get_css_class(ttype) + style = '' + if ndef['color']: + style += 'color: %s; ' % webify(ndef['color']) + if ndef['bold']: + style += 'font-weight: bold; ' + if ndef['italic']: + style += 'font-style: italic; ' + if ndef['underline']: + style += 'text-decoration: underline; ' + if ndef['bgcolor']: + style += 'background-color: %s; ' % webify(ndef['bgcolor']) + if ndef['border']: + style += 'border: 1px solid %s; ' % webify(ndef['border']) + if style: + t2c[ttype] = name + # save len(ttype) to enable ordering the styles by + # hierarchy (necessary for CSS cascading rules!) + c2s[name] = (style[:-2], ttype, len(ttype)) + + def get_style_defs(self, arg=None): + """ + Return CSS style definitions for the classes produced by the current + highlighting style. ``arg`` can be a string or list of selectors to + insert before the token type classes. + """ + style_lines = [] + + style_lines.extend(self.get_linenos_style_defs()) + style_lines.extend(self.get_background_style_defs(arg)) + style_lines.extend(self.get_token_style_defs(arg)) + + return '\n'.join(style_lines) + + def get_token_style_defs(self, arg=None): + prefix = self.get_css_prefix(arg) + + styles = [ + (level, ttype, cls, style) + for cls, (style, ttype, level) in self.class2style.items() + if cls and style + ] + styles.sort() + + lines = [ + '%s { %s } /* %s */' % (prefix(cls), style, repr(ttype)[6:]) + for (level, ttype, cls, style) in styles + ] + + return lines + + def get_background_style_defs(self, arg=None): + prefix = self.get_css_prefix(arg) + bg_color = self.style.background_color + hl_color = self.style.highlight_color + + lines = [] + + if arg and not self.nobackground and bg_color is not None: + text_style = '' + if Text in self.ttype2class: + text_style = ' ' + self.class2style[self.ttype2class[Text]][0] + lines.insert( + 0, '%s{ background: %s;%s }' % ( + prefix(''), bg_color, text_style + ) + ) + if hl_color is not None: + lines.insert( + 0, '%s { background-color: %s }' % (prefix('hll'), hl_color) + ) + + return lines + + def get_linenos_style_defs(self): + lines = [ + 'pre { %s }' % self._pre_style, + 'td.linenos .normal { %s }' % self._linenos_style, + 'span.linenos { %s }' % self._linenos_style, + 'td.linenos .special { %s }' % self._linenos_special_style, + 'span.linenos.special { %s }' % self._linenos_special_style, + ] + + return lines + + def get_css_prefix(self, arg): + if arg is None: + arg = ('cssclass' in self.options and '.'+self.cssclass or '') + if isinstance(arg, str): + args = [arg] + else: + args = list(arg) + + def prefix(cls): + if cls: + cls = '.' + cls + tmp = [] + for arg in args: + tmp.append((arg and arg + ' ' or '') + cls) + return ', '.join(tmp) + + return prefix + + @property + def _pre_style(self): + return 'line-height: 125%;' + + @property + def _linenos_style(self): + return 'color: %s; background-color: %s; padding-left: 5px; padding-right: 5px;' % ( + self.style.line_number_color, + self.style.line_number_background_color + ) + + @property + def _linenos_special_style(self): + return 'color: %s; background-color: %s; padding-left: 5px; padding-right: 5px;' % ( + self.style.line_number_special_color, + self.style.line_number_special_background_color + ) + + def _decodeifneeded(self, value): + if isinstance(value, bytes): + if self.encoding: + return value.decode(self.encoding) + return value.decode() + return value + + def _wrap_full(self, inner, outfile): + if self.cssfile: + if os.path.isabs(self.cssfile): + # it's an absolute filename + cssfilename = self.cssfile + else: + try: + filename = outfile.name + if not filename or filename[0] == '<': + # pseudo files, e.g. name == '<fdopen>' + raise AttributeError + cssfilename = os.path.join(os.path.dirname(filename), + self.cssfile) + except AttributeError: + print('Note: Cannot determine output file name, ' + 'using current directory as base for the CSS file name', + file=sys.stderr) + cssfilename = self.cssfile + # write CSS file only if noclobber_cssfile isn't given as an option. + try: + if not os.path.exists(cssfilename) or not self.noclobber_cssfile: + with open(cssfilename, "w") as cf: + cf.write(CSSFILE_TEMPLATE % + {'styledefs': self.get_style_defs('body')}) + except OSError as err: + err.strerror = 'Error writing CSS file: ' + err.strerror + raise + + yield 0, (DOC_HEADER_EXTERNALCSS % + dict(title=self.title, + cssfile=self.cssfile, + encoding=self.encoding)) + else: + yield 0, (DOC_HEADER % + dict(title=self.title, + styledefs=self.get_style_defs('body'), + encoding=self.encoding)) + + yield from inner + yield 0, DOC_FOOTER + + def _wrap_tablelinenos(self, inner): + dummyoutfile = StringIO() + lncount = 0 + for t, line in inner: + if t: + lncount += 1 + dummyoutfile.write(line) + + fl = self.linenostart + mw = len(str(lncount + fl - 1)) + sp = self.linenospecial + st = self.linenostep + la = self.lineanchors + aln = self.anchorlinenos + nocls = self.noclasses + + lines = [] + + for i in range(fl, fl+lncount): + print_line = i % st == 0 + special_line = sp and i % sp == 0 + + if print_line: + line = '%*d' % (mw, i) + if aln: + line = '<a href="#%s-%d">%s</a>' % (la, i, line) + else: + line = ' ' * mw + + if nocls: + if special_line: + style = ' style="%s"' % self._linenos_special_style + else: + style = ' style="%s"' % self._linenos_style + else: + if special_line: + style = ' class="special"' + else: + style = ' class="normal"' + + if style: + line = '<span%s>%s</span>' % (style, line) + + lines.append(line) + + ls = '\n'.join(lines) + + # If a filename was specified, we can't put it into the code table as it + # would misalign the line numbers. Hence we emit a separate row for it. + filename_tr = "" + if self.filename: + filename_tr = ( + '<tr><th colspan="2" class="filename"><div class="highlight">' + '<span class="filename">' + self.filename + '</span></div>' + '</th></tr>') + + # in case you wonder about the seemingly redundant <div> here: since the + # content in the other cell also is wrapped in a div, some browsers in + # some configurations seem to mess up the formatting... + yield 0, ( + '<table class="%stable">' % self.cssclass + filename_tr + + '<tr><td class="linenos"><div class="linenodiv"><pre>' + + ls + '</pre></div></td><td class="code">' + ) + yield 0, dummyoutfile.getvalue() + yield 0, '</td></tr></table>' + + def _wrap_inlinelinenos(self, inner): + # need a list of lines since we need the width of a single number :( + inner_lines = list(inner) + sp = self.linenospecial + st = self.linenostep + num = self.linenostart + mw = len(str(len(inner_lines) + num - 1)) + la = self.lineanchors + aln = self.anchorlinenos + nocls = self.noclasses + + for _, inner_line in inner_lines: + print_line = num % st == 0 + special_line = sp and num % sp == 0 + + if print_line: + line = '%*d' % (mw, num) + else: + line = ' ' * mw + + if nocls: + if special_line: + style = ' style="%s"' % self._linenos_special_style + else: + style = ' style="%s"' % self._linenos_style + else: + if special_line: + style = ' class="linenos special"' + else: + style = ' class="linenos"' + + if style: + linenos = '<span%s>%s</span>' % (style, line) + else: + linenos = line + + if aln: + yield 1, ('<a href="#%s-%d">%s</a>' % (la, num, linenos) + + inner_line) + else: + yield 1, linenos + inner_line + num += 1 + + def _wrap_lineanchors(self, inner): + s = self.lineanchors + # subtract 1 since we have to increment i *before* yielding + i = self.linenostart - 1 + for t, line in inner: + if t: + i += 1 + yield 1, '<a id="%s-%d" name="%s-%d"></a>' % (s, i, s, i) + line + else: + yield 0, line + + def _wrap_linespans(self, inner): + s = self.linespans + i = self.linenostart - 1 + for t, line in inner: + if t: + i += 1 + yield 1, '<span id="%s-%d">%s</span>' % (s, i, line) + else: + yield 0, line + + def _wrap_div(self, inner): + style = [] + if (self.noclasses and not self.nobackground and + self.style.background_color is not None): + style.append('background: %s' % (self.style.background_color,)) + if self.cssstyles: + style.append(self.cssstyles) + style = '; '.join(style) + + yield 0, ('<div' + (self.cssclass and ' class="%s"' % self.cssclass) + + (style and (' style="%s"' % style)) + '>') + yield from inner + yield 0, '</div>\n' + + def _wrap_pre(self, inner): + style = [] + if self.prestyles: + style.append(self.prestyles) + if self.noclasses: + style.append(self._pre_style) + style = '; '.join(style) + + if self.filename and self.linenos != 1: + yield 0, ('<span class="filename">' + self.filename + '</span>') + + # the empty span here is to keep leading empty lines from being + # ignored by HTML parsers + yield 0, ('<pre' + (style and ' style="%s"' % style) + '><span></span>') + yield from inner + yield 0, '</pre>' + + def _wrap_code(self, inner): + yield 0, '<code>' + yield from inner + yield 0, '</code>' + + @functools.lru_cache(maxsize=100) + def _translate_parts(self, value): + """HTML-escape a value and split it by newlines.""" + return value.translate(_escape_html_table).split('\n') + + def _format_lines(self, tokensource): + """ + Just format the tokens, without any wrapping tags. + Yield individual lines. + """ + nocls = self.noclasses + lsep = self.lineseparator + tagsfile = self.tagsfile + + lspan = '' + line = [] + for ttype, value in tokensource: + try: + cspan = self.span_element_openers[ttype] + except KeyError: + if nocls: + css_style = self._get_css_inline_styles(ttype) + cspan = css_style and '<span style="%s">' % self.class2style[css_style][0] or '' + else: + css_class = self._get_css_classes(ttype) + cspan = css_class and '<span class="%s">' % css_class or '' + self.span_element_openers[ttype] = cspan + + parts = self._translate_parts(value) + + if tagsfile and ttype in Token.Name: + filename, linenumber = self._lookup_ctag(value) + if linenumber: + base, filename = os.path.split(filename) + if base: + base += '/' + filename, extension = os.path.splitext(filename) + url = self.tagurlformat % {'path': base, 'fname': filename, + 'fext': extension} + parts[0] = "<a href=\"%s#%s-%d\">%s" % \ + (url, self.lineanchors, linenumber, parts[0]) + parts[-1] = parts[-1] + "</a>" + + # for all but the last line + for part in parts[:-1]: + if line: + if lspan != cspan: + line.extend(((lspan and '</span>'), cspan, part, + (cspan and '</span>'), lsep)) + else: # both are the same + line.extend((part, (lspan and '</span>'), lsep)) + yield 1, ''.join(line) + line = [] + elif part: + yield 1, ''.join((cspan, part, (cspan and '</span>'), lsep)) + else: + yield 1, lsep + # for the last line + if line and parts[-1]: + if lspan != cspan: + line.extend(((lspan and '</span>'), cspan, parts[-1])) + lspan = cspan + else: + line.append(parts[-1]) + elif parts[-1]: + line = [cspan, parts[-1]] + lspan = cspan + # else we neither have to open a new span nor set lspan + + if line: + line.extend(((lspan and '</span>'), lsep)) + yield 1, ''.join(line) + + def _lookup_ctag(self, token): + entry = ctags.TagEntry() + if self._ctags.find(entry, token.encode(), 0): + return entry['file'], entry['lineNumber'] + else: + return None, None + + def _highlight_lines(self, tokensource): + """ + Highlighted the lines specified in the `hl_lines` option by + post-processing the token stream coming from `_format_lines`. + """ + hls = self.hl_lines + + for i, (t, value) in enumerate(tokensource): + if t != 1: + yield t, value + if i + 1 in hls: # i + 1 because Python indexes start at 0 + if self.noclasses: + style = '' + if self.style.highlight_color is not None: + style = (' style="background-color: %s"' % + (self.style.highlight_color,)) + yield 1, '<span%s>%s</span>' % (style, value) + else: + yield 1, '<span class="hll">%s</span>' % value + else: + yield 1, value + + def wrap(self, source, outfile): + """ + Wrap the ``source``, which is a generator yielding + individual lines, in custom generators. See docstring + for `format`. Can be overridden. + """ + if self.wrapcode: + return self._wrap_div(self._wrap_pre(self._wrap_code(source))) + else: + return self._wrap_div(self._wrap_pre(source)) + + def format_unencoded(self, tokensource, outfile): + """ + The formatting process uses several nested generators; which of + them are used is determined by the user's options. + + Each generator should take at least one argument, ``inner``, + and wrap the pieces of text generated by this. + + Always yield 2-tuples: (code, text). If "code" is 1, the text + is part of the original tokensource being highlighted, if it's + 0, the text is some piece of wrapping. This makes it possible to + use several different wrappers that process the original source + linewise, e.g. line number generators. + """ + source = self._format_lines(tokensource) + + # As a special case, we wrap line numbers before line highlighting + # so the line numbers get wrapped in the highlighting tag. + if not self.nowrap and self.linenos == 2: + source = self._wrap_inlinelinenos(source) + + if self.hl_lines: + source = self._highlight_lines(source) + + if not self.nowrap: + if self.lineanchors: + source = self._wrap_lineanchors(source) + if self.linespans: + source = self._wrap_linespans(source) + source = self.wrap(source, outfile) + if self.linenos == 1: + source = self._wrap_tablelinenos(source) + if self.full: + source = self._wrap_full(source, outfile) + + for t, piece in source: + outfile.write(piece) diff --git a/src/pip/_vendor/pygments/formatters/img.py b/src/pip/_vendor/pygments/formatters/img.py new file mode 100644 index 000000000..978559237 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/img.py @@ -0,0 +1,641 @@ +""" + pygments.formatters.img + ~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for Pixmap output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import os +import sys + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.util import get_bool_opt, get_int_opt, get_list_opt, \ + get_choice_opt + +import subprocess + +# Import this carefully +try: + from PIL import Image, ImageDraw, ImageFont + pil_available = True +except ImportError: + pil_available = False + +try: + import _winreg +except ImportError: + try: + import winreg as _winreg + except ImportError: + _winreg = None + +__all__ = ['ImageFormatter', 'GifImageFormatter', 'JpgImageFormatter', + 'BmpImageFormatter'] + + +# For some unknown reason every font calls it something different +STYLES = { + 'NORMAL': ['', 'Roman', 'Book', 'Normal', 'Regular', 'Medium'], + 'ITALIC': ['Oblique', 'Italic'], + 'BOLD': ['Bold'], + 'BOLDITALIC': ['Bold Oblique', 'Bold Italic'], +} + +# A sane default for modern systems +DEFAULT_FONT_NAME_NIX = 'DejaVu Sans Mono' +DEFAULT_FONT_NAME_WIN = 'Courier New' +DEFAULT_FONT_NAME_MAC = 'Menlo' + + +class PilNotAvailable(ImportError): + """When Python imaging library is not available""" + + +class FontNotFound(Exception): + """When there are no usable fonts specified""" + + +class FontManager: + """ + Manages a set of fonts: normal, italic, bold, etc... + """ + + def __init__(self, font_name, font_size=14): + self.font_name = font_name + self.font_size = font_size + self.fonts = {} + self.encoding = None + if sys.platform.startswith('win'): + if not font_name: + self.font_name = DEFAULT_FONT_NAME_WIN + self._create_win() + elif sys.platform.startswith('darwin'): + if not font_name: + self.font_name = DEFAULT_FONT_NAME_MAC + self._create_mac() + else: + if not font_name: + self.font_name = DEFAULT_FONT_NAME_NIX + self._create_nix() + + def _get_nix_font_path(self, name, style): + proc = subprocess.Popen(['fc-list', "%s:style=%s" % (name, style), 'file'], + stdout=subprocess.PIPE, stderr=None) + stdout, _ = proc.communicate() + if proc.returncode == 0: + lines = stdout.splitlines() + for line in lines: + if line.startswith(b'Fontconfig warning:'): + continue + path = line.decode().strip().strip(':') + if path: + return path + return None + + def _create_nix(self): + for name in STYLES['NORMAL']: + path = self._get_nix_font_path(self.font_name, name) + if path is not None: + self.fonts['NORMAL'] = ImageFont.truetype(path, self.font_size) + break + else: + raise FontNotFound('No usable fonts named: "%s"' % + self.font_name) + for style in ('ITALIC', 'BOLD', 'BOLDITALIC'): + for stylename in STYLES[style]: + path = self._get_nix_font_path(self.font_name, stylename) + if path is not None: + self.fonts[style] = ImageFont.truetype(path, self.font_size) + break + else: + if style == 'BOLDITALIC': + self.fonts[style] = self.fonts['BOLD'] + else: + self.fonts[style] = self.fonts['NORMAL'] + + def _get_mac_font_path(self, font_map, name, style): + return font_map.get((name + ' ' + style).strip().lower()) + + def _create_mac(self): + font_map = {} + for font_dir in (os.path.join(os.getenv("HOME"), 'Library/Fonts/'), + '/Library/Fonts/', '/System/Library/Fonts/'): + font_map.update( + (os.path.splitext(f)[0].lower(), os.path.join(font_dir, f)) + for f in os.listdir(font_dir) + if f.lower().endswith(('ttf', 'ttc'))) + + for name in STYLES['NORMAL']: + path = self._get_mac_font_path(font_map, self.font_name, name) + if path is not None: + self.fonts['NORMAL'] = ImageFont.truetype(path, self.font_size) + break + else: + raise FontNotFound('No usable fonts named: "%s"' % + self.font_name) + for style in ('ITALIC', 'BOLD', 'BOLDITALIC'): + for stylename in STYLES[style]: + path = self._get_mac_font_path(font_map, self.font_name, stylename) + if path is not None: + self.fonts[style] = ImageFont.truetype(path, self.font_size) + break + else: + if style == 'BOLDITALIC': + self.fonts[style] = self.fonts['BOLD'] + else: + self.fonts[style] = self.fonts['NORMAL'] + + def _lookup_win(self, key, basename, styles, fail=False): + for suffix in ('', ' (TrueType)'): + for style in styles: + try: + valname = '%s%s%s' % (basename, style and ' '+style, suffix) + val, _ = _winreg.QueryValueEx(key, valname) + return val + except OSError: + continue + else: + if fail: + raise FontNotFound('Font %s (%s) not found in registry' % + (basename, styles[0])) + return None + + def _create_win(self): + lookuperror = None + keynames = [ (_winreg.HKEY_CURRENT_USER, r'Software\Microsoft\Windows NT\CurrentVersion\Fonts'), + (_winreg.HKEY_CURRENT_USER, r'Software\Microsoft\Windows\CurrentVersion\Fonts'), + (_winreg.HKEY_LOCAL_MACHINE, r'Software\Microsoft\Windows NT\CurrentVersion\Fonts'), + (_winreg.HKEY_LOCAL_MACHINE, r'Software\Microsoft\Windows\CurrentVersion\Fonts') ] + for keyname in keynames: + try: + key = _winreg.OpenKey(*keyname) + try: + path = self._lookup_win(key, self.font_name, STYLES['NORMAL'], True) + self.fonts['NORMAL'] = ImageFont.truetype(path, self.font_size) + for style in ('ITALIC', 'BOLD', 'BOLDITALIC'): + path = self._lookup_win(key, self.font_name, STYLES[style]) + if path: + self.fonts[style] = ImageFont.truetype(path, self.font_size) + else: + if style == 'BOLDITALIC': + self.fonts[style] = self.fonts['BOLD'] + else: + self.fonts[style] = self.fonts['NORMAL'] + return + except FontNotFound as err: + lookuperror = err + finally: + _winreg.CloseKey(key) + except OSError: + pass + else: + # If we get here, we checked all registry keys and had no luck + # We can be in one of two situations now: + # * All key lookups failed. In this case lookuperror is None and we + # will raise a generic error + # * At least one lookup failed with a FontNotFound error. In this + # case, we will raise that as a more specific error + if lookuperror: + raise lookuperror + raise FontNotFound('Can\'t open Windows font registry key') + + def get_char_size(self): + """ + Get the character size. + """ + return self.fonts['NORMAL'].getsize('M') + + def get_text_size(self, text): + """ + Get the text size(width, height). + """ + return self.fonts['NORMAL'].getsize(text) + + def get_font(self, bold, oblique): + """ + Get the font based on bold and italic flags. + """ + if bold and oblique: + return self.fonts['BOLDITALIC'] + elif bold: + return self.fonts['BOLD'] + elif oblique: + return self.fonts['ITALIC'] + else: + return self.fonts['NORMAL'] + + +class ImageFormatter(Formatter): + """ + Create a PNG image from source code. This uses the Python Imaging Library to + generate a pixmap from the source code. + + .. versionadded:: 0.10 + + Additional options accepted: + + `image_format` + An image format to output to that is recognised by PIL, these include: + + * "PNG" (default) + * "JPEG" + * "BMP" + * "GIF" + + `line_pad` + The extra spacing (in pixels) between each line of text. + + Default: 2 + + `font_name` + The font name to be used as the base font from which others, such as + bold and italic fonts will be generated. This really should be a + monospace font to look sane. + + Default: "Courier New" on Windows, "Menlo" on Mac OS, and + "DejaVu Sans Mono" on \\*nix + + `font_size` + The font size in points to be used. + + Default: 14 + + `image_pad` + The padding, in pixels to be used at each edge of the resulting image. + + Default: 10 + + `line_numbers` + Whether line numbers should be shown: True/False + + Default: True + + `line_number_start` + The line number of the first line. + + Default: 1 + + `line_number_step` + The step used when printing line numbers. + + Default: 1 + + `line_number_bg` + The background colour (in "#123456" format) of the line number bar, or + None to use the style background color. + + Default: "#eed" + + `line_number_fg` + The text color of the line numbers (in "#123456"-like format). + + Default: "#886" + + `line_number_chars` + The number of columns of line numbers allowable in the line number + margin. + + Default: 2 + + `line_number_bold` + Whether line numbers will be bold: True/False + + Default: False + + `line_number_italic` + Whether line numbers will be italicized: True/False + + Default: False + + `line_number_separator` + Whether a line will be drawn between the line number area and the + source code area: True/False + + Default: True + + `line_number_pad` + The horizontal padding (in pixels) between the line number margin, and + the source code area. + + Default: 6 + + `hl_lines` + Specify a list of lines to be highlighted. + + .. versionadded:: 1.2 + + Default: empty list + + `hl_color` + Specify the color for highlighting lines. + + .. versionadded:: 1.2 + + Default: highlight color of the selected style + """ + + # Required by the pygments mapper + name = 'img' + aliases = ['img', 'IMG', 'png'] + filenames = ['*.png'] + + unicodeoutput = False + + default_image_format = 'png' + + def __init__(self, **options): + """ + See the class docstring for explanation of options. + """ + if not pil_available: + raise PilNotAvailable( + 'Python Imaging Library is required for this formatter') + Formatter.__init__(self, **options) + self.encoding = 'latin1' # let pygments.format() do the right thing + # Read the style + self.styles = dict(self.style) + if self.style.background_color is None: + self.background_color = '#fff' + else: + self.background_color = self.style.background_color + # Image options + self.image_format = get_choice_opt( + options, 'image_format', ['png', 'jpeg', 'gif', 'bmp'], + self.default_image_format, normcase=True) + self.image_pad = get_int_opt(options, 'image_pad', 10) + self.line_pad = get_int_opt(options, 'line_pad', 2) + # The fonts + fontsize = get_int_opt(options, 'font_size', 14) + self.fonts = FontManager(options.get('font_name', ''), fontsize) + self.fontw, self.fonth = self.fonts.get_char_size() + # Line number options + self.line_number_fg = options.get('line_number_fg', '#886') + self.line_number_bg = options.get('line_number_bg', '#eed') + self.line_number_chars = get_int_opt(options, + 'line_number_chars', 2) + self.line_number_bold = get_bool_opt(options, + 'line_number_bold', False) + self.line_number_italic = get_bool_opt(options, + 'line_number_italic', False) + self.line_number_pad = get_int_opt(options, 'line_number_pad', 6) + self.line_numbers = get_bool_opt(options, 'line_numbers', True) + self.line_number_separator = get_bool_opt(options, + 'line_number_separator', True) + self.line_number_step = get_int_opt(options, 'line_number_step', 1) + self.line_number_start = get_int_opt(options, 'line_number_start', 1) + if self.line_numbers: + self.line_number_width = (self.fontw * self.line_number_chars + + self.line_number_pad * 2) + else: + self.line_number_width = 0 + self.hl_lines = [] + hl_lines_str = get_list_opt(options, 'hl_lines', []) + for line in hl_lines_str: + try: + self.hl_lines.append(int(line)) + except ValueError: + pass + self.hl_color = options.get('hl_color', + self.style.highlight_color) or '#f90' + self.drawables = [] + + def get_style_defs(self, arg=''): + raise NotImplementedError('The -S option is meaningless for the image ' + 'formatter. Use -O style=<stylename> instead.') + + def _get_line_height(self): + """ + Get the height of a line. + """ + return self.fonth + self.line_pad + + def _get_line_y(self, lineno): + """ + Get the Y coordinate of a line number. + """ + return lineno * self._get_line_height() + self.image_pad + + def _get_char_width(self): + """ + Get the width of a character. + """ + return self.fontw + + def _get_char_x(self, linelength): + """ + Get the X coordinate of a character position. + """ + return linelength + self.image_pad + self.line_number_width + + def _get_text_pos(self, linelength, lineno): + """ + Get the actual position for a character and line position. + """ + return self._get_char_x(linelength), self._get_line_y(lineno) + + def _get_linenumber_pos(self, lineno): + """ + Get the actual position for the start of a line number. + """ + return (self.image_pad, self._get_line_y(lineno)) + + def _get_text_color(self, style): + """ + Get the correct color for the token from the style. + """ + if style['color'] is not None: + fill = '#' + style['color'] + else: + fill = '#000' + return fill + + def _get_text_bg_color(self, style): + """ + Get the correct background color for the token from the style. + """ + if style['bgcolor'] is not None: + bg_color = '#' + style['bgcolor'] + else: + bg_color = None + return bg_color + + def _get_style_font(self, style): + """ + Get the correct font for the style. + """ + return self.fonts.get_font(style['bold'], style['italic']) + + def _get_image_size(self, maxlinelength, maxlineno): + """ + Get the required image size. + """ + return (self._get_char_x(maxlinelength) + self.image_pad, + self._get_line_y(maxlineno + 0) + self.image_pad) + + def _draw_linenumber(self, posno, lineno): + """ + Remember a line number drawable to paint later. + """ + self._draw_text( + self._get_linenumber_pos(posno), + str(lineno).rjust(self.line_number_chars), + font=self.fonts.get_font(self.line_number_bold, + self.line_number_italic), + text_fg=self.line_number_fg, + text_bg=None, + ) + + def _draw_text(self, pos, text, font, text_fg, text_bg): + """ + Remember a single drawable tuple to paint later. + """ + self.drawables.append((pos, text, font, text_fg, text_bg)) + + def _create_drawables(self, tokensource): + """ + Create drawables for the token content. + """ + lineno = charno = maxcharno = 0 + maxlinelength = linelength = 0 + for ttype, value in tokensource: + while ttype not in self.styles: + ttype = ttype.parent + style = self.styles[ttype] + # TODO: make sure tab expansion happens earlier in the chain. It + # really ought to be done on the input, as to do it right here is + # quite complex. + value = value.expandtabs(4) + lines = value.splitlines(True) + # print lines + for i, line in enumerate(lines): + temp = line.rstrip('\n') + if temp: + self._draw_text( + self._get_text_pos(linelength, lineno), + temp, + font = self._get_style_font(style), + text_fg = self._get_text_color(style), + text_bg = self._get_text_bg_color(style), + ) + temp_width, temp_hight = self.fonts.get_text_size(temp) + linelength += temp_width + maxlinelength = max(maxlinelength, linelength) + charno += len(temp) + maxcharno = max(maxcharno, charno) + if line.endswith('\n'): + # add a line for each extra line in the value + linelength = 0 + charno = 0 + lineno += 1 + self.maxlinelength = maxlinelength + self.maxcharno = maxcharno + self.maxlineno = lineno + + def _draw_line_numbers(self): + """ + Create drawables for the line numbers. + """ + if not self.line_numbers: + return + for p in range(self.maxlineno): + n = p + self.line_number_start + if (n % self.line_number_step) == 0: + self._draw_linenumber(p, n) + + def _paint_line_number_bg(self, im): + """ + Paint the line number background on the image. + """ + if not self.line_numbers: + return + if self.line_number_fg is None: + return + draw = ImageDraw.Draw(im) + recth = im.size[-1] + rectw = self.image_pad + self.line_number_width - self.line_number_pad + draw.rectangle([(0, 0), (rectw, recth)], + fill=self.line_number_bg) + if self.line_number_separator: + draw.line([(rectw, 0), (rectw, recth)], fill=self.line_number_fg) + del draw + + def format(self, tokensource, outfile): + """ + Format ``tokensource``, an iterable of ``(tokentype, tokenstring)`` + tuples and write it into ``outfile``. + + This implementation calculates where it should draw each token on the + pixmap, then calculates the required pixmap size and draws the items. + """ + self._create_drawables(tokensource) + self._draw_line_numbers() + im = Image.new( + 'RGB', + self._get_image_size(self.maxlinelength, self.maxlineno), + self.background_color + ) + self._paint_line_number_bg(im) + draw = ImageDraw.Draw(im) + # Highlight + if self.hl_lines: + x = self.image_pad + self.line_number_width - self.line_number_pad + 1 + recth = self._get_line_height() + rectw = im.size[0] - x + for linenumber in self.hl_lines: + y = self._get_line_y(linenumber - 1) + draw.rectangle([(x, y), (x + rectw, y + recth)], + fill=self.hl_color) + for pos, value, font, text_fg, text_bg in self.drawables: + if text_bg: + text_size = draw.textsize(text=value, font=font) + draw.rectangle([pos[0], pos[1], pos[0] + text_size[0], pos[1] + text_size[1]], fill=text_bg) + draw.text(pos, value, font=font, fill=text_fg) + im.save(outfile, self.image_format.upper()) + + +# Add one formatter per format, so that the "-f gif" option gives the correct result +# when used in pygmentize. + +class GifImageFormatter(ImageFormatter): + """ + Create a GIF image from source code. This uses the Python Imaging Library to + generate a pixmap from the source code. + + .. versionadded:: 1.0 + """ + + name = 'img_gif' + aliases = ['gif'] + filenames = ['*.gif'] + default_image_format = 'gif' + + +class JpgImageFormatter(ImageFormatter): + """ + Create a JPEG image from source code. This uses the Python Imaging Library to + generate a pixmap from the source code. + + .. versionadded:: 1.0 + """ + + name = 'img_jpg' + aliases = ['jpg', 'jpeg'] + filenames = ['*.jpg'] + default_image_format = 'jpeg' + + +class BmpImageFormatter(ImageFormatter): + """ + Create a bitmap image from source code. This uses the Python Imaging Library to + generate a pixmap from the source code. + + .. versionadded:: 1.0 + """ + + name = 'img_bmp' + aliases = ['bmp', 'bitmap'] + filenames = ['*.bmp'] + default_image_format = 'bmp' diff --git a/src/pip/_vendor/pygments/formatters/irc.py b/src/pip/_vendor/pygments/formatters/irc.py new file mode 100644 index 000000000..53cc58f99 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/irc.py @@ -0,0 +1,181 @@ +""" + pygments.formatters.irc + ~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for IRC output + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import sys + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.token import Keyword, Name, Comment, String, Error, \ + Number, Operator, Generic, Token, Whitespace +from pip._vendor.pygments.util import get_choice_opt + + +__all__ = ['IRCFormatter'] + + +#: Map token types to a tuple of color values for light and dark +#: backgrounds. +IRC_COLORS = { + Token: ('', ''), + + Whitespace: ('gray', 'brightblack'), + Comment: ('gray', 'brightblack'), + Comment.Preproc: ('cyan', 'brightcyan'), + Keyword: ('blue', 'brightblue'), + Keyword.Type: ('cyan', 'brightcyan'), + Operator.Word: ('magenta', 'brightcyan'), + Name.Builtin: ('cyan', 'brightcyan'), + Name.Function: ('green', 'brightgreen'), + Name.Namespace: ('_cyan_', '_brightcyan_'), + Name.Class: ('_green_', '_brightgreen_'), + Name.Exception: ('cyan', 'brightcyan'), + Name.Decorator: ('brightblack', 'gray'), + Name.Variable: ('red', 'brightred'), + Name.Constant: ('red', 'brightred'), + Name.Attribute: ('cyan', 'brightcyan'), + Name.Tag: ('brightblue', 'brightblue'), + String: ('yellow', 'yellow'), + Number: ('blue', 'brightblue'), + + Generic.Deleted: ('brightred', 'brightred'), + Generic.Inserted: ('green', 'brightgreen'), + Generic.Heading: ('**', '**'), + Generic.Subheading: ('*magenta*', '*brightmagenta*'), + Generic.Error: ('brightred', 'brightred'), + + Error: ('_brightred_', '_brightred_'), +} + + +IRC_COLOR_MAP = { + 'white': 0, + 'black': 1, + 'blue': 2, + 'brightgreen': 3, + 'brightred': 4, + 'yellow': 5, + 'magenta': 6, + 'orange': 7, + 'green': 7, #compat w/ ansi + 'brightyellow': 8, + 'lightgreen': 9, + 'brightcyan': 9, # compat w/ ansi + 'cyan': 10, + 'lightblue': 11, + 'red': 11, # compat w/ ansi + 'brightblue': 12, + 'brightmagenta': 13, + 'brightblack': 14, + 'gray': 15, +} + +def ircformat(color, text): + if len(color) < 1: + return text + add = sub = '' + if '_' in color: # italic + add += '\x1D' + sub = '\x1D' + sub + color = color.strip('_') + if '*' in color: # bold + add += '\x02' + sub = '\x02' + sub + color = color.strip('*') + # underline (\x1F) not supported + # backgrounds (\x03FF,BB) not supported + if len(color) > 0: # actual color - may have issues with ircformat("red", "blah")+"10" type stuff + add += '\x03' + str(IRC_COLOR_MAP[color]).zfill(2) + sub = '\x03' + sub + return add + text + sub + return '<'+add+'>'+text+'</'+sub+'>' + + +class IRCFormatter(Formatter): + r""" + Format tokens with IRC color sequences + + The `get_style_defs()` method doesn't do anything special since there is + no support for common styles. + + Options accepted: + + `bg` + Set to ``"light"`` or ``"dark"`` depending on the terminal's background + (default: ``"light"``). + + `colorscheme` + A dictionary mapping token types to (lightbg, darkbg) color names or + ``None`` (default: ``None`` = use builtin colorscheme). + + `linenos` + Set to ``True`` to have line numbers in the output as well + (default: ``False`` = no line numbers). + """ + name = 'IRC' + aliases = ['irc', 'IRC'] + filenames = [] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self.darkbg = get_choice_opt(options, 'bg', + ['light', 'dark'], 'light') == 'dark' + self.colorscheme = options.get('colorscheme', None) or IRC_COLORS + self.linenos = options.get('linenos', False) + self._lineno = 0 + + def _write_lineno(self, outfile): + self._lineno += 1 + outfile.write("\n%04d: " % self._lineno) + + def _format_unencoded_with_lineno(self, tokensource, outfile): + self._write_lineno(outfile) + + for ttype, value in tokensource: + if value.endswith("\n"): + self._write_lineno(outfile) + value = value[:-1] + color = self.colorscheme.get(ttype) + while color is None: + ttype = ttype[:-1] + color = self.colorscheme.get(ttype) + if color: + color = color[self.darkbg] + spl = value.split('\n') + for line in spl[:-1]: + self._write_lineno(outfile) + if line: + outfile.write(ircformat(color, line[:-1])) + if spl[-1]: + outfile.write(ircformat(color, spl[-1])) + else: + outfile.write(value) + + outfile.write("\n") + + def format_unencoded(self, tokensource, outfile): + if self.linenos: + self._format_unencoded_with_lineno(tokensource, outfile) + return + + for ttype, value in tokensource: + color = self.colorscheme.get(ttype) + while color is None: + ttype = ttype[:-1] + color = self.colorscheme.get(ttype) + if color: + color = color[self.darkbg] + spl = value.split('\n') + for line in spl[:-1]: + if line: + outfile.write(ircformat(color, line)) + outfile.write('\n') + if spl[-1]: + outfile.write(ircformat(color, spl[-1])) + else: + outfile.write(value) diff --git a/src/pip/_vendor/pygments/formatters/latex.py b/src/pip/_vendor/pygments/formatters/latex.py new file mode 100644 index 000000000..60e98921f --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/latex.py @@ -0,0 +1,511 @@ +""" + pygments.formatters.latex + ~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for LaTeX fancyvrb output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from io import StringIO + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.lexer import Lexer, do_insertions +from pip._vendor.pygments.token import Token, STANDARD_TYPES +from pip._vendor.pygments.util import get_bool_opt, get_int_opt + + +__all__ = ['LatexFormatter'] + + +def escape_tex(text, commandprefix): + return text.replace('\\', '\x00'). \ + replace('{', '\x01'). \ + replace('}', '\x02'). \ + replace('\x00', r'\%sZbs{}' % commandprefix). \ + replace('\x01', r'\%sZob{}' % commandprefix). \ + replace('\x02', r'\%sZcb{}' % commandprefix). \ + replace('^', r'\%sZca{}' % commandprefix). \ + replace('_', r'\%sZus{}' % commandprefix). \ + replace('&', r'\%sZam{}' % commandprefix). \ + replace('<', r'\%sZlt{}' % commandprefix). \ + replace('>', r'\%sZgt{}' % commandprefix). \ + replace('#', r'\%sZsh{}' % commandprefix). \ + replace('%', r'\%sZpc{}' % commandprefix). \ + replace('$', r'\%sZdl{}' % commandprefix). \ + replace('-', r'\%sZhy{}' % commandprefix). \ + replace("'", r'\%sZsq{}' % commandprefix). \ + replace('"', r'\%sZdq{}' % commandprefix). \ + replace('~', r'\%sZti{}' % commandprefix) + + +DOC_TEMPLATE = r''' +\documentclass{%(docclass)s} +\usepackage{fancyvrb} +\usepackage{color} +\usepackage[%(encoding)s]{inputenc} +%(preamble)s + +%(styledefs)s + +\begin{document} + +\section*{%(title)s} + +%(code)s +\end{document} +''' + +## Small explanation of the mess below :) +# +# The previous version of the LaTeX formatter just assigned a command to +# each token type defined in the current style. That obviously is +# problematic if the highlighted code is produced for a different style +# than the style commands themselves. +# +# This version works much like the HTML formatter which assigns multiple +# CSS classes to each <span> tag, from the most specific to the least +# specific token type, thus falling back to the parent token type if one +# is not defined. Here, the classes are there too and use the same short +# forms given in token.STANDARD_TYPES. +# +# Highlighted code now only uses one custom command, which by default is +# \PY and selectable by the commandprefix option (and in addition the +# escapes \PYZat, \PYZlb and \PYZrb which haven't been renamed for +# backwards compatibility purposes). +# +# \PY has two arguments: the classes, separated by +, and the text to +# render in that style. The classes are resolved into the respective +# style commands by magic, which serves to ignore unknown classes. +# +# The magic macros are: +# * \PY@it, \PY@bf, etc. are unconditionally wrapped around the text +# to render in \PY@do. Their definition determines the style. +# * \PY@reset resets \PY@it etc. to do nothing. +# * \PY@toks parses the list of classes, using magic inspired by the +# keyval package (but modified to use plusses instead of commas +# because fancyvrb redefines commas inside its environments). +# * \PY@tok processes one class, calling the \PY@tok@classname command +# if it exists. +# * \PY@tok@classname sets the \PY@it etc. to reflect the chosen style +# for its class. +# * \PY resets the style, parses the classnames and then calls \PY@do. +# +# Tip: to read this code, print it out in substituted form using e.g. +# >>> print STYLE_TEMPLATE % {'cp': 'PY'} + +STYLE_TEMPLATE = r''' +\makeatletter +\def\%(cp)s@reset{\let\%(cp)s@it=\relax \let\%(cp)s@bf=\relax%% + \let\%(cp)s@ul=\relax \let\%(cp)s@tc=\relax%% + \let\%(cp)s@bc=\relax \let\%(cp)s@ff=\relax} +\def\%(cp)s@tok#1{\csname %(cp)s@tok@#1\endcsname} +\def\%(cp)s@toks#1+{\ifx\relax#1\empty\else%% + \%(cp)s@tok{#1}\expandafter\%(cp)s@toks\fi} +\def\%(cp)s@do#1{\%(cp)s@bc{\%(cp)s@tc{\%(cp)s@ul{%% + \%(cp)s@it{\%(cp)s@bf{\%(cp)s@ff{#1}}}}}}} +\def\%(cp)s#1#2{\%(cp)s@reset\%(cp)s@toks#1+\relax+\%(cp)s@do{#2}} + +%(styles)s + +\def\%(cp)sZbs{\char`\\} +\def\%(cp)sZus{\char`\_} +\def\%(cp)sZob{\char`\{} +\def\%(cp)sZcb{\char`\}} +\def\%(cp)sZca{\char`\^} +\def\%(cp)sZam{\char`\&} +\def\%(cp)sZlt{\char`\<} +\def\%(cp)sZgt{\char`\>} +\def\%(cp)sZsh{\char`\#} +\def\%(cp)sZpc{\char`\%%} +\def\%(cp)sZdl{\char`\$} +\def\%(cp)sZhy{\char`\-} +\def\%(cp)sZsq{\char`\'} +\def\%(cp)sZdq{\char`\"} +\def\%(cp)sZti{\char`\~} +%% for compatibility with earlier versions +\def\%(cp)sZat{@} +\def\%(cp)sZlb{[} +\def\%(cp)sZrb{]} +\makeatother +''' + + +def _get_ttype_name(ttype): + fname = STANDARD_TYPES.get(ttype) + if fname: + return fname + aname = '' + while fname is None: + aname = ttype[-1] + aname + ttype = ttype.parent + fname = STANDARD_TYPES.get(ttype) + return fname + aname + + +class LatexFormatter(Formatter): + r""" + Format tokens as LaTeX code. This needs the `fancyvrb` and `color` + standard packages. + + Without the `full` option, code is formatted as one ``Verbatim`` + environment, like this: + + .. sourcecode:: latex + + \begin{Verbatim}[commandchars=\\\{\}] + \PY{k}{def }\PY{n+nf}{foo}(\PY{n}{bar}): + \PY{k}{pass} + \end{Verbatim} + + The special command used here (``\PY``) and all the other macros it needs + are output by the `get_style_defs` method. + + With the `full` option, a complete LaTeX document is output, including + the command definitions in the preamble. + + The `get_style_defs()` method of a `LatexFormatter` returns a string + containing ``\def`` commands defining the macros needed inside the + ``Verbatim`` environments. + + Additional options accepted: + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). + + `full` + Tells the formatter to output a "full" document, i.e. a complete + self-contained document (default: ``False``). + + `title` + If `full` is true, the title that should be used to caption the + document (default: ``''``). + + `docclass` + If the `full` option is enabled, this is the document class to use + (default: ``'article'``). + + `preamble` + If the `full` option is enabled, this can be further preamble commands, + e.g. ``\usepackage`` (default: ``''``). + + `linenos` + If set to ``True``, output line numbers (default: ``False``). + + `linenostart` + The line number for the first line (default: ``1``). + + `linenostep` + If set to a number n > 1, only every nth line number is printed. + + `verboptions` + Additional options given to the Verbatim environment (see the *fancyvrb* + docs for possible values) (default: ``''``). + + `commandprefix` + The LaTeX commands used to produce colored output are constructed + using this prefix and some letters (default: ``'PY'``). + + .. versionadded:: 0.7 + .. versionchanged:: 0.10 + The default is now ``'PY'`` instead of ``'C'``. + + `texcomments` + If set to ``True``, enables LaTeX comment lines. That is, LaTex markup + in comment tokens is not escaped so that LaTeX can render it (default: + ``False``). + + .. versionadded:: 1.2 + + `mathescape` + If set to ``True``, enables LaTeX math mode escape in comments. That + is, ``'$...$'`` inside a comment will trigger math mode (default: + ``False``). + + .. versionadded:: 1.2 + + `escapeinside` + If set to a string of length 2, enables escaping to LaTeX. Text + delimited by these 2 characters is read as LaTeX code and + typeset accordingly. It has no effect in string literals. It has + no effect in comments if `texcomments` or `mathescape` is + set. (default: ``''``). + + .. versionadded:: 2.0 + + `envname` + Allows you to pick an alternative environment name replacing Verbatim. + The alternate environment still has to support Verbatim's option syntax. + (default: ``'Verbatim'``). + + .. versionadded:: 2.0 + """ + name = 'LaTeX' + aliases = ['latex', 'tex'] + filenames = ['*.tex'] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self.docclass = options.get('docclass', 'article') + self.preamble = options.get('preamble', '') + self.linenos = get_bool_opt(options, 'linenos', False) + self.linenostart = abs(get_int_opt(options, 'linenostart', 1)) + self.linenostep = abs(get_int_opt(options, 'linenostep', 1)) + self.verboptions = options.get('verboptions', '') + self.nobackground = get_bool_opt(options, 'nobackground', False) + self.commandprefix = options.get('commandprefix', 'PY') + self.texcomments = get_bool_opt(options, 'texcomments', False) + self.mathescape = get_bool_opt(options, 'mathescape', False) + self.escapeinside = options.get('escapeinside', '') + if len(self.escapeinside) == 2: + self.left = self.escapeinside[0] + self.right = self.escapeinside[1] + else: + self.escapeinside = '' + self.envname = options.get('envname', 'Verbatim') + + self._create_stylesheet() + + def _create_stylesheet(self): + t2n = self.ttype2name = {Token: ''} + c2d = self.cmd2def = {} + cp = self.commandprefix + + def rgbcolor(col): + if col: + return ','.join(['%.2f' % (int(col[i] + col[i + 1], 16) / 255.0) + for i in (0, 2, 4)]) + else: + return '1,1,1' + + for ttype, ndef in self.style: + name = _get_ttype_name(ttype) + cmndef = '' + if ndef['bold']: + cmndef += r'\let\$$@bf=\textbf' + if ndef['italic']: + cmndef += r'\let\$$@it=\textit' + if ndef['underline']: + cmndef += r'\let\$$@ul=\underline' + if ndef['roman']: + cmndef += r'\let\$$@ff=\textrm' + if ndef['sans']: + cmndef += r'\let\$$@ff=\textsf' + if ndef['mono']: + cmndef += r'\let\$$@ff=\textsf' + if ndef['color']: + cmndef += (r'\def\$$@tc##1{\textcolor[rgb]{%s}{##1}}' % + rgbcolor(ndef['color'])) + if ndef['border']: + cmndef += (r'\def\$$@bc##1{{\setlength{\fboxsep}{\string -\fboxrule}' + r'\fcolorbox[rgb]{%s}{%s}{\strut ##1}}}' % + (rgbcolor(ndef['border']), + rgbcolor(ndef['bgcolor']))) + elif ndef['bgcolor']: + cmndef += (r'\def\$$@bc##1{{\setlength{\fboxsep}{0pt}' + r'\colorbox[rgb]{%s}{\strut ##1}}}' % + rgbcolor(ndef['bgcolor'])) + if cmndef == '': + continue + cmndef = cmndef.replace('$$', cp) + t2n[ttype] = name + c2d[name] = cmndef + + def get_style_defs(self, arg=''): + """ + Return the command sequences needed to define the commands + used to format text in the verbatim environment. ``arg`` is ignored. + """ + cp = self.commandprefix + styles = [] + for name, definition in self.cmd2def.items(): + styles.append(r'\@namedef{%s@tok@%s}{%s}' % (cp, name, definition)) + return STYLE_TEMPLATE % {'cp': self.commandprefix, + 'styles': '\n'.join(styles)} + + def format_unencoded(self, tokensource, outfile): + # TODO: add support for background colors + t2n = self.ttype2name + cp = self.commandprefix + + if self.full: + realoutfile = outfile + outfile = StringIO() + + outfile.write('\\begin{' + self.envname + '}[commandchars=\\\\\\{\\}') + if self.linenos: + start, step = self.linenostart, self.linenostep + outfile.write(',numbers=left' + + (start and ',firstnumber=%d' % start or '') + + (step and ',stepnumber=%d' % step or '')) + if self.mathescape or self.texcomments or self.escapeinside: + outfile.write(',codes={\\catcode`\\$=3\\catcode`\\^=7' + '\\catcode`\\_=8\\relax}') + if self.verboptions: + outfile.write(',' + self.verboptions) + outfile.write(']\n') + + for ttype, value in tokensource: + if ttype in Token.Comment: + if self.texcomments: + # Try to guess comment starting lexeme and escape it ... + start = value[0:1] + for i in range(1, len(value)): + if start[0] != value[i]: + break + start += value[i] + + value = value[len(start):] + start = escape_tex(start, cp) + + # ... but do not escape inside comment. + value = start + value + elif self.mathescape: + # Only escape parts not inside a math environment. + parts = value.split('$') + in_math = False + for i, part in enumerate(parts): + if not in_math: + parts[i] = escape_tex(part, cp) + in_math = not in_math + value = '$'.join(parts) + elif self.escapeinside: + text = value + value = '' + while text: + a, sep1, text = text.partition(self.left) + if sep1: + b, sep2, text = text.partition(self.right) + if sep2: + value += escape_tex(a, cp) + b + else: + value += escape_tex(a + sep1 + b, cp) + else: + value += escape_tex(a, cp) + else: + value = escape_tex(value, cp) + elif ttype not in Token.Escape: + value = escape_tex(value, cp) + styles = [] + while ttype is not Token: + try: + styles.append(t2n[ttype]) + except KeyError: + # not in current style + styles.append(_get_ttype_name(ttype)) + ttype = ttype.parent + styleval = '+'.join(reversed(styles)) + if styleval: + spl = value.split('\n') + for line in spl[:-1]: + if line: + outfile.write("\\%s{%s}{%s}" % (cp, styleval, line)) + outfile.write('\n') + if spl[-1]: + outfile.write("\\%s{%s}{%s}" % (cp, styleval, spl[-1])) + else: + outfile.write(value) + + outfile.write('\\end{' + self.envname + '}\n') + + if self.full: + encoding = self.encoding or 'utf8' + # map known existings encodings from LaTeX distribution + encoding = { + 'utf_8': 'utf8', + 'latin_1': 'latin1', + 'iso_8859_1': 'latin1', + }.get(encoding.replace('-', '_'), encoding) + realoutfile.write(DOC_TEMPLATE % + dict(docclass = self.docclass, + preamble = self.preamble, + title = self.title, + encoding = encoding, + styledefs = self.get_style_defs(), + code = outfile.getvalue())) + + +class LatexEmbeddedLexer(Lexer): + """ + This lexer takes one lexer as argument, the lexer for the language + being formatted, and the left and right delimiters for escaped text. + + First everything is scanned using the language lexer to obtain + strings and comments. All other consecutive tokens are merged and + the resulting text is scanned for escaped segments, which are given + the Token.Escape type. Finally text that is not escaped is scanned + again with the language lexer. + """ + def __init__(self, left, right, lang, **options): + self.left = left + self.right = right + self.lang = lang + Lexer.__init__(self, **options) + + def get_tokens_unprocessed(self, text): + # find and remove all the escape tokens (replace with an empty string) + # this is very similar to DelegatingLexer.get_tokens_unprocessed. + buffered = '' + insertions = [] + insertion_buf = [] + for i, t, v in self._find_safe_escape_tokens(text): + if t is None: + if insertion_buf: + insertions.append((len(buffered), insertion_buf)) + insertion_buf = [] + buffered += v + else: + insertion_buf.append((i, t, v)) + if insertion_buf: + insertions.append((len(buffered), insertion_buf)) + return do_insertions(insertions, + self.lang.get_tokens_unprocessed(buffered)) + + def _find_safe_escape_tokens(self, text): + """ find escape tokens that are not in strings or comments """ + for i, t, v in self._filter_to( + self.lang.get_tokens_unprocessed(text), + lambda t: t in Token.Comment or t in Token.String + ): + if t is None: + for i2, t2, v2 in self._find_escape_tokens(v): + yield i + i2, t2, v2 + else: + yield i, None, v + + def _filter_to(self, it, pred): + """ Keep only the tokens that match `pred`, merge the others together """ + buf = '' + idx = 0 + for i, t, v in it: + if pred(t): + if buf: + yield idx, None, buf + buf = '' + yield i, t, v + else: + if not buf: + idx = i + buf += v + if buf: + yield idx, None, buf + + def _find_escape_tokens(self, text): + """ Find escape tokens within text, give token=None otherwise """ + index = 0 + while text: + a, sep1, text = text.partition(self.left) + if a: + yield index, None, a + index += len(a) + if sep1: + b, sep2, text = text.partition(self.right) + if sep2: + yield index + len(sep1), Token.Escape, b + index += len(sep1) + len(b) + len(sep2) + else: + yield index, Token.Error, sep1 + index += len(sep1) + text = b diff --git a/src/pip/_vendor/pygments/formatters/other.py b/src/pip/_vendor/pygments/formatters/other.py new file mode 100644 index 000000000..4fdf5e72b --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/other.py @@ -0,0 +1,161 @@ +""" + pygments.formatters.other + ~~~~~~~~~~~~~~~~~~~~~~~~~ + + Other formatters: NullFormatter, RawTokenFormatter. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.util import get_choice_opt +from pip._vendor.pygments.token import Token +from pip._vendor.pygments.console import colorize + +__all__ = ['NullFormatter', 'RawTokenFormatter', 'TestcaseFormatter'] + + +class NullFormatter(Formatter): + """ + Output the text unchanged without any formatting. + """ + name = 'Text only' + aliases = ['text', 'null'] + filenames = ['*.txt'] + + def format(self, tokensource, outfile): + enc = self.encoding + for ttype, value in tokensource: + if enc: + outfile.write(value.encode(enc)) + else: + outfile.write(value) + + +class RawTokenFormatter(Formatter): + r""" + Format tokens as a raw representation for storing token streams. + + The format is ``tokentype<TAB>repr(tokenstring)\n``. The output can later + be converted to a token stream with the `RawTokenLexer`, described in the + :doc:`lexer list <lexers>`. + + Only two options are accepted: + + `compress` + If set to ``'gz'`` or ``'bz2'``, compress the output with the given + compression algorithm after encoding (default: ``''``). + `error_color` + If set to a color name, highlight error tokens using that color. If + set but with no value, defaults to ``'red'``. + + .. versionadded:: 0.11 + + """ + name = 'Raw tokens' + aliases = ['raw', 'tokens'] + filenames = ['*.raw'] + + unicodeoutput = False + + def __init__(self, **options): + Formatter.__init__(self, **options) + # We ignore self.encoding if it is set, since it gets set for lexer + # and formatter if given with -Oencoding on the command line. + # The RawTokenFormatter outputs only ASCII. Override here. + self.encoding = 'ascii' # let pygments.format() do the right thing + self.compress = get_choice_opt(options, 'compress', + ['', 'none', 'gz', 'bz2'], '') + self.error_color = options.get('error_color', None) + if self.error_color is True: + self.error_color = 'red' + if self.error_color is not None: + try: + colorize(self.error_color, '') + except KeyError: + raise ValueError("Invalid color %r specified" % + self.error_color) + + def format(self, tokensource, outfile): + try: + outfile.write(b'') + except TypeError: + raise TypeError('The raw tokens formatter needs a binary ' + 'output file') + if self.compress == 'gz': + import gzip + outfile = gzip.GzipFile('', 'wb', 9, outfile) + + write = outfile.write + flush = outfile.close + elif self.compress == 'bz2': + import bz2 + compressor = bz2.BZ2Compressor(9) + + def write(text): + outfile.write(compressor.compress(text)) + + def flush(): + outfile.write(compressor.flush()) + outfile.flush() + else: + write = outfile.write + flush = outfile.flush + + if self.error_color: + for ttype, value in tokensource: + line = b"%r\t%r\n" % (ttype, value) + if ttype is Token.Error: + write(colorize(self.error_color, line)) + else: + write(line) + else: + for ttype, value in tokensource: + write(b"%r\t%r\n" % (ttype, value)) + flush() + + +TESTCASE_BEFORE = '''\ + def testNeedsName(lexer): + fragment = %r + tokens = [ +''' +TESTCASE_AFTER = '''\ + ] + assert list(lexer.get_tokens(fragment)) == tokens +''' + + +class TestcaseFormatter(Formatter): + """ + Format tokens as appropriate for a new testcase. + + .. versionadded:: 2.0 + """ + name = 'Testcase' + aliases = ['testcase'] + + def __init__(self, **options): + Formatter.__init__(self, **options) + if self.encoding is not None and self.encoding != 'utf-8': + raise ValueError("Only None and utf-8 are allowed encodings.") + + def format(self, tokensource, outfile): + indentation = ' ' * 12 + rawbuf = [] + outbuf = [] + for ttype, value in tokensource: + rawbuf.append(value) + outbuf.append('%s(%s, %r),\n' % (indentation, ttype, value)) + + before = TESTCASE_BEFORE % (''.join(rawbuf),) + during = ''.join(outbuf) + after = TESTCASE_AFTER + if self.encoding is None: + outfile.write(before + during + after) + else: + outfile.write(before.encode('utf-8')) + outfile.write(during.encode('utf-8')) + outfile.write(after.encode('utf-8')) + outfile.flush() diff --git a/src/pip/_vendor/pygments/formatters/pangomarkup.py b/src/pip/_vendor/pygments/formatters/pangomarkup.py new file mode 100644 index 000000000..b0657a5f0 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/pangomarkup.py @@ -0,0 +1,83 @@ +""" + pygments.formatters.pangomarkup + ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for Pango markup output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.formatter import Formatter + + +__all__ = ['PangoMarkupFormatter'] + + +_escape_table = { + ord('&'): '&', + ord('<'): '<', +} + + +def escape_special_chars(text, table=_escape_table): + """Escape & and < for Pango Markup.""" + return text.translate(table) + + +class PangoMarkupFormatter(Formatter): + """ + Format tokens as Pango Markup code. It can then be rendered to an SVG. + + .. versionadded:: 2.9 + """ + + name = 'Pango Markup' + aliases = ['pango', 'pangomarkup'] + filenames = [] + + def __init__(self, **options): + Formatter.__init__(self, **options) + + self.styles = {} + + for token, style in self.style: + start = '' + end = '' + if style['color']: + start += '<span fgcolor="#%s">' % style['color'] + end = '</span>' + end + if style['bold']: + start += '<b>' + end = '</b>' + end + if style['italic']: + start += '<i>' + end = '</i>' + end + if style['underline']: + start += '<u>' + end = '</u>' + end + self.styles[token] = (start, end) + + def format_unencoded(self, tokensource, outfile): + lastval = '' + lasttype = None + + outfile.write('<tt>') + + for ttype, value in tokensource: + while ttype not in self.styles: + ttype = ttype.parent + if ttype == lasttype: + lastval += escape_special_chars(value) + else: + if lastval: + stylebegin, styleend = self.styles[lasttype] + outfile.write(stylebegin + lastval + styleend) + lastval = escape_special_chars(value) + lasttype = ttype + + if lastval: + stylebegin, styleend = self.styles[lasttype] + outfile.write(stylebegin + lastval + styleend) + + outfile.write('</tt>') diff --git a/src/pip/_vendor/pygments/formatters/rtf.py b/src/pip/_vendor/pygments/formatters/rtf.py new file mode 100644 index 000000000..b4b0acab9 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/rtf.py @@ -0,0 +1,146 @@ +""" + pygments.formatters.rtf + ~~~~~~~~~~~~~~~~~~~~~~~ + + A formatter that generates RTF files. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.util import get_int_opt, surrogatepair + + +__all__ = ['RtfFormatter'] + + +class RtfFormatter(Formatter): + """ + Format tokens as RTF markup. This formatter automatically outputs full RTF + documents with color information and other useful stuff. Perfect for Copy and + Paste into Microsoft(R) Word(R) documents. + + Please note that ``encoding`` and ``outencoding`` options are ignored. + The RTF format is ASCII natively, but handles unicode characters correctly + thanks to escape sequences. + + .. versionadded:: 0.6 + + Additional options accepted: + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). + + `fontface` + The used font family, for example ``Bitstream Vera Sans``. Defaults to + some generic font which is supposed to have fixed width. + + `fontsize` + Size of the font used. Size is specified in half points. The + default is 24 half-points, giving a size 12 font. + + .. versionadded:: 2.0 + """ + name = 'RTF' + aliases = ['rtf'] + filenames = ['*.rtf'] + + def __init__(self, **options): + r""" + Additional options accepted: + + ``fontface`` + Name of the font used. Could for example be ``'Courier New'`` + to further specify the default which is ``'\fmodern'``. The RTF + specification claims that ``\fmodern`` are "Fixed-pitch serif + and sans serif fonts". Hope every RTF implementation thinks + the same about modern... + + """ + Formatter.__init__(self, **options) + self.fontface = options.get('fontface') or '' + self.fontsize = get_int_opt(options, 'fontsize', 0) + + def _escape(self, text): + return text.replace('\\', '\\\\') \ + .replace('{', '\\{') \ + .replace('}', '\\}') + + def _escape_text(self, text): + # empty strings, should give a small performance improvement + if not text: + return '' + + # escape text + text = self._escape(text) + + buf = [] + for c in text: + cn = ord(c) + if cn < (2**7): + # ASCII character + buf.append(str(c)) + elif (2**7) <= cn < (2**16): + # single unicode escape sequence + buf.append('{\\u%d}' % cn) + elif (2**16) <= cn: + # RTF limits unicode to 16 bits. + # Force surrogate pairs + buf.append('{\\u%d}{\\u%d}' % surrogatepair(cn)) + + return ''.join(buf).replace('\n', '\\par\n') + + def format_unencoded(self, tokensource, outfile): + # rtf 1.8 header + outfile.write('{\\rtf1\\ansi\\uc0\\deff0' + '{\\fonttbl{\\f0\\fmodern\\fprq1\\fcharset0%s;}}' + '{\\colortbl;' % (self.fontface and + ' ' + self._escape(self.fontface) or + '')) + + # convert colors and save them in a mapping to access them later. + color_mapping = {} + offset = 1 + for _, style in self.style: + for color in style['color'], style['bgcolor'], style['border']: + if color and color not in color_mapping: + color_mapping[color] = offset + outfile.write('\\red%d\\green%d\\blue%d;' % ( + int(color[0:2], 16), + int(color[2:4], 16), + int(color[4:6], 16) + )) + offset += 1 + outfile.write('}\\f0 ') + if self.fontsize: + outfile.write('\\fs%d' % self.fontsize) + + # highlight stream + for ttype, value in tokensource: + while not self.style.styles_token(ttype) and ttype.parent: + ttype = ttype.parent + style = self.style.style_for_token(ttype) + buf = [] + if style['bgcolor']: + buf.append('\\cb%d' % color_mapping[style['bgcolor']]) + if style['color']: + buf.append('\\cf%d' % color_mapping[style['color']]) + if style['bold']: + buf.append('\\b') + if style['italic']: + buf.append('\\i') + if style['underline']: + buf.append('\\ul') + if style['border']: + buf.append('\\chbrdr\\chcfpat%d' % + color_mapping[style['border']]) + start = ''.join(buf) + if start: + outfile.write('{%s ' % start) + outfile.write(self._escape_text(value)) + if start: + outfile.write('}') + + outfile.write('}') diff --git a/src/pip/_vendor/pygments/formatters/svg.py b/src/pip/_vendor/pygments/formatters/svg.py new file mode 100644 index 000000000..d4de51f0e --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/svg.py @@ -0,0 +1,188 @@ +""" + pygments.formatters.svg + ~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for SVG output. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.token import Comment +from pip._vendor.pygments.util import get_bool_opt, get_int_opt + +__all__ = ['SvgFormatter'] + + +def escape_html(text): + """Escape &, <, > as well as single and double quotes for HTML.""" + return text.replace('&', '&'). \ + replace('<', '<'). \ + replace('>', '>'). \ + replace('"', '"'). \ + replace("'", ''') + + +class2style = {} + +class SvgFormatter(Formatter): + """ + Format tokens as an SVG graphics file. This formatter is still experimental. + Each line of code is a ``<text>`` element with explicit ``x`` and ``y`` + coordinates containing ``<tspan>`` elements with the individual token styles. + + By default, this formatter outputs a full SVG document including doctype + declaration and the ``<svg>`` root element. + + .. versionadded:: 0.9 + + Additional options accepted: + + `nowrap` + Don't wrap the SVG ``<text>`` elements in ``<svg><g>`` elements and + don't add a XML declaration and a doctype. If true, the `fontfamily` + and `fontsize` options are ignored. Defaults to ``False``. + + `fontfamily` + The value to give the wrapping ``<g>`` element's ``font-family`` + attribute, defaults to ``"monospace"``. + + `fontsize` + The value to give the wrapping ``<g>`` element's ``font-size`` + attribute, defaults to ``"14px"``. + + `linenos` + If ``True``, add line numbers (default: ``False``). + + `linenostart` + The line number for the first line (default: ``1``). + + `linenostep` + If set to a number n > 1, only every nth line number is printed. + + `linenowidth` + Maximum width devoted to line numbers (default: ``3*ystep``, sufficient + for up to 4-digit line numbers. Increase width for longer code blocks). + + `xoffset` + Starting offset in X direction, defaults to ``0``. + + `yoffset` + Starting offset in Y direction, defaults to the font size if it is given + in pixels, or ``20`` else. (This is necessary since text coordinates + refer to the text baseline, not the top edge.) + + `ystep` + Offset to add to the Y coordinate for each subsequent line. This should + roughly be the text size plus 5. It defaults to that value if the text + size is given in pixels, or ``25`` else. + + `spacehack` + Convert spaces in the source to `` ``, which are non-breaking + spaces. SVG provides the ``xml:space`` attribute to control how + whitespace inside tags is handled, in theory, the ``preserve`` value + could be used to keep all whitespace as-is. However, many current SVG + viewers don't obey that rule, so this option is provided as a workaround + and defaults to ``True``. + """ + name = 'SVG' + aliases = ['svg'] + filenames = ['*.svg'] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self.nowrap = get_bool_opt(options, 'nowrap', False) + self.fontfamily = options.get('fontfamily', 'monospace') + self.fontsize = options.get('fontsize', '14px') + self.xoffset = get_int_opt(options, 'xoffset', 0) + fs = self.fontsize.strip() + if fs.endswith('px'): fs = fs[:-2].strip() + try: + int_fs = int(fs) + except: + int_fs = 20 + self.yoffset = get_int_opt(options, 'yoffset', int_fs) + self.ystep = get_int_opt(options, 'ystep', int_fs + 5) + self.spacehack = get_bool_opt(options, 'spacehack', True) + self.linenos = get_bool_opt(options,'linenos',False) + self.linenostart = get_int_opt(options,'linenostart',1) + self.linenostep = get_int_opt(options,'linenostep',1) + self.linenowidth = get_int_opt(options,'linenowidth', 3*self.ystep) + self._stylecache = {} + + def format_unencoded(self, tokensource, outfile): + """ + Format ``tokensource``, an iterable of ``(tokentype, tokenstring)`` + tuples and write it into ``outfile``. + + For our implementation we put all lines in their own 'line group'. + """ + x = self.xoffset + y = self.yoffset + if not self.nowrap: + if self.encoding: + outfile.write('<?xml version="1.0" encoding="%s"?>\n' % + self.encoding) + else: + outfile.write('<?xml version="1.0"?>\n') + outfile.write('<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.0//EN" ' + '"http://www.w3.org/TR/2001/REC-SVG-20010904/DTD/' + 'svg10.dtd">\n') + outfile.write('<svg xmlns="http://www.w3.org/2000/svg">\n') + outfile.write('<g font-family="%s" font-size="%s">\n' % + (self.fontfamily, self.fontsize)) + + counter = self.linenostart + counter_step = self.linenostep + counter_style = self._get_style(Comment) + line_x = x + + if self.linenos: + if counter % counter_step == 0: + outfile.write('<text x="%s" y="%s" %s text-anchor="end">%s</text>' % + (x+self.linenowidth,y,counter_style,counter)) + line_x += self.linenowidth + self.ystep + counter += 1 + + outfile.write('<text x="%s" y="%s" xml:space="preserve">' % (line_x, y)) + for ttype, value in tokensource: + style = self._get_style(ttype) + tspan = style and '<tspan' + style + '>' or '' + tspanend = tspan and '</tspan>' or '' + value = escape_html(value) + if self.spacehack: + value = value.expandtabs().replace(' ', ' ') + parts = value.split('\n') + for part in parts[:-1]: + outfile.write(tspan + part + tspanend) + y += self.ystep + outfile.write('</text>\n') + if self.linenos and counter % counter_step == 0: + outfile.write('<text x="%s" y="%s" text-anchor="end" %s>%s</text>' % + (x+self.linenowidth,y,counter_style,counter)) + + counter += 1 + outfile.write('<text x="%s" y="%s" ' 'xml:space="preserve">' % (line_x,y)) + outfile.write(tspan + parts[-1] + tspanend) + outfile.write('</text>') + + if not self.nowrap: + outfile.write('</g></svg>\n') + + def _get_style(self, tokentype): + if tokentype in self._stylecache: + return self._stylecache[tokentype] + otokentype = tokentype + while not self.style.styles_token(tokentype): + tokentype = tokentype.parent + value = self.style.style_for_token(tokentype) + result = '' + if value['color']: + result = ' fill="#' + value['color'] + '"' + if value['bold']: + result += ' font-weight="bold"' + if value['italic']: + result += ' font-style="italic"' + self._stylecache[otokentype] = result + return result diff --git a/src/pip/_vendor/pygments/formatters/terminal.py b/src/pip/_vendor/pygments/formatters/terminal.py new file mode 100644 index 000000000..1e93ef6ee --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/terminal.py @@ -0,0 +1,129 @@ +""" + pygments.formatters.terminal + ~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for terminal output with ANSI sequences. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import sys + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.token import Keyword, Name, Comment, String, Error, \ + Number, Operator, Generic, Token, Whitespace +from pip._vendor.pygments.console import ansiformat +from pip._vendor.pygments.util import get_choice_opt + + +__all__ = ['TerminalFormatter'] + + +#: Map token types to a tuple of color values for light and dark +#: backgrounds. +TERMINAL_COLORS = { + Token: ('', ''), + + Whitespace: ('gray', 'brightblack'), + Comment: ('gray', 'brightblack'), + Comment.Preproc: ('cyan', 'brightcyan'), + Keyword: ('blue', 'brightblue'), + Keyword.Type: ('cyan', 'brightcyan'), + Operator.Word: ('magenta', 'brightmagenta'), + Name.Builtin: ('cyan', 'brightcyan'), + Name.Function: ('green', 'brightgreen'), + Name.Namespace: ('_cyan_', '_brightcyan_'), + Name.Class: ('_green_', '_brightgreen_'), + Name.Exception: ('cyan', 'brightcyan'), + Name.Decorator: ('brightblack', 'gray'), + Name.Variable: ('red', 'brightred'), + Name.Constant: ('red', 'brightred'), + Name.Attribute: ('cyan', 'brightcyan'), + Name.Tag: ('brightblue', 'brightblue'), + String: ('yellow', 'yellow'), + Number: ('blue', 'brightblue'), + + Generic.Deleted: ('brightred', 'brightred'), + Generic.Inserted: ('green', 'brightgreen'), + Generic.Heading: ('**', '**'), + Generic.Subheading: ('*magenta*', '*brightmagenta*'), + Generic.Prompt: ('**', '**'), + Generic.Error: ('brightred', 'brightred'), + + Error: ('_brightred_', '_brightred_'), +} + + +class TerminalFormatter(Formatter): + r""" + Format tokens with ANSI color sequences, for output in a text console. + Color sequences are terminated at newlines, so that paging the output + works correctly. + + The `get_style_defs()` method doesn't do anything special since there is + no support for common styles. + + Options accepted: + + `bg` + Set to ``"light"`` or ``"dark"`` depending on the terminal's background + (default: ``"light"``). + + `colorscheme` + A dictionary mapping token types to (lightbg, darkbg) color names or + ``None`` (default: ``None`` = use builtin colorscheme). + + `linenos` + Set to ``True`` to have line numbers on the terminal output as well + (default: ``False`` = no line numbers). + """ + name = 'Terminal' + aliases = ['terminal', 'console'] + filenames = [] + + def __init__(self, **options): + Formatter.__init__(self, **options) + self.darkbg = get_choice_opt(options, 'bg', + ['light', 'dark'], 'light') == 'dark' + self.colorscheme = options.get('colorscheme', None) or TERMINAL_COLORS + self.linenos = options.get('linenos', False) + self._lineno = 0 + + def format(self, tokensource, outfile): + return Formatter.format(self, tokensource, outfile) + + def _write_lineno(self, outfile): + self._lineno += 1 + outfile.write("%s%04d: " % (self._lineno != 1 and '\n' or '', self._lineno)) + + def _get_color(self, ttype): + # self.colorscheme is a dict containing usually generic types, so we + # have to walk the tree of dots. The base Token type must be a key, + # even if it's empty string, as in the default above. + colors = self.colorscheme.get(ttype) + while colors is None: + ttype = ttype.parent + colors = self.colorscheme.get(ttype) + return colors[self.darkbg] + + def format_unencoded(self, tokensource, outfile): + if self.linenos: + self._write_lineno(outfile) + + for ttype, value in tokensource: + color = self._get_color(ttype) + + for line in value.splitlines(True): + if color: + outfile.write(ansiformat(color, line.rstrip('\n'))) + else: + outfile.write(line.rstrip('\n')) + if line.endswith('\n'): + if self.linenos: + self._write_lineno(outfile) + else: + outfile.write('\n') + + if self.linenos: + outfile.write("\n") diff --git a/src/pip/_vendor/pygments/formatters/terminal256.py b/src/pip/_vendor/pygments/formatters/terminal256.py new file mode 100644 index 000000000..e1129fa05 --- /dev/null +++ b/src/pip/_vendor/pygments/formatters/terminal256.py @@ -0,0 +1,340 @@ +""" + pygments.formatters.terminal256 + ~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~ + + Formatter for 256-color terminal output with ANSI sequences. + + RGB-to-XTERM color conversion routines adapted from xterm256-conv + tool (http://frexx.de/xterm-256-notes/data/xterm256-conv2.tar.bz2) + by Wolfgang Frisch. + + Formatter version 1. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +# TODO: +# - Options to map style's bold/underline/italic/border attributes +# to some ANSI attrbutes (something like 'italic=underline') +# - An option to output "style RGB to xterm RGB/index" conversion table +# - An option to indicate that we are running in "reverse background" +# xterm. This means that default colors are white-on-black, not +# black-on-while, so colors like "white background" need to be converted +# to "white background, black foreground", etc... + +import sys + +from pip._vendor.pygments.formatter import Formatter +from pip._vendor.pygments.console import codes +from pip._vendor.pygments.style import ansicolors + + +__all__ = ['Terminal256Formatter', 'TerminalTrueColorFormatter'] + + +class EscapeSequence: + def __init__(self, fg=None, bg=None, bold=False, underline=False, italic=False): + self.fg = fg + self.bg = bg + self.bold = bold + self.underline = underline + self.italic = italic + + def escape(self, attrs): + if len(attrs): + return "\x1b[" + ";".join(attrs) + "m" + return "" + + def color_string(self): + attrs = [] + if self.fg is not None: + if self.fg in ansicolors: + esc = codes[self.fg.replace('ansi','')] + if ';01m' in esc: + self.bold = True + # extract fg color code. + attrs.append(esc[2:4]) + else: + attrs.extend(("38", "5", "%i" % self.fg)) + if self.bg is not None: + if self.bg in ansicolors: + esc = codes[self.bg.replace('ansi','')] + # extract fg color code, add 10 for bg. + attrs.append(str(int(esc[2:4])+10)) + else: + attrs.extend(("48", "5", "%i" % self.bg)) + if self.bold: + attrs.append("01") + if self.underline: + attrs.append("04") + if self.italic: + attrs.append("03") + return self.escape(attrs) + + def true_color_string(self): + attrs = [] + if self.fg: + attrs.extend(("38", "2", str(self.fg[0]), str(self.fg[1]), str(self.fg[2]))) + if self.bg: + attrs.extend(("48", "2", str(self.bg[0]), str(self.bg[1]), str(self.bg[2]))) + if self.bold: + attrs.append("01") + if self.underline: + attrs.append("04") + if self.italic: + attrs.append("03") + return self.escape(attrs) + + def reset_string(self): + attrs = [] + if self.fg is not None: + attrs.append("39") + if self.bg is not None: + attrs.append("49") + if self.bold or self.underline or self.italic: + attrs.append("00") + return self.escape(attrs) + + +class Terminal256Formatter(Formatter): + """ + Format tokens with ANSI color sequences, for output in a 256-color + terminal or console. Like in `TerminalFormatter` color sequences + are terminated at newlines, so that paging the output works correctly. + + The formatter takes colors from a style defined by the `style` option + and converts them to nearest ANSI 256-color escape sequences. Bold and + underline attributes from the style are preserved (and displayed). + + .. versionadded:: 0.9 + + .. versionchanged:: 2.2 + If the used style defines foreground colors in the form ``#ansi*``, then + `Terminal256Formatter` will map these to non extended foreground color. + See :ref:`AnsiTerminalStyle` for more information. + + .. versionchanged:: 2.4 + The ANSI color names have been updated with names that are easier to + understand and align with colornames of other projects and terminals. + See :ref:`this table <new-ansi-color-names>` for more information. + + + Options accepted: + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). + + `linenos` + Set to ``True`` to have line numbers on the terminal output as well + (default: ``False`` = no line numbers). + """ + name = 'Terminal256' + aliases = ['terminal256', 'console256', '256'] + filenames = [] + + def __init__(self, **options): + Formatter.__init__(self, **options) + + self.xterm_colors = [] + self.best_match = {} + self.style_string = {} + + self.usebold = 'nobold' not in options + self.useunderline = 'nounderline' not in options + self.useitalic = 'noitalic' not in options + + self._build_color_table() # build an RGB-to-256 color conversion table + self._setup_styles() # convert selected style's colors to term. colors + + self.linenos = options.get('linenos', False) + self._lineno = 0 + + def _build_color_table(self): + # colors 0..15: 16 basic colors + + self.xterm_colors.append((0x00, 0x00, 0x00)) # 0 + self.xterm_colors.append((0xcd, 0x00, 0x00)) # 1 + self.xterm_colors.append((0x00, 0xcd, 0x00)) # 2 + self.xterm_colors.append((0xcd, 0xcd, 0x00)) # 3 + self.xterm_colors.append((0x00, 0x00, 0xee)) # 4 + self.xterm_colors.append((0xcd, 0x00, 0xcd)) # 5 + self.xterm_colors.append((0x00, 0xcd, 0xcd)) # 6 + self.xterm_colors.append((0xe5, 0xe5, 0xe5)) # 7 + self.xterm_colors.append((0x7f, 0x7f, 0x7f)) # 8 + self.xterm_colors.append((0xff, 0x00, 0x00)) # 9 + self.xterm_colors.append((0x00, 0xff, 0x00)) # 10 + self.xterm_colors.append((0xff, 0xff, 0x00)) # 11 + self.xterm_colors.append((0x5c, 0x5c, 0xff)) # 12 + self.xterm_colors.append((0xff, 0x00, 0xff)) # 13 + self.xterm_colors.append((0x00, 0xff, 0xff)) # 14 + self.xterm_colors.append((0xff, 0xff, 0xff)) # 15 + + # colors 16..232: the 6x6x6 color cube + + valuerange = (0x00, 0x5f, 0x87, 0xaf, 0xd7, 0xff) + + for i in range(217): + r = valuerange[(i // 36) % 6] + g = valuerange[(i // 6) % 6] + b = valuerange[i % 6] + self.xterm_colors.append((r, g, b)) + + # colors 233..253: grayscale + + for i in range(1, 22): + v = 8 + i * 10 + self.xterm_colors.append((v, v, v)) + + def _closest_color(self, r, g, b): + distance = 257*257*3 # "infinity" (>distance from #000000 to #ffffff) + match = 0 + + for i in range(0, 254): + values = self.xterm_colors[i] + + rd = r - values[0] + gd = g - values[1] + bd = b - values[2] + d = rd*rd + gd*gd + bd*bd + + if d < distance: + match = i + distance = d + return match + + def _color_index(self, color): + index = self.best_match.get(color, None) + if color in ansicolors: + # strip the `ansi/#ansi` part and look up code + index = color + self.best_match[color] = index + if index is None: + try: + rgb = int(str(color), 16) + except ValueError: + rgb = 0 + + r = (rgb >> 16) & 0xff + g = (rgb >> 8) & 0xff + b = rgb & 0xff + index = self._closest_color(r, g, b) + self.best_match[color] = index + return index + + def _setup_styles(self): + for ttype, ndef in self.style: + escape = EscapeSequence() + # get foreground from ansicolor if set + if ndef['ansicolor']: + escape.fg = self._color_index(ndef['ansicolor']) + elif ndef['color']: + escape.fg = self._color_index(ndef['color']) + if ndef['bgansicolor']: + escape.bg = self._color_index(ndef['bgansicolor']) + elif ndef['bgcolor']: + escape.bg = self._color_index(ndef['bgcolor']) + if self.usebold and ndef['bold']: + escape.bold = True + if self.useunderline and ndef['underline']: + escape.underline = True + if self.useitalic and ndef['italic']: + escape.italic = True + self.style_string[str(ttype)] = (escape.color_string(), + escape.reset_string()) + + def _write_lineno(self, outfile): + self._lineno += 1 + outfile.write("%s%04d: " % (self._lineno != 1 and '\n' or '', self._lineno)) + + def format(self, tokensource, outfile): + return Formatter.format(self, tokensource, outfile) + + def format_unencoded(self, tokensource, outfile): + if self.linenos: + self._write_lineno(outfile) + + for ttype, value in tokensource: + not_found = True + while ttype and not_found: + try: + # outfile.write( "<" + str(ttype) + ">" ) + on, off = self.style_string[str(ttype)] + + # Like TerminalFormatter, add "reset colors" escape sequence + # on newline. + spl = value.split('\n') + for line in spl[:-1]: + if line: + outfile.write(on + line + off) + if self.linenos: + self._write_lineno(outfile) + else: + outfile.write('\n') + + if spl[-1]: + outfile.write(on + spl[-1] + off) + + not_found = False + # outfile.write( '#' + str(ttype) + '#' ) + + except KeyError: + # ottype = ttype + ttype = ttype[:-1] + # outfile.write( '!' + str(ottype) + '->' + str(ttype) + '!' ) + + if not_found: + outfile.write(value) + + if self.linenos: + outfile.write("\n") + + + +class TerminalTrueColorFormatter(Terminal256Formatter): + r""" + Format tokens with ANSI color sequences, for output in a true-color + terminal or console. Like in `TerminalFormatter` color sequences + are terminated at newlines, so that paging the output works correctly. + + .. versionadded:: 2.1 + + Options accepted: + + `style` + The style to use, can be a string or a Style subclass (default: + ``'default'``). + """ + name = 'TerminalTrueColor' + aliases = ['terminal16m', 'console16m', '16m'] + filenames = [] + + def _build_color_table(self): + pass + + def _color_tuple(self, color): + try: + rgb = int(str(color), 16) + except ValueError: + return None + r = (rgb >> 16) & 0xff + g = (rgb >> 8) & 0xff + b = rgb & 0xff + return (r, g, b) + + def _setup_styles(self): + for ttype, ndef in self.style: + escape = EscapeSequence() + if ndef['color']: + escape.fg = self._color_tuple(ndef['color']) + if ndef['bgcolor']: + escape.bg = self._color_tuple(ndef['bgcolor']) + if self.usebold and ndef['bold']: + escape.bold = True + if self.useunderline and ndef['underline']: + escape.underline = True + if self.useitalic and ndef['italic']: + escape.italic = True + self.style_string[str(ttype)] = (escape.true_color_string(), + escape.reset_string()) diff --git a/src/pip/_vendor/pygments/lexer.py b/src/pip/_vendor/pygments/lexer.py new file mode 100644 index 000000000..29b2f9d6b --- /dev/null +++ b/src/pip/_vendor/pygments/lexer.py @@ -0,0 +1,874 @@ +""" + pygments.lexer + ~~~~~~~~~~~~~~ + + Base lexer classes. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +import sys +import time + +from pip._vendor.pygments.filter import apply_filters, Filter +from pip._vendor.pygments.filters import get_filter_by_name +from pip._vendor.pygments.token import Error, Text, Other, _TokenType +from pip._vendor.pygments.util import get_bool_opt, get_int_opt, get_list_opt, \ + make_analysator, Future, guess_decode +from pip._vendor.pygments.regexopt import regex_opt + +__all__ = ['Lexer', 'RegexLexer', 'ExtendedRegexLexer', 'DelegatingLexer', + 'LexerContext', 'include', 'inherit', 'bygroups', 'using', 'this', + 'default', 'words'] + + +_encoding_map = [(b'\xef\xbb\xbf', 'utf-8'), + (b'\xff\xfe\0\0', 'utf-32'), + (b'\0\0\xfe\xff', 'utf-32be'), + (b'\xff\xfe', 'utf-16'), + (b'\xfe\xff', 'utf-16be')] + +_default_analyse = staticmethod(lambda x: 0.0) + + +class LexerMeta(type): + """ + This metaclass automagically converts ``analyse_text`` methods into + static methods which always return float values. + """ + + def __new__(mcs, name, bases, d): + if 'analyse_text' in d: + d['analyse_text'] = make_analysator(d['analyse_text']) + return type.__new__(mcs, name, bases, d) + + +class Lexer(metaclass=LexerMeta): + """ + Lexer for a specific language. + + Basic options recognized: + ``stripnl`` + Strip leading and trailing newlines from the input (default: True). + ``stripall`` + Strip all leading and trailing whitespace from the input + (default: False). + ``ensurenl`` + Make sure that the input ends with a newline (default: True). This + is required for some lexers that consume input linewise. + + .. versionadded:: 1.3 + + ``tabsize`` + If given and greater than 0, expand tabs in the input (default: 0). + ``encoding`` + If given, must be an encoding name. This encoding will be used to + convert the input string to Unicode, if it is not already a Unicode + string (default: ``'guess'``, which uses a simple UTF-8 / Locale / + Latin1 detection. Can also be ``'chardet'`` to use the chardet + library, if it is installed. + ``inencoding`` + Overrides the ``encoding`` if given. + """ + + #: Name of the lexer + name = None + + #: Shortcuts for the lexer + aliases = [] + + #: File name globs + filenames = [] + + #: Secondary file name globs + alias_filenames = [] + + #: MIME types + mimetypes = [] + + #: Priority, should multiple lexers match and no content is provided + priority = 0 + + def __init__(self, **options): + self.options = options + self.stripnl = get_bool_opt(options, 'stripnl', True) + self.stripall = get_bool_opt(options, 'stripall', False) + self.ensurenl = get_bool_opt(options, 'ensurenl', True) + self.tabsize = get_int_opt(options, 'tabsize', 0) + self.encoding = options.get('encoding', 'guess') + self.encoding = options.get('inencoding') or self.encoding + self.filters = [] + for filter_ in get_list_opt(options, 'filters', ()): + self.add_filter(filter_) + + def __repr__(self): + if self.options: + return '<pygments.lexers.%s with %r>' % (self.__class__.__name__, + self.options) + else: + return '<pygments.lexers.%s>' % self.__class__.__name__ + + def add_filter(self, filter_, **options): + """ + Add a new stream filter to this lexer. + """ + if not isinstance(filter_, Filter): + filter_ = get_filter_by_name(filter_, **options) + self.filters.append(filter_) + + def analyse_text(text): + """ + Has to return a float between ``0`` and ``1`` that indicates + if a lexer wants to highlight this text. Used by ``guess_lexer``. + If this method returns ``0`` it won't highlight it in any case, if + it returns ``1`` highlighting with this lexer is guaranteed. + + The `LexerMeta` metaclass automatically wraps this function so + that it works like a static method (no ``self`` or ``cls`` + parameter) and the return value is automatically converted to + `float`. If the return value is an object that is boolean `False` + it's the same as if the return values was ``0.0``. + """ + + def get_tokens(self, text, unfiltered=False): + """ + Return an iterable of (tokentype, value) pairs generated from + `text`. If `unfiltered` is set to `True`, the filtering mechanism + is bypassed even if filters are defined. + + Also preprocess the text, i.e. expand tabs and strip it if + wanted and applies registered filters. + """ + if not isinstance(text, str): + if self.encoding == 'guess': + text, _ = guess_decode(text) + elif self.encoding == 'chardet': + try: + from pip._vendor import chardet + except ImportError as e: + raise ImportError('To enable chardet encoding guessing, ' + 'please install the chardet library ' + 'from http://chardet.feedparser.org/') from e + # check for BOM first + decoded = None + for bom, encoding in _encoding_map: + if text.startswith(bom): + decoded = text[len(bom):].decode(encoding, 'replace') + break + # no BOM found, so use chardet + if decoded is None: + enc = chardet.detect(text[:1024]) # Guess using first 1KB + decoded = text.decode(enc.get('encoding') or 'utf-8', + 'replace') + text = decoded + else: + text = text.decode(self.encoding) + if text.startswith('\ufeff'): + text = text[len('\ufeff'):] + else: + if text.startswith('\ufeff'): + text = text[len('\ufeff'):] + + # text now *is* a unicode string + text = text.replace('\r\n', '\n') + text = text.replace('\r', '\n') + if self.stripall: + text = text.strip() + elif self.stripnl: + text = text.strip('\n') + if self.tabsize > 0: + text = text.expandtabs(self.tabsize) + if self.ensurenl and not text.endswith('\n'): + text += '\n' + + def streamer(): + for _, t, v in self.get_tokens_unprocessed(text): + yield t, v + stream = streamer() + if not unfiltered: + stream = apply_filters(stream, self.filters, self) + return stream + + def get_tokens_unprocessed(self, text): + """ + Return an iterable of (index, tokentype, value) pairs where "index" + is the starting position of the token within the input text. + + In subclasses, implement this method as a generator to + maximize effectiveness. + """ + raise NotImplementedError + + +class DelegatingLexer(Lexer): + """ + This lexer takes two lexer as arguments. A root lexer and + a language lexer. First everything is scanned using the language + lexer, afterwards all ``Other`` tokens are lexed using the root + lexer. + + The lexers from the ``template`` lexer package use this base lexer. + """ + + def __init__(self, _root_lexer, _language_lexer, _needle=Other, **options): + self.root_lexer = _root_lexer(**options) + self.language_lexer = _language_lexer(**options) + self.needle = _needle + Lexer.__init__(self, **options) + + def get_tokens_unprocessed(self, text): + buffered = '' + insertions = [] + lng_buffer = [] + for i, t, v in self.language_lexer.get_tokens_unprocessed(text): + if t is self.needle: + if lng_buffer: + insertions.append((len(buffered), lng_buffer)) + lng_buffer = [] + buffered += v + else: + lng_buffer.append((i, t, v)) + if lng_buffer: + insertions.append((len(buffered), lng_buffer)) + return do_insertions(insertions, + self.root_lexer.get_tokens_unprocessed(buffered)) + + +# ------------------------------------------------------------------------------ +# RegexLexer and ExtendedRegexLexer +# + + +class include(str): # pylint: disable=invalid-name + """ + Indicates that a state should include rules from another state. + """ + pass + + +class _inherit: + """ + Indicates the a state should inherit from its superclass. + """ + def __repr__(self): + return 'inherit' + +inherit = _inherit() # pylint: disable=invalid-name + + +class combined(tuple): # pylint: disable=invalid-name + """ + Indicates a state combined from multiple states. + """ + + def __new__(cls, *args): + return tuple.__new__(cls, args) + + def __init__(self, *args): + # tuple.__init__ doesn't do anything + pass + + +class _PseudoMatch: + """ + A pseudo match object constructed from a string. + """ + + def __init__(self, start, text): + self._text = text + self._start = start + + def start(self, arg=None): + return self._start + + def end(self, arg=None): + return self._start + len(self._text) + + def group(self, arg=None): + if arg: + raise IndexError('No such group') + return self._text + + def groups(self): + return (self._text,) + + def groupdict(self): + return {} + + +def bygroups(*args): + """ + Callback that yields multiple actions for each group in the match. + """ + def callback(lexer, match, ctx=None): + for i, action in enumerate(args): + if action is None: + continue + elif type(action) is _TokenType: + data = match.group(i + 1) + if data: + yield match.start(i + 1), action, data + else: + data = match.group(i + 1) + if data is not None: + if ctx: + ctx.pos = match.start(i + 1) + for item in action(lexer, + _PseudoMatch(match.start(i + 1), data), ctx): + if item: + yield item + if ctx: + ctx.pos = match.end() + return callback + + +class _This: + """ + Special singleton used for indicating the caller class. + Used by ``using``. + """ + +this = _This() + + +def using(_other, **kwargs): + """ + Callback that processes the match with a different lexer. + + The keyword arguments are forwarded to the lexer, except `state` which + is handled separately. + + `state` specifies the state that the new lexer will start in, and can + be an enumerable such as ('root', 'inline', 'string') or a simple + string which is assumed to be on top of the root state. + + Note: For that to work, `_other` must not be an `ExtendedRegexLexer`. + """ + gt_kwargs = {} + if 'state' in kwargs: + s = kwargs.pop('state') + if isinstance(s, (list, tuple)): + gt_kwargs['stack'] = s + else: + gt_kwargs['stack'] = ('root', s) + + if _other is this: + def callback(lexer, match, ctx=None): + # if keyword arguments are given the callback + # function has to create a new lexer instance + if kwargs: + # XXX: cache that somehow + kwargs.update(lexer.options) + lx = lexer.__class__(**kwargs) + else: + lx = lexer + s = match.start() + for i, t, v in lx.get_tokens_unprocessed(match.group(), **gt_kwargs): + yield i + s, t, v + if ctx: + ctx.pos = match.end() + else: + def callback(lexer, match, ctx=None): + # XXX: cache that somehow + kwargs.update(lexer.options) + lx = _other(**kwargs) + + s = match.start() + for i, t, v in lx.get_tokens_unprocessed(match.group(), **gt_kwargs): + yield i + s, t, v + if ctx: + ctx.pos = match.end() + return callback + + +class default: + """ + Indicates a state or state action (e.g. #pop) to apply. + For example default('#pop') is equivalent to ('', Token, '#pop') + Note that state tuples may be used as well. + + .. versionadded:: 2.0 + """ + def __init__(self, state): + self.state = state + + +class words(Future): + """ + Indicates a list of literal words that is transformed into an optimized + regex that matches any of the words. + + .. versionadded:: 2.0 + """ + def __init__(self, words, prefix='', suffix=''): + self.words = words + self.prefix = prefix + self.suffix = suffix + + def get(self): + return regex_opt(self.words, prefix=self.prefix, suffix=self.suffix) + + +class RegexLexerMeta(LexerMeta): + """ + Metaclass for RegexLexer, creates the self._tokens attribute from + self.tokens on the first instantiation. + """ + + def _process_regex(cls, regex, rflags, state): + """Preprocess the regular expression component of a token definition.""" + if isinstance(regex, Future): + regex = regex.get() + return re.compile(regex, rflags).match + + def _process_token(cls, token): + """Preprocess the token component of a token definition.""" + assert type(token) is _TokenType or callable(token), \ + 'token type must be simple type or callable, not %r' % (token,) + return token + + def _process_new_state(cls, new_state, unprocessed, processed): + """Preprocess the state transition action of a token definition.""" + if isinstance(new_state, str): + # an existing state + if new_state == '#pop': + return -1 + elif new_state in unprocessed: + return (new_state,) + elif new_state == '#push': + return new_state + elif new_state[:5] == '#pop:': + return -int(new_state[5:]) + else: + assert False, 'unknown new state %r' % new_state + elif isinstance(new_state, combined): + # combine a new state from existing ones + tmp_state = '_tmp_%d' % cls._tmpname + cls._tmpname += 1 + itokens = [] + for istate in new_state: + assert istate != new_state, 'circular state ref %r' % istate + itokens.extend(cls._process_state(unprocessed, + processed, istate)) + processed[tmp_state] = itokens + return (tmp_state,) + elif isinstance(new_state, tuple): + # push more than one state + for istate in new_state: + assert (istate in unprocessed or + istate in ('#pop', '#push')), \ + 'unknown new state ' + istate + return new_state + else: + assert False, 'unknown new state def %r' % new_state + + def _process_state(cls, unprocessed, processed, state): + """Preprocess a single state definition.""" + assert type(state) is str, "wrong state name %r" % state + assert state[0] != '#', "invalid state name %r" % state + if state in processed: + return processed[state] + tokens = processed[state] = [] + rflags = cls.flags + for tdef in unprocessed[state]: + if isinstance(tdef, include): + # it's a state reference + assert tdef != state, "circular state reference %r" % state + tokens.extend(cls._process_state(unprocessed, processed, + str(tdef))) + continue + if isinstance(tdef, _inherit): + # should be processed already, but may not in the case of: + # 1. the state has no counterpart in any parent + # 2. the state includes more than one 'inherit' + continue + if isinstance(tdef, default): + new_state = cls._process_new_state(tdef.state, unprocessed, processed) + tokens.append((re.compile('').match, None, new_state)) + continue + + assert type(tdef) is tuple, "wrong rule def %r" % tdef + + try: + rex = cls._process_regex(tdef[0], rflags, state) + except Exception as err: + raise ValueError("uncompilable regex %r in state %r of %r: %s" % + (tdef[0], state, cls, err)) from err + + token = cls._process_token(tdef[1]) + + if len(tdef) == 2: + new_state = None + else: + new_state = cls._process_new_state(tdef[2], + unprocessed, processed) + + tokens.append((rex, token, new_state)) + return tokens + + def process_tokendef(cls, name, tokendefs=None): + """Preprocess a dictionary of token definitions.""" + processed = cls._all_tokens[name] = {} + tokendefs = tokendefs or cls.tokens[name] + for state in list(tokendefs): + cls._process_state(tokendefs, processed, state) + return processed + + def get_tokendefs(cls): + """ + Merge tokens from superclasses in MRO order, returning a single tokendef + dictionary. + + Any state that is not defined by a subclass will be inherited + automatically. States that *are* defined by subclasses will, by + default, override that state in the superclass. If a subclass wishes to + inherit definitions from a superclass, it can use the special value + "inherit", which will cause the superclass' state definition to be + included at that point in the state. + """ + tokens = {} + inheritable = {} + for c in cls.__mro__: + toks = c.__dict__.get('tokens', {}) + + for state, items in toks.items(): + curitems = tokens.get(state) + if curitems is None: + # N.b. because this is assigned by reference, sufficiently + # deep hierarchies are processed incrementally (e.g. for + # A(B), B(C), C(RegexLexer), B will be premodified so X(B) + # will not see any inherits in B). + tokens[state] = items + try: + inherit_ndx = items.index(inherit) + except ValueError: + continue + inheritable[state] = inherit_ndx + continue + + inherit_ndx = inheritable.pop(state, None) + if inherit_ndx is None: + continue + + # Replace the "inherit" value with the items + curitems[inherit_ndx:inherit_ndx+1] = items + try: + # N.b. this is the index in items (that is, the superclass + # copy), so offset required when storing below. + new_inh_ndx = items.index(inherit) + except ValueError: + pass + else: + inheritable[state] = inherit_ndx + new_inh_ndx + + return tokens + + def __call__(cls, *args, **kwds): + """Instantiate cls after preprocessing its token definitions.""" + if '_tokens' not in cls.__dict__: + cls._all_tokens = {} + cls._tmpname = 0 + if hasattr(cls, 'token_variants') and cls.token_variants: + # don't process yet + pass + else: + cls._tokens = cls.process_tokendef('', cls.get_tokendefs()) + + return type.__call__(cls, *args, **kwds) + + +class RegexLexer(Lexer, metaclass=RegexLexerMeta): + """ + Base for simple stateful regular expression-based lexers. + Simplifies the lexing process so that you need only + provide a list of states and regular expressions. + """ + + #: Flags for compiling the regular expressions. + #: Defaults to MULTILINE. + flags = re.MULTILINE + + #: Dict of ``{'state': [(regex, tokentype, new_state), ...], ...}`` + #: + #: The initial state is 'root'. + #: ``new_state`` can be omitted to signify no state transition. + #: If it is a string, the state is pushed on the stack and changed. + #: If it is a tuple of strings, all states are pushed on the stack and + #: the current state will be the topmost. + #: It can also be ``combined('state1', 'state2', ...)`` + #: to signify a new, anonymous state combined from the rules of two + #: or more existing ones. + #: Furthermore, it can be '#pop' to signify going back one step in + #: the state stack, or '#push' to push the current state on the stack + #: again. + #: + #: The tuple can also be replaced with ``include('state')``, in which + #: case the rules from the state named by the string are included in the + #: current one. + tokens = {} + + def get_tokens_unprocessed(self, text, stack=('root',)): + """ + Split ``text`` into (tokentype, text) pairs. + + ``stack`` is the inital stack (default: ``['root']``) + """ + pos = 0 + tokendefs = self._tokens + statestack = list(stack) + statetokens = tokendefs[statestack[-1]] + while 1: + for rexmatch, action, new_state in statetokens: + m = rexmatch(text, pos) + if m: + if action is not None: + if type(action) is _TokenType: + yield pos, action, m.group() + else: + yield from action(self, m) + pos = m.end() + if new_state is not None: + # state transition + if isinstance(new_state, tuple): + for state in new_state: + if state == '#pop': + if len(statestack) > 1: + statestack.pop() + elif state == '#push': + statestack.append(statestack[-1]) + else: + statestack.append(state) + elif isinstance(new_state, int): + # pop, but keep at least one state on the stack + # (random code leading to unexpected pops should + # not allow exceptions) + if abs(new_state) >= len(statestack): + del statestack[1:] + else: + del statestack[new_state:] + elif new_state == '#push': + statestack.append(statestack[-1]) + else: + assert False, "wrong state def: %r" % new_state + statetokens = tokendefs[statestack[-1]] + break + else: + # We are here only if all state tokens have been considered + # and there was not a match on any of them. + try: + if text[pos] == '\n': + # at EOL, reset state to "root" + statestack = ['root'] + statetokens = tokendefs['root'] + yield pos, Text, '\n' + pos += 1 + continue + yield pos, Error, text[pos] + pos += 1 + except IndexError: + break + + +class LexerContext: + """ + A helper object that holds lexer position data. + """ + + def __init__(self, text, pos, stack=None, end=None): + self.text = text + self.pos = pos + self.end = end or len(text) # end=0 not supported ;-) + self.stack = stack or ['root'] + + def __repr__(self): + return 'LexerContext(%r, %r, %r)' % ( + self.text, self.pos, self.stack) + + +class ExtendedRegexLexer(RegexLexer): + """ + A RegexLexer that uses a context object to store its state. + """ + + def get_tokens_unprocessed(self, text=None, context=None): + """ + Split ``text`` into (tokentype, text) pairs. + If ``context`` is given, use this lexer context instead. + """ + tokendefs = self._tokens + if not context: + ctx = LexerContext(text, 0) + statetokens = tokendefs['root'] + else: + ctx = context + statetokens = tokendefs[ctx.stack[-1]] + text = ctx.text + while 1: + for rexmatch, action, new_state in statetokens: + m = rexmatch(text, ctx.pos, ctx.end) + if m: + if action is not None: + if type(action) is _TokenType: + yield ctx.pos, action, m.group() + ctx.pos = m.end() + else: + yield from action(self, m, ctx) + if not new_state: + # altered the state stack? + statetokens = tokendefs[ctx.stack[-1]] + # CAUTION: callback must set ctx.pos! + if new_state is not None: + # state transition + if isinstance(new_state, tuple): + for state in new_state: + if state == '#pop': + if len(ctx.stack) > 1: + ctx.stack.pop() + elif state == '#push': + ctx.stack.append(ctx.stack[-1]) + else: + ctx.stack.append(state) + elif isinstance(new_state, int): + # see RegexLexer for why this check is made + if abs(new_state) >= len(ctx.stack): + del ctx.state[1:] + else: + del ctx.stack[new_state:] + elif new_state == '#push': + ctx.stack.append(ctx.stack[-1]) + else: + assert False, "wrong state def: %r" % new_state + statetokens = tokendefs[ctx.stack[-1]] + break + else: + try: + if ctx.pos >= ctx.end: + break + if text[ctx.pos] == '\n': + # at EOL, reset state to "root" + ctx.stack = ['root'] + statetokens = tokendefs['root'] + yield ctx.pos, Text, '\n' + ctx.pos += 1 + continue + yield ctx.pos, Error, text[ctx.pos] + ctx.pos += 1 + except IndexError: + break + + +def do_insertions(insertions, tokens): + """ + Helper for lexers which must combine the results of several + sublexers. + + ``insertions`` is a list of ``(index, itokens)`` pairs. + Each ``itokens`` iterable should be inserted at position + ``index`` into the token stream given by the ``tokens`` + argument. + + The result is a combined token stream. + + TODO: clean up the code here. + """ + insertions = iter(insertions) + try: + index, itokens = next(insertions) + except StopIteration: + # no insertions + yield from tokens + return + + realpos = None + insleft = True + + # iterate over the token stream where we want to insert + # the tokens from the insertion list. + for i, t, v in tokens: + # first iteration. store the postition of first item + if realpos is None: + realpos = i + oldi = 0 + while insleft and i + len(v) >= index: + tmpval = v[oldi:index - i] + if tmpval: + yield realpos, t, tmpval + realpos += len(tmpval) + for it_index, it_token, it_value in itokens: + yield realpos, it_token, it_value + realpos += len(it_value) + oldi = index - i + try: + index, itokens = next(insertions) + except StopIteration: + insleft = False + break # not strictly necessary + if oldi < len(v): + yield realpos, t, v[oldi:] + realpos += len(v) - oldi + + # leftover tokens + while insleft: + # no normal tokens, set realpos to zero + realpos = realpos or 0 + for p, t, v in itokens: + yield realpos, t, v + realpos += len(v) + try: + index, itokens = next(insertions) + except StopIteration: + insleft = False + break # not strictly necessary + + +class ProfilingRegexLexerMeta(RegexLexerMeta): + """Metaclass for ProfilingRegexLexer, collects regex timing info.""" + + def _process_regex(cls, regex, rflags, state): + if isinstance(regex, words): + rex = regex_opt(regex.words, prefix=regex.prefix, + suffix=regex.suffix) + else: + rex = regex + compiled = re.compile(rex, rflags) + + def match_func(text, pos, endpos=sys.maxsize): + info = cls._prof_data[-1].setdefault((state, rex), [0, 0.0]) + t0 = time.time() + res = compiled.match(text, pos, endpos) + t1 = time.time() + info[0] += 1 + info[1] += t1 - t0 + return res + return match_func + + +class ProfilingRegexLexer(RegexLexer, metaclass=ProfilingRegexLexerMeta): + """Drop-in replacement for RegexLexer that does profiling of its regexes.""" + + _prof_data = [] + _prof_sort_index = 4 # defaults to time per call + + def get_tokens_unprocessed(self, text, stack=('root',)): + # this needs to be a stack, since using(this) will produce nested calls + self.__class__._prof_data.append({}) + yield from RegexLexer.get_tokens_unprocessed(self, text, stack) + rawdata = self.__class__._prof_data.pop() + data = sorted(((s, repr(r).strip('u\'').replace('\\\\', '\\')[:65], + n, 1000 * t, 1000 * t / n) + for ((s, r), (n, t)) in rawdata.items()), + key=lambda x: x[self._prof_sort_index], + reverse=True) + sum_total = sum(x[3] for x in data) + + print() + print('Profiling result for %s lexing %d chars in %.3f ms' % + (self.__class__.__name__, len(text), sum_total)) + print('=' * 110) + print('%-20s %-64s ncalls tottime percall' % ('state', 'regex')) + print('-' * 110) + for d in data: + print('%-20s %-65s %5d %8.4f %8.4f' % d) + print('=' * 110) diff --git a/src/pip/_vendor/pygments/lexers/__init__.py b/src/pip/_vendor/pygments/lexers/__init__.py new file mode 100644 index 000000000..6981b8d11 --- /dev/null +++ b/src/pip/_vendor/pygments/lexers/__init__.py @@ -0,0 +1,341 @@ +""" + pygments.lexers + ~~~~~~~~~~~~~~~ + + Pygments lexers. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +import sys +import types +import fnmatch +from os.path import basename + +from pip._vendor.pygments.lexers._mapping import LEXERS +from pip._vendor.pygments.modeline import get_filetype_from_buffer +from pip._vendor.pygments.plugin import find_plugin_lexers +from pip._vendor.pygments.util import ClassNotFound, guess_decode + +COMPAT = { + 'Python3Lexer': 'PythonLexer', + 'Python3TracebackLexer': 'PythonTracebackLexer', +} + +__all__ = ['get_lexer_by_name', 'get_lexer_for_filename', 'find_lexer_class', + 'guess_lexer', 'load_lexer_from_file'] + list(LEXERS) + list(COMPAT) + +_lexer_cache = {} +_pattern_cache = {} + + +def _fn_matches(fn, glob): + """Return whether the supplied file name fn matches pattern filename.""" + if glob not in _pattern_cache: + pattern = _pattern_cache[glob] = re.compile(fnmatch.translate(glob)) + return pattern.match(fn) + return _pattern_cache[glob].match(fn) + + +def _load_lexers(module_name): + """Load a lexer (and all others in the module too).""" + mod = __import__(module_name, None, None, ['__all__']) + for lexer_name in mod.__all__: + cls = getattr(mod, lexer_name) + _lexer_cache[cls.name] = cls + + +def get_all_lexers(): + """Return a generator of tuples in the form ``(name, aliases, + filenames, mimetypes)`` of all know lexers. + """ + for item in LEXERS.values(): + yield item[1:] + for lexer in find_plugin_lexers(): + yield lexer.name, lexer.aliases, lexer.filenames, lexer.mimetypes + + +def find_lexer_class(name): + """Lookup a lexer class by name. + + Return None if not found. + """ + if name in _lexer_cache: + return _lexer_cache[name] + # lookup builtin lexers + for module_name, lname, aliases, _, _ in LEXERS.values(): + if name == lname: + _load_lexers(module_name) + return _lexer_cache[name] + # continue with lexers from setuptools entrypoints + for cls in find_plugin_lexers(): + if cls.name == name: + return cls + + +def find_lexer_class_by_name(_alias): + """Lookup a lexer class by alias. + + Like `get_lexer_by_name`, but does not instantiate the class. + + .. versionadded:: 2.2 + """ + if not _alias: + raise ClassNotFound('no lexer for alias %r found' % _alias) + # lookup builtin lexers + for module_name, name, aliases, _, _ in LEXERS.values(): + if _alias.lower() in aliases: + if name not in _lexer_cache: + _load_lexers(module_name) + return _lexer_cache[name] + # continue with lexers from setuptools entrypoints + for cls in find_plugin_lexers(): + if _alias.lower() in cls.aliases: + return cls + raise ClassNotFound('no lexer for alias %r found' % _alias) + + +def get_lexer_by_name(_alias, **options): + """Get a lexer by an alias. + + Raises ClassNotFound if not found. + """ + if not _alias: + raise ClassNotFound('no lexer for alias %r found' % _alias) + + # lookup builtin lexers + for module_name, name, aliases, _, _ in LEXERS.values(): + if _alias.lower() in aliases: + if name not in _lexer_cache: + _load_lexers(module_name) + return _lexer_cache[name](**options) + # continue with lexers from setuptools entrypoints + for cls in find_plugin_lexers(): + if _alias.lower() in cls.aliases: + return cls(**options) + raise ClassNotFound('no lexer for alias %r found' % _alias) + + +def load_lexer_from_file(filename, lexername="CustomLexer", **options): + """Load a lexer from a file. + + This method expects a file located relative to the current working + directory, which contains a Lexer class. By default, it expects the + Lexer to be name CustomLexer; you can specify your own class name + as the second argument to this function. + + Users should be very careful with the input, because this method + is equivalent to running eval on the input file. + + Raises ClassNotFound if there are any problems importing the Lexer. + + .. versionadded:: 2.2 + """ + try: + # This empty dict will contain the namespace for the exec'd file + custom_namespace = {} + with open(filename, 'rb') as f: + exec(f.read(), custom_namespace) + # Retrieve the class `lexername` from that namespace + if lexername not in custom_namespace: + raise ClassNotFound('no valid %s class found in %s' % + (lexername, filename)) + lexer_class = custom_namespace[lexername] + # And finally instantiate it with the options + return lexer_class(**options) + except OSError as err: + raise ClassNotFound('cannot read %s: %s' % (filename, err)) + except ClassNotFound: + raise + except Exception as err: + raise ClassNotFound('error when loading custom lexer: %s' % err) + + +def find_lexer_class_for_filename(_fn, code=None): + """Get a lexer for a filename. + + If multiple lexers match the filename pattern, use ``analyse_text()`` to + figure out which one is more appropriate. + + Returns None if not found. + """ + matches = [] + fn = basename(_fn) + for modname, name, _, filenames, _ in LEXERS.values(): + for filename in filenames: + if _fn_matches(fn, filename): + if name not in _lexer_cache: + _load_lexers(modname) + matches.append((_lexer_cache[name], filename)) + for cls in find_plugin_lexers(): + for filename in cls.filenames: + if _fn_matches(fn, filename): + matches.append((cls, filename)) + + if isinstance(code, bytes): + # decode it, since all analyse_text functions expect unicode + code = guess_decode(code) + + def get_rating(info): + cls, filename = info + # explicit patterns get a bonus + bonus = '*' not in filename and 0.5 or 0 + # The class _always_ defines analyse_text because it's included in + # the Lexer class. The default implementation returns None which + # gets turned into 0.0. Run scripts/detect_missing_analyse_text.py + # to find lexers which need it overridden. + if code: + return cls.analyse_text(code) + bonus, cls.__name__ + return cls.priority + bonus, cls.__name__ + + if matches: + matches.sort(key=get_rating) + # print "Possible lexers, after sort:", matches + return matches[-1][0] + + +def get_lexer_for_filename(_fn, code=None, **options): + """Get a lexer for a filename. + + If multiple lexers match the filename pattern, use ``analyse_text()`` to + figure out which one is more appropriate. + + Raises ClassNotFound if not found. + """ + res = find_lexer_class_for_filename(_fn, code) + if not res: + raise ClassNotFound('no lexer for filename %r found' % _fn) + return res(**options) + + +def get_lexer_for_mimetype(_mime, **options): + """Get a lexer for a mimetype. + + Raises ClassNotFound if not found. + """ + for modname, name, _, _, mimetypes in LEXERS.values(): + if _mime in mimetypes: + if name not in _lexer_cache: + _load_lexers(modname) + return _lexer_cache[name](**options) + for cls in find_plugin_lexers(): + if _mime in cls.mimetypes: + return cls(**options) + raise ClassNotFound('no lexer for mimetype %r found' % _mime) + + +def _iter_lexerclasses(plugins=True): + """Return an iterator over all lexer classes.""" + for key in sorted(LEXERS): + module_name, name = LEXERS[key][:2] + if name not in _lexer_cache: + _load_lexers(module_name) + yield _lexer_cache[name] + if plugins: + yield from find_plugin_lexers() + + +def guess_lexer_for_filename(_fn, _text, **options): + """ + Lookup all lexers that handle those filenames primary (``filenames``) + or secondary (``alias_filenames``). Then run a text analysis for those + lexers and choose the best result. + + usage:: + + >>> from pygments.lexers import guess_lexer_for_filename + >>> guess_lexer_for_filename('hello.html', '<%= @foo %>') + <pygments.lexers.templates.RhtmlLexer object at 0xb7d2f32c> + >>> guess_lexer_for_filename('hello.html', '<h1>{{ title|e }}</h1>') + <pygments.lexers.templates.HtmlDjangoLexer object at 0xb7d2f2ac> + >>> guess_lexer_for_filename('style.css', 'a { color: <?= $link ?> }') + <pygments.lexers.templates.CssPhpLexer object at 0xb7ba518c> + """ + fn = basename(_fn) + primary = {} + matching_lexers = set() + for lexer in _iter_lexerclasses(): + for filename in lexer.filenames: + if _fn_matches(fn, filename): + matching_lexers.add(lexer) + primary[lexer] = True + for filename in lexer.alias_filenames: + if _fn_matches(fn, filename): + matching_lexers.add(lexer) + primary[lexer] = False + if not matching_lexers: + raise ClassNotFound('no lexer for filename %r found' % fn) + if len(matching_lexers) == 1: + return matching_lexers.pop()(**options) + result = [] + for lexer in matching_lexers: + rv = lexer.analyse_text(_text) + if rv == 1.0: + return lexer(**options) + result.append((rv, lexer)) + + def type_sort(t): + # sort by: + # - analyse score + # - is primary filename pattern? + # - priority + # - last resort: class name + return (t[0], primary[t[1]], t[1].priority, t[1].__name__) + result.sort(key=type_sort) + + return result[-1][1](**options) + + +def guess_lexer(_text, **options): + """Guess a lexer by strong distinctions in the text (eg, shebang).""" + + if not isinstance(_text, str): + inencoding = options.get('inencoding', options.get('encoding')) + if inencoding: + _text = _text.decode(inencoding or 'utf8') + else: + _text, _ = guess_decode(_text) + + # try to get a vim modeline first + ft = get_filetype_from_buffer(_text) + + if ft is not None: + try: + return get_lexer_by_name(ft, **options) + except ClassNotFound: + pass + + best_lexer = [0.0, None] + for lexer in _iter_lexerclasses(): + rv = lexer.analyse_text(_text) + if rv == 1.0: + return lexer(**options) + if rv > best_lexer[0]: + best_lexer[:] = (rv, lexer) + if not best_lexer[0] or best_lexer[1] is None: + raise ClassNotFound('no lexer matching the text found') + return best_lexer[1](**options) + + +class _automodule(types.ModuleType): + """Automatically import lexers.""" + + def __getattr__(self, name): + info = LEXERS.get(name) + if info: + _load_lexers(info[0]) + cls = _lexer_cache[info[1]] + setattr(self, name, cls) + return cls + if name in COMPAT: + return getattr(self, COMPAT[name]) + raise AttributeError(name) + + +oldmod = sys.modules[__name__] +newmod = _automodule(__name__) +newmod.__dict__.update(oldmod.__dict__) +sys.modules[__name__] = newmod +del newmod.newmod, newmod.oldmod, newmod.sys, newmod.types diff --git a/src/pip/_vendor/pygments/lexers/_mapping.py b/src/pip/_vendor/pygments/lexers/_mapping.py new file mode 100644 index 000000000..dbd2af87a --- /dev/null +++ b/src/pip/_vendor/pygments/lexers/_mapping.py @@ -0,0 +1,570 @@ +""" + pygments.lexers._mapping + ~~~~~~~~~~~~~~~~~~~~~~~~ + + Lexer mapping definitions. This file is generated by itself. Everytime + you change something on a builtin lexer definition, run this script from + the lexers folder to update it. + + Do not alter the LEXERS dictionary by hand. + + :copyright: Copyright 2006-2014, 2016 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +LEXERS = { + 'ABAPLexer': ('pip._vendor.pygments.lexer.business', 'ABAP', ('abap',), ('*.abap', '*.ABAP'), ('text/x-abap',)), + 'AMDGPULexer': ('pip._vendor.pygments.lexer.amdgpu', 'AMDGPU', ('amdgpu',), ('*.isa',), ()), + 'APLLexer': ('pip._vendor.pygments.lexer.apl', 'APL', ('apl',), ('*.apl', '*.aplf', '*.aplo', '*.apln', '*.aplc', '*.apli', '*.dyalog'), ()), + 'AbnfLexer': ('pip._vendor.pygments.lexer.grammar_notation', 'ABNF', ('abnf',), ('*.abnf',), ('text/x-abnf',)), + 'ActionScript3Lexer': ('pip._vendor.pygments.lexer.actionscript', 'ActionScript 3', ('actionscript3', 'as3'), ('*.as',), ('application/x-actionscript3', 'text/x-actionscript3', 'text/actionscript3')), + 'ActionScriptLexer': ('pip._vendor.pygments.lexer.actionscript', 'ActionScript', ('actionscript', 'as'), ('*.as',), ('application/x-actionscript', 'text/x-actionscript', 'text/actionscript')), + 'AdaLexer': ('pip._vendor.pygments.lexer.pascal', 'Ada', ('ada', 'ada95', 'ada2005'), ('*.adb', '*.ads', '*.ada'), ('text/x-ada',)), + 'AdlLexer': ('pip._vendor.pygments.lexer.archetype', 'ADL', ('adl',), ('*.adl', '*.adls', '*.adlf', '*.adlx'), ()), + 'AgdaLexer': ('pip._vendor.pygments.lexer.haskell', 'Agda', ('agda',), ('*.agda',), ('text/x-agda',)), + 'AheuiLexer': ('pip._vendor.pygments.lexer.esoteric', 'Aheui', ('aheui',), ('*.aheui',), ()), + 'AlloyLexer': ('pip._vendor.pygments.lexer.dsls', 'Alloy', ('alloy',), ('*.als',), ('text/x-alloy',)), + 'AmbientTalkLexer': ('pip._vendor.pygments.lexer.ambient', 'AmbientTalk', ('ambienttalk', 'ambienttalk/2', 'at'), ('*.at',), ('text/x-ambienttalk',)), + 'AmplLexer': ('pip._vendor.pygments.lexer.ampl', 'Ampl', ('ampl',), ('*.run',), ()), + 'Angular2HtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML + Angular2', ('html+ng2',), ('*.ng2',), ()), + 'Angular2Lexer': ('pip._vendor.pygments.lexer.templates', 'Angular2', ('ng2',), (), ()), + 'AntlrActionScriptLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With ActionScript Target', ('antlr-actionscript', 'antlr-as'), ('*.G', '*.g'), ()), + 'AntlrCSharpLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With C# Target', ('antlr-csharp', 'antlr-c#'), ('*.G', '*.g'), ()), + 'AntlrCppLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With CPP Target', ('antlr-cpp',), ('*.G', '*.g'), ()), + 'AntlrJavaLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With Java Target', ('antlr-java',), ('*.G', '*.g'), ()), + 'AntlrLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR', ('antlr',), (), ()), + 'AntlrObjectiveCLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With ObjectiveC Target', ('antlr-objc',), ('*.G', '*.g'), ()), + 'AntlrPerlLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With Perl Target', ('antlr-perl',), ('*.G', '*.g'), ()), + 'AntlrPythonLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With Python Target', ('antlr-python',), ('*.G', '*.g'), ()), + 'AntlrRubyLexer': ('pip._vendor.pygments.lexer.parsers', 'ANTLR With Ruby Target', ('antlr-ruby', 'antlr-rb'), ('*.G', '*.g'), ()), + 'ApacheConfLexer': ('pip._vendor.pygments.lexer.configs', 'ApacheConf', ('apacheconf', 'aconf', 'apache'), ('.htaccess', 'apache.conf', 'apache2.conf'), ('text/x-apacheconf',)), + 'AppleScriptLexer': ('pip._vendor.pygments.lexer.scripting', 'AppleScript', ('applescript',), ('*.applescript',), ()), + 'ArduinoLexer': ('pip._vendor.pygments.lexer.c_like', 'Arduino', ('arduino',), ('*.ino',), ('text/x-arduino',)), + 'ArrowLexer': ('pip._vendor.pygments.lexer.arrow', 'Arrow', ('arrow',), ('*.arw',), ()), + 'AscLexer': ('pip._vendor.pygments.lexer.asc', 'ASCII armored', ('asc', 'pem'), ('*.asc', '*.pem', 'id_dsa', 'id_ecdsa', 'id_ecdsa_sk', 'id_ed25519', 'id_ed25519_sk', 'id_rsa'), ('application/pgp-keys', 'application/pgp-encrypted', 'application/pgp-signature')), + 'AspectJLexer': ('pip._vendor.pygments.lexer.jvm', 'AspectJ', ('aspectj',), ('*.aj',), ('text/x-aspectj',)), + 'AsymptoteLexer': ('pip._vendor.pygments.lexer.graphics', 'Asymptote', ('asymptote', 'asy'), ('*.asy',), ('text/x-asymptote',)), + 'AugeasLexer': ('pip._vendor.pygments.lexer.configs', 'Augeas', ('augeas',), ('*.aug',), ()), + 'AutoItLexer': ('pip._vendor.pygments.lexer.automation', 'AutoIt', ('autoit',), ('*.au3',), ('text/x-autoit',)), + 'AutohotkeyLexer': ('pip._vendor.pygments.lexer.automation', 'autohotkey', ('autohotkey', 'ahk'), ('*.ahk', '*.ahkl'), ('text/x-autohotkey',)), + 'AwkLexer': ('pip._vendor.pygments.lexer.textedit', 'Awk', ('awk', 'gawk', 'mawk', 'nawk'), ('*.awk',), ('application/x-awk',)), + 'BBCBasicLexer': ('pip._vendor.pygments.lexer.basic', 'BBC Basic', ('bbcbasic',), ('*.bbc',), ()), + 'BBCodeLexer': ('pip._vendor.pygments.lexer.markup', 'BBCode', ('bbcode',), (), ('text/x-bbcode',)), + 'BCLexer': ('pip._vendor.pygments.lexer.algebra', 'BC', ('bc',), ('*.bc',), ()), + 'BSTLexer': ('pip._vendor.pygments.lexer.bibtex', 'BST', ('bst', 'bst-pybtex'), ('*.bst',), ()), + 'BareLexer': ('pip._vendor.pygments.lexer.bare', 'BARE', ('bare',), ('*.bare',), ()), + 'BaseMakefileLexer': ('pip._vendor.pygments.lexer.make', 'Base Makefile', ('basemake',), (), ()), + 'BashLexer': ('pip._vendor.pygments.lexer.shell', 'Bash', ('bash', 'sh', 'ksh', 'zsh', 'shell'), ('*.sh', '*.ksh', '*.bash', '*.ebuild', '*.eclass', '*.exheres-0', '*.exlib', '*.zsh', '.bashrc', 'bashrc', '.bash_*', 'bash_*', 'zshrc', '.zshrc', 'PKGBUILD'), ('application/x-sh', 'application/x-shellscript', 'text/x-shellscript')), + 'BashSessionLexer': ('pip._vendor.pygments.lexer.shell', 'Bash Session', ('console', 'shell-session'), ('*.sh-session', '*.shell-session'), ('application/x-shell-session', 'application/x-sh-session')), + 'BatchLexer': ('pip._vendor.pygments.lexer.shell', 'Batchfile', ('batch', 'bat', 'dosbatch', 'winbatch'), ('*.bat', '*.cmd'), ('application/x-dos-batch',)), + 'BefungeLexer': ('pip._vendor.pygments.lexer.esoteric', 'Befunge', ('befunge',), ('*.befunge',), ('application/x-befunge',)), + 'BibTeXLexer': ('pip._vendor.pygments.lexer.bibtex', 'BibTeX', ('bibtex', 'bib'), ('*.bib',), ('text/x-bibtex',)), + 'BlitzBasicLexer': ('pip._vendor.pygments.lexer.basic', 'BlitzBasic', ('blitzbasic', 'b3d', 'bplus'), ('*.bb', '*.decls'), ('text/x-bb',)), + 'BlitzMaxLexer': ('pip._vendor.pygments.lexer.basic', 'BlitzMax', ('blitzmax', 'bmax'), ('*.bmx',), ('text/x-bmx',)), + 'BnfLexer': ('pip._vendor.pygments.lexer.grammar_notation', 'BNF', ('bnf',), ('*.bnf',), ('text/x-bnf',)), + 'BoaLexer': ('pip._vendor.pygments.lexer.boa', 'Boa', ('boa',), ('*.boa',), ()), + 'BooLexer': ('pip._vendor.pygments.lexer.dotnet', 'Boo', ('boo',), ('*.boo',), ('text/x-boo',)), + 'BoogieLexer': ('pip._vendor.pygments.lexer.verification', 'Boogie', ('boogie',), ('*.bpl',), ()), + 'BrainfuckLexer': ('pip._vendor.pygments.lexer.esoteric', 'Brainfuck', ('brainfuck', 'bf'), ('*.bf', '*.b'), ('application/x-brainfuck',)), + 'BugsLexer': ('pip._vendor.pygments.lexer.modeling', 'BUGS', ('bugs', 'winbugs', 'openbugs'), ('*.bug',), ()), + 'CAmkESLexer': ('pip._vendor.pygments.lexer.esoteric', 'CAmkES', ('camkes', 'idl4'), ('*.camkes', '*.idl4'), ()), + 'CLexer': ('pip._vendor.pygments.lexer.c_cpp', 'C', ('c',), ('*.c', '*.h', '*.idc'), ('text/x-chdr', 'text/x-csrc')), + 'CMakeLexer': ('pip._vendor.pygments.lexer.make', 'CMake', ('cmake',), ('*.cmake', 'CMakeLists.txt'), ('text/x-cmake',)), + 'CObjdumpLexer': ('pip._vendor.pygments.lexer.asm', 'c-objdump', ('c-objdump',), ('*.c-objdump',), ('text/x-c-objdump',)), + 'CPSALexer': ('pip._vendor.pygments.lexer.lisp', 'CPSA', ('cpsa',), ('*.cpsa',), ()), + 'CSharpAspxLexer': ('pip._vendor.pygments.lexer.dotnet', 'aspx-cs', ('aspx-cs',), ('*.aspx', '*.asax', '*.ascx', '*.ashx', '*.asmx', '*.axd'), ()), + 'CSharpLexer': ('pip._vendor.pygments.lexer.dotnet', 'C#', ('csharp', 'c#'), ('*.cs',), ('text/x-csharp',)), + 'Ca65Lexer': ('pip._vendor.pygments.lexer.asm', 'ca65 assembler', ('ca65',), ('*.s',), ()), + 'CadlLexer': ('pip._vendor.pygments.lexer.archetype', 'cADL', ('cadl',), ('*.cadl',), ()), + 'CapDLLexer': ('pip._vendor.pygments.lexer.esoteric', 'CapDL', ('capdl',), ('*.cdl',), ()), + 'CapnProtoLexer': ('pip._vendor.pygments.lexer.capnproto', "Cap'n Proto", ('capnp',), ('*.capnp',), ()), + 'CbmBasicV2Lexer': ('pip._vendor.pygments.lexer.basic', 'CBM BASIC V2', ('cbmbas',), ('*.bas',), ()), + 'CddlLexer': ('pip._vendor.pygments.lexer.cddl', 'CDDL', ('cddl',), ('*.cddl',), ('text/x-cddl',)), + 'CeylonLexer': ('pip._vendor.pygments.lexer.jvm', 'Ceylon', ('ceylon',), ('*.ceylon',), ('text/x-ceylon',)), + 'Cfengine3Lexer': ('pip._vendor.pygments.lexer.configs', 'CFEngine3', ('cfengine3', 'cf3'), ('*.cf',), ()), + 'ChaiscriptLexer': ('pip._vendor.pygments.lexer.scripting', 'ChaiScript', ('chaiscript', 'chai'), ('*.chai',), ('text/x-chaiscript', 'application/x-chaiscript')), + 'ChapelLexer': ('pip._vendor.pygments.lexer.chapel', 'Chapel', ('chapel', 'chpl'), ('*.chpl',), ()), + 'CharmciLexer': ('pip._vendor.pygments.lexer.c_like', 'Charmci', ('charmci',), ('*.ci',), ()), + 'CheetahHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Cheetah', ('html+cheetah', 'html+spitfire', 'htmlcheetah'), (), ('text/html+cheetah', 'text/html+spitfire')), + 'CheetahJavascriptLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Cheetah', ('javascript+cheetah', 'js+cheetah', 'javascript+spitfire', 'js+spitfire'), (), ('application/x-javascript+cheetah', 'text/x-javascript+cheetah', 'text/javascript+cheetah', 'application/x-javascript+spitfire', 'text/x-javascript+spitfire', 'text/javascript+spitfire')), + 'CheetahLexer': ('pip._vendor.pygments.lexer.templates', 'Cheetah', ('cheetah', 'spitfire'), ('*.tmpl', '*.spt'), ('application/x-cheetah', 'application/x-spitfire')), + 'CheetahXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Cheetah', ('xml+cheetah', 'xml+spitfire'), (), ('application/xml+cheetah', 'application/xml+spitfire')), + 'CirruLexer': ('pip._vendor.pygments.lexer.webmisc', 'Cirru', ('cirru',), ('*.cirru',), ('text/x-cirru',)), + 'ClayLexer': ('pip._vendor.pygments.lexer.c_like', 'Clay', ('clay',), ('*.clay',), ('text/x-clay',)), + 'CleanLexer': ('pip._vendor.pygments.lexer.clean', 'Clean', ('clean',), ('*.icl', '*.dcl'), ()), + 'ClojureLexer': ('pip._vendor.pygments.lexer.jvm', 'Clojure', ('clojure', 'clj'), ('*.clj',), ('text/x-clojure', 'application/x-clojure')), + 'ClojureScriptLexer': ('pip._vendor.pygments.lexer.jvm', 'ClojureScript', ('clojurescript', 'cljs'), ('*.cljs',), ('text/x-clojurescript', 'application/x-clojurescript')), + 'CobolFreeformatLexer': ('pip._vendor.pygments.lexer.business', 'COBOLFree', ('cobolfree',), ('*.cbl', '*.CBL'), ()), + 'CobolLexer': ('pip._vendor.pygments.lexer.business', 'COBOL', ('cobol',), ('*.cob', '*.COB', '*.cpy', '*.CPY'), ('text/x-cobol',)), + 'CoffeeScriptLexer': ('pip._vendor.pygments.lexer.javascript', 'CoffeeScript', ('coffeescript', 'coffee-script', 'coffee'), ('*.coffee',), ('text/coffeescript',)), + 'ColdfusionCFCLexer': ('pip._vendor.pygments.lexer.templates', 'Coldfusion CFC', ('cfc',), ('*.cfc',), ()), + 'ColdfusionHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'Coldfusion HTML', ('cfm',), ('*.cfm', '*.cfml'), ('application/x-coldfusion',)), + 'ColdfusionLexer': ('pip._vendor.pygments.lexer.templates', 'cfstatement', ('cfs',), (), ()), + 'CommonLispLexer': ('pip._vendor.pygments.lexer.lisp', 'Common Lisp', ('common-lisp', 'cl', 'lisp'), ('*.cl', '*.lisp'), ('text/x-common-lisp',)), + 'ComponentPascalLexer': ('pip._vendor.pygments.lexer.oberon', 'Component Pascal', ('componentpascal', 'cp'), ('*.cp', '*.cps'), ('text/x-component-pascal',)), + 'CoqLexer': ('pip._vendor.pygments.lexer.theorem', 'Coq', ('coq',), ('*.v',), ('text/x-coq',)), + 'CppLexer': ('pip._vendor.pygments.lexer.c_cpp', 'C++', ('cpp', 'c++'), ('*.cpp', '*.hpp', '*.c++', '*.h++', '*.cc', '*.hh', '*.cxx', '*.hxx', '*.C', '*.H', '*.cp', '*.CPP'), ('text/x-c++hdr', 'text/x-c++src')), + 'CppObjdumpLexer': ('pip._vendor.pygments.lexer.asm', 'cpp-objdump', ('cpp-objdump', 'c++-objdumb', 'cxx-objdump'), ('*.cpp-objdump', '*.c++-objdump', '*.cxx-objdump'), ('text/x-cpp-objdump',)), + 'CrmshLexer': ('pip._vendor.pygments.lexer.dsls', 'Crmsh', ('crmsh', 'pcmk'), ('*.crmsh', '*.pcmk'), ()), + 'CrocLexer': ('pip._vendor.pygments.lexer.d', 'Croc', ('croc',), ('*.croc',), ('text/x-crocsrc',)), + 'CryptolLexer': ('pip._vendor.pygments.lexer.haskell', 'Cryptol', ('cryptol', 'cry'), ('*.cry',), ('text/x-cryptol',)), + 'CrystalLexer': ('pip._vendor.pygments.lexer.crystal', 'Crystal', ('cr', 'crystal'), ('*.cr',), ('text/x-crystal',)), + 'CsoundDocumentLexer': ('pip._vendor.pygments.lexer.csound', 'Csound Document', ('csound-document', 'csound-csd'), ('*.csd',), ()), + 'CsoundOrchestraLexer': ('pip._vendor.pygments.lexer.csound', 'Csound Orchestra', ('csound', 'csound-orc'), ('*.orc', '*.udo'), ()), + 'CsoundScoreLexer': ('pip._vendor.pygments.lexer.csound', 'Csound Score', ('csound-score', 'csound-sco'), ('*.sco',), ()), + 'CssDjangoLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Django/Jinja', ('css+django', 'css+jinja'), (), ('text/css+django', 'text/css+jinja')), + 'CssErbLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Ruby', ('css+ruby', 'css+erb'), (), ('text/css+ruby',)), + 'CssGenshiLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Genshi Text', ('css+genshitext', 'css+genshi'), (), ('text/css+genshi',)), + 'CssLexer': ('pip._vendor.pygments.lexer.css', 'CSS', ('css',), ('*.css',), ('text/css',)), + 'CssPhpLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+PHP', ('css+php',), (), ('text/css+php',)), + 'CssSmartyLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Smarty', ('css+smarty',), (), ('text/css+smarty',)), + 'CudaLexer': ('pip._vendor.pygments.lexer.c_like', 'CUDA', ('cuda', 'cu'), ('*.cu', '*.cuh'), ('text/x-cuda',)), + 'CypherLexer': ('pip._vendor.pygments.lexer.graph', 'Cypher', ('cypher',), ('*.cyp', '*.cypher'), ()), + 'CythonLexer': ('pip._vendor.pygments.lexer.python', 'Cython', ('cython', 'pyx', 'pyrex'), ('*.pyx', '*.pxd', '*.pxi'), ('text/x-cython', 'application/x-cython')), + 'DLexer': ('pip._vendor.pygments.lexer.d', 'D', ('d',), ('*.d', '*.di'), ('text/x-dsrc',)), + 'DObjdumpLexer': ('pip._vendor.pygments.lexer.asm', 'd-objdump', ('d-objdump',), ('*.d-objdump',), ('text/x-d-objdump',)), + 'DarcsPatchLexer': ('pip._vendor.pygments.lexer.diff', 'Darcs Patch', ('dpatch',), ('*.dpatch', '*.darcspatch'), ()), + 'DartLexer': ('pip._vendor.pygments.lexer.javascript', 'Dart', ('dart',), ('*.dart',), ('text/x-dart',)), + 'Dasm16Lexer': ('pip._vendor.pygments.lexer.asm', 'DASM16', ('dasm16',), ('*.dasm16', '*.dasm'), ('text/x-dasm16',)), + 'DebianControlLexer': ('pip._vendor.pygments.lexer.installers', 'Debian Control file', ('debcontrol', 'control'), ('control',), ()), + 'DelphiLexer': ('pip._vendor.pygments.lexer.pascal', 'Delphi', ('delphi', 'pas', 'pascal', 'objectpascal'), ('*.pas', '*.dpr'), ('text/x-pascal',)), + 'DevicetreeLexer': ('pip._vendor.pygments.lexer.devicetree', 'Devicetree', ('devicetree', 'dts'), ('*.dts', '*.dtsi'), ('text/x-c',)), + 'DgLexer': ('pip._vendor.pygments.lexer.python', 'dg', ('dg',), ('*.dg',), ('text/x-dg',)), + 'DiffLexer': ('pip._vendor.pygments.lexer.diff', 'Diff', ('diff', 'udiff'), ('*.diff', '*.patch'), ('text/x-diff', 'text/x-patch')), + 'DjangoLexer': ('pip._vendor.pygments.lexer.templates', 'Django/Jinja', ('django', 'jinja'), (), ('application/x-django-templating', 'application/x-jinja')), + 'DockerLexer': ('pip._vendor.pygments.lexer.configs', 'Docker', ('docker', 'dockerfile'), ('Dockerfile', '*.docker'), ('text/x-dockerfile-config',)), + 'DtdLexer': ('pip._vendor.pygments.lexer.html', 'DTD', ('dtd',), ('*.dtd',), ('application/xml-dtd',)), + 'DuelLexer': ('pip._vendor.pygments.lexer.webmisc', 'Duel', ('duel', 'jbst', 'jsonml+bst'), ('*.duel', '*.jbst'), ('text/x-duel', 'text/x-jbst')), + 'DylanConsoleLexer': ('pip._vendor.pygments.lexer.dylan', 'Dylan session', ('dylan-console', 'dylan-repl'), ('*.dylan-console',), ('text/x-dylan-console',)), + 'DylanLexer': ('pip._vendor.pygments.lexer.dylan', 'Dylan', ('dylan',), ('*.dylan', '*.dyl', '*.intr'), ('text/x-dylan',)), + 'DylanLidLexer': ('pip._vendor.pygments.lexer.dylan', 'DylanLID', ('dylan-lid', 'lid'), ('*.lid', '*.hdp'), ('text/x-dylan-lid',)), + 'ECLLexer': ('pip._vendor.pygments.lexer.ecl', 'ECL', ('ecl',), ('*.ecl',), ('application/x-ecl',)), + 'ECLexer': ('pip._vendor.pygments.lexer.c_like', 'eC', ('ec',), ('*.ec', '*.eh'), ('text/x-echdr', 'text/x-ecsrc')), + 'EarlGreyLexer': ('pip._vendor.pygments.lexer.javascript', 'Earl Grey', ('earl-grey', 'earlgrey', 'eg'), ('*.eg',), ('text/x-earl-grey',)), + 'EasytrieveLexer': ('pip._vendor.pygments.lexer.scripting', 'Easytrieve', ('easytrieve',), ('*.ezt', '*.mac'), ('text/x-easytrieve',)), + 'EbnfLexer': ('pip._vendor.pygments.lexer.parsers', 'EBNF', ('ebnf',), ('*.ebnf',), ('text/x-ebnf',)), + 'EiffelLexer': ('pip._vendor.pygments.lexer.eiffel', 'Eiffel', ('eiffel',), ('*.e',), ('text/x-eiffel',)), + 'ElixirConsoleLexer': ('pip._vendor.pygments.lexer.erlang', 'Elixir iex session', ('iex',), (), ('text/x-elixir-shellsession',)), + 'ElixirLexer': ('pip._vendor.pygments.lexer.erlang', 'Elixir', ('elixir', 'ex', 'exs'), ('*.ex', '*.eex', '*.exs', '*.leex'), ('text/x-elixir',)), + 'ElmLexer': ('pip._vendor.pygments.lexer.elm', 'Elm', ('elm',), ('*.elm',), ('text/x-elm',)), + 'EmacsLispLexer': ('pip._vendor.pygments.lexer.lisp', 'EmacsLisp', ('emacs-lisp', 'elisp', 'emacs'), ('*.el',), ('text/x-elisp', 'application/x-elisp')), + 'EmailLexer': ('pip._vendor.pygments.lexer.email', 'E-mail', ('email', 'eml'), ('*.eml',), ('message/rfc822',)), + 'ErbLexer': ('pip._vendor.pygments.lexer.templates', 'ERB', ('erb',), (), ('application/x-ruby-templating',)), + 'ErlangLexer': ('pip._vendor.pygments.lexer.erlang', 'Erlang', ('erlang',), ('*.erl', '*.hrl', '*.es', '*.escript'), ('text/x-erlang',)), + 'ErlangShellLexer': ('pip._vendor.pygments.lexer.erlang', 'Erlang erl session', ('erl',), ('*.erl-sh',), ('text/x-erl-shellsession',)), + 'EvoqueHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Evoque', ('html+evoque',), ('*.html',), ('text/html+evoque',)), + 'EvoqueLexer': ('pip._vendor.pygments.lexer.templates', 'Evoque', ('evoque',), ('*.evoque',), ('application/x-evoque',)), + 'EvoqueXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Evoque', ('xml+evoque',), ('*.xml',), ('application/xml+evoque',)), + 'ExeclineLexer': ('pip._vendor.pygments.lexer.shell', 'execline', ('execline',), ('*.exec',), ()), + 'EzhilLexer': ('pip._vendor.pygments.lexer.ezhil', 'Ezhil', ('ezhil',), ('*.n',), ('text/x-ezhil',)), + 'FSharpLexer': ('pip._vendor.pygments.lexer.dotnet', 'F#', ('fsharp', 'f#'), ('*.fs', '*.fsi'), ('text/x-fsharp',)), + 'FStarLexer': ('pip._vendor.pygments.lexer.ml', 'FStar', ('fstar',), ('*.fst', '*.fsti'), ('text/x-fstar',)), + 'FactorLexer': ('pip._vendor.pygments.lexer.factor', 'Factor', ('factor',), ('*.factor',), ('text/x-factor',)), + 'FancyLexer': ('pip._vendor.pygments.lexer.ruby', 'Fancy', ('fancy', 'fy'), ('*.fy', '*.fancypack'), ('text/x-fancysrc',)), + 'FantomLexer': ('pip._vendor.pygments.lexer.fantom', 'Fantom', ('fan',), ('*.fan',), ('application/x-fantom',)), + 'FelixLexer': ('pip._vendor.pygments.lexer.felix', 'Felix', ('felix', 'flx'), ('*.flx', '*.flxh'), ('text/x-felix',)), + 'FennelLexer': ('pip._vendor.pygments.lexer.lisp', 'Fennel', ('fennel', 'fnl'), ('*.fnl',), ()), + 'FishShellLexer': ('pip._vendor.pygments.lexer.shell', 'Fish', ('fish', 'fishshell'), ('*.fish', '*.load'), ('application/x-fish',)), + 'FlatlineLexer': ('pip._vendor.pygments.lexer.dsls', 'Flatline', ('flatline',), (), ('text/x-flatline',)), + 'FloScriptLexer': ('pip._vendor.pygments.lexer.floscript', 'FloScript', ('floscript', 'flo'), ('*.flo',), ()), + 'ForthLexer': ('pip._vendor.pygments.lexer.forth', 'Forth', ('forth',), ('*.frt', '*.fs'), ('application/x-forth',)), + 'FortranFixedLexer': ('pip._vendor.pygments.lexer.fortran', 'FortranFixed', ('fortranfixed',), ('*.f', '*.F'), ()), + 'FortranLexer': ('pip._vendor.pygments.lexer.fortran', 'Fortran', ('fortran',), ('*.f03', '*.f90', '*.F03', '*.F90'), ('text/x-fortran',)), + 'FoxProLexer': ('pip._vendor.pygments.lexer.foxpro', 'FoxPro', ('foxpro', 'vfp', 'clipper', 'xbase'), ('*.PRG', '*.prg'), ()), + 'FreeFemLexer': ('pip._vendor.pygments.lexer.freefem', 'Freefem', ('freefem',), ('*.edp',), ('text/x-freefem',)), + 'FutharkLexer': ('pip._vendor.pygments.lexer.futhark', 'Futhark', ('futhark',), ('*.fut',), ('text/x-futhark',)), + 'GAPLexer': ('pip._vendor.pygments.lexer.algebra', 'GAP', ('gap',), ('*.g', '*.gd', '*.gi', '*.gap'), ()), + 'GDScriptLexer': ('pip._vendor.pygments.lexer.gdscript', 'GDScript', ('gdscript', 'gd'), ('*.gd',), ('text/x-gdscript', 'application/x-gdscript')), + 'GLShaderLexer': ('pip._vendor.pygments.lexer.graphics', 'GLSL', ('glsl',), ('*.vert', '*.frag', '*.geo'), ('text/x-glslsrc',)), + 'GSQLLexer': ('pip._vendor.pygments.lexer.gsql', 'GSQL', ('gsql',), ('*.gsql',), ()), + 'GasLexer': ('pip._vendor.pygments.lexer.asm', 'GAS', ('gas', 'asm'), ('*.s', '*.S'), ('text/x-gas',)), + 'GcodeLexer': ('pip._vendor.pygments.lexer.gcodelexer', 'g-code', ('gcode',), ('*.gcode',), ()), + 'GenshiLexer': ('pip._vendor.pygments.lexer.templates', 'Genshi', ('genshi', 'kid', 'xml+genshi', 'xml+kid'), ('*.kid',), ('application/x-genshi', 'application/x-kid')), + 'GenshiTextLexer': ('pip._vendor.pygments.lexer.templates', 'Genshi Text', ('genshitext',), (), ('application/x-genshi-text', 'text/x-genshi')), + 'GettextLexer': ('pip._vendor.pygments.lexer.textfmts', 'Gettext Catalog', ('pot', 'po'), ('*.pot', '*.po'), ('application/x-gettext', 'text/x-gettext', 'text/gettext')), + 'GherkinLexer': ('pip._vendor.pygments.lexer.testing', 'Gherkin', ('gherkin', 'cucumber'), ('*.feature',), ('text/x-gherkin',)), + 'GnuplotLexer': ('pip._vendor.pygments.lexer.graphics', 'Gnuplot', ('gnuplot',), ('*.plot', '*.plt'), ('text/x-gnuplot',)), + 'GoLexer': ('pip._vendor.pygments.lexer.go', 'Go', ('go', 'golang'), ('*.go',), ('text/x-gosrc',)), + 'GoloLexer': ('pip._vendor.pygments.lexer.jvm', 'Golo', ('golo',), ('*.golo',), ()), + 'GoodDataCLLexer': ('pip._vendor.pygments.lexer.business', 'GoodData-CL', ('gooddata-cl',), ('*.gdc',), ('text/x-gooddata-cl',)), + 'GosuLexer': ('pip._vendor.pygments.lexer.jvm', 'Gosu', ('gosu',), ('*.gs', '*.gsx', '*.gsp', '*.vark'), ('text/x-gosu',)), + 'GosuTemplateLexer': ('pip._vendor.pygments.lexer.jvm', 'Gosu Template', ('gst',), ('*.gst',), ('text/x-gosu-template',)), + 'GraphvizLexer': ('pip._vendor.pygments.lexer.graphviz', 'Graphviz', ('graphviz', 'dot'), ('*.gv', '*.dot'), ('text/x-graphviz', 'text/vnd.graphviz')), + 'GroffLexer': ('pip._vendor.pygments.lexer.markup', 'Groff', ('groff', 'nroff', 'man'), ('*.[1234567]', '*.man'), ('application/x-troff', 'text/troff')), + 'GroovyLexer': ('pip._vendor.pygments.lexer.jvm', 'Groovy', ('groovy',), ('*.groovy', '*.gradle'), ('text/x-groovy',)), + 'HLSLShaderLexer': ('pip._vendor.pygments.lexer.graphics', 'HLSL', ('hlsl',), ('*.hlsl', '*.hlsli'), ('text/x-hlsl',)), + 'HamlLexer': ('pip._vendor.pygments.lexer.html', 'Haml', ('haml',), ('*.haml',), ('text/x-haml',)), + 'HandlebarsHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Handlebars', ('html+handlebars',), ('*.handlebars', '*.hbs'), ('text/html+handlebars', 'text/x-handlebars-template')), + 'HandlebarsLexer': ('pip._vendor.pygments.lexer.templates', 'Handlebars', ('handlebars',), (), ()), + 'HaskellLexer': ('pip._vendor.pygments.lexer.haskell', 'Haskell', ('haskell', 'hs'), ('*.hs',), ('text/x-haskell',)), + 'HaxeLexer': ('pip._vendor.pygments.lexer.haxe', 'Haxe', ('haxe', 'hxsl', 'hx'), ('*.hx', '*.hxsl'), ('text/haxe', 'text/x-haxe', 'text/x-hx')), + 'HexdumpLexer': ('pip._vendor.pygments.lexer.hexdump', 'Hexdump', ('hexdump',), (), ()), + 'HsailLexer': ('pip._vendor.pygments.lexer.asm', 'HSAIL', ('hsail', 'hsa'), ('*.hsail',), ('text/x-hsail',)), + 'HspecLexer': ('pip._vendor.pygments.lexer.haskell', 'Hspec', ('hspec',), (), ()), + 'HtmlDjangoLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Django/Jinja', ('html+django', 'html+jinja', 'htmldjango'), (), ('text/html+django', 'text/html+jinja')), + 'HtmlGenshiLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Genshi', ('html+genshi', 'html+kid'), (), ('text/html+genshi',)), + 'HtmlLexer': ('pip._vendor.pygments.lexer.html', 'HTML', ('html',), ('*.html', '*.htm', '*.xhtml', '*.xslt'), ('text/html', 'application/xhtml+xml')), + 'HtmlPhpLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+PHP', ('html+php',), ('*.phtml',), ('application/x-php', 'application/x-httpd-php', 'application/x-httpd-php3', 'application/x-httpd-php4', 'application/x-httpd-php5')), + 'HtmlSmartyLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Smarty', ('html+smarty',), (), ('text/html+smarty',)), + 'HttpLexer': ('pip._vendor.pygments.lexer.textfmts', 'HTTP', ('http',), (), ()), + 'HxmlLexer': ('pip._vendor.pygments.lexer.haxe', 'Hxml', ('haxeml', 'hxml'), ('*.hxml',), ()), + 'HyLexer': ('pip._vendor.pygments.lexer.lisp', 'Hy', ('hylang',), ('*.hy',), ('text/x-hy', 'application/x-hy')), + 'HybrisLexer': ('pip._vendor.pygments.lexer.scripting', 'Hybris', ('hybris', 'hy'), ('*.hy', '*.hyb'), ('text/x-hybris', 'application/x-hybris')), + 'IDLLexer': ('pip._vendor.pygments.lexer.idl', 'IDL', ('idl',), ('*.pro',), ('text/idl',)), + 'IconLexer': ('pip._vendor.pygments.lexer.unicon', 'Icon', ('icon',), ('*.icon', '*.ICON'), ()), + 'IdrisLexer': ('pip._vendor.pygments.lexer.haskell', 'Idris', ('idris', 'idr'), ('*.idr',), ('text/x-idris',)), + 'IgorLexer': ('pip._vendor.pygments.lexer.igor', 'Igor', ('igor', 'igorpro'), ('*.ipf',), ('text/ipf',)), + 'Inform6Lexer': ('pip._vendor.pygments.lexer.int_fiction', 'Inform 6', ('inform6', 'i6'), ('*.inf',), ()), + 'Inform6TemplateLexer': ('pip._vendor.pygments.lexer.int_fiction', 'Inform 6 template', ('i6t',), ('*.i6t',), ()), + 'Inform7Lexer': ('pip._vendor.pygments.lexer.int_fiction', 'Inform 7', ('inform7', 'i7'), ('*.ni', '*.i7x'), ()), + 'IniLexer': ('pip._vendor.pygments.lexer.configs', 'INI', ('ini', 'cfg', 'dosini'), ('*.ini', '*.cfg', '*.inf', '*.service', '*.socket', '*.device', '*.mount', '*.automount', '*.swap', '*.target', '*.path', '*.timer', '*.slice', '*.scope'), ('text/x-ini', 'text/inf')), + 'IoLexer': ('pip._vendor.pygments.lexer.iolang', 'Io', ('io',), ('*.io',), ('text/x-iosrc',)), + 'IokeLexer': ('pip._vendor.pygments.lexer.jvm', 'Ioke', ('ioke', 'ik'), ('*.ik',), ('text/x-iokesrc',)), + 'IrcLogsLexer': ('pip._vendor.pygments.lexer.textfmts', 'IRC logs', ('irc',), ('*.weechatlog',), ('text/x-irclog',)), + 'IsabelleLexer': ('pip._vendor.pygments.lexer.theorem', 'Isabelle', ('isabelle',), ('*.thy',), ('text/x-isabelle',)), + 'JLexer': ('pip._vendor.pygments.lexer.j', 'J', ('j',), ('*.ijs',), ('text/x-j',)), + 'JSLTLexer': ('pip._vendor.pygments.lexer.jslt', 'JSLT', ('jslt',), ('*.jslt',), ('text/x-jslt',)), + 'JagsLexer': ('pip._vendor.pygments.lexer.modeling', 'JAGS', ('jags',), ('*.jag', '*.bug'), ()), + 'JasminLexer': ('pip._vendor.pygments.lexer.jvm', 'Jasmin', ('jasmin', 'jasminxt'), ('*.j',), ()), + 'JavaLexer': ('pip._vendor.pygments.lexer.jvm', 'Java', ('java',), ('*.java',), ('text/x-java',)), + 'JavascriptDjangoLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Django/Jinja', ('javascript+django', 'js+django', 'javascript+jinja', 'js+jinja'), (), ('application/x-javascript+django', 'application/x-javascript+jinja', 'text/x-javascript+django', 'text/x-javascript+jinja', 'text/javascript+django', 'text/javascript+jinja')), + 'JavascriptErbLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Ruby', ('javascript+ruby', 'js+ruby', 'javascript+erb', 'js+erb'), (), ('application/x-javascript+ruby', 'text/x-javascript+ruby', 'text/javascript+ruby')), + 'JavascriptGenshiLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Genshi Text', ('js+genshitext', 'js+genshi', 'javascript+genshitext', 'javascript+genshi'), (), ('application/x-javascript+genshi', 'text/x-javascript+genshi', 'text/javascript+genshi')), + 'JavascriptLexer': ('pip._vendor.pygments.lexer.javascript', 'JavaScript', ('javascript', 'js'), ('*.js', '*.jsm', '*.mjs', '*.cjs'), ('application/javascript', 'application/x-javascript', 'text/x-javascript', 'text/javascript')), + 'JavascriptPhpLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+PHP', ('javascript+php', 'js+php'), (), ('application/x-javascript+php', 'text/x-javascript+php', 'text/javascript+php')), + 'JavascriptSmartyLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Smarty', ('javascript+smarty', 'js+smarty'), (), ('application/x-javascript+smarty', 'text/x-javascript+smarty', 'text/javascript+smarty')), + 'JclLexer': ('pip._vendor.pygments.lexer.scripting', 'JCL', ('jcl',), ('*.jcl',), ('text/x-jcl',)), + 'JsgfLexer': ('pip._vendor.pygments.lexer.grammar_notation', 'JSGF', ('jsgf',), ('*.jsgf',), ('application/jsgf', 'application/x-jsgf', 'text/jsgf')), + 'JsonBareObjectLexer': ('pip._vendor.pygments.lexer.data', 'JSONBareObject', (), (), ()), + 'JsonLdLexer': ('pip._vendor.pygments.lexer.data', 'JSON-LD', ('jsonld', 'json-ld'), ('*.jsonld',), ('application/ld+json',)), + 'JsonLexer': ('pip._vendor.pygments.lexer.data', 'JSON', ('json', 'json-object'), ('*.json', 'Pipfile.lock'), ('application/json', 'application/json-object')), + 'JspLexer': ('pip._vendor.pygments.lexer.templates', 'Java Server Page', ('jsp',), ('*.jsp',), ('application/x-jsp',)), + 'JuliaConsoleLexer': ('pip._vendor.pygments.lexer.julia', 'Julia console', ('jlcon', 'julia-repl'), (), ()), + 'JuliaLexer': ('pip._vendor.pygments.lexer.julia', 'Julia', ('julia', 'jl'), ('*.jl',), ('text/x-julia', 'application/x-julia')), + 'JuttleLexer': ('pip._vendor.pygments.lexer.javascript', 'Juttle', ('juttle',), ('*.juttle',), ('application/juttle', 'application/x-juttle', 'text/x-juttle', 'text/juttle')), + 'KalLexer': ('pip._vendor.pygments.lexer.javascript', 'Kal', ('kal',), ('*.kal',), ('text/kal', 'application/kal')), + 'KconfigLexer': ('pip._vendor.pygments.lexer.configs', 'Kconfig', ('kconfig', 'menuconfig', 'linux-config', 'kernel-config'), ('Kconfig*', '*Config.in*', 'external.in*', 'standard-modules.in'), ('text/x-kconfig',)), + 'KernelLogLexer': ('pip._vendor.pygments.lexer.textfmts', 'Kernel log', ('kmsg', 'dmesg'), ('*.kmsg', '*.dmesg'), ()), + 'KokaLexer': ('pip._vendor.pygments.lexer.haskell', 'Koka', ('koka',), ('*.kk', '*.kki'), ('text/x-koka',)), + 'KotlinLexer': ('pip._vendor.pygments.lexer.jvm', 'Kotlin', ('kotlin',), ('*.kt', '*.kts'), ('text/x-kotlin',)), + 'KuinLexer': ('pip._vendor.pygments.lexer.kuin', 'Kuin', ('kuin',), ('*.kn',), ()), + 'LSLLexer': ('pip._vendor.pygments.lexer.scripting', 'LSL', ('lsl',), ('*.lsl',), ('text/x-lsl',)), + 'LassoCssLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Lasso', ('css+lasso',), (), ('text/css+lasso',)), + 'LassoHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Lasso', ('html+lasso',), (), ('text/html+lasso', 'application/x-httpd-lasso', 'application/x-httpd-lasso[89]')), + 'LassoJavascriptLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Lasso', ('javascript+lasso', 'js+lasso'), (), ('application/x-javascript+lasso', 'text/x-javascript+lasso', 'text/javascript+lasso')), + 'LassoLexer': ('pip._vendor.pygments.lexer.javascript', 'Lasso', ('lasso', 'lassoscript'), ('*.lasso', '*.lasso[89]'), ('text/x-lasso',)), + 'LassoXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Lasso', ('xml+lasso',), (), ('application/xml+lasso',)), + 'LeanLexer': ('pip._vendor.pygments.lexer.theorem', 'Lean', ('lean',), ('*.lean',), ('text/x-lean',)), + 'LessCssLexer': ('pip._vendor.pygments.lexer.css', 'LessCss', ('less',), ('*.less',), ('text/x-less-css',)), + 'LighttpdConfLexer': ('pip._vendor.pygments.lexer.configs', 'Lighttpd configuration file', ('lighttpd', 'lighty'), ('lighttpd.conf',), ('text/x-lighttpd-conf',)), + 'LimboLexer': ('pip._vendor.pygments.lexer.inferno', 'Limbo', ('limbo',), ('*.b',), ('text/limbo',)), + 'LiquidLexer': ('pip._vendor.pygments.lexer.templates', 'liquid', ('liquid',), ('*.liquid',), ()), + 'LiterateAgdaLexer': ('pip._vendor.pygments.lexer.haskell', 'Literate Agda', ('literate-agda', 'lagda'), ('*.lagda',), ('text/x-literate-agda',)), + 'LiterateCryptolLexer': ('pip._vendor.pygments.lexer.haskell', 'Literate Cryptol', ('literate-cryptol', 'lcryptol', 'lcry'), ('*.lcry',), ('text/x-literate-cryptol',)), + 'LiterateHaskellLexer': ('pip._vendor.pygments.lexer.haskell', 'Literate Haskell', ('literate-haskell', 'lhaskell', 'lhs'), ('*.lhs',), ('text/x-literate-haskell',)), + 'LiterateIdrisLexer': ('pip._vendor.pygments.lexer.haskell', 'Literate Idris', ('literate-idris', 'lidris', 'lidr'), ('*.lidr',), ('text/x-literate-idris',)), + 'LiveScriptLexer': ('pip._vendor.pygments.lexer.javascript', 'LiveScript', ('livescript', 'live-script'), ('*.ls',), ('text/livescript',)), + 'LlvmLexer': ('pip._vendor.pygments.lexer.asm', 'LLVM', ('llvm',), ('*.ll',), ('text/x-llvm',)), + 'LlvmMirBodyLexer': ('pip._vendor.pygments.lexer.asm', 'LLVM-MIR Body', ('llvm-mir-body',), (), ()), + 'LlvmMirLexer': ('pip._vendor.pygments.lexer.asm', 'LLVM-MIR', ('llvm-mir',), ('*.mir',), ()), + 'LogosLexer': ('pip._vendor.pygments.lexer.objective', 'Logos', ('logos',), ('*.x', '*.xi', '*.xm', '*.xmi'), ('text/x-logos',)), + 'LogtalkLexer': ('pip._vendor.pygments.lexer.prolog', 'Logtalk', ('logtalk',), ('*.lgt', '*.logtalk'), ('text/x-logtalk',)), + 'LuaLexer': ('pip._vendor.pygments.lexer.scripting', 'Lua', ('lua',), ('*.lua', '*.wlua'), ('text/x-lua', 'application/x-lua')), + 'MIMELexer': ('pip._vendor.pygments.lexer.mime', 'MIME', ('mime',), (), ('multipart/mixed', 'multipart/related', 'multipart/alternative')), + 'MOOCodeLexer': ('pip._vendor.pygments.lexer.scripting', 'MOOCode', ('moocode', 'moo'), ('*.moo',), ('text/x-moocode',)), + 'MSDOSSessionLexer': ('pip._vendor.pygments.lexer.shell', 'MSDOS Session', ('doscon',), (), ()), + 'MakefileLexer': ('pip._vendor.pygments.lexer.make', 'Makefile', ('make', 'makefile', 'mf', 'bsdmake'), ('*.mak', '*.mk', 'Makefile', 'makefile', 'Makefile.*', 'GNUmakefile'), ('text/x-makefile',)), + 'MakoCssLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Mako', ('css+mako',), (), ('text/css+mako',)), + 'MakoHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Mako', ('html+mako',), (), ('text/html+mako',)), + 'MakoJavascriptLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Mako', ('javascript+mako', 'js+mako'), (), ('application/x-javascript+mako', 'text/x-javascript+mako', 'text/javascript+mako')), + 'MakoLexer': ('pip._vendor.pygments.lexer.templates', 'Mako', ('mako',), ('*.mao',), ('application/x-mako',)), + 'MakoXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Mako', ('xml+mako',), (), ('application/xml+mako',)), + 'MaqlLexer': ('pip._vendor.pygments.lexer.business', 'MAQL', ('maql',), ('*.maql',), ('text/x-gooddata-maql', 'application/x-gooddata-maql')), + 'MarkdownLexer': ('pip._vendor.pygments.lexer.markup', 'Markdown', ('markdown', 'md'), ('*.md', '*.markdown'), ('text/x-markdown',)), + 'MaskLexer': ('pip._vendor.pygments.lexer.javascript', 'Mask', ('mask',), ('*.mask',), ('text/x-mask',)), + 'MasonLexer': ('pip._vendor.pygments.lexer.templates', 'Mason', ('mason',), ('*.m', '*.mhtml', '*.mc', '*.mi', 'autohandler', 'dhandler'), ('application/x-mason',)), + 'MathematicaLexer': ('pip._vendor.pygments.lexer.algebra', 'Mathematica', ('mathematica', 'mma', 'nb'), ('*.nb', '*.cdf', '*.nbp', '*.ma'), ('application/mathematica', 'application/vnd.wolfram.mathematica', 'application/vnd.wolfram.mathematica.package', 'application/vnd.wolfram.cdf')), + 'MatlabLexer': ('pip._vendor.pygments.lexer.matlab', 'Matlab', ('matlab',), ('*.m',), ('text/matlab',)), + 'MatlabSessionLexer': ('pip._vendor.pygments.lexer.matlab', 'Matlab session', ('matlabsession',), (), ()), + 'MesonLexer': ('pip._vendor.pygments.lexer.meson', 'Meson', ('meson', 'meson.build'), ('meson.build', 'meson_options.txt'), ('text/x-meson',)), + 'MiniDLexer': ('pip._vendor.pygments.lexer.d', 'MiniD', ('minid',), (), ('text/x-minidsrc',)), + 'MiniScriptLexer': ('pip._vendor.pygments.lexer.scripting', 'MiniScript', ('miniscript', 'ms'), ('*.ms',), ('text/x-minicript', 'application/x-miniscript')), + 'ModelicaLexer': ('pip._vendor.pygments.lexer.modeling', 'Modelica', ('modelica',), ('*.mo',), ('text/x-modelica',)), + 'Modula2Lexer': ('pip._vendor.pygments.lexer.modula2', 'Modula-2', ('modula2', 'm2'), ('*.def', '*.mod'), ('text/x-modula2',)), + 'MoinWikiLexer': ('pip._vendor.pygments.lexer.markup', 'MoinMoin/Trac Wiki markup', ('trac-wiki', 'moin'), (), ('text/x-trac-wiki',)), + 'MonkeyLexer': ('pip._vendor.pygments.lexer.basic', 'Monkey', ('monkey',), ('*.monkey',), ('text/x-monkey',)), + 'MonteLexer': ('pip._vendor.pygments.lexer.monte', 'Monte', ('monte',), ('*.mt',), ()), + 'MoonScriptLexer': ('pip._vendor.pygments.lexer.scripting', 'MoonScript', ('moonscript', 'moon'), ('*.moon',), ('text/x-moonscript', 'application/x-moonscript')), + 'MoselLexer': ('pip._vendor.pygments.lexer.mosel', 'Mosel', ('mosel',), ('*.mos',), ()), + 'MozPreprocCssLexer': ('pip._vendor.pygments.lexer.markup', 'CSS+mozpreproc', ('css+mozpreproc',), ('*.css.in',), ()), + 'MozPreprocHashLexer': ('pip._vendor.pygments.lexer.markup', 'mozhashpreproc', ('mozhashpreproc',), (), ()), + 'MozPreprocJavascriptLexer': ('pip._vendor.pygments.lexer.markup', 'Javascript+mozpreproc', ('javascript+mozpreproc',), ('*.js.in',), ()), + 'MozPreprocPercentLexer': ('pip._vendor.pygments.lexer.markup', 'mozpercentpreproc', ('mozpercentpreproc',), (), ()), + 'MozPreprocXulLexer': ('pip._vendor.pygments.lexer.markup', 'XUL+mozpreproc', ('xul+mozpreproc',), ('*.xul.in',), ()), + 'MqlLexer': ('pip._vendor.pygments.lexer.c_like', 'MQL', ('mql', 'mq4', 'mq5', 'mql4', 'mql5'), ('*.mq4', '*.mq5', '*.mqh'), ('text/x-mql',)), + 'MscgenLexer': ('pip._vendor.pygments.lexer.dsls', 'Mscgen', ('mscgen', 'msc'), ('*.msc',), ()), + 'MuPADLexer': ('pip._vendor.pygments.lexer.algebra', 'MuPAD', ('mupad',), ('*.mu',), ()), + 'MxmlLexer': ('pip._vendor.pygments.lexer.actionscript', 'MXML', ('mxml',), ('*.mxml',), ()), + 'MySqlLexer': ('pip._vendor.pygments.lexer.sql', 'MySQL', ('mysql',), (), ('text/x-mysql',)), + 'MyghtyCssLexer': ('pip._vendor.pygments.lexer.templates', 'CSS+Myghty', ('css+myghty',), (), ('text/css+myghty',)), + 'MyghtyHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Myghty', ('html+myghty',), (), ('text/html+myghty',)), + 'MyghtyJavascriptLexer': ('pip._vendor.pygments.lexer.templates', 'JavaScript+Myghty', ('javascript+myghty', 'js+myghty'), (), ('application/x-javascript+myghty', 'text/x-javascript+myghty', 'text/javascript+mygthy')), + 'MyghtyLexer': ('pip._vendor.pygments.lexer.templates', 'Myghty', ('myghty',), ('*.myt', 'autodelegate'), ('application/x-myghty',)), + 'MyghtyXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Myghty', ('xml+myghty',), (), ('application/xml+myghty',)), + 'NCLLexer': ('pip._vendor.pygments.lexer.ncl', 'NCL', ('ncl',), ('*.ncl',), ('text/ncl',)), + 'NSISLexer': ('pip._vendor.pygments.lexer.installers', 'NSIS', ('nsis', 'nsi', 'nsh'), ('*.nsi', '*.nsh'), ('text/x-nsis',)), + 'NasmLexer': ('pip._vendor.pygments.lexer.asm', 'NASM', ('nasm',), ('*.asm', '*.ASM'), ('text/x-nasm',)), + 'NasmObjdumpLexer': ('pip._vendor.pygments.lexer.asm', 'objdump-nasm', ('objdump-nasm',), ('*.objdump-intel',), ('text/x-nasm-objdump',)), + 'NemerleLexer': ('pip._vendor.pygments.lexer.dotnet', 'Nemerle', ('nemerle',), ('*.n',), ('text/x-nemerle',)), + 'NesCLexer': ('pip._vendor.pygments.lexer.c_like', 'nesC', ('nesc',), ('*.nc',), ('text/x-nescsrc',)), + 'NestedTextLexer': ('pip._vendor.pygments.lexer.configs', 'NestedText', ('nestedtext', 'nt'), ('*.nt',), ()), + 'NewLispLexer': ('pip._vendor.pygments.lexer.lisp', 'NewLisp', ('newlisp',), ('*.lsp', '*.nl', '*.kif'), ('text/x-newlisp', 'application/x-newlisp')), + 'NewspeakLexer': ('pip._vendor.pygments.lexer.smalltalk', 'Newspeak', ('newspeak',), ('*.ns2',), ('text/x-newspeak',)), + 'NginxConfLexer': ('pip._vendor.pygments.lexer.configs', 'Nginx configuration file', ('nginx',), ('nginx.conf',), ('text/x-nginx-conf',)), + 'NimrodLexer': ('pip._vendor.pygments.lexer.nimrod', 'Nimrod', ('nimrod', 'nim'), ('*.nim', '*.nimrod'), ('text/x-nim',)), + 'NitLexer': ('pip._vendor.pygments.lexer.nit', 'Nit', ('nit',), ('*.nit',), ()), + 'NixLexer': ('pip._vendor.pygments.lexer.nix', 'Nix', ('nixos', 'nix'), ('*.nix',), ('text/x-nix',)), + 'NodeConsoleLexer': ('pip._vendor.pygments.lexer.javascript', 'Node.js REPL console session', ('nodejsrepl',), (), ('text/x-nodejsrepl',)), + 'NotmuchLexer': ('pip._vendor.pygments.lexer.textfmts', 'Notmuch', ('notmuch',), (), ()), + 'NuSMVLexer': ('pip._vendor.pygments.lexer.smv', 'NuSMV', ('nusmv',), ('*.smv',), ()), + 'NumPyLexer': ('pip._vendor.pygments.lexer.python', 'NumPy', ('numpy',), (), ()), + 'ObjdumpLexer': ('pip._vendor.pygments.lexer.asm', 'objdump', ('objdump',), ('*.objdump',), ('text/x-objdump',)), + 'ObjectiveCLexer': ('pip._vendor.pygments.lexer.objective', 'Objective-C', ('objective-c', 'objectivec', 'obj-c', 'objc'), ('*.m', '*.h'), ('text/x-objective-c',)), + 'ObjectiveCppLexer': ('pip._vendor.pygments.lexer.objective', 'Objective-C++', ('objective-c++', 'objectivec++', 'obj-c++', 'objc++'), ('*.mm', '*.hh'), ('text/x-objective-c++',)), + 'ObjectiveJLexer': ('pip._vendor.pygments.lexer.javascript', 'Objective-J', ('objective-j', 'objectivej', 'obj-j', 'objj'), ('*.j',), ('text/x-objective-j',)), + 'OcamlLexer': ('pip._vendor.pygments.lexer.ml', 'OCaml', ('ocaml',), ('*.ml', '*.mli', '*.mll', '*.mly'), ('text/x-ocaml',)), + 'OctaveLexer': ('pip._vendor.pygments.lexer.matlab', 'Octave', ('octave',), ('*.m',), ('text/octave',)), + 'OdinLexer': ('pip._vendor.pygments.lexer.archetype', 'ODIN', ('odin',), ('*.odin',), ('text/odin',)), + 'OmgIdlLexer': ('pip._vendor.pygments.lexer.c_like', 'OMG Interface Definition Language', ('omg-idl',), ('*.idl', '*.pidl'), ()), + 'OocLexer': ('pip._vendor.pygments.lexer.ooc', 'Ooc', ('ooc',), ('*.ooc',), ('text/x-ooc',)), + 'OpaLexer': ('pip._vendor.pygments.lexer.ml', 'Opa', ('opa',), ('*.opa',), ('text/x-opa',)), + 'OpenEdgeLexer': ('pip._vendor.pygments.lexer.business', 'OpenEdge ABL', ('openedge', 'abl', 'progress'), ('*.p', '*.cls'), ('text/x-openedge', 'application/x-openedge')), + 'OutputLexer': ('pip._vendor.pygments.lexer.special', 'Text output', ('output',), (), ()), + 'PacmanConfLexer': ('pip._vendor.pygments.lexer.configs', 'PacmanConf', ('pacmanconf',), ('pacman.conf',), ()), + 'PanLexer': ('pip._vendor.pygments.lexer.dsls', 'Pan', ('pan',), ('*.pan',), ()), + 'ParaSailLexer': ('pip._vendor.pygments.lexer.parasail', 'ParaSail', ('parasail',), ('*.psi', '*.psl'), ('text/x-parasail',)), + 'PawnLexer': ('pip._vendor.pygments.lexer.pawn', 'Pawn', ('pawn',), ('*.p', '*.pwn', '*.inc'), ('text/x-pawn',)), + 'PegLexer': ('pip._vendor.pygments.lexer.grammar_notation', 'PEG', ('peg',), ('*.peg',), ('text/x-peg',)), + 'Perl6Lexer': ('pip._vendor.pygments.lexer.perl', 'Perl6', ('perl6', 'pl6', 'raku'), ('*.pl', '*.pm', '*.nqp', '*.p6', '*.6pl', '*.p6l', '*.pl6', '*.6pm', '*.p6m', '*.pm6', '*.t', '*.raku', '*.rakumod', '*.rakutest', '*.rakudoc'), ('text/x-perl6', 'application/x-perl6')), + 'PerlLexer': ('pip._vendor.pygments.lexer.perl', 'Perl', ('perl', 'pl'), ('*.pl', '*.pm', '*.t', '*.perl'), ('text/x-perl', 'application/x-perl')), + 'PhpLexer': ('pip._vendor.pygments.lexer.php', 'PHP', ('php', 'php3', 'php4', 'php5'), ('*.php', '*.php[345]', '*.inc'), ('text/x-php',)), + 'PigLexer': ('pip._vendor.pygments.lexer.jvm', 'Pig', ('pig',), ('*.pig',), ('text/x-pig',)), + 'PikeLexer': ('pip._vendor.pygments.lexer.c_like', 'Pike', ('pike',), ('*.pike', '*.pmod'), ('text/x-pike',)), + 'PkgConfigLexer': ('pip._vendor.pygments.lexer.configs', 'PkgConfig', ('pkgconfig',), ('*.pc',), ()), + 'PlPgsqlLexer': ('pip._vendor.pygments.lexer.sql', 'PL/pgSQL', ('plpgsql',), (), ('text/x-plpgsql',)), + 'PointlessLexer': ('pip._vendor.pygments.lexer.pointless', 'Pointless', ('pointless',), ('*.ptls',), ()), + 'PonyLexer': ('pip._vendor.pygments.lexer.pony', 'Pony', ('pony',), ('*.pony',), ()), + 'PostScriptLexer': ('pip._vendor.pygments.lexer.graphics', 'PostScript', ('postscript', 'postscr'), ('*.ps', '*.eps'), ('application/postscript',)), + 'PostgresConsoleLexer': ('pip._vendor.pygments.lexer.sql', 'PostgreSQL console (psql)', ('psql', 'postgresql-console', 'postgres-console'), (), ('text/x-postgresql-psql',)), + 'PostgresLexer': ('pip._vendor.pygments.lexer.sql', 'PostgreSQL SQL dialect', ('postgresql', 'postgres'), (), ('text/x-postgresql',)), + 'PovrayLexer': ('pip._vendor.pygments.lexer.graphics', 'POVRay', ('pov',), ('*.pov', '*.inc'), ('text/x-povray',)), + 'PowerShellLexer': ('pip._vendor.pygments.lexer.shell', 'PowerShell', ('powershell', 'pwsh', 'posh', 'ps1', 'psm1'), ('*.ps1', '*.psm1'), ('text/x-powershell',)), + 'PowerShellSessionLexer': ('pip._vendor.pygments.lexer.shell', 'PowerShell Session', ('pwsh-session', 'ps1con'), (), ()), + 'PraatLexer': ('pip._vendor.pygments.lexer.praat', 'Praat', ('praat',), ('*.praat', '*.proc', '*.psc'), ()), + 'ProcfileLexer': ('pip._vendor.pygments.lexer.procfile', 'Procfile', ('procfile',), ('Procfile',), ()), + 'PrologLexer': ('pip._vendor.pygments.lexer.prolog', 'Prolog', ('prolog',), ('*.ecl', '*.prolog', '*.pro', '*.pl'), ('text/x-prolog',)), + 'PromQLLexer': ('pip._vendor.pygments.lexer.promql', 'PromQL', ('promql',), ('*.promql',), ()), + 'PropertiesLexer': ('pip._vendor.pygments.lexer.configs', 'Properties', ('properties', 'jproperties'), ('*.properties',), ('text/x-java-properties',)), + 'ProtoBufLexer': ('pip._vendor.pygments.lexer.dsls', 'Protocol Buffer', ('protobuf', 'proto'), ('*.proto',), ()), + 'PsyshConsoleLexer': ('pip._vendor.pygments.lexer.php', 'PsySH console session for PHP', ('psysh',), (), ()), + 'PugLexer': ('pip._vendor.pygments.lexer.html', 'Pug', ('pug', 'jade'), ('*.pug', '*.jade'), ('text/x-pug', 'text/x-jade')), + 'PuppetLexer': ('pip._vendor.pygments.lexer.dsls', 'Puppet', ('puppet',), ('*.pp',), ()), + 'PyPyLogLexer': ('pip._vendor.pygments.lexer.console', 'PyPy Log', ('pypylog', 'pypy'), ('*.pypylog',), ('application/x-pypylog',)), + 'Python2Lexer': ('pip._vendor.pygments.lexer.python', 'Python 2.x', ('python2', 'py2'), (), ('text/x-python2', 'application/x-python2')), + 'Python2TracebackLexer': ('pip._vendor.pygments.lexer.python', 'Python 2.x Traceback', ('py2tb',), ('*.py2tb',), ('text/x-python2-traceback',)), + 'PythonConsoleLexer': ('pip._vendor.pygments.lexer.python', 'Python console session', ('pycon',), (), ('text/x-python-doctest',)), + 'PythonLexer': ('pip._vendor.pygments.lexer.python', 'Python', ('python', 'py', 'sage', 'python3', 'py3'), ('*.py', '*.pyw', '*.jy', '*.sage', '*.sc', 'SConstruct', 'SConscript', '*.bzl', 'BUCK', 'BUILD', 'BUILD.bazel', 'WORKSPACE', '*.tac'), ('text/x-python', 'application/x-python', 'text/x-python3', 'application/x-python3')), + 'PythonTracebackLexer': ('pip._vendor.pygments.lexer.python', 'Python Traceback', ('pytb', 'py3tb'), ('*.pytb', '*.py3tb'), ('text/x-python-traceback', 'text/x-python3-traceback')), + 'QBasicLexer': ('pip._vendor.pygments.lexer.basic', 'QBasic', ('qbasic', 'basic'), ('*.BAS', '*.bas'), ('text/basic',)), + 'QVToLexer': ('pip._vendor.pygments.lexer.qvt', 'QVTO', ('qvto', 'qvt'), ('*.qvto',), ()), + 'QmlLexer': ('pip._vendor.pygments.lexer.webmisc', 'QML', ('qml', 'qbs'), ('*.qml', '*.qbs'), ('application/x-qml', 'application/x-qt.qbs+qml')), + 'RConsoleLexer': ('pip._vendor.pygments.lexer.r', 'RConsole', ('rconsole', 'rout'), ('*.Rout',), ()), + 'RNCCompactLexer': ('pip._vendor.pygments.lexer.rnc', 'Relax-NG Compact', ('rng-compact', 'rnc'), ('*.rnc',), ()), + 'RPMSpecLexer': ('pip._vendor.pygments.lexer.installers', 'RPMSpec', ('spec',), ('*.spec',), ('text/x-rpm-spec',)), + 'RacketLexer': ('pip._vendor.pygments.lexer.lisp', 'Racket', ('racket', 'rkt'), ('*.rkt', '*.rktd', '*.rktl'), ('text/x-racket', 'application/x-racket')), + 'RagelCLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in C Host', ('ragel-c',), ('*.rl',), ()), + 'RagelCppLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in CPP Host', ('ragel-cpp',), ('*.rl',), ()), + 'RagelDLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in D Host', ('ragel-d',), ('*.rl',), ()), + 'RagelEmbeddedLexer': ('pip._vendor.pygments.lexer.parsers', 'Embedded Ragel', ('ragel-em',), ('*.rl',), ()), + 'RagelJavaLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in Java Host', ('ragel-java',), ('*.rl',), ()), + 'RagelLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel', ('ragel',), (), ()), + 'RagelObjectiveCLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in Objective C Host', ('ragel-objc',), ('*.rl',), ()), + 'RagelRubyLexer': ('pip._vendor.pygments.lexer.parsers', 'Ragel in Ruby Host', ('ragel-ruby', 'ragel-rb'), ('*.rl',), ()), + 'RawTokenLexer': ('pip._vendor.pygments.lexer.special', 'Raw token data', (), (), ('application/x-pygments-tokens',)), + 'RdLexer': ('pip._vendor.pygments.lexer.r', 'Rd', ('rd',), ('*.Rd',), ('text/x-r-doc',)), + 'ReasonLexer': ('pip._vendor.pygments.lexer.ml', 'ReasonML', ('reasonml', 'reason'), ('*.re', '*.rei'), ('text/x-reasonml',)), + 'RebolLexer': ('pip._vendor.pygments.lexer.rebol', 'REBOL', ('rebol',), ('*.r', '*.r3', '*.reb'), ('text/x-rebol',)), + 'RedLexer': ('pip._vendor.pygments.lexer.rebol', 'Red', ('red', 'red/system'), ('*.red', '*.reds'), ('text/x-red', 'text/x-red-system')), + 'RedcodeLexer': ('pip._vendor.pygments.lexer.esoteric', 'Redcode', ('redcode',), ('*.cw',), ()), + 'RegeditLexer': ('pip._vendor.pygments.lexer.configs', 'reg', ('registry',), ('*.reg',), ('text/x-windows-registry',)), + 'ResourceLexer': ('pip._vendor.pygments.lexer.resource', 'ResourceBundle', ('resourcebundle', 'resource'), (), ()), + 'RexxLexer': ('pip._vendor.pygments.lexer.scripting', 'Rexx', ('rexx', 'arexx'), ('*.rexx', '*.rex', '*.rx', '*.arexx'), ('text/x-rexx',)), + 'RhtmlLexer': ('pip._vendor.pygments.lexer.templates', 'RHTML', ('rhtml', 'html+erb', 'html+ruby'), ('*.rhtml',), ('text/html+ruby',)), + 'RideLexer': ('pip._vendor.pygments.lexer.ride', 'Ride', ('ride',), ('*.ride',), ('text/x-ride',)), + 'RoboconfGraphLexer': ('pip._vendor.pygments.lexer.roboconf', 'Roboconf Graph', ('roboconf-graph',), ('*.graph',), ()), + 'RoboconfInstancesLexer': ('pip._vendor.pygments.lexer.roboconf', 'Roboconf Instances', ('roboconf-instances',), ('*.instances',), ()), + 'RobotFrameworkLexer': ('pip._vendor.pygments.lexer.robotframework', 'RobotFramework', ('robotframework',), ('*.robot',), ('text/x-robotframework',)), + 'RqlLexer': ('pip._vendor.pygments.lexer.sql', 'RQL', ('rql',), ('*.rql',), ('text/x-rql',)), + 'RslLexer': ('pip._vendor.pygments.lexer.dsls', 'RSL', ('rsl',), ('*.rsl',), ('text/rsl',)), + 'RstLexer': ('pip._vendor.pygments.lexer.markup', 'reStructuredText', ('restructuredtext', 'rst', 'rest'), ('*.rst', '*.rest'), ('text/x-rst', 'text/prs.fallenstein.rst')), + 'RtsLexer': ('pip._vendor.pygments.lexer.trafficscript', 'TrafficScript', ('trafficscript', 'rts'), ('*.rts',), ()), + 'RubyConsoleLexer': ('pip._vendor.pygments.lexer.ruby', 'Ruby irb session', ('rbcon', 'irb'), (), ('text/x-ruby-shellsession',)), + 'RubyLexer': ('pip._vendor.pygments.lexer.ruby', 'Ruby', ('ruby', 'rb', 'duby'), ('*.rb', '*.rbw', 'Rakefile', '*.rake', '*.gemspec', '*.rbx', '*.duby', 'Gemfile'), ('text/x-ruby', 'application/x-ruby')), + 'RustLexer': ('pip._vendor.pygments.lexer.rust', 'Rust', ('rust', 'rs'), ('*.rs', '*.rs.in'), ('text/rust', 'text/x-rust')), + 'SASLexer': ('pip._vendor.pygments.lexer.sas', 'SAS', ('sas',), ('*.SAS', '*.sas'), ('text/x-sas', 'text/sas', 'application/x-sas')), + 'SLexer': ('pip._vendor.pygments.lexer.r', 'S', ('splus', 's', 'r'), ('*.S', '*.R', '.Rhistory', '.Rprofile', '.Renviron'), ('text/S-plus', 'text/S', 'text/x-r-source', 'text/x-r', 'text/x-R', 'text/x-r-history', 'text/x-r-profile')), + 'SMLLexer': ('pip._vendor.pygments.lexer.ml', 'Standard ML', ('sml',), ('*.sml', '*.sig', '*.fun'), ('text/x-standardml', 'application/x-standardml')), + 'SarlLexer': ('pip._vendor.pygments.lexer.jvm', 'SARL', ('sarl',), ('*.sarl',), ('text/x-sarl',)), + 'SassLexer': ('pip._vendor.pygments.lexer.css', 'Sass', ('sass',), ('*.sass',), ('text/x-sass',)), + 'ScalaLexer': ('pip._vendor.pygments.lexer.jvm', 'Scala', ('scala',), ('*.scala',), ('text/x-scala',)), + 'ScamlLexer': ('pip._vendor.pygments.lexer.html', 'Scaml', ('scaml',), ('*.scaml',), ('text/x-scaml',)), + 'ScdocLexer': ('pip._vendor.pygments.lexer.scdoc', 'scdoc', ('scdoc', 'scd'), ('*.scd', '*.scdoc'), ()), + 'SchemeLexer': ('pip._vendor.pygments.lexer.lisp', 'Scheme', ('scheme', 'scm'), ('*.scm', '*.ss'), ('text/x-scheme', 'application/x-scheme')), + 'ScilabLexer': ('pip._vendor.pygments.lexer.matlab', 'Scilab', ('scilab',), ('*.sci', '*.sce', '*.tst'), ('text/scilab',)), + 'ScssLexer': ('pip._vendor.pygments.lexer.css', 'SCSS', ('scss',), ('*.scss',), ('text/x-scss',)), + 'ShExCLexer': ('pip._vendor.pygments.lexer.rdf', 'ShExC', ('shexc', 'shex'), ('*.shex',), ('text/shex',)), + 'ShenLexer': ('pip._vendor.pygments.lexer.lisp', 'Shen', ('shen',), ('*.shen',), ('text/x-shen', 'application/x-shen')), + 'SieveLexer': ('pip._vendor.pygments.lexer.sieve', 'Sieve', ('sieve',), ('*.siv', '*.sieve'), ()), + 'SilverLexer': ('pip._vendor.pygments.lexer.verification', 'Silver', ('silver',), ('*.sil', '*.vpr'), ()), + 'SingularityLexer': ('pip._vendor.pygments.lexer.configs', 'Singularity', ('singularity',), ('*.def', 'Singularity'), ()), + 'SlashLexer': ('pip._vendor.pygments.lexer.slash', 'Slash', ('slash',), ('*.sla',), ()), + 'SlimLexer': ('pip._vendor.pygments.lexer.webmisc', 'Slim', ('slim',), ('*.slim',), ('text/x-slim',)), + 'SlurmBashLexer': ('pip._vendor.pygments.lexer.shell', 'Slurm', ('slurm', 'sbatch'), ('*.sl',), ()), + 'SmaliLexer': ('pip._vendor.pygments.lexer.dalvik', 'Smali', ('smali',), ('*.smali',), ('text/smali',)), + 'SmalltalkLexer': ('pip._vendor.pygments.lexer.smalltalk', 'Smalltalk', ('smalltalk', 'squeak', 'st'), ('*.st',), ('text/x-smalltalk',)), + 'SmartGameFormatLexer': ('pip._vendor.pygments.lexer.sgf', 'SmartGameFormat', ('sgf',), ('*.sgf',), ()), + 'SmartyLexer': ('pip._vendor.pygments.lexer.templates', 'Smarty', ('smarty',), ('*.tpl',), ('application/x-smarty',)), + 'SmithyLexer': ('pip._vendor.pygments.lexer.smithy', 'Smithy', ('smithy',), ('*.smithy',), ()), + 'SnobolLexer': ('pip._vendor.pygments.lexer.snobol', 'Snobol', ('snobol',), ('*.snobol',), ('text/x-snobol',)), + 'SnowballLexer': ('pip._vendor.pygments.lexer.dsls', 'Snowball', ('snowball',), ('*.sbl',), ()), + 'SolidityLexer': ('pip._vendor.pygments.lexer.solidity', 'Solidity', ('solidity',), ('*.sol',), ()), + 'SourcePawnLexer': ('pip._vendor.pygments.lexer.pawn', 'SourcePawn', ('sp',), ('*.sp',), ('text/x-sourcepawn',)), + 'SourcesListLexer': ('pip._vendor.pygments.lexer.installers', 'Debian Sourcelist', ('debsources', 'sourceslist', 'sources.list'), ('sources.list',), ()), + 'SparqlLexer': ('pip._vendor.pygments.lexer.rdf', 'SPARQL', ('sparql',), ('*.rq', '*.sparql'), ('application/sparql-query',)), + 'SqlLexer': ('pip._vendor.pygments.lexer.sql', 'SQL', ('sql',), ('*.sql',), ('text/x-sql',)), + 'SqliteConsoleLexer': ('pip._vendor.pygments.lexer.sql', 'sqlite3con', ('sqlite3',), ('*.sqlite3-console',), ('text/x-sqlite3-console',)), + 'SquidConfLexer': ('pip._vendor.pygments.lexer.configs', 'SquidConf', ('squidconf', 'squid.conf', 'squid'), ('squid.conf',), ('text/x-squidconf',)), + 'SspLexer': ('pip._vendor.pygments.lexer.templates', 'Scalate Server Page', ('ssp',), ('*.ssp',), ('application/x-ssp',)), + 'StanLexer': ('pip._vendor.pygments.lexer.modeling', 'Stan', ('stan',), ('*.stan',), ()), + 'StataLexer': ('pip._vendor.pygments.lexer.stata', 'Stata', ('stata', 'do'), ('*.do', '*.ado'), ('text/x-stata', 'text/stata', 'application/x-stata')), + 'SuperColliderLexer': ('pip._vendor.pygments.lexer.supercollider', 'SuperCollider', ('supercollider', 'sc'), ('*.sc', '*.scd'), ('application/supercollider', 'text/supercollider')), + 'SwiftLexer': ('pip._vendor.pygments.lexer.objective', 'Swift', ('swift',), ('*.swift',), ('text/x-swift',)), + 'SwigLexer': ('pip._vendor.pygments.lexer.c_like', 'SWIG', ('swig',), ('*.swg', '*.i'), ('text/swig',)), + 'SystemVerilogLexer': ('pip._vendor.pygments.lexer.hdl', 'systemverilog', ('systemverilog', 'sv'), ('*.sv', '*.svh'), ('text/x-systemverilog',)), + 'TAPLexer': ('pip._vendor.pygments.lexer.testing', 'TAP', ('tap',), ('*.tap',), ()), + 'TNTLexer': ('pip._vendor.pygments.lexer.tnt', 'Typographic Number Theory', ('tnt',), ('*.tnt',), ()), + 'TOMLLexer': ('pip._vendor.pygments.lexer.configs', 'TOML', ('toml',), ('*.toml', 'Pipfile', 'poetry.lock'), ()), + 'Tads3Lexer': ('pip._vendor.pygments.lexer.int_fiction', 'TADS 3', ('tads3',), ('*.t',), ()), + 'TasmLexer': ('pip._vendor.pygments.lexer.asm', 'TASM', ('tasm',), ('*.asm', '*.ASM', '*.tasm'), ('text/x-tasm',)), + 'TclLexer': ('pip._vendor.pygments.lexer.tcl', 'Tcl', ('tcl',), ('*.tcl', '*.rvt'), ('text/x-tcl', 'text/x-script.tcl', 'application/x-tcl')), + 'TcshLexer': ('pip._vendor.pygments.lexer.shell', 'Tcsh', ('tcsh', 'csh'), ('*.tcsh', '*.csh'), ('application/x-csh',)), + 'TcshSessionLexer': ('pip._vendor.pygments.lexer.shell', 'Tcsh Session', ('tcshcon',), (), ()), + 'TeaTemplateLexer': ('pip._vendor.pygments.lexer.templates', 'Tea', ('tea',), ('*.tea',), ('text/x-tea',)), + 'TealLexer': ('pip._vendor.pygments.lexer.teal', 'teal', ('teal',), ('*.teal',), ()), + 'TeraTermLexer': ('pip._vendor.pygments.lexer.teraterm', 'Tera Term macro', ('teratermmacro', 'teraterm', 'ttl'), ('*.ttl',), ('text/x-teratermmacro',)), + 'TermcapLexer': ('pip._vendor.pygments.lexer.configs', 'Termcap', ('termcap',), ('termcap', 'termcap.src'), ()), + 'TerminfoLexer': ('pip._vendor.pygments.lexer.configs', 'Terminfo', ('terminfo',), ('terminfo', 'terminfo.src'), ()), + 'TerraformLexer': ('pip._vendor.pygments.lexer.configs', 'Terraform', ('terraform', 'tf'), ('*.tf',), ('application/x-tf', 'application/x-terraform')), + 'TexLexer': ('pip._vendor.pygments.lexer.markup', 'TeX', ('tex', 'latex'), ('*.tex', '*.aux', '*.toc'), ('text/x-tex', 'text/x-latex')), + 'TextLexer': ('pip._vendor.pygments.lexer.special', 'Text only', ('text',), ('*.txt',), ('text/plain',)), + 'ThingsDBLexer': ('pip._vendor.pygments.lexer.thingsdb', 'ThingsDB', ('ti', 'thingsdb'), ('*.ti',), ()), + 'ThriftLexer': ('pip._vendor.pygments.lexer.dsls', 'Thrift', ('thrift',), ('*.thrift',), ('application/x-thrift',)), + 'TiddlyWiki5Lexer': ('pip._vendor.pygments.lexer.markup', 'tiddler', ('tid',), ('*.tid',), ('text/vnd.tiddlywiki',)), + 'TodotxtLexer': ('pip._vendor.pygments.lexer.textfmts', 'Todotxt', ('todotxt',), ('todo.txt', '*.todotxt'), ('text/x-todo',)), + 'TransactSqlLexer': ('pip._vendor.pygments.lexer.sql', 'Transact-SQL', ('tsql', 't-sql'), ('*.sql',), ('text/x-tsql',)), + 'TreetopLexer': ('pip._vendor.pygments.lexer.parsers', 'Treetop', ('treetop',), ('*.treetop', '*.tt'), ()), + 'TurtleLexer': ('pip._vendor.pygments.lexer.rdf', 'Turtle', ('turtle',), ('*.ttl',), ('text/turtle', 'application/x-turtle')), + 'TwigHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Twig', ('html+twig',), ('*.twig',), ('text/html+twig',)), + 'TwigLexer': ('pip._vendor.pygments.lexer.templates', 'Twig', ('twig',), (), ('application/x-twig',)), + 'TypeScriptLexer': ('pip._vendor.pygments.lexer.javascript', 'TypeScript', ('typescript', 'ts'), ('*.ts',), ('application/x-typescript', 'text/x-typescript')), + 'TypoScriptCssDataLexer': ('pip._vendor.pygments.lexer.typoscript', 'TypoScriptCssData', ('typoscriptcssdata',), (), ()), + 'TypoScriptHtmlDataLexer': ('pip._vendor.pygments.lexer.typoscript', 'TypoScriptHtmlData', ('typoscripthtmldata',), (), ()), + 'TypoScriptLexer': ('pip._vendor.pygments.lexer.typoscript', 'TypoScript', ('typoscript',), ('*.typoscript',), ('text/x-typoscript',)), + 'UcodeLexer': ('pip._vendor.pygments.lexer.unicon', 'ucode', ('ucode',), ('*.u', '*.u1', '*.u2'), ()), + 'UniconLexer': ('pip._vendor.pygments.lexer.unicon', 'Unicon', ('unicon',), ('*.icn',), ('text/unicon',)), + 'UrbiscriptLexer': ('pip._vendor.pygments.lexer.urbi', 'UrbiScript', ('urbiscript',), ('*.u',), ('application/x-urbiscript',)), + 'UsdLexer': ('pip._vendor.pygments.lexer.usd', 'USD', ('usd', 'usda'), ('*.usd', '*.usda'), ()), + 'VBScriptLexer': ('pip._vendor.pygments.lexer.basic', 'VBScript', ('vbscript',), ('*.vbs', '*.VBS'), ()), + 'VCLLexer': ('pip._vendor.pygments.lexer.varnish', 'VCL', ('vcl',), ('*.vcl',), ('text/x-vclsrc',)), + 'VCLSnippetLexer': ('pip._vendor.pygments.lexer.varnish', 'VCLSnippets', ('vclsnippets', 'vclsnippet'), (), ('text/x-vclsnippet',)), + 'VCTreeStatusLexer': ('pip._vendor.pygments.lexer.console', 'VCTreeStatus', ('vctreestatus',), (), ()), + 'VGLLexer': ('pip._vendor.pygments.lexer.dsls', 'VGL', ('vgl',), ('*.rpf',), ()), + 'ValaLexer': ('pip._vendor.pygments.lexer.c_like', 'Vala', ('vala', 'vapi'), ('*.vala', '*.vapi'), ('text/x-vala',)), + 'VbNetAspxLexer': ('pip._vendor.pygments.lexer.dotnet', 'aspx-vb', ('aspx-vb',), ('*.aspx', '*.asax', '*.ascx', '*.ashx', '*.asmx', '*.axd'), ()), + 'VbNetLexer': ('pip._vendor.pygments.lexer.dotnet', 'VB.net', ('vb.net', 'vbnet'), ('*.vb', '*.bas'), ('text/x-vbnet', 'text/x-vba')), + 'VelocityHtmlLexer': ('pip._vendor.pygments.lexer.templates', 'HTML+Velocity', ('html+velocity',), (), ('text/html+velocity',)), + 'VelocityLexer': ('pip._vendor.pygments.lexer.templates', 'Velocity', ('velocity',), ('*.vm', '*.fhtml'), ()), + 'VelocityXmlLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Velocity', ('xml+velocity',), (), ('application/xml+velocity',)), + 'VerilogLexer': ('pip._vendor.pygments.lexer.hdl', 'verilog', ('verilog', 'v'), ('*.v',), ('text/x-verilog',)), + 'VhdlLexer': ('pip._vendor.pygments.lexer.hdl', 'vhdl', ('vhdl',), ('*.vhdl', '*.vhd'), ('text/x-vhdl',)), + 'VimLexer': ('pip._vendor.pygments.lexer.textedit', 'VimL', ('vim',), ('*.vim', '.vimrc', '.exrc', '.gvimrc', '_vimrc', '_exrc', '_gvimrc', 'vimrc', 'gvimrc'), ('text/x-vim',)), + 'WDiffLexer': ('pip._vendor.pygments.lexer.diff', 'WDiff', ('wdiff',), ('*.wdiff',), ()), + 'WatLexer': ('pip._vendor.pygments.lexer.webassembly', 'WebAssembly', ('wast', 'wat'), ('*.wat', '*.wast'), ()), + 'WebIDLLexer': ('pip._vendor.pygments.lexer.webidl', 'Web IDL', ('webidl',), ('*.webidl',), ()), + 'WhileyLexer': ('pip._vendor.pygments.lexer.whiley', 'Whiley', ('whiley',), ('*.whiley',), ('text/x-whiley',)), + 'X10Lexer': ('pip._vendor.pygments.lexer.x10', 'X10', ('x10', 'xten'), ('*.x10',), ('text/x-x10',)), + 'XQueryLexer': ('pip._vendor.pygments.lexer.webmisc', 'XQuery', ('xquery', 'xqy', 'xq', 'xql', 'xqm'), ('*.xqy', '*.xquery', '*.xq', '*.xql', '*.xqm'), ('text/xquery', 'application/xquery')), + 'XmlDjangoLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Django/Jinja', ('xml+django', 'xml+jinja'), (), ('application/xml+django', 'application/xml+jinja')), + 'XmlErbLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Ruby', ('xml+ruby', 'xml+erb'), (), ('application/xml+ruby',)), + 'XmlLexer': ('pip._vendor.pygments.lexer.html', 'XML', ('xml',), ('*.xml', '*.xsl', '*.rss', '*.xslt', '*.xsd', '*.wsdl', '*.wsf'), ('text/xml', 'application/xml', 'image/svg+xml', 'application/rss+xml', 'application/atom+xml')), + 'XmlPhpLexer': ('pip._vendor.pygments.lexer.templates', 'XML+PHP', ('xml+php',), (), ('application/xml+php',)), + 'XmlSmartyLexer': ('pip._vendor.pygments.lexer.templates', 'XML+Smarty', ('xml+smarty',), (), ('application/xml+smarty',)), + 'XorgLexer': ('pip._vendor.pygments.lexer.xorg', 'Xorg', ('xorg.conf',), ('xorg.conf',), ()), + 'XsltLexer': ('pip._vendor.pygments.lexer.html', 'XSLT', ('xslt',), ('*.xsl', '*.xslt', '*.xpl'), ('application/xsl+xml', 'application/xslt+xml')), + 'XtendLexer': ('pip._vendor.pygments.lexer.jvm', 'Xtend', ('xtend',), ('*.xtend',), ('text/x-xtend',)), + 'XtlangLexer': ('pip._vendor.pygments.lexer.lisp', 'xtlang', ('extempore',), ('*.xtm',), ()), + 'YamlJinjaLexer': ('pip._vendor.pygments.lexer.templates', 'YAML+Jinja', ('yaml+jinja', 'salt', 'sls'), ('*.sls',), ('text/x-yaml+jinja', 'text/x-sls')), + 'YamlLexer': ('pip._vendor.pygments.lexer.data', 'YAML', ('yaml',), ('*.yaml', '*.yml'), ('text/x-yaml',)), + 'YangLexer': ('pip._vendor.pygments.lexer.yang', 'YANG', ('yang',), ('*.yang',), ('application/yang',)), + 'ZeekLexer': ('pip._vendor.pygments.lexer.dsls', 'Zeek', ('zeek', 'bro'), ('*.zeek', '*.bro'), ()), + 'ZephirLexer': ('pip._vendor.pygments.lexer.php', 'Zephir', ('zephir',), ('*.zep',), ()), + 'ZigLexer': ('pip._vendor.pygments.lexer.zig', 'Zig', ('zig',), ('*.zig',), ('text/zig',)), + 'apdlexer': ('pip._vendor.pygments.lexer.apdlexer', 'ANSYS parametric design language', ('ansys', 'apdl'), ('*.ans',), ()), +} + +if __name__ == '__main__': # pragma: no cover + import sys + import os + + # lookup lexers + found_lexers = [] + sys.path.insert(0, os.path.join(os.path.dirname(__file__), '..', '..')) + for root, dirs, files in os.walk('.'): + for filename in files: + if filename.endswith('.py') and not filename.startswith('_'): + module_name = 'pygments.lexers%s.%s' % ( + root[1:].replace('/', '.'), filename[:-3]) + print(module_name) + module = __import__(module_name, None, None, ['']) + for lexer_name in module.__all__: + lexer = getattr(module, lexer_name) + found_lexers.append( + '%r: %r' % (lexer_name, + (module_name, + lexer.name, + tuple(lexer.aliases), + tuple(lexer.filenames), + tuple(lexer.mimetypes)))) + # sort them to make the diff minimal + found_lexers.sort() + + # extract useful sourcecode from this file + with open(__file__) as fp: + content = fp.read() + # replace crnl to nl for Windows. + # + # Note that, originally, contributers should keep nl of master + # repository, for example by using some kind of automatic + # management EOL, like `EolExtension + # <https://www.mercurial-scm.org/wiki/EolExtension>`. + content = content.replace("\r\n", "\n") + header = content[:content.find('LEXERS = {')] + footer = content[content.find("if __name__ == '__main__':"):] + + # write new file + with open(__file__, 'w') as fp: + fp.write(header) + fp.write('LEXERS = {\n %s,\n}\n\n' % ',\n '.join(found_lexers)) + fp.write(footer) + + print ('=== %d lexers processed.' % len(found_lexers)) diff --git a/src/pip/_vendor/pygments/lexers/python.py b/src/pip/_vendor/pygments/lexers/python.py new file mode 100644 index 000000000..5c30c0edb --- /dev/null +++ b/src/pip/_vendor/pygments/lexers/python.py @@ -0,0 +1,1172 @@ +""" + pygments.lexers.python + ~~~~~~~~~~~~~~~~~~~~~~ + + Lexers for Python and related languages. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re + +from pip._vendor.pygments.lexer import Lexer, RegexLexer, include, bygroups, using, \ + default, words, combined, do_insertions +from pip._vendor.pygments.util import get_bool_opt, shebang_matches +from pip._vendor.pygments.token import Text, Comment, Operator, Keyword, Name, String, \ + Number, Punctuation, Generic, Other, Error +from pip._vendor.pygments import unistring as uni + +__all__ = ['PythonLexer', 'PythonConsoleLexer', 'PythonTracebackLexer', + 'Python2Lexer', 'Python2TracebackLexer', + 'CythonLexer', 'DgLexer', 'NumPyLexer'] + +line_re = re.compile('.*?\n') + + +class PythonLexer(RegexLexer): + """ + For `Python <http://www.python.org>`_ source code (version 3.x). + + .. versionadded:: 0.10 + + .. versionchanged:: 2.5 + This is now the default ``PythonLexer``. It is still available as the + alias ``Python3Lexer``. + """ + + name = 'Python' + aliases = ['python', 'py', 'sage', 'python3', 'py3'] + filenames = [ + '*.py', + '*.pyw', + # Jython + '*.jy', + # Sage + '*.sage', + # SCons + '*.sc', + 'SConstruct', + 'SConscript', + # Skylark/Starlark (used by Bazel, Buck, and Pants) + '*.bzl', + 'BUCK', + 'BUILD', + 'BUILD.bazel', + 'WORKSPACE', + # Twisted Application infrastructure + '*.tac', + ] + mimetypes = ['text/x-python', 'application/x-python', + 'text/x-python3', 'application/x-python3'] + + flags = re.MULTILINE | re.UNICODE + + uni_name = "[%s][%s]*" % (uni.xid_start, uni.xid_continue) + + def innerstring_rules(ttype): + return [ + # the old style '%s' % (...) string formatting (still valid in Py3) + (r'%(\(\w+\))?[-#0 +]*([0-9]+|[*])?(\.([0-9]+|[*]))?' + '[hlL]?[E-GXc-giorsaux%]', String.Interpol), + # the new style '{}'.format(...) string formatting + (r'\{' + r'((\w+)((\.\w+)|(\[[^\]]+\]))*)?' # field name + r'(\![sra])?' # conversion + r'(\:(.?[<>=\^])?[-+ ]?#?0?(\d+)?,?(\.\d+)?[E-GXb-gnosx%]?)?' + r'\}', String.Interpol), + + # backslashes, quotes and formatting signs must be parsed one at a time + (r'[^\\\'"%{\n]+', ttype), + (r'[\'"\\]', ttype), + # unhandled string formatting sign + (r'%|(\{{1,2})', ttype) + # newlines are an error (use "nl" state) + ] + + def fstring_rules(ttype): + return [ + # Assuming that a '}' is the closing brace after format specifier. + # Sadly, this means that we won't detect syntax error. But it's + # more important to parse correct syntax correctly, than to + # highlight invalid syntax. + (r'\}', String.Interpol), + (r'\{', String.Interpol, 'expr-inside-fstring'), + # backslashes, quotes and formatting signs must be parsed one at a time + (r'[^\\\'"{}\n]+', ttype), + (r'[\'"\\]', ttype), + # newlines are an error (use "nl" state) + ] + + tokens = { + 'root': [ + (r'\n', Text), + (r'^(\s*)([rRuUbB]{,2})("""(?:.|\n)*?""")', + bygroups(Text, String.Affix, String.Doc)), + (r"^(\s*)([rRuUbB]{,2})('''(?:.|\n)*?''')", + bygroups(Text, String.Affix, String.Doc)), + (r'\A#!.+$', Comment.Hashbang), + (r'#.*$', Comment.Single), + (r'\\\n', Text), + (r'\\', Text), + include('keywords'), + (r'(def)((?:\s|\\\s)+)', bygroups(Keyword, Text), 'funcname'), + (r'(class)((?:\s|\\\s)+)', bygroups(Keyword, Text), 'classname'), + (r'(from)((?:\s|\\\s)+)', bygroups(Keyword.Namespace, Text), + 'fromimport'), + (r'(import)((?:\s|\\\s)+)', bygroups(Keyword.Namespace, Text), + 'import'), + include('expr'), + ], + 'expr': [ + # raw f-strings + ('(?i)(rf|fr)(""")', + bygroups(String.Affix, String.Double), + combined('rfstringescape', 'tdqf')), + ("(?i)(rf|fr)(''')", + bygroups(String.Affix, String.Single), + combined('rfstringescape', 'tsqf')), + ('(?i)(rf|fr)(")', + bygroups(String.Affix, String.Double), + combined('rfstringescape', 'dqf')), + ("(?i)(rf|fr)(')", + bygroups(String.Affix, String.Single), + combined('rfstringescape', 'sqf')), + # non-raw f-strings + ('([fF])(""")', bygroups(String.Affix, String.Double), + combined('fstringescape', 'tdqf')), + ("([fF])(''')", bygroups(String.Affix, String.Single), + combined('fstringescape', 'tsqf')), + ('([fF])(")', bygroups(String.Affix, String.Double), + combined('fstringescape', 'dqf')), + ("([fF])(')", bygroups(String.Affix, String.Single), + combined('fstringescape', 'sqf')), + # raw strings + ('(?i)(rb|br|r)(""")', + bygroups(String.Affix, String.Double), 'tdqs'), + ("(?i)(rb|br|r)(''')", + bygroups(String.Affix, String.Single), 'tsqs'), + ('(?i)(rb|br|r)(")', + bygroups(String.Affix, String.Double), 'dqs'), + ("(?i)(rb|br|r)(')", + bygroups(String.Affix, String.Single), 'sqs'), + # non-raw strings + ('([uUbB]?)(""")', bygroups(String.Affix, String.Double), + combined('stringescape', 'tdqs')), + ("([uUbB]?)(''')", bygroups(String.Affix, String.Single), + combined('stringescape', 'tsqs')), + ('([uUbB]?)(")', bygroups(String.Affix, String.Double), + combined('stringescape', 'dqs')), + ("([uUbB]?)(')", bygroups(String.Affix, String.Single), + combined('stringescape', 'sqs')), + (r'[^\S\n]+', Text), + include('numbers'), + (r'!=|==|<<|>>|:=|[-~+/*%=<>&^|.]', Operator), + (r'[]{}:(),;[]', Punctuation), + (r'(in|is|and|or|not)\b', Operator.Word), + include('expr-keywords'), + include('builtins'), + include('magicfuncs'), + include('magicvars'), + include('name'), + ], + 'expr-inside-fstring': [ + (r'[{([]', Punctuation, 'expr-inside-fstring-inner'), + # without format specifier + (r'(=\s*)?' # debug (https://bugs.python.org/issue36817) + r'(\![sraf])?' # conversion + r'\}', String.Interpol, '#pop'), + # with format specifier + # we'll catch the remaining '}' in the outer scope + (r'(=\s*)?' # debug (https://bugs.python.org/issue36817) + r'(\![sraf])?' # conversion + r':', String.Interpol, '#pop'), + (r'\s+', Text), # allow new lines + include('expr'), + ], + 'expr-inside-fstring-inner': [ + (r'[{([]', Punctuation, 'expr-inside-fstring-inner'), + (r'[])}]', Punctuation, '#pop'), + (r'\s+', Text), # allow new lines + include('expr'), + ], + 'expr-keywords': [ + # Based on https://docs.python.org/3/reference/expressions.html + (words(( + 'async for', 'await', 'else', 'for', 'if', 'lambda', + 'yield', 'yield from'), suffix=r'\b'), + Keyword), + (words(('True', 'False', 'None'), suffix=r'\b'), Keyword.Constant), + ], + 'keywords': [ + (words(( + 'assert', 'async', 'await', 'break', 'continue', 'del', 'elif', + 'else', 'except', 'finally', 'for', 'global', 'if', 'lambda', + 'pass', 'raise', 'nonlocal', 'return', 'try', 'while', 'yield', + 'yield from', 'as', 'with'), suffix=r'\b'), + Keyword), + (words(('True', 'False', 'None'), suffix=r'\b'), Keyword.Constant), + ], + 'builtins': [ + (words(( + '__import__', 'abs', 'all', 'any', 'bin', 'bool', 'bytearray', + 'bytes', 'chr', 'classmethod', 'compile', 'complex', + 'delattr', 'dict', 'dir', 'divmod', 'enumerate', 'eval', 'filter', + 'float', 'format', 'frozenset', 'getattr', 'globals', 'hasattr', + 'hash', 'hex', 'id', 'input', 'int', 'isinstance', 'issubclass', + 'iter', 'len', 'list', 'locals', 'map', 'max', 'memoryview', + 'min', 'next', 'object', 'oct', 'open', 'ord', 'pow', 'print', + 'property', 'range', 'repr', 'reversed', 'round', 'set', 'setattr', + 'slice', 'sorted', 'staticmethod', 'str', 'sum', 'super', 'tuple', + 'type', 'vars', 'zip'), prefix=r'(?<!\.)', suffix=r'\b'), + Name.Builtin), + (r'(?<!\.)(self|Ellipsis|NotImplemented|cls)\b', Name.Builtin.Pseudo), + (words(( + 'ArithmeticError', 'AssertionError', 'AttributeError', + 'BaseException', 'BufferError', 'BytesWarning', 'DeprecationWarning', + 'EOFError', 'EnvironmentError', 'Exception', 'FloatingPointError', + 'FutureWarning', 'GeneratorExit', 'IOError', 'ImportError', + 'ImportWarning', 'IndentationError', 'IndexError', 'KeyError', + 'KeyboardInterrupt', 'LookupError', 'MemoryError', 'NameError', + 'NotImplementedError', 'OSError', 'OverflowError', + 'PendingDeprecationWarning', 'ReferenceError', 'ResourceWarning', + 'RuntimeError', 'RuntimeWarning', 'StopIteration', + 'SyntaxError', 'SyntaxWarning', 'SystemError', 'SystemExit', + 'TabError', 'TypeError', 'UnboundLocalError', 'UnicodeDecodeError', + 'UnicodeEncodeError', 'UnicodeError', 'UnicodeTranslateError', + 'UnicodeWarning', 'UserWarning', 'ValueError', 'VMSError', + 'Warning', 'WindowsError', 'ZeroDivisionError', + # new builtin exceptions from PEP 3151 + 'BlockingIOError', 'ChildProcessError', 'ConnectionError', + 'BrokenPipeError', 'ConnectionAbortedError', 'ConnectionRefusedError', + 'ConnectionResetError', 'FileExistsError', 'FileNotFoundError', + 'InterruptedError', 'IsADirectoryError', 'NotADirectoryError', + 'PermissionError', 'ProcessLookupError', 'TimeoutError', + # others new in Python 3 + 'StopAsyncIteration', 'ModuleNotFoundError', 'RecursionError'), + prefix=r'(?<!\.)', suffix=r'\b'), + Name.Exception), + ], + 'magicfuncs': [ + (words(( + '__abs__', '__add__', '__aenter__', '__aexit__', '__aiter__', + '__and__', '__anext__', '__await__', '__bool__', '__bytes__', + '__call__', '__complex__', '__contains__', '__del__', '__delattr__', + '__delete__', '__delitem__', '__dir__', '__divmod__', '__enter__', + '__eq__', '__exit__', '__float__', '__floordiv__', '__format__', + '__ge__', '__get__', '__getattr__', '__getattribute__', + '__getitem__', '__gt__', '__hash__', '__iadd__', '__iand__', + '__ifloordiv__', '__ilshift__', '__imatmul__', '__imod__', + '__imul__', '__index__', '__init__', '__instancecheck__', + '__int__', '__invert__', '__ior__', '__ipow__', '__irshift__', + '__isub__', '__iter__', '__itruediv__', '__ixor__', '__le__', + '__len__', '__length_hint__', '__lshift__', '__lt__', '__matmul__', + '__missing__', '__mod__', '__mul__', '__ne__', '__neg__', + '__new__', '__next__', '__or__', '__pos__', '__pow__', + '__prepare__', '__radd__', '__rand__', '__rdivmod__', '__repr__', + '__reversed__', '__rfloordiv__', '__rlshift__', '__rmatmul__', + '__rmod__', '__rmul__', '__ror__', '__round__', '__rpow__', + '__rrshift__', '__rshift__', '__rsub__', '__rtruediv__', + '__rxor__', '__set__', '__setattr__', '__setitem__', '__str__', + '__sub__', '__subclasscheck__', '__truediv__', + '__xor__'), suffix=r'\b'), + Name.Function.Magic), + ], + 'magicvars': [ + (words(( + '__annotations__', '__bases__', '__class__', '__closure__', + '__code__', '__defaults__', '__dict__', '__doc__', '__file__', + '__func__', '__globals__', '__kwdefaults__', '__module__', + '__mro__', '__name__', '__objclass__', '__qualname__', + '__self__', '__slots__', '__weakref__'), suffix=r'\b'), + Name.Variable.Magic), + ], + 'numbers': [ + (r'(\d(?:_?\d)*\.(?:\d(?:_?\d)*)?|(?:\d(?:_?\d)*)?\.\d(?:_?\d)*)' + r'([eE][+-]?\d(?:_?\d)*)?', Number.Float), + (r'\d(?:_?\d)*[eE][+-]?\d(?:_?\d)*j?', Number.Float), + (r'0[oO](?:_?[0-7])+', Number.Oct), + (r'0[bB](?:_?[01])+', Number.Bin), + (r'0[xX](?:_?[a-fA-F0-9])+', Number.Hex), + (r'\d(?:_?\d)*', Number.Integer), + ], + 'name': [ + (r'@' + uni_name, Name.Decorator), + (r'@', Operator), # new matrix multiplication operator + (uni_name, Name), + ], + 'funcname': [ + include('magicfuncs'), + (uni_name, Name.Function, '#pop'), + default('#pop'), + ], + 'classname': [ + (uni_name, Name.Class, '#pop'), + ], + 'import': [ + (r'(\s+)(as)(\s+)', bygroups(Text, Keyword, Text)), + (r'\.', Name.Namespace), + (uni_name, Name.Namespace), + (r'(\s*)(,)(\s*)', bygroups(Text, Operator, Text)), + default('#pop') # all else: go back + ], + 'fromimport': [ + (r'(\s+)(import)\b', bygroups(Text, Keyword.Namespace), '#pop'), + (r'\.', Name.Namespace), + # if None occurs here, it's "raise x from None", since None can + # never be a module name + (r'None\b', Name.Builtin.Pseudo, '#pop'), + (uni_name, Name.Namespace), + default('#pop'), + ], + 'rfstringescape': [ + (r'\{\{', String.Escape), + (r'\}\}', String.Escape), + ], + 'fstringescape': [ + include('rfstringescape'), + include('stringescape'), + ], + 'stringescape': [ + (r'\\([\\abfnrtv"\']|\n|N\{.*?\}|u[a-fA-F0-9]{4}|' + r'U[a-fA-F0-9]{8}|x[a-fA-F0-9]{2}|[0-7]{1,3})', String.Escape) + ], + 'fstrings-single': fstring_rules(String.Single), + 'fstrings-double': fstring_rules(String.Double), + 'strings-single': innerstring_rules(String.Single), + 'strings-double': innerstring_rules(String.Double), + 'dqf': [ + (r'"', String.Double, '#pop'), + (r'\\\\|\\"|\\\n', String.Escape), # included here for raw strings + include('fstrings-double') + ], + 'sqf': [ + (r"'", String.Single, '#pop'), + (r"\\\\|\\'|\\\n", String.Escape), # included here for raw strings + include('fstrings-single') + ], + 'dqs': [ + (r'"', String.Double, '#pop'), + (r'\\\\|\\"|\\\n', String.Escape), # included here for raw strings + include('strings-double') + ], + 'sqs': [ + (r"'", String.Single, '#pop'), + (r"\\\\|\\'|\\\n", String.Escape), # included here for raw strings + include('strings-single') + ], + 'tdqf': [ + (r'"""', String.Double, '#pop'), + include('fstrings-double'), + (r'\n', String.Double) + ], + 'tsqf': [ + (r"'''", String.Single, '#pop'), + include('fstrings-single'), + (r'\n', String.Single) + ], + 'tdqs': [ + (r'"""', String.Double, '#pop'), + include('strings-double'), + (r'\n', String.Double) + ], + 'tsqs': [ + (r"'''", String.Single, '#pop'), + include('strings-single'), + (r'\n', String.Single) + ], + } + + def analyse_text(text): + return shebang_matches(text, r'pythonw?(3(\.\d)?)?') or \ + 'import ' in text[:1000] + + +Python3Lexer = PythonLexer + + +class Python2Lexer(RegexLexer): + """ + For `Python 2.x <http://www.python.org>`_ source code. + + .. versionchanged:: 2.5 + This class has been renamed from ``PythonLexer``. ``PythonLexer`` now + refers to the Python 3 variant. File name patterns like ``*.py`` have + been moved to Python 3 as well. + """ + + name = 'Python 2.x' + aliases = ['python2', 'py2'] + filenames = [] # now taken over by PythonLexer (3.x) + mimetypes = ['text/x-python2', 'application/x-python2'] + + def innerstring_rules(ttype): + return [ + # the old style '%s' % (...) string formatting + (r'%(\(\w+\))?[-#0 +]*([0-9]+|[*])?(\.([0-9]+|[*]))?' + '[hlL]?[E-GXc-giorsux%]', String.Interpol), + # backslashes, quotes and formatting signs must be parsed one at a time + (r'[^\\\'"%\n]+', ttype), + (r'[\'"\\]', ttype), + # unhandled string formatting sign + (r'%', ttype), + # newlines are an error (use "nl" state) + ] + + tokens = { + 'root': [ + (r'\n', Text), + (r'^(\s*)([rRuUbB]{,2})("""(?:.|\n)*?""")', + bygroups(Text, String.Affix, String.Doc)), + (r"^(\s*)([rRuUbB]{,2})('''(?:.|\n)*?''')", + bygroups(Text, String.Affix, String.Doc)), + (r'[^\S\n]+', Text), + (r'\A#!.+$', Comment.Hashbang), + (r'#.*$', Comment.Single), + (r'[]{}:(),;[]', Punctuation), + (r'\\\n', Text), + (r'\\', Text), + (r'(in|is|and|or|not)\b', Operator.Word), + (r'!=|==|<<|>>|[-~+/*%=<>&^|.]', Operator), + include('keywords'), + (r'(def)((?:\s|\\\s)+)', bygroups(Keyword, Text), 'funcname'), + (r'(class)((?:\s|\\\s)+)', bygroups(Keyword, Text), 'classname'), + (r'(from)((?:\s|\\\s)+)', bygroups(Keyword.Namespace, Text), + 'fromimport'), + (r'(import)((?:\s|\\\s)+)', bygroups(Keyword.Namespace, Text), + 'import'), + include('builtins'), + include('magicfuncs'), + include('magicvars'), + include('backtick'), + ('([rR]|[uUbB][rR]|[rR][uUbB])(""")', + bygroups(String.Affix, String.Double), 'tdqs'), + ("([rR]|[uUbB][rR]|[rR][uUbB])(''')", + bygroups(String.Affix, String.Single), 'tsqs'), + ('([rR]|[uUbB][rR]|[rR][uUbB])(")', + bygroups(String.Affix, String.Double), 'dqs'), + ("([rR]|[uUbB][rR]|[rR][uUbB])(')", + bygroups(String.Affix, String.Single), 'sqs'), + ('([uUbB]?)(""")', bygroups(String.Affix, String.Double), + combined('stringescape', 'tdqs')), + ("([uUbB]?)(''')", bygroups(String.Affix, String.Single), + combined('stringescape', 'tsqs')), + ('([uUbB]?)(")', bygroups(String.Affix, String.Double), + combined('stringescape', 'dqs')), + ("([uUbB]?)(')", bygroups(String.Affix, String.Single), + combined('stringescape', 'sqs')), + include('name'), + include('numbers'), + ], + 'keywords': [ + (words(( + 'assert', 'break', 'continue', 'del', 'elif', 'else', 'except', + 'exec', 'finally', 'for', 'global', 'if', 'lambda', 'pass', + 'print', 'raise', 'return', 'try', 'while', 'yield', + 'yield from', 'as', 'with'), suffix=r'\b'), + Keyword), + ], + 'builtins': [ + (words(( + '__import__', 'abs', 'all', 'any', 'apply', 'basestring', 'bin', + 'bool', 'buffer', 'bytearray', 'bytes', 'callable', 'chr', 'classmethod', + 'cmp', 'coerce', 'compile', 'complex', 'delattr', 'dict', 'dir', 'divmod', + 'enumerate', 'eval', 'execfile', 'exit', 'file', 'filter', 'float', + 'frozenset', 'getattr', 'globals', 'hasattr', 'hash', 'hex', 'id', + 'input', 'int', 'intern', 'isinstance', 'issubclass', 'iter', 'len', + 'list', 'locals', 'long', 'map', 'max', 'min', 'next', 'object', + 'oct', 'open', 'ord', 'pow', 'property', 'range', 'raw_input', 'reduce', + 'reload', 'repr', 'reversed', 'round', 'set', 'setattr', 'slice', + 'sorted', 'staticmethod', 'str', 'sum', 'super', 'tuple', 'type', + 'unichr', 'unicode', 'vars', 'xrange', 'zip'), + prefix=r'(?<!\.)', suffix=r'\b'), + Name.Builtin), + (r'(?<!\.)(self|None|Ellipsis|NotImplemented|False|True|cls' + r')\b', Name.Builtin.Pseudo), + (words(( + 'ArithmeticError', 'AssertionError', 'AttributeError', + 'BaseException', 'DeprecationWarning', 'EOFError', 'EnvironmentError', + 'Exception', 'FloatingPointError', 'FutureWarning', 'GeneratorExit', + 'IOError', 'ImportError', 'ImportWarning', 'IndentationError', + 'IndexError', 'KeyError', 'KeyboardInterrupt', 'LookupError', + 'MemoryError', 'NameError', + 'NotImplementedError', 'OSError', 'OverflowError', 'OverflowWarning', + 'PendingDeprecationWarning', 'ReferenceError', + 'RuntimeError', 'RuntimeWarning', 'StandardError', 'StopIteration', + 'SyntaxError', 'SyntaxWarning', 'SystemError', 'SystemExit', + 'TabError', 'TypeError', 'UnboundLocalError', 'UnicodeDecodeError', + 'UnicodeEncodeError', 'UnicodeError', 'UnicodeTranslateError', + 'UnicodeWarning', 'UserWarning', 'ValueError', 'VMSError', 'Warning', + 'WindowsError', 'ZeroDivisionError'), prefix=r'(?<!\.)', suffix=r'\b'), + Name.Exception), + ], + 'magicfuncs': [ + (words(( + '__abs__', '__add__', '__and__', '__call__', '__cmp__', '__coerce__', + '__complex__', '__contains__', '__del__', '__delattr__', '__delete__', + '__delitem__', '__delslice__', '__div__', '__divmod__', '__enter__', + '__eq__', '__exit__', '__float__', '__floordiv__', '__ge__', '__get__', + '__getattr__', '__getattribute__', '__getitem__', '__getslice__', '__gt__', + '__hash__', '__hex__', '__iadd__', '__iand__', '__idiv__', '__ifloordiv__', + '__ilshift__', '__imod__', '__imul__', '__index__', '__init__', + '__instancecheck__', '__int__', '__invert__', '__iop__', '__ior__', + '__ipow__', '__irshift__', '__isub__', '__iter__', '__itruediv__', + '__ixor__', '__le__', '__len__', '__long__', '__lshift__', '__lt__', + '__missing__', '__mod__', '__mul__', '__ne__', '__neg__', '__new__', + '__nonzero__', '__oct__', '__op__', '__or__', '__pos__', '__pow__', + '__radd__', '__rand__', '__rcmp__', '__rdiv__', '__rdivmod__', '__repr__', + '__reversed__', '__rfloordiv__', '__rlshift__', '__rmod__', '__rmul__', + '__rop__', '__ror__', '__rpow__', '__rrshift__', '__rshift__', '__rsub__', + '__rtruediv__', '__rxor__', '__set__', '__setattr__', '__setitem__', + '__setslice__', '__str__', '__sub__', '__subclasscheck__', '__truediv__', + '__unicode__', '__xor__'), suffix=r'\b'), + Name.Function.Magic), + ], + 'magicvars': [ + (words(( + '__bases__', '__class__', '__closure__', '__code__', '__defaults__', + '__dict__', '__doc__', '__file__', '__func__', '__globals__', + '__metaclass__', '__module__', '__mro__', '__name__', '__self__', + '__slots__', '__weakref__'), + suffix=r'\b'), + Name.Variable.Magic), + ], + 'numbers': [ + (r'(\d+\.\d*|\d*\.\d+)([eE][+-]?[0-9]+)?j?', Number.Float), + (r'\d+[eE][+-]?[0-9]+j?', Number.Float), + (r'0[0-7]+j?', Number.Oct), + (r'0[bB][01]+', Number.Bin), + (r'0[xX][a-fA-F0-9]+', Number.Hex), + (r'\d+L', Number.Integer.Long), + (r'\d+j?', Number.Integer) + ], + 'backtick': [ + ('`.*?`', String.Backtick), + ], + 'name': [ + (r'@[\w.]+', Name.Decorator), + (r'[a-zA-Z_]\w*', Name), + ], + 'funcname': [ + include('magicfuncs'), + (r'[a-zA-Z_]\w*', Name.Function, '#pop'), + default('#pop'), + ], + 'classname': [ + (r'[a-zA-Z_]\w*', Name.Class, '#pop') + ], + 'import': [ + (r'(?:[ \t]|\\\n)+', Text), + (r'as\b', Keyword.Namespace), + (r',', Operator), + (r'[a-zA-Z_][\w.]*', Name.Namespace), + default('#pop') # all else: go back + ], + 'fromimport': [ + (r'(?:[ \t]|\\\n)+', Text), + (r'import\b', Keyword.Namespace, '#pop'), + # if None occurs here, it's "raise x from None", since None can + # never be a module name + (r'None\b', Name.Builtin.Pseudo, '#pop'), + # sadly, in "raise x from y" y will be highlighted as namespace too + (r'[a-zA-Z_.][\w.]*', Name.Namespace), + # anything else here also means "raise x from y" and is therefore + # not an error + default('#pop'), + ], + 'stringescape': [ + (r'\\([\\abfnrtv"\']|\n|N\{.*?\}|u[a-fA-F0-9]{4}|' + r'U[a-fA-F0-9]{8}|x[a-fA-F0-9]{2}|[0-7]{1,3})', String.Escape) + ], + 'strings-single': innerstring_rules(String.Single), + 'strings-double': innerstring_rules(String.Double), + 'dqs': [ + (r'"', String.Double, '#pop'), + (r'\\\\|\\"|\\\n', String.Escape), # included here for raw strings + include('strings-double') + ], + 'sqs': [ + (r"'", String.Single, '#pop'), + (r"\\\\|\\'|\\\n", String.Escape), # included here for raw strings + include('strings-single') + ], + 'tdqs': [ + (r'"""', String.Double, '#pop'), + include('strings-double'), + (r'\n', String.Double) + ], + 'tsqs': [ + (r"'''", String.Single, '#pop'), + include('strings-single'), + (r'\n', String.Single) + ], + } + + def analyse_text(text): + return shebang_matches(text, r'pythonw?2(\.\d)?') + + +class PythonConsoleLexer(Lexer): + """ + For Python console output or doctests, such as: + + .. sourcecode:: pycon + + >>> a = 'foo' + >>> print a + foo + >>> 1 / 0 + Traceback (most recent call last): + File "<stdin>", line 1, in <module> + ZeroDivisionError: integer division or modulo by zero + + Additional options: + + `python3` + Use Python 3 lexer for code. Default is ``True``. + + .. versionadded:: 1.0 + .. versionchanged:: 2.5 + Now defaults to ``True``. + """ + name = 'Python console session' + aliases = ['pycon'] + mimetypes = ['text/x-python-doctest'] + + def __init__(self, **options): + self.python3 = get_bool_opt(options, 'python3', True) + Lexer.__init__(self, **options) + + def get_tokens_unprocessed(self, text): + if self.python3: + pylexer = PythonLexer(**self.options) + tblexer = PythonTracebackLexer(**self.options) + else: + pylexer = Python2Lexer(**self.options) + tblexer = Python2TracebackLexer(**self.options) + + curcode = '' + insertions = [] + curtb = '' + tbindex = 0 + tb = 0 + for match in line_re.finditer(text): + line = match.group() + if line.startswith('>>> ') or line.startswith('... '): + tb = 0 + insertions.append((len(curcode), + [(0, Generic.Prompt, line[:4])])) + curcode += line[4:] + elif line.rstrip() == '...' and not tb: + # only a new >>> prompt can end an exception block + # otherwise an ellipsis in place of the traceback frames + # will be mishandled + insertions.append((len(curcode), + [(0, Generic.Prompt, '...')])) + curcode += line[3:] + else: + if curcode: + yield from do_insertions( + insertions, pylexer.get_tokens_unprocessed(curcode)) + curcode = '' + insertions = [] + if (line.startswith('Traceback (most recent call last):') or + re.match(' File "[^"]+", line \\d+\\n$', line)): + tb = 1 + curtb = line + tbindex = match.start() + elif line == 'KeyboardInterrupt\n': + yield match.start(), Name.Class, line + elif tb: + curtb += line + if not (line.startswith(' ') or line.strip() == '...'): + tb = 0 + for i, t, v in tblexer.get_tokens_unprocessed(curtb): + yield tbindex+i, t, v + curtb = '' + else: + yield match.start(), Generic.Output, line + if curcode: + yield from do_insertions(insertions, + pylexer.get_tokens_unprocessed(curcode)) + if curtb: + for i, t, v in tblexer.get_tokens_unprocessed(curtb): + yield tbindex+i, t, v + + +class PythonTracebackLexer(RegexLexer): + """ + For Python 3.x tracebacks, with support for chained exceptions. + + .. versionadded:: 1.0 + + .. versionchanged:: 2.5 + This is now the default ``PythonTracebackLexer``. It is still available + as the alias ``Python3TracebackLexer``. + """ + + name = 'Python Traceback' + aliases = ['pytb', 'py3tb'] + filenames = ['*.pytb', '*.py3tb'] + mimetypes = ['text/x-python-traceback', 'text/x-python3-traceback'] + + tokens = { + 'root': [ + (r'\n', Text), + (r'^Traceback \(most recent call last\):\n', Generic.Traceback, 'intb'), + (r'^During handling of the above exception, another ' + r'exception occurred:\n\n', Generic.Traceback), + (r'^The above exception was the direct cause of the ' + r'following exception:\n\n', Generic.Traceback), + (r'^(?= File "[^"]+", line \d+)', Generic.Traceback, 'intb'), + (r'^.*\n', Other), + ], + 'intb': [ + (r'^( File )("[^"]+")(, line )(\d+)(, in )(.+)(\n)', + bygroups(Text, Name.Builtin, Text, Number, Text, Name, Text)), + (r'^( File )("[^"]+")(, line )(\d+)(\n)', + bygroups(Text, Name.Builtin, Text, Number, Text)), + (r'^( )(.+)(\n)', + bygroups(Text, using(PythonLexer), Text), 'markers'), + (r'^([ \t]*)(\.\.\.)(\n)', + bygroups(Text, Comment, Text)), # for doctests... + (r'^([^:]+)(: )(.+)(\n)', + bygroups(Generic.Error, Text, Name, Text), '#pop'), + (r'^([a-zA-Z_][\w.]*)(:?\n)', + bygroups(Generic.Error, Text), '#pop') + ], + 'markers': [ + # Either `PEP 657 <https://www.python.org/dev/peps/pep-0657/>` + # error locations in Python 3.11+, or single-caret markers + # for syntax errors before that. + (r'^( {4,})(\^+)(\n)', + bygroups(Text, Punctuation.Marker, Text), + '#pop'), + default('#pop'), + ], + } + + +Python3TracebackLexer = PythonTracebackLexer + + +class Python2TracebackLexer(RegexLexer): + """ + For Python tracebacks. + + .. versionadded:: 0.7 + + .. versionchanged:: 2.5 + This class has been renamed from ``PythonTracebackLexer``. + ``PythonTracebackLexer`` now refers to the Python 3 variant. + """ + + name = 'Python 2.x Traceback' + aliases = ['py2tb'] + filenames = ['*.py2tb'] + mimetypes = ['text/x-python2-traceback'] + + tokens = { + 'root': [ + # Cover both (most recent call last) and (innermost last) + # The optional ^C allows us to catch keyboard interrupt signals. + (r'^(\^C)?(Traceback.*\n)', + bygroups(Text, Generic.Traceback), 'intb'), + # SyntaxError starts with this. + (r'^(?= File "[^"]+", line \d+)', Generic.Traceback, 'intb'), + (r'^.*\n', Other), + ], + 'intb': [ + (r'^( File )("[^"]+")(, line )(\d+)(, in )(.+)(\n)', + bygroups(Text, Name.Builtin, Text, Number, Text, Name, Text)), + (r'^( File )("[^"]+")(, line )(\d+)(\n)', + bygroups(Text, Name.Builtin, Text, Number, Text)), + (r'^( )(.+)(\n)', + bygroups(Text, using(Python2Lexer), Text), 'marker'), + (r'^([ \t]*)(\.\.\.)(\n)', + bygroups(Text, Comment, Text)), # for doctests... + (r'^([^:]+)(: )(.+)(\n)', + bygroups(Generic.Error, Text, Name, Text), '#pop'), + (r'^([a-zA-Z_]\w*)(:?\n)', + bygroups(Generic.Error, Text), '#pop') + ], + 'marker': [ + # For syntax errors. + (r'( {4,})(\^)', bygroups(Text, Punctuation.Marker), '#pop'), + default('#pop'), + ], + } + + +class CythonLexer(RegexLexer): + """ + For Pyrex and `Cython <http://cython.org>`_ source code. + + .. versionadded:: 1.1 + """ + + name = 'Cython' + aliases = ['cython', 'pyx', 'pyrex'] + filenames = ['*.pyx', '*.pxd', '*.pxi'] + mimetypes = ['text/x-cython', 'application/x-cython'] + + tokens = { + 'root': [ + (r'\n', Text), + (r'^(\s*)("""(?:.|\n)*?""")', bygroups(Text, String.Doc)), + (r"^(\s*)('''(?:.|\n)*?''')", bygroups(Text, String.Doc)), + (r'[^\S\n]+', Text), + (r'#.*$', Comment), + (r'[]{}:(),;[]', Punctuation), + (r'\\\n', Text), + (r'\\', Text), + (r'(in|is|and|or|not)\b', Operator.Word), + (r'(<)([a-zA-Z0-9.?]+)(>)', + bygroups(Punctuation, Keyword.Type, Punctuation)), + (r'!=|==|<<|>>|[-~+/*%=<>&^|.?]', Operator), + (r'(from)(\d+)(<=)(\s+)(<)(\d+)(:)', + bygroups(Keyword, Number.Integer, Operator, Name, Operator, + Name, Punctuation)), + include('keywords'), + (r'(def|property)(\s+)', bygroups(Keyword, Text), 'funcname'), + (r'(cp?def)(\s+)', bygroups(Keyword, Text), 'cdef'), + # (should actually start a block with only cdefs) + (r'(cdef)(:)', bygroups(Keyword, Punctuation)), + (r'(class|struct)(\s+)', bygroups(Keyword, Text), 'classname'), + (r'(from)(\s+)', bygroups(Keyword, Text), 'fromimport'), + (r'(c?import)(\s+)', bygroups(Keyword, Text), 'import'), + include('builtins'), + include('backtick'), + ('(?:[rR]|[uU][rR]|[rR][uU])"""', String, 'tdqs'), + ("(?:[rR]|[uU][rR]|[rR][uU])'''", String, 'tsqs'), + ('(?:[rR]|[uU][rR]|[rR][uU])"', String, 'dqs'), + ("(?:[rR]|[uU][rR]|[rR][uU])'", String, 'sqs'), + ('[uU]?"""', String, combined('stringescape', 'tdqs')), + ("[uU]?'''", String, combined('stringescape', 'tsqs')), + ('[uU]?"', String, combined('stringescape', 'dqs')), + ("[uU]?'", String, combined('stringescape', 'sqs')), + include('name'), + include('numbers'), + ], + 'keywords': [ + (words(( + 'assert', 'async', 'await', 'break', 'by', 'continue', 'ctypedef', 'del', 'elif', + 'else', 'except', 'except?', 'exec', 'finally', 'for', 'fused', 'gil', + 'global', 'if', 'include', 'lambda', 'nogil', 'pass', 'print', + 'raise', 'return', 'try', 'while', 'yield', 'as', 'with'), suffix=r'\b'), + Keyword), + (r'(DEF|IF|ELIF|ELSE)\b', Comment.Preproc), + ], + 'builtins': [ + (words(( + '__import__', 'abs', 'all', 'any', 'apply', 'basestring', 'bin', 'bint', + 'bool', 'buffer', 'bytearray', 'bytes', 'callable', 'chr', + 'classmethod', 'cmp', 'coerce', 'compile', 'complex', 'delattr', + 'dict', 'dir', 'divmod', 'enumerate', 'eval', 'execfile', 'exit', + 'file', 'filter', 'float', 'frozenset', 'getattr', 'globals', + 'hasattr', 'hash', 'hex', 'id', 'input', 'int', 'intern', 'isinstance', + 'issubclass', 'iter', 'len', 'list', 'locals', 'long', 'map', 'max', + 'min', 'next', 'object', 'oct', 'open', 'ord', 'pow', 'property', 'Py_ssize_t', + 'range', 'raw_input', 'reduce', 'reload', 'repr', 'reversed', + 'round', 'set', 'setattr', 'slice', 'sorted', 'staticmethod', + 'str', 'sum', 'super', 'tuple', 'type', 'unichr', 'unicode', 'unsigned', + 'vars', 'xrange', 'zip'), prefix=r'(?<!\.)', suffix=r'\b'), + Name.Builtin), + (r'(?<!\.)(self|None|Ellipsis|NotImplemented|False|True|NULL' + r')\b', Name.Builtin.Pseudo), + (words(( + 'ArithmeticError', 'AssertionError', 'AttributeError', + 'BaseException', 'DeprecationWarning', 'EOFError', 'EnvironmentError', + 'Exception', 'FloatingPointError', 'FutureWarning', 'GeneratorExit', + 'IOError', 'ImportError', 'ImportWarning', 'IndentationError', + 'IndexError', 'KeyError', 'KeyboardInterrupt', 'LookupError', + 'MemoryError', 'NameError', 'NotImplemented', 'NotImplementedError', + 'OSError', 'OverflowError', 'OverflowWarning', + 'PendingDeprecationWarning', 'ReferenceError', 'RuntimeError', + 'RuntimeWarning', 'StandardError', 'StopIteration', 'SyntaxError', + 'SyntaxWarning', 'SystemError', 'SystemExit', 'TabError', + 'TypeError', 'UnboundLocalError', 'UnicodeDecodeError', + 'UnicodeEncodeError', 'UnicodeError', 'UnicodeTranslateError', + 'UnicodeWarning', 'UserWarning', 'ValueError', 'Warning', + 'ZeroDivisionError'), prefix=r'(?<!\.)', suffix=r'\b'), + Name.Exception), + ], + 'numbers': [ + (r'(\d+\.?\d*|\d*\.\d+)([eE][+-]?[0-9]+)?', Number.Float), + (r'0\d+', Number.Oct), + (r'0[xX][a-fA-F0-9]+', Number.Hex), + (r'\d+L', Number.Integer.Long), + (r'\d+', Number.Integer) + ], + 'backtick': [ + ('`.*?`', String.Backtick), + ], + 'name': [ + (r'@\w+', Name.Decorator), + (r'[a-zA-Z_]\w*', Name), + ], + 'funcname': [ + (r'[a-zA-Z_]\w*', Name.Function, '#pop') + ], + 'cdef': [ + (r'(public|readonly|extern|api|inline)\b', Keyword.Reserved), + (r'(struct|enum|union|class)\b', Keyword), + (r'([a-zA-Z_]\w*)(\s*)(?=[(:#=]|$)', + bygroups(Name.Function, Text), '#pop'), + (r'([a-zA-Z_]\w*)(\s*)(,)', + bygroups(Name.Function, Text, Punctuation)), + (r'from\b', Keyword, '#pop'), + (r'as\b', Keyword), + (r':', Punctuation, '#pop'), + (r'(?=["\'])', Text, '#pop'), + (r'[a-zA-Z_]\w*', Keyword.Type), + (r'.', Text), + ], + 'classname': [ + (r'[a-zA-Z_]\w*', Name.Class, '#pop') + ], + 'import': [ + (r'(\s+)(as)(\s+)', bygroups(Text, Keyword, Text)), + (r'[a-zA-Z_][\w.]*', Name.Namespace), + (r'(\s*)(,)(\s*)', bygroups(Text, Operator, Text)), + default('#pop') # all else: go back + ], + 'fromimport': [ + (r'(\s+)(c?import)\b', bygroups(Text, Keyword), '#pop'), + (r'[a-zA-Z_.][\w.]*', Name.Namespace), + # ``cdef foo from "header"``, or ``for foo from 0 < i < 10`` + default('#pop'), + ], + 'stringescape': [ + (r'\\([\\abfnrtv"\']|\n|N\{.*?\}|u[a-fA-F0-9]{4}|' + r'U[a-fA-F0-9]{8}|x[a-fA-F0-9]{2}|[0-7]{1,3})', String.Escape) + ], + 'strings': [ + (r'%(\([a-zA-Z0-9]+\))?[-#0 +]*([0-9]+|[*])?(\.([0-9]+|[*]))?' + '[hlL]?[E-GXc-giorsux%]', String.Interpol), + (r'[^\\\'"%\n]+', String), + # quotes, percents and backslashes must be parsed one at a time + (r'[\'"\\]', String), + # unhandled string formatting sign + (r'%', String) + # newlines are an error (use "nl" state) + ], + 'nl': [ + (r'\n', String) + ], + 'dqs': [ + (r'"', String, '#pop'), + (r'\\\\|\\"|\\\n', String.Escape), # included here again for raw strings + include('strings') + ], + 'sqs': [ + (r"'", String, '#pop'), + (r"\\\\|\\'|\\\n", String.Escape), # included here again for raw strings + include('strings') + ], + 'tdqs': [ + (r'"""', String, '#pop'), + include('strings'), + include('nl') + ], + 'tsqs': [ + (r"'''", String, '#pop'), + include('strings'), + include('nl') + ], + } + + +class DgLexer(RegexLexer): + """ + Lexer for `dg <http://pyos.github.com/dg>`_, + a functional and object-oriented programming language + running on the CPython 3 VM. + + .. versionadded:: 1.6 + """ + name = 'dg' + aliases = ['dg'] + filenames = ['*.dg'] + mimetypes = ['text/x-dg'] + + tokens = { + 'root': [ + (r'\s+', Text), + (r'#.*?$', Comment.Single), + + (r'(?i)0b[01]+', Number.Bin), + (r'(?i)0o[0-7]+', Number.Oct), + (r'(?i)0x[0-9a-f]+', Number.Hex), + (r'(?i)[+-]?[0-9]+\.[0-9]+(e[+-]?[0-9]+)?j?', Number.Float), + (r'(?i)[+-]?[0-9]+e[+-]?\d+j?', Number.Float), + (r'(?i)[+-]?[0-9]+j?', Number.Integer), + + (r"(?i)(br|r?b?)'''", String, combined('stringescape', 'tsqs', 'string')), + (r'(?i)(br|r?b?)"""', String, combined('stringescape', 'tdqs', 'string')), + (r"(?i)(br|r?b?)'", String, combined('stringescape', 'sqs', 'string')), + (r'(?i)(br|r?b?)"', String, combined('stringescape', 'dqs', 'string')), + + (r"`\w+'*`", Operator), + (r'\b(and|in|is|or|where)\b', Operator.Word), + (r'[!$%&*+\-./:<-@\\^|~;,]+', Operator), + + (words(( + 'bool', 'bytearray', 'bytes', 'classmethod', 'complex', 'dict', 'dict\'', + 'float', 'frozenset', 'int', 'list', 'list\'', 'memoryview', 'object', + 'property', 'range', 'set', 'set\'', 'slice', 'staticmethod', 'str', + 'super', 'tuple', 'tuple\'', 'type'), + prefix=r'(?<!\.)', suffix=r'(?![\'\w])'), + Name.Builtin), + (words(( + '__import__', 'abs', 'all', 'any', 'bin', 'bind', 'chr', 'cmp', 'compile', + 'complex', 'delattr', 'dir', 'divmod', 'drop', 'dropwhile', 'enumerate', + 'eval', 'exhaust', 'filter', 'flip', 'foldl1?', 'format', 'fst', + 'getattr', 'globals', 'hasattr', 'hash', 'head', 'hex', 'id', 'init', + 'input', 'isinstance', 'issubclass', 'iter', 'iterate', 'last', 'len', + 'locals', 'map', 'max', 'min', 'next', 'oct', 'open', 'ord', 'pow', + 'print', 'repr', 'reversed', 'round', 'setattr', 'scanl1?', 'snd', + 'sorted', 'sum', 'tail', 'take', 'takewhile', 'vars', 'zip'), + prefix=r'(?<!\.)', suffix=r'(?![\'\w])'), + Name.Builtin), + (r"(?<!\.)(self|Ellipsis|NotImplemented|None|True|False)(?!['\w])", + Name.Builtin.Pseudo), + + (r"(?<!\.)[A-Z]\w*(Error|Exception|Warning)'*(?!['\w])", + Name.Exception), + (r"(?<!\.)(Exception|GeneratorExit|KeyboardInterrupt|StopIteration|" + r"SystemExit)(?!['\w])", Name.Exception), + + (r"(?<![\w.])(except|finally|for|if|import|not|otherwise|raise|" + r"subclass|while|with|yield)(?!['\w])", Keyword.Reserved), + + (r"[A-Z_]+'*(?!['\w])", Name), + (r"[A-Z]\w+'*(?!['\w])", Keyword.Type), + (r"\w+'*", Name), + + (r'[()]', Punctuation), + (r'.', Error), + ], + 'stringescape': [ + (r'\\([\\abfnrtv"\']|\n|N\{.*?\}|u[a-fA-F0-9]{4}|' + r'U[a-fA-F0-9]{8}|x[a-fA-F0-9]{2}|[0-7]{1,3})', String.Escape) + ], + 'string': [ + (r'%(\(\w+\))?[-#0 +]*([0-9]+|[*])?(\.([0-9]+|[*]))?' + '[hlL]?[E-GXc-giorsux%]', String.Interpol), + (r'[^\\\'"%\n]+', String), + # quotes, percents and backslashes must be parsed one at a time + (r'[\'"\\]', String), + # unhandled string formatting sign + (r'%', String), + (r'\n', String) + ], + 'dqs': [ + (r'"', String, '#pop') + ], + 'sqs': [ + (r"'", String, '#pop') + ], + 'tdqs': [ + (r'"""', String, '#pop') + ], + 'tsqs': [ + (r"'''", String, '#pop') + ], + } + + +class NumPyLexer(PythonLexer): + """ + A Python lexer recognizing Numerical Python builtins. + + .. versionadded:: 0.10 + """ + + name = 'NumPy' + aliases = ['numpy'] + + # override the mimetypes to not inherit them from python + mimetypes = [] + filenames = [] + + EXTRA_KEYWORDS = { + 'abs', 'absolute', 'accumulate', 'add', 'alen', 'all', 'allclose', + 'alltrue', 'alterdot', 'amax', 'amin', 'angle', 'any', 'append', + 'apply_along_axis', 'apply_over_axes', 'arange', 'arccos', 'arccosh', + 'arcsin', 'arcsinh', 'arctan', 'arctan2', 'arctanh', 'argmax', 'argmin', + 'argsort', 'argwhere', 'around', 'array', 'array2string', 'array_equal', + 'array_equiv', 'array_repr', 'array_split', 'array_str', 'arrayrange', + 'asanyarray', 'asarray', 'asarray_chkfinite', 'ascontiguousarray', + 'asfarray', 'asfortranarray', 'asmatrix', 'asscalar', 'astype', + 'atleast_1d', 'atleast_2d', 'atleast_3d', 'average', 'bartlett', + 'base_repr', 'beta', 'binary_repr', 'bincount', 'binomial', + 'bitwise_and', 'bitwise_not', 'bitwise_or', 'bitwise_xor', 'blackman', + 'bmat', 'broadcast', 'byte_bounds', 'bytes', 'byteswap', 'c_', + 'can_cast', 'ceil', 'choose', 'clip', 'column_stack', 'common_type', + 'compare_chararrays', 'compress', 'concatenate', 'conj', 'conjugate', + 'convolve', 'copy', 'corrcoef', 'correlate', 'cos', 'cosh', 'cov', + 'cross', 'cumprod', 'cumproduct', 'cumsum', 'delete', 'deprecate', + 'diag', 'diagflat', 'diagonal', 'diff', 'digitize', 'disp', 'divide', + 'dot', 'dsplit', 'dstack', 'dtype', 'dump', 'dumps', 'ediff1d', 'empty', + 'empty_like', 'equal', 'exp', 'expand_dims', 'expm1', 'extract', 'eye', + 'fabs', 'fastCopyAndTranspose', 'fft', 'fftfreq', 'fftshift', 'fill', + 'finfo', 'fix', 'flat', 'flatnonzero', 'flatten', 'fliplr', 'flipud', + 'floor', 'floor_divide', 'fmod', 'frexp', 'fromarrays', 'frombuffer', + 'fromfile', 'fromfunction', 'fromiter', 'frompyfunc', 'fromstring', + 'generic', 'get_array_wrap', 'get_include', 'get_numarray_include', + 'get_numpy_include', 'get_printoptions', 'getbuffer', 'getbufsize', + 'geterr', 'geterrcall', 'geterrobj', 'getfield', 'gradient', 'greater', + 'greater_equal', 'gumbel', 'hamming', 'hanning', 'histogram', + 'histogram2d', 'histogramdd', 'hsplit', 'hstack', 'hypot', 'i0', + 'identity', 'ifft', 'imag', 'index_exp', 'indices', 'inf', 'info', + 'inner', 'insert', 'int_asbuffer', 'interp', 'intersect1d', + 'intersect1d_nu', 'inv', 'invert', 'iscomplex', 'iscomplexobj', + 'isfinite', 'isfortran', 'isinf', 'isnan', 'isneginf', 'isposinf', + 'isreal', 'isrealobj', 'isscalar', 'issctype', 'issubclass_', + 'issubdtype', 'issubsctype', 'item', 'itemset', 'iterable', 'ix_', + 'kaiser', 'kron', 'ldexp', 'left_shift', 'less', 'less_equal', 'lexsort', + 'linspace', 'load', 'loads', 'loadtxt', 'log', 'log10', 'log1p', 'log2', + 'logical_and', 'logical_not', 'logical_or', 'logical_xor', 'logspace', + 'lstsq', 'mat', 'matrix', 'max', 'maximum', 'maximum_sctype', + 'may_share_memory', 'mean', 'median', 'meshgrid', 'mgrid', 'min', + 'minimum', 'mintypecode', 'mod', 'modf', 'msort', 'multiply', 'nan', + 'nan_to_num', 'nanargmax', 'nanargmin', 'nanmax', 'nanmin', 'nansum', + 'ndenumerate', 'ndim', 'ndindex', 'negative', 'newaxis', 'newbuffer', + 'newbyteorder', 'nonzero', 'not_equal', 'obj2sctype', 'ogrid', 'ones', + 'ones_like', 'outer', 'permutation', 'piecewise', 'pinv', 'pkgload', + 'place', 'poisson', 'poly', 'poly1d', 'polyadd', 'polyder', 'polydiv', + 'polyfit', 'polyint', 'polymul', 'polysub', 'polyval', 'power', 'prod', + 'product', 'ptp', 'put', 'putmask', 'r_', 'randint', 'random_integers', + 'random_sample', 'ranf', 'rank', 'ravel', 'real', 'real_if_close', + 'recarray', 'reciprocal', 'reduce', 'remainder', 'repeat', 'require', + 'reshape', 'resize', 'restoredot', 'right_shift', 'rint', 'roll', + 'rollaxis', 'roots', 'rot90', 'round', 'round_', 'row_stack', 's_', + 'sample', 'savetxt', 'sctype2char', 'searchsorted', 'seed', 'select', + 'set_numeric_ops', 'set_printoptions', 'set_string_function', + 'setbufsize', 'setdiff1d', 'seterr', 'seterrcall', 'seterrobj', + 'setfield', 'setflags', 'setmember1d', 'setxor1d', 'shape', + 'show_config', 'shuffle', 'sign', 'signbit', 'sin', 'sinc', 'sinh', + 'size', 'slice', 'solve', 'sometrue', 'sort', 'sort_complex', 'source', + 'split', 'sqrt', 'square', 'squeeze', 'standard_normal', 'std', + 'subtract', 'sum', 'svd', 'swapaxes', 'take', 'tan', 'tanh', 'tensordot', + 'test', 'tile', 'tofile', 'tolist', 'tostring', 'trace', 'transpose', + 'trapz', 'tri', 'tril', 'trim_zeros', 'triu', 'true_divide', 'typeDict', + 'typename', 'uniform', 'union1d', 'unique', 'unique1d', 'unravel_index', + 'unwrap', 'vander', 'var', 'vdot', 'vectorize', 'view', 'vonmises', + 'vsplit', 'vstack', 'weibull', 'where', 'who', 'zeros', 'zeros_like' + } + + def get_tokens_unprocessed(self, text): + for index, token, value in \ + PythonLexer.get_tokens_unprocessed(self, text): + if token is Name and value in self.EXTRA_KEYWORDS: + yield index, Keyword.Pseudo, value + else: + yield index, token, value + + def analyse_text(text): + ltext = text[:1000] + return (shebang_matches(text, r'pythonw?(3(\.\d)?)?') or + 'import ' in ltext) \ + and ('import numpy' in ltext or 'from numpy import' in ltext) diff --git a/src/pip/_vendor/pygments/modeline.py b/src/pip/_vendor/pygments/modeline.py new file mode 100644 index 000000000..047d86d6b --- /dev/null +++ b/src/pip/_vendor/pygments/modeline.py @@ -0,0 +1,43 @@ +""" + pygments.modeline + ~~~~~~~~~~~~~~~~~ + + A simple modeline parser (based on pymodeline). + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re + +__all__ = ['get_filetype_from_buffer'] + + +modeline_re = re.compile(r''' + (?: vi | vim | ex ) (?: [<=>]? \d* )? : + .* (?: ft | filetype | syn | syntax ) = ( [^:\s]+ ) +''', re.VERBOSE) + + +def get_filetype_from_line(l): + m = modeline_re.search(l) + if m: + return m.group(1) + + +def get_filetype_from_buffer(buf, max_lines=5): + """ + Scan the buffer for modelines and return filetype if one is found. + """ + lines = buf.splitlines() + for l in lines[-1:-max_lines-1:-1]: + ret = get_filetype_from_line(l) + if ret: + return ret + for i in range(max_lines, -1, -1): + if i < len(lines): + ret = get_filetype_from_line(lines[i]) + if ret: + return ret + + return None diff --git a/src/pip/_vendor/pygments/plugin.py b/src/pip/_vendor/pygments/plugin.py new file mode 100644 index 000000000..958ca21a3 --- /dev/null +++ b/src/pip/_vendor/pygments/plugin.py @@ -0,0 +1,69 @@ +""" + pygments.plugin + ~~~~~~~~~~~~~~~ + + Pygments setuptools plugin interface. The methods defined + here also work if setuptools isn't installed but they just + return nothing. + + lexer plugins:: + + [pygments.lexers] + yourlexer = yourmodule:YourLexer + + formatter plugins:: + + [pygments.formatters] + yourformatter = yourformatter:YourFormatter + /.ext = yourformatter:YourFormatter + + As you can see, you can define extensions for the formatter + with a leading slash. + + syntax plugins:: + + [pygments.styles] + yourstyle = yourstyle:YourStyle + + filter plugin:: + + [pygments.filter] + yourfilter = yourfilter:YourFilter + + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" +LEXER_ENTRY_POINT = 'pygments.lexers' +FORMATTER_ENTRY_POINT = 'pygments.formatters' +STYLE_ENTRY_POINT = 'pygments.styles' +FILTER_ENTRY_POINT = 'pygments.filters' + + +def iter_entry_points(group_name): + try: + from pip._vendor import pkg_resources + except (ImportError, OSError): + return [] + + return pkg_resources.iter_entry_points(group_name) + + +def find_plugin_lexers(): + for entrypoint in iter_entry_points(LEXER_ENTRY_POINT): + yield entrypoint.load() + + +def find_plugin_formatters(): + for entrypoint in iter_entry_points(FORMATTER_ENTRY_POINT): + yield entrypoint.name, entrypoint.load() + + +def find_plugin_styles(): + for entrypoint in iter_entry_points(STYLE_ENTRY_POINT): + yield entrypoint.name, entrypoint.load() + + +def find_plugin_filters(): + for entrypoint in iter_entry_points(FILTER_ENTRY_POINT): + yield entrypoint.name, entrypoint.load() diff --git a/src/pip/_vendor/pygments/regexopt.py b/src/pip/_vendor/pygments/regexopt.py new file mode 100644 index 000000000..cb2c8e21a --- /dev/null +++ b/src/pip/_vendor/pygments/regexopt.py @@ -0,0 +1,91 @@ +""" + pygments.regexopt + ~~~~~~~~~~~~~~~~~ + + An algorithm that generates optimized regexes for matching long lists of + literal strings. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +from re import escape +from os.path import commonprefix +from itertools import groupby +from operator import itemgetter + +CS_ESCAPE = re.compile(r'[\[\^\\\-\]]') +FIRST_ELEMENT = itemgetter(0) + + +def make_charset(letters): + return '[' + CS_ESCAPE.sub(lambda m: '\\' + m.group(), ''.join(letters)) + ']' + + +def regex_opt_inner(strings, open_paren): + """Return a regex that matches any string in the sorted list of strings.""" + close_paren = open_paren and ')' or '' + # print strings, repr(open_paren) + if not strings: + # print '-> nothing left' + return '' + first = strings[0] + if len(strings) == 1: + # print '-> only 1 string' + return open_paren + escape(first) + close_paren + if not first: + # print '-> first string empty' + return open_paren + regex_opt_inner(strings[1:], '(?:') \ + + '?' + close_paren + if len(first) == 1: + # multiple one-char strings? make a charset + oneletter = [] + rest = [] + for s in strings: + if len(s) == 1: + oneletter.append(s) + else: + rest.append(s) + if len(oneletter) > 1: # do we have more than one oneletter string? + if rest: + # print '-> 1-character + rest' + return open_paren + regex_opt_inner(rest, '') + '|' \ + + make_charset(oneletter) + close_paren + # print '-> only 1-character' + return open_paren + make_charset(oneletter) + close_paren + prefix = commonprefix(strings) + if prefix: + plen = len(prefix) + # we have a prefix for all strings + # print '-> prefix:', prefix + return open_paren + escape(prefix) \ + + regex_opt_inner([s[plen:] for s in strings], '(?:') \ + + close_paren + # is there a suffix? + strings_rev = [s[::-1] for s in strings] + suffix = commonprefix(strings_rev) + if suffix: + slen = len(suffix) + # print '-> suffix:', suffix[::-1] + return open_paren \ + + regex_opt_inner(sorted(s[:-slen] for s in strings), '(?:') \ + + escape(suffix[::-1]) + close_paren + # recurse on common 1-string prefixes + # print '-> last resort' + return open_paren + \ + '|'.join(regex_opt_inner(list(group[1]), '') + for group in groupby(strings, lambda s: s[0] == first[0])) \ + + close_paren + + +def regex_opt(strings, prefix='', suffix=''): + """Return a compiled regex that matches any string in the given list. + + The strings to match must be literal strings, not regexes. They will be + regex-escaped. + + *prefix* and *suffix* are pre- and appended to the final regex. + """ + strings = sorted(strings) + return prefix + regex_opt_inner(strings, '(') + suffix diff --git a/src/pip/_vendor/pygments/scanner.py b/src/pip/_vendor/pygments/scanner.py new file mode 100644 index 000000000..5f32a22c3 --- /dev/null +++ b/src/pip/_vendor/pygments/scanner.py @@ -0,0 +1,104 @@ +""" + pygments.scanner + ~~~~~~~~~~~~~~~~ + + This library implements a regex based scanner. Some languages + like Pascal are easy to parse but have some keywords that + depend on the context. Because of this it's impossible to lex + that just by using a regular expression lexer like the + `RegexLexer`. + + Have a look at the `DelphiLexer` to get an idea of how to use + this scanner. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" +import re + + +class EndOfText(RuntimeError): + """ + Raise if end of text is reached and the user + tried to call a match function. + """ + + +class Scanner: + """ + Simple scanner + + All method patterns are regular expression strings (not + compiled expressions!) + """ + + def __init__(self, text, flags=0): + """ + :param text: The text which should be scanned + :param flags: default regular expression flags + """ + self.data = text + self.data_length = len(text) + self.start_pos = 0 + self.pos = 0 + self.flags = flags + self.last = None + self.match = None + self._re_cache = {} + + def eos(self): + """`True` if the scanner reached the end of text.""" + return self.pos >= self.data_length + eos = property(eos, eos.__doc__) + + def check(self, pattern): + """ + Apply `pattern` on the current position and return + the match object. (Doesn't touch pos). Use this for + lookahead. + """ + if self.eos: + raise EndOfText() + if pattern not in self._re_cache: + self._re_cache[pattern] = re.compile(pattern, self.flags) + return self._re_cache[pattern].match(self.data, self.pos) + + def test(self, pattern): + """Apply a pattern on the current position and check + if it patches. Doesn't touch pos. + """ + return self.check(pattern) is not None + + def scan(self, pattern): + """ + Scan the text for the given pattern and update pos/match + and related fields. The return value is a boolen that + indicates if the pattern matched. The matched value is + stored on the instance as ``match``, the last value is + stored as ``last``. ``start_pos`` is the position of the + pointer before the pattern was matched, ``pos`` is the + end position. + """ + if self.eos: + raise EndOfText() + if pattern not in self._re_cache: + self._re_cache[pattern] = re.compile(pattern, self.flags) + self.last = self.match + m = self._re_cache[pattern].match(self.data, self.pos) + if m is None: + return False + self.start_pos = m.start() + self.pos = m.end() + self.match = m.group() + return True + + def get_char(self): + """Scan exactly one char.""" + self.scan('.') + + def __repr__(self): + return '<%s %d/%d>' % ( + self.__class__.__name__, + self.pos, + self.data_length + ) diff --git a/src/pip/_vendor/pygments/sphinxext.py b/src/pip/_vendor/pygments/sphinxext.py new file mode 100644 index 000000000..2412dee0a --- /dev/null +++ b/src/pip/_vendor/pygments/sphinxext.py @@ -0,0 +1,155 @@ +""" + pygments.sphinxext + ~~~~~~~~~~~~~~~~~~ + + Sphinx extension to generate automatic documentation of lexers, + formatters and filters. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import sys + +from docutils import nodes +from docutils.statemachine import ViewList +from docutils.parsers.rst import Directive +from sphinx.util.nodes import nested_parse_with_titles + + +MODULEDOC = ''' +.. module:: %s + +%s +%s +''' + +LEXERDOC = ''' +.. class:: %s + + :Short names: %s + :Filenames: %s + :MIME types: %s + + %s + +''' + +FMTERDOC = ''' +.. class:: %s + + :Short names: %s + :Filenames: %s + + %s + +''' + +FILTERDOC = ''' +.. class:: %s + + :Name: %s + + %s + +''' + + +class PygmentsDoc(Directive): + """ + A directive to collect all lexers/formatters/filters and generate + autoclass directives for them. + """ + has_content = False + required_arguments = 1 + optional_arguments = 0 + final_argument_whitespace = False + option_spec = {} + + def run(self): + self.filenames = set() + if self.arguments[0] == 'lexers': + out = self.document_lexers() + elif self.arguments[0] == 'formatters': + out = self.document_formatters() + elif self.arguments[0] == 'filters': + out = self.document_filters() + else: + raise Exception('invalid argument for "pygmentsdoc" directive') + node = nodes.compound() + vl = ViewList(out.split('\n'), source='') + nested_parse_with_titles(self.state, vl, node) + for fn in self.filenames: + self.state.document.settings.record_dependencies.add(fn) + return node.children + + def document_lexers(self): + from pip._vendor.pygments.lexers._mapping import LEXERS + out = [] + modules = {} + moduledocstrings = {} + for classname, data in sorted(LEXERS.items(), key=lambda x: x[0]): + module = data[0] + mod = __import__(module, None, None, [classname]) + self.filenames.add(mod.__file__) + cls = getattr(mod, classname) + if not cls.__doc__: + print("Warning: %s does not have a docstring." % classname) + docstring = cls.__doc__ + if isinstance(docstring, bytes): + docstring = docstring.decode('utf8') + modules.setdefault(module, []).append(( + classname, + ', '.join(data[2]) or 'None', + ', '.join(data[3]).replace('*', '\\*').replace('_', '\\') or 'None', + ', '.join(data[4]) or 'None', + docstring)) + if module not in moduledocstrings: + moddoc = mod.__doc__ + if isinstance(moddoc, bytes): + moddoc = moddoc.decode('utf8') + moduledocstrings[module] = moddoc + + for module, lexers in sorted(modules.items(), key=lambda x: x[0]): + if moduledocstrings[module] is None: + raise Exception("Missing docstring for %s" % (module,)) + heading = moduledocstrings[module].splitlines()[4].strip().rstrip('.') + out.append(MODULEDOC % (module, heading, '-'*len(heading))) + for data in lexers: + out.append(LEXERDOC % data) + + return ''.join(out) + + def document_formatters(self): + from pip._vendor.pygments.formatters import FORMATTERS + + out = [] + for classname, data in sorted(FORMATTERS.items(), key=lambda x: x[0]): + module = data[0] + mod = __import__(module, None, None, [classname]) + self.filenames.add(mod.__file__) + cls = getattr(mod, classname) + docstring = cls.__doc__ + if isinstance(docstring, bytes): + docstring = docstring.decode('utf8') + heading = cls.__name__ + out.append(FMTERDOC % (heading, ', '.join(data[2]) or 'None', + ', '.join(data[3]).replace('*', '\\*') or 'None', + docstring)) + return ''.join(out) + + def document_filters(self): + from pip._vendor.pygments.filters import FILTERS + + out = [] + for name, cls in FILTERS.items(): + self.filenames.add(sys.modules[cls.__module__].__file__) + docstring = cls.__doc__ + if isinstance(docstring, bytes): + docstring = docstring.decode('utf8') + out.append(FILTERDOC % (cls.__name__, name, docstring)) + return ''.join(out) + + +def setup(app): + app.add_directive('pygmentsdoc', PygmentsDoc) diff --git a/src/pip/_vendor/pygments/style.py b/src/pip/_vendor/pygments/style.py new file mode 100644 index 000000000..ce79e2ba6 --- /dev/null +++ b/src/pip/_vendor/pygments/style.py @@ -0,0 +1,191 @@ +""" + pygments.style + ~~~~~~~~~~~~~~ + + Basic style object. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.token import Token, STANDARD_TYPES + +# Default mapping of ansixxx to RGB colors. +_ansimap = { + # dark + 'ansiblack': '000000', + 'ansired': '7f0000', + 'ansigreen': '007f00', + 'ansiyellow': '7f7fe0', + 'ansiblue': '00007f', + 'ansimagenta': '7f007f', + 'ansicyan': '007f7f', + 'ansigray': 'e5e5e5', + # normal + 'ansibrightblack': '555555', + 'ansibrightred': 'ff0000', + 'ansibrightgreen': '00ff00', + 'ansibrightyellow': 'ffff00', + 'ansibrightblue': '0000ff', + 'ansibrightmagenta': 'ff00ff', + 'ansibrightcyan': '00ffff', + 'ansiwhite': 'ffffff', +} +# mapping of deprecated #ansixxx colors to new color names +_deprecated_ansicolors = { + # dark + '#ansiblack': 'ansiblack', + '#ansidarkred': 'ansired', + '#ansidarkgreen': 'ansigreen', + '#ansibrown': 'ansiyellow', + '#ansidarkblue': 'ansiblue', + '#ansipurple': 'ansimagenta', + '#ansiteal': 'ansicyan', + '#ansilightgray': 'ansigray', + # normal + '#ansidarkgray': 'ansibrightblack', + '#ansired': 'ansibrightred', + '#ansigreen': 'ansibrightgreen', + '#ansiyellow': 'ansibrightyellow', + '#ansiblue': 'ansibrightblue', + '#ansifuchsia': 'ansibrightmagenta', + '#ansiturquoise': 'ansibrightcyan', + '#ansiwhite': 'ansiwhite', +} +ansicolors = set(_ansimap) + + +class StyleMeta(type): + + def __new__(mcs, name, bases, dct): + obj = type.__new__(mcs, name, bases, dct) + for token in STANDARD_TYPES: + if token not in obj.styles: + obj.styles[token] = '' + + def colorformat(text): + if text in ansicolors: + return text + if text[0:1] == '#': + col = text[1:] + if len(col) == 6: + return col + elif len(col) == 3: + return col[0] * 2 + col[1] * 2 + col[2] * 2 + elif text == '': + return '' + elif text.startswith('var') or text.startswith('calc'): + return text + assert False, "wrong color format %r" % text + + _styles = obj._styles = {} + + for ttype in obj.styles: + for token in ttype.split(): + if token in _styles: + continue + ndef = _styles.get(token.parent, None) + styledefs = obj.styles.get(token, '').split() + if not ndef or token is None: + ndef = ['', 0, 0, 0, '', '', 0, 0, 0] + elif 'noinherit' in styledefs and token is not Token: + ndef = _styles[Token][:] + else: + ndef = ndef[:] + _styles[token] = ndef + for styledef in obj.styles.get(token, '').split(): + if styledef == 'noinherit': + pass + elif styledef == 'bold': + ndef[1] = 1 + elif styledef == 'nobold': + ndef[1] = 0 + elif styledef == 'italic': + ndef[2] = 1 + elif styledef == 'noitalic': + ndef[2] = 0 + elif styledef == 'underline': + ndef[3] = 1 + elif styledef == 'nounderline': + ndef[3] = 0 + elif styledef[:3] == 'bg:': + ndef[4] = colorformat(styledef[3:]) + elif styledef[:7] == 'border:': + ndef[5] = colorformat(styledef[7:]) + elif styledef == 'roman': + ndef[6] = 1 + elif styledef == 'sans': + ndef[7] = 1 + elif styledef == 'mono': + ndef[8] = 1 + else: + ndef[0] = colorformat(styledef) + + return obj + + def style_for_token(cls, token): + t = cls._styles[token] + ansicolor = bgansicolor = None + color = t[0] + if color in _deprecated_ansicolors: + color = _deprecated_ansicolors[color] + if color in ansicolors: + ansicolor = color + color = _ansimap[color] + bgcolor = t[4] + if bgcolor in _deprecated_ansicolors: + bgcolor = _deprecated_ansicolors[bgcolor] + if bgcolor in ansicolors: + bgansicolor = bgcolor + bgcolor = _ansimap[bgcolor] + + return { + 'color': color or None, + 'bold': bool(t[1]), + 'italic': bool(t[2]), + 'underline': bool(t[3]), + 'bgcolor': bgcolor or None, + 'border': t[5] or None, + 'roman': bool(t[6]) or None, + 'sans': bool(t[7]) or None, + 'mono': bool(t[8]) or None, + 'ansicolor': ansicolor, + 'bgansicolor': bgansicolor, + } + + def list_styles(cls): + return list(cls) + + def styles_token(cls, ttype): + return ttype in cls._styles + + def __iter__(cls): + for token in cls._styles: + yield token, cls.style_for_token(token) + + def __len__(cls): + return len(cls._styles) + + +class Style(metaclass=StyleMeta): + + #: overall background color (``None`` means transparent) + background_color = '#ffffff' + + #: highlight background color + highlight_color = '#ffffcc' + + #: line number font color + line_number_color = 'inherit' + + #: line number background color + line_number_background_color = 'transparent' + + #: special line number font color + line_number_special_color = '#000000' + + #: special line number background color + line_number_special_background_color = '#ffffc0' + + #: Style definitions for individual token types. + styles = {} diff --git a/src/pip/_vendor/pygments/styles/__init__.py b/src/pip/_vendor/pygments/styles/__init__.py new file mode 100644 index 000000000..49cece87c --- /dev/null +++ b/src/pip/_vendor/pygments/styles/__init__.py @@ -0,0 +1,89 @@ +""" + pygments.styles + ~~~~~~~~~~~~~~~ + + Contains built-in styles. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +from pip._vendor.pygments.plugin import find_plugin_styles +from pip._vendor.pygments.util import ClassNotFound + + +#: Maps style names to 'submodule::classname'. +STYLE_MAP = { + 'default': 'default::DefaultStyle', + 'emacs': 'emacs::EmacsStyle', + 'friendly': 'friendly::FriendlyStyle', + 'colorful': 'colorful::ColorfulStyle', + 'autumn': 'autumn::AutumnStyle', + 'murphy': 'murphy::MurphyStyle', + 'manni': 'manni::ManniStyle', + 'material': 'material::MaterialStyle', + 'monokai': 'monokai::MonokaiStyle', + 'perldoc': 'perldoc::PerldocStyle', + 'pastie': 'pastie::PastieStyle', + 'borland': 'borland::BorlandStyle', + 'trac': 'trac::TracStyle', + 'native': 'native::NativeStyle', + 'fruity': 'fruity::FruityStyle', + 'bw': 'bw::BlackWhiteStyle', + 'vim': 'vim::VimStyle', + 'vs': 'vs::VisualStudioStyle', + 'tango': 'tango::TangoStyle', + 'rrt': 'rrt::RrtStyle', + 'xcode': 'xcode::XcodeStyle', + 'igor': 'igor::IgorStyle', + 'paraiso-light': 'paraiso_light::ParaisoLightStyle', + 'paraiso-dark': 'paraiso_dark::ParaisoDarkStyle', + 'lovelace': 'lovelace::LovelaceStyle', + 'algol': 'algol::AlgolStyle', + 'algol_nu': 'algol_nu::Algol_NuStyle', + 'arduino': 'arduino::ArduinoStyle', + 'rainbow_dash': 'rainbow_dash::RainbowDashStyle', + 'abap': 'abap::AbapStyle', + 'solarized-dark': 'solarized::SolarizedDarkStyle', + 'solarized-light': 'solarized::SolarizedLightStyle', + 'sas': 'sas::SasStyle', + 'stata': 'stata_light::StataLightStyle', + 'stata-light': 'stata_light::StataLightStyle', + 'stata-dark': 'stata_dark::StataDarkStyle', + 'inkpot': 'inkpot::InkPotStyle', + 'zenburn': 'zenburn::ZenburnStyle', + 'gruvbox-dark': 'gruvbox::GruvboxDarkStyle', + 'gruvbox-light': 'gruvbox::GruvboxLightStyle', +} + + +def get_style_by_name(name): + if name in STYLE_MAP: + mod, cls = STYLE_MAP[name].split('::') + builtin = "yes" + else: + for found_name, style in find_plugin_styles(): + if name == found_name: + return style + # perhaps it got dropped into our styles package + builtin = "" + mod = name + cls = name.title() + "Style" + + try: + mod = __import__('pygments.styles.' + mod, None, None, [cls]) + except ImportError: + raise ClassNotFound("Could not find style module %r" % mod + + (builtin and ", though it should be builtin") + ".") + try: + return getattr(mod, cls) + except AttributeError: + raise ClassNotFound("Could not find style class %r in style module." % cls) + + +def get_all_styles(): + """Return a generator for all styles by name, + both builtin and plugin.""" + yield from STYLE_MAP + for name, _ in find_plugin_styles(): + yield name diff --git a/src/pip/_vendor/pygments/token.py b/src/pip/_vendor/pygments/token.py new file mode 100644 index 000000000..9013acb70 --- /dev/null +++ b/src/pip/_vendor/pygments/token.py @@ -0,0 +1,212 @@ +""" + pygments.token + ~~~~~~~~~~~~~~ + + Basic token types and the standard tokens. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + + +class _TokenType(tuple): + parent = None + + def split(self): + buf = [] + node = self + while node is not None: + buf.append(node) + node = node.parent + buf.reverse() + return buf + + def __init__(self, *args): + # no need to call super.__init__ + self.subtypes = set() + + def __contains__(self, val): + return self is val or ( + type(val) is self.__class__ and + val[:len(self)] == self + ) + + def __getattr__(self, val): + if not val or not val[0].isupper(): + return tuple.__getattribute__(self, val) + new = _TokenType(self + (val,)) + setattr(self, val, new) + self.subtypes.add(new) + new.parent = self + return new + + def __repr__(self): + return 'Token' + (self and '.' or '') + '.'.join(self) + + def __copy__(self): + # These instances are supposed to be singletons + return self + + def __deepcopy__(self, memo): + # These instances are supposed to be singletons + return self + + +Token = _TokenType() + +# Special token types +Text = Token.Text +Whitespace = Text.Whitespace +Escape = Token.Escape +Error = Token.Error +# Text that doesn't belong to this lexer (e.g. HTML in PHP) +Other = Token.Other + +# Common token types for source code +Keyword = Token.Keyword +Name = Token.Name +Literal = Token.Literal +String = Literal.String +Number = Literal.Number +Punctuation = Token.Punctuation +Operator = Token.Operator +Comment = Token.Comment + +# Generic types for non-source code +Generic = Token.Generic + +# String and some others are not direct children of Token. +# alias them: +Token.Token = Token +Token.String = String +Token.Number = Number + + +def is_token_subtype(ttype, other): + """ + Return True if ``ttype`` is a subtype of ``other``. + + exists for backwards compatibility. use ``ttype in other`` now. + """ + return ttype in other + + +def string_to_tokentype(s): + """ + Convert a string into a token type:: + + >>> string_to_token('String.Double') + Token.Literal.String.Double + >>> string_to_token('Token.Literal.Number') + Token.Literal.Number + >>> string_to_token('') + Token + + Tokens that are already tokens are returned unchanged: + + >>> string_to_token(String) + Token.Literal.String + """ + if isinstance(s, _TokenType): + return s + if not s: + return Token + node = Token + for item in s.split('.'): + node = getattr(node, item) + return node + + +# Map standard token types to short names, used in CSS class naming. +# If you add a new item, please be sure to run this file to perform +# a consistency check for duplicate values. +STANDARD_TYPES = { + Token: '', + + Text: '', + Whitespace: 'w', + Escape: 'esc', + Error: 'err', + Other: 'x', + + Keyword: 'k', + Keyword.Constant: 'kc', + Keyword.Declaration: 'kd', + Keyword.Namespace: 'kn', + Keyword.Pseudo: 'kp', + Keyword.Reserved: 'kr', + Keyword.Type: 'kt', + + Name: 'n', + Name.Attribute: 'na', + Name.Builtin: 'nb', + Name.Builtin.Pseudo: 'bp', + Name.Class: 'nc', + Name.Constant: 'no', + Name.Decorator: 'nd', + Name.Entity: 'ni', + Name.Exception: 'ne', + Name.Function: 'nf', + Name.Function.Magic: 'fm', + Name.Property: 'py', + Name.Label: 'nl', + Name.Namespace: 'nn', + Name.Other: 'nx', + Name.Tag: 'nt', + Name.Variable: 'nv', + Name.Variable.Class: 'vc', + Name.Variable.Global: 'vg', + Name.Variable.Instance: 'vi', + Name.Variable.Magic: 'vm', + + Literal: 'l', + Literal.Date: 'ld', + + String: 's', + String.Affix: 'sa', + String.Backtick: 'sb', + String.Char: 'sc', + String.Delimiter: 'dl', + String.Doc: 'sd', + String.Double: 's2', + String.Escape: 'se', + String.Heredoc: 'sh', + String.Interpol: 'si', + String.Other: 'sx', + String.Regex: 'sr', + String.Single: 's1', + String.Symbol: 'ss', + + Number: 'm', + Number.Bin: 'mb', + Number.Float: 'mf', + Number.Hex: 'mh', + Number.Integer: 'mi', + Number.Integer.Long: 'il', + Number.Oct: 'mo', + + Operator: 'o', + Operator.Word: 'ow', + + Punctuation: 'p', + + Comment: 'c', + Comment.Hashbang: 'ch', + Comment.Multiline: 'cm', + Comment.Preproc: 'cp', + Comment.PreprocFile: 'cpf', + Comment.Single: 'c1', + Comment.Special: 'cs', + + Generic: 'g', + Generic.Deleted: 'gd', + Generic.Emph: 'ge', + Generic.Error: 'gr', + Generic.Heading: 'gh', + Generic.Inserted: 'gi', + Generic.Output: 'go', + Generic.Prompt: 'gp', + Generic.Strong: 'gs', + Generic.Subheading: 'gu', + Generic.Traceback: 'gt', +} diff --git a/src/pip/_vendor/pygments/unistring.py b/src/pip/_vendor/pygments/unistring.py new file mode 100644 index 000000000..4db9c7cef --- /dev/null +++ b/src/pip/_vendor/pygments/unistring.py @@ -0,0 +1,155 @@ +""" + pygments.unistring + ~~~~~~~~~~~~~~~~~~ + + Strings of all Unicode characters of a certain category. + Used for matching in Unicode-aware languages. Run to regenerate. + + Inspired by chartypes_create.py from the MoinMoin project. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import sys + +Cc = '\x00-\x1f\x7f-\x9f' + +Cf = '\xad\u0600-\u0605\u061c\u06dd\u070f\u08e2\u180e\u200b-\u200f\u202a-\u202e\u2060-\u2064\u2066-\u206f\ufeff\ufff9-\ufffb\U000110bd\U000110cd\U0001bca0-\U0001bca3\U0001d173-\U0001d17a\U000e0001\U000e0020-\U000e007f' + +Cn = '\u0378-\u0379\u0380-\u0383\u038b\u038d\u03a2\u0530\u0557-\u0558\u058b-\u058c\u0590\u05c8-\u05cf\u05eb-\u05ee\u05f5-\u05ff\u061d\u070e\u074b-\u074c\u07b2-\u07bf\u07fb-\u07fc\u082e-\u082f\u083f\u085c-\u085d\u085f\u086b-\u089f\u08b5\u08be-\u08d2\u0984\u098d-\u098e\u0991-\u0992\u09a9\u09b1\u09b3-\u09b5\u09ba-\u09bb\u09c5-\u09c6\u09c9-\u09ca\u09cf-\u09d6\u09d8-\u09db\u09de\u09e4-\u09e5\u09ff-\u0a00\u0a04\u0a0b-\u0a0e\u0a11-\u0a12\u0a29\u0a31\u0a34\u0a37\u0a3a-\u0a3b\u0a3d\u0a43-\u0a46\u0a49-\u0a4a\u0a4e-\u0a50\u0a52-\u0a58\u0a5d\u0a5f-\u0a65\u0a77-\u0a80\u0a84\u0a8e\u0a92\u0aa9\u0ab1\u0ab4\u0aba-\u0abb\u0ac6\u0aca\u0ace-\u0acf\u0ad1-\u0adf\u0ae4-\u0ae5\u0af2-\u0af8\u0b00\u0b04\u0b0d-\u0b0e\u0b11-\u0b12\u0b29\u0b31\u0b34\u0b3a-\u0b3b\u0b45-\u0b46\u0b49-\u0b4a\u0b4e-\u0b55\u0b58-\u0b5b\u0b5e\u0b64-\u0b65\u0b78-\u0b81\u0b84\u0b8b-\u0b8d\u0b91\u0b96-\u0b98\u0b9b\u0b9d\u0ba0-\u0ba2\u0ba5-\u0ba7\u0bab-\u0bad\u0bba-\u0bbd\u0bc3-\u0bc5\u0bc9\u0bce-\u0bcf\u0bd1-\u0bd6\u0bd8-\u0be5\u0bfb-\u0bff\u0c0d\u0c11\u0c29\u0c3a-\u0c3c\u0c45\u0c49\u0c4e-\u0c54\u0c57\u0c5b-\u0c5f\u0c64-\u0c65\u0c70-\u0c77\u0c8d\u0c91\u0ca9\u0cb4\u0cba-\u0cbb\u0cc5\u0cc9\u0cce-\u0cd4\u0cd7-\u0cdd\u0cdf\u0ce4-\u0ce5\u0cf0\u0cf3-\u0cff\u0d04\u0d0d\u0d11\u0d45\u0d49\u0d50-\u0d53\u0d64-\u0d65\u0d80-\u0d81\u0d84\u0d97-\u0d99\u0db2\u0dbc\u0dbe-\u0dbf\u0dc7-\u0dc9\u0dcb-\u0dce\u0dd5\u0dd7\u0de0-\u0de5\u0df0-\u0df1\u0df5-\u0e00\u0e3b-\u0e3e\u0e5c-\u0e80\u0e83\u0e85-\u0e86\u0e89\u0e8b-\u0e8c\u0e8e-\u0e93\u0e98\u0ea0\u0ea4\u0ea6\u0ea8-\u0ea9\u0eac\u0eba\u0ebe-\u0ebf\u0ec5\u0ec7\u0ece-\u0ecf\u0eda-\u0edb\u0ee0-\u0eff\u0f48\u0f6d-\u0f70\u0f98\u0fbd\u0fcd\u0fdb-\u0fff\u10c6\u10c8-\u10cc\u10ce-\u10cf\u1249\u124e-\u124f\u1257\u1259\u125e-\u125f\u1289\u128e-\u128f\u12b1\u12b6-\u12b7\u12bf\u12c1\u12c6-\u12c7\u12d7\u1311\u1316-\u1317\u135b-\u135c\u137d-\u137f\u139a-\u139f\u13f6-\u13f7\u13fe-\u13ff\u169d-\u169f\u16f9-\u16ff\u170d\u1715-\u171f\u1737-\u173f\u1754-\u175f\u176d\u1771\u1774-\u177f\u17de-\u17df\u17ea-\u17ef\u17fa-\u17ff\u180f\u181a-\u181f\u1879-\u187f\u18ab-\u18af\u18f6-\u18ff\u191f\u192c-\u192f\u193c-\u193f\u1941-\u1943\u196e-\u196f\u1975-\u197f\u19ac-\u19af\u19ca-\u19cf\u19db-\u19dd\u1a1c-\u1a1d\u1a5f\u1a7d-\u1a7e\u1a8a-\u1a8f\u1a9a-\u1a9f\u1aae-\u1aaf\u1abf-\u1aff\u1b4c-\u1b4f\u1b7d-\u1b7f\u1bf4-\u1bfb\u1c38-\u1c3a\u1c4a-\u1c4c\u1c89-\u1c8f\u1cbb-\u1cbc\u1cc8-\u1ccf\u1cfa-\u1cff\u1dfa\u1f16-\u1f17\u1f1e-\u1f1f\u1f46-\u1f47\u1f4e-\u1f4f\u1f58\u1f5a\u1f5c\u1f5e\u1f7e-\u1f7f\u1fb5\u1fc5\u1fd4-\u1fd5\u1fdc\u1ff0-\u1ff1\u1ff5\u1fff\u2065\u2072-\u2073\u208f\u209d-\u209f\u20c0-\u20cf\u20f1-\u20ff\u218c-\u218f\u2427-\u243f\u244b-\u245f\u2b74-\u2b75\u2b96-\u2b97\u2bc9\u2bff\u2c2f\u2c5f\u2cf4-\u2cf8\u2d26\u2d28-\u2d2c\u2d2e-\u2d2f\u2d68-\u2d6e\u2d71-\u2d7e\u2d97-\u2d9f\u2da7\u2daf\u2db7\u2dbf\u2dc7\u2dcf\u2dd7\u2ddf\u2e4f-\u2e7f\u2e9a\u2ef4-\u2eff\u2fd6-\u2fef\u2ffc-\u2fff\u3040\u3097-\u3098\u3100-\u3104\u3130\u318f\u31bb-\u31bf\u31e4-\u31ef\u321f\u32ff\u4db6-\u4dbf\u9ff0-\u9fff\ua48d-\ua48f\ua4c7-\ua4cf\ua62c-\ua63f\ua6f8-\ua6ff\ua7ba-\ua7f6\ua82c-\ua82f\ua83a-\ua83f\ua878-\ua87f\ua8c6-\ua8cd\ua8da-\ua8df\ua954-\ua95e\ua97d-\ua97f\ua9ce\ua9da-\ua9dd\ua9ff\uaa37-\uaa3f\uaa4e-\uaa4f\uaa5a-\uaa5b\uaac3-\uaada\uaaf7-\uab00\uab07-\uab08\uab0f-\uab10\uab17-\uab1f\uab27\uab2f\uab66-\uab6f\uabee-\uabef\uabfa-\uabff\ud7a4-\ud7af\ud7c7-\ud7ca\ud7fc-\ud7ff\ufa6e-\ufa6f\ufada-\ufaff\ufb07-\ufb12\ufb18-\ufb1c\ufb37\ufb3d\ufb3f\ufb42\ufb45\ufbc2-\ufbd2\ufd40-\ufd4f\ufd90-\ufd91\ufdc8-\ufdef\ufdfe-\ufdff\ufe1a-\ufe1f\ufe53\ufe67\ufe6c-\ufe6f\ufe75\ufefd-\ufefe\uff00\uffbf-\uffc1\uffc8-\uffc9\uffd0-\uffd1\uffd8-\uffd9\uffdd-\uffdf\uffe7\uffef-\ufff8\ufffe-\uffff\U0001000c\U00010027\U0001003b\U0001003e\U0001004e-\U0001004f\U0001005e-\U0001007f\U000100fb-\U000100ff\U00010103-\U00010106\U00010134-\U00010136\U0001018f\U0001019c-\U0001019f\U000101a1-\U000101cf\U000101fe-\U0001027f\U0001029d-\U0001029f\U000102d1-\U000102df\U000102fc-\U000102ff\U00010324-\U0001032c\U0001034b-\U0001034f\U0001037b-\U0001037f\U0001039e\U000103c4-\U000103c7\U000103d6-\U000103ff\U0001049e-\U0001049f\U000104aa-\U000104af\U000104d4-\U000104d7\U000104fc-\U000104ff\U00010528-\U0001052f\U00010564-\U0001056e\U00010570-\U000105ff\U00010737-\U0001073f\U00010756-\U0001075f\U00010768-\U000107ff\U00010806-\U00010807\U00010809\U00010836\U00010839-\U0001083b\U0001083d-\U0001083e\U00010856\U0001089f-\U000108a6\U000108b0-\U000108df\U000108f3\U000108f6-\U000108fa\U0001091c-\U0001091e\U0001093a-\U0001093e\U00010940-\U0001097f\U000109b8-\U000109bb\U000109d0-\U000109d1\U00010a04\U00010a07-\U00010a0b\U00010a14\U00010a18\U00010a36-\U00010a37\U00010a3b-\U00010a3e\U00010a49-\U00010a4f\U00010a59-\U00010a5f\U00010aa0-\U00010abf\U00010ae7-\U00010aea\U00010af7-\U00010aff\U00010b36-\U00010b38\U00010b56-\U00010b57\U00010b73-\U00010b77\U00010b92-\U00010b98\U00010b9d-\U00010ba8\U00010bb0-\U00010bff\U00010c49-\U00010c7f\U00010cb3-\U00010cbf\U00010cf3-\U00010cf9\U00010d28-\U00010d2f\U00010d3a-\U00010e5f\U00010e7f-\U00010eff\U00010f28-\U00010f2f\U00010f5a-\U00010fff\U0001104e-\U00011051\U00011070-\U0001107e\U000110c2-\U000110cc\U000110ce-\U000110cf\U000110e9-\U000110ef\U000110fa-\U000110ff\U00011135\U00011147-\U0001114f\U00011177-\U0001117f\U000111ce-\U000111cf\U000111e0\U000111f5-\U000111ff\U00011212\U0001123f-\U0001127f\U00011287\U00011289\U0001128e\U0001129e\U000112aa-\U000112af\U000112eb-\U000112ef\U000112fa-\U000112ff\U00011304\U0001130d-\U0001130e\U00011311-\U00011312\U00011329\U00011331\U00011334\U0001133a\U00011345-\U00011346\U00011349-\U0001134a\U0001134e-\U0001134f\U00011351-\U00011356\U00011358-\U0001135c\U00011364-\U00011365\U0001136d-\U0001136f\U00011375-\U000113ff\U0001145a\U0001145c\U0001145f-\U0001147f\U000114c8-\U000114cf\U000114da-\U0001157f\U000115b6-\U000115b7\U000115de-\U000115ff\U00011645-\U0001164f\U0001165a-\U0001165f\U0001166d-\U0001167f\U000116b8-\U000116bf\U000116ca-\U000116ff\U0001171b-\U0001171c\U0001172c-\U0001172f\U00011740-\U000117ff\U0001183c-\U0001189f\U000118f3-\U000118fe\U00011900-\U000119ff\U00011a48-\U00011a4f\U00011a84-\U00011a85\U00011aa3-\U00011abf\U00011af9-\U00011bff\U00011c09\U00011c37\U00011c46-\U00011c4f\U00011c6d-\U00011c6f\U00011c90-\U00011c91\U00011ca8\U00011cb7-\U00011cff\U00011d07\U00011d0a\U00011d37-\U00011d39\U00011d3b\U00011d3e\U00011d48-\U00011d4f\U00011d5a-\U00011d5f\U00011d66\U00011d69\U00011d8f\U00011d92\U00011d99-\U00011d9f\U00011daa-\U00011edf\U00011ef9-\U00011fff\U0001239a-\U000123ff\U0001246f\U00012475-\U0001247f\U00012544-\U00012fff\U0001342f-\U000143ff\U00014647-\U000167ff\U00016a39-\U00016a3f\U00016a5f\U00016a6a-\U00016a6d\U00016a70-\U00016acf\U00016aee-\U00016aef\U00016af6-\U00016aff\U00016b46-\U00016b4f\U00016b5a\U00016b62\U00016b78-\U00016b7c\U00016b90-\U00016e3f\U00016e9b-\U00016eff\U00016f45-\U00016f4f\U00016f7f-\U00016f8e\U00016fa0-\U00016fdf\U00016fe2-\U00016fff\U000187f2-\U000187ff\U00018af3-\U0001afff\U0001b11f-\U0001b16f\U0001b2fc-\U0001bbff\U0001bc6b-\U0001bc6f\U0001bc7d-\U0001bc7f\U0001bc89-\U0001bc8f\U0001bc9a-\U0001bc9b\U0001bca4-\U0001cfff\U0001d0f6-\U0001d0ff\U0001d127-\U0001d128\U0001d1e9-\U0001d1ff\U0001d246-\U0001d2df\U0001d2f4-\U0001d2ff\U0001d357-\U0001d35f\U0001d379-\U0001d3ff\U0001d455\U0001d49d\U0001d4a0-\U0001d4a1\U0001d4a3-\U0001d4a4\U0001d4a7-\U0001d4a8\U0001d4ad\U0001d4ba\U0001d4bc\U0001d4c4\U0001d506\U0001d50b-\U0001d50c\U0001d515\U0001d51d\U0001d53a\U0001d53f\U0001d545\U0001d547-\U0001d549\U0001d551\U0001d6a6-\U0001d6a7\U0001d7cc-\U0001d7cd\U0001da8c-\U0001da9a\U0001daa0\U0001dab0-\U0001dfff\U0001e007\U0001e019-\U0001e01a\U0001e022\U0001e025\U0001e02b-\U0001e7ff\U0001e8c5-\U0001e8c6\U0001e8d7-\U0001e8ff\U0001e94b-\U0001e94f\U0001e95a-\U0001e95d\U0001e960-\U0001ec70\U0001ecb5-\U0001edff\U0001ee04\U0001ee20\U0001ee23\U0001ee25-\U0001ee26\U0001ee28\U0001ee33\U0001ee38\U0001ee3a\U0001ee3c-\U0001ee41\U0001ee43-\U0001ee46\U0001ee48\U0001ee4a\U0001ee4c\U0001ee50\U0001ee53\U0001ee55-\U0001ee56\U0001ee58\U0001ee5a\U0001ee5c\U0001ee5e\U0001ee60\U0001ee63\U0001ee65-\U0001ee66\U0001ee6b\U0001ee73\U0001ee78\U0001ee7d\U0001ee7f\U0001ee8a\U0001ee9c-\U0001eea0\U0001eea4\U0001eeaa\U0001eebc-\U0001eeef\U0001eef2-\U0001efff\U0001f02c-\U0001f02f\U0001f094-\U0001f09f\U0001f0af-\U0001f0b0\U0001f0c0\U0001f0d0\U0001f0f6-\U0001f0ff\U0001f10d-\U0001f10f\U0001f16c-\U0001f16f\U0001f1ad-\U0001f1e5\U0001f203-\U0001f20f\U0001f23c-\U0001f23f\U0001f249-\U0001f24f\U0001f252-\U0001f25f\U0001f266-\U0001f2ff\U0001f6d5-\U0001f6df\U0001f6ed-\U0001f6ef\U0001f6fa-\U0001f6ff\U0001f774-\U0001f77f\U0001f7d9-\U0001f7ff\U0001f80c-\U0001f80f\U0001f848-\U0001f84f\U0001f85a-\U0001f85f\U0001f888-\U0001f88f\U0001f8ae-\U0001f8ff\U0001f90c-\U0001f90f\U0001f93f\U0001f971-\U0001f972\U0001f977-\U0001f979\U0001f97b\U0001f9a3-\U0001f9af\U0001f9ba-\U0001f9bf\U0001f9c3-\U0001f9cf\U0001fa00-\U0001fa5f\U0001fa6e-\U0001ffff\U0002a6d7-\U0002a6ff\U0002b735-\U0002b73f\U0002b81e-\U0002b81f\U0002cea2-\U0002ceaf\U0002ebe1-\U0002f7ff\U0002fa1e-\U000e0000\U000e0002-\U000e001f\U000e0080-\U000e00ff\U000e01f0-\U000effff\U000ffffe-\U000fffff\U0010fffe-\U0010ffff' + +Co = '\ue000-\uf8ff\U000f0000-\U000ffffd\U00100000-\U0010fffd' + +Cs = '\ud800-\udbff\\\udc00\udc01-\udfff' + +Ll = 'a-z\xb5\xdf-\xf6\xf8-\xff\u0101\u0103\u0105\u0107\u0109\u010b\u010d\u010f\u0111\u0113\u0115\u0117\u0119\u011b\u011d\u011f\u0121\u0123\u0125\u0127\u0129\u012b\u012d\u012f\u0131\u0133\u0135\u0137-\u0138\u013a\u013c\u013e\u0140\u0142\u0144\u0146\u0148-\u0149\u014b\u014d\u014f\u0151\u0153\u0155\u0157\u0159\u015b\u015d\u015f\u0161\u0163\u0165\u0167\u0169\u016b\u016d\u016f\u0171\u0173\u0175\u0177\u017a\u017c\u017e-\u0180\u0183\u0185\u0188\u018c-\u018d\u0192\u0195\u0199-\u019b\u019e\u01a1\u01a3\u01a5\u01a8\u01aa-\u01ab\u01ad\u01b0\u01b4\u01b6\u01b9-\u01ba\u01bd-\u01bf\u01c6\u01c9\u01cc\u01ce\u01d0\u01d2\u01d4\u01d6\u01d8\u01da\u01dc-\u01dd\u01df\u01e1\u01e3\u01e5\u01e7\u01e9\u01eb\u01ed\u01ef-\u01f0\u01f3\u01f5\u01f9\u01fb\u01fd\u01ff\u0201\u0203\u0205\u0207\u0209\u020b\u020d\u020f\u0211\u0213\u0215\u0217\u0219\u021b\u021d\u021f\u0221\u0223\u0225\u0227\u0229\u022b\u022d\u022f\u0231\u0233-\u0239\u023c\u023f-\u0240\u0242\u0247\u0249\u024b\u024d\u024f-\u0293\u0295-\u02af\u0371\u0373\u0377\u037b-\u037d\u0390\u03ac-\u03ce\u03d0-\u03d1\u03d5-\u03d7\u03d9\u03db\u03dd\u03df\u03e1\u03e3\u03e5\u03e7\u03e9\u03eb\u03ed\u03ef-\u03f3\u03f5\u03f8\u03fb-\u03fc\u0430-\u045f\u0461\u0463\u0465\u0467\u0469\u046b\u046d\u046f\u0471\u0473\u0475\u0477\u0479\u047b\u047d\u047f\u0481\u048b\u048d\u048f\u0491\u0493\u0495\u0497\u0499\u049b\u049d\u049f\u04a1\u04a3\u04a5\u04a7\u04a9\u04ab\u04ad\u04af\u04b1\u04b3\u04b5\u04b7\u04b9\u04bb\u04bd\u04bf\u04c2\u04c4\u04c6\u04c8\u04ca\u04cc\u04ce-\u04cf\u04d1\u04d3\u04d5\u04d7\u04d9\u04db\u04dd\u04df\u04e1\u04e3\u04e5\u04e7\u04e9\u04eb\u04ed\u04ef\u04f1\u04f3\u04f5\u04f7\u04f9\u04fb\u04fd\u04ff\u0501\u0503\u0505\u0507\u0509\u050b\u050d\u050f\u0511\u0513\u0515\u0517\u0519\u051b\u051d\u051f\u0521\u0523\u0525\u0527\u0529\u052b\u052d\u052f\u0560-\u0588\u10d0-\u10fa\u10fd-\u10ff\u13f8-\u13fd\u1c80-\u1c88\u1d00-\u1d2b\u1d6b-\u1d77\u1d79-\u1d9a\u1e01\u1e03\u1e05\u1e07\u1e09\u1e0b\u1e0d\u1e0f\u1e11\u1e13\u1e15\u1e17\u1e19\u1e1b\u1e1d\u1e1f\u1e21\u1e23\u1e25\u1e27\u1e29\u1e2b\u1e2d\u1e2f\u1e31\u1e33\u1e35\u1e37\u1e39\u1e3b\u1e3d\u1e3f\u1e41\u1e43\u1e45\u1e47\u1e49\u1e4b\u1e4d\u1e4f\u1e51\u1e53\u1e55\u1e57\u1e59\u1e5b\u1e5d\u1e5f\u1e61\u1e63\u1e65\u1e67\u1e69\u1e6b\u1e6d\u1e6f\u1e71\u1e73\u1e75\u1e77\u1e79\u1e7b\u1e7d\u1e7f\u1e81\u1e83\u1e85\u1e87\u1e89\u1e8b\u1e8d\u1e8f\u1e91\u1e93\u1e95-\u1e9d\u1e9f\u1ea1\u1ea3\u1ea5\u1ea7\u1ea9\u1eab\u1ead\u1eaf\u1eb1\u1eb3\u1eb5\u1eb7\u1eb9\u1ebb\u1ebd\u1ebf\u1ec1\u1ec3\u1ec5\u1ec7\u1ec9\u1ecb\u1ecd\u1ecf\u1ed1\u1ed3\u1ed5\u1ed7\u1ed9\u1edb\u1edd\u1edf\u1ee1\u1ee3\u1ee5\u1ee7\u1ee9\u1eeb\u1eed\u1eef\u1ef1\u1ef3\u1ef5\u1ef7\u1ef9\u1efb\u1efd\u1eff-\u1f07\u1f10-\u1f15\u1f20-\u1f27\u1f30-\u1f37\u1f40-\u1f45\u1f50-\u1f57\u1f60-\u1f67\u1f70-\u1f7d\u1f80-\u1f87\u1f90-\u1f97\u1fa0-\u1fa7\u1fb0-\u1fb4\u1fb6-\u1fb7\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fc7\u1fd0-\u1fd3\u1fd6-\u1fd7\u1fe0-\u1fe7\u1ff2-\u1ff4\u1ff6-\u1ff7\u210a\u210e-\u210f\u2113\u212f\u2134\u2139\u213c-\u213d\u2146-\u2149\u214e\u2184\u2c30-\u2c5e\u2c61\u2c65-\u2c66\u2c68\u2c6a\u2c6c\u2c71\u2c73-\u2c74\u2c76-\u2c7b\u2c81\u2c83\u2c85\u2c87\u2c89\u2c8b\u2c8d\u2c8f\u2c91\u2c93\u2c95\u2c97\u2c99\u2c9b\u2c9d\u2c9f\u2ca1\u2ca3\u2ca5\u2ca7\u2ca9\u2cab\u2cad\u2caf\u2cb1\u2cb3\u2cb5\u2cb7\u2cb9\u2cbb\u2cbd\u2cbf\u2cc1\u2cc3\u2cc5\u2cc7\u2cc9\u2ccb\u2ccd\u2ccf\u2cd1\u2cd3\u2cd5\u2cd7\u2cd9\u2cdb\u2cdd\u2cdf\u2ce1\u2ce3-\u2ce4\u2cec\u2cee\u2cf3\u2d00-\u2d25\u2d27\u2d2d\ua641\ua643\ua645\ua647\ua649\ua64b\ua64d\ua64f\ua651\ua653\ua655\ua657\ua659\ua65b\ua65d\ua65f\ua661\ua663\ua665\ua667\ua669\ua66b\ua66d\ua681\ua683\ua685\ua687\ua689\ua68b\ua68d\ua68f\ua691\ua693\ua695\ua697\ua699\ua69b\ua723\ua725\ua727\ua729\ua72b\ua72d\ua72f-\ua731\ua733\ua735\ua737\ua739\ua73b\ua73d\ua73f\ua741\ua743\ua745\ua747\ua749\ua74b\ua74d\ua74f\ua751\ua753\ua755\ua757\ua759\ua75b\ua75d\ua75f\ua761\ua763\ua765\ua767\ua769\ua76b\ua76d\ua76f\ua771-\ua778\ua77a\ua77c\ua77f\ua781\ua783\ua785\ua787\ua78c\ua78e\ua791\ua793-\ua795\ua797\ua799\ua79b\ua79d\ua79f\ua7a1\ua7a3\ua7a5\ua7a7\ua7a9\ua7af\ua7b5\ua7b7\ua7b9\ua7fa\uab30-\uab5a\uab60-\uab65\uab70-\uabbf\ufb00-\ufb06\ufb13-\ufb17\uff41-\uff5a\U00010428-\U0001044f\U000104d8-\U000104fb\U00010cc0-\U00010cf2\U000118c0-\U000118df\U00016e60-\U00016e7f\U0001d41a-\U0001d433\U0001d44e-\U0001d454\U0001d456-\U0001d467\U0001d482-\U0001d49b\U0001d4b6-\U0001d4b9\U0001d4bb\U0001d4bd-\U0001d4c3\U0001d4c5-\U0001d4cf\U0001d4ea-\U0001d503\U0001d51e-\U0001d537\U0001d552-\U0001d56b\U0001d586-\U0001d59f\U0001d5ba-\U0001d5d3\U0001d5ee-\U0001d607\U0001d622-\U0001d63b\U0001d656-\U0001d66f\U0001d68a-\U0001d6a5\U0001d6c2-\U0001d6da\U0001d6dc-\U0001d6e1\U0001d6fc-\U0001d714\U0001d716-\U0001d71b\U0001d736-\U0001d74e\U0001d750-\U0001d755\U0001d770-\U0001d788\U0001d78a-\U0001d78f\U0001d7aa-\U0001d7c2\U0001d7c4-\U0001d7c9\U0001d7cb\U0001e922-\U0001e943' + +Lm = '\u02b0-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0374\u037a\u0559\u0640\u06e5-\u06e6\u07f4-\u07f5\u07fa\u081a\u0824\u0828\u0971\u0e46\u0ec6\u10fc\u17d7\u1843\u1aa7\u1c78-\u1c7d\u1d2c-\u1d6a\u1d78\u1d9b-\u1dbf\u2071\u207f\u2090-\u209c\u2c7c-\u2c7d\u2d6f\u2e2f\u3005\u3031-\u3035\u303b\u309d-\u309e\u30fc-\u30fe\ua015\ua4f8-\ua4fd\ua60c\ua67f\ua69c-\ua69d\ua717-\ua71f\ua770\ua788\ua7f8-\ua7f9\ua9cf\ua9e6\uaa70\uaadd\uaaf3-\uaaf4\uab5c-\uab5f\uff70\uff9e-\uff9f\U00016b40-\U00016b43\U00016f93-\U00016f9f\U00016fe0-\U00016fe1' + +Lo = '\xaa\xba\u01bb\u01c0-\u01c3\u0294\u05d0-\u05ea\u05ef-\u05f2\u0620-\u063f\u0641-\u064a\u066e-\u066f\u0671-\u06d3\u06d5\u06ee-\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u0800-\u0815\u0840-\u0858\u0860-\u086a\u08a0-\u08b4\u08b6-\u08bd\u0904-\u0939\u093d\u0950\u0958-\u0961\u0972-\u0980\u0985-\u098c\u098f-\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc-\u09dd\u09df-\u09e1\u09f0-\u09f1\u09fc\u0a05-\u0a0a\u0a0f-\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32-\u0a33\u0a35-\u0a36\u0a38-\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2-\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0-\u0ae1\u0af9\u0b05-\u0b0c\u0b0f-\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32-\u0b33\u0b35-\u0b39\u0b3d\u0b5c-\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99-\u0b9a\u0b9c\u0b9e-\u0b9f\u0ba3-\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c39\u0c3d\u0c58-\u0c5a\u0c60-\u0c61\u0c80\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0-\u0ce1\u0cf1-\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d54-\u0d56\u0d5f-\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32-\u0e33\u0e40-\u0e45\u0e81-\u0e82\u0e84\u0e87-\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa-\u0eab\u0ead-\u0eb0\u0eb2-\u0eb3\u0ebd\u0ec0-\u0ec4\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065-\u1066\u106e-\u1070\u1075-\u1081\u108e\u1100-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16f1-\u16f8\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17dc\u1820-\u1842\u1844-\u1878\u1880-\u1884\u1887-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191e\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u1a00-\u1a16\u1a20-\u1a54\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae-\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c77\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5-\u1cf6\u2135-\u2138\u2d30-\u2d67\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u3006\u303c\u3041-\u3096\u309f\u30a1-\u30fa\u30ff\u3105-\u312f\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fef\ua000-\ua014\ua016-\ua48c\ua4d0-\ua4f7\ua500-\ua60b\ua610-\ua61f\ua62a-\ua62b\ua66e\ua6a0-\ua6e5\ua78f\ua7f7\ua7fb-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua8fd-\ua8fe\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9e0-\ua9e4\ua9e7-\ua9ef\ua9fa-\ua9fe\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa6f\uaa71-\uaa76\uaa7a\uaa7e-\uaaaf\uaab1\uaab5-\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadc\uaae0-\uaaea\uaaf2\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uabc0-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40-\ufb41\ufb43-\ufb44\ufb46-\ufbb1\ufbd3-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdfb\ufe70-\ufe74\ufe76-\ufefc\uff66-\uff6f\uff71-\uff9d\uffa0-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc\U00010000-\U0001000b\U0001000d-\U00010026\U00010028-\U0001003a\U0001003c-\U0001003d\U0001003f-\U0001004d\U00010050-\U0001005d\U00010080-\U000100fa\U00010280-\U0001029c\U000102a0-\U000102d0\U00010300-\U0001031f\U0001032d-\U00010340\U00010342-\U00010349\U00010350-\U00010375\U00010380-\U0001039d\U000103a0-\U000103c3\U000103c8-\U000103cf\U00010450-\U0001049d\U00010500-\U00010527\U00010530-\U00010563\U00010600-\U00010736\U00010740-\U00010755\U00010760-\U00010767\U00010800-\U00010805\U00010808\U0001080a-\U00010835\U00010837-\U00010838\U0001083c\U0001083f-\U00010855\U00010860-\U00010876\U00010880-\U0001089e\U000108e0-\U000108f2\U000108f4-\U000108f5\U00010900-\U00010915\U00010920-\U00010939\U00010980-\U000109b7\U000109be-\U000109bf\U00010a00\U00010a10-\U00010a13\U00010a15-\U00010a17\U00010a19-\U00010a35\U00010a60-\U00010a7c\U00010a80-\U00010a9c\U00010ac0-\U00010ac7\U00010ac9-\U00010ae4\U00010b00-\U00010b35\U00010b40-\U00010b55\U00010b60-\U00010b72\U00010b80-\U00010b91\U00010c00-\U00010c48\U00010d00-\U00010d23\U00010f00-\U00010f1c\U00010f27\U00010f30-\U00010f45\U00011003-\U00011037\U00011083-\U000110af\U000110d0-\U000110e8\U00011103-\U00011126\U00011144\U00011150-\U00011172\U00011176\U00011183-\U000111b2\U000111c1-\U000111c4\U000111da\U000111dc\U00011200-\U00011211\U00011213-\U0001122b\U00011280-\U00011286\U00011288\U0001128a-\U0001128d\U0001128f-\U0001129d\U0001129f-\U000112a8\U000112b0-\U000112de\U00011305-\U0001130c\U0001130f-\U00011310\U00011313-\U00011328\U0001132a-\U00011330\U00011332-\U00011333\U00011335-\U00011339\U0001133d\U00011350\U0001135d-\U00011361\U00011400-\U00011434\U00011447-\U0001144a\U00011480-\U000114af\U000114c4-\U000114c5\U000114c7\U00011580-\U000115ae\U000115d8-\U000115db\U00011600-\U0001162f\U00011644\U00011680-\U000116aa\U00011700-\U0001171a\U00011800-\U0001182b\U000118ff\U00011a00\U00011a0b-\U00011a32\U00011a3a\U00011a50\U00011a5c-\U00011a83\U00011a86-\U00011a89\U00011a9d\U00011ac0-\U00011af8\U00011c00-\U00011c08\U00011c0a-\U00011c2e\U00011c40\U00011c72-\U00011c8f\U00011d00-\U00011d06\U00011d08-\U00011d09\U00011d0b-\U00011d30\U00011d46\U00011d60-\U00011d65\U00011d67-\U00011d68\U00011d6a-\U00011d89\U00011d98\U00011ee0-\U00011ef2\U00012000-\U00012399\U00012480-\U00012543\U00013000-\U0001342e\U00014400-\U00014646\U00016800-\U00016a38\U00016a40-\U00016a5e\U00016ad0-\U00016aed\U00016b00-\U00016b2f\U00016b63-\U00016b77\U00016b7d-\U00016b8f\U00016f00-\U00016f44\U00016f50\U00017000-\U000187f1\U00018800-\U00018af2\U0001b000-\U0001b11e\U0001b170-\U0001b2fb\U0001bc00-\U0001bc6a\U0001bc70-\U0001bc7c\U0001bc80-\U0001bc88\U0001bc90-\U0001bc99\U0001e800-\U0001e8c4\U0001ee00-\U0001ee03\U0001ee05-\U0001ee1f\U0001ee21-\U0001ee22\U0001ee24\U0001ee27\U0001ee29-\U0001ee32\U0001ee34-\U0001ee37\U0001ee39\U0001ee3b\U0001ee42\U0001ee47\U0001ee49\U0001ee4b\U0001ee4d-\U0001ee4f\U0001ee51-\U0001ee52\U0001ee54\U0001ee57\U0001ee59\U0001ee5b\U0001ee5d\U0001ee5f\U0001ee61-\U0001ee62\U0001ee64\U0001ee67-\U0001ee6a\U0001ee6c-\U0001ee72\U0001ee74-\U0001ee77\U0001ee79-\U0001ee7c\U0001ee7e\U0001ee80-\U0001ee89\U0001ee8b-\U0001ee9b\U0001eea1-\U0001eea3\U0001eea5-\U0001eea9\U0001eeab-\U0001eebb\U00020000-\U0002a6d6\U0002a700-\U0002b734\U0002b740-\U0002b81d\U0002b820-\U0002cea1\U0002ceb0-\U0002ebe0\U0002f800-\U0002fa1d' + +Lt = '\u01c5\u01c8\u01cb\u01f2\u1f88-\u1f8f\u1f98-\u1f9f\u1fa8-\u1faf\u1fbc\u1fcc\u1ffc' + +Lu = 'A-Z\xc0-\xd6\xd8-\xde\u0100\u0102\u0104\u0106\u0108\u010a\u010c\u010e\u0110\u0112\u0114\u0116\u0118\u011a\u011c\u011e\u0120\u0122\u0124\u0126\u0128\u012a\u012c\u012e\u0130\u0132\u0134\u0136\u0139\u013b\u013d\u013f\u0141\u0143\u0145\u0147\u014a\u014c\u014e\u0150\u0152\u0154\u0156\u0158\u015a\u015c\u015e\u0160\u0162\u0164\u0166\u0168\u016a\u016c\u016e\u0170\u0172\u0174\u0176\u0178-\u0179\u017b\u017d\u0181-\u0182\u0184\u0186-\u0187\u0189-\u018b\u018e-\u0191\u0193-\u0194\u0196-\u0198\u019c-\u019d\u019f-\u01a0\u01a2\u01a4\u01a6-\u01a7\u01a9\u01ac\u01ae-\u01af\u01b1-\u01b3\u01b5\u01b7-\u01b8\u01bc\u01c4\u01c7\u01ca\u01cd\u01cf\u01d1\u01d3\u01d5\u01d7\u01d9\u01db\u01de\u01e0\u01e2\u01e4\u01e6\u01e8\u01ea\u01ec\u01ee\u01f1\u01f4\u01f6-\u01f8\u01fa\u01fc\u01fe\u0200\u0202\u0204\u0206\u0208\u020a\u020c\u020e\u0210\u0212\u0214\u0216\u0218\u021a\u021c\u021e\u0220\u0222\u0224\u0226\u0228\u022a\u022c\u022e\u0230\u0232\u023a-\u023b\u023d-\u023e\u0241\u0243-\u0246\u0248\u024a\u024c\u024e\u0370\u0372\u0376\u037f\u0386\u0388-\u038a\u038c\u038e-\u038f\u0391-\u03a1\u03a3-\u03ab\u03cf\u03d2-\u03d4\u03d8\u03da\u03dc\u03de\u03e0\u03e2\u03e4\u03e6\u03e8\u03ea\u03ec\u03ee\u03f4\u03f7\u03f9-\u03fa\u03fd-\u042f\u0460\u0462\u0464\u0466\u0468\u046a\u046c\u046e\u0470\u0472\u0474\u0476\u0478\u047a\u047c\u047e\u0480\u048a\u048c\u048e\u0490\u0492\u0494\u0496\u0498\u049a\u049c\u049e\u04a0\u04a2\u04a4\u04a6\u04a8\u04aa\u04ac\u04ae\u04b0\u04b2\u04b4\u04b6\u04b8\u04ba\u04bc\u04be\u04c0-\u04c1\u04c3\u04c5\u04c7\u04c9\u04cb\u04cd\u04d0\u04d2\u04d4\u04d6\u04d8\u04da\u04dc\u04de\u04e0\u04e2\u04e4\u04e6\u04e8\u04ea\u04ec\u04ee\u04f0\u04f2\u04f4\u04f6\u04f8\u04fa\u04fc\u04fe\u0500\u0502\u0504\u0506\u0508\u050a\u050c\u050e\u0510\u0512\u0514\u0516\u0518\u051a\u051c\u051e\u0520\u0522\u0524\u0526\u0528\u052a\u052c\u052e\u0531-\u0556\u10a0-\u10c5\u10c7\u10cd\u13a0-\u13f5\u1c90-\u1cba\u1cbd-\u1cbf\u1e00\u1e02\u1e04\u1e06\u1e08\u1e0a\u1e0c\u1e0e\u1e10\u1e12\u1e14\u1e16\u1e18\u1e1a\u1e1c\u1e1e\u1e20\u1e22\u1e24\u1e26\u1e28\u1e2a\u1e2c\u1e2e\u1e30\u1e32\u1e34\u1e36\u1e38\u1e3a\u1e3c\u1e3e\u1e40\u1e42\u1e44\u1e46\u1e48\u1e4a\u1e4c\u1e4e\u1e50\u1e52\u1e54\u1e56\u1e58\u1e5a\u1e5c\u1e5e\u1e60\u1e62\u1e64\u1e66\u1e68\u1e6a\u1e6c\u1e6e\u1e70\u1e72\u1e74\u1e76\u1e78\u1e7a\u1e7c\u1e7e\u1e80\u1e82\u1e84\u1e86\u1e88\u1e8a\u1e8c\u1e8e\u1e90\u1e92\u1e94\u1e9e\u1ea0\u1ea2\u1ea4\u1ea6\u1ea8\u1eaa\u1eac\u1eae\u1eb0\u1eb2\u1eb4\u1eb6\u1eb8\u1eba\u1ebc\u1ebe\u1ec0\u1ec2\u1ec4\u1ec6\u1ec8\u1eca\u1ecc\u1ece\u1ed0\u1ed2\u1ed4\u1ed6\u1ed8\u1eda\u1edc\u1ede\u1ee0\u1ee2\u1ee4\u1ee6\u1ee8\u1eea\u1eec\u1eee\u1ef0\u1ef2\u1ef4\u1ef6\u1ef8\u1efa\u1efc\u1efe\u1f08-\u1f0f\u1f18-\u1f1d\u1f28-\u1f2f\u1f38-\u1f3f\u1f48-\u1f4d\u1f59\u1f5b\u1f5d\u1f5f\u1f68-\u1f6f\u1fb8-\u1fbb\u1fc8-\u1fcb\u1fd8-\u1fdb\u1fe8-\u1fec\u1ff8-\u1ffb\u2102\u2107\u210b-\u210d\u2110-\u2112\u2115\u2119-\u211d\u2124\u2126\u2128\u212a-\u212d\u2130-\u2133\u213e-\u213f\u2145\u2183\u2c00-\u2c2e\u2c60\u2c62-\u2c64\u2c67\u2c69\u2c6b\u2c6d-\u2c70\u2c72\u2c75\u2c7e-\u2c80\u2c82\u2c84\u2c86\u2c88\u2c8a\u2c8c\u2c8e\u2c90\u2c92\u2c94\u2c96\u2c98\u2c9a\u2c9c\u2c9e\u2ca0\u2ca2\u2ca4\u2ca6\u2ca8\u2caa\u2cac\u2cae\u2cb0\u2cb2\u2cb4\u2cb6\u2cb8\u2cba\u2cbc\u2cbe\u2cc0\u2cc2\u2cc4\u2cc6\u2cc8\u2cca\u2ccc\u2cce\u2cd0\u2cd2\u2cd4\u2cd6\u2cd8\u2cda\u2cdc\u2cde\u2ce0\u2ce2\u2ceb\u2ced\u2cf2\ua640\ua642\ua644\ua646\ua648\ua64a\ua64c\ua64e\ua650\ua652\ua654\ua656\ua658\ua65a\ua65c\ua65e\ua660\ua662\ua664\ua666\ua668\ua66a\ua66c\ua680\ua682\ua684\ua686\ua688\ua68a\ua68c\ua68e\ua690\ua692\ua694\ua696\ua698\ua69a\ua722\ua724\ua726\ua728\ua72a\ua72c\ua72e\ua732\ua734\ua736\ua738\ua73a\ua73c\ua73e\ua740\ua742\ua744\ua746\ua748\ua74a\ua74c\ua74e\ua750\ua752\ua754\ua756\ua758\ua75a\ua75c\ua75e\ua760\ua762\ua764\ua766\ua768\ua76a\ua76c\ua76e\ua779\ua77b\ua77d-\ua77e\ua780\ua782\ua784\ua786\ua78b\ua78d\ua790\ua792\ua796\ua798\ua79a\ua79c\ua79e\ua7a0\ua7a2\ua7a4\ua7a6\ua7a8\ua7aa-\ua7ae\ua7b0-\ua7b4\ua7b6\ua7b8\uff21-\uff3a\U00010400-\U00010427\U000104b0-\U000104d3\U00010c80-\U00010cb2\U000118a0-\U000118bf\U00016e40-\U00016e5f\U0001d400-\U0001d419\U0001d434-\U0001d44d\U0001d468-\U0001d481\U0001d49c\U0001d49e-\U0001d49f\U0001d4a2\U0001d4a5-\U0001d4a6\U0001d4a9-\U0001d4ac\U0001d4ae-\U0001d4b5\U0001d4d0-\U0001d4e9\U0001d504-\U0001d505\U0001d507-\U0001d50a\U0001d50d-\U0001d514\U0001d516-\U0001d51c\U0001d538-\U0001d539\U0001d53b-\U0001d53e\U0001d540-\U0001d544\U0001d546\U0001d54a-\U0001d550\U0001d56c-\U0001d585\U0001d5a0-\U0001d5b9\U0001d5d4-\U0001d5ed\U0001d608-\U0001d621\U0001d63c-\U0001d655\U0001d670-\U0001d689\U0001d6a8-\U0001d6c0\U0001d6e2-\U0001d6fa\U0001d71c-\U0001d734\U0001d756-\U0001d76e\U0001d790-\U0001d7a8\U0001d7ca\U0001e900-\U0001e921' + +Mc = '\u0903\u093b\u093e-\u0940\u0949-\u094c\u094e-\u094f\u0982-\u0983\u09be-\u09c0\u09c7-\u09c8\u09cb-\u09cc\u09d7\u0a03\u0a3e-\u0a40\u0a83\u0abe-\u0ac0\u0ac9\u0acb-\u0acc\u0b02-\u0b03\u0b3e\u0b40\u0b47-\u0b48\u0b4b-\u0b4c\u0b57\u0bbe-\u0bbf\u0bc1-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcc\u0bd7\u0c01-\u0c03\u0c41-\u0c44\u0c82-\u0c83\u0cbe\u0cc0-\u0cc4\u0cc7-\u0cc8\u0cca-\u0ccb\u0cd5-\u0cd6\u0d02-\u0d03\u0d3e-\u0d40\u0d46-\u0d48\u0d4a-\u0d4c\u0d57\u0d82-\u0d83\u0dcf-\u0dd1\u0dd8-\u0ddf\u0df2-\u0df3\u0f3e-\u0f3f\u0f7f\u102b-\u102c\u1031\u1038\u103b-\u103c\u1056-\u1057\u1062-\u1064\u1067-\u106d\u1083-\u1084\u1087-\u108c\u108f\u109a-\u109c\u17b6\u17be-\u17c5\u17c7-\u17c8\u1923-\u1926\u1929-\u192b\u1930-\u1931\u1933-\u1938\u1a19-\u1a1a\u1a55\u1a57\u1a61\u1a63-\u1a64\u1a6d-\u1a72\u1b04\u1b35\u1b3b\u1b3d-\u1b41\u1b43-\u1b44\u1b82\u1ba1\u1ba6-\u1ba7\u1baa\u1be7\u1bea-\u1bec\u1bee\u1bf2-\u1bf3\u1c24-\u1c2b\u1c34-\u1c35\u1ce1\u1cf2-\u1cf3\u1cf7\u302e-\u302f\ua823-\ua824\ua827\ua880-\ua881\ua8b4-\ua8c3\ua952-\ua953\ua983\ua9b4-\ua9b5\ua9ba-\ua9bb\ua9bd-\ua9c0\uaa2f-\uaa30\uaa33-\uaa34\uaa4d\uaa7b\uaa7d\uaaeb\uaaee-\uaaef\uaaf5\uabe3-\uabe4\uabe6-\uabe7\uabe9-\uabea\uabec\U00011000\U00011002\U00011082\U000110b0-\U000110b2\U000110b7-\U000110b8\U0001112c\U00011145-\U00011146\U00011182\U000111b3-\U000111b5\U000111bf-\U000111c0\U0001122c-\U0001122e\U00011232-\U00011233\U00011235\U000112e0-\U000112e2\U00011302-\U00011303\U0001133e-\U0001133f\U00011341-\U00011344\U00011347-\U00011348\U0001134b-\U0001134d\U00011357\U00011362-\U00011363\U00011435-\U00011437\U00011440-\U00011441\U00011445\U000114b0-\U000114b2\U000114b9\U000114bb-\U000114be\U000114c1\U000115af-\U000115b1\U000115b8-\U000115bb\U000115be\U00011630-\U00011632\U0001163b-\U0001163c\U0001163e\U000116ac\U000116ae-\U000116af\U000116b6\U00011720-\U00011721\U00011726\U0001182c-\U0001182e\U00011838\U00011a39\U00011a57-\U00011a58\U00011a97\U00011c2f\U00011c3e\U00011ca9\U00011cb1\U00011cb4\U00011d8a-\U00011d8e\U00011d93-\U00011d94\U00011d96\U00011ef5-\U00011ef6\U00016f51-\U00016f7e\U0001d165-\U0001d166\U0001d16d-\U0001d172' + +Me = '\u0488-\u0489\u1abe\u20dd-\u20e0\u20e2-\u20e4\ua670-\ua672' + +Mn = '\u0300-\u036f\u0483-\u0487\u0591-\u05bd\u05bf\u05c1-\u05c2\u05c4-\u05c5\u05c7\u0610-\u061a\u064b-\u065f\u0670\u06d6-\u06dc\u06df-\u06e4\u06e7-\u06e8\u06ea-\u06ed\u0711\u0730-\u074a\u07a6-\u07b0\u07eb-\u07f3\u07fd\u0816-\u0819\u081b-\u0823\u0825-\u0827\u0829-\u082d\u0859-\u085b\u08d3-\u08e1\u08e3-\u0902\u093a\u093c\u0941-\u0948\u094d\u0951-\u0957\u0962-\u0963\u0981\u09bc\u09c1-\u09c4\u09cd\u09e2-\u09e3\u09fe\u0a01-\u0a02\u0a3c\u0a41-\u0a42\u0a47-\u0a48\u0a4b-\u0a4d\u0a51\u0a70-\u0a71\u0a75\u0a81-\u0a82\u0abc\u0ac1-\u0ac5\u0ac7-\u0ac8\u0acd\u0ae2-\u0ae3\u0afa-\u0aff\u0b01\u0b3c\u0b3f\u0b41-\u0b44\u0b4d\u0b56\u0b62-\u0b63\u0b82\u0bc0\u0bcd\u0c00\u0c04\u0c3e-\u0c40\u0c46-\u0c48\u0c4a-\u0c4d\u0c55-\u0c56\u0c62-\u0c63\u0c81\u0cbc\u0cbf\u0cc6\u0ccc-\u0ccd\u0ce2-\u0ce3\u0d00-\u0d01\u0d3b-\u0d3c\u0d41-\u0d44\u0d4d\u0d62-\u0d63\u0dca\u0dd2-\u0dd4\u0dd6\u0e31\u0e34-\u0e3a\u0e47-\u0e4e\u0eb1\u0eb4-\u0eb9\u0ebb-\u0ebc\u0ec8-\u0ecd\u0f18-\u0f19\u0f35\u0f37\u0f39\u0f71-\u0f7e\u0f80-\u0f84\u0f86-\u0f87\u0f8d-\u0f97\u0f99-\u0fbc\u0fc6\u102d-\u1030\u1032-\u1037\u1039-\u103a\u103d-\u103e\u1058-\u1059\u105e-\u1060\u1071-\u1074\u1082\u1085-\u1086\u108d\u109d\u135d-\u135f\u1712-\u1714\u1732-\u1734\u1752-\u1753\u1772-\u1773\u17b4-\u17b5\u17b7-\u17bd\u17c6\u17c9-\u17d3\u17dd\u180b-\u180d\u1885-\u1886\u18a9\u1920-\u1922\u1927-\u1928\u1932\u1939-\u193b\u1a17-\u1a18\u1a1b\u1a56\u1a58-\u1a5e\u1a60\u1a62\u1a65-\u1a6c\u1a73-\u1a7c\u1a7f\u1ab0-\u1abd\u1b00-\u1b03\u1b34\u1b36-\u1b3a\u1b3c\u1b42\u1b6b-\u1b73\u1b80-\u1b81\u1ba2-\u1ba5\u1ba8-\u1ba9\u1bab-\u1bad\u1be6\u1be8-\u1be9\u1bed\u1bef-\u1bf1\u1c2c-\u1c33\u1c36-\u1c37\u1cd0-\u1cd2\u1cd4-\u1ce0\u1ce2-\u1ce8\u1ced\u1cf4\u1cf8-\u1cf9\u1dc0-\u1df9\u1dfb-\u1dff\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2cef-\u2cf1\u2d7f\u2de0-\u2dff\u302a-\u302d\u3099-\u309a\ua66f\ua674-\ua67d\ua69e-\ua69f\ua6f0-\ua6f1\ua802\ua806\ua80b\ua825-\ua826\ua8c4-\ua8c5\ua8e0-\ua8f1\ua8ff\ua926-\ua92d\ua947-\ua951\ua980-\ua982\ua9b3\ua9b6-\ua9b9\ua9bc\ua9e5\uaa29-\uaa2e\uaa31-\uaa32\uaa35-\uaa36\uaa43\uaa4c\uaa7c\uaab0\uaab2-\uaab4\uaab7-\uaab8\uaabe-\uaabf\uaac1\uaaec-\uaaed\uaaf6\uabe5\uabe8\uabed\ufb1e\ufe00-\ufe0f\ufe20-\ufe2f\U000101fd\U000102e0\U00010376-\U0001037a\U00010a01-\U00010a03\U00010a05-\U00010a06\U00010a0c-\U00010a0f\U00010a38-\U00010a3a\U00010a3f\U00010ae5-\U00010ae6\U00010d24-\U00010d27\U00010f46-\U00010f50\U00011001\U00011038-\U00011046\U0001107f-\U00011081\U000110b3-\U000110b6\U000110b9-\U000110ba\U00011100-\U00011102\U00011127-\U0001112b\U0001112d-\U00011134\U00011173\U00011180-\U00011181\U000111b6-\U000111be\U000111c9-\U000111cc\U0001122f-\U00011231\U00011234\U00011236-\U00011237\U0001123e\U000112df\U000112e3-\U000112ea\U00011300-\U00011301\U0001133b-\U0001133c\U00011340\U00011366-\U0001136c\U00011370-\U00011374\U00011438-\U0001143f\U00011442-\U00011444\U00011446\U0001145e\U000114b3-\U000114b8\U000114ba\U000114bf-\U000114c0\U000114c2-\U000114c3\U000115b2-\U000115b5\U000115bc-\U000115bd\U000115bf-\U000115c0\U000115dc-\U000115dd\U00011633-\U0001163a\U0001163d\U0001163f-\U00011640\U000116ab\U000116ad\U000116b0-\U000116b5\U000116b7\U0001171d-\U0001171f\U00011722-\U00011725\U00011727-\U0001172b\U0001182f-\U00011837\U00011839-\U0001183a\U00011a01-\U00011a0a\U00011a33-\U00011a38\U00011a3b-\U00011a3e\U00011a47\U00011a51-\U00011a56\U00011a59-\U00011a5b\U00011a8a-\U00011a96\U00011a98-\U00011a99\U00011c30-\U00011c36\U00011c38-\U00011c3d\U00011c3f\U00011c92-\U00011ca7\U00011caa-\U00011cb0\U00011cb2-\U00011cb3\U00011cb5-\U00011cb6\U00011d31-\U00011d36\U00011d3a\U00011d3c-\U00011d3d\U00011d3f-\U00011d45\U00011d47\U00011d90-\U00011d91\U00011d95\U00011d97\U00011ef3-\U00011ef4\U00016af0-\U00016af4\U00016b30-\U00016b36\U00016f8f-\U00016f92\U0001bc9d-\U0001bc9e\U0001d167-\U0001d169\U0001d17b-\U0001d182\U0001d185-\U0001d18b\U0001d1aa-\U0001d1ad\U0001d242-\U0001d244\U0001da00-\U0001da36\U0001da3b-\U0001da6c\U0001da75\U0001da84\U0001da9b-\U0001da9f\U0001daa1-\U0001daaf\U0001e000-\U0001e006\U0001e008-\U0001e018\U0001e01b-\U0001e021\U0001e023-\U0001e024\U0001e026-\U0001e02a\U0001e8d0-\U0001e8d6\U0001e944-\U0001e94a\U000e0100-\U000e01ef' + +Nd = '0-9\u0660-\u0669\u06f0-\u06f9\u07c0-\u07c9\u0966-\u096f\u09e6-\u09ef\u0a66-\u0a6f\u0ae6-\u0aef\u0b66-\u0b6f\u0be6-\u0bef\u0c66-\u0c6f\u0ce6-\u0cef\u0d66-\u0d6f\u0de6-\u0def\u0e50-\u0e59\u0ed0-\u0ed9\u0f20-\u0f29\u1040-\u1049\u1090-\u1099\u17e0-\u17e9\u1810-\u1819\u1946-\u194f\u19d0-\u19d9\u1a80-\u1a89\u1a90-\u1a99\u1b50-\u1b59\u1bb0-\u1bb9\u1c40-\u1c49\u1c50-\u1c59\ua620-\ua629\ua8d0-\ua8d9\ua900-\ua909\ua9d0-\ua9d9\ua9f0-\ua9f9\uaa50-\uaa59\uabf0-\uabf9\uff10-\uff19\U000104a0-\U000104a9\U00010d30-\U00010d39\U00011066-\U0001106f\U000110f0-\U000110f9\U00011136-\U0001113f\U000111d0-\U000111d9\U000112f0-\U000112f9\U00011450-\U00011459\U000114d0-\U000114d9\U00011650-\U00011659\U000116c0-\U000116c9\U00011730-\U00011739\U000118e0-\U000118e9\U00011c50-\U00011c59\U00011d50-\U00011d59\U00011da0-\U00011da9\U00016a60-\U00016a69\U00016b50-\U00016b59\U0001d7ce-\U0001d7ff\U0001e950-\U0001e959' + +Nl = '\u16ee-\u16f0\u2160-\u2182\u2185-\u2188\u3007\u3021-\u3029\u3038-\u303a\ua6e6-\ua6ef\U00010140-\U00010174\U00010341\U0001034a\U000103d1-\U000103d5\U00012400-\U0001246e' + +No = '\xb2-\xb3\xb9\xbc-\xbe\u09f4-\u09f9\u0b72-\u0b77\u0bf0-\u0bf2\u0c78-\u0c7e\u0d58-\u0d5e\u0d70-\u0d78\u0f2a-\u0f33\u1369-\u137c\u17f0-\u17f9\u19da\u2070\u2074-\u2079\u2080-\u2089\u2150-\u215f\u2189\u2460-\u249b\u24ea-\u24ff\u2776-\u2793\u2cfd\u3192-\u3195\u3220-\u3229\u3248-\u324f\u3251-\u325f\u3280-\u3289\u32b1-\u32bf\ua830-\ua835\U00010107-\U00010133\U00010175-\U00010178\U0001018a-\U0001018b\U000102e1-\U000102fb\U00010320-\U00010323\U00010858-\U0001085f\U00010879-\U0001087f\U000108a7-\U000108af\U000108fb-\U000108ff\U00010916-\U0001091b\U000109bc-\U000109bd\U000109c0-\U000109cf\U000109d2-\U000109ff\U00010a40-\U00010a48\U00010a7d-\U00010a7e\U00010a9d-\U00010a9f\U00010aeb-\U00010aef\U00010b58-\U00010b5f\U00010b78-\U00010b7f\U00010ba9-\U00010baf\U00010cfa-\U00010cff\U00010e60-\U00010e7e\U00010f1d-\U00010f26\U00010f51-\U00010f54\U00011052-\U00011065\U000111e1-\U000111f4\U0001173a-\U0001173b\U000118ea-\U000118f2\U00011c5a-\U00011c6c\U00016b5b-\U00016b61\U00016e80-\U00016e96\U0001d2e0-\U0001d2f3\U0001d360-\U0001d378\U0001e8c7-\U0001e8cf\U0001ec71-\U0001ecab\U0001ecad-\U0001ecaf\U0001ecb1-\U0001ecb4\U0001f100-\U0001f10c' + +Pc = '_\u203f-\u2040\u2054\ufe33-\ufe34\ufe4d-\ufe4f\uff3f' + +Pd = '\\-\u058a\u05be\u1400\u1806\u2010-\u2015\u2e17\u2e1a\u2e3a-\u2e3b\u2e40\u301c\u3030\u30a0\ufe31-\ufe32\ufe58\ufe63\uff0d' + +Pe = ')\\]}\u0f3b\u0f3d\u169c\u2046\u207e\u208e\u2309\u230b\u232a\u2769\u276b\u276d\u276f\u2771\u2773\u2775\u27c6\u27e7\u27e9\u27eb\u27ed\u27ef\u2984\u2986\u2988\u298a\u298c\u298e\u2990\u2992\u2994\u2996\u2998\u29d9\u29db\u29fd\u2e23\u2e25\u2e27\u2e29\u3009\u300b\u300d\u300f\u3011\u3015\u3017\u3019\u301b\u301e-\u301f\ufd3e\ufe18\ufe36\ufe38\ufe3a\ufe3c\ufe3e\ufe40\ufe42\ufe44\ufe48\ufe5a\ufe5c\ufe5e\uff09\uff3d\uff5d\uff60\uff63' + +Pf = '\xbb\u2019\u201d\u203a\u2e03\u2e05\u2e0a\u2e0d\u2e1d\u2e21' + +Pi = '\xab\u2018\u201b-\u201c\u201f\u2039\u2e02\u2e04\u2e09\u2e0c\u2e1c\u2e20' + +Po = "!-#%-'*,.-/:-;?-@\\\\\xa1\xa7\xb6-\xb7\xbf\u037e\u0387\u055a-\u055f\u0589\u05c0\u05c3\u05c6\u05f3-\u05f4\u0609-\u060a\u060c-\u060d\u061b\u061e-\u061f\u066a-\u066d\u06d4\u0700-\u070d\u07f7-\u07f9\u0830-\u083e\u085e\u0964-\u0965\u0970\u09fd\u0a76\u0af0\u0c84\u0df4\u0e4f\u0e5a-\u0e5b\u0f04-\u0f12\u0f14\u0f85\u0fd0-\u0fd4\u0fd9-\u0fda\u104a-\u104f\u10fb\u1360-\u1368\u166d-\u166e\u16eb-\u16ed\u1735-\u1736\u17d4-\u17d6\u17d8-\u17da\u1800-\u1805\u1807-\u180a\u1944-\u1945\u1a1e-\u1a1f\u1aa0-\u1aa6\u1aa8-\u1aad\u1b5a-\u1b60\u1bfc-\u1bff\u1c3b-\u1c3f\u1c7e-\u1c7f\u1cc0-\u1cc7\u1cd3\u2016-\u2017\u2020-\u2027\u2030-\u2038\u203b-\u203e\u2041-\u2043\u2047-\u2051\u2053\u2055-\u205e\u2cf9-\u2cfc\u2cfe-\u2cff\u2d70\u2e00-\u2e01\u2e06-\u2e08\u2e0b\u2e0e-\u2e16\u2e18-\u2e19\u2e1b\u2e1e-\u2e1f\u2e2a-\u2e2e\u2e30-\u2e39\u2e3c-\u2e3f\u2e41\u2e43-\u2e4e\u3001-\u3003\u303d\u30fb\ua4fe-\ua4ff\ua60d-\ua60f\ua673\ua67e\ua6f2-\ua6f7\ua874-\ua877\ua8ce-\ua8cf\ua8f8-\ua8fa\ua8fc\ua92e-\ua92f\ua95f\ua9c1-\ua9cd\ua9de-\ua9df\uaa5c-\uaa5f\uaade-\uaadf\uaaf0-\uaaf1\uabeb\ufe10-\ufe16\ufe19\ufe30\ufe45-\ufe46\ufe49-\ufe4c\ufe50-\ufe52\ufe54-\ufe57\ufe5f-\ufe61\ufe68\ufe6a-\ufe6b\uff01-\uff03\uff05-\uff07\uff0a\uff0c\uff0e-\uff0f\uff1a-\uff1b\uff1f-\uff20\uff3c\uff61\uff64-\uff65\U00010100-\U00010102\U0001039f\U000103d0\U0001056f\U00010857\U0001091f\U0001093f\U00010a50-\U00010a58\U00010a7f\U00010af0-\U00010af6\U00010b39-\U00010b3f\U00010b99-\U00010b9c\U00010f55-\U00010f59\U00011047-\U0001104d\U000110bb-\U000110bc\U000110be-\U000110c1\U00011140-\U00011143\U00011174-\U00011175\U000111c5-\U000111c8\U000111cd\U000111db\U000111dd-\U000111df\U00011238-\U0001123d\U000112a9\U0001144b-\U0001144f\U0001145b\U0001145d\U000114c6\U000115c1-\U000115d7\U00011641-\U00011643\U00011660-\U0001166c\U0001173c-\U0001173e\U0001183b\U00011a3f-\U00011a46\U00011a9a-\U00011a9c\U00011a9e-\U00011aa2\U00011c41-\U00011c45\U00011c70-\U00011c71\U00011ef7-\U00011ef8\U00012470-\U00012474\U00016a6e-\U00016a6f\U00016af5\U00016b37-\U00016b3b\U00016b44\U00016e97-\U00016e9a\U0001bc9f\U0001da87-\U0001da8b\U0001e95e-\U0001e95f" + +Ps = '(\\[{\u0f3a\u0f3c\u169b\u201a\u201e\u2045\u207d\u208d\u2308\u230a\u2329\u2768\u276a\u276c\u276e\u2770\u2772\u2774\u27c5\u27e6\u27e8\u27ea\u27ec\u27ee\u2983\u2985\u2987\u2989\u298b\u298d\u298f\u2991\u2993\u2995\u2997\u29d8\u29da\u29fc\u2e22\u2e24\u2e26\u2e28\u2e42\u3008\u300a\u300c\u300e\u3010\u3014\u3016\u3018\u301a\u301d\ufd3f\ufe17\ufe35\ufe37\ufe39\ufe3b\ufe3d\ufe3f\ufe41\ufe43\ufe47\ufe59\ufe5b\ufe5d\uff08\uff3b\uff5b\uff5f\uff62' + +Sc = '$\xa2-\xa5\u058f\u060b\u07fe-\u07ff\u09f2-\u09f3\u09fb\u0af1\u0bf9\u0e3f\u17db\u20a0-\u20bf\ua838\ufdfc\ufe69\uff04\uffe0-\uffe1\uffe5-\uffe6\U0001ecb0' + +Sk = '\\^`\xa8\xaf\xb4\xb8\u02c2-\u02c5\u02d2-\u02df\u02e5-\u02eb\u02ed\u02ef-\u02ff\u0375\u0384-\u0385\u1fbd\u1fbf-\u1fc1\u1fcd-\u1fcf\u1fdd-\u1fdf\u1fed-\u1fef\u1ffd-\u1ffe\u309b-\u309c\ua700-\ua716\ua720-\ua721\ua789-\ua78a\uab5b\ufbb2-\ufbc1\uff3e\uff40\uffe3\U0001f3fb-\U0001f3ff' + +Sm = '+<->|~\xac\xb1\xd7\xf7\u03f6\u0606-\u0608\u2044\u2052\u207a-\u207c\u208a-\u208c\u2118\u2140-\u2144\u214b\u2190-\u2194\u219a-\u219b\u21a0\u21a3\u21a6\u21ae\u21ce-\u21cf\u21d2\u21d4\u21f4-\u22ff\u2320-\u2321\u237c\u239b-\u23b3\u23dc-\u23e1\u25b7\u25c1\u25f8-\u25ff\u266f\u27c0-\u27c4\u27c7-\u27e5\u27f0-\u27ff\u2900-\u2982\u2999-\u29d7\u29dc-\u29fb\u29fe-\u2aff\u2b30-\u2b44\u2b47-\u2b4c\ufb29\ufe62\ufe64-\ufe66\uff0b\uff1c-\uff1e\uff5c\uff5e\uffe2\uffe9-\uffec\U0001d6c1\U0001d6db\U0001d6fb\U0001d715\U0001d735\U0001d74f\U0001d76f\U0001d789\U0001d7a9\U0001d7c3\U0001eef0-\U0001eef1' + +So = '\xa6\xa9\xae\xb0\u0482\u058d-\u058e\u060e-\u060f\u06de\u06e9\u06fd-\u06fe\u07f6\u09fa\u0b70\u0bf3-\u0bf8\u0bfa\u0c7f\u0d4f\u0d79\u0f01-\u0f03\u0f13\u0f15-\u0f17\u0f1a-\u0f1f\u0f34\u0f36\u0f38\u0fbe-\u0fc5\u0fc7-\u0fcc\u0fce-\u0fcf\u0fd5-\u0fd8\u109e-\u109f\u1390-\u1399\u1940\u19de-\u19ff\u1b61-\u1b6a\u1b74-\u1b7c\u2100-\u2101\u2103-\u2106\u2108-\u2109\u2114\u2116-\u2117\u211e-\u2123\u2125\u2127\u2129\u212e\u213a-\u213b\u214a\u214c-\u214d\u214f\u218a-\u218b\u2195-\u2199\u219c-\u219f\u21a1-\u21a2\u21a4-\u21a5\u21a7-\u21ad\u21af-\u21cd\u21d0-\u21d1\u21d3\u21d5-\u21f3\u2300-\u2307\u230c-\u231f\u2322-\u2328\u232b-\u237b\u237d-\u239a\u23b4-\u23db\u23e2-\u2426\u2440-\u244a\u249c-\u24e9\u2500-\u25b6\u25b8-\u25c0\u25c2-\u25f7\u2600-\u266e\u2670-\u2767\u2794-\u27bf\u2800-\u28ff\u2b00-\u2b2f\u2b45-\u2b46\u2b4d-\u2b73\u2b76-\u2b95\u2b98-\u2bc8\u2bca-\u2bfe\u2ce5-\u2cea\u2e80-\u2e99\u2e9b-\u2ef3\u2f00-\u2fd5\u2ff0-\u2ffb\u3004\u3012-\u3013\u3020\u3036-\u3037\u303e-\u303f\u3190-\u3191\u3196-\u319f\u31c0-\u31e3\u3200-\u321e\u322a-\u3247\u3250\u3260-\u327f\u328a-\u32b0\u32c0-\u32fe\u3300-\u33ff\u4dc0-\u4dff\ua490-\ua4c6\ua828-\ua82b\ua836-\ua837\ua839\uaa77-\uaa79\ufdfd\uffe4\uffe8\uffed-\uffee\ufffc-\ufffd\U00010137-\U0001013f\U00010179-\U00010189\U0001018c-\U0001018e\U00010190-\U0001019b\U000101a0\U000101d0-\U000101fc\U00010877-\U00010878\U00010ac8\U0001173f\U00016b3c-\U00016b3f\U00016b45\U0001bc9c\U0001d000-\U0001d0f5\U0001d100-\U0001d126\U0001d129-\U0001d164\U0001d16a-\U0001d16c\U0001d183-\U0001d184\U0001d18c-\U0001d1a9\U0001d1ae-\U0001d1e8\U0001d200-\U0001d241\U0001d245\U0001d300-\U0001d356\U0001d800-\U0001d9ff\U0001da37-\U0001da3a\U0001da6d-\U0001da74\U0001da76-\U0001da83\U0001da85-\U0001da86\U0001ecac\U0001f000-\U0001f02b\U0001f030-\U0001f093\U0001f0a0-\U0001f0ae\U0001f0b1-\U0001f0bf\U0001f0c1-\U0001f0cf\U0001f0d1-\U0001f0f5\U0001f110-\U0001f16b\U0001f170-\U0001f1ac\U0001f1e6-\U0001f202\U0001f210-\U0001f23b\U0001f240-\U0001f248\U0001f250-\U0001f251\U0001f260-\U0001f265\U0001f300-\U0001f3fa\U0001f400-\U0001f6d4\U0001f6e0-\U0001f6ec\U0001f6f0-\U0001f6f9\U0001f700-\U0001f773\U0001f780-\U0001f7d8\U0001f800-\U0001f80b\U0001f810-\U0001f847\U0001f850-\U0001f859\U0001f860-\U0001f887\U0001f890-\U0001f8ad\U0001f900-\U0001f90b\U0001f910-\U0001f93e\U0001f940-\U0001f970\U0001f973-\U0001f976\U0001f97a\U0001f97c-\U0001f9a2\U0001f9b0-\U0001f9b9\U0001f9c0-\U0001f9c2\U0001f9d0-\U0001f9ff\U0001fa60-\U0001fa6d' + +Zl = '\u2028' + +Zp = '\u2029' + +Zs = ' \xa0\u1680\u2000-\u200a\u202f\u205f\u3000' + +xid_continue = '0-9A-Z_a-z\xaa\xb5\xb7\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0300-\u0374\u0376-\u0377\u037b-\u037d\u037f\u0386-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u0483-\u0487\u048a-\u052f\u0531-\u0556\u0559\u0560-\u0588\u0591-\u05bd\u05bf\u05c1-\u05c2\u05c4-\u05c5\u05c7\u05d0-\u05ea\u05ef-\u05f2\u0610-\u061a\u0620-\u0669\u066e-\u06d3\u06d5-\u06dc\u06df-\u06e8\u06ea-\u06fc\u06ff\u0710-\u074a\u074d-\u07b1\u07c0-\u07f5\u07fa\u07fd\u0800-\u082d\u0840-\u085b\u0860-\u086a\u08a0-\u08b4\u08b6-\u08bd\u08d3-\u08e1\u08e3-\u0963\u0966-\u096f\u0971-\u0983\u0985-\u098c\u098f-\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bc-\u09c4\u09c7-\u09c8\u09cb-\u09ce\u09d7\u09dc-\u09dd\u09df-\u09e3\u09e6-\u09f1\u09fc\u09fe\u0a01-\u0a03\u0a05-\u0a0a\u0a0f-\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32-\u0a33\u0a35-\u0a36\u0a38-\u0a39\u0a3c\u0a3e-\u0a42\u0a47-\u0a48\u0a4b-\u0a4d\u0a51\u0a59-\u0a5c\u0a5e\u0a66-\u0a75\u0a81-\u0a83\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2-\u0ab3\u0ab5-\u0ab9\u0abc-\u0ac5\u0ac7-\u0ac9\u0acb-\u0acd\u0ad0\u0ae0-\u0ae3\u0ae6-\u0aef\u0af9-\u0aff\u0b01-\u0b03\u0b05-\u0b0c\u0b0f-\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32-\u0b33\u0b35-\u0b39\u0b3c-\u0b44\u0b47-\u0b48\u0b4b-\u0b4d\u0b56-\u0b57\u0b5c-\u0b5d\u0b5f-\u0b63\u0b66-\u0b6f\u0b71\u0b82-\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99-\u0b9a\u0b9c\u0b9e-\u0b9f\u0ba3-\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bbe-\u0bc2\u0bc6-\u0bc8\u0bca-\u0bcd\u0bd0\u0bd7\u0be6-\u0bef\u0c00-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c39\u0c3d-\u0c44\u0c46-\u0c48\u0c4a-\u0c4d\u0c55-\u0c56\u0c58-\u0c5a\u0c60-\u0c63\u0c66-\u0c6f\u0c80-\u0c83\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbc-\u0cc4\u0cc6-\u0cc8\u0cca-\u0ccd\u0cd5-\u0cd6\u0cde\u0ce0-\u0ce3\u0ce6-\u0cef\u0cf1-\u0cf2\u0d00-\u0d03\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d44\u0d46-\u0d48\u0d4a-\u0d4e\u0d54-\u0d57\u0d5f-\u0d63\u0d66-\u0d6f\u0d7a-\u0d7f\u0d82-\u0d83\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0dca\u0dcf-\u0dd4\u0dd6\u0dd8-\u0ddf\u0de6-\u0def\u0df2-\u0df3\u0e01-\u0e3a\u0e40-\u0e4e\u0e50-\u0e59\u0e81-\u0e82\u0e84\u0e87-\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa-\u0eab\u0ead-\u0eb9\u0ebb-\u0ebd\u0ec0-\u0ec4\u0ec6\u0ec8-\u0ecd\u0ed0-\u0ed9\u0edc-\u0edf\u0f00\u0f18-\u0f19\u0f20-\u0f29\u0f35\u0f37\u0f39\u0f3e-\u0f47\u0f49-\u0f6c\u0f71-\u0f84\u0f86-\u0f97\u0f99-\u0fbc\u0fc6\u1000-\u1049\u1050-\u109d\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u135d-\u135f\u1369-\u1371\u1380-\u138f\u13a0-\u13f5\u13f8-\u13fd\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f8\u1700-\u170c\u170e-\u1714\u1720-\u1734\u1740-\u1753\u1760-\u176c\u176e-\u1770\u1772-\u1773\u1780-\u17d3\u17d7\u17dc-\u17dd\u17e0-\u17e9\u180b-\u180d\u1810-\u1819\u1820-\u1878\u1880-\u18aa\u18b0-\u18f5\u1900-\u191e\u1920-\u192b\u1930-\u193b\u1946-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u19d0-\u19da\u1a00-\u1a1b\u1a20-\u1a5e\u1a60-\u1a7c\u1a7f-\u1a89\u1a90-\u1a99\u1aa7\u1ab0-\u1abd\u1b00-\u1b4b\u1b50-\u1b59\u1b6b-\u1b73\u1b80-\u1bf3\u1c00-\u1c37\u1c40-\u1c49\u1c4d-\u1c7d\u1c80-\u1c88\u1c90-\u1cba\u1cbd-\u1cbf\u1cd0-\u1cd2\u1cd4-\u1cf9\u1d00-\u1df9\u1dfb-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u203f-\u2040\u2054\u2071\u207f\u2090-\u209c\u20d0-\u20dc\u20e1\u20e5-\u20f0\u2102\u2107\u210a-\u2113\u2115\u2118-\u211d\u2124\u2126\u2128\u212a-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d7f-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u2de0-\u2dff\u3005-\u3007\u3021-\u302f\u3031-\u3035\u3038-\u303c\u3041-\u3096\u3099-\u309a\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312f\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fef\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua62b\ua640-\ua66f\ua674-\ua67d\ua67f-\ua6f1\ua717-\ua71f\ua722-\ua788\ua78b-\ua7b9\ua7f7-\ua827\ua840-\ua873\ua880-\ua8c5\ua8d0-\ua8d9\ua8e0-\ua8f7\ua8fb\ua8fd-\ua92d\ua930-\ua953\ua960-\ua97c\ua980-\ua9c0\ua9cf-\ua9d9\ua9e0-\ua9fe\uaa00-\uaa36\uaa40-\uaa4d\uaa50-\uaa59\uaa60-\uaa76\uaa7a-\uaac2\uaadb-\uaadd\uaae0-\uaaef\uaaf2-\uaaf6\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uab30-\uab5a\uab5c-\uab65\uab70-\uabea\uabec-\uabed\uabf0-\uabf9\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40-\ufb41\ufb43-\ufb44\ufb46-\ufbb1\ufbd3-\ufc5d\ufc64-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdf9\ufe00-\ufe0f\ufe20-\ufe2f\ufe33-\ufe34\ufe4d-\ufe4f\ufe71\ufe73\ufe77\ufe79\ufe7b\ufe7d\ufe7f-\ufefc\uff10-\uff19\uff21-\uff3a\uff3f\uff41-\uff5a\uff66-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc\U00010000-\U0001000b\U0001000d-\U00010026\U00010028-\U0001003a\U0001003c-\U0001003d\U0001003f-\U0001004d\U00010050-\U0001005d\U00010080-\U000100fa\U00010140-\U00010174\U000101fd\U00010280-\U0001029c\U000102a0-\U000102d0\U000102e0\U00010300-\U0001031f\U0001032d-\U0001034a\U00010350-\U0001037a\U00010380-\U0001039d\U000103a0-\U000103c3\U000103c8-\U000103cf\U000103d1-\U000103d5\U00010400-\U0001049d\U000104a0-\U000104a9\U000104b0-\U000104d3\U000104d8-\U000104fb\U00010500-\U00010527\U00010530-\U00010563\U00010600-\U00010736\U00010740-\U00010755\U00010760-\U00010767\U00010800-\U00010805\U00010808\U0001080a-\U00010835\U00010837-\U00010838\U0001083c\U0001083f-\U00010855\U00010860-\U00010876\U00010880-\U0001089e\U000108e0-\U000108f2\U000108f4-\U000108f5\U00010900-\U00010915\U00010920-\U00010939\U00010980-\U000109b7\U000109be-\U000109bf\U00010a00-\U00010a03\U00010a05-\U00010a06\U00010a0c-\U00010a13\U00010a15-\U00010a17\U00010a19-\U00010a35\U00010a38-\U00010a3a\U00010a3f\U00010a60-\U00010a7c\U00010a80-\U00010a9c\U00010ac0-\U00010ac7\U00010ac9-\U00010ae6\U00010b00-\U00010b35\U00010b40-\U00010b55\U00010b60-\U00010b72\U00010b80-\U00010b91\U00010c00-\U00010c48\U00010c80-\U00010cb2\U00010cc0-\U00010cf2\U00010d00-\U00010d27\U00010d30-\U00010d39\U00010f00-\U00010f1c\U00010f27\U00010f30-\U00010f50\U00011000-\U00011046\U00011066-\U0001106f\U0001107f-\U000110ba\U000110d0-\U000110e8\U000110f0-\U000110f9\U00011100-\U00011134\U00011136-\U0001113f\U00011144-\U00011146\U00011150-\U00011173\U00011176\U00011180-\U000111c4\U000111c9-\U000111cc\U000111d0-\U000111da\U000111dc\U00011200-\U00011211\U00011213-\U00011237\U0001123e\U00011280-\U00011286\U00011288\U0001128a-\U0001128d\U0001128f-\U0001129d\U0001129f-\U000112a8\U000112b0-\U000112ea\U000112f0-\U000112f9\U00011300-\U00011303\U00011305-\U0001130c\U0001130f-\U00011310\U00011313-\U00011328\U0001132a-\U00011330\U00011332-\U00011333\U00011335-\U00011339\U0001133b-\U00011344\U00011347-\U00011348\U0001134b-\U0001134d\U00011350\U00011357\U0001135d-\U00011363\U00011366-\U0001136c\U00011370-\U00011374\U00011400-\U0001144a\U00011450-\U00011459\U0001145e\U00011480-\U000114c5\U000114c7\U000114d0-\U000114d9\U00011580-\U000115b5\U000115b8-\U000115c0\U000115d8-\U000115dd\U00011600-\U00011640\U00011644\U00011650-\U00011659\U00011680-\U000116b7\U000116c0-\U000116c9\U00011700-\U0001171a\U0001171d-\U0001172b\U00011730-\U00011739\U00011800-\U0001183a\U000118a0-\U000118e9\U000118ff\U00011a00-\U00011a3e\U00011a47\U00011a50-\U00011a83\U00011a86-\U00011a99\U00011a9d\U00011ac0-\U00011af8\U00011c00-\U00011c08\U00011c0a-\U00011c36\U00011c38-\U00011c40\U00011c50-\U00011c59\U00011c72-\U00011c8f\U00011c92-\U00011ca7\U00011ca9-\U00011cb6\U00011d00-\U00011d06\U00011d08-\U00011d09\U00011d0b-\U00011d36\U00011d3a\U00011d3c-\U00011d3d\U00011d3f-\U00011d47\U00011d50-\U00011d59\U00011d60-\U00011d65\U00011d67-\U00011d68\U00011d6a-\U00011d8e\U00011d90-\U00011d91\U00011d93-\U00011d98\U00011da0-\U00011da9\U00011ee0-\U00011ef6\U00012000-\U00012399\U00012400-\U0001246e\U00012480-\U00012543\U00013000-\U0001342e\U00014400-\U00014646\U00016800-\U00016a38\U00016a40-\U00016a5e\U00016a60-\U00016a69\U00016ad0-\U00016aed\U00016af0-\U00016af4\U00016b00-\U00016b36\U00016b40-\U00016b43\U00016b50-\U00016b59\U00016b63-\U00016b77\U00016b7d-\U00016b8f\U00016e40-\U00016e7f\U00016f00-\U00016f44\U00016f50-\U00016f7e\U00016f8f-\U00016f9f\U00016fe0-\U00016fe1\U00017000-\U000187f1\U00018800-\U00018af2\U0001b000-\U0001b11e\U0001b170-\U0001b2fb\U0001bc00-\U0001bc6a\U0001bc70-\U0001bc7c\U0001bc80-\U0001bc88\U0001bc90-\U0001bc99\U0001bc9d-\U0001bc9e\U0001d165-\U0001d169\U0001d16d-\U0001d172\U0001d17b-\U0001d182\U0001d185-\U0001d18b\U0001d1aa-\U0001d1ad\U0001d242-\U0001d244\U0001d400-\U0001d454\U0001d456-\U0001d49c\U0001d49e-\U0001d49f\U0001d4a2\U0001d4a5-\U0001d4a6\U0001d4a9-\U0001d4ac\U0001d4ae-\U0001d4b9\U0001d4bb\U0001d4bd-\U0001d4c3\U0001d4c5-\U0001d505\U0001d507-\U0001d50a\U0001d50d-\U0001d514\U0001d516-\U0001d51c\U0001d51e-\U0001d539\U0001d53b-\U0001d53e\U0001d540-\U0001d544\U0001d546\U0001d54a-\U0001d550\U0001d552-\U0001d6a5\U0001d6a8-\U0001d6c0\U0001d6c2-\U0001d6da\U0001d6dc-\U0001d6fa\U0001d6fc-\U0001d714\U0001d716-\U0001d734\U0001d736-\U0001d74e\U0001d750-\U0001d76e\U0001d770-\U0001d788\U0001d78a-\U0001d7a8\U0001d7aa-\U0001d7c2\U0001d7c4-\U0001d7cb\U0001d7ce-\U0001d7ff\U0001da00-\U0001da36\U0001da3b-\U0001da6c\U0001da75\U0001da84\U0001da9b-\U0001da9f\U0001daa1-\U0001daaf\U0001e000-\U0001e006\U0001e008-\U0001e018\U0001e01b-\U0001e021\U0001e023-\U0001e024\U0001e026-\U0001e02a\U0001e800-\U0001e8c4\U0001e8d0-\U0001e8d6\U0001e900-\U0001e94a\U0001e950-\U0001e959\U0001ee00-\U0001ee03\U0001ee05-\U0001ee1f\U0001ee21-\U0001ee22\U0001ee24\U0001ee27\U0001ee29-\U0001ee32\U0001ee34-\U0001ee37\U0001ee39\U0001ee3b\U0001ee42\U0001ee47\U0001ee49\U0001ee4b\U0001ee4d-\U0001ee4f\U0001ee51-\U0001ee52\U0001ee54\U0001ee57\U0001ee59\U0001ee5b\U0001ee5d\U0001ee5f\U0001ee61-\U0001ee62\U0001ee64\U0001ee67-\U0001ee6a\U0001ee6c-\U0001ee72\U0001ee74-\U0001ee77\U0001ee79-\U0001ee7c\U0001ee7e\U0001ee80-\U0001ee89\U0001ee8b-\U0001ee9b\U0001eea1-\U0001eea3\U0001eea5-\U0001eea9\U0001eeab-\U0001eebb\U00020000-\U0002a6d6\U0002a700-\U0002b734\U0002b740-\U0002b81d\U0002b820-\U0002cea1\U0002ceb0-\U0002ebe0\U0002f800-\U0002fa1d\U000e0100-\U000e01ef' + +xid_start = 'A-Z_a-z\xaa\xb5\xba\xc0-\xd6\xd8-\xf6\xf8-\u02c1\u02c6-\u02d1\u02e0-\u02e4\u02ec\u02ee\u0370-\u0374\u0376-\u0377\u037b-\u037d\u037f\u0386\u0388-\u038a\u038c\u038e-\u03a1\u03a3-\u03f5\u03f7-\u0481\u048a-\u052f\u0531-\u0556\u0559\u0560-\u0588\u05d0-\u05ea\u05ef-\u05f2\u0620-\u064a\u066e-\u066f\u0671-\u06d3\u06d5\u06e5-\u06e6\u06ee-\u06ef\u06fa-\u06fc\u06ff\u0710\u0712-\u072f\u074d-\u07a5\u07b1\u07ca-\u07ea\u07f4-\u07f5\u07fa\u0800-\u0815\u081a\u0824\u0828\u0840-\u0858\u0860-\u086a\u08a0-\u08b4\u08b6-\u08bd\u0904-\u0939\u093d\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098c\u098f-\u0990\u0993-\u09a8\u09aa-\u09b0\u09b2\u09b6-\u09b9\u09bd\u09ce\u09dc-\u09dd\u09df-\u09e1\u09f0-\u09f1\u09fc\u0a05-\u0a0a\u0a0f-\u0a10\u0a13-\u0a28\u0a2a-\u0a30\u0a32-\u0a33\u0a35-\u0a36\u0a38-\u0a39\u0a59-\u0a5c\u0a5e\u0a72-\u0a74\u0a85-\u0a8d\u0a8f-\u0a91\u0a93-\u0aa8\u0aaa-\u0ab0\u0ab2-\u0ab3\u0ab5-\u0ab9\u0abd\u0ad0\u0ae0-\u0ae1\u0af9\u0b05-\u0b0c\u0b0f-\u0b10\u0b13-\u0b28\u0b2a-\u0b30\u0b32-\u0b33\u0b35-\u0b39\u0b3d\u0b5c-\u0b5d\u0b5f-\u0b61\u0b71\u0b83\u0b85-\u0b8a\u0b8e-\u0b90\u0b92-\u0b95\u0b99-\u0b9a\u0b9c\u0b9e-\u0b9f\u0ba3-\u0ba4\u0ba8-\u0baa\u0bae-\u0bb9\u0bd0\u0c05-\u0c0c\u0c0e-\u0c10\u0c12-\u0c28\u0c2a-\u0c39\u0c3d\u0c58-\u0c5a\u0c60-\u0c61\u0c80\u0c85-\u0c8c\u0c8e-\u0c90\u0c92-\u0ca8\u0caa-\u0cb3\u0cb5-\u0cb9\u0cbd\u0cde\u0ce0-\u0ce1\u0cf1-\u0cf2\u0d05-\u0d0c\u0d0e-\u0d10\u0d12-\u0d3a\u0d3d\u0d4e\u0d54-\u0d56\u0d5f-\u0d61\u0d7a-\u0d7f\u0d85-\u0d96\u0d9a-\u0db1\u0db3-\u0dbb\u0dbd\u0dc0-\u0dc6\u0e01-\u0e30\u0e32\u0e40-\u0e46\u0e81-\u0e82\u0e84\u0e87-\u0e88\u0e8a\u0e8d\u0e94-\u0e97\u0e99-\u0e9f\u0ea1-\u0ea3\u0ea5\u0ea7\u0eaa-\u0eab\u0ead-\u0eb0\u0eb2\u0ebd\u0ec0-\u0ec4\u0ec6\u0edc-\u0edf\u0f00\u0f40-\u0f47\u0f49-\u0f6c\u0f88-\u0f8c\u1000-\u102a\u103f\u1050-\u1055\u105a-\u105d\u1061\u1065-\u1066\u106e-\u1070\u1075-\u1081\u108e\u10a0-\u10c5\u10c7\u10cd\u10d0-\u10fa\u10fc-\u1248\u124a-\u124d\u1250-\u1256\u1258\u125a-\u125d\u1260-\u1288\u128a-\u128d\u1290-\u12b0\u12b2-\u12b5\u12b8-\u12be\u12c0\u12c2-\u12c5\u12c8-\u12d6\u12d8-\u1310\u1312-\u1315\u1318-\u135a\u1380-\u138f\u13a0-\u13f5\u13f8-\u13fd\u1401-\u166c\u166f-\u167f\u1681-\u169a\u16a0-\u16ea\u16ee-\u16f8\u1700-\u170c\u170e-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176c\u176e-\u1770\u1780-\u17b3\u17d7\u17dc\u1820-\u1878\u1880-\u18a8\u18aa\u18b0-\u18f5\u1900-\u191e\u1950-\u196d\u1970-\u1974\u1980-\u19ab\u19b0-\u19c9\u1a00-\u1a16\u1a20-\u1a54\u1aa7\u1b05-\u1b33\u1b45-\u1b4b\u1b83-\u1ba0\u1bae-\u1baf\u1bba-\u1be5\u1c00-\u1c23\u1c4d-\u1c4f\u1c5a-\u1c7d\u1c80-\u1c88\u1c90-\u1cba\u1cbd-\u1cbf\u1ce9-\u1cec\u1cee-\u1cf1\u1cf5-\u1cf6\u1d00-\u1dbf\u1e00-\u1f15\u1f18-\u1f1d\u1f20-\u1f45\u1f48-\u1f4d\u1f50-\u1f57\u1f59\u1f5b\u1f5d\u1f5f-\u1f7d\u1f80-\u1fb4\u1fb6-\u1fbc\u1fbe\u1fc2-\u1fc4\u1fc6-\u1fcc\u1fd0-\u1fd3\u1fd6-\u1fdb\u1fe0-\u1fec\u1ff2-\u1ff4\u1ff6-\u1ffc\u2071\u207f\u2090-\u209c\u2102\u2107\u210a-\u2113\u2115\u2118-\u211d\u2124\u2126\u2128\u212a-\u2139\u213c-\u213f\u2145-\u2149\u214e\u2160-\u2188\u2c00-\u2c2e\u2c30-\u2c5e\u2c60-\u2ce4\u2ceb-\u2cee\u2cf2-\u2cf3\u2d00-\u2d25\u2d27\u2d2d\u2d30-\u2d67\u2d6f\u2d80-\u2d96\u2da0-\u2da6\u2da8-\u2dae\u2db0-\u2db6\u2db8-\u2dbe\u2dc0-\u2dc6\u2dc8-\u2dce\u2dd0-\u2dd6\u2dd8-\u2dde\u3005-\u3007\u3021-\u3029\u3031-\u3035\u3038-\u303c\u3041-\u3096\u309d-\u309f\u30a1-\u30fa\u30fc-\u30ff\u3105-\u312f\u3131-\u318e\u31a0-\u31ba\u31f0-\u31ff\u3400-\u4db5\u4e00-\u9fef\ua000-\ua48c\ua4d0-\ua4fd\ua500-\ua60c\ua610-\ua61f\ua62a-\ua62b\ua640-\ua66e\ua67f-\ua69d\ua6a0-\ua6ef\ua717-\ua71f\ua722-\ua788\ua78b-\ua7b9\ua7f7-\ua801\ua803-\ua805\ua807-\ua80a\ua80c-\ua822\ua840-\ua873\ua882-\ua8b3\ua8f2-\ua8f7\ua8fb\ua8fd-\ua8fe\ua90a-\ua925\ua930-\ua946\ua960-\ua97c\ua984-\ua9b2\ua9cf\ua9e0-\ua9e4\ua9e6-\ua9ef\ua9fa-\ua9fe\uaa00-\uaa28\uaa40-\uaa42\uaa44-\uaa4b\uaa60-\uaa76\uaa7a\uaa7e-\uaaaf\uaab1\uaab5-\uaab6\uaab9-\uaabd\uaac0\uaac2\uaadb-\uaadd\uaae0-\uaaea\uaaf2-\uaaf4\uab01-\uab06\uab09-\uab0e\uab11-\uab16\uab20-\uab26\uab28-\uab2e\uab30-\uab5a\uab5c-\uab65\uab70-\uabe2\uac00-\ud7a3\ud7b0-\ud7c6\ud7cb-\ud7fb\uf900-\ufa6d\ufa70-\ufad9\ufb00-\ufb06\ufb13-\ufb17\ufb1d\ufb1f-\ufb28\ufb2a-\ufb36\ufb38-\ufb3c\ufb3e\ufb40-\ufb41\ufb43-\ufb44\ufb46-\ufbb1\ufbd3-\ufc5d\ufc64-\ufd3d\ufd50-\ufd8f\ufd92-\ufdc7\ufdf0-\ufdf9\ufe71\ufe73\ufe77\ufe79\ufe7b\ufe7d\ufe7f-\ufefc\uff21-\uff3a\uff41-\uff5a\uff66-\uff9d\uffa0-\uffbe\uffc2-\uffc7\uffca-\uffcf\uffd2-\uffd7\uffda-\uffdc\U00010000-\U0001000b\U0001000d-\U00010026\U00010028-\U0001003a\U0001003c-\U0001003d\U0001003f-\U0001004d\U00010050-\U0001005d\U00010080-\U000100fa\U00010140-\U00010174\U00010280-\U0001029c\U000102a0-\U000102d0\U00010300-\U0001031f\U0001032d-\U0001034a\U00010350-\U00010375\U00010380-\U0001039d\U000103a0-\U000103c3\U000103c8-\U000103cf\U000103d1-\U000103d5\U00010400-\U0001049d\U000104b0-\U000104d3\U000104d8-\U000104fb\U00010500-\U00010527\U00010530-\U00010563\U00010600-\U00010736\U00010740-\U00010755\U00010760-\U00010767\U00010800-\U00010805\U00010808\U0001080a-\U00010835\U00010837-\U00010838\U0001083c\U0001083f-\U00010855\U00010860-\U00010876\U00010880-\U0001089e\U000108e0-\U000108f2\U000108f4-\U000108f5\U00010900-\U00010915\U00010920-\U00010939\U00010980-\U000109b7\U000109be-\U000109bf\U00010a00\U00010a10-\U00010a13\U00010a15-\U00010a17\U00010a19-\U00010a35\U00010a60-\U00010a7c\U00010a80-\U00010a9c\U00010ac0-\U00010ac7\U00010ac9-\U00010ae4\U00010b00-\U00010b35\U00010b40-\U00010b55\U00010b60-\U00010b72\U00010b80-\U00010b91\U00010c00-\U00010c48\U00010c80-\U00010cb2\U00010cc0-\U00010cf2\U00010d00-\U00010d23\U00010f00-\U00010f1c\U00010f27\U00010f30-\U00010f45\U00011003-\U00011037\U00011083-\U000110af\U000110d0-\U000110e8\U00011103-\U00011126\U00011144\U00011150-\U00011172\U00011176\U00011183-\U000111b2\U000111c1-\U000111c4\U000111da\U000111dc\U00011200-\U00011211\U00011213-\U0001122b\U00011280-\U00011286\U00011288\U0001128a-\U0001128d\U0001128f-\U0001129d\U0001129f-\U000112a8\U000112b0-\U000112de\U00011305-\U0001130c\U0001130f-\U00011310\U00011313-\U00011328\U0001132a-\U00011330\U00011332-\U00011333\U00011335-\U00011339\U0001133d\U00011350\U0001135d-\U00011361\U00011400-\U00011434\U00011447-\U0001144a\U00011480-\U000114af\U000114c4-\U000114c5\U000114c7\U00011580-\U000115ae\U000115d8-\U000115db\U00011600-\U0001162f\U00011644\U00011680-\U000116aa\U00011700-\U0001171a\U00011800-\U0001182b\U000118a0-\U000118df\U000118ff\U00011a00\U00011a0b-\U00011a32\U00011a3a\U00011a50\U00011a5c-\U00011a83\U00011a86-\U00011a89\U00011a9d\U00011ac0-\U00011af8\U00011c00-\U00011c08\U00011c0a-\U00011c2e\U00011c40\U00011c72-\U00011c8f\U00011d00-\U00011d06\U00011d08-\U00011d09\U00011d0b-\U00011d30\U00011d46\U00011d60-\U00011d65\U00011d67-\U00011d68\U00011d6a-\U00011d89\U00011d98\U00011ee0-\U00011ef2\U00012000-\U00012399\U00012400-\U0001246e\U00012480-\U00012543\U00013000-\U0001342e\U00014400-\U00014646\U00016800-\U00016a38\U00016a40-\U00016a5e\U00016ad0-\U00016aed\U00016b00-\U00016b2f\U00016b40-\U00016b43\U00016b63-\U00016b77\U00016b7d-\U00016b8f\U00016e40-\U00016e7f\U00016f00-\U00016f44\U00016f50\U00016f93-\U00016f9f\U00016fe0-\U00016fe1\U00017000-\U000187f1\U00018800-\U00018af2\U0001b000-\U0001b11e\U0001b170-\U0001b2fb\U0001bc00-\U0001bc6a\U0001bc70-\U0001bc7c\U0001bc80-\U0001bc88\U0001bc90-\U0001bc99\U0001d400-\U0001d454\U0001d456-\U0001d49c\U0001d49e-\U0001d49f\U0001d4a2\U0001d4a5-\U0001d4a6\U0001d4a9-\U0001d4ac\U0001d4ae-\U0001d4b9\U0001d4bb\U0001d4bd-\U0001d4c3\U0001d4c5-\U0001d505\U0001d507-\U0001d50a\U0001d50d-\U0001d514\U0001d516-\U0001d51c\U0001d51e-\U0001d539\U0001d53b-\U0001d53e\U0001d540-\U0001d544\U0001d546\U0001d54a-\U0001d550\U0001d552-\U0001d6a5\U0001d6a8-\U0001d6c0\U0001d6c2-\U0001d6da\U0001d6dc-\U0001d6fa\U0001d6fc-\U0001d714\U0001d716-\U0001d734\U0001d736-\U0001d74e\U0001d750-\U0001d76e\U0001d770-\U0001d788\U0001d78a-\U0001d7a8\U0001d7aa-\U0001d7c2\U0001d7c4-\U0001d7cb\U0001e800-\U0001e8c4\U0001e900-\U0001e943\U0001ee00-\U0001ee03\U0001ee05-\U0001ee1f\U0001ee21-\U0001ee22\U0001ee24\U0001ee27\U0001ee29-\U0001ee32\U0001ee34-\U0001ee37\U0001ee39\U0001ee3b\U0001ee42\U0001ee47\U0001ee49\U0001ee4b\U0001ee4d-\U0001ee4f\U0001ee51-\U0001ee52\U0001ee54\U0001ee57\U0001ee59\U0001ee5b\U0001ee5d\U0001ee5f\U0001ee61-\U0001ee62\U0001ee64\U0001ee67-\U0001ee6a\U0001ee6c-\U0001ee72\U0001ee74-\U0001ee77\U0001ee79-\U0001ee7c\U0001ee7e\U0001ee80-\U0001ee89\U0001ee8b-\U0001ee9b\U0001eea1-\U0001eea3\U0001eea5-\U0001eea9\U0001eeab-\U0001eebb\U00020000-\U0002a6d6\U0002a700-\U0002b734\U0002b740-\U0002b81d\U0002b820-\U0002cea1\U0002ceb0-\U0002ebe0\U0002f800-\U0002fa1d' + +cats = ['Cc', 'Cf', 'Cn', 'Co', 'Cs', 'Ll', 'Lm', 'Lo', 'Lt', 'Lu', 'Mc', 'Me', 'Mn', 'Nd', 'Nl', 'No', 'Pc', 'Pd', 'Pe', 'Pf', 'Pi', 'Po', 'Ps', 'Sc', 'Sk', 'Sm', 'So', 'Zl', 'Zp', 'Zs'] + +# Generated from unidata 11.0.0 + +def combine(*args): + return ''.join(globals()[cat] for cat in args) + + +def allexcept(*args): + newcats = cats[:] + for arg in args: + newcats.remove(arg) + return ''.join(globals()[cat] for cat in newcats) + + +def _handle_runs(char_list): # pragma: no cover + buf = [] + for c in char_list: + if len(c) == 1: + if buf and buf[-1][1] == chr(ord(c)-1): + buf[-1] = (buf[-1][0], c) + else: + buf.append((c, c)) + else: + buf.append((c, c)) + for a, b in buf: + if a == b: + yield a + else: + yield '%s-%s' % (a, b) + + +if __name__ == '__main__': # pragma: no cover + import unicodedata + + categories = {'xid_start': [], 'xid_continue': []} + + with open(__file__) as fp: + content = fp.read() + + header = content[:content.find('Cc =')] + footer = content[content.find("def combine("):] + + for code in range(0x110000): + c = chr(code) + cat = unicodedata.category(c) + if ord(c) == 0xdc00: + # Hack to avoid combining this combining with the preceeding high + # surrogate, 0xdbff, when doing a repr. + c = '\\' + c + elif ord(c) in (0x2d, 0x5b, 0x5c, 0x5d, 0x5e): + # Escape regex metachars. + c = '\\' + c + categories.setdefault(cat, []).append(c) + # XID_START and XID_CONTINUE are special categories used for matching + # identifiers in Python 3. + if c.isidentifier(): + categories['xid_start'].append(c) + if ('a' + c).isidentifier(): + categories['xid_continue'].append(c) + + with open(__file__, 'w') as fp: + fp.write(header) + + for cat in sorted(categories): + val = ''.join(_handle_runs(categories[cat])) + fp.write('%s = %a\n\n' % (cat, val)) + + cats = sorted(categories) + cats.remove('xid_start') + cats.remove('xid_continue') + fp.write('cats = %r\n\n' % cats) + + fp.write('# Generated from unidata %s\n\n' % (unicodedata.unidata_version,)) + + fp.write(footer) diff --git a/src/pip/_vendor/pygments/util.py b/src/pip/_vendor/pygments/util.py new file mode 100644 index 000000000..5d6ddc3f5 --- /dev/null +++ b/src/pip/_vendor/pygments/util.py @@ -0,0 +1,308 @@ +""" + pygments.util + ~~~~~~~~~~~~~ + + Utility functions. + + :copyright: Copyright 2006-2021 by the Pygments team, see AUTHORS. + :license: BSD, see LICENSE for details. +""" + +import re +from io import TextIOWrapper + + +split_path_re = re.compile(r'[/\\ ]') +doctype_lookup_re = re.compile(r''' + <!DOCTYPE\s+( + [a-zA-Z_][a-zA-Z0-9]* + (?: \s+ # optional in HTML5 + [a-zA-Z_][a-zA-Z0-9]*\s+ + "[^"]*")? + ) + [^>]*> +''', re.DOTALL | re.MULTILINE | re.VERBOSE) +tag_re = re.compile(r'<(.+?)(\s.*?)?>.*?</.+?>', + re.UNICODE | re.IGNORECASE | re.DOTALL | re.MULTILINE) +xml_decl_re = re.compile(r'\s*<\?xml[^>]*\?>', re.I) + + +class ClassNotFound(ValueError): + """Raised if one of the lookup functions didn't find a matching class.""" + + +class OptionError(Exception): + pass + + +def get_choice_opt(options, optname, allowed, default=None, normcase=False): + string = options.get(optname, default) + if normcase: + string = string.lower() + if string not in allowed: + raise OptionError('Value for option %s must be one of %s' % + (optname, ', '.join(map(str, allowed)))) + return string + + +def get_bool_opt(options, optname, default=None): + string = options.get(optname, default) + if isinstance(string, bool): + return string + elif isinstance(string, int): + return bool(string) + elif not isinstance(string, str): + raise OptionError('Invalid type %r for option %s; use ' + '1/0, yes/no, true/false, on/off' % ( + string, optname)) + elif string.lower() in ('1', 'yes', 'true', 'on'): + return True + elif string.lower() in ('0', 'no', 'false', 'off'): + return False + else: + raise OptionError('Invalid value %r for option %s; use ' + '1/0, yes/no, true/false, on/off' % ( + string, optname)) + + +def get_int_opt(options, optname, default=None): + string = options.get(optname, default) + try: + return int(string) + except TypeError: + raise OptionError('Invalid type %r for option %s; you ' + 'must give an integer value' % ( + string, optname)) + except ValueError: + raise OptionError('Invalid value %r for option %s; you ' + 'must give an integer value' % ( + string, optname)) + + +def get_list_opt(options, optname, default=None): + val = options.get(optname, default) + if isinstance(val, str): + return val.split() + elif isinstance(val, (list, tuple)): + return list(val) + else: + raise OptionError('Invalid type %r for option %s; you ' + 'must give a list value' % ( + val, optname)) + + +def docstring_headline(obj): + if not obj.__doc__: + return '' + res = [] + for line in obj.__doc__.strip().splitlines(): + if line.strip(): + res.append(" " + line.strip()) + else: + break + return ''.join(res).lstrip() + + +def make_analysator(f): + """Return a static text analyser function that returns float values.""" + def text_analyse(text): + try: + rv = f(text) + except Exception: + return 0.0 + if not rv: + return 0.0 + try: + return min(1.0, max(0.0, float(rv))) + except (ValueError, TypeError): + return 0.0 + text_analyse.__doc__ = f.__doc__ + return staticmethod(text_analyse) + + +def shebang_matches(text, regex): + r"""Check if the given regular expression matches the last part of the + shebang if one exists. + + >>> from pygments.util import shebang_matches + >>> shebang_matches('#!/usr/bin/env python', r'python(2\.\d)?') + True + >>> shebang_matches('#!/usr/bin/python2.4', r'python(2\.\d)?') + True + >>> shebang_matches('#!/usr/bin/python-ruby', r'python(2\.\d)?') + False + >>> shebang_matches('#!/usr/bin/python/ruby', r'python(2\.\d)?') + False + >>> shebang_matches('#!/usr/bin/startsomethingwith python', + ... r'python(2\.\d)?') + True + + It also checks for common windows executable file extensions:: + + >>> shebang_matches('#!C:\\Python2.4\\Python.exe', r'python(2\.\d)?') + True + + Parameters (``'-f'`` or ``'--foo'`` are ignored so ``'perl'`` does + the same as ``'perl -e'``) + + Note that this method automatically searches the whole string (eg: + the regular expression is wrapped in ``'^$'``) + """ + index = text.find('\n') + if index >= 0: + first_line = text[:index].lower() + else: + first_line = text.lower() + if first_line.startswith('#!'): + try: + found = [x for x in split_path_re.split(first_line[2:].strip()) + if x and not x.startswith('-')][-1] + except IndexError: + return False + regex = re.compile(r'^%s(\.(exe|cmd|bat|bin))?$' % regex, re.IGNORECASE) + if regex.search(found) is not None: + return True + return False + + +def doctype_matches(text, regex): + """Check if the doctype matches a regular expression (if present). + + Note that this method only checks the first part of a DOCTYPE. + eg: 'html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN"' + """ + m = doctype_lookup_re.search(text) + if m is None: + return False + doctype = m.group(1) + return re.compile(regex, re.I).match(doctype.strip()) is not None + + +def html_doctype_matches(text): + """Check if the file looks like it has a html doctype.""" + return doctype_matches(text, r'html') + + +_looks_like_xml_cache = {} + + +def looks_like_xml(text): + """Check if a doctype exists or if we have some tags.""" + if xml_decl_re.match(text): + return True + key = hash(text) + try: + return _looks_like_xml_cache[key] + except KeyError: + m = doctype_lookup_re.search(text) + if m is not None: + return True + rv = tag_re.search(text[:1000]) is not None + _looks_like_xml_cache[key] = rv + return rv + + +def surrogatepair(c): + """Given a unicode character code with length greater than 16 bits, + return the two 16 bit surrogate pair. + """ + # From example D28 of: + # http://www.unicode.org/book/ch03.pdf + return (0xd7c0 + (c >> 10), (0xdc00 + (c & 0x3ff))) + + +def format_lines(var_name, seq, raw=False, indent_level=0): + """Formats a sequence of strings for output.""" + lines = [] + base_indent = ' ' * indent_level * 4 + inner_indent = ' ' * (indent_level + 1) * 4 + lines.append(base_indent + var_name + ' = (') + if raw: + # These should be preformatted reprs of, say, tuples. + for i in seq: + lines.append(inner_indent + i + ',') + else: + for i in seq: + # Force use of single quotes + r = repr(i + '"') + lines.append(inner_indent + r[:-2] + r[-1] + ',') + lines.append(base_indent + ')') + return '\n'.join(lines) + + +def duplicates_removed(it, already_seen=()): + """ + Returns a list with duplicates removed from the iterable `it`. + + Order is preserved. + """ + lst = [] + seen = set() + for i in it: + if i in seen or i in already_seen: + continue + lst.append(i) + seen.add(i) + return lst + + +class Future: + """Generic class to defer some work. + + Handled specially in RegexLexerMeta, to support regex string construction at + first use. + """ + def get(self): + raise NotImplementedError + + +def guess_decode(text): + """Decode *text* with guessed encoding. + + First try UTF-8; this should fail for non-UTF-8 encodings. + Then try the preferred locale encoding. + Fall back to latin-1, which always works. + """ + try: + text = text.decode('utf-8') + return text, 'utf-8' + except UnicodeDecodeError: + try: + import locale + prefencoding = locale.getpreferredencoding() + text = text.decode() + return text, prefencoding + except (UnicodeDecodeError, LookupError): + text = text.decode('latin1') + return text, 'latin1' + + +def guess_decode_from_terminal(text, term): + """Decode *text* coming from terminal *term*. + + First try the terminal encoding, if given. + Then try UTF-8. Then try the preferred locale encoding. + Fall back to latin-1, which always works. + """ + if getattr(term, 'encoding', None): + try: + text = text.decode(term.encoding) + except UnicodeDecodeError: + pass + else: + return text, term.encoding + return guess_decode(text) + + +def terminal_encoding(term): + """Return our best guess of encoding for the given *term*.""" + if getattr(term, 'encoding', None): + return term.encoding + import locale + return locale.getpreferredencoding() + + +class UnclosingTextIOWrapper(TextIOWrapper): + # Don't close underlying buffer on destruction. + def close(self): + self.flush() diff --git a/src/pip/_vendor/rich/LICENSE b/src/pip/_vendor/rich/LICENSE new file mode 100644 index 000000000..441550556 --- /dev/null +++ b/src/pip/_vendor/rich/LICENSE @@ -0,0 +1,19 @@ +Copyright (c) 2020 Will McGugan + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/src/pip/_vendor/rich/__init__.py b/src/pip/_vendor/rich/__init__.py new file mode 100644 index 000000000..50f381576 --- /dev/null +++ b/src/pip/_vendor/rich/__init__.py @@ -0,0 +1,172 @@ +"""Rich text and beautiful formatting in the terminal.""" + +import os +from typing import Callable, IO, TYPE_CHECKING, Any, Optional + +from ._extension import load_ipython_extension + +__all__ = ["get_console", "reconfigure", "print", "inspect"] + +if TYPE_CHECKING: + from .console import Console + +# Global console used by alternative print +_console: Optional["Console"] = None + +_IMPORT_CWD = os.path.abspath(os.getcwd()) + + +def get_console() -> "Console": + """Get a global :class:`~rich.console.Console` instance. This function is used when Rich requires a Console, + and hasn't been explicitly given one. + + Returns: + Console: A console instance. + """ + global _console + if _console is None: + from .console import Console + + _console = Console() + + return _console + + +def reconfigure(*args: Any, **kwargs: Any) -> None: + """Reconfigures the global console by replacing it with another. + + Args: + console (Console): Replacement console instance. + """ + from pip._vendor.rich.console import Console + + new_console = Console(*args, **kwargs) + _console = get_console() + _console.__dict__ = new_console.__dict__ + + +def print( + *objects: Any, + sep: str = " ", + end: str = "\n", + file: Optional[IO[str]] = None, + flush: bool = False, +) -> None: + r"""Print object(s) supplied via positional arguments. + This function has an identical signature to the built-in print. + For more advanced features, see the :class:`~rich.console.Console` class. + + Args: + sep (str, optional): Separator between printed objects. Defaults to " ". + end (str, optional): Character to write at end of output. Defaults to "\\n". + file (IO[str], optional): File to write to, or None for stdout. Defaults to None. + flush (bool, optional): Has no effect as Rich always flushes output. Defaults to False. + + """ + from .console import Console + + write_console = get_console() if file is None else Console(file=file) + return write_console.print(*objects, sep=sep, end=end) + + +def print_json( + json: Optional[str] = None, + *, + data: Any = None, + indent: int = 2, + highlight: bool = True, + skip_keys: bool = False, + ensure_ascii: bool = True, + check_circular: bool = True, + allow_nan: bool = True, + default: Optional[Callable[[Any], Any]] = None, + sort_keys: bool = False, +) -> None: + """Pretty prints JSON. Output will be valid JSON. + + Args: + json (str): A string containing JSON. + data (Any): If json is not supplied, then encode this data. + indent (int, optional): Number of spaces to indent. Defaults to 2. + highlight (bool, optional): Enable highlighting of output: Defaults to True. + skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. + ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. + check_circular (bool, optional): Check for circular references. Defaults to True. + allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. + default (Callable, optional): A callable that converts values that can not be encoded + in to something that can be JSON encoded. Defaults to None. + sort_keys (bool, optional): Sort dictionary keys. Defaults to False. + """ + + get_console().print_json( + json, + data=data, + indent=indent, + highlight=highlight, + skip_keys=skip_keys, + ensure_ascii=ensure_ascii, + check_circular=check_circular, + allow_nan=allow_nan, + default=default, + sort_keys=sort_keys, + ) + + +def inspect( + obj: Any, + *, + console: Optional["Console"] = None, + title: Optional[str] = None, + help: bool = False, + methods: bool = False, + docs: bool = True, + private: bool = False, + dunder: bool = False, + sort: bool = True, + all: bool = False, + value: bool = True, +) -> None: + """Inspect any Python object. + + * inspect(<OBJECT>) to see summarized info. + * inspect(<OBJECT>, methods=True) to see methods. + * inspect(<OBJECT>, help=True) to see full (non-abbreviated) help. + * inspect(<OBJECT>, private=True) to see private attributes (single underscore). + * inspect(<OBJECT>, dunder=True) to see attributes beginning with double underscore. + * inspect(<OBJECT>, all=True) to see all attributes. + + Args: + obj (Any): An object to inspect. + title (str, optional): Title to display over inspect result, or None use type. Defaults to None. + help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. + methods (bool, optional): Enable inspection of callables. Defaults to False. + docs (bool, optional): Also render doc strings. Defaults to True. + private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. + dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. + sort (bool, optional): Sort attributes alphabetically. Defaults to True. + all (bool, optional): Show all attributes. Defaults to False. + value (bool, optional): Pretty print value. Defaults to True. + """ + _console = console or get_console() + from pip._vendor.rich._inspect import Inspect + + # Special case for inspect(inspect) + is_inspect = obj is inspect + + _inspect = Inspect( + obj, + title=title, + help=is_inspect or help, + methods=is_inspect or methods, + docs=is_inspect or docs, + private=private, + dunder=dunder, + sort=sort, + all=all, + value=value, + ) + _console.print(_inspect) + + +if __name__ == "__main__": # pragma: no cover + print("Hello, **World**") diff --git a/src/pip/_vendor/rich/__main__.py b/src/pip/_vendor/rich/__main__.py new file mode 100644 index 000000000..60d03efba --- /dev/null +++ b/src/pip/_vendor/rich/__main__.py @@ -0,0 +1,285 @@ +import colorsys +import io +from time import process_time + +from pip._vendor.rich import box +from pip._vendor.rich.color import Color +from pip._vendor.rich.console import ( + Console, + ConsoleOptions, + Group, + RenderResult, + RenderableType, +) +from pip._vendor.rich.markdown import Markdown +from pip._vendor.rich.measure import Measurement +from pip._vendor.rich.pretty import Pretty +from pip._vendor.rich.segment import Segment +from pip._vendor.rich.style import Style +from pip._vendor.rich.syntax import Syntax +from pip._vendor.rich.table import Table +from pip._vendor.rich.text import Text + + +class ColorBox: + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + for y in range(0, 5): + for x in range(options.max_width): + h = x / options.max_width + l = 0.1 + ((y / 5) * 0.7) + r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) + r2, g2, b2 = colorsys.hls_to_rgb(h, l + 0.7 / 10, 1.0) + bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) + color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) + yield Segment("▄", Style(color=color, bgcolor=bgcolor)) + yield Segment.line() + + def __rich_measure__( + self, console: "Console", options: ConsoleOptions + ) -> Measurement: + return Measurement(1, options.max_width) + + +def make_test_card() -> Table: + """Get a renderable that demonstrates a number of features.""" + table = Table.grid(padding=1, pad_edge=True) + table.title = "Rich features" + table.add_column("Feature", no_wrap=True, justify="center", style="bold red") + table.add_column("Demonstration") + + color_table = Table( + box=None, + expand=False, + show_header=False, + show_edge=False, + pad_edge=False, + ) + color_table.add_row( + # "[bold yellow]256[/] colors or [bold green]16.7 million[/] colors [blue](if supported by your terminal)[/].", + ( + "✓ [bold green]4-bit color[/]\n" + "✓ [bold blue]8-bit color[/]\n" + "✓ [bold magenta]Truecolor (16.7 million)[/]\n" + "✓ [bold yellow]Dumb terminals[/]\n" + "✓ [bold cyan]Automatic color conversion" + ), + ColorBox(), + ) + + table.add_row("Colors", color_table) + + table.add_row( + "Styles", + "All ansi styles: [bold]bold[/], [dim]dim[/], [italic]italic[/italic], [underline]underline[/], [strike]strikethrough[/], [reverse]reverse[/], and even [blink]blink[/].", + ) + + lorem = "Lorem ipsum dolor sit amet, consectetur adipiscing elit. Quisque in metus sed sapien ultricies pretium a at justo. Maecenas luctus velit et auctor maximus." + lorem_table = Table.grid(padding=1, collapse_padding=True) + lorem_table.pad_edge = False + lorem_table.add_row( + Text(lorem, justify="left", style="green"), + Text(lorem, justify="center", style="yellow"), + Text(lorem, justify="right", style="blue"), + Text(lorem, justify="full", style="red"), + ) + table.add_row( + "Text", + Group( + Text.from_markup( + """Word wrap text. Justify [green]left[/], [yellow]center[/], [blue]right[/] or [red]full[/].\n""" + ), + lorem_table, + ), + ) + + def comparison(renderable1: RenderableType, renderable2: RenderableType) -> Table: + table = Table(show_header=False, pad_edge=False, box=None, expand=True) + table.add_column("1", ratio=1) + table.add_column("2", ratio=1) + table.add_row(renderable1, renderable2) + return table + + table.add_row( + "Asian\nlanguage\nsupport", + ":flag_for_china: 该库支持中文,日文和韩文文本!\n:flag_for_japan: ライブラリは中国語、日本語、韓国語のテキストをサポートしています\n:flag_for_south_korea: 이 라이브러리는 중국어, 일본어 및 한국어 텍스트를 지원합니다", + ) + + markup_example = ( + "[bold magenta]Rich[/] supports a simple [i]bbcode[/i]-like [b]markup[/b] for [yellow]color[/], [underline]style[/], and emoji! " + ":+1: :apple: :ant: :bear: :baguette_bread: :bus: " + ) + table.add_row("Markup", markup_example) + + example_table = Table( + show_edge=False, + show_header=True, + expand=False, + row_styles=["none", "dim"], + box=box.SIMPLE, + ) + example_table.add_column("[green]Date", style="green", no_wrap=True) + example_table.add_column("[blue]Title", style="blue") + example_table.add_column( + "[cyan]Production Budget", + style="cyan", + justify="right", + no_wrap=True, + ) + example_table.add_column( + "[magenta]Box Office", + style="magenta", + justify="right", + no_wrap=True, + ) + example_table.add_row( + "Dec 20, 2019", + "Star Wars: The Rise of Skywalker", + "$275,000,000", + "$375,126,118", + ) + example_table.add_row( + "May 25, 2018", + "[b]Solo[/]: A Star Wars Story", + "$275,000,000", + "$393,151,347", + ) + example_table.add_row( + "Dec 15, 2017", + "Star Wars Ep. VIII: The Last Jedi", + "$262,000,000", + "[bold]$1,332,539,889[/bold]", + ) + example_table.add_row( + "May 19, 1999", + "Star Wars Ep. [b]I[/b]: [i]The phantom Menace", + "$115,000,000", + "$1,027,044,677", + ) + + table.add_row("Tables", example_table) + + code = '''\ +def iter_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''' + + pretty_data = { + "foo": [ + 3.1427, + ( + "Paul Atreides", + "Vladimir Harkonnen", + "Thufir Hawat", + ), + ], + "atomic": (False, True, None), + } + table.add_row( + "Syntax\nhighlighting\n&\npretty\nprinting", + comparison( + Syntax(code, "python3", line_numbers=True, indent_guides=True), + Pretty(pretty_data, indent_guides=True), + ), + ) + + markdown_example = """\ +# Markdown + +Supports much of the *markdown* __syntax__! + +- Headers +- Basic formatting: **bold**, *italic*, `code` +- Block quotes +- Lists, and more... + """ + table.add_row( + "Markdown", comparison("[cyan]" + markdown_example, Markdown(markdown_example)) + ) + + table.add_row( + "+more!", + """Progress bars, columns, styled logging handler, tracebacks, etc...""", + ) + return table + + +if __name__ == "__main__": # pragma: no cover + + console = Console( + file=io.StringIO(), + force_terminal=True, + ) + test_card = make_test_card() + + # Print once to warm cache + console.print(test_card) + console.file = io.StringIO() + + start = process_time() + console.print(test_card) + taken = round((process_time() - start) * 1000.0, 1) + + text = console.file.getvalue() + # https://bugs.python.org/issue37871 + for line in text.splitlines(True): + print(line, end="") + + print(f"rendered in {taken}ms") + + from pip._vendor.rich.panel import Panel + + console = Console() + + sponsor_message = Table.grid(padding=1) + sponsor_message.add_column(style="green", justify="right") + sponsor_message.add_column(no_wrap=True) + sponsor_message.add_row( + "Sponsor me", + "[u blue link=https://github.com/sponsors/willmcgugan]https://github.com/sponsors/willmcgugan", + ) + sponsor_message.add_row( + "Buy me a :coffee:", + "[u blue link=https://ko-fi.com/willmcgugan]https://ko-fi.com/willmcgugan", + ) + sponsor_message.add_row( + "Twitter", + "[u blue link=https://twitter.com/willmcgugan]https://twitter.com/willmcgugan", + ) + sponsor_message.add_row( + "Blog", "[u blue link=https://www.willmcgugan.com]https://www.willmcgugan.com" + ) + + intro_message = Text.from_markup( + """\ +It takes a lot of time to develop Rich and to provide support. + +Consider supporting my work via Github Sponsors (ask your company / organization), or buy me a coffee to say thanks. + +- Will McGugan""" + ) + + message = Table.grid(padding=2) + message.add_column() + message.add_column(no_wrap=True) + message.add_row(intro_message, sponsor_message) + + console.print( + Panel.fit( + message, + box=box.ROUNDED, + padding=(1, 2), + title="[b red]Thanks for trying out Rich!", + border_style="bright_blue", + ), + justify="center", + ) diff --git a/src/pip/_vendor/rich/_cell_widths.py b/src/pip/_vendor/rich/_cell_widths.py new file mode 100644 index 000000000..36286df37 --- /dev/null +++ b/src/pip/_vendor/rich/_cell_widths.py @@ -0,0 +1,451 @@ +# Auto generated by make_terminal_widths.py + +CELL_WIDTHS = [ + (0, 0, 0), + (1, 31, -1), + (127, 159, -1), + (768, 879, 0), + (1155, 1161, 0), + (1425, 1469, 0), + (1471, 1471, 0), + (1473, 1474, 0), + (1476, 1477, 0), + (1479, 1479, 0), + (1552, 1562, 0), + (1611, 1631, 0), + (1648, 1648, 0), + (1750, 1756, 0), + (1759, 1764, 0), + (1767, 1768, 0), + (1770, 1773, 0), + (1809, 1809, 0), + (1840, 1866, 0), + (1958, 1968, 0), + (2027, 2035, 0), + (2045, 2045, 0), + (2070, 2073, 0), + (2075, 2083, 0), + (2085, 2087, 0), + (2089, 2093, 0), + (2137, 2139, 0), + (2259, 2273, 0), + (2275, 2306, 0), + (2362, 2362, 0), + (2364, 2364, 0), + (2369, 2376, 0), + (2381, 2381, 0), + (2385, 2391, 0), + (2402, 2403, 0), + (2433, 2433, 0), + (2492, 2492, 0), + (2497, 2500, 0), + (2509, 2509, 0), + (2530, 2531, 0), + (2558, 2558, 0), + (2561, 2562, 0), + (2620, 2620, 0), + (2625, 2626, 0), + (2631, 2632, 0), + (2635, 2637, 0), + (2641, 2641, 0), + (2672, 2673, 0), + (2677, 2677, 0), + (2689, 2690, 0), + (2748, 2748, 0), + (2753, 2757, 0), + (2759, 2760, 0), + (2765, 2765, 0), + (2786, 2787, 0), + (2810, 2815, 0), + (2817, 2817, 0), + (2876, 2876, 0), + (2879, 2879, 0), + (2881, 2884, 0), + (2893, 2893, 0), + (2901, 2902, 0), + (2914, 2915, 0), + (2946, 2946, 0), + (3008, 3008, 0), + (3021, 3021, 0), + (3072, 3072, 0), + (3076, 3076, 0), + (3134, 3136, 0), + (3142, 3144, 0), + (3146, 3149, 0), + (3157, 3158, 0), + (3170, 3171, 0), + (3201, 3201, 0), + (3260, 3260, 0), + (3263, 3263, 0), + (3270, 3270, 0), + (3276, 3277, 0), + (3298, 3299, 0), + (3328, 3329, 0), + (3387, 3388, 0), + (3393, 3396, 0), + (3405, 3405, 0), + (3426, 3427, 0), + (3457, 3457, 0), + (3530, 3530, 0), + (3538, 3540, 0), + (3542, 3542, 0), + (3633, 3633, 0), + (3636, 3642, 0), + (3655, 3662, 0), + (3761, 3761, 0), + (3764, 3772, 0), + (3784, 3789, 0), + (3864, 3865, 0), + (3893, 3893, 0), + (3895, 3895, 0), + (3897, 3897, 0), + (3953, 3966, 0), + (3968, 3972, 0), + (3974, 3975, 0), + (3981, 3991, 0), + (3993, 4028, 0), + (4038, 4038, 0), + (4141, 4144, 0), + (4146, 4151, 0), + (4153, 4154, 0), + (4157, 4158, 0), + (4184, 4185, 0), + (4190, 4192, 0), + (4209, 4212, 0), + (4226, 4226, 0), + (4229, 4230, 0), + (4237, 4237, 0), + (4253, 4253, 0), + (4352, 4447, 2), + (4957, 4959, 0), + (5906, 5908, 0), + (5938, 5940, 0), + (5970, 5971, 0), + (6002, 6003, 0), + (6068, 6069, 0), + (6071, 6077, 0), + (6086, 6086, 0), + (6089, 6099, 0), + (6109, 6109, 0), + (6155, 6157, 0), + (6277, 6278, 0), + (6313, 6313, 0), + (6432, 6434, 0), + (6439, 6440, 0), + (6450, 6450, 0), + (6457, 6459, 0), + (6679, 6680, 0), + (6683, 6683, 0), + (6742, 6742, 0), + (6744, 6750, 0), + (6752, 6752, 0), + (6754, 6754, 0), + (6757, 6764, 0), + (6771, 6780, 0), + (6783, 6783, 0), + (6832, 6848, 0), + (6912, 6915, 0), + (6964, 6964, 0), + (6966, 6970, 0), + (6972, 6972, 0), + (6978, 6978, 0), + (7019, 7027, 0), + (7040, 7041, 0), + (7074, 7077, 0), + (7080, 7081, 0), + (7083, 7085, 0), + (7142, 7142, 0), + (7144, 7145, 0), + (7149, 7149, 0), + (7151, 7153, 0), + (7212, 7219, 0), + (7222, 7223, 0), + (7376, 7378, 0), + (7380, 7392, 0), + (7394, 7400, 0), + (7405, 7405, 0), + (7412, 7412, 0), + (7416, 7417, 0), + (7616, 7673, 0), + (7675, 7679, 0), + (8203, 8207, 0), + (8232, 8238, 0), + (8288, 8291, 0), + (8400, 8432, 0), + (8986, 8987, 2), + (9001, 9002, 2), + (9193, 9196, 2), + (9200, 9200, 2), + (9203, 9203, 2), + (9725, 9726, 2), + (9748, 9749, 2), + (9800, 9811, 2), + (9855, 9855, 2), + (9875, 9875, 2), + (9889, 9889, 2), + (9898, 9899, 2), + (9917, 9918, 2), + (9924, 9925, 2), + (9934, 9934, 2), + (9940, 9940, 2), + (9962, 9962, 2), + (9970, 9971, 2), + (9973, 9973, 2), + (9978, 9978, 2), + (9981, 9981, 2), + (9989, 9989, 2), + (9994, 9995, 2), + (10024, 10024, 2), + (10060, 10060, 2), + (10062, 10062, 2), + (10067, 10069, 2), + (10071, 10071, 2), + (10133, 10135, 2), + (10160, 10160, 2), + (10175, 10175, 2), + (11035, 11036, 2), + (11088, 11088, 2), + (11093, 11093, 2), + (11503, 11505, 0), + (11647, 11647, 0), + (11744, 11775, 0), + (11904, 11929, 2), + (11931, 12019, 2), + (12032, 12245, 2), + (12272, 12283, 2), + (12288, 12329, 2), + (12330, 12333, 0), + (12334, 12350, 2), + (12353, 12438, 2), + (12441, 12442, 0), + (12443, 12543, 2), + (12549, 12591, 2), + (12593, 12686, 2), + (12688, 12771, 2), + (12784, 12830, 2), + (12832, 12871, 2), + (12880, 19903, 2), + (19968, 42124, 2), + (42128, 42182, 2), + (42607, 42610, 0), + (42612, 42621, 0), + (42654, 42655, 0), + (42736, 42737, 0), + (43010, 43010, 0), + (43014, 43014, 0), + (43019, 43019, 0), + (43045, 43046, 0), + (43052, 43052, 0), + (43204, 43205, 0), + (43232, 43249, 0), + (43263, 43263, 0), + (43302, 43309, 0), + (43335, 43345, 0), + (43360, 43388, 2), + (43392, 43394, 0), + (43443, 43443, 0), + (43446, 43449, 0), + (43452, 43453, 0), + (43493, 43493, 0), + (43561, 43566, 0), + (43569, 43570, 0), + (43573, 43574, 0), + (43587, 43587, 0), + (43596, 43596, 0), + (43644, 43644, 0), + (43696, 43696, 0), + (43698, 43700, 0), + (43703, 43704, 0), + (43710, 43711, 0), + (43713, 43713, 0), + (43756, 43757, 0), + (43766, 43766, 0), + (44005, 44005, 0), + (44008, 44008, 0), + (44013, 44013, 0), + (44032, 55203, 2), + (63744, 64255, 2), + (64286, 64286, 0), + (65024, 65039, 0), + (65040, 65049, 2), + (65056, 65071, 0), + (65072, 65106, 2), + (65108, 65126, 2), + (65128, 65131, 2), + (65281, 65376, 2), + (65504, 65510, 2), + (66045, 66045, 0), + (66272, 66272, 0), + (66422, 66426, 0), + (68097, 68099, 0), + (68101, 68102, 0), + (68108, 68111, 0), + (68152, 68154, 0), + (68159, 68159, 0), + (68325, 68326, 0), + (68900, 68903, 0), + (69291, 69292, 0), + (69446, 69456, 0), + (69633, 69633, 0), + (69688, 69702, 0), + (69759, 69761, 0), + (69811, 69814, 0), + (69817, 69818, 0), + (69888, 69890, 0), + (69927, 69931, 0), + (69933, 69940, 0), + (70003, 70003, 0), + (70016, 70017, 0), + (70070, 70078, 0), + (70089, 70092, 0), + (70095, 70095, 0), + (70191, 70193, 0), + (70196, 70196, 0), + (70198, 70199, 0), + (70206, 70206, 0), + (70367, 70367, 0), + (70371, 70378, 0), + (70400, 70401, 0), + (70459, 70460, 0), + (70464, 70464, 0), + (70502, 70508, 0), + (70512, 70516, 0), + (70712, 70719, 0), + (70722, 70724, 0), + (70726, 70726, 0), + (70750, 70750, 0), + (70835, 70840, 0), + (70842, 70842, 0), + (70847, 70848, 0), + (70850, 70851, 0), + (71090, 71093, 0), + (71100, 71101, 0), + (71103, 71104, 0), + (71132, 71133, 0), + (71219, 71226, 0), + (71229, 71229, 0), + (71231, 71232, 0), + (71339, 71339, 0), + (71341, 71341, 0), + (71344, 71349, 0), + (71351, 71351, 0), + (71453, 71455, 0), + (71458, 71461, 0), + (71463, 71467, 0), + (71727, 71735, 0), + (71737, 71738, 0), + (71995, 71996, 0), + (71998, 71998, 0), + (72003, 72003, 0), + (72148, 72151, 0), + (72154, 72155, 0), + (72160, 72160, 0), + (72193, 72202, 0), + (72243, 72248, 0), + (72251, 72254, 0), + (72263, 72263, 0), + (72273, 72278, 0), + (72281, 72283, 0), + (72330, 72342, 0), + (72344, 72345, 0), + (72752, 72758, 0), + (72760, 72765, 0), + (72767, 72767, 0), + (72850, 72871, 0), + (72874, 72880, 0), + (72882, 72883, 0), + (72885, 72886, 0), + (73009, 73014, 0), + (73018, 73018, 0), + (73020, 73021, 0), + (73023, 73029, 0), + (73031, 73031, 0), + (73104, 73105, 0), + (73109, 73109, 0), + (73111, 73111, 0), + (73459, 73460, 0), + (92912, 92916, 0), + (92976, 92982, 0), + (94031, 94031, 0), + (94095, 94098, 0), + (94176, 94179, 2), + (94180, 94180, 0), + (94192, 94193, 2), + (94208, 100343, 2), + (100352, 101589, 2), + (101632, 101640, 2), + (110592, 110878, 2), + (110928, 110930, 2), + (110948, 110951, 2), + (110960, 111355, 2), + (113821, 113822, 0), + (119143, 119145, 0), + (119163, 119170, 0), + (119173, 119179, 0), + (119210, 119213, 0), + (119362, 119364, 0), + (121344, 121398, 0), + (121403, 121452, 0), + (121461, 121461, 0), + (121476, 121476, 0), + (121499, 121503, 0), + (121505, 121519, 0), + (122880, 122886, 0), + (122888, 122904, 0), + (122907, 122913, 0), + (122915, 122916, 0), + (122918, 122922, 0), + (123184, 123190, 0), + (123628, 123631, 0), + (125136, 125142, 0), + (125252, 125258, 0), + (126980, 126980, 2), + (127183, 127183, 2), + (127374, 127374, 2), + (127377, 127386, 2), + (127488, 127490, 2), + (127504, 127547, 2), + (127552, 127560, 2), + (127568, 127569, 2), + (127584, 127589, 2), + (127744, 127776, 2), + (127789, 127797, 2), + (127799, 127868, 2), + (127870, 127891, 2), + (127904, 127946, 2), + (127951, 127955, 2), + (127968, 127984, 2), + (127988, 127988, 2), + (127992, 128062, 2), + (128064, 128064, 2), + (128066, 128252, 2), + (128255, 128317, 2), + (128331, 128334, 2), + (128336, 128359, 2), + (128378, 128378, 2), + (128405, 128406, 2), + (128420, 128420, 2), + (128507, 128591, 2), + (128640, 128709, 2), + (128716, 128716, 2), + (128720, 128722, 2), + (128725, 128727, 2), + (128747, 128748, 2), + (128756, 128764, 2), + (128992, 129003, 2), + (129292, 129338, 2), + (129340, 129349, 2), + (129351, 129400, 2), + (129402, 129483, 2), + (129485, 129535, 2), + (129648, 129652, 2), + (129656, 129658, 2), + (129664, 129670, 2), + (129680, 129704, 2), + (129712, 129718, 2), + (129728, 129730, 2), + (129744, 129750, 2), + (131072, 196605, 2), + (196608, 262141, 2), + (917760, 917999, 0), +] diff --git a/src/pip/_vendor/rich/_emoji_codes.py b/src/pip/_vendor/rich/_emoji_codes.py new file mode 100644 index 000000000..1f2877bb2 --- /dev/null +++ b/src/pip/_vendor/rich/_emoji_codes.py @@ -0,0 +1,3610 @@ +EMOJI = { + "1st_place_medal": "🥇", + "2nd_place_medal": "🥈", + "3rd_place_medal": "🥉", + "ab_button_(blood_type)": "🆎", + "atm_sign": "🏧", + "a_button_(blood_type)": "🅰", + "afghanistan": "🇦🇫", + "albania": "🇦🇱", + "algeria": "🇩🇿", + "american_samoa": "🇦🇸", + "andorra": "🇦🇩", + "angola": "🇦🇴", + "anguilla": "🇦🇮", + "antarctica": "🇦🇶", + "antigua_&_barbuda": "🇦🇬", + "aquarius": "♒", + "argentina": "🇦🇷", + "aries": "♈", + "armenia": "🇦🇲", + "aruba": "🇦🇼", + "ascension_island": "🇦🇨", + "australia": "🇦🇺", + "austria": "🇦🇹", + "azerbaijan": "🇦🇿", + "back_arrow": "🔙", + "b_button_(blood_type)": "🅱", + "bahamas": "🇧🇸", + "bahrain": "🇧🇭", + "bangladesh": "🇧🇩", + "barbados": "🇧🇧", + "belarus": "🇧🇾", + "belgium": "🇧🇪", + "belize": "🇧🇿", + "benin": "🇧🇯", + "bermuda": "🇧🇲", + "bhutan": "🇧🇹", + "bolivia": "🇧🇴", + "bosnia_&_herzegovina": "🇧🇦", + "botswana": "🇧🇼", + "bouvet_island": "🇧🇻", + "brazil": "🇧🇷", + "british_indian_ocean_territory": "🇮🇴", + "british_virgin_islands": "🇻🇬", + "brunei": "🇧🇳", + "bulgaria": "🇧🇬", + "burkina_faso": "🇧🇫", + "burundi": "🇧🇮", + "cl_button": "🆑", + "cool_button": "🆒", + "cambodia": "🇰🇭", + "cameroon": "🇨🇲", + "canada": "🇨🇦", + "canary_islands": "🇮🇨", + "cancer": "♋", + "cape_verde": "🇨🇻", + "capricorn": "♑", + "caribbean_netherlands": "🇧🇶", + "cayman_islands": "🇰🇾", + "central_african_republic": "🇨🇫", + "ceuta_&_melilla": "🇪🇦", + "chad": "🇹🇩", + "chile": "🇨🇱", + "china": "🇨🇳", + "christmas_island": "🇨🇽", + "christmas_tree": "🎄", + "clipperton_island": "🇨🇵", + "cocos_(keeling)_islands": "🇨🇨", + "colombia": "🇨🇴", + "comoros": "🇰🇲", + "congo_-_brazzaville": "🇨🇬", + "congo_-_kinshasa": "🇨🇩", + "cook_islands": "🇨🇰", + "costa_rica": "🇨🇷", + "croatia": "🇭🇷", + "cuba": "🇨🇺", + "curaçao": "🇨🇼", + "cyprus": "🇨🇾", + "czechia": "🇨🇿", + "côte_d’ivoire": "🇨🇮", + "denmark": "🇩🇰", + "diego_garcia": "🇩🇬", + "djibouti": "🇩🇯", + "dominica": "🇩🇲", + "dominican_republic": "🇩🇴", + "end_arrow": "🔚", + "ecuador": "🇪🇨", + "egypt": "🇪🇬", + "el_salvador": "🇸🇻", + "england": "🏴\U000e0067\U000e0062\U000e0065\U000e006e\U000e0067\U000e007f", + "equatorial_guinea": "🇬🇶", + "eritrea": "🇪🇷", + "estonia": "🇪🇪", + "ethiopia": "🇪🇹", + "european_union": "🇪🇺", + "free_button": "🆓", + "falkland_islands": "🇫🇰", + "faroe_islands": "🇫🇴", + "fiji": "🇫🇯", + "finland": "🇫🇮", + "france": "🇫🇷", + "french_guiana": "🇬🇫", + "french_polynesia": "🇵🇫", + "french_southern_territories": "🇹🇫", + "gabon": "🇬🇦", + "gambia": "🇬🇲", + "gemini": "♊", + "georgia": "🇬🇪", + "germany": "🇩🇪", + "ghana": "🇬🇭", + "gibraltar": "🇬🇮", + "greece": "🇬🇷", + "greenland": "🇬🇱", + "grenada": "🇬🇩", + "guadeloupe": "🇬🇵", + "guam": "🇬🇺", + "guatemala": "🇬🇹", + "guernsey": "🇬🇬", + "guinea": "🇬🇳", + "guinea-bissau": "🇬🇼", + "guyana": "🇬🇾", + "haiti": "🇭🇹", + "heard_&_mcdonald_islands": "🇭🇲", + "honduras": "🇭🇳", + "hong_kong_sar_china": "🇭🇰", + "hungary": "🇭🇺", + "id_button": "🆔", + "iceland": "🇮🇸", + "india": "🇮🇳", + "indonesia": "🇮🇩", + "iran": "🇮🇷", + "iraq": "🇮🇶", + "ireland": "🇮🇪", + "isle_of_man": "🇮🇲", + "israel": "🇮🇱", + "italy": "🇮🇹", + "jamaica": "🇯🇲", + "japan": "🗾", + "japanese_acceptable_button": "🉑", + "japanese_application_button": "🈸", + "japanese_bargain_button": "🉐", + "japanese_castle": "🏯", + "japanese_congratulations_button": "㊗", + "japanese_discount_button": "🈹", + "japanese_dolls": "🎎", + "japanese_free_of_charge_button": "🈚", + "japanese_here_button": "🈁", + "japanese_monthly_amount_button": "🈷", + "japanese_no_vacancy_button": "🈵", + "japanese_not_free_of_charge_button": "🈶", + "japanese_open_for_business_button": "🈺", + "japanese_passing_grade_button": "🈴", + "japanese_post_office": "🏣", + "japanese_prohibited_button": "🈲", + "japanese_reserved_button": "🈯", + "japanese_secret_button": "㊙", + "japanese_service_charge_button": "🈂", + "japanese_symbol_for_beginner": "🔰", + "japanese_vacancy_button": "🈳", + "jersey": "🇯🇪", + "jordan": "🇯🇴", + "kazakhstan": "🇰🇿", + "kenya": "🇰🇪", + "kiribati": "🇰🇮", + "kosovo": "🇽🇰", + "kuwait": "🇰🇼", + "kyrgyzstan": "🇰🇬", + "laos": "🇱🇦", + "latvia": "🇱🇻", + "lebanon": "🇱🇧", + "leo": "♌", + "lesotho": "🇱🇸", + "liberia": "🇱🇷", + "libra": "♎", + "libya": "🇱🇾", + "liechtenstein": "🇱🇮", + "lithuania": "🇱🇹", + "luxembourg": "🇱🇺", + "macau_sar_china": "🇲🇴", + "macedonia": "🇲🇰", + "madagascar": "🇲🇬", + "malawi": "🇲🇼", + "malaysia": "🇲🇾", + "maldives": "🇲🇻", + "mali": "🇲🇱", + "malta": "🇲🇹", + "marshall_islands": "🇲🇭", + "martinique": "🇲🇶", + "mauritania": "🇲🇷", + "mauritius": "🇲🇺", + "mayotte": "🇾🇹", + "mexico": "🇲🇽", + "micronesia": "🇫🇲", + "moldova": "🇲🇩", + "monaco": "🇲🇨", + "mongolia": "🇲🇳", + "montenegro": "🇲🇪", + "montserrat": "🇲🇸", + "morocco": "🇲🇦", + "mozambique": "🇲🇿", + "mrs._claus": "🤶", + "mrs._claus_dark_skin_tone": "🤶🏿", + "mrs._claus_light_skin_tone": "🤶🏻", + "mrs._claus_medium-dark_skin_tone": "🤶🏾", + "mrs._claus_medium-light_skin_tone": "🤶🏼", + "mrs._claus_medium_skin_tone": "🤶🏽", + "myanmar_(burma)": "🇲🇲", + "new_button": "🆕", + "ng_button": "🆖", + "namibia": "🇳🇦", + "nauru": "🇳🇷", + "nepal": "🇳🇵", + "netherlands": "🇳🇱", + "new_caledonia": "🇳🇨", + "new_zealand": "🇳🇿", + "nicaragua": "🇳🇮", + "niger": "🇳🇪", + "nigeria": "🇳🇬", + "niue": "🇳🇺", + "norfolk_island": "🇳🇫", + "north_korea": "🇰🇵", + "northern_mariana_islands": "🇲🇵", + "norway": "🇳🇴", + "ok_button": "🆗", + "ok_hand": "👌", + "ok_hand_dark_skin_tone": "👌🏿", + "ok_hand_light_skin_tone": "👌🏻", + "ok_hand_medium-dark_skin_tone": "👌🏾", + "ok_hand_medium-light_skin_tone": "👌🏼", + "ok_hand_medium_skin_tone": "👌🏽", + "on!_arrow": "🔛", + "o_button_(blood_type)": "🅾", + "oman": "🇴🇲", + "ophiuchus": "⛎", + "p_button": "🅿", + "pakistan": "🇵🇰", + "palau": "🇵🇼", + "palestinian_territories": "🇵🇸", + "panama": "🇵🇦", + "papua_new_guinea": "🇵🇬", + "paraguay": "🇵🇾", + "peru": "🇵🇪", + "philippines": "🇵🇭", + "pisces": "♓", + "pitcairn_islands": "🇵🇳", + "poland": "🇵🇱", + "portugal": "🇵🇹", + "puerto_rico": "🇵🇷", + "qatar": "🇶🇦", + "romania": "🇷🇴", + "russia": "🇷🇺", + "rwanda": "🇷🇼", + "réunion": "🇷🇪", + "soon_arrow": "🔜", + "sos_button": "🆘", + "sagittarius": "♐", + "samoa": "🇼🇸", + "san_marino": "🇸🇲", + "santa_claus": "🎅", + "santa_claus_dark_skin_tone": "🎅🏿", + "santa_claus_light_skin_tone": "🎅🏻", + "santa_claus_medium-dark_skin_tone": "🎅🏾", + "santa_claus_medium-light_skin_tone": "🎅🏼", + "santa_claus_medium_skin_tone": "🎅🏽", + "saudi_arabia": "🇸🇦", + "scorpio": "♏", + "scotland": "🏴\U000e0067\U000e0062\U000e0073\U000e0063\U000e0074\U000e007f", + "senegal": "🇸🇳", + "serbia": "🇷🇸", + "seychelles": "🇸🇨", + "sierra_leone": "🇸🇱", + "singapore": "🇸🇬", + "sint_maarten": "🇸🇽", + "slovakia": "🇸🇰", + "slovenia": "🇸🇮", + "solomon_islands": "🇸🇧", + "somalia": "🇸🇴", + "south_africa": "🇿🇦", + "south_georgia_&_south_sandwich_islands": "🇬🇸", + "south_korea": "🇰🇷", + "south_sudan": "🇸🇸", + "spain": "🇪🇸", + "sri_lanka": "🇱🇰", + "st._barthélemy": "🇧🇱", + "st._helena": "🇸🇭", + "st._kitts_&_nevis": "🇰🇳", + "st._lucia": "🇱🇨", + "st._martin": "🇲🇫", + "st._pierre_&_miquelon": "🇵🇲", + "st._vincent_&_grenadines": "🇻🇨", + "statue_of_liberty": "🗽", + "sudan": "🇸🇩", + "suriname": "🇸🇷", + "svalbard_&_jan_mayen": "🇸🇯", + "swaziland": "🇸🇿", + "sweden": "🇸🇪", + "switzerland": "🇨🇭", + "syria": "🇸🇾", + "são_tomé_&_príncipe": "🇸🇹", + "t-rex": "🦖", + "top_arrow": "🔝", + "taiwan": "🇹🇼", + "tajikistan": "🇹🇯", + "tanzania": "🇹🇿", + "taurus": "♉", + "thailand": "🇹🇭", + "timor-leste": "🇹🇱", + "togo": "🇹🇬", + "tokelau": "🇹🇰", + "tokyo_tower": "🗼", + "tonga": "🇹🇴", + "trinidad_&_tobago": "🇹🇹", + "tristan_da_cunha": "🇹🇦", + "tunisia": "🇹🇳", + "turkey": "🦃", + "turkmenistan": "🇹🇲", + "turks_&_caicos_islands": "🇹🇨", + "tuvalu": "🇹🇻", + "u.s._outlying_islands": "🇺🇲", + "u.s._virgin_islands": "🇻🇮", + "up!_button": "🆙", + "uganda": "🇺🇬", + "ukraine": "🇺🇦", + "united_arab_emirates": "🇦🇪", + "united_kingdom": "🇬🇧", + "united_nations": "🇺🇳", + "united_states": "🇺🇸", + "uruguay": "🇺🇾", + "uzbekistan": "🇺🇿", + "vs_button": "🆚", + "vanuatu": "🇻🇺", + "vatican_city": "🇻🇦", + "venezuela": "🇻🇪", + "vietnam": "🇻🇳", + "virgo": "♍", + "wales": "🏴\U000e0067\U000e0062\U000e0077\U000e006c\U000e0073\U000e007f", + "wallis_&_futuna": "🇼🇫", + "western_sahara": "🇪🇭", + "yemen": "🇾🇪", + "zambia": "🇿🇲", + "zimbabwe": "🇿🇼", + "abacus": "🧮", + "adhesive_bandage": "🩹", + "admission_tickets": "🎟", + "adult": "🧑", + "adult_dark_skin_tone": "🧑🏿", + "adult_light_skin_tone": "🧑🏻", + "adult_medium-dark_skin_tone": "🧑🏾", + "adult_medium-light_skin_tone": "🧑🏼", + "adult_medium_skin_tone": "🧑🏽", + "aerial_tramway": "🚡", + "airplane": "✈", + "airplane_arrival": "🛬", + "airplane_departure": "🛫", + "alarm_clock": "⏰", + "alembic": "⚗", + "alien": "👽", + "alien_monster": "👾", + "ambulance": "🚑", + "american_football": "🏈", + "amphora": "🏺", + "anchor": "⚓", + "anger_symbol": "💢", + "angry_face": "😠", + "angry_face_with_horns": "👿", + "anguished_face": "😧", + "ant": "🐜", + "antenna_bars": "📶", + "anxious_face_with_sweat": "😰", + "articulated_lorry": "🚛", + "artist_palette": "🎨", + "astonished_face": "😲", + "atom_symbol": "⚛", + "auto_rickshaw": "🛺", + "automobile": "🚗", + "avocado": "🥑", + "axe": "🪓", + "baby": "👶", + "baby_angel": "👼", + "baby_angel_dark_skin_tone": "👼🏿", + "baby_angel_light_skin_tone": "👼🏻", + "baby_angel_medium-dark_skin_tone": "👼🏾", + "baby_angel_medium-light_skin_tone": "👼🏼", + "baby_angel_medium_skin_tone": "👼🏽", + "baby_bottle": "🍼", + "baby_chick": "🐤", + "baby_dark_skin_tone": "👶🏿", + "baby_light_skin_tone": "👶🏻", + "baby_medium-dark_skin_tone": "👶🏾", + "baby_medium-light_skin_tone": "👶🏼", + "baby_medium_skin_tone": "👶🏽", + "baby_symbol": "🚼", + "backhand_index_pointing_down": "👇", + "backhand_index_pointing_down_dark_skin_tone": "👇🏿", + "backhand_index_pointing_down_light_skin_tone": "👇🏻", + "backhand_index_pointing_down_medium-dark_skin_tone": "👇🏾", + "backhand_index_pointing_down_medium-light_skin_tone": "👇🏼", + "backhand_index_pointing_down_medium_skin_tone": "👇🏽", + "backhand_index_pointing_left": "👈", + "backhand_index_pointing_left_dark_skin_tone": "👈🏿", + "backhand_index_pointing_left_light_skin_tone": "👈🏻", + "backhand_index_pointing_left_medium-dark_skin_tone": "👈🏾", + "backhand_index_pointing_left_medium-light_skin_tone": "👈🏼", + "backhand_index_pointing_left_medium_skin_tone": "👈🏽", + "backhand_index_pointing_right": "👉", + "backhand_index_pointing_right_dark_skin_tone": "👉🏿", + "backhand_index_pointing_right_light_skin_tone": "👉🏻", + "backhand_index_pointing_right_medium-dark_skin_tone": "👉🏾", + "backhand_index_pointing_right_medium-light_skin_tone": "👉🏼", + "backhand_index_pointing_right_medium_skin_tone": "👉🏽", + "backhand_index_pointing_up": "👆", + "backhand_index_pointing_up_dark_skin_tone": "👆🏿", + "backhand_index_pointing_up_light_skin_tone": "👆🏻", + "backhand_index_pointing_up_medium-dark_skin_tone": "👆🏾", + "backhand_index_pointing_up_medium-light_skin_tone": "👆🏼", + "backhand_index_pointing_up_medium_skin_tone": "👆🏽", + "bacon": "🥓", + "badger": "🦡", + "badminton": "🏸", + "bagel": "🥯", + "baggage_claim": "🛄", + "baguette_bread": "🥖", + "balance_scale": "⚖", + "bald": "🦲", + "bald_man": "👨\u200d🦲", + "bald_woman": "👩\u200d🦲", + "ballet_shoes": "🩰", + "balloon": "🎈", + "ballot_box_with_ballot": "🗳", + "ballot_box_with_check": "☑", + "banana": "🍌", + "banjo": "🪕", + "bank": "🏦", + "bar_chart": "📊", + "barber_pole": "💈", + "baseball": "⚾", + "basket": "🧺", + "basketball": "🏀", + "bat": "🦇", + "bathtub": "🛁", + "battery": "🔋", + "beach_with_umbrella": "🏖", + "beaming_face_with_smiling_eyes": "😁", + "bear_face": "🐻", + "bearded_person": "🧔", + "bearded_person_dark_skin_tone": "🧔🏿", + "bearded_person_light_skin_tone": "🧔🏻", + "bearded_person_medium-dark_skin_tone": "🧔🏾", + "bearded_person_medium-light_skin_tone": "🧔🏼", + "bearded_person_medium_skin_tone": "🧔🏽", + "beating_heart": "💓", + "bed": "🛏", + "beer_mug": "🍺", + "bell": "🔔", + "bell_with_slash": "🔕", + "bellhop_bell": "🛎", + "bento_box": "🍱", + "beverage_box": "🧃", + "bicycle": "🚲", + "bikini": "👙", + "billed_cap": "🧢", + "biohazard": "☣", + "bird": "🐦", + "birthday_cake": "🎂", + "black_circle": "⚫", + "black_flag": "🏴", + "black_heart": "🖤", + "black_large_square": "⬛", + "black_medium-small_square": "◾", + "black_medium_square": "◼", + "black_nib": "✒", + "black_small_square": "▪", + "black_square_button": "🔲", + "blond-haired_man": "👱\u200d♂️", + "blond-haired_man_dark_skin_tone": "👱🏿\u200d♂️", + "blond-haired_man_light_skin_tone": "👱🏻\u200d♂️", + "blond-haired_man_medium-dark_skin_tone": "👱🏾\u200d♂️", + "blond-haired_man_medium-light_skin_tone": "👱🏼\u200d♂️", + "blond-haired_man_medium_skin_tone": "👱🏽\u200d♂️", + "blond-haired_person": "👱", + "blond-haired_person_dark_skin_tone": "👱🏿", + "blond-haired_person_light_skin_tone": "👱🏻", + "blond-haired_person_medium-dark_skin_tone": "👱🏾", + "blond-haired_person_medium-light_skin_tone": "👱🏼", + "blond-haired_person_medium_skin_tone": "👱🏽", + "blond-haired_woman": "👱\u200d♀️", + "blond-haired_woman_dark_skin_tone": "👱🏿\u200d♀️", + "blond-haired_woman_light_skin_tone": "👱🏻\u200d♀️", + "blond-haired_woman_medium-dark_skin_tone": "👱🏾\u200d♀️", + "blond-haired_woman_medium-light_skin_tone": "👱🏼\u200d♀️", + "blond-haired_woman_medium_skin_tone": "👱🏽\u200d♀️", + "blossom": "🌼", + "blowfish": "🐡", + "blue_book": "📘", + "blue_circle": "🔵", + "blue_heart": "💙", + "blue_square": "🟦", + "boar": "🐗", + "bomb": "💣", + "bone": "🦴", + "bookmark": "🔖", + "bookmark_tabs": "📑", + "books": "📚", + "bottle_with_popping_cork": "🍾", + "bouquet": "💐", + "bow_and_arrow": "🏹", + "bowl_with_spoon": "🥣", + "bowling": "🎳", + "boxing_glove": "🥊", + "boy": "👦", + "boy_dark_skin_tone": "👦🏿", + "boy_light_skin_tone": "👦🏻", + "boy_medium-dark_skin_tone": "👦🏾", + "boy_medium-light_skin_tone": "👦🏼", + "boy_medium_skin_tone": "👦🏽", + "brain": "🧠", + "bread": "🍞", + "breast-feeding": "🤱", + "breast-feeding_dark_skin_tone": "🤱🏿", + "breast-feeding_light_skin_tone": "🤱🏻", + "breast-feeding_medium-dark_skin_tone": "🤱🏾", + "breast-feeding_medium-light_skin_tone": "🤱🏼", + "breast-feeding_medium_skin_tone": "🤱🏽", + "brick": "🧱", + "bride_with_veil": "👰", + "bride_with_veil_dark_skin_tone": "👰🏿", + "bride_with_veil_light_skin_tone": "👰🏻", + "bride_with_veil_medium-dark_skin_tone": "👰🏾", + "bride_with_veil_medium-light_skin_tone": "👰🏼", + "bride_with_veil_medium_skin_tone": "👰🏽", + "bridge_at_night": "🌉", + "briefcase": "💼", + "briefs": "🩲", + "bright_button": "🔆", + "broccoli": "🥦", + "broken_heart": "💔", + "broom": "🧹", + "brown_circle": "🟤", + "brown_heart": "🤎", + "brown_square": "🟫", + "bug": "🐛", + "building_construction": "🏗", + "bullet_train": "🚅", + "burrito": "🌯", + "bus": "🚌", + "bus_stop": "🚏", + "bust_in_silhouette": "👤", + "busts_in_silhouette": "👥", + "butter": "🧈", + "butterfly": "🦋", + "cactus": "🌵", + "calendar": "📆", + "call_me_hand": "🤙", + "call_me_hand_dark_skin_tone": "🤙🏿", + "call_me_hand_light_skin_tone": "🤙🏻", + "call_me_hand_medium-dark_skin_tone": "🤙🏾", + "call_me_hand_medium-light_skin_tone": "🤙🏼", + "call_me_hand_medium_skin_tone": "🤙🏽", + "camel": "🐫", + "camera": "📷", + "camera_with_flash": "📸", + "camping": "🏕", + "candle": "🕯", + "candy": "🍬", + "canned_food": "🥫", + "canoe": "🛶", + "card_file_box": "🗃", + "card_index": "📇", + "card_index_dividers": "🗂", + "carousel_horse": "🎠", + "carp_streamer": "🎏", + "carrot": "🥕", + "castle": "🏰", + "cat": "🐱", + "cat_face": "🐱", + "cat_face_with_tears_of_joy": "😹", + "cat_face_with_wry_smile": "😼", + "chains": "⛓", + "chair": "🪑", + "chart_decreasing": "📉", + "chart_increasing": "📈", + "chart_increasing_with_yen": "💹", + "cheese_wedge": "🧀", + "chequered_flag": "🏁", + "cherries": "🍒", + "cherry_blossom": "🌸", + "chess_pawn": "♟", + "chestnut": "🌰", + "chicken": "🐔", + "child": "🧒", + "child_dark_skin_tone": "🧒🏿", + "child_light_skin_tone": "🧒🏻", + "child_medium-dark_skin_tone": "🧒🏾", + "child_medium-light_skin_tone": "🧒🏼", + "child_medium_skin_tone": "🧒🏽", + "children_crossing": "🚸", + "chipmunk": "🐿", + "chocolate_bar": "🍫", + "chopsticks": "🥢", + "church": "⛪", + "cigarette": "🚬", + "cinema": "🎦", + "circled_m": "Ⓜ", + "circus_tent": "🎪", + "cityscape": "🏙", + "cityscape_at_dusk": "🌆", + "clamp": "🗜", + "clapper_board": "🎬", + "clapping_hands": "👏", + "clapping_hands_dark_skin_tone": "👏🏿", + "clapping_hands_light_skin_tone": "👏🏻", + "clapping_hands_medium-dark_skin_tone": "👏🏾", + "clapping_hands_medium-light_skin_tone": "👏🏼", + "clapping_hands_medium_skin_tone": "👏🏽", + "classical_building": "🏛", + "clinking_beer_mugs": "🍻", + "clinking_glasses": "🥂", + "clipboard": "📋", + "clockwise_vertical_arrows": "🔃", + "closed_book": "📕", + "closed_mailbox_with_lowered_flag": "📪", + "closed_mailbox_with_raised_flag": "📫", + "closed_umbrella": "🌂", + "cloud": "☁", + "cloud_with_lightning": "🌩", + "cloud_with_lightning_and_rain": "⛈", + "cloud_with_rain": "🌧", + "cloud_with_snow": "🌨", + "clown_face": "🤡", + "club_suit": "♣", + "clutch_bag": "👝", + "coat": "🧥", + "cocktail_glass": "🍸", + "coconut": "🥥", + "coffin": "⚰", + "cold_face": "🥶", + "collision": "💥", + "comet": "☄", + "compass": "🧭", + "computer_disk": "💽", + "computer_mouse": "🖱", + "confetti_ball": "🎊", + "confounded_face": "😖", + "confused_face": "😕", + "construction": "🚧", + "construction_worker": "👷", + "construction_worker_dark_skin_tone": "👷🏿", + "construction_worker_light_skin_tone": "👷🏻", + "construction_worker_medium-dark_skin_tone": "👷🏾", + "construction_worker_medium-light_skin_tone": "👷🏼", + "construction_worker_medium_skin_tone": "👷🏽", + "control_knobs": "🎛", + "convenience_store": "🏪", + "cooked_rice": "🍚", + "cookie": "🍪", + "cooking": "🍳", + "copyright": "©", + "couch_and_lamp": "🛋", + "counterclockwise_arrows_button": "🔄", + "couple_with_heart": "💑", + "couple_with_heart_man_man": "👨\u200d❤️\u200d👨", + "couple_with_heart_woman_man": "👩\u200d❤️\u200d👨", + "couple_with_heart_woman_woman": "👩\u200d❤️\u200d👩", + "cow": "🐮", + "cow_face": "🐮", + "cowboy_hat_face": "🤠", + "crab": "🦀", + "crayon": "🖍", + "credit_card": "💳", + "crescent_moon": "🌙", + "cricket": "🦗", + "cricket_game": "🏏", + "crocodile": "🐊", + "croissant": "🥐", + "cross_mark": "❌", + "cross_mark_button": "❎", + "crossed_fingers": "🤞", + "crossed_fingers_dark_skin_tone": "🤞🏿", + "crossed_fingers_light_skin_tone": "🤞🏻", + "crossed_fingers_medium-dark_skin_tone": "🤞🏾", + "crossed_fingers_medium-light_skin_tone": "🤞🏼", + "crossed_fingers_medium_skin_tone": "🤞🏽", + "crossed_flags": "🎌", + "crossed_swords": "⚔", + "crown": "👑", + "crying_cat_face": "😿", + "crying_face": "😢", + "crystal_ball": "🔮", + "cucumber": "🥒", + "cupcake": "🧁", + "cup_with_straw": "🥤", + "curling_stone": "🥌", + "curly_hair": "🦱", + "curly-haired_man": "👨\u200d🦱", + "curly-haired_woman": "👩\u200d🦱", + "curly_loop": "➰", + "currency_exchange": "💱", + "curry_rice": "🍛", + "custard": "🍮", + "customs": "🛃", + "cut_of_meat": "🥩", + "cyclone": "🌀", + "dagger": "🗡", + "dango": "🍡", + "dashing_away": "💨", + "deaf_person": "🧏", + "deciduous_tree": "🌳", + "deer": "🦌", + "delivery_truck": "🚚", + "department_store": "🏬", + "derelict_house": "🏚", + "desert": "🏜", + "desert_island": "🏝", + "desktop_computer": "🖥", + "detective": "🕵", + "detective_dark_skin_tone": "🕵🏿", + "detective_light_skin_tone": "🕵🏻", + "detective_medium-dark_skin_tone": "🕵🏾", + "detective_medium-light_skin_tone": "🕵🏼", + "detective_medium_skin_tone": "🕵🏽", + "diamond_suit": "♦", + "diamond_with_a_dot": "💠", + "dim_button": "🔅", + "direct_hit": "🎯", + "disappointed_face": "😞", + "diving_mask": "🤿", + "diya_lamp": "🪔", + "dizzy": "💫", + "dizzy_face": "😵", + "dna": "🧬", + "dog": "🐶", + "dog_face": "🐶", + "dollar_banknote": "💵", + "dolphin": "🐬", + "door": "🚪", + "dotted_six-pointed_star": "🔯", + "double_curly_loop": "➿", + "double_exclamation_mark": "‼", + "doughnut": "🍩", + "dove": "🕊", + "down-left_arrow": "↙", + "down-right_arrow": "↘", + "down_arrow": "⬇", + "downcast_face_with_sweat": "😓", + "downwards_button": "🔽", + "dragon": "🐉", + "dragon_face": "🐲", + "dress": "👗", + "drooling_face": "🤤", + "drop_of_blood": "🩸", + "droplet": "💧", + "drum": "🥁", + "duck": "🦆", + "dumpling": "🥟", + "dvd": "📀", + "e-mail": "📧", + "eagle": "🦅", + "ear": "👂", + "ear_dark_skin_tone": "👂🏿", + "ear_light_skin_tone": "👂🏻", + "ear_medium-dark_skin_tone": "👂🏾", + "ear_medium-light_skin_tone": "👂🏼", + "ear_medium_skin_tone": "👂🏽", + "ear_of_corn": "🌽", + "ear_with_hearing_aid": "🦻", + "egg": "🍳", + "eggplant": "🍆", + "eight-pointed_star": "✴", + "eight-spoked_asterisk": "✳", + "eight-thirty": "🕣", + "eight_o’clock": "🕗", + "eject_button": "⏏", + "electric_plug": "🔌", + "elephant": "🐘", + "eleven-thirty": "🕦", + "eleven_o’clock": "🕚", + "elf": "🧝", + "elf_dark_skin_tone": "🧝🏿", + "elf_light_skin_tone": "🧝🏻", + "elf_medium-dark_skin_tone": "🧝🏾", + "elf_medium-light_skin_tone": "🧝🏼", + "elf_medium_skin_tone": "🧝🏽", + "envelope": "✉", + "envelope_with_arrow": "📩", + "euro_banknote": "💶", + "evergreen_tree": "🌲", + "ewe": "🐑", + "exclamation_mark": "❗", + "exclamation_question_mark": "⁉", + "exploding_head": "🤯", + "expressionless_face": "😑", + "eye": "👁", + "eye_in_speech_bubble": "👁️\u200d🗨️", + "eyes": "👀", + "face_blowing_a_kiss": "😘", + "face_savoring_food": "😋", + "face_screaming_in_fear": "😱", + "face_vomiting": "🤮", + "face_with_hand_over_mouth": "🤭", + "face_with_head-bandage": "🤕", + "face_with_medical_mask": "😷", + "face_with_monocle": "🧐", + "face_with_open_mouth": "😮", + "face_with_raised_eyebrow": "🤨", + "face_with_rolling_eyes": "🙄", + "face_with_steam_from_nose": "😤", + "face_with_symbols_on_mouth": "🤬", + "face_with_tears_of_joy": "😂", + "face_with_thermometer": "🤒", + "face_with_tongue": "😛", + "face_without_mouth": "😶", + "factory": "🏭", + "fairy": "🧚", + "fairy_dark_skin_tone": "🧚🏿", + "fairy_light_skin_tone": "🧚🏻", + "fairy_medium-dark_skin_tone": "🧚🏾", + "fairy_medium-light_skin_tone": "🧚🏼", + "fairy_medium_skin_tone": "🧚🏽", + "falafel": "🧆", + "fallen_leaf": "🍂", + "family": "👪", + "family_man_boy": "👨\u200d👦", + "family_man_boy_boy": "👨\u200d👦\u200d👦", + "family_man_girl": "👨\u200d👧", + "family_man_girl_boy": "👨\u200d👧\u200d👦", + "family_man_girl_girl": "👨\u200d👧\u200d👧", + "family_man_man_boy": "👨\u200d👨\u200d👦", + "family_man_man_boy_boy": "👨\u200d👨\u200d👦\u200d👦", + "family_man_man_girl": "👨\u200d👨\u200d👧", + "family_man_man_girl_boy": "👨\u200d👨\u200d👧\u200d👦", + "family_man_man_girl_girl": "👨\u200d👨\u200d👧\u200d👧", + "family_man_woman_boy": "👨\u200d👩\u200d👦", + "family_man_woman_boy_boy": "👨\u200d👩\u200d👦\u200d👦", + "family_man_woman_girl": "👨\u200d👩\u200d👧", + "family_man_woman_girl_boy": "👨\u200d👩\u200d👧\u200d👦", + "family_man_woman_girl_girl": "👨\u200d👩\u200d👧\u200d👧", + "family_woman_boy": "👩\u200d👦", + "family_woman_boy_boy": "👩\u200d👦\u200d👦", + "family_woman_girl": "👩\u200d👧", + "family_woman_girl_boy": "👩\u200d👧\u200d👦", + "family_woman_girl_girl": "👩\u200d👧\u200d👧", + "family_woman_woman_boy": "👩\u200d👩\u200d👦", + "family_woman_woman_boy_boy": "👩\u200d👩\u200d👦\u200d👦", + "family_woman_woman_girl": "👩\u200d👩\u200d👧", + "family_woman_woman_girl_boy": "👩\u200d👩\u200d👧\u200d👦", + "family_woman_woman_girl_girl": "👩\u200d👩\u200d👧\u200d👧", + "fast-forward_button": "⏩", + "fast_down_button": "⏬", + "fast_reverse_button": "⏪", + "fast_up_button": "⏫", + "fax_machine": "📠", + "fearful_face": "😨", + "female_sign": "♀", + "ferris_wheel": "🎡", + "ferry": "⛴", + "field_hockey": "🏑", + "file_cabinet": "🗄", + "file_folder": "📁", + "film_frames": "🎞", + "film_projector": "📽", + "fire": "🔥", + "fire_extinguisher": "🧯", + "firecracker": "🧨", + "fire_engine": "🚒", + "fireworks": "🎆", + "first_quarter_moon": "🌓", + "first_quarter_moon_face": "🌛", + "fish": "🐟", + "fish_cake_with_swirl": "🍥", + "fishing_pole": "🎣", + "five-thirty": "🕠", + "five_o’clock": "🕔", + "flag_in_hole": "⛳", + "flamingo": "🦩", + "flashlight": "🔦", + "flat_shoe": "🥿", + "fleur-de-lis": "⚜", + "flexed_biceps": "💪", + "flexed_biceps_dark_skin_tone": "💪🏿", + "flexed_biceps_light_skin_tone": "💪🏻", + "flexed_biceps_medium-dark_skin_tone": "💪🏾", + "flexed_biceps_medium-light_skin_tone": "💪🏼", + "flexed_biceps_medium_skin_tone": "💪🏽", + "floppy_disk": "💾", + "flower_playing_cards": "🎴", + "flushed_face": "😳", + "flying_disc": "🥏", + "flying_saucer": "🛸", + "fog": "🌫", + "foggy": "🌁", + "folded_hands": "🙏", + "folded_hands_dark_skin_tone": "🙏🏿", + "folded_hands_light_skin_tone": "🙏🏻", + "folded_hands_medium-dark_skin_tone": "🙏🏾", + "folded_hands_medium-light_skin_tone": "🙏🏼", + "folded_hands_medium_skin_tone": "🙏🏽", + "foot": "🦶", + "footprints": "👣", + "fork_and_knife": "🍴", + "fork_and_knife_with_plate": "🍽", + "fortune_cookie": "🥠", + "fountain": "⛲", + "fountain_pen": "🖋", + "four-thirty": "🕟", + "four_leaf_clover": "🍀", + "four_o’clock": "🕓", + "fox_face": "🦊", + "framed_picture": "🖼", + "french_fries": "🍟", + "fried_shrimp": "🍤", + "frog_face": "🐸", + "front-facing_baby_chick": "🐥", + "frowning_face": "☹", + "frowning_face_with_open_mouth": "😦", + "fuel_pump": "⛽", + "full_moon": "🌕", + "full_moon_face": "🌝", + "funeral_urn": "⚱", + "game_die": "🎲", + "garlic": "🧄", + "gear": "⚙", + "gem_stone": "💎", + "genie": "🧞", + "ghost": "👻", + "giraffe": "🦒", + "girl": "👧", + "girl_dark_skin_tone": "👧🏿", + "girl_light_skin_tone": "👧🏻", + "girl_medium-dark_skin_tone": "👧🏾", + "girl_medium-light_skin_tone": "👧🏼", + "girl_medium_skin_tone": "👧🏽", + "glass_of_milk": "🥛", + "glasses": "👓", + "globe_showing_americas": "🌎", + "globe_showing_asia-australia": "🌏", + "globe_showing_europe-africa": "🌍", + "globe_with_meridians": "🌐", + "gloves": "🧤", + "glowing_star": "🌟", + "goal_net": "🥅", + "goat": "🐐", + "goblin": "👺", + "goggles": "🥽", + "gorilla": "🦍", + "graduation_cap": "🎓", + "grapes": "🍇", + "green_apple": "🍏", + "green_book": "📗", + "green_circle": "🟢", + "green_heart": "💚", + "green_salad": "🥗", + "green_square": "🟩", + "grimacing_face": "😬", + "grinning_cat_face": "😺", + "grinning_cat_face_with_smiling_eyes": "😸", + "grinning_face": "😀", + "grinning_face_with_big_eyes": "😃", + "grinning_face_with_smiling_eyes": "😄", + "grinning_face_with_sweat": "😅", + "grinning_squinting_face": "😆", + "growing_heart": "💗", + "guard": "💂", + "guard_dark_skin_tone": "💂🏿", + "guard_light_skin_tone": "💂🏻", + "guard_medium-dark_skin_tone": "💂🏾", + "guard_medium-light_skin_tone": "💂🏼", + "guard_medium_skin_tone": "💂🏽", + "guide_dog": "🦮", + "guitar": "🎸", + "hamburger": "🍔", + "hammer": "🔨", + "hammer_and_pick": "⚒", + "hammer_and_wrench": "🛠", + "hamster_face": "🐹", + "hand_with_fingers_splayed": "🖐", + "hand_with_fingers_splayed_dark_skin_tone": "🖐🏿", + "hand_with_fingers_splayed_light_skin_tone": "🖐🏻", + "hand_with_fingers_splayed_medium-dark_skin_tone": "🖐🏾", + "hand_with_fingers_splayed_medium-light_skin_tone": "🖐🏼", + "hand_with_fingers_splayed_medium_skin_tone": "🖐🏽", + "handbag": "👜", + "handshake": "🤝", + "hatching_chick": "🐣", + "headphone": "🎧", + "hear-no-evil_monkey": "🙉", + "heart_decoration": "💟", + "heart_suit": "♥", + "heart_with_arrow": "💘", + "heart_with_ribbon": "💝", + "heavy_check_mark": "✔", + "heavy_division_sign": "➗", + "heavy_dollar_sign": "💲", + "heavy_heart_exclamation": "❣", + "heavy_large_circle": "⭕", + "heavy_minus_sign": "➖", + "heavy_multiplication_x": "✖", + "heavy_plus_sign": "➕", + "hedgehog": "🦔", + "helicopter": "🚁", + "herb": "🌿", + "hibiscus": "🌺", + "high-heeled_shoe": "👠", + "high-speed_train": "🚄", + "high_voltage": "⚡", + "hiking_boot": "🥾", + "hindu_temple": "🛕", + "hippopotamus": "🦛", + "hole": "🕳", + "honey_pot": "🍯", + "honeybee": "🐝", + "horizontal_traffic_light": "🚥", + "horse": "🐴", + "horse_face": "🐴", + "horse_racing": "🏇", + "horse_racing_dark_skin_tone": "🏇🏿", + "horse_racing_light_skin_tone": "🏇🏻", + "horse_racing_medium-dark_skin_tone": "🏇🏾", + "horse_racing_medium-light_skin_tone": "🏇🏼", + "horse_racing_medium_skin_tone": "🏇🏽", + "hospital": "🏥", + "hot_beverage": "☕", + "hot_dog": "🌭", + "hot_face": "🥵", + "hot_pepper": "🌶", + "hot_springs": "♨", + "hotel": "🏨", + "hourglass_done": "⌛", + "hourglass_not_done": "⏳", + "house": "🏠", + "house_with_garden": "🏡", + "houses": "🏘", + "hugging_face": "🤗", + "hundred_points": "💯", + "hushed_face": "😯", + "ice": "🧊", + "ice_cream": "🍨", + "ice_hockey": "🏒", + "ice_skate": "⛸", + "inbox_tray": "📥", + "incoming_envelope": "📨", + "index_pointing_up": "☝", + "index_pointing_up_dark_skin_tone": "☝🏿", + "index_pointing_up_light_skin_tone": "☝🏻", + "index_pointing_up_medium-dark_skin_tone": "☝🏾", + "index_pointing_up_medium-light_skin_tone": "☝🏼", + "index_pointing_up_medium_skin_tone": "☝🏽", + "infinity": "♾", + "information": "ℹ", + "input_latin_letters": "🔤", + "input_latin_lowercase": "🔡", + "input_latin_uppercase": "🔠", + "input_numbers": "🔢", + "input_symbols": "🔣", + "jack-o-lantern": "🎃", + "jeans": "👖", + "jigsaw": "🧩", + "joker": "🃏", + "joystick": "🕹", + "kaaba": "🕋", + "kangaroo": "🦘", + "key": "🔑", + "keyboard": "⌨", + "keycap_#": "#️⃣", + "keycap_*": "*️⃣", + "keycap_0": "0️⃣", + "keycap_1": "1️⃣", + "keycap_10": "🔟", + "keycap_2": "2️⃣", + "keycap_3": "3️⃣", + "keycap_4": "4️⃣", + "keycap_5": "5️⃣", + "keycap_6": "6️⃣", + "keycap_7": "7️⃣", + "keycap_8": "8️⃣", + "keycap_9": "9️⃣", + "kick_scooter": "🛴", + "kimono": "👘", + "kiss": "💋", + "kiss_man_man": "👨\u200d❤️\u200d💋\u200d👨", + "kiss_mark": "💋", + "kiss_woman_man": "👩\u200d❤️\u200d💋\u200d👨", + "kiss_woman_woman": "👩\u200d❤️\u200d💋\u200d👩", + "kissing_cat_face": "😽", + "kissing_face": "😗", + "kissing_face_with_closed_eyes": "😚", + "kissing_face_with_smiling_eyes": "😙", + "kitchen_knife": "🔪", + "kite": "🪁", + "kiwi_fruit": "🥝", + "koala": "🐨", + "lab_coat": "🥼", + "label": "🏷", + "lacrosse": "🥍", + "lady_beetle": "🐞", + "laptop_computer": "💻", + "large_blue_diamond": "🔷", + "large_orange_diamond": "🔶", + "last_quarter_moon": "🌗", + "last_quarter_moon_face": "🌜", + "last_track_button": "⏮", + "latin_cross": "✝", + "leaf_fluttering_in_wind": "🍃", + "leafy_green": "🥬", + "ledger": "📒", + "left-facing_fist": "🤛", + "left-facing_fist_dark_skin_tone": "🤛🏿", + "left-facing_fist_light_skin_tone": "🤛🏻", + "left-facing_fist_medium-dark_skin_tone": "🤛🏾", + "left-facing_fist_medium-light_skin_tone": "🤛🏼", + "left-facing_fist_medium_skin_tone": "🤛🏽", + "left-right_arrow": "↔", + "left_arrow": "⬅", + "left_arrow_curving_right": "↪", + "left_luggage": "🛅", + "left_speech_bubble": "🗨", + "leg": "🦵", + "lemon": "🍋", + "leopard": "🐆", + "level_slider": "🎚", + "light_bulb": "💡", + "light_rail": "🚈", + "link": "🔗", + "linked_paperclips": "🖇", + "lion_face": "🦁", + "lipstick": "💄", + "litter_in_bin_sign": "🚮", + "lizard": "🦎", + "llama": "🦙", + "lobster": "🦞", + "locked": "🔒", + "locked_with_key": "🔐", + "locked_with_pen": "🔏", + "locomotive": "🚂", + "lollipop": "🍭", + "lotion_bottle": "🧴", + "loudly_crying_face": "😭", + "loudspeaker": "📢", + "love-you_gesture": "🤟", + "love-you_gesture_dark_skin_tone": "🤟🏿", + "love-you_gesture_light_skin_tone": "🤟🏻", + "love-you_gesture_medium-dark_skin_tone": "🤟🏾", + "love-you_gesture_medium-light_skin_tone": "🤟🏼", + "love-you_gesture_medium_skin_tone": "🤟🏽", + "love_hotel": "🏩", + "love_letter": "💌", + "luggage": "🧳", + "lying_face": "🤥", + "mage": "🧙", + "mage_dark_skin_tone": "🧙🏿", + "mage_light_skin_tone": "🧙🏻", + "mage_medium-dark_skin_tone": "🧙🏾", + "mage_medium-light_skin_tone": "🧙🏼", + "mage_medium_skin_tone": "🧙🏽", + "magnet": "🧲", + "magnifying_glass_tilted_left": "🔍", + "magnifying_glass_tilted_right": "🔎", + "mahjong_red_dragon": "🀄", + "male_sign": "♂", + "man": "👨", + "man_and_woman_holding_hands": "👫", + "man_artist": "👨\u200d🎨", + "man_artist_dark_skin_tone": "👨🏿\u200d🎨", + "man_artist_light_skin_tone": "👨🏻\u200d🎨", + "man_artist_medium-dark_skin_tone": "👨🏾\u200d🎨", + "man_artist_medium-light_skin_tone": "👨🏼\u200d🎨", + "man_artist_medium_skin_tone": "👨🏽\u200d🎨", + "man_astronaut": "👨\u200d🚀", + "man_astronaut_dark_skin_tone": "👨🏿\u200d🚀", + "man_astronaut_light_skin_tone": "👨🏻\u200d🚀", + "man_astronaut_medium-dark_skin_tone": "👨🏾\u200d🚀", + "man_astronaut_medium-light_skin_tone": "👨🏼\u200d🚀", + "man_astronaut_medium_skin_tone": "👨🏽\u200d🚀", + "man_biking": "🚴\u200d♂️", + "man_biking_dark_skin_tone": "🚴🏿\u200d♂️", + "man_biking_light_skin_tone": "🚴🏻\u200d♂️", + "man_biking_medium-dark_skin_tone": "🚴🏾\u200d♂️", + "man_biking_medium-light_skin_tone": "🚴🏼\u200d♂️", + "man_biking_medium_skin_tone": "🚴🏽\u200d♂️", + "man_bouncing_ball": "⛹️\u200d♂️", + "man_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♂️", + "man_bouncing_ball_light_skin_tone": "⛹🏻\u200d♂️", + "man_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♂️", + "man_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♂️", + "man_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♂️", + "man_bowing": "🙇\u200d♂️", + "man_bowing_dark_skin_tone": "🙇🏿\u200d♂️", + "man_bowing_light_skin_tone": "🙇🏻\u200d♂️", + "man_bowing_medium-dark_skin_tone": "🙇🏾\u200d♂️", + "man_bowing_medium-light_skin_tone": "🙇🏼\u200d♂️", + "man_bowing_medium_skin_tone": "🙇🏽\u200d♂️", + "man_cartwheeling": "🤸\u200d♂️", + "man_cartwheeling_dark_skin_tone": "🤸🏿\u200d♂️", + "man_cartwheeling_light_skin_tone": "🤸🏻\u200d♂️", + "man_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♂️", + "man_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♂️", + "man_cartwheeling_medium_skin_tone": "🤸🏽\u200d♂️", + "man_climbing": "🧗\u200d♂️", + "man_climbing_dark_skin_tone": "🧗🏿\u200d♂️", + "man_climbing_light_skin_tone": "🧗🏻\u200d♂️", + "man_climbing_medium-dark_skin_tone": "🧗🏾\u200d♂️", + "man_climbing_medium-light_skin_tone": "🧗🏼\u200d♂️", + "man_climbing_medium_skin_tone": "🧗🏽\u200d♂️", + "man_construction_worker": "👷\u200d♂️", + "man_construction_worker_dark_skin_tone": "👷🏿\u200d♂️", + "man_construction_worker_light_skin_tone": "👷🏻\u200d♂️", + "man_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♂️", + "man_construction_worker_medium-light_skin_tone": "👷🏼\u200d♂️", + "man_construction_worker_medium_skin_tone": "👷🏽\u200d♂️", + "man_cook": "👨\u200d🍳", + "man_cook_dark_skin_tone": "👨🏿\u200d🍳", + "man_cook_light_skin_tone": "👨🏻\u200d🍳", + "man_cook_medium-dark_skin_tone": "👨🏾\u200d🍳", + "man_cook_medium-light_skin_tone": "👨🏼\u200d🍳", + "man_cook_medium_skin_tone": "👨🏽\u200d🍳", + "man_dancing": "🕺", + "man_dancing_dark_skin_tone": "🕺🏿", + "man_dancing_light_skin_tone": "🕺🏻", + "man_dancing_medium-dark_skin_tone": "🕺🏾", + "man_dancing_medium-light_skin_tone": "🕺🏼", + "man_dancing_medium_skin_tone": "🕺🏽", + "man_dark_skin_tone": "👨🏿", + "man_detective": "🕵️\u200d♂️", + "man_detective_dark_skin_tone": "🕵🏿\u200d♂️", + "man_detective_light_skin_tone": "🕵🏻\u200d♂️", + "man_detective_medium-dark_skin_tone": "🕵🏾\u200d♂️", + "man_detective_medium-light_skin_tone": "🕵🏼\u200d♂️", + "man_detective_medium_skin_tone": "🕵🏽\u200d♂️", + "man_elf": "🧝\u200d♂️", + "man_elf_dark_skin_tone": "🧝🏿\u200d♂️", + "man_elf_light_skin_tone": "🧝🏻\u200d♂️", + "man_elf_medium-dark_skin_tone": "🧝🏾\u200d♂️", + "man_elf_medium-light_skin_tone": "🧝🏼\u200d♂️", + "man_elf_medium_skin_tone": "🧝🏽\u200d♂️", + "man_facepalming": "🤦\u200d♂️", + "man_facepalming_dark_skin_tone": "🤦🏿\u200d♂️", + "man_facepalming_light_skin_tone": "🤦🏻\u200d♂️", + "man_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♂️", + "man_facepalming_medium-light_skin_tone": "🤦🏼\u200d♂️", + "man_facepalming_medium_skin_tone": "🤦🏽\u200d♂️", + "man_factory_worker": "👨\u200d🏭", + "man_factory_worker_dark_skin_tone": "👨🏿\u200d🏭", + "man_factory_worker_light_skin_tone": "👨🏻\u200d🏭", + "man_factory_worker_medium-dark_skin_tone": "👨🏾\u200d🏭", + "man_factory_worker_medium-light_skin_tone": "👨🏼\u200d🏭", + "man_factory_worker_medium_skin_tone": "👨🏽\u200d🏭", + "man_fairy": "🧚\u200d♂️", + "man_fairy_dark_skin_tone": "🧚🏿\u200d♂️", + "man_fairy_light_skin_tone": "🧚🏻\u200d♂️", + "man_fairy_medium-dark_skin_tone": "🧚🏾\u200d♂️", + "man_fairy_medium-light_skin_tone": "🧚🏼\u200d♂️", + "man_fairy_medium_skin_tone": "🧚🏽\u200d♂️", + "man_farmer": "👨\u200d🌾", + "man_farmer_dark_skin_tone": "👨🏿\u200d🌾", + "man_farmer_light_skin_tone": "👨🏻\u200d🌾", + "man_farmer_medium-dark_skin_tone": "👨🏾\u200d🌾", + "man_farmer_medium-light_skin_tone": "👨🏼\u200d🌾", + "man_farmer_medium_skin_tone": "👨🏽\u200d🌾", + "man_firefighter": "👨\u200d🚒", + "man_firefighter_dark_skin_tone": "👨🏿\u200d🚒", + "man_firefighter_light_skin_tone": "👨🏻\u200d🚒", + "man_firefighter_medium-dark_skin_tone": "👨🏾\u200d🚒", + "man_firefighter_medium-light_skin_tone": "👨🏼\u200d🚒", + "man_firefighter_medium_skin_tone": "👨🏽\u200d🚒", + "man_frowning": "🙍\u200d♂️", + "man_frowning_dark_skin_tone": "🙍🏿\u200d♂️", + "man_frowning_light_skin_tone": "🙍🏻\u200d♂️", + "man_frowning_medium-dark_skin_tone": "🙍🏾\u200d♂️", + "man_frowning_medium-light_skin_tone": "🙍🏼\u200d♂️", + "man_frowning_medium_skin_tone": "🙍🏽\u200d♂️", + "man_genie": "🧞\u200d♂️", + "man_gesturing_no": "🙅\u200d♂️", + "man_gesturing_no_dark_skin_tone": "🙅🏿\u200d♂️", + "man_gesturing_no_light_skin_tone": "🙅🏻\u200d♂️", + "man_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♂️", + "man_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♂️", + "man_gesturing_no_medium_skin_tone": "🙅🏽\u200d♂️", + "man_gesturing_ok": "🙆\u200d♂️", + "man_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♂️", + "man_gesturing_ok_light_skin_tone": "🙆🏻\u200d♂️", + "man_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♂️", + "man_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♂️", + "man_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♂️", + "man_getting_haircut": "💇\u200d♂️", + "man_getting_haircut_dark_skin_tone": "💇🏿\u200d♂️", + "man_getting_haircut_light_skin_tone": "💇🏻\u200d♂️", + "man_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♂️", + "man_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♂️", + "man_getting_haircut_medium_skin_tone": "💇🏽\u200d♂️", + "man_getting_massage": "💆\u200d♂️", + "man_getting_massage_dark_skin_tone": "💆🏿\u200d♂️", + "man_getting_massage_light_skin_tone": "💆🏻\u200d♂️", + "man_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♂️", + "man_getting_massage_medium-light_skin_tone": "💆🏼\u200d♂️", + "man_getting_massage_medium_skin_tone": "💆🏽\u200d♂️", + "man_golfing": "🏌️\u200d♂️", + "man_golfing_dark_skin_tone": "🏌🏿\u200d♂️", + "man_golfing_light_skin_tone": "🏌🏻\u200d♂️", + "man_golfing_medium-dark_skin_tone": "🏌🏾\u200d♂️", + "man_golfing_medium-light_skin_tone": "🏌🏼\u200d♂️", + "man_golfing_medium_skin_tone": "🏌🏽\u200d♂️", + "man_guard": "💂\u200d♂️", + "man_guard_dark_skin_tone": "💂🏿\u200d♂️", + "man_guard_light_skin_tone": "💂🏻\u200d♂️", + "man_guard_medium-dark_skin_tone": "💂🏾\u200d♂️", + "man_guard_medium-light_skin_tone": "💂🏼\u200d♂️", + "man_guard_medium_skin_tone": "💂🏽\u200d♂️", + "man_health_worker": "👨\u200d⚕️", + "man_health_worker_dark_skin_tone": "👨🏿\u200d⚕️", + "man_health_worker_light_skin_tone": "👨🏻\u200d⚕️", + "man_health_worker_medium-dark_skin_tone": "👨🏾\u200d⚕️", + "man_health_worker_medium-light_skin_tone": "👨🏼\u200d⚕️", + "man_health_worker_medium_skin_tone": "👨🏽\u200d⚕️", + "man_in_lotus_position": "🧘\u200d♂️", + "man_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♂️", + "man_in_lotus_position_light_skin_tone": "🧘🏻\u200d♂️", + "man_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♂️", + "man_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♂️", + "man_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♂️", + "man_in_manual_wheelchair": "👨\u200d🦽", + "man_in_motorized_wheelchair": "👨\u200d🦼", + "man_in_steamy_room": "🧖\u200d♂️", + "man_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♂️", + "man_in_steamy_room_light_skin_tone": "🧖🏻\u200d♂️", + "man_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♂️", + "man_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♂️", + "man_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♂️", + "man_in_suit_levitating": "🕴", + "man_in_suit_levitating_dark_skin_tone": "🕴🏿", + "man_in_suit_levitating_light_skin_tone": "🕴🏻", + "man_in_suit_levitating_medium-dark_skin_tone": "🕴🏾", + "man_in_suit_levitating_medium-light_skin_tone": "🕴🏼", + "man_in_suit_levitating_medium_skin_tone": "🕴🏽", + "man_in_tuxedo": "🤵", + "man_in_tuxedo_dark_skin_tone": "🤵🏿", + "man_in_tuxedo_light_skin_tone": "🤵🏻", + "man_in_tuxedo_medium-dark_skin_tone": "🤵🏾", + "man_in_tuxedo_medium-light_skin_tone": "🤵🏼", + "man_in_tuxedo_medium_skin_tone": "🤵🏽", + "man_judge": "👨\u200d⚖️", + "man_judge_dark_skin_tone": "👨🏿\u200d⚖️", + "man_judge_light_skin_tone": "👨🏻\u200d⚖️", + "man_judge_medium-dark_skin_tone": "👨🏾\u200d⚖️", + "man_judge_medium-light_skin_tone": "👨🏼\u200d⚖️", + "man_judge_medium_skin_tone": "👨🏽\u200d⚖️", + "man_juggling": "🤹\u200d♂️", + "man_juggling_dark_skin_tone": "🤹🏿\u200d♂️", + "man_juggling_light_skin_tone": "🤹🏻\u200d♂️", + "man_juggling_medium-dark_skin_tone": "🤹🏾\u200d♂️", + "man_juggling_medium-light_skin_tone": "🤹🏼\u200d♂️", + "man_juggling_medium_skin_tone": "🤹🏽\u200d♂️", + "man_lifting_weights": "🏋️\u200d♂️", + "man_lifting_weights_dark_skin_tone": "🏋🏿\u200d♂️", + "man_lifting_weights_light_skin_tone": "🏋🏻\u200d♂️", + "man_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♂️", + "man_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♂️", + "man_lifting_weights_medium_skin_tone": "🏋🏽\u200d♂️", + "man_light_skin_tone": "👨🏻", + "man_mage": "🧙\u200d♂️", + "man_mage_dark_skin_tone": "🧙🏿\u200d♂️", + "man_mage_light_skin_tone": "🧙🏻\u200d♂️", + "man_mage_medium-dark_skin_tone": "🧙🏾\u200d♂️", + "man_mage_medium-light_skin_tone": "🧙🏼\u200d♂️", + "man_mage_medium_skin_tone": "🧙🏽\u200d♂️", + "man_mechanic": "👨\u200d🔧", + "man_mechanic_dark_skin_tone": "👨🏿\u200d🔧", + "man_mechanic_light_skin_tone": "👨🏻\u200d🔧", + "man_mechanic_medium-dark_skin_tone": "👨🏾\u200d🔧", + "man_mechanic_medium-light_skin_tone": "👨🏼\u200d🔧", + "man_mechanic_medium_skin_tone": "👨🏽\u200d🔧", + "man_medium-dark_skin_tone": "👨🏾", + "man_medium-light_skin_tone": "👨🏼", + "man_medium_skin_tone": "👨🏽", + "man_mountain_biking": "🚵\u200d♂️", + "man_mountain_biking_dark_skin_tone": "🚵🏿\u200d♂️", + "man_mountain_biking_light_skin_tone": "🚵🏻\u200d♂️", + "man_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♂️", + "man_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♂️", + "man_mountain_biking_medium_skin_tone": "🚵🏽\u200d♂️", + "man_office_worker": "👨\u200d💼", + "man_office_worker_dark_skin_tone": "👨🏿\u200d💼", + "man_office_worker_light_skin_tone": "👨🏻\u200d💼", + "man_office_worker_medium-dark_skin_tone": "👨🏾\u200d💼", + "man_office_worker_medium-light_skin_tone": "👨🏼\u200d💼", + "man_office_worker_medium_skin_tone": "👨🏽\u200d💼", + "man_pilot": "👨\u200d✈️", + "man_pilot_dark_skin_tone": "👨🏿\u200d✈️", + "man_pilot_light_skin_tone": "👨🏻\u200d✈️", + "man_pilot_medium-dark_skin_tone": "👨🏾\u200d✈️", + "man_pilot_medium-light_skin_tone": "👨🏼\u200d✈️", + "man_pilot_medium_skin_tone": "👨🏽\u200d✈️", + "man_playing_handball": "🤾\u200d♂️", + "man_playing_handball_dark_skin_tone": "🤾🏿\u200d♂️", + "man_playing_handball_light_skin_tone": "🤾🏻\u200d♂️", + "man_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♂️", + "man_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♂️", + "man_playing_handball_medium_skin_tone": "🤾🏽\u200d♂️", + "man_playing_water_polo": "🤽\u200d♂️", + "man_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♂️", + "man_playing_water_polo_light_skin_tone": "🤽🏻\u200d♂️", + "man_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♂️", + "man_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♂️", + "man_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♂️", + "man_police_officer": "👮\u200d♂️", + "man_police_officer_dark_skin_tone": "👮🏿\u200d♂️", + "man_police_officer_light_skin_tone": "👮🏻\u200d♂️", + "man_police_officer_medium-dark_skin_tone": "👮🏾\u200d♂️", + "man_police_officer_medium-light_skin_tone": "👮🏼\u200d♂️", + "man_police_officer_medium_skin_tone": "👮🏽\u200d♂️", + "man_pouting": "🙎\u200d♂️", + "man_pouting_dark_skin_tone": "🙎🏿\u200d♂️", + "man_pouting_light_skin_tone": "🙎🏻\u200d♂️", + "man_pouting_medium-dark_skin_tone": "🙎🏾\u200d♂️", + "man_pouting_medium-light_skin_tone": "🙎🏼\u200d♂️", + "man_pouting_medium_skin_tone": "🙎🏽\u200d♂️", + "man_raising_hand": "🙋\u200d♂️", + "man_raising_hand_dark_skin_tone": "🙋🏿\u200d♂️", + "man_raising_hand_light_skin_tone": "🙋🏻\u200d♂️", + "man_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♂️", + "man_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♂️", + "man_raising_hand_medium_skin_tone": "🙋🏽\u200d♂️", + "man_rowing_boat": "🚣\u200d♂️", + "man_rowing_boat_dark_skin_tone": "🚣🏿\u200d♂️", + "man_rowing_boat_light_skin_tone": "🚣🏻\u200d♂️", + "man_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♂️", + "man_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♂️", + "man_rowing_boat_medium_skin_tone": "🚣🏽\u200d♂️", + "man_running": "🏃\u200d♂️", + "man_running_dark_skin_tone": "🏃🏿\u200d♂️", + "man_running_light_skin_tone": "🏃🏻\u200d♂️", + "man_running_medium-dark_skin_tone": "🏃🏾\u200d♂️", + "man_running_medium-light_skin_tone": "🏃🏼\u200d♂️", + "man_running_medium_skin_tone": "🏃🏽\u200d♂️", + "man_scientist": "👨\u200d🔬", + "man_scientist_dark_skin_tone": "👨🏿\u200d🔬", + "man_scientist_light_skin_tone": "👨🏻\u200d🔬", + "man_scientist_medium-dark_skin_tone": "👨🏾\u200d🔬", + "man_scientist_medium-light_skin_tone": "👨🏼\u200d🔬", + "man_scientist_medium_skin_tone": "👨🏽\u200d🔬", + "man_shrugging": "🤷\u200d♂️", + "man_shrugging_dark_skin_tone": "🤷🏿\u200d♂️", + "man_shrugging_light_skin_tone": "🤷🏻\u200d♂️", + "man_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♂️", + "man_shrugging_medium-light_skin_tone": "🤷🏼\u200d♂️", + "man_shrugging_medium_skin_tone": "🤷🏽\u200d♂️", + "man_singer": "👨\u200d🎤", + "man_singer_dark_skin_tone": "👨🏿\u200d🎤", + "man_singer_light_skin_tone": "👨🏻\u200d🎤", + "man_singer_medium-dark_skin_tone": "👨🏾\u200d🎤", + "man_singer_medium-light_skin_tone": "👨🏼\u200d🎤", + "man_singer_medium_skin_tone": "👨🏽\u200d🎤", + "man_student": "👨\u200d🎓", + "man_student_dark_skin_tone": "👨🏿\u200d🎓", + "man_student_light_skin_tone": "👨🏻\u200d🎓", + "man_student_medium-dark_skin_tone": "👨🏾\u200d🎓", + "man_student_medium-light_skin_tone": "👨🏼\u200d🎓", + "man_student_medium_skin_tone": "👨🏽\u200d🎓", + "man_surfing": "🏄\u200d♂️", + "man_surfing_dark_skin_tone": "🏄🏿\u200d♂️", + "man_surfing_light_skin_tone": "🏄🏻\u200d♂️", + "man_surfing_medium-dark_skin_tone": "🏄🏾\u200d♂️", + "man_surfing_medium-light_skin_tone": "🏄🏼\u200d♂️", + "man_surfing_medium_skin_tone": "🏄🏽\u200d♂️", + "man_swimming": "🏊\u200d♂️", + "man_swimming_dark_skin_tone": "🏊🏿\u200d♂️", + "man_swimming_light_skin_tone": "🏊🏻\u200d♂️", + "man_swimming_medium-dark_skin_tone": "🏊🏾\u200d♂️", + "man_swimming_medium-light_skin_tone": "🏊🏼\u200d♂️", + "man_swimming_medium_skin_tone": "🏊🏽\u200d♂️", + "man_teacher": "👨\u200d🏫", + "man_teacher_dark_skin_tone": "👨🏿\u200d🏫", + "man_teacher_light_skin_tone": "👨🏻\u200d🏫", + "man_teacher_medium-dark_skin_tone": "👨🏾\u200d🏫", + "man_teacher_medium-light_skin_tone": "👨🏼\u200d🏫", + "man_teacher_medium_skin_tone": "👨🏽\u200d🏫", + "man_technologist": "👨\u200d💻", + "man_technologist_dark_skin_tone": "👨🏿\u200d💻", + "man_technologist_light_skin_tone": "👨🏻\u200d💻", + "man_technologist_medium-dark_skin_tone": "👨🏾\u200d💻", + "man_technologist_medium-light_skin_tone": "👨🏼\u200d💻", + "man_technologist_medium_skin_tone": "👨🏽\u200d💻", + "man_tipping_hand": "💁\u200d♂️", + "man_tipping_hand_dark_skin_tone": "💁🏿\u200d♂️", + "man_tipping_hand_light_skin_tone": "💁🏻\u200d♂️", + "man_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♂️", + "man_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♂️", + "man_tipping_hand_medium_skin_tone": "💁🏽\u200d♂️", + "man_vampire": "🧛\u200d♂️", + "man_vampire_dark_skin_tone": "🧛🏿\u200d♂️", + "man_vampire_light_skin_tone": "🧛🏻\u200d♂️", + "man_vampire_medium-dark_skin_tone": "🧛🏾\u200d♂️", + "man_vampire_medium-light_skin_tone": "🧛🏼\u200d♂️", + "man_vampire_medium_skin_tone": "🧛🏽\u200d♂️", + "man_walking": "🚶\u200d♂️", + "man_walking_dark_skin_tone": "🚶🏿\u200d♂️", + "man_walking_light_skin_tone": "🚶🏻\u200d♂️", + "man_walking_medium-dark_skin_tone": "🚶🏾\u200d♂️", + "man_walking_medium-light_skin_tone": "🚶🏼\u200d♂️", + "man_walking_medium_skin_tone": "🚶🏽\u200d♂️", + "man_wearing_turban": "👳\u200d♂️", + "man_wearing_turban_dark_skin_tone": "👳🏿\u200d♂️", + "man_wearing_turban_light_skin_tone": "👳🏻\u200d♂️", + "man_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♂️", + "man_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♂️", + "man_wearing_turban_medium_skin_tone": "👳🏽\u200d♂️", + "man_with_probing_cane": "👨\u200d🦯", + "man_with_chinese_cap": "👲", + "man_with_chinese_cap_dark_skin_tone": "👲🏿", + "man_with_chinese_cap_light_skin_tone": "👲🏻", + "man_with_chinese_cap_medium-dark_skin_tone": "👲🏾", + "man_with_chinese_cap_medium-light_skin_tone": "👲🏼", + "man_with_chinese_cap_medium_skin_tone": "👲🏽", + "man_zombie": "🧟\u200d♂️", + "mango": "🥭", + "mantelpiece_clock": "🕰", + "manual_wheelchair": "🦽", + "man’s_shoe": "👞", + "map_of_japan": "🗾", + "maple_leaf": "🍁", + "martial_arts_uniform": "🥋", + "mate": "🧉", + "meat_on_bone": "🍖", + "mechanical_arm": "🦾", + "mechanical_leg": "🦿", + "medical_symbol": "⚕", + "megaphone": "📣", + "melon": "🍈", + "memo": "📝", + "men_with_bunny_ears": "👯\u200d♂️", + "men_wrestling": "🤼\u200d♂️", + "menorah": "🕎", + "men’s_room": "🚹", + "mermaid": "🧜\u200d♀️", + "mermaid_dark_skin_tone": "🧜🏿\u200d♀️", + "mermaid_light_skin_tone": "🧜🏻\u200d♀️", + "mermaid_medium-dark_skin_tone": "🧜🏾\u200d♀️", + "mermaid_medium-light_skin_tone": "🧜🏼\u200d♀️", + "mermaid_medium_skin_tone": "🧜🏽\u200d♀️", + "merman": "🧜\u200d♂️", + "merman_dark_skin_tone": "🧜🏿\u200d♂️", + "merman_light_skin_tone": "🧜🏻\u200d♂️", + "merman_medium-dark_skin_tone": "🧜🏾\u200d♂️", + "merman_medium-light_skin_tone": "🧜🏼\u200d♂️", + "merman_medium_skin_tone": "🧜🏽\u200d♂️", + "merperson": "🧜", + "merperson_dark_skin_tone": "🧜🏿", + "merperson_light_skin_tone": "🧜🏻", + "merperson_medium-dark_skin_tone": "🧜🏾", + "merperson_medium-light_skin_tone": "🧜🏼", + "merperson_medium_skin_tone": "🧜🏽", + "metro": "🚇", + "microbe": "🦠", + "microphone": "🎤", + "microscope": "🔬", + "middle_finger": "🖕", + "middle_finger_dark_skin_tone": "🖕🏿", + "middle_finger_light_skin_tone": "🖕🏻", + "middle_finger_medium-dark_skin_tone": "🖕🏾", + "middle_finger_medium-light_skin_tone": "🖕🏼", + "middle_finger_medium_skin_tone": "🖕🏽", + "military_medal": "🎖", + "milky_way": "🌌", + "minibus": "🚐", + "moai": "🗿", + "mobile_phone": "📱", + "mobile_phone_off": "📴", + "mobile_phone_with_arrow": "📲", + "money-mouth_face": "🤑", + "money_bag": "💰", + "money_with_wings": "💸", + "monkey": "🐒", + "monkey_face": "🐵", + "monorail": "🚝", + "moon_cake": "🥮", + "moon_viewing_ceremony": "🎑", + "mosque": "🕌", + "mosquito": "🦟", + "motor_boat": "🛥", + "motor_scooter": "🛵", + "motorcycle": "🏍", + "motorized_wheelchair": "🦼", + "motorway": "🛣", + "mount_fuji": "🗻", + "mountain": "⛰", + "mountain_cableway": "🚠", + "mountain_railway": "🚞", + "mouse": "🐭", + "mouse_face": "🐭", + "mouth": "👄", + "movie_camera": "🎥", + "mushroom": "🍄", + "musical_keyboard": "🎹", + "musical_note": "🎵", + "musical_notes": "🎶", + "musical_score": "🎼", + "muted_speaker": "🔇", + "nail_polish": "💅", + "nail_polish_dark_skin_tone": "💅🏿", + "nail_polish_light_skin_tone": "💅🏻", + "nail_polish_medium-dark_skin_tone": "💅🏾", + "nail_polish_medium-light_skin_tone": "💅🏼", + "nail_polish_medium_skin_tone": "💅🏽", + "name_badge": "📛", + "national_park": "🏞", + "nauseated_face": "🤢", + "nazar_amulet": "🧿", + "necktie": "👔", + "nerd_face": "🤓", + "neutral_face": "😐", + "new_moon": "🌑", + "new_moon_face": "🌚", + "newspaper": "📰", + "next_track_button": "⏭", + "night_with_stars": "🌃", + "nine-thirty": "🕤", + "nine_o’clock": "🕘", + "no_bicycles": "🚳", + "no_entry": "⛔", + "no_littering": "🚯", + "no_mobile_phones": "📵", + "no_one_under_eighteen": "🔞", + "no_pedestrians": "🚷", + "no_smoking": "🚭", + "non-potable_water": "🚱", + "nose": "👃", + "nose_dark_skin_tone": "👃🏿", + "nose_light_skin_tone": "👃🏻", + "nose_medium-dark_skin_tone": "👃🏾", + "nose_medium-light_skin_tone": "👃🏼", + "nose_medium_skin_tone": "👃🏽", + "notebook": "📓", + "notebook_with_decorative_cover": "📔", + "nut_and_bolt": "🔩", + "octopus": "🐙", + "oden": "🍢", + "office_building": "🏢", + "ogre": "👹", + "oil_drum": "🛢", + "old_key": "🗝", + "old_man": "👴", + "old_man_dark_skin_tone": "👴🏿", + "old_man_light_skin_tone": "👴🏻", + "old_man_medium-dark_skin_tone": "👴🏾", + "old_man_medium-light_skin_tone": "👴🏼", + "old_man_medium_skin_tone": "👴🏽", + "old_woman": "👵", + "old_woman_dark_skin_tone": "👵🏿", + "old_woman_light_skin_tone": "👵🏻", + "old_woman_medium-dark_skin_tone": "👵🏾", + "old_woman_medium-light_skin_tone": "👵🏼", + "old_woman_medium_skin_tone": "👵🏽", + "older_adult": "🧓", + "older_adult_dark_skin_tone": "🧓🏿", + "older_adult_light_skin_tone": "🧓🏻", + "older_adult_medium-dark_skin_tone": "🧓🏾", + "older_adult_medium-light_skin_tone": "🧓🏼", + "older_adult_medium_skin_tone": "🧓🏽", + "om": "🕉", + "oncoming_automobile": "🚘", + "oncoming_bus": "🚍", + "oncoming_fist": "👊", + "oncoming_fist_dark_skin_tone": "👊🏿", + "oncoming_fist_light_skin_tone": "👊🏻", + "oncoming_fist_medium-dark_skin_tone": "👊🏾", + "oncoming_fist_medium-light_skin_tone": "👊🏼", + "oncoming_fist_medium_skin_tone": "👊🏽", + "oncoming_police_car": "🚔", + "oncoming_taxi": "🚖", + "one-piece_swimsuit": "🩱", + "one-thirty": "🕜", + "one_o’clock": "🕐", + "onion": "🧅", + "open_book": "📖", + "open_file_folder": "📂", + "open_hands": "👐", + "open_hands_dark_skin_tone": "👐🏿", + "open_hands_light_skin_tone": "👐🏻", + "open_hands_medium-dark_skin_tone": "👐🏾", + "open_hands_medium-light_skin_tone": "👐🏼", + "open_hands_medium_skin_tone": "👐🏽", + "open_mailbox_with_lowered_flag": "📭", + "open_mailbox_with_raised_flag": "📬", + "optical_disk": "💿", + "orange_book": "📙", + "orange_circle": "🟠", + "orange_heart": "🧡", + "orange_square": "🟧", + "orangutan": "🦧", + "orthodox_cross": "☦", + "otter": "🦦", + "outbox_tray": "📤", + "owl": "🦉", + "ox": "🐂", + "oyster": "🦪", + "package": "📦", + "page_facing_up": "📄", + "page_with_curl": "📃", + "pager": "📟", + "paintbrush": "🖌", + "palm_tree": "🌴", + "palms_up_together": "🤲", + "palms_up_together_dark_skin_tone": "🤲🏿", + "palms_up_together_light_skin_tone": "🤲🏻", + "palms_up_together_medium-dark_skin_tone": "🤲🏾", + "palms_up_together_medium-light_skin_tone": "🤲🏼", + "palms_up_together_medium_skin_tone": "🤲🏽", + "pancakes": "🥞", + "panda_face": "🐼", + "paperclip": "📎", + "parrot": "🦜", + "part_alternation_mark": "〽", + "party_popper": "🎉", + "partying_face": "🥳", + "passenger_ship": "🛳", + "passport_control": "🛂", + "pause_button": "⏸", + "paw_prints": "🐾", + "peace_symbol": "☮", + "peach": "🍑", + "peacock": "🦚", + "peanuts": "🥜", + "pear": "🍐", + "pen": "🖊", + "pencil": "📝", + "penguin": "🐧", + "pensive_face": "😔", + "people_holding_hands": "🧑\u200d🤝\u200d🧑", + "people_with_bunny_ears": "👯", + "people_wrestling": "🤼", + "performing_arts": "🎭", + "persevering_face": "😣", + "person_biking": "🚴", + "person_biking_dark_skin_tone": "🚴🏿", + "person_biking_light_skin_tone": "🚴🏻", + "person_biking_medium-dark_skin_tone": "🚴🏾", + "person_biking_medium-light_skin_tone": "🚴🏼", + "person_biking_medium_skin_tone": "🚴🏽", + "person_bouncing_ball": "⛹", + "person_bouncing_ball_dark_skin_tone": "⛹🏿", + "person_bouncing_ball_light_skin_tone": "⛹🏻", + "person_bouncing_ball_medium-dark_skin_tone": "⛹🏾", + "person_bouncing_ball_medium-light_skin_tone": "⛹🏼", + "person_bouncing_ball_medium_skin_tone": "⛹🏽", + "person_bowing": "🙇", + "person_bowing_dark_skin_tone": "🙇🏿", + "person_bowing_light_skin_tone": "🙇🏻", + "person_bowing_medium-dark_skin_tone": "🙇🏾", + "person_bowing_medium-light_skin_tone": "🙇🏼", + "person_bowing_medium_skin_tone": "🙇🏽", + "person_cartwheeling": "🤸", + "person_cartwheeling_dark_skin_tone": "🤸🏿", + "person_cartwheeling_light_skin_tone": "🤸🏻", + "person_cartwheeling_medium-dark_skin_tone": "🤸🏾", + "person_cartwheeling_medium-light_skin_tone": "🤸🏼", + "person_cartwheeling_medium_skin_tone": "🤸🏽", + "person_climbing": "🧗", + "person_climbing_dark_skin_tone": "🧗🏿", + "person_climbing_light_skin_tone": "🧗🏻", + "person_climbing_medium-dark_skin_tone": "🧗🏾", + "person_climbing_medium-light_skin_tone": "🧗🏼", + "person_climbing_medium_skin_tone": "🧗🏽", + "person_facepalming": "🤦", + "person_facepalming_dark_skin_tone": "🤦🏿", + "person_facepalming_light_skin_tone": "🤦🏻", + "person_facepalming_medium-dark_skin_tone": "🤦🏾", + "person_facepalming_medium-light_skin_tone": "🤦🏼", + "person_facepalming_medium_skin_tone": "🤦🏽", + "person_fencing": "🤺", + "person_frowning": "🙍", + "person_frowning_dark_skin_tone": "🙍🏿", + "person_frowning_light_skin_tone": "🙍🏻", + "person_frowning_medium-dark_skin_tone": "🙍🏾", + "person_frowning_medium-light_skin_tone": "🙍🏼", + "person_frowning_medium_skin_tone": "🙍🏽", + "person_gesturing_no": "🙅", + "person_gesturing_no_dark_skin_tone": "🙅🏿", + "person_gesturing_no_light_skin_tone": "🙅🏻", + "person_gesturing_no_medium-dark_skin_tone": "🙅🏾", + "person_gesturing_no_medium-light_skin_tone": "🙅🏼", + "person_gesturing_no_medium_skin_tone": "🙅🏽", + "person_gesturing_ok": "🙆", + "person_gesturing_ok_dark_skin_tone": "🙆🏿", + "person_gesturing_ok_light_skin_tone": "🙆🏻", + "person_gesturing_ok_medium-dark_skin_tone": "🙆🏾", + "person_gesturing_ok_medium-light_skin_tone": "🙆🏼", + "person_gesturing_ok_medium_skin_tone": "🙆🏽", + "person_getting_haircut": "💇", + "person_getting_haircut_dark_skin_tone": "💇🏿", + "person_getting_haircut_light_skin_tone": "💇🏻", + "person_getting_haircut_medium-dark_skin_tone": "💇🏾", + "person_getting_haircut_medium-light_skin_tone": "💇🏼", + "person_getting_haircut_medium_skin_tone": "💇🏽", + "person_getting_massage": "💆", + "person_getting_massage_dark_skin_tone": "💆🏿", + "person_getting_massage_light_skin_tone": "💆🏻", + "person_getting_massage_medium-dark_skin_tone": "💆🏾", + "person_getting_massage_medium-light_skin_tone": "💆🏼", + "person_getting_massage_medium_skin_tone": "💆🏽", + "person_golfing": "🏌", + "person_golfing_dark_skin_tone": "🏌🏿", + "person_golfing_light_skin_tone": "🏌🏻", + "person_golfing_medium-dark_skin_tone": "🏌🏾", + "person_golfing_medium-light_skin_tone": "🏌🏼", + "person_golfing_medium_skin_tone": "🏌🏽", + "person_in_bed": "🛌", + "person_in_bed_dark_skin_tone": "🛌🏿", + "person_in_bed_light_skin_tone": "🛌🏻", + "person_in_bed_medium-dark_skin_tone": "🛌🏾", + "person_in_bed_medium-light_skin_tone": "🛌🏼", + "person_in_bed_medium_skin_tone": "🛌🏽", + "person_in_lotus_position": "🧘", + "person_in_lotus_position_dark_skin_tone": "🧘🏿", + "person_in_lotus_position_light_skin_tone": "🧘🏻", + "person_in_lotus_position_medium-dark_skin_tone": "🧘🏾", + "person_in_lotus_position_medium-light_skin_tone": "🧘🏼", + "person_in_lotus_position_medium_skin_tone": "🧘🏽", + "person_in_steamy_room": "🧖", + "person_in_steamy_room_dark_skin_tone": "🧖🏿", + "person_in_steamy_room_light_skin_tone": "🧖🏻", + "person_in_steamy_room_medium-dark_skin_tone": "🧖🏾", + "person_in_steamy_room_medium-light_skin_tone": "🧖🏼", + "person_in_steamy_room_medium_skin_tone": "🧖🏽", + "person_juggling": "🤹", + "person_juggling_dark_skin_tone": "🤹🏿", + "person_juggling_light_skin_tone": "🤹🏻", + "person_juggling_medium-dark_skin_tone": "🤹🏾", + "person_juggling_medium-light_skin_tone": "🤹🏼", + "person_juggling_medium_skin_tone": "🤹🏽", + "person_kneeling": "🧎", + "person_lifting_weights": "🏋", + "person_lifting_weights_dark_skin_tone": "🏋🏿", + "person_lifting_weights_light_skin_tone": "🏋🏻", + "person_lifting_weights_medium-dark_skin_tone": "🏋🏾", + "person_lifting_weights_medium-light_skin_tone": "🏋🏼", + "person_lifting_weights_medium_skin_tone": "🏋🏽", + "person_mountain_biking": "🚵", + "person_mountain_biking_dark_skin_tone": "🚵🏿", + "person_mountain_biking_light_skin_tone": "🚵🏻", + "person_mountain_biking_medium-dark_skin_tone": "🚵🏾", + "person_mountain_biking_medium-light_skin_tone": "🚵🏼", + "person_mountain_biking_medium_skin_tone": "🚵🏽", + "person_playing_handball": "🤾", + "person_playing_handball_dark_skin_tone": "🤾🏿", + "person_playing_handball_light_skin_tone": "🤾🏻", + "person_playing_handball_medium-dark_skin_tone": "🤾🏾", + "person_playing_handball_medium-light_skin_tone": "🤾🏼", + "person_playing_handball_medium_skin_tone": "🤾🏽", + "person_playing_water_polo": "🤽", + "person_playing_water_polo_dark_skin_tone": "🤽🏿", + "person_playing_water_polo_light_skin_tone": "🤽🏻", + "person_playing_water_polo_medium-dark_skin_tone": "🤽🏾", + "person_playing_water_polo_medium-light_skin_tone": "🤽🏼", + "person_playing_water_polo_medium_skin_tone": "🤽🏽", + "person_pouting": "🙎", + "person_pouting_dark_skin_tone": "🙎🏿", + "person_pouting_light_skin_tone": "🙎🏻", + "person_pouting_medium-dark_skin_tone": "🙎🏾", + "person_pouting_medium-light_skin_tone": "🙎🏼", + "person_pouting_medium_skin_tone": "🙎🏽", + "person_raising_hand": "🙋", + "person_raising_hand_dark_skin_tone": "🙋🏿", + "person_raising_hand_light_skin_tone": "🙋🏻", + "person_raising_hand_medium-dark_skin_tone": "🙋🏾", + "person_raising_hand_medium-light_skin_tone": "🙋🏼", + "person_raising_hand_medium_skin_tone": "🙋🏽", + "person_rowing_boat": "🚣", + "person_rowing_boat_dark_skin_tone": "🚣🏿", + "person_rowing_boat_light_skin_tone": "🚣🏻", + "person_rowing_boat_medium-dark_skin_tone": "🚣🏾", + "person_rowing_boat_medium-light_skin_tone": "🚣🏼", + "person_rowing_boat_medium_skin_tone": "🚣🏽", + "person_running": "🏃", + "person_running_dark_skin_tone": "🏃🏿", + "person_running_light_skin_tone": "🏃🏻", + "person_running_medium-dark_skin_tone": "🏃🏾", + "person_running_medium-light_skin_tone": "🏃🏼", + "person_running_medium_skin_tone": "🏃🏽", + "person_shrugging": "🤷", + "person_shrugging_dark_skin_tone": "🤷🏿", + "person_shrugging_light_skin_tone": "🤷🏻", + "person_shrugging_medium-dark_skin_tone": "🤷🏾", + "person_shrugging_medium-light_skin_tone": "🤷🏼", + "person_shrugging_medium_skin_tone": "🤷🏽", + "person_standing": "🧍", + "person_surfing": "🏄", + "person_surfing_dark_skin_tone": "🏄🏿", + "person_surfing_light_skin_tone": "🏄🏻", + "person_surfing_medium-dark_skin_tone": "🏄🏾", + "person_surfing_medium-light_skin_tone": "🏄🏼", + "person_surfing_medium_skin_tone": "🏄🏽", + "person_swimming": "🏊", + "person_swimming_dark_skin_tone": "🏊🏿", + "person_swimming_light_skin_tone": "🏊🏻", + "person_swimming_medium-dark_skin_tone": "🏊🏾", + "person_swimming_medium-light_skin_tone": "🏊🏼", + "person_swimming_medium_skin_tone": "🏊🏽", + "person_taking_bath": "🛀", + "person_taking_bath_dark_skin_tone": "🛀🏿", + "person_taking_bath_light_skin_tone": "🛀🏻", + "person_taking_bath_medium-dark_skin_tone": "🛀🏾", + "person_taking_bath_medium-light_skin_tone": "🛀🏼", + "person_taking_bath_medium_skin_tone": "🛀🏽", + "person_tipping_hand": "💁", + "person_tipping_hand_dark_skin_tone": "💁🏿", + "person_tipping_hand_light_skin_tone": "💁🏻", + "person_tipping_hand_medium-dark_skin_tone": "💁🏾", + "person_tipping_hand_medium-light_skin_tone": "💁🏼", + "person_tipping_hand_medium_skin_tone": "💁🏽", + "person_walking": "🚶", + "person_walking_dark_skin_tone": "🚶🏿", + "person_walking_light_skin_tone": "🚶🏻", + "person_walking_medium-dark_skin_tone": "🚶🏾", + "person_walking_medium-light_skin_tone": "🚶🏼", + "person_walking_medium_skin_tone": "🚶🏽", + "person_wearing_turban": "👳", + "person_wearing_turban_dark_skin_tone": "👳🏿", + "person_wearing_turban_light_skin_tone": "👳🏻", + "person_wearing_turban_medium-dark_skin_tone": "👳🏾", + "person_wearing_turban_medium-light_skin_tone": "👳🏼", + "person_wearing_turban_medium_skin_tone": "👳🏽", + "petri_dish": "🧫", + "pick": "⛏", + "pie": "🥧", + "pig": "🐷", + "pig_face": "🐷", + "pig_nose": "🐽", + "pile_of_poo": "💩", + "pill": "💊", + "pinching_hand": "🤏", + "pine_decoration": "🎍", + "pineapple": "🍍", + "ping_pong": "🏓", + "pirate_flag": "🏴\u200d☠️", + "pistol": "🔫", + "pizza": "🍕", + "place_of_worship": "🛐", + "play_button": "▶", + "play_or_pause_button": "⏯", + "pleading_face": "🥺", + "police_car": "🚓", + "police_car_light": "🚨", + "police_officer": "👮", + "police_officer_dark_skin_tone": "👮🏿", + "police_officer_light_skin_tone": "👮🏻", + "police_officer_medium-dark_skin_tone": "👮🏾", + "police_officer_medium-light_skin_tone": "👮🏼", + "police_officer_medium_skin_tone": "👮🏽", + "poodle": "🐩", + "pool_8_ball": "🎱", + "popcorn": "🍿", + "post_office": "🏣", + "postal_horn": "📯", + "postbox": "📮", + "pot_of_food": "🍲", + "potable_water": "🚰", + "potato": "🥔", + "poultry_leg": "🍗", + "pound_banknote": "💷", + "pouting_cat_face": "😾", + "pouting_face": "😡", + "prayer_beads": "📿", + "pregnant_woman": "🤰", + "pregnant_woman_dark_skin_tone": "🤰🏿", + "pregnant_woman_light_skin_tone": "🤰🏻", + "pregnant_woman_medium-dark_skin_tone": "🤰🏾", + "pregnant_woman_medium-light_skin_tone": "🤰🏼", + "pregnant_woman_medium_skin_tone": "🤰🏽", + "pretzel": "🥨", + "probing_cane": "🦯", + "prince": "🤴", + "prince_dark_skin_tone": "🤴🏿", + "prince_light_skin_tone": "🤴🏻", + "prince_medium-dark_skin_tone": "🤴🏾", + "prince_medium-light_skin_tone": "🤴🏼", + "prince_medium_skin_tone": "🤴🏽", + "princess": "👸", + "princess_dark_skin_tone": "👸🏿", + "princess_light_skin_tone": "👸🏻", + "princess_medium-dark_skin_tone": "👸🏾", + "princess_medium-light_skin_tone": "👸🏼", + "princess_medium_skin_tone": "👸🏽", + "printer": "🖨", + "prohibited": "🚫", + "purple_circle": "🟣", + "purple_heart": "💜", + "purple_square": "🟪", + "purse": "👛", + "pushpin": "📌", + "question_mark": "❓", + "rabbit": "🐰", + "rabbit_face": "🐰", + "raccoon": "🦝", + "racing_car": "🏎", + "radio": "📻", + "radio_button": "🔘", + "radioactive": "☢", + "railway_car": "🚃", + "railway_track": "🛤", + "rainbow": "🌈", + "rainbow_flag": "🏳️\u200d🌈", + "raised_back_of_hand": "🤚", + "raised_back_of_hand_dark_skin_tone": "🤚🏿", + "raised_back_of_hand_light_skin_tone": "🤚🏻", + "raised_back_of_hand_medium-dark_skin_tone": "🤚🏾", + "raised_back_of_hand_medium-light_skin_tone": "🤚🏼", + "raised_back_of_hand_medium_skin_tone": "🤚🏽", + "raised_fist": "✊", + "raised_fist_dark_skin_tone": "✊🏿", + "raised_fist_light_skin_tone": "✊🏻", + "raised_fist_medium-dark_skin_tone": "✊🏾", + "raised_fist_medium-light_skin_tone": "✊🏼", + "raised_fist_medium_skin_tone": "✊🏽", + "raised_hand": "✋", + "raised_hand_dark_skin_tone": "✋🏿", + "raised_hand_light_skin_tone": "✋🏻", + "raised_hand_medium-dark_skin_tone": "✋🏾", + "raised_hand_medium-light_skin_tone": "✋🏼", + "raised_hand_medium_skin_tone": "✋🏽", + "raising_hands": "🙌", + "raising_hands_dark_skin_tone": "🙌🏿", + "raising_hands_light_skin_tone": "🙌🏻", + "raising_hands_medium-dark_skin_tone": "🙌🏾", + "raising_hands_medium-light_skin_tone": "🙌🏼", + "raising_hands_medium_skin_tone": "🙌🏽", + "ram": "🐏", + "rat": "🐀", + "razor": "🪒", + "ringed_planet": "🪐", + "receipt": "🧾", + "record_button": "⏺", + "recycling_symbol": "♻", + "red_apple": "🍎", + "red_circle": "🔴", + "red_envelope": "🧧", + "red_hair": "🦰", + "red-haired_man": "👨\u200d🦰", + "red-haired_woman": "👩\u200d🦰", + "red_heart": "❤", + "red_paper_lantern": "🏮", + "red_square": "🟥", + "red_triangle_pointed_down": "🔻", + "red_triangle_pointed_up": "🔺", + "registered": "®", + "relieved_face": "😌", + "reminder_ribbon": "🎗", + "repeat_button": "🔁", + "repeat_single_button": "🔂", + "rescue_worker’s_helmet": "⛑", + "restroom": "🚻", + "reverse_button": "◀", + "revolving_hearts": "💞", + "rhinoceros": "🦏", + "ribbon": "🎀", + "rice_ball": "🍙", + "rice_cracker": "🍘", + "right-facing_fist": "🤜", + "right-facing_fist_dark_skin_tone": "🤜🏿", + "right-facing_fist_light_skin_tone": "🤜🏻", + "right-facing_fist_medium-dark_skin_tone": "🤜🏾", + "right-facing_fist_medium-light_skin_tone": "🤜🏼", + "right-facing_fist_medium_skin_tone": "🤜🏽", + "right_anger_bubble": "🗯", + "right_arrow": "➡", + "right_arrow_curving_down": "⤵", + "right_arrow_curving_left": "↩", + "right_arrow_curving_up": "⤴", + "ring": "💍", + "roasted_sweet_potato": "🍠", + "robot_face": "🤖", + "rocket": "🚀", + "roll_of_paper": "🧻", + "rolled-up_newspaper": "🗞", + "roller_coaster": "🎢", + "rolling_on_the_floor_laughing": "🤣", + "rooster": "🐓", + "rose": "🌹", + "rosette": "🏵", + "round_pushpin": "📍", + "rugby_football": "🏉", + "running_shirt": "🎽", + "running_shoe": "👟", + "sad_but_relieved_face": "😥", + "safety_pin": "🧷", + "safety_vest": "🦺", + "salt": "🧂", + "sailboat": "⛵", + "sake": "🍶", + "sandwich": "🥪", + "sari": "🥻", + "satellite": "📡", + "satellite_antenna": "📡", + "sauropod": "🦕", + "saxophone": "🎷", + "scarf": "🧣", + "school": "🏫", + "school_backpack": "🎒", + "scissors": "✂", + "scorpion": "🦂", + "scroll": "📜", + "seat": "💺", + "see-no-evil_monkey": "🙈", + "seedling": "🌱", + "selfie": "🤳", + "selfie_dark_skin_tone": "🤳🏿", + "selfie_light_skin_tone": "🤳🏻", + "selfie_medium-dark_skin_tone": "🤳🏾", + "selfie_medium-light_skin_tone": "🤳🏼", + "selfie_medium_skin_tone": "🤳🏽", + "service_dog": "🐕\u200d🦺", + "seven-thirty": "🕢", + "seven_o’clock": "🕖", + "shallow_pan_of_food": "🥘", + "shamrock": "☘", + "shark": "🦈", + "shaved_ice": "🍧", + "sheaf_of_rice": "🌾", + "shield": "🛡", + "shinto_shrine": "⛩", + "ship": "🚢", + "shooting_star": "🌠", + "shopping_bags": "🛍", + "shopping_cart": "🛒", + "shortcake": "🍰", + "shorts": "🩳", + "shower": "🚿", + "shrimp": "🦐", + "shuffle_tracks_button": "🔀", + "shushing_face": "🤫", + "sign_of_the_horns": "🤘", + "sign_of_the_horns_dark_skin_tone": "🤘🏿", + "sign_of_the_horns_light_skin_tone": "🤘🏻", + "sign_of_the_horns_medium-dark_skin_tone": "🤘🏾", + "sign_of_the_horns_medium-light_skin_tone": "🤘🏼", + "sign_of_the_horns_medium_skin_tone": "🤘🏽", + "six-thirty": "🕡", + "six_o’clock": "🕕", + "skateboard": "🛹", + "skier": "⛷", + "skis": "🎿", + "skull": "💀", + "skull_and_crossbones": "☠", + "skunk": "🦨", + "sled": "🛷", + "sleeping_face": "😴", + "sleepy_face": "😪", + "slightly_frowning_face": "🙁", + "slightly_smiling_face": "🙂", + "slot_machine": "🎰", + "sloth": "🦥", + "small_airplane": "🛩", + "small_blue_diamond": "🔹", + "small_orange_diamond": "🔸", + "smiling_cat_face_with_heart-eyes": "😻", + "smiling_face": "☺", + "smiling_face_with_halo": "😇", + "smiling_face_with_3_hearts": "🥰", + "smiling_face_with_heart-eyes": "😍", + "smiling_face_with_horns": "😈", + "smiling_face_with_smiling_eyes": "😊", + "smiling_face_with_sunglasses": "😎", + "smirking_face": "😏", + "snail": "🐌", + "snake": "🐍", + "sneezing_face": "🤧", + "snow-capped_mountain": "🏔", + "snowboarder": "🏂", + "snowboarder_dark_skin_tone": "🏂🏿", + "snowboarder_light_skin_tone": "🏂🏻", + "snowboarder_medium-dark_skin_tone": "🏂🏾", + "snowboarder_medium-light_skin_tone": "🏂🏼", + "snowboarder_medium_skin_tone": "🏂🏽", + "snowflake": "❄", + "snowman": "☃", + "snowman_without_snow": "⛄", + "soap": "🧼", + "soccer_ball": "⚽", + "socks": "🧦", + "softball": "🥎", + "soft_ice_cream": "🍦", + "spade_suit": "♠", + "spaghetti": "🍝", + "sparkle": "❇", + "sparkler": "🎇", + "sparkles": "✨", + "sparkling_heart": "💖", + "speak-no-evil_monkey": "🙊", + "speaker_high_volume": "🔊", + "speaker_low_volume": "🔈", + "speaker_medium_volume": "🔉", + "speaking_head": "🗣", + "speech_balloon": "💬", + "speedboat": "🚤", + "spider": "🕷", + "spider_web": "🕸", + "spiral_calendar": "🗓", + "spiral_notepad": "🗒", + "spiral_shell": "🐚", + "spoon": "🥄", + "sponge": "🧽", + "sport_utility_vehicle": "🚙", + "sports_medal": "🏅", + "spouting_whale": "🐳", + "squid": "🦑", + "squinting_face_with_tongue": "😝", + "stadium": "🏟", + "star-struck": "🤩", + "star_and_crescent": "☪", + "star_of_david": "✡", + "station": "🚉", + "steaming_bowl": "🍜", + "stethoscope": "🩺", + "stop_button": "⏹", + "stop_sign": "🛑", + "stopwatch": "⏱", + "straight_ruler": "📏", + "strawberry": "🍓", + "studio_microphone": "🎙", + "stuffed_flatbread": "🥙", + "sun": "☀", + "sun_behind_cloud": "⛅", + "sun_behind_large_cloud": "🌥", + "sun_behind_rain_cloud": "🌦", + "sun_behind_small_cloud": "🌤", + "sun_with_face": "🌞", + "sunflower": "🌻", + "sunglasses": "😎", + "sunrise": "🌅", + "sunrise_over_mountains": "🌄", + "sunset": "🌇", + "superhero": "🦸", + "supervillain": "🦹", + "sushi": "🍣", + "suspension_railway": "🚟", + "swan": "🦢", + "sweat_droplets": "💦", + "synagogue": "🕍", + "syringe": "💉", + "t-shirt": "👕", + "taco": "🌮", + "takeout_box": "🥡", + "tanabata_tree": "🎋", + "tangerine": "🍊", + "taxi": "🚕", + "teacup_without_handle": "🍵", + "tear-off_calendar": "📆", + "teddy_bear": "🧸", + "telephone": "☎", + "telephone_receiver": "📞", + "telescope": "🔭", + "television": "📺", + "ten-thirty": "🕥", + "ten_o’clock": "🕙", + "tennis": "🎾", + "tent": "⛺", + "test_tube": "🧪", + "thermometer": "🌡", + "thinking_face": "🤔", + "thought_balloon": "💭", + "thread": "🧵", + "three-thirty": "🕞", + "three_o’clock": "🕒", + "thumbs_down": "👎", + "thumbs_down_dark_skin_tone": "👎🏿", + "thumbs_down_light_skin_tone": "👎🏻", + "thumbs_down_medium-dark_skin_tone": "👎🏾", + "thumbs_down_medium-light_skin_tone": "👎🏼", + "thumbs_down_medium_skin_tone": "👎🏽", + "thumbs_up": "👍", + "thumbs_up_dark_skin_tone": "👍🏿", + "thumbs_up_light_skin_tone": "👍🏻", + "thumbs_up_medium-dark_skin_tone": "👍🏾", + "thumbs_up_medium-light_skin_tone": "👍🏼", + "thumbs_up_medium_skin_tone": "👍🏽", + "ticket": "🎫", + "tiger": "🐯", + "tiger_face": "🐯", + "timer_clock": "⏲", + "tired_face": "😫", + "toolbox": "🧰", + "toilet": "🚽", + "tomato": "🍅", + "tongue": "👅", + "tooth": "🦷", + "top_hat": "🎩", + "tornado": "🌪", + "trackball": "🖲", + "tractor": "🚜", + "trade_mark": "™", + "train": "🚋", + "tram": "🚊", + "tram_car": "🚋", + "triangular_flag": "🚩", + "triangular_ruler": "📐", + "trident_emblem": "🔱", + "trolleybus": "🚎", + "trophy": "🏆", + "tropical_drink": "🍹", + "tropical_fish": "🐠", + "trumpet": "🎺", + "tulip": "🌷", + "tumbler_glass": "🥃", + "turtle": "🐢", + "twelve-thirty": "🕧", + "twelve_o’clock": "🕛", + "two-hump_camel": "🐫", + "two-thirty": "🕝", + "two_hearts": "💕", + "two_men_holding_hands": "👬", + "two_o’clock": "🕑", + "two_women_holding_hands": "👭", + "umbrella": "☂", + "umbrella_on_ground": "⛱", + "umbrella_with_rain_drops": "☔", + "unamused_face": "😒", + "unicorn_face": "🦄", + "unlocked": "🔓", + "up-down_arrow": "↕", + "up-left_arrow": "↖", + "up-right_arrow": "↗", + "up_arrow": "⬆", + "upside-down_face": "🙃", + "upwards_button": "🔼", + "vampire": "🧛", + "vampire_dark_skin_tone": "🧛🏿", + "vampire_light_skin_tone": "🧛🏻", + "vampire_medium-dark_skin_tone": "🧛🏾", + "vampire_medium-light_skin_tone": "🧛🏼", + "vampire_medium_skin_tone": "🧛🏽", + "vertical_traffic_light": "🚦", + "vibration_mode": "📳", + "victory_hand": "✌", + "victory_hand_dark_skin_tone": "✌🏿", + "victory_hand_light_skin_tone": "✌🏻", + "victory_hand_medium-dark_skin_tone": "✌🏾", + "victory_hand_medium-light_skin_tone": "✌🏼", + "victory_hand_medium_skin_tone": "✌🏽", + "video_camera": "📹", + "video_game": "🎮", + "videocassette": "📼", + "violin": "🎻", + "volcano": "🌋", + "volleyball": "🏐", + "vulcan_salute": "🖖", + "vulcan_salute_dark_skin_tone": "🖖🏿", + "vulcan_salute_light_skin_tone": "🖖🏻", + "vulcan_salute_medium-dark_skin_tone": "🖖🏾", + "vulcan_salute_medium-light_skin_tone": "🖖🏼", + "vulcan_salute_medium_skin_tone": "🖖🏽", + "waffle": "🧇", + "waning_crescent_moon": "🌘", + "waning_gibbous_moon": "🌖", + "warning": "⚠", + "wastebasket": "🗑", + "watch": "⌚", + "water_buffalo": "🐃", + "water_closet": "🚾", + "water_wave": "🌊", + "watermelon": "🍉", + "waving_hand": "👋", + "waving_hand_dark_skin_tone": "👋🏿", + "waving_hand_light_skin_tone": "👋🏻", + "waving_hand_medium-dark_skin_tone": "👋🏾", + "waving_hand_medium-light_skin_tone": "👋🏼", + "waving_hand_medium_skin_tone": "👋🏽", + "wavy_dash": "〰", + "waxing_crescent_moon": "🌒", + "waxing_gibbous_moon": "🌔", + "weary_cat_face": "🙀", + "weary_face": "😩", + "wedding": "💒", + "whale": "🐳", + "wheel_of_dharma": "☸", + "wheelchair_symbol": "♿", + "white_circle": "⚪", + "white_exclamation_mark": "❕", + "white_flag": "🏳", + "white_flower": "💮", + "white_hair": "🦳", + "white-haired_man": "👨\u200d🦳", + "white-haired_woman": "👩\u200d🦳", + "white_heart": "🤍", + "white_heavy_check_mark": "✅", + "white_large_square": "⬜", + "white_medium-small_square": "◽", + "white_medium_square": "◻", + "white_medium_star": "⭐", + "white_question_mark": "❔", + "white_small_square": "▫", + "white_square_button": "🔳", + "wilted_flower": "🥀", + "wind_chime": "🎐", + "wind_face": "🌬", + "wine_glass": "🍷", + "winking_face": "😉", + "winking_face_with_tongue": "😜", + "wolf_face": "🐺", + "woman": "👩", + "woman_artist": "👩\u200d🎨", + "woman_artist_dark_skin_tone": "👩🏿\u200d🎨", + "woman_artist_light_skin_tone": "👩🏻\u200d🎨", + "woman_artist_medium-dark_skin_tone": "👩🏾\u200d🎨", + "woman_artist_medium-light_skin_tone": "👩🏼\u200d🎨", + "woman_artist_medium_skin_tone": "👩🏽\u200d🎨", + "woman_astronaut": "👩\u200d🚀", + "woman_astronaut_dark_skin_tone": "👩🏿\u200d🚀", + "woman_astronaut_light_skin_tone": "👩🏻\u200d🚀", + "woman_astronaut_medium-dark_skin_tone": "👩🏾\u200d🚀", + "woman_astronaut_medium-light_skin_tone": "👩🏼\u200d🚀", + "woman_astronaut_medium_skin_tone": "👩🏽\u200d🚀", + "woman_biking": "🚴\u200d♀️", + "woman_biking_dark_skin_tone": "🚴🏿\u200d♀️", + "woman_biking_light_skin_tone": "🚴🏻\u200d♀️", + "woman_biking_medium-dark_skin_tone": "🚴🏾\u200d♀️", + "woman_biking_medium-light_skin_tone": "🚴🏼\u200d♀️", + "woman_biking_medium_skin_tone": "🚴🏽\u200d♀️", + "woman_bouncing_ball": "⛹️\u200d♀️", + "woman_bouncing_ball_dark_skin_tone": "⛹🏿\u200d♀️", + "woman_bouncing_ball_light_skin_tone": "⛹🏻\u200d♀️", + "woman_bouncing_ball_medium-dark_skin_tone": "⛹🏾\u200d♀️", + "woman_bouncing_ball_medium-light_skin_tone": "⛹🏼\u200d♀️", + "woman_bouncing_ball_medium_skin_tone": "⛹🏽\u200d♀️", + "woman_bowing": "🙇\u200d♀️", + "woman_bowing_dark_skin_tone": "🙇🏿\u200d♀️", + "woman_bowing_light_skin_tone": "🙇🏻\u200d♀️", + "woman_bowing_medium-dark_skin_tone": "🙇🏾\u200d♀️", + "woman_bowing_medium-light_skin_tone": "🙇🏼\u200d♀️", + "woman_bowing_medium_skin_tone": "🙇🏽\u200d♀️", + "woman_cartwheeling": "🤸\u200d♀️", + "woman_cartwheeling_dark_skin_tone": "🤸🏿\u200d♀️", + "woman_cartwheeling_light_skin_tone": "🤸🏻\u200d♀️", + "woman_cartwheeling_medium-dark_skin_tone": "🤸🏾\u200d♀️", + "woman_cartwheeling_medium-light_skin_tone": "🤸🏼\u200d♀️", + "woman_cartwheeling_medium_skin_tone": "🤸🏽\u200d♀️", + "woman_climbing": "🧗\u200d♀️", + "woman_climbing_dark_skin_tone": "🧗🏿\u200d♀️", + "woman_climbing_light_skin_tone": "🧗🏻\u200d♀️", + "woman_climbing_medium-dark_skin_tone": "🧗🏾\u200d♀️", + "woman_climbing_medium-light_skin_tone": "🧗🏼\u200d♀️", + "woman_climbing_medium_skin_tone": "🧗🏽\u200d♀️", + "woman_construction_worker": "👷\u200d♀️", + "woman_construction_worker_dark_skin_tone": "👷🏿\u200d♀️", + "woman_construction_worker_light_skin_tone": "👷🏻\u200d♀️", + "woman_construction_worker_medium-dark_skin_tone": "👷🏾\u200d♀️", + "woman_construction_worker_medium-light_skin_tone": "👷🏼\u200d♀️", + "woman_construction_worker_medium_skin_tone": "👷🏽\u200d♀️", + "woman_cook": "👩\u200d🍳", + "woman_cook_dark_skin_tone": "👩🏿\u200d🍳", + "woman_cook_light_skin_tone": "👩🏻\u200d🍳", + "woman_cook_medium-dark_skin_tone": "👩🏾\u200d🍳", + "woman_cook_medium-light_skin_tone": "👩🏼\u200d🍳", + "woman_cook_medium_skin_tone": "👩🏽\u200d🍳", + "woman_dancing": "💃", + "woman_dancing_dark_skin_tone": "💃🏿", + "woman_dancing_light_skin_tone": "💃🏻", + "woman_dancing_medium-dark_skin_tone": "💃🏾", + "woman_dancing_medium-light_skin_tone": "💃🏼", + "woman_dancing_medium_skin_tone": "💃🏽", + "woman_dark_skin_tone": "👩🏿", + "woman_detective": "🕵️\u200d♀️", + "woman_detective_dark_skin_tone": "🕵🏿\u200d♀️", + "woman_detective_light_skin_tone": "🕵🏻\u200d♀️", + "woman_detective_medium-dark_skin_tone": "🕵🏾\u200d♀️", + "woman_detective_medium-light_skin_tone": "🕵🏼\u200d♀️", + "woman_detective_medium_skin_tone": "🕵🏽\u200d♀️", + "woman_elf": "🧝\u200d♀️", + "woman_elf_dark_skin_tone": "🧝🏿\u200d♀️", + "woman_elf_light_skin_tone": "🧝🏻\u200d♀️", + "woman_elf_medium-dark_skin_tone": "🧝🏾\u200d♀️", + "woman_elf_medium-light_skin_tone": "🧝🏼\u200d♀️", + "woman_elf_medium_skin_tone": "🧝🏽\u200d♀️", + "woman_facepalming": "🤦\u200d♀️", + "woman_facepalming_dark_skin_tone": "🤦🏿\u200d♀️", + "woman_facepalming_light_skin_tone": "🤦🏻\u200d♀️", + "woman_facepalming_medium-dark_skin_tone": "🤦🏾\u200d♀️", + "woman_facepalming_medium-light_skin_tone": "🤦🏼\u200d♀️", + "woman_facepalming_medium_skin_tone": "🤦🏽\u200d♀️", + "woman_factory_worker": "👩\u200d🏭", + "woman_factory_worker_dark_skin_tone": "👩🏿\u200d🏭", + "woman_factory_worker_light_skin_tone": "👩🏻\u200d🏭", + "woman_factory_worker_medium-dark_skin_tone": "👩🏾\u200d🏭", + "woman_factory_worker_medium-light_skin_tone": "👩🏼\u200d🏭", + "woman_factory_worker_medium_skin_tone": "👩🏽\u200d🏭", + "woman_fairy": "🧚\u200d♀️", + "woman_fairy_dark_skin_tone": "🧚🏿\u200d♀️", + "woman_fairy_light_skin_tone": "🧚🏻\u200d♀️", + "woman_fairy_medium-dark_skin_tone": "🧚🏾\u200d♀️", + "woman_fairy_medium-light_skin_tone": "🧚🏼\u200d♀️", + "woman_fairy_medium_skin_tone": "🧚🏽\u200d♀️", + "woman_farmer": "👩\u200d🌾", + "woman_farmer_dark_skin_tone": "👩🏿\u200d🌾", + "woman_farmer_light_skin_tone": "👩🏻\u200d🌾", + "woman_farmer_medium-dark_skin_tone": "👩🏾\u200d🌾", + "woman_farmer_medium-light_skin_tone": "👩🏼\u200d🌾", + "woman_farmer_medium_skin_tone": "👩🏽\u200d🌾", + "woman_firefighter": "👩\u200d🚒", + "woman_firefighter_dark_skin_tone": "👩🏿\u200d🚒", + "woman_firefighter_light_skin_tone": "👩🏻\u200d🚒", + "woman_firefighter_medium-dark_skin_tone": "👩🏾\u200d🚒", + "woman_firefighter_medium-light_skin_tone": "👩🏼\u200d🚒", + "woman_firefighter_medium_skin_tone": "👩🏽\u200d🚒", + "woman_frowning": "🙍\u200d♀️", + "woman_frowning_dark_skin_tone": "🙍🏿\u200d♀️", + "woman_frowning_light_skin_tone": "🙍🏻\u200d♀️", + "woman_frowning_medium-dark_skin_tone": "🙍🏾\u200d♀️", + "woman_frowning_medium-light_skin_tone": "🙍🏼\u200d♀️", + "woman_frowning_medium_skin_tone": "🙍🏽\u200d♀️", + "woman_genie": "🧞\u200d♀️", + "woman_gesturing_no": "🙅\u200d♀️", + "woman_gesturing_no_dark_skin_tone": "🙅🏿\u200d♀️", + "woman_gesturing_no_light_skin_tone": "🙅🏻\u200d♀️", + "woman_gesturing_no_medium-dark_skin_tone": "🙅🏾\u200d♀️", + "woman_gesturing_no_medium-light_skin_tone": "🙅🏼\u200d♀️", + "woman_gesturing_no_medium_skin_tone": "🙅🏽\u200d♀️", + "woman_gesturing_ok": "🙆\u200d♀️", + "woman_gesturing_ok_dark_skin_tone": "🙆🏿\u200d♀️", + "woman_gesturing_ok_light_skin_tone": "🙆🏻\u200d♀️", + "woman_gesturing_ok_medium-dark_skin_tone": "🙆🏾\u200d♀️", + "woman_gesturing_ok_medium-light_skin_tone": "🙆🏼\u200d♀️", + "woman_gesturing_ok_medium_skin_tone": "🙆🏽\u200d♀️", + "woman_getting_haircut": "💇\u200d♀️", + "woman_getting_haircut_dark_skin_tone": "💇🏿\u200d♀️", + "woman_getting_haircut_light_skin_tone": "💇🏻\u200d♀️", + "woman_getting_haircut_medium-dark_skin_tone": "💇🏾\u200d♀️", + "woman_getting_haircut_medium-light_skin_tone": "💇🏼\u200d♀️", + "woman_getting_haircut_medium_skin_tone": "💇🏽\u200d♀️", + "woman_getting_massage": "💆\u200d♀️", + "woman_getting_massage_dark_skin_tone": "💆🏿\u200d♀️", + "woman_getting_massage_light_skin_tone": "💆🏻\u200d♀️", + "woman_getting_massage_medium-dark_skin_tone": "💆🏾\u200d♀️", + "woman_getting_massage_medium-light_skin_tone": "💆🏼\u200d♀️", + "woman_getting_massage_medium_skin_tone": "💆🏽\u200d♀️", + "woman_golfing": "🏌️\u200d♀️", + "woman_golfing_dark_skin_tone": "🏌🏿\u200d♀️", + "woman_golfing_light_skin_tone": "🏌🏻\u200d♀️", + "woman_golfing_medium-dark_skin_tone": "🏌🏾\u200d♀️", + "woman_golfing_medium-light_skin_tone": "🏌🏼\u200d♀️", + "woman_golfing_medium_skin_tone": "🏌🏽\u200d♀️", + "woman_guard": "💂\u200d♀️", + "woman_guard_dark_skin_tone": "💂🏿\u200d♀️", + "woman_guard_light_skin_tone": "💂🏻\u200d♀️", + "woman_guard_medium-dark_skin_tone": "💂🏾\u200d♀️", + "woman_guard_medium-light_skin_tone": "💂🏼\u200d♀️", + "woman_guard_medium_skin_tone": "💂🏽\u200d♀️", + "woman_health_worker": "👩\u200d⚕️", + "woman_health_worker_dark_skin_tone": "👩🏿\u200d⚕️", + "woman_health_worker_light_skin_tone": "👩🏻\u200d⚕️", + "woman_health_worker_medium-dark_skin_tone": "👩🏾\u200d⚕️", + "woman_health_worker_medium-light_skin_tone": "👩🏼\u200d⚕️", + "woman_health_worker_medium_skin_tone": "👩🏽\u200d⚕️", + "woman_in_lotus_position": "🧘\u200d♀️", + "woman_in_lotus_position_dark_skin_tone": "🧘🏿\u200d♀️", + "woman_in_lotus_position_light_skin_tone": "🧘🏻\u200d♀️", + "woman_in_lotus_position_medium-dark_skin_tone": "🧘🏾\u200d♀️", + "woman_in_lotus_position_medium-light_skin_tone": "🧘🏼\u200d♀️", + "woman_in_lotus_position_medium_skin_tone": "🧘🏽\u200d♀️", + "woman_in_manual_wheelchair": "👩\u200d🦽", + "woman_in_motorized_wheelchair": "👩\u200d🦼", + "woman_in_steamy_room": "🧖\u200d♀️", + "woman_in_steamy_room_dark_skin_tone": "🧖🏿\u200d♀️", + "woman_in_steamy_room_light_skin_tone": "🧖🏻\u200d♀️", + "woman_in_steamy_room_medium-dark_skin_tone": "🧖🏾\u200d♀️", + "woman_in_steamy_room_medium-light_skin_tone": "🧖🏼\u200d♀️", + "woman_in_steamy_room_medium_skin_tone": "🧖🏽\u200d♀️", + "woman_judge": "👩\u200d⚖️", + "woman_judge_dark_skin_tone": "👩🏿\u200d⚖️", + "woman_judge_light_skin_tone": "👩🏻\u200d⚖️", + "woman_judge_medium-dark_skin_tone": "👩🏾\u200d⚖️", + "woman_judge_medium-light_skin_tone": "👩🏼\u200d⚖️", + "woman_judge_medium_skin_tone": "👩🏽\u200d⚖️", + "woman_juggling": "🤹\u200d♀️", + "woman_juggling_dark_skin_tone": "🤹🏿\u200d♀️", + "woman_juggling_light_skin_tone": "🤹🏻\u200d♀️", + "woman_juggling_medium-dark_skin_tone": "🤹🏾\u200d♀️", + "woman_juggling_medium-light_skin_tone": "🤹🏼\u200d♀️", + "woman_juggling_medium_skin_tone": "🤹🏽\u200d♀️", + "woman_lifting_weights": "🏋️\u200d♀️", + "woman_lifting_weights_dark_skin_tone": "🏋🏿\u200d♀️", + "woman_lifting_weights_light_skin_tone": "🏋🏻\u200d♀️", + "woman_lifting_weights_medium-dark_skin_tone": "🏋🏾\u200d♀️", + "woman_lifting_weights_medium-light_skin_tone": "🏋🏼\u200d♀️", + "woman_lifting_weights_medium_skin_tone": "🏋🏽\u200d♀️", + "woman_light_skin_tone": "👩🏻", + "woman_mage": "🧙\u200d♀️", + "woman_mage_dark_skin_tone": "🧙🏿\u200d♀️", + "woman_mage_light_skin_tone": "🧙🏻\u200d♀️", + "woman_mage_medium-dark_skin_tone": "🧙🏾\u200d♀️", + "woman_mage_medium-light_skin_tone": "🧙🏼\u200d♀️", + "woman_mage_medium_skin_tone": "🧙🏽\u200d♀️", + "woman_mechanic": "👩\u200d🔧", + "woman_mechanic_dark_skin_tone": "👩🏿\u200d🔧", + "woman_mechanic_light_skin_tone": "👩🏻\u200d🔧", + "woman_mechanic_medium-dark_skin_tone": "👩🏾\u200d🔧", + "woman_mechanic_medium-light_skin_tone": "👩🏼\u200d🔧", + "woman_mechanic_medium_skin_tone": "👩🏽\u200d🔧", + "woman_medium-dark_skin_tone": "👩🏾", + "woman_medium-light_skin_tone": "👩🏼", + "woman_medium_skin_tone": "👩🏽", + "woman_mountain_biking": "🚵\u200d♀️", + "woman_mountain_biking_dark_skin_tone": "🚵🏿\u200d♀️", + "woman_mountain_biking_light_skin_tone": "🚵🏻\u200d♀️", + "woman_mountain_biking_medium-dark_skin_tone": "🚵🏾\u200d♀️", + "woman_mountain_biking_medium-light_skin_tone": "🚵🏼\u200d♀️", + "woman_mountain_biking_medium_skin_tone": "🚵🏽\u200d♀️", + "woman_office_worker": "👩\u200d💼", + "woman_office_worker_dark_skin_tone": "👩🏿\u200d💼", + "woman_office_worker_light_skin_tone": "👩🏻\u200d💼", + "woman_office_worker_medium-dark_skin_tone": "👩🏾\u200d💼", + "woman_office_worker_medium-light_skin_tone": "👩🏼\u200d💼", + "woman_office_worker_medium_skin_tone": "👩🏽\u200d💼", + "woman_pilot": "👩\u200d✈️", + "woman_pilot_dark_skin_tone": "👩🏿\u200d✈️", + "woman_pilot_light_skin_tone": "👩🏻\u200d✈️", + "woman_pilot_medium-dark_skin_tone": "👩🏾\u200d✈️", + "woman_pilot_medium-light_skin_tone": "👩🏼\u200d✈️", + "woman_pilot_medium_skin_tone": "👩🏽\u200d✈️", + "woman_playing_handball": "🤾\u200d♀️", + "woman_playing_handball_dark_skin_tone": "🤾🏿\u200d♀️", + "woman_playing_handball_light_skin_tone": "🤾🏻\u200d♀️", + "woman_playing_handball_medium-dark_skin_tone": "🤾🏾\u200d♀️", + "woman_playing_handball_medium-light_skin_tone": "🤾🏼\u200d♀️", + "woman_playing_handball_medium_skin_tone": "🤾🏽\u200d♀️", + "woman_playing_water_polo": "🤽\u200d♀️", + "woman_playing_water_polo_dark_skin_tone": "🤽🏿\u200d♀️", + "woman_playing_water_polo_light_skin_tone": "🤽🏻\u200d♀️", + "woman_playing_water_polo_medium-dark_skin_tone": "🤽🏾\u200d♀️", + "woman_playing_water_polo_medium-light_skin_tone": "🤽🏼\u200d♀️", + "woman_playing_water_polo_medium_skin_tone": "🤽🏽\u200d♀️", + "woman_police_officer": "👮\u200d♀️", + "woman_police_officer_dark_skin_tone": "👮🏿\u200d♀️", + "woman_police_officer_light_skin_tone": "👮🏻\u200d♀️", + "woman_police_officer_medium-dark_skin_tone": "👮🏾\u200d♀️", + "woman_police_officer_medium-light_skin_tone": "👮🏼\u200d♀️", + "woman_police_officer_medium_skin_tone": "👮🏽\u200d♀️", + "woman_pouting": "🙎\u200d♀️", + "woman_pouting_dark_skin_tone": "🙎🏿\u200d♀️", + "woman_pouting_light_skin_tone": "🙎🏻\u200d♀️", + "woman_pouting_medium-dark_skin_tone": "🙎🏾\u200d♀️", + "woman_pouting_medium-light_skin_tone": "🙎🏼\u200d♀️", + "woman_pouting_medium_skin_tone": "🙎🏽\u200d♀️", + "woman_raising_hand": "🙋\u200d♀️", + "woman_raising_hand_dark_skin_tone": "🙋🏿\u200d♀️", + "woman_raising_hand_light_skin_tone": "🙋🏻\u200d♀️", + "woman_raising_hand_medium-dark_skin_tone": "🙋🏾\u200d♀️", + "woman_raising_hand_medium-light_skin_tone": "🙋🏼\u200d♀️", + "woman_raising_hand_medium_skin_tone": "🙋🏽\u200d♀️", + "woman_rowing_boat": "🚣\u200d♀️", + "woman_rowing_boat_dark_skin_tone": "🚣🏿\u200d♀️", + "woman_rowing_boat_light_skin_tone": "🚣🏻\u200d♀️", + "woman_rowing_boat_medium-dark_skin_tone": "🚣🏾\u200d♀️", + "woman_rowing_boat_medium-light_skin_tone": "🚣🏼\u200d♀️", + "woman_rowing_boat_medium_skin_tone": "🚣🏽\u200d♀️", + "woman_running": "🏃\u200d♀️", + "woman_running_dark_skin_tone": "🏃🏿\u200d♀️", + "woman_running_light_skin_tone": "🏃🏻\u200d♀️", + "woman_running_medium-dark_skin_tone": "🏃🏾\u200d♀️", + "woman_running_medium-light_skin_tone": "🏃🏼\u200d♀️", + "woman_running_medium_skin_tone": "🏃🏽\u200d♀️", + "woman_scientist": "👩\u200d🔬", + "woman_scientist_dark_skin_tone": "👩🏿\u200d🔬", + "woman_scientist_light_skin_tone": "👩🏻\u200d🔬", + "woman_scientist_medium-dark_skin_tone": "👩🏾\u200d🔬", + "woman_scientist_medium-light_skin_tone": "👩🏼\u200d🔬", + "woman_scientist_medium_skin_tone": "👩🏽\u200d🔬", + "woman_shrugging": "🤷\u200d♀️", + "woman_shrugging_dark_skin_tone": "🤷🏿\u200d♀️", + "woman_shrugging_light_skin_tone": "🤷🏻\u200d♀️", + "woman_shrugging_medium-dark_skin_tone": "🤷🏾\u200d♀️", + "woman_shrugging_medium-light_skin_tone": "🤷🏼\u200d♀️", + "woman_shrugging_medium_skin_tone": "🤷🏽\u200d♀️", + "woman_singer": "👩\u200d🎤", + "woman_singer_dark_skin_tone": "👩🏿\u200d🎤", + "woman_singer_light_skin_tone": "👩🏻\u200d🎤", + "woman_singer_medium-dark_skin_tone": "👩🏾\u200d🎤", + "woman_singer_medium-light_skin_tone": "👩🏼\u200d🎤", + "woman_singer_medium_skin_tone": "👩🏽\u200d🎤", + "woman_student": "👩\u200d🎓", + "woman_student_dark_skin_tone": "👩🏿\u200d🎓", + "woman_student_light_skin_tone": "👩🏻\u200d🎓", + "woman_student_medium-dark_skin_tone": "👩🏾\u200d🎓", + "woman_student_medium-light_skin_tone": "👩🏼\u200d🎓", + "woman_student_medium_skin_tone": "👩🏽\u200d🎓", + "woman_surfing": "🏄\u200d♀️", + "woman_surfing_dark_skin_tone": "🏄🏿\u200d♀️", + "woman_surfing_light_skin_tone": "🏄🏻\u200d♀️", + "woman_surfing_medium-dark_skin_tone": "🏄🏾\u200d♀️", + "woman_surfing_medium-light_skin_tone": "🏄🏼\u200d♀️", + "woman_surfing_medium_skin_tone": "🏄🏽\u200d♀️", + "woman_swimming": "🏊\u200d♀️", + "woman_swimming_dark_skin_tone": "🏊🏿\u200d♀️", + "woman_swimming_light_skin_tone": "🏊🏻\u200d♀️", + "woman_swimming_medium-dark_skin_tone": "🏊🏾\u200d♀️", + "woman_swimming_medium-light_skin_tone": "🏊🏼\u200d♀️", + "woman_swimming_medium_skin_tone": "🏊🏽\u200d♀️", + "woman_teacher": "👩\u200d🏫", + "woman_teacher_dark_skin_tone": "👩🏿\u200d🏫", + "woman_teacher_light_skin_tone": "👩🏻\u200d🏫", + "woman_teacher_medium-dark_skin_tone": "👩🏾\u200d🏫", + "woman_teacher_medium-light_skin_tone": "👩🏼\u200d🏫", + "woman_teacher_medium_skin_tone": "👩🏽\u200d🏫", + "woman_technologist": "👩\u200d💻", + "woman_technologist_dark_skin_tone": "👩🏿\u200d💻", + "woman_technologist_light_skin_tone": "👩🏻\u200d💻", + "woman_technologist_medium-dark_skin_tone": "👩🏾\u200d💻", + "woman_technologist_medium-light_skin_tone": "👩🏼\u200d💻", + "woman_technologist_medium_skin_tone": "👩🏽\u200d💻", + "woman_tipping_hand": "💁\u200d♀️", + "woman_tipping_hand_dark_skin_tone": "💁🏿\u200d♀️", + "woman_tipping_hand_light_skin_tone": "💁🏻\u200d♀️", + "woman_tipping_hand_medium-dark_skin_tone": "💁🏾\u200d♀️", + "woman_tipping_hand_medium-light_skin_tone": "💁🏼\u200d♀️", + "woman_tipping_hand_medium_skin_tone": "💁🏽\u200d♀️", + "woman_vampire": "🧛\u200d♀️", + "woman_vampire_dark_skin_tone": "🧛🏿\u200d♀️", + "woman_vampire_light_skin_tone": "🧛🏻\u200d♀️", + "woman_vampire_medium-dark_skin_tone": "🧛🏾\u200d♀️", + "woman_vampire_medium-light_skin_tone": "🧛🏼\u200d♀️", + "woman_vampire_medium_skin_tone": "🧛🏽\u200d♀️", + "woman_walking": "🚶\u200d♀️", + "woman_walking_dark_skin_tone": "🚶🏿\u200d♀️", + "woman_walking_light_skin_tone": "🚶🏻\u200d♀️", + "woman_walking_medium-dark_skin_tone": "🚶🏾\u200d♀️", + "woman_walking_medium-light_skin_tone": "🚶🏼\u200d♀️", + "woman_walking_medium_skin_tone": "🚶🏽\u200d♀️", + "woman_wearing_turban": "👳\u200d♀️", + "woman_wearing_turban_dark_skin_tone": "👳🏿\u200d♀️", + "woman_wearing_turban_light_skin_tone": "👳🏻\u200d♀️", + "woman_wearing_turban_medium-dark_skin_tone": "👳🏾\u200d♀️", + "woman_wearing_turban_medium-light_skin_tone": "👳🏼\u200d♀️", + "woman_wearing_turban_medium_skin_tone": "👳🏽\u200d♀️", + "woman_with_headscarf": "🧕", + "woman_with_headscarf_dark_skin_tone": "🧕🏿", + "woman_with_headscarf_light_skin_tone": "🧕🏻", + "woman_with_headscarf_medium-dark_skin_tone": "🧕🏾", + "woman_with_headscarf_medium-light_skin_tone": "🧕🏼", + "woman_with_headscarf_medium_skin_tone": "🧕🏽", + "woman_with_probing_cane": "👩\u200d🦯", + "woman_zombie": "🧟\u200d♀️", + "woman’s_boot": "👢", + "woman’s_clothes": "👚", + "woman’s_hat": "👒", + "woman’s_sandal": "👡", + "women_with_bunny_ears": "👯\u200d♀️", + "women_wrestling": "🤼\u200d♀️", + "women’s_room": "🚺", + "woozy_face": "🥴", + "world_map": "🗺", + "worried_face": "😟", + "wrapped_gift": "🎁", + "wrench": "🔧", + "writing_hand": "✍", + "writing_hand_dark_skin_tone": "✍🏿", + "writing_hand_light_skin_tone": "✍🏻", + "writing_hand_medium-dark_skin_tone": "✍🏾", + "writing_hand_medium-light_skin_tone": "✍🏼", + "writing_hand_medium_skin_tone": "✍🏽", + "yarn": "🧶", + "yawning_face": "🥱", + "yellow_circle": "🟡", + "yellow_heart": "💛", + "yellow_square": "🟨", + "yen_banknote": "💴", + "yo-yo": "🪀", + "yin_yang": "☯", + "zany_face": "🤪", + "zebra": "🦓", + "zipper-mouth_face": "🤐", + "zombie": "🧟", + "zzz": "💤", + "åland_islands": "🇦🇽", + "keycap_asterisk": "*⃣", + "keycap_digit_eight": "8⃣", + "keycap_digit_five": "5⃣", + "keycap_digit_four": "4⃣", + "keycap_digit_nine": "9⃣", + "keycap_digit_one": "1⃣", + "keycap_digit_seven": "7⃣", + "keycap_digit_six": "6⃣", + "keycap_digit_three": "3⃣", + "keycap_digit_two": "2⃣", + "keycap_digit_zero": "0⃣", + "keycap_number_sign": "#⃣", + "light_skin_tone": "🏻", + "medium_light_skin_tone": "🏼", + "medium_skin_tone": "🏽", + "medium_dark_skin_tone": "🏾", + "dark_skin_tone": "🏿", + "regional_indicator_symbol_letter_a": "🇦", + "regional_indicator_symbol_letter_b": "🇧", + "regional_indicator_symbol_letter_c": "🇨", + "regional_indicator_symbol_letter_d": "🇩", + "regional_indicator_symbol_letter_e": "🇪", + "regional_indicator_symbol_letter_f": "🇫", + "regional_indicator_symbol_letter_g": "🇬", + "regional_indicator_symbol_letter_h": "🇭", + "regional_indicator_symbol_letter_i": "🇮", + "regional_indicator_symbol_letter_j": "🇯", + "regional_indicator_symbol_letter_k": "🇰", + "regional_indicator_symbol_letter_l": "🇱", + "regional_indicator_symbol_letter_m": "🇲", + "regional_indicator_symbol_letter_n": "🇳", + "regional_indicator_symbol_letter_o": "🇴", + "regional_indicator_symbol_letter_p": "🇵", + "regional_indicator_symbol_letter_q": "🇶", + "regional_indicator_symbol_letter_r": "🇷", + "regional_indicator_symbol_letter_s": "🇸", + "regional_indicator_symbol_letter_t": "🇹", + "regional_indicator_symbol_letter_u": "🇺", + "regional_indicator_symbol_letter_v": "🇻", + "regional_indicator_symbol_letter_w": "🇼", + "regional_indicator_symbol_letter_x": "🇽", + "regional_indicator_symbol_letter_y": "🇾", + "regional_indicator_symbol_letter_z": "🇿", + "airplane_arriving": "🛬", + "space_invader": "👾", + "football": "🏈", + "anger": "💢", + "angry": "😠", + "anguished": "😧", + "signal_strength": "📶", + "arrows_counterclockwise": "🔄", + "arrow_heading_down": "⤵", + "arrow_heading_up": "⤴", + "art": "🎨", + "astonished": "😲", + "athletic_shoe": "👟", + "atm": "🏧", + "car": "🚗", + "red_car": "🚗", + "angel": "👼", + "back": "🔙", + "badminton_racquet_and_shuttlecock": "🏸", + "dollar": "💵", + "euro": "💶", + "pound": "💷", + "yen": "💴", + "barber": "💈", + "bath": "🛀", + "bear": "🐻", + "heartbeat": "💓", + "beer": "🍺", + "no_bell": "🔕", + "bento": "🍱", + "bike": "🚲", + "bicyclist": "🚴", + "8ball": "🎱", + "biohazard_sign": "☣", + "birthday": "🎂", + "black_circle_for_record": "⏺", + "clubs": "♣", + "diamonds": "♦", + "arrow_double_down": "⏬", + "hearts": "♥", + "rewind": "⏪", + "black_left__pointing_double_triangle_with_vertical_bar": "⏮", + "arrow_backward": "◀", + "black_medium_small_square": "◾", + "question": "❓", + "fast_forward": "⏩", + "black_right__pointing_double_triangle_with_vertical_bar": "⏭", + "arrow_forward": "▶", + "black_right__pointing_triangle_with_double_vertical_bar": "⏯", + "arrow_right": "➡", + "spades": "♠", + "black_square_for_stop": "⏹", + "sunny": "☀", + "phone": "☎", + "recycle": "♻", + "arrow_double_up": "⏫", + "busstop": "🚏", + "date": "📅", + "flags": "🎏", + "cat2": "🐈", + "joy_cat": "😹", + "smirk_cat": "😼", + "chart_with_downwards_trend": "📉", + "chart_with_upwards_trend": "📈", + "chart": "💹", + "mega": "📣", + "checkered_flag": "🏁", + "accept": "🉑", + "ideograph_advantage": "🉐", + "congratulations": "㊗", + "secret": "㊙", + "m": "Ⓜ", + "city_sunset": "🌆", + "clapper": "🎬", + "clap": "👏", + "beers": "🍻", + "clock830": "🕣", + "clock8": "🕗", + "clock1130": "🕦", + "clock11": "🕚", + "clock530": "🕠", + "clock5": "🕔", + "clock430": "🕟", + "clock4": "🕓", + "clock930": "🕤", + "clock9": "🕘", + "clock130": "🕜", + "clock1": "🕐", + "clock730": "🕢", + "clock7": "🕖", + "clock630": "🕡", + "clock6": "🕕", + "clock1030": "🕥", + "clock10": "🕙", + "clock330": "🕞", + "clock3": "🕒", + "clock1230": "🕧", + "clock12": "🕛", + "clock230": "🕝", + "clock2": "🕑", + "arrows_clockwise": "🔃", + "repeat": "🔁", + "repeat_one": "🔂", + "closed_lock_with_key": "🔐", + "mailbox_closed": "📪", + "mailbox": "📫", + "cloud_with_tornado": "🌪", + "cocktail": "🍸", + "boom": "💥", + "compression": "🗜", + "confounded": "😖", + "confused": "😕", + "rice": "🍚", + "cow2": "🐄", + "cricket_bat_and_ball": "🏏", + "x": "❌", + "cry": "😢", + "curry": "🍛", + "dagger_knife": "🗡", + "dancer": "💃", + "dark_sunglasses": "🕶", + "dash": "💨", + "truck": "🚚", + "derelict_house_building": "🏚", + "diamond_shape_with_a_dot_inside": "💠", + "dart": "🎯", + "disappointed_relieved": "😥", + "disappointed": "😞", + "do_not_litter": "🚯", + "dog2": "🐕", + "flipper": "🐬", + "loop": "➿", + "bangbang": "‼", + "double_vertical_bar": "⏸", + "dove_of_peace": "🕊", + "small_red_triangle_down": "🔻", + "arrow_down_small": "🔽", + "arrow_down": "⬇", + "dromedary_camel": "🐪", + "e__mail": "📧", + "corn": "🌽", + "ear_of_rice": "🌾", + "earth_americas": "🌎", + "earth_asia": "🌏", + "earth_africa": "🌍", + "eight_pointed_black_star": "✴", + "eight_spoked_asterisk": "✳", + "eject_symbol": "⏏", + "bulb": "💡", + "emoji_modifier_fitzpatrick_type__1__2": "🏻", + "emoji_modifier_fitzpatrick_type__3": "🏼", + "emoji_modifier_fitzpatrick_type__4": "🏽", + "emoji_modifier_fitzpatrick_type__5": "🏾", + "emoji_modifier_fitzpatrick_type__6": "🏿", + "end": "🔚", + "email": "✉", + "european_castle": "🏰", + "european_post_office": "🏤", + "interrobang": "⁉", + "expressionless": "😑", + "eyeglasses": "👓", + "massage": "💆", + "yum": "😋", + "scream": "😱", + "kissing_heart": "😘", + "sweat": "😓", + "face_with_head__bandage": "🤕", + "triumph": "😤", + "mask": "😷", + "no_good": "🙅", + "ok_woman": "🙆", + "open_mouth": "😮", + "cold_sweat": "😰", + "stuck_out_tongue": "😛", + "stuck_out_tongue_closed_eyes": "😝", + "stuck_out_tongue_winking_eye": "😜", + "joy": "😂", + "no_mouth": "😶", + "santa": "🎅", + "fax": "📠", + "fearful": "😨", + "field_hockey_stick_and_ball": "🏑", + "first_quarter_moon_with_face": "🌛", + "fish_cake": "🍥", + "fishing_pole_and_fish": "🎣", + "facepunch": "👊", + "punch": "👊", + "flag_for_afghanistan": "🇦🇫", + "flag_for_albania": "🇦🇱", + "flag_for_algeria": "🇩🇿", + "flag_for_american_samoa": "🇦🇸", + "flag_for_andorra": "🇦🇩", + "flag_for_angola": "🇦🇴", + "flag_for_anguilla": "🇦🇮", + "flag_for_antarctica": "🇦🇶", + "flag_for_antigua_&_barbuda": "🇦🇬", + "flag_for_argentina": "🇦🇷", + "flag_for_armenia": "🇦🇲", + "flag_for_aruba": "🇦🇼", + "flag_for_ascension_island": "🇦🇨", + "flag_for_australia": "🇦🇺", + "flag_for_austria": "🇦🇹", + "flag_for_azerbaijan": "🇦🇿", + "flag_for_bahamas": "🇧🇸", + "flag_for_bahrain": "🇧🇭", + "flag_for_bangladesh": "🇧🇩", + "flag_for_barbados": "🇧🇧", + "flag_for_belarus": "🇧🇾", + "flag_for_belgium": "🇧🇪", + "flag_for_belize": "🇧🇿", + "flag_for_benin": "🇧🇯", + "flag_for_bermuda": "🇧🇲", + "flag_for_bhutan": "🇧🇹", + "flag_for_bolivia": "🇧🇴", + "flag_for_bosnia_&_herzegovina": "🇧🇦", + "flag_for_botswana": "🇧🇼", + "flag_for_bouvet_island": "🇧🇻", + "flag_for_brazil": "🇧🇷", + "flag_for_british_indian_ocean_territory": "🇮🇴", + "flag_for_british_virgin_islands": "🇻🇬", + "flag_for_brunei": "🇧🇳", + "flag_for_bulgaria": "🇧🇬", + "flag_for_burkina_faso": "🇧🇫", + "flag_for_burundi": "🇧🇮", + "flag_for_cambodia": "🇰🇭", + "flag_for_cameroon": "🇨🇲", + "flag_for_canada": "🇨🇦", + "flag_for_canary_islands": "🇮🇨", + "flag_for_cape_verde": "🇨🇻", + "flag_for_caribbean_netherlands": "🇧🇶", + "flag_for_cayman_islands": "🇰🇾", + "flag_for_central_african_republic": "🇨🇫", + "flag_for_ceuta_&_melilla": "🇪🇦", + "flag_for_chad": "🇹🇩", + "flag_for_chile": "🇨🇱", + "flag_for_china": "🇨🇳", + "flag_for_christmas_island": "🇨🇽", + "flag_for_clipperton_island": "🇨🇵", + "flag_for_cocos__islands": "🇨🇨", + "flag_for_colombia": "🇨🇴", + "flag_for_comoros": "🇰🇲", + "flag_for_congo____brazzaville": "🇨🇬", + "flag_for_congo____kinshasa": "🇨🇩", + "flag_for_cook_islands": "🇨🇰", + "flag_for_costa_rica": "🇨🇷", + "flag_for_croatia": "🇭🇷", + "flag_for_cuba": "🇨🇺", + "flag_for_curaçao": "🇨🇼", + "flag_for_cyprus": "🇨🇾", + "flag_for_czech_republic": "🇨🇿", + "flag_for_côte_d’ivoire": "🇨🇮", + "flag_for_denmark": "🇩🇰", + "flag_for_diego_garcia": "🇩🇬", + "flag_for_djibouti": "🇩🇯", + "flag_for_dominica": "🇩🇲", + "flag_for_dominican_republic": "🇩🇴", + "flag_for_ecuador": "🇪🇨", + "flag_for_egypt": "🇪🇬", + "flag_for_el_salvador": "🇸🇻", + "flag_for_equatorial_guinea": "🇬🇶", + "flag_for_eritrea": "🇪🇷", + "flag_for_estonia": "🇪🇪", + "flag_for_ethiopia": "🇪🇹", + "flag_for_european_union": "🇪🇺", + "flag_for_falkland_islands": "🇫🇰", + "flag_for_faroe_islands": "🇫🇴", + "flag_for_fiji": "🇫🇯", + "flag_for_finland": "🇫🇮", + "flag_for_france": "🇫🇷", + "flag_for_french_guiana": "🇬🇫", + "flag_for_french_polynesia": "🇵🇫", + "flag_for_french_southern_territories": "🇹🇫", + "flag_for_gabon": "🇬🇦", + "flag_for_gambia": "🇬🇲", + "flag_for_georgia": "🇬🇪", + "flag_for_germany": "🇩🇪", + "flag_for_ghana": "🇬🇭", + "flag_for_gibraltar": "🇬🇮", + "flag_for_greece": "🇬🇷", + "flag_for_greenland": "🇬🇱", + "flag_for_grenada": "🇬🇩", + "flag_for_guadeloupe": "🇬🇵", + "flag_for_guam": "🇬🇺", + "flag_for_guatemala": "🇬🇹", + "flag_for_guernsey": "🇬🇬", + "flag_for_guinea": "🇬🇳", + "flag_for_guinea__bissau": "🇬🇼", + "flag_for_guyana": "🇬🇾", + "flag_for_haiti": "🇭🇹", + "flag_for_heard_&_mcdonald_islands": "🇭🇲", + "flag_for_honduras": "🇭🇳", + "flag_for_hong_kong": "🇭🇰", + "flag_for_hungary": "🇭🇺", + "flag_for_iceland": "🇮🇸", + "flag_for_india": "🇮🇳", + "flag_for_indonesia": "🇮🇩", + "flag_for_iran": "🇮🇷", + "flag_for_iraq": "🇮🇶", + "flag_for_ireland": "🇮🇪", + "flag_for_isle_of_man": "🇮🇲", + "flag_for_israel": "🇮🇱", + "flag_for_italy": "🇮🇹", + "flag_for_jamaica": "🇯🇲", + "flag_for_japan": "🇯🇵", + "flag_for_jersey": "🇯🇪", + "flag_for_jordan": "🇯🇴", + "flag_for_kazakhstan": "🇰🇿", + "flag_for_kenya": "🇰🇪", + "flag_for_kiribati": "🇰🇮", + "flag_for_kosovo": "🇽🇰", + "flag_for_kuwait": "🇰🇼", + "flag_for_kyrgyzstan": "🇰🇬", + "flag_for_laos": "🇱🇦", + "flag_for_latvia": "🇱🇻", + "flag_for_lebanon": "🇱🇧", + "flag_for_lesotho": "🇱🇸", + "flag_for_liberia": "🇱🇷", + "flag_for_libya": "🇱🇾", + "flag_for_liechtenstein": "🇱🇮", + "flag_for_lithuania": "🇱🇹", + "flag_for_luxembourg": "🇱🇺", + "flag_for_macau": "🇲🇴", + "flag_for_macedonia": "🇲🇰", + "flag_for_madagascar": "🇲🇬", + "flag_for_malawi": "🇲🇼", + "flag_for_malaysia": "🇲🇾", + "flag_for_maldives": "🇲🇻", + "flag_for_mali": "🇲🇱", + "flag_for_malta": "🇲🇹", + "flag_for_marshall_islands": "🇲🇭", + "flag_for_martinique": "🇲🇶", + "flag_for_mauritania": "🇲🇷", + "flag_for_mauritius": "🇲🇺", + "flag_for_mayotte": "🇾🇹", + "flag_for_mexico": "🇲🇽", + "flag_for_micronesia": "🇫🇲", + "flag_for_moldova": "🇲🇩", + "flag_for_monaco": "🇲🇨", + "flag_for_mongolia": "🇲🇳", + "flag_for_montenegro": "🇲🇪", + "flag_for_montserrat": "🇲🇸", + "flag_for_morocco": "🇲🇦", + "flag_for_mozambique": "🇲🇿", + "flag_for_myanmar": "🇲🇲", + "flag_for_namibia": "🇳🇦", + "flag_for_nauru": "🇳🇷", + "flag_for_nepal": "🇳🇵", + "flag_for_netherlands": "🇳🇱", + "flag_for_new_caledonia": "🇳🇨", + "flag_for_new_zealand": "🇳🇿", + "flag_for_nicaragua": "🇳🇮", + "flag_for_niger": "🇳🇪", + "flag_for_nigeria": "🇳🇬", + "flag_for_niue": "🇳🇺", + "flag_for_norfolk_island": "🇳🇫", + "flag_for_north_korea": "🇰🇵", + "flag_for_northern_mariana_islands": "🇲🇵", + "flag_for_norway": "🇳🇴", + "flag_for_oman": "🇴🇲", + "flag_for_pakistan": "🇵🇰", + "flag_for_palau": "🇵🇼", + "flag_for_palestinian_territories": "🇵🇸", + "flag_for_panama": "🇵🇦", + "flag_for_papua_new_guinea": "🇵🇬", + "flag_for_paraguay": "🇵🇾", + "flag_for_peru": "🇵🇪", + "flag_for_philippines": "🇵🇭", + "flag_for_pitcairn_islands": "🇵🇳", + "flag_for_poland": "🇵🇱", + "flag_for_portugal": "🇵🇹", + "flag_for_puerto_rico": "🇵🇷", + "flag_for_qatar": "🇶🇦", + "flag_for_romania": "🇷🇴", + "flag_for_russia": "🇷🇺", + "flag_for_rwanda": "🇷🇼", + "flag_for_réunion": "🇷🇪", + "flag_for_samoa": "🇼🇸", + "flag_for_san_marino": "🇸🇲", + "flag_for_saudi_arabia": "🇸🇦", + "flag_for_senegal": "🇸🇳", + "flag_for_serbia": "🇷🇸", + "flag_for_seychelles": "🇸🇨", + "flag_for_sierra_leone": "🇸🇱", + "flag_for_singapore": "🇸🇬", + "flag_for_sint_maarten": "🇸🇽", + "flag_for_slovakia": "🇸🇰", + "flag_for_slovenia": "🇸🇮", + "flag_for_solomon_islands": "🇸🇧", + "flag_for_somalia": "🇸🇴", + "flag_for_south_africa": "🇿🇦", + "flag_for_south_georgia_&_south_sandwich_islands": "🇬🇸", + "flag_for_south_korea": "🇰🇷", + "flag_for_south_sudan": "🇸🇸", + "flag_for_spain": "🇪🇸", + "flag_for_sri_lanka": "🇱🇰", + "flag_for_st._barthélemy": "🇧🇱", + "flag_for_st._helena": "🇸🇭", + "flag_for_st._kitts_&_nevis": "🇰🇳", + "flag_for_st._lucia": "🇱🇨", + "flag_for_st._martin": "🇲🇫", + "flag_for_st._pierre_&_miquelon": "🇵🇲", + "flag_for_st._vincent_&_grenadines": "🇻🇨", + "flag_for_sudan": "🇸🇩", + "flag_for_suriname": "🇸🇷", + "flag_for_svalbard_&_jan_mayen": "🇸🇯", + "flag_for_swaziland": "🇸🇿", + "flag_for_sweden": "🇸🇪", + "flag_for_switzerland": "🇨🇭", + "flag_for_syria": "🇸🇾", + "flag_for_são_tomé_&_príncipe": "🇸🇹", + "flag_for_taiwan": "🇹🇼", + "flag_for_tajikistan": "🇹🇯", + "flag_for_tanzania": "🇹🇿", + "flag_for_thailand": "🇹🇭", + "flag_for_timor__leste": "🇹🇱", + "flag_for_togo": "🇹🇬", + "flag_for_tokelau": "🇹🇰", + "flag_for_tonga": "🇹🇴", + "flag_for_trinidad_&_tobago": "🇹🇹", + "flag_for_tristan_da_cunha": "🇹🇦", + "flag_for_tunisia": "🇹🇳", + "flag_for_turkey": "🇹🇷", + "flag_for_turkmenistan": "🇹🇲", + "flag_for_turks_&_caicos_islands": "🇹🇨", + "flag_for_tuvalu": "🇹🇻", + "flag_for_u.s._outlying_islands": "🇺🇲", + "flag_for_u.s._virgin_islands": "🇻🇮", + "flag_for_uganda": "🇺🇬", + "flag_for_ukraine": "🇺🇦", + "flag_for_united_arab_emirates": "🇦🇪", + "flag_for_united_kingdom": "🇬🇧", + "flag_for_united_states": "🇺🇸", + "flag_for_uruguay": "🇺🇾", + "flag_for_uzbekistan": "🇺🇿", + "flag_for_vanuatu": "🇻🇺", + "flag_for_vatican_city": "🇻🇦", + "flag_for_venezuela": "🇻🇪", + "flag_for_vietnam": "🇻🇳", + "flag_for_wallis_&_futuna": "🇼🇫", + "flag_for_western_sahara": "🇪🇭", + "flag_for_yemen": "🇾🇪", + "flag_for_zambia": "🇿🇲", + "flag_for_zimbabwe": "🇿🇼", + "flag_for_åland_islands": "🇦🇽", + "golf": "⛳", + "fleur__de__lis": "⚜", + "muscle": "💪", + "flushed": "😳", + "frame_with_picture": "🖼", + "fries": "🍟", + "frog": "🐸", + "hatched_chick": "🐥", + "frowning": "😦", + "fuelpump": "⛽", + "full_moon_with_face": "🌝", + "gem": "💎", + "star2": "🌟", + "golfer": "🏌", + "mortar_board": "🎓", + "grimacing": "😬", + "smile_cat": "😸", + "grinning": "😀", + "grin": "😁", + "heartpulse": "💗", + "guardsman": "💂", + "haircut": "💇", + "hamster": "🐹", + "raising_hand": "🙋", + "headphones": "🎧", + "hear_no_evil": "🙉", + "cupid": "💘", + "gift_heart": "💝", + "heart": "❤", + "exclamation": "❗", + "heavy_exclamation_mark": "❗", + "heavy_heart_exclamation_mark_ornament": "❣", + "o": "⭕", + "helm_symbol": "⎈", + "helmet_with_white_cross": "⛑", + "high_heel": "👠", + "bullettrain_side": "🚄", + "bullettrain_front": "🚅", + "high_brightness": "🔆", + "zap": "⚡", + "hocho": "🔪", + "knife": "🔪", + "bee": "🐝", + "traffic_light": "🚥", + "racehorse": "🐎", + "coffee": "☕", + "hotsprings": "♨", + "hourglass": "⌛", + "hourglass_flowing_sand": "⏳", + "house_buildings": "🏘", + "100": "💯", + "hushed": "😯", + "ice_hockey_stick_and_puck": "🏒", + "imp": "👿", + "information_desk_person": "💁", + "information_source": "ℹ", + "capital_abcd": "🔠", + "abc": "🔤", + "abcd": "🔡", + "1234": "🔢", + "symbols": "🔣", + "izakaya_lantern": "🏮", + "lantern": "🏮", + "jack_o_lantern": "🎃", + "dolls": "🎎", + "japanese_goblin": "👺", + "japanese_ogre": "👹", + "beginner": "🔰", + "zero": "0️⃣", + "one": "1️⃣", + "ten": "🔟", + "two": "2️⃣", + "three": "3️⃣", + "four": "4️⃣", + "five": "5️⃣", + "six": "6️⃣", + "seven": "7️⃣", + "eight": "8️⃣", + "nine": "9️⃣", + "couplekiss": "💏", + "kissing_cat": "😽", + "kissing": "😗", + "kissing_closed_eyes": "😚", + "kissing_smiling_eyes": "😙", + "beetle": "🐞", + "large_blue_circle": "🔵", + "last_quarter_moon_with_face": "🌜", + "leaves": "🍃", + "mag": "🔍", + "left_right_arrow": "↔", + "leftwards_arrow_with_hook": "↩", + "arrow_left": "⬅", + "lock": "🔒", + "lock_with_ink_pen": "🔏", + "sob": "😭", + "low_brightness": "🔅", + "lower_left_ballpoint_pen": "🖊", + "lower_left_crayon": "🖍", + "lower_left_fountain_pen": "🖋", + "lower_left_paintbrush": "🖌", + "mahjong": "🀄", + "couple": "👫", + "man_in_business_suit_levitating": "🕴", + "man_with_gua_pi_mao": "👲", + "man_with_turban": "👳", + "mans_shoe": "👞", + "shoe": "👞", + "menorah_with_nine_branches": "🕎", + "mens": "🚹", + "minidisc": "💽", + "iphone": "📱", + "calling": "📲", + "money__mouth_face": "🤑", + "moneybag": "💰", + "rice_scene": "🎑", + "mountain_bicyclist": "🚵", + "mouse2": "🐁", + "lips": "👄", + "moyai": "🗿", + "notes": "🎶", + "nail_care": "💅", + "ab": "🆎", + "negative_squared_cross_mark": "❎", + "a": "🅰", + "b": "🅱", + "o2": "🅾", + "parking": "🅿", + "new_moon_with_face": "🌚", + "no_entry_sign": "🚫", + "underage": "🔞", + "non__potable_water": "🚱", + "arrow_upper_right": "↗", + "arrow_upper_left": "↖", + "office": "🏢", + "older_man": "👴", + "older_woman": "👵", + "om_symbol": "🕉", + "on": "🔛", + "book": "📖", + "unlock": "🔓", + "mailbox_with_no_mail": "📭", + "mailbox_with_mail": "📬", + "cd": "💿", + "tada": "🎉", + "feet": "🐾", + "walking": "🚶", + "pencil2": "✏", + "pensive": "😔", + "persevere": "😣", + "bow": "🙇", + "raised_hands": "🙌", + "person_with_ball": "⛹", + "person_with_blond_hair": "👱", + "pray": "🙏", + "person_with_pouting_face": "🙎", + "computer": "💻", + "pig2": "🐖", + "hankey": "💩", + "poop": "💩", + "shit": "💩", + "bamboo": "🎍", + "gun": "🔫", + "black_joker": "🃏", + "rotating_light": "🚨", + "cop": "👮", + "stew": "🍲", + "pouch": "👝", + "pouting_cat": "😾", + "rage": "😡", + "put_litter_in_its_place": "🚮", + "rabbit2": "🐇", + "racing_motorcycle": "🏍", + "radioactive_sign": "☢", + "fist": "✊", + "hand": "✋", + "raised_hand_with_fingers_splayed": "🖐", + "raised_hand_with_part_between_middle_and_ring_fingers": "🖖", + "blue_car": "🚙", + "apple": "🍎", + "relieved": "😌", + "reversed_hand_with_middle_finger_extended": "🖕", + "mag_right": "🔎", + "arrow_right_hook": "↪", + "sweet_potato": "🍠", + "robot": "🤖", + "rolled__up_newspaper": "🗞", + "rowboat": "🚣", + "runner": "🏃", + "running": "🏃", + "running_shirt_with_sash": "🎽", + "boat": "⛵", + "scales": "⚖", + "school_satchel": "🎒", + "scorpius": "♏", + "see_no_evil": "🙈", + "sheep": "🐑", + "stars": "🌠", + "cake": "🍰", + "six_pointed_star": "🔯", + "ski": "🎿", + "sleeping_accommodation": "🛌", + "sleeping": "😴", + "sleepy": "😪", + "sleuth_or_spy": "🕵", + "heart_eyes_cat": "😻", + "smiley_cat": "😺", + "innocent": "😇", + "heart_eyes": "😍", + "smiling_imp": "😈", + "smiley": "😃", + "sweat_smile": "😅", + "smile": "😄", + "laughing": "😆", + "satisfied": "😆", + "blush": "😊", + "smirk": "😏", + "smoking": "🚬", + "snow_capped_mountain": "🏔", + "soccer": "⚽", + "icecream": "🍦", + "soon": "🔜", + "arrow_lower_right": "↘", + "arrow_lower_left": "↙", + "speak_no_evil": "🙊", + "speaker": "🔈", + "mute": "🔇", + "sound": "🔉", + "loud_sound": "🔊", + "speaking_head_in_silhouette": "🗣", + "spiral_calendar_pad": "🗓", + "spiral_note_pad": "🗒", + "shell": "🐚", + "sweat_drops": "💦", + "u5272": "🈹", + "u5408": "🈴", + "u55b6": "🈺", + "u6307": "🈯", + "u6708": "🈷", + "u6709": "🈶", + "u6e80": "🈵", + "u7121": "🈚", + "u7533": "🈸", + "u7981": "🈲", + "u7a7a": "🈳", + "cl": "🆑", + "cool": "🆒", + "free": "🆓", + "id": "🆔", + "koko": "🈁", + "sa": "🈂", + "new": "🆕", + "ng": "🆖", + "ok": "🆗", + "sos": "🆘", + "up": "🆙", + "vs": "🆚", + "steam_locomotive": "🚂", + "ramen": "🍜", + "partly_sunny": "⛅", + "city_sunrise": "🌇", + "surfer": "🏄", + "swimmer": "🏊", + "shirt": "👕", + "tshirt": "👕", + "table_tennis_paddle_and_ball": "🏓", + "tea": "🍵", + "tv": "📺", + "three_button_mouse": "🖱", + "+1": "👍", + "thumbsup": "👍", + "__1": "👎", + "-1": "👎", + "thumbsdown": "👎", + "thunder_cloud_and_rain": "⛈", + "tiger2": "🐅", + "tophat": "🎩", + "top": "🔝", + "tm": "™", + "train2": "🚆", + "triangular_flag_on_post": "🚩", + "trident": "🔱", + "twisted_rightwards_arrows": "🔀", + "unamused": "😒", + "small_red_triangle": "🔺", + "arrow_up_small": "🔼", + "arrow_up_down": "↕", + "upside__down_face": "🙃", + "arrow_up": "⬆", + "v": "✌", + "vhs": "📼", + "wc": "🚾", + "ocean": "🌊", + "waving_black_flag": "🏴", + "wave": "👋", + "waving_white_flag": "🏳", + "moon": "🌔", + "scream_cat": "🙀", + "weary": "😩", + "weight_lifter": "🏋", + "whale2": "🐋", + "wheelchair": "♿", + "point_down": "👇", + "grey_exclamation": "❕", + "white_frowning_face": "☹", + "white_check_mark": "✅", + "point_left": "👈", + "white_medium_small_square": "◽", + "star": "⭐", + "grey_question": "❔", + "point_right": "👉", + "relaxed": "☺", + "white_sun_behind_cloud": "🌥", + "white_sun_behind_cloud_with_rain": "🌦", + "white_sun_with_small_cloud": "🌤", + "point_up_2": "👆", + "point_up": "☝", + "wind_blowing_face": "🌬", + "wink": "😉", + "wolf": "🐺", + "dancers": "👯", + "boot": "👢", + "womans_clothes": "👚", + "womans_hat": "👒", + "sandal": "👡", + "womens": "🚺", + "worried": "😟", + "gift": "🎁", + "zipper__mouth_face": "🤐", + "regional_indicator_a": "🇦", + "regional_indicator_b": "🇧", + "regional_indicator_c": "🇨", + "regional_indicator_d": "🇩", + "regional_indicator_e": "🇪", + "regional_indicator_f": "🇫", + "regional_indicator_g": "🇬", + "regional_indicator_h": "🇭", + "regional_indicator_i": "🇮", + "regional_indicator_j": "🇯", + "regional_indicator_k": "🇰", + "regional_indicator_l": "🇱", + "regional_indicator_m": "🇲", + "regional_indicator_n": "🇳", + "regional_indicator_o": "🇴", + "regional_indicator_p": "🇵", + "regional_indicator_q": "🇶", + "regional_indicator_r": "🇷", + "regional_indicator_s": "🇸", + "regional_indicator_t": "🇹", + "regional_indicator_u": "🇺", + "regional_indicator_v": "🇻", + "regional_indicator_w": "🇼", + "regional_indicator_x": "🇽", + "regional_indicator_y": "🇾", + "regional_indicator_z": "🇿", +} diff --git a/src/pip/_vendor/rich/_emoji_replace.py b/src/pip/_vendor/rich/_emoji_replace.py new file mode 100644 index 000000000..bb2cafa18 --- /dev/null +++ b/src/pip/_vendor/rich/_emoji_replace.py @@ -0,0 +1,32 @@ +from typing import Callable, Match, Optional +import re + +from ._emoji_codes import EMOJI + + +_ReStringMatch = Match[str] # regex match object +_ReSubCallable = Callable[[_ReStringMatch], str] # Callable invoked by re.sub +_EmojiSubMethod = Callable[[_ReSubCallable, str], str] # Sub method of a compiled re + + +def _emoji_replace( + text: str, + default_variant: Optional[str] = None, + _emoji_sub: _EmojiSubMethod = re.compile(r"(:(\S*?)(?:(?:\-)(emoji|text))?:)").sub, +) -> str: + """Replace emoji code in text.""" + get_emoji = EMOJI.__getitem__ + variants = {"text": "\uFE0E", "emoji": "\uFE0F"} + get_variant = variants.get + default_variant_code = variants.get(default_variant, "") if default_variant else "" + + def do_replace(match: Match[str]) -> str: + emoji_code, emoji_name, variant = match.groups() + try: + return get_emoji(emoji_name.lower()) + get_variant( + variant, default_variant_code + ) + except KeyError: + return emoji_code + + return _emoji_sub(do_replace, text) diff --git a/src/pip/_vendor/rich/_extension.py b/src/pip/_vendor/rich/_extension.py new file mode 100644 index 000000000..cbd6da9be --- /dev/null +++ b/src/pip/_vendor/rich/_extension.py @@ -0,0 +1,10 @@ +from typing import Any + + +def load_ipython_extension(ip: Any) -> None: # pragma: no cover + # prevent circular import + from pip._vendor.rich.pretty import install + from pip._vendor.rich.traceback import install as tr_install + + install() + tr_install() diff --git a/src/pip/_vendor/rich/_inspect.py b/src/pip/_vendor/rich/_inspect.py new file mode 100644 index 000000000..262695b1c --- /dev/null +++ b/src/pip/_vendor/rich/_inspect.py @@ -0,0 +1,210 @@ +from __future__ import absolute_import + +from inspect import cleandoc, getdoc, getfile, isclass, ismodule, signature +from typing import Any, Iterable, Optional, Tuple + +from .console import RenderableType, Group +from .highlighter import ReprHighlighter +from .jupyter import JupyterMixin +from .panel import Panel +from .pretty import Pretty +from .table import Table +from .text import Text, TextType + + +def _first_paragraph(doc: str) -> str: + """Get the first paragraph from a docstring.""" + paragraph, _, _ = doc.partition("\n\n") + return paragraph + + +def _reformat_doc(doc: str) -> str: + """Reformat docstring.""" + doc = cleandoc(doc).strip() + return doc + + +class Inspect(JupyterMixin): + """A renderable to inspect any Python Object. + + Args: + obj (Any): An object to inspect. + title (str, optional): Title to display over inspect result, or None use type. Defaults to None. + help (bool, optional): Show full help text rather than just first paragraph. Defaults to False. + methods (bool, optional): Enable inspection of callables. Defaults to False. + docs (bool, optional): Also render doc strings. Defaults to True. + private (bool, optional): Show private attributes (beginning with underscore). Defaults to False. + dunder (bool, optional): Show attributes starting with double underscore. Defaults to False. + sort (bool, optional): Sort attributes alphabetically. Defaults to True. + all (bool, optional): Show all attributes. Defaults to False. + value (bool, optional): Pretty print value of object. Defaults to True. + """ + + def __init__( + self, + obj: Any, + *, + title: Optional[TextType] = None, + help: bool = False, + methods: bool = False, + docs: bool = True, + private: bool = False, + dunder: bool = False, + sort: bool = True, + all: bool = True, + value: bool = True, + ) -> None: + self.highlighter = ReprHighlighter() + self.obj = obj + self.title = title or self._make_title(obj) + if all: + methods = private = dunder = True + self.help = help + self.methods = methods + self.docs = docs or help + self.private = private or dunder + self.dunder = dunder + self.sort = sort + self.value = value + + def _make_title(self, obj: Any) -> Text: + """Make a default title.""" + title_str = ( + str(obj) + if (isclass(obj) or callable(obj) or ismodule(obj)) + else str(type(obj)) + ) + title_text = self.highlighter(title_str) + return title_text + + def __rich__(self) -> Panel: + return Panel.fit( + Group(*self._render()), + title=self.title, + border_style="scope.border", + padding=(0, 1), + ) + + def _get_signature(self, name: str, obj: Any) -> Optional[Text]: + """Get a signature for a callable.""" + try: + _signature = str(signature(obj)) + ":" + except ValueError: + _signature = "(...)" + except TypeError: + return None + + source_filename: Optional[str] = None + try: + source_filename = getfile(obj) + except TypeError: + pass + + callable_name = Text(name, style="inspect.callable") + if source_filename: + callable_name.stylize(f"link file://{source_filename}") + signature_text = self.highlighter(_signature) + + qualname = name or getattr(obj, "__qualname__", name) + qual_signature = Text.assemble( + ("def ", "inspect.def"), (qualname, "inspect.callable"), signature_text + ) + + return qual_signature + + def _render(self) -> Iterable[RenderableType]: + """Render object.""" + + def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: + key, (_error, value) = item + return (callable(value), key.strip("_").lower()) + + def safe_getattr(attr_name: str) -> Tuple[Any, Any]: + """Get attribute or any exception.""" + try: + return (None, getattr(obj, attr_name)) + except Exception as error: + return (error, None) + + obj = self.obj + keys = dir(obj) + total_items = len(keys) + if not self.dunder: + keys = [key for key in keys if not key.startswith("__")] + if not self.private: + keys = [key for key in keys if not key.startswith("_")] + not_shown_count = total_items - len(keys) + items = [(key, safe_getattr(key)) for key in keys] + if self.sort: + items.sort(key=sort_items) + + items_table = Table.grid(padding=(0, 1), expand=False) + items_table.add_column(justify="right") + add_row = items_table.add_row + highlighter = self.highlighter + + if callable(obj): + signature = self._get_signature("", obj) + if signature is not None: + yield signature + yield "" + + if self.docs: + _doc = getdoc(obj) + if _doc is not None: + if not self.help: + _doc = _first_paragraph(_doc) + doc_text = Text(_reformat_doc(_doc), style="inspect.help") + doc_text = highlighter(doc_text) + yield doc_text + yield "" + + if self.value and not (isclass(obj) or callable(obj) or ismodule(obj)): + yield Panel( + Pretty(obj, indent_guides=True, max_length=10, max_string=60), + border_style="inspect.value.border", + ) + yield "" + + for key, (error, value) in items: + key_text = Text.assemble( + ( + key, + "inspect.attr.dunder" if key.startswith("__") else "inspect.attr", + ), + (" =", "inspect.equals"), + ) + if error is not None: + warning = key_text.copy() + warning.stylize("inspect.error") + add_row(warning, highlighter(repr(error))) + continue + + if callable(value): + if not self.methods: + continue + + _signature_text = self._get_signature(key, value) + if _signature_text is None: + add_row(key_text, Pretty(value, highlighter=highlighter)) + else: + if self.docs: + docs = getdoc(value) + if docs is not None: + _doc = _reformat_doc(str(docs)) + if not self.help: + _doc = _first_paragraph(_doc) + _signature_text.append("\n" if "\n" in _doc else " ") + doc = highlighter(_doc) + doc.stylize("inspect.doc") + _signature_text.append(doc) + + add_row(key_text, _signature_text) + else: + add_row(key_text, Pretty(value, highlighter=highlighter)) + if items_table.row_count: + yield items_table + else: + yield Text.from_markup( + f"[b cyan]{not_shown_count}[/][i] attribute(s) not shown.[/i] Run [b][magenta]inspect[/]([not b]inspect[/])[/b] for options." + ) diff --git a/src/pip/_vendor/rich/_log_render.py b/src/pip/_vendor/rich/_log_render.py new file mode 100644 index 000000000..fc16c8443 --- /dev/null +++ b/src/pip/_vendor/rich/_log_render.py @@ -0,0 +1,94 @@ +from datetime import datetime +from typing import Iterable, List, Optional, TYPE_CHECKING, Union, Callable + + +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import Console, ConsoleRenderable, RenderableType + from .table import Table + +FormatTimeCallable = Callable[[datetime], Text] + + +class LogRender: + def __init__( + self, + show_time: bool = True, + show_level: bool = False, + show_path: bool = True, + time_format: Union[str, FormatTimeCallable] = "[%x %X]", + omit_repeated_times: bool = True, + level_width: Optional[int] = 8, + ) -> None: + self.show_time = show_time + self.show_level = show_level + self.show_path = show_path + self.time_format = time_format + self.omit_repeated_times = omit_repeated_times + self.level_width = level_width + self._last_time: Optional[Text] = None + + def __call__( + self, + console: "Console", + renderables: Iterable["ConsoleRenderable"], + log_time: Optional[datetime] = None, + time_format: Optional[Union[str, FormatTimeCallable]] = None, + level: TextType = "", + path: Optional[str] = None, + line_no: Optional[int] = None, + link_path: Optional[str] = None, + ) -> "Table": + from .containers import Renderables + from .table import Table + + output = Table.grid(padding=(0, 1)) + output.expand = True + if self.show_time: + output.add_column(style="log.time") + if self.show_level: + output.add_column(style="log.level", width=self.level_width) + output.add_column(ratio=1, style="log.message", overflow="fold") + if self.show_path and path: + output.add_column(style="log.path") + row: List["RenderableType"] = [] + if self.show_time: + log_time = log_time or console.get_datetime() + time_format = time_format or self.time_format + if callable(time_format): + log_time_display = time_format(log_time) + else: + log_time_display = Text(log_time.strftime(time_format)) + if log_time_display == self._last_time and self.omit_repeated_times: + row.append(Text(" " * len(log_time_display))) + else: + row.append(log_time_display) + self._last_time = log_time_display + if self.show_level: + row.append(level) + + row.append(Renderables(renderables)) + if self.show_path and path: + path_text = Text() + path_text.append( + path, style=f"link file://{link_path}" if link_path else "" + ) + if line_no: + path_text.append(":") + path_text.append( + f"{line_no}", + style=f"link file://{link_path}#{line_no}" if link_path else "", + ) + row.append(path_text) + + output.add_row(*row) + return output + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + + c = Console() + c.print("[on blue]Hello", justify="right") + c.log("[on blue]hello", justify="right") diff --git a/src/pip/_vendor/rich/_loop.py b/src/pip/_vendor/rich/_loop.py new file mode 100644 index 000000000..01c6cafbe --- /dev/null +++ b/src/pip/_vendor/rich/_loop.py @@ -0,0 +1,43 @@ +from typing import Iterable, Tuple, TypeVar + +T = TypeVar("T") + + +def loop_first(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for first value.""" + iter_values = iter(values) + try: + value = next(iter_values) + except StopIteration: + return + yield True, value + for value in iter_values: + yield False, value + + +def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value + + +def loop_first_last(values: Iterable[T]) -> Iterable[Tuple[bool, bool, T]]: + """Iterate and generate a tuple with a flag for first and last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + first = True + for value in iter_values: + yield first, False, previous_value + first = False + previous_value = value + yield first, True, previous_value diff --git a/src/pip/_vendor/rich/_lru_cache.py b/src/pip/_vendor/rich/_lru_cache.py new file mode 100644 index 000000000..b7bf2ce1a --- /dev/null +++ b/src/pip/_vendor/rich/_lru_cache.py @@ -0,0 +1,34 @@ +from collections import OrderedDict +from typing import Dict, Generic, TypeVar + + +CacheKey = TypeVar("CacheKey") +CacheValue = TypeVar("CacheValue") + + +class LRUCache(Generic[CacheKey, CacheValue], OrderedDict): # type: ignore # https://github.com/python/mypy/issues/6904 + """ + A dictionary-like container that stores a given maximum items. + + If an additional item is added when the LRUCache is full, the least + recently used key is discarded to make room for the new item. + + """ + + def __init__(self, cache_size: int) -> None: + self.cache_size = cache_size + super(LRUCache, self).__init__() + + def __setitem__(self, key: CacheKey, value: CacheValue) -> None: + """Store a new views, potentially discarding an old value.""" + if key not in self: + if len(self) >= self.cache_size: + self.popitem(last=False) + OrderedDict.__setitem__(self, key, value) + + def __getitem__(self: Dict[CacheKey, CacheValue], key: CacheKey) -> CacheValue: + """Gets the item, but also makes it most recent.""" + value: CacheValue = OrderedDict.__getitem__(self, key) + OrderedDict.__delitem__(self, key) + OrderedDict.__setitem__(self, key, value) + return value diff --git a/src/pip/_vendor/rich/_palettes.py b/src/pip/_vendor/rich/_palettes.py new file mode 100644 index 000000000..3c748d33e --- /dev/null +++ b/src/pip/_vendor/rich/_palettes.py @@ -0,0 +1,309 @@ +from .palette import Palette + + +# Taken from https://en.wikipedia.org/wiki/ANSI_escape_code (Windows 10 column) +WINDOWS_PALETTE = Palette( + [ + (12, 12, 12), + (197, 15, 31), + (19, 161, 14), + (193, 156, 0), + (0, 55, 218), + (136, 23, 152), + (58, 150, 221), + (204, 204, 204), + (118, 118, 118), + (231, 72, 86), + (22, 198, 12), + (249, 241, 165), + (59, 120, 255), + (180, 0, 158), + (97, 214, 214), + (242, 242, 242), + ] +) + +# # The standard ansi colors (including bright variants) +STANDARD_PALETTE = Palette( + [ + (0, 0, 0), + (170, 0, 0), + (0, 170, 0), + (170, 85, 0), + (0, 0, 170), + (170, 0, 170), + (0, 170, 170), + (170, 170, 170), + (85, 85, 85), + (255, 85, 85), + (85, 255, 85), + (255, 255, 85), + (85, 85, 255), + (255, 85, 255), + (85, 255, 255), + (255, 255, 255), + ] +) + + +# The 256 color palette +EIGHT_BIT_PALETTE = Palette( + [ + (0, 0, 0), + (128, 0, 0), + (0, 128, 0), + (128, 128, 0), + (0, 0, 128), + (128, 0, 128), + (0, 128, 128), + (192, 192, 192), + (128, 128, 128), + (255, 0, 0), + (0, 255, 0), + (255, 255, 0), + (0, 0, 255), + (255, 0, 255), + (0, 255, 255), + (255, 255, 255), + (0, 0, 0), + (0, 0, 95), + (0, 0, 135), + (0, 0, 175), + (0, 0, 215), + (0, 0, 255), + (0, 95, 0), + (0, 95, 95), + (0, 95, 135), + (0, 95, 175), + (0, 95, 215), + (0, 95, 255), + (0, 135, 0), + (0, 135, 95), + (0, 135, 135), + (0, 135, 175), + (0, 135, 215), + (0, 135, 255), + (0, 175, 0), + (0, 175, 95), + (0, 175, 135), + (0, 175, 175), + (0, 175, 215), + (0, 175, 255), + (0, 215, 0), + (0, 215, 95), + (0, 215, 135), + (0, 215, 175), + (0, 215, 215), + (0, 215, 255), + (0, 255, 0), + (0, 255, 95), + (0, 255, 135), + (0, 255, 175), + (0, 255, 215), + (0, 255, 255), + (95, 0, 0), + (95, 0, 95), + (95, 0, 135), + (95, 0, 175), + (95, 0, 215), + (95, 0, 255), + (95, 95, 0), + (95, 95, 95), + (95, 95, 135), + (95, 95, 175), + (95, 95, 215), + (95, 95, 255), + (95, 135, 0), + (95, 135, 95), + (95, 135, 135), + (95, 135, 175), + (95, 135, 215), + (95, 135, 255), + (95, 175, 0), + (95, 175, 95), + (95, 175, 135), + (95, 175, 175), + (95, 175, 215), + (95, 175, 255), + (95, 215, 0), + (95, 215, 95), + (95, 215, 135), + (95, 215, 175), + (95, 215, 215), + (95, 215, 255), + (95, 255, 0), + (95, 255, 95), + (95, 255, 135), + (95, 255, 175), + (95, 255, 215), + (95, 255, 255), + (135, 0, 0), + (135, 0, 95), + (135, 0, 135), + (135, 0, 175), + (135, 0, 215), + (135, 0, 255), + (135, 95, 0), + (135, 95, 95), + (135, 95, 135), + (135, 95, 175), + (135, 95, 215), + (135, 95, 255), + (135, 135, 0), + (135, 135, 95), + (135, 135, 135), + (135, 135, 175), + (135, 135, 215), + (135, 135, 255), + (135, 175, 0), + (135, 175, 95), + (135, 175, 135), + (135, 175, 175), + (135, 175, 215), + (135, 175, 255), + (135, 215, 0), + (135, 215, 95), + (135, 215, 135), + (135, 215, 175), + (135, 215, 215), + (135, 215, 255), + (135, 255, 0), + (135, 255, 95), + (135, 255, 135), + (135, 255, 175), + (135, 255, 215), + (135, 255, 255), + (175, 0, 0), + (175, 0, 95), + (175, 0, 135), + (175, 0, 175), + (175, 0, 215), + (175, 0, 255), + (175, 95, 0), + (175, 95, 95), + (175, 95, 135), + (175, 95, 175), + (175, 95, 215), + (175, 95, 255), + (175, 135, 0), + (175, 135, 95), + (175, 135, 135), + (175, 135, 175), + (175, 135, 215), + (175, 135, 255), + (175, 175, 0), + (175, 175, 95), + (175, 175, 135), + (175, 175, 175), + (175, 175, 215), + (175, 175, 255), + (175, 215, 0), + (175, 215, 95), + (175, 215, 135), + (175, 215, 175), + (175, 215, 215), + (175, 215, 255), + (175, 255, 0), + (175, 255, 95), + (175, 255, 135), + (175, 255, 175), + (175, 255, 215), + (175, 255, 255), + (215, 0, 0), + (215, 0, 95), + (215, 0, 135), + (215, 0, 175), + (215, 0, 215), + (215, 0, 255), + (215, 95, 0), + (215, 95, 95), + (215, 95, 135), + (215, 95, 175), + (215, 95, 215), + (215, 95, 255), + (215, 135, 0), + (215, 135, 95), + (215, 135, 135), + (215, 135, 175), + (215, 135, 215), + (215, 135, 255), + (215, 175, 0), + (215, 175, 95), + (215, 175, 135), + (215, 175, 175), + (215, 175, 215), + (215, 175, 255), + (215, 215, 0), + (215, 215, 95), + (215, 215, 135), + (215, 215, 175), + (215, 215, 215), + (215, 215, 255), + (215, 255, 0), + (215, 255, 95), + (215, 255, 135), + (215, 255, 175), + (215, 255, 215), + (215, 255, 255), + (255, 0, 0), + (255, 0, 95), + (255, 0, 135), + (255, 0, 175), + (255, 0, 215), + (255, 0, 255), + (255, 95, 0), + (255, 95, 95), + (255, 95, 135), + (255, 95, 175), + (255, 95, 215), + (255, 95, 255), + (255, 135, 0), + (255, 135, 95), + (255, 135, 135), + (255, 135, 175), + (255, 135, 215), + (255, 135, 255), + (255, 175, 0), + (255, 175, 95), + (255, 175, 135), + (255, 175, 175), + (255, 175, 215), + (255, 175, 255), + (255, 215, 0), + (255, 215, 95), + (255, 215, 135), + (255, 215, 175), + (255, 215, 215), + (255, 215, 255), + (255, 255, 0), + (255, 255, 95), + (255, 255, 135), + (255, 255, 175), + (255, 255, 215), + (255, 255, 255), + (8, 8, 8), + (18, 18, 18), + (28, 28, 28), + (38, 38, 38), + (48, 48, 48), + (58, 58, 58), + (68, 68, 68), + (78, 78, 78), + (88, 88, 88), + (98, 98, 98), + (108, 108, 108), + (118, 118, 118), + (128, 128, 128), + (138, 138, 138), + (148, 148, 148), + (158, 158, 158), + (168, 168, 168), + (178, 178, 178), + (188, 188, 188), + (198, 198, 198), + (208, 208, 208), + (218, 218, 218), + (228, 228, 228), + (238, 238, 238), + ] +) diff --git a/src/pip/_vendor/rich/_pick.py b/src/pip/_vendor/rich/_pick.py new file mode 100644 index 000000000..4f6d8b2d7 --- /dev/null +++ b/src/pip/_vendor/rich/_pick.py @@ -0,0 +1,17 @@ +from typing import Optional + + +def pick_bool(*values: Optional[bool]) -> bool: + """Pick the first non-none bool or return the last value. + + Args: + *values (bool): Any number of boolean or None values. + + Returns: + bool: First non-none boolean. + """ + assert values, "1 or more values required" + for value in values: + if value is not None: + return value + return bool(value) diff --git a/src/pip/_vendor/rich/_ratio.py b/src/pip/_vendor/rich/_ratio.py new file mode 100644 index 000000000..e8a3a674e --- /dev/null +++ b/src/pip/_vendor/rich/_ratio.py @@ -0,0 +1,160 @@ +import sys +from fractions import Fraction +from math import ceil +from typing import cast, List, Optional, Sequence + +if sys.version_info >= (3, 8): + from typing import Protocol +else: + from pip._vendor.typing_extensions import Protocol # pragma: no cover + + +class Edge(Protocol): + """Any object that defines an edge (such as Layout).""" + + size: Optional[int] = None + ratio: int = 1 + minimum_size: int = 1 + + +def ratio_resolve(total: int, edges: Sequence[Edge]) -> List[int]: + """Divide total space to satisfy size, ratio, and minimum_size, constraints. + + The returned list of integers should add up to total in most cases, unless it is + impossible to satisfy all the constraints. For instance, if there are two edges + with a minimum size of 20 each and `total` is 30 then the returned list will be + greater than total. In practice, this would mean that a Layout object would + clip the rows that would overflow the screen height. + + Args: + total (int): Total number of characters. + edges (List[Edge]): Edges within total space. + + Returns: + List[int]: Number of characters for each edge. + """ + # Size of edge or None for yet to be determined + sizes = [(edge.size or None) for edge in edges] + + _Fraction = Fraction + + # While any edges haven't been calculated + while None in sizes: + # Get flexible edges and index to map these back on to sizes list + flexible_edges = [ + (index, edge) + for index, (size, edge) in enumerate(zip(sizes, edges)) + if size is None + ] + # Remaining space in total + remaining = total - sum(size or 0 for size in sizes) + if remaining <= 0: + # No room for flexible edges + return [ + ((edge.minimum_size or 1) if size is None else size) + for size, edge in zip(sizes, edges) + ] + # Calculate number of characters in a ratio portion + portion = _Fraction( + remaining, sum((edge.ratio or 1) for _, edge in flexible_edges) + ) + + # If any edges will be less than their minimum, replace size with the minimum + for index, edge in flexible_edges: + if portion * edge.ratio <= edge.minimum_size: + sizes[index] = edge.minimum_size + # New fixed size will invalidate calculations, so we need to repeat the process + break + else: + # Distribute flexible space and compensate for rounding error + # Since edge sizes can only be integers we need to add the remainder + # to the following line + remainder = _Fraction(0) + for index, edge in flexible_edges: + size, remainder = divmod(portion * edge.ratio + remainder, 1) + sizes[index] = size + break + # Sizes now contains integers only + return cast(List[int], sizes) + + +def ratio_reduce( + total: int, ratios: List[int], maximums: List[int], values: List[int] +) -> List[int]: + """Divide an integer total in to parts based on ratios. + + Args: + total (int): The total to divide. + ratios (List[int]): A list of integer ratios. + maximums (List[int]): List of maximums values for each slot. + values (List[int]): List of values + + Returns: + List[int]: A list of integers guaranteed to sum to total. + """ + ratios = [ratio if _max else 0 for ratio, _max in zip(ratios, maximums)] + total_ratio = sum(ratios) + if not total_ratio: + return values[:] + total_remaining = total + result: List[int] = [] + append = result.append + for ratio, maximum, value in zip(ratios, maximums, values): + if ratio and total_ratio > 0: + distributed = min(maximum, round(ratio * total_remaining / total_ratio)) + append(value - distributed) + total_remaining -= distributed + total_ratio -= ratio + else: + append(value) + return result + + +def ratio_distribute( + total: int, ratios: List[int], minimums: Optional[List[int]] = None +) -> List[int]: + """Distribute an integer total in to parts based on ratios. + + Args: + total (int): The total to divide. + ratios (List[int]): A list of integer ratios. + minimums (List[int]): List of minimum values for each slot. + + Returns: + List[int]: A list of integers guaranteed to sum to total. + """ + if minimums: + ratios = [ratio if _min else 0 for ratio, _min in zip(ratios, minimums)] + total_ratio = sum(ratios) + assert total_ratio > 0, "Sum of ratios must be > 0" + + total_remaining = total + distributed_total: List[int] = [] + append = distributed_total.append + if minimums is None: + _minimums = [0] * len(ratios) + else: + _minimums = minimums + for ratio, minimum in zip(ratios, _minimums): + if total_ratio > 0: + distributed = max(minimum, ceil(ratio * total_remaining / total_ratio)) + else: + distributed = total_remaining + append(distributed) + total_ratio -= ratio + total_remaining -= distributed + return distributed_total + + +if __name__ == "__main__": + from dataclasses import dataclass + + @dataclass + class E: + + size: Optional[int] = None + ratio: int = 1 + minimum_size: int = 1 + + resolved = ratio_resolve(110, [E(None, 1, 1), E(None, 1, 1), E(None, 1, 1)]) + print(sum(resolved)) diff --git a/src/pip/_vendor/rich/_spinners.py b/src/pip/_vendor/rich/_spinners.py new file mode 100644 index 000000000..dc1db0777 --- /dev/null +++ b/src/pip/_vendor/rich/_spinners.py @@ -0,0 +1,848 @@ +""" +Spinners are from: +* cli-spinners: + MIT License + Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com) + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights to + use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of + the Software, and to permit persons to whom the Software is furnished to do so, + subject to the following conditions: + The above copyright notice and this permission notice shall be included + in all copies or substantial portions of the Software. + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR + PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE + FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, + ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS + IN THE SOFTWARE. +""" + +SPINNERS = { + "dots": { + "interval": 80, + "frames": ["⠋", "⠙", "⠹", "⠸", "⠼", "⠴", "⠦", "⠧", "⠇", "⠏"], + }, + "dots2": {"interval": 80, "frames": ["⣾", "⣽", "⣻", "⢿", "⡿", "⣟", "⣯", "⣷"]}, + "dots3": { + "interval": 80, + "frames": ["⠋", "⠙", "⠚", "⠞", "⠖", "⠦", "⠴", "⠲", "⠳", "⠓"], + }, + "dots4": { + "interval": 80, + "frames": [ + "⠄", + "⠆", + "⠇", + "⠋", + "⠙", + "⠸", + "⠰", + "⠠", + "⠰", + "⠸", + "⠙", + "⠋", + "⠇", + "⠆", + ], + }, + "dots5": { + "interval": 80, + "frames": [ + "⠋", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + ], + }, + "dots6": { + "interval": 80, + "frames": [ + "⠁", + "⠉", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠤", + "⠄", + "⠄", + "⠤", + "⠴", + "⠲", + "⠒", + "⠂", + "⠂", + "⠒", + "⠚", + "⠙", + "⠉", + "⠁", + ], + }, + "dots7": { + "interval": 80, + "frames": [ + "⠈", + "⠉", + "⠋", + "⠓", + "⠒", + "⠐", + "⠐", + "⠒", + "⠖", + "⠦", + "⠤", + "⠠", + "⠠", + "⠤", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + "⠉", + "⠈", + ], + }, + "dots8": { + "interval": 80, + "frames": [ + "⠁", + "⠁", + "⠉", + "⠙", + "⠚", + "⠒", + "⠂", + "⠂", + "⠒", + "⠲", + "⠴", + "⠤", + "⠄", + "⠄", + "⠤", + "⠠", + "⠠", + "⠤", + "⠦", + "⠖", + "⠒", + "⠐", + "⠐", + "⠒", + "⠓", + "⠋", + "⠉", + "⠈", + "⠈", + ], + }, + "dots9": {"interval": 80, "frames": ["⢹", "⢺", "⢼", "⣸", "⣇", "⡧", "⡗", "⡏"]}, + "dots10": {"interval": 80, "frames": ["⢄", "⢂", "⢁", "⡁", "⡈", "⡐", "⡠"]}, + "dots11": {"interval": 100, "frames": ["⠁", "⠂", "⠄", "⡀", "⢀", "⠠", "⠐", "⠈"]}, + "dots12": { + "interval": 80, + "frames": [ + "⢀⠀", + "⡀⠀", + "⠄⠀", + "⢂⠀", + "⡂⠀", + "⠅⠀", + "⢃⠀", + "⡃⠀", + "⠍⠀", + "⢋⠀", + "⡋⠀", + "⠍⠁", + "⢋⠁", + "⡋⠁", + "⠍⠉", + "⠋⠉", + "⠋⠉", + "⠉⠙", + "⠉⠙", + "⠉⠩", + "⠈⢙", + "⠈⡙", + "⢈⠩", + "⡀⢙", + "⠄⡙", + "⢂⠩", + "⡂⢘", + "⠅⡘", + "⢃⠨", + "⡃⢐", + "⠍⡐", + "⢋⠠", + "⡋⢀", + "⠍⡁", + "⢋⠁", + "⡋⠁", + "⠍⠉", + "⠋⠉", + "⠋⠉", + "⠉⠙", + "⠉⠙", + "⠉⠩", + "⠈⢙", + "⠈⡙", + "⠈⠩", + "⠀⢙", + "⠀⡙", + "⠀⠩", + "⠀⢘", + "⠀⡘", + "⠀⠨", + "⠀⢐", + "⠀⡐", + "⠀⠠", + "⠀⢀", + "⠀⡀", + ], + }, + "dots8Bit": { + "interval": 80, + "frames": [ + "⠀", + "⠁", + "⠂", + "⠃", + "⠄", + "⠅", + "⠆", + "⠇", + "⡀", + "⡁", + "⡂", + "⡃", + "⡄", + "⡅", + "⡆", + "⡇", + "⠈", + "⠉", + "⠊", + "⠋", + "⠌", + "⠍", + "⠎", + "⠏", + "⡈", + "⡉", + "⡊", + "⡋", + "⡌", + "⡍", + "⡎", + "⡏", + "⠐", + "⠑", + "⠒", + "⠓", + "⠔", + "⠕", + "⠖", + "⠗", + "⡐", + "⡑", + "⡒", + "⡓", + "⡔", + "⡕", + "⡖", + "⡗", + "⠘", + "⠙", + "⠚", + "⠛", + "⠜", + "⠝", + "⠞", + "⠟", + "⡘", + "⡙", + "⡚", + "⡛", + "⡜", + "⡝", + "⡞", + "⡟", + "⠠", + "⠡", + "⠢", + "⠣", + "⠤", + "⠥", + "⠦", + "⠧", + "⡠", + "⡡", + "⡢", + "⡣", + "⡤", + "⡥", + "⡦", + "⡧", + "⠨", + "⠩", + "⠪", + "⠫", + "⠬", + "⠭", + "⠮", + "⠯", + "⡨", + "⡩", + "⡪", + "⡫", + "⡬", + "⡭", + "⡮", + "⡯", + "⠰", + "⠱", + "⠲", + "⠳", + "⠴", + "⠵", + "⠶", + "⠷", + "⡰", + "⡱", + "⡲", + "⡳", + "⡴", + "⡵", + "⡶", + "⡷", + "⠸", + "⠹", + "⠺", + "⠻", + "⠼", + "⠽", + "⠾", + "⠿", + "⡸", + "⡹", + "⡺", + "⡻", + "⡼", + "⡽", + "⡾", + "⡿", + "⢀", + "⢁", + "⢂", + "⢃", + "⢄", + "⢅", + "⢆", + "⢇", + "⣀", + "⣁", + "⣂", + "⣃", + "⣄", + "⣅", + "⣆", + "⣇", + "⢈", + "⢉", + "⢊", + "⢋", + "⢌", + "⢍", + "⢎", + "⢏", + "⣈", + "⣉", + "⣊", + "⣋", + "⣌", + "⣍", + "⣎", + "⣏", + "⢐", + "⢑", + "⢒", + "⢓", + "⢔", + "⢕", + "⢖", + "⢗", + "⣐", + "⣑", + "⣒", + "⣓", + "⣔", + "⣕", + "⣖", + "⣗", + "⢘", + "⢙", + "⢚", + "⢛", + "⢜", + "⢝", + "⢞", + "⢟", + "⣘", + "⣙", + "⣚", + "⣛", + "⣜", + "⣝", + "⣞", + "⣟", + "⢠", + "⢡", + "⢢", + "⢣", + "⢤", + "⢥", + "⢦", + "⢧", + "⣠", + "⣡", + "⣢", + "⣣", + "⣤", + "⣥", + "⣦", + "⣧", + "⢨", + "⢩", + "⢪", + "⢫", + "⢬", + "⢭", + "⢮", + "⢯", + "⣨", + "⣩", + "⣪", + "⣫", + "⣬", + "⣭", + "⣮", + "⣯", + "⢰", + "⢱", + "⢲", + "⢳", + "⢴", + "⢵", + "⢶", + "⢷", + "⣰", + "⣱", + "⣲", + "⣳", + "⣴", + "⣵", + "⣶", + "⣷", + "⢸", + "⢹", + "⢺", + "⢻", + "⢼", + "⢽", + "⢾", + "⢿", + "⣸", + "⣹", + "⣺", + "⣻", + "⣼", + "⣽", + "⣾", + "⣿", + ], + }, + "line": {"interval": 130, "frames": ["-", "\\", "|", "/"]}, + "line2": {"interval": 100, "frames": ["⠂", "-", "–", "—", "–", "-"]}, + "pipe": {"interval": 100, "frames": ["┤", "┘", "┴", "└", "├", "┌", "┬", "┐"]}, + "simpleDots": {"interval": 400, "frames": [". ", ".. ", "...", " "]}, + "simpleDotsScrolling": { + "interval": 200, + "frames": [". ", ".. ", "...", " ..", " .", " "], + }, + "star": {"interval": 70, "frames": ["✶", "✸", "✹", "✺", "✹", "✷"]}, + "star2": {"interval": 80, "frames": ["+", "x", "*"]}, + "flip": { + "interval": 70, + "frames": ["_", "_", "_", "-", "`", "`", "'", "´", "-", "_", "_", "_"], + }, + "hamburger": {"interval": 100, "frames": ["☱", "☲", "☴"]}, + "growVertical": { + "interval": 120, + "frames": ["▁", "▃", "▄", "▅", "▆", "▇", "▆", "▅", "▄", "▃"], + }, + "growHorizontal": { + "interval": 120, + "frames": ["▏", "▎", "▍", "▌", "▋", "▊", "▉", "▊", "▋", "▌", "▍", "▎"], + }, + "balloon": {"interval": 140, "frames": [" ", ".", "o", "O", "@", "*", " "]}, + "balloon2": {"interval": 120, "frames": [".", "o", "O", "°", "O", "o", "."]}, + "noise": {"interval": 100, "frames": ["▓", "▒", "░"]}, + "bounce": {"interval": 120, "frames": ["⠁", "⠂", "⠄", "⠂"]}, + "boxBounce": {"interval": 120, "frames": ["▖", "▘", "▝", "▗"]}, + "boxBounce2": {"interval": 100, "frames": ["▌", "▀", "▐", "▄"]}, + "triangle": {"interval": 50, "frames": ["◢", "◣", "◤", "◥"]}, + "arc": {"interval": 100, "frames": ["◜", "◠", "◝", "◞", "◡", "◟"]}, + "circle": {"interval": 120, "frames": ["◡", "⊙", "◠"]}, + "squareCorners": {"interval": 180, "frames": ["◰", "◳", "◲", "◱"]}, + "circleQuarters": {"interval": 120, "frames": ["◴", "◷", "◶", "◵"]}, + "circleHalves": {"interval": 50, "frames": ["◐", "◓", "◑", "◒"]}, + "squish": {"interval": 100, "frames": ["╫", "╪"]}, + "toggle": {"interval": 250, "frames": ["⊶", "⊷"]}, + "toggle2": {"interval": 80, "frames": ["▫", "▪"]}, + "toggle3": {"interval": 120, "frames": ["□", "■"]}, + "toggle4": {"interval": 100, "frames": ["■", "□", "▪", "▫"]}, + "toggle5": {"interval": 100, "frames": ["▮", "▯"]}, + "toggle6": {"interval": 300, "frames": ["ဝ", "၀"]}, + "toggle7": {"interval": 80, "frames": ["⦾", "⦿"]}, + "toggle8": {"interval": 100, "frames": ["◍", "◌"]}, + "toggle9": {"interval": 100, "frames": ["◉", "◎"]}, + "toggle10": {"interval": 100, "frames": ["㊂", "㊀", "㊁"]}, + "toggle11": {"interval": 50, "frames": ["⧇", "⧆"]}, + "toggle12": {"interval": 120, "frames": ["☗", "☖"]}, + "toggle13": {"interval": 80, "frames": ["=", "*", "-"]}, + "arrow": {"interval": 100, "frames": ["←", "↖", "↑", "↗", "→", "↘", "↓", "↙"]}, + "arrow2": { + "interval": 80, + "frames": ["⬆️ ", "↗️ ", "➡️ ", "↘️ ", "⬇️ ", "↙️ ", "⬅️ ", "↖️ "], + }, + "arrow3": { + "interval": 120, + "frames": ["▹▹▹▹▹", "▸▹▹▹▹", "▹▸▹▹▹", "▹▹▸▹▹", "▹▹▹▸▹", "▹▹▹▹▸"], + }, + "bouncingBar": { + "interval": 80, + "frames": [ + "[ ]", + "[= ]", + "[== ]", + "[=== ]", + "[ ===]", + "[ ==]", + "[ =]", + "[ ]", + "[ =]", + "[ ==]", + "[ ===]", + "[====]", + "[=== ]", + "[== ]", + "[= ]", + ], + }, + "bouncingBall": { + "interval": 80, + "frames": [ + "( ● )", + "( ● )", + "( ● )", + "( ● )", + "( ●)", + "( ● )", + "( ● )", + "( ● )", + "( ● )", + "(● )", + ], + }, + "smiley": {"interval": 200, "frames": ["😄 ", "😝 "]}, + "monkey": {"interval": 300, "frames": ["🙈 ", "🙈 ", "🙉 ", "🙊 "]}, + "hearts": {"interval": 100, "frames": ["💛 ", "💙 ", "💜 ", "💚 ", "❤️ "]}, + "clock": { + "interval": 100, + "frames": [ + "🕛 ", + "🕐 ", + "🕑 ", + "🕒 ", + "🕓 ", + "🕔 ", + "🕕 ", + "🕖 ", + "🕗 ", + "🕘 ", + "🕙 ", + "🕚 ", + ], + }, + "earth": {"interval": 180, "frames": ["🌍 ", "🌎 ", "🌏 "]}, + "material": { + "interval": 17, + "frames": [ + "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "███████▁▁▁▁▁▁▁▁▁▁▁▁▁", + "████████▁▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "██████████▁▁▁▁▁▁▁▁▁▁", + "███████████▁▁▁▁▁▁▁▁▁", + "█████████████▁▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁▁██████████████▁▁▁▁", + "▁▁▁██████████████▁▁▁", + "▁▁▁▁█████████████▁▁▁", + "▁▁▁▁██████████████▁▁", + "▁▁▁▁██████████████▁▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁██████████████▁", + "▁▁▁▁▁▁██████████████", + "▁▁▁▁▁▁██████████████", + "▁▁▁▁▁▁▁█████████████", + "▁▁▁▁▁▁▁█████████████", + "▁▁▁▁▁▁▁▁████████████", + "▁▁▁▁▁▁▁▁████████████", + "▁▁▁▁▁▁▁▁▁███████████", + "▁▁▁▁▁▁▁▁▁███████████", + "▁▁▁▁▁▁▁▁▁▁██████████", + "▁▁▁▁▁▁▁▁▁▁██████████", + "▁▁▁▁▁▁▁▁▁▁▁▁████████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁██████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "█▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "██▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "███▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "████▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "█████▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "██████▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "████████▁▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "█████████▁▁▁▁▁▁▁▁▁▁▁", + "███████████▁▁▁▁▁▁▁▁▁", + "████████████▁▁▁▁▁▁▁▁", + "████████████▁▁▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "██████████████▁▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁██████████████▁▁▁▁▁", + "▁▁▁█████████████▁▁▁▁", + "▁▁▁▁▁████████████▁▁▁", + "▁▁▁▁▁████████████▁▁▁", + "▁▁▁▁▁▁███████████▁▁▁", + "▁▁▁▁▁▁▁▁█████████▁▁▁", + "▁▁▁▁▁▁▁▁█████████▁▁▁", + "▁▁▁▁▁▁▁▁▁█████████▁▁", + "▁▁▁▁▁▁▁▁▁█████████▁▁", + "▁▁▁▁▁▁▁▁▁▁█████████▁", + "▁▁▁▁▁▁▁▁▁▁▁████████▁", + "▁▁▁▁▁▁▁▁▁▁▁████████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁███████▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁███████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁████", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁███", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁██", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁█", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + "▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁▁", + ], + }, + "moon": { + "interval": 80, + "frames": ["🌑 ", "🌒 ", "🌓 ", "🌔 ", "🌕 ", "🌖 ", "🌗 ", "🌘 "], + }, + "runner": {"interval": 140, "frames": ["🚶 ", "🏃 "]}, + "pong": { + "interval": 80, + "frames": [ + "▐⠂ ▌", + "▐⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂▌", + "▐ ⠠▌", + "▐ ⡀▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐ ⠠ ▌", + "▐ ⠂ ▌", + "▐ ⠈ ▌", + "▐ ⠂ ▌", + "▐ ⠠ ▌", + "▐ ⡀ ▌", + "▐⠠ ▌", + ], + }, + "shark": { + "interval": 120, + "frames": [ + "▐|\\____________▌", + "▐_|\\___________▌", + "▐__|\\__________▌", + "▐___|\\_________▌", + "▐____|\\________▌", + "▐_____|\\_______▌", + "▐______|\\______▌", + "▐_______|\\_____▌", + "▐________|\\____▌", + "▐_________|\\___▌", + "▐__________|\\__▌", + "▐___________|\\_▌", + "▐____________|\\▌", + "▐____________/|▌", + "▐___________/|_▌", + "▐__________/|__▌", + "▐_________/|___▌", + "▐________/|____▌", + "▐_______/|_____▌", + "▐______/|______▌", + "▐_____/|_______▌", + "▐____/|________▌", + "▐___/|_________▌", + "▐__/|__________▌", + "▐_/|___________▌", + "▐/|____________▌", + ], + }, + "dqpb": {"interval": 100, "frames": ["d", "q", "p", "b"]}, + "weather": { + "interval": 100, + "frames": [ + "☀️ ", + "☀️ ", + "☀️ ", + "🌤 ", + "⛅️ ", + "🌥 ", + "☁️ ", + "🌧 ", + "🌨 ", + "🌧 ", + "🌨 ", + "🌧 ", + "🌨 ", + "⛈ ", + "🌨 ", + "🌧 ", + "🌨 ", + "☁️ ", + "🌥 ", + "⛅️ ", + "🌤 ", + "☀️ ", + "☀️ ", + ], + }, + "christmas": {"interval": 400, "frames": ["🌲", "🎄"]}, + "grenade": { + "interval": 80, + "frames": [ + "، ", + "′ ", + " ´ ", + " ‾ ", + " ⸌", + " ⸊", + " |", + " ⁎", + " ⁕", + " ෴ ", + " ⁓", + " ", + " ", + " ", + ], + }, + "point": {"interval": 125, "frames": ["∙∙∙", "●∙∙", "∙●∙", "∙∙●", "∙∙∙"]}, + "layer": {"interval": 150, "frames": ["-", "=", "≡"]}, + "betaWave": { + "interval": 80, + "frames": [ + "ρββββββ", + "βρβββββ", + "ββρββββ", + "βββρβββ", + "ββββρββ", + "βββββρβ", + "ββββββρ", + ], + }, + "aesthetic": { + "interval": 80, + "frames": [ + "▰▱▱▱▱▱▱", + "▰▰▱▱▱▱▱", + "▰▰▰▱▱▱▱", + "▰▰▰▰▱▱▱", + "▰▰▰▰▰▱▱", + "▰▰▰▰▰▰▱", + "▰▰▰▰▰▰▰", + "▰▱▱▱▱▱▱", + ], + }, +} diff --git a/src/pip/_vendor/rich/_stack.py b/src/pip/_vendor/rich/_stack.py new file mode 100644 index 000000000..194564e76 --- /dev/null +++ b/src/pip/_vendor/rich/_stack.py @@ -0,0 +1,16 @@ +from typing import List, TypeVar + +T = TypeVar("T") + + +class Stack(List[T]): + """A small shim over builtin list.""" + + @property + def top(self) -> T: + """Get top of stack.""" + return self[-1] + + def push(self, item: T) -> None: + """Push an item on to the stack (append in stack nomenclature).""" + self.append(item) diff --git a/src/pip/_vendor/rich/_timer.py b/src/pip/_vendor/rich/_timer.py new file mode 100644 index 000000000..a2ca6be03 --- /dev/null +++ b/src/pip/_vendor/rich/_timer.py @@ -0,0 +1,19 @@ +""" +Timer context manager, only used in debug. + +""" + +from time import time + +import contextlib +from typing import Generator + + +@contextlib.contextmanager +def timer(subject: str = "time") -> Generator[None, None, None]: + """print the elapsed time. (only used in debugging)""" + start = time() + yield + elapsed = time() - start + elapsed_ms = elapsed * 1000 + print(f"{subject} elapsed {elapsed_ms:.1f}ms") diff --git a/src/pip/_vendor/rich/_windows.py b/src/pip/_vendor/rich/_windows.py new file mode 100644 index 000000000..0fdbc4539 --- /dev/null +++ b/src/pip/_vendor/rich/_windows.py @@ -0,0 +1,75 @@ +import sys + +from dataclasses import dataclass + + +@dataclass +class WindowsConsoleFeatures: + """Windows features available.""" + + vt: bool = False + """The console supports VT codes.""" + truecolor: bool = False + """The console supports truecolor.""" + + +try: + import ctypes + from ctypes import wintypes + from ctypes import LibraryLoader + + if sys.platform == "win32": + windll = LibraryLoader(ctypes.WinDLL) + else: + windll = None + raise ImportError("Not windows") +except (AttributeError, ImportError, ValueError): + + # Fallback if we can't load the Windows DLL + def get_windows_console_features() -> WindowsConsoleFeatures: + features = WindowsConsoleFeatures() + return features + + +else: + + STDOUT = -11 + ENABLE_VIRTUAL_TERMINAL_PROCESSING = 4 + _GetConsoleMode = windll.kernel32.GetConsoleMode + _GetConsoleMode.argtypes = [wintypes.HANDLE, wintypes.LPDWORD] + _GetConsoleMode.restype = wintypes.BOOL + + _GetStdHandle = windll.kernel32.GetStdHandle + _GetStdHandle.argtypes = [ + wintypes.DWORD, + ] + _GetStdHandle.restype = wintypes.HANDLE + + def get_windows_console_features() -> WindowsConsoleFeatures: + """Get windows console features. + + Returns: + WindowsConsoleFeatures: An instance of WindowsConsoleFeatures. + """ + handle = _GetStdHandle(STDOUT) + console_mode = wintypes.DWORD() + result = _GetConsoleMode(handle, console_mode) + vt = bool(result and console_mode.value & ENABLE_VIRTUAL_TERMINAL_PROCESSING) + truecolor = False + if vt: + win_version = sys.getwindowsversion() + truecolor = win_version.major > 10 or ( + win_version.major == 10 and win_version.build >= 15063 + ) + features = WindowsConsoleFeatures(vt=vt, truecolor=truecolor) + return features + + +if __name__ == "__main__": + import platform + + features = get_windows_console_features() + from pip._vendor.rich import print + + print(f'platform="{platform.system()}"') + print(repr(features)) diff --git a/src/pip/_vendor/rich/_wrap.py b/src/pip/_vendor/rich/_wrap.py new file mode 100644 index 000000000..b537757a5 --- /dev/null +++ b/src/pip/_vendor/rich/_wrap.py @@ -0,0 +1,55 @@ +import re +from typing import Iterable, List, Tuple + +from .cells import cell_len, chop_cells +from ._loop import loop_last + +re_word = re.compile(r"\s*\S+\s*") + + +def words(text: str) -> Iterable[Tuple[int, int, str]]: + position = 0 + word_match = re_word.match(text, position) + while word_match is not None: + start, end = word_match.span() + word = word_match.group(0) + yield start, end, word + word_match = re_word.match(text, end) + + +def divide_line(text: str, width: int, fold: bool = True) -> List[int]: + divides: List[int] = [] + append = divides.append + line_position = 0 + _cell_len = cell_len + for start, _end, word in words(text): + word_length = _cell_len(word.rstrip()) + if line_position + word_length > width: + if word_length > width: + if fold: + for last, line in loop_last( + chop_cells(word, width, position=line_position) + ): + if last: + line_position = _cell_len(line) + else: + start += len(line) + append(start) + else: + if start: + append(start) + line_position = _cell_len(word) + elif line_position and start: + append(start) + line_position = _cell_len(word) + else: + line_position += _cell_len(word) + return divides + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + console = Console(width=10) + console.print("12345 abcdefghijklmnopqrstuvwyxzABCDEFGHIJKLMNOPQRSTUVWXYZ 12345") + print(chop_cells("abcdefghijklmnopqrstuvwxyz", 10, position=2)) diff --git a/src/pip/_vendor/rich/abc.py b/src/pip/_vendor/rich/abc.py new file mode 100644 index 000000000..e6e498efa --- /dev/null +++ b/src/pip/_vendor/rich/abc.py @@ -0,0 +1,33 @@ +from abc import ABC + + +class RichRenderable(ABC): + """An abstract base class for Rich renderables. + + Note that there is no need to extend this class, the intended use is to check if an + object supports the Rich renderable protocol. For example:: + + if isinstance(my_object, RichRenderable): + console.print(my_object) + + """ + + @classmethod + def __subclasshook__(cls, other: type) -> bool: + """Check if this class supports the rich render protocol.""" + return hasattr(other, "__rich_console__") or hasattr(other, "__rich__") + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.text import Text + + t = Text() + print(isinstance(Text, RichRenderable)) + print(isinstance(t, RichRenderable)) + + class Foo: + pass + + f = Foo() + print(isinstance(f, RichRenderable)) + print(isinstance("", RichRenderable)) diff --git a/src/pip/_vendor/rich/align.py b/src/pip/_vendor/rich/align.py new file mode 100644 index 000000000..4344ae141 --- /dev/null +++ b/src/pip/_vendor/rich/align.py @@ -0,0 +1,312 @@ +import sys +from itertools import chain +from typing import TYPE_CHECKING, Iterable, Optional + +if sys.version_info >= (3, 8): + from typing import Literal +else: + from pip._vendor.typing_extensions import Literal # pragma: no cover + +from .constrain import Constrain +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import StyleType + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType, RenderResult + +AlignMethod = Literal["left", "center", "right"] +VerticalAlignMethod = Literal["top", "middle", "bottom"] +AlignValues = AlignMethod # TODO: deprecate AlignValues + + +class Align(JupyterMixin): + """Align a renderable by adding spaces if necessary. + + Args: + renderable (RenderableType): A console renderable. + align (AlignMethod): One of "left", "center", or "right"" + style (StyleType, optional): An optional style to apply to the background. + vertical (Optional[VerticalAlginMethod], optional): Optional vertical align, one of "top", "middle", or "bottom". Defaults to None. + pad (bool, optional): Pad the right with spaces. Defaults to True. + width (int, optional): Restrict contents to given width, or None to use default width. Defaults to None. + height (int, optional): Set height of align renderable, or None to fit to contents. Defaults to None. + + Raises: + ValueError: if ``align`` is not one of the expected values. + """ + + def __init__( + self, + renderable: "RenderableType", + align: AlignMethod = "left", + style: Optional[StyleType] = None, + *, + vertical: Optional[VerticalAlignMethod] = None, + pad: bool = True, + width: Optional[int] = None, + height: Optional[int] = None, + ) -> None: + if align not in ("left", "center", "right"): + raise ValueError( + f'invalid value for align, expected "left", "center", or "right" (not {align!r})' + ) + if vertical is not None and vertical not in ("top", "middle", "bottom"): + raise ValueError( + f'invalid value for vertical, expected "top", "middle", or "bottom" (not {vertical!r})' + ) + self.renderable = renderable + self.align = align + self.style = style + self.vertical = vertical + self.pad = pad + self.width = width + self.height = height + + def __repr__(self) -> str: + return f"Align({self.renderable!r}, {self.align!r})" + + @classmethod + def left( + cls, + renderable: "RenderableType", + style: Optional[StyleType] = None, + *, + vertical: Optional[VerticalAlignMethod] = None, + pad: bool = True, + width: Optional[int] = None, + height: Optional[int] = None, + ) -> "Align": + """Align a renderable to the left.""" + return cls( + renderable, + "left", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + @classmethod + def center( + cls, + renderable: "RenderableType", + style: Optional[StyleType] = None, + *, + vertical: Optional[VerticalAlignMethod] = None, + pad: bool = True, + width: Optional[int] = None, + height: Optional[int] = None, + ) -> "Align": + """Align a renderable to the center.""" + return cls( + renderable, + "center", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + @classmethod + def right( + cls, + renderable: "RenderableType", + style: Optional[StyleType] = None, + *, + vertical: Optional[VerticalAlignMethod] = None, + pad: bool = True, + width: Optional[int] = None, + height: Optional[int] = None, + ) -> "Align": + """Align a renderable to the right.""" + return cls( + renderable, + "right", + style=style, + vertical=vertical, + pad=pad, + width=width, + height=height, + ) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + align = self.align + width = console.measure(self.renderable, options=options).maximum + rendered = console.render( + Constrain( + self.renderable, width if self.width is None else min(width, self.width) + ), + options.update(height=None), + ) + lines = list(Segment.split_lines(rendered)) + width, height = Segment.get_shape(lines) + lines = Segment.set_shape(lines, width, height) + new_line = Segment.line() + excess_space = options.max_width - width + style = console.get_style(self.style) if self.style is not None else None + + def generate_segments() -> Iterable[Segment]: + if excess_space <= 0: + # Exact fit + for line in lines: + yield from line + yield new_line + + elif align == "left": + # Pad on the right + pad = Segment(" " * excess_space, style) if self.pad else None + for line in lines: + yield from line + if pad: + yield pad + yield new_line + + elif align == "center": + # Pad left and right + left = excess_space // 2 + pad = Segment(" " * left, style) + pad_right = ( + Segment(" " * (excess_space - left), style) if self.pad else None + ) + for line in lines: + if left: + yield pad + yield from line + if pad_right: + yield pad_right + yield new_line + + elif align == "right": + # Padding on left + pad = Segment(" " * excess_space, style) + for line in lines: + yield pad + yield from line + yield new_line + + blank_line = ( + Segment(f"{' ' * (self.width or options.max_width)}\n", style) + if self.pad + else Segment("\n") + ) + + def blank_lines(count: int) -> Iterable[Segment]: + if count > 0: + for _ in range(count): + yield blank_line + + vertical_height = self.height or options.height + iter_segments: Iterable[Segment] + if self.vertical and vertical_height is not None: + if self.vertical == "top": + bottom_space = vertical_height - height + iter_segments = chain(generate_segments(), blank_lines(bottom_space)) + elif self.vertical == "middle": + top_space = (vertical_height - height) // 2 + bottom_space = vertical_height - top_space - height + iter_segments = chain( + blank_lines(top_space), + generate_segments(), + blank_lines(bottom_space), + ) + else: # self.vertical == "bottom": + top_space = vertical_height - height + iter_segments = chain(blank_lines(top_space), generate_segments()) + else: + iter_segments = generate_segments() + if self.style: + style = console.get_style(self.style) + iter_segments = Segment.apply_style(iter_segments, style) + yield from iter_segments + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + measurement = Measurement.get(console, options, self.renderable) + return measurement + + +class VerticalCenter(JupyterMixin): + """Vertically aligns a renderable. + + Warn: + This class is deprecated and may be removed in a future version. Use Align class with + `vertical="middle"`. + + Args: + renderable (RenderableType): A renderable object. + """ + + def __init__( + self, + renderable: "RenderableType", + style: Optional[StyleType] = None, + ) -> None: + self.renderable = renderable + self.style = style + + def __repr__(self) -> str: + return f"VerticalCenter({self.renderable!r})" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + style = console.get_style(self.style) if self.style is not None else None + lines = console.render_lines( + self.renderable, options.update(height=None), pad=False + ) + width, _height = Segment.get_shape(lines) + new_line = Segment.line() + height = options.height or options.size.height + top_space = (height - len(lines)) // 2 + bottom_space = height - top_space - len(lines) + blank_line = Segment(f"{' ' * width}", style) + + def blank_lines(count: int) -> Iterable[Segment]: + for _ in range(count): + yield blank_line + yield new_line + + if top_space > 0: + yield from blank_lines(top_space) + for line in lines: + yield from line + yield new_line + if bottom_space > 0: + yield from blank_lines(bottom_space) + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + measurement = Measurement.get(console, options, self.renderable) + return measurement + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console, Group + from pip._vendor.rich.highlighter import ReprHighlighter + from pip._vendor.rich.panel import Panel + + highlighter = ReprHighlighter() + console = Console() + + panel = Panel( + Group( + Align.left(highlighter("align='left'")), + Align.center(highlighter("align='center'")), + Align.right(highlighter("align='right'")), + ), + width=60, + style="on dark_blue", + title="Algin", + ) + + console.print( + Align.center(panel, vertical="middle", style="on red", height=console.height) + ) diff --git a/src/pip/_vendor/rich/ansi.py b/src/pip/_vendor/rich/ansi.py new file mode 100644 index 000000000..92e4772ed --- /dev/null +++ b/src/pip/_vendor/rich/ansi.py @@ -0,0 +1,228 @@ +from contextlib import suppress +import re +from typing import Iterable, NamedTuple + +from .color import Color +from .style import Style +from .text import Text + +re_ansi = re.compile(r"(?:\x1b\[(.*?)m)|(?:\x1b\](.*?)\x1b\\)") +re_csi = re.compile(r"\x1B(?:[@-Z\\-_]|\[[0-?]*[ -/]*[@-~])") + + +class _AnsiToken(NamedTuple): + """Result of ansi tokenized string.""" + + plain: str = "" + sgr: str = "" + osc: str = "" + + +def _ansi_tokenize(ansi_text: str) -> Iterable[_AnsiToken]: + """Tokenize a string in to plain text and ANSI codes. + + Args: + ansi_text (str): A String containing ANSI codes. + + Yields: + AnsiToken: A named tuple of (plain, sgr, osc) + """ + + def remove_csi(ansi_text: str) -> str: + """Remove unknown CSI sequences.""" + return re_csi.sub("", ansi_text) + + position = 0 + for match in re_ansi.finditer(ansi_text): + start, end = match.span(0) + sgr, osc = match.groups() + if start > position: + yield _AnsiToken(remove_csi(ansi_text[position:start])) + yield _AnsiToken("", sgr, osc) + position = end + if position < len(ansi_text): + yield _AnsiToken(remove_csi(ansi_text[position:])) + + +SGR_STYLE_MAP = { + 1: "bold", + 2: "dim", + 3: "italic", + 4: "underline", + 5: "blink", + 6: "blink2", + 7: "reverse", + 8: "conceal", + 9: "strike", + 21: "underline2", + 22: "not dim not bold", + 23: "not italic", + 24: "not underline", + 25: "not blink", + 26: "not blink2", + 27: "not reverse", + 28: "not conceal", + 29: "not strike", + 30: "color(0)", + 31: "color(1)", + 32: "color(2)", + 33: "color(3)", + 34: "color(4)", + 35: "color(5)", + 36: "color(6)", + 37: "color(7)", + 39: "default", + 40: "on color(0)", + 41: "on color(1)", + 42: "on color(2)", + 43: "on color(3)", + 44: "on color(4)", + 45: "on color(5)", + 46: "on color(6)", + 47: "on color(7)", + 49: "on default", + 51: "frame", + 52: "encircle", + 53: "overline", + 54: "not frame not encircle", + 55: "not overline", + 90: "color(8)", + 91: "color(9)", + 92: "color(10)", + 93: "color(11)", + 94: "color(12)", + 95: "color(13)", + 96: "color(14)", + 97: "color(15)", + 100: "on color(8)", + 101: "on color(9)", + 102: "on color(10)", + 103: "on color(11)", + 104: "on color(12)", + 105: "on color(13)", + 106: "on color(14)", + 107: "on color(15)", +} + + +class AnsiDecoder: + """Translate ANSI code in to styled Text.""" + + def __init__(self) -> None: + self.style = Style.null() + + def decode(self, terminal_text: str) -> Iterable[Text]: + """Decode ANSI codes in an interable of lines. + + Args: + lines (Iterable[str]): An iterable of lines of terminal output. + + Yields: + Text: Marked up Text. + """ + for line in terminal_text.splitlines(): + yield self.decode_line(line) + + def decode_line(self, line: str) -> Text: + """Decode a line containing ansi codes. + + Args: + line (str): A line of terminal output. + + Returns: + Text: A Text instance marked up according to ansi codes. + """ + from_ansi = Color.from_ansi + from_rgb = Color.from_rgb + _Style = Style + text = Text() + append = text.append + line = line.rsplit("\r", 1)[-1] + for token in _ansi_tokenize(line): + plain_text, sgr, osc = token + if plain_text: + append(plain_text, self.style or None) + elif osc: + if osc.startswith("8;"): + _params, semicolon, link = osc[2:].partition(";") + if semicolon: + self.style = self.style.update_link(link or None) + elif sgr: + # Translate in to semi-colon separated codes + # Ignore invalid codes, because we want to be lenient + codes = [ + min(255, int(_code)) for _code in sgr.split(";") if _code.isdigit() + ] + iter_codes = iter(codes) + for code in iter_codes: + if code == 0: + # reset + self.style = _Style.null() + elif code in SGR_STYLE_MAP: + # styles + self.style += _Style.parse(SGR_STYLE_MAP[code]) + elif code == 38: + # Foreground + with suppress(StopIteration): + color_type = next(iter_codes) + if color_type == 5: + self.style += _Style.from_color( + from_ansi(next(iter_codes)) + ) + elif color_type == 2: + self.style += _Style.from_color( + from_rgb( + next(iter_codes), + next(iter_codes), + next(iter_codes), + ) + ) + elif code == 48: + # Background + with suppress(StopIteration): + color_type = next(iter_codes) + if color_type == 5: + self.style += _Style.from_color( + None, from_ansi(next(iter_codes)) + ) + elif color_type == 2: + self.style += _Style.from_color( + None, + from_rgb( + next(iter_codes), + next(iter_codes), + next(iter_codes), + ), + ) + + return text + + +if __name__ == "__main__": # pragma: no cover + import pty + import io + import os + import sys + + decoder = AnsiDecoder() + + stdout = io.BytesIO() + + def read(fd: int) -> bytes: + data = os.read(fd, 1024) + stdout.write(data) + return data + + pty.spawn(sys.argv[1:], read) + + from .console import Console + + console = Console(record=True) + + stdout_result = stdout.getvalue().decode("utf-8") + print(stdout_result) + + for line in decoder.decode(stdout_result): + console.print(line) + + console.save_html("stdout.html") diff --git a/src/pip/_vendor/rich/bar.py b/src/pip/_vendor/rich/bar.py new file mode 100644 index 000000000..ed86a552d --- /dev/null +++ b/src/pip/_vendor/rich/bar.py @@ -0,0 +1,94 @@ +from typing import Optional, Union + +from .color import Color +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style + +# There are left-aligned characters for 1/8 to 7/8, but +# the right-aligned characters exist only for 1/8 and 4/8. +BEGIN_BLOCK_ELEMENTS = ["█", "█", "█", "▐", "▐", "▐", "▕", "▕"] +END_BLOCK_ELEMENTS = [" ", "▏", "▎", "▍", "▌", "▋", "▊", "▉"] +FULL_BLOCK = "█" + + +class Bar(JupyterMixin): + """Renders a solid block bar. + + Args: + size (float): Value for the end of the bar. + begin (float): Begin point (between 0 and size, inclusive). + end (float): End point (between 0 and size, inclusive). + width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. + color (Union[Color, str], optional): Color of the bar. Defaults to "default". + bgcolor (Union[Color, str], optional): Color of bar background. Defaults to "default". + """ + + def __init__( + self, + size: float, + begin: float, + end: float, + *, + width: Optional[int] = None, + color: Union[Color, str] = "default", + bgcolor: Union[Color, str] = "default", + ): + self.size = size + self.begin = max(begin, 0) + self.end = min(end, size) + self.width = width + self.style = Style(color=color, bgcolor=bgcolor) + + def __repr__(self) -> str: + return f"Bar({self.size}, {self.begin}, {self.end})" + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + width = min( + self.width if self.width is not None else options.max_width, + options.max_width, + ) + + if self.begin >= self.end: + yield Segment(" " * width, self.style) + yield Segment.line() + return + + prefix_complete_eights = int(width * 8 * self.begin / self.size) + prefix_bar_count = prefix_complete_eights // 8 + prefix_eights_count = prefix_complete_eights % 8 + + body_complete_eights = int(width * 8 * self.end / self.size) + body_bar_count = body_complete_eights // 8 + body_eights_count = body_complete_eights % 8 + + # When start and end fall into the same cell, we ideally should render + # a symbol that's "center-aligned", but there is no good symbol in Unicode. + # In this case, we fall back to right-aligned block symbol for simplicity. + + prefix = " " * prefix_bar_count + if prefix_eights_count: + prefix += BEGIN_BLOCK_ELEMENTS[prefix_eights_count] + + body = FULL_BLOCK * body_bar_count + if body_eights_count: + body += END_BLOCK_ELEMENTS[body_eights_count] + + suffix = " " * (width - len(body)) + + yield Segment(prefix + body[len(prefix) :] + suffix, self.style) + yield Segment.line() + + def __rich_measure__( + self, console: Console, options: ConsoleOptions + ) -> Measurement: + return ( + Measurement(self.width, self.width) + if self.width is not None + else Measurement(4, options.max_width) + ) diff --git a/src/pip/_vendor/rich/box.py b/src/pip/_vendor/rich/box.py new file mode 100644 index 000000000..aec2926be --- /dev/null +++ b/src/pip/_vendor/rich/box.py @@ -0,0 +1,483 @@ +import sys +from typing import TYPE_CHECKING, Iterable, List + +if sys.version_info >= (3, 8): + from typing import Literal +else: + from pip._vendor.typing_extensions import Literal # pragma: no cover + + +from ._loop import loop_last + +if TYPE_CHECKING: + from pip._vendor.rich.console import ConsoleOptions + + +class Box: + """Defines characters to render boxes. + + ┌─┬┐ top + │ ││ head + ├─┼┤ head_row + │ ││ mid + ├─┼┤ row + ├─┼┤ foot_row + │ ││ foot + └─┴┘ bottom + + Args: + box (str): Characters making up box. + ascii (bool, optional): True if this box uses ascii characters only. Default is False. + """ + + def __init__(self, box: str, *, ascii: bool = False) -> None: + self._box = box + self.ascii = ascii + line1, line2, line3, line4, line5, line6, line7, line8 = box.splitlines() + # top + self.top_left, self.top, self.top_divider, self.top_right = iter(line1) + # head + self.head_left, _, self.head_vertical, self.head_right = iter(line2) + # head_row + ( + self.head_row_left, + self.head_row_horizontal, + self.head_row_cross, + self.head_row_right, + ) = iter(line3) + + # mid + self.mid_left, _, self.mid_vertical, self.mid_right = iter(line4) + # row + self.row_left, self.row_horizontal, self.row_cross, self.row_right = iter(line5) + # foot_row + ( + self.foot_row_left, + self.foot_row_horizontal, + self.foot_row_cross, + self.foot_row_right, + ) = iter(line6) + # foot + self.foot_left, _, self.foot_vertical, self.foot_right = iter(line7) + # bottom + self.bottom_left, self.bottom, self.bottom_divider, self.bottom_right = iter( + line8 + ) + + def __repr__(self) -> str: + return "Box(...)" + + def __str__(self) -> str: + return self._box + + def substitute(self, options: "ConsoleOptions", safe: bool = True) -> "Box": + """Substitute this box for another if it won't render due to platform issues. + + Args: + options (ConsoleOptions): Console options used in rendering. + safe (bool, optional): Substitute this for another Box if there are known problems + displaying on the platform (currently only relevant on Windows). Default is True. + + Returns: + Box: A different Box or the same Box. + """ + box = self + if options.legacy_windows and safe: + box = LEGACY_WINDOWS_SUBSTITUTIONS.get(box, box) + if options.ascii_only and not box.ascii: + box = ASCII + return box + + def get_top(self, widths: Iterable[int]) -> str: + """Get the top of a simple box. + + Args: + widths (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + + parts: List[str] = [] + append = parts.append + append(self.top_left) + for last, width in loop_last(widths): + append(self.top * width) + if not last: + append(self.top_divider) + append(self.top_right) + return "".join(parts) + + def get_row( + self, + widths: Iterable[int], + level: Literal["head", "row", "foot", "mid"] = "row", + edge: bool = True, + ) -> str: + """Get the top of a simple box. + + Args: + width (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + if level == "head": + left = self.head_row_left + horizontal = self.head_row_horizontal + cross = self.head_row_cross + right = self.head_row_right + elif level == "row": + left = self.row_left + horizontal = self.row_horizontal + cross = self.row_cross + right = self.row_right + elif level == "mid": + left = self.mid_left + horizontal = " " + cross = self.mid_vertical + right = self.mid_right + elif level == "foot": + left = self.foot_row_left + horizontal = self.foot_row_horizontal + cross = self.foot_row_cross + right = self.foot_row_right + else: + raise ValueError("level must be 'head', 'row' or 'foot'") + + parts: List[str] = [] + append = parts.append + if edge: + append(left) + for last, width in loop_last(widths): + append(horizontal * width) + if not last: + append(cross) + if edge: + append(right) + return "".join(parts) + + def get_bottom(self, widths: Iterable[int]) -> str: + """Get the bottom of a simple box. + + Args: + widths (List[int]): Widths of columns. + + Returns: + str: A string of box characters. + """ + + parts: List[str] = [] + append = parts.append + append(self.bottom_left) + for last, width in loop_last(widths): + append(self.bottom * width) + if not last: + append(self.bottom_divider) + append(self.bottom_right) + return "".join(parts) + + +ASCII: Box = Box( + """\ ++--+ +| || +|-+| +| || +|-+| +|-+| +| || ++--+ +""", + ascii=True, +) + +ASCII2: Box = Box( + """\ ++-++ +| || ++-++ +| || ++-++ ++-++ +| || ++-++ +""", + ascii=True, +) + +ASCII_DOUBLE_HEAD: Box = Box( + """\ ++-++ +| || ++=++ +| || ++-++ ++-++ +| || ++-++ +""", + ascii=True, +) + +SQUARE: Box = Box( + """\ +┌─┬┐ +│ ││ +├─┼┤ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +SQUARE_DOUBLE_HEAD: Box = Box( + """\ +┌─┬┐ +│ ││ +╞═╪╡ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +MINIMAL: Box = Box( + """\ + ╷ + │ +╶─┼╴ + │ +╶─┼╴ +╶─┼╴ + │ + ╵ +""" +) + + +MINIMAL_HEAVY_HEAD: Box = Box( + """\ + ╷ + │ +╺━┿╸ + │ +╶─┼╴ +╶─┼╴ + │ + ╵ +""" +) + +MINIMAL_DOUBLE_HEAD: Box = Box( + """\ + ╷ + │ + ═╪ + │ + ─┼ + ─┼ + │ + ╵ +""" +) + + +SIMPLE: Box = Box( + """\ + + + ── + + + ── + + +""" +) + +SIMPLE_HEAD: Box = Box( + """\ + + + ── + + + + + +""" +) + + +SIMPLE_HEAVY: Box = Box( + """\ + + + ━━ + + + ━━ + + +""" +) + + +HORIZONTALS: Box = Box( + """\ + ── + + ── + + ── + ── + + ── +""" +) + +ROUNDED: Box = Box( + """\ +╭─┬╮ +│ ││ +├─┼┤ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +╰─┴╯ +""" +) + +HEAVY: Box = Box( + """\ +┏━┳┓ +┃ ┃┃ +┣━╋┫ +┃ ┃┃ +┣━╋┫ +┣━╋┫ +┃ ┃┃ +┗━┻┛ +""" +) + +HEAVY_EDGE: Box = Box( + """\ +┏━┯┓ +┃ │┃ +┠─┼┨ +┃ │┃ +┠─┼┨ +┠─┼┨ +┃ │┃ +┗━┷┛ +""" +) + +HEAVY_HEAD: Box = Box( + """\ +┏━┳┓ +┃ ┃┃ +┡━╇┩ +│ ││ +├─┼┤ +├─┼┤ +│ ││ +└─┴┘ +""" +) + +DOUBLE: Box = Box( + """\ +╔═╦╗ +║ ║║ +╠═╬╣ +║ ║║ +╠═╬╣ +╠═╬╣ +║ ║║ +╚═╩╝ +""" +) + +DOUBLE_EDGE: Box = Box( + """\ +╔═╤╗ +║ │║ +╟─┼╢ +║ │║ +╟─┼╢ +╟─┼╢ +║ │║ +╚═╧╝ +""" +) + +# Map Boxes that don't render with raster fonts on to equivalent that do +LEGACY_WINDOWS_SUBSTITUTIONS = { + ROUNDED: SQUARE, + MINIMAL_HEAVY_HEAD: MINIMAL, + SIMPLE_HEAVY: SIMPLE, + HEAVY: SQUARE, + HEAVY_EDGE: SQUARE, + HEAVY_HEAD: SQUARE, +} + + +if __name__ == "__main__": # pragma: no cover + + from pip._vendor.rich.columns import Columns + from pip._vendor.rich.panel import Panel + + from . import box as box + from .console import Console + from .table import Table + from .text import Text + + console = Console(record=True) + + BOXES = [ + "ASCII", + "ASCII2", + "ASCII_DOUBLE_HEAD", + "SQUARE", + "SQUARE_DOUBLE_HEAD", + "MINIMAL", + "MINIMAL_HEAVY_HEAD", + "MINIMAL_DOUBLE_HEAD", + "SIMPLE", + "SIMPLE_HEAD", + "SIMPLE_HEAVY", + "HORIZONTALS", + "ROUNDED", + "HEAVY", + "HEAVY_EDGE", + "HEAVY_HEAD", + "DOUBLE", + "DOUBLE_EDGE", + ] + + console.print(Panel("[bold green]Box Constants", style="green"), justify="center") + console.print() + + columns = Columns(expand=True, padding=2) + for box_name in sorted(BOXES): + table = Table( + show_footer=True, style="dim", border_style="not dim", expand=True + ) + table.add_column("Header 1", "Footer 1") + table.add_column("Header 2", "Footer 2") + table.add_row("Cell", "Cell") + table.add_row("Cell", "Cell") + table.box = getattr(box, box_name) + table.title = Text(f"box.{box_name}", style="magenta") + columns.add_renderable(table) + console.print(columns) + + # console.save_html("box.html", inline_styles=True) diff --git a/src/pip/_vendor/rich/cells.py b/src/pip/_vendor/rich/cells.py new file mode 100644 index 000000000..7f9c0c16c --- /dev/null +++ b/src/pip/_vendor/rich/cells.py @@ -0,0 +1,133 @@ +from functools import lru_cache +from typing import Dict, List + +from ._cell_widths import CELL_WIDTHS +from ._lru_cache import LRUCache + + +def cell_len(text: str, _cache: Dict[str, int] = LRUCache(1024 * 4)) -> int: + """Get the number of cells required to display text. + + Args: + text (str): Text to display. + + Returns: + int: Number of cells required to display the text. + """ + cached_result = _cache.get(text, None) + if cached_result is not None: + return cached_result + + _get_size = get_character_cell_size + total_size = sum(_get_size(character) for character in text) + if len(text) <= 64: + _cache[text] = total_size + return total_size + + +@lru_cache(maxsize=4096) +def get_character_cell_size(character: str) -> int: + """Get the cell size of a character. + + Args: + character (str): A single character. + + Returns: + int: Number of cells (0, 1 or 2) occupied by that character. + """ + + codepoint = ord(character) + if 127 > codepoint > 31: + # Shortcut for ascii + return 1 + return _get_codepoint_cell_size(codepoint) + + +@lru_cache(maxsize=4096) +def _get_codepoint_cell_size(codepoint: int) -> int: + """Get the cell size of a character. + + Args: + character (str): A single character. + + Returns: + int: Number of cells (0, 1 or 2) occupied by that character. + """ + + _table = CELL_WIDTHS + lower_bound = 0 + upper_bound = len(_table) - 1 + index = (lower_bound + upper_bound) // 2 + while True: + start, end, width = _table[index] + if codepoint < start: + upper_bound = index - 1 + elif codepoint > end: + lower_bound = index + 1 + else: + return 0 if width == -1 else width + if upper_bound < lower_bound: + break + index = (lower_bound + upper_bound) // 2 + return 1 + + +def set_cell_size(text: str, total: int) -> str: + """Set the length of a string to fit within given number of cells.""" + cell_size = cell_len(text) + if cell_size == total: + return text + if cell_size < total: + return text + " " * (total - cell_size) + + start = 0 + end = cell_size + + # Binary search until we find the right size + while True: + pos = (start + end) // 2 + before = text[:pos] + before_len = cell_len(before) + if before_len == total + 1 and cell_len(before[-1]) == 2: + return before[:-1] + " " + if before_len == total: + return before + if before_len > total: + end = pos + else: + start = pos + + +# TODO: This is inefficient +# TODO: This might not work with CWJ type characters +def chop_cells(text: str, max_size: int, position: int = 0) -> List[str]: + """Break text in to equal (cell) length strings.""" + _get_character_cell_size = get_character_cell_size + characters = [ + (character, _get_character_cell_size(character)) for character in text + ][::-1] + total_size = position + lines: List[List[str]] = [[]] + append = lines[-1].append + + pop = characters.pop + while characters: + character, size = pop() + if total_size + size > max_size: + lines.append([character]) + append = lines[-1].append + total_size = size + else: + total_size += size + append(character) + return ["".join(line) for line in lines] + + +if __name__ == "__main__": # pragma: no cover + + print(get_character_cell_size("😽")) + for line in chop_cells("""这是对亚洲语言支持的测试。面对模棱两可的想法,拒绝猜测的诱惑。""", 8): + print(line) + for n in range(80, 1, -1): + print(set_cell_size("""这是对亚洲语言支持的测试。面对模棱两可的想法,拒绝猜测的诱惑。""", n) + "|") + print("x" * n) diff --git a/src/pip/_vendor/rich/color.py b/src/pip/_vendor/rich/color.py new file mode 100644 index 000000000..f0fa026d6 --- /dev/null +++ b/src/pip/_vendor/rich/color.py @@ -0,0 +1,581 @@ +import platform +import re +from colorsys import rgb_to_hls +from enum import IntEnum +from functools import lru_cache +from typing import TYPE_CHECKING, NamedTuple, Optional, Tuple + +from ._palettes import EIGHT_BIT_PALETTE, STANDARD_PALETTE, WINDOWS_PALETTE +from .color_triplet import ColorTriplet +from .repr import rich_repr, Result +from .terminal_theme import DEFAULT_TERMINAL_THEME + +if TYPE_CHECKING: # pragma: no cover + from .terminal_theme import TerminalTheme + from .text import Text + + +WINDOWS = platform.system() == "Windows" + + +class ColorSystem(IntEnum): + """One of the 3 color system supported by terminals.""" + + STANDARD = 1 + EIGHT_BIT = 2 + TRUECOLOR = 3 + WINDOWS = 4 + + def __repr__(self) -> str: + return f"ColorSystem.{self.name}" + + +class ColorType(IntEnum): + """Type of color stored in Color class.""" + + DEFAULT = 0 + STANDARD = 1 + EIGHT_BIT = 2 + TRUECOLOR = 3 + WINDOWS = 4 + + def __repr__(self) -> str: + return f"ColorType.{self.name}" + + +ANSI_COLOR_NAMES = { + "black": 0, + "red": 1, + "green": 2, + "yellow": 3, + "blue": 4, + "magenta": 5, + "cyan": 6, + "white": 7, + "bright_black": 8, + "bright_red": 9, + "bright_green": 10, + "bright_yellow": 11, + "bright_blue": 12, + "bright_magenta": 13, + "bright_cyan": 14, + "bright_white": 15, + "grey0": 16, + "navy_blue": 17, + "dark_blue": 18, + "blue3": 20, + "blue1": 21, + "dark_green": 22, + "deep_sky_blue4": 25, + "dodger_blue3": 26, + "dodger_blue2": 27, + "green4": 28, + "spring_green4": 29, + "turquoise4": 30, + "deep_sky_blue3": 32, + "dodger_blue1": 33, + "green3": 40, + "spring_green3": 41, + "dark_cyan": 36, + "light_sea_green": 37, + "deep_sky_blue2": 38, + "deep_sky_blue1": 39, + "spring_green2": 47, + "cyan3": 43, + "dark_turquoise": 44, + "turquoise2": 45, + "green1": 46, + "spring_green1": 48, + "medium_spring_green": 49, + "cyan2": 50, + "cyan1": 51, + "dark_red": 88, + "deep_pink4": 125, + "purple4": 55, + "purple3": 56, + "blue_violet": 57, + "orange4": 94, + "grey37": 59, + "medium_purple4": 60, + "slate_blue3": 62, + "royal_blue1": 63, + "chartreuse4": 64, + "dark_sea_green4": 71, + "pale_turquoise4": 66, + "steel_blue": 67, + "steel_blue3": 68, + "cornflower_blue": 69, + "chartreuse3": 76, + "cadet_blue": 73, + "sky_blue3": 74, + "steel_blue1": 81, + "pale_green3": 114, + "sea_green3": 78, + "aquamarine3": 79, + "medium_turquoise": 80, + "chartreuse2": 112, + "sea_green2": 83, + "sea_green1": 85, + "aquamarine1": 122, + "dark_slate_gray2": 87, + "dark_magenta": 91, + "dark_violet": 128, + "purple": 129, + "light_pink4": 95, + "plum4": 96, + "medium_purple3": 98, + "slate_blue1": 99, + "yellow4": 106, + "wheat4": 101, + "grey53": 102, + "light_slate_grey": 103, + "medium_purple": 104, + "light_slate_blue": 105, + "dark_olive_green3": 149, + "dark_sea_green": 108, + "light_sky_blue3": 110, + "sky_blue2": 111, + "dark_sea_green3": 150, + "dark_slate_gray3": 116, + "sky_blue1": 117, + "chartreuse1": 118, + "light_green": 120, + "pale_green1": 156, + "dark_slate_gray1": 123, + "red3": 160, + "medium_violet_red": 126, + "magenta3": 164, + "dark_orange3": 166, + "indian_red": 167, + "hot_pink3": 168, + "medium_orchid3": 133, + "medium_orchid": 134, + "medium_purple2": 140, + "dark_goldenrod": 136, + "light_salmon3": 173, + "rosy_brown": 138, + "grey63": 139, + "medium_purple1": 141, + "gold3": 178, + "dark_khaki": 143, + "navajo_white3": 144, + "grey69": 145, + "light_steel_blue3": 146, + "light_steel_blue": 147, + "yellow3": 184, + "dark_sea_green2": 157, + "light_cyan3": 152, + "light_sky_blue1": 153, + "green_yellow": 154, + "dark_olive_green2": 155, + "dark_sea_green1": 193, + "pale_turquoise1": 159, + "deep_pink3": 162, + "magenta2": 200, + "hot_pink2": 169, + "orchid": 170, + "medium_orchid1": 207, + "orange3": 172, + "light_pink3": 174, + "pink3": 175, + "plum3": 176, + "violet": 177, + "light_goldenrod3": 179, + "tan": 180, + "misty_rose3": 181, + "thistle3": 182, + "plum2": 183, + "khaki3": 185, + "light_goldenrod2": 222, + "light_yellow3": 187, + "grey84": 188, + "light_steel_blue1": 189, + "yellow2": 190, + "dark_olive_green1": 192, + "honeydew2": 194, + "light_cyan1": 195, + "red1": 196, + "deep_pink2": 197, + "deep_pink1": 199, + "magenta1": 201, + "orange_red1": 202, + "indian_red1": 204, + "hot_pink": 206, + "dark_orange": 208, + "salmon1": 209, + "light_coral": 210, + "pale_violet_red1": 211, + "orchid2": 212, + "orchid1": 213, + "orange1": 214, + "sandy_brown": 215, + "light_salmon1": 216, + "light_pink1": 217, + "pink1": 218, + "plum1": 219, + "gold1": 220, + "navajo_white1": 223, + "misty_rose1": 224, + "thistle1": 225, + "yellow1": 226, + "light_goldenrod1": 227, + "khaki1": 228, + "wheat1": 229, + "cornsilk1": 230, + "grey100": 231, + "grey3": 232, + "grey7": 233, + "grey11": 234, + "grey15": 235, + "grey19": 236, + "grey23": 237, + "grey27": 238, + "grey30": 239, + "grey35": 240, + "grey39": 241, + "grey42": 242, + "grey46": 243, + "grey50": 244, + "grey54": 245, + "grey58": 246, + "grey62": 247, + "grey66": 248, + "grey70": 249, + "grey74": 250, + "grey78": 251, + "grey82": 252, + "grey85": 253, + "grey89": 254, + "grey93": 255, +} + + +class ColorParseError(Exception): + """The color could not be parsed.""" + + +RE_COLOR = re.compile( + r"""^ +\#([0-9a-f]{6})$| +color\(([0-9]{1,3})\)$| +rgb\(([\d\s,]+)\)$ +""", + re.VERBOSE, +) + + +@rich_repr +class Color(NamedTuple): + """Terminal color definition.""" + + name: str + """The name of the color (typically the input to Color.parse).""" + type: ColorType + """The type of the color.""" + number: Optional[int] = None + """The color number, if a standard color, or None.""" + triplet: Optional[ColorTriplet] = None + """A triplet of color components, if an RGB color.""" + + def __rich__(self) -> "Text": + """Dispays the actual color if Rich printed.""" + from .text import Text + from .style import Style + + return Text.assemble( + f"<color {self.name!r} ({self.type.name.lower()})", + ("⬤", Style(color=self)), + " >", + ) + + def __rich_repr__(self) -> Result: + yield self.name + yield self.type + yield "number", self.number, None + yield "triplet", self.triplet, None + + @property + def system(self) -> ColorSystem: + """Get the native color system for this color.""" + if self.type == ColorType.DEFAULT: + return ColorSystem.STANDARD + return ColorSystem(int(self.type)) + + @property + def is_system_defined(self) -> bool: + """Check if the color is ultimately defined by the system.""" + return self.system not in (ColorSystem.EIGHT_BIT, ColorSystem.TRUECOLOR) + + @property + def is_default(self) -> bool: + """Check if the color is a default color.""" + return self.type == ColorType.DEFAULT + + def get_truecolor( + self, theme: Optional["TerminalTheme"] = None, foreground: bool = True + ) -> ColorTriplet: + """Get an equivalent color triplet for this color. + + Args: + theme (TerminalTheme, optional): Optional terminal theme, or None to use default. Defaults to None. + foreground (bool, optional): True for a foreground color, or False for background. Defaults to True. + + Returns: + ColorTriplet: A color triplet containing RGB components. + """ + + if theme is None: + theme = DEFAULT_TERMINAL_THEME + if self.type == ColorType.TRUECOLOR: + assert self.triplet is not None + return self.triplet + elif self.type == ColorType.EIGHT_BIT: + assert self.number is not None + return EIGHT_BIT_PALETTE[self.number] + elif self.type == ColorType.STANDARD: + assert self.number is not None + return theme.ansi_colors[self.number] + elif self.type == ColorType.WINDOWS: + assert self.number is not None + return WINDOWS_PALETTE[self.number] + else: # self.type == ColorType.DEFAULT: + assert self.number is None + return theme.foreground_color if foreground else theme.background_color + + @classmethod + def from_ansi(cls, number: int) -> "Color": + """Create a Color number from it's 8-bit ansi number. + + Args: + number (int): A number between 0-255 inclusive. + + Returns: + Color: A new Color instance. + """ + return cls( + name=f"color({number})", + type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), + number=number, + ) + + @classmethod + def from_triplet(cls, triplet: "ColorTriplet") -> "Color": + """Create a truecolor RGB color from a triplet of values. + + Args: + triplet (ColorTriplet): A color triplet containing red, green and blue components. + + Returns: + Color: A new color object. + """ + return cls(name=triplet.hex, type=ColorType.TRUECOLOR, triplet=triplet) + + @classmethod + def from_rgb(cls, red: float, green: float, blue: float) -> "Color": + """Create a truecolor from three color components in the range(0->255). + + Args: + red (float): Red component in range 0-255. + green (float): Green component in range 0-255. + blue (float): Blue component in range 0-255. + + Returns: + Color: A new color object. + """ + return cls.from_triplet(ColorTriplet(int(red), int(green), int(blue))) + + @classmethod + def default(cls) -> "Color": + """Get a Color instance representing the default color. + + Returns: + Color: Default color. + """ + return cls(name="default", type=ColorType.DEFAULT) + + @classmethod + @lru_cache(maxsize=1024) + def parse(cls, color: str) -> "Color": + """Parse a color definition.""" + original_color = color + color = color.lower().strip() + + if color == "default": + return cls(color, type=ColorType.DEFAULT) + + color_number = ANSI_COLOR_NAMES.get(color) + if color_number is not None: + return cls( + color, + type=(ColorType.STANDARD if color_number < 16 else ColorType.EIGHT_BIT), + number=color_number, + ) + + color_match = RE_COLOR.match(color) + if color_match is None: + raise ColorParseError(f"{original_color!r} is not a valid color") + + color_24, color_8, color_rgb = color_match.groups() + if color_24: + triplet = ColorTriplet( + int(color_24[0:2], 16), int(color_24[2:4], 16), int(color_24[4:6], 16) + ) + return cls(color, ColorType.TRUECOLOR, triplet=triplet) + + elif color_8: + number = int(color_8) + if number > 255: + raise ColorParseError(f"color number must be <= 255 in {color!r}") + return cls( + color, + type=(ColorType.STANDARD if number < 16 else ColorType.EIGHT_BIT), + number=number, + ) + + else: # color_rgb: + components = color_rgb.split(",") + if len(components) != 3: + raise ColorParseError( + f"expected three components in {original_color!r}" + ) + red, green, blue = components + triplet = ColorTriplet(int(red), int(green), int(blue)) + if not all(component <= 255 for component in triplet): + raise ColorParseError( + f"color components must be <= 255 in {original_color!r}" + ) + return cls(color, ColorType.TRUECOLOR, triplet=triplet) + + @lru_cache(maxsize=1024) + def get_ansi_codes(self, foreground: bool = True) -> Tuple[str, ...]: + """Get the ANSI escape codes for this color.""" + _type = self.type + if _type == ColorType.DEFAULT: + return ("39" if foreground else "49",) + + elif _type == ColorType.WINDOWS: + number = self.number + assert number is not None + fore, back = (30, 40) if number < 8 else (82, 92) + return (str(fore + number if foreground else back + number),) + + elif _type == ColorType.STANDARD: + number = self.number + assert number is not None + fore, back = (30, 40) if number < 8 else (82, 92) + return (str(fore + number if foreground else back + number),) + + elif _type == ColorType.EIGHT_BIT: + assert self.number is not None + return ("38" if foreground else "48", "5", str(self.number)) + + else: # self.standard == ColorStandard.TRUECOLOR: + assert self.triplet is not None + red, green, blue = self.triplet + return ("38" if foreground else "48", "2", str(red), str(green), str(blue)) + + @lru_cache(maxsize=1024) + def downgrade(self, system: ColorSystem) -> "Color": + """Downgrade a color system to a system with fewer colors.""" + + if self.type in [ColorType.DEFAULT, system]: + return self + # Convert to 8-bit color from truecolor color + if system == ColorSystem.EIGHT_BIT and self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + red, green, blue = self.triplet.normalized + _h, l, s = rgb_to_hls(red, green, blue) + # If saturation is under 10% assume it is grayscale + if s < 0.1: + gray = round(l * 25.0) + if gray == 0: + color_number = 16 + elif gray == 25: + color_number = 231 + else: + color_number = 231 + gray + return Color(self.name, ColorType.EIGHT_BIT, number=color_number) + + color_number = ( + 16 + 36 * round(red * 5.0) + 6 * round(green * 5.0) + round(blue * 5.0) + ) + return Color(self.name, ColorType.EIGHT_BIT, number=color_number) + + # Convert to standard from truecolor or 8-bit + elif system == ColorSystem.STANDARD: + if self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + triplet = self.triplet + else: # self.system == ColorSystem.EIGHT_BIT + assert self.number is not None + triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number]) + + color_number = STANDARD_PALETTE.match(triplet) + return Color(self.name, ColorType.STANDARD, number=color_number) + + elif system == ColorSystem.WINDOWS: + if self.system == ColorSystem.TRUECOLOR: + assert self.triplet is not None + triplet = self.triplet + else: # self.system == ColorSystem.EIGHT_BIT + assert self.number is not None + if self.number < 16: + return Color(self.name, ColorType.WINDOWS, number=self.number) + triplet = ColorTriplet(*EIGHT_BIT_PALETTE[self.number]) + + color_number = WINDOWS_PALETTE.match(triplet) + return Color(self.name, ColorType.WINDOWS, number=color_number) + + return self + + +def parse_rgb_hex(hex_color: str) -> ColorTriplet: + """Parse six hex characters in to RGB triplet.""" + assert len(hex_color) == 6, "must be 6 characters" + color = ColorTriplet( + int(hex_color[0:2], 16), int(hex_color[2:4], 16), int(hex_color[4:6], 16) + ) + return color + + +def blend_rgb( + color1: ColorTriplet, color2: ColorTriplet, cross_fade: float = 0.5 +) -> ColorTriplet: + """Blend one RGB color in to another.""" + r1, g1, b1 = color1 + r2, g2, b2 = color2 + new_color = ColorTriplet( + int(r1 + (r2 - r1) * cross_fade), + int(g1 + (g2 - g1) * cross_fade), + int(b1 + (b2 - b1) * cross_fade), + ) + return new_color + + +if __name__ == "__main__": # pragma: no cover + + from .console import Console + from .table import Table + from .text import Text + + console = Console() + + table = Table(show_footer=False, show_edge=True) + table.add_column("Color", width=10, overflow="ellipsis") + table.add_column("Number", justify="right", style="yellow") + table.add_column("Name", style="green") + table.add_column("Hex", style="blue") + table.add_column("RGB", style="magenta") + + colors = sorted((v, k) for k, v in ANSI_COLOR_NAMES.items()) + for color_number, name in colors: + color_cell = Text(" " * 10, style=f"on {name}") + if color_number < 16: + table.add_row(color_cell, f"{color_number}", Text(f'"{name}"')) + else: + color = EIGHT_BIT_PALETTE[color_number] # type: ignore + table.add_row( + color_cell, str(color_number), Text(f'"{name}"'), color.hex, color.rgb + ) + + console.print(table) diff --git a/src/pip/_vendor/rich/color_triplet.py b/src/pip/_vendor/rich/color_triplet.py new file mode 100644 index 000000000..02cab3282 --- /dev/null +++ b/src/pip/_vendor/rich/color_triplet.py @@ -0,0 +1,38 @@ +from typing import NamedTuple, Tuple + + +class ColorTriplet(NamedTuple): + """The red, green, and blue components of a color.""" + + red: int + """Red component in 0 to 255 range.""" + green: int + """Green component in 0 to 255 range.""" + blue: int + """Blue component in 0 to 255 range.""" + + @property + def hex(self) -> str: + """get the color triplet in CSS style.""" + red, green, blue = self + return f"#{red:02x}{green:02x}{blue:02x}" + + @property + def rgb(self) -> str: + """The color in RGB format. + + Returns: + str: An rgb color, e.g. ``"rgb(100,23,255)"``. + """ + red, green, blue = self + return f"rgb({red},{green},{blue})" + + @property + def normalized(self) -> Tuple[float, float, float]: + """Convert components into floats between 0 and 1. + + Returns: + Tuple[float, float, float]: A tuple of three normalized colour components. + """ + red, green, blue = self + return red / 255.0, green / 255.0, blue / 255.0 diff --git a/src/pip/_vendor/rich/columns.py b/src/pip/_vendor/rich/columns.py new file mode 100644 index 000000000..669a3a707 --- /dev/null +++ b/src/pip/_vendor/rich/columns.py @@ -0,0 +1,187 @@ +from collections import defaultdict +from itertools import chain +from operator import itemgetter +from typing import Dict, Iterable, List, Optional, Tuple + +from .align import Align, AlignMethod +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .constrain import Constrain +from .measure import Measurement +from .padding import Padding, PaddingDimensions +from .table import Table +from .text import TextType +from .jupyter import JupyterMixin + + +class Columns(JupyterMixin): + """Display renderables in neat columns. + + Args: + renderables (Iterable[RenderableType]): Any number of Rich renderables (including str). + width (int, optional): The desired width of the columns, or None to auto detect. Defaults to None. + padding (PaddingDimensions, optional): Optional padding around cells. Defaults to (0, 1). + expand (bool, optional): Expand columns to full width. Defaults to False. + equal (bool, optional): Arrange in to equal sized columns. Defaults to False. + column_first (bool, optional): Align items from top to bottom (rather than left to right). Defaults to False. + right_to_left (bool, optional): Start column from right hand side. Defaults to False. + align (str, optional): Align value ("left", "right", or "center") or None for default. Defaults to None. + title (TextType, optional): Optional title for Columns. + """ + + def __init__( + self, + renderables: Optional[Iterable[RenderableType]] = None, + padding: PaddingDimensions = (0, 1), + *, + width: Optional[int] = None, + expand: bool = False, + equal: bool = False, + column_first: bool = False, + right_to_left: bool = False, + align: Optional[AlignMethod] = None, + title: Optional[TextType] = None, + ) -> None: + self.renderables = list(renderables or []) + self.width = width + self.padding = padding + self.expand = expand + self.equal = equal + self.column_first = column_first + self.right_to_left = right_to_left + self.align: Optional[AlignMethod] = align + self.title = title + + def add_renderable(self, renderable: RenderableType) -> None: + """Add a renderable to the columns. + + Args: + renderable (RenderableType): Any renderable object. + """ + self.renderables.append(renderable) + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + render_str = console.render_str + renderables = [ + render_str(renderable) if isinstance(renderable, str) else renderable + for renderable in self.renderables + ] + if not renderables: + return + _top, right, _bottom, left = Padding.unpack(self.padding) + width_padding = max(left, right) + max_width = options.max_width + widths: Dict[int, int] = defaultdict(int) + column_count = len(renderables) + + get_measurement = Measurement.get + renderable_widths = [ + get_measurement(console, options, renderable).maximum + for renderable in renderables + ] + if self.equal: + renderable_widths = [max(renderable_widths)] * len(renderable_widths) + + def iter_renderables( + column_count: int, + ) -> Iterable[Tuple[int, Optional[RenderableType]]]: + item_count = len(renderables) + if self.column_first: + width_renderables = list(zip(renderable_widths, renderables)) + + column_lengths: List[int] = [item_count // column_count] * column_count + for col_no in range(item_count % column_count): + column_lengths[col_no] += 1 + + row_count = (item_count + column_count - 1) // column_count + cells = [[-1] * column_count for _ in range(row_count)] + row = col = 0 + for index in range(item_count): + cells[row][col] = index + column_lengths[col] -= 1 + if column_lengths[col]: + row += 1 + else: + col += 1 + row = 0 + for index in chain.from_iterable(cells): + if index == -1: + break + yield width_renderables[index] + else: + yield from zip(renderable_widths, renderables) + # Pad odd elements with spaces + if item_count % column_count: + for _ in range(column_count - (item_count % column_count)): + yield 0, None + + table = Table.grid(padding=self.padding, collapse_padding=True, pad_edge=False) + table.expand = self.expand + table.title = self.title + + if self.width is not None: + column_count = (max_width) // (self.width + width_padding) + for _ in range(column_count): + table.add_column(width=self.width) + else: + while column_count > 1: + widths.clear() + column_no = 0 + for renderable_width, _ in iter_renderables(column_count): + widths[column_no] = max(widths[column_no], renderable_width) + total_width = sum(widths.values()) + width_padding * ( + len(widths) - 1 + ) + if total_width > max_width: + column_count = len(widths) - 1 + break + else: + column_no = (column_no + 1) % column_count + else: + break + + get_renderable = itemgetter(1) + _renderables = [ + get_renderable(_renderable) + for _renderable in iter_renderables(column_count) + ] + if self.equal: + _renderables = [ + None + if renderable is None + else Constrain(renderable, renderable_widths[0]) + for renderable in _renderables + ] + if self.align: + align = self.align + _Align = Align + _renderables = [ + None if renderable is None else _Align(renderable, align) + for renderable in _renderables + ] + + right_to_left = self.right_to_left + add_row = table.add_row + for start in range(0, len(_renderables), column_count): + row = _renderables[start : start + column_count] + if right_to_left: + row = row[::-1] + add_row(*row) + yield table + + +if __name__ == "__main__": # pragma: no cover + import os + + console = Console() + + files = [f"{i} {s}" for i, s in enumerate(sorted(os.listdir()))] + columns = Columns(files, padding=(0, 1), expand=False, equal=False) + console.print(columns) + console.rule() + columns.column_first = True + console.print(columns) + columns.right_to_left = True + console.rule() + console.print(columns) diff --git a/src/pip/_vendor/rich/console.py b/src/pip/_vendor/rich/console.py new file mode 100644 index 000000000..b7ae13574 --- /dev/null +++ b/src/pip/_vendor/rich/console.py @@ -0,0 +1,2191 @@ +import inspect +import os +import platform +import shutil +import sys +import threading +from abc import ABC, abstractmethod +from dataclasses import dataclass, field +from datetime import datetime +from functools import wraps +from getpass import getpass +from html import escape +from inspect import isclass +from itertools import islice +from time import monotonic +from types import FrameType, TracebackType, ModuleType +from typing import ( + IO, + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + Mapping, + NamedTuple, + Optional, + TextIO, + Tuple, + Type, + Union, + cast, +) + +if sys.version_info >= (3, 8): + from typing import Literal, Protocol, runtime_checkable +else: + from pip._vendor.typing_extensions import ( + Literal, + Protocol, + runtime_checkable, + ) # pragma: no cover + +from . import errors, themes +from ._emoji_replace import _emoji_replace +from ._log_render import FormatTimeCallable, LogRender +from .align import Align, AlignMethod +from .color import ColorSystem +from .control import Control +from .emoji import EmojiVariant +from .highlighter import NullHighlighter, ReprHighlighter +from .markup import render as render_markup +from .measure import Measurement, measure_renderables +from .pager import Pager, SystemPager +from .pretty import Pretty, is_expandable +from .region import Region +from .scope import render_scope +from .screen import Screen +from .segment import Segment +from .style import Style, StyleType +from .styled import Styled +from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme +from .text import Text, TextType +from .theme import Theme, ThemeStack + +if TYPE_CHECKING: + from ._windows import WindowsConsoleFeatures + from .live import Live + from .status import Status + +WINDOWS = platform.system() == "Windows" + +HighlighterType = Callable[[Union[str, "Text"]], "Text"] +JustifyMethod = Literal["default", "left", "center", "right", "full"] +OverflowMethod = Literal["fold", "crop", "ellipsis", "ignore"] + + +class NoChange: + pass + + +NO_CHANGE = NoChange() + + +CONSOLE_HTML_FORMAT = """\ +<!DOCTYPE html> +<head> +<meta charset="UTF-8"> +<style> +{stylesheet} +body {{ + color: {foreground}; + background-color: {background}; +}} +</style> +</head> +<html> +<body> + <code> + <pre style="font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre> + </code> +</body> +</html> +""" + +_TERM_COLORS = {"256color": ColorSystem.EIGHT_BIT, "16color": ColorSystem.STANDARD} + + +class ConsoleDimensions(NamedTuple): + """Size of the terminal.""" + + width: int + """The width of the console in 'cells'.""" + height: int + """The height of the console in lines.""" + + +@dataclass +class ConsoleOptions: + """Options for __rich_console__ method.""" + + size: ConsoleDimensions + """Size of console.""" + legacy_windows: bool + """legacy_windows: flag for legacy windows.""" + min_width: int + """Minimum width of renderable.""" + max_width: int + """Maximum width of renderable.""" + is_terminal: bool + """True if the target is a terminal, otherwise False.""" + encoding: str + """Encoding of terminal.""" + max_height: int + """Height of container (starts as terminal)""" + justify: Optional[JustifyMethod] = None + """Justify value override for renderable.""" + overflow: Optional[OverflowMethod] = None + """Overflow value override for renderable.""" + no_wrap: Optional[bool] = False + """Disable wrapping for text.""" + highlight: Optional[bool] = None + """Highlight override for render_str.""" + markup: Optional[bool] = None + """Enable markup when rendering strings.""" + height: Optional[int] = None + + @property + def ascii_only(self) -> bool: + """Check if renderables should use ascii only.""" + return not self.encoding.startswith("utf") + + def copy(self) -> "ConsoleOptions": + """Return a copy of the options. + + Returns: + ConsoleOptions: a copy of self. + """ + options: ConsoleOptions = ConsoleOptions.__new__(ConsoleOptions) + options.__dict__ = self.__dict__.copy() + return options + + def update( + self, + *, + width: Union[int, NoChange] = NO_CHANGE, + min_width: Union[int, NoChange] = NO_CHANGE, + max_width: Union[int, NoChange] = NO_CHANGE, + justify: Union[Optional[JustifyMethod], NoChange] = NO_CHANGE, + overflow: Union[Optional[OverflowMethod], NoChange] = NO_CHANGE, + no_wrap: Union[Optional[bool], NoChange] = NO_CHANGE, + highlight: Union[Optional[bool], NoChange] = NO_CHANGE, + markup: Union[Optional[bool], NoChange] = NO_CHANGE, + height: Union[Optional[int], NoChange] = NO_CHANGE, + ) -> "ConsoleOptions": + """Update values, return a copy.""" + options = self.copy() + if not isinstance(width, NoChange): + options.min_width = options.max_width = max(0, width) + if not isinstance(min_width, NoChange): + options.min_width = min_width + if not isinstance(max_width, NoChange): + options.max_width = max_width + if not isinstance(justify, NoChange): + options.justify = justify + if not isinstance(overflow, NoChange): + options.overflow = overflow + if not isinstance(no_wrap, NoChange): + options.no_wrap = no_wrap + if not isinstance(highlight, NoChange): + options.highlight = highlight + if not isinstance(markup, NoChange): + options.markup = markup + if not isinstance(height, NoChange): + if height is not None: + options.max_height = height + options.height = None if height is None else max(0, height) + return options + + def update_width(self, width: int) -> "ConsoleOptions": + """Update just the width, return a copy. + + Args: + width (int): New width (sets both min_width and max_width) + + Returns: + ~ConsoleOptions: New console options instance. + """ + options = self.copy() + options.min_width = options.max_width = max(0, width) + return options + + def update_dimensions(self, width: int, height: int) -> "ConsoleOptions": + """Update the width and height, and return a copy. + + Args: + width (int): New width (sets both min_width and max_width). + height (int): New height. + + Returns: + ~ConsoleOptions: New console options instance. + """ + options = self.copy() + options.min_width = options.max_width = max(0, width) + options.height = height + options.max_height = height + return options + + +@runtime_checkable +class RichCast(Protocol): + """An object that may be 'cast' to a console renderable.""" + + def __rich__(self) -> Union["ConsoleRenderable", str]: # pragma: no cover + ... + + +@runtime_checkable +class ConsoleRenderable(Protocol): + """An object that supports the console protocol.""" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": # pragma: no cover + ... + + +RenderableType = Union[ConsoleRenderable, RichCast, str] +"""A type that may be rendered by Console.""" + +RenderResult = Iterable[Union[RenderableType, Segment]] +"""The result of calling a __rich_console__ method.""" + + +_null_highlighter = NullHighlighter() + + +class CaptureError(Exception): + """An error in the Capture context manager.""" + + +class NewLine: + """A renderable to generate new line(s)""" + + def __init__(self, count: int = 1) -> None: + self.count = count + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> Iterable[Segment]: + yield Segment("\n" * self.count) + + +class ScreenUpdate: + """Render a list of lines at a given offset.""" + + def __init__(self, lines: List[List[Segment]], x: int, y: int) -> None: + self._lines = lines + self.x = x + self.y = y + + def __rich_console__( + self, console: "Console", options: ConsoleOptions + ) -> RenderResult: + x = self.x + move_to = Control.move_to + for offset, line in enumerate(self._lines, self.y): + yield move_to(x, offset) + yield from line + + +class Capture: + """Context manager to capture the result of printing to the console. + See :meth:`~rich.console.Console.capture` for how to use. + + Args: + console (Console): A console instance to capture output. + """ + + def __init__(self, console: "Console") -> None: + self._console = console + self._result: Optional[str] = None + + def __enter__(self) -> "Capture": + self._console.begin_capture() + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self._result = self._console.end_capture() + + def get(self) -> str: + """Get the result of the capture.""" + if self._result is None: + raise CaptureError( + "Capture result is not available until context manager exits." + ) + return self._result + + +class ThemeContext: + """A context manager to use a temporary theme. See :meth:`~rich.console.Console.use_theme` for usage.""" + + def __init__(self, console: "Console", theme: Theme, inherit: bool = True) -> None: + self.console = console + self.theme = theme + self.inherit = inherit + + def __enter__(self) -> "ThemeContext": + self.console.push_theme(self.theme) + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self.console.pop_theme() + + +class PagerContext: + """A context manager that 'pages' content. See :meth:`~rich.console.Console.pager` for usage.""" + + def __init__( + self, + console: "Console", + pager: Optional[Pager] = None, + styles: bool = False, + links: bool = False, + ) -> None: + self._console = console + self.pager = SystemPager() if pager is None else pager + self.styles = styles + self.links = links + + def __enter__(self) -> "PagerContext": + self._console._enter_buffer() + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + if exc_type is None: + with self._console._lock: + buffer: List[Segment] = self._console._buffer[:] + del self._console._buffer[:] + segments: Iterable[Segment] = buffer + if not self.styles: + segments = Segment.strip_styles(segments) + elif not self.links: + segments = Segment.strip_links(segments) + content = self._console._render_buffer(segments) + self.pager.show(content) + self._console._exit_buffer() + + +class ScreenContext: + """A context manager that enables an alternative screen. See :meth:`~rich.console.Console.screen` for usage.""" + + def __init__( + self, console: "Console", hide_cursor: bool, style: StyleType = "" + ) -> None: + self.console = console + self.hide_cursor = hide_cursor + self.screen = Screen(style=style) + self._changed = False + + def update( + self, *renderables: RenderableType, style: Optional[StyleType] = None + ) -> None: + """Update the screen. + + Args: + renderable (RenderableType, optional): Optional renderable to replace current renderable, + or None for no change. Defaults to None. + style: (Style, optional): Replacement style, or None for no change. Defaults to None. + """ + if renderables: + self.screen.renderable = ( + Group(*renderables) if len(renderables) > 1 else renderables[0] + ) + if style is not None: + self.screen.style = style + self.console.print(self.screen, end="") + + def __enter__(self) -> "ScreenContext": + self._changed = self.console.set_alt_screen(True) + if self._changed and self.hide_cursor: + self.console.show_cursor(False) + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + if self._changed: + self.console.set_alt_screen(False) + if self.hide_cursor: + self.console.show_cursor(True) + + +class Group: + """Takes a group of renderables and returns a renderable object that renders the group. + + Args: + renderables (Iterable[RenderableType]): An iterable of renderable objects. + fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. + """ + + def __init__(self, *renderables: "RenderableType", fit: bool = True) -> None: + self._renderables = renderables + self.fit = fit + self._render: Optional[List[RenderableType]] = None + + @property + def renderables(self) -> List["RenderableType"]: + if self._render is None: + self._render = list(self._renderables) + return self._render + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + if self.fit: + return measure_renderables(console, options, self.renderables) + else: + return Measurement(options.max_width, options.max_width) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> RenderResult: + yield from self.renderables + + +RenderGroup = Group # TODO: deprecate at some point + + +def group(fit: bool = True) -> Callable[..., Callable[..., Group]]: + """A decorator that turns an iterable of renderables in to a group. + + Args: + fit (bool, optional): Fit dimension of group to contents, or fill available space. Defaults to True. + """ + + def decorator( + method: Callable[..., Iterable[RenderableType]] + ) -> Callable[..., Group]: + """Convert a method that returns an iterable of renderables in to a RenderGroup.""" + + @wraps(method) + def _replace(*args: Any, **kwargs: Any) -> Group: + renderables = method(*args, **kwargs) + return Group(*renderables, fit=fit) + + return _replace + + return decorator + + +render_group = group + + +def _is_jupyter() -> bool: # pragma: no cover + """Check if we're running in a Jupyter notebook.""" + try: + get_ipython # type: ignore + except NameError: + return False + ipython = get_ipython() # type: ignore + shell = ipython.__class__.__name__ + if "google.colab" in str(ipython.__class__) or shell == "ZMQInteractiveShell": + return True # Jupyter notebook or qtconsole + elif shell == "TerminalInteractiveShell": + return False # Terminal running IPython + else: + return False # Other type (?) + + +COLOR_SYSTEMS = { + "standard": ColorSystem.STANDARD, + "256": ColorSystem.EIGHT_BIT, + "truecolor": ColorSystem.TRUECOLOR, + "windows": ColorSystem.WINDOWS, +} + + +_COLOR_SYSTEMS_NAMES = {system: name for name, system in COLOR_SYSTEMS.items()} + + +@dataclass +class ConsoleThreadLocals(threading.local): + """Thread local values for Console context.""" + + theme_stack: ThemeStack + buffer: List[Segment] = field(default_factory=list) + buffer_index: int = 0 + + +class RenderHook(ABC): + """Provides hooks in to the render process.""" + + @abstractmethod + def process_renderables( + self, renderables: List[ConsoleRenderable] + ) -> List[ConsoleRenderable]: + """Called with a list of objects to render. + + This method can return a new list of renderables, or modify and return the same list. + + Args: + renderables (List[ConsoleRenderable]): A number of renderable objects. + + Returns: + List[ConsoleRenderable]: A replacement list of renderables. + """ + + +_windows_console_features: Optional["WindowsConsoleFeatures"] = None + + +def get_windows_console_features() -> "WindowsConsoleFeatures": # pragma: no cover + global _windows_console_features + if _windows_console_features is not None: + return _windows_console_features + from ._windows import get_windows_console_features + + _windows_console_features = get_windows_console_features() + return _windows_console_features + + +def detect_legacy_windows() -> bool: + """Detect legacy Windows.""" + return WINDOWS and not get_windows_console_features().vt + + +if detect_legacy_windows(): # pragma: no cover + from pip._vendor.colorama import init + + init(strip=False) + + +class Console: + """A high level console interface. + + Args: + color_system (str, optional): The color system supported by your terminal, + either ``"standard"``, ``"256"`` or ``"truecolor"``. Leave as ``"auto"`` to autodetect. + force_terminal (Optional[bool], optional): Enable/disable terminal control codes, or None to auto-detect terminal. Defaults to None. + force_jupyter (Optional[bool], optional): Enable/disable Jupyter rendering, or None to auto-detect Jupyter. Defaults to None. + force_interactive (Optional[bool], optional): Enable/disable interactive mode, or None to auto detect. Defaults to None. + soft_wrap (Optional[bool], optional): Set soft wrap default on print method. Defaults to False. + theme (Theme, optional): An optional style theme object, or ``None`` for default theme. + stderr (bool, optional): Use stderr rather than stdout if ``file`` is not specified. Defaults to False. + file (IO, optional): A file object where the console should write to. Defaults to stdout. + quiet (bool, Optional): Boolean to suppress all output. Defaults to False. + width (int, optional): The width of the terminal. Leave as default to auto-detect width. + height (int, optional): The height of the terminal. Leave as default to auto-detect height. + style (StyleType, optional): Style to apply to all output, or None for no style. Defaults to None. + no_color (Optional[bool], optional): Enabled no color mode, or None to auto detect. Defaults to None. + tab_size (int, optional): Number of spaces used to replace a tab character. Defaults to 8. + record (bool, optional): Boolean to enable recording of terminal output, + required to call :meth:`export_html` and :meth:`export_text`. Defaults to False. + markup (bool, optional): Boolean to enable :ref:`console_markup`. Defaults to True. + emoji (bool, optional): Enable emoji code. Defaults to True. + emoji_variant (str, optional): Optional emoji variant, either "text" or "emoji". Defaults to None. + highlight (bool, optional): Enable automatic highlighting. Defaults to True. + log_time (bool, optional): Boolean to enable logging of time by :meth:`log` methods. Defaults to True. + log_path (bool, optional): Boolean to enable the logging of the caller by :meth:`log`. Defaults to True. + log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%X] ". + highlighter (HighlighterType, optional): Default highlighter. + legacy_windows (bool, optional): Enable legacy Windows mode, or ``None`` to auto detect. Defaults to ``None``. + safe_box (bool, optional): Restrict box options that don't render on legacy Windows. + get_datetime (Callable[[], datetime], optional): Callable that gets the current time as a datetime.datetime object (used by Console.log), + or None for datetime.now. + get_time (Callable[[], time], optional): Callable that gets the current time in seconds, default uses time.monotonic. + """ + + _environ: Mapping[str, str] = os.environ + + def __init__( + self, + *, + color_system: Optional[ + Literal["auto", "standard", "256", "truecolor", "windows"] + ] = "auto", + force_terminal: Optional[bool] = None, + force_jupyter: Optional[bool] = None, + force_interactive: Optional[bool] = None, + soft_wrap: bool = False, + theme: Optional[Theme] = None, + stderr: bool = False, + file: Optional[IO[str]] = None, + quiet: bool = False, + width: Optional[int] = None, + height: Optional[int] = None, + style: Optional[StyleType] = None, + no_color: Optional[bool] = None, + tab_size: int = 8, + record: bool = False, + markup: bool = True, + emoji: bool = True, + emoji_variant: Optional[EmojiVariant] = None, + highlight: bool = True, + log_time: bool = True, + log_path: bool = True, + log_time_format: Union[str, FormatTimeCallable] = "[%X]", + highlighter: Optional["HighlighterType"] = ReprHighlighter(), + legacy_windows: Optional[bool] = None, + safe_box: bool = True, + get_datetime: Optional[Callable[[], datetime]] = None, + get_time: Optional[Callable[[], float]] = None, + _environ: Optional[Mapping[str, str]] = None, + ): + # Copy of os.environ allows us to replace it for testing + if _environ is not None: + self._environ = _environ + + self.is_jupyter = _is_jupyter() if force_jupyter is None else force_jupyter + if self.is_jupyter: + width = width or 93 + height = height or 100 + + if width is None: + columns = self._environ.get("COLUMNS") + if columns is not None and columns.isdigit(): + width = int(columns) + if height is None: + lines = self._environ.get("LINES") + if lines is not None and lines.isdigit(): + height = int(lines) + + self.soft_wrap = soft_wrap + self._width = width + self._height = height + self.tab_size = tab_size + self.record = record + self._markup = markup + self._emoji = emoji + self._emoji_variant: Optional[EmojiVariant] = emoji_variant + self._highlight = highlight + self.legacy_windows: bool = ( + (detect_legacy_windows() and not self.is_jupyter) + if legacy_windows is None + else legacy_windows + ) + + self._color_system: Optional[ColorSystem] + self._force_terminal = force_terminal + self._file = file + self.quiet = quiet + self.stderr = stderr + + if color_system is None: + self._color_system = None + elif color_system == "auto": + self._color_system = self._detect_color_system() + else: + self._color_system = COLOR_SYSTEMS[color_system] + + self._lock = threading.RLock() + self._log_render = LogRender( + show_time=log_time, + show_path=log_path, + time_format=log_time_format, + ) + self.highlighter: HighlighterType = highlighter or _null_highlighter + self.safe_box = safe_box + self.get_datetime = get_datetime or datetime.now + self.get_time = get_time or monotonic + self.style = style + self.no_color = ( + no_color if no_color is not None else "NO_COLOR" in self._environ + ) + self.is_interactive = ( + (self.is_terminal and not self.is_dumb_terminal) + if force_interactive is None + else force_interactive + ) + + self._record_buffer_lock = threading.RLock() + self._thread_locals = ConsoleThreadLocals( + theme_stack=ThemeStack(themes.DEFAULT if theme is None else theme) + ) + self._record_buffer: List[Segment] = [] + self._render_hooks: List[RenderHook] = [] + self._live: Optional["Live"] = None + self._is_alt_screen = False + + def __repr__(self) -> str: + return f"<console width={self.width} {str(self._color_system)}>" + + @property + def file(self) -> IO[str]: + """Get the file object to write to.""" + file = self._file or (sys.stderr if self.stderr else sys.stdout) + file = getattr(file, "rich_proxied_file", file) + return file + + @file.setter + def file(self, new_file: IO[str]) -> None: + """Set a new file object.""" + self._file = new_file + + @property + def _buffer(self) -> List[Segment]: + """Get a thread local buffer.""" + return self._thread_locals.buffer + + @property + def _buffer_index(self) -> int: + """Get a thread local buffer.""" + return self._thread_locals.buffer_index + + @_buffer_index.setter + def _buffer_index(self, value: int) -> None: + self._thread_locals.buffer_index = value + + @property + def _theme_stack(self) -> ThemeStack: + """Get the thread local theme stack.""" + return self._thread_locals.theme_stack + + def _detect_color_system(self) -> Optional[ColorSystem]: + """Detect color system from env vars.""" + if self.is_jupyter: + return ColorSystem.TRUECOLOR + if not self.is_terminal or self.is_dumb_terminal: + return None + if WINDOWS: # pragma: no cover + if self.legacy_windows: # pragma: no cover + return ColorSystem.WINDOWS + windows_console_features = get_windows_console_features() + return ( + ColorSystem.TRUECOLOR + if windows_console_features.truecolor + else ColorSystem.EIGHT_BIT + ) + else: + color_term = self._environ.get("COLORTERM", "").strip().lower() + if color_term in ("truecolor", "24bit"): + return ColorSystem.TRUECOLOR + term = self._environ.get("TERM", "").strip().lower() + _term_name, _hyphen, colors = term.rpartition("-") + color_system = _TERM_COLORS.get(colors, ColorSystem.STANDARD) + return color_system + + def _enter_buffer(self) -> None: + """Enter in to a buffer context, and buffer all output.""" + self._buffer_index += 1 + + def _exit_buffer(self) -> None: + """Leave buffer context, and render content if required.""" + self._buffer_index -= 1 + self._check_buffer() + + def set_live(self, live: "Live") -> None: + """Set Live instance. Used by Live context manager. + + Args: + live (Live): Live instance using this Console. + + Raises: + errors.LiveError: If this Console has a Live context currently active. + """ + with self._lock: + if self._live is not None: + raise errors.LiveError("Only one live display may be active at once") + self._live = live + + def clear_live(self) -> None: + """Clear the Live instance.""" + with self._lock: + self._live = None + + def push_render_hook(self, hook: RenderHook) -> None: + """Add a new render hook to the stack. + + Args: + hook (RenderHook): Render hook instance. + """ + + self._render_hooks.append(hook) + + def pop_render_hook(self) -> None: + """Pop the last renderhook from the stack.""" + self._render_hooks.pop() + + def __enter__(self) -> "Console": + """Own context manager to enter buffer context.""" + self._enter_buffer() + return self + + def __exit__(self, exc_type: Any, exc_value: Any, traceback: Any) -> None: + """Exit buffer context.""" + self._exit_buffer() + + def begin_capture(self) -> None: + """Begin capturing console output. Call :meth:`end_capture` to exit capture mode and return output.""" + self._enter_buffer() + + def end_capture(self) -> str: + """End capture mode and return captured string. + + Returns: + str: Console output. + """ + render_result = self._render_buffer(self._buffer) + del self._buffer[:] + self._exit_buffer() + return render_result + + def push_theme(self, theme: Theme, *, inherit: bool = True) -> None: + """Push a new theme on to the top of the stack, replacing the styles from the previous theme. + Generally speaking, you should call :meth:`~rich.console.Console.use_theme` to get a context manager, rather + than calling this method directly. + + Args: + theme (Theme): A theme instance. + inherit (bool, optional): Inherit existing styles. Defaults to True. + """ + self._theme_stack.push_theme(theme, inherit=inherit) + + def pop_theme(self) -> None: + """Remove theme from top of stack, restoring previous theme.""" + self._theme_stack.pop_theme() + + def use_theme(self, theme: Theme, *, inherit: bool = True) -> ThemeContext: + """Use a different theme for the duration of the context manager. + + Args: + theme (Theme): Theme instance to user. + inherit (bool, optional): Inherit existing console styles. Defaults to True. + + Returns: + ThemeContext: [description] + """ + return ThemeContext(self, theme, inherit) + + @property + def color_system(self) -> Optional[str]: + """Get color system string. + + Returns: + Optional[str]: "standard", "256" or "truecolor". + """ + + if self._color_system is not None: + return _COLOR_SYSTEMS_NAMES[self._color_system] + else: + return None + + @property + def encoding(self) -> str: + """Get the encoding of the console file, e.g. ``"utf-8"``. + + Returns: + str: A standard encoding string. + """ + return (getattr(self.file, "encoding", "utf-8") or "utf-8").lower() + + @property + def is_terminal(self) -> bool: + """Check if the console is writing to a terminal. + + Returns: + bool: True if the console writing to a device capable of + understanding terminal codes, otherwise False. + """ + if self._force_terminal is not None: + return self._force_terminal + isatty: Optional[Callable[[], bool]] = getattr(self.file, "isatty", None) + try: + return False if isatty is None else isatty() + except ValueError: + # in some situation (at the end of a pytest run for example) isatty() can raise + # ValueError: I/O operation on closed file + # return False because we aren't in a terminal anymore + return False + + @property + def is_dumb_terminal(self) -> bool: + """Detect dumb terminal. + + Returns: + bool: True if writing to a dumb terminal, otherwise False. + + """ + _term = self._environ.get("TERM", "") + is_dumb = _term.lower() in ("dumb", "unknown") + return self.is_terminal and is_dumb + + @property + def options(self) -> ConsoleOptions: + """Get default console options.""" + return ConsoleOptions( + max_height=self.size.height, + size=self.size, + legacy_windows=self.legacy_windows, + min_width=1, + max_width=self.width, + encoding=self.encoding, + is_terminal=self.is_terminal, + ) + + @property + def size(self) -> ConsoleDimensions: + """Get the size of the console. + + Returns: + ConsoleDimensions: A named tuple containing the dimensions. + """ + + if self._width is not None and self._height is not None: + return ConsoleDimensions(self._width, self._height) + + if self.is_dumb_terminal: + return ConsoleDimensions(80, 25) + + width: Optional[int] = None + height: Optional[int] = None + if WINDOWS: # pragma: no cover + width, height = shutil.get_terminal_size() + else: + try: + width, height = os.get_terminal_size(sys.__stdin__.fileno()) + except (AttributeError, ValueError, OSError): + try: + width, height = os.get_terminal_size(sys.__stdout__.fileno()) + except (AttributeError, ValueError, OSError): + pass + + # get_terminal_size can report 0, 0 if run from pseudo-terminal + width = width or 80 + height = height or 25 + return ConsoleDimensions( + ((width - self.legacy_windows) if self._width is None else self._width), + height if self._height is None else self._height, + ) + + @size.setter + def size(self, new_size: Tuple[int, int]) -> None: + """Set a new size for the terminal. + + Args: + new_size (Tuple[int, int]): New width and height. + """ + width, height = new_size + self._width = width + self._height = height + + @property + def width(self) -> int: + """Get the width of the console. + + Returns: + int: The width (in characters) of the console. + """ + return self.size.width + + @width.setter + def width(self, width: int) -> None: + """Set width. + + Args: + width (int): New width. + """ + self._width = width + + @property + def height(self) -> int: + """Get the height of the console. + + Returns: + int: The height (in lines) of the console. + """ + return self.size.height + + @height.setter + def height(self, height: int) -> None: + """Set height. + + Args: + height (int): new height. + """ + self._height = height + + def bell(self) -> None: + """Play a 'bell' sound (if supported by the terminal).""" + self.control(Control.bell()) + + def capture(self) -> Capture: + """A context manager to *capture* the result of print() or log() in a string, + rather than writing it to the console. + + Example: + >>> from rich.console import Console + >>> console = Console() + >>> with console.capture() as capture: + ... console.print("[bold magenta]Hello World[/]") + >>> print(capture.get()) + + Returns: + Capture: Context manager with disables writing to the terminal. + """ + capture = Capture(self) + return capture + + def pager( + self, pager: Optional[Pager] = None, styles: bool = False, links: bool = False + ) -> PagerContext: + """A context manager to display anything printed within a "pager". The pager application + is defined by the system and will typically support at least pressing a key to scroll. + + Args: + pager (Pager, optional): A pager object, or None to use :class:~rich.pager.SystemPager`. Defaults to None. + styles (bool, optional): Show styles in pager. Defaults to False. + links (bool, optional): Show links in pager. Defaults to False. + + Example: + >>> from rich.console import Console + >>> from rich.__main__ import make_test_card + >>> console = Console() + >>> with console.pager(): + console.print(make_test_card()) + + Returns: + PagerContext: A context manager. + """ + return PagerContext(self, pager=pager, styles=styles, links=links) + + def line(self, count: int = 1) -> None: + """Write new line(s). + + Args: + count (int, optional): Number of new lines. Defaults to 1. + """ + + assert count >= 0, "count must be >= 0" + self.print(NewLine(count)) + + def clear(self, home: bool = True) -> None: + """Clear the screen. + + Args: + home (bool, optional): Also move the cursor to 'home' position. Defaults to True. + """ + if home: + self.control(Control.clear(), Control.home()) + else: + self.control(Control.clear()) + + def status( + self, + status: RenderableType, + *, + spinner: str = "dots", + spinner_style: str = "status.spinner", + speed: float = 1.0, + refresh_per_second: float = 12.5, + ) -> "Status": + """Display a status and spinner. + + Args: + status (RenderableType): A status renderable (str or Text typically). + spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". + spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". + speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. + refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. + + Returns: + Status: A Status object that may be used as a context manager. + """ + from .status import Status + + status_renderable = Status( + status, + console=self, + spinner=spinner, + spinner_style=spinner_style, + speed=speed, + refresh_per_second=refresh_per_second, + ) + return status_renderable + + def show_cursor(self, show: bool = True) -> bool: + """Show or hide the cursor. + + Args: + show (bool, optional): Set visibility of the cursor. + """ + if self.is_terminal and not self.legacy_windows: + self.control(Control.show_cursor(show)) + return True + return False + + def set_alt_screen(self, enable: bool = True) -> bool: + """Enables alternative screen mode. + + Note, if you enable this mode, you should ensure that is disabled before + the application exits. See :meth:`~rich.Console.screen` for a context manager + that handles this for you. + + Args: + enable (bool, optional): Enable (True) or disable (False) alternate screen. Defaults to True. + + Returns: + bool: True if the control codes were written. + + """ + changed = False + if self.is_terminal and not self.legacy_windows: + self.control(Control.alt_screen(enable)) + changed = True + self._is_alt_screen = enable + return changed + + @property + def is_alt_screen(self) -> bool: + """Check if the alt screen was enabled. + + Returns: + bool: True if the alt screen was enabled, otherwise False. + """ + return self._is_alt_screen + + def screen( + self, hide_cursor: bool = True, style: Optional[StyleType] = None + ) -> "ScreenContext": + """Context manager to enable and disable 'alternative screen' mode. + + Args: + hide_cursor (bool, optional): Also hide the cursor. Defaults to False. + style (Style, optional): Optional style for screen. Defaults to None. + + Returns: + ~ScreenContext: Context which enables alternate screen on enter, and disables it on exit. + """ + return ScreenContext(self, hide_cursor=hide_cursor, style=style or "") + + def measure( + self, renderable: RenderableType, *, options: Optional[ConsoleOptions] = None + ) -> Measurement: + """Measure a renderable. Returns a :class:`~rich.measure.Measurement` object which contains + information regarding the number of characters required to print the renderable. + + Args: + renderable (RenderableType): Any renderable or string. + options (Optional[ConsoleOptions], optional): Options to use when measuring, or None + to use default options. Defaults to None. + + Returns: + Measurement: A measurement of the renderable. + """ + measurement = Measurement.get(self, options or self.options, renderable) + return measurement + + def render( + self, renderable: RenderableType, options: Optional[ConsoleOptions] = None + ) -> Iterable[Segment]: + """Render an object in to an iterable of `Segment` instances. + + This method contains the logic for rendering objects with the console protocol. + You are unlikely to need to use it directly, unless you are extending the library. + + Args: + renderable (RenderableType): An object supporting the console protocol, or + an object that may be converted to a string. + options (ConsoleOptions, optional): An options object, or None to use self.options. Defaults to None. + + Returns: + Iterable[Segment]: An iterable of segments that may be rendered. + """ + + _options = options or self.options + if _options.max_width < 1: + # No space to render anything. This prevents potential recursion errors. + return + render_iterable: RenderResult + if hasattr(renderable, "__rich__") and not isclass(renderable): + renderable = renderable.__rich__() # type: ignore + if hasattr(renderable, "__rich_console__") and not isclass(renderable): + render_iterable = renderable.__rich_console__(self, _options) # type: ignore + elif isinstance(renderable, str): + text_renderable = self.render_str( + renderable, highlight=_options.highlight, markup=_options.markup + ) + render_iterable = text_renderable.__rich_console__(self, _options) + else: + raise errors.NotRenderableError( + f"Unable to render {renderable!r}; " + "A str, Segment or object with __rich_console__ method is required" + ) + + try: + iter_render = iter(render_iterable) + except TypeError: + raise errors.NotRenderableError( + f"object {render_iterable!r} is not renderable" + ) + _Segment = Segment + for render_output in iter_render: + if isinstance(render_output, _Segment): + yield render_output + else: + yield from self.render(render_output, _options) + + def render_lines( + self, + renderable: RenderableType, + options: Optional[ConsoleOptions] = None, + *, + style: Optional[Style] = None, + pad: bool = True, + new_lines: bool = False, + ) -> List[List[Segment]]: + """Render objects in to a list of lines. + + The output of render_lines is useful when further formatting of rendered console text + is required, such as the Panel class which draws a border around any renderable object. + + Args: + renderable (RenderableType): Any object renderable in the console. + options (Optional[ConsoleOptions], optional): Console options, or None to use self.options. Default to ``None``. + style (Style, optional): Optional style to apply to renderables. Defaults to ``None``. + pad (bool, optional): Pad lines shorter than render width. Defaults to ``True``. + new_lines (bool, optional): Include "\n" characters at end of lines. + + Returns: + List[List[Segment]]: A list of lines, where a line is a list of Segment objects. + """ + with self._lock: + render_options = options or self.options + _rendered = self.render(renderable, render_options) + if style: + _rendered = Segment.apply_style(_rendered, style) + lines = list( + islice( + Segment.split_and_crop_lines( + _rendered, + render_options.max_width, + include_new_lines=new_lines, + pad=pad, + ), + None, + render_options.height, + ) + ) + if render_options.height is not None: + extra_lines = render_options.height - len(lines) + if extra_lines > 0: + pad_line = [ + [Segment(" " * render_options.max_width, style), Segment("\n")] + if new_lines + else [Segment(" " * render_options.max_width, style)] + ] + lines.extend(pad_line * extra_lines) + + return lines + + def render_str( + self, + text: str, + *, + style: Union[str, Style] = "", + justify: Optional[JustifyMethod] = None, + overflow: Optional[OverflowMethod] = None, + emoji: Optional[bool] = None, + markup: Optional[bool] = None, + highlight: Optional[bool] = None, + highlighter: Optional[HighlighterType] = None, + ) -> "Text": + """Convert a string to a Text instance. This is is called automatically if + you print or log a string. + + Args: + text (str): Text to render. + style (Union[str, Style], optional): Style to apply to rendered text. + justify (str, optional): Justify method: "default", "left", "center", "full", or "right". Defaults to ``None``. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to ``None``. + emoji (Optional[bool], optional): Enable emoji, or ``None`` to use Console default. + markup (Optional[bool], optional): Enable markup, or ``None`` to use Console default. + highlight (Optional[bool], optional): Enable highlighting, or ``None`` to use Console default. + highlighter (HighlighterType, optional): Optional highlighter to apply. + Returns: + ConsoleRenderable: Renderable object. + + """ + emoji_enabled = emoji or (emoji is None and self._emoji) + markup_enabled = markup or (markup is None and self._markup) + highlight_enabled = highlight or (highlight is None and self._highlight) + + if markup_enabled: + rich_text = render_markup( + text, + style=style, + emoji=emoji_enabled, + emoji_variant=self._emoji_variant, + ) + rich_text.justify = justify + rich_text.overflow = overflow + else: + rich_text = Text( + _emoji_replace(text, default_variant=self._emoji_variant) + if emoji_enabled + else text, + justify=justify, + overflow=overflow, + style=style, + ) + + _highlighter = (highlighter or self.highlighter) if highlight_enabled else None + if _highlighter is not None: + highlight_text = _highlighter(str(rich_text)) + highlight_text.copy_styles(rich_text) + return highlight_text + + return rich_text + + def get_style( + self, name: Union[str, Style], *, default: Optional[Union[Style, str]] = None + ) -> Style: + """Get a Style instance by it's theme name or parse a definition. + + Args: + name (str): The name of a style or a style definition. + + Returns: + Style: A Style object. + + Raises: + MissingStyle: If no style could be parsed from name. + + """ + if isinstance(name, Style): + return name + + try: + style = self._theme_stack.get(name) + if style is None: + style = Style.parse(name) + return style.copy() if style.link else style + except errors.StyleSyntaxError as error: + if default is not None: + return self.get_style(default) + raise errors.MissingStyle( + f"Failed to get style {name!r}; {error}" + ) from None + + def _collect_renderables( + self, + objects: Iterable[Any], + sep: str, + end: str, + *, + justify: Optional[JustifyMethod] = None, + emoji: Optional[bool] = None, + markup: Optional[bool] = None, + highlight: Optional[bool] = None, + ) -> List[ConsoleRenderable]: + """Combine a number of renderables and text into one renderable. + + Args: + objects (Iterable[Any]): Anything that Rich can render. + sep (str): String to write between print data. + end (str): String to write at end of print data. + justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. + + Returns: + List[ConsoleRenderable]: A list of things to render. + """ + renderables: List[ConsoleRenderable] = [] + _append = renderables.append + text: List[Text] = [] + append_text = text.append + + append = _append + if justify in ("left", "center", "right"): + + def align_append(renderable: RenderableType) -> None: + _append(Align(renderable, cast(AlignMethod, justify))) + + append = align_append + + _highlighter: HighlighterType = _null_highlighter + if highlight or (highlight is None and self._highlight): + _highlighter = self.highlighter + + def check_text() -> None: + if text: + sep_text = Text(sep, justify=justify, end=end) + append(sep_text.join(text)) + del text[:] + + for renderable in objects: + # I promise this is sane + # This detects an object which claims to have all attributes, such as MagicMock.mock_calls + if hasattr( + renderable, "jwevpw_eors4dfo6mwo345ermk7kdnfnwerwer" + ): # pragma: no cover + renderable = repr(renderable) + rich_cast = getattr(renderable, "__rich__", None) + if rich_cast: + renderable = rich_cast() + if isinstance(renderable, str): + append_text( + self.render_str( + renderable, emoji=emoji, markup=markup, highlighter=_highlighter + ) + ) + elif isinstance(renderable, ConsoleRenderable): + check_text() + append(renderable) + elif is_expandable(renderable): + check_text() + append(Pretty(renderable, highlighter=_highlighter)) + else: + append_text(_highlighter(str(renderable))) + + check_text() + + if self.style is not None: + style = self.get_style(self.style) + renderables = [Styled(renderable, style) for renderable in renderables] + + return renderables + + def rule( + self, + title: TextType = "", + *, + characters: str = "─", + style: Union[str, Style] = "rule.line", + align: AlignMethod = "center", + ) -> None: + """Draw a line with optional centered title. + + Args: + title (str, optional): Text to render over the rule. Defaults to "". + characters (str, optional): Character(s) to form the line. Defaults to "─". + style (str, optional): Style of line. Defaults to "rule.line". + align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". + """ + from .rule import Rule + + rule = Rule(title=title, characters=characters, style=style, align=align) + self.print(rule) + + def control(self, *control: Control) -> None: + """Insert non-printing control codes. + + Args: + control_codes (str): Control codes, such as those that may move the cursor. + """ + if not self.is_dumb_terminal: + for _control in control: + self._buffer.append(_control.segment) + self._check_buffer() + + def out( + self, + *objects: Any, + sep: str = " ", + end: str = "\n", + style: Optional[Union[str, Style]] = None, + highlight: Optional[bool] = None, + ) -> None: + """Output to the terminal. This is a low-level way of writing to the terminal which unlike + :meth:`~rich.console.Console.print` won't pretty print, wrap text, or apply markup, but will + optionally apply highlighting and a basic style. + + Args: + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use + console default. Defaults to ``None``. + """ + raw_output: str = sep.join(str(_object) for _object in objects) + self.print( + raw_output, + style=style, + highlight=highlight, + emoji=False, + markup=False, + no_wrap=True, + overflow="ignore", + crop=False, + end=end, + ) + + def print( + self, + *objects: Any, + sep: str = " ", + end: str = "\n", + style: Optional[Union[str, Style]] = None, + justify: Optional[JustifyMethod] = None, + overflow: Optional[OverflowMethod] = None, + no_wrap: Optional[bool] = None, + emoji: Optional[bool] = None, + markup: Optional[bool] = None, + highlight: Optional[bool] = None, + width: Optional[int] = None, + height: Optional[int] = None, + crop: bool = True, + soft_wrap: Optional[bool] = None, + new_line_start: bool = False, + ) -> None: + """Print to the console. + + Args: + objects (positional args): Objects to log to the terminal. + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + justify (str, optional): Justify method: "default", "left", "right", "center", or "full". Defaults to ``None``. + overflow (str, optional): Overflow method: "ignore", "crop", "fold", or "ellipsis". Defaults to None. + no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to None. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to ``None``. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to ``None``. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to ``None``. + width (Optional[int], optional): Width of output, or ``None`` to auto-detect. Defaults to ``None``. + crop (Optional[bool], optional): Crop output to width of terminal. Defaults to True. + soft_wrap (bool, optional): Enable soft wrap mode which disables word wrapping and cropping of text or ``None`` for + Console default. Defaults to ``None``. + new_line_start (bool, False): Insert a new line at the start if the output contains more than one line. Defaults to ``False``. + """ + if not objects: + objects = (NewLine(),) + + if soft_wrap is None: + soft_wrap = self.soft_wrap + if soft_wrap: + if no_wrap is None: + no_wrap = True + if overflow is None: + overflow = "ignore" + crop = False + + with self: + renderables = self._collect_renderables( + objects, + sep, + end, + justify=justify, + emoji=emoji, + markup=markup, + highlight=highlight, + ) + for hook in self._render_hooks: + renderables = hook.process_renderables(renderables) + render_options = self.options.update( + justify=justify, + overflow=overflow, + width=min(width, self.width) if width is not None else NO_CHANGE, + height=height, + no_wrap=no_wrap, + markup=markup, + highlight=highlight, + ) + + new_segments: List[Segment] = [] + extend = new_segments.extend + render = self.render + if style is None: + for renderable in renderables: + extend(render(renderable, render_options)) + else: + for renderable in renderables: + extend( + Segment.apply_style( + render(renderable, render_options), self.get_style(style) + ) + ) + if new_line_start: + if ( + len("".join(segment.text for segment in new_segments).splitlines()) + > 1 + ): + new_segments.insert(0, Segment.line()) + if crop: + buffer_extend = self._buffer.extend + for line in Segment.split_and_crop_lines( + new_segments, self.width, pad=False + ): + buffer_extend(line) + else: + self._buffer.extend(new_segments) + + def print_json( + self, + json: Optional[str] = None, + *, + data: Any = None, + indent: int = 2, + highlight: bool = True, + skip_keys: bool = False, + ensure_ascii: bool = True, + check_circular: bool = True, + allow_nan: bool = True, + default: Optional[Callable[[Any], Any]] = None, + sort_keys: bool = False, + ) -> None: + """Pretty prints JSON. Output will be valid JSON. + + Args: + json (Optional[str]): A string containing JSON. + data (Any): If json is not supplied, then encode this data. + indent (int, optional): Number of spaces to indent. Defaults to 2. + highlight (bool, optional): Enable highlighting of output: Defaults to True. + skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. + ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. + check_circular (bool, optional): Check for circular references. Defaults to True. + allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. + default (Callable, optional): A callable that converts values that can not be encoded + in to something that can be JSON encoded. Defaults to None. + sort_keys (bool, optional): Sort dictionary keys. Defaults to False. + """ + from pip._vendor.rich.json import JSON + + if json is None: + json_renderable = JSON.from_data( + data, + indent=indent, + highlight=highlight, + skip_keys=skip_keys, + ensure_ascii=ensure_ascii, + check_circular=check_circular, + allow_nan=allow_nan, + default=default, + sort_keys=sort_keys, + ) + else: + if not isinstance(json, str): + raise TypeError( + f"json must be str. Did you mean print_json(data={json!r}) ?" + ) + json_renderable = JSON( + json, + indent=indent, + highlight=highlight, + skip_keys=skip_keys, + ensure_ascii=ensure_ascii, + check_circular=check_circular, + allow_nan=allow_nan, + default=default, + sort_keys=sort_keys, + ) + self.print(json_renderable, soft_wrap=True) + + def update_screen( + self, + renderable: RenderableType, + *, + region: Optional[Region] = None, + options: Optional[ConsoleOptions] = None, + ) -> None: + """Update the screen at a given offset. + + Args: + renderable (RenderableType): A Rich renderable. + region (Region, optional): Region of screen to update, or None for entire screen. Defaults to None. + x (int, optional): x offset. Defaults to 0. + y (int, optional): y offset. Defaults to 0. + + Raises: + errors.NoAltScreen: If the Console isn't in alt screen mode. + + """ + if not self.is_alt_screen: + raise errors.NoAltScreen("Alt screen must be enabled to call update_screen") + render_options = options or self.options + if region is None: + x = y = 0 + render_options = render_options.update_dimensions( + render_options.max_width, render_options.height or self.height + ) + else: + x, y, width, height = region + render_options = render_options.update_dimensions(width, height) + + lines = self.render_lines(renderable, options=render_options) + self.update_screen_lines(lines, x, y) + + def update_screen_lines( + self, lines: List[List[Segment]], x: int = 0, y: int = 0 + ) -> None: + """Update lines of the screen at a given offset. + + Args: + lines (List[List[Segment]]): Rendered lines (as produced by :meth:`~rich.Console.render_lines`). + x (int, optional): x offset (column no). Defaults to 0. + y (int, optional): y offset (column no). Defaults to 0. + + Raises: + errors.NoAltScreen: If the Console isn't in alt screen mode. + """ + if not self.is_alt_screen: + raise errors.NoAltScreen("Alt screen must be enabled to call update_screen") + screen_update = ScreenUpdate(lines, x, y) + segments = self.render(screen_update) + self._buffer.extend(segments) + self._check_buffer() + + def print_exception( + self, + *, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + suppress: Iterable[Union[str, ModuleType]] = (), + max_frames: int = 100, + ) -> None: + """Prints a rich render of the last exception and traceback. + + Args: + width (Optional[int], optional): Number of characters used to render code. Defaults to 88. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. + max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. + """ + from .traceback import Traceback + + traceback = Traceback( + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + suppress=suppress, + max_frames=max_frames, + ) + self.print(traceback) + + @staticmethod + def _caller_frame_info( + offset: int, + currentframe: Callable[[], Optional[FrameType]] = inspect.currentframe, + ) -> Tuple[str, int, Dict[str, Any]]: + """Get caller frame information. + + Args: + offset (int): the caller offset within the current frame stack. + currentframe (Callable[[], Optional[FrameType]], optional): the callable to use to + retrieve the current frame. Defaults to ``inspect.currentframe``. + + Returns: + Tuple[str, int, Dict[str, Any]]: A tuple containing the filename, the line number and + the dictionary of local variables associated with the caller frame. + + Raises: + RuntimeError: If the stack offset is invalid. + """ + # Ignore the frame of this local helper + offset += 1 + + frame = currentframe() + if frame is not None: + # Use the faster currentframe where implemented + while offset and frame: + frame = frame.f_back + offset -= 1 + assert frame is not None + return frame.f_code.co_filename, frame.f_lineno, frame.f_locals + else: + # Fallback to the slower stack + frame_info = inspect.stack()[offset] + return frame_info.filename, frame_info.lineno, frame_info.frame.f_locals + + def log( + self, + *objects: Any, + sep: str = " ", + end: str = "\n", + style: Optional[Union[str, Style]] = None, + justify: Optional[JustifyMethod] = None, + emoji: Optional[bool] = None, + markup: Optional[bool] = None, + highlight: Optional[bool] = None, + log_locals: bool = False, + _stack_offset: int = 1, + ) -> None: + """Log rich content to the terminal. + + Args: + objects (positional args): Objects to log to the terminal. + sep (str, optional): String to write between print data. Defaults to " ". + end (str, optional): String to write at end of print data. Defaults to "\\\\n". + style (Union[str, Style], optional): A style to apply to output. Defaults to None. + justify (str, optional): One of "left", "right", "center", or "full". Defaults to ``None``. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None. + emoji (Optional[bool], optional): Enable emoji code, or ``None`` to use console default. Defaults to None. + markup (Optional[bool], optional): Enable markup, or ``None`` to use console default. Defaults to None. + highlight (Optional[bool], optional): Enable automatic highlighting, or ``None`` to use console default. Defaults to None. + log_locals (bool, optional): Boolean to enable logging of locals where ``log()`` + was called. Defaults to False. + _stack_offset (int, optional): Offset of caller from end of call stack. Defaults to 1. + """ + if not objects: + objects = (NewLine(),) + + with self: + renderables = self._collect_renderables( + objects, + sep, + end, + justify=justify, + emoji=emoji, + markup=markup, + highlight=highlight, + ) + if style is not None: + renderables = [Styled(renderable, style) for renderable in renderables] + + filename, line_no, locals = self._caller_frame_info(_stack_offset) + link_path = None if filename.startswith("<") else os.path.abspath(filename) + path = filename.rpartition(os.sep)[-1] + if log_locals: + locals_map = { + key: value + for key, value in locals.items() + if not key.startswith("__") + } + renderables.append(render_scope(locals_map, title="[i]locals")) + + renderables = [ + self._log_render( + self, + renderables, + log_time=self.get_datetime(), + path=path, + line_no=line_no, + link_path=link_path, + ) + ] + for hook in self._render_hooks: + renderables = hook.process_renderables(renderables) + new_segments: List[Segment] = [] + extend = new_segments.extend + render = self.render + render_options = self.options + for renderable in renderables: + extend(render(renderable, render_options)) + buffer_extend = self._buffer.extend + for line in Segment.split_and_crop_lines( + new_segments, self.width, pad=False + ): + buffer_extend(line) + + def _check_buffer(self) -> None: + """Check if the buffer may be rendered.""" + if self.quiet: + del self._buffer[:] + return + with self._lock: + if self._buffer_index == 0: + if self.is_jupyter: # pragma: no cover + from .jupyter import display + + display(self._buffer, self._render_buffer(self._buffer[:])) + del self._buffer[:] + else: + text = self._render_buffer(self._buffer[:]) + del self._buffer[:] + if text: + try: + if WINDOWS: # pragma: no cover + # https://bugs.python.org/issue37871 + self.file.writelines(text.splitlines(True)) + else: + self.file.write(text) + self.file.flush() + except UnicodeEncodeError as error: + error.reason = f"{error.reason}\n*** You may need to add PYTHONIOENCODING=utf-8 to your environment ***" + raise + + def _render_buffer(self, buffer: Iterable[Segment]) -> str: + """Render buffered output, and clear buffer.""" + output: List[str] = [] + append = output.append + color_system = self._color_system + legacy_windows = self.legacy_windows + if self.record: + with self._record_buffer_lock: + self._record_buffer.extend(buffer) + not_terminal = not self.is_terminal + if self.no_color and color_system: + buffer = Segment.remove_color(buffer) + for text, style, control in buffer: + if style: + append( + style.render( + text, + color_system=color_system, + legacy_windows=legacy_windows, + ) + ) + elif not (not_terminal and control): + append(text) + + rendered = "".join(output) + return rendered + + def input( + self, + prompt: TextType = "", + *, + markup: bool = True, + emoji: bool = True, + password: bool = False, + stream: Optional[TextIO] = None, + ) -> str: + """Displays a prompt and waits for input from the user. The prompt may contain color / style. + + It works in the same way as Python's builtin :func:`input` function and provides elaborate line editing and history features if Python's builtin :mod:`readline` module is previously loaded. + + Args: + prompt (Union[str, Text]): Text to render in the prompt. + markup (bool, optional): Enable console markup (requires a str prompt). Defaults to True. + emoji (bool, optional): Enable emoji (requires a str prompt). Defaults to True. + password: (bool, optional): Hide typed text. Defaults to False. + stream: (TextIO, optional): Optional file to read input from (rather than stdin). Defaults to None. + + Returns: + str: Text read from stdin. + """ + prompt_str = "" + if prompt: + with self.capture() as capture: + self.print(prompt, markup=markup, emoji=emoji, end="") + prompt_str = capture.get() + if self.legacy_windows: + # Legacy windows doesn't like ANSI codes in getpass or input (colorama bug)? + self.file.write(prompt_str) + prompt_str = "" + if password: + result = getpass(prompt_str, stream=stream) + else: + if stream: + self.file.write(prompt_str) + result = stream.readline() + else: + result = input(prompt_str) + return result + + def export_text(self, *, clear: bool = True, styles: bool = False) -> str: + """Generate text from console contents (requires record=True argument in constructor). + + Args: + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + styles (bool, optional): If ``True``, ansi escape codes will be included. ``False`` for plain text. + Defaults to ``False``. + + Returns: + str: String containing console contents. + + """ + assert ( + self.record + ), "To export console contents set record=True in the constructor or instance" + + with self._record_buffer_lock: + if styles: + text = "".join( + (style.render(text) if style else text) + for text, style, _ in self._record_buffer + ) + else: + text = "".join( + segment.text + for segment in self._record_buffer + if not segment.control + ) + if clear: + del self._record_buffer[:] + return text + + def save_text(self, path: str, *, clear: bool = True, styles: bool = False) -> None: + """Generate text from console and save to a given location (requires record=True argument in constructor). + + Args: + path (str): Path to write text files. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + styles (bool, optional): If ``True``, ansi style codes will be included. ``False`` for plain text. + Defaults to ``False``. + + """ + text = self.export_text(clear=clear, styles=styles) + with open(path, "wt", encoding="utf-8") as write_file: + write_file.write(text) + + def export_html( + self, + *, + theme: Optional[TerminalTheme] = None, + clear: bool = True, + code_format: Optional[str] = None, + inline_styles: bool = False, + ) -> str: + """Generate HTML from console contents (requires record=True argument in constructor). + + Args: + theme (TerminalTheme, optional): TerminalTheme object containing console colors. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + code_format (str, optional): Format string to render HTML, should contain {foreground} + {background} and {code}. + inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files + larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. + Defaults to False. + + Returns: + str: String containing console contents as HTML. + """ + assert ( + self.record + ), "To export console contents set record=True in the constructor or instance" + fragments: List[str] = [] + append = fragments.append + _theme = theme or DEFAULT_TERMINAL_THEME + stylesheet = "" + + render_code_format = CONSOLE_HTML_FORMAT if code_format is None else code_format + + with self._record_buffer_lock: + if inline_styles: + for text, style, _ in Segment.filter_control( + Segment.simplify(self._record_buffer) + ): + text = escape(text) + if style: + rule = style.get_html_style(_theme) + if style.link: + text = f'<a href="{style.link}">{text}</a>' + text = f'<span style="{rule}">{text}</span>' if rule else text + append(text) + else: + styles: Dict[str, int] = {} + for text, style, _ in Segment.filter_control( + Segment.simplify(self._record_buffer) + ): + text = escape(text) + if style: + rule = style.get_html_style(_theme) + style_number = styles.setdefault(rule, len(styles) + 1) + if style.link: + text = f'<a class="r{style_number}" href="{style.link}">{text}</a>' + else: + text = f'<span class="r{style_number}">{text}</span>' + append(text) + stylesheet_rules: List[str] = [] + stylesheet_append = stylesheet_rules.append + for style_rule, style_number in styles.items(): + if style_rule: + stylesheet_append(f".r{style_number} {{{style_rule}}}") + stylesheet = "\n".join(stylesheet_rules) + + rendered_code = render_code_format.format( + code="".join(fragments), + stylesheet=stylesheet, + foreground=_theme.foreground_color.hex, + background=_theme.background_color.hex, + ) + if clear: + del self._record_buffer[:] + return rendered_code + + def save_html( + self, + path: str, + *, + theme: Optional[TerminalTheme] = None, + clear: bool = True, + code_format: str = CONSOLE_HTML_FORMAT, + inline_styles: bool = False, + ) -> None: + """Generate HTML from console contents and write to a file (requires record=True argument in constructor). + + Args: + path (str): Path to write html file. + theme (TerminalTheme, optional): TerminalTheme object containing console colors. + clear (bool, optional): Clear record buffer after exporting. Defaults to ``True``. + code_format (str, optional): Format string to render HTML, should contain {foreground} + {background} and {code}. + inline_styles (bool, optional): If ``True`` styles will be inlined in to spans, which makes files + larger but easier to cut and paste markup. If ``False``, styles will be embedded in a style tag. + Defaults to False. + + """ + html = self.export_html( + theme=theme, + clear=clear, + code_format=code_format, + inline_styles=inline_styles, + ) + with open(path, "wt", encoding="utf-8") as write_file: + write_file.write(html) + + +if __name__ == "__main__": # pragma: no cover + console = Console() + + console.log( + "JSONRPC [i]request[/i]", + 5, + 1.3, + True, + False, + None, + { + "jsonrpc": "2.0", + "method": "subtract", + "params": {"minuend": 42, "subtrahend": 23}, + "id": 3, + }, + ) + + console.log("Hello, World!", "{'a': 1}", repr(console)) + + console.print( + { + "name": None, + "empty": [], + "quiz": { + "sport": { + "answered": True, + "q1": { + "question": "Which one is correct team name in NBA?", + "options": [ + "New York Bulls", + "Los Angeles Kings", + "Golden State Warriors", + "Huston Rocket", + ], + "answer": "Huston Rocket", + }, + }, + "maths": { + "answered": False, + "q1": { + "question": "5 + 7 = ?", + "options": [10, 11, 12, 13], + "answer": 12, + }, + "q2": { + "question": "12 - 8 = ?", + "options": [1, 2, 3, 4], + "answer": 4, + }, + }, + }, + } + ) + console.log("foo") diff --git a/src/pip/_vendor/rich/constrain.py b/src/pip/_vendor/rich/constrain.py new file mode 100644 index 000000000..65fdf5634 --- /dev/null +++ b/src/pip/_vendor/rich/constrain.py @@ -0,0 +1,37 @@ +from typing import Optional, TYPE_CHECKING + +from .jupyter import JupyterMixin +from .measure import Measurement + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType, RenderResult + + +class Constrain(JupyterMixin): + """Constrain the width of a renderable to a given number of characters. + + Args: + renderable (RenderableType): A renderable object. + width (int, optional): The maximum width (in characters) to render. Defaults to 80. + """ + + def __init__(self, renderable: "RenderableType", width: Optional[int] = 80) -> None: + self.renderable = renderable + self.width = width + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + if self.width is None: + yield self.renderable + else: + child_options = options.update_width(min(self.width, options.max_width)) + yield from console.render(self.renderable, child_options) + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + if self.width is not None: + options = options.update_width(self.width) + measurement = Measurement.get(console, options, self.renderable) + return measurement diff --git a/src/pip/_vendor/rich/containers.py b/src/pip/_vendor/rich/containers.py new file mode 100644 index 000000000..e29cf3689 --- /dev/null +++ b/src/pip/_vendor/rich/containers.py @@ -0,0 +1,167 @@ +from itertools import zip_longest +from typing import ( + Iterator, + Iterable, + List, + Optional, + Union, + overload, + TypeVar, + TYPE_CHECKING, +) + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + JustifyMethod, + OverflowMethod, + RenderResult, + RenderableType, + ) + from .text import Text + +from .cells import cell_len +from .measure import Measurement + +T = TypeVar("T") + + +class Renderables: + """A list subclass which renders its contents to the console.""" + + def __init__( + self, renderables: Optional[Iterable["RenderableType"]] = None + ) -> None: + self._renderables: List["RenderableType"] = ( + list(renderables) if renderables is not None else [] + ) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + """Console render method to insert line-breaks.""" + yield from self._renderables + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + dimensions = [ + Measurement.get(console, options, renderable) + for renderable in self._renderables + ] + if not dimensions: + return Measurement(1, 1) + _min = max(dimension.minimum for dimension in dimensions) + _max = max(dimension.maximum for dimension in dimensions) + return Measurement(_min, _max) + + def append(self, renderable: "RenderableType") -> None: + self._renderables.append(renderable) + + def __iter__(self) -> Iterable["RenderableType"]: + return iter(self._renderables) + + +class Lines: + """A list subclass which can render to the console.""" + + def __init__(self, lines: Iterable["Text"] = ()) -> None: + self._lines: List["Text"] = list(lines) + + def __repr__(self) -> str: + return f"Lines({self._lines!r})" + + def __iter__(self) -> Iterator["Text"]: + return iter(self._lines) + + @overload + def __getitem__(self, index: int) -> "Text": + ... + + @overload + def __getitem__(self, index: slice) -> List["Text"]: + ... + + def __getitem__(self, index: Union[slice, int]) -> Union["Text", List["Text"]]: + return self._lines[index] + + def __setitem__(self, index: int, value: "Text") -> "Lines": + self._lines[index] = value + return self + + def __len__(self) -> int: + return self._lines.__len__() + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + """Console render method to insert line-breaks.""" + yield from self._lines + + def append(self, line: "Text") -> None: + self._lines.append(line) + + def extend(self, lines: Iterable["Text"]) -> None: + self._lines.extend(lines) + + def pop(self, index: int = -1) -> "Text": + return self._lines.pop(index) + + def justify( + self, + console: "Console", + width: int, + justify: "JustifyMethod" = "left", + overflow: "OverflowMethod" = "fold", + ) -> None: + """Justify and overflow text to a given width. + + Args: + console (Console): Console instance. + width (int): Number of characters per line. + justify (str, optional): Default justify method for text: "left", "center", "full" or "right". Defaults to "left". + overflow (str, optional): Default overflow for text: "crop", "fold", or "ellipsis". Defaults to "fold". + + """ + from .text import Text + + if justify == "left": + for line in self._lines: + line.truncate(width, overflow=overflow, pad=True) + elif justify == "center": + for line in self._lines: + line.rstrip() + line.truncate(width, overflow=overflow) + line.pad_left((width - cell_len(line.plain)) // 2) + line.pad_right(width - cell_len(line.plain)) + elif justify == "right": + for line in self._lines: + line.rstrip() + line.truncate(width, overflow=overflow) + line.pad_left(width - cell_len(line.plain)) + elif justify == "full": + for line_index, line in enumerate(self._lines): + if line_index == len(self._lines) - 1: + break + words = line.split(" ") + words_size = sum(cell_len(word.plain) for word in words) + num_spaces = len(words) - 1 + spaces = [1 for _ in range(num_spaces)] + index = 0 + if spaces: + while words_size + num_spaces < width: + spaces[len(spaces) - index - 1] += 1 + num_spaces += 1 + index = (index + 1) % len(spaces) + tokens: List[Text] = [] + for index, (word, next_word) in enumerate( + zip_longest(words, words[1:]) + ): + tokens.append(word) + if index < len(spaces): + style = word.get_style_at_offset(console, -1) + next_style = next_word.get_style_at_offset(console, 0) + space_style = style if style == next_style else line.style + tokens.append(Text(" " * spaces[index], style=space_style)) + self[line_index] = Text("").join(tokens) diff --git a/src/pip/_vendor/rich/control.py b/src/pip/_vendor/rich/control.py new file mode 100644 index 000000000..c98d0d7d9 --- /dev/null +++ b/src/pip/_vendor/rich/control.py @@ -0,0 +1,175 @@ +from typing import Any, Callable, Dict, Iterable, List, TYPE_CHECKING, Union + +from .segment import ControlCode, ControlType, Segment + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult + +STRIP_CONTROL_CODES = [ + 8, # Backspace + 11, # Vertical tab + 12, # Form feed + 13, # Carriage return +] +_CONTROL_TRANSLATE = {_codepoint: None for _codepoint in STRIP_CONTROL_CODES} + + +CONTROL_CODES_FORMAT: Dict[int, Callable[..., str]] = { + ControlType.BELL: lambda: "\x07", + ControlType.CARRIAGE_RETURN: lambda: "\r", + ControlType.HOME: lambda: "\x1b[H", + ControlType.CLEAR: lambda: "\x1b[2J", + ControlType.ENABLE_ALT_SCREEN: lambda: "\x1b[?1049h", + ControlType.DISABLE_ALT_SCREEN: lambda: "\x1b[?1049l", + ControlType.SHOW_CURSOR: lambda: "\x1b[?25h", + ControlType.HIDE_CURSOR: lambda: "\x1b[?25l", + ControlType.CURSOR_UP: lambda param: f"\x1b[{param}A", + ControlType.CURSOR_DOWN: lambda param: f"\x1b[{param}B", + ControlType.CURSOR_FORWARD: lambda param: f"\x1b[{param}C", + ControlType.CURSOR_BACKWARD: lambda param: f"\x1b[{param}D", + ControlType.CURSOR_MOVE_TO_COLUMN: lambda param: f"\x1b[{param+1}G", + ControlType.ERASE_IN_LINE: lambda param: f"\x1b[{param}K", + ControlType.CURSOR_MOVE_TO: lambda x, y: f"\x1b[{y+1};{x+1}H", +} + + +class Control: + """A renderable that inserts a control code (non printable but may move cursor). + + Args: + *codes (str): Positional arguments are either a :class:`~rich.segment.ControlType` enum or a + tuple of ControlType and an integer parameter + """ + + __slots__ = ["segment"] + + def __init__(self, *codes: Union[ControlType, ControlCode]) -> None: + control_codes: List[ControlCode] = [ + (code,) if isinstance(code, ControlType) else code for code in codes + ] + _format_map = CONTROL_CODES_FORMAT + rendered_codes = "".join( + _format_map[code](*parameters) for code, *parameters in control_codes + ) + self.segment = Segment(rendered_codes, None, control_codes) + + @classmethod + def bell(cls) -> "Control": + """Ring the 'bell'.""" + return cls(ControlType.BELL) + + @classmethod + def home(cls) -> "Control": + """Move cursor to 'home' position.""" + return cls(ControlType.HOME) + + @classmethod + def move(cls, x: int = 0, y: int = 0) -> "Control": + """Move cursor relative to current position. + + Args: + x (int): X offset. + y (int): Y offset. + + Returns: + ~Control: Control object. + + """ + + def get_codes() -> Iterable[ControlCode]: + control = ControlType + if x: + yield ( + control.CURSOR_FORWARD if x > 0 else control.CURSOR_BACKWARD, + abs(x), + ) + if y: + yield ( + control.CURSOR_DOWN if y > 0 else control.CURSOR_UP, + abs(y), + ) + + control = cls(*get_codes()) + return control + + @classmethod + def move_to_column(cls, x: int, y: int = 0) -> "Control": + """Move to the given column, optionally add offset to row. + + Returns: + x (int): absolute x (column) + y (int): optional y offset (row) + + Returns: + ~Control: Control object. + """ + + return ( + cls( + (ControlType.CURSOR_MOVE_TO_COLUMN, x), + ( + ControlType.CURSOR_DOWN if y > 0 else ControlType.CURSOR_UP, + abs(y), + ), + ) + if y + else cls((ControlType.CURSOR_MOVE_TO_COLUMN, x)) + ) + + @classmethod + def move_to(cls, x: int, y: int) -> "Control": + """Move cursor to absolute position. + + Args: + x (int): x offset (column) + y (int): y offset (row) + + Returns: + ~Control: Control object. + """ + return cls((ControlType.CURSOR_MOVE_TO, x, y)) + + @classmethod + def clear(cls) -> "Control": + """Clear the screen.""" + return cls(ControlType.CLEAR) + + @classmethod + def show_cursor(cls, show: bool) -> "Control": + """Show or hide the cursor.""" + return cls(ControlType.SHOW_CURSOR if show else ControlType.HIDE_CURSOR) + + @classmethod + def alt_screen(cls, enable: bool) -> "Control": + """Enable or disable alt screen.""" + if enable: + return cls(ControlType.ENABLE_ALT_SCREEN, ControlType.HOME) + else: + return cls(ControlType.DISABLE_ALT_SCREEN) + + def __str__(self) -> str: + return self.segment.text + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + if self.segment.text: + yield self.segment + + +def strip_control_codes( + text: str, _translate_table: Dict[int, None] = _CONTROL_TRANSLATE +) -> str: + """Remove control codes from text. + + Args: + text (str): A string possibly contain control codes. + + Returns: + str: String with control codes removed. + """ + return text.translate(_translate_table) + + +if __name__ == "__main__": # pragma: no cover + print(strip_control_codes("hello\rWorld")) diff --git a/src/pip/_vendor/rich/default_styles.py b/src/pip/_vendor/rich/default_styles.py new file mode 100644 index 000000000..355f9df85 --- /dev/null +++ b/src/pip/_vendor/rich/default_styles.py @@ -0,0 +1,159 @@ +from typing import Dict + +from .style import Style + + +DEFAULT_STYLES: Dict[str, Style] = { + "none": Style.null(), + "reset": Style( + color="default", + bgcolor="default", + dim=False, + bold=False, + italic=False, + underline=False, + blink=False, + blink2=False, + reverse=False, + conceal=False, + strike=False, + ), + "dim": Style(dim=True), + "bright": Style(dim=False), + "bold": Style(bold=True), + "strong": Style(bold=True), + "code": Style(reverse=True, bold=True), + "italic": Style(italic=True), + "emphasize": Style(italic=True), + "underline": Style(underline=True), + "blink": Style(blink=True), + "blink2": Style(blink2=True), + "reverse": Style(reverse=True), + "strike": Style(strike=True), + "black": Style(color="black"), + "red": Style(color="red"), + "green": Style(color="green"), + "yellow": Style(color="yellow"), + "magenta": Style(color="magenta"), + "cyan": Style(color="cyan"), + "white": Style(color="white"), + "inspect.attr": Style(color="yellow", italic=True), + "inspect.attr.dunder": Style(color="yellow", italic=True, dim=True), + "inspect.callable": Style(bold=True, color="red"), + "inspect.def": Style(italic=True, color="bright_cyan"), + "inspect.error": Style(bold=True, color="red"), + "inspect.equals": Style(), + "inspect.help": Style(color="cyan"), + "inspect.doc": Style(dim=True), + "inspect.value.border": Style(color="green"), + "live.ellipsis": Style(bold=True, color="red"), + "layout.tree.row": Style(dim=False, color="red"), + "layout.tree.column": Style(dim=False, color="blue"), + "logging.keyword": Style(bold=True, color="yellow"), + "logging.level.notset": Style(dim=True), + "logging.level.debug": Style(color="green"), + "logging.level.info": Style(color="blue"), + "logging.level.warning": Style(color="red"), + "logging.level.error": Style(color="red", bold=True), + "logging.level.critical": Style(color="red", bold=True, reverse=True), + "log.level": Style.null(), + "log.time": Style(color="cyan", dim=True), + "log.message": Style.null(), + "log.path": Style(dim=True), + "repr.ellipsis": Style(color="yellow"), + "repr.indent": Style(color="green", dim=True), + "repr.error": Style(color="red", bold=True), + "repr.str": Style(color="green", italic=False, bold=False), + "repr.brace": Style(bold=True), + "repr.comma": Style(bold=True), + "repr.ipv4": Style(bold=True, color="bright_green"), + "repr.ipv6": Style(bold=True, color="bright_green"), + "repr.eui48": Style(bold=True, color="bright_green"), + "repr.eui64": Style(bold=True, color="bright_green"), + "repr.tag_start": Style(bold=True), + "repr.tag_name": Style(color="bright_magenta", bold=True), + "repr.tag_contents": Style(color="default"), + "repr.tag_end": Style(bold=True), + "repr.attrib_name": Style(color="yellow", italic=False), + "repr.attrib_equal": Style(bold=True), + "repr.attrib_value": Style(color="magenta", italic=False), + "repr.number": Style(color="cyan", bold=True, italic=False), + "repr.bool_true": Style(color="bright_green", italic=True), + "repr.bool_false": Style(color="bright_red", italic=True), + "repr.none": Style(color="magenta", italic=True), + "repr.url": Style(underline=True, color="bright_blue", italic=False, bold=False), + "repr.uuid": Style(color="bright_yellow", bold=False), + "repr.call": Style(color="magenta", bold=True), + "repr.path": Style(color="magenta"), + "repr.filename": Style(color="bright_magenta"), + "rule.line": Style(color="bright_green"), + "rule.text": Style.null(), + "json.brace": Style(bold=True), + "json.bool_true": Style(color="bright_green", italic=True), + "json.bool_false": Style(color="bright_red", italic=True), + "json.null": Style(color="magenta", italic=True), + "json.number": Style(color="cyan", bold=True, italic=False), + "json.str": Style(color="green", italic=False, bold=False), + "json.key": Style(color="blue", bold=True), + "prompt": Style.null(), + "prompt.choices": Style(color="magenta", bold=True), + "prompt.default": Style(color="cyan", bold=True), + "prompt.invalid": Style(color="red"), + "prompt.invalid.choice": Style(color="red"), + "pretty": Style.null(), + "scope.border": Style(color="blue"), + "scope.key": Style(color="yellow", italic=True), + "scope.key.special": Style(color="yellow", italic=True, dim=True), + "scope.equals": Style(color="red"), + "table.header": Style(bold=True), + "table.footer": Style(bold=True), + "table.cell": Style.null(), + "table.title": Style(italic=True), + "table.caption": Style(italic=True, dim=True), + "traceback.error": Style(color="red", italic=True), + "traceback.border.syntax_error": Style(color="bright_red"), + "traceback.border": Style(color="red"), + "traceback.text": Style.null(), + "traceback.title": Style(color="red", bold=True), + "traceback.exc_type": Style(color="bright_red", bold=True), + "traceback.exc_value": Style.null(), + "traceback.offset": Style(color="bright_red", bold=True), + "bar.back": Style(color="grey23"), + "bar.complete": Style(color="rgb(249,38,114)"), + "bar.finished": Style(color="rgb(114,156,31)"), + "bar.pulse": Style(color="rgb(249,38,114)"), + "progress.description": Style.null(), + "progress.filesize": Style(color="green"), + "progress.filesize.total": Style(color="green"), + "progress.download": Style(color="green"), + "progress.elapsed": Style(color="yellow"), + "progress.percentage": Style(color="magenta"), + "progress.remaining": Style(color="cyan"), + "progress.data.speed": Style(color="red"), + "progress.spinner": Style(color="green"), + "status.spinner": Style(color="green"), + "tree": Style(), + "tree.line": Style(), + "markdown.paragraph": Style(), + "markdown.text": Style(), + "markdown.emph": Style(italic=True), + "markdown.strong": Style(bold=True), + "markdown.code": Style(bgcolor="black", color="bright_white"), + "markdown.code_block": Style(dim=True, color="cyan", bgcolor="black"), + "markdown.block_quote": Style(color="magenta"), + "markdown.list": Style(color="cyan"), + "markdown.item": Style(), + "markdown.item.bullet": Style(color="yellow", bold=True), + "markdown.item.number": Style(color="yellow", bold=True), + "markdown.hr": Style(color="yellow"), + "markdown.h1.border": Style(), + "markdown.h1": Style(bold=True), + "markdown.h2": Style(bold=True, underline=True), + "markdown.h3": Style(bold=True), + "markdown.h4": Style(bold=True, dim=True), + "markdown.h5": Style(underline=True), + "markdown.h6": Style(italic=True), + "markdown.h7": Style(italic=True, dim=True), + "markdown.link": Style(color="bright_blue"), + "markdown.link_url": Style(color="blue"), +} diff --git a/src/pip/_vendor/rich/diagnose.py b/src/pip/_vendor/rich/diagnose.py new file mode 100644 index 000000000..38728da2a --- /dev/null +++ b/src/pip/_vendor/rich/diagnose.py @@ -0,0 +1,6 @@ +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + from pip._vendor.rich import inspect + + console = Console() + inspect(console) diff --git a/src/pip/_vendor/rich/emoji.py b/src/pip/_vendor/rich/emoji.py new file mode 100644 index 000000000..791f0465d --- /dev/null +++ b/src/pip/_vendor/rich/emoji.py @@ -0,0 +1,96 @@ +import sys +from typing import TYPE_CHECKING, Optional, Union + +from .jupyter import JupyterMixin +from .segment import Segment +from .style import Style +from ._emoji_codes import EMOJI +from ._emoji_replace import _emoji_replace + +if sys.version_info >= (3, 8): + from typing import Literal +else: + from pip._vendor.typing_extensions import Literal # pragma: no cover + + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult + + +EmojiVariant = Literal["emoji", "text"] + + +class NoEmoji(Exception): + """No emoji by that name.""" + + +class Emoji(JupyterMixin): + __slots__ = ["name", "style", "_char", "variant"] + + VARIANTS = {"text": "\uFE0E", "emoji": "\uFE0F"} + + def __init__( + self, + name: str, + style: Union[str, Style] = "none", + variant: Optional[EmojiVariant] = None, + ) -> None: + """A single emoji character. + + Args: + name (str): Name of emoji. + style (Union[str, Style], optional): Optional style. Defaults to None. + + Raises: + NoEmoji: If the emoji doesn't exist. + """ + self.name = name + self.style = style + self.variant = variant + try: + self._char = EMOJI[name] + except KeyError: + raise NoEmoji(f"No emoji called {name!r}") + if variant is not None: + self._char += self.VARIANTS.get(variant, "") + + @classmethod + def replace(cls, text: str) -> str: + """Replace emoji markup with corresponding unicode characters. + + Args: + text (str): A string with emojis codes, e.g. "Hello :smiley:!" + + Returns: + str: A string with emoji codes replaces with actual emoji. + """ + return _emoji_replace(text) + + def __repr__(self) -> str: + return f"<emoji {self.name!r}>" + + def __str__(self) -> str: + return self._char + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + yield Segment(self._char, console.get_style(self.style)) + + +if __name__ == "__main__": # pragma: no cover + import sys + + from pip._vendor.rich.columns import Columns + from pip._vendor.rich.console import Console + + console = Console(record=True) + + columns = Columns( + (f":{name}: {name}" for name in sorted(EMOJI.keys()) if "\u200D" not in name), + column_first=True, + ) + + console.print(columns) + if len(sys.argv) > 1: + console.save_html(sys.argv[1]) diff --git a/src/pip/_vendor/rich/errors.py b/src/pip/_vendor/rich/errors.py new file mode 100644 index 000000000..0bcbe53ef --- /dev/null +++ b/src/pip/_vendor/rich/errors.py @@ -0,0 +1,34 @@ +class ConsoleError(Exception): + """An error in console operation.""" + + +class StyleError(Exception): + """An error in styles.""" + + +class StyleSyntaxError(ConsoleError): + """Style was badly formatted.""" + + +class MissingStyle(StyleError): + """No such style.""" + + +class StyleStackError(ConsoleError): + """Style stack is invalid.""" + + +class NotRenderableError(ConsoleError): + """Object is not renderable.""" + + +class MarkupError(ConsoleError): + """Markup was badly formatted.""" + + +class LiveError(ConsoleError): + """Error related to Live display.""" + + +class NoAltScreen(ConsoleError): + """Alt screen mode was required.""" diff --git a/src/pip/_vendor/rich/file_proxy.py b/src/pip/_vendor/rich/file_proxy.py new file mode 100644 index 000000000..99a6922cb --- /dev/null +++ b/src/pip/_vendor/rich/file_proxy.py @@ -0,0 +1,54 @@ +import io +from typing import List, Any, IO, TYPE_CHECKING + +from .ansi import AnsiDecoder +from .text import Text + +if TYPE_CHECKING: + from .console import Console + + +class FileProxy(io.TextIOBase): + """Wraps a file (e.g. sys.stdout) and redirects writes to a console.""" + + def __init__(self, console: "Console", file: IO[str]) -> None: + self.__console = console + self.__file = file + self.__buffer: List[str] = [] + self.__ansi_decoder = AnsiDecoder() + + @property + def rich_proxied_file(self) -> IO[str]: + """Get proxied file.""" + return self.__file + + def __getattr__(self, name: str) -> Any: + return getattr(self.__file, name) + + def write(self, text: str) -> int: + if not isinstance(text, str): + raise TypeError(f"write() argument must be str, not {type(text).__name__}") + buffer = self.__buffer + lines: List[str] = [] + while text: + line, new_line, text = text.partition("\n") + if new_line: + lines.append("".join(buffer) + line) + del buffer[:] + else: + buffer.append(line) + break + if lines: + console = self.__console + with console: + output = Text("\n").join( + self.__ansi_decoder.decode_line(line) for line in lines + ) + console.print(output, markup=False, emoji=False, highlight=False) + return len(text) + + def flush(self) -> None: + buffer = self.__buffer + if buffer: + self.__console.print("".join(buffer)) + del buffer[:] diff --git a/src/pip/_vendor/rich/filesize.py b/src/pip/_vendor/rich/filesize.py new file mode 100644 index 000000000..b3a0996b0 --- /dev/null +++ b/src/pip/_vendor/rich/filesize.py @@ -0,0 +1,89 @@ +# coding: utf-8 +"""Functions for reporting filesizes. Borrowed from https://github.com/PyFilesystem/pyfilesystem2 + +The functions declared in this module should cover the different +usecases needed to generate a string representation of a file size +using several different units. Since there are many standards regarding +file size units, three different functions have been implemented. + +See Also: + * `Wikipedia: Binary prefix <https://en.wikipedia.org/wiki/Binary_prefix>`_ + +""" + +__all__ = ["decimal"] + +from typing import Iterable, List, Tuple, Optional + + +def _to_str( + size: int, + suffixes: Iterable[str], + base: int, + *, + precision: Optional[int] = 1, + separator: Optional[str] = " ", +) -> str: + if size == 1: + return "1 byte" + elif size < base: + return "{:,} bytes".format(size) + + for i, suffix in enumerate(suffixes, 2): # noqa: B007 + unit = base ** i + if size < unit: + break + return "{:,.{precision}f}{separator}{}".format( + (base * size / unit), + suffix, + precision=precision, + separator=separator, + ) + + +def pick_unit_and_suffix(size: int, suffixes: List[str], base: int) -> Tuple[int, str]: + """Pick a suffix and base for the given size.""" + for i, suffix in enumerate(suffixes): + unit = base ** i + if size < unit * base: + break + return unit, suffix + + +def decimal( + size: int, + *, + precision: Optional[int] = 1, + separator: Optional[str] = " ", +) -> str: + """Convert a filesize in to a string (powers of 1000, SI prefixes). + + In this convention, ``1000 B = 1 kB``. + + This is typically the format used to advertise the storage + capacity of USB flash drives and the like (*256 MB* meaning + actually a storage capacity of more than *256 000 000 B*), + or used by **Mac OS X** since v10.6 to report file sizes. + + Arguments: + int (size): A file size. + int (precision): The number of decimal places to include (default = 1). + str (separator): The string to separate the value from the units (default = " "). + + Returns: + `str`: A string containing a abbreviated file size and units. + + Example: + >>> filesize.decimal(30000) + '30.0 kB' + >>> filesize.decimal(30000, precision=2, separator="") + '30.00kB' + + """ + return _to_str( + size, + ("kB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"), + 1000, + precision=precision, + separator=separator, + ) diff --git a/src/pip/_vendor/rich/highlighter.py b/src/pip/_vendor/rich/highlighter.py new file mode 100644 index 000000000..9e71d0053 --- /dev/null +++ b/src/pip/_vendor/rich/highlighter.py @@ -0,0 +1,147 @@ +from abc import ABC, abstractmethod +from typing import List, Union + +from .text import Text + + +def _combine_regex(*regexes: str) -> str: + """Combine a number of regexes in to a single regex. + + Returns: + str: New regex with all regexes ORed together. + """ + return "|".join(regexes) + + +class Highlighter(ABC): + """Abstract base class for highlighters.""" + + def __call__(self, text: Union[str, Text]) -> Text: + """Highlight a str or Text instance. + + Args: + text (Union[str, ~Text]): Text to highlight. + + Raises: + TypeError: If not called with text or str. + + Returns: + Text: A test instance with highlighting applied. + """ + if isinstance(text, str): + highlight_text = Text(text) + elif isinstance(text, Text): + highlight_text = text.copy() + else: + raise TypeError(f"str or Text instance required, not {text!r}") + self.highlight(highlight_text) + return highlight_text + + @abstractmethod + def highlight(self, text: Text) -> None: + """Apply highlighting in place to text. + + Args: + text (~Text): A text object highlight. + """ + + +class NullHighlighter(Highlighter): + """A highlighter object that doesn't highlight. + + May be used to disable highlighting entirely. + + """ + + def highlight(self, text: Text) -> None: + """Nothing to do""" + + +class RegexHighlighter(Highlighter): + """Applies highlighting from a list of regular expressions.""" + + highlights: List[str] = [] + base_style: str = "" + + def highlight(self, text: Text) -> None: + """Highlight :class:`rich.text.Text` using regular expressions. + + Args: + text (~Text): Text to highlighted. + + """ + + highlight_regex = text.highlight_regex + for re_highlight in self.highlights: + highlight_regex(re_highlight, style_prefix=self.base_style) + + +class ReprHighlighter(RegexHighlighter): + """Highlights the text typically produced from ``__repr__`` methods.""" + + base_style = "repr." + highlights = [ + r"(?P<tag_start>\<)(?P<tag_name>[\w\-\.\:]*)(?P<tag_contents>[\w\W]*?)(?P<tag_end>\>)", + r"(?P<attrib_name>[\w_]{1,50})=(?P<attrib_value>\"?[\w_]+\"?)?", + r"(?P<brace>[\{\[\(\)\]\}])", + _combine_regex( + r"(?P<ipv4>[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3}\.[0-9]{1,3})", + r"(?P<ipv6>([A-Fa-f0-9]{1,4}::?){1,7}[A-Fa-f0-9]{1,4})", + r"(?P<eui64>(?:[0-9A-Fa-f]{1,2}-){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){7}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){3}[0-9A-Fa-f]{4})", + r"(?P<eui48>(?:[0-9A-Fa-f]{1,2}-){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{1,2}:){5}[0-9A-Fa-f]{1,2}|(?:[0-9A-Fa-f]{4}\.){2}[0-9A-Fa-f]{4})", + r"(?P<call>[\w\.]*?)\(", + r"\b(?P<bool_true>True)\b|\b(?P<bool_false>False)\b|\b(?P<none>None)\b", + r"(?P<ellipsis>\.\.\.)", + r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)", + r"(?P<path>\B(\/[\w\.\-\_\+]+)*\/)(?P<filename>[\w\.\-\_\+]*)?", + r"(?<![\\\w])(?P<str>b?\'\'\'.*?(?<!\\)\'\'\'|b?\'.*?(?<!\\)\'|b?\"\"\".*?(?<!\\)\"\"\"|b?\".*?(?<!\\)\")", + r"(?P<uuid>[a-fA-F0-9]{8}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{4}\-[a-fA-F0-9]{12})", + r"(?P<url>(https|http|ws|wss):\/\/[0-9a-zA-Z\$\-\_\+\!`\(\)\,\.\?\/\;\:\&\=\%\#]*)", + ), + ] + + +class JSONHighlighter(RegexHighlighter): + """Highlights JSON""" + + base_style = "json." + highlights = [ + _combine_regex( + r"(?P<brace>[\{\[\(\)\]\}])", + r"\b(?P<bool_true>true)\b|\b(?P<bool_false>false)\b|\b(?P<null>null)\b", + r"(?P<number>(?<!\w)\-?[0-9]+\.?[0-9]*(e[\-\+]?\d+?)?\b|0x[0-9a-fA-F]*)", + r"(?<![\\\w])(?P<str>b?\".*?(?<!\\)\")", + ), + r"(?<![\\\w])(?P<key>b?\".*?(?<!\\)\")\:", + ] + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + console = Console() + console.print("[bold green]hello world![/bold green]") + console.print("'[bold green]hello world![/bold green]'") + + console.print(" /foo") + console.print("/foo/") + console.print("/foo/bar") + console.print("foo/bar/baz") + + console.print("/foo/bar/baz?foo=bar+egg&egg=baz") + console.print("/foo/bar/baz/") + console.print("/foo/bar/baz/egg") + console.print("/foo/bar/baz/egg.py") + console.print("/foo/bar/baz/egg.py word") + console.print(" /foo/bar/baz/egg.py word") + console.print("foo /foo/bar/baz/egg.py word") + console.print("foo /foo/bar/ba._++z/egg+.py word") + console.print("https://example.org?foo=bar#header") + + console.print(1234567.34) + console.print(1 / 2) + console.print(-1 / 123123123123) + + console.print( + "127.0.1.1 bar 192.168.1.4 2001:0db8:85a3:0000:0000:8a2e:0370:7334 foo" + ) diff --git a/src/pip/_vendor/rich/json.py b/src/pip/_vendor/rich/json.py new file mode 100644 index 000000000..7cf6b5fb2 --- /dev/null +++ b/src/pip/_vendor/rich/json.py @@ -0,0 +1,140 @@ +from json import loads, dumps +from typing import Any, Callable, Optional + +from .text import Text +from .highlighter import JSONHighlighter, NullHighlighter + + +class JSON: + """A renderable which pretty prints JSON. + + Args: + json (str): JSON encoded data. + indent (int, optional): Number of characters to indent by. Defaults to 2. + highlight (bool, optional): Enable highlighting. Defaults to True. + skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. + ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. + check_circular (bool, optional): Check for circular references. Defaults to True. + allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. + default (Callable, optional): A callable that converts values that can not be encoded + in to something that can be JSON encoded. Defaults to None. + sort_keys (bool, optional): Sort dictionary keys. Defaults to False. + """ + + def __init__( + self, + json: str, + indent: int = 2, + highlight: bool = True, + skip_keys: bool = False, + ensure_ascii: bool = True, + check_circular: bool = True, + allow_nan: bool = True, + default: Optional[Callable[[Any], Any]] = None, + sort_keys: bool = False, + ) -> None: + data = loads(json) + json = dumps( + data, + indent=indent, + skipkeys=skip_keys, + ensure_ascii=ensure_ascii, + check_circular=check_circular, + allow_nan=allow_nan, + default=default, + sort_keys=sort_keys, + ) + highlighter = JSONHighlighter() if highlight else NullHighlighter() + self.text = highlighter(json) + self.text.no_wrap = True + self.text.overflow = None + + @classmethod + def from_data( + cls, + data: Any, + indent: int = 2, + highlight: bool = True, + skip_keys: bool = False, + ensure_ascii: bool = True, + check_circular: bool = True, + allow_nan: bool = True, + default: Optional[Callable[[Any], Any]] = None, + sort_keys: bool = False, + ) -> "JSON": + """Encodes a JSON object from arbitrary data. + + Args: + data (Any): An object that may be encoded in to JSON + indent (int, optional): Number of characters to indent by. Defaults to 2. + highlight (bool, optional): Enable highlighting. Defaults to True. + default (Callable, optional): Optional callable which will be called for objects that cannot be serialized. Defaults to None. + skip_keys (bool, optional): Skip keys not of a basic type. Defaults to False. + ensure_ascii (bool, optional): Escape all non-ascii characters. Defaults to False. + check_circular (bool, optional): Check for circular references. Defaults to True. + allow_nan (bool, optional): Allow NaN and Infinity values. Defaults to True. + default (Callable, optional): A callable that converts values that can not be encoded + in to something that can be JSON encoded. Defaults to None. + sort_keys (bool, optional): Sort dictionary keys. Defaults to False. + + Returns: + JSON: New JSON object from the given data. + """ + json_instance: "JSON" = cls.__new__(cls) + json = dumps( + data, + indent=indent, + skipkeys=skip_keys, + ensure_ascii=ensure_ascii, + check_circular=check_circular, + allow_nan=allow_nan, + default=default, + sort_keys=sort_keys, + ) + highlighter = JSONHighlighter() if highlight else NullHighlighter() + json_instance.text = highlighter(json) + json_instance.text.no_wrap = True + json_instance.text.overflow = None + return json_instance + + def __rich__(self) -> Text: + return self.text + + +if __name__ == "__main__": + + import argparse + import sys + + parser = argparse.ArgumentParser(description="Pretty print json") + parser.add_argument( + "path", + metavar="PATH", + help="path to file, or - for stdin", + ) + parser.add_argument( + "-i", + "--indent", + metavar="SPACES", + type=int, + help="Number of spaces in an indent", + default=2, + ) + args = parser.parse_args() + + from pip._vendor.rich.console import Console + + console = Console() + error_console = Console(stderr=True) + + try: + if args.path == "-": + json_data = sys.stdin.read() + else: + with open(args.path, "rt") as json_file: + json_data = json_file.read() + except Exception as error: + error_console.print(f"Unable to read {args.path!r}; {error}") + sys.exit(-1) + + console.print(JSON(json_data, indent=args.indent), soft_wrap=True) diff --git a/src/pip/_vendor/rich/jupyter.py b/src/pip/_vendor/rich/jupyter.py new file mode 100644 index 000000000..7cdcc9cab --- /dev/null +++ b/src/pip/_vendor/rich/jupyter.py @@ -0,0 +1,88 @@ +from typing import Any, Dict, Iterable, List + +from . import get_console +from .segment import Segment +from .terminal_theme import DEFAULT_TERMINAL_THEME + + +JUPYTER_HTML_FORMAT = """\ +<pre style="white-space:pre;overflow-x:auto;line-height:normal;font-family:Menlo,'DejaVu Sans Mono',consolas,'Courier New',monospace">{code}</pre> +""" + + +class JupyterRenderable: + """A shim to write html to Jupyter notebook.""" + + def __init__(self, html: str, text: str) -> None: + self.html = html + self.text = text + + def _repr_mimebundle_( + self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any + ) -> Dict[str, str]: + data = {"text/plain": self.text, "text/html": self.html} + if include: + data = {k: v for (k, v) in data.items() if k in include} + if exclude: + data = {k: v for (k, v) in data.items() if k not in exclude} + return data + + +class JupyterMixin: + """Add to an Rich renderable to make it render in Jupyter notebook.""" + + __slots__ = () + + def _repr_mimebundle_( + self, include: Iterable[str], exclude: Iterable[str], **kwargs: Any + ) -> Dict[str, str]: + console = get_console() + segments = list(console.render(self, console.options)) # type: ignore + html = _render_segments(segments) + text = console._render_buffer(segments) + data = {"text/plain": text, "text/html": html} + if include: + data = {k: v for (k, v) in data.items() if k in include} + if exclude: + data = {k: v for (k, v) in data.items() if k not in exclude} + return data + + +def _render_segments(segments: Iterable[Segment]) -> str: + def escape(text: str) -> str: + """Escape html.""" + return text.replace("&", "&").replace("<", "<").replace(">", ">") + + fragments: List[str] = [] + append_fragment = fragments.append + theme = DEFAULT_TERMINAL_THEME + for text, style, control in Segment.simplify(segments): + if control: + continue + text = escape(text) + if style: + rule = style.get_html_style(theme) + text = f'<span style="{rule}">{text}</span>' if rule else text + if style.link: + text = f'<a href="{style.link}">{text}</a>' + append_fragment(text) + + code = "".join(fragments) + html = JUPYTER_HTML_FORMAT.format(code=code) + + return html + + +def display(segments: Iterable[Segment], text: str) -> None: + """Render segments to Jupyter.""" + from IPython.display import display as ipython_display + + html = _render_segments(segments) + jupyter_renderable = JupyterRenderable(html, text) + ipython_display(jupyter_renderable) + + +def print(*args: Any, **kwargs: Any) -> None: + """Proxy for Console print.""" + console = get_console() + return console.print(*args, **kwargs) diff --git a/src/pip/_vendor/rich/layout.py b/src/pip/_vendor/rich/layout.py new file mode 100644 index 000000000..22a4c5478 --- /dev/null +++ b/src/pip/_vendor/rich/layout.py @@ -0,0 +1,444 @@ +from abc import ABC, abstractmethod +from itertools import islice +from operator import itemgetter +from threading import RLock +from typing import ( + TYPE_CHECKING, + Dict, + Iterable, + List, + NamedTuple, + Optional, + Sequence, + Tuple, + Union, +) + +from ._ratio import ratio_resolve +from .align import Align +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .highlighter import ReprHighlighter +from .panel import Panel +from .pretty import Pretty +from .repr import rich_repr, Result +from .region import Region +from .segment import Segment +from .style import StyleType + +if TYPE_CHECKING: + from pip._vendor.rich.tree import Tree + + +class LayoutRender(NamedTuple): + """An individual layout render.""" + + region: Region + render: List[List[Segment]] + + +RegionMap = Dict["Layout", Region] +RenderMap = Dict["Layout", LayoutRender] + + +class LayoutError(Exception): + """Layout related error.""" + + +class NoSplitter(LayoutError): + """Requested splitter does not exist.""" + + +class _Placeholder: + """An internal renderable used as a Layout placeholder.""" + + highlighter = ReprHighlighter() + + def __init__(self, layout: "Layout", style: StyleType = "") -> None: + self.layout = layout + self.style = style + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + width = options.max_width + height = options.height or options.size.height + layout = self.layout + title = ( + f"{layout.name!r} ({width} x {height})" + if layout.name + else f"({width} x {height})" + ) + yield Panel( + Align.center(Pretty(layout), vertical="middle"), + style=self.style, + title=self.highlighter(title), + border_style="blue", + ) + + +class Splitter(ABC): + """Base class for a splitter.""" + + name: str = "" + + @abstractmethod + def get_tree_icon(self) -> str: + """Get the icon (emoji) used in layout.tree""" + + @abstractmethod + def divide( + self, children: Sequence["Layout"], region: Region + ) -> Iterable[Tuple["Layout", Region]]: + """Divide a region amongst several child layouts. + + Args: + children (Sequence(Layout)): A number of child layouts. + region (Region): A rectangular region to divide. + """ + + +class RowSplitter(Splitter): + """Split a layout region in to rows.""" + + name = "row" + + def get_tree_icon(self) -> str: + return "[layout.tree.row]⬌" + + def divide( + self, children: Sequence["Layout"], region: Region + ) -> Iterable[Tuple["Layout", Region]]: + x, y, width, height = region + render_widths = ratio_resolve(width, children) + offset = 0 + _Region = Region + for child, child_width in zip(children, render_widths): + yield child, _Region(x + offset, y, child_width, height) + offset += child_width + + +class ColumnSplitter(Splitter): + """Split a layout region in to columns.""" + + name = "column" + + def get_tree_icon(self) -> str: + return "[layout.tree.column]⬍" + + def divide( + self, children: Sequence["Layout"], region: Region + ) -> Iterable[Tuple["Layout", Region]]: + x, y, width, height = region + render_heights = ratio_resolve(height, children) + offset = 0 + _Region = Region + for child, child_height in zip(children, render_heights): + yield child, _Region(x, y + offset, width, child_height) + offset += child_height + + +@rich_repr +class Layout: + """A renderable to divide a fixed height in to rows or columns. + + Args: + renderable (RenderableType, optional): Renderable content, or None for placeholder. Defaults to None. + name (str, optional): Optional identifier for Layout. Defaults to None. + size (int, optional): Optional fixed size of layout. Defaults to None. + minimum_size (int, optional): Minimum size of layout. Defaults to 1. + ratio (int, optional): Optional ratio for flexible layout. Defaults to 1. + visible (bool, optional): Visibility of layout. Defaults to True. + """ + + splitters = {"row": RowSplitter, "column": ColumnSplitter} + + def __init__( + self, + renderable: Optional[RenderableType] = None, + *, + name: Optional[str] = None, + size: Optional[int] = None, + minimum_size: int = 1, + ratio: int = 1, + visible: bool = True, + height: Optional[int] = None, + ) -> None: + self._renderable = renderable or _Placeholder(self) + self.size = size + self.minimum_size = minimum_size + self.ratio = ratio + self.name = name + self.visible = visible + self.height = height + self.splitter: Splitter = self.splitters["column"]() + self._children: List[Layout] = [] + self._render_map: RenderMap = {} + self._lock = RLock() + + def __rich_repr__(self) -> Result: + yield "name", self.name, None + yield "size", self.size, None + yield "minimum_size", self.minimum_size, 1 + yield "ratio", self.ratio, 1 + + @property + def renderable(self) -> RenderableType: + """Layout renderable.""" + return self if self._children else self._renderable + + @property + def children(self) -> List["Layout"]: + """Gets (visible) layout children.""" + return [child for child in self._children if child.visible] + + @property + def map(self) -> RenderMap: + """Get a map of the last render.""" + return self._render_map + + def get(self, name: str) -> Optional["Layout"]: + """Get a named layout, or None if it doesn't exist. + + Args: + name (str): Name of layout. + + Returns: + Optional[Layout]: Layout instance or None if no layout was found. + """ + if self.name == name: + return self + else: + for child in self._children: + named_layout = child.get(name) + if named_layout is not None: + return named_layout + return None + + def __getitem__(self, name: str) -> "Layout": + layout = self.get(name) + if layout is None: + raise KeyError(f"No layout with name {name!r}") + return layout + + @property + def tree(self) -> "Tree": + """Get a tree renderable to show layout structure.""" + from pip._vendor.rich.styled import Styled + from pip._vendor.rich.table import Table + from pip._vendor.rich.tree import Tree + + def summary(layout: "Layout") -> Table: + + icon = layout.splitter.get_tree_icon() + + table = Table.grid(padding=(0, 1, 0, 0)) + + text: RenderableType = ( + Pretty(layout) if layout.visible else Styled(Pretty(layout), "dim") + ) + table.add_row(icon, text) + _summary = table + return _summary + + layout = self + tree = Tree( + summary(layout), + guide_style=f"layout.tree.{layout.splitter.name}", + highlight=True, + ) + + def recurse(tree: "Tree", layout: "Layout") -> None: + for child in layout._children: + recurse( + tree.add( + summary(child), + guide_style=f"layout.tree.{child.splitter.name}", + ), + child, + ) + + recurse(tree, self) + return tree + + def split( + self, + *layouts: Union["Layout", RenderableType], + splitter: Union[Splitter, str] = "column", + ) -> None: + """Split the layout in to multiple sub-layouts. + + Args: + *layouts (Layout): Positional arguments should be (sub) Layout instances. + splitter (Union[Splitter, str]): Splitter instance or name of splitter. + """ + _layouts = [ + layout if isinstance(layout, Layout) else Layout(layout) + for layout in layouts + ] + try: + self.splitter = ( + splitter + if isinstance(splitter, Splitter) + else self.splitters[splitter]() + ) + except KeyError: + raise NoSplitter(f"No splitter called {splitter!r}") + self._children[:] = _layouts + + def add_split(self, *layouts: Union["Layout", RenderableType]) -> None: + """Add a new layout(s) to existing split. + + Args: + *layouts (Union[Layout, RenderableType]): Positional arguments should be renderables or (sub) Layout instances. + + """ + _layouts = ( + layout if isinstance(layout, Layout) else Layout(layout) + for layout in layouts + ) + self._children.extend(_layouts) + + def split_row(self, *layouts: Union["Layout", RenderableType]) -> None: + """Split the layout in tow a row (Layouts side by side). + + Args: + *layouts (Layout): Positional arguments should be (sub) Layout instances. + """ + self.split(*layouts, splitter="row") + + def split_column(self, *layouts: Union["Layout", RenderableType]) -> None: + """Split the layout in to a column (layouts stacked on top of each other). + + Args: + *layouts (Layout): Positional arguments should be (sub) Layout instances. + """ + self.split(*layouts, splitter="column") + + def unsplit(self) -> None: + """Reset splits to initial state.""" + del self._children[:] + + def update(self, renderable: RenderableType) -> None: + """Update renderable. + + Args: + renderable (RenderableType): New renderable object. + """ + with self._lock: + self._renderable = renderable + + def refresh_screen(self, console: "Console", layout_name: str) -> None: + """Refresh a sub-layout. + + Args: + console (Console): Console instance where Layout is to be rendered. + layout_name (str): Name of layout. + """ + with self._lock: + layout = self[layout_name] + region, _lines = self._render_map[layout] + (x, y, width, height) = region + lines = console.render_lines( + layout, console.options.update_dimensions(width, height) + ) + self._render_map[layout] = LayoutRender(region, lines) + console.update_screen_lines(lines, x, y) + + def _make_region_map(self, width: int, height: int) -> RegionMap: + """Create a dict that maps layout on to Region.""" + stack: List[Tuple[Layout, Region]] = [(self, Region(0, 0, width, height))] + push = stack.append + pop = stack.pop + layout_regions: List[Tuple[Layout, Region]] = [] + append_layout_region = layout_regions.append + while stack: + append_layout_region(pop()) + layout, region = layout_regions[-1] + children = layout.children + if children: + for child_and_region in layout.splitter.divide(children, region): + push(child_and_region) + + region_map = { + layout: region + for layout, region in sorted(layout_regions, key=itemgetter(1)) + } + return region_map + + def render(self, console: Console, options: ConsoleOptions) -> RenderMap: + """Render the sub_layouts. + + Args: + console (Console): Console instance. + options (ConsoleOptions): Console options. + + Returns: + RenderMap: A dict that maps Layout on to a tuple of Region, lines + """ + render_width = options.max_width + render_height = options.height or console.height + region_map = self._make_region_map(render_width, render_height) + layout_regions = [ + (layout, region) + for layout, region in region_map.items() + if not layout.children + ] + render_map: Dict["Layout", "LayoutRender"] = {} + render_lines = console.render_lines + update_dimensions = options.update_dimensions + + for layout, region in layout_regions: + lines = render_lines( + layout.renderable, update_dimensions(region.width, region.height) + ) + render_map[layout] = LayoutRender(region, lines) + return render_map + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + with self._lock: + width = options.max_width or console.width + height = options.height or console.height + render_map = self.render(console, options.update_dimensions(width, height)) + self._render_map = render_map + layout_lines: List[List[Segment]] = [[] for _ in range(height)] + _islice = islice + for (region, lines) in render_map.values(): + _x, y, _layout_width, layout_height = region + for row, line in zip( + _islice(layout_lines, y, y + layout_height), lines + ): + row.extend(line) + + new_line = Segment.line() + for layout_row in layout_lines: + yield from layout_row + yield new_line + + +if __name__ == "__main__": + from pip._vendor.rich.console import Console + + console = Console() + layout = Layout() + + layout.split_column( + Layout(name="header", size=3), + Layout(ratio=1, name="main"), + Layout(size=10, name="footer"), + ) + + layout["main"].split_row(Layout(name="side"), Layout(name="body", ratio=2)) + + layout["body"].split_row(Layout(name="content", ratio=2), Layout(name="s2")) + + layout["s2"].split_column( + Layout(name="top"), Layout(name="middle"), Layout(name="bottom") + ) + + layout["side"].split_column(Layout(layout.tree, name="left1"), Layout(name="left2")) + + layout["content"].update("foo") + + console.print(layout) diff --git a/src/pip/_vendor/rich/live.py b/src/pip/_vendor/rich/live.py new file mode 100644 index 000000000..cb36ddb8d --- /dev/null +++ b/src/pip/_vendor/rich/live.py @@ -0,0 +1,377 @@ +import sys +from threading import Event, RLock, Thread +from types import TracebackType +from typing import IO, Any, Callable, List, Optional, TextIO, Type, cast + +from . import get_console +from .console import Console, ConsoleRenderable, RenderableType, RenderHook +from .control import Control +from .file_proxy import FileProxy +from .jupyter import JupyterMixin +from .live_render import LiveRender, VerticalOverflowMethod +from .screen import Screen +from .text import Text + + +class _RefreshThread(Thread): + """A thread that calls refresh() at regular intervals.""" + + def __init__(self, live: "Live", refresh_per_second: float) -> None: + self.live = live + self.refresh_per_second = refresh_per_second + self.done = Event() + super().__init__(daemon=True) + + def stop(self) -> None: + self.done.set() + + def run(self) -> None: + while not self.done.wait(1 / self.refresh_per_second): + with self.live._lock: + if not self.done.is_set(): + self.live.refresh() + + +class Live(JupyterMixin, RenderHook): + """Renders an auto-updating live display of any given renderable. + + Args: + renderable (RenderableType, optional): The renderable to live display. Defaults to displaying nothing. + console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout. + screen (bool, optional): Enable alternate screen mode. Defaults to False. + auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()` or `update()` with refresh flag. Defaults to True + refresh_per_second (float, optional): Number of times per second to refresh the live display. Defaults to 4. + transient (bool, optional): Clear the renderable on exit (has no effect when screen=True). Defaults to False. + redirect_stdout (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. + redirect_stderr (bool, optional): Enable redirection of stderr. Defaults to True. + vertical_overflow (VerticalOverflowMethod, optional): How to handle renderable when it is too tall for the console. Defaults to "ellipsis". + get_renderable (Callable[[], RenderableType], optional): Optional callable to get renderable. Defaults to None. + """ + + def __init__( + self, + renderable: Optional[RenderableType] = None, + *, + console: Optional[Console] = None, + screen: bool = False, + auto_refresh: bool = True, + refresh_per_second: float = 4, + transient: bool = False, + redirect_stdout: bool = True, + redirect_stderr: bool = True, + vertical_overflow: VerticalOverflowMethod = "ellipsis", + get_renderable: Optional[Callable[[], RenderableType]] = None, + ) -> None: + assert refresh_per_second > 0, "refresh_per_second must be > 0" + self._renderable = renderable + self.console = console if console is not None else get_console() + self._screen = screen + self._alt_screen = False + + self._redirect_stdout = redirect_stdout + self._redirect_stderr = redirect_stderr + self._restore_stdout: Optional[IO[str]] = None + self._restore_stderr: Optional[IO[str]] = None + + self._lock = RLock() + self.ipy_widget: Optional[Any] = None + self.auto_refresh = auto_refresh + self._started: bool = False + self.transient = True if screen else transient + + self._refresh_thread: Optional[_RefreshThread] = None + self.refresh_per_second = refresh_per_second + + self.vertical_overflow = vertical_overflow + self._get_renderable = get_renderable + self._live_render = LiveRender( + self.get_renderable(), vertical_overflow=vertical_overflow + ) + + @property + def is_started(self) -> bool: + """Check if live display has been started.""" + return self._started + + def get_renderable(self) -> RenderableType: + renderable = ( + self._get_renderable() + if self._get_renderable is not None + else self._renderable + ) + return renderable or "" + + def start(self, refresh: bool = False) -> None: + """Start live rendering display. + + Args: + refresh (bool, optional): Also refresh. Defaults to False. + """ + with self._lock: + if self._started: + return + self.console.set_live(self) + self._started = True + if self._screen: + self._alt_screen = self.console.set_alt_screen(True) + self.console.show_cursor(False) + self._enable_redirect_io() + self.console.push_render_hook(self) + if refresh: + self.refresh() + if self.auto_refresh: + self._refresh_thread = _RefreshThread(self, self.refresh_per_second) + self._refresh_thread.start() + + def stop(self) -> None: + """Stop live rendering display.""" + with self._lock: + if not self._started: + return + self.console.clear_live() + self._started = False + try: + if self.auto_refresh and self._refresh_thread is not None: + self._refresh_thread.stop() + # allow it to fully render on the last even if overflow + self.vertical_overflow = "visible" + if not self._alt_screen and not self.console.is_jupyter: + self.refresh() + + finally: + self._disable_redirect_io() + self.console.pop_render_hook() + if not self._alt_screen and self.console.is_terminal: + self.console.line() + self.console.show_cursor(True) + if self._alt_screen: + self.console.set_alt_screen(False) + + if self._refresh_thread is not None: + self._refresh_thread.join() + self._refresh_thread = None + if self.transient and not self._alt_screen: + self.console.control(self._live_render.restore_cursor()) + if self.ipy_widget is not None: # pragma: no cover + if self.transient: + self.ipy_widget.close() + else: + # jupyter last refresh must occur after console pop render hook + # i am not sure why this is needed + self.refresh() + if not self.console.is_interactive: + return self.console.print() + + def __enter__(self) -> "Live": + self.start(refresh=self._renderable is not None) + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self.stop() + + def _enable_redirect_io(self) -> None: + """Enable redirecting of stdout / stderr.""" + if self.console.is_terminal: + if self._redirect_stdout and not isinstance(sys.stdout, FileProxy): + self._restore_stdout = sys.stdout + sys.stdout = cast("TextIO", FileProxy(self.console, sys.stdout)) + if self._redirect_stderr and not isinstance(sys.stderr, FileProxy): + self._restore_stderr = sys.stderr + sys.stderr = cast("TextIO", FileProxy(self.console, sys.stderr)) + + def _disable_redirect_io(self) -> None: + """Disable redirecting of stdout / stderr.""" + if self._restore_stdout: + sys.stdout = cast("TextIO", self._restore_stdout) + self._restore_stdout = None + if self._restore_stderr: + sys.stderr = cast("TextIO", self._restore_stderr) + self._restore_stderr = None + + @property + def renderable(self) -> RenderableType: + """Get the renderable that is being displayed + + Returns: + RenderableType: Displayed renderable. + """ + renderable = self.get_renderable() + return Screen(renderable) if self._alt_screen else renderable + + def update(self, renderable: RenderableType, *, refresh: bool = False) -> None: + """Update the renderable that is being displayed + + Args: + renderable (RenderableType): New renderable to use. + refresh (bool, optional): Refresh the display. Defaults to False. + """ + with self._lock: + self._renderable = renderable + if refresh: + self.refresh() + + def refresh(self) -> None: + """Update the display of the Live Render.""" + with self._lock: + self._live_render.set_renderable(self.renderable) + if self.console.is_jupyter: # pragma: no cover + try: + from IPython.display import display + from ipywidgets import Output + except ImportError: + import warnings + + warnings.warn('install "ipywidgets" for Jupyter support') + else: + if self.ipy_widget is None: + self.ipy_widget = Output() + display(self.ipy_widget) + + with self.ipy_widget: + self.ipy_widget.clear_output(wait=True) + self.console.print(self._live_render.renderable) + elif self.console.is_terminal and not self.console.is_dumb_terminal: + with self.console: + self.console.print(Control()) + elif ( + not self._started and not self.transient + ): # if it is finished allow files or dumb-terminals to see final result + with self.console: + self.console.print(Control()) + + def process_renderables( + self, renderables: List[ConsoleRenderable] + ) -> List[ConsoleRenderable]: + """Process renderables to restore cursor and display progress.""" + self._live_render.vertical_overflow = self.vertical_overflow + if self.console.is_interactive: + # lock needs acquiring as user can modify live_render renderable at any time unlike in Progress. + with self._lock: + reset = ( + Control.home() + if self._alt_screen + else self._live_render.position_cursor() + ) + renderables = [ + reset, + *renderables, + self._live_render, + ] + elif ( + not self._started and not self.transient + ): # if it is finished render the final output for files or dumb_terminals + renderables = [*renderables, self._live_render] + + return renderables + + +if __name__ == "__main__": # pragma: no cover + import random + import time + from itertools import cycle + from typing import Dict, List, Tuple + + from .align import Align + from .console import Console + from .live import Live as Live + from .panel import Panel + from .rule import Rule + from .syntax import Syntax + from .table import Table + + console = Console() + + syntax = Syntax( + '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''', + "python", + line_numbers=True, + ) + + table = Table("foo", "bar", "baz") + table.add_row("1", "2", "3") + + progress_renderables = [ + "You can make the terminal shorter and taller to see the live table hide" + "Text may be printed while the progress bars are rendering.", + Panel("In fact, [i]any[/i] renderable will work"), + "Such as [magenta]tables[/]...", + table, + "Pretty printed structures...", + {"type": "example", "text": "Pretty printed"}, + "Syntax...", + syntax, + Rule("Give it a try!"), + ] + + examples = cycle(progress_renderables) + + exchanges = [ + "SGD", + "MYR", + "EUR", + "USD", + "AUD", + "JPY", + "CNH", + "HKD", + "CAD", + "INR", + "DKK", + "GBP", + "RUB", + "NZD", + "MXN", + "IDR", + "TWD", + "THB", + "VND", + ] + with Live(console=console) as live_table: + exchange_rate_dict: Dict[Tuple[str, str], float] = {} + + for index in range(100): + select_exchange = exchanges[index % len(exchanges)] + + for exchange in exchanges: + if exchange == select_exchange: + continue + time.sleep(0.4) + if random.randint(0, 10) < 1: + console.log(next(examples)) + exchange_rate_dict[(select_exchange, exchange)] = 200 / ( + (random.random() * 320) + 1 + ) + if len(exchange_rate_dict) > len(exchanges) - 1: + exchange_rate_dict.pop(list(exchange_rate_dict.keys())[0]) + table = Table(title="Exchange Rates") + + table.add_column("Source Currency") + table.add_column("Destination Currency") + table.add_column("Exchange Rate") + + for ((source, dest), exchange_rate) in exchange_rate_dict.items(): + table.add_row( + source, + dest, + Text( + f"{exchange_rate:.4f}", + style="red" if exchange_rate < 1.0 else "green", + ), + ) + + live_table.update(Align.center(table)) diff --git a/src/pip/_vendor/rich/live_render.py b/src/pip/_vendor/rich/live_render.py new file mode 100644 index 000000000..b02fd3176 --- /dev/null +++ b/src/pip/_vendor/rich/live_render.py @@ -0,0 +1,113 @@ +import sys +from typing import Optional, Tuple + +if sys.version_info >= (3, 8): + from typing import Literal +else: + from pip._vendor.typing_extensions import Literal # pragma: no cover + + +from ._loop import loop_last +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .control import Control +from .segment import ControlType, Segment +from .style import StyleType +from .text import Text + +VerticalOverflowMethod = Literal["crop", "ellipsis", "visible"] + + +class LiveRender: + """Creates a renderable that may be updated. + + Args: + renderable (RenderableType): Any renderable object. + style (StyleType, optional): An optional style to apply to the renderable. Defaults to "". + """ + + def __init__( + self, + renderable: RenderableType, + style: StyleType = "", + vertical_overflow: VerticalOverflowMethod = "ellipsis", + ) -> None: + self.renderable = renderable + self.style = style + self.vertical_overflow = vertical_overflow + self._shape: Optional[Tuple[int, int]] = None + + def set_renderable(self, renderable: RenderableType) -> None: + """Set a new renderable. + + Args: + renderable (RenderableType): Any renderable object, including str. + """ + self.renderable = renderable + + def position_cursor(self) -> Control: + """Get control codes to move cursor to beginning of live render. + + Returns: + Control: A control instance that may be printed. + """ + if self._shape is not None: + _, height = self._shape + return Control( + ControlType.CARRIAGE_RETURN, + (ControlType.ERASE_IN_LINE, 2), + *( + ( + (ControlType.CURSOR_UP, 1), + (ControlType.ERASE_IN_LINE, 2), + ) + * (height - 1) + ) + ) + return Control() + + def restore_cursor(self) -> Control: + """Get control codes to clear the render and restore the cursor to its previous position. + + Returns: + Control: A Control instance that may be printed. + """ + if self._shape is not None: + _, height = self._shape + return Control( + ControlType.CARRIAGE_RETURN, + *((ControlType.CURSOR_UP, 1), (ControlType.ERASE_IN_LINE, 2)) * height + ) + return Control() + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + renderable = self.renderable + _Segment = Segment + style = console.get_style(self.style) + lines = console.render_lines(renderable, options, style=style, pad=False) + shape = _Segment.get_shape(lines) + + _, height = shape + if height > options.size.height: + if self.vertical_overflow == "crop": + lines = lines[: options.size.height] + shape = _Segment.get_shape(lines) + elif self.vertical_overflow == "ellipsis": + lines = lines[: (options.size.height - 1)] + overflow_text = Text( + "...", + overflow="crop", + justify="center", + end="", + style="live.ellipsis", + ) + lines.append(list(console.render(overflow_text))) + shape = _Segment.get_shape(lines) + self._shape = shape + + for last, line in loop_last(lines): + yield from line + if not last: + yield _Segment.line() diff --git a/src/pip/_vendor/rich/logging.py b/src/pip/_vendor/rich/logging.py new file mode 100644 index 000000000..47ca7d42d --- /dev/null +++ b/src/pip/_vendor/rich/logging.py @@ -0,0 +1,267 @@ +import logging +from datetime import datetime +from logging import Handler, LogRecord +from pathlib import Path +from typing import ClassVar, List, Optional, Type, Union + +from . import get_console +from ._log_render import LogRender, FormatTimeCallable +from .console import Console, ConsoleRenderable +from .highlighter import Highlighter, ReprHighlighter +from .text import Text +from .traceback import Traceback + + +class RichHandler(Handler): + """A logging handler that renders output with Rich. The time / level / message and file are displayed in columns. + The level is color coded, and the message is syntax highlighted. + + Note: + Be careful when enabling console markup in log messages if you have configured logging for libraries not + under your control. If a dependency writes messages containing square brackets, it may not produce the intended output. + + Args: + level (Union[int, str], optional): Log level. Defaults to logging.NOTSET. + console (:class:`~rich.console.Console`, optional): Optional console instance to write logs. + Default will use a global console instance writing to stdout. + show_time (bool, optional): Show a column for the time. Defaults to True. + omit_repeated_times (bool, optional): Omit repetition of the same time. Defaults to True. + show_level (bool, optional): Show a column for the level. Defaults to True. + show_path (bool, optional): Show the path to the original log call. Defaults to True. + enable_link_path (bool, optional): Enable terminal link of path column to file. Defaults to True. + highlighter (Highlighter, optional): Highlighter to style log messages, or None to use ReprHighlighter. Defaults to None. + markup (bool, optional): Enable console markup in log messages. Defaults to False. + rich_tracebacks (bool, optional): Enable rich tracebacks with syntax highlighting and formatting. Defaults to False. + tracebacks_width (Optional[int], optional): Number of characters used to render tracebacks, or None for full width. Defaults to None. + tracebacks_extra_lines (int, optional): Additional lines of code to render tracebacks, or None for full width. Defaults to None. + tracebacks_theme (str, optional): Override pygments theme used in traceback. + tracebacks_word_wrap (bool, optional): Enable word wrapping of long tracebacks lines. Defaults to True. + tracebacks_show_locals (bool, optional): Enable display of locals in tracebacks. Defaults to False. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + log_time_format (Union[str, TimeFormatterCallable], optional): If ``log_time`` is enabled, either string for strftime or callable that formats the time. Defaults to "[%x %X] ". + """ + + KEYWORDS: ClassVar[Optional[List[str]]] = [ + "GET", + "POST", + "HEAD", + "PUT", + "DELETE", + "OPTIONS", + "TRACE", + "PATCH", + ] + HIGHLIGHTER_CLASS: ClassVar[Type[Highlighter]] = ReprHighlighter + + def __init__( + self, + level: Union[int, str] = logging.NOTSET, + console: Optional[Console] = None, + *, + show_time: bool = True, + omit_repeated_times: bool = True, + show_level: bool = True, + show_path: bool = True, + enable_link_path: bool = True, + highlighter: Optional[Highlighter] = None, + markup: bool = False, + rich_tracebacks: bool = False, + tracebacks_width: Optional[int] = None, + tracebacks_extra_lines: int = 3, + tracebacks_theme: Optional[str] = None, + tracebacks_word_wrap: bool = True, + tracebacks_show_locals: bool = False, + locals_max_length: int = 10, + locals_max_string: int = 80, + log_time_format: Union[str, FormatTimeCallable] = "[%x %X]", + ) -> None: + super().__init__(level=level) + self.console = console or get_console() + self.highlighter = highlighter or self.HIGHLIGHTER_CLASS() + self._log_render = LogRender( + show_time=show_time, + show_level=show_level, + show_path=show_path, + time_format=log_time_format, + omit_repeated_times=omit_repeated_times, + level_width=None, + ) + self.enable_link_path = enable_link_path + self.markup = markup + self.rich_tracebacks = rich_tracebacks + self.tracebacks_width = tracebacks_width + self.tracebacks_extra_lines = tracebacks_extra_lines + self.tracebacks_theme = tracebacks_theme + self.tracebacks_word_wrap = tracebacks_word_wrap + self.tracebacks_show_locals = tracebacks_show_locals + self.locals_max_length = locals_max_length + self.locals_max_string = locals_max_string + + def get_level_text(self, record: LogRecord) -> Text: + """Get the level name from the record. + + Args: + record (LogRecord): LogRecord instance. + + Returns: + Text: A tuple of the style and level name. + """ + level_name = record.levelname + level_text = Text.styled( + level_name.ljust(8), f"logging.level.{level_name.lower()}" + ) + return level_text + + def emit(self, record: LogRecord) -> None: + """Invoked by logging.""" + message = self.format(record) + traceback = None + if ( + self.rich_tracebacks + and record.exc_info + and record.exc_info != (None, None, None) + ): + exc_type, exc_value, exc_traceback = record.exc_info + assert exc_type is not None + assert exc_value is not None + traceback = Traceback.from_exception( + exc_type, + exc_value, + exc_traceback, + width=self.tracebacks_width, + extra_lines=self.tracebacks_extra_lines, + theme=self.tracebacks_theme, + word_wrap=self.tracebacks_word_wrap, + show_locals=self.tracebacks_show_locals, + locals_max_length=self.locals_max_length, + locals_max_string=self.locals_max_string, + ) + message = record.getMessage() + if self.formatter: + record.message = record.getMessage() + formatter = self.formatter + if hasattr(formatter, "usesTime") and formatter.usesTime(): + record.asctime = formatter.formatTime(record, formatter.datefmt) + message = formatter.formatMessage(record) + + message_renderable = self.render_message(record, message) + log_renderable = self.render( + record=record, traceback=traceback, message_renderable=message_renderable + ) + try: + self.console.print(log_renderable) + except Exception: + self.handleError(record) + + def render_message(self, record: LogRecord, message: str) -> "ConsoleRenderable": + """Render message text in to Text. + + record (LogRecord): logging Record. + message (str): String containing log message. + + Returns: + ConsoleRenderable: Renderable to display log message. + """ + use_markup = ( + getattr(record, "markup") if hasattr(record, "markup") else self.markup + ) + message_text = Text.from_markup(message) if use_markup else Text(message) + if self.highlighter: + message_text = self.highlighter(message_text) + if self.KEYWORDS: + message_text.highlight_words(self.KEYWORDS, "logging.keyword") + return message_text + + def render( + self, + *, + record: LogRecord, + traceback: Optional[Traceback], + message_renderable: "ConsoleRenderable", + ) -> "ConsoleRenderable": + """Render log for display. + + Args: + record (LogRecord): logging Record. + traceback (Optional[Traceback]): Traceback instance or None for no Traceback. + message_renderable (ConsoleRenderable): Renderable (typically Text) containing log message contents. + + Returns: + ConsoleRenderable: Renderable to display log. + """ + path = Path(record.pathname).name + level = self.get_level_text(record) + time_format = None if self.formatter is None else self.formatter.datefmt + log_time = datetime.fromtimestamp(record.created) + + log_renderable = self._log_render( + self.console, + [message_renderable] if not traceback else [message_renderable, traceback], + log_time=log_time, + time_format=time_format, + level=level, + path=path, + line_no=record.lineno, + link_path=record.pathname if self.enable_link_path else None, + ) + return log_renderable + + +if __name__ == "__main__": # pragma: no cover + from time import sleep + + FORMAT = "%(message)s" + # FORMAT = "%(asctime)-15s - %(levelname)s - %(message)s" + logging.basicConfig( + level="NOTSET", + format=FORMAT, + datefmt="[%X]", + handlers=[RichHandler(rich_tracebacks=True, tracebacks_show_locals=True)], + ) + log = logging.getLogger("rich") + + log.info("Server starting...") + log.info("Listening on http://127.0.0.1:8080") + sleep(1) + + log.info("GET /index.html 200 1298") + log.info("GET /imgs/backgrounds/back1.jpg 200 54386") + log.info("GET /css/styles.css 200 54386") + log.warning("GET /favicon.ico 404 242") + sleep(1) + + log.debug( + "JSONRPC request\n--> %r\n<-- %r", + { + "version": "1.1", + "method": "confirmFruitPurchase", + "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], + "id": "194521489", + }, + {"version": "1.1", "result": True, "error": None, "id": "194521489"}, + ) + log.debug( + "Loading configuration file /adasd/asdasd/qeqwe/qwrqwrqwr/sdgsdgsdg/werwerwer/dfgerert/ertertert/ertetert/werwerwer" + ) + log.error("Unable to find 'pomelo' in database!") + log.info("POST /jsonrpc/ 200 65532") + log.info("POST /admin/ 401 42234") + log.warning("password was rejected for admin site.") + + def divide() -> None: + number = 1 + divisor = 0 + foos = ["foo"] * 100 + log.debug("in divide") + try: + number / divisor + except: + log.exception("An error of some kind occurred!") + + divide() + sleep(1) + log.critical("Out of memory!") + log.info("Server exited with code=-1") + log.info("[bold]EXITING...[/bold]", extra=dict(markup=True)) diff --git a/src/pip/_vendor/rich/markup.py b/src/pip/_vendor/rich/markup.py new file mode 100644 index 000000000..ff861a354 --- /dev/null +++ b/src/pip/_vendor/rich/markup.py @@ -0,0 +1,244 @@ +from ast import literal_eval +from operator import attrgetter +import re +from typing import Callable, Iterable, List, Match, NamedTuple, Optional, Tuple, Union + +from .errors import MarkupError +from .style import Style +from .text import Span, Text +from .emoji import EmojiVariant +from ._emoji_replace import _emoji_replace + + +RE_TAGS = re.compile( + r"""((\\*)\[([a-z#\/@].*?)\])""", + re.VERBOSE, +) + +RE_HANDLER = re.compile(r"^([\w\.]*?)(\(.*?\))?$") + + +class Tag(NamedTuple): + """A tag in console markup.""" + + name: str + """The tag name. e.g. 'bold'.""" + parameters: Optional[str] + """Any additional parameters after the name.""" + + def __str__(self) -> str: + return ( + self.name if self.parameters is None else f"{self.name} {self.parameters}" + ) + + @property + def markup(self) -> str: + """Get the string representation of this tag.""" + return ( + f"[{self.name}]" + if self.parameters is None + else f"[{self.name}={self.parameters}]" + ) + + +_ReStringMatch = Match[str] # regex match object +_ReSubCallable = Callable[[_ReStringMatch], str] # Callable invoked by re.sub +_EscapeSubMethod = Callable[[_ReSubCallable, str], str] # Sub method of a compiled re + + +def escape( + markup: str, _escape: _EscapeSubMethod = re.compile(r"(\\*)(\[[a-z#\/].*?\])").sub +) -> str: + """Escapes text so that it won't be interpreted as markup. + + Args: + markup (str): Content to be inserted in to markup. + + Returns: + str: Markup with square brackets escaped. + """ + + def escape_backslashes(match: Match[str]) -> str: + """Called by re.sub replace matches.""" + backslashes, text = match.groups() + return f"{backslashes}{backslashes}\\{text}" + + markup = _escape(escape_backslashes, markup) + return markup + + +def _parse(markup: str) -> Iterable[Tuple[int, Optional[str], Optional[Tag]]]: + """Parse markup in to an iterable of tuples of (position, text, tag). + + Args: + markup (str): A string containing console markup + + """ + position = 0 + _divmod = divmod + _Tag = Tag + for match in RE_TAGS.finditer(markup): + full_text, escapes, tag_text = match.groups() + start, end = match.span() + if start > position: + yield start, markup[position:start], None + if escapes: + backslashes, escaped = _divmod(len(escapes), 2) + if backslashes: + # Literal backslashes + yield start, "\\" * backslashes, None + start += backslashes * 2 + if escaped: + # Escape of tag + yield start, full_text[len(escapes) :], None + position = end + continue + text, equals, parameters = tag_text.partition("=") + yield start, None, _Tag(text, parameters if equals else None) + position = end + if position < len(markup): + yield position, markup[position:], None + + +def render( + markup: str, + style: Union[str, Style] = "", + emoji: bool = True, + emoji_variant: Optional[EmojiVariant] = None, +) -> Text: + """Render console markup in to a Text instance. + + Args: + markup (str): A string containing console markup. + emoji (bool, optional): Also render emoji code. Defaults to True. + + Raises: + MarkupError: If there is a syntax error in the markup. + + Returns: + Text: A test instance. + """ + emoji_replace = _emoji_replace + if "[" not in markup: + return Text( + emoji_replace(markup, default_variant=emoji_variant) if emoji else markup, + style=style, + ) + text = Text(style=style) + append = text.append + normalize = Style.normalize + + style_stack: List[Tuple[int, Tag]] = [] + pop = style_stack.pop + + spans: List[Span] = [] + append_span = spans.append + + _Span = Span + _Tag = Tag + + def pop_style(style_name: str) -> Tuple[int, Tag]: + """Pop tag matching given style name.""" + for index, (_, tag) in enumerate(reversed(style_stack), 1): + if tag.name == style_name: + return pop(-index) + raise KeyError(style_name) + + for position, plain_text, tag in _parse(markup): + if plain_text is not None: + append(emoji_replace(plain_text) if emoji else plain_text) + elif tag is not None: + if tag.name.startswith("/"): # Closing tag + style_name = tag.name[1:].strip() + + if style_name: # explicit close + style_name = normalize(style_name) + try: + start, open_tag = pop_style(style_name) + except KeyError: + raise MarkupError( + f"closing tag '{tag.markup}' at position {position} doesn't match any open tag" + ) from None + else: # implicit close + try: + start, open_tag = pop() + except IndexError: + raise MarkupError( + f"closing tag '[/]' at position {position} has nothing to close" + ) from None + + if open_tag.name.startswith("@"): + if open_tag.parameters: + handler_name = "" + parameters = open_tag.parameters.strip() + handler_match = RE_HANDLER.match(parameters) + if handler_match is not None: + handler_name, match_parameters = handler_match.groups() + parameters = ( + "()" if match_parameters is None else match_parameters + ) + + try: + meta_params = literal_eval(parameters) + except SyntaxError as error: + raise MarkupError( + f"error parsing {parameters!r} in {open_tag.parameters!r}; {error.msg}" + ) + except Exception as error: + raise MarkupError( + f"error parsing {open_tag.parameters!r}; {error}" + ) from None + + if handler_name: + meta_params = ( + handler_name, + meta_params + if isinstance(meta_params, tuple) + else (meta_params,), + ) + + else: + meta_params = () + + append_span( + _Span( + start, len(text), Style(meta={open_tag.name: meta_params}) + ) + ) + else: + append_span(_Span(start, len(text), str(open_tag))) + + else: # Opening tag + normalized_tag = _Tag(normalize(tag.name), tag.parameters) + style_stack.append((len(text), normalized_tag)) + + text_length = len(text) + while style_stack: + start, tag = style_stack.pop() + style = str(tag) + if style: + append_span(_Span(start, text_length, style)) + + text.spans = sorted(spans[::-1], key=attrgetter("start")) + return text + + +if __name__ == "__main__": # pragma: no cover + + MARKUP = [ + "[red]Hello World[/red]", + "[magenta]Hello [b]World[/b]", + "[bold]Bold[italic] bold and italic [/bold]italic[/italic]", + "Click [link=https://www.willmcgugan.com]here[/link] to visit my Blog", + ":warning-emoji: [bold red blink] DANGER![/]", + ] + + from pip._vendor.rich.table import Table + from pip._vendor.rich import print + + grid = Table("Markup", "Result", padding=(0, 1)) + + for markup in MARKUP: + grid.add_row(Text(markup), markup) + + print(grid) diff --git a/src/pip/_vendor/rich/measure.py b/src/pip/_vendor/rich/measure.py new file mode 100644 index 000000000..b57aa9c85 --- /dev/null +++ b/src/pip/_vendor/rich/measure.py @@ -0,0 +1,150 @@ +from operator import itemgetter +from typing import Callable, Iterable, NamedTuple, Optional, TYPE_CHECKING + +from . import errors +from .protocol import is_renderable + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType + + +class Measurement(NamedTuple): + """Stores the minimum and maximum widths (in characters) required to render an object.""" + + minimum: int + """Minimum number of cells required to render.""" + maximum: int + """Maximum number of cells required to render.""" + + @property + def span(self) -> int: + """Get difference between maximum and minimum.""" + return self.maximum - self.minimum + + def normalize(self) -> "Measurement": + """Get measurement that ensures that minimum <= maximum and minimum >= 0 + + Returns: + Measurement: A normalized measurement. + """ + minimum, maximum = self + minimum = min(max(0, minimum), maximum) + return Measurement(max(0, minimum), max(0, max(minimum, maximum))) + + def with_maximum(self, width: int) -> "Measurement": + """Get a RenderableWith where the widths are <= width. + + Args: + width (int): Maximum desired width. + + Returns: + Measurement: New Measurement object. + """ + minimum, maximum = self + return Measurement(min(minimum, width), min(maximum, width)) + + def with_minimum(self, width: int) -> "Measurement": + """Get a RenderableWith where the widths are >= width. + + Args: + width (int): Minimum desired width. + + Returns: + Measurement: New Measurement object. + """ + minimum, maximum = self + width = max(0, width) + return Measurement(max(minimum, width), max(maximum, width)) + + def clamp( + self, min_width: Optional[int] = None, max_width: Optional[int] = None + ) -> "Measurement": + """Clamp a measurement within the specified range. + + Args: + min_width (int): Minimum desired width, or ``None`` for no minimum. Defaults to None. + max_width (int): Maximum desired width, or ``None`` for no maximum. Defaults to None. + + Returns: + Measurement: New Measurement object. + """ + measurement = self + if min_width is not None: + measurement = measurement.with_minimum(min_width) + if max_width is not None: + measurement = measurement.with_maximum(max_width) + return measurement + + @classmethod + def get( + cls, console: "Console", options: "ConsoleOptions", renderable: "RenderableType" + ) -> "Measurement": + """Get a measurement for a renderable. + + Args: + console (~rich.console.Console): Console instance. + options (~rich.console.ConsoleOptions): Console options. + renderable (RenderableType): An object that may be rendered with Rich. + + Raises: + errors.NotRenderableError: If the object is not renderable. + + Returns: + Measurement: Measurement object containing range of character widths required to render the object. + """ + _max_width = options.max_width + if _max_width < 1: + return Measurement(0, 0) + if isinstance(renderable, str): + renderable = console.render_str(renderable, markup=options.markup) + if hasattr(renderable, "__rich__"): + renderable = renderable.__rich__() # type: ignore + if is_renderable(renderable): + get_console_width: Optional[ + Callable[["Console", "ConsoleOptions"], "Measurement"] + ] = getattr(renderable, "__rich_measure__", None) + if get_console_width is not None: + render_width = ( + get_console_width(console, options) + .normalize() + .with_maximum(_max_width) + ) + if render_width.maximum < 1: + return Measurement(0, 0) + return render_width.normalize() + else: + return Measurement(0, _max_width) + else: + raise errors.NotRenderableError( + f"Unable to get render width for {renderable!r}; " + "a str, Segment, or object with __rich_console__ method is required" + ) + + +def measure_renderables( + console: "Console", + options: "ConsoleOptions", + renderables: Iterable["RenderableType"], +) -> "Measurement": + """Get a measurement that would fit a number of renderables. + + Args: + console (~rich.console.Console): Console instance. + renderables (Iterable[RenderableType]): One or more renderable objects. + max_width (int): The maximum width available. + + Returns: + Measurement: Measurement object containing range of character widths required to + contain all given renderables. + """ + if not renderables: + return Measurement(0, 0) + get_measurement = Measurement.get + measurements = [ + get_measurement(console, options, renderable) for renderable in renderables + ] + measured_width = Measurement( + max(measurements, key=itemgetter(0)).minimum, + max(measurements, key=itemgetter(1)).maximum, + ) + return measured_width diff --git a/src/pip/_vendor/rich/padding.py b/src/pip/_vendor/rich/padding.py new file mode 100644 index 000000000..f024e95e0 --- /dev/null +++ b/src/pip/_vendor/rich/padding.py @@ -0,0 +1,139 @@ +from typing import cast, List, Optional, Tuple, TYPE_CHECKING, Union + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + RenderableType, + RenderResult, + ) +from .jupyter import JupyterMixin +from .measure import Measurement +from .style import Style +from .segment import Segment + + +PaddingDimensions = Union[int, Tuple[int], Tuple[int, int], Tuple[int, int, int, int]] + + +class Padding(JupyterMixin): + """Draw space around content. + + Example: + >>> print(Padding("Hello", (2, 4), style="on blue")) + + Args: + renderable (RenderableType): String or other renderable. + pad (Union[int, Tuple[int]]): Padding for top, right, bottom, and left borders. + May be specified with 1, 2, or 4 integers (CSS style). + style (Union[str, Style], optional): Style for padding characters. Defaults to "none". + expand (bool, optional): Expand padding to fit available width. Defaults to True. + """ + + def __init__( + self, + renderable: "RenderableType", + pad: "PaddingDimensions" = (0, 0, 0, 0), + *, + style: Union[str, Style] = "none", + expand: bool = True, + ): + self.renderable = renderable + self.top, self.right, self.bottom, self.left = self.unpack(pad) + self.style = style + self.expand = expand + + @classmethod + def indent(cls, renderable: "RenderableType", level: int) -> "Padding": + """Make padding instance to render an indent. + + Args: + renderable (RenderableType): String or other renderable. + level (int): Number of characters to indent. + + Returns: + Padding: A Padding instance. + """ + + return Padding(renderable, pad=(0, 0, 0, level), expand=False) + + @staticmethod + def unpack(pad: "PaddingDimensions") -> Tuple[int, int, int, int]: + """Unpack padding specified in CSS style.""" + if isinstance(pad, int): + return (pad, pad, pad, pad) + if len(pad) == 1: + _pad = pad[0] + return (_pad, _pad, _pad, _pad) + if len(pad) == 2: + pad_top, pad_right = cast(Tuple[int, int], pad) + return (pad_top, pad_right, pad_top, pad_right) + if len(pad) == 4: + top, right, bottom, left = cast(Tuple[int, int, int, int], pad) + return (top, right, bottom, left) + raise ValueError(f"1, 2 or 4 integers required for padding; {len(pad)} given") + + def __repr__(self) -> str: + return f"Padding({self.renderable!r}, ({self.top},{self.right},{self.bottom},{self.left}))" + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + style = console.get_style(self.style) + if self.expand: + width = options.max_width + else: + width = min( + Measurement.get(console, options, self.renderable).maximum + + self.left + + self.right, + options.max_width, + ) + lines = console.render_lines( + self.renderable, + options.update_width(width - self.left - self.right), + style=style, + pad=True, + ) + _Segment = Segment + + left = _Segment(" " * self.left, style) if self.left else None + right = ( + [_Segment(f'{" " * self.right}', style), _Segment.line()] + if self.right + else [_Segment.line()] + ) + blank_line: Optional[List[Segment]] = None + if self.top: + blank_line = [_Segment(f'{" " * width}\n', style)] + yield from blank_line * self.top + if left: + for line in lines: + yield left + yield from line + yield from right + else: + for line in lines: + yield from line + yield from right + if self.bottom: + blank_line = blank_line or [_Segment(f'{" " * width}\n', style)] + yield from blank_line * self.bottom + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + max_width = options.max_width + extra_width = self.left + self.right + if max_width - extra_width < 1: + return Measurement(max_width, max_width) + measure_min, measure_max = Measurement.get(console, options, self.renderable) + measurement = Measurement(measure_min + extra_width, measure_max + extra_width) + measurement = measurement.with_maximum(max_width) + return measurement + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich import print + + print(Padding("Hello, World", (2, 4), style="on blue")) diff --git a/src/pip/_vendor/rich/pager.py b/src/pip/_vendor/rich/pager.py new file mode 100644 index 000000000..ea9bdf08f --- /dev/null +++ b/src/pip/_vendor/rich/pager.py @@ -0,0 +1,34 @@ +from abc import ABC, abstractmethod +from typing import Any, Callable + + +class Pager(ABC): + """Base class for a pager.""" + + @abstractmethod + def show(self, content: str) -> None: + """Show content in pager. + + Args: + content (str): Content to be displayed. + """ + + +class SystemPager(Pager): + """Uses the pager installed on the system.""" + + def _pager(self, content: str) -> Any: + return __import__("pydoc").pager(content) + + def show(self, content: str) -> None: + """Use the same pager used by pydoc.""" + self._pager(content) + + +if __name__ == "__main__": # pragma: no cover + from .__main__ import make_test_card + from .console import Console + + console = Console() + with console.pager(styles=True): + console.print(make_test_card()) diff --git a/src/pip/_vendor/rich/palette.py b/src/pip/_vendor/rich/palette.py new file mode 100644 index 000000000..fa0c4dd40 --- /dev/null +++ b/src/pip/_vendor/rich/palette.py @@ -0,0 +1,100 @@ +from math import sqrt +from functools import lru_cache +from typing import Sequence, Tuple, TYPE_CHECKING + +from .color_triplet import ColorTriplet + +if TYPE_CHECKING: + from pip._vendor.rich.table import Table + + +class Palette: + """A palette of available colors.""" + + def __init__(self, colors: Sequence[Tuple[int, int, int]]): + self._colors = colors + + def __getitem__(self, number: int) -> ColorTriplet: + return ColorTriplet(*self._colors[number]) + + def __rich__(self) -> "Table": + from pip._vendor.rich.color import Color + from pip._vendor.rich.style import Style + from pip._vendor.rich.text import Text + from pip._vendor.rich.table import Table + + table = Table( + "index", + "RGB", + "Color", + title="Palette", + caption=f"{len(self._colors)} colors", + highlight=True, + caption_justify="right", + ) + for index, color in enumerate(self._colors): + table.add_row( + str(index), + repr(color), + Text(" " * 16, style=Style(bgcolor=Color.from_rgb(*color))), + ) + return table + + # This is somewhat inefficient and needs caching + @lru_cache(maxsize=1024) + def match(self, color: Tuple[int, int, int]) -> int: + """Find a color from a palette that most closely matches a given color. + + Args: + color (Tuple[int, int, int]): RGB components in range 0 > 255. + + Returns: + int: Index of closes matching color. + """ + red1, green1, blue1 = color + _sqrt = sqrt + get_color = self._colors.__getitem__ + + def get_color_distance(index: int) -> float: + """Get the distance to a color.""" + red2, green2, blue2 = get_color(index) + red_mean = (red1 + red2) // 2 + red = red1 - red2 + green = green1 - green2 + blue = blue1 - blue2 + return _sqrt( + (((512 + red_mean) * red * red) >> 8) + + 4 * green * green + + (((767 - red_mean) * blue * blue) >> 8) + ) + + min_index = min(range(len(self._colors)), key=get_color_distance) + return min_index + + +if __name__ == "__main__": # pragma: no cover + import colorsys + from typing import Iterable + from pip._vendor.rich.color import Color + from pip._vendor.rich.console import Console, ConsoleOptions + from pip._vendor.rich.segment import Segment + from pip._vendor.rich.style import Style + + class ColorBox: + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> Iterable[Segment]: + height = console.size.height - 3 + for y in range(0, height): + for x in range(options.max_width): + h = x / options.max_width + l = y / (height + 1) + r1, g1, b1 = colorsys.hls_to_rgb(h, l, 1.0) + r2, g2, b2 = colorsys.hls_to_rgb(h, l + (1 / height / 2), 1.0) + bgcolor = Color.from_rgb(r1 * 255, g1 * 255, b1 * 255) + color = Color.from_rgb(r2 * 255, g2 * 255, b2 * 255) + yield Segment("▄", Style(color=color, bgcolor=bgcolor)) + yield Segment.line() + + console = Console() + console.print(ColorBox()) diff --git a/src/pip/_vendor/rich/panel.py b/src/pip/_vendor/rich/panel.py new file mode 100644 index 000000000..151fe5f01 --- /dev/null +++ b/src/pip/_vendor/rich/panel.py @@ -0,0 +1,250 @@ +from typing import Optional, TYPE_CHECKING + +from .box import Box, ROUNDED + +from .align import AlignMethod +from .jupyter import JupyterMixin +from .measure import Measurement, measure_renderables +from .padding import Padding, PaddingDimensions +from .style import StyleType +from .text import Text, TextType +from .segment import Segment + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderableType, RenderResult + + +class Panel(JupyterMixin): + """A console renderable that draws a border around its contents. + + Example: + >>> console.print(Panel("Hello, World!")) + + Args: + renderable (RenderableType): A console renderable object. + box (Box, optional): A Box instance that defines the look of the border (see :ref:`appendix_box`. + Defaults to box.ROUNDED. + safe_box (bool, optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True. + expand (bool, optional): If True the panel will stretch to fill the console + width, otherwise it will be sized to fit the contents. Defaults to True. + style (str, optional): The style of the panel (border and contents). Defaults to "none". + border_style (str, optional): The style of the border. Defaults to "none". + width (Optional[int], optional): Optional width of panel. Defaults to None to auto-detect. + height (Optional[int], optional): Optional height of panel. Defaults to None to auto-detect. + padding (Optional[PaddingDimensions]): Optional padding around renderable. Defaults to 0. + highlight (bool, optional): Enable automatic highlighting of panel title (if str). Defaults to False. + """ + + def __init__( + self, + renderable: "RenderableType", + box: Box = ROUNDED, + *, + title: Optional[TextType] = None, + title_align: AlignMethod = "center", + subtitle: Optional[TextType] = None, + subtitle_align: AlignMethod = "center", + safe_box: Optional[bool] = None, + expand: bool = True, + style: StyleType = "none", + border_style: StyleType = "none", + width: Optional[int] = None, + height: Optional[int] = None, + padding: PaddingDimensions = (0, 1), + highlight: bool = False, + ) -> None: + self.renderable = renderable + self.box = box + self.title = title + self.title_align: AlignMethod = title_align + self.subtitle = subtitle + self.subtitle_align = subtitle_align + self.safe_box = safe_box + self.expand = expand + self.style = style + self.border_style = border_style + self.width = width + self.height = height + self.padding = padding + self.highlight = highlight + + @classmethod + def fit( + cls, + renderable: "RenderableType", + box: Box = ROUNDED, + *, + title: Optional[TextType] = None, + title_align: AlignMethod = "center", + subtitle: Optional[TextType] = None, + subtitle_align: AlignMethod = "center", + safe_box: Optional[bool] = None, + style: StyleType = "none", + border_style: StyleType = "none", + width: Optional[int] = None, + padding: PaddingDimensions = (0, 1), + ) -> "Panel": + """An alternative constructor that sets expand=False.""" + return cls( + renderable, + box, + title=title, + title_align=title_align, + subtitle=subtitle, + subtitle_align=subtitle_align, + safe_box=safe_box, + style=style, + border_style=border_style, + width=width, + padding=padding, + expand=False, + ) + + @property + def _title(self) -> Optional[Text]: + if self.title: + title_text = ( + Text.from_markup(self.title) + if isinstance(self.title, str) + else self.title.copy() + ) + title_text.end = "" + title_text.plain = title_text.plain.replace("\n", " ") + title_text.no_wrap = True + title_text.expand_tabs() + title_text.pad(1) + return title_text + return None + + @property + def _subtitle(self) -> Optional[Text]: + if self.subtitle: + subtitle_text = ( + Text.from_markup(self.subtitle) + if isinstance(self.subtitle, str) + else self.subtitle.copy() + ) + subtitle_text.end = "" + subtitle_text.plain = subtitle_text.plain.replace("\n", " ") + subtitle_text.no_wrap = True + subtitle_text.expand_tabs() + subtitle_text.pad(1) + return subtitle_text + return None + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + _padding = Padding.unpack(self.padding) + renderable = ( + Padding(self.renderable, _padding) if any(_padding) else self.renderable + ) + style = console.get_style(self.style) + border_style = style + console.get_style(self.border_style) + width = ( + options.max_width + if self.width is None + else min(options.max_width, self.width) + ) + + safe_box: bool = console.safe_box if self.safe_box is None else self.safe_box + box = self.box.substitute(options, safe=safe_box) + + title_text = self._title + if title_text is not None: + title_text.style = border_style + + child_width = ( + width - 2 + if self.expand + else console.measure( + renderable, options=options.update_width(width - 2) + ).maximum + ) + child_height = self.height or options.height or None + if child_height: + child_height -= 2 + if title_text is not None: + child_width = min( + options.max_width - 2, max(child_width, title_text.cell_len + 2) + ) + + width = child_width + 2 + child_options = options.update( + width=child_width, height=child_height, highlight=self.highlight + ) + lines = console.render_lines(renderable, child_options, style=style) + + line_start = Segment(box.mid_left, border_style) + line_end = Segment(f"{box.mid_right}", border_style) + new_line = Segment.line() + if title_text is None or width <= 4: + yield Segment(box.get_top([width - 2]), border_style) + else: + title_text.align(self.title_align, width - 4, character=box.top) + yield Segment(box.top_left + box.top, border_style) + yield from console.render(title_text) + yield Segment(box.top + box.top_right, border_style) + + yield new_line + for line in lines: + yield line_start + yield from line + yield line_end + yield new_line + + subtitle_text = self._subtitle + if subtitle_text is not None: + subtitle_text.style = border_style + + if subtitle_text is None or width <= 4: + yield Segment(box.get_bottom([width - 2]), border_style) + else: + subtitle_text.align(self.subtitle_align, width - 4, character=box.bottom) + yield Segment(box.bottom_left + box.bottom, border_style) + yield from console.render(subtitle_text) + yield Segment(box.bottom + box.bottom_right, border_style) + + yield new_line + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + _title = self._title + _, right, _, left = Padding.unpack(self.padding) + padding = left + right + renderables = [self.renderable, _title] if _title else [self.renderable] + + if self.width is None: + width = ( + measure_renderables( + console, + options.update_width(options.max_width - padding - 2), + renderables, + ).maximum + + padding + + 2 + ) + else: + width = self.width + return Measurement(width, width) + + +if __name__ == "__main__": # pragma: no cover + from .console import Console + + c = Console() + + from .padding import Padding + from .box import ROUNDED, DOUBLE + + p = Panel( + "Hello, World!", + title="rich.Panel", + style="white on blue", + box=DOUBLE, + padding=1, + ) + + c.print() + c.print(p) diff --git a/src/pip/_vendor/rich/pretty.py b/src/pip/_vendor/rich/pretty.py new file mode 100644 index 000000000..ae9fb5cfc --- /dev/null +++ b/src/pip/_vendor/rich/pretty.py @@ -0,0 +1,834 @@ +import builtins +import os +from pip._vendor.rich.repr import RichReprResult +import sys +from array import array +from collections import Counter, defaultdict, deque, UserDict, UserList +import dataclasses +from dataclasses import dataclass, fields, is_dataclass +from inspect import isclass +from itertools import islice +import re +from typing import ( + DefaultDict, + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + Optional, + Set, + Union, + Tuple, +) +from types import MappingProxyType + +try: + import attr as _attr_module +except ImportError: # pragma: no cover + _attr_module = None # type: ignore + + +from .highlighter import ReprHighlighter +from . import get_console +from ._loop import loop_last +from ._pick import pick_bool +from .abc import RichRenderable +from .cells import cell_len +from .highlighter import ReprHighlighter +from .jupyter import JupyterMixin, JupyterRenderable +from .measure import Measurement +from .text import Text + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + HighlighterType, + JustifyMethod, + OverflowMethod, + RenderResult, + ) + +# Matches Jupyter's special methods +_re_jupyter_repr = re.compile(f"^_repr_.+_$") + + +def _is_attr_object(obj: Any) -> bool: + """Check if an object was created with attrs module.""" + return _attr_module is not None and _attr_module.has(type(obj)) + + +def _get_attr_fields(obj: Any) -> Iterable["_attr_module.Attribute[Any]"]: + """Get fields for an attrs object.""" + return _attr_module.fields(type(obj)) if _attr_module is not None else [] + + +def _is_dataclass_repr(obj: object) -> bool: + """Check if an instance of a dataclass contains the default repr. + + Args: + obj (object): A dataclass instance. + + Returns: + bool: True if the default repr is used, False if there is a custom repr. + """ + # Digging in to a lot of internals here + # Catching all exceptions in case something is missing on a non CPython implementation + try: + return obj.__repr__.__code__.co_filename == dataclasses.__file__ + except Exception: + return False + + +def install( + console: Optional["Console"] = None, + overflow: "OverflowMethod" = "ignore", + crop: bool = False, + indent_guides: bool = False, + max_length: Optional[int] = None, + max_string: Optional[int] = None, + expand_all: bool = False, +) -> None: + """Install automatic pretty printing in the Python REPL. + + Args: + console (Console, optional): Console instance or ``None`` to use global console. Defaults to None. + overflow (Optional[OverflowMethod], optional): Overflow method. Defaults to "ignore". + crop (Optional[bool], optional): Enable cropping of long lines. Defaults to False. + indent_guides (bool, optional): Enable indentation guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + expand_all (bool, optional): Expand all containers. Defaults to False. + max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. + """ + from pip._vendor.rich import get_console + + from .console import ConsoleRenderable # needed here to prevent circular import + + console = console or get_console() + assert console is not None + + def display_hook(value: Any) -> None: + """Replacement sys.displayhook which prettifies objects with Rich.""" + if value is not None: + assert console is not None + builtins._ = None # type: ignore + console.print( + value + if isinstance(value, RichRenderable) + else Pretty( + value, + overflow=overflow, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + expand_all=expand_all, + ), + crop=crop, + ) + builtins._ = value # type: ignore + + def ipy_display_hook(value: Any) -> None: # pragma: no cover + assert console is not None + # always skip rich generated jupyter renderables or None values + if isinstance(value, JupyterRenderable) or value is None: + return + # on jupyter rich display, if using one of the special representations don't use rich + if console.is_jupyter and any( + _re_jupyter_repr.match(attr) for attr in dir(value) + ): + return + + # certain renderables should start on a new line + if isinstance(value, ConsoleRenderable): + console.line() + + console.print( + value + if isinstance(value, RichRenderable) + else Pretty( + value, + overflow=overflow, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + expand_all=expand_all, + margin=12, + ), + crop=crop, + new_line_start=True, + ) + + try: # pragma: no cover + ip = get_ipython() # type: ignore + from IPython.core.formatters import BaseFormatter + + class RichFormatter(BaseFormatter): # type: ignore + pprint: bool = True + + def __call__(self, value: Any) -> Any: + if self.pprint: + return ipy_display_hook(value) + else: + return repr(value) + + # replace plain text formatter with rich formatter + rich_formatter = RichFormatter() + ip.display_formatter.formatters["text/plain"] = rich_formatter + except Exception: + sys.displayhook = display_hook + + +class Pretty(JupyterMixin): + """A rich renderable that pretty prints an object. + + Args: + _object (Any): An object to pretty print. + highlighter (HighlighterType, optional): Highlighter object to apply to result, or None for ReprHighlighter. Defaults to None. + indent_size (int, optional): Number of spaces in indent. Defaults to 4. + justify (JustifyMethod, optional): Justify method, or None for default. Defaults to None. + overflow (OverflowMethod, optional): Overflow method, or None for default. Defaults to None. + no_wrap (Optional[bool], optional): Disable word wrapping. Defaults to False. + indent_guides (bool, optional): Enable indentation guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + expand_all (bool, optional): Expand all containers. Defaults to False. + margin (int, optional): Subtrace a margin from width to force containers to expand earlier. Defaults to 0. + insert_line (bool, optional): Insert a new line if the output has multiple new lines. Defaults to False. + """ + + def __init__( + self, + _object: Any, + highlighter: Optional["HighlighterType"] = None, + *, + indent_size: int = 4, + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + no_wrap: Optional[bool] = False, + indent_guides: bool = False, + max_length: Optional[int] = None, + max_string: Optional[int] = None, + expand_all: bool = False, + margin: int = 0, + insert_line: bool = False, + ) -> None: + self._object = _object + self.highlighter = highlighter or ReprHighlighter() + self.indent_size = indent_size + self.justify: Optional["JustifyMethod"] = justify + self.overflow: Optional["OverflowMethod"] = overflow + self.no_wrap = no_wrap + self.indent_guides = indent_guides + self.max_length = max_length + self.max_string = max_string + self.expand_all = expand_all + self.margin = margin + self.insert_line = insert_line + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + pretty_str = pretty_repr( + self._object, + max_width=options.max_width - self.margin, + indent_size=self.indent_size, + max_length=self.max_length, + max_string=self.max_string, + expand_all=self.expand_all, + ) + pretty_text = Text( + pretty_str, + justify=self.justify or options.justify, + overflow=self.overflow or options.overflow, + no_wrap=pick_bool(self.no_wrap, options.no_wrap), + style="pretty", + ) + pretty_text = ( + self.highlighter(pretty_text) + if pretty_text + else Text( + f"{type(self._object)}.__repr__ returned empty string", + style="dim italic", + ) + ) + if self.indent_guides and not options.ascii_only: + pretty_text = pretty_text.with_indent_guides( + self.indent_size, style="repr.indent" + ) + if self.insert_line and "\n" in pretty_text: + yield "" + yield pretty_text + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + pretty_str = pretty_repr( + self._object, + max_width=options.max_width, + indent_size=self.indent_size, + max_length=self.max_length, + max_string=self.max_string, + ) + text_width = ( + max(cell_len(line) for line in pretty_str.splitlines()) if pretty_str else 0 + ) + return Measurement(text_width, text_width) + + +def _get_braces_for_defaultdict(_object: DefaultDict[Any, Any]) -> Tuple[str, str, str]: + return ( + f"defaultdict({_object.default_factory!r}, {{", + "})", + f"defaultdict({_object.default_factory!r}, {{}})", + ) + + +def _get_braces_for_array(_object: "array[Any]") -> Tuple[str, str, str]: + return (f"array({_object.typecode!r}, [", "])", "array({_object.typecode!r})") + + +_BRACES: Dict[type, Callable[[Any], Tuple[str, str, str]]] = { + os._Environ: lambda _object: ("environ({", "})", "environ({})"), + array: _get_braces_for_array, + defaultdict: _get_braces_for_defaultdict, + Counter: lambda _object: ("Counter({", "})", "Counter()"), + deque: lambda _object: ("deque([", "])", "deque()"), + dict: lambda _object: ("{", "}", "{}"), + UserDict: lambda _object: ("{", "}", "{}"), + frozenset: lambda _object: ("frozenset({", "})", "frozenset()"), + list: lambda _object: ("[", "]", "[]"), + UserList: lambda _object: ("[", "]", "[]"), + set: lambda _object: ("{", "}", "set()"), + tuple: lambda _object: ("(", ")", "()"), + MappingProxyType: lambda _object: ("mappingproxy({", "})", "mappingproxy({})"), +} +_CONTAINERS = tuple(_BRACES.keys()) +_MAPPING_CONTAINERS = (dict, os._Environ, MappingProxyType, UserDict) + + +def is_expandable(obj: Any) -> bool: + """Check if an object may be expanded by pretty print.""" + return ( + isinstance(obj, _CONTAINERS) + or (is_dataclass(obj)) + or (hasattr(obj, "__rich_repr__")) + or _is_attr_object(obj) + ) and not isclass(obj) + + +@dataclass +class Node: + """A node in a repr tree. May be atomic or a container.""" + + key_repr: str = "" + value_repr: str = "" + open_brace: str = "" + close_brace: str = "" + empty: str = "" + last: bool = False + is_tuple: bool = False + children: Optional[List["Node"]] = None + key_separator = ": " + separator: str = ", " + + def iter_tokens(self) -> Iterable[str]: + """Generate tokens for this node.""" + if self.key_repr: + yield self.key_repr + yield self.key_separator + if self.value_repr: + yield self.value_repr + elif self.children is not None: + if self.children: + yield self.open_brace + if self.is_tuple and len(self.children) == 1: + yield from self.children[0].iter_tokens() + yield "," + else: + for child in self.children: + yield from child.iter_tokens() + if not child.last: + yield self.separator + yield self.close_brace + else: + yield self.empty + + def check_length(self, start_length: int, max_length: int) -> bool: + """Check the length fits within a limit. + + Args: + start_length (int): Starting length of the line (indent, prefix, suffix). + max_length (int): Maximum length. + + Returns: + bool: True if the node can be rendered within max length, otherwise False. + """ + total_length = start_length + for token in self.iter_tokens(): + total_length += cell_len(token) + if total_length > max_length: + return False + return True + + def __str__(self) -> str: + repr_text = "".join(self.iter_tokens()) + return repr_text + + def render( + self, max_width: int = 80, indent_size: int = 4, expand_all: bool = False + ) -> str: + """Render the node to a pretty repr. + + Args: + max_width (int, optional): Maximum width of the repr. Defaults to 80. + indent_size (int, optional): Size of indents. Defaults to 4. + expand_all (bool, optional): Expand all levels. Defaults to False. + + Returns: + str: A repr string of the original object. + """ + lines = [_Line(node=self, is_root=True)] + line_no = 0 + while line_no < len(lines): + line = lines[line_no] + if line.expandable and not line.expanded: + if expand_all or not line.check_length(max_width): + lines[line_no : line_no + 1] = line.expand(indent_size) + line_no += 1 + + repr_str = "\n".join(str(line) for line in lines) + return repr_str + + +@dataclass +class _Line: + """A line in repr output.""" + + parent: Optional["_Line"] = None + is_root: bool = False + node: Optional[Node] = None + text: str = "" + suffix: str = "" + whitespace: str = "" + expanded: bool = False + last: bool = False + + @property + def expandable(self) -> bool: + """Check if the line may be expanded.""" + return bool(self.node is not None and self.node.children) + + def check_length(self, max_length: int) -> bool: + """Check this line fits within a given number of cells.""" + start_length = ( + len(self.whitespace) + cell_len(self.text) + cell_len(self.suffix) + ) + assert self.node is not None + return self.node.check_length(start_length, max_length) + + def expand(self, indent_size: int) -> Iterable["_Line"]: + """Expand this line by adding children on their own line.""" + node = self.node + assert node is not None + whitespace = self.whitespace + assert node.children + if node.key_repr: + new_line = yield _Line( + text=f"{node.key_repr}{node.key_separator}{node.open_brace}", + whitespace=whitespace, + ) + else: + new_line = yield _Line(text=node.open_brace, whitespace=whitespace) + child_whitespace = self.whitespace + " " * indent_size + tuple_of_one = node.is_tuple and len(node.children) == 1 + for last, child in loop_last(node.children): + separator = "," if tuple_of_one else node.separator + line = _Line( + parent=new_line, + node=child, + whitespace=child_whitespace, + suffix=separator, + last=last and not tuple_of_one, + ) + yield line + + yield _Line( + text=node.close_brace, + whitespace=whitespace, + suffix=self.suffix, + last=self.last, + ) + + def __str__(self) -> str: + if self.last: + return f"{self.whitespace}{self.text}{self.node or ''}" + else: + return ( + f"{self.whitespace}{self.text}{self.node or ''}{self.suffix.rstrip()}" + ) + + +def traverse( + _object: Any, max_length: Optional[int] = None, max_string: Optional[int] = None +) -> Node: + """Traverse object and generate a tree. + + Args: + _object (Any): Object to be traversed. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. + Defaults to None. + + Returns: + Node: The root of a tree structure which can be used to render a pretty repr. + """ + + def to_repr(obj: Any) -> str: + """Get repr string for an object, but catch errors.""" + if ( + max_string is not None + and isinstance(obj, (bytes, str)) + and len(obj) > max_string + ): + truncated = len(obj) - max_string + obj_repr = f"{obj[:max_string]!r}+{truncated}" + else: + try: + obj_repr = repr(obj) + except Exception as error: + obj_repr = f"<repr-error {str(error)!r}>" + return obj_repr + + visited_ids: Set[int] = set() + push_visited = visited_ids.add + pop_visited = visited_ids.remove + + def _traverse(obj: Any, root: bool = False) -> Node: + """Walk the object depth first.""" + obj_type = type(obj) + py_version = (sys.version_info.major, sys.version_info.minor) + children: List[Node] + + def iter_rich_args(rich_args: Any) -> Iterable[Union[Any, Tuple[str, Any]]]: + for arg in rich_args: + if isinstance(arg, tuple): + if len(arg) == 3: + key, child, default = arg + if default == child: + continue + yield key, child + elif len(arg) == 2: + key, child = arg + yield key, child + elif len(arg) == 1: + yield arg[0] + else: + yield arg + + try: + fake_attributes = hasattr( + obj, "awehoi234_wdfjwljet234_234wdfoijsdfmmnxpi492" + ) + except Exception: + fake_attributes = False + + rich_repr_result: Optional[RichReprResult] = None + if not fake_attributes: + try: + if hasattr(obj, "__rich_repr__") and not isclass(obj): + rich_repr_result = obj.__rich_repr__() + except Exception: + pass + + if rich_repr_result is not None: + angular = getattr(obj.__rich_repr__, "angular", False) + args = list(iter_rich_args(rich_repr_result)) + class_name = obj.__class__.__name__ + + if args: + children = [] + append = children.append + if angular: + node = Node( + open_brace=f"<{class_name} ", + close_brace=">", + children=children, + last=root, + separator=" ", + ) + else: + node = Node( + open_brace=f"{class_name}(", + close_brace=")", + children=children, + last=root, + ) + for last, arg in loop_last(args): + if isinstance(arg, tuple): + key, child = arg + child_node = _traverse(child) + child_node.last = last + child_node.key_repr = key + child_node.key_separator = "=" + append(child_node) + else: + child_node = _traverse(arg) + child_node.last = last + append(child_node) + else: + node = Node( + value_repr=f"<{class_name}>" if angular else f"{class_name}()", + children=[], + last=root, + ) + elif _is_attr_object(obj) and not fake_attributes: + children = [] + append = children.append + + attr_fields = _get_attr_fields(obj) + if attr_fields: + node = Node( + open_brace=f"{obj.__class__.__name__}(", + close_brace=")", + children=children, + last=root, + ) + + def iter_attrs() -> Iterable[ + Tuple[str, Any, Optional[Callable[[Any], str]]] + ]: + """Iterate over attr fields and values.""" + for attr in attr_fields: + if attr.repr: + try: + value = getattr(obj, attr.name) + except Exception as error: + # Can happen, albeit rarely + yield (attr.name, error, None) + else: + yield ( + attr.name, + value, + attr.repr if callable(attr.repr) else None, + ) + + for last, (name, value, repr_callable) in loop_last(iter_attrs()): + if repr_callable: + child_node = Node(value_repr=str(repr_callable(value))) + else: + child_node = _traverse(value) + child_node.last = last + child_node.key_repr = name + child_node.key_separator = "=" + append(child_node) + else: + node = Node( + value_repr=f"{obj.__class__.__name__}()", children=[], last=root + ) + + elif ( + is_dataclass(obj) + and not isinstance(obj, type) + and not fake_attributes + and (_is_dataclass_repr(obj) or py_version == (3, 6)) + ): + obj_id = id(obj) + if obj_id in visited_ids: + # Recursion detected + return Node(value_repr="...") + push_visited(obj_id) + + children = [] + append = children.append + node = Node( + open_brace=f"{obj.__class__.__name__}(", + close_brace=")", + children=children, + last=root, + ) + + for last, field in loop_last(field for field in fields(obj) if field.repr): + if field.repr: + child_node = _traverse(getattr(obj, field.name)) + child_node.key_repr = field.name + child_node.last = last + child_node.key_separator = "=" + append(child_node) + + pop_visited(obj_id) + + elif isinstance(obj, _CONTAINERS): + for container_type in _CONTAINERS: + if isinstance(obj, container_type): + obj_type = container_type + break + + obj_id = id(obj) + if obj_id in visited_ids: + # Recursion detected + return Node(value_repr="...") + push_visited(obj_id) + + open_brace, close_brace, empty = _BRACES[obj_type](obj) + + if obj_type.__repr__ != type(obj).__repr__: + node = Node(value_repr=to_repr(obj), last=root) + elif obj: + children = [] + node = Node( + open_brace=open_brace, + close_brace=close_brace, + children=children, + last=root, + ) + append = children.append + num_items = len(obj) + last_item_index = num_items - 1 + + if isinstance(obj, _MAPPING_CONTAINERS): + iter_items = iter(obj.items()) + if max_length is not None: + iter_items = islice(iter_items, max_length) + for index, (key, child) in enumerate(iter_items): + child_node = _traverse(child) + child_node.key_repr = to_repr(key) + child_node.last = index == last_item_index + append(child_node) + else: + iter_values = iter(obj) + if max_length is not None: + iter_values = islice(iter_values, max_length) + for index, child in enumerate(iter_values): + child_node = _traverse(child) + child_node.last = index == last_item_index + append(child_node) + if max_length is not None and num_items > max_length: + append(Node(value_repr=f"... +{num_items-max_length}", last=True)) + else: + node = Node(empty=empty, children=[], last=root) + + pop_visited(obj_id) + else: + node = Node(value_repr=to_repr(obj), last=root) + node.is_tuple = isinstance(obj, tuple) + return node + + node = _traverse(_object, root=True) + return node + + +def pretty_repr( + _object: Any, + *, + max_width: int = 80, + indent_size: int = 4, + max_length: Optional[int] = None, + max_string: Optional[int] = None, + expand_all: bool = False, +) -> str: + """Prettify repr string by expanding on to new lines to fit within a given width. + + Args: + _object (Any): Object to repr. + max_width (int, optional): Desired maximum width of repr string. Defaults to 80. + indent_size (int, optional): Number of spaces to indent. Defaults to 4. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable truncating. + Defaults to None. + expand_all (bool, optional): Expand all containers regardless of available width. Defaults to False. + + Returns: + str: A possibly multi-line representation of the object. + """ + + if isinstance(_object, Node): + node = _object + else: + node = traverse(_object, max_length=max_length, max_string=max_string) + repr_str = node.render( + max_width=max_width, indent_size=indent_size, expand_all=expand_all + ) + return repr_str + + +def pprint( + _object: Any, + *, + console: Optional["Console"] = None, + indent_guides: bool = True, + max_length: Optional[int] = None, + max_string: Optional[int] = None, + expand_all: bool = False, +) -> None: + """A convenience function for pretty printing. + + Args: + _object (Any): Object to pretty print. + console (Console, optional): Console instance, or None to use default. Defaults to None. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of strings before truncating, or None to disable. Defaults to None. + indent_guides (bool, optional): Enable indentation guides. Defaults to True. + expand_all (bool, optional): Expand all containers. Defaults to False. + """ + _console = get_console() if console is None else console + _console.print( + Pretty( + _object, + max_length=max_length, + max_string=max_string, + indent_guides=indent_guides, + expand_all=expand_all, + overflow="ignore", + ), + soft_wrap=True, + ) + + +if __name__ == "__main__": # pragma: no cover + + class BrokenRepr: + def __repr__(self) -> str: + 1 / 0 + return "this will fail" + + d = defaultdict(int) + d["foo"] = 5 + data = { + "foo": [ + 1, + "Hello World!", + 100.123, + 323.232, + 432324.0, + {5, 6, 7, (1, 2, 3, 4), 8}, + ], + "bar": frozenset({1, 2, 3}), + "defaultdict": defaultdict( + list, {"crumble": ["apple", "rhubarb", "butter", "sugar", "flour"]} + ), + "counter": Counter( + [ + "apple", + "orange", + "pear", + "kumquat", + "kumquat", + "durian" * 100, + ] + ), + "atomic": (False, True, None), + "Broken": BrokenRepr(), + } + data["foo"].append(data) # type: ignore + + from pip._vendor.rich import print + + print(Pretty(data, indent_guides=True, max_string=20)) diff --git a/src/pip/_vendor/rich/progress.py b/src/pip/_vendor/rich/progress.py new file mode 100644 index 000000000..8f2ec0266 --- /dev/null +++ b/src/pip/_vendor/rich/progress.py @@ -0,0 +1,1034 @@ +from abc import ABC, abstractmethod +from collections import deque +from collections.abc import Sized +from dataclasses import dataclass, field +from datetime import timedelta +from math import ceil +from threading import Event, RLock, Thread +from types import TracebackType +from typing import ( + Any, + Callable, + Deque, + Dict, + Iterable, + List, + NamedTuple, + NewType, + Optional, + Sequence, + Tuple, + Type, + TypeVar, + Union, +) + +from . import filesize, get_console +from .console import Console, JustifyMethod, RenderableType, Group +from .highlighter import Highlighter +from .jupyter import JupyterMixin +from .live import Live +from .progress_bar import ProgressBar +from .spinner import Spinner +from .style import StyleType +from .table import Column, Table +from .text import Text, TextType + +TaskID = NewType("TaskID", int) + +ProgressType = TypeVar("ProgressType") + +GetTimeCallable = Callable[[], float] + + +class _TrackThread(Thread): + """A thread to periodically update progress.""" + + def __init__(self, progress: "Progress", task_id: "TaskID", update_period: float): + self.progress = progress + self.task_id = task_id + self.update_period = update_period + self.done = Event() + + self.completed = 0 + super().__init__() + + def run(self) -> None: + task_id = self.task_id + advance = self.progress.advance + update_period = self.update_period + last_completed = 0 + wait = self.done.wait + while not wait(update_period): + completed = self.completed + if last_completed != completed: + advance(task_id, completed - last_completed) + last_completed = completed + + self.progress.update(self.task_id, completed=self.completed, refresh=True) + + def __enter__(self) -> "_TrackThread": + self.start() + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self.done.set() + self.join() + + +def track( + sequence: Union[Sequence[ProgressType], Iterable[ProgressType]], + description: str = "Working...", + total: Optional[float] = None, + auto_refresh: bool = True, + console: Optional[Console] = None, + transient: bool = False, + get_time: Optional[Callable[[], float]] = None, + refresh_per_second: float = 10, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + update_period: float = 0.1, + disable: bool = False, +) -> Iterable[ProgressType]: + """Track progress by iterating over a sequence. + + Args: + sequence (Iterable[ProgressType]): A sequence (must support "len") you wish to iterate over. + description (str, optional): Description of task show next to progress bar. Defaults to "Working". + total: (float, optional): Total number of steps. Default is len(sequence). + auto_refresh (bool, optional): Automatic refresh, disable to force a refresh after each iteration. Default is True. + transient: (bool, optional): Clear the progress on exit. Defaults to False. + console (Console, optional): Console to write to. Default creates internal Console instance. + refresh_per_second (float): Number of times per second to refresh the progress information. Defaults to 10. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. + disable (bool, optional): Disable display of progress. + Returns: + Iterable[ProgressType]: An iterable of the values in the sequence. + + """ + + columns: List["ProgressColumn"] = ( + [TextColumn("[progress.description]{task.description}")] if description else [] + ) + columns.extend( + ( + BarColumn( + style=style, + complete_style=complete_style, + finished_style=finished_style, + pulse_style=pulse_style, + ), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + ) + ) + progress = Progress( + *columns, + auto_refresh=auto_refresh, + console=console, + transient=transient, + get_time=get_time, + refresh_per_second=refresh_per_second or 10, + disable=disable, + ) + + with progress: + yield from progress.track( + sequence, total=total, description=description, update_period=update_period + ) + + +class ProgressColumn(ABC): + """Base class for a widget to use in progress display.""" + + max_refresh: Optional[float] = None + + def __init__(self, table_column: Optional[Column] = None) -> None: + self._table_column = table_column + self._renderable_cache: Dict[TaskID, Tuple[float, RenderableType]] = {} + self._update_time: Optional[float] = None + + def get_table_column(self) -> Column: + """Get a table column, used to build tasks table.""" + return self._table_column or Column() + + def __call__(self, task: "Task") -> RenderableType: + """Called by the Progress object to return a renderable for the given task. + + Args: + task (Task): An object containing information regarding the task. + + Returns: + RenderableType: Anything renderable (including str). + """ + current_time = task.get_time() + if self.max_refresh is not None and not task.completed: + try: + timestamp, renderable = self._renderable_cache[task.id] + except KeyError: + pass + else: + if timestamp + self.max_refresh > current_time: + return renderable + + renderable = self.render(task) + self._renderable_cache[task.id] = (current_time, renderable) + return renderable + + @abstractmethod + def render(self, task: "Task") -> RenderableType: + """Should return a renderable object.""" + + +class RenderableColumn(ProgressColumn): + """A column to insert an arbitrary column. + + Args: + renderable (RenderableType, optional): Any renderable. Defaults to empty string. + """ + + def __init__( + self, renderable: RenderableType = "", *, table_column: Optional[Column] = None + ): + self.renderable = renderable + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> RenderableType: + return self.renderable + + +class SpinnerColumn(ProgressColumn): + """A column with a 'spinner' animation. + + Args: + spinner_name (str, optional): Name of spinner animation. Defaults to "dots". + style (StyleType, optional): Style of spinner. Defaults to "progress.spinner". + speed (float, optional): Speed factor of spinner. Defaults to 1.0. + finished_text (TextType, optional): Text used when task is finished. Defaults to " ". + """ + + def __init__( + self, + spinner_name: str = "dots", + style: Optional[StyleType] = "progress.spinner", + speed: float = 1.0, + finished_text: TextType = " ", + table_column: Optional[Column] = None, + ): + self.spinner = Spinner(spinner_name, style=style, speed=speed) + self.finished_text = ( + Text.from_markup(finished_text) + if isinstance(finished_text, str) + else finished_text + ) + super().__init__(table_column=table_column) + + def set_spinner( + self, + spinner_name: str, + spinner_style: Optional[StyleType] = "progress.spinner", + speed: float = 1.0, + ) -> None: + """Set a new spinner. + + Args: + spinner_name (str): Spinner name, see python -m rich.spinner. + spinner_style (Optional[StyleType], optional): Spinner style. Defaults to "progress.spinner". + speed (float, optional): Speed factor of spinner. Defaults to 1.0. + """ + self.spinner = Spinner(spinner_name, style=spinner_style, speed=speed) + + def render(self, task: "Task") -> RenderableType: + text = ( + self.finished_text + if task.finished + else self.spinner.render(task.get_time()) + ) + return text + + +class TextColumn(ProgressColumn): + """A column containing text.""" + + def __init__( + self, + text_format: str, + style: StyleType = "none", + justify: JustifyMethod = "left", + markup: bool = True, + highlighter: Optional[Highlighter] = None, + table_column: Optional[Column] = None, + ) -> None: + self.text_format = text_format + self.justify: JustifyMethod = justify + self.style = style + self.markup = markup + self.highlighter = highlighter + super().__init__(table_column=table_column or Column(no_wrap=True)) + + def render(self, task: "Task") -> Text: + _text = self.text_format.format(task=task) + if self.markup: + text = Text.from_markup(_text, style=self.style, justify=self.justify) + else: + text = Text(_text, style=self.style, justify=self.justify) + if self.highlighter: + self.highlighter.highlight(text) + return text + + +class BarColumn(ProgressColumn): + """Renders a visual progress bar. + + Args: + bar_width (Optional[int], optional): Width of bar or None for full width. Defaults to 40. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + """ + + def __init__( + self, + bar_width: Optional[int] = 40, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + table_column: Optional[Column] = None, + ) -> None: + self.bar_width = bar_width + self.style = style + self.complete_style = complete_style + self.finished_style = finished_style + self.pulse_style = pulse_style + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> ProgressBar: + """Gets a progress bar widget for a task.""" + return ProgressBar( + total=max(0, task.total), + completed=max(0, task.completed), + width=None if self.bar_width is None else max(1, self.bar_width), + pulse=not task.started, + animation_time=task.get_time(), + style=self.style, + complete_style=self.complete_style, + finished_style=self.finished_style, + pulse_style=self.pulse_style, + ) + + +class TimeElapsedColumn(ProgressColumn): + """Renders time elapsed.""" + + def render(self, task: "Task") -> Text: + """Show time remaining.""" + elapsed = task.finished_time if task.finished else task.elapsed + if elapsed is None: + return Text("-:--:--", style="progress.elapsed") + delta = timedelta(seconds=int(elapsed)) + return Text(str(delta), style="progress.elapsed") + + +class TimeRemainingColumn(ProgressColumn): + """Renders estimated time remaining.""" + + # Only refresh twice a second to prevent jitter + max_refresh = 0.5 + + def render(self, task: "Task") -> Text: + """Show time remaining.""" + remaining = task.time_remaining + if remaining is None: + return Text("-:--:--", style="progress.remaining") + remaining_delta = timedelta(seconds=int(remaining)) + return Text(str(remaining_delta), style="progress.remaining") + + +class FileSizeColumn(ProgressColumn): + """Renders completed filesize.""" + + def render(self, task: "Task") -> Text: + """Show data completed.""" + data_size = filesize.decimal(int(task.completed)) + return Text(data_size, style="progress.filesize") + + +class TotalFileSizeColumn(ProgressColumn): + """Renders total filesize.""" + + def render(self, task: "Task") -> Text: + """Show data completed.""" + data_size = filesize.decimal(int(task.total)) + return Text(data_size, style="progress.filesize.total") + + +class DownloadColumn(ProgressColumn): + """Renders file size downloaded and total, e.g. '0.5/2.3 GB'. + + Args: + binary_units (bool, optional): Use binary units, KiB, MiB etc. Defaults to False. + """ + + def __init__( + self, binary_units: bool = False, table_column: Optional[Column] = None + ) -> None: + self.binary_units = binary_units + super().__init__(table_column=table_column) + + def render(self, task: "Task") -> Text: + """Calculate common unit for completed and total.""" + completed = int(task.completed) + total = int(task.total) + if self.binary_units: + unit, suffix = filesize.pick_unit_and_suffix( + total, + ["bytes", "KiB", "MiB", "GiB", "TiB", "PiB", "EiB", "ZiB", "YiB"], + 1024, + ) + else: + unit, suffix = filesize.pick_unit_and_suffix( + total, ["bytes", "KB", "MB", "GB", "TB", "PB", "EB", "ZB", "YB"], 1000 + ) + completed_ratio = completed / unit + total_ratio = total / unit + precision = 0 if unit == 1 else 1 + completed_str = f"{completed_ratio:,.{precision}f}" + total_str = f"{total_ratio:,.{precision}f}" + download_status = f"{completed_str}/{total_str} {suffix}" + download_text = Text(download_status, style="progress.download") + return download_text + + +class TransferSpeedColumn(ProgressColumn): + """Renders human readable transfer speed.""" + + def render(self, task: "Task") -> Text: + """Show data transfer speed.""" + speed = task.finished_speed or task.speed + if speed is None: + return Text("?", style="progress.data.speed") + data_speed = filesize.decimal(int(speed)) + return Text(f"{data_speed}/s", style="progress.data.speed") + + +class ProgressSample(NamedTuple): + """Sample of progress for a given time.""" + + timestamp: float + """Timestamp of sample.""" + completed: float + """Number of steps completed.""" + + +@dataclass +class Task: + """Information regarding a progress task. + + This object should be considered read-only outside of the :class:`~Progress` class. + + """ + + id: TaskID + """Task ID associated with this task (used in Progress methods).""" + + description: str + """str: Description of the task.""" + + total: float + """str: Total number of steps in this task.""" + + completed: float + """float: Number of steps completed""" + + _get_time: GetTimeCallable + """Callable to get the current time.""" + + finished_time: Optional[float] = None + """float: Time task was finished.""" + + visible: bool = True + """bool: Indicates if this task is visible in the progress display.""" + + fields: Dict[str, Any] = field(default_factory=dict) + """dict: Arbitrary fields passed in via Progress.update.""" + + start_time: Optional[float] = field(default=None, init=False, repr=False) + """Optional[float]: Time this task was started, or None if not started.""" + + stop_time: Optional[float] = field(default=None, init=False, repr=False) + """Optional[float]: Time this task was stopped, or None if not stopped.""" + + finished_speed: Optional[float] = None + """Optional[float]: The last speed for a finished task.""" + + _progress: Deque[ProgressSample] = field( + default_factory=deque, init=False, repr=False + ) + + _lock: RLock = field(repr=False, default_factory=RLock) + """Thread lock.""" + + def get_time(self) -> float: + """float: Get the current time, in seconds.""" + return self._get_time() + + @property + def started(self) -> bool: + """bool: Check if the task as started.""" + return self.start_time is not None + + @property + def remaining(self) -> float: + """float: Get the number of steps remaining.""" + return self.total - self.completed + + @property + def elapsed(self) -> Optional[float]: + """Optional[float]: Time elapsed since task was started, or ``None`` if the task hasn't started.""" + if self.start_time is None: + return None + if self.stop_time is not None: + return self.stop_time - self.start_time + return self.get_time() - self.start_time + + @property + def finished(self) -> bool: + """Check if the task has finished.""" + return self.finished_time is not None + + @property + def percentage(self) -> float: + """float: Get progress of task as a percentage.""" + if not self.total: + return 0.0 + completed = (self.completed / self.total) * 100.0 + completed = min(100.0, max(0.0, completed)) + return completed + + @property + def speed(self) -> Optional[float]: + """Optional[float]: Get the estimated speed in steps per second.""" + if self.start_time is None: + return None + with self._lock: + progress = self._progress + if not progress: + return None + total_time = progress[-1].timestamp - progress[0].timestamp + if total_time == 0: + return None + iter_progress = iter(progress) + next(iter_progress) + total_completed = sum(sample.completed for sample in iter_progress) + speed = total_completed / total_time + return speed + + @property + def time_remaining(self) -> Optional[float]: + """Optional[float]: Get estimated time to completion, or ``None`` if no data.""" + if self.finished: + return 0.0 + speed = self.speed + if not speed: + return None + estimate = ceil(self.remaining / speed) + return estimate + + def _reset(self) -> None: + """Reset progress.""" + self._progress.clear() + self.finished_time = None + self.finished_speed = None + + +class Progress(JupyterMixin): + """Renders an auto-updating progress bar(s). + + Args: + console (Console, optional): Optional Console instance. Default will an internal Console instance writing to stdout. + auto_refresh (bool, optional): Enable auto refresh. If disabled, you will need to call `refresh()`. + refresh_per_second (Optional[float], optional): Number of times per second to refresh the progress information or None to use default (10). Defaults to None. + speed_estimate_period: (float, optional): Period (in seconds) used to calculate the speed estimate. Defaults to 30. + transient: (bool, optional): Clear the progress on exit. Defaults to False. + redirect_stdout: (bool, optional): Enable redirection of stdout, so ``print`` may be used. Defaults to True. + redirect_stderr: (bool, optional): Enable redirection of stderr. Defaults to True. + get_time: (Callable, optional): A callable that gets the current time, or None to use Console.get_time. Defaults to None. + disable (bool, optional): Disable progress display. Defaults to False + expand (bool, optional): Expand tasks table to fit width. Defaults to False. + """ + + def __init__( + self, + *columns: Union[str, ProgressColumn], + console: Optional[Console] = None, + auto_refresh: bool = True, + refresh_per_second: float = 10, + speed_estimate_period: float = 30.0, + transient: bool = False, + redirect_stdout: bool = True, + redirect_stderr: bool = True, + get_time: Optional[GetTimeCallable] = None, + disable: bool = False, + expand: bool = False, + ) -> None: + assert ( + refresh_per_second is None or refresh_per_second > 0 + ), "refresh_per_second must be > 0" + self._lock = RLock() + self.columns = columns or ( + TextColumn("[progress.description]{task.description}"), + BarColumn(), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + ) + self.speed_estimate_period = speed_estimate_period + + self.disable = disable + self.expand = expand + self._tasks: Dict[TaskID, Task] = {} + self._task_index: TaskID = TaskID(0) + self.live = Live( + console=console or get_console(), + auto_refresh=auto_refresh, + refresh_per_second=refresh_per_second, + transient=transient, + redirect_stdout=redirect_stdout, + redirect_stderr=redirect_stderr, + get_renderable=self.get_renderable, + ) + self.get_time = get_time or self.console.get_time + self.print = self.console.print + self.log = self.console.log + + @property + def console(self) -> Console: + return self.live.console + + @property + def tasks(self) -> List[Task]: + """Get a list of Task instances.""" + with self._lock: + return list(self._tasks.values()) + + @property + def task_ids(self) -> List[TaskID]: + """A list of task IDs.""" + with self._lock: + return list(self._tasks.keys()) + + @property + def finished(self) -> bool: + """Check if all tasks have been completed.""" + with self._lock: + if not self._tasks: + return True + return all(task.finished for task in self._tasks.values()) + + def start(self) -> None: + """Start the progress display.""" + if not self.disable: + self.live.start(refresh=True) + + def stop(self) -> None: + """Stop the progress display.""" + self.live.stop() + + def __enter__(self) -> "Progress": + self.start() + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self.stop() + + def track( + self, + sequence: Union[Iterable[ProgressType], Sequence[ProgressType]], + total: Optional[float] = None, + task_id: Optional[TaskID] = None, + description: str = "Working...", + update_period: float = 0.1, + ) -> Iterable[ProgressType]: + """Track progress by iterating over a sequence. + + Args: + sequence (Sequence[ProgressType]): A sequence of values you want to iterate over and track progress. + total: (float, optional): Total number of steps. Default is len(sequence). + task_id: (TaskID): Task to track. Default is new task. + description: (str, optional): Description of task, if new task is created. + update_period (float, optional): Minimum time (in seconds) between calls to update(). Defaults to 0.1. + + Returns: + Iterable[ProgressType]: An iterable of values taken from the provided sequence. + """ + + if total is None: + if isinstance(sequence, Sized): + task_total = float(len(sequence)) + else: + raise ValueError( + f"unable to get size of {sequence!r}, please specify 'total'" + ) + else: + task_total = total + + if task_id is None: + task_id = self.add_task(description, total=task_total) + else: + self.update(task_id, total=task_total) + + if self.live.auto_refresh: + with _TrackThread(self, task_id, update_period) as track_thread: + for value in sequence: + yield value + track_thread.completed += 1 + else: + advance = self.advance + refresh = self.refresh + for value in sequence: + yield value + advance(task_id, 1) + refresh() + + def start_task(self, task_id: TaskID) -> None: + """Start a task. + + Starts a task (used when calculating elapsed time). You may need to call this manually, + if you called ``add_task`` with ``start=False``. + + Args: + task_id (TaskID): ID of task. + """ + with self._lock: + task = self._tasks[task_id] + if task.start_time is None: + task.start_time = self.get_time() + + def stop_task(self, task_id: TaskID) -> None: + """Stop a task. + + This will freeze the elapsed time on the task. + + Args: + task_id (TaskID): ID of task. + """ + with self._lock: + task = self._tasks[task_id] + current_time = self.get_time() + if task.start_time is None: + task.start_time = current_time + task.stop_time = current_time + + def update( + self, + task_id: TaskID, + *, + total: Optional[float] = None, + completed: Optional[float] = None, + advance: Optional[float] = None, + description: Optional[str] = None, + visible: Optional[bool] = None, + refresh: bool = False, + **fields: Any, + ) -> None: + """Update information associated with a task. + + Args: + task_id (TaskID): Task id (returned by add_task). + total (float, optional): Updates task.total if not None. + completed (float, optional): Updates task.completed if not None. + advance (float, optional): Add a value to task.completed if not None. + description (str, optional): Change task description if not None. + visible (bool, optional): Set visible flag if not None. + refresh (bool): Force a refresh of progress information. Default is False. + **fields (Any): Additional data fields required for rendering. + """ + with self._lock: + task = self._tasks[task_id] + completed_start = task.completed + + if total is not None: + task.total = total + task._reset() + if advance is not None: + task.completed += advance + if completed is not None: + task.completed = completed + if description is not None: + task.description = description + if visible is not None: + task.visible = visible + task.fields.update(fields) + update_completed = task.completed - completed_start + + current_time = self.get_time() + old_sample_time = current_time - self.speed_estimate_period + _progress = task._progress + + popleft = _progress.popleft + while _progress and _progress[0].timestamp < old_sample_time: + popleft() + while len(_progress) > 1000: + popleft() + if update_completed > 0: + _progress.append(ProgressSample(current_time, update_completed)) + if task.completed >= task.total and task.finished_time is None: + task.finished_time = task.elapsed + + if refresh: + self.refresh() + + def reset( + self, + task_id: TaskID, + *, + start: bool = True, + total: Optional[float] = None, + completed: int = 0, + visible: Optional[bool] = None, + description: Optional[str] = None, + **fields: Any, + ) -> None: + """Reset a task so completed is 0 and the clock is reset. + + Args: + task_id (TaskID): ID of task. + start (bool, optional): Start the task after reset. Defaults to True. + total (float, optional): New total steps in task, or None to use current total. Defaults to None. + completed (int, optional): Number of steps completed. Defaults to 0. + **fields (str): Additional data fields required for rendering. + """ + current_time = self.get_time() + with self._lock: + task = self._tasks[task_id] + task._reset() + task.start_time = current_time if start else None + if total is not None: + task.total = total + task.completed = completed + if visible is not None: + task.visible = visible + if fields: + task.fields = fields + if description is not None: + task.description = description + task.finished_time = None + self.refresh() + + def advance(self, task_id: TaskID, advance: float = 1) -> None: + """Advance task by a number of steps. + + Args: + task_id (TaskID): ID of task. + advance (float): Number of steps to advance. Default is 1. + """ + current_time = self.get_time() + with self._lock: + task = self._tasks[task_id] + completed_start = task.completed + task.completed += advance + update_completed = task.completed - completed_start + old_sample_time = current_time - self.speed_estimate_period + _progress = task._progress + + popleft = _progress.popleft + while _progress and _progress[0].timestamp < old_sample_time: + popleft() + while len(_progress) > 1000: + popleft() + _progress.append(ProgressSample(current_time, update_completed)) + if task.completed >= task.total and task.finished_time is None: + task.finished_time = task.elapsed + task.finished_speed = task.speed + + def refresh(self) -> None: + """Refresh (render) the progress information.""" + if not self.disable and self.live.is_started: + self.live.refresh() + + def get_renderable(self) -> RenderableType: + """Get a renderable for the progress display.""" + renderable = Group(*self.get_renderables()) + return renderable + + def get_renderables(self) -> Iterable[RenderableType]: + """Get a number of renderables for the progress display.""" + table = self.make_tasks_table(self.tasks) + yield table + + def make_tasks_table(self, tasks: Iterable[Task]) -> Table: + """Get a table to render the Progress display. + + Args: + tasks (Iterable[Task]): An iterable of Task instances, one per row of the table. + + Returns: + Table: A table instance. + """ + table_columns = ( + ( + Column(no_wrap=True) + if isinstance(_column, str) + else _column.get_table_column().copy() + ) + for _column in self.columns + ) + table = Table.grid(*table_columns, padding=(0, 1), expand=self.expand) + + for task in tasks: + if task.visible: + table.add_row( + *( + ( + column.format(task=task) + if isinstance(column, str) + else column(task) + ) + for column in self.columns + ) + ) + return table + + def __rich__(self) -> RenderableType: + """Makes the Progress class itself renderable.""" + with self._lock: + return self.get_renderable() + + def add_task( + self, + description: str, + start: bool = True, + total: float = 100.0, + completed: int = 0, + visible: bool = True, + **fields: Any, + ) -> TaskID: + """Add a new 'task' to the Progress display. + + Args: + description (str): A description of the task. + start (bool, optional): Start the task immediately (to calculate elapsed time). If set to False, + you will need to call `start` manually. Defaults to True. + total (float, optional): Number of total steps in the progress if know. Defaults to 100. + completed (int, optional): Number of steps completed so far.. Defaults to 0. + visible (bool, optional): Enable display of the task. Defaults to True. + **fields (str): Additional data fields required for rendering. + + Returns: + TaskID: An ID you can use when calling `update`. + """ + with self._lock: + task = Task( + self._task_index, + description, + total, + completed, + visible=visible, + fields=fields, + _get_time=self.get_time, + _lock=self._lock, + ) + self._tasks[self._task_index] = task + if start: + self.start_task(self._task_index) + new_task_index = self._task_index + self._task_index = TaskID(int(self._task_index) + 1) + self.refresh() + return new_task_index + + def remove_task(self, task_id: TaskID) -> None: + """Delete a task if it exists. + + Args: + task_id (TaskID): A task ID. + + """ + with self._lock: + del self._tasks[task_id] + + +if __name__ == "__main__": # pragma: no coverage + + import random + import time + + from .panel import Panel + from .rule import Rule + from .syntax import Syntax + from .table import Table + + syntax = Syntax( + '''def loop_last(values: Iterable[T]) -> Iterable[Tuple[bool, T]]: + """Iterate and generate a tuple with a flag for last value.""" + iter_values = iter(values) + try: + previous_value = next(iter_values) + except StopIteration: + return + for value in iter_values: + yield False, previous_value + previous_value = value + yield True, previous_value''', + "python", + line_numbers=True, + ) + + table = Table("foo", "bar", "baz") + table.add_row("1", "2", "3") + + progress_renderables = [ + "Text may be printed while the progress bars are rendering.", + Panel("In fact, [i]any[/i] renderable will work"), + "Such as [magenta]tables[/]...", + table, + "Pretty printed structures...", + {"type": "example", "text": "Pretty printed"}, + "Syntax...", + syntax, + Rule("Give it a try!"), + ] + + from itertools import cycle + + examples = cycle(progress_renderables) + + console = Console(record=True) + + with Progress( + SpinnerColumn(), + TextColumn("[progress.description]{task.description}"), + BarColumn(), + TextColumn("[progress.percentage]{task.percentage:>3.0f}%"), + TimeRemainingColumn(), + TimeElapsedColumn(), + console=console, + transient=True, + ) as progress: + + task1 = progress.add_task("[red]Downloading", total=1000) + task2 = progress.add_task("[green]Processing", total=1000) + task3 = progress.add_task("[yellow]Thinking", total=1000, start=False) + + while not progress.finished: + progress.update(task1, advance=0.5) + progress.update(task2, advance=0.3) + time.sleep(0.01) + if random.randint(0, 100) < 1: + progress.log(next(examples)) diff --git a/src/pip/_vendor/rich/progress_bar.py b/src/pip/_vendor/rich/progress_bar.py new file mode 100644 index 000000000..1797b5f78 --- /dev/null +++ b/src/pip/_vendor/rich/progress_bar.py @@ -0,0 +1,216 @@ +import math +from functools import lru_cache +from time import monotonic +from typing import Iterable, List, Optional + +from .color import Color, blend_rgb +from .color_triplet import ColorTriplet +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleType + +# Number of characters before 'pulse' animation repeats +PULSE_SIZE = 20 + + +class ProgressBar(JupyterMixin): + """Renders a (progress) bar. Used by rich.progress. + + Args: + total (float, optional): Number of steps in the bar. Defaults to 100. + completed (float, optional): Number of steps completed. Defaults to 0. + width (int, optional): Width of the bar, or ``None`` for maximum width. Defaults to None. + pulse (bool, optional): Enable pulse effect. Defaults to False. + style (StyleType, optional): Style for the bar background. Defaults to "bar.back". + complete_style (StyleType, optional): Style for the completed bar. Defaults to "bar.complete". + finished_style (StyleType, optional): Style for a finished bar. Defaults to "bar.done". + pulse_style (StyleType, optional): Style for pulsing bars. Defaults to "bar.pulse". + animation_time (Optional[float], optional): Time in seconds to use for animation, or None to use system time. + """ + + def __init__( + self, + total: float = 100.0, + completed: float = 0, + width: Optional[int] = None, + pulse: bool = False, + style: StyleType = "bar.back", + complete_style: StyleType = "bar.complete", + finished_style: StyleType = "bar.finished", + pulse_style: StyleType = "bar.pulse", + animation_time: Optional[float] = None, + ): + self.total = total + self.completed = completed + self.width = width + self.pulse = pulse + self.style = style + self.complete_style = complete_style + self.finished_style = finished_style + self.pulse_style = pulse_style + self.animation_time = animation_time + + self._pulse_segments: Optional[List[Segment]] = None + + def __repr__(self) -> str: + return f"<Bar {self.completed!r} of {self.total!r}>" + + @property + def percentage_completed(self) -> float: + """Calculate percentage complete.""" + completed = (self.completed / self.total) * 100.0 + completed = min(100, max(0.0, completed)) + return completed + + @lru_cache(maxsize=16) + def _get_pulse_segments( + self, + fore_style: Style, + back_style: Style, + color_system: str, + no_color: bool, + ascii: bool = False, + ) -> List[Segment]: + """Get a list of segments to render a pulse animation. + + Returns: + List[Segment]: A list of segments, one segment per character. + """ + bar = "-" if ascii else "━" + segments: List[Segment] = [] + if color_system not in ("standard", "eight_bit", "truecolor") or no_color: + segments += [Segment(bar, fore_style)] * (PULSE_SIZE // 2) + segments += [Segment(" " if no_color else bar, back_style)] * ( + PULSE_SIZE - (PULSE_SIZE // 2) + ) + return segments + + append = segments.append + fore_color = ( + fore_style.color.get_truecolor() + if fore_style.color + else ColorTriplet(255, 0, 255) + ) + back_color = ( + back_style.color.get_truecolor() + if back_style.color + else ColorTriplet(0, 0, 0) + ) + cos = math.cos + pi = math.pi + _Segment = Segment + _Style = Style + from_triplet = Color.from_triplet + + for index in range(PULSE_SIZE): + position = index / PULSE_SIZE + fade = 0.5 + cos((position * pi * 2)) / 2.0 + color = blend_rgb(fore_color, back_color, cross_fade=fade) + append(_Segment(bar, _Style(color=from_triplet(color)))) + return segments + + def update(self, completed: float, total: Optional[float] = None) -> None: + """Update progress with new values. + + Args: + completed (float): Number of steps completed. + total (float, optional): Total number of steps, or ``None`` to not change. Defaults to None. + """ + self.completed = completed + self.total = total if total is not None else self.total + + def _render_pulse( + self, console: Console, width: int, ascii: bool = False + ) -> Iterable[Segment]: + """Renders the pulse animation. + + Args: + console (Console): Console instance. + width (int): Width in characters of pulse animation. + + Returns: + RenderResult: [description] + + Yields: + Iterator[Segment]: Segments to render pulse + """ + fore_style = console.get_style(self.pulse_style, default="white") + back_style = console.get_style(self.style, default="black") + + pulse_segments = self._get_pulse_segments( + fore_style, back_style, console.color_system, console.no_color, ascii=ascii + ) + segment_count = len(pulse_segments) + current_time = ( + monotonic() if self.animation_time is None else self.animation_time + ) + segments = pulse_segments * (int(width / segment_count) + 2) + offset = int(-current_time * 15) % segment_count + segments = segments[offset : offset + width] + yield from segments + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + width = min(self.width or options.max_width, options.max_width) + ascii = options.legacy_windows or options.ascii_only + if self.pulse: + yield from self._render_pulse(console, width, ascii=ascii) + return + + completed = min(self.total, max(0, self.completed)) + + bar = "-" if ascii else "━" + half_bar_right = " " if ascii else "╸" + half_bar_left = " " if ascii else "╺" + complete_halves = ( + int(width * 2 * completed / self.total) if self.total else width * 2 + ) + bar_count = complete_halves // 2 + half_bar_count = complete_halves % 2 + style = console.get_style(self.style) + complete_style = console.get_style( + self.complete_style if self.completed < self.total else self.finished_style + ) + _Segment = Segment + if bar_count: + yield _Segment(bar * bar_count, complete_style) + if half_bar_count: + yield _Segment(half_bar_right * half_bar_count, complete_style) + + if not console.no_color: + remaining_bars = width - bar_count - half_bar_count + if remaining_bars and console.color_system is not None: + if not half_bar_count and bar_count: + yield _Segment(half_bar_left, style) + remaining_bars -= 1 + if remaining_bars: + yield _Segment(bar * remaining_bars, style) + + def __rich_measure__( + self, console: Console, options: ConsoleOptions + ) -> Measurement: + return ( + Measurement(self.width, self.width) + if self.width is not None + else Measurement(4, options.max_width) + ) + + +if __name__ == "__main__": # pragma: no cover + console = Console() + bar = ProgressBar(width=50, total=100) + + import time + + console.show_cursor(False) + for n in range(0, 101, 1): + bar.update(n) + console.print(bar) + console.file.write("\r") + time.sleep(0.05) + console.show_cursor(True) + console.print() diff --git a/src/pip/_vendor/rich/prompt.py b/src/pip/_vendor/rich/prompt.py new file mode 100644 index 000000000..b2cea2b52 --- /dev/null +++ b/src/pip/_vendor/rich/prompt.py @@ -0,0 +1,376 @@ +from typing import Any, Generic, List, Optional, TextIO, TypeVar, Union, overload + +from . import get_console +from .console import Console +from .text import Text, TextType + +PromptType = TypeVar("PromptType") +DefaultType = TypeVar("DefaultType") + + +class PromptError(Exception): + """Exception base class for prompt related errors.""" + + +class InvalidResponse(PromptError): + """Exception to indicate a response was invalid. Raise this within process_response() to indicate an error + and provide an error message. + + Args: + message (Union[str, Text]): Error message. + """ + + def __init__(self, message: TextType) -> None: + self.message = message + + def __rich__(self) -> TextType: + return self.message + + +class PromptBase(Generic[PromptType]): + """Ask the user for input until a valid response is received. This is the base class, see one of + the concrete classes for examples. + + Args: + prompt (TextType, optional): Prompt text. Defaults to "". + console (Console, optional): A Console instance or None to use global console. Defaults to None. + password (bool, optional): Enable password input. Defaults to False. + choices (List[str], optional): A list of valid choices. Defaults to None. + show_default (bool, optional): Show default in prompt. Defaults to True. + show_choices (bool, optional): Show choices in prompt. Defaults to True. + """ + + response_type: type = str + + validate_error_message = "[prompt.invalid]Please enter a valid value" + illegal_choice_message = ( + "[prompt.invalid.choice]Please select one of the available options" + ) + prompt_suffix = ": " + + choices: Optional[List[str]] = None + + def __init__( + self, + prompt: TextType = "", + *, + console: Optional[Console] = None, + password: bool = False, + choices: Optional[List[str]] = None, + show_default: bool = True, + show_choices: bool = True, + ) -> None: + self.console = console or get_console() + self.prompt = ( + Text.from_markup(prompt, style="prompt") + if isinstance(prompt, str) + else prompt + ) + self.password = password + if choices is not None: + self.choices = choices + self.show_default = show_default + self.show_choices = show_choices + + @classmethod + @overload + def ask( + cls, + prompt: TextType = "", + *, + console: Optional[Console] = None, + password: bool = False, + choices: Optional[List[str]] = None, + show_default: bool = True, + show_choices: bool = True, + default: DefaultType, + stream: Optional[TextIO] = None, + ) -> Union[DefaultType, PromptType]: + ... + + @classmethod + @overload + def ask( + cls, + prompt: TextType = "", + *, + console: Optional[Console] = None, + password: bool = False, + choices: Optional[List[str]] = None, + show_default: bool = True, + show_choices: bool = True, + stream: Optional[TextIO] = None, + ) -> PromptType: + ... + + @classmethod + def ask( + cls, + prompt: TextType = "", + *, + console: Optional[Console] = None, + password: bool = False, + choices: Optional[List[str]] = None, + show_default: bool = True, + show_choices: bool = True, + default: Any = ..., + stream: Optional[TextIO] = None, + ) -> Any: + """Shortcut to construct and run a prompt loop and return the result. + + Example: + >>> filename = Prompt.ask("Enter a filename") + + Args: + prompt (TextType, optional): Prompt text. Defaults to "". + console (Console, optional): A Console instance or None to use global console. Defaults to None. + password (bool, optional): Enable password input. Defaults to False. + choices (List[str], optional): A list of valid choices. Defaults to None. + show_default (bool, optional): Show default in prompt. Defaults to True. + show_choices (bool, optional): Show choices in prompt. Defaults to True. + stream (TextIO, optional): Optional text file open for reading to get input. Defaults to None. + """ + _prompt = cls( + prompt, + console=console, + password=password, + choices=choices, + show_default=show_default, + show_choices=show_choices, + ) + return _prompt(default=default, stream=stream) + + def render_default(self, default: DefaultType) -> Text: + """Turn the supplied default in to a Text instance. + + Args: + default (DefaultType): Default value. + + Returns: + Text: Text containing rendering of default value. + """ + return Text(f"({default})", "prompt.default") + + def make_prompt(self, default: DefaultType) -> Text: + """Make prompt text. + + Args: + default (DefaultType): Default value. + + Returns: + Text: Text to display in prompt. + """ + prompt = self.prompt.copy() + prompt.end = "" + + if self.show_choices and self.choices: + _choices = "/".join(self.choices) + choices = f"[{_choices}]" + prompt.append(" ") + prompt.append(choices, "prompt.choices") + + if ( + default != ... + and self.show_default + and isinstance(default, (str, self.response_type)) + ): + prompt.append(" ") + _default = self.render_default(default) + prompt.append(_default) + + prompt.append(self.prompt_suffix) + + return prompt + + @classmethod + def get_input( + cls, + console: Console, + prompt: TextType, + password: bool, + stream: Optional[TextIO] = None, + ) -> str: + """Get input from user. + + Args: + console (Console): Console instance. + prompt (TextType): Prompt text. + password (bool): Enable password entry. + + Returns: + str: String from user. + """ + return console.input(prompt, password=password, stream=stream) + + def check_choice(self, value: str) -> bool: + """Check value is in the list of valid choices. + + Args: + value (str): Value entered by user. + + Returns: + bool: True if choice was valid, otherwise False. + """ + assert self.choices is not None + return value.strip() in self.choices + + def process_response(self, value: str) -> PromptType: + """Process response from user, convert to prompt type. + + Args: + value (str): String typed by user. + + Raises: + InvalidResponse: If ``value`` is invalid. + + Returns: + PromptType: The value to be returned from ask method. + """ + value = value.strip() + try: + return_value = self.response_type(value) + except ValueError: + raise InvalidResponse(self.validate_error_message) + + if self.choices is not None and not self.check_choice(value): + raise InvalidResponse(self.illegal_choice_message) + + return return_value # type: ignore + + def on_validate_error(self, value: str, error: InvalidResponse) -> None: + """Called to handle validation error. + + Args: + value (str): String entered by user. + error (InvalidResponse): Exception instance the initiated the error. + """ + self.console.print(error) + + def pre_prompt(self) -> None: + """Hook to display something before the prompt.""" + + @overload + def __call__(self, *, stream: Optional[TextIO] = None) -> PromptType: + ... + + @overload + def __call__( + self, *, default: DefaultType, stream: Optional[TextIO] = None + ) -> Union[PromptType, DefaultType]: + ... + + def __call__(self, *, default: Any = ..., stream: Optional[TextIO] = None) -> Any: + """Run the prompt loop. + + Args: + default (Any, optional): Optional default value. + + Returns: + PromptType: Processed value. + """ + while True: + self.pre_prompt() + prompt = self.make_prompt(default) + value = self.get_input(self.console, prompt, self.password, stream=stream) + if value == "" and default != ...: + return default + try: + return_value = self.process_response(value) + except InvalidResponse as error: + self.on_validate_error(value, error) + continue + else: + return return_value + + +class Prompt(PromptBase[str]): + """A prompt that returns a str. + + Example: + >>> name = Prompt.ask("Enter your name") + + + """ + + response_type = str + + +class IntPrompt(PromptBase[int]): + """A prompt that returns an integer. + + Example: + >>> burrito_count = IntPrompt.ask("How many burritos do you want to order") + + """ + + response_type = int + validate_error_message = "[prompt.invalid]Please enter a valid integer number" + + +class FloatPrompt(PromptBase[int]): + """A prompt that returns a float. + + Example: + >>> temperature = FloatPrompt.ask("Enter desired temperature") + + """ + + response_type = float + validate_error_message = "[prompt.invalid]Please enter a number" + + +class Confirm(PromptBase[bool]): + """A yes / no confirmation prompt. + + Example: + >>> if Confirm.ask("Continue"): + run_job() + + """ + + response_type = bool + validate_error_message = "[prompt.invalid]Please enter Y or N" + choices: List[str] = ["y", "n"] + + def render_default(self, default: DefaultType) -> Text: + """Render the default as (y) or (n) rather than True/False.""" + yes, no = self.choices + return Text(f"({yes})" if default else f"({no})", style="prompt.default") + + def process_response(self, value: str) -> bool: + """Convert choices to a bool.""" + value = value.strip().lower() + if value not in self.choices: + raise InvalidResponse(self.validate_error_message) + return value == self.choices[0] + + +if __name__ == "__main__": # pragma: no cover + + from pip._vendor.rich import print + + if Confirm.ask("Run [i]prompt[/i] tests?", default=True): + while True: + result = IntPrompt.ask( + ":rocket: Enter a number between [b]1[/b] and [b]10[/b]", default=5 + ) + if result >= 1 and result <= 10: + break + print(":pile_of_poo: [prompt.invalid]Number must be between 1 and 10") + print(f"number={result}") + + while True: + password = Prompt.ask( + "Please enter a password [cyan](must be at least 5 characters)", + password=True, + ) + if len(password) >= 5: + break + print("[prompt.invalid]password too short") + print(f"password={password!r}") + + fruit = Prompt.ask("Enter a fruit", choices=["apple", "orange", "pear"]) + print(f"fruit={fruit!r}") + + else: + print("[b]OK :loudly_crying_face:") diff --git a/src/pip/_vendor/rich/protocol.py b/src/pip/_vendor/rich/protocol.py new file mode 100644 index 000000000..711b31b6a --- /dev/null +++ b/src/pip/_vendor/rich/protocol.py @@ -0,0 +1,10 @@ +from typing import Any + + +def is_renderable(check_object: Any) -> bool: + """Check if an object may be rendered by Rich.""" + return ( + isinstance(check_object, str) + or hasattr(check_object, "__rich__") + or hasattr(check_object, "__rich_console__") + ) diff --git a/src/pip/_vendor/rich/py.typed b/src/pip/_vendor/rich/py.typed new file mode 100644 index 000000000..e69de29bb --- /dev/null +++ b/src/pip/_vendor/rich/py.typed diff --git a/src/pip/_vendor/rich/region.py b/src/pip/_vendor/rich/region.py new file mode 100644 index 000000000..75b3631c3 --- /dev/null +++ b/src/pip/_vendor/rich/region.py @@ -0,0 +1,10 @@ +from typing import NamedTuple + + +class Region(NamedTuple): + """Defines a rectangular region of the screen.""" + + x: int + y: int + width: int + height: int diff --git a/src/pip/_vendor/rich/repr.py b/src/pip/_vendor/rich/repr.py new file mode 100644 index 000000000..17147fd4b --- /dev/null +++ b/src/pip/_vendor/rich/repr.py @@ -0,0 +1,151 @@ +from functools import partial +import inspect + +from typing import ( + Any, + Callable, + Iterable, + List, + Optional, + overload, + Union, + Tuple, + Type, + TypeVar, +) + + +T = TypeVar("T") + + +Result = Iterable[Union[Any, Tuple[Any], Tuple[str, Any], Tuple[str, Any, Any]]] +RichReprResult = Result + + +class ReprError(Exception): + """An error occurred when attempting to build a repr.""" + + +@overload +def auto(cls: Optional[T]) -> T: + ... + + +@overload +def auto(*, angular: bool = False) -> Callable[[T], T]: + ... + + +def auto( + cls: Optional[T] = None, *, angular: Optional[bool] = None +) -> Union[T, Callable[[T], T]]: + """Class decorator to create __repr__ from __rich_repr__""" + + def do_replace(cls: Type[T], angular: Optional[bool] = None) -> Type[T]: + def auto_repr(self: Type[T]) -> str: + """Create repr string from __rich_repr__""" + repr_str: List[str] = [] + append = repr_str.append + + angular = getattr(self.__rich_repr__, "angular", False) # type: ignore + for arg in self.__rich_repr__(): # type: ignore + if isinstance(arg, tuple): + if len(arg) == 1: + append(repr(arg[0])) + else: + key, value, *default = arg + if key is None: + append(repr(value)) + else: + if len(default) and default[0] == value: + continue + append(f"{key}={value!r}") + else: + append(repr(arg)) + if angular: + return f"<{self.__class__.__name__} {' '.join(repr_str)}>" + else: + return f"{self.__class__.__name__}({', '.join(repr_str)})" + + def auto_rich_repr(self: Type[T]) -> Result: + """Auto generate __rich_rep__ from signature of __init__""" + try: + signature = inspect.signature(self.__init__) ## type: ignore + for name, param in signature.parameters.items(): + if param.kind == param.POSITIONAL_ONLY: + yield getattr(self, name) + elif param.kind in ( + param.POSITIONAL_OR_KEYWORD, + param.KEYWORD_ONLY, + ): + if param.default == param.empty: + yield getattr(self, param.name) + else: + yield param.name, getattr(self, param.name), param.default + except Exception as error: + raise ReprError( + f"Failed to auto generate __rich_repr__; {error}" + ) from None + + if not hasattr(cls, "__rich_repr__"): + auto_rich_repr.__doc__ = "Build a rich repr" + cls.__rich_repr__ = auto_rich_repr # type: ignore + + auto_repr.__doc__ = "Return repr(self)" + cls.__repr__ = auto_repr # type: ignore + if angular is not None: + cls.__rich_repr__.angular = angular # type: ignore + return cls + + if cls is None: + return partial(do_replace, angular=angular) # type: ignore + else: + return do_replace(cls, angular=angular) # type: ignore + + +@overload +def rich_repr(cls: Optional[T]) -> T: + ... + + +@overload +def rich_repr(*, angular: bool = False) -> Callable[[T], T]: + ... + + +def rich_repr( + cls: Optional[T] = None, *, angular: bool = False +) -> Union[T, Callable[[T], T]]: + if cls is None: + return auto(angular=angular) + else: + return auto(cls) + + +if __name__ == "__main__": + + @auto + class Foo: + def __rich_repr__(self) -> Result: + yield "foo" + yield "bar", {"shopping": ["eggs", "ham", "pineapple"]} + yield "buy", "hand sanitizer" + + foo = Foo() + from pip._vendor.rich.console import Console + + console = Console() + + console.rule("Standard repr") + console.print(foo) + + console.print(foo, width=60) + console.print(foo, width=30) + + console.rule("Angular repr") + Foo.__rich_repr__.angular = True # type: ignore + + console.print(foo) + + console.print(foo, width=60) + console.print(foo, width=30) diff --git a/src/pip/_vendor/rich/rule.py b/src/pip/_vendor/rich/rule.py new file mode 100644 index 000000000..ce4754f6a --- /dev/null +++ b/src/pip/_vendor/rich/rule.py @@ -0,0 +1,115 @@ +from typing import Union + +from .align import AlignMethod +from .cells import cell_len, set_cell_size +from .console import Console, ConsoleOptions, RenderResult +from .jupyter import JupyterMixin +from .style import Style +from .text import Text + + +class Rule(JupyterMixin): + """A console renderable to draw a horizontal rule (line). + + Args: + title (Union[str, Text], optional): Text to render in the rule. Defaults to "". + characters (str, optional): Character(s) used to draw the line. Defaults to "─". + style (StyleType, optional): Style of Rule. Defaults to "rule.line". + end (str, optional): Character at end of Rule. defaults to "\\\\n" + align (str, optional): How to align the title, one of "left", "center", or "right". Defaults to "center". + """ + + def __init__( + self, + title: Union[str, Text] = "", + *, + characters: str = "─", + style: Union[str, Style] = "rule.line", + end: str = "\n", + align: AlignMethod = "center", + ) -> None: + if cell_len(characters) < 1: + raise ValueError( + "'characters' argument must have a cell width of at least 1" + ) + if align not in ("left", "center", "right"): + raise ValueError( + f'invalid value for align, expected "left", "center", "right" (not {align!r})' + ) + self.title = title + self.characters = characters + self.style = style + self.end = end + self.align = align + + def __repr__(self) -> str: + return f"Rule({self.title!r}, {self.characters!r})" + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + width = options.max_width + + # Python3.6 doesn't have an isascii method on str + isascii = getattr(str, "isascii", None) or ( + lambda s: all(ord(c) < 128 for c in s) + ) + characters = ( + "-" + if (options.ascii_only and not isascii(self.characters)) + else self.characters + ) + + chars_len = cell_len(characters) + if not self.title: + rule_text = Text(characters * ((width // chars_len) + 1), self.style) + rule_text.truncate(width) + rule_text.plain = set_cell_size(rule_text.plain, width) + yield rule_text + return + + if isinstance(self.title, Text): + title_text = self.title + else: + title_text = console.render_str(self.title, style="rule.text") + + title_text.plain = title_text.plain.replace("\n", " ") + title_text.expand_tabs() + rule_text = Text(end=self.end) + + if self.align == "center": + title_text.truncate(width - 4, overflow="ellipsis") + side_width = (width - cell_len(title_text.plain)) // 2 + left = Text(characters * (side_width // chars_len + 1)) + left.truncate(side_width - 1) + right_length = width - cell_len(left.plain) - cell_len(title_text.plain) + right = Text(characters * (side_width // chars_len + 1)) + right.truncate(right_length) + rule_text.append(left.plain + " ", self.style) + rule_text.append(title_text) + rule_text.append(" " + right.plain, self.style) + elif self.align == "left": + title_text.truncate(width - 2, overflow="ellipsis") + rule_text.append(title_text) + rule_text.append(" ") + rule_text.append(characters * (width - rule_text.cell_len), self.style) + elif self.align == "right": + title_text.truncate(width - 2, overflow="ellipsis") + rule_text.append(characters * (width - title_text.cell_len - 1), self.style) + rule_text.append(" ") + rule_text.append(title_text) + + rule_text.plain = set_cell_size(rule_text.plain, width) + yield rule_text + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + import sys + + try: + text = sys.argv[1] + except IndexError: + text = "Hello, World" + console = Console() + console.print(Rule(title=text)) diff --git a/src/pip/_vendor/rich/scope.py b/src/pip/_vendor/rich/scope.py new file mode 100644 index 000000000..6822b8ca5 --- /dev/null +++ b/src/pip/_vendor/rich/scope.py @@ -0,0 +1,86 @@ +from collections.abc import Mapping +from typing import TYPE_CHECKING, Any, Optional, Tuple + +from .highlighter import ReprHighlighter +from .panel import Panel +from .pretty import Pretty +from .table import Table +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import ConsoleRenderable + + +def render_scope( + scope: "Mapping[str, Any]", + *, + title: Optional[TextType] = None, + sort_keys: bool = True, + indent_guides: bool = False, + max_length: Optional[int] = None, + max_string: Optional[int] = None, +) -> "ConsoleRenderable": + """Render python variables in a given scope. + + Args: + scope (Mapping): A mapping containing variable names and values. + title (str, optional): Optional title. Defaults to None. + sort_keys (bool, optional): Enable sorting of items. Defaults to True. + indent_guides (bool, optional): Enable indentaton guides. Defaults to False. + max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to None. + max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to None. + + Returns: + ConsoleRenderable: A renderable object. + """ + highlighter = ReprHighlighter() + items_table = Table.grid(padding=(0, 1), expand=False) + items_table.add_column(justify="right") + + def sort_items(item: Tuple[str, Any]) -> Tuple[bool, str]: + """Sort special variables first, then alphabetically.""" + key, _ = item + return (not key.startswith("__"), key.lower()) + + items = sorted(scope.items(), key=sort_items) if sort_keys else scope.items() + for key, value in items: + key_text = Text.assemble( + (key, "scope.key.special" if key.startswith("__") else "scope.key"), + (" =", "scope.equals"), + ) + items_table.add_row( + key_text, + Pretty( + value, + highlighter=highlighter, + indent_guides=indent_guides, + max_length=max_length, + max_string=max_string, + ), + ) + return Panel.fit( + items_table, + title=title, + border_style="scope.border", + padding=(0, 1), + ) + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich import print + + print() + + def test(foo: float, bar: float) -> None: + list_of_things = [1, 2, 3, None, 4, True, False, "Hello World"] + dict_of_things = { + "version": "1.1", + "method": "confirmFruitPurchase", + "params": [["apple", "orange", "mangoes", "pomelo"], 1.123], + "id": "194521489", + } + print(render_scope(locals(), title="[i]locals", sort_keys=False)) + + test(20.3423, 3.1427) + print() diff --git a/src/pip/_vendor/rich/screen.py b/src/pip/_vendor/rich/screen.py new file mode 100644 index 000000000..7f416e1e7 --- /dev/null +++ b/src/pip/_vendor/rich/screen.py @@ -0,0 +1,54 @@ +from typing import Optional, TYPE_CHECKING + +from .segment import Segment +from .style import StyleType +from ._loop import loop_last + + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + RenderResult, + RenderableType, + Group, + ) + + +class Screen: + """A renderable that fills the terminal screen and crops excess. + + Args: + renderable (RenderableType): Child renderable. + style (StyleType, optional): Optional background style. Defaults to None. + """ + + renderable: "RenderableType" + + def __init__( + self, + *renderables: "RenderableType", + style: Optional[StyleType] = None, + application_mode: bool = False, + ) -> None: + from pip._vendor.rich.console import Group + + self.renderable = Group(*renderables) + self.style = style + self.application_mode = application_mode + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + width, height = options.size + style = console.get_style(self.style) if self.style else None + render_options = options.update(width=width, height=height) + lines = console.render_lines( + self.renderable or "", render_options, style=style, pad=True + ) + lines = Segment.set_shape(lines, width, height, style=style) + new_line = Segment("\n\r") if self.application_mode else Segment.line() + for last, line in loop_last(lines): + yield from line + if not last: + yield new_line diff --git a/src/pip/_vendor/rich/segment.py b/src/pip/_vendor/rich/segment.py new file mode 100644 index 000000000..869b61010 --- /dev/null +++ b/src/pip/_vendor/rich/segment.py @@ -0,0 +1,623 @@ +from enum import IntEnum +from functools import lru_cache +from itertools import filterfalse +from logging import getLogger +from operator import attrgetter +from typing import ( + TYPE_CHECKING, + Dict, + Iterable, + List, + NamedTuple, + Optional, + Sequence, + Tuple, + Union, +) + +from .cells import cell_len, get_character_cell_size, set_cell_size +from .repr import Result, rich_repr +from .style import Style + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult + +log = getLogger("rich") + + +class ControlType(IntEnum): + """Non-printable control codes which typically translate to ANSI codes.""" + + BELL = 1 + CARRIAGE_RETURN = 2 + HOME = 3 + CLEAR = 4 + SHOW_CURSOR = 5 + HIDE_CURSOR = 6 + ENABLE_ALT_SCREEN = 7 + DISABLE_ALT_SCREEN = 8 + CURSOR_UP = 9 + CURSOR_DOWN = 10 + CURSOR_FORWARD = 11 + CURSOR_BACKWARD = 12 + CURSOR_MOVE_TO_COLUMN = 13 + CURSOR_MOVE_TO = 14 + ERASE_IN_LINE = 15 + + +ControlCode = Union[ + Tuple[ControlType], Tuple[ControlType, int], Tuple[ControlType, int, int] +] + + +@rich_repr() +class Segment(NamedTuple): + """A piece of text with associated style. Segments are produced by the Console render process and + are ultimately converted in to strings to be written to the terminal. + + Args: + text (str): A piece of text. + style (:class:`~rich.style.Style`, optional): An optional style to apply to the text. + control (Tuple[ControlCode..], optional): Optional sequence of control codes. + """ + + text: str = "" + """Raw text.""" + style: Optional[Style] = None + """An optional style.""" + control: Optional[Sequence[ControlCode]] = None + """Optional sequence of control codes.""" + + def __rich_repr__(self) -> Result: + yield self.text + if self.control is None: + if self.style is not None: + yield self.style + else: + yield self.style + yield self.control + + def __bool__(self) -> bool: + """Check if the segment contains text.""" + return bool(self.text) + + @property + def cell_length(self) -> int: + """Get cell length of segment.""" + return 0 if self.control else cell_len(self.text) + + @property + def is_control(self) -> bool: + """Check if the segment contains control codes.""" + return self.control is not None + + @classmethod + @lru_cache(1024 * 16) + def _split_cells(cls, segment: "Segment", cut: int) -> Tuple["Segment", "Segment"]: # type: ignore + + text, style, control = segment + _Segment = Segment + if cut >= segment.cell_length: + return segment, _Segment("", style, control) + + if len(text) == segment.cell_length: + # Fast path with all 1 cell characters + return ( + _Segment(text[:cut], style, control), + _Segment(text[cut:], style, control), + ) + + cell_size = get_character_cell_size + + pos = int((cut / segment.cell_length) * len(text)) + + before = text[:pos] + cell_pos = cell_len(before) + if cell_pos == cut: + return ( + _Segment(before, style, control), + _Segment(text[pos:], style, control), + ) + while pos < len(text): + char = text[pos] + pos += 1 + cell_pos += cell_size(char) + before = text[:pos] + if cell_pos == cut: + return ( + _Segment(before, style, control), + _Segment(text[pos:], style, control), + ) + if cell_pos > cut: + return ( + _Segment(before[: pos - 1] + " ", style, control), + _Segment(" " + text[pos:], style, control), + ) + + def split_cells(self, cut: int) -> Tuple["Segment", "Segment"]: + """Split segment in to two segments at the specified column. + + If the cut point falls in the middle of a 2-cell wide character then it is replaced + by two spaces, to preserve the display width of the parent segment. + + Returns: + Tuple[Segment, Segment]: Two segments. + """ + return self._split_cells(self, cut) + + @classmethod + def line(cls) -> "Segment": + """Make a new line segment.""" + return cls("\n") + + @classmethod + def apply_style( + cls, + segments: Iterable["Segment"], + style: Optional[Style] = None, + post_style: Optional[Style] = None, + ) -> Iterable["Segment"]: + """Apply style(s) to an iterable of segments. + + Returns an iterable of segments where the style is replaced by ``style + segment.style + post_style``. + + Args: + segments (Iterable[Segment]): Segments to process. + style (Style, optional): Base style. Defaults to None. + post_style (Style, optional): Style to apply on top of segment style. Defaults to None. + + Returns: + Iterable[Segments]: A new iterable of segments (possibly the same iterable). + """ + result_segments = segments + if style: + apply = style.__add__ + result_segments = ( + cls(text, None if control else apply(_style), control) + for text, _style, control in result_segments + ) + if post_style: + result_segments = ( + cls( + text, + ( + None + if control + else (_style + post_style if _style else post_style) + ), + control, + ) + for text, _style, control in result_segments + ) + return result_segments + + @classmethod + def filter_control( + cls, segments: Iterable["Segment"], is_control: bool = False + ) -> Iterable["Segment"]: + """Filter segments by ``is_control`` attribute. + + Args: + segments (Iterable[Segment]): An iterable of Segment instances. + is_control (bool, optional): is_control flag to match in search. + + Returns: + Iterable[Segment]: And iterable of Segment instances. + + """ + if is_control: + return filter(attrgetter("control"), segments) + else: + return filterfalse(attrgetter("control"), segments) + + @classmethod + def split_lines(cls, segments: Iterable["Segment"]) -> Iterable[List["Segment"]]: + """Split a sequence of segments in to a list of lines. + + Args: + segments (Iterable[Segment]): Segments potentially containing line feeds. + + Yields: + Iterable[List[Segment]]: Iterable of segment lists, one per line. + """ + line: List[Segment] = [] + append = line.append + + for segment in segments: + if "\n" in segment.text and not segment.control: + text, style, _ = segment + while text: + _text, new_line, text = text.partition("\n") + if _text: + append(cls(_text, style)) + if new_line: + yield line + line = [] + append = line.append + else: + append(segment) + if line: + yield line + + @classmethod + def split_and_crop_lines( + cls, + segments: Iterable["Segment"], + length: int, + style: Optional[Style] = None, + pad: bool = True, + include_new_lines: bool = True, + ) -> Iterable[List["Segment"]]: + """Split segments in to lines, and crop lines greater than a given length. + + Args: + segments (Iterable[Segment]): An iterable of segments, probably + generated from console.render. + length (int): Desired line length. + style (Style, optional): Style to use for any padding. + pad (bool): Enable padding of lines that are less than `length`. + + Returns: + Iterable[List[Segment]]: An iterable of lines of segments. + """ + line: List[Segment] = [] + append = line.append + + adjust_line_length = cls.adjust_line_length + new_line_segment = cls("\n") + + for segment in segments: + if "\n" in segment.text and not segment.control: + text, style, _ = segment + while text: + _text, new_line, text = text.partition("\n") + if _text: + append(cls(_text, style)) + if new_line: + cropped_line = adjust_line_length( + line, length, style=style, pad=pad + ) + if include_new_lines: + cropped_line.append(new_line_segment) + yield cropped_line + del line[:] + else: + append(segment) + if line: + yield adjust_line_length(line, length, style=style, pad=pad) + + @classmethod + def adjust_line_length( + cls, + line: List["Segment"], + length: int, + style: Optional[Style] = None, + pad: bool = True, + ) -> List["Segment"]: + """Adjust a line to a given width (cropping or padding as required). + + Args: + segments (Iterable[Segment]): A list of segments in a single line. + length (int): The desired width of the line. + style (Style, optional): The style of padding if used (space on the end). Defaults to None. + pad (bool, optional): Pad lines with spaces if they are shorter than `length`. Defaults to True. + + Returns: + List[Segment]: A line of segments with the desired length. + """ + line_length = sum(segment.cell_length for segment in line) + new_line: List[Segment] + + if line_length < length: + if pad: + new_line = line + [cls(" " * (length - line_length), style)] + else: + new_line = line[:] + elif line_length > length: + new_line = [] + append = new_line.append + line_length = 0 + for segment in line: + segment_length = segment.cell_length + if line_length + segment_length < length or segment.control: + append(segment) + line_length += segment_length + else: + text, segment_style, _ = segment + text = set_cell_size(text, length - line_length) + append(cls(text, segment_style)) + break + else: + new_line = line[:] + return new_line + + @classmethod + def get_line_length(cls, line: List["Segment"]) -> int: + """Get the length of list of segments. + + Args: + line (List[Segment]): A line encoded as a list of Segments (assumes no '\\\\n' characters), + + Returns: + int: The length of the line. + """ + return sum(segment.cell_length for segment in line) + + @classmethod + def get_shape(cls, lines: List[List["Segment"]]) -> Tuple[int, int]: + """Get the shape (enclosing rectangle) of a list of lines. + + Args: + lines (List[List[Segment]]): A list of lines (no '\\\\n' characters). + + Returns: + Tuple[int, int]: Width and height in characters. + """ + get_line_length = cls.get_line_length + max_width = max(get_line_length(line) for line in lines) if lines else 0 + return (max_width, len(lines)) + + @classmethod + def set_shape( + cls, + lines: List[List["Segment"]], + width: int, + height: Optional[int] = None, + style: Optional[Style] = None, + new_lines: bool = False, + ) -> List[List["Segment"]]: + """Set the shape of a list of lines (enclosing rectangle). + + Args: + lines (List[List[Segment]]): A list of lines. + width (int): Desired width. + height (int, optional): Desired height or None for no change. + style (Style, optional): Style of any padding added. Defaults to None. + new_lines (bool, optional): Padded lines should include "\n". Defaults to False. + + Returns: + List[List[Segment]]: New list of lines that fits width x height. + """ + if height is None: + height = len(lines) + shaped_lines: List[List[Segment]] = [] + pad_line = ( + [Segment(" " * width, style), Segment("\n")] + if new_lines + else [Segment(" " * width, style)] + ) + + append = shaped_lines.append + adjust_line_length = cls.adjust_line_length + line: Optional[List[Segment]] + iter_lines = iter(lines) + for _ in range(height): + line = next(iter_lines, None) + if line is None: + append(pad_line) + else: + append(adjust_line_length(line, width, style=style)) + return shaped_lines + + @classmethod + def simplify(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Simplify an iterable of segments by combining contiguous segments with the same style. + + Args: + segments (Iterable[Segment]): An iterable of segments. + + Returns: + Iterable[Segment]: A possibly smaller iterable of segments that will render the same way. + """ + iter_segments = iter(segments) + try: + last_segment = next(iter_segments) + except StopIteration: + return + + _Segment = Segment + for segment in iter_segments: + if last_segment.style == segment.style and not segment.control: + last_segment = _Segment( + last_segment.text + segment.text, last_segment.style + ) + else: + yield last_segment + last_segment = segment + yield last_segment + + @classmethod + def strip_links(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all links from an iterable of styles. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with link removed. + """ + for segment in segments: + if segment.control or segment.style is None: + yield segment + else: + text, style, _control = segment + yield cls(text, style.update_link(None) if style else None) + + @classmethod + def strip_styles(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all styles from an iterable of segments. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with styles replace with None + """ + for text, _style, control in segments: + yield cls(text, None, control) + + @classmethod + def remove_color(cls, segments: Iterable["Segment"]) -> Iterable["Segment"]: + """Remove all color from an iterable of segments. + + Args: + segments (Iterable[Segment]): An iterable segments. + + Yields: + Segment: Segments with colorless style. + """ + + cache: Dict[Style, Style] = {} + for text, style, control in segments: + if style: + colorless_style = cache.get(style) + if colorless_style is None: + colorless_style = style.without_color + cache[style] = colorless_style + yield cls(text, colorless_style, control) + else: + yield cls(text, None, control) + + @classmethod + def divide( + cls, segments: Iterable["Segment"], cuts: Iterable[int] + ) -> Iterable[List["Segment"]]: + """Divides an iterable of segments in to portions. + + Args: + cuts (Iterable[int]): Cell positions where to divide. + + Yields: + [Iterable[List[Segment]]]: An iterable of Segments in List. + """ + split_segments: List["Segment"] = [] + add_segment = split_segments.append + iter_cuts = iter(cuts) + + while True: + try: + cut = next(iter_cuts) + except StopIteration: + return [] + if cut != 0: + break + yield [] + pos = 0 + + for segment in segments: + while segment.text: + end_pos = pos + segment.cell_length + if end_pos < cut: + add_segment(segment) + pos = end_pos + break + + try: + if end_pos == cut: + add_segment(segment) + yield split_segments[:] + del split_segments[:] + pos = end_pos + break + else: + before, segment = segment.split_cells(cut - pos) + add_segment(before) + yield split_segments[:] + del split_segments[:] + pos = cut + finally: + try: + cut = next(iter_cuts) + except StopIteration: + if split_segments: + yield split_segments[:] + return + yield split_segments[:] + + +class Segments: + """A simple renderable to render an iterable of segments. This class may be useful if + you want to print segments outside of a __rich_console__ method. + + Args: + segments (Iterable[Segment]): An iterable of segments. + new_lines (bool, optional): Add new lines between segments. Defaults to False. + """ + + def __init__(self, segments: Iterable[Segment], new_lines: bool = False) -> None: + self.segments = list(segments) + self.new_lines = new_lines + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + if self.new_lines: + line = Segment.line() + for segment in self.segments: + yield segment + yield line + else: + yield from self.segments + + +class SegmentLines: + def __init__(self, lines: Iterable[List[Segment]], new_lines: bool = False) -> None: + """A simple renderable containing a number of lines of segments. May be used as an intermediate + in rendering process. + + Args: + lines (Iterable[List[Segment]]): Lists of segments forming lines. + new_lines (bool, optional): Insert new lines after each line. Defaults to False. + """ + self.lines = list(lines) + self.new_lines = new_lines + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + if self.new_lines: + new_line = Segment.line() + for line in self.lines: + yield from line + yield new_line + else: + for line in self.lines: + yield from line + + +if __name__ == "__main__": + + if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + from pip._vendor.rich.syntax import Syntax + from pip._vendor.rich.text import Text + + code = """from rich.console import Console + console = Console() + text = Text.from_markup("Hello, [bold magenta]World[/]!") + console.print(text)""" + + text = Text.from_markup("Hello, [bold magenta]World[/]!") + + console = Console() + + console.rule("rich.Segment") + console.print( + "A Segment is the last step in the Rich render process before generating text with ANSI codes." + ) + console.print("\nConsider the following code:\n") + console.print(Syntax(code, "python", line_numbers=True)) + console.print() + console.print( + "When you call [b]print()[/b], Rich [i]renders[/i] the object in to the the following:\n" + ) + fragments = list(console.render(text)) + console.print(fragments) + console.print() + console.print( + "The Segments are then processed to produce the following output:\n" + ) + console.print(text) + console.print( + "\nYou will only need to know this if you are implementing your own Rich renderables." + ) diff --git a/src/pip/_vendor/rich/spinner.py b/src/pip/_vendor/rich/spinner.py new file mode 100644 index 000000000..5b13b1e9b --- /dev/null +++ b/src/pip/_vendor/rich/spinner.py @@ -0,0 +1,134 @@ +from typing import cast, List, Optional, TYPE_CHECKING + +from ._spinners import SPINNERS +from .measure import Measurement +from .table import Table +from .text import Text + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult, RenderableType + from .style import StyleType + + +class Spinner: + def __init__( + self, + name: str, + text: "RenderableType" = "", + *, + style: Optional["StyleType"] = None, + speed: float = 1.0, + ) -> None: + """A spinner animation. + + Args: + name (str): Name of spinner (run python -m rich.spinner). + text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "". + style (StyleType, optional): Style for spinner animation. Defaults to None. + speed (float, optional): Speed factor for animation. Defaults to 1.0. + + Raises: + KeyError: If name isn't one of the supported spinner animations. + """ + try: + spinner = SPINNERS[name] + except KeyError: + raise KeyError(f"no spinner called {name!r}") + self.text = Text.from_markup(text) if isinstance(text, str) else text + self.frames = cast(List[str], spinner["frames"])[:] + self.interval = cast(float, spinner["interval"]) + self.start_time: Optional[float] = None + self.style = style + self.speed = speed + self.frame_no_offset: float = 0.0 + self._update_speed = 0.0 + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + yield self.render(console.get_time()) + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + text = self.render(0) + return Measurement.get(console, options, text) + + def render(self, time: float) -> "RenderableType": + """Render the spinner for a given time. + + Args: + time (float): Time in seconds. + + Returns: + RenderableType: A renderable containing animation frame. + """ + if self.start_time is None: + self.start_time = time + + frame_no = ((time - self.start_time) * self.speed) / ( + self.interval / 1000.0 + ) + self.frame_no_offset + frame = Text( + self.frames[int(frame_no) % len(self.frames)], style=self.style or "" + ) + + if self._update_speed: + self.frame_no_offset = frame_no + self.start_time = time + self.speed = self._update_speed + self._update_speed = 0.0 + + if not self.text: + return frame + elif isinstance(self.text, (str, Text)): + return Text.assemble(frame, " ", self.text) + else: + table = Table.grid(padding=1) + table.add_row(frame, self.text) + return table + + def update( + self, + *, + text: "RenderableType" = "", + style: Optional["StyleType"] = None, + speed: Optional[float] = None, + ) -> None: + """Updates attributes of a spinner after it has been started. + + Args: + text (RenderableType, optional): A renderable to display at the right of the spinner (str or Text typically). Defaults to "". + style (StyleType, optional): Style for spinner animation. Defaults to None. + speed (float, optional): Speed factor for animation. Defaults to None. + """ + if text: + self.text = Text.from_markup(text) if isinstance(text, str) else text + if style: + self.style = style + if speed: + self._update_speed = speed + + +if __name__ == "__main__": # pragma: no cover + from time import sleep + + from .columns import Columns + from .panel import Panel + from .live import Live + + all_spinners = Columns( + [ + Spinner(spinner_name, text=Text(repr(spinner_name), style="green")) + for spinner_name in sorted(SPINNERS.keys()) + ], + column_first=True, + expand=True, + ) + + with Live( + Panel(all_spinners, title="Spinners", border_style="blue"), + refresh_per_second=20, + ) as live: + while True: + sleep(0.1) diff --git a/src/pip/_vendor/rich/status.py b/src/pip/_vendor/rich/status.py new file mode 100644 index 000000000..09eff405e --- /dev/null +++ b/src/pip/_vendor/rich/status.py @@ -0,0 +1,132 @@ +from types import TracebackType +from typing import Optional, Type + +from .console import Console, RenderableType +from .jupyter import JupyterMixin +from .live import Live +from .spinner import Spinner +from .style import StyleType + + +class Status(JupyterMixin): + """Displays a status indicator with a 'spinner' animation. + + Args: + status (RenderableType): A status renderable (str or Text typically). + console (Console, optional): Console instance to use, or None for global console. Defaults to None. + spinner (str, optional): Name of spinner animation (see python -m rich.spinner). Defaults to "dots". + spinner_style (StyleType, optional): Style of spinner. Defaults to "status.spinner". + speed (float, optional): Speed factor for spinner animation. Defaults to 1.0. + refresh_per_second (float, optional): Number of refreshes per second. Defaults to 12.5. + """ + + def __init__( + self, + status: RenderableType, + *, + console: Optional[Console] = None, + spinner: str = "dots", + spinner_style: StyleType = "status.spinner", + speed: float = 1.0, + refresh_per_second: float = 12.5, + ): + self.status = status + self.spinner_style = spinner_style + self.speed = speed + self._spinner = Spinner(spinner, text=status, style=spinner_style, speed=speed) + self._live = Live( + self.renderable, + console=console, + refresh_per_second=refresh_per_second, + transient=True, + ) + + @property + def renderable(self) -> Spinner: + return self._spinner + + @property + def console(self) -> "Console": + """Get the Console used by the Status objects.""" + return self._live.console + + def update( + self, + status: Optional[RenderableType] = None, + *, + spinner: Optional[str] = None, + spinner_style: Optional[StyleType] = None, + speed: Optional[float] = None, + ) -> None: + """Update status. + + Args: + status (Optional[RenderableType], optional): New status renderable or None for no change. Defaults to None. + spinner (Optional[str], optional): New spinner or None for no change. Defaults to None. + spinner_style (Optional[StyleType], optional): New spinner style or None for no change. Defaults to None. + speed (Optional[float], optional): Speed factor for spinner animation or None for no change. Defaults to None. + """ + if status is not None: + self.status = status + if spinner_style is not None: + self.spinner_style = spinner_style + if speed is not None: + self.speed = speed + if spinner is not None: + self._spinner = Spinner( + spinner, text=self.status, style=self.spinner_style, speed=self.speed + ) + self._live.update(self.renderable, refresh=True) + else: + self._spinner.update( + text=self.status, style=self.spinner_style, speed=self.speed + ) + + def start(self) -> None: + """Start the status animation.""" + self._live.start() + + def stop(self) -> None: + """Stop the spinner animation.""" + self._live.stop() + + def __rich__(self) -> RenderableType: + return self.renderable + + def __enter__(self) -> "Status": + self.start() + return self + + def __exit__( + self, + exc_type: Optional[Type[BaseException]], + exc_val: Optional[BaseException], + exc_tb: Optional[TracebackType], + ) -> None: + self.stop() + + +if __name__ == "__main__": # pragma: no cover + + from time import sleep + + from .console import Console + + console = Console() + with console.status("[magenta]Covid detector booting up") as status: + sleep(3) + console.log("Importing advanced AI") + sleep(3) + console.log("Advanced Covid AI Ready") + sleep(3) + status.update(status="[bold blue] Scanning for Covid", spinner="earth") + sleep(3) + console.log("Found 10,000,000,000 copies of Covid32.exe") + sleep(3) + status.update( + status="[bold red]Moving Covid32.exe to Trash", + spinner="bouncingBall", + spinner_style="yellow", + ) + sleep(5) + console.print("[bold green]Covid deleted successfully") diff --git a/src/pip/_vendor/rich/style.py b/src/pip/_vendor/rich/style.py new file mode 100644 index 000000000..0787c3314 --- /dev/null +++ b/src/pip/_vendor/rich/style.py @@ -0,0 +1,785 @@ +import sys +from functools import lru_cache +from marshal import loads, dumps +from random import randint +from typing import Any, cast, Dict, Iterable, List, Optional, Type, Union + +from . import errors +from .color import Color, ColorParseError, ColorSystem, blend_rgb +from .repr import rich_repr, Result +from .terminal_theme import DEFAULT_TERMINAL_THEME, TerminalTheme + + +# Style instances and style definitions are often interchangeable +StyleType = Union[str, "Style"] + + +class _Bit: + """A descriptor to get/set a style attribute bit.""" + + __slots__ = ["bit"] + + def __init__(self, bit_no: int) -> None: + self.bit = 1 << bit_no + + def __get__(self, obj: "Style", objtype: Type["Style"]) -> Optional[bool]: + if obj._set_attributes & self.bit: + return obj._attributes & self.bit != 0 + return None + + +@rich_repr +class Style: + """A terminal style. + + A terminal style consists of a color (`color`), a background color (`bgcolor`), and a number of attributes, such + as bold, italic etc. The attributes have 3 states: they can either be on + (``True``), off (``False``), or not set (``None``). + + Args: + color (Union[Color, str], optional): Color of terminal text. Defaults to None. + bgcolor (Union[Color, str], optional): Color of terminal background. Defaults to None. + bold (bool, optional): Enable bold text. Defaults to None. + dim (bool, optional): Enable dim text. Defaults to None. + italic (bool, optional): Enable italic text. Defaults to None. + underline (bool, optional): Enable underlined text. Defaults to None. + blink (bool, optional): Enabled blinking text. Defaults to None. + blink2 (bool, optional): Enable fast blinking text. Defaults to None. + reverse (bool, optional): Enabled reverse text. Defaults to None. + conceal (bool, optional): Enable concealed text. Defaults to None. + strike (bool, optional): Enable strikethrough text. Defaults to None. + underline2 (bool, optional): Enable doubly underlined text. Defaults to None. + frame (bool, optional): Enable framed text. Defaults to None. + encircle (bool, optional): Enable encircled text. Defaults to None. + overline (bool, optional): Enable overlined text. Defaults to None. + link (str, link): Link URL. Defaults to None. + + """ + + _color: Optional[Color] + _bgcolor: Optional[Color] + _attributes: int + _set_attributes: int + _hash: int + _null: bool + _meta: Optional[bytes] + + __slots__ = [ + "_color", + "_bgcolor", + "_attributes", + "_set_attributes", + "_link", + "_link_id", + "_ansi", + "_style_definition", + "_hash", + "_null", + "_meta", + ] + + # maps bits on to SGR parameter + _style_map = { + 0: "1", + 1: "2", + 2: "3", + 3: "4", + 4: "5", + 5: "6", + 6: "7", + 7: "8", + 8: "9", + 9: "21", + 10: "51", + 11: "52", + 12: "53", + } + + STYLE_ATTRIBUTES = { + "dim": "dim", + "d": "dim", + "bold": "bold", + "b": "bold", + "italic": "italic", + "i": "italic", + "underline": "underline", + "u": "underline", + "blink": "blink", + "blink2": "blink2", + "reverse": "reverse", + "r": "reverse", + "conceal": "conceal", + "c": "conceal", + "strike": "strike", + "s": "strike", + "underline2": "underline2", + "uu": "underline2", + "frame": "frame", + "encircle": "encircle", + "overline": "overline", + "o": "overline", + } + + def __init__( + self, + *, + color: Optional[Union[Color, str]] = None, + bgcolor: Optional[Union[Color, str]] = None, + bold: Optional[bool] = None, + dim: Optional[bool] = None, + italic: Optional[bool] = None, + underline: Optional[bool] = None, + blink: Optional[bool] = None, + blink2: Optional[bool] = None, + reverse: Optional[bool] = None, + conceal: Optional[bool] = None, + strike: Optional[bool] = None, + underline2: Optional[bool] = None, + frame: Optional[bool] = None, + encircle: Optional[bool] = None, + overline: Optional[bool] = None, + link: Optional[str] = None, + meta: Optional[Dict[str, Any]] = None, + ): + self._ansi: Optional[str] = None + self._style_definition: Optional[str] = None + + def _make_color(color: Union[Color, str]) -> Color: + return color if isinstance(color, Color) else Color.parse(color) + + self._color = None if color is None else _make_color(color) + self._bgcolor = None if bgcolor is None else _make_color(bgcolor) + self._set_attributes = sum( + ( + bold is not None, + dim is not None and 2, + italic is not None and 4, + underline is not None and 8, + blink is not None and 16, + blink2 is not None and 32, + reverse is not None and 64, + conceal is not None and 128, + strike is not None and 256, + underline2 is not None and 512, + frame is not None and 1024, + encircle is not None and 2048, + overline is not None and 4096, + ) + ) + self._attributes = ( + sum( + ( + bold and 1 or 0, + dim and 2 or 0, + italic and 4 or 0, + underline and 8 or 0, + blink and 16 or 0, + blink2 and 32 or 0, + reverse and 64 or 0, + conceal and 128 or 0, + strike and 256 or 0, + underline2 and 512 or 0, + frame and 1024 or 0, + encircle and 2048 or 0, + overline and 4096 or 0, + ) + ) + if self._set_attributes + else 0 + ) + + self._link = link + self._link_id = f"{randint(0, 999999)}" if link else "" + self._meta = None if meta is None else dumps(meta) + self._hash = hash( + ( + self._color, + self._bgcolor, + self._attributes, + self._set_attributes, + link, + self._meta, + ) + ) + self._null = not (self._set_attributes or color or bgcolor or link or meta) + + @classmethod + def null(cls) -> "Style": + """Create an 'null' style, equivalent to Style(), but more performant.""" + return NULL_STYLE + + @classmethod + def from_color( + cls, color: Optional[Color] = None, bgcolor: Optional[Color] = None + ) -> "Style": + """Create a new style with colors and no attributes. + + Returns: + color (Optional[Color]): A (foreground) color, or None for no color. Defaults to None. + bgcolor (Optional[Color]): A (background) color, or None for no color. Defaults to None. + """ + style: Style = cls.__new__(Style) + style._ansi = None + style._style_definition = None + style._color = color + style._bgcolor = bgcolor + style._set_attributes = 0 + style._attributes = 0 + style._link = None + style._link_id = "" + style._meta = None + style._hash = hash( + ( + color, + bgcolor, + None, + None, + None, + None, + ) + ) + style._null = not (color or bgcolor) + return style + + @classmethod + def from_meta(cls, meta: Optional[Dict[str, Any]]) -> "Style": + """Create a new style with meta data. + + Returns: + meta (Optional[Dict[str, Any]]): A dictionary of meta data. Defaults to None. + """ + style: Style = cls.__new__(Style) + style._ansi = None + style._style_definition = None + style._color = None + style._bgcolor = None + style._set_attributes = 0 + style._attributes = 0 + style._link = None + style._link_id = "" + style._meta = dumps(meta) + style._hash = hash( + ( + None, + None, + None, + None, + None, + style._meta, + ) + ) + style._null = not (meta) + return style + + @classmethod + def on(cls, meta: Optional[Dict[str, Any]] = None, **handlers: Any) -> "Style": + """Create a blank style with meta information. + + Example: + style = Style.on(click=self.on_click) + + Args: + meta (Optiona[Dict[str, Any]], optional): An optional dict of meta information. + **handlers (Any): Keyword arguments are translated in to handlers. + + Returns: + Style: A Style with meta information attached. + """ + meta = {} if meta is None else meta + meta.update({f"@{key}": value for key, value in handlers.items()}) + return cls.from_meta(meta) + + bold = _Bit(0) + dim = _Bit(1) + italic = _Bit(2) + underline = _Bit(3) + blink = _Bit(4) + blink2 = _Bit(5) + reverse = _Bit(6) + conceal = _Bit(7) + strike = _Bit(8) + underline2 = _Bit(9) + frame = _Bit(10) + encircle = _Bit(11) + overline = _Bit(12) + + @property + def link_id(self) -> str: + """Get a link id, used in ansi code for links.""" + return self._link_id + + def __str__(self) -> str: + """Re-generate style definition from attributes.""" + if self._style_definition is None: + attributes: List[str] = [] + append = attributes.append + bits = self._set_attributes + if bits & 0b0000000001111: + if bits & 1: + append("bold" if self.bold else "not bold") + if bits & (1 << 1): + append("dim" if self.dim else "not dim") + if bits & (1 << 2): + append("italic" if self.italic else "not italic") + if bits & (1 << 3): + append("underline" if self.underline else "not underline") + if bits & 0b0000111110000: + if bits & (1 << 4): + append("blink" if self.blink else "not blink") + if bits & (1 << 5): + append("blink2" if self.blink2 else "not blink2") + if bits & (1 << 6): + append("reverse" if self.reverse else "not reverse") + if bits & (1 << 7): + append("conceal" if self.conceal else "not conceal") + if bits & (1 << 8): + append("strike" if self.strike else "not strike") + if bits & 0b1111000000000: + if bits & (1 << 9): + append("underline2" if self.underline2 else "not underline2") + if bits & (1 << 10): + append("frame" if self.frame else "not frame") + if bits & (1 << 11): + append("encircle" if self.encircle else "not encircle") + if bits & (1 << 12): + append("overline" if self.overline else "not overline") + if self._color is not None: + append(self._color.name) + if self._bgcolor is not None: + append("on") + append(self._bgcolor.name) + if self._link: + append("link") + append(self._link) + self._style_definition = " ".join(attributes) or "none" + return self._style_definition + + def __bool__(self) -> bool: + """A Style is false if it has no attributes, colors, or links.""" + return not self._null + + def _make_ansi_codes(self, color_system: ColorSystem) -> str: + """Generate ANSI codes for this style. + + Args: + color_system (ColorSystem): Color system. + + Returns: + str: String containing codes. + """ + if self._ansi is None: + sgr: List[str] = [] + append = sgr.append + _style_map = self._style_map + attributes = self._attributes & self._set_attributes + if attributes: + if attributes & 1: + append(_style_map[0]) + if attributes & 2: + append(_style_map[1]) + if attributes & 4: + append(_style_map[2]) + if attributes & 8: + append(_style_map[3]) + if attributes & 0b0000111110000: + for bit in range(4, 9): + if attributes & (1 << bit): + append(_style_map[bit]) + if attributes & 0b1111000000000: + for bit in range(9, 13): + if attributes & (1 << bit): + append(_style_map[bit]) + if self._color is not None: + sgr.extend(self._color.downgrade(color_system).get_ansi_codes()) + if self._bgcolor is not None: + sgr.extend( + self._bgcolor.downgrade(color_system).get_ansi_codes( + foreground=False + ) + ) + self._ansi = ";".join(sgr) + return self._ansi + + @classmethod + @lru_cache(maxsize=1024) + def normalize(cls, style: str) -> str: + """Normalize a style definition so that styles with the same effect have the same string + representation. + + Args: + style (str): A style definition. + + Returns: + str: Normal form of style definition. + """ + try: + return str(cls.parse(style)) + except errors.StyleSyntaxError: + return style.strip().lower() + + @classmethod + def pick_first(cls, *values: Optional[StyleType]) -> StyleType: + """Pick first non-None style.""" + for value in values: + if value is not None: + return value + raise ValueError("expected at least one non-None style") + + def __rich_repr__(self) -> Result: + yield "color", self.color, None + yield "bgcolor", self.bgcolor, None + yield "bold", self.bold, None, + yield "dim", self.dim, None, + yield "italic", self.italic, None + yield "underline", self.underline, None, + yield "blink", self.blink, None + yield "blink2", self.blink2, None + yield "reverse", self.reverse, None + yield "conceal", self.conceal, None + yield "strike", self.strike, None + yield "underline2", self.underline2, None + yield "frame", self.frame, None + yield "encircle", self.encircle, None + yield "link", self.link, None + if self._meta: + yield "meta", self.meta + + def __eq__(self, other: Any) -> bool: + if not isinstance(other, Style): + return NotImplemented + return ( + self._color == other._color + and self._bgcolor == other._bgcolor + and self._set_attributes == other._set_attributes + and self._attributes == other._attributes + and self._link == other._link + and self._meta == other._meta + ) + + def __hash__(self) -> int: + return self._hash + + @property + def color(self) -> Optional[Color]: + """The foreground color or None if it is not set.""" + return self._color + + @property + def bgcolor(self) -> Optional[Color]: + """The background color or None if it is not set.""" + return self._bgcolor + + @property + def link(self) -> Optional[str]: + """Link text, if set.""" + return self._link + + @property + def transparent_background(self) -> bool: + """Check if the style specified a transparent background.""" + return self.bgcolor is None or self.bgcolor.is_default + + @property + def background_style(self) -> "Style": + """A Style with background only.""" + return Style(bgcolor=self.bgcolor) + + @property + def meta(self) -> Dict[str, Any]: + """Get meta information (can not be changed after construction).""" + return {} if self._meta is None else cast(Dict[str, Any], loads(self._meta)) + + @property + def without_color(self) -> "Style": + """Get a copy of the style with color removed.""" + if self._null: + return NULL_STYLE + style: Style = self.__new__(Style) + style._ansi = None + style._style_definition = None + style._color = None + style._bgcolor = None + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = self._link + style._link_id = f"{randint(0, 999999)}" if self._link else "" + style._hash = self._hash + style._null = False + style._meta = None + return style + + @classmethod + @lru_cache(maxsize=4096) + def parse(cls, style_definition: str) -> "Style": + """Parse a style definition. + + Args: + style_definition (str): A string containing a style. + + Raises: + errors.StyleSyntaxError: If the style definition syntax is invalid. + + Returns: + `Style`: A Style instance. + """ + if style_definition.strip() == "none" or not style_definition: + return cls.null() + + STYLE_ATTRIBUTES = cls.STYLE_ATTRIBUTES + color: Optional[str] = None + bgcolor: Optional[str] = None + attributes: Dict[str, Optional[Any]] = {} + link: Optional[str] = None + + words = iter(style_definition.split()) + for original_word in words: + word = original_word.lower() + if word == "on": + word = next(words, "") + if not word: + raise errors.StyleSyntaxError("color expected after 'on'") + try: + Color.parse(word) is None + except ColorParseError as error: + raise errors.StyleSyntaxError( + f"unable to parse {word!r} as background color; {error}" + ) from None + bgcolor = word + + elif word == "not": + word = next(words, "") + attribute = STYLE_ATTRIBUTES.get(word) + if attribute is None: + raise errors.StyleSyntaxError( + f"expected style attribute after 'not', found {word!r}" + ) + attributes[attribute] = False + + elif word == "link": + word = next(words, "") + if not word: + raise errors.StyleSyntaxError("URL expected after 'link'") + link = word + + elif word in STYLE_ATTRIBUTES: + attributes[STYLE_ATTRIBUTES[word]] = True + + else: + try: + Color.parse(word) + except ColorParseError as error: + raise errors.StyleSyntaxError( + f"unable to parse {word!r} as color; {error}" + ) from None + color = word + style = Style(color=color, bgcolor=bgcolor, link=link, **attributes) + return style + + @lru_cache(maxsize=1024) + def get_html_style(self, theme: Optional[TerminalTheme] = None) -> str: + """Get a CSS style rule.""" + theme = theme or DEFAULT_TERMINAL_THEME + css: List[str] = [] + append = css.append + + color = self.color + bgcolor = self.bgcolor + if self.reverse: + color, bgcolor = bgcolor, color + if self.dim: + foreground_color = ( + theme.foreground_color if color is None else color.get_truecolor(theme) + ) + color = Color.from_triplet( + blend_rgb(foreground_color, theme.background_color, 0.5) + ) + if color is not None: + theme_color = color.get_truecolor(theme) + append(f"color: {theme_color.hex}") + append(f"text-decoration-color: {theme_color.hex}") + if bgcolor is not None: + theme_color = bgcolor.get_truecolor(theme, foreground=False) + append(f"background-color: {theme_color.hex}") + if self.bold: + append("font-weight: bold") + if self.italic: + append("font-style: italic") + if self.underline: + append("text-decoration: underline") + if self.strike: + append("text-decoration: line-through") + if self.overline: + append("text-decoration: overline") + return "; ".join(css) + + @classmethod + def combine(cls, styles: Iterable["Style"]) -> "Style": + """Combine styles and get result. + + Args: + styles (Iterable[Style]): Styles to combine. + + Returns: + Style: A new style instance. + """ + iter_styles = iter(styles) + return sum(iter_styles, next(iter_styles)) + + @classmethod + def chain(cls, *styles: "Style") -> "Style": + """Combine styles from positional argument in to a single style. + + Args: + *styles (Iterable[Style]): Styles to combine. + + Returns: + Style: A new style instance. + """ + iter_styles = iter(styles) + return sum(iter_styles, next(iter_styles)) + + def copy(self) -> "Style": + """Get a copy of this style. + + Returns: + Style: A new Style instance with identical attributes. + """ + if self._null: + return NULL_STYLE + style: Style = self.__new__(Style) + style._ansi = self._ansi + style._style_definition = self._style_definition + style._color = self._color + style._bgcolor = self._bgcolor + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = self._link + style._link_id = f"{randint(0, 999999)}" if self._link else "" + style._hash = self._hash + style._null = False + style._meta = self._meta + return style + + def update_link(self, link: Optional[str] = None) -> "Style": + """Get a copy with a different value for link. + + Args: + link (str, optional): New value for link. Defaults to None. + + Returns: + Style: A new Style instance. + """ + style: Style = self.__new__(Style) + style._ansi = self._ansi + style._style_definition = self._style_definition + style._color = self._color + style._bgcolor = self._bgcolor + style._attributes = self._attributes + style._set_attributes = self._set_attributes + style._link = link + style._link_id = f"{randint(0, 999999)}" if link else "" + style._hash = self._hash + style._null = False + style._meta = self._meta + return style + + def render( + self, + text: str = "", + *, + color_system: Optional[ColorSystem] = ColorSystem.TRUECOLOR, + legacy_windows: bool = False, + ) -> str: + """Render the ANSI codes for the style. + + Args: + text (str, optional): A string to style. Defaults to "". + color_system (Optional[ColorSystem], optional): Color system to render to. Defaults to ColorSystem.TRUECOLOR. + + Returns: + str: A string containing ANSI style codes. + """ + if not text or color_system is None: + return text + attrs = self._make_ansi_codes(color_system) + rendered = f"\x1b[{attrs}m{text}\x1b[0m" if attrs else text + if self._link and not legacy_windows: + rendered = ( + f"\x1b]8;id={self._link_id};{self._link}\x1b\\{rendered}\x1b]8;;\x1b\\" + ) + return rendered + + def test(self, text: Optional[str] = None) -> None: + """Write text with style directly to terminal. + + This method is for testing purposes only. + + Args: + text (Optional[str], optional): Text to style or None for style name. + + """ + text = text or str(self) + sys.stdout.write(f"{self.render(text)}\n") + + def __add__(self, style: Optional["Style"]) -> "Style": + if not (isinstance(style, Style) or style is None): + return NotImplemented + if style is None or style._null: + return self + if self._null: + return style + new_style: Style = self.__new__(Style) + new_style._ansi = None + new_style._style_definition = None + new_style._color = style._color or self._color + new_style._bgcolor = style._bgcolor or self._bgcolor + new_style._attributes = (self._attributes & ~style._set_attributes) | ( + style._attributes & style._set_attributes + ) + new_style._set_attributes = self._set_attributes | style._set_attributes + new_style._link = style._link or self._link + new_style._link_id = style._link_id or self._link_id + new_style._hash = style._hash + new_style._null = self._null or style._null + if self._meta and style._meta: + new_style._meta = dumps({**self.meta, **style.meta}) + else: + new_style._meta = self._meta or style._meta + return new_style + + +NULL_STYLE = Style() + + +class StyleStack: + """A stack of styles.""" + + __slots__ = ["_stack"] + + def __init__(self, default_style: "Style") -> None: + self._stack: List[Style] = [default_style] + + def __repr__(self) -> str: + return f"<stylestack {self._stack!r}>" + + @property + def current(self) -> Style: + """Get the Style at the top of the stack.""" + return self._stack[-1] + + def push(self, style: Style) -> None: + """Push a new style on to the stack. + + Args: + style (Style): New style to combine with current style. + """ + self._stack.append(self._stack[-1] + style) + + def pop(self) -> Style: + """Pop last style and discard. + + Returns: + Style: New current style (also available as stack.current) + """ + self._stack.pop() + return self._stack[-1] diff --git a/src/pip/_vendor/rich/styled.py b/src/pip/_vendor/rich/styled.py new file mode 100644 index 000000000..91cd0db31 --- /dev/null +++ b/src/pip/_vendor/rich/styled.py @@ -0,0 +1,42 @@ +from typing import TYPE_CHECKING + +from .measure import Measurement +from .segment import Segment +from .style import StyleType + +if TYPE_CHECKING: + from .console import Console, ConsoleOptions, RenderResult, RenderableType + + +class Styled: + """Apply a style to a renderable. + + Args: + renderable (RenderableType): Any renderable. + style (StyleType): A style to apply across the entire renderable. + """ + + def __init__(self, renderable: "RenderableType", style: "StyleType") -> None: + self.renderable = renderable + self.style = style + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + style = console.get_style(self.style) + rendered_segments = console.render(self.renderable, options) + segments = Segment.apply_style(rendered_segments, style) + return segments + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + return Measurement.get(console, options, self.renderable) + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich import print + from pip._vendor.rich.panel import Panel + + panel = Styled(Panel("hello"), "on blue") + print(panel) diff --git a/src/pip/_vendor/rich/syntax.py b/src/pip/_vendor/rich/syntax.py new file mode 100644 index 000000000..254963e91 --- /dev/null +++ b/src/pip/_vendor/rich/syntax.py @@ -0,0 +1,717 @@ +import os.path +import platform +from pip._vendor.rich.containers import Lines +import textwrap +from abc import ABC, abstractmethod +from typing import Any, Dict, Iterable, List, Optional, Set, Tuple, Type, Union + +from pip._vendor.pygments.lexers import get_lexer_by_name, guess_lexer_for_filename +from pip._vendor.pygments.style import Style as PygmentsStyle +from pip._vendor.pygments.styles import get_style_by_name +from pip._vendor.pygments.token import ( + Comment, + Error, + Generic, + Keyword, + Name, + Number, + Operator, + String, + Token, + Whitespace, +) +from pip._vendor.pygments.util import ClassNotFound + +from ._loop import loop_first +from .color import Color, blend_rgb +from .console import Console, ConsoleOptions, JustifyMethod, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style +from .text import Text + +TokenType = Tuple[str, ...] + +WINDOWS = platform.system() == "Windows" +DEFAULT_THEME = "monokai" + +# The following styles are based on https://github.com/pygments/pygments/blob/master/pygments/formatters/terminal.py +# A few modifications were made + +ANSI_LIGHT: Dict[TokenType, Style] = { + Token: Style(), + Whitespace: Style(color="white"), + Comment: Style(dim=True), + Comment.Preproc: Style(color="cyan"), + Keyword: Style(color="blue"), + Keyword.Type: Style(color="cyan"), + Operator.Word: Style(color="magenta"), + Name.Builtin: Style(color="cyan"), + Name.Function: Style(color="green"), + Name.Namespace: Style(color="cyan", underline=True), + Name.Class: Style(color="green", underline=True), + Name.Exception: Style(color="cyan"), + Name.Decorator: Style(color="magenta", bold=True), + Name.Variable: Style(color="red"), + Name.Constant: Style(color="red"), + Name.Attribute: Style(color="cyan"), + Name.Tag: Style(color="bright_blue"), + String: Style(color="yellow"), + Number: Style(color="blue"), + Generic.Deleted: Style(color="bright_red"), + Generic.Inserted: Style(color="green"), + Generic.Heading: Style(bold=True), + Generic.Subheading: Style(color="magenta", bold=True), + Generic.Prompt: Style(bold=True), + Generic.Error: Style(color="bright_red"), + Error: Style(color="red", underline=True), +} + +ANSI_DARK: Dict[TokenType, Style] = { + Token: Style(), + Whitespace: Style(color="bright_black"), + Comment: Style(dim=True), + Comment.Preproc: Style(color="bright_cyan"), + Keyword: Style(color="bright_blue"), + Keyword.Type: Style(color="bright_cyan"), + Operator.Word: Style(color="bright_magenta"), + Name.Builtin: Style(color="bright_cyan"), + Name.Function: Style(color="bright_green"), + Name.Namespace: Style(color="bright_cyan", underline=True), + Name.Class: Style(color="bright_green", underline=True), + Name.Exception: Style(color="bright_cyan"), + Name.Decorator: Style(color="bright_magenta", bold=True), + Name.Variable: Style(color="bright_red"), + Name.Constant: Style(color="bright_red"), + Name.Attribute: Style(color="bright_cyan"), + Name.Tag: Style(color="bright_blue"), + String: Style(color="yellow"), + Number: Style(color="bright_blue"), + Generic.Deleted: Style(color="bright_red"), + Generic.Inserted: Style(color="bright_green"), + Generic.Heading: Style(bold=True), + Generic.Subheading: Style(color="bright_magenta", bold=True), + Generic.Prompt: Style(bold=True), + Generic.Error: Style(color="bright_red"), + Error: Style(color="red", underline=True), +} + +RICH_SYNTAX_THEMES = {"ansi_light": ANSI_LIGHT, "ansi_dark": ANSI_DARK} + + +class SyntaxTheme(ABC): + """Base class for a syntax theme.""" + + @abstractmethod + def get_style_for_token(self, token_type: TokenType) -> Style: + """Get a style for a given Pygments token.""" + raise NotImplementedError # pragma: no cover + + @abstractmethod + def get_background_style(self) -> Style: + """Get the background color.""" + raise NotImplementedError # pragma: no cover + + +class PygmentsSyntaxTheme(SyntaxTheme): + """Syntax theme that delegates to Pygments theme.""" + + def __init__(self, theme: Union[str, Type[PygmentsStyle]]) -> None: + self._style_cache: Dict[TokenType, Style] = {} + if isinstance(theme, str): + try: + self._pygments_style_class = get_style_by_name(theme) + except ClassNotFound: + self._pygments_style_class = get_style_by_name("default") + else: + self._pygments_style_class = theme + + self._background_color = self._pygments_style_class.background_color + self._background_style = Style(bgcolor=self._background_color) + + def get_style_for_token(self, token_type: TokenType) -> Style: + """Get a style from a Pygments class.""" + try: + return self._style_cache[token_type] + except KeyError: + try: + pygments_style = self._pygments_style_class.style_for_token(token_type) + except KeyError: + style = Style.null() + else: + color = pygments_style["color"] + bgcolor = pygments_style["bgcolor"] + style = Style( + color="#" + color if color else "#000000", + bgcolor="#" + bgcolor if bgcolor else self._background_color, + bold=pygments_style["bold"], + italic=pygments_style["italic"], + underline=pygments_style["underline"], + ) + self._style_cache[token_type] = style + return style + + def get_background_style(self) -> Style: + return self._background_style + + +class ANSISyntaxTheme(SyntaxTheme): + """Syntax theme to use standard colors.""" + + def __init__(self, style_map: Dict[TokenType, Style]) -> None: + self.style_map = style_map + self._missing_style = Style.null() + self._background_style = Style.null() + self._style_cache: Dict[TokenType, Style] = {} + + def get_style_for_token(self, token_type: TokenType) -> Style: + """Look up style in the style map.""" + try: + return self._style_cache[token_type] + except KeyError: + # Styles form a hierarchy + # We need to go from most to least specific + # e.g. ("foo", "bar", "baz") to ("foo", "bar") to ("foo",) + get_style = self.style_map.get + token = tuple(token_type) + style = self._missing_style + while token: + _style = get_style(token) + if _style is not None: + style = _style + break + token = token[:-1] + self._style_cache[token_type] = style + return style + + def get_background_style(self) -> Style: + return self._background_style + + +class Syntax(JupyterMixin): + """Construct a Syntax object to render syntax highlighted code. + + Args: + code (str): Code to highlight. + lexer_name (str): Lexer to use (see https://pygments.org/docs/lexers/) + theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "monokai". + dedent (bool, optional): Enable stripping of initial whitespace. Defaults to False. + line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. + start_line (int, optional): Starting number for line numbers. Defaults to 1. + line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render. + highlight_lines (Set[int]): A set of line numbers to highlight. + code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. + tab_size (int, optional): Size of tabs. Defaults to 4. + word_wrap (bool, optional): Enable word wrapping. + background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. + indent_guides (bool, optional): Show indent guides. Defaults to False. + """ + + _pygments_style_class: Type[PygmentsStyle] + _theme: SyntaxTheme + + @classmethod + def get_theme(cls, name: Union[str, SyntaxTheme]) -> SyntaxTheme: + """Get a syntax theme instance.""" + if isinstance(name, SyntaxTheme): + return name + theme: SyntaxTheme + if name in RICH_SYNTAX_THEMES: + theme = ANSISyntaxTheme(RICH_SYNTAX_THEMES[name]) + else: + theme = PygmentsSyntaxTheme(name) + return theme + + def __init__( + self, + code: str, + lexer_name: str, + *, + theme: Union[str, SyntaxTheme] = DEFAULT_THEME, + dedent: bool = False, + line_numbers: bool = False, + start_line: int = 1, + line_range: Optional[Tuple[int, int]] = None, + highlight_lines: Optional[Set[int]] = None, + code_width: Optional[int] = None, + tab_size: int = 4, + word_wrap: bool = False, + background_color: Optional[str] = None, + indent_guides: bool = False, + ) -> None: + self.code = code + self.lexer_name = lexer_name + self.dedent = dedent + self.line_numbers = line_numbers + self.start_line = start_line + self.line_range = line_range + self.highlight_lines = highlight_lines or set() + self.code_width = code_width + self.tab_size = tab_size + self.word_wrap = word_wrap + self.background_color = background_color + self.background_style = ( + Style(bgcolor=background_color) if background_color else Style() + ) + self.indent_guides = indent_guides + + self._theme = self.get_theme(theme) + + @classmethod + def from_path( + cls, + path: str, + encoding: str = "utf-8", + theme: Union[str, SyntaxTheme] = DEFAULT_THEME, + dedent: bool = False, + line_numbers: bool = False, + line_range: Optional[Tuple[int, int]] = None, + start_line: int = 1, + highlight_lines: Optional[Set[int]] = None, + code_width: Optional[int] = None, + tab_size: int = 4, + word_wrap: bool = False, + background_color: Optional[str] = None, + indent_guides: bool = False, + ) -> "Syntax": + """Construct a Syntax object from a file. + + Args: + path (str): Path to file to highlight. + encoding (str): Encoding of file. + theme (str, optional): Color theme, aka Pygments style (see https://pygments.org/docs/styles/#getting-a-list-of-available-styles). Defaults to "emacs". + dedent (bool, optional): Enable stripping of initial whitespace. Defaults to True. + line_numbers (bool, optional): Enable rendering of line numbers. Defaults to False. + start_line (int, optional): Starting number for line numbers. Defaults to 1. + line_range (Tuple[int, int], optional): If given should be a tuple of the start and end line to render. + highlight_lines (Set[int]): A set of line numbers to highlight. + code_width: Width of code to render (not including line numbers), or ``None`` to use all available width. + tab_size (int, optional): Size of tabs. Defaults to 4. + word_wrap (bool, optional): Enable word wrapping of code. + background_color (str, optional): Optional background color, or None to use theme color. Defaults to None. + indent_guides (bool, optional): Show indent guides. Defaults to False. + + Returns: + [Syntax]: A Syntax object that may be printed to the console + """ + with open(path, "rt", encoding=encoding) as code_file: + code = code_file.read() + + lexer = None + lexer_name = "default" + try: + _, ext = os.path.splitext(path) + if ext: + extension = ext.lstrip(".").lower() + lexer = get_lexer_by_name(extension) + lexer_name = lexer.name + except ClassNotFound: + pass + + if lexer is None: + try: + lexer_name = guess_lexer_for_filename(path, code).name + except ClassNotFound: + pass + + return cls( + code, + lexer_name, + theme=theme, + dedent=dedent, + line_numbers=line_numbers, + line_range=line_range, + start_line=start_line, + highlight_lines=highlight_lines, + code_width=code_width, + tab_size=tab_size, + word_wrap=word_wrap, + background_color=background_color, + indent_guides=indent_guides, + ) + + def _get_base_style(self) -> Style: + """Get the base style.""" + default_style = self._theme.get_background_style() + self.background_style + return default_style + + def _get_token_color(self, token_type: TokenType) -> Optional[Color]: + """Get a color (if any) for the given token. + + Args: + token_type (TokenType): A token type tuple from Pygments. + + Returns: + Optional[Color]: Color from theme, or None for no color. + """ + style = self._theme.get_style_for_token(token_type) + return style.color + + def highlight( + self, code: str, line_range: Optional[Tuple[int, int]] = None + ) -> Text: + """Highlight code and return a Text instance. + + Args: + code (str): Code to highlight. + line_range(Tuple[int, int], optional): Optional line range to highlight. + + Returns: + Text: A text instance containing highlighted syntax. + """ + + base_style = self._get_base_style() + justify: JustifyMethod = ( + "default" if base_style.transparent_background else "left" + ) + + text = Text( + justify=justify, + style=base_style, + tab_size=self.tab_size, + no_wrap=not self.word_wrap, + ) + _get_theme_style = self._theme.get_style_for_token + try: + lexer = get_lexer_by_name( + self.lexer_name, + stripnl=False, + ensurenl=True, + tabsize=self.tab_size, + ) + except ClassNotFound: + text.append(code) + else: + if line_range: + # More complicated path to only stylize a portion of the code + # This speeds up further operations as there are less spans to process + line_start, line_end = line_range + + def line_tokenize() -> Iterable[Tuple[Any, str]]: + """Split tokens to one per line.""" + for token_type, token in lexer.get_tokens(code): + while token: + line_token, new_line, token = token.partition("\n") + yield token_type, line_token + new_line + + def tokens_to_spans() -> Iterable[Tuple[str, Optional[Style]]]: + """Convert tokens to spans.""" + tokens = iter(line_tokenize()) + line_no = 0 + _line_start = line_start - 1 + + # Skip over tokens until line start + while line_no < _line_start: + _token_type, token = next(tokens) + yield (token, None) + if token.endswith("\n"): + line_no += 1 + # Generate spans until line end + for token_type, token in tokens: + yield (token, _get_theme_style(token_type)) + if token.endswith("\n"): + line_no += 1 + if line_no >= line_end: + break + + text.append_tokens(tokens_to_spans()) + + else: + text.append_tokens( + (token, _get_theme_style(token_type)) + for token_type, token in lexer.get_tokens(code) + ) + if self.background_color is not None: + text.stylize(f"on {self.background_color}") + return text + + def _get_line_numbers_color(self, blend: float = 0.3) -> Color: + background_style = self._theme.get_background_style() + self.background_style + background_color = background_style.bgcolor + if background_color is None or background_color.is_system_defined: + return Color.default() + foreground_color = self._get_token_color(Token.Text) + if foreground_color is None or foreground_color.is_system_defined: + return foreground_color or Color.default() + new_color = blend_rgb( + background_color.get_truecolor(), + foreground_color.get_truecolor(), + cross_fade=blend, + ) + return Color.from_triplet(new_color) + + @property + def _numbers_column_width(self) -> int: + """Get the number of characters used to render the numbers column.""" + column_width = 0 + if self.line_numbers: + column_width = len(str(self.start_line + self.code.count("\n"))) + 2 + return column_width + + def _get_number_styles(self, console: Console) -> Tuple[Style, Style, Style]: + """Get background, number, and highlight styles for line numbers.""" + background_style = self._get_base_style() + if background_style.transparent_background: + return Style.null(), Style(dim=True), Style.null() + if console.color_system in ("256", "truecolor"): + number_style = Style.chain( + background_style, + self._theme.get_style_for_token(Token.Text), + Style(color=self._get_line_numbers_color()), + self.background_style, + ) + highlight_number_style = Style.chain( + background_style, + self._theme.get_style_for_token(Token.Text), + Style(bold=True, color=self._get_line_numbers_color(0.9)), + self.background_style, + ) + else: + number_style = background_style + Style(dim=True) + highlight_number_style = background_style + Style(dim=False) + return background_style, number_style, highlight_number_style + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + if self.code_width is not None: + width = self.code_width + self._numbers_column_width + return Measurement(self._numbers_column_width, width) + return Measurement(self._numbers_column_width, options.max_width) + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + + transparent_background = self._get_base_style().transparent_background + code_width = ( + ( + (options.max_width - self._numbers_column_width - 1) + if self.line_numbers + else options.max_width + ) + if self.code_width is None + else self.code_width + ) + + line_offset = 0 + if self.line_range: + start_line, end_line = self.line_range + line_offset = max(0, start_line - 1) + + ends_on_nl = self.code.endswith("\n") + code = self.code if ends_on_nl else self.code + "\n" + code = textwrap.dedent(code) if self.dedent else code + code = code.expandtabs(self.tab_size) + text = self.highlight(code, self.line_range) + + ( + background_style, + number_style, + highlight_number_style, + ) = self._get_number_styles(console) + + if not self.line_numbers and not self.word_wrap and not self.line_range: + if not ends_on_nl: + text.remove_suffix("\n") + # Simple case of just rendering text + style = ( + self._get_base_style() + + self._theme.get_style_for_token(Comment) + + Style(dim=True) + + self.background_style + ) + if self.indent_guides and not options.ascii_only: + text = text.with_indent_guides(self.tab_size, style=style) + text.overflow = "crop" + if style.transparent_background: + yield from console.render( + text, options=options.update(width=code_width) + ) + else: + syntax_lines = console.render_lines( + text, + options.update(width=code_width, height=None), + style=self.background_style, + pad=True, + new_lines=True, + ) + for syntax_line in syntax_lines: + yield from syntax_line + return + + lines: Union[List[Text], Lines] = text.split("\n", allow_blank=ends_on_nl) + if self.line_range: + lines = lines[line_offset:end_line] + + if self.indent_guides and not options.ascii_only: + style = ( + self._get_base_style() + + self._theme.get_style_for_token(Comment) + + Style(dim=True) + + self.background_style + ) + lines = ( + Text("\n") + .join(lines) + .with_indent_guides(self.tab_size, style=style) + .split("\n", allow_blank=True) + ) + + numbers_column_width = self._numbers_column_width + render_options = options.update(width=code_width) + + highlight_line = self.highlight_lines.__contains__ + _Segment = Segment + padding = _Segment(" " * numbers_column_width + " ", background_style) + new_line = _Segment("\n") + + line_pointer = "> " if options.legacy_windows else "❱ " + + for line_no, line in enumerate(lines, self.start_line + line_offset): + if self.word_wrap: + wrapped_lines = console.render_lines( + line, + render_options.update(height=None), + style=background_style, + pad=not transparent_background, + ) + + else: + segments = list(line.render(console, end="")) + if options.no_wrap: + wrapped_lines = [segments] + else: + wrapped_lines = [ + _Segment.adjust_line_length( + segments, + render_options.max_width, + style=background_style, + pad=not transparent_background, + ) + ] + if self.line_numbers: + for first, wrapped_line in loop_first(wrapped_lines): + if first: + line_column = str(line_no).rjust(numbers_column_width - 2) + " " + if highlight_line(line_no): + yield _Segment(line_pointer, Style(color="red")) + yield _Segment(line_column, highlight_number_style) + else: + yield _Segment(" ", highlight_number_style) + yield _Segment(line_column, number_style) + else: + yield padding + yield from wrapped_line + yield new_line + else: + for wrapped_line in wrapped_lines: + yield from wrapped_line + yield new_line + + +if __name__ == "__main__": # pragma: no cover + + import argparse + import sys + + parser = argparse.ArgumentParser( + description="Render syntax to the console with Rich" + ) + parser.add_argument( + "path", + metavar="PATH", + help="path to file, or - for stdin", + ) + parser.add_argument( + "-c", + "--force-color", + dest="force_color", + action="store_true", + default=None, + help="force color for non-terminals", + ) + parser.add_argument( + "-i", + "--indent-guides", + dest="indent_guides", + action="store_true", + default=False, + help="display indent guides", + ) + parser.add_argument( + "-l", + "--line-numbers", + dest="line_numbers", + action="store_true", + help="render line numbers", + ) + parser.add_argument( + "-w", + "--width", + type=int, + dest="width", + default=None, + help="width of output (default will auto-detect)", + ) + parser.add_argument( + "-r", + "--wrap", + dest="word_wrap", + action="store_true", + default=False, + help="word wrap long lines", + ) + parser.add_argument( + "-s", + "--soft-wrap", + action="store_true", + dest="soft_wrap", + default=False, + help="enable soft wrapping mode", + ) + parser.add_argument( + "-t", "--theme", dest="theme", default="monokai", help="pygments theme" + ) + parser.add_argument( + "-b", + "--background-color", + dest="background_color", + default=None, + help="Override background color", + ) + parser.add_argument( + "-x", + "--lexer", + default="default", + dest="lexer_name", + help="Lexer name", + ) + args = parser.parse_args() + + from pip._vendor.rich.console import Console + + console = Console(force_terminal=args.force_color, width=args.width) + + if args.path == "-": + code = sys.stdin.read() + syntax = Syntax( + code=code, + lexer_name=args.lexer_name, + line_numbers=args.line_numbers, + word_wrap=args.word_wrap, + theme=args.theme, + background_color=args.background_color, + indent_guides=args.indent_guides, + ) + else: + syntax = Syntax.from_path( + args.path, + line_numbers=args.line_numbers, + word_wrap=args.word_wrap, + theme=args.theme, + background_color=args.background_color, + indent_guides=args.indent_guides, + ) + console.print(syntax, soft_wrap=args.soft_wrap) diff --git a/src/pip/_vendor/rich/table.py b/src/pip/_vendor/rich/table.py new file mode 100644 index 000000000..554ff4013 --- /dev/null +++ b/src/pip/_vendor/rich/table.py @@ -0,0 +1,919 @@ +from dataclasses import dataclass, field, replace +from typing import ( + Dict, + TYPE_CHECKING, + Iterable, + List, + NamedTuple, + Optional, + Sequence, + Tuple, + Union, +) + +from . import box, errors +from ._loop import loop_first_last, loop_last +from ._pick import pick_bool +from ._ratio import ratio_distribute, ratio_reduce +from .jupyter import JupyterMixin +from .measure import Measurement +from .padding import Padding, PaddingDimensions +from .protocol import is_renderable +from .segment import Segment +from .style import Style, StyleType +from .text import Text, TextType + +if TYPE_CHECKING: + from .console import ( + Console, + ConsoleOptions, + JustifyMethod, + OverflowMethod, + RenderableType, + RenderResult, + ) + + +@dataclass +class Column: + """Defines a column in a table.""" + + header: "RenderableType" = "" + """RenderableType: Renderable for the header (typically a string)""" + + footer: "RenderableType" = "" + """RenderableType: Renderable for the footer (typically a string)""" + + header_style: StyleType = "" + """StyleType: The style of the header.""" + + footer_style: StyleType = "" + """StyleType: The style of the footer.""" + + style: StyleType = "" + """StyleType: The style of the column.""" + + justify: "JustifyMethod" = "left" + """str: How to justify text within the column ("left", "center", "right", or "full")""" + + overflow: "OverflowMethod" = "ellipsis" + """str: Overflow method.""" + + width: Optional[int] = None + """Optional[int]: Width of the column, or ``None`` (default) to auto calculate width.""" + + min_width: Optional[int] = None + """Optional[int]: Minimum width of column, or ``None`` for no minimum. Defaults to None.""" + + max_width: Optional[int] = None + """Optional[int]: Maximum width of column, or ``None`` for no maximum. Defaults to None.""" + + ratio: Optional[int] = None + """Optional[int]: Ratio to use when calculating column width, or ``None`` (default) to adapt to column contents.""" + + no_wrap: bool = False + """bool: Prevent wrapping of text within the column. Defaults to ``False``.""" + + _index: int = 0 + """Index of column.""" + + _cells: List["RenderableType"] = field(default_factory=list) + + def copy(self) -> "Column": + """Return a copy of this Column.""" + return replace(self, _cells=[]) + + @property + def cells(self) -> Iterable["RenderableType"]: + """Get all cells in the column, not including header.""" + yield from self._cells + + @property + def flexible(self) -> bool: + """Check if this column is flexible.""" + return self.ratio is not None + + +@dataclass +class Row: + """Information regarding a row.""" + + style: Optional[StyleType] = None + """Style to apply to row.""" + + end_section: bool = False + """Indicated end of section, which will force a line beneath the row.""" + + +class _Cell(NamedTuple): + """A single cell in a table.""" + + style: StyleType + """Style to apply to cell.""" + renderable: "RenderableType" + """Cell renderable.""" + + +class Table(JupyterMixin): + """A console renderable to draw a table. + + Args: + *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. + title (Union[str, Text], optional): The title of the table rendered at the top. Defaults to None. + caption (Union[str, Text], optional): The table caption rendered below. Defaults to None. + width (int, optional): The width in characters of the table, or ``None`` to automatically fit. Defaults to None. + min_width (Optional[int], optional): The minimum width of the table, or ``None`` for no minimum. Defaults to None. + box (box.Box, optional): One of the constants in box.py used to draw the edges (see :ref:`appendix_box`), or ``None`` for no box lines. Defaults to box.HEAVY_HEAD. + safe_box (Optional[bool], optional): Disable box characters that don't display on windows legacy terminal with *raster* fonts. Defaults to True. + padding (PaddingDimensions, optional): Padding for cells (top, right, bottom, left). Defaults to (0, 1). + collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to False. + pad_edge (bool, optional): Enable padding of edge cells. Defaults to True. + expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. + show_header (bool, optional): Show a header row. Defaults to True. + show_footer (bool, optional): Show a footer row. Defaults to False. + show_edge (bool, optional): Draw a box around the outside of the table. Defaults to True. + show_lines (bool, optional): Draw lines between every row. Defaults to False. + leading (bool, optional): Number of blank lines between rows (precludes ``show_lines``). Defaults to 0. + style (Union[str, Style], optional): Default style for the table. Defaults to "none". + row_styles (List[Union, str], optional): Optional list of row styles, if more than one style is given then the styles will alternate. Defaults to None. + header_style (Union[str, Style], optional): Style of the header. Defaults to "table.header". + footer_style (Union[str, Style], optional): Style of the footer. Defaults to "table.footer". + border_style (Union[str, Style], optional): Style of the border. Defaults to None. + title_style (Union[str, Style], optional): Style of the title. Defaults to None. + caption_style (Union[str, Style], optional): Style of the caption. Defaults to None. + title_justify (str, optional): Justify method for title. Defaults to "center". + caption_justify (str, optional): Justify method for caption. Defaults to "center". + highlight (bool, optional): Highlight cell contents (if str). Defaults to False. + """ + + columns: List[Column] + rows: List[Row] + + def __init__( + self, + *headers: Union[Column, str], + title: Optional[TextType] = None, + caption: Optional[TextType] = None, + width: Optional[int] = None, + min_width: Optional[int] = None, + box: Optional[box.Box] = box.HEAVY_HEAD, + safe_box: Optional[bool] = None, + padding: PaddingDimensions = (0, 1), + collapse_padding: bool = False, + pad_edge: bool = True, + expand: bool = False, + show_header: bool = True, + show_footer: bool = False, + show_edge: bool = True, + show_lines: bool = False, + leading: int = 0, + style: StyleType = "none", + row_styles: Optional[Iterable[StyleType]] = None, + header_style: Optional[StyleType] = "table.header", + footer_style: Optional[StyleType] = "table.footer", + border_style: Optional[StyleType] = None, + title_style: Optional[StyleType] = None, + caption_style: Optional[StyleType] = None, + title_justify: "JustifyMethod" = "center", + caption_justify: "JustifyMethod" = "center", + highlight: bool = False, + ) -> None: + + self.columns: List[Column] = [] + self.rows: List[Row] = [] + self.title = title + self.caption = caption + self.width = width + self.min_width = min_width + self.box = box + self.safe_box = safe_box + self._padding = Padding.unpack(padding) + self.pad_edge = pad_edge + self._expand = expand + self.show_header = show_header + self.show_footer = show_footer + self.show_edge = show_edge + self.show_lines = show_lines + self.leading = leading + self.collapse_padding = collapse_padding + self.style = style + self.header_style = header_style or "" + self.footer_style = footer_style or "" + self.border_style = border_style + self.title_style = title_style + self.caption_style = caption_style + self.title_justify: "JustifyMethod" = title_justify + self.caption_justify: "JustifyMethod" = caption_justify + self.highlight = highlight + self.row_styles: Sequence[StyleType] = list(row_styles or []) + append_column = self.columns.append + for header in headers: + if isinstance(header, str): + self.add_column(header=header) + else: + header._index = len(self.columns) + append_column(header) + + @classmethod + def grid( + cls, + *headers: Union[Column, str], + padding: PaddingDimensions = 0, + collapse_padding: bool = True, + pad_edge: bool = False, + expand: bool = False, + ) -> "Table": + """Get a table with no lines, headers, or footer. + + Args: + *headers (Union[Column, str]): Column headers, either as a string, or :class:`~rich.table.Column` instance. + padding (PaddingDimensions, optional): Get padding around cells. Defaults to 0. + collapse_padding (bool, optional): Enable collapsing of padding around cells. Defaults to True. + pad_edge (bool, optional): Enable padding around edges of table. Defaults to False. + expand (bool, optional): Expand the table to fit the available space if ``True``, otherwise the table width will be auto-calculated. Defaults to False. + + Returns: + Table: A table instance. + """ + return cls( + *headers, + box=None, + padding=padding, + collapse_padding=collapse_padding, + show_header=False, + show_footer=False, + show_edge=False, + pad_edge=pad_edge, + expand=expand, + ) + + @property + def expand(self) -> bool: + """Setting a non-None self.width implies expand.""" + return self._expand or self.width is not None + + @expand.setter + def expand(self, expand: bool) -> None: + """Set expand.""" + self._expand = expand + + @property + def _extra_width(self) -> int: + """Get extra width to add to cell content.""" + width = 0 + if self.box and self.show_edge: + width += 2 + if self.box: + width += len(self.columns) - 1 + return width + + @property + def row_count(self) -> int: + """Get the current number of rows.""" + return len(self.rows) + + def get_row_style(self, console: "Console", index: int) -> StyleType: + """Get the current row style.""" + style = Style.null() + if self.row_styles: + style += console.get_style(self.row_styles[index % len(self.row_styles)]) + row_style = self.rows[index].style + if row_style is not None: + style += console.get_style(row_style) + return style + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + max_width = options.max_width + if self.width is not None: + max_width = self.width + if max_width < 0: + return Measurement(0, 0) + + extra_width = self._extra_width + max_width = sum( + self._calculate_column_widths( + console, options.update_width(max_width - extra_width) + ) + ) + _measure_column = self._measure_column + + measurements = [ + _measure_column(console, options.update_width(max_width), column) + for column in self.columns + ] + minimum_width = ( + sum(measurement.minimum for measurement in measurements) + extra_width + ) + maximum_width = ( + sum(measurement.maximum for measurement in measurements) + extra_width + if (self.width is None) + else self.width + ) + measurement = Measurement(minimum_width, maximum_width) + measurement = measurement.clamp(self.min_width) + return measurement + + @property + def padding(self) -> Tuple[int, int, int, int]: + """Get cell padding.""" + return self._padding + + @padding.setter + def padding(self, padding: PaddingDimensions) -> "Table": + """Set cell padding.""" + self._padding = Padding.unpack(padding) + return self + + def add_column( + self, + header: "RenderableType" = "", + footer: "RenderableType" = "", + *, + header_style: Optional[StyleType] = None, + footer_style: Optional[StyleType] = None, + style: Optional[StyleType] = None, + justify: "JustifyMethod" = "left", + overflow: "OverflowMethod" = "ellipsis", + width: Optional[int] = None, + min_width: Optional[int] = None, + max_width: Optional[int] = None, + ratio: Optional[int] = None, + no_wrap: bool = False, + ) -> None: + """Add a column to the table. + + Args: + header (RenderableType, optional): Text or renderable for the header. + Defaults to "". + footer (RenderableType, optional): Text or renderable for the footer. + Defaults to "". + header_style (Union[str, Style], optional): Style for the header, or None for default. Defaults to None. + footer_style (Union[str, Style], optional): Style for the footer, or None for default. Defaults to None. + style (Union[str, Style], optional): Style for the column cells, or None for default. Defaults to None. + justify (JustifyMethod, optional): Alignment for cells. Defaults to "left". + overflow (OverflowMethod): Overflow method: "crop", "fold", "ellipsis". Defaults to "ellipsis". + width (int, optional): Desired width of column in characters, or None to fit to contents. Defaults to None. + min_width (Optional[int], optional): Minimum width of column, or ``None`` for no minimum. Defaults to None. + max_width (Optional[int], optional): Maximum width of column, or ``None`` for no maximum. Defaults to None. + ratio (int, optional): Flexible ratio for the column (requires ``Table.expand`` or ``Table.width``). Defaults to None. + no_wrap (bool, optional): Set to ``True`` to disable wrapping of this column. + """ + + column = Column( + _index=len(self.columns), + header=header, + footer=footer, + header_style=header_style or "", + footer_style=footer_style or "", + style=style or "", + justify=justify, + overflow=overflow, + width=width, + min_width=min_width, + max_width=max_width, + ratio=ratio, + no_wrap=no_wrap, + ) + self.columns.append(column) + + def add_row( + self, + *renderables: Optional["RenderableType"], + style: Optional[StyleType] = None, + end_section: bool = False, + ) -> None: + """Add a row of renderables. + + Args: + *renderables (None or renderable): Each cell in a row must be a renderable object (including str), + or ``None`` for a blank cell. + style (StyleType, optional): An optional style to apply to the entire row. Defaults to None. + end_section (bool, optional): End a section and draw a line. Defaults to False. + + Raises: + errors.NotRenderableError: If you add something that can't be rendered. + """ + + def add_cell(column: Column, renderable: "RenderableType") -> None: + column._cells.append(renderable) + + cell_renderables: List[Optional["RenderableType"]] = list(renderables) + + columns = self.columns + if len(cell_renderables) < len(columns): + cell_renderables = [ + *cell_renderables, + *[None] * (len(columns) - len(cell_renderables)), + ] + for index, renderable in enumerate(cell_renderables): + if index == len(columns): + column = Column(_index=index) + for _ in self.rows: + add_cell(column, Text("")) + self.columns.append(column) + else: + column = columns[index] + if renderable is None: + add_cell(column, "") + elif is_renderable(renderable): + add_cell(column, renderable) + else: + raise errors.NotRenderableError( + f"unable to render {type(renderable).__name__}; a string or other renderable object is required" + ) + self.rows.append(Row(style=style, end_section=end_section)) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + + if not self.columns: + yield Segment("\n") + return + + max_width = options.max_width + if self.width is not None: + max_width = self.width + + extra_width = self._extra_width + widths = self._calculate_column_widths( + console, options.update_width(max_width - extra_width) + ) + table_width = sum(widths) + extra_width + + render_options = options.update( + width=table_width, highlight=self.highlight, height=None + ) + + def render_annotation( + text: TextType, style: StyleType, justify: "JustifyMethod" = "center" + ) -> "RenderResult": + render_text = ( + console.render_str(text, style=style, highlight=False) + if isinstance(text, str) + else text + ) + return console.render( + render_text, options=render_options.update(justify=justify) + ) + + if self.title: + yield from render_annotation( + self.title, + style=Style.pick_first(self.title_style, "table.title"), + justify=self.title_justify, + ) + yield from self._render(console, render_options, widths) + if self.caption: + yield from render_annotation( + self.caption, + style=Style.pick_first(self.caption_style, "table.caption"), + justify=self.caption_justify, + ) + + def _calculate_column_widths( + self, console: "Console", options: "ConsoleOptions" + ) -> List[int]: + """Calculate the widths of each column, including padding, not including borders.""" + max_width = options.max_width + columns = self.columns + width_ranges = [ + self._measure_column(console, options, column) for column in columns + ] + widths = [_range.maximum or 1 for _range in width_ranges] + get_padding_width = self._get_padding_width + extra_width = self._extra_width + if self.expand: + ratios = [col.ratio or 0 for col in columns if col.flexible] + if any(ratios): + fixed_widths = [ + 0 if column.flexible else _range.maximum + for _range, column in zip(width_ranges, columns) + ] + flex_minimum = [ + (column.width or 1) + get_padding_width(column._index) + for column in columns + if column.flexible + ] + flexible_width = max_width - sum(fixed_widths) + flex_widths = ratio_distribute(flexible_width, ratios, flex_minimum) + iter_flex_widths = iter(flex_widths) + for index, column in enumerate(columns): + if column.flexible: + widths[index] = fixed_widths[index] + next(iter_flex_widths) + table_width = sum(widths) + + if table_width > max_width: + widths = self._collapse_widths( + widths, + [(column.width is None and not column.no_wrap) for column in columns], + max_width, + ) + table_width = sum(widths) + # last resort, reduce columns evenly + if table_width > max_width: + excess_width = table_width - max_width + widths = ratio_reduce(excess_width, [1] * len(widths), widths, widths) + table_width = sum(widths) + + width_ranges = [ + self._measure_column(console, options.update_width(width), column) + for width, column in zip(widths, columns) + ] + widths = [_range.maximum or 0 for _range in width_ranges] + + if (table_width < max_width and self.expand) or ( + self.min_width is not None and table_width < (self.min_width - extra_width) + ): + _max_width = ( + max_width + if self.min_width is None + else min(self.min_width - extra_width, max_width) + ) + pad_widths = ratio_distribute(_max_width - table_width, widths) + widths = [_width + pad for _width, pad in zip(widths, pad_widths)] + + return widths + + @classmethod + def _collapse_widths( + cls, widths: List[int], wrapable: List[bool], max_width: int + ) -> List[int]: + """Reduce widths so that the total is under max_width. + + Args: + widths (List[int]): List of widths. + wrapable (List[bool]): List of booleans that indicate if a column may shrink. + max_width (int): Maximum width to reduce to. + + Returns: + List[int]: A new list of widths. + """ + total_width = sum(widths) + excess_width = total_width - max_width + if any(wrapable): + while total_width and excess_width > 0: + max_column = max( + width for width, allow_wrap in zip(widths, wrapable) if allow_wrap + ) + second_max_column = max( + width if allow_wrap and width != max_column else 0 + for width, allow_wrap in zip(widths, wrapable) + ) + column_difference = max_column - second_max_column + ratios = [ + (1 if (width == max_column and allow_wrap) else 0) + for width, allow_wrap in zip(widths, wrapable) + ] + if not any(ratios) or not column_difference: + break + max_reduce = [min(excess_width, column_difference)] * len(widths) + widths = ratio_reduce(excess_width, ratios, max_reduce, widths) + + total_width = sum(widths) + excess_width = total_width - max_width + return widths + + def _get_cells( + self, console: "Console", column_index: int, column: Column + ) -> Iterable[_Cell]: + """Get all the cells with padding and optional header.""" + + collapse_padding = self.collapse_padding + pad_edge = self.pad_edge + padding = self.padding + any_padding = any(padding) + + first_column = column_index == 0 + last_column = column_index == len(self.columns) - 1 + + _padding_cache: Dict[Tuple[bool, bool], Tuple[int, int, int, int]] = {} + + def get_padding(first_row: bool, last_row: bool) -> Tuple[int, int, int, int]: + cached = _padding_cache.get((first_row, last_row)) + if cached: + return cached + top, right, bottom, left = padding + + if collapse_padding: + if not first_column: + left = max(0, left - right) + if not last_row: + bottom = max(0, top - bottom) + + if not pad_edge: + if first_column: + left = 0 + if last_column: + right = 0 + if first_row: + top = 0 + if last_row: + bottom = 0 + _padding = (top, right, bottom, left) + _padding_cache[(first_row, last_row)] = _padding + return _padding + + raw_cells: List[Tuple[StyleType, "RenderableType"]] = [] + _append = raw_cells.append + get_style = console.get_style + if self.show_header: + header_style = get_style(self.header_style or "") + get_style( + column.header_style + ) + _append((header_style, column.header)) + cell_style = get_style(column.style or "") + for cell in column.cells: + _append((cell_style, cell)) + if self.show_footer: + footer_style = get_style(self.footer_style or "") + get_style( + column.footer_style + ) + _append((footer_style, column.footer)) + + if any_padding: + _Padding = Padding + for first, last, (style, renderable) in loop_first_last(raw_cells): + yield _Cell(style, _Padding(renderable, get_padding(first, last))) + else: + for (style, renderable) in raw_cells: + yield _Cell(style, renderable) + + def _get_padding_width(self, column_index: int) -> int: + """Get extra width from padding.""" + _, pad_right, _, pad_left = self.padding + if self.collapse_padding: + if column_index > 0: + pad_left = max(0, pad_left - pad_right) + return pad_left + pad_right + + def _measure_column( + self, + console: "Console", + options: "ConsoleOptions", + column: Column, + ) -> Measurement: + """Get the minimum and maximum width of the column.""" + + max_width = options.max_width + if max_width < 1: + return Measurement(0, 0) + + padding_width = self._get_padding_width(column._index) + + if column.width is not None: + # Fixed width column + return Measurement( + column.width + padding_width, column.width + padding_width + ).with_maximum(max_width) + # Flexible column, we need to measure contents + min_widths: List[int] = [] + max_widths: List[int] = [] + append_min = min_widths.append + append_max = max_widths.append + get_render_width = Measurement.get + for cell in self._get_cells(console, column._index, column): + _min, _max = get_render_width(console, options, cell.renderable) + append_min(_min) + append_max(_max) + + measurement = Measurement( + max(min_widths) if min_widths else 1, + max(max_widths) if max_widths else max_width, + ).with_maximum(max_width) + measurement = measurement.clamp( + None if column.min_width is None else column.min_width + padding_width, + None if column.max_width is None else column.max_width + padding_width, + ) + return measurement + + def _render( + self, console: "Console", options: "ConsoleOptions", widths: List[int] + ) -> "RenderResult": + table_style = console.get_style(self.style or "") + + border_style = table_style + console.get_style(self.border_style or "") + _column_cells = ( + self._get_cells(console, column_index, column) + for column_index, column in enumerate(self.columns) + ) + row_cells: List[Tuple[_Cell, ...]] = list(zip(*_column_cells)) + _box = ( + self.box.substitute( + options, safe=pick_bool(self.safe_box, console.safe_box) + ) + if self.box + else None + ) + + # _box = self.box + new_line = Segment.line() + + columns = self.columns + show_header = self.show_header + show_footer = self.show_footer + show_edge = self.show_edge + show_lines = self.show_lines + leading = self.leading + + _Segment = Segment + if _box: + box_segments = [ + ( + _Segment(_box.head_left, border_style), + _Segment(_box.head_right, border_style), + _Segment(_box.head_vertical, border_style), + ), + ( + _Segment(_box.foot_left, border_style), + _Segment(_box.foot_right, border_style), + _Segment(_box.foot_vertical, border_style), + ), + ( + _Segment(_box.mid_left, border_style), + _Segment(_box.mid_right, border_style), + _Segment(_box.mid_vertical, border_style), + ), + ] + if show_edge: + yield _Segment(_box.get_top(widths), border_style) + yield new_line + else: + box_segments = [] + + get_row_style = self.get_row_style + get_style = console.get_style + + for index, (first, last, row_cell) in enumerate(loop_first_last(row_cells)): + header_row = first and show_header + footer_row = last and show_footer + row = ( + self.rows[index - show_header] + if (not header_row and not footer_row) + else None + ) + max_height = 1 + cells: List[List[List[Segment]]] = [] + if header_row or footer_row: + row_style = Style.null() + else: + row_style = get_style( + get_row_style(console, index - 1 if show_header else index) + ) + for width, cell, column in zip(widths, row_cell, columns): + render_options = options.update( + width=width, + justify=column.justify, + no_wrap=column.no_wrap, + overflow=column.overflow, + height=None, + ) + cell_style = table_style + row_style + get_style(cell.style) + lines = console.render_lines( + cell.renderable, render_options, style=cell_style + ) + max_height = max(max_height, len(lines)) + cells.append(lines) + + cells[:] = [ + _Segment.set_shape( + _cell, width, max_height, style=table_style + row_style + ) + for width, _cell in zip(widths, cells) + ] + + if _box: + if last and show_footer: + yield _Segment( + _box.get_row(widths, "foot", edge=show_edge), border_style + ) + yield new_line + left, right, _divider = box_segments[0 if first else (2 if last else 1)] + + # If the column divider is whitespace also style it with the row background + divider = ( + _divider + if _divider.text.strip() + else _Segment( + _divider.text, row_style.background_style + _divider.style + ) + ) + for line_no in range(max_height): + if show_edge: + yield left + for last_cell, rendered_cell in loop_last(cells): + yield from rendered_cell[line_no] + if not last_cell: + yield divider + if show_edge: + yield right + yield new_line + else: + for line_no in range(max_height): + for rendered_cell in cells: + yield from rendered_cell[line_no] + yield new_line + if _box and first and show_header: + yield _Segment( + _box.get_row(widths, "head", edge=show_edge), border_style + ) + yield new_line + end_section = row and row.end_section + if _box and (show_lines or leading or end_section): + if ( + not last + and not (show_footer and index >= len(row_cells) - 2) + and not (show_header and header_row) + ): + if leading: + yield _Segment( + _box.get_row(widths, "mid", edge=show_edge) * leading, + border_style, + ) + else: + yield _Segment( + _box.get_row(widths, "row", edge=show_edge), border_style + ) + yield new_line + + if _box and show_edge: + yield _Segment(_box.get_bottom(widths), border_style) + yield new_line + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + from pip._vendor.rich.highlighter import ReprHighlighter + from pip._vendor.rich.table import Table as Table + + table = Table( + title="Star Wars Movies", + caption="Rich example table", + caption_justify="right", + ) + + table.add_column("Released", header_style="bright_cyan", style="cyan", no_wrap=True) + table.add_column("Title", style="magenta") + table.add_column("Box Office", justify="right", style="green") + + table.add_row( + "Dec 20, 2019", + "Star Wars: The Rise of Skywalker", + "$952,110,690", + ) + table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") + table.add_row( + "Dec 15, 2017", + "Star Wars Ep. V111: The Last Jedi", + "$1,332,539,889", + style="on black", + end_section=True, + ) + table.add_row( + "Dec 16, 2016", + "Rogue One: A Star Wars Story", + "$1,332,439,889", + ) + + def header(text: str) -> None: + console.print() + console.rule(highlight(text)) + console.print() + + console = Console() + highlight = ReprHighlighter() + header("Example Table") + console.print(table, justify="center") + + table.expand = True + header("expand=True") + console.print(table) + + table.width = 50 + header("width=50") + + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + header("row_styles=['dim', 'none']") + + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + table.leading = 1 + header("leading=1, row_styles=['dim', 'none']") + console.print(table, justify="center") + + table.width = None + table.expand = False + table.row_styles = ["dim", "none"] + table.show_lines = True + table.leading = 0 + header("show_lines=True, row_styles=['dim', 'none']") + console.print(table, justify="center") diff --git a/src/pip/_vendor/rich/tabulate.py b/src/pip/_vendor/rich/tabulate.py new file mode 100644 index 000000000..6889f2d33 --- /dev/null +++ b/src/pip/_vendor/rich/tabulate.py @@ -0,0 +1,51 @@ +from collections.abc import Mapping +from typing import Any, Optional +import warnings + +from pip._vendor.rich.console import JustifyMethod + +from . import box +from .highlighter import ReprHighlighter +from .pretty import Pretty +from .table import Table + + +def tabulate_mapping( + mapping: "Mapping[Any, Any]", + title: Optional[str] = None, + caption: Optional[str] = None, + title_justify: Optional[JustifyMethod] = None, + caption_justify: Optional[JustifyMethod] = None, +) -> Table: + """Generate a simple table from a mapping. + + Args: + mapping (Mapping): A mapping object (e.g. a dict); + title (str, optional): Optional title to be displayed over the table. + caption (str, optional): Optional caption to be displayed below the table. + title_justify (str, optional): Justify method for title. Defaults to None. + caption_justify (str, optional): Justify method for caption. Defaults to None. + + Returns: + Table: A table instance which may be rendered by the Console. + """ + warnings.warn("tabulate_mapping will be deprecated in Rich v11", DeprecationWarning) + table = Table( + show_header=False, + title=title, + caption=caption, + box=box.ROUNDED, + border_style="blue", + ) + table.title = title + table.caption = caption + if title_justify is not None: + table.title_justify = title_justify + if caption_justify is not None: + table.caption_justify = caption_justify + highlighter = ReprHighlighter() + for key, value in mapping.items(): + table.add_row( + Pretty(key, highlighter=highlighter), Pretty(value, highlighter=highlighter) + ) + return table diff --git a/src/pip/_vendor/rich/terminal_theme.py b/src/pip/_vendor/rich/terminal_theme.py new file mode 100644 index 000000000..801ac0b7b --- /dev/null +++ b/src/pip/_vendor/rich/terminal_theme.py @@ -0,0 +1,55 @@ +from typing import List, Optional, Tuple + +from .color_triplet import ColorTriplet +from .palette import Palette + +_ColorTuple = Tuple[int, int, int] + + +class TerminalTheme: + """A color theme used when exporting console content. + + Args: + background (Tuple[int, int, int]): The background color. + foreground (Tuple[int, int, int]): The foreground (text) color. + normal (List[Tuple[int, int, int]]): A list of 8 normal intensity colors. + bright (List[Tuple[int, int, int]], optional): A list of 8 bright colors, or None + to repeat normal intensity. Defaults to None. + """ + + def __init__( + self, + background: _ColorTuple, + foreground: _ColorTuple, + normal: List[_ColorTuple], + bright: Optional[List[_ColorTuple]] = None, + ) -> None: + self.background_color = ColorTriplet(*background) + self.foreground_color = ColorTriplet(*foreground) + self.ansi_colors = Palette(normal + (bright or normal)) + + +DEFAULT_TERMINAL_THEME = TerminalTheme( + (255, 255, 255), + (0, 0, 0), + [ + (0, 0, 0), + (128, 0, 0), + (0, 128, 0), + (128, 128, 0), + (0, 0, 128), + (128, 0, 128), + (0, 128, 128), + (192, 192, 192), + ], + [ + (128, 128, 128), + (255, 0, 0), + (0, 255, 0), + (255, 255, 0), + (0, 0, 255), + (255, 0, 255), + (0, 255, 255), + (255, 255, 255), + ], +) diff --git a/src/pip/_vendor/rich/text.py b/src/pip/_vendor/rich/text.py new file mode 100644 index 000000000..0ea6da5fe --- /dev/null +++ b/src/pip/_vendor/rich/text.py @@ -0,0 +1,1196 @@ +import re +from functools import partial, reduce +from math import gcd +from operator import attrgetter, itemgetter +from pip._vendor.rich.emoji import EmojiVariant +from typing import ( + TYPE_CHECKING, + Any, + Callable, + Dict, + Iterable, + List, + NamedTuple, + Optional, + Tuple, + Union, +) + +from ._loop import loop_last +from ._pick import pick_bool +from ._wrap import divide_line +from .align import AlignMethod +from .cells import cell_len, set_cell_size +from .containers import Lines +from .control import strip_control_codes +from .emoji import EmojiVariant +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleType + +if TYPE_CHECKING: # pragma: no cover + from .console import Console, ConsoleOptions, JustifyMethod, OverflowMethod + +DEFAULT_JUSTIFY: "JustifyMethod" = "default" +DEFAULT_OVERFLOW: "OverflowMethod" = "fold" + + +_re_whitespace = re.compile(r"\s+$") + +TextType = Union[str, "Text"] + +GetStyleCallable = Callable[[str], Optional[StyleType]] + + +class Span(NamedTuple): + """A marked up region in some text.""" + + start: int + """Span start index.""" + end: int + """Span end index.""" + style: Union[str, Style] + """Style associated with the span.""" + + def __repr__(self) -> str: + return ( + f"Span({self.start}, {self.end}, {self.style!r})" + if (isinstance(self.style, Style) and self.style._meta) + else f"Span({self.start}, {self.end}, {str(self.style)!r})" + ) + + def __bool__(self) -> bool: + return self.end > self.start + + def split(self, offset: int) -> Tuple["Span", Optional["Span"]]: + """Split a span in to 2 from a given offset.""" + + if offset < self.start: + return self, None + if offset >= self.end: + return self, None + + start, end, style = self + span1 = Span(start, min(end, offset), style) + span2 = Span(span1.end, end, style) + return span1, span2 + + def move(self, offset: int) -> "Span": + """Move start and end by a given offset. + + Args: + offset (int): Number of characters to add to start and end. + + Returns: + TextSpan: A new TextSpan with adjusted position. + """ + start, end, style = self + return Span(start + offset, end + offset, style) + + def right_crop(self, offset: int) -> "Span": + """Crop the span at the given offset. + + Args: + offset (int): A value between start and end. + + Returns: + Span: A new (possibly smaller) span. + """ + start, end, style = self + if offset >= end: + return self + return Span(start, min(offset, end), style) + + +class Text(JupyterMixin): + """Text with color / style. + + Args: + text (str, optional): Default unstyled text. Defaults to "". + style (Union[str, Style], optional): Base style for text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + no_wrap (bool, optional): Disable text wrapping, or None for default. Defaults to None. + end (str, optional): Character to end text with. Defaults to "\\\\n". + tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8. + spans (List[Span], optional). A list of predefined style spans. Defaults to None. + """ + + __slots__ = [ + "_text", + "style", + "justify", + "overflow", + "no_wrap", + "end", + "tab_size", + "_spans", + "_length", + ] + + def __init__( + self, + text: str = "", + style: Union[str, Style] = "", + *, + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + no_wrap: Optional[bool] = None, + end: str = "\n", + tab_size: Optional[int] = 8, + spans: Optional[List[Span]] = None, + ) -> None: + self._text = [strip_control_codes(text)] + self.style = style + self.justify: Optional["JustifyMethod"] = justify + self.overflow: Optional["OverflowMethod"] = overflow + self.no_wrap = no_wrap + self.end = end + self.tab_size = tab_size + self._spans: List[Span] = spans or [] + self._length: int = len(text) + + def __len__(self) -> int: + return self._length + + def __bool__(self) -> bool: + return bool(self._length) + + def __str__(self) -> str: + return self.plain + + def __repr__(self) -> str: + return f"<text {self.plain!r} {self._spans!r}>" + + def __add__(self, other: Any) -> "Text": + if isinstance(other, (str, Text)): + result = self.copy() + result.append(other) + return result + return NotImplemented + + def __eq__(self, other: object) -> bool: + if not isinstance(other, Text): + return NotImplemented + return self.plain == other.plain and self._spans == other._spans + + def __contains__(self, other: object) -> bool: + if isinstance(other, str): + return other in self.plain + elif isinstance(other, Text): + return other.plain in self.plain + return False + + def __getitem__(self, slice: Union[int, slice]) -> "Text": + def get_text_at(offset: int) -> "Text": + _Span = Span + text = Text( + self.plain[offset], + spans=[ + _Span(0, 1, style) + for start, end, style in self._spans + if end > offset >= start + ], + end="", + ) + return text + + if isinstance(slice, int): + return get_text_at(slice) + else: + start, stop, step = slice.indices(len(self.plain)) + if step == 1: + lines = self.divide([start, stop]) + return lines[1] + else: + # This would be a bit of work to implement efficiently + # For now, its not required + raise TypeError("slices with step!=1 are not supported") + + @property + def cell_len(self) -> int: + """Get the number of cells required to render this text.""" + return cell_len(self.plain) + + @classmethod + def from_markup( + cls, + text: str, + *, + style: Union[str, Style] = "", + emoji: bool = True, + emoji_variant: Optional[EmojiVariant] = None, + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + ) -> "Text": + """Create Text instance from markup. + + Args: + text (str): A string containing console markup. + emoji (bool, optional): Also render emoji code. Defaults to True. + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + + Returns: + Text: A Text instance with markup rendered. + """ + from .markup import render + + rendered_text = render(text, style, emoji=emoji, emoji_variant=emoji_variant) + rendered_text.justify = justify + rendered_text.overflow = overflow + return rendered_text + + @classmethod + def styled( + cls, + text: str, + style: StyleType = "", + *, + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + ) -> "Text": + """Construct a Text instance with a pre-applied styled. A style applied in this way won't be used + to pad the text when it is justified. + + Args: + text (str): A string containing console markup. + style (Union[str, Style]): Style to apply to the text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + + Returns: + Text: A text instance with a style applied to the entire string. + """ + styled_text = cls(text, justify=justify, overflow=overflow) + styled_text.stylize(style) + return styled_text + + @classmethod + def assemble( + cls, + *parts: Union[str, "Text", Tuple[str, StyleType]], + style: Union[str, Style] = "", + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + no_wrap: Optional[bool] = None, + end: str = "\n", + tab_size: int = 8, + meta: Optional[Dict[str, Any]] = None, + ) -> "Text": + """Construct a text instance by combining a sequence of strings with optional styles. + The positional arguments should be either strings, or a tuple of string + style. + + Args: + style (Union[str, Style], optional): Base style for text. Defaults to "". + justify (str, optional): Justify method: "left", "center", "full", "right". Defaults to None. + overflow (str, optional): Overflow method: "crop", "fold", "ellipsis". Defaults to None. + end (str, optional): Character to end text with. Defaults to "\\\\n". + tab_size (int): Number of spaces per tab, or ``None`` to use ``console.tab_size``. Defaults to 8. + meta (Dict[str, Any], optional). Meta data to apply to text, or None for no meta data. Default to None + + Returns: + Text: A new text instance. + """ + text = cls( + style=style, + justify=justify, + overflow=overflow, + no_wrap=no_wrap, + end=end, + tab_size=tab_size, + ) + append = text.append + _Text = Text + for part in parts: + if isinstance(part, (_Text, str)): + append(part) + else: + append(*part) + if meta: + text.apply_meta(meta) + return text + + @property + def plain(self) -> str: + """Get the text as a single string.""" + if len(self._text) != 1: + self._text[:] = ["".join(self._text)] + return self._text[0] + + @plain.setter + def plain(self, new_text: str) -> None: + """Set the text to a new value.""" + if new_text != self.plain: + self._text[:] = [new_text] + old_length = self._length + self._length = len(new_text) + if old_length > self._length: + self._trim_spans() + + @property + def spans(self) -> List[Span]: + """Get a reference to the internal list of spans.""" + return self._spans + + @spans.setter + def spans(self, spans: List[Span]) -> None: + """Set spans.""" + self._spans = spans[:] + + def blank_copy(self, plain: str = "") -> "Text": + """Return a new Text instance with copied meta data (but not the string or spans).""" + copy_self = Text( + plain, + style=self.style, + justify=self.justify, + overflow=self.overflow, + no_wrap=self.no_wrap, + end=self.end, + tab_size=self.tab_size, + ) + return copy_self + + def copy(self) -> "Text": + """Return a copy of this instance.""" + copy_self = Text( + self.plain, + style=self.style, + justify=self.justify, + overflow=self.overflow, + no_wrap=self.no_wrap, + end=self.end, + tab_size=self.tab_size, + ) + copy_self._spans[:] = self._spans + return copy_self + + def stylize( + self, + style: Union[str, Style], + start: int = 0, + end: Optional[int] = None, + ) -> None: + """Apply a style to the text, or a portion of the text. + + Args: + style (Union[str, Style]): Style instance or style definition to apply. + start (int): Start offset (negative indexing is supported). Defaults to 0. + end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. + + """ + if style: + length = len(self) + if start < 0: + start = length + start + if end is None: + end = length + if end < 0: + end = length + end + if start >= length or end <= start: + # Span not in text or not valid + return + self._spans.append(Span(start, min(length, end), style)) + + def apply_meta( + self, meta: Dict[str, Any], start: int = 0, end: Optional[int] = None + ) -> None: + """Apply meta data to the text, or a portion of the text. + + Args: + meta (Dict[str, Any]): A dict of meta information. + start (int): Start offset (negative indexing is supported). Defaults to 0. + end (Optional[int], optional): End offset (negative indexing is supported), or None for end of text. Defaults to None. + + """ + style = Style.from_meta(meta) + self.stylize(style, start=start, end=end) + + def on(self, meta: Optional[Dict[str, Any]] = None, **handlers: Any) -> "Text": + """Apply event handlers (used by Textual project). + + Example: + >>> from rich.text import Text + >>> text = Text("hello world") + >>> text.on(click="view.toggle('world')") + + Args: + meta (Dict[str, Any]): Mapping of meta information. + **handlers: Keyword args are prefixed with "@" to defined handlers. + + Returns: + Text: Self is returned to method may be chained. + """ + meta = {} if meta is None else meta + meta.update({f"@{key}": value for key, value in handlers.items()}) + self.stylize(Style.from_meta(meta)) + return self + + def remove_suffix(self, suffix: str) -> None: + """Remove a suffix if it exists. + + Args: + suffix (str): Suffix to remove. + """ + if self.plain.endswith(suffix): + self.right_crop(len(suffix)) + + def get_style_at_offset(self, console: "Console", offset: int) -> Style: + """Get the style of a character at give offset. + + Args: + console (~Console): Console where text will be rendered. + offset (int): Offset in to text (negative indexing supported) + + Returns: + Style: A Style instance. + """ + # TODO: This is a little inefficient, it is only used by full justify + if offset < 0: + offset = len(self) + offset + get_style = console.get_style + style = get_style(self.style).copy() + for start, end, span_style in self._spans: + if end > offset >= start: + style += get_style(span_style, default="") + return style + + def highlight_regex( + self, + re_highlight: str, + style: Optional[Union[GetStyleCallable, StyleType]] = None, + *, + style_prefix: str = "", + ) -> int: + """Highlight text with a regular expression, where group names are + translated to styles. + + Args: + re_highlight (str): A regular expression. + style (Union[GetStyleCallable, StyleType]): Optional style to apply to whole match, or a callable + which accepts the matched text and returns a style. Defaults to None. + style_prefix (str, optional): Optional prefix to add to style group names. + + Returns: + int: Number of regex matches + """ + count = 0 + append_span = self._spans.append + _Span = Span + plain = self.plain + for match in re.finditer(re_highlight, plain): + get_span = match.span + if style: + start, end = get_span() + match_style = style(plain[start:end]) if callable(style) else style + if match_style is not None and end > start: + append_span(_Span(start, end, match_style)) + + count += 1 + for name in match.groupdict().keys(): + start, end = get_span(name) + if start != -1 and end > start: + append_span(_Span(start, end, f"{style_prefix}{name}")) + return count + + def highlight_words( + self, + words: Iterable[str], + style: Union[str, Style], + *, + case_sensitive: bool = True, + ) -> int: + """Highlight words with a style. + + Args: + words (Iterable[str]): Worlds to highlight. + style (Union[str, Style]): Style to apply. + case_sensitive (bool, optional): Enable case sensitive matchings. Defaults to True. + + Returns: + int: Number of words highlighted. + """ + re_words = "|".join(re.escape(word) for word in words) + add_span = self._spans.append + count = 0 + _Span = Span + for match in re.finditer( + re_words, self.plain, flags=0 if case_sensitive else re.IGNORECASE + ): + start, end = match.span(0) + add_span(_Span(start, end, style)) + count += 1 + return count + + def rstrip(self) -> None: + """Strip whitespace from end of text.""" + self.plain = self.plain.rstrip() + + def rstrip_end(self, size: int) -> None: + """Remove whitespace beyond a certain width at the end of the text. + + Args: + size (int): The desired size of the text. + """ + text_length = len(self) + if text_length > size: + excess = text_length - size + whitespace_match = _re_whitespace.search(self.plain) + if whitespace_match is not None: + whitespace_count = len(whitespace_match.group(0)) + self.right_crop(min(whitespace_count, excess)) + + def set_length(self, new_length: int) -> None: + """Set new length of the text, clipping or padding is required.""" + length = len(self) + if length != new_length: + if length < new_length: + self.pad_right(new_length - length) + else: + self.right_crop(length - new_length) + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> Iterable[Segment]: + tab_size: int = console.tab_size or self.tab_size or 8 + justify = self.justify or options.justify or DEFAULT_JUSTIFY + + overflow = self.overflow or options.overflow or DEFAULT_OVERFLOW + + lines = self.wrap( + console, + options.max_width, + justify=justify, + overflow=overflow, + tab_size=tab_size or 8, + no_wrap=pick_bool(self.no_wrap, options.no_wrap, False), + ) + all_lines = Text("\n").join(lines) + yield from all_lines.render(console, end=self.end) + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> Measurement: + text = self.plain + lines = text.splitlines() + max_text_width = max(cell_len(line) for line in lines) if lines else 0 + words = text.split() + min_text_width = ( + max(cell_len(word) for word in words) if words else max_text_width + ) + return Measurement(min_text_width, max_text_width) + + def render(self, console: "Console", end: str = "") -> Iterable["Segment"]: + """Render the text as Segments. + + Args: + console (Console): Console instance. + end (Optional[str], optional): Optional end character. + + Returns: + Iterable[Segment]: Result of render that may be written to the console. + """ + _Segment = Segment + text = self.plain + if not self._spans: + yield Segment(text) + if end: + yield _Segment(end) + return + get_style = partial(console.get_style, default=Style.null()) + + enumerated_spans = list(enumerate(self._spans, 1)) + style_map = {index: get_style(span.style) for index, span in enumerated_spans} + style_map[0] = get_style(self.style) + + spans = [ + (0, False, 0), + *((span.start, False, index) for index, span in enumerated_spans), + *((span.end, True, index) for index, span in enumerated_spans), + (len(text), True, 0), + ] + spans.sort(key=itemgetter(0, 1)) + + stack: List[int] = [] + stack_append = stack.append + stack_pop = stack.remove + + style_cache: Dict[Tuple[Style, ...], Style] = {} + style_cache_get = style_cache.get + combine = Style.combine + + def get_current_style() -> Style: + """Construct current style from stack.""" + styles = tuple(style_map[_style_id] for _style_id in sorted(stack)) + cached_style = style_cache_get(styles) + if cached_style is not None: + return cached_style + current_style = combine(styles) + style_cache[styles] = current_style + return current_style + + for (offset, leaving, style_id), (next_offset, _, _) in zip(spans, spans[1:]): + if leaving: + stack_pop(style_id) + else: + stack_append(style_id) + if next_offset > offset: + yield _Segment(text[offset:next_offset], get_current_style()) + if end: + yield _Segment(end) + + def join(self, lines: Iterable["Text"]) -> "Text": + """Join text together with this instance as the separator. + + Args: + lines (Iterable[Text]): An iterable of Text instances to join. + + Returns: + Text: A new text instance containing join text. + """ + + new_text = self.blank_copy() + + def iter_text() -> Iterable["Text"]: + if self.plain: + for last, line in loop_last(lines): + yield line + if not last: + yield self + else: + yield from lines + + extend_text = new_text._text.extend + append_span = new_text._spans.append + extend_spans = new_text._spans.extend + offset = 0 + _Span = Span + + for text in iter_text(): + extend_text(text._text) + if text.style: + append_span(_Span(offset, offset + len(text), text.style)) + extend_spans( + _Span(offset + start, offset + end, style) + for start, end, style in text._spans + ) + offset += len(text) + new_text._length = offset + return new_text + + def expand_tabs(self, tab_size: Optional[int] = None) -> None: + """Converts tabs to spaces. + + Args: + tab_size (int, optional): Size of tabs. Defaults to 8. + + """ + if "\t" not in self.plain: + return + pos = 0 + if tab_size is None: + tab_size = self.tab_size + assert tab_size is not None + result = self.blank_copy() + append = result.append + + _style = self.style + for line in self.split("\n", include_separator=True): + parts = line.split("\t", include_separator=True) + for part in parts: + if part.plain.endswith("\t"): + part._text = [part.plain[:-1] + " "] + append(part) + pos += len(part) + spaces = tab_size - ((pos - 1) % tab_size) - 1 + if spaces: + append(" " * spaces, _style) + pos += spaces + else: + append(part) + self._text = [result.plain] + self._length = len(self.plain) + self._spans[:] = result._spans + + def truncate( + self, + max_width: int, + *, + overflow: Optional["OverflowMethod"] = None, + pad: bool = False, + ) -> None: + """Truncate text if it is longer that a given width. + + Args: + max_width (int): Maximum number of characters in text. + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None, to use self.overflow. + pad (bool, optional): Pad with spaces if the length is less than max_width. Defaults to False. + """ + _overflow = overflow or self.overflow or DEFAULT_OVERFLOW + if _overflow != "ignore": + length = cell_len(self.plain) + if length > max_width: + if _overflow == "ellipsis": + self.plain = set_cell_size(self.plain, max_width - 1) + "…" + else: + self.plain = set_cell_size(self.plain, max_width) + if pad and length < max_width: + spaces = max_width - length + self._text = [f"{self.plain}{' ' * spaces}"] + self._length = len(self.plain) + + def _trim_spans(self) -> None: + """Remove or modify any spans that are over the end of the text.""" + max_offset = len(self.plain) + _Span = Span + self._spans[:] = [ + ( + span + if span.end < max_offset + else _Span(span.start, min(max_offset, span.end), span.style) + ) + for span in self._spans + if span.start < max_offset + ] + + def pad(self, count: int, character: str = " ") -> None: + """Pad left and right with a given number of characters. + + Args: + count (int): Width of padding. + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + pad_characters = character * count + self.plain = f"{pad_characters}{self.plain}{pad_characters}" + _Span = Span + self._spans[:] = [ + _Span(start + count, end + count, style) + for start, end, style in self._spans + ] + + def pad_left(self, count: int, character: str = " ") -> None: + """Pad the left with a given character. + + Args: + count (int): Number of characters to pad. + character (str, optional): Character to pad with. Defaults to " ". + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + self.plain = f"{character * count}{self.plain}" + _Span = Span + self._spans[:] = [ + _Span(start + count, end + count, style) + for start, end, style in self._spans + ] + + def pad_right(self, count: int, character: str = " ") -> None: + """Pad the right with a given character. + + Args: + count (int): Number of characters to pad. + character (str, optional): Character to pad with. Defaults to " ". + """ + assert len(character) == 1, "Character must be a string of length 1" + if count: + self.plain = f"{self.plain}{character * count}" + + def align(self, align: AlignMethod, width: int, character: str = " ") -> None: + """Align text to a given width. + + Args: + align (AlignMethod): One of "left", "center", or "right". + width (int): Desired width. + character (str, optional): Character to pad with. Defaults to " ". + """ + self.truncate(width) + excess_space = width - cell_len(self.plain) + if excess_space: + if align == "left": + self.pad_right(excess_space, character) + elif align == "center": + left = excess_space // 2 + self.pad_left(left, character) + self.pad_right(excess_space - left, character) + else: + self.pad_left(excess_space, character) + + def append( + self, text: Union["Text", str], style: Optional[Union[str, "Style"]] = None + ) -> "Text": + """Add text with an optional style. + + Args: + text (Union[Text, str]): A str or Text to append. + style (str, optional): A style name. Defaults to None. + + Returns: + Text: Returns self for chaining. + """ + + if not isinstance(text, (str, Text)): + raise TypeError("Only str or Text can be appended to Text") + + if len(text): + if isinstance(text, str): + text = strip_control_codes(text) + self._text.append(text) + offset = len(self) + text_length = len(text) + if style is not None: + self._spans.append(Span(offset, offset + text_length, style)) + self._length += text_length + elif isinstance(text, Text): + _Span = Span + if style is not None: + raise ValueError( + "style must not be set when appending Text instance" + ) + text_length = self._length + if text.style is not None: + self._spans.append( + _Span(text_length, text_length + len(text), text.style) + ) + self._text.append(text.plain) + self._spans.extend( + _Span(start + text_length, end + text_length, style) + for start, end, style in text._spans + ) + self._length += len(text) + return self + + def append_text(self, text: "Text") -> "Text": + """Append another Text instance. This method is more performant that Text.append, but + only works for Text. + + Returns: + Text: Returns self for chaining. + """ + _Span = Span + text_length = self._length + if text.style is not None: + self._spans.append(_Span(text_length, text_length + len(text), text.style)) + self._text.append(text.plain) + self._spans.extend( + _Span(start + text_length, end + text_length, style) + for start, end, style in text._spans + ) + self._length += len(text) + return self + + def append_tokens( + self, tokens: Iterable[Tuple[str, Optional[StyleType]]] + ) -> "Text": + """Append iterable of str and style. Style may be a Style instance or a str style definition. + + Args: + pairs (Iterable[Tuple[str, Optional[StyleType]]]): An iterable of tuples containing str content and style. + + Returns: + Text: Returns self for chaining. + """ + append_text = self._text.append + append_span = self._spans.append + _Span = Span + offset = len(self) + for content, style in tokens: + append_text(content) + if style is not None: + append_span(_Span(offset, offset + len(content), style)) + offset += len(content) + self._length = offset + return self + + def copy_styles(self, text: "Text") -> None: + """Copy styles from another Text instance. + + Args: + text (Text): A Text instance to copy styles from, must be the same length. + """ + self._spans.extend(text._spans) + + def split( + self, + separator: str = "\n", + *, + include_separator: bool = False, + allow_blank: bool = False, + ) -> Lines: + """Split rich text in to lines, preserving styles. + + Args: + separator (str, optional): String to split on. Defaults to "\\\\n". + include_separator (bool, optional): Include the separator in the lines. Defaults to False. + allow_blank (bool, optional): Return a blank line if the text ends with a separator. Defaults to False. + + Returns: + List[RichText]: A list of rich text, one per line of the original. + """ + assert separator, "separator must not be empty" + + text = self.plain + if separator not in text: + return Lines([self.copy()]) + + if include_separator: + lines = self.divide( + match.end() for match in re.finditer(re.escape(separator), text) + ) + else: + + def flatten_spans() -> Iterable[int]: + for match in re.finditer(re.escape(separator), text): + start, end = match.span() + yield start + yield end + + lines = Lines( + line for line in self.divide(flatten_spans()) if line.plain != separator + ) + + if not allow_blank and text.endswith(separator): + lines.pop() + + return lines + + def divide(self, offsets: Iterable[int]) -> Lines: + """Divide text in to a number of lines at given offsets. + + Args: + offsets (Iterable[int]): Offsets used to divide text. + + Returns: + Lines: New RichText instances between offsets. + """ + _offsets = list(offsets) + if not _offsets: + return Lines([self.copy()]) + + text = self.plain + text_length = len(text) + divide_offsets = [0, *_offsets, text_length] + line_ranges = list(zip(divide_offsets, divide_offsets[1:])) + + style = self.style + justify = self.justify + overflow = self.overflow + _Text = Text + new_lines = Lines( + _Text( + text[start:end], + style=style, + justify=justify, + overflow=overflow, + ) + for start, end in line_ranges + ) + if not self._spans: + return new_lines + order = {span: span_index for span_index, span in enumerate(self._spans)} + span_stack = sorted(self._spans, key=attrgetter("start"), reverse=True) + + pop = span_stack.pop + push = span_stack.append + _Span = Span + get_order = order.__getitem__ + + for line, (start, end) in zip(new_lines, line_ranges): + if not span_stack: + break + append_span = line._spans.append + position = len(span_stack) - 1 + while span_stack[position].start < end: + span = pop(position) + add_span, remaining_span = span.split(end) + if remaining_span: + push(remaining_span) + order[remaining_span] = order[span] + span_start, span_end, span_style = add_span + line_span = _Span(span_start - start, span_end - start, span_style) + order[line_span] = order[span] + append_span(line_span) + position -= 1 + if position < 0 or not span_stack: + break # pragma: no cover + line._spans.sort(key=get_order) + + return new_lines + + def right_crop(self, amount: int = 1) -> None: + """Remove a number of characters from the end of the text.""" + max_offset = len(self.plain) - amount + _Span = Span + self._spans[:] = [ + ( + span + if span.end < max_offset + else _Span(span.start, min(max_offset, span.end), span.style) + ) + for span in self._spans + if span.start < max_offset + ] + self._text = [self.plain[:-amount]] + self._length -= amount + + def wrap( + self, + console: "Console", + width: int, + *, + justify: Optional["JustifyMethod"] = None, + overflow: Optional["OverflowMethod"] = None, + tab_size: int = 8, + no_wrap: Optional[bool] = None, + ) -> Lines: + """Word wrap the text. + + Args: + console (Console): Console instance. + width (int): Number of characters per line. + emoji (bool, optional): Also render emoji code. Defaults to True. + justify (str, optional): Justify method: "default", "left", "center", "full", "right". Defaults to "default". + overflow (str, optional): Overflow method: "crop", "fold", or "ellipsis". Defaults to None. + tab_size (int, optional): Default tab size. Defaults to 8. + no_wrap (bool, optional): Disable wrapping, Defaults to False. + + Returns: + Lines: Number of lines. + """ + wrap_justify = justify or self.justify or DEFAULT_JUSTIFY + wrap_overflow = overflow or self.overflow or DEFAULT_OVERFLOW + + no_wrap = pick_bool(no_wrap, self.no_wrap, False) or overflow == "ignore" + + lines = Lines() + for line in self.split(allow_blank=True): + if "\t" in line: + line.expand_tabs(tab_size) + if no_wrap: + new_lines = Lines([line]) + else: + offsets = divide_line(str(line), width, fold=wrap_overflow == "fold") + new_lines = line.divide(offsets) + for line in new_lines: + line.rstrip_end(width) + if wrap_justify: + new_lines.justify( + console, width, justify=wrap_justify, overflow=wrap_overflow + ) + for line in new_lines: + line.truncate(width, overflow=wrap_overflow) + lines.extend(new_lines) + return lines + + def fit(self, width: int) -> Lines: + """Fit the text in to given width by chopping in to lines. + + Args: + width (int): Maximum characters in a line. + + Returns: + Lines: List of lines. + """ + lines: Lines = Lines() + append = lines.append + for line in self.split(): + line.set_length(width) + append(line) + return lines + + def detect_indentation(self) -> int: + """Auto-detect indentation of code. + + Returns: + int: Number of spaces used to indent code. + """ + + _indentations = { + len(match.group(1)) + for match in re.finditer(r"^( *)(.*)$", self.plain, flags=re.MULTILINE) + } + + try: + indentation = ( + reduce(gcd, [indent for indent in _indentations if not indent % 2]) or 1 + ) + except TypeError: + indentation = 1 + + return indentation + + def with_indent_guides( + self, + indent_size: Optional[int] = None, + *, + character: str = "│", + style: StyleType = "dim green", + ) -> "Text": + """Adds indent guide lines to text. + + Args: + indent_size (Optional[int]): Size of indentation, or None to auto detect. Defaults to None. + character (str, optional): Character to use for indentation. Defaults to "│". + style (Union[Style, str], optional): Style of indent guides. + + Returns: + Text: New text with indentation guides. + """ + + _indent_size = self.detect_indentation() if indent_size is None else indent_size + + text = self.copy() + text.expand_tabs() + indent_line = f"{character}{' ' * (_indent_size - 1)}" + + re_indent = re.compile(r"^( *)(.*)$") + new_lines: List[Text] = [] + add_line = new_lines.append + blank_lines = 0 + for line in text.split(allow_blank=True): + match = re_indent.match(line.plain) + if not match or not match.group(2): + blank_lines += 1 + continue + indent = match.group(1) + full_indents, remaining_space = divmod(len(indent), _indent_size) + new_indent = f"{indent_line * full_indents}{' ' * remaining_space}" + line.plain = new_indent + line.plain[len(new_indent) :] + line.stylize(style, 0, len(new_indent)) + if blank_lines: + new_lines.extend([Text(new_indent, style=style)] * blank_lines) + blank_lines = 0 + add_line(line) + if blank_lines: + new_lines.extend([Text("", style=style)] * blank_lines) + + new_text = text.blank_copy("\n").join(new_lines) + return new_text + + +if __name__ == "__main__": # pragma: no cover + from pip._vendor.rich.console import Console + + text = Text( + """\nLorem ipsum dolor sit amet, consectetur adipiscing elit, sed do eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut enim ad minim veniam, quis nostrud exercitation ullamco laboris nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor in reprehenderit in voluptate velit esse cillum dolore eu fugiat nulla pariatur. Excepteur sint occaecat cupidatat non proident, sunt in culpa qui officia deserunt mollit anim id est laborum.\n""" + ) + text.highlight_words(["Lorem"], "bold") + text.highlight_words(["ipsum"], "italic") + + console = Console() + console.rule("justify='left'") + console.print(text, style="red") + console.print() + + console.rule("justify='center'") + console.print(text, style="green", justify="center") + console.print() + + console.rule("justify='right'") + console.print(text, style="blue", justify="right") + console.print() + + console.rule("justify='full'") + console.print(text, style="magenta", justify="full") + console.print() diff --git a/src/pip/_vendor/rich/theme.py b/src/pip/_vendor/rich/theme.py new file mode 100644 index 000000000..bfb3c7f82 --- /dev/null +++ b/src/pip/_vendor/rich/theme.py @@ -0,0 +1,112 @@ +import configparser +from typing import Dict, List, IO, Mapping, Optional + +from .default_styles import DEFAULT_STYLES +from .style import Style, StyleType + + +class Theme: + """A container for style information, used by :class:`~rich.console.Console`. + + Args: + styles (Dict[str, Style], optional): A mapping of style names on to styles. Defaults to None for a theme with no styles. + inherit (bool, optional): Inherit default styles. Defaults to True. + """ + + styles: Dict[str, Style] + + def __init__( + self, styles: Optional[Mapping[str, StyleType]] = None, inherit: bool = True + ): + self.styles = DEFAULT_STYLES.copy() if inherit else {} + if styles is not None: + self.styles.update( + { + name: style if isinstance(style, Style) else Style.parse(style) + for name, style in styles.items() + } + ) + + @property + def config(self) -> str: + """Get contents of a config file for this theme.""" + config = "[styles]\n" + "\n".join( + f"{name} = {style}" for name, style in sorted(self.styles.items()) + ) + return config + + @classmethod + def from_file( + cls, config_file: IO[str], source: Optional[str] = None, inherit: bool = True + ) -> "Theme": + """Load a theme from a text mode file. + + Args: + config_file (IO[str]): An open conf file. + source (str, optional): The filename of the open file. Defaults to None. + inherit (bool, optional): Inherit default styles. Defaults to True. + + Returns: + Theme: A New theme instance. + """ + config = configparser.ConfigParser() + config.read_file(config_file, source=source) + styles = {name: Style.parse(value) for name, value in config.items("styles")} + theme = Theme(styles, inherit=inherit) + return theme + + @classmethod + def read(cls, path: str, inherit: bool = True) -> "Theme": + """Read a theme from a path. + + Args: + path (str): Path to a config file readable by Python configparser module. + inherit (bool, optional): Inherit default styles. Defaults to True. + + Returns: + Theme: A new theme instance. + """ + with open(path, "rt") as config_file: + return cls.from_file(config_file, source=path, inherit=inherit) + + +class ThemeStackError(Exception): + """Base exception for errors related to the theme stack.""" + + +class ThemeStack: + """A stack of themes. + + Args: + theme (Theme): A theme instance + """ + + def __init__(self, theme: Theme) -> None: + self._entries: List[Dict[str, Style]] = [theme.styles] + self.get = self._entries[-1].get + + def push_theme(self, theme: Theme, inherit: bool = True) -> None: + """Push a theme on the top of the stack. + + Args: + theme (Theme): A Theme instance. + inherit (boolean, optional): Inherit styles from current top of stack. + """ + styles: Dict[str, Style] + styles = ( + {**self._entries[-1], **theme.styles} if inherit else theme.styles.copy() + ) + self._entries.append(styles) + self.get = self._entries[-1].get + + def pop_theme(self) -> None: + """Pop (and discard) the top-most theme.""" + if len(self._entries) == 1: + raise ThemeStackError("Unable to pop base theme") + self._entries.pop() + self.get = self._entries[-1].get + + +if __name__ == "__main__": # pragma: no cover + theme = Theme() + print(theme.config) diff --git a/src/pip/_vendor/rich/themes.py b/src/pip/_vendor/rich/themes.py new file mode 100644 index 000000000..bf6db104a --- /dev/null +++ b/src/pip/_vendor/rich/themes.py @@ -0,0 +1,5 @@ +from .default_styles import DEFAULT_STYLES +from .theme import Theme + + +DEFAULT = Theme(DEFAULT_STYLES) diff --git a/src/pip/_vendor/rich/traceback.py b/src/pip/_vendor/rich/traceback.py new file mode 100644 index 000000000..dbb9f1f70 --- /dev/null +++ b/src/pip/_vendor/rich/traceback.py @@ -0,0 +1,680 @@ +from __future__ import absolute_import + +import os +import platform +import sys +from dataclasses import dataclass, field +from traceback import walk_tb +from types import ModuleType, TracebackType +from typing import Any, Callable, Dict, Iterable, List, Optional, Sequence, Type, Union + +from pip._vendor.pygments.lexers import guess_lexer_for_filename +from pip._vendor.pygments.token import Comment, Keyword, Name, Number, Operator, String +from pip._vendor.pygments.token import Text as TextToken +from pip._vendor.pygments.token import Token + +from . import pretty +from ._loop import loop_first, loop_last +from .columns import Columns +from .console import ( + Console, + ConsoleOptions, + ConsoleRenderable, + RenderResult, + group, +) +from .constrain import Constrain +from .highlighter import RegexHighlighter, ReprHighlighter +from .panel import Panel +from .scope import render_scope +from .style import Style +from .syntax import Syntax +from .text import Text +from .theme import Theme + +WINDOWS = platform.system() == "Windows" + +LOCALS_MAX_LENGTH = 10 +LOCALS_MAX_STRING = 80 + + +def install( + *, + console: Optional[Console] = None, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, + suppress: Iterable[Union[str, ModuleType]] = (), + max_frames: int = 100, +) -> Callable[[Type[BaseException], BaseException, Optional[TracebackType]], Any]: + """Install a rich traceback handler. + + Once installed, any tracebacks will be printed with syntax highlighting and rich formatting. + + + Args: + console (Optional[Console], optional): Console to write exception to. Default uses internal Console instance. + width (Optional[int], optional): Width (in characters) of traceback. Defaults to 100. + extra_lines (int, optional): Extra lines of code. Defaults to 3. + theme (Optional[str], optional): Pygments theme to use in traceback. Defaults to ``None`` which will pick + a theme appropriate for the platform. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. + + Returns: + Callable: The previous exception handler that was replaced. + + """ + traceback_console = Console(file=sys.stderr) if console is None else console + + def excepthook( + type_: Type[BaseException], + value: BaseException, + traceback: Optional[TracebackType], + ) -> None: + traceback_console.print( + Traceback.from_exception( + type_, + value, + traceback, + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + indent_guides=indent_guides, + suppress=suppress, + max_frames=max_frames, + ) + ) + + def ipy_excepthook_closure(ip: Any) -> None: # pragma: no cover + tb_data = {} # store information about showtraceback call + default_showtraceback = ip.showtraceback # keep reference of default traceback + + def ipy_show_traceback(*args: Any, **kwargs: Any) -> None: + """wrap the default ip.showtraceback to store info for ip._showtraceback""" + nonlocal tb_data + tb_data = kwargs + default_showtraceback(*args, **kwargs) + + def ipy_display_traceback( + *args: Any, is_syntax: bool = False, **kwargs: Any + ) -> None: + """Internally called traceback from ip._showtraceback""" + nonlocal tb_data + exc_tuple = ip._get_exc_info() + + # do not display trace on syntax error + tb: Optional[TracebackType] = None if is_syntax else exc_tuple[2] + + # determine correct tb_offset + compiled = tb_data.get("running_compiled_code", False) + tb_offset = tb_data.get("tb_offset", 1 if compiled else 0) + # remove ipython internal frames from trace with tb_offset + for _ in range(tb_offset): + if tb is None: + break + tb = tb.tb_next + + excepthook(exc_tuple[0], exc_tuple[1], tb) + tb_data = {} # clear data upon usage + + # replace _showtraceback instead of showtraceback to allow ipython features such as debugging to work + # this is also what the ipython docs recommends to modify when subclassing InteractiveShell + ip._showtraceback = ipy_display_traceback + # add wrapper to capture tb_data + ip.showtraceback = ipy_show_traceback + ip.showsyntaxerror = lambda *args, **kwargs: ipy_display_traceback( + *args, is_syntax=True, **kwargs + ) + + try: # pragma: no cover + # if wihin ipython, use customized traceback + ip = get_ipython() # type: ignore + ipy_excepthook_closure(ip) + return sys.excepthook # type: ignore # more strict signature that mypy can't interpret + except Exception: + # otherwise use default system hook + old_excepthook = sys.excepthook + sys.excepthook = excepthook + return old_excepthook # type: ignore # more strict signature that mypy can't interpret + + +@dataclass +class Frame: + filename: str + lineno: int + name: str + line: str = "" + locals: Optional[Dict[str, pretty.Node]] = None + + +@dataclass +class _SyntaxError: + offset: int + filename: str + line: str + lineno: int + msg: str + + +@dataclass +class Stack: + exc_type: str + exc_value: str + syntax_error: Optional[_SyntaxError] = None + is_cause: bool = False + frames: List[Frame] = field(default_factory=list) + + +@dataclass +class Trace: + stacks: List[Stack] + + +class PathHighlighter(RegexHighlighter): + highlights = [r"(?P<dim>.*/)(?P<bold>.+)"] + + +class Traceback: + """A Console renderable that renders a traceback. + + Args: + trace (Trace, optional): A `Trace` object produced from `extract`. Defaults to None, which uses + the last exception. + width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + suppress (Sequence[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. + max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. + + """ + + LEXERS = { + "": "text", + ".py": "python", + ".pxd": "cython", + ".pyx": "cython", + ".pxi": "pyrex", + } + + def __init__( + self, + trace: Optional[Trace] = None, + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + suppress: Iterable[Union[str, ModuleType]] = (), + max_frames: int = 100, + ): + if trace is None: + exc_type, exc_value, traceback = sys.exc_info() + if exc_type is None or exc_value is None or traceback is None: + raise ValueError( + "Value for 'trace' required if not called in except: block" + ) + trace = self.extract( + exc_type, exc_value, traceback, show_locals=show_locals + ) + self.trace = trace + self.width = width + self.extra_lines = extra_lines + self.theme = Syntax.get_theme(theme or "ansi_dark") + self.word_wrap = word_wrap + self.show_locals = show_locals + self.indent_guides = indent_guides + self.locals_max_length = locals_max_length + self.locals_max_string = locals_max_string + + self.suppress: Sequence[str] = [] + for suppress_entity in suppress: + if not isinstance(suppress_entity, str): + path = os.path.dirname(suppress_entity.__file__) + else: + path = suppress_entity + path = os.path.normpath(os.path.abspath(path)) + self.suppress.append(path) + self.max_frames = max(4, max_frames) if max_frames > 0 else 0 + + @classmethod + def from_exception( + cls, + exc_type: Type[Any], + exc_value: BaseException, + traceback: Optional[TracebackType], + width: Optional[int] = 100, + extra_lines: int = 3, + theme: Optional[str] = None, + word_wrap: bool = False, + show_locals: bool = False, + indent_guides: bool = True, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + suppress: Iterable[Union[str, ModuleType]] = (), + max_frames: int = 100, + ) -> "Traceback": + """Create a traceback from exception info + + Args: + exc_type (Type[BaseException]): Exception type. + exc_value (BaseException): Exception value. + traceback (TracebackType): Python Traceback object. + width (Optional[int], optional): Number of characters used to traceback. Defaults to 100. + extra_lines (int, optional): Additional lines of code to render. Defaults to 3. + theme (str, optional): Override pygments theme used in traceback. + word_wrap (bool, optional): Enable word wrapping of long lines. Defaults to False. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + indent_guides (bool, optional): Enable indent guides in code and locals. Defaults to True. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + suppress (Iterable[Union[str, ModuleType]]): Optional sequence of modules or paths to exclude from traceback. + max_frames (int): Maximum number of frames to show in a traceback, 0 for no maximum. Defaults to 100. + + Returns: + Traceback: A Traceback instance that may be printed. + """ + rich_traceback = cls.extract( + exc_type, exc_value, traceback, show_locals=show_locals + ) + return cls( + rich_traceback, + width=width, + extra_lines=extra_lines, + theme=theme, + word_wrap=word_wrap, + show_locals=show_locals, + indent_guides=indent_guides, + locals_max_length=locals_max_length, + locals_max_string=locals_max_string, + suppress=suppress, + max_frames=max_frames, + ) + + @classmethod + def extract( + cls, + exc_type: Type[BaseException], + exc_value: BaseException, + traceback: Optional[TracebackType], + show_locals: bool = False, + locals_max_length: int = LOCALS_MAX_LENGTH, + locals_max_string: int = LOCALS_MAX_STRING, + ) -> Trace: + """Extract traceback information. + + Args: + exc_type (Type[BaseException]): Exception type. + exc_value (BaseException): Exception value. + traceback (TracebackType): Python Traceback object. + show_locals (bool, optional): Enable display of local variables. Defaults to False. + locals_max_length (int, optional): Maximum length of containers before abbreviating, or None for no abbreviation. + Defaults to 10. + locals_max_string (int, optional): Maximum length of string before truncating, or None to disable. Defaults to 80. + + Returns: + Trace: A Trace instance which you can use to construct a `Traceback`. + """ + + stacks: List[Stack] = [] + is_cause = False + + from pip._vendor.rich import _IMPORT_CWD + + def safe_str(_object: Any) -> str: + """Don't allow exceptions from __str__ to propegate.""" + try: + return str(_object) + except Exception: + return "<exception str() failed>" + + while True: + stack = Stack( + exc_type=safe_str(exc_type.__name__), + exc_value=safe_str(exc_value), + is_cause=is_cause, + ) + + if isinstance(exc_value, SyntaxError): + stack.syntax_error = _SyntaxError( + offset=exc_value.offset or 0, + filename=exc_value.filename or "?", + lineno=exc_value.lineno or 0, + line=exc_value.text or "", + msg=exc_value.msg, + ) + + stacks.append(stack) + append = stack.frames.append + + for frame_summary, line_no in walk_tb(traceback): + filename = frame_summary.f_code.co_filename + if filename and not filename.startswith("<"): + if not os.path.isabs(filename): + filename = os.path.join(_IMPORT_CWD, filename) + frame = Frame( + filename=filename or "?", + lineno=line_no, + name=frame_summary.f_code.co_name, + locals={ + key: pretty.traverse( + value, + max_length=locals_max_length, + max_string=locals_max_string, + ) + for key, value in frame_summary.f_locals.items() + } + if show_locals + else None, + ) + append(frame) + if "_rich_traceback_guard" in frame_summary.f_locals: + del stack.frames[:] + + cause = getattr(exc_value, "__cause__", None) + if cause and cause.__traceback__: + exc_type = cause.__class__ + exc_value = cause + traceback = cause.__traceback__ + if traceback: + is_cause = True + continue + + cause = exc_value.__context__ + if ( + cause + and cause.__traceback__ + and not getattr(exc_value, "__suppress_context__", False) + ): + exc_type = cause.__class__ + exc_value = cause + traceback = cause.__traceback__ + if traceback: + is_cause = False + continue + # No cover, code is reached but coverage doesn't recognize it. + break # pragma: no cover + + trace = Trace(stacks=stacks) + return trace + + def __rich_console__( + self, console: Console, options: ConsoleOptions + ) -> RenderResult: + theme = self.theme + background_style = theme.get_background_style() + token_style = theme.get_style_for_token + + traceback_theme = Theme( + { + "pretty": token_style(TextToken), + "pygments.text": token_style(Token), + "pygments.string": token_style(String), + "pygments.function": token_style(Name.Function), + "pygments.number": token_style(Number), + "repr.indent": token_style(Comment) + Style(dim=True), + "repr.str": token_style(String), + "repr.brace": token_style(TextToken) + Style(bold=True), + "repr.number": token_style(Number), + "repr.bool_true": token_style(Keyword.Constant), + "repr.bool_false": token_style(Keyword.Constant), + "repr.none": token_style(Keyword.Constant), + "scope.border": token_style(String.Delimiter), + "scope.equals": token_style(Operator), + "scope.key": token_style(Name), + "scope.key.special": token_style(Name.Constant) + Style(dim=True), + } + ) + + highlighter = ReprHighlighter() + for last, stack in loop_last(reversed(self.trace.stacks)): + if stack.frames: + stack_renderable: ConsoleRenderable = Panel( + self._render_stack(stack), + title="[traceback.title]Traceback [dim](most recent call last)", + style=background_style, + border_style="traceback.border.syntax_error", + expand=True, + padding=(0, 1), + ) + stack_renderable = Constrain(stack_renderable, self.width) + with console.use_theme(traceback_theme): + yield stack_renderable + if stack.syntax_error is not None: + with console.use_theme(traceback_theme): + yield Constrain( + Panel( + self._render_syntax_error(stack.syntax_error), + style=background_style, + border_style="traceback.border", + expand=True, + padding=(0, 1), + width=self.width, + ), + self.width, + ) + yield Text.assemble( + (f"{stack.exc_type}: ", "traceback.exc_type"), + highlighter(stack.syntax_error.msg), + ) + elif stack.exc_value: + yield Text.assemble( + (f"{stack.exc_type}: ", "traceback.exc_type"), + highlighter(stack.exc_value), + ) + else: + yield Text.assemble((f"{stack.exc_type}", "traceback.exc_type")) + + if not last: + if stack.is_cause: + yield Text.from_markup( + "\n[i]The above exception was the direct cause of the following exception:\n", + ) + else: + yield Text.from_markup( + "\n[i]During handling of the above exception, another exception occurred:\n", + ) + + @group() + def _render_syntax_error(self, syntax_error: _SyntaxError) -> RenderResult: + highlighter = ReprHighlighter() + path_highlighter = PathHighlighter() + if syntax_error.filename != "<stdin>": + text = Text.assemble( + (f" {syntax_error.filename}", "pygments.string"), + (":", "pygments.text"), + (str(syntax_error.lineno), "pygments.number"), + style="pygments.text", + ) + yield path_highlighter(text) + syntax_error_text = highlighter(syntax_error.line.rstrip()) + syntax_error_text.no_wrap = True + offset = min(syntax_error.offset - 1, len(syntax_error_text)) + syntax_error_text.stylize("bold underline", offset, offset) + syntax_error_text += Text.from_markup( + "\n" + " " * offset + "[traceback.offset]▲[/]", + style="pygments.text", + ) + yield syntax_error_text + + @classmethod + def _guess_lexer(cls, filename: str, code: str) -> str: + ext = os.path.splitext(filename)[-1] + if not ext: + # No extension, look at first line to see if it is a hashbang + # Note, this is an educated guess and not a guarantee + # If it fails, the only downside is that the code is highlighted strangely + new_line_index = code.index("\n") + first_line = code[:new_line_index] if new_line_index != -1 else code + if first_line.startswith("#!") and "python" in first_line.lower(): + return "python" + lexer_name = ( + cls.LEXERS.get(ext) or guess_lexer_for_filename(filename, code).name + ) + return lexer_name + + @group() + def _render_stack(self, stack: Stack) -> RenderResult: + path_highlighter = PathHighlighter() + theme = self.theme + code_cache: Dict[str, str] = {} + + def read_code(filename: str) -> str: + """Read files, and cache results on filename. + + Args: + filename (str): Filename to read + + Returns: + str: Contents of file + """ + code = code_cache.get(filename) + if code is None: + with open( + filename, "rt", encoding="utf-8", errors="replace" + ) as code_file: + code = code_file.read() + code_cache[filename] = code + return code + + def render_locals(frame: Frame) -> Iterable[ConsoleRenderable]: + if frame.locals: + yield render_scope( + frame.locals, + title="locals", + indent_guides=self.indent_guides, + max_length=self.locals_max_length, + max_string=self.locals_max_string, + ) + + exclude_frames: Optional[range] = None + if self.max_frames != 0: + exclude_frames = range( + self.max_frames // 2, + len(stack.frames) - self.max_frames // 2, + ) + + excluded = False + for frame_index, frame in enumerate(stack.frames): + + if exclude_frames and frame_index in exclude_frames: + excluded = True + continue + + if excluded: + assert exclude_frames is not None + yield Text( + f"\n... {len(exclude_frames)} frames hidden ...", + justify="center", + style="traceback.error", + ) + excluded = False + + first = frame_index == 1 + frame_filename = frame.filename + suppressed = any(frame_filename.startswith(path) for path in self.suppress) + + text = Text.assemble( + path_highlighter(Text(frame.filename, style="pygments.string")), + (":", "pygments.text"), + (str(frame.lineno), "pygments.number"), + " in ", + (frame.name, "pygments.function"), + style="pygments.text", + ) + if not frame.filename.startswith("<") and not first: + yield "" + yield text + if frame.filename.startswith("<"): + yield from render_locals(frame) + continue + if not suppressed: + try: + code = read_code(frame.filename) + lexer_name = self._guess_lexer(frame.filename, code) + syntax = Syntax( + code, + lexer_name, + theme=theme, + line_numbers=True, + line_range=( + frame.lineno - self.extra_lines, + frame.lineno + self.extra_lines, + ), + highlight_lines={frame.lineno}, + word_wrap=self.word_wrap, + code_width=88, + indent_guides=self.indent_guides, + dedent=False, + ) + yield "" + except Exception as error: + yield Text.assemble( + (f"\n{error}", "traceback.error"), + ) + else: + yield ( + Columns( + [ + syntax, + *render_locals(frame), + ], + padding=1, + ) + if frame.locals + else syntax + ) + + +if __name__ == "__main__": # pragma: no cover + + from .console import Console + + console = Console() + import sys + + def bar(a: Any) -> None: # 这是对亚洲语言支持的测试。面对模棱两可的想法,拒绝猜测的诱惑 + one = 1 + print(one / a) + + def foo(a: Any) -> None: + _rich_traceback_guard = True + zed = { + "characters": { + "Paul Atreides", + "Vladimir Harkonnen", + "Thufir Hawat", + "Duncan Idaho", + }, + "atomic_types": (None, False, True), + } + bar(a) + + def error() -> None: + + try: + try: + foo(0) + except: + slfkjsldkfj # type: ignore + except: + console.print_exception(show_locals=True) + + error() diff --git a/src/pip/_vendor/rich/tree.py b/src/pip/_vendor/rich/tree.py new file mode 100644 index 000000000..c5ec27da9 --- /dev/null +++ b/src/pip/_vendor/rich/tree.py @@ -0,0 +1,249 @@ +from typing import Iterator, List, Optional, Tuple + +from ._loop import loop_first, loop_last +from .console import Console, ConsoleOptions, RenderableType, RenderResult +from .jupyter import JupyterMixin +from .measure import Measurement +from .segment import Segment +from .style import Style, StyleStack, StyleType +from .styled import Styled + + +class Tree(JupyterMixin): + """A renderable for a tree structure. + + Args: + label (RenderableType): The renderable or str for the tree label. + style (StyleType, optional): Style of this tree. Defaults to "tree". + guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". + expanded (bool, optional): Also display children. Defaults to True. + highlight (bool, optional): Highlight renderable (if str). Defaults to False. + """ + + def __init__( + self, + label: RenderableType, + *, + style: StyleType = "tree", + guide_style: StyleType = "tree.line", + expanded: bool = True, + highlight: bool = False, + hide_root: bool = False, + ) -> None: + self.label = label + self.style = style + self.guide_style = guide_style + self.children: List[Tree] = [] + self.expanded = expanded + self.highlight = highlight + self.hide_root = hide_root + + def add( + self, + label: RenderableType, + *, + style: Optional[StyleType] = None, + guide_style: Optional[StyleType] = None, + expanded: bool = True, + highlight: bool = False, + ) -> "Tree": + """Add a child tree. + + Args: + label (RenderableType): The renderable or str for the tree label. + style (StyleType, optional): Style of this tree. Defaults to "tree". + guide_style (StyleType, optional): Style of the guide lines. Defaults to "tree.line". + expanded (bool, optional): Also display children. Defaults to True. + highlight (Optional[bool], optional): Highlight renderable (if str). Defaults to False. + + Returns: + Tree: A new child Tree, which may be further modified. + """ + node = Tree( + label, + style=self.style if style is None else style, + guide_style=self.guide_style if guide_style is None else guide_style, + expanded=expanded, + highlight=self.highlight if highlight is None else highlight, + ) + self.children.append(node) + return node + + def __rich_console__( + self, console: "Console", options: "ConsoleOptions" + ) -> "RenderResult": + + stack: List[Iterator[Tuple[bool, Tree]]] = [] + pop = stack.pop + push = stack.append + new_line = Segment.line() + + get_style = console.get_style + null_style = Style.null() + guide_style = get_style(self.guide_style, default="") or null_style + SPACE, CONTINUE, FORK, END = range(4) + + ASCII_GUIDES = (" ", "| ", "+-- ", "`-- ") + TREE_GUIDES = [ + (" ", "│ ", "├── ", "└── "), + (" ", "┃ ", "┣━━ ", "┗━━ "), + (" ", "║ ", "╠══ ", "╚══ "), + ] + _Segment = Segment + + def make_guide(index: int, style: Style) -> Segment: + """Make a Segment for a level of the guide lines.""" + if options.ascii_only: + line = ASCII_GUIDES[index] + else: + guide = 1 if style.bold else (2 if style.underline2 else 0) + line = TREE_GUIDES[0 if options.legacy_windows else guide][index] + return _Segment(line, style) + + levels: List[Segment] = [make_guide(CONTINUE, guide_style)] + push(iter(loop_last([self]))) + + guide_style_stack = StyleStack(get_style(self.guide_style)) + style_stack = StyleStack(get_style(self.style)) + remove_guide_styles = Style(bold=False, underline2=False) + + depth = 0 + + while stack: + stack_node = pop() + try: + last, node = next(stack_node) + except StopIteration: + levels.pop() + if levels: + guide_style = levels[-1].style or null_style + levels[-1] = make_guide(FORK, guide_style) + guide_style_stack.pop() + style_stack.pop() + continue + push(stack_node) + if last: + levels[-1] = make_guide(END, levels[-1].style or null_style) + + guide_style = guide_style_stack.current + get_style(node.guide_style) + style = style_stack.current + get_style(node.style) + prefix = levels[(2 if self.hide_root else 1) :] + renderable_lines = console.render_lines( + Styled(node.label, style), + options.update( + width=options.max_width + - sum(level.cell_length for level in prefix), + highlight=self.highlight, + height=None, + ), + ) + + if not (depth == 0 and self.hide_root): + for first, line in loop_first(renderable_lines): + if prefix: + yield from _Segment.apply_style( + prefix, + style.background_style, + post_style=remove_guide_styles, + ) + yield from line + yield new_line + if first and prefix: + prefix[-1] = make_guide( + SPACE if last else CONTINUE, prefix[-1].style or null_style + ) + + if node.expanded and node.children: + levels[-1] = make_guide( + SPACE if last else CONTINUE, levels[-1].style or null_style + ) + levels.append( + make_guide(END if len(node.children) == 1 else FORK, guide_style) + ) + style_stack.push(get_style(node.style)) + guide_style_stack.push(get_style(node.guide_style)) + push(iter(loop_last(node.children))) + depth += 1 + + def __rich_measure__( + self, console: "Console", options: "ConsoleOptions" + ) -> "Measurement": + stack: List[Iterator[Tree]] = [iter([self])] + pop = stack.pop + push = stack.append + minimum = 0 + maximum = 0 + measure = Measurement.get + level = 0 + while stack: + iter_tree = pop() + try: + tree = next(iter_tree) + except StopIteration: + level -= 1 + continue + push(iter_tree) + min_measure, max_measure = measure(console, options, tree.label) + indent = level * 4 + minimum = max(min_measure + indent, minimum) + maximum = max(max_measure + indent, maximum) + if tree.expanded and tree.children: + push(iter(tree.children)) + level += 1 + return Measurement(minimum, maximum) + + +if __name__ == "__main__": # pragma: no cover + + from pip._vendor.rich.console import Group + from pip._vendor.rich.markdown import Markdown + from pip._vendor.rich.panel import Panel + from pip._vendor.rich.syntax import Syntax + from pip._vendor.rich.table import Table + + table = Table(row_styles=["", "dim"]) + + table.add_column("Released", style="cyan", no_wrap=True) + table.add_column("Title", style="magenta") + table.add_column("Box Office", justify="right", style="green") + + table.add_row("Dec 20, 2019", "Star Wars: The Rise of Skywalker", "$952,110,690") + table.add_row("May 25, 2018", "Solo: A Star Wars Story", "$393,151,347") + table.add_row("Dec 15, 2017", "Star Wars Ep. V111: The Last Jedi", "$1,332,539,889") + table.add_row("Dec 16, 2016", "Rogue One: A Star Wars Story", "$1,332,439,889") + + code = """\ +class Segment(NamedTuple): + text: str = "" + style: Optional[Style] = None + is_control: bool = False +""" + syntax = Syntax(code, "python", theme="monokai", line_numbers=True) + + markdown = Markdown( + """\ +### example.md +> Hello, World! +> +> Markdown _all_ the things +""" + ) + + root = Tree("🌲 [b green]Rich Tree", highlight=True, hide_root=True) + + node = root.add(":file_folder: Renderables", guide_style="red") + simple_node = node.add(":file_folder: [bold yellow]Atomic", guide_style="uu green") + simple_node.add(Group("📄 Syntax", syntax)) + simple_node.add(Group("📄 Markdown", Panel(markdown, border_style="green"))) + + containers_node = node.add( + ":file_folder: [bold magenta]Containers", guide_style="bold magenta" + ) + containers_node.expanded = True + panel = Panel.fit("Just a panel", border_style="red") + containers_node.add(Group("📄 Panels", panel)) + + containers_node.add(Group("📄 [b magenta]Table", table)) + + console = Console() + console.print(root) diff --git a/src/pip/_vendor/typing_extensions.LICENSE b/src/pip/_vendor/typing_extensions.LICENSE new file mode 100644 index 000000000..583f9f6e6 --- /dev/null +++ b/src/pip/_vendor/typing_extensions.LICENSE @@ -0,0 +1,254 @@ +A. HISTORY OF THE SOFTWARE +========================== + +Python was created in the early 1990s by Guido van Rossum at Stichting +Mathematisch Centrum (CWI, see http://www.cwi.nl) in the Netherlands +as a successor of a language called ABC. Guido remains Python's +principal author, although it includes many contributions from others. + +In 1995, Guido continued his work on Python at the Corporation for +National Research Initiatives (CNRI, see http://www.cnri.reston.va.us) +in Reston, Virginia where he released several versions of the +software. + +In May 2000, Guido and the Python core development team moved to +BeOpen.com to form the BeOpen PythonLabs team. In October of the same +year, the PythonLabs team moved to Digital Creations (now Zope +Corporation, see http://www.zope.com). In 2001, the Python Software +Foundation (PSF, see http://www.python.org/psf/) was formed, a +non-profit organization created specifically to own Python-related +Intellectual Property. Zope Corporation is a sponsoring member of +the PSF. + +All Python releases are Open Source (see http://www.opensource.org for +the Open Source Definition). Historically, most, but not all, Python +releases have also been GPL-compatible; the table below summarizes +the various releases. + + Release Derived Year Owner GPL- + from compatible? (1) + + 0.9.0 thru 1.2 1991-1995 CWI yes + 1.3 thru 1.5.2 1.2 1995-1999 CNRI yes + 1.6 1.5.2 2000 CNRI no + 2.0 1.6 2000 BeOpen.com no + 1.6.1 1.6 2001 CNRI yes (2) + 2.1 2.0+1.6.1 2001 PSF no + 2.0.1 2.0+1.6.1 2001 PSF yes + 2.1.1 2.1+2.0.1 2001 PSF yes + 2.1.2 2.1.1 2002 PSF yes + 2.1.3 2.1.2 2002 PSF yes + 2.2 and above 2.1.1 2001-now PSF yes + +Footnotes: + +(1) GPL-compatible doesn't mean that we're distributing Python under + the GPL. All Python licenses, unlike the GPL, let you distribute + a modified version without making your changes open source. The + GPL-compatible licenses make it possible to combine Python with + other software that is released under the GPL; the others don't. + +(2) According to Richard Stallman, 1.6.1 is not GPL-compatible, + because its license has a choice of law clause. According to + CNRI, however, Stallman's lawyer has told CNRI's lawyer that 1.6.1 + is "not incompatible" with the GPL. + +Thanks to the many outside volunteers who have worked under Guido's +direction to make these releases possible. + + +B. TERMS AND CONDITIONS FOR ACCESSING OR OTHERWISE USING PYTHON +=============================================================== + +PYTHON SOFTWARE FOUNDATION LICENSE VERSION 2 +-------------------------------------------- + +1. This LICENSE AGREEMENT is between the Python Software Foundation +("PSF"), and the Individual or Organization ("Licensee") accessing and +otherwise using this software ("Python") in source or binary form and +its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, PSF hereby +grants Licensee a nonexclusive, royalty-free, world-wide license to reproduce, +analyze, test, perform and/or display publicly, prepare derivative works, +distribute, and otherwise use Python alone or in any derivative version, +provided, however, that PSF's License Agreement and PSF's notice of copyright, +i.e., "Copyright (c) 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010, +2011, 2012, 2013, 2014 Python Software Foundation; All Rights Reserved" are +retained in Python alone or in any derivative version prepared by Licensee. + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python. + +4. PSF is making Python available to Licensee on an "AS IS" +basis. PSF MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, PSF MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. PSF SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. Nothing in this License Agreement shall be deemed to create any +relationship of agency, partnership, or joint venture between PSF and +Licensee. This License Agreement does not grant permission to use PSF +trademarks or trade name in a trademark sense to endorse or promote +products or services of Licensee, or any third party. + +8. By copying, installing or otherwise using Python, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +BEOPEN.COM LICENSE AGREEMENT FOR PYTHON 2.0 +------------------------------------------- + +BEOPEN PYTHON OPEN SOURCE LICENSE AGREEMENT VERSION 1 + +1. This LICENSE AGREEMENT is between BeOpen.com ("BeOpen"), having an +office at 160 Saratoga Avenue, Santa Clara, CA 95051, and the +Individual or Organization ("Licensee") accessing and otherwise using +this software in source or binary form and its associated +documentation ("the Software"). + +2. Subject to the terms and conditions of this BeOpen Python License +Agreement, BeOpen hereby grants Licensee a non-exclusive, +royalty-free, world-wide license to reproduce, analyze, test, perform +and/or display publicly, prepare derivative works, distribute, and +otherwise use the Software alone or in any derivative version, +provided, however, that the BeOpen Python License is retained in the +Software, alone or in any derivative version prepared by Licensee. + +3. BeOpen is making the Software available to Licensee on an "AS IS" +basis. BEOPEN MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, BEOPEN MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF THE SOFTWARE WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +4. BEOPEN SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF THE +SOFTWARE FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS +AS A RESULT OF USING, MODIFYING OR DISTRIBUTING THE SOFTWARE, OR ANY +DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +5. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +6. This License Agreement shall be governed by and interpreted in all +respects by the law of the State of California, excluding conflict of +law provisions. Nothing in this License Agreement shall be deemed to +create any relationship of agency, partnership, or joint venture +between BeOpen and Licensee. This License Agreement does not grant +permission to use BeOpen trademarks or trade names in a trademark +sense to endorse or promote products or services of Licensee, or any +third party. As an exception, the "BeOpen Python" logos available at +http://www.pythonlabs.com/logos.html may be used according to the +permissions granted on that web page. + +7. By copying, installing or otherwise using the software, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +CNRI LICENSE AGREEMENT FOR PYTHON 1.6.1 +--------------------------------------- + +1. This LICENSE AGREEMENT is between the Corporation for National +Research Initiatives, having an office at 1895 Preston White Drive, +Reston, VA 20191 ("CNRI"), and the Individual or Organization +("Licensee") accessing and otherwise using Python 1.6.1 software in +source or binary form and its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, CNRI +hereby grants Licensee a nonexclusive, royalty-free, world-wide +license to reproduce, analyze, test, perform and/or display publicly, +prepare derivative works, distribute, and otherwise use Python 1.6.1 +alone or in any derivative version, provided, however, that CNRI's +License Agreement and CNRI's notice of copyright, i.e., "Copyright (c) +1995-2001 Corporation for National Research Initiatives; All Rights +Reserved" are retained in Python 1.6.1 alone or in any derivative +version prepared by Licensee. Alternately, in lieu of CNRI's License +Agreement, Licensee may substitute the following text (omitting the +quotes): "Python 1.6.1 is made available subject to the terms and +conditions in CNRI's License Agreement. This Agreement together with +Python 1.6.1 may be located on the Internet using the following +unique, persistent identifier (known as a handle): 1895.22/1013. This +Agreement may also be obtained from a proxy server on the Internet +using the following URL: http://hdl.handle.net/1895.22/1013". + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python 1.6.1 or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python 1.6.1. + +4. CNRI is making Python 1.6.1 available to Licensee on an "AS IS" +basis. CNRI MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, CNRI MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON 1.6.1 WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. CNRI SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +1.6.1 FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON 1.6.1, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. This License Agreement shall be governed by the federal +intellectual property law of the United States, including without +limitation the federal copyright law, and, to the extent such +U.S. federal law does not apply, by the law of the Commonwealth of +Virginia, excluding Virginia's conflict of law provisions. +Notwithstanding the foregoing, with regard to derivative works based +on Python 1.6.1 that incorporate non-separable material that was +previously distributed under the GNU General Public License (GPL), the +law of the Commonwealth of Virginia shall govern this License +Agreement only as to issues arising under or with respect to +Paragraphs 4, 5, and 7 of this License Agreement. Nothing in this +License Agreement shall be deemed to create any relationship of +agency, partnership, or joint venture between CNRI and Licensee. This +License Agreement does not grant permission to use CNRI trademarks or +trade name in a trademark sense to endorse or promote products or +services of Licensee, or any third party. + +8. By clicking on the "ACCEPT" button where indicated, or by copying, +installing or otherwise using Python 1.6.1, Licensee agrees to be +bound by the terms and conditions of this License Agreement. + + ACCEPT + + +CWI LICENSE AGREEMENT FOR PYTHON 0.9.0 THROUGH 1.2 +-------------------------------------------------- + +Copyright (c) 1991 - 1995, Stichting Mathematisch Centrum Amsterdam, +The Netherlands. All rights reserved. + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Stichting Mathematisch +Centrum or CWI not be used in advertising or publicity pertaining to +distribution of the software without specific, written prior +permission. + +STICHTING MATHEMATISCH CENTRUM DISCLAIMS ALL WARRANTIES WITH REGARD TO +THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS, IN NO EVENT SHALL STICHTING MATHEMATISCH CENTRUM BE LIABLE +FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT +OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/src/pip/_vendor/typing_extensions.py b/src/pip/_vendor/typing_extensions.py new file mode 100644 index 000000000..95bb87357 --- /dev/null +++ b/src/pip/_vendor/typing_extensions.py @@ -0,0 +1,2843 @@ +import abc +import collections +import contextlib +import sys +import typing +import collections.abc as collections_abc +import operator + +# These are used by Protocol implementation +# We use internal typing helpers here, but this significantly reduces +# code duplication. (Also this is only until Protocol is in typing.) +from typing import Generic, Callable, TypeVar, Tuple + +# After PEP 560, internal typing API was substantially reworked. +# This is especially important for Protocol class which uses internal APIs +# quite extensivelly. +PEP_560 = sys.version_info[:3] >= (3, 7, 0) + +if PEP_560: + GenericMeta = TypingMeta = type + from typing import _GenericAlias +else: + from typing import GenericMeta, TypingMeta +OLD_GENERICS = False +try: + from typing import _type_vars, _next_in_mro, _type_check +except ImportError: + OLD_GENERICS = True +try: + from typing import _subs_tree # noqa + SUBS_TREE = True +except ImportError: + SUBS_TREE = False +try: + from typing import _tp_cache +except ImportError: + def _tp_cache(x): + return x +try: + from typing import _TypingEllipsis, _TypingEmpty +except ImportError: + class _TypingEllipsis: + pass + + class _TypingEmpty: + pass + + +# The two functions below are copies of typing internal helpers. +# They are needed by _ProtocolMeta + + +def _no_slots_copy(dct): + dict_copy = dict(dct) + if '__slots__' in dict_copy: + for slot in dict_copy['__slots__']: + dict_copy.pop(slot, None) + return dict_copy + + +def _check_generic(cls, parameters): + if not cls.__parameters__: + raise TypeError("%s is not a generic class" % repr(cls)) + alen = len(parameters) + elen = len(cls.__parameters__) + if alen != elen: + raise TypeError("Too %s parameters for %s; actual %s, expected %s" % + ("many" if alen > elen else "few", repr(cls), alen, elen)) + + +if hasattr(typing, '_generic_new'): + _generic_new = typing._generic_new +else: + # Note: The '_generic_new(...)' function is used as a part of the + # process of creating a generic type and was added to the typing module + # as of Python 3.5.3. + # + # We've defined '_generic_new(...)' below to exactly match the behavior + # implemented in older versions of 'typing' bundled with Python 3.5.0 to + # 3.5.2. This helps eliminate redundancy when defining collection types + # like 'Deque' later. + # + # See https://github.com/python/typing/pull/308 for more details -- in + # particular, compare and contrast the definition of types like + # 'typing.List' before and after the merge. + + def _generic_new(base_cls, cls, *args, **kwargs): + return base_cls.__new__(cls, *args, **kwargs) + +# See https://github.com/python/typing/pull/439 +if hasattr(typing, '_geqv'): + from typing import _geqv + _geqv_defined = True +else: + _geqv = None + _geqv_defined = False + +if sys.version_info[:2] >= (3, 6): + import _collections_abc + _check_methods_in_mro = _collections_abc._check_methods +else: + def _check_methods_in_mro(C, *methods): + mro = C.__mro__ + for method in methods: + for B in mro: + if method in B.__dict__: + if B.__dict__[method] is None: + return NotImplemented + break + else: + return NotImplemented + return True + + +# Please keep __all__ alphabetized within each category. +__all__ = [ + # Super-special typing primitives. + 'ClassVar', + 'Concatenate', + 'Final', + 'ParamSpec', + 'Type', + + # ABCs (from collections.abc). + # The following are added depending on presence + # of their non-generic counterparts in stdlib: + # 'Awaitable', + # 'AsyncIterator', + # 'AsyncIterable', + # 'Coroutine', + # 'AsyncGenerator', + # 'AsyncContextManager', + # 'ChainMap', + + # Concrete collection types. + 'ContextManager', + 'Counter', + 'Deque', + 'DefaultDict', + 'OrderedDict', + 'TypedDict', + + # Structural checks, a.k.a. protocols. + 'SupportsIndex', + + # One-off things. + 'final', + 'IntVar', + 'Literal', + 'NewType', + 'overload', + 'Text', + 'TypeAlias', + 'TypeGuard', + 'TYPE_CHECKING', +] + +# Annotated relies on substitution trees of pep 560. It will not work for +# versions of typing older than 3.5.3 +HAVE_ANNOTATED = PEP_560 or SUBS_TREE + +if PEP_560: + __all__.extend(["get_args", "get_origin", "get_type_hints"]) + +if HAVE_ANNOTATED: + __all__.append("Annotated") + +# Protocols are hard to backport to the original version of typing 3.5.0 +HAVE_PROTOCOLS = sys.version_info[:3] != (3, 5, 0) + +if HAVE_PROTOCOLS: + __all__.extend(['Protocol', 'runtime', 'runtime_checkable']) + + +# TODO +if hasattr(typing, 'NoReturn'): + NoReturn = typing.NoReturn +elif hasattr(typing, '_FinalTypingBase'): + class _NoReturn(typing._FinalTypingBase, _root=True): + """Special type indicating functions that never return. + Example:: + + from typing import NoReturn + + def stop() -> NoReturn: + raise Exception('no way') + + This type is invalid in other positions, e.g., ``List[NoReturn]`` + will fail in static type checkers. + """ + __slots__ = () + + def __instancecheck__(self, obj): + raise TypeError("NoReturn cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("NoReturn cannot be used with issubclass().") + + NoReturn = _NoReturn(_root=True) +else: + class _NoReturnMeta(typing.TypingMeta): + """Metaclass for NoReturn""" + def __new__(cls, name, bases, namespace, _root=False): + return super().__new__(cls, name, bases, namespace, _root=_root) + + def __instancecheck__(self, obj): + raise TypeError("NoReturn cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("NoReturn cannot be used with issubclass().") + + class NoReturn(typing.Final, metaclass=_NoReturnMeta, _root=True): + """Special type indicating functions that never return. + Example:: + + from typing import NoReturn + + def stop() -> NoReturn: + raise Exception('no way') + + This type is invalid in other positions, e.g., ``List[NoReturn]`` + will fail in static type checkers. + """ + __slots__ = () + + +# Some unconstrained type variables. These are used by the container types. +# (These are not for export.) +T = typing.TypeVar('T') # Any type. +KT = typing.TypeVar('KT') # Key type. +VT = typing.TypeVar('VT') # Value type. +T_co = typing.TypeVar('T_co', covariant=True) # Any type covariant containers. +V_co = typing.TypeVar('V_co', covariant=True) # Any type covariant containers. +VT_co = typing.TypeVar('VT_co', covariant=True) # Value type covariant containers. +T_contra = typing.TypeVar('T_contra', contravariant=True) # Ditto contravariant. + + +if hasattr(typing, 'ClassVar'): + ClassVar = typing.ClassVar +elif hasattr(typing, '_FinalTypingBase'): + class _ClassVar(typing._FinalTypingBase, _root=True): + """Special type construct to mark class variables. + + An annotation wrapped in ClassVar indicates that a given + attribute is intended to be used as a class variable and + should not be set on instances of that class. Usage:: + + class Starship: + stats: ClassVar[Dict[str, int]] = {} # class variable + damage: int = 10 # instance variable + + ClassVar accepts only types and cannot be further subscribed. + + Note that ClassVar is not a class itself, and should not + be used with isinstance() or issubclass(). + """ + + __slots__ = ('__type__',) + + def __init__(self, tp=None, **kwds): + self.__type__ = tp + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is None: + return cls(typing._type_check(item, + '{} accepts only single type.'.format(cls.__name__[1:])), + _root=True) + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(new_tp, _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not isinstance(other, _ClassVar): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + ClassVar = _ClassVar(_root=True) +else: + class _ClassVarMeta(typing.TypingMeta): + """Metaclass for ClassVar""" + + def __new__(cls, name, bases, namespace, tp=None, _root=False): + self = super().__new__(cls, name, bases, namespace, _root=_root) + if tp is not None: + self.__type__ = tp + return self + + def __instancecheck__(self, obj): + raise TypeError("ClassVar cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("ClassVar cannot be used with issubclass().") + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is not None: + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + param = typing._type_check( + item, + '{} accepts only single type.'.format(cls.__name__[1:])) + return cls(self.__name__, self.__bases__, + dict(self.__dict__), tp=param, _root=True) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(self.__name__, self.__bases__, + dict(self.__dict__), tp=self.__type__, + _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not isinstance(other, ClassVar): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + class ClassVar(typing.Final, metaclass=_ClassVarMeta, _root=True): + """Special type construct to mark class variables. + + An annotation wrapped in ClassVar indicates that a given + attribute is intended to be used as a class variable and + should not be set on instances of that class. Usage:: + + class Starship: + stats: ClassVar[Dict[str, int]] = {} # class variable + damage: int = 10 # instance variable + + ClassVar accepts only types and cannot be further subscribed. + + Note that ClassVar is not a class itself, and should not + be used with isinstance() or issubclass(). + """ + + __type__ = None + +# On older versions of typing there is an internal class named "Final". +if hasattr(typing, 'Final') and sys.version_info[:2] >= (3, 7): + Final = typing.Final +elif sys.version_info[:2] >= (3, 7): + class _FinalForm(typing._SpecialForm, _root=True): + + def __repr__(self): + return 'typing_extensions.' + self._name + + def __getitem__(self, parameters): + item = typing._type_check(parameters, + '{} accepts only single type'.format(self._name)) + return _GenericAlias(self, (item,)) + + Final = _FinalForm('Final', + doc="""A special typing construct to indicate that a name + cannot be re-assigned or overridden in a subclass. + For example: + + MAX_SIZE: Final = 9000 + MAX_SIZE += 1 # Error reported by type checker + + class Connection: + TIMEOUT: Final[int] = 10 + class FastConnector(Connection): + TIMEOUT = 1 # Error reported by type checker + + There is no runtime checking of these properties.""") +elif hasattr(typing, '_FinalTypingBase'): + class _Final(typing._FinalTypingBase, _root=True): + """A special typing construct to indicate that a name + cannot be re-assigned or overridden in a subclass. + For example: + + MAX_SIZE: Final = 9000 + MAX_SIZE += 1 # Error reported by type checker + + class Connection: + TIMEOUT: Final[int] = 10 + class FastConnector(Connection): + TIMEOUT = 1 # Error reported by type checker + + There is no runtime checking of these properties. + """ + + __slots__ = ('__type__',) + + def __init__(self, tp=None, **kwds): + self.__type__ = tp + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is None: + return cls(typing._type_check(item, + '{} accepts only single type.'.format(cls.__name__[1:])), + _root=True) + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(new_tp, _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not isinstance(other, _Final): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + Final = _Final(_root=True) +else: + class _FinalMeta(typing.TypingMeta): + """Metaclass for Final""" + + def __new__(cls, name, bases, namespace, tp=None, _root=False): + self = super().__new__(cls, name, bases, namespace, _root=_root) + if tp is not None: + self.__type__ = tp + return self + + def __instancecheck__(self, obj): + raise TypeError("Final cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("Final cannot be used with issubclass().") + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is not None: + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + param = typing._type_check( + item, + '{} accepts only single type.'.format(cls.__name__[1:])) + return cls(self.__name__, self.__bases__, + dict(self.__dict__), tp=param, _root=True) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(self.__name__, self.__bases__, + dict(self.__dict__), tp=self.__type__, + _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not isinstance(other, Final): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + class Final(typing.Final, metaclass=_FinalMeta, _root=True): + """A special typing construct to indicate that a name + cannot be re-assigned or overridden in a subclass. + For example: + + MAX_SIZE: Final = 9000 + MAX_SIZE += 1 # Error reported by type checker + + class Connection: + TIMEOUT: Final[int] = 10 + class FastConnector(Connection): + TIMEOUT = 1 # Error reported by type checker + + There is no runtime checking of these properties. + """ + + __type__ = None + + +if hasattr(typing, 'final'): + final = typing.final +else: + def final(f): + """This decorator can be used to indicate to type checkers that + the decorated method cannot be overridden, and decorated class + cannot be subclassed. For example: + + class Base: + @final + def done(self) -> None: + ... + class Sub(Base): + def done(self) -> None: # Error reported by type checker + ... + @final + class Leaf: + ... + class Other(Leaf): # Error reported by type checker + ... + + There is no runtime checking of these properties. + """ + return f + + +def IntVar(name): + return TypeVar(name) + + +if hasattr(typing, 'Literal'): + Literal = typing.Literal +elif sys.version_info[:2] >= (3, 7): + class _LiteralForm(typing._SpecialForm, _root=True): + + def __repr__(self): + return 'typing_extensions.' + self._name + + def __getitem__(self, parameters): + return _GenericAlias(self, parameters) + + Literal = _LiteralForm('Literal', + doc="""A type that can be used to indicate to type checkers + that the corresponding value has a value literally equivalent + to the provided parameter. For example: + + var: Literal[4] = 4 + + The type checker understands that 'var' is literally equal to + the value 4 and no other value. + + Literal[...] cannot be subclassed. There is no runtime + checking verifying that the parameter is actually a value + instead of a type.""") +elif hasattr(typing, '_FinalTypingBase'): + class _Literal(typing._FinalTypingBase, _root=True): + """A type that can be used to indicate to type checkers that the + corresponding value has a value literally equivalent to the + provided parameter. For example: + + var: Literal[4] = 4 + + The type checker understands that 'var' is literally equal to the + value 4 and no other value. + + Literal[...] cannot be subclassed. There is no runtime checking + verifying that the parameter is actually a value instead of a type. + """ + + __slots__ = ('__values__',) + + def __init__(self, values=None, **kwds): + self.__values__ = values + + def __getitem__(self, values): + cls = type(self) + if self.__values__ is None: + if not isinstance(values, tuple): + values = (values,) + return cls(values, _root=True) + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + def _eval_type(self, globalns, localns): + return self + + def __repr__(self): + r = super().__repr__() + if self.__values__ is not None: + r += '[{}]'.format(', '.join(map(typing._type_repr, self.__values__))) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__values__)) + + def __eq__(self, other): + if not isinstance(other, _Literal): + return NotImplemented + if self.__values__ is not None: + return self.__values__ == other.__values__ + return self is other + + Literal = _Literal(_root=True) +else: + class _LiteralMeta(typing.TypingMeta): + """Metaclass for Literal""" + + def __new__(cls, name, bases, namespace, values=None, _root=False): + self = super().__new__(cls, name, bases, namespace, _root=_root) + if values is not None: + self.__values__ = values + return self + + def __instancecheck__(self, obj): + raise TypeError("Literal cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("Literal cannot be used with issubclass().") + + def __getitem__(self, item): + cls = type(self) + if self.__values__ is not None: + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + if not isinstance(item, tuple): + item = (item,) + return cls(self.__name__, self.__bases__, + dict(self.__dict__), values=item, _root=True) + + def _eval_type(self, globalns, localns): + return self + + def __repr__(self): + r = super().__repr__() + if self.__values__ is not None: + r += '[{}]'.format(', '.join(map(typing._type_repr, self.__values__))) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__values__)) + + def __eq__(self, other): + if not isinstance(other, Literal): + return NotImplemented + if self.__values__ is not None: + return self.__values__ == other.__values__ + return self is other + + class Literal(typing.Final, metaclass=_LiteralMeta, _root=True): + """A type that can be used to indicate to type checkers that the + corresponding value has a value literally equivalent to the + provided parameter. For example: + + var: Literal[4] = 4 + + The type checker understands that 'var' is literally equal to the + value 4 and no other value. + + Literal[...] cannot be subclassed. There is no runtime checking + verifying that the parameter is actually a value instead of a type. + """ + + __values__ = None + + +def _overload_dummy(*args, **kwds): + """Helper for @overload to raise when called.""" + raise NotImplementedError( + "You should not call an overloaded function. " + "A series of @overload-decorated functions " + "outside a stub module should always be followed " + "by an implementation that is not @overload-ed.") + + +def overload(func): + """Decorator for overloaded functions/methods. + + In a stub file, place two or more stub definitions for the same + function in a row, each decorated with @overload. For example: + + @overload + def utf8(value: None) -> None: ... + @overload + def utf8(value: bytes) -> bytes: ... + @overload + def utf8(value: str) -> bytes: ... + + In a non-stub file (i.e. a regular .py file), do the same but + follow it with an implementation. The implementation should *not* + be decorated with @overload. For example: + + @overload + def utf8(value: None) -> None: ... + @overload + def utf8(value: bytes) -> bytes: ... + @overload + def utf8(value: str) -> bytes: ... + def utf8(value): + # implementation goes here + """ + return _overload_dummy + + +# This is not a real generic class. Don't use outside annotations. +if hasattr(typing, 'Type'): + Type = typing.Type +else: + # Internal type variable used for Type[]. + CT_co = typing.TypeVar('CT_co', covariant=True, bound=type) + + class Type(typing.Generic[CT_co], extra=type): + """A special construct usable to annotate class objects. + + For example, suppose we have the following classes:: + + class User: ... # Abstract base for User classes + class BasicUser(User): ... + class ProUser(User): ... + class TeamUser(User): ... + + And a function that takes a class argument that's a subclass of + User and returns an instance of the corresponding class:: + + U = TypeVar('U', bound=User) + def new_user(user_class: Type[U]) -> U: + user = user_class() + # (Here we could write the user object to a database) + return user + joe = new_user(BasicUser) + + At this point the type checker knows that joe has type BasicUser. + """ + + __slots__ = () + + +# Various ABCs mimicking those in collections.abc. +# A few are simply re-exported for completeness. + +def _define_guard(type_name): + """ + Returns True if the given type isn't defined in typing but + is defined in collections_abc. + + Adds the type to __all__ if the collection is found in either + typing or collection_abc. + """ + if hasattr(typing, type_name): + __all__.append(type_name) + globals()[type_name] = getattr(typing, type_name) + return False + elif hasattr(collections_abc, type_name): + __all__.append(type_name) + return True + else: + return False + + +class _ExtensionsGenericMeta(GenericMeta): + def __subclasscheck__(self, subclass): + """This mimics a more modern GenericMeta.__subclasscheck__() logic + (that does not have problems with recursion) to work around interactions + between collections, typing, and typing_extensions on older + versions of Python, see https://github.com/python/typing/issues/501. + """ + if sys.version_info[:3] >= (3, 5, 3) or sys.version_info[:3] < (3, 5, 0): + if self.__origin__ is not None: + if sys._getframe(1).f_globals['__name__'] not in ['abc', 'functools']: + raise TypeError("Parameterized generics cannot be used with class " + "or instance checks") + return False + if not self.__extra__: + return super().__subclasscheck__(subclass) + res = self.__extra__.__subclasshook__(subclass) + if res is not NotImplemented: + return res + if self.__extra__ in subclass.__mro__: + return True + for scls in self.__extra__.__subclasses__(): + if isinstance(scls, GenericMeta): + continue + if issubclass(subclass, scls): + return True + return False + + +if _define_guard('Awaitable'): + class Awaitable(typing.Generic[T_co], metaclass=_ExtensionsGenericMeta, + extra=collections_abc.Awaitable): + __slots__ = () + + +if _define_guard('Coroutine'): + class Coroutine(Awaitable[V_co], typing.Generic[T_co, T_contra, V_co], + metaclass=_ExtensionsGenericMeta, + extra=collections_abc.Coroutine): + __slots__ = () + + +if _define_guard('AsyncIterable'): + class AsyncIterable(typing.Generic[T_co], + metaclass=_ExtensionsGenericMeta, + extra=collections_abc.AsyncIterable): + __slots__ = () + + +if _define_guard('AsyncIterator'): + class AsyncIterator(AsyncIterable[T_co], + metaclass=_ExtensionsGenericMeta, + extra=collections_abc.AsyncIterator): + __slots__ = () + + +if hasattr(typing, 'Deque'): + Deque = typing.Deque +elif _geqv_defined: + class Deque(collections.deque, typing.MutableSequence[T], + metaclass=_ExtensionsGenericMeta, + extra=collections.deque): + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, Deque): + return collections.deque(*args, **kwds) + return _generic_new(collections.deque, cls, *args, **kwds) +else: + class Deque(collections.deque, typing.MutableSequence[T], + metaclass=_ExtensionsGenericMeta, + extra=collections.deque): + __slots__ = () + + def __new__(cls, *args, **kwds): + if cls._gorg is Deque: + return collections.deque(*args, **kwds) + return _generic_new(collections.deque, cls, *args, **kwds) + + +if hasattr(typing, 'ContextManager'): + ContextManager = typing.ContextManager +elif hasattr(contextlib, 'AbstractContextManager'): + class ContextManager(typing.Generic[T_co], + metaclass=_ExtensionsGenericMeta, + extra=contextlib.AbstractContextManager): + __slots__ = () +else: + class ContextManager(typing.Generic[T_co]): + __slots__ = () + + def __enter__(self): + return self + + @abc.abstractmethod + def __exit__(self, exc_type, exc_value, traceback): + return None + + @classmethod + def __subclasshook__(cls, C): + if cls is ContextManager: + # In Python 3.6+, it is possible to set a method to None to + # explicitly indicate that the class does not implement an ABC + # (https://bugs.python.org/issue25958), but we do not support + # that pattern here because this fallback class is only used + # in Python 3.5 and earlier. + if (any("__enter__" in B.__dict__ for B in C.__mro__) and + any("__exit__" in B.__dict__ for B in C.__mro__)): + return True + return NotImplemented + + +if hasattr(typing, 'AsyncContextManager'): + AsyncContextManager = typing.AsyncContextManager + __all__.append('AsyncContextManager') +elif hasattr(contextlib, 'AbstractAsyncContextManager'): + class AsyncContextManager(typing.Generic[T_co], + metaclass=_ExtensionsGenericMeta, + extra=contextlib.AbstractAsyncContextManager): + __slots__ = () + + __all__.append('AsyncContextManager') +elif sys.version_info[:2] >= (3, 5): + exec(""" +class AsyncContextManager(typing.Generic[T_co]): + __slots__ = () + + async def __aenter__(self): + return self + + @abc.abstractmethod + async def __aexit__(self, exc_type, exc_value, traceback): + return None + + @classmethod + def __subclasshook__(cls, C): + if cls is AsyncContextManager: + return _check_methods_in_mro(C, "__aenter__", "__aexit__") + return NotImplemented + +__all__.append('AsyncContextManager') +""") + + +if hasattr(typing, 'DefaultDict'): + DefaultDict = typing.DefaultDict +elif _geqv_defined: + class DefaultDict(collections.defaultdict, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.defaultdict): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, DefaultDict): + return collections.defaultdict(*args, **kwds) + return _generic_new(collections.defaultdict, cls, *args, **kwds) +else: + class DefaultDict(collections.defaultdict, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.defaultdict): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if cls._gorg is DefaultDict: + return collections.defaultdict(*args, **kwds) + return _generic_new(collections.defaultdict, cls, *args, **kwds) + + +if hasattr(typing, 'OrderedDict'): + OrderedDict = typing.OrderedDict +elif (3, 7, 0) <= sys.version_info[:3] < (3, 7, 2): + OrderedDict = typing._alias(collections.OrderedDict, (KT, VT)) +elif _geqv_defined: + class OrderedDict(collections.OrderedDict, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.OrderedDict): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, OrderedDict): + return collections.OrderedDict(*args, **kwds) + return _generic_new(collections.OrderedDict, cls, *args, **kwds) +else: + class OrderedDict(collections.OrderedDict, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.OrderedDict): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if cls._gorg is OrderedDict: + return collections.OrderedDict(*args, **kwds) + return _generic_new(collections.OrderedDict, cls, *args, **kwds) + + +if hasattr(typing, 'Counter'): + Counter = typing.Counter +elif (3, 5, 0) <= sys.version_info[:3] <= (3, 5, 1): + assert _geqv_defined + _TInt = typing.TypeVar('_TInt') + + class _CounterMeta(typing.GenericMeta): + """Metaclass for Counter""" + def __getitem__(self, item): + return super().__getitem__((item, int)) + + class Counter(collections.Counter, + typing.Dict[T, int], + metaclass=_CounterMeta, + extra=collections.Counter): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, Counter): + return collections.Counter(*args, **kwds) + return _generic_new(collections.Counter, cls, *args, **kwds) + +elif _geqv_defined: + class Counter(collections.Counter, + typing.Dict[T, int], + metaclass=_ExtensionsGenericMeta, extra=collections.Counter): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, Counter): + return collections.Counter(*args, **kwds) + return _generic_new(collections.Counter, cls, *args, **kwds) + +else: + class Counter(collections.Counter, + typing.Dict[T, int], + metaclass=_ExtensionsGenericMeta, extra=collections.Counter): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if cls._gorg is Counter: + return collections.Counter(*args, **kwds) + return _generic_new(collections.Counter, cls, *args, **kwds) + + +if hasattr(typing, 'ChainMap'): + ChainMap = typing.ChainMap + __all__.append('ChainMap') +elif hasattr(collections, 'ChainMap'): + # ChainMap only exists in 3.3+ + if _geqv_defined: + class ChainMap(collections.ChainMap, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.ChainMap): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if _geqv(cls, ChainMap): + return collections.ChainMap(*args, **kwds) + return _generic_new(collections.ChainMap, cls, *args, **kwds) + else: + class ChainMap(collections.ChainMap, typing.MutableMapping[KT, VT], + metaclass=_ExtensionsGenericMeta, + extra=collections.ChainMap): + + __slots__ = () + + def __new__(cls, *args, **kwds): + if cls._gorg is ChainMap: + return collections.ChainMap(*args, **kwds) + return _generic_new(collections.ChainMap, cls, *args, **kwds) + + __all__.append('ChainMap') + + +if _define_guard('AsyncGenerator'): + class AsyncGenerator(AsyncIterator[T_co], typing.Generic[T_co, T_contra], + metaclass=_ExtensionsGenericMeta, + extra=collections_abc.AsyncGenerator): + __slots__ = () + + +if hasattr(typing, 'NewType'): + NewType = typing.NewType +else: + def NewType(name, tp): + """NewType creates simple unique types with almost zero + runtime overhead. NewType(name, tp) is considered a subtype of tp + by static type checkers. At runtime, NewType(name, tp) returns + a dummy function that simply returns its argument. Usage:: + + UserId = NewType('UserId', int) + + def name_by_id(user_id: UserId) -> str: + ... + + UserId('user') # Fails type check + + name_by_id(42) # Fails type check + name_by_id(UserId(42)) # OK + + num = UserId(5) + 1 # type: int + """ + + def new_type(x): + return x + + new_type.__name__ = name + new_type.__supertype__ = tp + return new_type + + +if hasattr(typing, 'Text'): + Text = typing.Text +else: + Text = str + + +if hasattr(typing, 'TYPE_CHECKING'): + TYPE_CHECKING = typing.TYPE_CHECKING +else: + # Constant that's True when type checking, but False here. + TYPE_CHECKING = False + + +def _gorg(cls): + """This function exists for compatibility with old typing versions.""" + assert isinstance(cls, GenericMeta) + if hasattr(cls, '_gorg'): + return cls._gorg + while cls.__origin__ is not None: + cls = cls.__origin__ + return cls + + +if OLD_GENERICS: + def _next_in_mro(cls): # noqa + """This function exists for compatibility with old typing versions.""" + next_in_mro = object + for i, c in enumerate(cls.__mro__[:-1]): + if isinstance(c, GenericMeta) and _gorg(c) is Generic: + next_in_mro = cls.__mro__[i + 1] + return next_in_mro + + +_PROTO_WHITELIST = ['Callable', 'Awaitable', + 'Iterable', 'Iterator', 'AsyncIterable', 'AsyncIterator', + 'Hashable', 'Sized', 'Container', 'Collection', 'Reversible', + 'ContextManager', 'AsyncContextManager'] + + +def _get_protocol_attrs(cls): + attrs = set() + for base in cls.__mro__[:-1]: # without object + if base.__name__ in ('Protocol', 'Generic'): + continue + annotations = getattr(base, '__annotations__', {}) + for attr in list(base.__dict__.keys()) + list(annotations.keys()): + if (not attr.startswith('_abc_') and attr not in ( + '__abstractmethods__', '__annotations__', '__weakref__', + '_is_protocol', '_is_runtime_protocol', '__dict__', + '__args__', '__slots__', + '__next_in_mro__', '__parameters__', '__origin__', + '__orig_bases__', '__extra__', '__tree_hash__', + '__doc__', '__subclasshook__', '__init__', '__new__', + '__module__', '_MutableMapping__marker', '_gorg')): + attrs.add(attr) + return attrs + + +def _is_callable_members_only(cls): + return all(callable(getattr(cls, attr, None)) for attr in _get_protocol_attrs(cls)) + + +if hasattr(typing, 'Protocol'): + Protocol = typing.Protocol +elif HAVE_PROTOCOLS and not PEP_560: + + def _no_init(self, *args, **kwargs): + if type(self)._is_protocol: + raise TypeError('Protocols cannot be instantiated') + + class _ProtocolMeta(GenericMeta): + """Internal metaclass for Protocol. + + This exists so Protocol classes can be generic without deriving + from Generic. + """ + if not OLD_GENERICS: + def __new__(cls, name, bases, namespace, + tvars=None, args=None, origin=None, extra=None, orig_bases=None): + # This is just a version copied from GenericMeta.__new__ that + # includes "Protocol" special treatment. (Comments removed for brevity.) + assert extra is None # Protocols should not have extra + if tvars is not None: + assert origin is not None + assert all(isinstance(t, TypeVar) for t in tvars), tvars + else: + tvars = _type_vars(bases) + gvars = None + for base in bases: + if base is Generic: + raise TypeError("Cannot inherit from plain Generic") + if (isinstance(base, GenericMeta) and + base.__origin__ in (Generic, Protocol)): + if gvars is not None: + raise TypeError( + "Cannot inherit from Generic[...] or" + " Protocol[...] multiple times.") + gvars = base.__parameters__ + if gvars is None: + gvars = tvars + else: + tvarset = set(tvars) + gvarset = set(gvars) + if not tvarset <= gvarset: + raise TypeError( + "Some type variables (%s) " + "are not listed in %s[%s]" % + (", ".join(str(t) for t in tvars if t not in gvarset), + "Generic" if any(b.__origin__ is Generic + for b in bases) else "Protocol", + ", ".join(str(g) for g in gvars))) + tvars = gvars + + initial_bases = bases + if (extra is not None and type(extra) is abc.ABCMeta and + extra not in bases): + bases = (extra,) + bases + bases = tuple(_gorg(b) if isinstance(b, GenericMeta) else b + for b in bases) + if any(isinstance(b, GenericMeta) and b is not Generic for b in bases): + bases = tuple(b for b in bases if b is not Generic) + namespace.update({'__origin__': origin, '__extra__': extra}) + self = super(GenericMeta, cls).__new__(cls, name, bases, namespace, + _root=True) + super(GenericMeta, self).__setattr__('_gorg', + self if not origin else + _gorg(origin)) + self.__parameters__ = tvars + self.__args__ = tuple(... if a is _TypingEllipsis else + () if a is _TypingEmpty else + a for a in args) if args else None + self.__next_in_mro__ = _next_in_mro(self) + if orig_bases is None: + self.__orig_bases__ = initial_bases + elif origin is not None: + self._abc_registry = origin._abc_registry + self._abc_cache = origin._abc_cache + if hasattr(self, '_subs_tree'): + self.__tree_hash__ = (hash(self._subs_tree()) if origin else + super(GenericMeta, self).__hash__()) + return self + + def __init__(cls, *args, **kwargs): + super().__init__(*args, **kwargs) + if not cls.__dict__.get('_is_protocol', None): + cls._is_protocol = any(b is Protocol or + isinstance(b, _ProtocolMeta) and + b.__origin__ is Protocol + for b in cls.__bases__) + if cls._is_protocol: + for base in cls.__mro__[1:]: + if not (base in (object, Generic) or + base.__module__ == 'collections.abc' and + base.__name__ in _PROTO_WHITELIST or + isinstance(base, TypingMeta) and base._is_protocol or + isinstance(base, GenericMeta) and + base.__origin__ is Generic): + raise TypeError('Protocols can only inherit from other' + ' protocols, got %r' % base) + + cls.__init__ = _no_init + + def _proto_hook(other): + if not cls.__dict__.get('_is_protocol', None): + return NotImplemented + if not isinstance(other, type): + # Same error as for issubclass(1, int) + raise TypeError('issubclass() arg 1 must be a class') + for attr in _get_protocol_attrs(cls): + for base in other.__mro__: + if attr in base.__dict__: + if base.__dict__[attr] is None: + return NotImplemented + break + annotations = getattr(base, '__annotations__', {}) + if (isinstance(annotations, typing.Mapping) and + attr in annotations and + isinstance(other, _ProtocolMeta) and + other._is_protocol): + break + else: + return NotImplemented + return True + if '__subclasshook__' not in cls.__dict__: + cls.__subclasshook__ = _proto_hook + + def __instancecheck__(self, instance): + # We need this method for situations where attributes are + # assigned in __init__. + if ((not getattr(self, '_is_protocol', False) or + _is_callable_members_only(self)) and + issubclass(instance.__class__, self)): + return True + if self._is_protocol: + if all(hasattr(instance, attr) and + (not callable(getattr(self, attr, None)) or + getattr(instance, attr) is not None) + for attr in _get_protocol_attrs(self)): + return True + return super(GenericMeta, self).__instancecheck__(instance) + + def __subclasscheck__(self, cls): + if self.__origin__ is not None: + if sys._getframe(1).f_globals['__name__'] not in ['abc', 'functools']: + raise TypeError("Parameterized generics cannot be used with class " + "or instance checks") + return False + if (self.__dict__.get('_is_protocol', None) and + not self.__dict__.get('_is_runtime_protocol', None)): + if sys._getframe(1).f_globals['__name__'] in ['abc', + 'functools', + 'typing']: + return False + raise TypeError("Instance and class checks can only be used with" + " @runtime protocols") + if (self.__dict__.get('_is_runtime_protocol', None) and + not _is_callable_members_only(self)): + if sys._getframe(1).f_globals['__name__'] in ['abc', + 'functools', + 'typing']: + return super(GenericMeta, self).__subclasscheck__(cls) + raise TypeError("Protocols with non-method members" + " don't support issubclass()") + return super(GenericMeta, self).__subclasscheck__(cls) + + if not OLD_GENERICS: + @_tp_cache + def __getitem__(self, params): + # We also need to copy this from GenericMeta.__getitem__ to get + # special treatment of "Protocol". (Comments removed for brevity.) + if not isinstance(params, tuple): + params = (params,) + if not params and _gorg(self) is not Tuple: + raise TypeError( + "Parameter list to %s[...] cannot be empty" % self.__qualname__) + msg = "Parameters to generic types must be types." + params = tuple(_type_check(p, msg) for p in params) + if self in (Generic, Protocol): + if not all(isinstance(p, TypeVar) for p in params): + raise TypeError( + "Parameters to %r[...] must all be type variables" % self) + if len(set(params)) != len(params): + raise TypeError( + "Parameters to %r[...] must all be unique" % self) + tvars = params + args = params + elif self in (Tuple, Callable): + tvars = _type_vars(params) + args = params + elif self.__origin__ in (Generic, Protocol): + raise TypeError("Cannot subscript already-subscripted %s" % + repr(self)) + else: + _check_generic(self, params) + tvars = _type_vars(params) + args = params + + prepend = (self,) if self.__origin__ is None else () + return self.__class__(self.__name__, + prepend + self.__bases__, + _no_slots_copy(self.__dict__), + tvars=tvars, + args=args, + origin=self, + extra=self.__extra__, + orig_bases=self.__orig_bases__) + + class Protocol(metaclass=_ProtocolMeta): + """Base class for protocol classes. Protocol classes are defined as:: + + class Proto(Protocol): + def meth(self) -> int: + ... + + Such classes are primarily used with static type checkers that recognize + structural subtyping (static duck-typing), for example:: + + class C: + def meth(self) -> int: + return 0 + + def func(x: Proto) -> int: + return x.meth() + + func(C()) # Passes static type check + + See PEP 544 for details. Protocol classes decorated with + @typing_extensions.runtime act as simple-minded runtime protocol that checks + only the presence of given attributes, ignoring their type signatures. + + Protocol classes can be generic, they are defined as:: + + class GenProto({bases}): + def meth(self) -> T: + ... + """ + __slots__ = () + _is_protocol = True + + def __new__(cls, *args, **kwds): + if _gorg(cls) is Protocol: + raise TypeError("Type Protocol cannot be instantiated; " + "it can be used only as a base class") + if OLD_GENERICS: + return _generic_new(_next_in_mro(cls), cls, *args, **kwds) + return _generic_new(cls.__next_in_mro__, cls, *args, **kwds) + if Protocol.__doc__ is not None: + Protocol.__doc__ = Protocol.__doc__.format(bases="Protocol, Generic[T]" if + OLD_GENERICS else "Protocol[T]") + + +elif PEP_560: + from typing import _type_check, _collect_type_vars # noqa + + def _no_init(self, *args, **kwargs): + if type(self)._is_protocol: + raise TypeError('Protocols cannot be instantiated') + + class _ProtocolMeta(abc.ABCMeta): + # This metaclass is a bit unfortunate and exists only because of the lack + # of __instancehook__. + def __instancecheck__(cls, instance): + # We need this method for situations where attributes are + # assigned in __init__. + if ((not getattr(cls, '_is_protocol', False) or + _is_callable_members_only(cls)) and + issubclass(instance.__class__, cls)): + return True + if cls._is_protocol: + if all(hasattr(instance, attr) and + (not callable(getattr(cls, attr, None)) or + getattr(instance, attr) is not None) + for attr in _get_protocol_attrs(cls)): + return True + return super().__instancecheck__(instance) + + class Protocol(metaclass=_ProtocolMeta): + # There is quite a lot of overlapping code with typing.Generic. + # Unfortunately it is hard to avoid this while these live in two different + # modules. The duplicated code will be removed when Protocol is moved to typing. + """Base class for protocol classes. Protocol classes are defined as:: + + class Proto(Protocol): + def meth(self) -> int: + ... + + Such classes are primarily used with static type checkers that recognize + structural subtyping (static duck-typing), for example:: + + class C: + def meth(self) -> int: + return 0 + + def func(x: Proto) -> int: + return x.meth() + + func(C()) # Passes static type check + + See PEP 544 for details. Protocol classes decorated with + @typing_extensions.runtime act as simple-minded runtime protocol that checks + only the presence of given attributes, ignoring their type signatures. + + Protocol classes can be generic, they are defined as:: + + class GenProto(Protocol[T]): + def meth(self) -> T: + ... + """ + __slots__ = () + _is_protocol = True + + def __new__(cls, *args, **kwds): + if cls is Protocol: + raise TypeError("Type Protocol cannot be instantiated; " + "it can only be used as a base class") + return super().__new__(cls) + + @_tp_cache + def __class_getitem__(cls, params): + if not isinstance(params, tuple): + params = (params,) + if not params and cls is not Tuple: + raise TypeError( + "Parameter list to {}[...] cannot be empty".format(cls.__qualname__)) + msg = "Parameters to generic types must be types." + params = tuple(_type_check(p, msg) for p in params) + if cls is Protocol: + # Generic can only be subscripted with unique type variables. + if not all(isinstance(p, TypeVar) for p in params): + i = 0 + while isinstance(params[i], TypeVar): + i += 1 + raise TypeError( + "Parameters to Protocol[...] must all be type variables." + " Parameter {} is {}".format(i + 1, params[i])) + if len(set(params)) != len(params): + raise TypeError( + "Parameters to Protocol[...] must all be unique") + else: + # Subscripting a regular Generic subclass. + _check_generic(cls, params) + return _GenericAlias(cls, params) + + def __init_subclass__(cls, *args, **kwargs): + tvars = [] + if '__orig_bases__' in cls.__dict__: + error = Generic in cls.__orig_bases__ + else: + error = Generic in cls.__bases__ + if error: + raise TypeError("Cannot inherit from plain Generic") + if '__orig_bases__' in cls.__dict__: + tvars = _collect_type_vars(cls.__orig_bases__) + # Look for Generic[T1, ..., Tn] or Protocol[T1, ..., Tn]. + # If found, tvars must be a subset of it. + # If not found, tvars is it. + # Also check for and reject plain Generic, + # and reject multiple Generic[...] and/or Protocol[...]. + gvars = None + for base in cls.__orig_bases__: + if (isinstance(base, _GenericAlias) and + base.__origin__ in (Generic, Protocol)): + # for error messages + the_base = 'Generic' if base.__origin__ is Generic else 'Protocol' + if gvars is not None: + raise TypeError( + "Cannot inherit from Generic[...]" + " and/or Protocol[...] multiple types.") + gvars = base.__parameters__ + if gvars is None: + gvars = tvars + else: + tvarset = set(tvars) + gvarset = set(gvars) + if not tvarset <= gvarset: + s_vars = ', '.join(str(t) for t in tvars if t not in gvarset) + s_args = ', '.join(str(g) for g in gvars) + raise TypeError("Some type variables ({}) are" + " not listed in {}[{}]".format(s_vars, + the_base, s_args)) + tvars = gvars + cls.__parameters__ = tuple(tvars) + + # Determine if this is a protocol or a concrete subclass. + if not cls.__dict__.get('_is_protocol', None): + cls._is_protocol = any(b is Protocol for b in cls.__bases__) + + # Set (or override) the protocol subclass hook. + def _proto_hook(other): + if not cls.__dict__.get('_is_protocol', None): + return NotImplemented + if not getattr(cls, '_is_runtime_protocol', False): + if sys._getframe(2).f_globals['__name__'] in ['abc', 'functools']: + return NotImplemented + raise TypeError("Instance and class checks can only be used with" + " @runtime protocols") + if not _is_callable_members_only(cls): + if sys._getframe(2).f_globals['__name__'] in ['abc', 'functools']: + return NotImplemented + raise TypeError("Protocols with non-method members" + " don't support issubclass()") + if not isinstance(other, type): + # Same error as for issubclass(1, int) + raise TypeError('issubclass() arg 1 must be a class') + for attr in _get_protocol_attrs(cls): + for base in other.__mro__: + if attr in base.__dict__: + if base.__dict__[attr] is None: + return NotImplemented + break + annotations = getattr(base, '__annotations__', {}) + if (isinstance(annotations, typing.Mapping) and + attr in annotations and + isinstance(other, _ProtocolMeta) and + other._is_protocol): + break + else: + return NotImplemented + return True + if '__subclasshook__' not in cls.__dict__: + cls.__subclasshook__ = _proto_hook + + # We have nothing more to do for non-protocols. + if not cls._is_protocol: + return + + # Check consistency of bases. + for base in cls.__bases__: + if not (base in (object, Generic) or + base.__module__ == 'collections.abc' and + base.__name__ in _PROTO_WHITELIST or + isinstance(base, _ProtocolMeta) and base._is_protocol): + raise TypeError('Protocols can only inherit from other' + ' protocols, got %r' % base) + cls.__init__ = _no_init + + +if hasattr(typing, 'runtime_checkable'): + runtime_checkable = typing.runtime_checkable +elif HAVE_PROTOCOLS: + def runtime_checkable(cls): + """Mark a protocol class as a runtime protocol, so that it + can be used with isinstance() and issubclass(). Raise TypeError + if applied to a non-protocol class. + + This allows a simple-minded structural check very similar to the + one-offs in collections.abc such as Hashable. + """ + if not isinstance(cls, _ProtocolMeta) or not cls._is_protocol: + raise TypeError('@runtime_checkable can be only applied to protocol classes,' + ' got %r' % cls) + cls._is_runtime_protocol = True + return cls + + +if HAVE_PROTOCOLS: + # Exists for backwards compatibility. + runtime = runtime_checkable + + +if hasattr(typing, 'SupportsIndex'): + SupportsIndex = typing.SupportsIndex +elif HAVE_PROTOCOLS: + @runtime_checkable + class SupportsIndex(Protocol): + __slots__ = () + + @abc.abstractmethod + def __index__(self) -> int: + pass + + +if sys.version_info >= (3, 9, 2): + # The standard library TypedDict in Python 3.8 does not store runtime information + # about which (if any) keys are optional. See https://bugs.python.org/issue38834 + # The standard library TypedDict in Python 3.9.0/1 does not honour the "total" + # keyword with old-style TypedDict(). See https://bugs.python.org/issue42059 + TypedDict = typing.TypedDict +else: + def _check_fails(cls, other): + try: + if sys._getframe(1).f_globals['__name__'] not in ['abc', + 'functools', + 'typing']: + # Typed dicts are only for static structural subtyping. + raise TypeError('TypedDict does not support instance and class checks') + except (AttributeError, ValueError): + pass + return False + + def _dict_new(*args, **kwargs): + if not args: + raise TypeError('TypedDict.__new__(): not enough arguments') + _, args = args[0], args[1:] # allow the "cls" keyword be passed + return dict(*args, **kwargs) + + _dict_new.__text_signature__ = '($cls, _typename, _fields=None, /, **kwargs)' + + def _typeddict_new(*args, total=True, **kwargs): + if not args: + raise TypeError('TypedDict.__new__(): not enough arguments') + _, args = args[0], args[1:] # allow the "cls" keyword be passed + if args: + typename, args = args[0], args[1:] # allow the "_typename" keyword be passed + elif '_typename' in kwargs: + typename = kwargs.pop('_typename') + import warnings + warnings.warn("Passing '_typename' as keyword argument is deprecated", + DeprecationWarning, stacklevel=2) + else: + raise TypeError("TypedDict.__new__() missing 1 required positional " + "argument: '_typename'") + if args: + try: + fields, = args # allow the "_fields" keyword be passed + except ValueError: + raise TypeError('TypedDict.__new__() takes from 2 to 3 ' + 'positional arguments but {} ' + 'were given'.format(len(args) + 2)) + elif '_fields' in kwargs and len(kwargs) == 1: + fields = kwargs.pop('_fields') + import warnings + warnings.warn("Passing '_fields' as keyword argument is deprecated", + DeprecationWarning, stacklevel=2) + else: + fields = None + + if fields is None: + fields = kwargs + elif kwargs: + raise TypeError("TypedDict takes either a dict or keyword arguments," + " but not both") + + ns = {'__annotations__': dict(fields)} + try: + # Setting correct module is necessary to make typed dict classes pickleable. + ns['__module__'] = sys._getframe(1).f_globals.get('__name__', '__main__') + except (AttributeError, ValueError): + pass + + return _TypedDictMeta(typename, (), ns, total=total) + + _typeddict_new.__text_signature__ = ('($cls, _typename, _fields=None,' + ' /, *, total=True, **kwargs)') + + class _TypedDictMeta(type): + def __init__(cls, name, bases, ns, total=True): + # In Python 3.4 and 3.5 the __init__ method also needs to support the + # keyword arguments. + # See https://www.python.org/dev/peps/pep-0487/#implementation-details + super(_TypedDictMeta, cls).__init__(name, bases, ns) + + def __new__(cls, name, bases, ns, total=True): + # Create new typed dict class object. + # This method is called directly when TypedDict is subclassed, + # or via _typeddict_new when TypedDict is instantiated. This way + # TypedDict supports all three syntaxes described in its docstring. + # Subclasses and instances of TypedDict return actual dictionaries + # via _dict_new. + ns['__new__'] = _typeddict_new if name == 'TypedDict' else _dict_new + tp_dict = super(_TypedDictMeta, cls).__new__(cls, name, (dict,), ns) + + annotations = {} + own_annotations = ns.get('__annotations__', {}) + own_annotation_keys = set(own_annotations.keys()) + msg = "TypedDict('Name', {f0: t0, f1: t1, ...}); each t must be a type" + own_annotations = { + n: typing._type_check(tp, msg) for n, tp in own_annotations.items() + } + required_keys = set() + optional_keys = set() + + for base in bases: + annotations.update(base.__dict__.get('__annotations__', {})) + required_keys.update(base.__dict__.get('__required_keys__', ())) + optional_keys.update(base.__dict__.get('__optional_keys__', ())) + + annotations.update(own_annotations) + if total: + required_keys.update(own_annotation_keys) + else: + optional_keys.update(own_annotation_keys) + + tp_dict.__annotations__ = annotations + tp_dict.__required_keys__ = frozenset(required_keys) + tp_dict.__optional_keys__ = frozenset(optional_keys) + if not hasattr(tp_dict, '__total__'): + tp_dict.__total__ = total + return tp_dict + + __instancecheck__ = __subclasscheck__ = _check_fails + + TypedDict = _TypedDictMeta('TypedDict', (dict,), {}) + TypedDict.__module__ = __name__ + TypedDict.__doc__ = \ + """A simple typed name space. At runtime it is equivalent to a plain dict. + + TypedDict creates a dictionary type that expects all of its + instances to have a certain set of keys, with each key + associated with a value of a consistent type. This expectation + is not checked at runtime but is only enforced by type checkers. + Usage:: + + class Point2D(TypedDict): + x: int + y: int + label: str + + a: Point2D = {'x': 1, 'y': 2, 'label': 'good'} # OK + b: Point2D = {'z': 3, 'label': 'bad'} # Fails type check + + assert Point2D(x=1, y=2, label='first') == dict(x=1, y=2, label='first') + + The type info can be accessed via the Point2D.__annotations__ dict, and + the Point2D.__required_keys__ and Point2D.__optional_keys__ frozensets. + TypedDict supports two additional equivalent forms:: + + Point2D = TypedDict('Point2D', x=int, y=int, label=str) + Point2D = TypedDict('Point2D', {'x': int, 'y': int, 'label': str}) + + The class syntax is only supported in Python 3.6+, while two other + syntax forms work for Python 2.7 and 3.2+ + """ + + +# Python 3.9+ has PEP 593 (Annotated and modified get_type_hints) +if hasattr(typing, 'Annotated'): + Annotated = typing.Annotated + get_type_hints = typing.get_type_hints + # Not exported and not a public API, but needed for get_origin() and get_args() + # to work. + _AnnotatedAlias = typing._AnnotatedAlias +elif PEP_560: + class _AnnotatedAlias(typing._GenericAlias, _root=True): + """Runtime representation of an annotated type. + + At its core 'Annotated[t, dec1, dec2, ...]' is an alias for the type 't' + with extra annotations. The alias behaves like a normal typing alias, + instantiating is the same as instantiating the underlying type, binding + it to types is also the same. + """ + def __init__(self, origin, metadata): + if isinstance(origin, _AnnotatedAlias): + metadata = origin.__metadata__ + metadata + origin = origin.__origin__ + super().__init__(origin, origin) + self.__metadata__ = metadata + + def copy_with(self, params): + assert len(params) == 1 + new_type = params[0] + return _AnnotatedAlias(new_type, self.__metadata__) + + def __repr__(self): + return "typing_extensions.Annotated[{}, {}]".format( + typing._type_repr(self.__origin__), + ", ".join(repr(a) for a in self.__metadata__) + ) + + def __reduce__(self): + return operator.getitem, ( + Annotated, (self.__origin__,) + self.__metadata__ + ) + + def __eq__(self, other): + if not isinstance(other, _AnnotatedAlias): + return NotImplemented + if self.__origin__ != other.__origin__: + return False + return self.__metadata__ == other.__metadata__ + + def __hash__(self): + return hash((self.__origin__, self.__metadata__)) + + class Annotated: + """Add context specific metadata to a type. + + Example: Annotated[int, runtime_check.Unsigned] indicates to the + hypothetical runtime_check module that this type is an unsigned int. + Every other consumer of this type can ignore this metadata and treat + this type as int. + + The first argument to Annotated must be a valid type (and will be in + the __origin__ field), the remaining arguments are kept as a tuple in + the __extra__ field. + + Details: + + - It's an error to call `Annotated` with less than two arguments. + - Nested Annotated are flattened:: + + Annotated[Annotated[T, Ann1, Ann2], Ann3] == Annotated[T, Ann1, Ann2, Ann3] + + - Instantiating an annotated type is equivalent to instantiating the + underlying type:: + + Annotated[C, Ann1](5) == C(5) + + - Annotated can be used as a generic type alias:: + + Optimized = Annotated[T, runtime.Optimize()] + Optimized[int] == Annotated[int, runtime.Optimize()] + + OptimizedList = Annotated[List[T], runtime.Optimize()] + OptimizedList[int] == Annotated[List[int], runtime.Optimize()] + """ + + __slots__ = () + + def __new__(cls, *args, **kwargs): + raise TypeError("Type Annotated cannot be instantiated.") + + @_tp_cache + def __class_getitem__(cls, params): + if not isinstance(params, tuple) or len(params) < 2: + raise TypeError("Annotated[...] should be used " + "with at least two arguments (a type and an " + "annotation).") + msg = "Annotated[t, ...]: t must be a type." + origin = typing._type_check(params[0], msg) + metadata = tuple(params[1:]) + return _AnnotatedAlias(origin, metadata) + + def __init_subclass__(cls, *args, **kwargs): + raise TypeError( + "Cannot subclass {}.Annotated".format(cls.__module__) + ) + + def _strip_annotations(t): + """Strips the annotations from a given type. + """ + if isinstance(t, _AnnotatedAlias): + return _strip_annotations(t.__origin__) + if isinstance(t, typing._GenericAlias): + stripped_args = tuple(_strip_annotations(a) for a in t.__args__) + if stripped_args == t.__args__: + return t + res = t.copy_with(stripped_args) + res._special = t._special + return res + return t + + def get_type_hints(obj, globalns=None, localns=None, include_extras=False): + """Return type hints for an object. + + This is often the same as obj.__annotations__, but it handles + forward references encoded as string literals, adds Optional[t] if a + default value equal to None is set and recursively replaces all + 'Annotated[T, ...]' with 'T' (unless 'include_extras=True'). + + The argument may be a module, class, method, or function. The annotations + are returned as a dictionary. For classes, annotations include also + inherited members. + + TypeError is raised if the argument is not of a type that can contain + annotations, and an empty dictionary is returned if no annotations are + present. + + BEWARE -- the behavior of globalns and localns is counterintuitive + (unless you are familiar with how eval() and exec() work). The + search order is locals first, then globals. + + - If no dict arguments are passed, an attempt is made to use the + globals from obj (or the respective module's globals for classes), + and these are also used as the locals. If the object does not appear + to have globals, an empty dictionary is used. + + - If one dict argument is passed, it is used for both globals and + locals. + + - If two dict arguments are passed, they specify globals and + locals, respectively. + """ + hint = typing.get_type_hints(obj, globalns=globalns, localns=localns) + if include_extras: + return hint + return {k: _strip_annotations(t) for k, t in hint.items()} + +elif HAVE_ANNOTATED: + + def _is_dunder(name): + """Returns True if name is a __dunder_variable_name__.""" + return len(name) > 4 and name.startswith('__') and name.endswith('__') + + # Prior to Python 3.7 types did not have `copy_with`. A lot of the equality + # checks, argument expansion etc. are done on the _subs_tre. As a result we + # can't provide a get_type_hints function that strips out annotations. + + class AnnotatedMeta(typing.GenericMeta): + """Metaclass for Annotated""" + + def __new__(cls, name, bases, namespace, **kwargs): + if any(b is not object for b in bases): + raise TypeError("Cannot subclass " + str(Annotated)) + return super().__new__(cls, name, bases, namespace, **kwargs) + + @property + def __metadata__(self): + return self._subs_tree()[2] + + def _tree_repr(self, tree): + cls, origin, metadata = tree + if not isinstance(origin, tuple): + tp_repr = typing._type_repr(origin) + else: + tp_repr = origin[0]._tree_repr(origin) + metadata_reprs = ", ".join(repr(arg) for arg in metadata) + return '%s[%s, %s]' % (cls, tp_repr, metadata_reprs) + + def _subs_tree(self, tvars=None, args=None): # noqa + if self is Annotated: + return Annotated + res = super()._subs_tree(tvars=tvars, args=args) + # Flatten nested Annotated + if isinstance(res[1], tuple) and res[1][0] is Annotated: + sub_tp = res[1][1] + sub_annot = res[1][2] + return (Annotated, sub_tp, sub_annot + res[2]) + return res + + def _get_cons(self): + """Return the class used to create instance of this type.""" + if self.__origin__ is None: + raise TypeError("Cannot get the underlying type of a " + "non-specialized Annotated type.") + tree = self._subs_tree() + while isinstance(tree, tuple) and tree[0] is Annotated: + tree = tree[1] + if isinstance(tree, tuple): + return tree[0] + else: + return tree + + @_tp_cache + def __getitem__(self, params): + if not isinstance(params, tuple): + params = (params,) + if self.__origin__ is not None: # specializing an instantiated type + return super().__getitem__(params) + elif not isinstance(params, tuple) or len(params) < 2: + raise TypeError("Annotated[...] should be instantiated " + "with at least two arguments (a type and an " + "annotation).") + else: + msg = "Annotated[t, ...]: t must be a type." + tp = typing._type_check(params[0], msg) + metadata = tuple(params[1:]) + return self.__class__( + self.__name__, + self.__bases__, + _no_slots_copy(self.__dict__), + tvars=_type_vars((tp,)), + # Metadata is a tuple so it won't be touched by _replace_args et al. + args=(tp, metadata), + origin=self, + ) + + def __call__(self, *args, **kwargs): + cons = self._get_cons() + result = cons(*args, **kwargs) + try: + result.__orig_class__ = self + except AttributeError: + pass + return result + + def __getattr__(self, attr): + # For simplicity we just don't relay all dunder names + if self.__origin__ is not None and not _is_dunder(attr): + return getattr(self._get_cons(), attr) + raise AttributeError(attr) + + def __setattr__(self, attr, value): + if _is_dunder(attr) or attr.startswith('_abc_'): + super().__setattr__(attr, value) + elif self.__origin__ is None: + raise AttributeError(attr) + else: + setattr(self._get_cons(), attr, value) + + def __instancecheck__(self, obj): + raise TypeError("Annotated cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("Annotated cannot be used with issubclass().") + + class Annotated(metaclass=AnnotatedMeta): + """Add context specific metadata to a type. + + Example: Annotated[int, runtime_check.Unsigned] indicates to the + hypothetical runtime_check module that this type is an unsigned int. + Every other consumer of this type can ignore this metadata and treat + this type as int. + + The first argument to Annotated must be a valid type, the remaining + arguments are kept as a tuple in the __metadata__ field. + + Details: + + - It's an error to call `Annotated` with less than two arguments. + - Nested Annotated are flattened:: + + Annotated[Annotated[T, Ann1, Ann2], Ann3] == Annotated[T, Ann1, Ann2, Ann3] + + - Instantiating an annotated type is equivalent to instantiating the + underlying type:: + + Annotated[C, Ann1](5) == C(5) + + - Annotated can be used as a generic type alias:: + + Optimized = Annotated[T, runtime.Optimize()] + Optimized[int] == Annotated[int, runtime.Optimize()] + + OptimizedList = Annotated[List[T], runtime.Optimize()] + OptimizedList[int] == Annotated[List[int], runtime.Optimize()] + """ + +# Python 3.8 has get_origin() and get_args() but those implementations aren't +# Annotated-aware, so we can't use those, only Python 3.9 versions will do. +# Similarly, Python 3.9's implementation doesn't support ParamSpecArgs and +# ParamSpecKwargs. +if sys.version_info[:2] >= (3, 10): + get_origin = typing.get_origin + get_args = typing.get_args +elif PEP_560: + try: + # 3.9+ + from typing import _BaseGenericAlias + except ImportError: + _BaseGenericAlias = _GenericAlias + try: + # 3.9+ + from typing import GenericAlias + except ImportError: + GenericAlias = _GenericAlias + + def get_origin(tp): + """Get the unsubscripted version of a type. + + This supports generic types, Callable, Tuple, Union, Literal, Final, ClassVar + and Annotated. Return None for unsupported types. Examples:: + + get_origin(Literal[42]) is Literal + get_origin(int) is None + get_origin(ClassVar[int]) is ClassVar + get_origin(Generic) is Generic + get_origin(Generic[T]) is Generic + get_origin(Union[T, int]) is Union + get_origin(List[Tuple[T, T]][int]) == list + get_origin(P.args) is P + """ + if isinstance(tp, _AnnotatedAlias): + return Annotated + if isinstance(tp, (_GenericAlias, GenericAlias, _BaseGenericAlias, + ParamSpecArgs, ParamSpecKwargs)): + return tp.__origin__ + if tp is Generic: + return Generic + return None + + def get_args(tp): + """Get type arguments with all substitutions performed. + + For unions, basic simplifications used by Union constructor are performed. + Examples:: + get_args(Dict[str, int]) == (str, int) + get_args(int) == () + get_args(Union[int, Union[T, int], str][int]) == (int, str) + get_args(Union[int, Tuple[T, int]][str]) == (int, Tuple[str, int]) + get_args(Callable[[], T][int]) == ([], int) + """ + if isinstance(tp, _AnnotatedAlias): + return (tp.__origin__,) + tp.__metadata__ + if isinstance(tp, (_GenericAlias, GenericAlias)): + if getattr(tp, "_special", False): + return () + res = tp.__args__ + if get_origin(tp) is collections.abc.Callable and res[0] is not Ellipsis: + res = (list(res[:-1]), res[-1]) + return res + return () + + +if hasattr(typing, 'TypeAlias'): + TypeAlias = typing.TypeAlias +elif sys.version_info[:2] >= (3, 9): + class _TypeAliasForm(typing._SpecialForm, _root=True): + def __repr__(self): + return 'typing_extensions.' + self._name + + @_TypeAliasForm + def TypeAlias(self, parameters): + """Special marker indicating that an assignment should + be recognized as a proper type alias definition by type + checkers. + + For example:: + + Predicate: TypeAlias = Callable[..., bool] + + It's invalid when used anywhere except as in the example above. + """ + raise TypeError("{} is not subscriptable".format(self)) + +elif sys.version_info[:2] >= (3, 7): + class _TypeAliasForm(typing._SpecialForm, _root=True): + def __repr__(self): + return 'typing_extensions.' + self._name + + TypeAlias = _TypeAliasForm('TypeAlias', + doc="""Special marker indicating that an assignment should + be recognized as a proper type alias definition by type + checkers. + + For example:: + + Predicate: TypeAlias = Callable[..., bool] + + It's invalid when used anywhere except as in the example + above.""") + +elif hasattr(typing, '_FinalTypingBase'): + class _TypeAliasMeta(typing.TypingMeta): + """Metaclass for TypeAlias""" + + def __repr__(self): + return 'typing_extensions.TypeAlias' + + class _TypeAliasBase(typing._FinalTypingBase, metaclass=_TypeAliasMeta, _root=True): + """Special marker indicating that an assignment should + be recognized as a proper type alias definition by type + checkers. + + For example:: + + Predicate: TypeAlias = Callable[..., bool] + + It's invalid when used anywhere except as in the example above. + """ + __slots__ = () + + def __instancecheck__(self, obj): + raise TypeError("TypeAlias cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("TypeAlias cannot be used with issubclass().") + + def __repr__(self): + return 'typing_extensions.TypeAlias' + + TypeAlias = _TypeAliasBase(_root=True) +else: + class _TypeAliasMeta(typing.TypingMeta): + """Metaclass for TypeAlias""" + + def __instancecheck__(self, obj): + raise TypeError("TypeAlias cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("TypeAlias cannot be used with issubclass().") + + def __call__(self, *args, **kwargs): + raise TypeError("Cannot instantiate TypeAlias") + + class TypeAlias(metaclass=_TypeAliasMeta, _root=True): + """Special marker indicating that an assignment should + be recognized as a proper type alias definition by type + checkers. + + For example:: + + Predicate: TypeAlias = Callable[..., bool] + + It's invalid when used anywhere except as in the example above. + """ + __slots__ = () + + +# Python 3.10+ has PEP 612 +if hasattr(typing, 'ParamSpecArgs'): + ParamSpecArgs = typing.ParamSpecArgs + ParamSpecKwargs = typing.ParamSpecKwargs +else: + class _Immutable: + """Mixin to indicate that object should not be copied.""" + __slots__ = () + + def __copy__(self): + return self + + def __deepcopy__(self, memo): + return self + + class ParamSpecArgs(_Immutable): + """The args for a ParamSpec object. + + Given a ParamSpec object P, P.args is an instance of ParamSpecArgs. + + ParamSpecArgs objects have a reference back to their ParamSpec: + + P.args.__origin__ is P + + This type is meant for runtime introspection and has no special meaning to + static type checkers. + """ + def __init__(self, origin): + self.__origin__ = origin + + def __repr__(self): + return "{}.args".format(self.__origin__.__name__) + + class ParamSpecKwargs(_Immutable): + """The kwargs for a ParamSpec object. + + Given a ParamSpec object P, P.kwargs is an instance of ParamSpecKwargs. + + ParamSpecKwargs objects have a reference back to their ParamSpec: + + P.kwargs.__origin__ is P + + This type is meant for runtime introspection and has no special meaning to + static type checkers. + """ + def __init__(self, origin): + self.__origin__ = origin + + def __repr__(self): + return "{}.kwargs".format(self.__origin__.__name__) + +if hasattr(typing, 'ParamSpec'): + ParamSpec = typing.ParamSpec +else: + + # Inherits from list as a workaround for Callable checks in Python < 3.9.2. + class ParamSpec(list): + """Parameter specification variable. + + Usage:: + + P = ParamSpec('P') + + Parameter specification variables exist primarily for the benefit of static + type checkers. They are used to forward the parameter types of one + callable to another callable, a pattern commonly found in higher order + functions and decorators. They are only valid when used in ``Concatenate``, + or s the first argument to ``Callable``. In Python 3.10 and higher, + they are also supported in user-defined Generics at runtime. + See class Generic for more information on generic types. An + example for annotating a decorator:: + + T = TypeVar('T') + P = ParamSpec('P') + + def add_logging(f: Callable[P, T]) -> Callable[P, T]: + '''A type-safe decorator to add logging to a function.''' + def inner(*args: P.args, **kwargs: P.kwargs) -> T: + logging.info(f'{f.__name__} was called') + return f(*args, **kwargs) + return inner + + @add_logging + def add_two(x: float, y: float) -> float: + '''Add two numbers together.''' + return x + y + + Parameter specification variables defined with covariant=True or + contravariant=True can be used to declare covariant or contravariant + generic types. These keyword arguments are valid, but their actual semantics + are yet to be decided. See PEP 612 for details. + + Parameter specification variables can be introspected. e.g.: + + P.__name__ == 'T' + P.__bound__ == None + P.__covariant__ == False + P.__contravariant__ == False + + Note that only parameter specification variables defined in global scope can + be pickled. + """ + + # Trick Generic __parameters__. + __class__ = TypeVar + + @property + def args(self): + return ParamSpecArgs(self) + + @property + def kwargs(self): + return ParamSpecKwargs(self) + + def __init__(self, name, *, bound=None, covariant=False, contravariant=False): + super().__init__([self]) + self.__name__ = name + self.__covariant__ = bool(covariant) + self.__contravariant__ = bool(contravariant) + if bound: + self.__bound__ = typing._type_check(bound, 'Bound must be a type.') + else: + self.__bound__ = None + + # for pickling: + try: + def_mod = sys._getframe(1).f_globals.get('__name__', '__main__') + except (AttributeError, ValueError): + def_mod = None + if def_mod != 'typing_extensions': + self.__module__ = def_mod + + def __repr__(self): + if self.__covariant__: + prefix = '+' + elif self.__contravariant__: + prefix = '-' + else: + prefix = '~' + return prefix + self.__name__ + + def __hash__(self): + return object.__hash__(self) + + def __eq__(self, other): + return self is other + + def __reduce__(self): + return self.__name__ + + # Hack to get typing._type_check to pass. + def __call__(self, *args, **kwargs): + pass + + if not PEP_560: + # Only needed in 3.6 and lower. + def _get_type_vars(self, tvars): + if self not in tvars: + tvars.append(self) + + +# Inherits from list as a workaround for Callable checks in Python < 3.9.2. +class _ConcatenateGenericAlias(list): + + # Trick Generic into looking into this for __parameters__. + if PEP_560: + __class__ = typing._GenericAlias + elif sys.version_info[:3] == (3, 5, 2): + __class__ = typing.TypingMeta + else: + __class__ = typing._TypingBase + + # Flag in 3.8. + _special = False + # Attribute in 3.6 and earlier. + if sys.version_info[:3] == (3, 5, 2): + _gorg = typing.GenericMeta + else: + _gorg = typing.Generic + + def __init__(self, origin, args): + super().__init__(args) + self.__origin__ = origin + self.__args__ = args + + def __repr__(self): + _type_repr = typing._type_repr + return '{origin}[{args}]' \ + .format(origin=_type_repr(self.__origin__), + args=', '.join(_type_repr(arg) for arg in self.__args__)) + + def __hash__(self): + return hash((self.__origin__, self.__args__)) + + # Hack to get typing._type_check to pass in Generic. + def __call__(self, *args, **kwargs): + pass + + @property + def __parameters__(self): + return tuple(tp for tp in self.__args__ if isinstance(tp, (TypeVar, ParamSpec))) + + if not PEP_560: + # Only required in 3.6 and lower. + def _get_type_vars(self, tvars): + if self.__origin__ and self.__parameters__: + typing._get_type_vars(self.__parameters__, tvars) + + +@_tp_cache +def _concatenate_getitem(self, parameters): + if parameters == (): + raise TypeError("Cannot take a Concatenate of no types.") + if not isinstance(parameters, tuple): + parameters = (parameters,) + if not isinstance(parameters[-1], ParamSpec): + raise TypeError("The last parameter to Concatenate should be a " + "ParamSpec variable.") + msg = "Concatenate[arg, ...]: each arg must be a type." + parameters = tuple(typing._type_check(p, msg) for p in parameters) + return _ConcatenateGenericAlias(self, parameters) + + +if hasattr(typing, 'Concatenate'): + Concatenate = typing.Concatenate + _ConcatenateGenericAlias = typing._ConcatenateGenericAlias # noqa +elif sys.version_info[:2] >= (3, 9): + @_TypeAliasForm + def Concatenate(self, parameters): + """Used in conjunction with ``ParamSpec`` and ``Callable`` to represent a + higher order function which adds, removes or transforms parameters of a + callable. + + For example:: + + Callable[Concatenate[int, P], int] + + See PEP 612 for detailed information. + """ + return _concatenate_getitem(self, parameters) + +elif sys.version_info[:2] >= (3, 7): + class _ConcatenateForm(typing._SpecialForm, _root=True): + def __repr__(self): + return 'typing_extensions.' + self._name + + def __getitem__(self, parameters): + return _concatenate_getitem(self, parameters) + + Concatenate = _ConcatenateForm( + 'Concatenate', + doc="""Used in conjunction with ``ParamSpec`` and ``Callable`` to represent a + higher order function which adds, removes or transforms parameters of a + callable. + + For example:: + + Callable[Concatenate[int, P], int] + + See PEP 612 for detailed information. + """) + +elif hasattr(typing, '_FinalTypingBase'): + class _ConcatenateAliasMeta(typing.TypingMeta): + """Metaclass for Concatenate.""" + + def __repr__(self): + return 'typing_extensions.Concatenate' + + class _ConcatenateAliasBase(typing._FinalTypingBase, + metaclass=_ConcatenateAliasMeta, + _root=True): + """Used in conjunction with ``ParamSpec`` and ``Callable`` to represent a + higher order function which adds, removes or transforms parameters of a + callable. + + For example:: + + Callable[Concatenate[int, P], int] + + See PEP 612 for detailed information. + """ + __slots__ = () + + def __instancecheck__(self, obj): + raise TypeError("Concatenate cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("Concatenate cannot be used with issubclass().") + + def __repr__(self): + return 'typing_extensions.Concatenate' + + def __getitem__(self, parameters): + return _concatenate_getitem(self, parameters) + + Concatenate = _ConcatenateAliasBase(_root=True) +# For 3.5.0 - 3.5.2 +else: + class _ConcatenateAliasMeta(typing.TypingMeta): + """Metaclass for Concatenate.""" + + def __instancecheck__(self, obj): + raise TypeError("TypeAlias cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("TypeAlias cannot be used with issubclass().") + + def __call__(self, *args, **kwargs): + raise TypeError("Cannot instantiate TypeAlias") + + def __getitem__(self, parameters): + return _concatenate_getitem(self, parameters) + + class Concatenate(metaclass=_ConcatenateAliasMeta, _root=True): + """Used in conjunction with ``ParamSpec`` and ``Callable`` to represent a + higher order function which adds, removes or transforms parameters of a + callable. + + For example:: + + Callable[Concatenate[int, P], int] + + See PEP 612 for detailed information. + """ + __slots__ = () + +if hasattr(typing, 'TypeGuard'): + TypeGuard = typing.TypeGuard +elif sys.version_info[:2] >= (3, 9): + class _TypeGuardForm(typing._SpecialForm, _root=True): + def __repr__(self): + return 'typing_extensions.' + self._name + + @_TypeGuardForm + def TypeGuard(self, parameters): + """Special typing form used to annotate the return type of a user-defined + type guard function. ``TypeGuard`` only accepts a single type argument. + At runtime, functions marked this way should return a boolean. + + ``TypeGuard`` aims to benefit *type narrowing* -- a technique used by static + type checkers to determine a more precise type of an expression within a + program's code flow. Usually type narrowing is done by analyzing + conditional code flow and applying the narrowing to a block of code. The + conditional expression here is sometimes referred to as a "type guard". + + Sometimes it would be convenient to use a user-defined boolean function + as a type guard. Such a function should use ``TypeGuard[...]`` as its + return type to alert static type checkers to this intention. + + Using ``-> TypeGuard`` tells the static type checker that for a given + function: + + 1. The return value is a boolean. + 2. If the return value is ``True``, the type of its argument + is the type inside ``TypeGuard``. + + For example:: + + def is_str(val: Union[str, float]): + # "isinstance" type guard + if isinstance(val, str): + # Type of ``val`` is narrowed to ``str`` + ... + else: + # Else, type of ``val`` is narrowed to ``float``. + ... + + Strict type narrowing is not enforced -- ``TypeB`` need not be a narrower + form of ``TypeA`` (it can even be a wider form) and this may lead to + type-unsafe results. The main reason is to allow for things like + narrowing ``List[object]`` to ``List[str]`` even though the latter is not + a subtype of the former, since ``List`` is invariant. The responsibility of + writing type-safe type guards is left to the user. + + ``TypeGuard`` also works with type variables. For more information, see + PEP 647 (User-Defined Type Guards). + """ + item = typing._type_check(parameters, '{} accepts only single type.'.format(self)) + return _GenericAlias(self, (item,)) + +elif sys.version_info[:2] >= (3, 7): + class _TypeGuardForm(typing._SpecialForm, _root=True): + + def __repr__(self): + return 'typing_extensions.' + self._name + + def __getitem__(self, parameters): + item = typing._type_check(parameters, + '{} accepts only a single type'.format(self._name)) + return _GenericAlias(self, (item,)) + + TypeGuard = _TypeGuardForm( + 'TypeGuard', + doc="""Special typing form used to annotate the return type of a user-defined + type guard function. ``TypeGuard`` only accepts a single type argument. + At runtime, functions marked this way should return a boolean. + + ``TypeGuard`` aims to benefit *type narrowing* -- a technique used by static + type checkers to determine a more precise type of an expression within a + program's code flow. Usually type narrowing is done by analyzing + conditional code flow and applying the narrowing to a block of code. The + conditional expression here is sometimes referred to as a "type guard". + + Sometimes it would be convenient to use a user-defined boolean function + as a type guard. Such a function should use ``TypeGuard[...]`` as its + return type to alert static type checkers to this intention. + + Using ``-> TypeGuard`` tells the static type checker that for a given + function: + + 1. The return value is a boolean. + 2. If the return value is ``True``, the type of its argument + is the type inside ``TypeGuard``. + + For example:: + + def is_str(val: Union[str, float]): + # "isinstance" type guard + if isinstance(val, str): + # Type of ``val`` is narrowed to ``str`` + ... + else: + # Else, type of ``val`` is narrowed to ``float``. + ... + + Strict type narrowing is not enforced -- ``TypeB`` need not be a narrower + form of ``TypeA`` (it can even be a wider form) and this may lead to + type-unsafe results. The main reason is to allow for things like + narrowing ``List[object]`` to ``List[str]`` even though the latter is not + a subtype of the former, since ``List`` is invariant. The responsibility of + writing type-safe type guards is left to the user. + + ``TypeGuard`` also works with type variables. For more information, see + PEP 647 (User-Defined Type Guards). + """) +elif hasattr(typing, '_FinalTypingBase'): + class _TypeGuard(typing._FinalTypingBase, _root=True): + """Special typing form used to annotate the return type of a user-defined + type guard function. ``TypeGuard`` only accepts a single type argument. + At runtime, functions marked this way should return a boolean. + + ``TypeGuard`` aims to benefit *type narrowing* -- a technique used by static + type checkers to determine a more precise type of an expression within a + program's code flow. Usually type narrowing is done by analyzing + conditional code flow and applying the narrowing to a block of code. The + conditional expression here is sometimes referred to as a "type guard". + + Sometimes it would be convenient to use a user-defined boolean function + as a type guard. Such a function should use ``TypeGuard[...]`` as its + return type to alert static type checkers to this intention. + + Using ``-> TypeGuard`` tells the static type checker that for a given + function: + + 1. The return value is a boolean. + 2. If the return value is ``True``, the type of its argument + is the type inside ``TypeGuard``. + + For example:: + + def is_str(val: Union[str, float]): + # "isinstance" type guard + if isinstance(val, str): + # Type of ``val`` is narrowed to ``str`` + ... + else: + # Else, type of ``val`` is narrowed to ``float``. + ... + + Strict type narrowing is not enforced -- ``TypeB`` need not be a narrower + form of ``TypeA`` (it can even be a wider form) and this may lead to + type-unsafe results. The main reason is to allow for things like + narrowing ``List[object]`` to ``List[str]`` even though the latter is not + a subtype of the former, since ``List`` is invariant. The responsibility of + writing type-safe type guards is left to the user. + + ``TypeGuard`` also works with type variables. For more information, see + PEP 647 (User-Defined Type Guards). + """ + + __slots__ = ('__type__',) + + def __init__(self, tp=None, **kwds): + self.__type__ = tp + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is None: + return cls(typing._type_check(item, + '{} accepts only a single type.'.format(cls.__name__[1:])), + _root=True) + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(new_tp, _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not isinstance(other, _TypeGuard): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + TypeGuard = _TypeGuard(_root=True) +else: + class _TypeGuardMeta(typing.TypingMeta): + """Metaclass for TypeGuard""" + + def __new__(cls, name, bases, namespace, tp=None, _root=False): + self = super().__new__(cls, name, bases, namespace, _root=_root) + if tp is not None: + self.__type__ = tp + return self + + def __instancecheck__(self, obj): + raise TypeError("TypeGuard cannot be used with isinstance().") + + def __subclasscheck__(self, cls): + raise TypeError("TypeGuard cannot be used with issubclass().") + + def __getitem__(self, item): + cls = type(self) + if self.__type__ is not None: + raise TypeError('{} cannot be further subscripted' + .format(cls.__name__[1:])) + + param = typing._type_check( + item, + '{} accepts only single type.'.format(cls.__name__[1:])) + return cls(self.__name__, self.__bases__, + dict(self.__dict__), tp=param, _root=True) + + def _eval_type(self, globalns, localns): + new_tp = typing._eval_type(self.__type__, globalns, localns) + if new_tp == self.__type__: + return self + return type(self)(self.__name__, self.__bases__, + dict(self.__dict__), tp=self.__type__, + _root=True) + + def __repr__(self): + r = super().__repr__() + if self.__type__ is not None: + r += '[{}]'.format(typing._type_repr(self.__type__)) + return r + + def __hash__(self): + return hash((type(self).__name__, self.__type__)) + + def __eq__(self, other): + if not hasattr(other, "__type__"): + return NotImplemented + if self.__type__ is not None: + return self.__type__ == other.__type__ + return self is other + + class TypeGuard(typing.Final, metaclass=_TypeGuardMeta, _root=True): + """Special typing form used to annotate the return type of a user-defined + type guard function. ``TypeGuard`` only accepts a single type argument. + At runtime, functions marked this way should return a boolean. + + ``TypeGuard`` aims to benefit *type narrowing* -- a technique used by static + type checkers to determine a more precise type of an expression within a + program's code flow. Usually type narrowing is done by analyzing + conditional code flow and applying the narrowing to a block of code. The + conditional expression here is sometimes referred to as a "type guard". + + Sometimes it would be convenient to use a user-defined boolean function + as a type guard. Such a function should use ``TypeGuard[...]`` as its + return type to alert static type checkers to this intention. + + Using ``-> TypeGuard`` tells the static type checker that for a given + function: + + 1. The return value is a boolean. + 2. If the return value is ``True``, the type of its argument + is the type inside ``TypeGuard``. + + For example:: + + def is_str(val: Union[str, float]): + # "isinstance" type guard + if isinstance(val, str): + # Type of ``val`` is narrowed to ``str`` + ... + else: + # Else, type of ``val`` is narrowed to ``float``. + ... + + Strict type narrowing is not enforced -- ``TypeB`` need not be a narrower + form of ``TypeA`` (it can even be a wider form) and this may lead to + type-unsafe results. The main reason is to allow for things like + narrowing ``List[object]`` to ``List[str]`` even though the latter is not + a subtype of the former, since ``List`` is invariant. The responsibility of + writing type-safe type guards is left to the user. + + ``TypeGuard`` also works with type variables. For more information, see + PEP 647 (User-Defined Type Guards). + """ + __type__ = None diff --git a/src/pip/_vendor/typing_extensions.pyi b/src/pip/_vendor/typing_extensions.pyi new file mode 100644 index 000000000..547f7a1b0 --- /dev/null +++ b/src/pip/_vendor/typing_extensions.pyi @@ -0,0 +1 @@ +from typing_extensions import *
\ No newline at end of file diff --git a/src/pip/_vendor/vendor.txt b/src/pip/_vendor/vendor.txt index bf8ebcf55..da38f4c68 100644 --- a/src/pip/_vendor/vendor.txt +++ b/src/pip/_vendor/vendor.txt @@ -14,6 +14,9 @@ requests==2.26.0 chardet==4.0.0 idna==3.2 urllib3==1.26.7 +rich==10.13.0 + pygments==2.10.0 + typing_extensions==3.10.0.2 resolvelib==0.8.1 setuptools==44.0.0 six==1.16.0 diff --git a/tools/vendoring/patches/pygments.patch b/tools/vendoring/patches/pygments.patch new file mode 100644 index 000000000..3cabf9d6d --- /dev/null +++ b/tools/vendoring/patches/pygments.patch @@ -0,0 +1,37 @@ +This patch mainly handles tweaking imports into a form that can be transformed +to import from the vendored namespace. + +diff --git a/src/pip/_vendor/pygments/cmdline.py b/src/pip/_vendor/pygments/cmdline.py +index d9a0fdc8b..db6de0cd3 100644 +--- a/src/pip/_vendor/pygments/cmdline.py ++++ b/src/pip/_vendor/pygments/cmdline.py +@@ -410,11 +410,11 @@ def is_only_option(opt): + outfile = UnclosingTextIOWrapper(outfile, encoding=fmter.encoding) + fmter.encoding = None + try: +- import colorama.initialise ++ import colorama.initialise as colorama_initialise + except ImportError: + pass + else: +- outfile = colorama.initialise.wrap_stream( ++ outfile = colorama_initialise.wrap_stream( + outfile, convert=None, strip=None, autoreset=False, wrap=True) + + # When using the LaTeX formatter and the option `escapeinside` is +diff --git a/src/pip/_vendor/pygments/__main__.py b/src/pip/_vendor/pygments/__main__.py +index c6e2517df..76255b525 100644 +--- a/src/pip/_vendor/pygments/__main__.py ++++ b/src/pip/_vendor/pygments/__main__.py +@@ -9,9 +9,9 @@ + """ + + import sys +-import pygments.cmdline ++from pygments.cmdline import main + + try: +- sys.exit(pygments.cmdline.main(sys.argv)) ++ sys.exit(main(sys.argv)) + except KeyboardInterrupt: + sys.exit(1) |